From: Lars Gullik Bjønnes Date: Wed, 28 Jun 2000 13:35:52 +0000 (+0000) Subject: several changes and some new insets, read the Changelog X-Git-Tag: 1.6.10~22149 X-Git-Url: https://git.lyx.org/gitweb/?a=commitdiff_plain;h=ee72ce87743857b4317da00e6e09cb6842095664;p=features.git several changes and some new insets, read the Changelog git-svn-id: svn://svn.lyx.org/lyx/lyx-devel/trunk@844 a592a061-630c-0410-9148-cb99ea01b6c8 --- diff --git a/ChangeLog b/ChangeLog index 3015d594dd..6de26b0ab1 100644 --- a/ChangeLog +++ b/ChangeLog @@ -1,3 +1,78 @@ +2000-06-28 Lars Gullik Bjønnes + + * src/support/lyxsum.C (sum): '\0' teminate file read when using + strstream. + + * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE + + * src/insets/insettext.C (Read): remove tmptok unused variable + (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING + (InsertInset): change for new InsetInset code + + * src/insets/insettext.h: add TEXT inline method + + * src/insets/insettext.C: remove TEXT macro + + * src/insets/insetmarginal.C (Write): new method + (Latex): change output slightly + + * src/insets/insetfoot.C (Write): new method + (Latex): change output slightly (don't use endl when no need) + + * src/insets/insetert.C (Write): new method + + * src/insets/insetcollapsable.h: make button_length, button_top_y + and button_bottm_y protected. + + * src/insets/insetcollapsable.C (Write): simplify code by using + tostr. Also do not output the float name, the children class + should to that to get control over own arguments + + * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch] + src/insets/insetminipage.[Ch]: + new files + + * src/insets/Makefile.am (libinsets_la_SOURCES): add new files + + * src/lyxfunc.C (Dispatch): cases for new insets/commands + + * src/Makefile.am (lyx_SOURCES): add the new files + + * src/LyXAction.C (init): add LFUN_INSET_MARGINAL, + LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST + * src/commandtags.h: ditto + + * src/LaTeXFeatures.h: add a std::set of used floattypes + + * src/LaTeXFeatures.C (getPackages): add basic support for float.sty + + * src/FloatList.[Ch] src/Floating.h: new files + + * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to + InsertInset. + * src/lyx_cb.C (TableApplyCB): ditto + * src/text.C: ditto + * src/text2.C: ditto + * src/buffer.C (SimpleLinuxDocOnePar): ditto + (parseSingleLyXformat2Token): ditto + add code for + backwards compability for old float styles + add code for new insets + + * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new + method + (InsertInset(size_type, Inset *, LyXFont)): new method + (InsetChar(size_type, char)): changed to use the other InsetChar + with a LyXFont(ALL_INHERIT). + (InsetInset(size_type, Inset*)): changed to use InsetChar to + insert the META_INSET. + + * sigc++/thread.cc (Privete::operator int&): move definition + out of line. + * sigc++/thread.h (Threads): from here + + * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move + definition out of line + * sigc++/scope.h: from here + 2000-06-27 Jean-Marc Lasgouttes * src/lyxrc.C (read): make sure the .kmap files exist when a keymap diff --git a/sigc++/scope.cc b/sigc++/scope.cc index bfbfd4edfd..351c932b28 100644 --- a/sigc++/scope.cc +++ b/sigc++/scope.cc @@ -225,6 +225,10 @@ ScopeIterator_ ScopeList::erase(Iterator pos) return tmp; } +ScopeIterator_::ScopeIterator_(const ScopeIterator_ & n) + : node_(n.node_) +{} + void ScopeList::swap_elements(Iterator p1,Iterator p2) { NodeType *loc1=p1.node(); diff --git a/sigc++/scope.h b/sigc++/scope.h index 091eea84d1..3b2cc6944e 100644 --- a/sigc++/scope.h +++ b/sigc++/scope.h @@ -246,7 +246,8 @@ struct LIBSIGC_API ScopeIterator_ return *this; } - ScopeIterator_(const ScopeIterator_ &n):node_(n.node_) {} + ScopeIterator_(const ScopeIterator_ &n); + //:node_(n.node_) {} ScopeIterator_(NodeType *n):node_(n) {} ScopeIterator_():node_(0) {} }; diff --git a/sigc++/thread.cc b/sigc++/thread.cc index bd1e51a9f6..035a2980b1 100644 --- a/sigc++/thread.cc +++ b/sigc++/thread.cc @@ -135,6 +135,13 @@ void Private_::destroy() #endif } +Private::operator int&() +{ + int * value = static_cast(get()); + if (!value) + set(static_cast(value = new int(0))); + return *(value); +} #ifdef SIGC_PTHREAD_DCE MutexAttr Mutex::Default={pthread_mutexattr_default}; diff --git a/sigc++/thread.h b/sigc++/thread.h index 0310d19537..2228c5345c 100644 --- a/sigc++/thread.h +++ b/sigc++/thread.h @@ -191,13 +191,13 @@ class Private : private Private_ int& operator =(const int& t) {return (((int&)*this)=t);} - operator int& () - { - int *value=(int*)get(); - if (!value) - set((void*)(value=new int(0))); - return *(value); - } + operator int& (); + //{ + // int *value=(int*)get(); + // if (!value) + // set((void*)(value=new int(0))); + // return *(value); + //} Private() { create(&dtor); } ~Private() { destroy(); } diff --git a/src/CutAndPaste.C b/src/CutAndPaste.C index 0371955bb9..70eb686b32 100644 --- a/src/CutAndPaste.C +++ b/src/CutAndPaste.C @@ -412,8 +412,12 @@ int CutAndPaste::SwitchLayoutsBetweenClasses(LyXTextClassList::size_type c1, + textclasslist.NameOfClass(c1) + _(" to ") + textclasslist.NameOfClass(c2); InsetError * new_inset = new InsetError(s); +#ifdef NEW_WAY + par->InsertInset(0, new_inset); +#else par->InsertChar(0, LyXParagraph::META_INSET); par->InsertInset(0, new_inset); +#endif } par = par->next; diff --git a/src/FloatList.C b/src/FloatList.C new file mode 100644 index 0000000000..77a885a2bf --- /dev/null +++ b/src/FloatList.C @@ -0,0 +1,5 @@ +#include + +#include "FloatList.h" + +FloatList floatList; diff --git a/src/FloatList.h b/src/FloatList.h new file mode 100644 index 0000000000..422110d6fd --- /dev/null +++ b/src/FloatList.h @@ -0,0 +1,81 @@ +// -*- C++ -*- +/* This file is part of + * ====================================================== + * + * LyX, The Document Processor + * + * Copyright 1998-2000 The LyX Team. + * + * ====================================================== + */ + +#ifndef FLOATLIST_H +#define FLOATLIST_H + +#ifdef __GNUG__ +#pragma interface +#endif + +#include + +#include "LString.h" +#include "Floating.h" + +/// +class FloatList { +public: + /// + typedef std::map List; + /// + FloatList() { + // Insert the latex builtin float-types + Floating table; + table.type = "table"; + table.placement = ""; + table.ext = "lot"; + table.within = ""; + table.style = ""; + table.name = ""; + table.builtin = true; + list[table.type] = table; + Floating figure; + figure.type = "figure"; + figure.placement = ""; + figure.ext = "lof"; + figure.within = ""; + figure.style = ""; + figure.name = ""; + figure.builtin = true; + list[figure.type] = figure; + // And we add algorithm too since LyX has + // supported that for a long time + Floating algorithm; + algorithm.type = "algorithm"; + algorithm.placement = "htbp"; + algorithm.ext = "loa"; + algorithm.within = ""; + algorithm.style = "ruled"; + algorithm.name = "Algorithm"; + algorithm.builtin = false; + list[algorithm.type] = algorithm; + } + /// + void newFloat(Floating const & fl) { + list[fl.type] = fl; + } + /// + string defaultPlacement(string const & t) const { + List::const_iterator cit = list.find(t); + if (cit != list.end()) + return (*cit).second.placement; + return string(); + } + +private: + /// + List list; +}; + +extern FloatList floatList; + +#endif diff --git a/src/Floating.h b/src/Floating.h new file mode 100644 index 0000000000..b845ea289e --- /dev/null +++ b/src/Floating.h @@ -0,0 +1,36 @@ +// -*- C++ -*- +/* This file is part of + * ====================================================== + * + * LyX, The Document Processor + * + * Copyright 1998-2000 The LyX Team. + * + * ====================================================== + */ + +#ifndef FLOATING_H +#define FLOATING_H + +#ifdef __GNUG__ +#pragma interface +#endif + +class Floating { +public: + /// + string type; + /// + string placement; + /// + string ext; + /// + string within; + /// + string style; + /// + string name; + /// + bool builtin; +}; +#endif diff --git a/src/LaTeXFeatures.C b/src/LaTeXFeatures.C index 61dd8a821c..67341747bd 100644 --- a/src/LaTeXFeatures.C +++ b/src/LaTeXFeatures.C @@ -245,6 +245,13 @@ string LaTeXFeatures::getPackages() if (prettyref) packages += "\\usepackage{prettyref}\n"; + // float.sty + // This is not correct and needs fixing. + // We don't need float.sty if we only use unchanged + // table and figure floats. (Lgb) + if (!usedFloats.empty()) + packages += "\\usepackage{float}\n"; + packages += externalPreambles; return packages; @@ -298,6 +305,12 @@ string LaTeXFeatures::getMacros() if (NeedLyXFootnoteCode) macros += floatingfootnote_def; + // floats + // Here we will output the code to create the needed float styles. + // We will try to do this as minimal as possible. + // \floatstyle{ruled} + // \newfloat{algorithm}{htbp}{loa} + // \floatname{algorithm}{Algorithm} return macros; } diff --git a/src/LaTeXFeatures.h b/src/LaTeXFeatures.h index 33b51556cf..70054ca33d 100644 --- a/src/LaTeXFeatures.h +++ b/src/LaTeXFeatures.h @@ -148,6 +148,10 @@ struct LaTeXFeatures { typedef std::set LanguageList; /// LanguageList UsedLanguages; + /// + typedef std::set FloatList; + /// + FloatList usedFloats; //@} BufferParams const & bufferParams() const; private: diff --git a/src/LyXAction.C b/src/LyXAction.C index 3cc0237afd..0f6caa20e9 100644 --- a/src/LyXAction.C +++ b/src/LyXAction.C @@ -218,6 +218,8 @@ void LyXAction::init() Noop }, { LFUN_INSET_FOOTNOTE, "footnote-inset-insert", N_("Insert Footnote"), Noop }, + { LFUN_INSET_MARGINAL, "marginalnote-inset-insert", + N_("Insert Marginalnote"), Noop }, { LFUN_RIGHTSEL, "forward-select", N_("Select next char"), ReadOnly }, { LFUN_HFILL, "hfill-insert", @@ -394,6 +396,9 @@ void LyXAction::init() { LFUN_DATE_INSERT, "date-insert", "", Noop }, { LFUN_PARAGRAPH_SPACING, "paragraph-spacing", "", Noop }, { LFUN_SET_COLOR, "set-color", "", Noop }, + { LFUN_INSET_MINIPAGE, "minipage-inset-insert", "", Noop }, + { LFUN_INSET_FLOAT, "float-inset-insert", "", Noop }, + { LFUN_INSET_LIST, "list-inset-insert", "", Noop }, { LFUN_NOACTION, "", "", Noop } }; diff --git a/src/Makefile.am b/src/Makefile.am index 819ddbf45b..b5d2b9afef 100644 --- a/src/Makefile.am +++ b/src/Makefile.am @@ -29,6 +29,9 @@ lyx_SOURCES = \ CutAndPaste.h \ DepTable.C \ DepTable.h \ + FloatList.C \ + FloatList.h \ + Floating.h \ FontInfo.C \ FontInfo.h \ FontLoader.C \ diff --git a/src/buffer.C b/src/buffer.C index a64627987a..ce75dd2b10 100644 --- a/src/buffer.C +++ b/src/buffer.C @@ -66,6 +66,10 @@ #include "insets/insetert.h" #include "insets/insetgraphics.h" #include "insets/insetfoot.h" +#include "insets/insetmarginal.h" +#include "insets/insetminipage.h" +#include "insets/insetfloat.h" +#include "insets/insetlist.h" #include "insets/insettabular.h" #include "support/filetools.h" #include "support/path.h" @@ -304,16 +308,24 @@ Buffer::parseSingleLyXformat2Token(LyXLex & lex, LyXParagraph *& par, if (token[0] != '\\') { for (string::const_iterator cit = token.begin(); cit != token.end(); ++cit) { +#ifdef NEW_WAY + par->InsertChar(pos, (*cit), font); +#else par->InsertChar(pos, (*cit)); par->SetFont(pos, font); +#endif ++pos; } } else if (token == "\\i") { Inset * inset = new InsetLatexAccent; inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif ++pos; } else if (token == "\\layout") { if (!return_par) @@ -348,6 +360,7 @@ Buffer::parseSingleLyXformat2Token(LyXLex & lex, LyXParagraph *& par, font = LyXFont(LyXFont::ALL_INHERIT, params.language_info); if (format < 2.16 && params.language == "hebrew") font.setLanguage(default_language); +#ifndef NEW_INSETS } else if (token == "\\end_float") { if (!return_par) return_par = par; @@ -373,6 +386,53 @@ Buffer::parseSingleLyXformat2Token(LyXLex & lex, LyXParagraph *& par, footnoteflag = LyXParagraph::CLOSED_FOOTNOTE; else footnoteflag = LyXParagraph::OPEN_FOOTNOTE; +#else + } else if (token == "\\begin_float") { + // This is the compability reader, unfinished but tested. + // (Lgb) + lex.next(); + string tmptok = lex.GetString(); + //lyxerr << "old float: " << tmptok << endl; + + Inset * inset = 0; + + if (tmptok == "footnote") { + inset = new InsetFoot; + } else if (tmptok == "margin") { + inset = new InsetMarginal; + } else if (tmptok == "fig") { + //inset = new InsetFigure; + } else if (tmptok == "tab") { + //inset = new InsetTable; + } else if (tmptok == "alg") { + //inset = new InsetAlgorithm; + } else if (tmptok == "wide-fig") { + //inset = new InsetFigure(true); + } else if (tmptok == "wide-tab") { + //inset = new InsetTable(true); + } + + if (!inset) return false; // no end read yet + + string old_float = "\ncollapsed true\n"; + old_float += lex.getLongString("\\end_float"); + old_float += "\n\\end_inset\n"; + lyxerr << "float body: " << old_float << endl; + + istrstream istr(old_float.c_str()); + LyXLex nylex(0, 0); + nylex.setStream(istr); + + inset->Read(this, nylex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else + par->InsertChar(pos, LyXParagraph::META_INSET); + par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif + ++pos; +#endif } else if (token == "\\begin_deeper") { ++depth; } else if (token == "\\end_deeper") { @@ -649,11 +709,6 @@ Buffer::parseSingleLyXformat2Token(LyXLex & lex, LyXParagraph *& par, } else if (token == "\\float_placement") { lex.nextToken(); params.float_placement = lex.GetString(); -#if 0 - } else if (token == "\\cursor") { // obsolete - // this is obsolete, so we just skip it. - lex.nextToken(); -#endif } else if (token == "\\family") { lex.next(); font.setLyXFamily(lex.GetString()); @@ -761,95 +816,178 @@ Buffer::parseSingleLyXformat2Token(LyXLex & lex, LyXParagraph *& par, if (tmptok == "Quotes") { Inset * inset = new InsetQuotes; inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); - ++pos; -#if 0 - } else if (tmptok == "\\i") { - Inset * inset = new InsetLatexAccent; - inset->Read(this, lex); - par->InsertChar(pos, LyXParagraph::META_INSET); par->InsertInset(pos, inset); - par->SetFont(pos, font); - ++pos; #endif + ++pos; } else if (tmptok == "External") { Inset * inset = new InsetExternal; inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif ++pos; } else if (tmptok == "FormulaMacro") { Inset * inset = new InsetFormulaMacro; inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif ++pos; } else if (tmptok == "Formula") { Inset * inset = new InsetFormula; inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif ++pos; } else if (tmptok == "Figure") { Inset * inset = new InsetFig(100, 100, this); inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif ++pos; } else if (tmptok == "Info") { Inset * inset = new InsetInfo; inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif ++pos; } else if (tmptok == "Include") { Inset * inset = new InsetInclude(string(), this); inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif ++pos; } else if (tmptok == "ERT") { - Inset * inset = new InsetERT(); + Inset * inset = new InsetERT; inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif ++pos; } else if (tmptok == "Tabular") { Inset * inset = new InsetTabular(this); inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif ++pos; } else if (tmptok == "Text") { - Inset * inset = new InsetText(); + Inset * inset = new InsetText; inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif ++pos; } else if (tmptok == "Foot") { - Inset * inset = new InsetFoot(); + Inset * inset = new InsetFoot; + inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else + par->InsertChar(pos, LyXParagraph::META_INSET); + par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif + ++pos; + } else if (tmptok == "Marginal") { + Inset * inset = new InsetMarginal; + inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else + par->InsertChar(pos, LyXParagraph::META_INSET); + par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif + ++pos; + } else if (tmptok == "Minipage") { + Inset * inset = new InsetMinipage; + inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else + par->InsertChar(pos, LyXParagraph::META_INSET); + par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif + ++pos; + } else if (tmptok == "Float") { + Inset * inset = new InsetFloat; inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); + par->SetFont(pos, font); par->InsertInset(pos, inset); +#endif + ++pos; + } else if (tmptok == "List") { + Inset * inset = new InsetList; + inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else + par->InsertChar(pos, LyXParagraph::META_INSET); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif ++pos; } else if (tmptok == "GRAPHICS") { Inset * inset = new InsetGraphics; //inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif } else if (tmptok == "LatexCommand") { InsetCommand inscmd; inscmd.Read(this, lex); @@ -893,9 +1031,13 @@ Buffer::parseSingleLyXformat2Token(LyXLex & lex, LyXParagraph *& par, } if (inset) { +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif ++pos; } } @@ -911,12 +1053,20 @@ Buffer::parseSingleLyXformat2Token(LyXLex & lex, LyXParagraph *& par, lex.next(); next_token = lex.GetString(); if (next_token == "\\-") { +#ifdef NEW_WAY + par->InsertChar(pos, '-', font); +#else par->InsertChar(pos, '-'); par->SetFont(pos, font); +#endif } else if (next_token == "\\protected_separator" || next_token == "~") { +#ifdef NEW_WAY + par->InsertChar(pos, ' ', font); +#else par->InsertChar(pos, ' '); par->SetFont(pos, font); +#endif } else { lex.printError("Token `$$Token' " "is in free space " @@ -927,29 +1077,45 @@ Buffer::parseSingleLyXformat2Token(LyXLex & lex, LyXParagraph *& par, } else { Inset * inset = new InsetSpecialChar; inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif } ++pos; } else if (token == "\\newline") { +#ifdef NEW_WAY + par->InsertChar(pos, LyXParagraph::META_NEWLINE, font); +#else par->InsertChar(pos, LyXParagraph::META_NEWLINE); par->SetFont(pos, font); +#endif ++pos; } else if (token == "\\LyXTable") { #ifdef USE_TABULAR_INSETS Inset * inset = new InsetTabular(this); inset->Read(this, lex); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif ++pos; #else par->table = new LyXTable(lex); #endif } else if (token == "\\hfill") { +#ifdef NEW_WAY + par->InsertChar(pos, LyXParagraph::META_HFILL, font); +#else par->InsertChar(pos, LyXParagraph::META_HFILL); par->SetFont(pos, font); +#endif ++pos; } else if (token == "\\protected_separator") { // obsolete // This is a backward compability thingie. (Lgb) @@ -960,13 +1126,21 @@ Buffer::parseSingleLyXformat2Token(LyXLex & lex, LyXParagraph *& par, par->GetLayout()); if (layout.free_spacing) { +#ifdef NEW_WAY + par->InsertChar(pos, ' ', font); +#else par->InsertChar(pos, ' '); par->SetFont(pos, font); +#endif } else { Inset * inset = new InsetSpecialChar(InsetSpecialChar::PROTECTED_SEPARATOR); +#ifdef NEW_WAY + par->InsertInset(pos, inset, font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); - par->InsertInset(pos, inset); par->SetFont(pos, font); + par->InsertInset(pos, inset); +#endif } ++pos; } else if (token == "\\bibitem") { // ale970302 @@ -974,8 +1148,12 @@ Buffer::parseSingleLyXformat2Token(LyXLex & lex, LyXParagraph *& par, par->bibkey = new InsetBibKey; par->bibkey->Read(this, lex); }else if (token == "\\backslash") { +#ifdef NEW_WAY + par->InsertChar(pos, '\\', font); +#else par->InsertChar(pos, '\\'); par->SetFont(pos, font); +#endif ++pos; }else if (token == "\\the_end") { the_end_read = true; @@ -985,8 +1163,12 @@ Buffer::parseSingleLyXformat2Token(LyXLex & lex, LyXParagraph *& par, "Inserting as text."); for(string::const_iterator cit = token.begin(); cit != token.end(); ++cit) { +#ifdef NEW_WAY + par->InsertChar(pos, (*cit), font); +#else par->InsertChar(pos, (*cit)); par->SetFont(pos, font); +#endif ++pos; } } @@ -1311,14 +1493,6 @@ void Buffer::writeFileAscii(string const & fname, int linelen) #ifndef NEW_TABULAR /* It might be a table */ if (par->table){ -#if 0 - if (!lyxrc.ascii_roff_command.empty() && - lyxrc.ascii_roff_command != "none") { - RoffAsciiTable(ofs, par); - par = par->next; - continue; - } -#endif cell = 1; actcell = 0; cells = par->table->columns; @@ -2723,12 +2897,14 @@ void Buffer::SimpleLinuxDocOnePar(ostream & os, LyXParagraph * par, void Buffer::LinuxDocError(LyXParagraph * par, int pos, char const * message) { - InsetError * new_inset; - // insert an error marker in text - new_inset = new InsetError(message); + InsetError * new_inset = new InsetError(message); +#ifdef NEW_WAY + par->InsertInset(pos, new_inset); +#else par->InsertChar(pos, LyXParagraph::META_INSET); par->InsertInset(pos, new_inset); +#endif } // This constant defines the maximum number of @@ -3401,130 +3577,6 @@ int Buffer::runChktex() } -#if 0 -void Buffer::RoffAsciiTable(ostream & os, LyXParagraph * par) -{ - LyXFont font1(LyXFont::ALL_INHERIT,params.language_info); - LyXFont font2; - Inset * inset; - LyXParagraph::size_type i; - int j, cell = 0; - char c; - - string fname1 = TmpFileName(string(), "RAT1"); - string fname2 = TmpFileName(string(), "RAT2"); - - ofstream ofs(fname1.c_str()); - if (!ofs) { - WriteAlert(_("LYX_ERROR:"), - _("Cannot open temporary file:"), fname1); - return; - } - par->table->RoffEndOfCell(ofs, -1); - for (i = 0; i < par->size(); ++i) { - c = par->GetChar(i); - if (par->table->IsContRow(cell)) { - if (c == LyXParagraph::META_NEWLINE) - ++cell; - continue; - } - font2 = par->GetFontSettings(i); - if (font1.latex() != font2.latex()) { - if (font2.latex() != LyXFont::OFF) - continue; - } - switch (c) { - case LyXParagraph::META_INSET: - if ((inset = par->GetInset(i))) { -#ifdef HAVE_SSTREAM - stringstresm ss(ios::in | ios::out); - inset->Ascii(this, ss); - ss.seekp(0); - ss.get(c); - while (!ss) { - if (c == '\\') - ofs << "\\\\"; - else - ofs << c; - ss.get(c); - } -#else - strstream ss; - inset->Ascii(this, ss); - ss.seekp(0); - ss.get(c); - while (!ss) { - if (c == '\\') - ofs << "\\\\"; - else - ofs << c; - ss.get(c); - } - delete [] ss.str(); -#endif - } - break; - case LyXParagraph::META_NEWLINE: - if (par->table->CellHasContRow(cell)>= 0) - par->RoffContTableRows(ofs, i+1, cell); - par->table->RoffEndOfCell(ofs, cell); - ++cell; - break; - case LyXParagraph::META_HFILL: - break; - case '\\': - ofs << "\\\\"; - break; - default: - if (c != '\0') - ofs << c; - else if (c == '\0') - lyxerr.debug() - << "RoffAsciiTable:" - " NULL char in structure." << endl; - break; - } - } - par->table->RoffEndOfCell(ofs, cell); - ofs.close(); - string cmd = lyxrc.ascii_roff_command + " >" + fname2; - cmd = subst(cmd, "$$FName", fname1); - Systemcalls one(Systemcalls::System, cmd); - if (!(lyxerr.debugging(Debug::ROFF))) { - remove(fname1.c_str()); - } - ifstream ifs(fname2.c_str()); - if (!ifs) { - WriteFSAlert(_("Error! Can't open temporary file:"), fname2); - return; - } - // now output the produced file - os << "\n\n"; - ifs.get(c); - if (!ifs) - WriteAlert(_("Error!"), - _("Error executing *roff command on table")); - // overread leading blank lines - while(!ifs && (c == '\n')) - ifs.get(c); - while(!ifs) { - for(j = 0; j < par->depth; ++j) - os << " "; - while(!ifs && (c != '\n')) { - os << c; - ifs.get(c); - } - os << '\n'; - // overread trailing blank lines - while(!ifs && (c == '\n')) - ifs.get(c); - } - ifs.close(); - remove(fname2.c_str()); -} -#endif - - void Buffer::validate(LaTeXFeatures & features) const { LyXParagraph * par = paragraph; diff --git a/src/buffer.h b/src/buffer.h index 10388ce064..6e02dfce38 100644 --- a/src/buffer.h +++ b/src/buffer.h @@ -375,11 +375,6 @@ private: void pop_tag(std::ostream & os, char const * tag, int & pos, char stack[5][3]); -#if 0 - /// - void RoffAsciiTable(std::ostream &, LyXParagraph * par); -#endif - /// is save needed mutable bool lyx_clean; diff --git a/src/commandtags.h b/src/commandtags.h index 91fca71d90..10a85331eb 100644 --- a/src/commandtags.h +++ b/src/commandtags.h @@ -255,6 +255,10 @@ enum kb_action { LFUN_LOAVIEW, // Dekel 20000519 LFUN_SET_COLOR, // SLior 20000611 LFUN_INSET_EXTERNAL, // Alstrup 20000609 + LFUN_INSET_MARGINAL, // Lgb 20000626 + LFUN_INSET_MINIPAGE, // Lgb 20000627 + LFUN_INSET_FLOAT, // Lgb 20000627 + LFUN_INSET_LIST, // Lgb 20000627 LFUN_LASTACTION /* this marks the end of the table */ }; diff --git a/src/insets/Makefile.am b/src/insets/Makefile.am index b89284af8f..df4dccd2fa 100644 --- a/src/insets/Makefile.am +++ b/src/insets/Makefile.am @@ -33,6 +33,8 @@ libinsets_la_SOURCES = \ insetert.h \ insetexternal.C \ insetexternal.h \ + insetfloat.h \ + insetfloat.C \ insetfoot.C \ insetfoot.h \ insetgraphics.C \ @@ -47,6 +49,8 @@ libinsets_la_SOURCES = \ insetlabel.h \ insetlatexaccent.C \ insetlatexaccent.h \ + insetlist.C \ + insetlist.h \ insetloa.C \ insetloa.h \ insetlof.C \ @@ -55,6 +59,8 @@ libinsets_la_SOURCES = \ insetlot.h \ insetmarginal.h \ insetmarginal.C \ + insetminipage.C \ + insetminipage.h \ insetparent.C \ insetparent.h \ insetquotes.C \ diff --git a/src/insets/insetcollapsable.C b/src/insets/insetcollapsable.C index 4d1d4c3973..3bc1309455 100644 --- a/src/insets/insetcollapsable.C +++ b/src/insets/insetcollapsable.C @@ -19,6 +19,7 @@ #include "BufferView.h" #include "Painter.h" #include "support/LOstream.h" +#include "support/lstrings.h" using std::ostream; @@ -44,14 +45,11 @@ Inset * InsetCollapsable::Clone() const return result; } + void InsetCollapsable::Write(Buffer const * buf, ostream & os) const { - os << getInsetName() << "\n\ncollapsed "; - if (display()) - os << "false\n"; - else - os << "true\n"; - WriteParagraphData(buf, os); + os << "collapsed " << tostr(!display()) << "\n"; + WriteParagraphData(buf, os); } @@ -251,7 +249,9 @@ int InsetCollapsable::getMaxTextWidth(Painter & pain, width_collapsed(pain, labelfont) - widthOffset; } -void InsetCollapsable::update(BufferView * bv, LyXFont const & font, bool dodraw) + +void InsetCollapsable::update(BufferView * bv, + LyXFont const & font, bool dodraw) { drawTextXOffset = width_collapsed(bv->painter(), font); InsetText::update(bv, font, dodraw); diff --git a/src/insets/insetcollapsable.h b/src/insets/insetcollapsable.h index a290e8e59c..6e65c586ac 100644 --- a/src/insets/insetcollapsable.h +++ b/src/insets/insetcollapsable.h @@ -101,9 +101,13 @@ private: string label; /// bool autocollapse; +protected: + // Instead of making these ints protected we could have a + // protected method "clickInButton" (Lgb) /// mutable int button_length, button_top_y, button_bottom_y; +private: /// int widthOffset; }; diff --git a/src/insets/insetert.C b/src/insets/insetert.C index 854a3f52ce..67af3e3d13 100644 --- a/src/insets/insetert.C +++ b/src/insets/insetert.C @@ -37,6 +37,13 @@ InsetERT::InsetERT() : InsetCollapsable() } +void InsetERT::Write(Buffer const * buf, ostream & os) const +{ + os << getInsetName() << "\n"; + InsetCollapsable::Write(buf, os); +} + + Inset * InsetERT::Clone() const { InsetERT * result = new InsetERT(); diff --git a/src/insets/insetert.h b/src/insets/insetert.h index 0946976ac4..1a2c53d02e 100644 --- a/src/insets/insetert.h +++ b/src/insets/insetert.h @@ -29,21 +29,23 @@ class Painter; */ class InsetERT : public InsetCollapsable { public: - /// - InsetERT(); - /// - ~InsetERT() {} - /// - Inset * Clone() const; - /// - char const * EditMessage() const; - /// - bool InsertInset(BufferView *, Inset *); - /// - void SetFont(BufferView *, LyXFont const &, bool toggleall = false); - /// - void Edit(BufferView *, int, int, unsigned int); - /// + /// + InsetERT(); + /// + ~InsetERT() {} + /// + void Write(Buffer const * buf, ostream & os) const; + /// + Inset * Clone() const; + /// + char const * EditMessage() const; + /// + bool InsertInset(BufferView *, Inset *); + /// + void SetFont(BufferView *, LyXFont const &, bool toggleall = false); + /// + void Edit(BufferView *, int, int, unsigned int); + /// }; #endif diff --git a/src/insets/insetfloat.C b/src/insets/insetfloat.C new file mode 100644 index 0000000000..8d8c8c6a2f --- /dev/null +++ b/src/insets/insetfloat.C @@ -0,0 +1,203 @@ +/* This file is part of + * ====================================================== + * + * LyX, The Document Processor + * + * Copyright 1998 The LyX Team. + * + *======================================================*/ + +#include + +#ifdef __GNUG__ +#pragma implementation +#endif + +#include "insetfloat.h" +#include "gettext.h" +#include "lyxfont.h" +#include "BufferView.h" +#include "Painter.h" +#include "lyxtext.h" +#include "support/LOstream.h" +#include "FloatList.h" +#include "LaTeXFeatures.h" +#include "debug.h" + +using std::ostream; +using std::endl; + +// With this inset it will be possible to support the latex package +// float.sty, and I am sure that with this and some additional support +// classes we can support similar functionality in other formats +// (read DocBook). +// By using float.sty we will have the same handling for all floats, both +// for those already in existance (table and figure) and all user created +// ones¹. So suddenly we give the users the possibility of creating new +// kinds of floats on the fly. (and with a uniform look) +// +// API to float.sty: +// \newfloat{type}{placement}{ext}[within] +// type - The "type" of the new class of floats, like program or +// algorithm. After the appropriate \newfloat, commands +// such as \begin{program} or \end{algorithm*} will be +// available. +// placement - The default placement for the given class of floats. +// They are like in standard LaTeX: t, b, p and h for top, +// bottom, page, and here, respectively. On top of that +// there is a new type, H, which does not really correspond +// to a float, since it means: put it "here" and nowhere else. +// Note, however that the H specifier is special and, because +// of implementation details cannot be used in the second +// argument of \newfloat. +// ext - The file name extension of an auxiliary file for the list +// of figures (or whatever). LaTeX writes the captions to +// this file. +// within - This (optional) argument determines whether floats of this +// class will be numbered within some sectional unit of the +// document. For example, if within is equal to chapter, the +// floats will be numbered within chapters. +// \floatstyle{style} +// style - plain, boxed, ruled +// \floatname{float}{floatname} +// float - +// floatname - +// \floatplacement{float}{placement} +// float - +// placement - +// \restylefloat{float} +// float - +// \listof{type}{title} +// title - + +// ¹ the algorithm float is defined using the float.sty package. Like this +// \floatstyle{ruled} +// \newfloat{algorithm}{htbp}{loa}[] +// \floatname{algorithm}{Algorithm} +// +// Lgb + +InsetFloat::InsetFloat() : InsetCollapsable() +{ + setLabel(_("float")); + LyXFont font(LyXFont::ALL_SANE); + font.decSize(); + font.decSize(); + font.setColor(LColor::footnote); + setLabelFont(font); + setAutoCollapse(false); + setInsetName("Float"); + floatType = "table"; + floatPlacement = "H"; +} + + +void InsetFloat::Write(Buffer const * buf, ostream & os) const +{ + os << getInsetName() + << "\ntype " << floatType + << "\nplacement " << floatPlacement << "\n"; + InsetCollapsable::Write(buf, os); +} + + +void InsetFloat::Read(Buffer const * buf, LyXLex & lex) +{ + if (lex.IsOK()) { + lex.next(); + string token = lex.GetString(); + if (token == "type") { + lex.next(); + floatType = lex.GetString(); + } + lex.next(); + token = lex.GetString(); + if (token == "placement") { + lex.next(); + floatPlacement = lex.GetString(); + } + } + InsetCollapsable::Read(buf, lex); +} + + +void InsetFloat::Validate(LaTeXFeatures & features) const +{ + features.usedFloats.insert(floatType); +} + + +Inset * InsetFloat::Clone() const +{ + InsetFloat * result = new InsetFloat; + result->init(this); + + result->collapsed = collapsed; + return result; +} + + +char const * InsetFloat::EditMessage() const +{ + return _("Opened Float Inset"); +} + + +int InsetFloat::Latex(Buffer const * buf, + ostream & os, bool fragile, bool fp) const +{ + os << "\\begin{" << floatType << "}"; + if (!floatPlacement.empty() + && floatPlacement != floatList.defaultPlacement(floatType)) + os << "[" << floatPlacement << "]"; + os << "%\n"; + + int i = InsetText::Latex(buf, os, fragile, fp); + os << "\\end{" << floatType << "}%\n"; + + return i + 2; +} + + +bool InsetFloat::InsertInset(BufferView * bv, Inset * inset) +{ + if (!InsertInsetAllowed(inset)) + return false; + + return InsetText::InsertInset(bv, inset); +} + + +bool InsetFloat::InsertInsetAllowed(Inset * inset) const +{ + if ((inset->LyxCode() == Inset::FOOT_CODE) || + (inset->LyxCode() == Inset::MARGIN_CODE)) { + return false; + } + return true; +} + + +LyXFont InsetFloat::GetDrawFont(BufferView * bv, + LyXParagraph * p, int pos) const +{ + LyXFont fn = getLyXText(bv)->GetFont(bv->buffer(), p, pos); + fn.decSize().decSize(); + return fn; +} + + +void InsetFloat::InsetButtonRelease(BufferView * bv, int x, int y, int button) +{ + if (x >= 0 + && x < button_length + && y >= button_top_y + && y < button_bottom_y + && button == 3) { + // This obviously need to change. + lyxerr << "InsetFloat: Let's edit this floats parameters!" + << endl; + } else { + InsetCollapsable::InsetButtonRelease(bv, x, y, button); + } +} diff --git a/src/insets/insetfloat.h b/src/insets/insetfloat.h new file mode 100644 index 0000000000..960ed603f2 --- /dev/null +++ b/src/insets/insetfloat.h @@ -0,0 +1,62 @@ +// -*- C++ -*- +/* This file is part of + * ====================================================== + * + * LyX, The Document Processor + * + * Copyright 1998 The LyX Team. + * + * ====================================================== + */ + +#ifndef InsetFloat_H +#define InsetFloat_H + +#ifdef __GNUG__ +#pragma interface +#endif + +#include "insetcollapsable.h" + +class Painter; + +/** The float inset + +*/ +class InsetFloat : public InsetCollapsable { +public: + /// + explicit + InsetFloat(); + /// + ~InsetFloat() {} + /// + void Write(Buffer const * buf, ostream & os) const; + /// + void Read(Buffer const * buf, LyXLex & lex); + /// + void Validate(LaTeXFeatures & features) const; + /// + Inset * Clone() const; + /// + Inset::Code LyxCode() const { return Inset::FLOAT_CODE; } + /// + int Latex(Buffer const *, std::ostream &, bool fragile, bool fp) const; + /// + const char * EditMessage() const; + /// + bool InsertInset(BufferView *, Inset * inset); + /// + bool InsertInsetAllowed(Inset * inset) const; + /// + LyXFont GetDrawFont(BufferView *, LyXParagraph * par, int pos) const; + /// + void InsetButtonRelease(BufferView * bv, int x, int y, int button); +private: + /// + string floatType; + /// + string floatPlacement; +}; + +#endif diff --git a/src/insets/insetfoot.C b/src/insets/insetfoot.C index 41496c6dd5..9b33e6f08b 100644 --- a/src/insets/insetfoot.C +++ b/src/insets/insetfoot.C @@ -37,6 +37,13 @@ InsetFoot::InsetFoot() : InsetCollapsable() } +void InsetFoot::Write(Buffer const * buf, ostream & os) const +{ + os << getInsetName() << "\n"; + InsetCollapsable::Write(buf, os); +} + + Inset * InsetFoot::Clone() const { InsetFoot * result = new InsetFoot; @@ -55,10 +62,10 @@ char const * InsetFoot::EditMessage() const int InsetFoot::Latex(Buffer const * buf, ostream & os, bool fragile, bool fp) const { - os << "\\footnote{%" << endl; + os << "\\footnote{%\n"; int i = InsetText::Latex(buf, os, fragile, fp); - os << "}%" << endl; + os << "}%\n"; return i + 2; } diff --git a/src/insets/insetfoot.h b/src/insets/insetfoot.h index 938226e015..33f3eac1ad 100644 --- a/src/insets/insetfoot.h +++ b/src/insets/insetfoot.h @@ -27,25 +27,27 @@ class Painter; */ class InsetFoot : public InsetCollapsable { public: - /// + /// explicit - InsetFoot(); - /// - ~InsetFoot() {} - /// - Inset * Clone() const; - /// - Inset::Code LyxCode() const { return Inset::FOOT_CODE; } - /// - int Latex(Buffer const *, std::ostream &, bool fragile, bool fp) const; - /// - const char * EditMessage() const; - /// - bool InsertInset(BufferView *, Inset * inset); - /// - bool InsertInsetAllowed(Inset * inset) const; - /// - LyXFont GetDrawFont(BufferView *, LyXParagraph * par, int pos) const; + InsetFoot(); + /// + ~InsetFoot() {} + /// + void Write(Buffer const * buf, ostream & os) const; + /// + Inset * Clone() const; + /// + Inset::Code LyxCode() const { return Inset::FOOT_CODE; } + /// + int Latex(Buffer const *, std::ostream &, bool fragile, bool fp) const; + /// + const char * EditMessage() const; + /// + bool InsertInset(BufferView *, Inset * inset); + /// + bool InsertInsetAllowed(Inset * inset) const; + /// + LyXFont GetDrawFont(BufferView *, LyXParagraph * par, int pos) const; }; #endif diff --git a/src/insets/insetlist.C b/src/insets/insetlist.C new file mode 100644 index 0000000000..640b3cb5f1 --- /dev/null +++ b/src/insets/insetlist.C @@ -0,0 +1,111 @@ +/* This file is part of + * ====================================================== + * + * LyX, The Document Processor + * + * Copyright 1998 The LyX Team. + * + * ====================================================== */ + +#include + +#ifdef __GNUG__ +#pragma implementation +#endif + +#include "insetlist.h" +#include "gettext.h" +#include "lyxfont.h" +#include "BufferView.h" +#include "Painter.h" +#include "lyxtext.h" +#include "support/LOstream.h" + +using std::ostream; +using std::endl; + +// This class is _far_ from finished. I hope that we can have a inset to +// handle the different lists that we have. It should also be possible +// to create new lists on the fly. +// Currently LyX only supports: itemize, enumerate, description and +// lyxlist. All support for these should be moved to this class and other +// helper classes. +// It is also possible that we will need a baseclass and subclasses for +// different types of lists. (and should they be collapsable?) +// +// Lgb + +InsetList::InsetList() + : InsetCollapsable() +{ + setLabel(_("list")); + LyXFont font(LyXFont::ALL_SANE); + font.decSize(); + font.decSize(); + font.setColor(LColor::footnote); + setLabelFont(font); + setAutoCollapse(false); + setInsetName("List"); +} + + +void InsetList::Write(Buffer const * buf, ostream & os) const +{ + os << getInsetName() << "\n"; + InsetCollapsable::Write(buf, os); +} + + +Inset * InsetList::Clone() const +{ + InsetList * result = new InsetList; + result->init(this); + + result->collapsed = collapsed; + return result; +} + + +char const * InsetList::EditMessage() const +{ + return _("Opened List Inset"); +} + + +int InsetList::Latex(Buffer const * buf, + ostream & os, bool fragile, bool fp) const +{ + os << "\\footnote{%\n"; + + int i = InsetText::Latex(buf, os, fragile, fp); + os << "}%\n"; + + return i + 2; +} + + +bool InsetList::InsertInset(BufferView * bv, Inset * inset) +{ + if (!InsertInsetAllowed(inset)) + return false; + + return InsetText::InsertInset(bv, inset); +} + + +bool InsetList::InsertInsetAllowed(Inset * inset) const +{ + if ((inset->LyxCode() == Inset::FOOT_CODE) || + (inset->LyxCode() == Inset::MARGIN_CODE)) { + return false; + } + return true; +} + + +LyXFont InsetList::GetDrawFont(BufferView * bv,LyXParagraph * p, int pos) const +{ + LyXFont fn = getLyXText(bv)->GetFont(bv->buffer(), p, pos); + fn.decSize().decSize(); + return fn; +} diff --git a/src/insets/insetlist.h b/src/insets/insetlist.h new file mode 100644 index 0000000000..3c75c5f15a --- /dev/null +++ b/src/insets/insetlist.h @@ -0,0 +1,51 @@ +// -*- C++ -*- +/* This file is part of + * ====================================================== + * + * LyX, The Document Processor + * + * Copyright 1998 The LyX Team. + * + * ====================================================== + */ + +#ifndef InsetList_H +#define InsetList_H + +#ifdef __GNUG__ +#pragma interface +#endif + +#include "insetcollapsable.h" + +class Painter; + +/** The footnote inset + +*/ +class InsetList : public InsetCollapsable { +public: + /// + explicit + InsetList(); + /// + ~InsetList() {} + /// + void Write(Buffer const * buf, ostream & os) const; + /// + Inset * Clone() const; + /// + Inset::Code LyxCode() const { return Inset::FOOT_CODE; } + /// + int Latex(Buffer const *, std::ostream &, bool fragile, bool fp) const; + /// + const char * EditMessage() const; + /// + bool InsertInset(BufferView *, Inset * inset); + /// + bool InsertInsetAllowed(Inset * inset) const; + /// + LyXFont GetDrawFont(BufferView *, LyXParagraph * par, int pos) const; +}; + +#endif diff --git a/src/insets/insetmarginal.C b/src/insets/insetmarginal.C index 9a592c972b..b5cb253760 100644 --- a/src/insets/insetmarginal.C +++ b/src/insets/insetmarginal.C @@ -37,6 +37,13 @@ InsetMarginal::InsetMarginal() : InsetCollapsable() } +void InsetMarginal::Write(Buffer const * buf, ostream & os) const +{ + os << getInsetName() << "\n"; + InsetCollapsable::Write(buf, os); +} + + Inset * InsetMarginal::Clone() const { InsetMarginal * result = new InsetMarginal; @@ -56,10 +63,10 @@ char const * InsetMarginal::EditMessage() const int InsetMarginal::Latex(Buffer const * buf, ostream & os, bool fragile, bool fp) const { - os << "\\marginpar{%" << endl; + os << "\\marginpar{%\n"; int i = InsetText::Latex(buf, os, fragile, fp); - os << "}%" << endl; + os << "}%\n"; return i + 2; } diff --git a/src/insets/insetmarginal.h b/src/insets/insetmarginal.h index d9698ff3c2..a2c907025b 100644 --- a/src/insets/insetmarginal.h +++ b/src/insets/insetmarginal.h @@ -31,6 +31,8 @@ public: /// ~InsetMarginal() {} /// + void Write(Buffer const * buf, ostream & os) const; + /// Inset * Clone() const; /// Inset::Code LyxCode() const { return Inset::MARGIN_CODE; } diff --git a/src/insets/insetminipage.C b/src/insets/insetminipage.C new file mode 100644 index 0000000000..606648bcb9 --- /dev/null +++ b/src/insets/insetminipage.C @@ -0,0 +1,130 @@ +/* This file is part of + * ====================================================== + * + * LyX, The Document Processor + * + * Copyright 1998 The LyX Team. + * + *======================================================*/ + +#include + +#ifdef __GNUG__ +#pragma implementation +#endif + +#include "insetminipage.h" +#include "gettext.h" +#include "lyxfont.h" +#include "BufferView.h" +#include "Painter.h" +#include "lyxtext.h" +#include "support/LOstream.h" + +using std::ostream; +using std::endl; + + +// Some information about Minipages in LaTeX: +// A minipage is a complete miniversion of a page and can contain +// its own footnotes, paragraphs, and array, tabular, and multicols +// environments. However it cannot contain floats or \marginpar's, +// but it can appear inside floats. +// +// The minipage environment is defined like this: +// +// \begin{minipage}[pos][height][inner-pos]{width} \end{minipage} +// +// Where: +// pos [opt] = is the vertical placement of the box with respect +// to the text baseline, [c], [t] and [b]. +// height [opt] = the height of the box +// inner-pos [opt] = the position of the text within the box. +// It can be t, c, b or s, if unspecified the value +// of pos is used. +// width = the width of the box +// +// In LyX we should try to support all these parameters, settable in a +// pop-up dialog. +// In this pop-up diallog it should also be possible to set all margin +// values that is usable in the minipage. +// With regard to different formats (like DocBook) I guess a minipage +// can be used there also. Perhaps not in the latex way, but we do not +// have to output "" for minipages. +// (Lgb) + +InsetMinipage::InsetMinipage() + : InsetCollapsable() +{ + setLabel(_("minipage")); + LyXFont font(LyXFont::ALL_SANE); + font.decSize(); + font.decSize(); + font.setColor(LColor::footnote); + setLabelFont(font); + setAutoCollapse(false); + setInsetName("Minipage"); +} + + +void InsetMinipage::Write(Buffer const * buf, ostream & os) const +{ + os << getInsetName() << "\n"; + InsetCollapsable::Write(buf, os); +} + + +Inset * InsetMinipage::Clone() const +{ + InsetMinipage * result = new InsetMinipage; + result->init(this); + + result->collapsed = collapsed; + return result; +} + + +char const * InsetMinipage::EditMessage() const +{ + return _("Opened Minipage Inset"); +} + + +int InsetMinipage::Latex(Buffer const * buf, + ostream & os, bool fragile, bool fp) const +{ + os << "\\begin{minipage}{\\columnwidth}%\n"; + + int i = InsetText::Latex(buf, os, fragile, fp); + os << "\\end{minipage}%\n"; + + return i + 2; +} + + +bool InsetMinipage::InsertInset(BufferView * bv, Inset * inset) +{ + if (!InsertInsetAllowed(inset)) + return false; + + return InsetText::InsertInset(bv, inset); +} + + +bool InsetMinipage::InsertInsetAllowed(Inset * inset) const +{ + if ((inset->LyxCode() == Inset::FLOAT_CODE) || + (inset->LyxCode() == Inset::MARGIN_CODE)) { + return false; + } + return true; +} + + +LyXFont InsetMinipage::GetDrawFont(BufferView * bv, + LyXParagraph * p, int pos) const +{ + LyXFont fn = getLyXText(bv)->GetFont(bv->buffer(), p, pos); + fn.decSize().decSize(); + return fn; +} diff --git a/src/insets/insetminipage.h b/src/insets/insetminipage.h new file mode 100644 index 0000000000..2587139c34 --- /dev/null +++ b/src/insets/insetminipage.h @@ -0,0 +1,51 @@ +// -*- C++ -*- +/* This file is part of + * ====================================================== + * + * LyX, The Document Processor + * + * Copyright 1998 The LyX Team. + * + *====================================================== + */ + +#ifndef InsetMinipage_H +#define InsetMinipage_H + +#ifdef __GNUG__ +#pragma interface +#endif + +#include "insetcollapsable.h" + +class Painter; + +/** The footnote inset + +*/ +class InsetMinipage : public InsetCollapsable { +public: + /// + explicit + InsetMinipage(); + /// + ~InsetMinipage() {} + /// + void Write(Buffer const * buf, ostream & os) const; + /// + Inset * Clone() const; + /// + Inset::Code LyxCode() const { return Inset::MINIPAGE_CODE; } + /// + int Latex(Buffer const *, std::ostream &, bool fragile, bool fp) const; + /// + const char * EditMessage() const; + /// + bool InsertInset(BufferView *, Inset * inset); + /// + bool InsertInsetAllowed(Inset * inset) const; + /// + LyXFont GetDrawFont(BufferView *, LyXParagraph * par, int pos) const; +}; + +#endif diff --git a/src/insets/insettext.C b/src/insets/insettext.C index 427e4689f0..8a826ce105 100644 --- a/src/insets/insettext.C +++ b/src/insets/insettext.C @@ -56,7 +56,9 @@ using std::max; extern unsigned char getCurrentTextClass(Buffer *); -#define TEXT(a) getLyXText(a) +// Jürgen, we don't like macros, even small ones like this. (Lgb) +//#define TEXT(a) getLyXText(a) +// I created a inline function in insettext.h instead. (Lgb) InsetText::InsetText() { @@ -140,7 +142,7 @@ void InsetText::WriteParagraphData(Buffer const * buf, ostream & os) const void InsetText::Read(Buffer const * buf, LyXLex & lex) { - string token, tmptok; + string token; int pos = 0; LyXParagraph * return_par = 0; char depth = 0; // signed or unsigned? @@ -148,8 +150,7 @@ void InsetText::Read(Buffer const * buf, LyXLex & lex) LyXParagraph::footnote_kind footnotekind = LyXParagraph::FOOTNOTE; LyXFont font(LyXFont::ALL_INHERIT); - LyXParagraph * p; - p = par->next; + LyXParagraph * p = par->next; delete par; while(p) { par = p; @@ -206,6 +207,7 @@ int InsetText::width(Painter &, LyXFont const &) const return insetWidth; } + int InsetText::textWidth(Painter & pain) const { return getMaxTextWidth(pain, this) - drawTextXOffset; @@ -742,6 +744,58 @@ InsetText::LocalDispatch(BufferView * bv, } } break; + case LFUN_PARAGRAPH_SPACING: + // This one is absolutely not working. When fiddling with this + // it also seems to me that the paragraphs inside the insettext + // inherit bufferparams/paragraphparams in a strange way. (Lgb) + { + LyXParagraph * par = TEXT(bv)->cursor.par(); + Spacing::Space cur_spacing = par->spacing.getSpace(); + float cur_value = 1.0; + if (cur_spacing == Spacing::Other) { + cur_value = par->spacing.getValue(); + } + +#ifdef HAVE_SSTREAM + istringstream istr(arg); +#else + istrstream istr(arg.c_str()); +#endif + string tmp; + istr >> tmp; + Spacing::Space new_spacing = cur_spacing; + float new_value = cur_value; + if (tmp.empty()) { + lyxerr << "Missing argument to `paragraph-spacing'" + << endl; + } else if (tmp == "single") { + new_spacing = Spacing::Single; + } else if (tmp == "onehalf") { + new_spacing = Spacing::Onehalf; + } else if (tmp == "double") { + new_spacing = Spacing::Double; + } else if (tmp == "other") { + new_spacing = Spacing::Other; + float tmpval = 0.0; + istr >> tmpval; + lyxerr << "new_value = " << tmpval << endl; + if (tmpval != 0.0) + new_value = tmpval; + } else if (tmp == "default") { + new_spacing = Spacing::Default; + } else { + lyxerr << _("Unknown spacing argument: ") + << arg << endl; + } + if (cur_spacing != new_spacing || cur_value != new_value) { + par->spacing.set(new_spacing, new_value); + //TEXT(bv)->RedoParagraph(owner->view()); + UpdateLocal(bv, CURSOR_PAR, true); + //bv->update(BufferView::SELECT|BufferView::FITCUR|BufferView::CHANGE); + } + } + break; + default: result = UNDISPATCHED; break; @@ -910,8 +964,12 @@ bool InsetText::InsertInset(BufferView * bv, Inset * inset) UpdatableInset * i = static_cast(inset); i->setOwner(static_cast(this)); } +#ifdef NEW_WAY + cpar(bv)->InsertInset(cpos(bv), inset); +#else cpar(bv)->InsertChar(cpos(bv), LyXParagraph::META_INSET); cpar(bv)->InsertInset(cpos(bv), inset); +#endif TEXT(bv)->selection = 0; UpdateLocal(bv, CURSOR_PAR, true); static_cast(inset)->Edit(bv, 0, 0, 0); @@ -979,11 +1037,13 @@ bool InsetText::checkAndActivateInset(BufferView * bv, int x, int y, } -int InsetText::getMaxTextWidth(Painter & pain, UpdatableInset const * inset) const +int InsetText::getMaxTextWidth(Painter & pain, + UpdatableInset const * inset) const { return getMaxWidth(pain, inset) - (2 * TEXT_TO_INSET_OFFSET); } + void InsetText::SetParagraphData(LyXParagraph *p) { LyXParagraph * np; @@ -1010,6 +1070,7 @@ void InsetText::SetParagraphData(LyXParagraph *p) need_update = INIT; } + void InsetText::SetAutoBreakRows(bool flag) { if (flag != autoBreakRows) { @@ -1018,28 +1079,33 @@ void InsetText::SetAutoBreakRows(bool flag) } } + void InsetText::SetDrawLockedFrame(bool flag) { if (flag != drawLockedFrame) drawLockedFrame = flag; } + void InsetText::SetFrameColor(LColor::color col) { if (frame_color != col) frame_color = col; } + LyXFont InsetText::GetDrawFont(BufferView * bv, LyXParagraph * p, int pos) const { return TEXT(bv)->GetFont(bv->buffer(), p, pos); } + int InsetText::cx(BufferView * bv) const { return TEXT(bv)->cursor.x() + top_x + 1; } + int InsetText::cy(BufferView * bv) const { long int y_dummy = 0; @@ -1047,31 +1113,36 @@ int InsetText::cy(BufferView * bv) const return TEXT(bv)->cursor.y() - tmprow->baseline(); } + int InsetText::cpos(BufferView * bv) const { return TEXT(bv)->cursor.pos(); } + LyXParagraph * InsetText::cpar(BufferView * bv) const { return TEXT(bv)->cursor.par(); } + Row * InsetText::crow(BufferView * bv) const { return TEXT(bv)->cursor.row(); } + LyXText * InsetText::getLyXText(BufferView * bv) const { if (cache.find(bv) != cache.end()) return cache[bv]; - LyXText *lt = new LyXText(const_cast(this)); + LyXText * lt = new LyXText(const_cast(this)); lt->init(bv); cache[bv] = lt; return lt; } + void InsetText::deleteLyXText(BufferView * bv) { cache.erase(bv); diff --git a/src/insets/insettext.h b/src/insets/insettext.h index 98c44b5147..7174d2a55e 100644 --- a/src/insets/insettext.h +++ b/src/insets/insettext.h @@ -195,6 +195,11 @@ private: int cpos(BufferView *) const; LyXParagraph * cpar(BufferView *) const; Row * crow(BufferView *) const; + + /// This instead of a macro + LyXText * TEXT(BufferView * bv) const { + return getLyXText(bv); + } /* Private structures and variables */ /// diff --git a/src/insets/lyxinset.h b/src/insets/lyxinset.h index 2955938572..cd73abe283 100644 --- a/src/insets/lyxinset.h +++ b/src/insets/lyxinset.h @@ -91,6 +91,10 @@ public: /// MARGIN_CODE, /// + FLOAT_CODE, + /// + MINIPAGE_CODE, + /// SPECIALCHAR_CODE, /// TABULAR_CODE, diff --git a/src/layout.C b/src/layout.C index 777358827f..0e8dfae7c0 100644 --- a/src/layout.C +++ b/src/layout.C @@ -509,29 +509,6 @@ enum LabelTypeTags { }; -#if 0 -static keyword_item labelTypeTags[] = { - { "bibliography", LA_BIBLIO }, - { "centered_top_environment", LA_CENTERED_TOP_ENVIRONMENT }, - { "counter_chapter", LA_COUNTER_CHAPTER }, - { "counter_enumi", LA_COUNTER_ENUMI }, - { "counter_enumii", LA_COUNTER_ENUMII }, - { "counter_enumiii", LA_COUNTER_ENUMIII }, - { "counter_enumiv", LA_COUNTER_ENUMIV }, - { "counter_paragraph", LA_COUNTER_PARAGRAPH }, - { "counter_section", LA_COUNTER_SECTION }, - { "counter_subparagraph", LA_COUNTER_SUBPARAGRAPH }, - { "counter_subsection", LA_COUNTER_SUBSECTION }, - { "counter_subsubsection", LA_COUNTER_SUBSUBSECTION }, - { "manual", LA_MANUAL }, - { "no_label", LA_NO_LABEL }, - { "sensitive", LA_SENSITIVE }, - { "static", LA_STATIC }, - { "top_environment", LA_TOP_ENVIRONMENT } -}; -#endif - - void LyXLayout::readLabelType(LyXLex & lexrc) { keyword_item labelTypeTags[] = { @@ -646,15 +623,6 @@ void LyXLayout::readEndLabelType(LyXLex & lexrc) } } -#if 0 -static keyword_item marginTags[] = { - { "dynamic", MARGIN_DYNAMIC }, - { "first_dynamic", MARGIN_FIRST_DYNAMIC }, - { "manual", MARGIN_MANUAL }, - { "right_address_box", MARGIN_RIGHT_ADDRESS_BOX }, - { "static", MARGIN_STATIC } -}; -#endif void LyXLayout::readMargin(LyXLex & lexrc) { @@ -688,17 +656,6 @@ void LyXLayout::readMargin(LyXLex & lexrc) } -#if 0 -static keyword_item latexTypeTags[] = { - { "command", LATEX_COMMAND }, - { "environment", LATEX_ENVIRONMENT }, - { "item_environment", LATEX_ITEM_ENVIRONMENT }, - { "list_environment", LATEX_LIST_ENVIRONMENT }, - { "paragraph", LATEX_PARAGRAPH } -}; -#endif - - void LyXLayout::readLatexType(LyXLex & lexrc) { keyword_item latexTypeTags[] = { @@ -738,16 +695,6 @@ enum SpacingTags { }; -#if 0 -static keyword_item spacingTags[] = { - {"double", ST_SPACING_DOUBLE }, - {"onehalf", ST_SPACING_ONEHALF }, - {"other", ST_OTHER }, - {"single", ST_SPACING_SINGLE } -}; -#endif - - void LyXLayout::readSpacing(LyXLex & lexrc) { keyword_item spacingTags[] = { @@ -842,30 +789,6 @@ enum TextClassTags { }; -#if 0 -static keyword_item textClassTags[] = { - { "classoptions", TC_CLASSOPTIONS }, - { "columns", TC_COLUMNS }, - { "defaultfont", TC_DEFAULTFONT }, - { "input", TC_INPUT }, - { "leftmargin", TC_LEFTMARGIN }, - { "maxcounter", TC_MAXCOUNTER }, - { "nostyle", TC_NOSTYLE }, - { "outputtype", TC_OUTPUTTYPE }, - { "pagestyle", TC_PAGESTYLE }, - { "preamble", TC_PREAMBLE }, - { "providesamsmath", TC_PROVIDESAMSMATH }, - { "providesmakeidx", TC_PROVIDESMAKEIDX }, - { "providesurl", TC_PROVIDESURL }, - { "rightmargin", TC_RIGHTMARGIN }, - { "secnumdepth", TC_SECNUMDEPTH }, - { "sides", TC_SIDES }, - { "style", TC_STYLE }, - { "tocdepth", TC_TOCDEPTH } -}; -#endif - - // Reads a textclass structure from file. bool LyXTextClass::Read(string const & filename, bool merge) { @@ -1064,15 +987,6 @@ bool LyXTextClass::Read(string const & filename, bool merge) } -#if 0 -static keyword_item outputTypeTags[] = { - { "docbook", DOCBOOK }, - { "latex", LATEX }, - { "linuxdoc", LINUXDOC }, - { "literate", LITERATE } -}; -#endif - void LyXTextClass::readOutputType(LyXLex & lexrc) { keyword_item outputTypeTags[] = { @@ -1118,22 +1032,6 @@ enum MaxCounterTags { }; -#if 0 -static keyword_item maxCounterTags[] = { - {"counter_chapter", MC_COUNTER_CHAPTER }, - {"counter_enumi", MC_COUNTER_ENUMI }, - {"counter_enumii", MC_COUNTER_ENUMII }, - {"counter_enumiii", MC_COUNTER_ENUMIII }, - {"counter_enumiv", MC_COUNTER_ENUMIV }, - {"counter_paragraph", MC_COUNTER_PARAGRAPH }, - {"counter_section", MC_COUNTER_SECTION }, - {"counter_subparagraph", MC_COUNTER_SUBPARAGRAPH }, - {"counter_subsection", MC_COUNTER_SUBSECTION }, - {"counter_subsubsection", MC_COUNTER_SUBSUBSECTION } -}; -#endif - - void LyXTextClass::readMaxCounter(LyXLex & lexrc) { keyword_item maxCounterTags[] = { @@ -1200,16 +1098,6 @@ enum ClassOptionsTags { }; -#if 0 -static keyword_item classOptionsTags[] = { - {"end", CO_END }, - {"fontsize", CO_FONTSIZE }, - {"other", CO_OTHER }, - {"pagestyle", CO_PAGESTYLE } -}; -#endif - - void LyXTextClass::readClassOptions(LyXLex & lexrc) { keyword_item classOptionsTags[] = { diff --git a/src/lyx_cb.C b/src/lyx_cb.C index 12cef90b2b..51ea17a1d1 100644 --- a/src/lyx_cb.C +++ b/src/lyx_cb.C @@ -2643,8 +2643,13 @@ extern "C" void TableApplyCB(FL_OBJECT *, long) current_view->text->cursor.par()->getParLanguage(current_view->buffer()->params); LyXFont font(LyXFont::ALL_INHERIT, lang); for (int i = 0; i < xsize * ysize - 1; ++i) { +#ifdef NEW_WAY + current_view->text->cursor.par() + ->InsertChar(0, LyXParagraph::META_NEWLINE, font); +#else current_view->text->cursor.par()->InsertChar(0, LyXParagraph::META_NEWLINE); current_view->text->cursor.par()->SetFont(0, font); +#endif } current_view->text->RedoParagraph(current_view); diff --git a/src/lyxfunc.C b/src/lyxfunc.C index 02c3c25452..ed1d3c00fa 100644 --- a/src/lyxfunc.C +++ b/src/lyxfunc.C @@ -56,6 +56,10 @@ using std::istringstream; #include "insets/insetexternal.h" #include "insets/insetgraphics.h" #include "insets/insetfoot.h" +#include "insets/insetmarginal.h" +#include "insets/insetminipage.h" +#include "insets/insetfloat.h" +#include "insets/insetlist.h" #include "insets/insettabular.h" #include "mathed/formulamacro.h" #include "toolbar.h" @@ -1996,16 +2000,17 @@ string LyXFunc::Dispatch(int ac, case LFUN_INSET_TEXT: { - InsetText * new_inset = new InsetText(); + InsetText * new_inset = new InsetText; if (owner->view()->insertInset(new_inset)) new_inset->Edit(owner->view(), 0, 0, 0); else delete new_inset; } break; + case LFUN_INSET_ERT: { - InsetERT * new_inset = new InsetERT(); + InsetERT * new_inset = new InsetERT; if (owner->view()->insertInset(new_inset)) new_inset->Edit(owner->view(), 0, 0, 0); else @@ -2015,7 +2020,7 @@ string LyXFunc::Dispatch(int ac, case LFUN_INSET_EXTERNAL: { - InsetExternal * new_inset = new InsetExternal(); + InsetExternal * new_inset = new InsetExternal; if (owner->view()->insertInset(new_inset)) new_inset->Edit(owner->view(), 0, 0, 0); else @@ -2025,7 +2030,27 @@ string LyXFunc::Dispatch(int ac, case LFUN_INSET_FOOTNOTE: { - InsetFoot * new_inset = new InsetFoot(); + InsetFoot * new_inset = new InsetFoot; + if (owner->view()->insertInset(new_inset)) + new_inset->Edit(owner->view(), 0, 0, 0); + else + delete new_inset; + } + break; + + case LFUN_INSET_MARGINAL: + { + InsetMarginal * new_inset = new InsetMarginal; + if (owner->view()->insertInset(new_inset)) + new_inset->Edit(owner->view(), 0, 0, 0); + else + delete new_inset; + } + break; + + case LFUN_INSET_MINIPAGE: + { + InsetMinipage * new_inset = new InsetMinipage; if (owner->view()->insertInset(new_inset)) new_inset->Edit(owner->view(), 0, 0, 0); else @@ -2033,6 +2058,26 @@ string LyXFunc::Dispatch(int ac, } break; + case LFUN_INSET_FLOAT: + { + InsetFloat * new_inset = new InsetFloat; + if (owner->view()->insertInset(new_inset)) + new_inset->Edit(owner->view(), 0, 0, 0); + else + delete new_inset; + } + break; + + case LFUN_INSET_LIST: + { + InsetList * new_inset = new InsetList; + if (owner->view()->insertInset(new_inset)) + new_inset->Edit(owner->view(), 0, 0, 0); + else + delete new_inset; + } + break; + case LFUN_INSET_TABULAR: { int r = 2, c = 2; diff --git a/src/lyxparagraph.h b/src/lyxparagraph.h index bafa4a29dc..00a76906f6 100644 --- a/src/lyxparagraph.h +++ b/src/lyxparagraph.h @@ -26,6 +26,8 @@ #include "support/block.h" #include "language.h" +#define NEW_WAY 1 + class BufferParams; class LyXBuffer; class TexRow; @@ -56,6 +58,7 @@ public: /// MINIPAGE_ALIGN_BOTTOM }; +#ifndef NEW_INSETS /// enum META_KIND { /// @@ -109,7 +112,7 @@ public: /// WIDE_TAB // CFO-G, 971106 }; - +#endif /// typedef char value_type; /// @@ -230,7 +233,7 @@ public: /// LyXTextClass::LayoutList::size_type layout; - +#ifndef NEW_INSETS /** \begin{itemize} \item no footnote, closed footnote, @@ -242,7 +245,7 @@ public: /// footnote, margin, fig, tab footnote_kind footnotekind; - +#endif //@Man: the LyX- DTP-switches //@{ /// @@ -421,8 +424,16 @@ public: size_type endpos) const; /// void InsertChar(size_type pos, char c); +#ifdef NEW_WAY + /// + void InsertChar(size_type pos, char c, LyXFont const &); +#endif /// void InsertInset(size_type pos, Inset * inset); +#ifdef NEW_WAY + /// + void InsertInset(size_type pos, Inset * inset, LyXFont const &); +#endif /// bool InsertInsetAllowed(Inset * inset); /// @@ -502,10 +513,6 @@ public: int type, char const * width, char const * widthp); /// void UnsetPExtraType(BufferParams const &); -#if 0 - /// - bool RoffContTableRows(std::ostream &, size_type i, int actcell); -#endif /// bool linuxDocConvertChar(char c, string & sgml_string); /// diff --git a/src/paragraph.C b/src/paragraph.C index 75a48929e8..6e432b619c 100644 --- a/src/paragraph.C +++ b/src/paragraph.C @@ -16,6 +16,7 @@ #include #include +#include #include "lyxparagraph.h" #include "support/textutils.h" @@ -71,9 +72,10 @@ LyXParagraph::LyXParagraph() itemdepth = 0; next = 0; previous = 0; +#ifndef NEW_INSETS footnoteflag = LyXParagraph::NO_FOOTNOTE; footnotekind = LyXParagraph::FOOTNOTE; // should not be needed - +#endif align = LYX_ALIGN_BLOCK; #ifndef NEW_TABULAR @@ -105,9 +107,10 @@ LyXParagraph::LyXParagraph(LyXParagraph * par) previous = par; previous->next = this; // end +#ifndef NEW_INSETS footnoteflag = LyXParagraph::NO_FOOTNOTE; footnotekind = LyXParagraph::FOOTNOTE; - +#endif #ifndef NEW_TABULAR /* table stuff -- begin*/ table = 0; @@ -133,7 +136,7 @@ void LyXParagraph::writeFile(Buffer const * buf, ostream & os, if (footnoteflag != LyXParagraph::NO_FOOTNOTE || !previous - || previous->footnoteflag == LyXParagraph::NO_FOOTNOTE){ + || previous->footnoteflag == LyXParagraph::NO_FOOTNOTE) { // The beginning or the end of a footnote environment? if (footflag != footnoteflag) { @@ -461,10 +464,17 @@ bool LyXParagraph::InsertFromMinibuffer(LyXParagraph::size_type pos) if ((minibuffer_char == LyXParagraph::META_INSET) && !InsertInsetAllowed(minibuffer_inset)) return false; +#ifdef NEW_WAY + if (minibuffer_char == LyXParagraph::META_INSET) + InsertInset(pos, minibuffer_inset, minibuffer_font); + else + InsertChar(pos, minibuffer_char, minibuffer_font); +#else InsertChar(pos, minibuffer_char); SetFont(pos, minibuffer_font); if (minibuffer_char == LyXParagraph::META_INSET) InsertInset(pos, minibuffer_inset); +#endif return true; } @@ -535,9 +545,11 @@ void LyXParagraph::Erase(LyXParagraph::size_type pos) // > because last is the next unused position, and you can // use it if you want if (pos > size()) { +#ifndef NEW_INSETS if (next && next->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) NextAfterFootnote()->Erase(pos - text.size() - 1); else +#endif lyxerr.debug() << "ERROR (LyXParagraph::Erase): " "position does not exist." << endl; return; @@ -596,14 +608,17 @@ void LyXParagraph::Erase(LyXParagraph::size_type pos) void LyXParagraph::InsertChar(LyXParagraph::size_type pos, char c) { +#ifndef NEW_WAY // > because last is the next unused position, and you can // use it if you want if (pos > size()) { +#ifndef NEW_INSETS if (next && next->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) NextAfterFootnote()->InsertChar(pos - text.size() - 1, c); else +#endif lyxerr.debug() << "ERROR (LyXParagraph::InsertChar): " "position does not exist." << endl; return; @@ -622,20 +637,68 @@ void LyXParagraph::InsertChar(LyXParagraph::size_type pos, char c) pos, matchIT()); it != insetlist.end(); ++it) ++(*it).pos; +#else + LyXFont f(LyXFont::ALL_INHERIT); + InsertChar(pos, c, f); +#endif } +#ifdef NEW_WAY +void LyXParagraph::InsertChar(LyXParagraph::size_type pos, + char c, LyXFont const & font) +{ + // > because last is the next unused position, and you can + // use it if you want + if (pos > size()) { +#ifndef NEW_INSETS + if (next + && next->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) + NextAfterFootnote()->InsertChar(pos - text.size() - 1, + c); + else +#endif + lyxerr.debug() << "ERROR (LyXParagraph::InsertChar): " + "position does not exist." << endl; + return; + } + text.insert(text.begin() + pos, c); + // Update the font table. + for (FontList::iterator it = lower_bound(fontlist.begin(), + fontlist.end(), + pos, matchFT()); + it != fontlist.end(); ++it) + ++(*it).pos; + + // Update the inset table. + for (InsetList::iterator it = lower_bound(insetlist.begin(), + insetlist.end(), + pos, matchIT()); + it != insetlist.end(); ++it) + ++(*it).pos; + + SetFont(pos, font); +} +#endif + + void LyXParagraph::InsertInset(LyXParagraph::size_type pos, Inset * inset) { +#ifdef NEW_WAY + LyXFont f(LyXFont::ALL_INHERIT); + InsertInset(pos, inset, f); +#else // > because last is the next unused position, and you can // use it if you want if (pos > size()) { +#ifndef NEW_INSETS if (next && next->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) NextAfterFootnote() ->InsertInset(pos - text.size() - 1, inset); - else + else +#endif lyxerr << "ERROR (LyXParagraph::InsertInset): " "position does not exist: " << pos << endl; return; @@ -659,9 +722,50 @@ void LyXParagraph::InsertInset(LyXParagraph::size_type pos, if (inset_owner) inset->setOwner(inset_owner); } +#endif } +#ifdef NEW_WAY +void LyXParagraph::InsertInset(LyXParagraph::size_type pos, + Inset * inset, LyXFont const & font) +{ + Assert(inset); + + // > because last is the next unused position, and you can + // use it if you want + if (pos > size()) { +#ifndef NEW_INSETS + if (next + && next->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) + NextAfterFootnote() + ->InsertInset(pos - text.size() - 1, + inset, font); + else +#endif + lyxerr << "ERROR (LyXParagraph::InsertInset): " + "position does not exist: " << pos << endl; + return; + } + + InsertChar(pos, META_INSET, font); + Assert(text[pos] == META_INSET); + + // Add a new entry in the inset table. + InsetList::iterator it = lower_bound(insetlist.begin(), + insetlist.end(), + pos, matchIT()); + if (it != insetlist.end() && (*it).pos == pos) + lyxerr << "ERROR (LyXParagraph::InsertInset): " + "there is an inset in position: " << pos << endl; + else + insetlist.insert(it, InsetTable(pos, inset)); + if (inset_owner) + inset->setOwner(inset_owner); +} +#endif + + bool LyXParagraph::InsertInsetAllowed(Inset * inset) { if (inset_owner) @@ -673,15 +777,17 @@ bool LyXParagraph::InsertInsetAllowed(Inset * inset) Inset * LyXParagraph::GetInset(LyXParagraph::size_type pos) { if (pos >= size()) { +#ifndef NEW_INSETS if (next && next->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) return NextAfterFootnote() ->GetInset(pos - text.size() - 1); - else { + else +#endif lyxerr << "ERROR (LyXParagraph::GetInset): " "position does not exist: " << pos << endl; - } + return 0; } // Find the inset. @@ -693,6 +799,8 @@ Inset * LyXParagraph::GetInset(LyXParagraph::size_type pos) lyxerr << "ERROR (LyXParagraph::GetInset): " "Inset does not exist: " << pos << endl; + //::raise(SIGSTOP); + // text[pos] = ' '; // WHY!!! does this set the pos to ' '???? // Did this commenting out introduce a bug? So far I have not // see any, please enlighten me. (Lgb) @@ -705,15 +813,17 @@ Inset * LyXParagraph::GetInset(LyXParagraph::size_type pos) Inset const * LyXParagraph::GetInset(LyXParagraph::size_type pos) const { if (pos >= size()) { +#ifndef NEW_INSETS if (next && next->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) return NextAfterFootnote() ->GetInset(pos - text.size() - 1); - else { + else +#endif lyxerr << "ERROR (LyXParagraph::GetInset): " "position does not exist: " << pos << endl; - } + return 0; } // Find the inset. @@ -725,6 +835,7 @@ Inset const * LyXParagraph::GetInset(LyXParagraph::size_type pos) const lyxerr << "ERROR (LyXParagraph::GetInset): " "Inset does not exist: " << pos << endl; + //::raise(SIGSTOP); //text[pos] = ' '; // WHY!!! does this set the pos to ' '???? // Did this commenting out introduce a bug? So far I have not // see any, please enlighten me. (Lgb) @@ -749,12 +860,14 @@ LyXFont LyXParagraph::GetFontSettings(BufferParams const & bparams, // > because last is the next unused position, and you can // use it if you want else if (pos > size()) { +#ifndef NEW_INSETS if (next && next->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) return NextAfterFootnote() ->GetFontSettings(bparams, pos - text.size() - 1); - else { + else +#endif // Why is it an error to ask for the font of a // position that does not exist? Would it be // enough for this to be enabled on debug? @@ -764,7 +877,6 @@ LyXFont LyXParagraph::GetFontSettings(BufferParams const & bparams, "position does not exist. " << pos << " (" << static_cast(pos) << ")" << endl; - } } else if (pos > 0) { return GetFontSettings(bparams, pos - 1); } else // pos = size() = 0 @@ -779,8 +891,12 @@ LyXFont LyXParagraph::GetFirstFontSettings() const if (size() > 0) { if (!fontlist.empty()) return fontlist[0].font; - } else if (next && next->footnoteflag != LyXParagraph::NO_FOOTNOTE) + } + +#ifndef NEW_INSETS + else if (next && next->footnoteflag != LyXParagraph::NO_FOOTNOTE) return NextAfterFootnote()->GetFirstFontSettings(); +#endif return LyXFont(LyXFont::ALL_INHERIT); } @@ -877,10 +993,13 @@ char LyXParagraph::GetChar(LyXParagraph::size_type pos) // > because last is the next unused position, and you can // use it if you want else if (pos > size()) { +#ifndef NEW_INSETS if (next && next->footnoteflag != LyXParagraph::NO_FOOTNOTE) return NextAfterFootnote() ->GetChar(pos - text.size() - 1); - else { + else +#endif + { lyxerr << "ERROR (LyXParagraph::GetChar): " "position does not exist." << pos << " (" << static_cast(pos) @@ -888,8 +1007,12 @@ char LyXParagraph::GetChar(LyXParagraph::size_type pos) // Assert(false); // This triggers sometimes... // Why? } + return '\0'; - } else { + } + +#ifndef NEW_INSETS + else { // We should have a footnote environment. if (!next || next->footnoteflag == LyXParagraph::NO_FOOTNOTE) { // Notice that LyX does request the @@ -914,6 +1037,7 @@ char LyXParagraph::GetChar(LyXParagraph::size_type pos) } return '\0'; // to shut up gcc } +#endif } @@ -927,10 +1051,13 @@ char LyXParagraph::GetChar(LyXParagraph::size_type pos) const // > because last is the next unused position, and you can // use it if you want else if (pos > size()) { +#ifndef NEW_INSETS if (next && next->footnoteflag != LyXParagraph::NO_FOOTNOTE) return NextAfterFootnote() ->GetChar(pos - text.size() - 1); - else { + else +#endif + { lyxerr << "ERROR (LyXParagraph::GetChar const): " "position does not exist." << pos << " (" << static_cast(pos) @@ -938,7 +1065,9 @@ char LyXParagraph::GetChar(LyXParagraph::size_type pos) const Assert(false); } return '\0'; - } else { + } +#ifndef NEW_INSETS + else { // We should have a footnote environment. if (!next || next->footnoteflag == LyXParagraph::NO_FOOTNOTE) { // Notice that LyX does request the @@ -963,6 +1092,7 @@ char LyXParagraph::GetChar(LyXParagraph::size_type pos) const } return '\0'; // to shut up gcc } +#endif } @@ -1015,11 +1145,13 @@ string LyXParagraph::GetWord(LyXParagraph::size_type & lastpos) const LyXParagraph::size_type LyXParagraph::Last() const { +#ifndef NEW_INSETS if (next && next->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) return text.size() + NextAfterFootnote()->Last() + 1; // the 1 is the symbol // for the footnote else +#endif return text.size(); } @@ -1029,11 +1161,13 @@ LyXParagraph * LyXParagraph::ParFromPos(LyXParagraph::size_type pos) // > because last is the next unused position, and you can // use it if you want if (pos > size()) { +#ifndef NEW_INSETS if (next && next->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) return NextAfterFootnote() ->ParFromPos(pos - text.size() - 1); - else + else +#endif lyxerr << "ERROR (LyXParagraph::ParFromPos): " "position does not exist." << endl; return this; @@ -1047,11 +1181,13 @@ int LyXParagraph::PositionInParFromPos(LyXParagraph::size_type pos) const // > because last is the next unused position, and you can // use it if you want if (pos > size()) { +#ifndef NEW_INSETS if (next && next->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) return NextAfterFootnote() ->PositionInParFromPos(pos - text.size() - 1); - else + else +#endif lyxerr << "ERROR (LyXParagraph::PositionInParFromPos): " "position does not exist." << endl; @@ -1068,14 +1204,16 @@ void LyXParagraph::SetFont(LyXParagraph::size_type pos, // > because last is the next unused position, and you can // use it if you want if (pos > size()) { +#ifndef NEW_INSETS if (next && next->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) { NextAfterFootnote()->SetFont(pos - text.size() - 1, font); - } else { + } else +#endif lyxerr << "ERROR (LyXParagraph::SetFont): " "position does not exist." << endl; - } + return; } @@ -1136,6 +1274,7 @@ void LyXParagraph::SetFont(LyXParagraph::size_type pos, // This function is able to hide closed footnotes. LyXParagraph * LyXParagraph::Next() { +#ifndef NEW_INSETS if (next && next->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) { LyXParagraph * tmp = next; while (tmp @@ -1148,12 +1287,14 @@ LyXParagraph * LyXParagraph::Next() else return next; // This should never happen! } else +#endif return next; } LyXParagraph * LyXParagraph::NextAfterFootnote() { +#ifndef NEW_INSETS if (next && next->footnoteflag != LyXParagraph::NO_FOOTNOTE) { LyXParagraph * tmp = next; while (tmp && tmp->footnoteflag != LyXParagraph::NO_FOOTNOTE) @@ -1164,12 +1305,14 @@ LyXParagraph * LyXParagraph::NextAfterFootnote() else return next; // This should never happen! } else +#endif return next; } LyXParagraph const * LyXParagraph::NextAfterFootnote() const { +#ifndef NEW_INSETS if (next && next->footnoteflag != LyXParagraph::NO_FOOTNOTE) { LyXParagraph * tmp = next; while (tmp && tmp->footnoteflag != LyXParagraph::NO_FOOTNOTE) @@ -1180,12 +1323,14 @@ LyXParagraph const * LyXParagraph::NextAfterFootnote() const else return next; // This should never happen! } else +#endif return next; } LyXParagraph * LyXParagraph::PreviousBeforeFootnote() { +#ifndef NEW_INSETS LyXParagraph * tmp; if (previous && previous->footnoteflag != LyXParagraph::NO_FOOTNOTE) { tmp = previous; @@ -1197,12 +1342,14 @@ LyXParagraph * LyXParagraph::PreviousBeforeFootnote() else return previous; // This should never happen! } else +#endif return previous; } LyXParagraph * LyXParagraph::LastPhysicalPar() { +#ifndef NEW_INSETS if (footnoteflag != LyXParagraph::NO_FOOTNOTE) return this; @@ -1212,10 +1359,14 @@ LyXParagraph * LyXParagraph::LastPhysicalPar() tmp = tmp->NextAfterFootnote(); return tmp; +#else + return this; +#endif } LyXParagraph const * LyXParagraph::LastPhysicalPar() const { +#ifndef NEW_INSETS if (footnoteflag != LyXParagraph::NO_FOOTNOTE) return this; @@ -1224,11 +1375,15 @@ LyXParagraph const * LyXParagraph::LastPhysicalPar() const && tmp->next->footnoteflag != LyXParagraph::NO_FOOTNOTE) tmp = tmp->NextAfterFootnote(); - return tmp; + return tmp; +#else + return this; +#endif } LyXParagraph * LyXParagraph::FirstPhysicalPar() { +#ifndef NEW_INSETS if (!IsDummy()) return this; LyXParagraph * tmppar = this; @@ -1242,11 +1397,15 @@ LyXParagraph * LyXParagraph::FirstPhysicalPar() return this; } else return tmppar; +#else + return this; +#endif } LyXParagraph const * LyXParagraph::FirstPhysicalPar() const { +#ifndef NEW_INSETS if (!IsDummy()) return this; LyXParagraph const * tmppar = this; @@ -1260,6 +1419,9 @@ LyXParagraph const * LyXParagraph::FirstPhysicalPar() const return this; } else return tmppar; +#else + return this; +#endif } @@ -1269,7 +1431,8 @@ LyXParagraph * LyXParagraph::Previous() LyXParagraph * tmp = previous; if (!tmp) return tmp; - + +#ifndef NEW_INSETS if (tmp->previous && tmp->previous->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) { tmp = tmp->previous; @@ -1282,6 +1445,7 @@ LyXParagraph * LyXParagraph::Previous() else return previous; } else +#endif return previous; } @@ -1292,7 +1456,7 @@ LyXParagraph const * LyXParagraph::Previous() const LyXParagraph * tmp = previous; if (!tmp) return tmp; - +#ifndef NEW_INSETS if (tmp->previous && tmp->previous->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) { tmp = tmp->previous; @@ -1305,6 +1469,7 @@ LyXParagraph const * LyXParagraph::Previous() const else return previous; } else +#endif return previous; } @@ -1319,10 +1484,11 @@ void LyXParagraph::BreakParagraph(BufferParams const & bparams, LyXParagraph * firstpar = FirstPhysicalPar(); LyXParagraph * tmp = new LyXParagraph(par); - + +#ifndef NEW_INSETS tmp->footnoteflag = footnoteflag; tmp->footnotekind = footnotekind; - +#endif // this is an idea for a more userfriendly layout handling, I will // see what the users say @@ -1387,9 +1553,10 @@ void LyXParagraph::BreakParagraph(BufferParams const & bparams, void LyXParagraph::MakeSameLayout(LyXParagraph const * par) { par = par->FirstPhysicalPar(); +#ifndef NEW_INSETS footnoteflag = par->footnoteflag; footnotekind = par->footnotekind; - +#endif layout = par->layout; align = par-> align; SetLabelWidthString(par->labelwidthstring); @@ -1416,6 +1583,7 @@ void LyXParagraph::MakeSameLayout(LyXParagraph const * par) } +#ifndef NEW_INSETS LyXParagraph * LyXParagraph::FirstSelfrowPar() { LyXParagraph * tmppar = this; @@ -1431,6 +1599,8 @@ LyXParagraph * LyXParagraph::FirstSelfrowPar() else return tmppar; } +#endif + int LyXParagraph::StripLeadingSpaces(LyXTextClassList::size_type tclass) { @@ -1491,9 +1661,10 @@ bool LyXParagraph::HasSameLayout(LyXParagraph const * par) const par = par->FirstPhysicalPar(); return ( +#ifndef NEW_INSETS par->footnoteflag == footnoteflag && par->footnotekind == footnotekind && - +#endif par->layout == layout && par->align == align && @@ -1583,13 +1754,14 @@ void LyXParagraph::PasteParagraph(BufferParams const & bparams) } // delete the next paragraph - LyXParagraph *ppar = the_next->previous; - LyXParagraph *npar = the_next->next; + LyXParagraph * ppar = the_next->previous; + LyXParagraph * npar = the_next->next; delete the_next; ppar->next = npar; } +#ifndef NEW_INSETS void LyXParagraph::OpenFootnote(LyXParagraph::size_type pos) { LyXParagraph * par = ParFromPos(pos); @@ -1610,6 +1782,7 @@ void LyXParagraph::CloseFootnote(LyXParagraph::size_type pos) par = par->next; } } +#endif int LyXParagraph::GetEndLabel(BufferParams const & bparams) const { @@ -2024,6 +2197,7 @@ LyXParagraph * LyXParagraph::TeXOnePar(Buffer const * buf, bool need_par = SimpleTeXOnePar(buf, bparams, os, texrow, moving_arg); +#ifndef NEW_INSETS // Spit out footnotes LyXParagraph * par = next; if (lyxrc.rtl_support) { @@ -2070,6 +2244,7 @@ LyXParagraph * LyXParagraph::TeXOnePar(Buffer const * buf, par = par->next; } } +#endif // Make sure that \\par is done with the font of the last // character if this has another size as the default. @@ -3376,99 +3551,6 @@ void LyXParagraph::SimpleTeXSpecialChars(Buffer const * buf, } -#if 0 -bool LyXParagraph::RoffContTableRows(ostream & os, - LyXParagraph::size_type i, - int actcell) -{ - if (!table) - return false; - - LyXFont font1(LyXFont::ALL_INHERIT); - LyXFont font2; - Inset * inset; - char c; - - string fname2 = TmpFileName(string(), "RAT2"); - int lastpos = i; - int cell = table->CellHasContRow(actcell); - ++actcell; - while(cell >= 0) { - // first find the right position - i = lastpos; - for (; i < size() && actcell < cell; ++i) { - c = GetChar(i); - if (c == LyXParagraph::META_NEWLINE) - ++actcell; - } - lastpos = i; - c = GetChar(i); - if ((c != ' ') && (c != LyXParagraph::META_NEWLINE)) - os << " "; - for (; i < size() - && (c = GetChar(i)) != LyXParagraph::META_NEWLINE; - ++i) { - font2 = GetFontSettings(i); - if (font1.latex() != font2.latex()) { - if (font2.latex() != LyXFont::OFF) - continue; - } - c = GetChar(i); - switch (c) { - case LyXParagraph::META_INSET: - if ((inset = GetInset(i))) { -#ifdef HAVE_SSTREAM - stringstream ss(ios::in | ios::out); - inset->Ascii(buffer, ss); - ss.seekp(0); - ss.get(c); - while (!ss) { - if (c == '\\') - os << "\\\\"; - else - os << c; - ss.get(c); - } -#else - strstream ss; - inset->Ascii(buffer, ss); - ss.seekp(0); - ss.get(c); - while (!ss) { - if (c == '\\') - os << "\\\\"; - else - os << c; - ss.get(c); - } - delete [] ss.str(); -#endif - } - break; - case LyXParagraph::META_NEWLINE: - break; - case LyXParagraph::META_HFILL: - break; - case '\\': - os << "\\\\"; - break; - default: - if (c != '\0') - os << c; - else - lyxerr.debug() << "RoffAsciiTable: " - "NULL char in structure." - << endl; - break; - } - } - cell = table->CellHasContRow(actcell); - } - return true; -} -#endif - - LyXParagraph * LyXParagraph::TeXDeeper(Buffer const * buf, BufferParams const & bparams, ostream & os, TexRow & texrow, @@ -3790,6 +3872,7 @@ LyXParagraph * LyXParagraph::TeXEnvironment(Buffer const * buf, } +#ifndef NEW_INSETS LyXParagraph * LyXParagraph::TeXFootnote(Buffer const * buf, BufferParams const & bparams, ostream & os, TexRow & texrow, @@ -4070,7 +4153,7 @@ bool LyXParagraph::IsDummy() const return (footnoteflag == LyXParagraph::NO_FOOTNOTE && previous && previous->footnoteflag != LyXParagraph::NO_FOOTNOTE); } - +#endif void LyXParagraph::SetPExtraType(BufferParams const & bparams, int type, char const * width, @@ -4310,11 +4393,14 @@ string LyXParagraph::String(Buffer const * buffer, bool label) } } +#ifndef NEW_INSETS if (next && next->footnoteflag != LyXParagraph::NO_FOOTNOTE && footnoteflag == LyXParagraph::NO_FOOTNOTE) s += NextAfterFootnote()->String(buffer, false); - if (!IsDummy()) { + if (!IsDummy()) +#endif + { if (isRightToLeftPar(bparams)) reverse(s.begin() + len,s.end()); } diff --git a/src/support/lyxsum.C b/src/support/lyxsum.C index 26028bb103..fbf532d34d 100644 --- a/src/support/lyxsum.C +++ b/src/support/lyxsum.C @@ -126,6 +126,7 @@ unsigned long lyx::sum(char const * file) #else ostrstream ostr; ostr << ifs.rdbuf(); + ostr << '\0'; char * tmp = ostr.str(); if (!tmp) return 0; // empty file string w(tmp, ostr.tellp()); diff --git a/src/text.C b/src/text.C index 00250ee27a..b5f04719ce 100644 --- a/src/text.C +++ b/src/text.C @@ -207,6 +207,7 @@ int LyXText::SingleWidth(BufferView * bview, LyXParagraph * par, } else if (IsHfillChar(c)) { return 3; /* Because of the representation * as vertical lines */ +#ifndef NEW_INSETS } else if (c == LyXParagraph::META_FOOTNOTE || c == LyXParagraph::META_MARGIN || c == LyXParagraph::META_FIG || @@ -241,6 +242,7 @@ int LyXText::SingleWidth(BufferView * bview, LyXParagraph * par, font.decSize(); font.decSize(); return lyxfont::width(fs, font); +#endif } else if (c == LyXParagraph::META_INSET) { Inset * tmpinset = par->GetInset(pos); if (tmpinset) { @@ -420,6 +422,7 @@ bool LyXText::IsBoundary(Buffer const * buf, LyXParagraph * par, return rtl != rtl2; } + bool LyXText::IsBoundary(Buffer const * buf, LyXParagraph * par, LyXParagraph::size_type pos, LyXFont const & font) const @@ -508,7 +511,7 @@ void LyXText::draw(BufferView * bview, Row const * row, LyXFont font = GetFont(bview->buffer(), row->par(), pos); LyXFont font2 = font; - +#ifndef NEW_INSETS if (c == LyXParagraph::META_FOOTNOTE || c == LyXParagraph::META_MARGIN || c == LyXParagraph::META_FIG @@ -559,7 +562,9 @@ void LyXText::draw(BufferView * bview, Row const * row, ++vpos; return; - } else if (c == LyXParagraph::META_INSET) { + } else +#endif + if (c == LyXParagraph::META_INSET) { Inset const * tmpinset = row->par()->GetInset(pos); if (tmpinset) { tmpinset->draw(bview, font, offset+row->baseline(), x, @@ -700,14 +705,14 @@ int LyXText::LeftMargin(BufferView * bview, Row const * row) const textclasslist .TextClass(bview->buffer()->params.textclass) .defaultfont()); - +#ifndef NEW_INSETS if (row->par()->footnoteflag == LyXParagraph::OPEN_FOOTNOTE) { LyXFont font(LyXFont::ALL_SANE); font.setSize(LyXFont::SIZE_SMALL); x += lyxfont::width("Mwide-figM", font) + LYX_PAPER_MARGIN/2; } - +#endif // this is the way, LyX handles the LaTeX-Environments. // I have had this idea very late, so it seems to be a // later added hack and this is true @@ -916,11 +921,12 @@ int LyXText::RightMargin(Buffer const * buf, Row const * row) const textclasslist .TextClass(buf->params.textclass) .defaultfont()); - + +#ifndef NEW_INSETS if (row->par()->footnoteflag == LyXParagraph::OPEN_FOOTNOTE) { x += LYX_PAPER_MARGIN / 2; } - +#endif // this is the way, LyX handles the LaTeX-Environments. // I have had this idea very late, so it seems to be a // later added hack and this is true @@ -982,6 +988,7 @@ int LyXText::LabelEnd (BufferView * bview, Row const * row) const } +#ifndef NEW_TABULAR /* table stuff -- begin*/ int LyXText::NumberOfCell(LyXParagraph * par, LyXParagraph::size_type pos) const @@ -1011,7 +1018,6 @@ int LyXText::WidthOfCell(BufferView * bview, LyXParagraph * par, } -#ifndef NEW_TABULAR bool LyXText::HitInTable(BufferView * bview, Row * row, int x) const { float tmpx; @@ -1022,7 +1028,6 @@ bool LyXText::HitInTable(BufferView * bview, Row * row, int x) const fill_hfill, fill_label_hfill, false); return (x > tmpx && x < tmpx + row->par()->table->WidthOfTable()); } -#endif bool LyXText::MouseHitInTable(BufferView * bview, int x, long y) const @@ -1033,6 +1038,7 @@ bool LyXText::MouseHitInTable(BufferView * bview, int x, long y) const /* table stuff -- end*/ +#endif // get the next breakpoint in a given paragraph @@ -1927,6 +1933,7 @@ void LyXText::BreakParagraph(BufferView * bview, char keep_layout) } +#ifndef NEW_INSETS void LyXText::OpenFootnote(BufferView * bview) { LyXParagraph * endpar,* tmppar; @@ -1981,8 +1988,10 @@ void LyXText::OpenFootnote(BufferView * bview) SetCursor(bview, par->next, 0); sel_cursor = cursor; } - +#endif + +#ifndef NEW_TABULAR /* table stuff -- begin*/ void LyXText::TableFeatures(BufferView * bview, int feature, string const & val) const @@ -2086,8 +2095,12 @@ void LyXText::TableFeatures(BufferView * bview, int feature) const Language const * lang = cursor.par()->getParLanguage(bview->buffer()->params); LyXFont font(LyXFont::ALL_INHERIT,lang); for (int i = 0; i < number; ++i) { +#ifdef NEW_WAY + cursor.par()->InsertChar(pos, LyXParagraph::META_NEWLINE, font); +#else cursor.par()->InsertChar(pos, LyXParagraph::META_NEWLINE); cursor.par()->SetFont(pos, font); +#endif } /* append the row into the table */ @@ -2125,8 +2138,12 @@ void LyXText::TableFeatures(BufferView * bview, int feature) const Language const * lang = cursor.par()->getParLanguage(bview->buffer()->params); LyXFont font(LyXFont::ALL_INHERIT,lang); for (int i = 0; i < number; ++i) { +#ifdef NEW_WAY + cursor.par()->InsertChar(pos, LyXParagraph::META_NEWLINE, font); +#else cursor.par()->InsertChar(pos, LyXParagraph::META_NEWLINE); cursor.par()->SetFont(pos, font); +#endif } /* append the row into the table */ @@ -2143,8 +2160,14 @@ void LyXText::TableFeatures(BufferView * bview, int feature) const do{ if (pos && (cursor.par()->IsNewline(pos-1))){ if (cursor.par()->table->AppendCellAfterCell(cell_org, cell)) { +#ifdef NEW_WAY + cursor.par()->InsertChar(pos, + LyXParagraph::META_NEWLINE, + font); +#else cursor.par()->InsertChar(pos, LyXParagraph::META_NEWLINE); cursor.par()->SetFont(pos, font); +#endif if (pos <= cursor.pos()) cursor.pos(cursor.pos() + 1); ++pos; @@ -2157,8 +2180,13 @@ void LyXText::TableFeatures(BufferView * bview, int feature) const This saves one byte memory per table ;-) */ if (cursor.par()->table->AppendCellAfterCell(cell_org, cell)) { LyXParagraph::size_type last = cursor.par()->Last(); +#ifdef NEW_WAY + cursor.par()->InsertChar(last, + LyXParagraph::META_NEWLINE, font); +#else cursor.par()->InsertChar(last, LyXParagraph::META_NEWLINE); cursor.par()->SetFont(last, font); +#endif } /* append the column into the table */ @@ -2656,6 +2684,7 @@ void LyXText::BackspaceInTable(BufferView * bview) } /* table stuff -- end*/ +#endif // Just a macro to make some thing easier. @@ -2895,6 +2924,7 @@ void LyXText::charInserted() } } + void LyXText::PrepareToPrint(BufferView * bview, Row * row, float & x, float & fill_separator, @@ -2910,6 +2940,7 @@ void LyXText::PrepareToPrint(BufferView * bview, fill_separator = 0; fill_label_hfill = 0; +#ifndef NEW_INSETS bool is_rtl = row->par()->isRightToLeftPar(bview->buffer()->params); if (is_rtl) { @@ -2919,7 +2950,9 @@ void LyXText::PrepareToPrint(BufferView * bview, font.setSize(LyXFont::SIZE_SMALL); x += lyxfont::width("Mwide-figM", font); } - } else if (workWidth(bview) > 0) + } else +#endif + if (workWidth(bview) > 0) x = LeftMargin(bview, row); else x = 0; @@ -3969,6 +4002,7 @@ void LyXText::GetVisibleRow(BufferView * bview, int y_offset, int x_offset, } int box_x = 0; +#ifndef NEW_INSETS if (row_ptr->par()->footnoteflag == LyXParagraph::OPEN_FOOTNOTE) { LyXFont font(LyXFont::ALL_SANE); font.setSize(LyXFont::SIZE_FOOTNOTE); @@ -4086,7 +4120,7 @@ void LyXText::GetVisibleRow(BufferView * bview, int y_offset, int x_offset, workWidth(bview) - LYX_PAPER_MARGIN, y_offset, LColor::footnote); } - +#endif // Draw appendix lines LyXParagraph * firstpar = row_ptr->par()->FirstPhysicalPar(); if (firstpar->appendix){ @@ -4800,7 +4834,8 @@ int LyXText::GetColumnNearX(BufferView * bview, Row * row, int & x, return c; } - + +#ifndef NEW_INSETS /* turn the selection into a new environment. If there is no selection, * create an empty environment */ void LyXText::InsertFootnoteEnvironment(BufferView * bview, @@ -4943,7 +4978,8 @@ void LyXText::InsertFootnoteEnvironment(BufferView * bview, ClearSelection(); } - +#endif + // returns pointer to a specified row Row * LyXText::GetRow(LyXParagraph * par, diff --git a/src/text2.C b/src/text2.C index ecf2b2eb2b..81b2ed8e8b 100644 --- a/src/text2.C +++ b/src/text2.C @@ -162,14 +162,6 @@ LyXText::~LyXText() } -#if 0 -void LyXText::owner(BufferView * bv) -{ - if (bv_owner && bv) lyxerr << "LyXText::bv_owner already set!" << endl; - bv_owner = bv; -} -#endif - // Gets the fully instantiated font at a given position in a paragraph // Basically the same routine as LyXParagraph::getFont() in paragraph.C. // The difference is that this one is used for displaying, and thus we @@ -243,13 +235,14 @@ LyXFont LyXText::GetFont(Buffer const * buf, LyXParagraph * par, tmpfont.realize(textclasslist.TextClass(buf->params.textclass).defaultfont()); +#ifndef NEW_INSETS // Cosmetic improvement: If this is an open footnote, make the font // smaller. if (par->footnoteflag == LyXParagraph::OPEN_FOOTNOTE && par->footnotekind == LyXParagraph::FOOTNOTE) { tmpfont.decSize(); } - +#endif return tmpfont; } @@ -291,11 +284,12 @@ void LyXText::SetCharFont(Buffer const * buf, LyXParagraph * par, layoutfont.realize(textclasslist.TextClass(buf->params.textclass).defaultfont()); +#ifndef NEW_INSETS if (par->footnoteflag == LyXParagraph::OPEN_FOOTNOTE && par->footnotekind == LyXParagraph::FOOTNOTE) { layoutfont.decSize(); } - +#endif // Now, reduce font against full layout font font.reduce(layoutfont); @@ -394,8 +388,9 @@ void LyXText::InsertParagraph(BufferView * bview, LyXParagraph * par, AppendParagraph(bview, row->next()); } } - + +#ifndef NEW_INSETS void LyXText::ToggleFootnote(BufferView * bview) { LyXParagraph * par = cursor.par()->ParFromPos(cursor.pos()); @@ -408,6 +403,7 @@ void LyXText::ToggleFootnote(BufferView * bview) CloseFootnote(bview); } } +#endif void LyXText::OpenStuff(BufferView * bview) @@ -429,6 +425,7 @@ void LyXText::OpenStuff(BufferView * bview) } +#ifndef NEW_INSETS void LyXText::CloseFootnote(BufferView * bview) { LyXParagraph * tmppar; @@ -498,11 +495,13 @@ void LyXText::CloseFootnote(BufferView * bview) if (cursor.row()->next()) SetHeightOfRow(bview, cursor.row()->next()); } +#endif /* used in setlayout */ // Asger is not sure we want to do this... -void LyXText::MakeFontEntriesLayoutSpecific(Buffer const * buf, LyXParagraph * par) +void LyXText::MakeFontEntriesLayoutSpecific(Buffer const * buf, + LyXParagraph * par) { LyXLayout const & layout = @@ -522,6 +521,7 @@ void LyXText::MakeFontEntriesLayoutSpecific(Buffer const * buf, LyXParagraph * p } } + LyXParagraph * LyXText::SetLayout(BufferView * bview, LyXCursor & cur, LyXCursor & sstart_cur, LyXCursor & send_cur, @@ -701,7 +701,8 @@ void LyXText::IncDepth(BufferView * bview) } // We end at the next paragraph with depth 0 - LyXParagraph * endpar = sel_end_cursor.par()->LastPhysicalPar()->Next(); + LyXParagraph * endpar = + sel_end_cursor.par()->LastPhysicalPar()->Next(); LyXParagraph * undoendpar = endpar; if (endpar && endpar->GetDepth()) { @@ -1238,7 +1239,8 @@ Row * LyXText::GetRowNearY(long & y) const } -void LyXText::ToggleFree(BufferView * bview, LyXFont const & font, bool toggleall) +void LyXText::ToggleFree(BufferView * bview, + LyXFont const & font, bool toggleall) { // If the mask is completely neutral, tell user if (font == LyXFont(LyXFont::ALL_IGNORE)) { @@ -1271,7 +1273,8 @@ void LyXText::ToggleFree(BufferView * bview, LyXFont const & font, bool toggleal LyXParagraph::size_type -LyXText::BeginningOfMainBody(Buffer const * buf, LyXParagraph const * par) const +LyXText::BeginningOfMainBody(Buffer const * buf, + LyXParagraph const * par) const { if (textclasslist.Style(buf->params.textclass, par->GetLayout()).labeltype != LABEL_MANUAL) @@ -1281,6 +1284,7 @@ LyXText::BeginningOfMainBody(Buffer const * buf, LyXParagraph const * par) const } +#ifndef NEW_INSETS /* if there is a selection, reset every environment you can find * in the selection, otherwise just the environment you are in */ void LyXText::MeltFootnoteEnvironment(BufferView * bview) @@ -1375,6 +1379,7 @@ void LyXText::MeltFootnoteEnvironment(BufferView * bview) ClearSelection(); } +#endif /* the DTP switches for paragraphs. LyX will store them in the @@ -1618,6 +1623,7 @@ void LyXText::SetCounter(Buffer const * buf, LyXParagraph * par) const par->itemdepth = 0; } +#ifndef NEW_INSETS // if this is an open marginnote and this is the first // entry in the marginnote and the enclosing // environment is an enum/item then correct for the @@ -1639,7 +1645,7 @@ void LyXText::SetCounter(Buffer const * buf, LyXParagraph * par) const par->enumdepth++; par->itemdepth++; } - +#endif /* Maybe we have to increment the enumeration depth. * BUT, enumeration in a footnote is considered in isolation from its * surrounding paragraph so don't increment if this is the @@ -1991,7 +1997,8 @@ void LyXText::UpdateCounters(BufferView * bview, Row * row) const /* Rebreak the paragraph */ RemoveParagraph(row); AppendParagraph(bview, row); - + +#ifndef NEW_INSETS /* think about the damned open footnotes! */ while (par->Next() && (par->Next()->footnoteflag == LyXParagraph::OPEN_FOOTNOTE @@ -2004,6 +2011,7 @@ void LyXText::UpdateCounters(BufferView * bview, Row * row) const AppendParagraph(bview, row); } } +#endif } par = par->LastPhysicalPar()->Next(); @@ -2013,15 +2021,19 @@ void LyXText::UpdateCounters(BufferView * bview, Row * row) const /* insets an inset. */ -void LyXText::InsertInset(BufferView * bview, Inset *inset) +void LyXText::InsertInset(BufferView * bview, Inset * inset) { if (!cursor.par()->InsertInsetAllowed(inset)) return; SetUndo(bview->buffer(), Undo::INSERT, cursor.par()->ParFromPos(cursor.pos())->previous, cursor.par()->ParFromPos(cursor.pos())->next); +#ifdef NEW_WAY + cursor.par()->InsertInset(cursor.pos(), inset); +#else cursor.par()->InsertChar(cursor.pos(), LyXParagraph::META_INSET); cursor.par()->InsertInset(cursor.pos(), inset); +#endif InsertChar(bview, LyXParagraph::META_INSET); /* just to rebreak and refresh correctly. * The character will not be inserted a * second time */ @@ -2059,7 +2071,8 @@ void LyXText::CutSelection(BufferView * bview, bool doclear) // OK, we have a selection. This is always between sel_start_cursor // and sel_end cursor LyXParagraph * tmppar; - + +#ifndef NEW_INSETS // Check whether there are half footnotes in the selection if (sel_start_cursor.par()->footnoteflag != LyXParagraph::NO_FOOTNOTE || sel_end_cursor.par()->footnoteflag != LyXParagraph::NO_FOOTNOTE) { @@ -2074,7 +2087,7 @@ void LyXText::CutSelection(BufferView * bview, bool doclear) tmppar = tmppar->Next(); } } - +#endif #ifndef NEW_TABULAR /* table stuff -- begin */ if (sel_start_cursor.par()->table || sel_end_cursor.par()->table) { @@ -2164,7 +2177,8 @@ void LyXText::CopySelection(BufferView * bview) // ok we have a selection. This is always between sel_start_cursor // and sel_end cursor LyXParagraph * tmppar; - + +#ifndef NEW_INSETS /* check wether there are half footnotes in the selection */ if (sel_start_cursor.par()->footnoteflag != LyXParagraph::NO_FOOTNOTE || sel_end_cursor.par()->footnoteflag != LyXParagraph::NO_FOOTNOTE) { @@ -2181,7 +2195,7 @@ void LyXText::CopySelection(BufferView * bview) tmppar = tmppar->Next(); } } - +#endif #ifndef NEW_TABULAR /* table stuff -- begin */ if (sel_start_cursor.par()->table || sel_end_cursor.par()->table){ @@ -2293,8 +2307,12 @@ void LyXText::ReplaceSelectionWithString(BufferView * bview, char const * str) // Insert the new string for (int i = 0; str[i]; ++i) { +#ifdef NEW_WAY + sel_end_cursor.par()->InsertChar(pos, str[i], font); +#else sel_end_cursor.par()->InsertChar(pos, str[i]); sel_end_cursor.par()->SetFont(pos, font); +#endif ++pos; } @@ -2378,8 +2396,12 @@ void LyXText::InsertStringA(BufferView * bview, string const & str) if (str[i] == ' ' && i + 1 < str.length() && str[i + 1] != ' ' && pos && par->GetChar(pos - 1)!= ' ') { +#ifdef NEW_WAY + par->InsertChar(pos, ' ', current_font); +#else par->InsertChar(pos,' '); par->SetFont(pos, current_font); +#endif ++pos; #ifndef NEW_TABLAR } else if (par->table) { @@ -2393,8 +2415,13 @@ void LyXText::InsertStringA(BufferView * bview, string const & str) break; } else if ((str[i] != 13) && ((str[i] & 127) >= ' ')) { +#ifdef NEW_WAY + par->InsertChar(pos, str[i], + current_font); +#else par->InsertChar(pos, str[i]); par->SetFont(pos, current_font); +#endif ++pos; } #endif @@ -2402,9 +2429,14 @@ void LyXText::InsertStringA(BufferView * bview, string const & str) InsetSpecialChar * new_inset = new InsetSpecialChar(InsetSpecialChar::PROTECTED_SEPARATOR); if (par->InsertInsetAllowed(new_inset)) { +#ifdef NEW_WAY + par->InsertInset(pos, new_inset, + current_font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); par->SetFont(pos, current_font); par->InsertInset(pos, new_inset); +#endif } else { delete new_inset; } @@ -2414,9 +2446,14 @@ void LyXText::InsertStringA(BufferView * bview, string const & str) InsetSpecialChar * new_inset = new InsetSpecialChar(InsetSpecialChar::PROTECTED_SEPARATOR); if (par->InsertInsetAllowed(new_inset)) { +#ifdef NEW_WAY + par->InsertInset(pos, new_inset, + current_font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); par->SetFont(pos, current_font); par->InsertInset(pos, new_inset); +#endif } else { delete new_inset; } @@ -2425,8 +2462,12 @@ void LyXText::InsertStringA(BufferView * bview, string const & str) } else if (str[i] != 13 && // Ignore unprintables (str[i] & 127) >= ' ') { +#ifdef NEW_WAY + par->InsertChar(pos, str[i], current_font); +#else par->InsertChar(pos, str[i]); par->SetFont(pos, current_font); +#endif ++pos; } } else { @@ -2460,9 +2501,15 @@ void LyXText::InsertStringA(BufferView * bview, string const & str) InsetSpecialChar * new_inset = new InsetSpecialChar(InsetSpecialChar::PROTECTED_SEPARATOR); if (par->InsertInsetAllowed(new_inset)) { +#ifdef NEW_WAY + par->InsertInset(pos, + new_inset, + current_font); +#else par->InsertChar(pos, LyXParagraph::META_INSET); par->SetFont(pos, current_font); par->InsertInset(pos, new_inset); +#endif } else { delete new_inset; } @@ -2704,6 +2751,7 @@ void LyXText::SetCursor(BufferView *bview, LyXCursor & cur, LyXParagraph * par, pos = par->PositionInParFromPos(pos); par = tmppar; } +#ifndef NEW_INSETS if (par->IsDummy() && par->previous && par->previous->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) { while (par->previous && @@ -2723,7 +2771,7 @@ void LyXText::SetCursor(BufferView *bview, LyXCursor & cur, LyXParagraph * par, } pos += par->size() + 1; } - +#endif cur.par(par); cur.pos(pos); cur.boundary(boundary); @@ -2834,127 +2882,6 @@ void LyXText::SetCursorIntern(BufferView * bview, LyXParagraph * par, bool setfont, bool boundary) const { SetCursor(bview, cursor, par, pos, boundary); -// #warning Remove this when verified working (Jug 20000413) -#if 0 - // correct the cursor position if impossible - if (pos > par->Last()){ - LyXParagraph * tmppar = par->ParFromPos(pos); - pos = par->PositionInParFromPos(pos); - par = tmppar; - } - if (par->IsDummy() && par->previous && - par->previous->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) { - while (par->previous && - ((par->previous->IsDummy() && par->previous->previous->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) || - (par->previous->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE))) { - par = par->previous ; - if (par->IsDummy() && - par->previous->footnoteflag == LyXParagraph::CLOSED_FOOTNOTE) - pos += par->size() + 1; - } - if (par->previous) { - par = par->previous; - } - pos += par->size() + 1; - } - - cursor.par() = par; - cursor.pos() = pos; - - /* get the cursor y position in text */ - long y = 0; - Row * row = GetRow(par, pos, y); - /* y is now the beginning of the cursor row */ - y += row->baseline(); - /* y is now the cursor baseline */ - cursor.y() = y; - - /* now get the cursors x position */ - float x; - float fill_separator, fill_hfill, fill_label_hfill; - PrepareToPrint(row, x, fill_separator, fill_hfill, fill_label_hfill); - LyXParagraph::size_type cursor_vpos; - LyXParagraph::size_type last = RowLastPrintable(row); - - if (pos > last + 1) // This shouldn't happen. - pos = last+1; - - if (last < row->pos()) - cursor_vpos = 0; - else if (pos > last || - (pos - 1 >= row->pos() && - (row->par()->IsSeparator(pos) || - (row->par()->table && row->par()->IsNewline(pos)) - ))) - /// Place cursor after char at (logical) position pos-1 - cursor_vpos = (bidi_level(pos-1) % 2 == 0) - ? log2vis(pos-1) + 1 : log2vis(pos-1); - else - /// Place cursor before char at (logical) position pos - cursor_vpos = (bidi_level(pos) % 2 == 0) - ? log2vis(pos) : log2vis(pos) + 1; - -#ifndef NEW_TABULAR - /* table stuff -- begin*/ - if (row->par()->table) { - int cell = NumberOfCell(row->par(), row->pos()); - float x_old = x; - x += row->par()->table->GetBeginningOfTextInCell(cell); - for (LyXParagraph::size_type vpos = row->pos(); vpos < cursor_vpos; ++vpos) { - pos = vis2log(vpos); - if (row->par()->IsNewline(pos)) { - x = x_old + row->par()->table->WidthOfColumn(cell); - x_old = x; - ++cell; - x += row->par()->table->GetBeginningOfTextInCell(cell); - } else { - x += SingleWidth(row->par(), pos); - } - } - } else { - /* table stuff -- end*/ -#endif - LyXParagraph::size_type main_body = - BeginningOfMainBody(row->par()); - if (main_body > 0 && - (main_body-1 > last || - !row->par()->IsLineSeparator(main_body-1))) - main_body = 0; - - for (LyXParagraph::size_type vpos = row->pos(); vpos < cursor_vpos; ++vpos) { - pos = vis2log(vpos); - if (main_body > 0 && pos == main_body-1) { - x += fill_label_hfill + - lyxfont::width(textclasslist - .Style(bview->buffer()->params.textclass, - row->par()->GetLayout()) - .labelsep, - GetFont(row->par(), -2)); - if (row->par()->IsLineSeparator(main_body-1)) - x -= SingleWidth(row->par(), main_body-1); - } - if (HfillExpansion(row, pos)) { - x += SingleWidth(row->par(), pos); - if (pos >= main_body) - x += fill_hfill; - else - x += fill_label_hfill; - } - else if (row->par()->IsSeparator(pos)) { - x += SingleWidth(row->par(), pos); - if (pos >= main_body) - x += fill_separator; - } else - x += SingleWidth(row->par(), pos); - } -#ifndef NEW_TABULAR - } -#endif - cursor.x = int(x); - - cursor.x_fix = cursor.x; - cursor.row() = row; -#endif if (setfont) SetCurrentFont(bview); } @@ -2979,7 +2906,8 @@ void LyXText::SetCurrentFont(BufferView * bview) const } } - current_font = cursor.par()->GetFontSettings(bview->buffer()->params, pos); + current_font = + cursor.par()->GetFontSettings(bview->buffer()->params, pos); real_current_font = GetFont(bview->buffer(), cursor.par(), pos); }