+2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/insets/insetcommand.h (hide): new SigC::Signal0
+ (d-tor) new virtual destructor emits hide signal
+
+ * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
+ * src/insets/inseturl.[Ch] (hide, d-tor): ditto
+
+ * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
+ LOF and LOT. Inset is now GUI-independent
+
+ * src/insets/insetloa.[Ch]: redundant
+ * src/insets/insetlof.[Ch]: ditto
+ * src/insets/insetlot.[Ch]: ditto
+
+ * src/frontends/xforms/forms/form_url.fd: tweaked!
+ * src/frontends/xforms/forms/form_citation.fd: ditto
+
+ * src/frontends/xforms/FormCommand.[Ch]: new base class to those
+ dialogs dealing with InsetCommand insets
+
+ * src/frontends/xforms/FormCitation.[Ch]: now makes use of
+ FormCommand base class
+ * src/frontends/xforms/FormUrl.[Ch]: ditto
+
+ * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
+ of the TOC dialog
+ * src/frontends/xforms/FormToc.[Ch]: ditto
+
+ * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
+ passed a generic InsetCommand pointer
+ * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
+
+ * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
+ and modified InsetTOC class
+ * src/buffer.C: ditto
+
+ * forms/lyx.fd: strip out old FD_form_toc code
+ * src/lyx_gui_misc.C: ditto
+ * src/lyx_gui.C: ditto
+ * src/lyx_cb.C: ditto
+ * src/lyx.[Ch]: ditto
+
+2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/utility.hpp: tr -d '\r'
+
+2000-08-01 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.h: removed initFeatures() as it's not needed.
+
+ * src/commandtags.h:
+ * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
+ LFUN_TABULAR_FEATURES.
+
+ * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
+ LFUN_LAYOUT_TABULAR.
+
+ * src/insets/insettabular.C (getStatus): implemented helper function.
+
+ * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
+
+2000-07-31 Juergen Vigna <jug@sad.it>
+
+ * src/text.C (draw): fixed screen update problem for text-insets.
+
+ * src/text2.C (SetParagrpah): call an update of the inset-owner when
+ something changed probably this has to be added in various other
+ functions too.
+
+ * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
+
+2000-07-31 Baruch Even <baruch.even@writeme.com>
+
+ * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
+ templates to satisfy compaq cxx.
+
+
+2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/translator.h (equal_1st_in_pair::operator()): take
+ const ref pair_type as arg.
+ (equal_2nd_in_pair::operator()): ditto
+ (Translator::~Translator): remove empty d-tor.
+
+ * src/graphics/GraphicsCache.C: move include config.h to top, also
+ put initialization of GraphicsCache::singleton here.
+ (~GraphicsCache): move here
+ (addFile): take const ref as arg
+ (removeFile): ditto
+
+ * src/lyxlex_pimpl.C (setFile): comment in old behaviour
+
+ * src/BufferView2.C (insertLyXFile): change te with/without header
+ check slightly.
+
+2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/frontends/xforms/FormGraphics.C (apply): add some
+ static_cast. Not very nice, but required by compaq cxx.
+
+ * src/frontends/xforms/RadioButtonGroup.h: include header
+ <utility> instead of <pair.h>
+
+ * src/insets/insetgraphicsParams.C: add using directive.
+ (readResize): change return type to void.
+ (readOrigin): ditto.
+
+ * src/lyxfunc.C (getStatus): add missing break for build-program
+ function; add test for Literate for export functions.
+
+ * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
+ entries in Options menu.
+
+2000-07-31 Baruch Even <baruch.even@writeme.com>
+
+ * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
+ protect against auto-allocation; release icon when needed.
+
+2000-07-31 Matej Cepl <CeplM@seznam.cz>
+
+ * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
+ on usual typewriter.
+
+ * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
+ earlier czech.kmap), useful only for programming.
+
+2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/frontends/xforms/FormCitation.h: fix conditioning around
+ #pragma.
+
+2000-07-31 Juergen Vigna <jug@sad.it>
+
+ * src/frontends/xforms/FormTabular.C (local_update): changed
+ radio_linebreaks to radio_useparbox and added radio_useminipage.
+
+ * src/tabular.C: made support for using minipages/parboxes.
+
+ * src/bufferlist.C (QwriteAll): small fix for asking for save.
+
+ * src/insets/insetgraphics.C (draw): just draw the inset so that the
+ cursor is visible.
+ (descent): so the cursor is in the middle.
+ (width): bit smaller box.
+
+ * src/insets/insetgraphics.h: added display() function.
+
+2000-07-31 Baruch Even <baruch.even@writeme.com>
+
+ * src/frontends/Dialogs.h: Added showGraphics signals.
+
+ * src/frontends/xforms/forms/form_graphics.fd: Added file, the
+ xforms form definition of the graphics dialog.
+
+ * src/frontends/xforms/FormGraphics.h:
+ * src/frontends/xforms/FormGraphics.C: Added files, the
+ GUIndependent code of InsetGraphics
+
+ * src/insets/insetgraphics.h:
+ * src/insets/insetgraphics.C: Major writing to make it work.
+
+ * src/insets/insetgraphicsParams.h:
+ * src/insets/insetgraphicsParams.C: Added files, parameter passing
+ struct between InsetGraphics and GUI.
+
+ * src/LaTeXFeatures.h:
+ * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
+ support for graphicx package.
+
+ * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
+ for the graphics inset.
+
+ * src/support/translator.h: Added file, used in
+ InsetGraphicsParams. this is a template to translate between two
+ types.
+
+ * src/frontends/xforms/RadioButtonGroup.h:
+ * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
+ way to easily control a radio button group.
+
+2000-07-28 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.C (LocalDispatch):
+ (TabularFeatures): added support for lyx-functions of tabular features.
+ (cellstart): refixed this function after someone wrongly changed it.
+
+ * src/commandtags.h:
+ * src/LyXAction.C (init): added support for tabular-features
+
+2000-07-28 Allan Rae <rae@lyx.org>
+
+ * src/frontends/xforms/FormPreferences.C (build): Setup input return
+ checking. NOTE: It seems that pressing ESC to cancel the dialog also
+ triggers the callback for input checking. As a result we sometimes get
+ "LyX: This shouldn't happen..." printed to cerr.
+ (input): Started using status variable since I only free() on
+ destruction. Some input checking for paths and font sizes.
+
+ * src/frontends/xforms/FormPreferences.h: Use status to control
+ activation of Ok and Apply
+
+ * src/frontends/xforms/forms/form_preferences.fd: Setup input return
+ callback. Also resized to stop segfaults with 0.88. The problem is
+ that xforms-0.88 requires the folder to be wide enough to fit all the
+ tabs. If it isn't it causes all sorts of problems.
+
+ * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
+
+ * src/frontends/xforms/forms/README: Reflect reality.
+
+ * src/frontends/xforms/forms/fdfix.sh: Clean up comments
+ * src/frontends/xforms/forms/makefile: ditto.
+
+ * src/commandtags.h: Get access to new Preferences dialog
+ * src/LyXAction.C: ditto
+ * src/lyxfunc.C: ditto
+ * lib/ui/default.ui: ditto
+
+2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
+
+ * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
+ few files.
+
+ * src/frontends/xforms/form_url.[Ch]: added.
+
+2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/insets/insetbib.h: fixed bug in previous commit
+
+ * src/frontends/xforms/FormUrl.h: ditto
+
+ * src/frontends/xforms/FormPrint.h: ditto
+
+ * src/frontends/xforms/FormPreferences.h: ditto
+
+ * src/frontends/xforms/FormCopyright.h: ditto
+
+ * src/frontends/xforms/FormCitation.C: ditto
+
+ * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
+ private copyconstructor and private default contructor
+
+ * src/support/Makefile.am: add utility.hpp
+
+ * src/support/utility.hpp: new file from boost
+
+ * src/insets/insetbib.h: set owner in clone
+
+ * src/frontends/xforms/FormCitation.C: added missing include
+ algorithm
+
+ * src/insets/form_url.[Ch]: removed
+
+2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
+
+ * development/lyx.spec.in
+ * Makefile.am: Fix buglet for LyX RPM generation resulting from
+ file/directory re-organization.
+
+2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/insets/insetcommand.[Ch]: moved the string data and
+ associated manipulation methods into a new stand-alone class
+ InsetCommandParams. This class has two additional methods
+ getAsString() and setFromString() allowing the contents to be
+ moved around as a single string.
+ (addContents) method removed.
+ (setContents) method no longer virtual.
+
+ * src/buffer.C (readInset): made use of new InsetCitation,
+ InsetUrl constructors based on InsetCommandParams.
+
+ * src/commandtags.h: add LFUN_INSERT_URL
+
+ * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
+ independent InsetUrl and use InsetCommandParams to extract
+ string info and create new Insets.
+
+ * src/frontends/Dialogs.h: add signals showUrl, createUrl.
+
+ * src/frontends/xforms/FormCitation.C (apply): uses
+ InsetCommandParams.
+
+ * src/frontends/xforms/form_url.C
+ * src/frontends/xforms/form_url.h
+ * src/frontends/xforms/FormUrl.h
+ * src/frontends/xforms/FormUrl.C
+ * src/frontends/xforms/forms/form_url.fd: new files
+
+ * src/insets/insetcite.[Ch]: removed unused constructors.
+
+ * src/insets/insetinclude.[Ch]: no longer store filename
+
+ * src/insets/inseturl.[Ch]: GUI-independent.
+
+2000-07-26 Juergen Vigna <jug@sad.it>
+ * renamed frontend from gtk to gnome as it is that what is realized
+ and did the necessary changes in the files.
+
+2000-07-26 Marko Vendelin <markov@ioc.ee>
+ * autogen.sh
+ * configure.in: cleaning up gnome configuration scripts
+
+2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
+ shortcuts syndrom by redrawing them explicitely (a better solution
+ would be appreciated).
+
+ * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
+
+ * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
+ the button.
+
+ * src/lyx_cb.C (MenuExport): change html export to do the right
+ thing depending of the document type (instead of having
+ html-linuxdoc and html-docbook).
+ * src/lyxfunc.C (getStatus): update for html
+ * lib/ui/default.ui: simplify due to the above change.
+ * src/menus.C (ShowFileMenu): update too (in case we need it).
+
+ * src/MenuBackend.C (read): if a menu is defined twice, add the
+ new entries to the exiting one.
+
+2000-07-26 Juergen Vigna <jug@sad.it>
+
+ * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
+
+ * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
+ and return a bool if it did actual save the file.
+ (AutoSave): don't autosave a unnamed doc.
+
+ * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
+ check if this is an UNNAMED new file and react to it.
+ (newFile): set buffer to unnamed and change to not mark a new
+ buffer dirty if I didn't do anything with it.
+
+ * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
+
+2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/frontends/Menubar.h: make "struct Pimpl;" public + the
+ friend as per Angus's patch posted to lyx-devel.
+
+ * src/ext_l10n.h: updated
+
+ * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
+ gettext on the style string right before inserting them into the
+ combox.
+
+ * autogen.sh: add code to extract style strings form layout files,
+ not good enough yet.
+
+ * src/frontends/gtk/.cvsignore: add MAKEFILE
+
+ * src/MenuBackend.C (read): run the label strings through gettext
+ before storing them in the containers.
+
+ * src/ext_l10n.h: new file
+
+ * autogen.sh : generate the ext_l10n.h file here
+
+2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
+ arguments.
+
+ * lib/ui/default.ui: fix a couple of typos.
+
+ * config/gnome/gtk.m4: added (and added to the list of files in
+ autogen.sh).
+
+ * src/insets/insetinclude.C (unique_id): fix when we are using
+ lyxstring instead of basic_string<>.
+ * src/insets/insettext.C (LocalDispatch): ditto.
+ * src/support/filetools.C: ditto.
+
+ * lib/configure.m4: create the ui/ directory if necessary.
+
+ * src/LyXView.[Ch] (updateToolbar): new method.
+
+ * src/BufferView_pimpl.C (buffer): update the toolbar when
+ opening/closing buffer.
+
+2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/LyXAction.C (getActionName): enhance to return also the name
+ and options of pseudo-actions.
+ (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
+
+ * lib/ui/default.ui: use OptItem in the vc submenu (intented just
+ as an example of what is possible). Used in File->Build too (more
+ useful) and in the import/export menus (to mimick the complicated
+ handling of linuxdoc and friends). Try to update all the entries.
+
+ * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
+ optional entries.
+
+ * src/MenuBackend.C (read): Parse the new OptItem tag.
+
+ * src/MenuBackend.h: Add a new optional_ data member (used if the
+ entry should be omitted when the lyxfunc is disabled).
+
+ * src/frontends/xforms/Menubar_pimpl.C (string_width): new
+ function, used as a shortcut.
+ (create_submenu): align correctly the shortcuts on the widest
+ entry.
+
+ * src/MenuBackend.h: MenuItem.label() only returns the label of
+ the menu without shortcut; new method shortcut().
+
+2000-07-14 Marko Vendelin <markov@ioc.ee>
+
+ * src/frontends/gtk/Dialogs.C:
+ * src/frontends/gtk/FormCopyright.C:
+ * src/frontends/gtk/FormCopyright.h:
+ * src/frontends/gtk/Makefile.am: added these source-files for the
+ Gtk/Gnome support of the Copyright-Dialog.
+
+ * src/main.C: added Gnome::Main initialization if using
+ Gtk/Gnome frontend-GUI.
+
+ * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
+ frontend-GUI.
+ * config/gnome/aclocal-include.m4
+ * config/gnome/compiler-flags.m4
+ * config/gnome/curses.m4
+ * config/gnome/gnome--.m4
+ * config/gnome/gnome-bonobo-check.m4
+ * config/gnome/gnome-common.m4
+ * config/gnome/gnome-fileutils.m4
+ * config/gnome/gnome-ghttp-check.m4
+ * config/gnome/gnome-gnorba-check.m4
+ * config/gnome/gnome-guile-checks.m4
+ * config/gnome/gnome-libgtop-check.m4
+ * config/gnome/gnome-objc-checks.m4
+ * config/gnome/gnome-orbit-check.m4
+ * config/gnome/gnome-print-check.m4
+ * config/gnome/gnome-pthread-check.m4
+ * config/gnome/gnome-support.m4
+ * config/gnome/gnome-undelfs.m4
+ * config/gnome/gnome-vfs.m4
+ * config/gnome/gnome-x-checks.m4
+ * config/gnome/gnome-xml-check.m4
+ * config/gnome/gnome.m4
+ * config/gnome/gperf-check.m4
+ * config/gnome/gtk--.m4
+ * config/gnome/linger.m4
+ * config/gnome/need-declaration.m4: added configuration scripts
+ for Gtk/Gnome frontend-GUI
+
+ * configure.in: added support for the --with-frontend=gtk option
+
+ * autogen.sh: added config/gnome/* to list of config-files
+
+ * acconfig.h: added define for GTKGUI-support
+
+ * config/lyxinclude.m4: added --with-frontend[=value] option value
+ for Gtk/Gnome frontend-GUI support.
+
+2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
+ can be used.
+ (suffixIs): ditto
+
+ * src/paragraph.C (GetChar): remove non-const version
+
+ * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
+ (search_kw): use it.
+
+ * src/lyx_main.C (init): if "preferences" exist, read that instead
+ of "lyxrc".
+ (ReadRcFile): return bool if the file could be read ok.
+ (ReadUIFile): add a check to see if lex file is set ok.
+
+ * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
+ bastring can be used instead of lyxstring (still uses the old code
+ if std::string is good enough or if lyxstring is used.)
+
+ * src/encoding.C: make the arrays static, move ininle functions
+ here
+ * src/encoding.h: from here.
+
+ * src/buffer.C: have last_isnet_read as a file scope variable for now.
+ (parseSingleLyXformat2Token): move inset parsing to separate method
+ (readInset): new private method
+
+ * src/Variables.h: remove virtual from get().
+
+ * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
+ access to NEW_INSETS and NEW_TABULAR
+
+ * src/MenuBackend.h: remove superfluous forward declaration of
+ MenuItem. Add documentations tags "///", remove empty MenuItem
+ destructor, remove private default contructor.
+
+ * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
+ (add): return *this
+ (read): more string mlabel and mname to where they are used
+ (read): remove unused variables mlabel and mname
+ (defaults): unconditional clear, make menusetup take advantage of
+ add returning Menu &.
+
+ * src/LyXView.h: define NEW_MENUBAR as default
+
+ * src/LyXAction.C: include lyxparagraph.h temporary to get access
+ to NEW_INSETS and NEW_TABULAR.
+ (init): commetn out some funcs that is obsolete when NEW_INSETS is
+ defined. Change some of the "xxxx-inset-insert" functions names to
+ "xxxx-insert".
+
+ * several files: more enahncements to NEW_INSETS and the resulting
+ LyXParagraph code.
+
+ * lib/lyxrc.example (\date_insert_format): move to misc section
+
+ * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
+ bastring and use AC_CACHE_CHECK.
+ (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
+ the system have the newest methods. uses AC_CACHE_CHECK
+ (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
+ (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
+ (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
+
+ * configure.in: add LYX_CXX_GOOD_STD_STRING
+
+ * acinclude.m4: recreated
+
+2000-07-24 Amir Karger
+
+ * README: add Hebrew, Arabic kmaps
+ * ANNOUNCE: typo
+
+2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/buffer.C (writeFileAscii): Define actcell as an int instead
+ of int*.
+
+2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * Lot of files: add pragma interface/implementation.
+
+ * src/lyx_main.C (ReadUFile): new method. Read the UI file.
+
+ * lib/ui/default.ui: new file (ans new directory). Contains the
+ default menu and toolbar.
+
+ * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
+ global space. Toolbars are now read (as menus) in ui files.
+
+ * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
+
+ * src/lyxfunc.C (getStatus): do not exit immediately if a command
+ is disabled because the document is read-only. We want to have the
+ toggle state of the function anyway.
+ (getStatus): add code for LFUN_VC* functions (mimicking what is
+ done in old-style menus)
+
+ * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
+ LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
+
+ * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
+ * src/BufferView_pimpl.C: ditto.
+ * src/lyxfunc.C: ditto.
+
+ * src/LyXView.h: add a define NEW_MENUBAR (commented out by
+ default). This replaces old-style menus by new ones.
+
+ * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
+ MenuItem. Contain the data structure of a menu.
+
+ * src/insets/insettext.C: use LyXView::setLayout instead of
+ accessing directly the toolbar combox.
+ * src/lyxfunc.C (Dispatch): ditto.
+
+ * src/LyXView.C (setLayout): new method, which just calls
+ Toolbar::setLayout().
+ (updateLayoutChoice): move part of this method in Toolbar.
+
+ * src/toolbar.[Ch]: removed.
+
+ * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
+ implementation the toolbar.
+
+ * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
+ the toolbar. It might make sense to merge it with ToolbarDefaults
+ later.
+ (setLayout): new function.
+ (updateLayoutList): ditto.
+ (openLayoutList): ditto.
+
+ * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
+ xforms implementation of the toolbar.
+ (get_toolbar_func): comment out, since I do not
+ know what it is good for.
+
+ * src/ToolbarDefaults.h: Add the ItemType enum.
+
+ * src/support/StrPool.[Ch]: new class. Acts as a reference holder
+ for a list of allocated C strings. Used in Menubar xforms
+ implementation to avoid memory leaks.
+
+ * src/support/lstrings.[Ch] (uppercase): new version taking and
+ returning a char.
+ (lowercase): ditto.
+
+ * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
+ * lib/bind/emacs.bind: ditto.
+
+2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
+ forward decl of LyXView.
+
+ * src/toolbar.C (toolbarItem): moved from toolbar.h
+ (toolbarItem::clean): ditto
+ (toolbarItem::~toolbarItem): ditto
+ (toolbarItem::operator): ditto
+
+ * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
+
+ * src/paragraph.h: control the NEW_TABULAR define from here
+
+ * src/buffer.C: remove define USE_PARSE_FUNCTION, change
+ USE_TABULAR_INSETS to NEW_TABULAR
+
+ * src/ToolbarDefaults.C: add include "lyxlex.h"
+
+ * files using the old table/tabular: use NEW_TABULAR to control
+ compilation of old tabular stuff.
+
+ * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
+ to correct place.
+
+ * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
+ planemet in reading of old style floats, fix the \end_deeper
+ problem when reading old style floats.
+
+2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
+
+2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
+
+ * lib/bind/sciword.bind: updated.
+
+2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
+ layout write problem
+
+2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/Makefile.am (INCLUDES): remove image directory from include
+ path.
+
+ * src/bullet_forms.C (create_form_form_bullet): small cleanup.
+ * src/bullet_forms_cb.C (BulletPanelCB): ditto.
+
+ * src/LyXView.C (create_form_form_main): read the application icon
+ from the disk.
+
+ * lib/images/*.xpm: change the icons to use transparent color for
+ background.
+
+ * src/toolbar.C (update): change the color of the button when it
+ is toggled on.
+
+2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
+ setting explicitely the minibuffer.
+ * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
+
+ * src/LyXView.C (showState): new function. Shows font information
+ in minibuffer and update toolbar state.
+ (LyXView): call Toolbar::update after creating the
+ view.
+
+ * src/toolbar.C: change toollist to be a vector instead of a
+ linked list.
+ (BubbleTimerCB): get help string directly from the callback
+ argument of the corresponding icon (which is the action)
+ (set): remove unnecessary ugliness.
+ (update): new function. update the icons (depressed, disabled)
+ depending of the status of the corresponding action.
+
+ * src/toolbar.h: remove help in toolbarItem
+
+2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/Painter.C (text): Added code for using symbol glyphs from
+ iso10646 fonts. Currently diabled.
+
+ * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
+ symbol_encoding.
+
+ * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
+ magyar,turkish and usorbian.
+
+ * src/paragraph.C (isMultiLingual): Made more efficient.
+
+ * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
+ keyboard.
+
+ * src/mathed/math_symbols.C (math_insert_greek): Changed to use
+ LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
+ Also changed the prototype to "bool math_insert_greek(char)".
+
+2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * lots of files: apply the NEW_INSETS on all code that will not be
+ needed when we move to use the new insets. Enable the define in
+ lyxparagrah.h to try it.
+
+ * src/insets/insettabular.C (cellstart): change to be a static
+ inline function
+ (InsetTabular): initialize buffer in the initializer list.
+
+2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/xforms/FormPrint.[Ch] : moved #include
+ form_print.h out of the header file. Replaced with forward
+ declarations of the relevant struct.
+
+ * src/frontends/xforms/FormPreferences.[Ch] : ditto for
+ form_preferences.h.
+
+ * src/commandtags.h: do not include "debug.h" which does not
+ belong there. #include it in some other places because of this
+ change.
+
+2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/insets/insetcaption.C: add a couple "using" directives.
+
+ * src/toolbar.C (add): get the help text directly from lyxaction.
+ (getPixmap): nuked.
+ (setPixmap): new function. Loads from disk and sets a pixmap on a
+ botton; the name of the pixmap file is derived from the command
+ name.
+
+ * src/toolbar.h: remove members isBitmap and pixmap from
+ toobarItem struct.
+
+ * lib/images/*.xbm *_bw.xpm: remove (not used any more).
+ * lib/images/: move many files from images/banner.xpm.
+
+ * src/lyx_gui.C (create_forms): read banner pixmap from file.
+
+ * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
+ * src/toolbar.C: ditto.
+ * configure.in: ditto.
+ * INSTALL: document.
+
+ * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
+ the spellchecker popup is closed from the WM.
+
+2000-07-19 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insetfloat.C (Write): small fix because we use the
+ insetname for the type now!
+
+2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/xforms/forms/form_citation.fd: object sizes are
+ now set here
+
+ * src/frontends/Dialogs.h: removed hideCitation signal
+
+ * src/insets/insetcite.h: added hide signal
+
+ * src/insets/insetcite.C (~InsetCitation): emits new signal
+ (getScreenLabel): "intelligent" label should now fit on the screen!
+
+ * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
+
+ * src/frontends/xforms/FormCitation.C (showInset): connects
+ hide() to the inset's hide signal
+ (show): modified to use fl_set_object_position rather than
+ fl_set_object_geometry wherever possible
+
+2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/insets/lyxinset.h: add caption code
+
+ * src/insets/insetfloat.C (type): new method
+
+ * src/insets/insetcaption.C (Write): new method
+ (Read): new method
+ (LyxCode): new method
+
+ * src/text2.C (SetCounter): revert Jürgens code, but use his idea
+ to get it right together with using the FloatList.
+
+ * src/commandtags.h: add LFUN_INSET_CAPTION
+ * src/lyxfunc.C (Dispatch): handle it
+
+ * src/buffer.C (parseSingleLyXformat2Token): add code to read a
+ caption inset.
+
+ * src/Variables.[Ch]: make expand take a const reference, remove
+ the destructor, some whitespace changes.
+
+ * src/LyXAction.C (init): add caption-inset-insert
+
+ * src/FloatList.C (FloatList): update the default floats a bit.
+
+2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/Variables.[Ch]: new files. Intended to be used for language
+ specific strings (like \chaptername) and filename substitution in
+ commands.
+
+ * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
+ kmap files.
+ * lib/kbd/american.kmap: update
+
+ * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
+
+ * src/bufferparams.[Ch]: remove member allowAccents.
+
+ * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
+
+ * src/LaTeXLog.C: use the log_form.h header.
+ * src/lyx_gui.C: ditto.
+ * src/lyx_gui_misc.C: ditto.
+ * src/lyxvc.h: ditto.
+
+ * forms/log_form.fd: new file, created from latexoptions.fd. I
+ kept the log popup and nuked the options form.
+
+ * src/{la,}texoptions.[Ch]: removed.
+ * src/lyx_cb.C (LaTeXOptions): ditto
+
+ * src/lyx_gui.C (create_forms): do not handle the
+ fd_latex_options form.
+
+2000-07-18 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
+ name of the inset so that it can be requested outside (text2.C).
+
+ * src/text2.C (SetCounter): modified so it sees insetfloat for caption
+ labels.
+
+2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/mathed/formula.h (ConvertFont): constify
+
+ * src/mathed/formula.C (Read): add warning if \end_inset is not
+ found on expected place.
+
+ * src/insets/lyxinset.h (ConvertFont): consify
+
+ * src/insets/insetquotes.C (ConvertFont): constify
+ * src/insets/insetquotes.h: ditto
+
+ * src/insets/insetinfo.h: add labelfont
+
+ * src/insets/insetinfo.C (InsetInfo): set the labelfont
+ (ascent): use labelfont
+ (descent): likewise
+ (width): likewise
+ (draw): likewise
+ (Write): make .lyx file a bit nicer
+
+ * src/insets/insetfloat.C (Write): simplify somewhat...
+ (Read): add warning if arg is not found
+
+ * src/insets/insetcollapsable.C: add using std::max
+ (Read): move string token and add warning in arg is not found
+ (draw): use std::max to get the right ty
+ (getMaxWidth): simplify by using std::max
+
+ * src/insets/insetsection.h: new file
+ * src/insets/insetsection.C: new file
+ * src/insets/insetcaption.h: new file
+ * src/insets/insetcaption.C: new file
+
+ * src/insets/inset.C (ConvertFont): constify signature
+
+ * src/insets/Makefile.am (libinsets_la_SOURCES): add
+ insetcaption.[Ch] and insetsection.[Ch]
+
+ * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
+ uses to use LABEL_COUNTER_CHAPTER instead.
+ * src/text2.C (SetCounter): here
+
+ * src/counters.h: new file
+ * src/counters.C: new file
+ * src/Sectioning.h: new file
+ * src/Sectioning.C: new file
+
+ * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
+
+2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
+ not always in "."!
+
+ * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
+ the last argument.
+
+2000-07-17 Juergen Vigna <jug@sad.it>
+
+ * src/tabular.C (Validate): check if array-package is needed.
+ (SetVAlignment): added support for vertical alignment.
+ (SetLTFoot): better support for longtable header/footers
+ (Latex): modified to support added features.
+
+ * src/LaTeXFeatures.[Ch]: added array-package.
+
+2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
+
+ * src/lyx_gui.C (LyXGUI): make sure that the height is large
+ enough.
+
+2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
+
+ * configure.in: do not forget to put a space after -isystem.
+
+2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * lib/kbd/arabic.kmap: a few fixes.
+
2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
* some whitespace chagnes to a number of files.
projects / lyx.git / blobdiff