+2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/frontends/gtk/.cvsignore: add MAKEFILE
+
+ * src/MenuBackend.C (read): run the label strings through gettext
+ before storing them in the containers.
+
+ * src/ext_l10n.h: new file
+
+ * autogen.sh : generate the ext_l10n.h file here
+
+2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
+ arguments.
+
+ * lib/ui/default.ui: fix a couple of typos.
+
+ * config/gnome/gtk.m4: added (and added to the list of files in
+ autogen.sh).
+
+ * src/insets/insetinclude.C (unique_id): fix when we are using
+ lyxstring instead of basic_string<>.
+ * src/insets/insettext.C (LocalDispatch): ditto.
+ * src/support/filetools.C: ditto.
+
+ * lib/configure.m4: create the ui/ directory if necessary.
+
+ * src/LyXView.[Ch] (updateToolbar): new method.
+
+ * src/BufferView_pimpl.C (buffer): update the toolbar when
+ opening/closing buffer.
+
+2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/LyXAction.C (getActionName): enhance to return also the name
+ and options of pseudo-actions.
+ (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
+
+ * lib/ui/default.ui: use OptItem in the vc submenu (intented just
+ as an example of what is possible). Used in File->Build too (more
+ useful) and in the import/export menus (to mimick the complicated
+ handling of linuxdoc and friends). Try to update all the entries.
+
+ * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
+ optional entries.
+
+ * src/MenuBackend.C (read): Parse the new OptItem tag.
+
+ * src/MenuBackend.h: Add a new optional_ data member (used if the
+ entry should be omitted when the lyxfunc is disabled).
+
+ * src/frontends/xforms/Menubar_pimpl.C (string_width): new
+ function, used as a shortcut.
+ (create_submenu): align correctly the shortcuts on the widest
+ entry.
+
+ * src/MenuBackend.h: MenuItem.label() only returns the label of
+ the menu without shortcut; new method shortcut().
+
+2000-07-14 Marko Vendelin <markov@ioc.ee>
+
+ * src/frontends/gtk/Dialogs.C:
+ * src/frontends/gtk/FormCopyright.C:
+ * src/frontends/gtk/FormCopyright.h:
+ * src/frontends/gtk/Makefile.am: added these source-files for the
+ Gtk/Gnome support of the Copyright-Dialog.
+
+ * src/main.C: added Gnome::Main initialization if using
+ Gtk/Gnome frontend-GUI.
+
+ * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
+ frontend-GUI.
+ * config/gnome/aclocal-include.m4
+ * config/gnome/compiler-flags.m4
+ * config/gnome/curses.m4
+ * config/gnome/gnome--.m4
+ * config/gnome/gnome-bonobo-check.m4
+ * config/gnome/gnome-common.m4
+ * config/gnome/gnome-fileutils.m4
+ * config/gnome/gnome-ghttp-check.m4
+ * config/gnome/gnome-gnorba-check.m4
+ * config/gnome/gnome-guile-checks.m4
+ * config/gnome/gnome-libgtop-check.m4
+ * config/gnome/gnome-objc-checks.m4
+ * config/gnome/gnome-orbit-check.m4
+ * config/gnome/gnome-print-check.m4
+ * config/gnome/gnome-pthread-check.m4
+ * config/gnome/gnome-support.m4
+ * config/gnome/gnome-undelfs.m4
+ * config/gnome/gnome-vfs.m4
+ * config/gnome/gnome-x-checks.m4
+ * config/gnome/gnome-xml-check.m4
+ * config/gnome/gnome.m4
+ * config/gnome/gperf-check.m4
+ * config/gnome/gtk--.m4
+ * config/gnome/linger.m4
+ * config/gnome/need-declaration.m4: added configuration scripts
+ for Gtk/Gnome frontend-GUI
+
+ * configure.in: added support for the --with-frontend=gtk option
+
+ * autogen.sh: added config/gnome/* to list of config-files
+
+ * acconfig.h: added define for GTKGUI-support
+
+ * config/lyxinclude.m4: added --with-frontend[=value] option value
+ for Gtk/Gnome frontend-GUI support.
+
+2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
+ can be used.
+ (suffixIs): ditto
+
+ * src/paragraph.C (GetChar): remove non-const version
+
+ * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
+ (search_kw): use it.
+
+ * src/lyx_main.C (init): if "preferences" exist, read that instead
+ of "lyxrc".
+ (ReadRcFile): return bool if the file could be read ok.
+ (ReadUIFile): add a check to see if lex file is set ok.
+
+ * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
+ bastring can be used instead of lyxstring (still uses the old code
+ if std::string is good enough or if lyxstring is used.)
+
+ * src/encoding.C: make the arrays static, move ininle functions
+ here
+ * src/encoding.h: from here.
+
+ * src/buffer.C: have last_isnet_read as a file scope variable for now.
+ (parseSingleLyXformat2Token): move inset parsing to separate method
+ (readInset): new private method
+
+ * src/Variables.h: remove virtual from get().
+
+ * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
+ access to NEW_INSETS and NEW_TABULAR
+
+ * src/MenuBackend.h: remove superfluous forward declaration of
+ MenuItem. Add documentations tags "///", remove empty MenuItem
+ destructor, remove private default contructor.
+
+ * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
+ (add): return *this
+ (read): more string mlabel and mname to where they are used
+ (read): remove unused variables mlabel and mname
+ (defaults): unconditional clear, make menusetup take advantage of
+ add returning Menu &.
+
+ * src/LyXView.h: define NEW_MENUBAR as default
+
+ * src/LyXAction.C: include lyxparagraph.h temporary to get access
+ to NEW_INSETS and NEW_TABULAR.
+ (init): commetn out some funcs that is obsolete when NEW_INSETS is
+ defined. Change some of the "xxxx-inset-insert" functions names to
+ "xxxx-insert".
+
+ * several files: more enahncements to NEW_INSETS and the resulting
+ LyXParagraph code.
+
+ * lib/lyxrc.example (\date_insert_format): move to misc section
+
+ * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
+ bastring and use AC_CACHE_CHECK.
+ (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
+ the system have the newest methods. uses AC_CACHE_CHECK
+ (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
+ (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
+ (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
+
+ * configure.in: add LYX_CXX_GOOD_STD_STRING
+
+ * acinclude.m4: recreated
+
+2000-07-24 Amir Karger
+
+ * README: add Hebrew, Arabic kmaps
+ * ANNOUNCE: typo
+
+2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/buffer.C (writeFileAscii): Define actcell as an int instead
+ of int*.
+
+2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * Lot of files: add pragma interface/implementation.
+
+ * src/lyx_main.C (ReadUFile): new method. Read the UI file.
+
+ * lib/ui/default.ui: new file (ans new directory). Contains the
+ default menu and toolbar.
+
+ * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
+ global space. Toolbars are now read (as menus) in ui files.
+
+ * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
+
+ * src/lyxfunc.C (getStatus): do not exit immediately if a command
+ is disabled because the document is read-only. We want to have the
+ toggle state of the function anyway.
+ (getStatus): add code for LFUN_VC* functions (mimicking what is
+ done in old-style menus)
+
+ * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
+ LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
+
+ * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
+ * src/BufferView_pimpl.C: ditto.
+ * src/lyxfunc.C: ditto.
+
+ * src/LyXView.h: add a define NEW_MENUBAR (commented out by
+ default). This replaces old-style menus by new ones.
+
+ * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
+ MenuItem. Contain the data structure of a menu.
+
+ * src/insets/insettext.C: use LyXView::setLayout instead of
+ accessing directly the toolbar combox.
+ * src/lyxfunc.C (Dispatch): ditto.
+
+ * src/LyXView.C (setLayout): new method, which just calls
+ Toolbar::setLayout().
+ (updateLayoutChoice): move part of this method in Toolbar.
+
+ * src/toolbar.[Ch]: removed.
+
+ * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
+ implementation the toolbar.
+
+ * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
+ the toolbar. It might make sense to merge it with ToolbarDefaults
+ later.
+ (setLayout): new function.
+ (updateLayoutList): ditto.
+ (openLayoutList): ditto.
+
+ * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
+ xforms implementation of the toolbar.
+ (get_toolbar_func): comment out, since I do not
+ know what it is good for.
+
+ * src/ToolbarDefaults.h: Add the ItemType enum.
+
+ * src/support/StrPool.[Ch]: new class. Acts as a reference holder
+ for a list of allocated C strings. Used in Menubar xforms
+ implementation to avoid memory leaks.
+
+ * src/support/lstrings.[Ch] (uppercase): new version taking and
+ returning a char.
+ (lowercase): ditto.
+
+ * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
+ * lib/bind/emacs.bind: ditto.
+
+2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
+ forward decl of LyXView.
+
+ * src/toolbar.C (toolbarItem): moved from toolbar.h
+ (toolbarItem::clean): ditto
+ (toolbarItem::~toolbarItem): ditto
+ (toolbarItem::operator): ditto
+
+ * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
+
+ * src/paragraph.h: control the NEW_TABULAR define from here
+
+ * src/buffer.C: remove define USE_PARSE_FUNCTION, change
+ USE_TABULAR_INSETS to NEW_TABULAR
+
+ * src/ToolbarDefaults.C: add include "lyxlex.h"
+
+ * files using the old table/tabular: use NEW_TABULAR to control
+ compilation of old tabular stuff.
+
+ * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
+ to correct place.
+
+ * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
+ planemet in reading of old style floats, fix the \end_deeper
+ problem when reading old style floats.
+
+2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
+
+2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
+
+ * lib/bind/sciword.bind: updated.
+
+2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
+ layout write problem
+
+2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/Makefile.am (INCLUDES): remove image directory from include
+ path.
+
+ * src/bullet_forms.C (create_form_form_bullet): small cleanup.
+ * src/bullet_forms_cb.C (BulletPanelCB): ditto.
+
+ * src/LyXView.C (create_form_form_main): read the application icon
+ from the disk.
+
+ * lib/images/*.xpm: change the icons to use transparent color for
+ background.
+
+ * src/toolbar.C (update): change the color of the button when it
+ is toggled on.
+
+2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
+ setting explicitely the minibuffer.
+ * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
+
+ * src/LyXView.C (showState): new function. Shows font information
+ in minibuffer and update toolbar state.
+ (LyXView): call Toolbar::update after creating the
+ view.
+
+ * src/toolbar.C: change toollist to be a vector instead of a
+ linked list.
+ (BubbleTimerCB): get help string directly from the callback
+ argument of the corresponding icon (which is the action)
+ (set): remove unnecessary ugliness.
+ (update): new function. update the icons (depressed, disabled)
+ depending of the status of the corresponding action.
+
+ * src/toolbar.h: remove help in toolbarItem
+
+2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/Painter.C (text): Added code for using symbol glyphs from
+ iso10646 fonts. Currently diabled.
+
+ * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
+ symbol_encoding.
+
+ * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
+ magyar,turkish and usorbian.
+
+ * src/paragraph.C (isMultiLingual): Made more efficient.
+
+ * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
+ keyboard.
+
+ * src/mathed/math_symbols.C (math_insert_greek): Changed to use
+ LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
+ Also changed the prototype to "bool math_insert_greek(char)".
+
+2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * lots of files: apply the NEW_INSETS on all code that will not be
+ needed when we move to use the new insets. Enable the define in
+ lyxparagrah.h to try it.
+
+ * src/insets/insettabular.C (cellstart): change to be a static
+ inline function
+ (InsetTabular): initialize buffer in the initializer list.
+
+2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/xforms/FormPrint.[Ch] : moved #include
+ form_print.h out of the header file. Replaced with forward
+ declarations of the relevant struct.
+
+ * src/frontends/xforms/FormPreferences.[Ch] : ditto for
+ form_preferences.h.
+
+ * src/commandtags.h: do not include "debug.h" which does not
+ belong there. #include it in some other places because of this
+ change.
+
+2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/insets/insetcaption.C: add a couple "using" directives.
+
+ * src/toolbar.C (add): get the help text directly from lyxaction.
+ (getPixmap): nuked.
+ (setPixmap): new function. Loads from disk and sets a pixmap on a
+ botton; the name of the pixmap file is derived from the command
+ name.
+
+ * src/toolbar.h: remove members isBitmap and pixmap from
+ toobarItem struct.
+
+ * lib/images/*.xbm *_bw.xpm: remove (not used any more).
+ * lib/images/: move many files from images/banner.xpm.
+
+ * src/lyx_gui.C (create_forms): read banner pixmap from file.
+
+ * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
+ * src/toolbar.C: ditto.
+ * configure.in: ditto.
+ * INSTALL: document.
+
+ * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
+ the spellchecker popup is closed from the WM.
+
+2000-07-19 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insetfloat.C (Write): small fix because we use the
+ insetname for the type now!
+
+2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/xforms/forms/form_citation.fd: object sizes are
+ now set here
+
+ * src/frontends/Dialogs.h: removed hideCitation signal
+
+ * src/insets/insetcite.h: added hide signal
+
+ * src/insets/insetcite.C (~InsetCitation): emits new signal
+ (getScreenLabel): "intelligent" label should now fit on the screen!
+
+ * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
+
+ * src/frontends/xforms/FormCitation.C (showInset): connects
+ hide() to the inset's hide signal
+ (show): modified to use fl_set_object_position rather than
+ fl_set_object_geometry wherever possible
+
+2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/insets/lyxinset.h: add caption code
+
+ * src/insets/insetfloat.C (type): new method
+
+ * src/insets/insetcaption.C (Write): new method
+ (Read): new method
+ (LyxCode): new method
+
+ * src/text2.C (SetCounter): revert Jürgens code, but use his idea
+ to get it right together with using the FloatList.
+
+ * src/commandtags.h: add LFUN_INSET_CAPTION
+ * src/lyxfunc.C (Dispatch): handle it
+
+ * src/buffer.C (parseSingleLyXformat2Token): add code to read a
+ caption inset.
+
+ * src/Variables.[Ch]: make expand take a const reference, remove
+ the destructor, some whitespace changes.
+
+ * src/LyXAction.C (init): add caption-inset-insert
+
+ * src/FloatList.C (FloatList): update the default floats a bit.
+
+2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/Variables.[Ch]: new files. Intended to be used for language
+ specific strings (like \chaptername) and filename substitution in
+ commands.
+
+ * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
+ kmap files.
+ * lib/kbd/american.kmap: update
+
+ * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
+
+ * src/bufferparams.[Ch]: remove member allowAccents.
+
+ * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
+
+ * src/LaTeXLog.C: use the log_form.h header.
+ * src/lyx_gui.C: ditto.
+ * src/lyx_gui_misc.C: ditto.
+ * src/lyxvc.h: ditto.
+
+ * forms/log_form.fd: new file, created from latexoptions.fd. I
+ kept the log popup and nuked the options form.
+
+ * src/{la,}texoptions.[Ch]: removed.
+ * src/lyx_cb.C (LaTeXOptions): ditto
+
+ * src/lyx_gui.C (create_forms): do not handle the
+ fd_latex_options form.
+
+2000-07-18 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
+ name of the inset so that it can be requested outside (text2.C).
+
+ * src/text2.C (SetCounter): modified so it sees insetfloat for caption
+ labels.
+
+2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/mathed/formula.h (ConvertFont): constify
+
+ * src/mathed/formula.C (Read): add warning if \end_inset is not
+ found on expected place.
+
+ * src/insets/lyxinset.h (ConvertFont): consify
+
+ * src/insets/insetquotes.C (ConvertFont): constify
+ * src/insets/insetquotes.h: ditto
+
+ * src/insets/insetinfo.h: add labelfont
+
+ * src/insets/insetinfo.C (InsetInfo): set the labelfont
+ (ascent): use labelfont
+ (descent): likewise
+ (width): likewise
+ (draw): likewise
+ (Write): make .lyx file a bit nicer
+
+ * src/insets/insetfloat.C (Write): simplify somewhat...
+ (Read): add warning if arg is not found
+
+ * src/insets/insetcollapsable.C: add using std::max
+ (Read): move string token and add warning in arg is not found
+ (draw): use std::max to get the right ty
+ (getMaxWidth): simplify by using std::max
+
+ * src/insets/insetsection.h: new file
+ * src/insets/insetsection.C: new file
+ * src/insets/insetcaption.h: new file
+ * src/insets/insetcaption.C: new file
+
+ * src/insets/inset.C (ConvertFont): constify signature
+
+ * src/insets/Makefile.am (libinsets_la_SOURCES): add
+ insetcaption.[Ch] and insetsection.[Ch]
+
+ * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
+ uses to use LABEL_COUNTER_CHAPTER instead.
+ * src/text2.C (SetCounter): here
+
+ * src/counters.h: new file
+ * src/counters.C: new file
+ * src/Sectioning.h: new file
+ * src/Sectioning.C: new file
+
+ * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
+
+2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
+ not always in "."!
+
+ * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
+ the last argument.
+
+2000-07-17 Juergen Vigna <jug@sad.it>
+
+ * src/tabular.C (Validate): check if array-package is needed.
+ (SetVAlignment): added support for vertical alignment.
+ (SetLTFoot): better support for longtable header/footers
+ (Latex): modified to support added features.
+
+ * src/LaTeXFeatures.[Ch]: added array-package.
+
+2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
+
+ * src/lyx_gui.C (LyXGUI): make sure that the height is large
+ enough.
+
+2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
+
+ * configure.in: do not forget to put a space after -isystem.
+
+2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * lib/kbd/arabic.kmap: a few fixes.
+
+2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * some whitespace chagnes to a number of files.
+
+ * src/support/DebugStream.h: change to make it easier for
+ doc++ to parse correctly.
+ * src/support/lyxstring.h: ditto
+
+ * src/mathed/math_utils.C (compara): change to have only one
+ operator()
+ (MathedLookupBOP): change because of the above.
+
+ * src/mathed/math_delim.C (math_deco_compare): change to have only
+ one operator()
+ (search_deco): change becasue of the above.
+
+ * src/insets/insettabular.C (DrawCellSelection): use std::swap
+ instead of manually coded one.
+
+ * src/insets/insetquotes.C (Read): read the \end_inset too
+
+ * src/insets/insetlatex.h: remove file
+ * src/insets/insetlatex.C: remove file
+
+ * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
+ constructor
+ (InsetPrintIndex): remove destructor
+
+ * src/insets/insetinclude.h: remove default constructor
+
+ * src/insets/insetfloat.C: work to make it work better
+
+ * src/insets/inseterror.[Ch] (InsetError): remove default constructor
+
+ * src/insets/insetcite.h (InsetCitation): remove default constructor
+
+ * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
+
+ * src/text.C (GetColumnNearX): comment out some currently unused code.
+
+ * src/paragraph.C (writeFile): move some initializations closer to
+ first use.
+ (CutIntoMinibuffer): small change to use new matchIT operator
+ (Erase): ditto
+ (Erase): ditto
+ (InsertChar): ditto
+ (InsertInset): ditto
+ (GetInset): ditto
+ (GetInset): ditto
+ (InsetIterator): ditto
+ (Erase): small change to use new matchFT operator
+ (InsertChar): ditto
+ (GetFontSettings): ditto
+ (HighestFontInRange): ditto
+ (SetFont): ditto
+
+ * src/lyxparagraph.h: some chars changed to value_type
+ (matchIT): because of some stronger checking (perhaps too strong)
+ in SGI STL, the two operator() unified to one.
+ (matchFT): ditto
+
+ * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
+
+ * src/buffer.C (parseSingleLyXformat2Token): static string to hold
+ the last inset read added
+ (parseSingleLyXformat2Token): some more (future) compability code added
+ (parseSingleLyXformat2Token): warning about solitary \end_inset added
+ (parseSingleLyXformat2Token): set last_inset_read
+ (parseSingleLyXformat2Token): more code to read new "Float" correctly
+ (parseSingleLyXformat2Token): don't double intializw string next_token
+
+ * src/TextCache.C (text_fits::operator()): add const's to the signature
+ (has_buffer::operator()): ditto
+
+ * src/Floating.h: add some comments on the class
+
+ * src/FloatList.[Ch] (typeExist): new method
+ (getType): ditto
+
+ * src/BackStack.h: added default constructor, wanted by Gcc.
+
+2000-07-14 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
+
+ * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
+
+ * src/insets/insettabular.C (resizeLyXText): need this to be able to
+ do a redraw when the window is resized!
+ (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
+
+ * src/insets/insettext.C (resizeLyXText): added function to correctly
+ being able to resize the LyXWindow.
+
+ * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
+
+2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
+ crashes when closing dialog to a deleted inset.
+
+ * src/insets/insetcite.[Ch] (Edit) : the return of this former
+ method! Now similar to other insets.
+
+2000-07-13 Juergen Vigna <jug@sad.it>
+
+ * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
+
+ * lib/examples/Literate.lyx: small patch!
+
+ * src/insets/insetbib.C (Read): added this function because of wrong
+ Write (without [begin|end]_inset).
+
+2000-07-11 Juergen Vigna <jug@sad.it>
+
+ * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
+ as the insertInset could not be good!
+
+ * src/screen.C (ToggleSelection): fixed toggle selection bug as
+ the bool param should not be last.
+
+2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * sigc++/configure.in: fix bug in threading-related code (Yes, I
+ did submit that to Karl).
+
+ * configure.in: use -isystem instead of -I for X headers. This
+ fixes a problem on solaris with a recent gcc;
+ put the front-end code after the X detection code;
+ configure in sigc++ before lib/
+
+ * src/lyx_main.C (commandLineHelp): remove -display from command
+ line help.
+
+2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
+
+ * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
+ Also put in Makefile rules for building the ``listerrors''
+ program for parsing errors from literate programs written in LyX.
+
+ * lib/build-listerrors: Added small shell script as part of compile
+ process. This builds a working ``listerrors'' binary if noweb is
+ installed and either 1) the VNC X server is installed on the machine,
+ or 2) the user is compiling from within a GUI. The existence of a GUI
+ is necessary to use the ``lyx --export'' feature for now. This
+ hack can be removed once ``lyx --export'' no longer requires a GUI to
+ function.
+
+2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
+
+ * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
+ now passed back correctly from gcc and placed "under" error
+ buttons in a Literate LyX source.
+
+2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/text.C (GetColumnNearX): Better behavior when a RTL
+ paragraph is ended by LTR text.
+
+ * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
+ Ditto
+
+2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
+ true when clipboard is empty.
+
+2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * text.C (Backspace): Prevent rebreaking of a row if it is the last
+ row of the paragraph.
+ (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
+ to prevent calculation of bidi tables
+
+2000-07-07 Juergen Vigna <jug@sad.it>
+
+ * src/screen.C (ToggleSelection): added y_offset and x_offset
+ parameters.
+
+ * src/insets/insettext.C (InsetMotionNotify): fixed selection with
+ mouse.
+
+ * src/text.C (GetVisibleRow): fixed selection drawing in insets.
+
+ * src/insets/insettext.C: fixed Layout-Display!
+
+2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * configure.in: add check for strings.h header.
+
+ * src/spellchecker.C: include <strings.h> in order to have a
+ definition for bzero().
+
+2000-07-07 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettext.C (draw): set the status of the bv->text to
+ CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
+
+ * src/screen.C (DrawOneRow):
+ (DrawFromTo): redraw the actual row if something has changed in it
+ while drawing.
+
+ * src/text.C (draw): call an update of the toplevel-inset if something
+ has changed inside while drawing.
+
+ * src/lyxtext.h: added CHANGED_IN_DRAW status.
+
+2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/insets/insetbib.[Ch] (callback) new method, moving callback
+ processing inside class.
+
+ * src/insets/insetindex.[Ch] (callback) new method, moving callback
+ processing inside class.
+
+ * src/insets/insetindex.h new struct Holder, consistent with other
+ insets.
+
+ * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
+ citation dialog from main code and placed it in src/frontends/xforms.
+ Dialog launched through signals instead of callbacks
+
+2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
+
+ * lyx.man: update the options description.
+
+2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
+
+ * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
+ handle neg values, set min width to 590, add doc about -display
+
+2000-07-05 Juergen Vigna <jug@sad.it>
+
+ * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
+ calls to BufferView *.
+
+ * src/insets/insettext.C (checkAndActivateInset): small fix non
+ HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
+
+ * src/insets/insetcommand.C (Read): Fixed as insets should read till
+ their \end_inset token!
+
+2000-07-04 edscott <edscott@imp.mx>
+
+ * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
+ lib/lyxrc.example: added option \wheel_jump
+
+2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
+
+ * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
+ remove support for -width,-height,-xpos and -ypos.
+
+2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/encoding.[Ch]: New files.
+
+ * src/painter.C (text(int,int,XChar2b const *,...)): New method.
+ (text): Call to the underline() method only when needed.
+
+ * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
+
+ * src/buffer.C (makeLaTeXFile): Compute automatically the input
+ encoding(s) for the document.
+
+ * src/bufferparams.C (BufferParams): Changed default value of
+ inputenc to "auto".
+
+ * src/language.C (newLang): Removed.
+ (items[]): Added encoding information for all defined languages.
+
+ * src/lyx_gui.C (create_forms): Added "auto" option to the input
+ encoding choice button.
+
+ * src/lyxrc.h (font_norm_type): New member variable.
+ (set_font_norm_type): New method.
+
+ * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
+ paragraphs with different encodings.
+
+ * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
+ (TransformChar): Changed to work correctly with Arabic points.
+ (draw): Added support for drawing Arabic points.
+ (draw): Removed code for drawing underbars (this is done by
+ the Painter!)
+
+ * src/support/textutils.h (IsPrintableNonspace): New function.
+
+ * src/BufferView_pimpl.h: Added "using SigC::Object".
+ * src/LyXView.h: ditto.
+
+ * src/insets/insetinclude.h (include_label): Changed to mutable.
+
+2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/mathed/math_iter.h: remove empty destructor
+
+ * src/mathed/math_cursor.h: remove empty destructor
+
+ * src/insets/lyxinset.h: add THEOREM_CODE
+
+ * src/insets/insettheorem.[Ch]: new files
+
+ * src/insets/insetminipage.C: (InsertInset): remove
+
+ * src/insets/insetmarginal.C: inherit from InsetFootLike instead
+ of InsetCollapsable
+ (InsertInset): remove
+
+ * src/insets/insetlist.C: (InsertList): remove
+
+ * src/insets/insetfootlike.[Ch]: new files
+
+ * src/insets/insetfoot.C: inherit from InsetFootLike instead of
+ InsetCollapsable.
+ (Write): remove
+ (InsertInset): ditto
+
+ * src/insets/insetert.C: remove include Painter.h, reindent
+ (InsertInset): move to header
+
+ * src/insets/insetcollapsable.h: remove explicit from default
+ contructor, remove empty destructor, add InsertInset
+
+ * src/insets/insetcollapsable.C (InsertInset): new func
+
+ * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
+
+ * src/vspace.h: add explicit to constructor
+
+ * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
+ \textcompwordmark, please test this.
+
+ * src/lyxrc.C: set ascii_linelen to 65 by default
+
+ * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
+
+ * src/commandtags.h: add LFUN_INSET_THEOREM
+
+ * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
+ (makeLinuxDocFile): remove _some_ of the nice logic
+ (makeDocBookFile): ditto
+
+ * src/Painter.[Ch]: (~Painter): removed
+
+ * src/LyXAction.C (init): entry for insettheorem added
+
+ * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
+ enum
+ (deplog): code to detect files generated by LaTeX, needs testing
+ (deptex): removed
+
+2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
+
+2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/LaTeX.C (deplog): Add a check for files that are going to be
+ created by the first latex run, part of the project to remove the
+ all_files array.
+
+ * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
+ contents to the extension list.
+
+2000-07-04 Juergen Vigna <jug@sad.it>
+
+ * src/text.C (NextBreakPoint): added support for needFullRow()
+
+ * src/insets/lyxinset.h: added needFullRow()
+
+ * src/insets/insetcollapsable.C: redone now this uses a text-inset
+ and isn't one.
+
+ * src/insets/insettext.C: lots of changes for update!
+
+2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/LaTeXFeatures.h: add a missing std:: qualifier.
+
+2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
+
+ * src/insets/insetinclude.C (InsetInclude): fixed
+ initialization of include_label.
+ (unique_id): now returns a string.
+
+2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
+
+ * src/LaTeXFeatures.h: new member IncludedFiles, for
+ a map of key, included file name.
+
+ * src/LaTeXFeatures.C (getIncludedFiles): returns a string
+ with the included files for inclusion in SGML preamble,
+ i. e., linuxdoc and docbook.
+
+ * src/buffer.h:
+ * src/buffer.C (makeLinuxDocFile): takes two new arguments,
+ nice (is the generated linuxdoc code to be exported?), that
+ allows to remove column, and only_body that will be true for
+ slave documents. Insets are allowed inside SGML font type.
+ New handling of the SGML preamble for included files.
+ (makeDocBookFile): the same for docbook.
+
+ * src/insets/insetinclude.h:
+ * src/insets/insetinclude.C (Validate): keeps a list of included files.
+ (Linuxdoc):
+ (DocBook): new export methods.
+
+ * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
+ and makeDocBookFile.
+
+ * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
+ formats to export with command line argument -x.
+
+2000-06-29 Juergen Vigna <jug@sad.it>
+
+ * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
+ to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
+
+ * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
+ region could already been cleared by an inset!
+
+2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/BufferView_pimpl.h: remove member variables lyx_focus and
+ work_area_focus
+
+ * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
+ and lyx_focus
+ (cursorToggle): remove special handling of lyx focus.
+
+2000-06-28 Juergen Vigna <jug@sad.it>
+
+ * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
+ insetHeight.
+
+2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/insets/insetindex.C (Edit): add a callback when popup is
+ closed by the WM.
+
+ * src/insets/insettext.C (LocalDispatch):
+ * src/insets/insetmarginal.h:
+ * src/insets/insetlist.h:
+ * src/insets/insetfoot.h:
+ * src/insets/insetfloat.h:
+ * src/insets/insetert.h: add a missing std:: qualifier.
+
2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/lyxsum.C (sum): '\0' teminate file read when using