+2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/frontends/gtk/.cvsignore: add MAKEFILE
+
+ * src/MenuBackend.C (read): run the label strings through gettext
+ before storing them in the containers.
+
+ * src/ext_l10n.h: new file
+
+ * autogen.sh : generate the ext_l10n.h file here
+
+2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
+ arguments.
+
+ * lib/ui/default.ui: fix a couple of typos.
+
+ * config/gnome/gtk.m4: added (and added to the list of files in
+ autogen.sh).
+
+ * src/insets/insetinclude.C (unique_id): fix when we are using
+ lyxstring instead of basic_string<>.
+ * src/insets/insettext.C (LocalDispatch): ditto.
+ * src/support/filetools.C: ditto.
+
+ * lib/configure.m4: create the ui/ directory if necessary.
+
+ * src/LyXView.[Ch] (updateToolbar): new method.
+
+ * src/BufferView_pimpl.C (buffer): update the toolbar when
+ opening/closing buffer.
+
+2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/LyXAction.C (getActionName): enhance to return also the name
+ and options of pseudo-actions.
+ (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
+
+ * lib/ui/default.ui: use OptItem in the vc submenu (intented just
+ as an example of what is possible). Used in File->Build too (more
+ useful) and in the import/export menus (to mimick the complicated
+ handling of linuxdoc and friends). Try to update all the entries.
+
+ * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
+ optional entries.
+
+ * src/MenuBackend.C (read): Parse the new OptItem tag.
+
+ * src/MenuBackend.h: Add a new optional_ data member (used if the
+ entry should be omitted when the lyxfunc is disabled).
+
+ * src/frontends/xforms/Menubar_pimpl.C (string_width): new
+ function, used as a shortcut.
+ (create_submenu): align correctly the shortcuts on the widest
+ entry.
+
+ * src/MenuBackend.h: MenuItem.label() only returns the label of
+ the menu without shortcut; new method shortcut().
+
+2000-07-14 Marko Vendelin <markov@ioc.ee>
+
+ * src/frontends/gtk/Dialogs.C:
+ * src/frontends/gtk/FormCopyright.C:
+ * src/frontends/gtk/FormCopyright.h:
+ * src/frontends/gtk/Makefile.am: added these source-files for the
+ Gtk/Gnome support of the Copyright-Dialog.
+
+ * src/main.C: added Gnome::Main initialization if using
+ Gtk/Gnome frontend-GUI.
+
+ * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
+ frontend-GUI.
+ * config/gnome/aclocal-include.m4
+ * config/gnome/compiler-flags.m4
+ * config/gnome/curses.m4
+ * config/gnome/gnome--.m4
+ * config/gnome/gnome-bonobo-check.m4
+ * config/gnome/gnome-common.m4
+ * config/gnome/gnome-fileutils.m4
+ * config/gnome/gnome-ghttp-check.m4
+ * config/gnome/gnome-gnorba-check.m4
+ * config/gnome/gnome-guile-checks.m4
+ * config/gnome/gnome-libgtop-check.m4
+ * config/gnome/gnome-objc-checks.m4
+ * config/gnome/gnome-orbit-check.m4
+ * config/gnome/gnome-print-check.m4
+ * config/gnome/gnome-pthread-check.m4
+ * config/gnome/gnome-support.m4
+ * config/gnome/gnome-undelfs.m4
+ * config/gnome/gnome-vfs.m4
+ * config/gnome/gnome-x-checks.m4
+ * config/gnome/gnome-xml-check.m4
+ * config/gnome/gnome.m4
+ * config/gnome/gperf-check.m4
+ * config/gnome/gtk--.m4
+ * config/gnome/linger.m4
+ * config/gnome/need-declaration.m4: added configuration scripts
+ for Gtk/Gnome frontend-GUI
+
+ * configure.in: added support for the --with-frontend=gtk option
+
+ * autogen.sh: added config/gnome/* to list of config-files
+
+ * acconfig.h: added define for GTKGUI-support
+
+ * config/lyxinclude.m4: added --with-frontend[=value] option value
+ for Gtk/Gnome frontend-GUI support.
+
+2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
+ can be used.
+ (suffixIs): ditto
+
+ * src/paragraph.C (GetChar): remove non-const version
+
+ * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
+ (search_kw): use it.
+
+ * src/lyx_main.C (init): if "preferences" exist, read that instead
+ of "lyxrc".
+ (ReadRcFile): return bool if the file could be read ok.
+ (ReadUIFile): add a check to see if lex file is set ok.
+
+ * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
+ bastring can be used instead of lyxstring (still uses the old code
+ if std::string is good enough or if lyxstring is used.)
+
+ * src/encoding.C: make the arrays static, move ininle functions
+ here
+ * src/encoding.h: from here.
+
+ * src/buffer.C: have last_isnet_read as a file scope variable for now.
+ (parseSingleLyXformat2Token): move inset parsing to separate method
+ (readInset): new private method
+
+ * src/Variables.h: remove virtual from get().
+
+ * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
+ access to NEW_INSETS and NEW_TABULAR
+
+ * src/MenuBackend.h: remove superfluous forward declaration of
+ MenuItem. Add documentations tags "///", remove empty MenuItem
+ destructor, remove private default contructor.
+
+ * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
+ (add): return *this
+ (read): more string mlabel and mname to where they are used
+ (read): remove unused variables mlabel and mname
+ (defaults): unconditional clear, make menusetup take advantage of
+ add returning Menu &.
+
+ * src/LyXView.h: define NEW_MENUBAR as default
+
+ * src/LyXAction.C: include lyxparagraph.h temporary to get access
+ to NEW_INSETS and NEW_TABULAR.
+ (init): commetn out some funcs that is obsolete when NEW_INSETS is
+ defined. Change some of the "xxxx-inset-insert" functions names to
+ "xxxx-insert".
+
+ * several files: more enahncements to NEW_INSETS and the resulting
+ LyXParagraph code.
+
+ * lib/lyxrc.example (\date_insert_format): move to misc section
+
+ * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
+ bastring and use AC_CACHE_CHECK.
+ (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
+ the system have the newest methods. uses AC_CACHE_CHECK
+ (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
+ (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
+ (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
+
+ * configure.in: add LYX_CXX_GOOD_STD_STRING
+
+ * acinclude.m4: recreated
+
+2000-07-24 Amir Karger
+
+ * README: add Hebrew, Arabic kmaps
+ * ANNOUNCE: typo
+
+2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/buffer.C (writeFileAscii): Define actcell as an int instead
+ of int*.
+
+2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * Lot of files: add pragma interface/implementation.
+
+ * src/lyx_main.C (ReadUFile): new method. Read the UI file.
+
+ * lib/ui/default.ui: new file (ans new directory). Contains the
+ default menu and toolbar.
+
+ * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
+ global space. Toolbars are now read (as menus) in ui files.
+
+ * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
+
+ * src/lyxfunc.C (getStatus): do not exit immediately if a command
+ is disabled because the document is read-only. We want to have the
+ toggle state of the function anyway.
+ (getStatus): add code for LFUN_VC* functions (mimicking what is
+ done in old-style menus)
+
+ * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
+ LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
+
+ * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
+ * src/BufferView_pimpl.C: ditto.
+ * src/lyxfunc.C: ditto.
+
+ * src/LyXView.h: add a define NEW_MENUBAR (commented out by
+ default). This replaces old-style menus by new ones.
+
+ * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
+ MenuItem. Contain the data structure of a menu.
+
+ * src/insets/insettext.C: use LyXView::setLayout instead of
+ accessing directly the toolbar combox.
+ * src/lyxfunc.C (Dispatch): ditto.
+
+ * src/LyXView.C (setLayout): new method, which just calls
+ Toolbar::setLayout().
+ (updateLayoutChoice): move part of this method in Toolbar.
+
+ * src/toolbar.[Ch]: removed.
+
+ * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
+ implementation the toolbar.
+
+ * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
+ the toolbar. It might make sense to merge it with ToolbarDefaults
+ later.
+ (setLayout): new function.
+ (updateLayoutList): ditto.
+ (openLayoutList): ditto.
+
+ * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
+ xforms implementation of the toolbar.
+ (get_toolbar_func): comment out, since I do not
+ know what it is good for.
+
+ * src/ToolbarDefaults.h: Add the ItemType enum.
+
+ * src/support/StrPool.[Ch]: new class. Acts as a reference holder
+ for a list of allocated C strings. Used in Menubar xforms
+ implementation to avoid memory leaks.
+
+ * src/support/lstrings.[Ch] (uppercase): new version taking and
+ returning a char.
+ (lowercase): ditto.
+
+ * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
+ * lib/bind/emacs.bind: ditto.
+
+2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
+ forward decl of LyXView.
+
+ * src/toolbar.C (toolbarItem): moved from toolbar.h
+ (toolbarItem::clean): ditto
+ (toolbarItem::~toolbarItem): ditto
+ (toolbarItem::operator): ditto
+
+ * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
+
+ * src/paragraph.h: control the NEW_TABULAR define from here
+
+ * src/buffer.C: remove define USE_PARSE_FUNCTION, change
+ USE_TABULAR_INSETS to NEW_TABULAR
+
+ * src/ToolbarDefaults.C: add include "lyxlex.h"
+
+ * files using the old table/tabular: use NEW_TABULAR to control
+ compilation of old tabular stuff.
+
+ * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
+ to correct place.
+
+ * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
+ planemet in reading of old style floats, fix the \end_deeper
+ problem when reading old style floats.
+
+2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
+
+2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
+
+ * lib/bind/sciword.bind: updated.
+
2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/paragraph.C (writeFile): NEW_INSETS: possible fix to the