+2000-07-05 Juergen Vigna <jug@sad.it>
+
+ * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
+ calls to BufferView *.
+
+ * src/insets/insettext.C (checkAndActivateInset): small fix non
+ HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
+
+ * src/insets/insetcommand.C (Read): Fixed as insets should read till
+ their \end_inset token!
+
+2000-07-04 edscott <edscott@imp.mx>
+
+ * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
+ lib/lyxrc.example: added option \wheel_jump
+
+2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
+
+ * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
+ remove support for -width,-height,-xpos and -ypos.
+
+2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/encoding.[Ch]: New files.
+
+ * src/painter.C (text(int,int,XChar2b const *,...)): New method.
+ (text): Call to the underline() method only when needed.
+
+ * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
+
+ * src/buffer.C (makeLaTeXFile): Compute automatically the input
+ encoding(s) for the document.
+
+ * src/bufferparams.C (BufferParams): Changed default value of
+ inputenc to "auto".
+
+ * src/language.C (newLang): Removed.
+ (items[]): Added encoding information for all defined languages.
+
+ * src/lyx_gui.C (create_forms): Added "auto" option to the input
+ encoding choice button.
+
+ * src/lyxrc.h (font_norm_type): New member variable.
+ (set_font_norm_type): New method.
+
+ * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
+ paragraphs with different encodings.
+
+ * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
+ (TransformChar): Changed to work correctly with Arabic points.
+ (draw): Added support for drawing Arabic points.
+ (draw): Removed code for drawing underbars (this is done by
+ the Painter!)
+
+ * src/support/textutils.h (IsPrintableNonspace): New function.
+
+ * src/BufferView_pimpl.h: Added "using SigC::Object".
+ * src/LyXView.h: ditto.
+
+ * src/insets/insetinclude.h (include_label): Changed to mutable.
+
+2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/mathed/math_iter.h: remove empty destructor
+
+ * src/mathed/math_cursor.h: remove empty destructor
+
+ * src/insets/lyxinset.h: add THEOREM_CODE
+
+ * src/insets/insettheorem.[Ch]: new files
+
+ * src/insets/insetminipage.C: (InsertInset): remove
+
+ * src/insets/insetmarginal.C: inherit from InsetFootLike instead
+ of InsetCollapsable
+ (InsertInset): remove
+
+ * src/insets/insetlist.C: (InsertList): remove
+
+ * src/insets/insetfootlike.[Ch]: new files
+
+ * src/insets/insetfoot.C: inherit from InsetFootLike instead of
+ InsetCollapsable.
+ (Write): remove
+ (InsertInset): ditto
+
+ * src/insets/insetert.C: remove include Painter.h, reindent
+ (InsertInset): move to header
+
+ * src/insets/insetcollapsable.h: remove explicit from default
+ contructor, remove empty destructor, add InsertInset
+
+ * src/insets/insetcollapsable.C (InsertInset): new func
+
+ * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
+
+ * src/vspace.h: add explicit to constructor
+
+ * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
+ \textcompwordmark, please test this.
+
+ * src/lyxrc.C: set ascii_linelen to 65 by default
+
+ * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
+
+ * src/commandtags.h: add LFUN_INSET_THEOREM
+
+ * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
+ (makeLinuxDocFile): remove _some_ of the nice logic
+ (makeDocBookFile): ditto
+
+ * src/Painter.[Ch]: (~Painter): removed
+
+ * src/LyXAction.C (init): entry for insettheorem added
+
+ * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
+ enum
+ (deplog): code to detect files generated by LaTeX, needs testing
+ (deptex): removed
+
+2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
+
+2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/LaTeX.C (deplog): Add a check for files that are going to be
+ created by the first latex run, part of the project to remove the
+ all_files array.
+
+ * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
+ contents to the extension list.
+
+2000-07-04 Juergen Vigna <jug@sad.it>
+
+ * src/text.C (NextBreakPoint): added support for needFullRow()
+
+ * src/insets/lyxinset.h: added needFullRow()
+
+ * src/insets/insetcollapsable.C: redone now this uses a text-inset
+ and isn't one.
+
+ * src/insets/insettext.C: lots of changes for update!
+
+2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/LaTeXFeatures.h: add a missing std:: qualifier.
+
+2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
+
+ * src/insets/insetinclude.C (InsetInclude): fixed
+ initialization of include_label.
+ (unique_id): now returns a string.
+
+2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
+
+ * src/LaTeXFeatures.h: new member IncludedFiles, for
+ a map of key, included file name.
+
+ * src/LaTeXFeatures.C (getIncludedFiles): returns a string
+ with the included files for inclusion in SGML preamble,
+ i. e., linuxdoc and docbook.
+
+ * src/buffer.h:
+ * src/buffer.C (makeLinuxDocFile): takes two new arguments,
+ nice (is the generated linuxdoc code to be exported?), that
+ allows to remove column, and only_body that will be true for
+ slave documents. Insets are allowed inside SGML font type.
+ New handling of the SGML preamble for included files.
+ (makeDocBookFile): the same for docbook.
+
+ * src/insets/insetinclude.h:
+ * src/insets/insetinclude.C (Validate): keeps a list of included files.
+ (Linuxdoc):
+ (DocBook): new export methods.
+
+ * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
+ and makeDocBookFile.
+
+ * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
+ formats to export with command line argument -x.
+
+2000-06-29 Juergen Vigna <jug@sad.it>
+
+ * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
+ to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
+
+ * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
+ region could already been cleared by an inset!
+
+2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/BufferView_pimpl.h: remove member variables lyx_focus and
+ work_area_focus
+
+ * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
+ and lyx_focus
+ (cursorToggle): remove special handling of lyx focus.
+
+2000-06-28 Juergen Vigna <jug@sad.it>
+
+ * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
+ insetHeight.
+
+2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/insets/insetindex.C (Edit): add a callback when popup is
+ closed by the WM.
+
+ * src/insets/insettext.C (LocalDispatch):
+ * src/insets/insetmarginal.h:
+ * src/insets/insetlist.h:
+ * src/insets/insetfoot.h:
+ * src/insets/insetfloat.h:
+ * src/insets/insetert.h: add a missing std:: qualifier.
+
+2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/lyxsum.C (sum): '\0' teminate file read when using
+ strstream.
+
+ * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
+
+ * src/insets/insettext.C (Read): remove tmptok unused variable
+ (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
+ (InsertInset): change for new InsetInset code
+
+ * src/insets/insettext.h: add TEXT inline method
+
+ * src/insets/insettext.C: remove TEXT macro
+
+ * src/insets/insetmarginal.C (Write): new method
+ (Latex): change output slightly
+
+ * src/insets/insetfoot.C (Write): new method
+ (Latex): change output slightly (don't use endl when no need)
+
+ * src/insets/insetert.C (Write): new method
+
+ * src/insets/insetcollapsable.h: make button_length, button_top_y
+ and button_bottm_y protected.
+
+ * src/insets/insetcollapsable.C (Write): simplify code by using
+ tostr. Also do not output the float name, the children class
+ should to that to get control over own arguments
+
+ * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
+ src/insets/insetminipage.[Ch]:
+ new files
+
+ * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
+
+ * src/lyxfunc.C (Dispatch): cases for new insets/commands
+
+ * src/Makefile.am (lyx_SOURCES): add the new files
+
+ * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
+ LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
+ * src/commandtags.h: ditto
+
+ * src/LaTeXFeatures.h: add a std::set of used floattypes
+
+ * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
+
+ * src/FloatList.[Ch] src/Floating.h: new files
+
+ * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
+ InsertInset.
+ * src/lyx_cb.C (TableApplyCB): ditto
+ * src/text.C: ditto
+ * src/text2.C: ditto
+ * src/buffer.C (SimpleLinuxDocOnePar): ditto
+ (parseSingleLyXformat2Token): ditto + add code for
+ backwards compability for old float styles + add code for new insets
+
+ * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
+ method
+ (InsertInset(size_type, Inset *, LyXFont)): new method
+ (InsetChar(size_type, char)): changed to use the other InsetChar
+ with a LyXFont(ALL_INHERIT).
+ (InsetInset(size_type, Inset*)): changed to use InsetChar to
+ insert the META_INSET.
+
+ * sigc++/thread.cc (Privete<int>::operator int&): move definition
+ out of line.
+ * sigc++/thread.h (Threads): from here
+
+ * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
+ definition out of line
+ * sigc++/scope.h: from here
+
+2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
+ is specified (adapted from a patch from edscott <edscott@imp.mx>).
+
+ * Makefile.am (bindist): new target.
+
+ * INSTALL: add instructions for doing a binary distribution.
+
+ * development/tools/README.bin.example: update a bit.
+
+2000-06-26 Lior Silberman <slior@math.huji.ac.il>
+
+ * src/lyxrc.C:
+ * lib/lyxrc.example: new lyxrc tag \set_color.
+
+ * src/lyxfunc.C (Dispatch):
+ * src/commandtags.h:
+ * src/LyXAction.C: new lyxfunc "set-color".
+
+ * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
+ and an x11name given as strings.
+
+ * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
+ cache when a color is changed.
+
+2000-06-26 Juergen Vigna <jug@sad.it>
+
+ * src/lyxrow.C (width): added this functions and variable.
+
+ * src/insets/insetcite.C (create_form_citation_form): some Gravity
+ changes.
+
+ * src/text.C (SetHeightOfRow): fixed calcualting of width.
+
+2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * images/undo_bw.xpm: new icon.
+ * images/redo_bw.xpm: ditto.
+
+ * configure.in (INSTALL_SCRIPT): change value to
+ ${INSTALL} to avoid failures of install-script target.
+ * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
+
+ * src/BufferView.h: add a magic "friend" declaration to please
+ compaq cxx.
+
+2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * forms/cite.fd: modified to allow resizing without messing
+ up the dialog.
+
+ * src/insetcite.C: Uses code from cite.fd almost without
+ tweaking. ;-)
+ User can now resize dialog in the x-direction.
+ Resizing the dialog in the y-direction is prevented, as the
+ code does this intelligently already.
+
+2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * INSTALL: remove obsolete entry in "problems" section.
+
+ * lib/examples/sl_*.lyx: update of the slovenian examples.
+
+ * src/support/FileInfo.[Ch] (getBlockSize): remove.
+
+2000-06-23 Juergen Vigna <jug@sad.it>
+
+ * src/lyxtext.h: added a 'cleared' flag to draw() function.
+
+ * src/buffer.C (resize): delete the LyXText of textinsets.
+
+ * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
+
+ * src/insets/lyxinset.h: added another parameter 'cleared' to
+ the draw() function.
+
+ * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
+ unlocking inset in inset.
+
+2000-06-22 Juergen Vigna <jug@sad.it>
+
+ * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
+ of insets and moved first to LyXText.
+
+ * src/mathed/formulamacro.[Ch]:
+ * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
+
+2000-06-21 Juergen Vigna <jug@sad.it>
+
+ * src/text.C (GetVisibleRow): look if I should clear the area or not
+ using Inset::doClearArea() function.
+
+ * src/insets/lyxinset.h: added doClearArea() function and
+ modified draw(Painter &, ...) to draw(BufferView *, ...)
+
+ * src/text2.C (UpdateInset): return bool insted of int
+
+2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/lyx_gui.C (create_forms): Add "Reset" option to the language
+ combox in the character popup
+
+ * src/lyx_cb.C (UserFreeFont): Add argument to the method:
+ BufferParams const & params
+
+2000-06-20 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettext.C (SetParagraphData): set insetowner on
+ 2- paragraphs.
+
+2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/Timeout.[Ch]: Change to use signals instead of callbacks.
+ * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
+ from SigC::Object
+ (form_main_): remove
+
+ * src/LyXView.C (LyXView_AutosaveTimerCB): remove
+ (create_form_form_main): remove FD_form_main stuff, connect to
+ autosave_timeout signal
+
+ * src/LyXView.[Ch] (getMainForm): remove
+ (UpdateTimerCB): remove
+ * src/BufferView_pimpl.h: inherit from SigC::Object
+
+ * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
+ signal instead of callback
+
+ * src/BufferView.[Ch] (cursorToggleCB): remove
+
+2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/BufferView_pimpl.C: changes because of the one below
+
+ * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
+ instead of storing a pointer to a LyXText.
+
+ * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
+
+2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/lyxparagraph.h
+
+ * src/paragraph.C: Changed fontlist to a sorted vector.
+
+2000-06-19 Juergen Vigna <jug@sad.it>
+
+ * src/BufferView.h: added screen() function.
+
+ * src/insets/insettext.C (LocalDispatch): some selection code
+ fixed.
+
+ * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
+
+ * src/insets/insettext.C (SetParagraphData):
+ (Read):
+ (InsetText): fixes for multiple paragraphs.
+
+2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
+
+ * development/lyx.spec.in: Call configure with ``--without-warnings''
+ to work around a bug with the Makefiles when doing ``make lyxrpm''.
+ This should be fine, however, since we generally don't want to be
+ verbose when making an RPM.
+
+2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * lib/scripts/fig2pstex.py: New file
+
+2000-06-16 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.C (UpdateLocal):
+ * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
+ (LocalDispatch): Changed all functions to use LyXText.
+
+2000-06-15 Juergen Vigna <jug@sad.it>
+
+ * src/text.C (SetHeightOfRow): call inset::update before requesting
+ any width/height.
+
+ * src/insets/insettext.C (update):
+ * src/insets/insettabular.C (update): added implementation
+
+ * src/insets/lyxinset.h: added update function
+
+2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/text.C (SelectNextWord): protect against null pointers with
+ old-style string streams. (fix from Paul Theo Gonciari
+ <gptheo@yahoo.com>)
+
+ * src/cite.[Ch]: remove erroneous files.
+
+ * lib/configure.m4: update the list of created directories.
+
+ * src/lyxrow.C: include <config.h>
+ * src/lyxcursor.C: ditto.
+
+2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * lib/examples/decimal.lyx: new example file from Mike.
+
+ * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
+ to find template definitions (from Dekel)
+
+ * src/frontends/.cvsignore: add a few things.
+
+ * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
+
+ * src/Timeout.C (TimeOut): remove default argument.
+
+ * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
+ "C" linkage.
+
+ * src/insets/ExternalTemplate.C: add a "using" directive.
+
+ * src/lyx_main.h: remove the act_ struct, which seems unused
+ anyway.
+
+2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * LyX Developers Meeting: All files changed, due to random C++ (by
+ coincidence) code generator script.
+
+ - external inset (cool!)
+ - initial online editing of preferences
+ - insettabular breaks insettext(s contents)
+ - cleanup
+ - some DocBook fixes
+ - example files update
+ - other cool stuff, create a diff and look for yourself.
+
+2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
+
+ * src/insets/insettext.C (computeTextRows): if the maxWidth is
+ -1 this is a non-line-breaking textinset.
+
+ * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
+ if there is no width set.
+
+2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * Lots of files: Merged the dialogbase branch.
+
+2000-06-09 Allan Rae <rae@lyx.org>
+
+ * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
+ and the Dispatch methods that used it.
+
+ * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
+ access to functions formerly kept in Dispatch.
+
+2000-05-19 Allan Rae <rae@lyx.org>
+
+ * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
+ made to_page and count_copies integers again. from_page remains a
+ string however because I want to allow entry of a print range like
+ "1,4,22-25" using this field.
+
+ * src/LyXAction.C: added action info and commands for buffer-print-xtl
+ and printer-params-get. These aren't useful from the minibuffer but
+ could be used by a script/LyXServer app provided it passes a suitable
+ auto_mem_buffer. I guess I should take a look at how the LyXServer
+ works and make it support xtl buffers.
+
+ * sigc++/: updated to libsigc++-1.0.1
+
+ * src/xtl/: updated to xtl-1.3.pl.11
+
+ * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
+ those changes done to the files in src/ are actually recreated when
+ they get regenerated. Please don't ever accept a patch that changes a
+ dialog unless that patch includes the changes to the corresponding *.fd
+ file.
+
+ * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
+ stringOnlyContains, renamed it and generalised it.
+
+ * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
+ branch. Removed the remaining old form_print code.
+
+2000-04-26 Allan Rae <rae@lyx.org>
+
+ * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
+ trap I was trying to fix with the ID: fields in src/xtl/ :-)
+
+2000-04-25 Allan Rae <rae@lyx.org>
+
+ * src/xtl/: Updated to incorporate Angus's two patches as well as mine
+ against a base of xtl-1.3.pl.4
+
+ * development/tools/lxtl.sh: fixed a couple of silly typos and now
+ filter the Id: entries so they still show the xtl version number
+ they are based on.
+
+ * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
+ into the src/xtl code. Patch still pending with José (XTL)
+
+2000-04-24 Allan Rae <rae@lyx.org>
+
+ * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
+ both more generic and much safer. Use the new template functions.
+ * src/buffer.[Ch] (Dispatch): ditto.
+
+ * src/frontends/xforms/FormPrint.C (update): Use new template functions
+ and mem buffer more intelligently. Also a little general cleanup.
+ (apply): ditto.
+
+ * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
+ * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
+ * src/xtl/Makefile.am: ditto.
+ * src/xtl/.cvsignore: ditto.
+ * src/Makefile.am: ditto.
+
+ * src/PrinterParams.h: Removed the macros member functions. Added a
+ testInvariant member function. A bit of tidying up and commenting.
+ Included Angus's idea for fixing operation with egcs-1.1.2.
+
+ * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
+ cool expansion of XTL's mem_buffer to support automatic memory
+ management within the buffer itself. Removed the various macros and
+ replaced them with template functions that use either auto_mem_buffer
+ or mem_buffer depending on a #define. The mem_buffer support will
+ disappear as soon as the auto_mem_buffer is confirmed to be good on
+ other platforms/compilers. That is, it's there so you've got something
+ to compare against.
+
+ * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
+ effectively forked XTL. However I expect José will include my code
+ into the next major release. Also fixed a memory leak.
+ * src/xtl/text.h: ditto.
+ * src/xtl/xdr.h: ditto.
+ * src/xtl/giop.h: ditto.
+
+2000-04-16 Allan Rae <rae@lyx.org>
+
+ * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
+ by autogen.sh and removed by maintainer-clean anyway.
+ * .cvsignore, sigc++/.cvsignore: Support the above.
+
+ * sigc++/.cvsignore: Forgot that retbind.h was generated.
+
+ * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
+
+ * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
+ macros, renamed static callback-target member functions to suit new
+ scheme and made them public.
+ * src/frontends/xforms/forms/form_print.fd: ditto.
+ * src/frontends/xforms/forms/form_copyright.fd: ditto.
+
+ * src/support/lxtl.h: small cleanup to use typedef instead of #define
+ for gui_format.
+
+ * src/xtl/: New directory containing a minimal distribution of XTL.
+ This is XTL-1.3.pl.4.
+
+ * development/tools/lxtl.sh: A script to generate the above mini-dist.
+
+2000-04-15 Allan Rae <rae@lyx.org>
+
+ * development/tools/makeLyXsigc.sh: Remove the library version numbers
+
+ * sigc++/: Updated to libsigc++-1.0.0
+
+2000-04-14 Allan Rae <rae@lyx.org>
+
+ * src/frontends/xforms/xform_macros.h: Remove specific macros and just
+ use the generic ones in future. I'll modify my conversion script.
+
+ * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
+
+ * src/lyx_gui_misc.[Ch]: Removed references to form_print.
+ (CloseAllBufferRelatedDialogs): Renamed.
+ (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
+
+ * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
+ of the generic ones. These are the same ones my conversion script
+ generates.
+
+ * src/PrinterParams.h: Allow you to print a range of odd or even pages.
+ * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
+ * src/buffer.C (Dispatch): ditto
+
+ * src/LyXView.C (LyXView): Use new signals instead of old hard coded
+ functions for updating and hiding buffer dependent dialogs.
+ * src/BufferView.C (buffer): ditto
+ * src/buffer.C (setReadonly): ditto
+ * src/lyxfunc.C (CloseBuffer): ditto
+
+ * src/buffer.h: Take setReadonly() out of line so I don't have to include
+ Dialogs.h, and hence all the SigC stuff, into every file that includes
+ buffer.h. We also don't need to include lyx_gui_misc.h in everything.
+
+ * src/BufferView2.C: reduce the number of headers included by buffer.h
+
+2000-04-11 Allan Rae <rae@lyx.org>
+
+ * src/frontends/xforms/xform_macros.h: A small collection of macros
+ for building C callbacks.
+
+ * src/frontends/xforms/Makefile.am: Added above file.
+
+ * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
+ scheme again. This time it should work for JMarc. If this is
+ successful I'll revise my conversion script to automate some of this.
+ The static member functions in the class also have to be public for
+ this scheme will work. If the scheme works (it's almost identical to
+ the way BufferView::cursorToggleCB is handled so it should work) then
+ FormCopyright and FormPrint will be ready for inclusion into the main
+ trunk immediately after 1.1.5 is released -- provided we're prepared
+ for complaints about lame compilers not handling XTL.
+
+ * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
+
+2000-04-07 Allan Rae <rae@lyx.org>
+
+ * config/lyxinclude.m4: A bit more tidying up (Angus)
+
+ * src/LString.h: JMarc's <string> header fix
+
+ * src/PrinterParams.h: Used string for most data to remove some
+ ugly code in the Print dialog and avoid even uglier code when
+ appending the ints to a string for output.
+
+ * src/buffer.C (Dispatch): Added a couple of braces to fix an error
+ and moved "default:" back to the end of switch statement. Cleaned
+ up the printing so it uses the right function calls and so the
+ "print to file" option actually puts the file in the right directory.
+
+ * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
+
+ * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
+ and Ok+Apply button control into a separate method: input (Angus).
+ (input) Cleaned it up and improved it to be very thorough now.
+ (All CB) static_cast used instead of C style cast (Angus). This will
+ probably change again once we've worked out how to keep gcc-2.8.1 happy
+ with real C callbacks.
+ (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
+ ignore some of the bool settings and has random numbers instead. Needs
+ some more investigation. Added other input length checks and checking
+ of file and printer names.
+
+ * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
+ would link (Angus). Seems the old code doesn't compile with the pragma
+ statement either. Separated callback entries from internal methods.
+
+ * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
+
+2000-03-17 Allan Rae <rae@lyx.org>
+
+ * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
+ need it? Maybe it could go in Dialogs instead? I could make it a
+ LFUN but you'd have to call Dispatch(int, int, char*) with dummy
+ values to get the bool return value.
+ (Dispatch): New overloaded method for xtl support.
+
+ * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
+ extern "C" callback instead of static member functions. Hopefully,
+ JMarc will be able to compile this. I haven't changed
+ forms/form_copyright.fd yet. Breaking one of my own rules already.
+
+ * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
+ because they aren't useful from the minibuffer. Maybe a LyXServer
+ might want a help message though?
+
+ * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
+
+ * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
+ xtl which needs both rtti and exceptions.
+
+ * src/support/Makefile.am:
+ * src/support/lxtl.h: New file. Some helper macros for using XTL.
+
+ * src/frontends/xforms/input_validators.[ch]: input filters and
+ validators. These conrol what keys are valid in input boxes.
+ Use them and write some more. Much better idea than waiting till
+ after the user has pressed Ok to say that the input fields don't make
+ sense.
+
+ * src/frontends/xforms/Makefile.am:
+ * src/frontends/xforms/forms/form_print.fd:
+ * src/frontends/xforms/forms/makefile:
+ * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
+ new scheme. Still have to make sure I haven't missed anything from
+ the current implementation.
+
+ * src/Makefile.am, src/PrinterParams.h: New data store.
+
+ * other files: Added a couple of copyright notices.
+
+2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/insets/insetbib.h: move Holder struct in public space.
+
+ * src/frontends/include/DialogBase.h: use SigC:: only when
+ SIGC_CXX_NAMESPACES is defined.
+ * src/frontends/include/Dialogs.h: ditto.
+
+ * sigc++/Makefile.am (%.h): use the autodected GNU m4.
+
+ * src/frontends/xforms/FormCopyright.[Ch]: do not
+ mention SigC:: explicitely.
+
+2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
+ deals with testing KDE in main configure.in
+ * configure.in: ditto.
+
+2000-02-22 Allan Rae <rae@lyx.org>
+
+ * Lots of files: Merged from HEAD
+
+ * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
+ with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
+
+ * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
+
+ * sigc++/: new minidist.
+
+2000-02-14 Allan Rae <rae@lyx.org>
+
+ * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
+
+2000-02-08 Juergen Vigna <jug@sad.it>
+
+ * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
+ file for the buildin GUI builder of KDevelop of the copyright-dialog.
+
+ * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
+ for this port and so it is much easier for other people to port
+ dialogs in a common development environment.
+
+ * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
+ the QT/KDE implementation.
+
+ * src/frontends/kde/Dialogs.C:
+ * src/frontends/kde/FormCopyright.C:
+ * src/frontends/kde/FormCopyright.h:
+ * src/frontends/kde/Makefile.am:
+ * src/frontends/kde/formcopyrightdialog.C:
+ * src/frontends/kde/formcopyrightdialog.h:
+ * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
+ for the kde support of the Copyright-Dialog.
+
+ * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
+ subdir-substitution instead of hardcoded 'xforms' as we now have also
+ the kde subdir.
+
+ * src/frontends/include/DialogBase.h (Object): just commented the
+ label after #endif (nasty warning and I don't like warnings ;)
+
+ * src/main.C (main): added KApplication initialization if using
+ KDE frontend-GUI.
+
+ * src/lyx_gui.C (runTime): added support for multiple toolkit support.
+ For now only the KDE event-loop is added if frontend==kde.
+
+ * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
+
+ * configure.in: added support for the --with-frontend[=value] option
+
+ * autogen.sh: added kde.m4 file to list of config-files
+
+ * acconfig.h: added define for KDEGUI-support
+
+ * config/kde.m4: added configuration functions for KDE-port
+
+ * config/lyxinclude.m4: added --with-frontend[=value] option with
+ support for xforms and KDE.
+
+2000-02-08 Allan Rae <rae@lyx.org>
+
+ * all Makefile.am: Fixed up so the make targets dist, distclean,
+ install and uninstall all work even if builddir != srcdir. Still
+ have a new sigc++ minidist update to come.
+
+ * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
+
+2000-02-01 Allan Rae <rae@lyx.org>
+
+ * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
+ Many mods to get builddir != srcdir working.
+
+ * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
+ for building on NT and so we can do the builddir != srcdir stuff.
+
+2000-01-30 Allan Rae <rae@lyx.org>
+
+ * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
+ This will stay in "rae" branch. We probably don't really need it in
+ the main trunk as anyone who wants to help programming it should get
+ a full library installed also. So they can check both included and
+ system supplied library compilation.
+
+ * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
+ Added a 'mini' distribution of libsigc++. If you feel the urge to
+ change something in these directories - Resist it. If you can't
+ resist the urge then you should modify the following script and rebuild
+ the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
+ all happen. Still uses a hacked version of libsigc++'s configure.in.
+ I'm quite happy with the results. I'm not sure the extra work to turn
+ the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
+ worth the trouble and would probably lead to extra maintenance
+ headaches.
+ I haven't tested the following important make targets: install, dist.
+ Not ready for prime time but very close. Maybe 1.1.5.
+
+ * development/tools/makeLyXsigc.sh: A shell script to automatically
+ generate our mini-dist of libsigc++. It can only be used with a CVS
+ checkout of libsigc++ not a tarball distribution. It's well commented.
+ This will end up as part of the libsigc++ distribution so other apps
+ can easily have an included mini-dist. If someone makes mods to the
+ sigc++ subpackage without modifying this script to generate those
+ changes I'll be very upset!
+
+ * src/frontends/: Started the gui/system indep structure.
+
+ * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
+ to access the gui-indep dialogs are in this class. Much improved
+ design compared to previous revision. Lars, please refrain from
+ moving this header into src/ like you did with Popups.h last time.
+
+ * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
+
+ * src/frontends/xforms/: Started the gui-indep system with a single
+ dialog: FormCopyright. Initial testing of use of libsigc++ was very
+ successful.
+
+ * src/frontends/xforms/forms: Repository for the xforms .fd files.
+ Here you'll find a very useful makefile and automated fdfix.sh that
+ makes updating dailogs a no-brainer -- provided you follow the rules
+ set out in the README. I'm thinking about adding another script to
+ automatically generate skeleton code for a new dialog given just the
+ name of the dialog.
+
+ * src/commandtags.h, src/lyxfunc.C, src/menus.C:
+ * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
+ Made FormCopyright gui-indep and added a lyxfunc to get to it.
+
+2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/LSubstring.C (operator): simplify
+
+ * src/lyxtext.h: removed bparams, use buffer_->params instead
+
+ * src/lyxrow.h: make Row a real class, move all variables to
+ private and use accessors.
+
+ * src/lyxparagraph.h (getParLanguage): add BufferParamas as
+ arguament.
+ (isRightToLeftPar): ditto
+ (ChangeLanguage): ditto
+ (isMultiLingual): ditto
+ (String): ditto
+ (TeXOnePar): ditto
+ (SimpleTeXOnePar): ditto
+ (TeXEnvironment): ditto
+ (GetEndLabel): ditto
+ (SetLayout): ditto
+ (SetOnlyLayout): ditto
+ (BreakParagraph): ditto
+ (BreakParagraphConservative): ditto
+ (GetFontSettings): ditto
+ (getFont): ditto
+ (CopyIntoMinibuffer): ditto
+ (CutIntoMinibuffer): ditto
+ (PasteParagraph): ditto
+ (SetPExtraType): ditto
+ (UnsetPExtraType): ditto
+ (DocBookContTableRows): ditto
+ (SimpleDocBookOneTablePar): ditto
+ (TeXDeeper): ditto
+ (TeXFootnote): ditto
+ (SimpleTeXOneTablePar): ditto
+ (TeXContTableRows): ditto
+ (SimpleTeXSpecialChars): ditto
+
+
+ * src/lyxcursor.h: make LyXCursor a real class, move all variables
+ to private and use accessors.
+
+ * src/lyx_cb.C: remove char updatetimer, and all code that uses
+ this, we did not use it anymore and has not been for ages. Just a
+ waste of cpu cycles.
+
+ * src/language.h: make Language a real class, move all variables
+ to private and use accessors.
+
+ * src/BufferView_pimpl.C (Pimpl): use new timer code.
+ (create_view): remove
+ (update): some changes for new timer
+ (cursorToggle): use new timer
+ (beforeChange): change for new timer
+
+ * src/BufferView.h (cursorToggleCB): removed last paramter because
+ of new timer code.
+
+ * src/BufferView.C (C_BufferView_CursorToggleCB): removed
+ (cursorToggleCB): change because of new timer code
+
+ * lib/CREDITS: updated own mailaddress
+
+2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/support/filetools.C (PutEnv): fix the code in case neither
+ putenv() nor setenv() have been found.
+
+ * INSTALL: mention the install-strip Makefile target.
+
+ * src/LyXAction.C (init): make LFUN_BUILDPROG available in
+ read-only documents.
+
+2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * lib/reLyX/configure.in (VERSION): avoid using a previously
+ generated reLyX wrapper to find out $prefix.
+
+ * lib/examples/eu_adibide_lyx-atua.lyx:
+ * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
+ translation of the Tutorial (Dooteo)
+
+2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * forms/cite.fd: new citation dialog
+
+ * src/insetcite.[Ch]: the new citation dialog is moved into
+ its own files.
+
+ * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
+ (Dekel).
+
+ * src/insets/insetcommand.h: data members made private.
+
+2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * LyX 1.1.5 released
+
+2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/version.h (LYX_RELEASE): to 1.1.5
+
+ * src/spellchecker.C (RunSpellChecker): return false if the
+ spellchecker dies upon creation.
+
+2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
+ in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
+
+ * NEWS: update.
+
+ * lib/CREDITS: update entry for Martin Vermeer.
+
+2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/text.C (draw): Draw foreign language bars at the bottom of
+ the row instead of at the baseline.
+
+ * lib/examples/Minipage.lyx: Use the new multi-lingual support.
+
+2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * lib/bind/de_menus.bind: updated
+
+2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
+
+2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/menus.C (Limit_string_length): New function
+ (ShowTocMenu): Limit the number of items/length of items in the
+ LOT/LOF/LOA menus.
+
+ * src/paragraph.C (String): Correct result for a paragraph inside
+ a footnote.
+
+2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/bufferlist.C (close): test of buf->getuser() == NULL
+
+2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/BufferView2.C (removeAutoInsets): Fix a bug:
+ Do not call to SetCursor when the paragraph is a closed footnote!
+
+2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
+ label is changed.
+
+ * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
+
+2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * forms/lyx.fd
+ * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
+ reference popup, that activates the reference-back action
+
+ * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
+
+ * src/menus.C (Add_to_refs_menu): Limit the size of each item in
+ the menus. Also fixed a bug.
+
+ * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
+ the math panels when switching buffers (unless new buffer is readonly).
+
+ * src/BufferView.C (NoSavedPositions)
+ * src/BufferView_pimpl.C (NoSavedPositions): New methods
+
+2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
+ less of dvi dirty or not.
+
+ * src/trans_mgr.[Ch] (insert): change first parameter to string
+ const &.
+
+ * src/chset.[Ch] (encodeString): add const to first parameter
+
+2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/lyxstring.C (begin): fix a "shared" string bug. use
+ rep->get_own_copy()
+ (end): ditto
+
+ * src/LaTeX.C (deplog): better searching for dependency files in
+ the latex log. Uses now regexps.
+
+ * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
+ instead of the box hack or \hfill.
+
+2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/lyxfunc.C (doImportHelper): do not create the file before
+ doing the actual import.
+ (doImportASCIIasLines): create a new file before doing the insert.
+ (doImportASCIIasParagraphs): ditto.
+
+ * lib/lyxrc.example: remove mention of non-existing commands
+
+ * lyx.man: remove mention of color-related switches.
+
+ * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
+
+ * src/lyx_gui.C: remove all the color-related ressources, which
+ are not used anymore.
+
+ * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
+ name.
+
+2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/lyxrc.C (read): Add a missing break in the switch
+
+2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/text2.C (InsertStringA): Fix a bug with insertion into table
+
+ * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
+ text is Hebrew.
+
+2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/text.C (draw): draw bars under foreign language words.
+
+ * src/LColor.[Ch]: add LColor::language
+
+2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/lyxcursor.h (boundary): New member variable
+
+ * src/text.C (IsBoundary): New methods
+
+ * src/text.C: Use the above for currect cursor movement when there
+ is both RTL & LTR text.
+
+ * src/text2.C: ditto
+
+ * src/bufferview_funcs.C (ToggleAndShow): ditto
+
+2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/text.C (DeleteLineForward): set selection to true to avoid
+ that DeleteEmptyParagraphMechanism does some magic. This is how it
+ is done in all other functions, and seems reasonable.
+ (DeleteWordForward): do not jump over non-word stuff, since
+ CursorRightOneWord() already does it.
+
+ Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
+ DeleteWordBackward, since they seem safe to me (since selection is
+ set to "true") DeleteEmptyParagraphMechanism does nothing.
+
+2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/lyx_main.C (easyParse): simplify the code by factoring the
+ part that removes parameters from the command line.
+ (LyX): check wether wrong command line options have been given.
+
+2000-05-29 Lior Silberman <slior@math.huji.ac.il>
+
+ * src/lyx_main.C : add support for specifying user LyX
+ directory via command line option -userdir.
+
+2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
+ the number of items per popup.
+ (Add_to_refs_menu): Ditto.
+
+2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/lyxparagraph.h: renamed ClearParagraph() to
+ StripLeadingSpaces() and moved it to paragraph.C. We pass the
+ textclass as parameter, and do nothing if free_spacing is
+ true. This fixes part of the line-delete-forward problems.
+
+ * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
+ (pasteSelection): ditto.
+ (SwitchLayoutsBetweenClasses): more translatable strings.
+
+ * src/text2.C (CutSelection): use StripLeadingSpaces.
+ (PasteSelection): ditto.
+ (DeleteEmptyParagraphMechanism): ditto.
+
+2000-05-26 Juergen Vigna <jug@sad.it>
+
+ * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
+ is not needed in tabular insets.
+
+ * src/insets/insettabular.C (TabularFeatures): added missing features.
+
+ * src/tabular.C (DeleteColumn):
+ (AppendColumn):
+ (AppendRow): implemented this functions
+ (cellsturct::operator=): clone the inset too;
+
+2000-05-23 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.C (LocalDispatch): better selection support
+ when having multicolumn-cells.
+
+2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
+
+ * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
+
+2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/ColorHandler.C (getGCForeground): put more test into _()
+
+ * lib/examples/eu_splash.lyx: new file (Basque translation) from
+ Dooteo.
+
+ * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
+ get the version.
+
+2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
+ there are no labels, or when buffer is readonly.
+
+ * src/menus.C (ShowRefsMenu) disable appropriate menu items when
+ there are no labels, buffer is SGML, or when buffer is readonly.
+
+2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/LColor.C (LColor): change a couple of grey40 to grey60
+ (LColor): rewore initalization to make compiles go some magnitude
+ faster.
+ (getGUIName): don't use gettext until we need the string.
+
+2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/Bullet.[Ch]: Fixed a small bug.
+
+2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/paragraph.C (String): Several fixes/improvements
+
+ * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
+
+2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/paragraph.C (String): give more correct output.
+
+2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/lyxfont.C (stateText) Do not output the language if it is
+ eqaul to the language of the document.
+
+ * src/paragraph.C (TeXOnePar): Do not put language switch commands
+ between two paragraphs with the same language.
+
+ * src/paragraph.C (getParLanguage) Return a correct answer for an
+ empty dummy paragraph.
+
+ * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
+ menus.
+
+ * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
+ layout menu.
+
+ * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
+ the menus/popup, if requested fonts are unavailable.
+
+2000-05-22 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.C (LocalDispatch): added some more cursor
+ movement support (Up/Down/Tab/Shift-Tab).
+ (LocalDispatch): added also preliminari cursor-selection.
+
+ * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
+
+ * src/paragraph.C (PasteParagraph): Hopefully now right!
+
+2000-05-22 Garst R. Reese <reese@isn.net>
+
+ * layouts/hollywood.layout, broadway.layout : move Dialogue to top
+ of list, change all references to Environment to Command
+ * tex/hollywood.cls : rewrite environments as commands, add
+ \uppercase to interiorshot and exteriorshot to force uppecase.
+ * tex/broadway.cls : rewrite environments as commands. Tweak
+ whitespace.
+
+2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/menus.C (Add_to_toc_menu): fix the code which limits the
+ size of items: use a constant intead of the hardcoded 40, and more
+ importantly do not remove the %m and %x tags added at the end.
+ (Add_to_refs_menu): use vector::size_type instead of
+ unsigned int as basic types for the variables. _Please_ do not
+ assume that size_t is equal to unsigned int. On an alpha, this is
+ unsigned long, which is _not_ the same.
+
+ * src/language.C (initL): remove language "hungarian", since it
+ seems that "magyar" is better.
+
+2000-05-22 Juergen Vigna <jug@sad.it>
+
+ * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
+
+ * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
+ end markers!
+
+ * src/paragraph.C (PasteParagraph): Possibly a memory leak as
+ next was deleted but not set to 0.
+
+2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/language.C (initL): change the initialization of languages
+ so that compiles goes _fast_.
+
+ * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
+ 40 chars.
+
+ * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
+
+2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * release 1.1.5pre3
+
+2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
+
+2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/commandtags.h
+ * src/LyXAction.C
+ * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
+ and LFUN_LOAVIEW
+
+ * src/insets/insetlo*.[Ch]: Made editable
+
+2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/text2.C (SetSelection): call BufferView::stuffClipboard with
+ the current selection.
+
+ * src/BufferView_pimpl.C (stuffClipboard): new method
+
+ * src/BufferView.C (stuffClipboard): new method
+
+ * src/paragraph.C (String): new method
+
+ * src/LColor.C (getFromLyXName): return LColor::inherit instead of
+ LColor::ignore when lyxname is not found.
+
+ * src/BufferView.C (pasteSelection): new method
+
+ * src/BufferView_pimpl.C (pasteSelection): new method
+
+ * src/lyxfunc.C (Dispatch): use the new clipboard functions.
+
+ * src/WorkArea.C (request_clipboard_cb): new static function
+ (getClipboard): new method
+ (putClipboard): new method
+
+2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * LyX 1.1.5pre2 released
+
+2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/vspace.C (operator=): removed
+ (operator=): removed
+
+ * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
+
+ * src/layout.C (NumberOfClass): manually set the type in make_pair
+ (NumberOfLayout): ditto
+
+ * src/language.C: use the Language constructor for ignore_lang
+
+ * src/language.h: add constructors to struct Language
+
+ * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
+
+ * src/text2.C (SetCursorIntern): comment out #warning
+
+ * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
+
+ * src/mathed/math_iter.h: initialize sx and sw to 0
+
+2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * forms/lyx.fd: Redesign of form_ref
+
+ * src/LaTeXFeatures.[Ch]
+ * src/buffer.C
+ * src/lyx_cb.C
+ * src/menus.C
+ * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
+
+ * src/buffer.h
+ * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
+ and Buffer::inset_iterator.
+
+ * src/menus.C: Added new menus: TOC and Refs.
+
+ * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
+
+ * src/buffer.C (getTocList): New method.
+
+ * src/BufferView2.C (ChangeRefs): New method.
+
+ * src/buffer.C (getLabelList): New method. It replaces the old
+ getReferenceList. The return type is vector<string> instead of
+ string.
+
+ * src/insets/insetinclude.C (getLabelList): New method. Replaces
+ the old getLabel() and GetNumberOfLabels() methods.
+ * src/insets/insetlabel.C (getLabelList): ditto
+ * src/mathed/formula.C (getLabelList): ditto
+
+ * src/paragraph.C (String): New method.
+
+ * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
+ Uses the new getTocList() method.
+ TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
+ which automatically updates the contents of the browser.
+ (RefUpdateCB): Use the new getLabelList method.
+
+ * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
+
+ * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
+
+ * src/spellchecker.C: Added using std::reverse;
+
+2000-05-19 Juergen Vigna <jug@sad.it>
+
+ * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
+
+ * src/insets/insettext.C (computeTextRows): small fix for display of
+ 1 character after a newline.
+
+ * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
+ to cont-rows!
+
+2000-05-18 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.C (TabularFeatures): fixed update of display
+ when changing width of column.
+
+ * src/tabular.C (set_row_column_number_info): setting of
+ autobreak rows if necessary.
+
+2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
+
+ * src/vc-backend.*: renamed stat() to status() and vcstat to
+ vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
+ compilation broke. The new name seems more relevant, anyway.
+
+2000-05-17 Juergen Vigna <jug@sad.it>
+
+ * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
+ which was wrong if the removing caused removing of rows!
+
+ * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
+ (pushToken): new function.
+
+ * src/text2.C (CutSelection): fix problem discovered with purify
+
2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/debug.C (showTags): enlarge the first column, now that we