+2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/converter.[Ch]: New file for converting between different
+ formats.
+
+ * src/export.[Ch]: New file for exporting a LyX file to different
+ formats.
+
+ * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
+ MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
+ PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
+ MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
+ MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
+ RunDocBook, MenuExport.
+
+ * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
+ Exporter::Preview methods if NEW_EXPORT is defined.
+
+ * src/buffer.C (Dispatch): Use Exporter::Export.
+
+ * src/lyxrc.C: Added new tags: \converter and \viewer.
+
+ * src/commandtags.h
+ * src/LyXAction.C: Define new lyx-function: buffer-update.
+ Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
+ when NEW_EXPORT is defined.
+
+ * src/MenuBackend.C: Added new tags: updateformats and viewformats.
+
+ * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
+
+ * lib/ui/default.ui: Added submenus "view" and "update" to the
+ "file" menu.
+
+ * src/filetools.C (GetExtension): New function.
+
+ * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
+
+2000-08-29 Allan Rae <rae@lyx.org>
+
+ * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
+
+ * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
+ (EnableDocumentLayout): removed
+ (DisableDocumentLayout): removed
+ (build): make use of ButtonController's read-only handling to
+ de/activate various objects. Replaces both of the above functions.
+
+ * src/frontends/xforms/ButtonController.h (readWrite): was read_write
+ (readOnly): was read_only
+ (refresh): fixed dumb mistakes with read_only_ handling
+
+ * src/frontends/xforms/forms/form_document.fd:
+ * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
+ tabbed dialogs so the tabs look more like tabs and so its easier to
+ work out which is the current tab.
+
+ * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
+ segfault with form_table
+
+ * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
+
+2000-08-28 Juergen Vigna <jug@sad.it>
+
+ * acconfig.h: added USE_PSPELL.
+
+ * src/config.h.in: added USE_PSPELL.
+
+ * autogen.sh: added pspell.m4
+
+ * config/pspell.m4: new file.
+
+ * src/spellchecker.C: implemented support for pspell libary.
+
+2000-08-25 Juergen Vigna <jug@sad.it>
+
+ * src/LyXAction.C (init): renamed LFUN_TABLE to
+ LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
+
+ * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
+
+ * src/lyxscreen.h: add force_clear variable and fuction to force
+ a clear area when redrawing in LyXText.
+
+ * src/text.C (GetVisibleRow): look if the screen forces a redraw.
+
+2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * some whitespace and comment changes.
+
+ * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
+
+ * src/buffer.C: up te LYX_FORMAT to 2.17
+
+2000-08-23 Juergen Vigna <jug@sad.it>
+
+ * src/BufferView_pimpl.C (tripleClick): disable this when in a
+ locking_inset.
+
+ * src/insets/insettabular.C (pasteSelection): delete the insets
+ LyXText as it is not valid anymore.
+ (copySelection): new function.
+ (pasteSelection): new function.
+ (cutSelection): new function.
+ (LocalDispatch): implemented cut/copy/paste of cell selections.
+
+ * src/insets/insettext.C (resizeLyXText): don't need resize if I still
+ don't have a LyXText.
+
+ * src/LyXAction.C (init): a NEW_TABULAR define too much.
+
+ * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
+ NEW_TABULAR define.
+
+2000-08-22 Juergen Vigna <jug@sad.it>
+
+ * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
+ ifdef form_table out if NEW_TABULAR.
+
+2000-08-21 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
+ (draw): fixed draw position so that the cursor is positioned in the
+ right place.
+ (InsetMotionNotify): hide/show cursor so the position is updated.
+ (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
+ using cellstart() function where it should be used.
+
+ * src/insets/insettext.C (draw): ditto.
+
+ * src/tabular.C: fixed initialization of some missing variables and
+ made BoxType into an enum.
+
+2000-08-22 Marko Vendelin <markov@ioc.ee>
+ * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
+ stock menu item using action numerical value, not its string
+ representation.
+
+
+2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
+ GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
+
+ * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
+
+ * src/frontends/xforms/GUIRunTime.C: new file
+
+ * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
+ GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
+
+ * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
+
+ * src/frontends/kde/GUIRunTime.C: new file
+
+ * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
+ GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
+
+ * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
+
+ * src/frontends/gnome/GUIRunTime.C: new file
+
+ * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
+ GUIRunTime.C
+
+ * src/frontends/GUIRunTime.h: removed constructor and destructor,
+ small change to documetentation.
+
+ * src/frontends/GUIRunTime.C: removed file
+
+ * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
+
+ * src/lyxparagraph.h: enable NEW_TABULAR as default
+
+ * src/lyxfunc.C (processKeySym): remove some commented code
+
+ * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
+ NEW_TABULAR around the fd_form_table_options.
+
+ * src/lyx_gui.C (runTime): call the static member function as
+ GUIRunTime::runTime().
+
+2000-08-21 Allan Rae <rae@lyx.org>
+
+ * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
+ policy here also.
+
+2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
+
+2000-08-21 Allan Rae <rae@lyx.org>
+
+ * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
+ keep Garst happy ;-)
+ * src/frontends/xforms/FormPreferences.C (build): use setOK
+ * src/frontends/xforms/FormDocument.C (build): use setOK
+ (FormDocument): use the appropriate policy.
+
+2000-08-21 Allan Rae <rae@lyx.org>
+
+ * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
+ automatic [de]activation of arbitrary objects when in a read-only state.
+
+ * src/frontends/ButtonPolicies.h: More documentation
+ (isReadOnly): added to support the above.
+
+ * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
+
+2000-08-18 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.C (getStatus): changed to return func_status.
+
+ * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
+ display toggle menu entries if they are.
+
+ * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
+ new document layout now.
+
+ * src/lyxfunc.C: ditto
+
+ * src/lyx_gui_misc.C: ditto
+
+ * src/lyx_gui.C: ditto
+
+ * lib/ui/default.ui: removed paper and quotes layout as they are now
+ all in the document layout tabbed folder.
+
+ * src/frontends/xforms/forms/form_document.fd: added Restore
+ button and callbacks for all inputs for Allan's ButtonPolicy.
+
+ * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
+ (CheckChoiceClass): added missing params setting on class change.
+ (UpdateLayoutDocument): added for updating the layout on params.
+ (build): forgot to RETURN_ALWAYS input_doc_spacing.
+ (FormDocument): Implemented Allan's ButtonPolicy with the
+ PreferencesPolicy.
+
+2000-08-17 Allan Rae <rae@lyx.org>
+
+ * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
+ so we can at least see the credits again.
+
+ * src/frontends/xforms/FormPreferences.C: Used the appropriate button
+ controller calls for the appropriate callbacks. Note that since Ok
+ calls apply followed by cancel, and apply isn't a valid input for the
+ APPLIED state, the bc_ calls have to be made in the static callback not
+ within each of the real callbacks.
+
+ * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
+ (setOk): renamed from setOkay()
+
+2000-08-17 Juergen Vigna <jug@sad.it>
+
+ * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
+ in the implementation part.
+ (composeUIInfo): don't show optional menu-items.
+
+ * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
+
+ * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
+
+ * src/bufferview_funcs.C (CurrentState): fixed to show also the
+ text-state when in a text-inset.
+
+ * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
+
+2000-08-17 Marko Vendelin <markov@ioc.ee>
+ * src/frontends/gnome/FormIndex.C
+ * src/frontends/gnome/FormIndex.h
+ * src/frontends/gnome/FormToc.C
+ * src/frontends/gnome/FormToc.h
+ * src/frontends/gnome/dialogs
+ * src/frontends/gnome/diatoc_callbacks.c
+ * src/frontends/gnome/diatoc_callbacks.h
+ * src/frontends/gnome/diainsertindex_callbacks.h
+ * src/frontends/gnome/diainsertindex_callbacks.c
+ * src/frontends/gnome/diainsertindex_interface.c
+ * src/frontends/gnome/diainsertindex_interface.h
+ * src/frontends/gnome/diatoc_interface.h
+ * src/frontends/gnome/diatoc_interface.c
+ * src/frontends/gnome/Makefile.am: Table of Contents and
+ Insert Index dialogs implementation for Gnome frontend
+
+ * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
+
+ * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
+
+ * src/frontends/gnome/diainserturl_interface.c: make the dialog
+ resizable
+
+2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
+ destructor. Don't definde if you don't need it
+ (processEvents): made static, non-blocking events processing for
+ xforms.
+ (runTime): static method. event loop for xforms
+ * similar as above for kde and gnome.
+
+ * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
+ new Pimpl is correct
+ (runTime): new method calss the real frontends runtime func.
+
+ * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
+
+2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
+
+2000-08-16 Juergen Vigna <jug@sad.it>
+
+ * src/lyx_gui.C (runTime): added GUII RunTime support.
+
+ * src/frontends/Makefile.am:
+ * src/frontends/GUIRunTime.[Ch]:
+ * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
+ * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
+ * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
+
+ * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
+
+ * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
+ as this is already set in ${FRONTEND_INCLUDE} if needed.
+
+ * configure.in (CPPFLAGS): setting the include dir for the frontend
+ directory and don't set FRONTEND=xforms for now as this is executed
+ always.
+
+2000-08-16 John Levon (moz@compsoc.man.ac.uk)
+
+ * src/frontends/kde/Makefile.am:
+ * src/frontends/kde/FormUrl.C:
+ * src/frontends/kde/FormUrl.h:
+ * src/frontends/kde/formurldialog.h:
+ * src/frontends/kde/formurldialog.C: Add KDE URL dialog
+
+2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
+
+ * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
+
+2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/BufferView_pimpl.C (workAreaKeyPress): enable the
+ processKeySym
+
+2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/WorkArea.C (work_area_handler): more work to get te
+ FL_KEYBOARD to work with xforms 0.88 too, please test.
+
+ * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
+
+2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
+ -pedantic
+
+2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/Timeout.h: remove Qt::emit hack.
+
+ * several files: changes to allo doc++ compilation
+
+ * src/lyxfunc.C (processKeySym): new method
+ (processKeyEvent): comment out if FL_REVISION < 89
+
+ * src/WorkArea.C: change some debugging levels.
+ (WorkArea): set wantkey to FL_KEY_ALL
+ (work_area_handler): enable the FL_KEYBOARD clause, this enables
+ clearer code and the use of compose with XForms 0.89. Change to
+ use signals instead of calling methods in bufferview directly.
+
+ * src/Painter.C: change some debugging levels.
+
+ * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
+ if FL_REVISION < 89
+
+ * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
+ (workAreaKeyPress): new method
+
+2000-08-14 Juergen Vigna <jug@sad.it>
+
+ * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
+
+ * config/kde.m4: addes some features
+
+ * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
+ include missing xforms dialogs.
+
+ * src/Timeout.h: a hack to be able to compile with qt/kde.
+
+ * sigc++/.cvsignore: added acinclude.m4
+
+ * lib/.cvsignore: added listerros
+
+ * src/frontends/Makefile.am: modified for now to ALWAYS compile the
+ xforms tree as objects are needed for other frontends.
+
+ * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
+ linking with not yet implemented xforms objects.
+
+ * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
+
+2000-08-14 Baruch Even <baruch.even@writeme.com>
+
+ * src/frontends/xforms/FormGraphics.h:
+ * src/frontends/xforms/FormGraphics.C:
+ * src/frontends/xforms/RadioButtonGroup.h:
+ * src/frontends/xforms/RadioButtonGroup.C:
+ * src/insets/insetgraphics.h:
+ * src/insets/insetgraphics.C:
+ * src/insets/insetgraphicsParams.h:
+ * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
+ instead of spaces, and various other indentation issues to make the
+ sources more consistent.
+
+2000-08-14 Marko Vendelin <markov@ioc.ee>
+
+ * src/frontends/gnome/dialogs/diaprint.glade
+ * src/frontends/gnome/FormPrint.C
+ * src/frontends/gnome/FormPrint.h
+ * src/frontends/gnome/diaprint_callbacks.c
+ * src/frontends/gnome/diaprint_callbacks.h
+ * src/frontends/gnome/diaprint_interface.c
+ * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
+ implementation
+
+ * src/frontends/gnome/dialogs/diainserturl.glade
+ * src/frontends/gnome/FormUrl.C
+ * src/frontends/gnome/FormUrl.h
+ * src/frontends/gnome/diainserturl_callbacks.c
+ * src/frontends/gnome/diainserturl_callbacks.h
+ * src/frontends/gnome/diainserturl_interface.c
+ * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
+ Gnome implementation
+
+ * src/frontends/gnome/Dialogs.C
+ * src/frontends/gnome/Makefile.am: added Print, Insert Url and
+ all other dialogs. Copy all unimplemented dialogs from Xforms
+ frontend
+
+ * src/frontends/gnome/support.c
+ * src/frontends/gnome/support.h: support files generated by Glade
+
+ * autogen.sh
+ * configure.in
+ * config/gnome.m4: Gnome configuration scripts
+
+ * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
+ configure --help message
+
+ * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
+ only if there are no events pendling in Gnome/Gtk. This enhances
+ the performance of menus.
+
+
+2000-08-14 Allan Rae <rae@lyx.org>
+
+ * lib/Makefile.am: listerrors cleaning
+
+ * lib/listerrors: removed -- generated file
+ * acinclude.m4: ditto
+ * sigc++/acinclude.m4: ditto
+
+ * src/frontends/xforms/forms/form_citation.fd:
+ * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
+ manageable size.
+
+ * src/frontends/xforms/forms/makefile: I renamed the `install` target
+ `updatesrc` and now we have a `test` target that does what `updatesrc`
+ used to do. I didn't like having an install target that wasn't related
+ to the dist.
+
+ * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
+ on all except FormGraphics. This may yet happen. Followed by a major
+ cleanup including using FL_TRANSIENT for most of the dialogs. More
+ changes to come when the ButtonController below is introduced.
+
+ * src/frontends/xforms/ButtonController.h: New file for managing up to
+ four buttons on a dialog according to an externally defined policy.
+ * src/frontends/xforms/Makefile.am: added above
+
+ * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
+ Apply and Cancel/Close buttons and everything in between and beyond.
+ * src/frontends/Makefile.am: added above.
+
+ * src/frontends/xforms/forms/form_preferences.fd:
+ * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
+ and removed variable 'status' as a result. Fixed the set_minsize thing.
+ Use the new screen-font-update after checking screen fonts were changed
+ Added a "Restore" button to restore the original lyxrc values while
+ editing. This restores everything not just the last input changed.
+ That's still a tricky one. As is the "LyX: this shouldn't happen..."
+
+ * src/LyXAction.C: screen-font-update added for updating buffers after
+ screen font settings have been changed.
+ * src/commandtags.h: ditto
+ * src/lyxfunc.C: ditto
+
+ * forms/lyx.fd: removed screen fonts dialog.
+ * src/lyx_gui.C: ditto
+ * src/menus.[Ch]: ditto
+ * src/lyx.[Ch]: ditto
+ * src/lyx_cb.C: ditto + code from here moved to make
+ screen-font-update. And people wonder why progress on GUII is
+ slow. Look at how scattered this stuff was! It takes forever
+ just find it all.
+
+ * forms/fdfix.sh: Fixup the spacing after commas.
+ * forms/makefile: Remove date from generated files. Fewer clashes now.
+ * forms/bullet_forms.C.patch: included someones handwritten changes
+
+ * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
+ once I've discovered why LyXRC was made noncopyable.
+ * src/lyx_main.C: ditto
+
+2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/xforms/forms/fdfix.sh:
+ * src/frontends/xforms/forms/fdfixh.sed:
+ * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
+ * src/frontends/xforms/Form*.[hC]:
+ * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
+ scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
+ provide a destructor for the struct FD_form_xxxx. Another version of
+ the set_[max|min]size workaround and a few other cleanups. Actually,
+ Angus' patch from 20000809.
+
+2000-08-13 Baruch Even <baruch.even@writeme.com>
+
+ * src/insets/insetgraphics.C (Clone): Added several fields that needed
+ copying.
+
+2000-08-11 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insetgraphics.C (InsetGraphics): changing init
+ order because of warnings.
+
+ * src/frontends/xforms/forms/makefile: adding patching .C with
+ .C.patch files.
+
+ * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
+ from .C.patch to .c.patch
+
+ * src/frontends/xforms/FormCommand.C (FormCommand): changing init
+ order because of warning.
+
+ * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
+
+ * src/frontends/Liason.C (setMinibuffer): new helper function
+
+ * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
+
+ * src/lyxfunc.C (Dispatch): calling new Document-Layout
+
+ * lib/ui/default.ui: commented out PaperLayout entry
+
+ * src/frontends/xforms/form_document.[Ch]: new added files
+
+ * src/frontends/xforms/FormDocument.[Ch]: ditto
+
+ * src/frontends/xforms/forms/form_document.fd: ditto
+
+ * src/frontends/xforms/forms/form_document.C.patch: ditto
+
+2000-08-10 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
+ (InsetGraphics): initialized cacheHandle to 0.
+ (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
+
+2000-08-10 Baruch Even <baruch.even@writeme.com>
+
+ * src/graphics/GraphicsCache.h:
+ * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
+ correctly as a cache.
+
+ * src/graphics/GraphicsCacheItem.h:
+ * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
+ reference counting.
+
+ * src/graphics/GraphicsCacheItem_pimpl.h:
+ * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
+ GraphicsCacheItem.
+
+ * src/insets/insetgraphics.h:
+ * src/insets/insetgraphics.C: Changed from using a signal notification
+ to polling when image is not loaded.
+
+2000-08-10 Allan Rae <rae@lyx.org>
+
+ * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
+ that there are two functions that have to been taken out of line by
+ hand and aren't taken care of in the script. (Just a reminder note)
+
+ * sigc++/macros/*.h.m4: Updated as above.
+
+2000-08-09 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettext.C (draw): small fix for clearing rectangle.
+
+ * src/insets/insettabular.C: make drawing of single cell smarter.
+
+2000-08-09 Marko Vendelin <markov@ioc.ee>
+ * src/frontends/gnome/Menubar_pimpl.C
+ * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
+ implementation: new files
+
+ * src/frontends/gnome/mainapp.C
+ * src/frontends/gnome/mainapp.h: Gnome main window (temporary
+ implementation)
+
+ * src/main.C: create Gnome main window
+
+ * src/frontends/xforms/Menubar_pimpl.h
+ * src/frontends/Menubar.C
+ * src/frontends/Menubar.h: added method Menubar::update that calls
+ Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
+
+ * src/LyXView.C: calls Menubar::update to update the state
+ of menu items
+
+ * src/frontends/gnome/Makefile.am: added new files
+
+ * src/frontends/Makefile.am: added frontend compiler options
+
+2000-08-08 Juergen Vigna <jug@sad.it>
+
+ * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
+
+ * src/bufferlist.C (close):
+ * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
+ documents if exiting without saving.
+
+ * src/buffer.C (save): use removeAutosaveFile()
+
+ * src/support/filetools.C (removeAutosaveFile): new function.
+
+ * src/lyx_cb.C (MenuWrite): returns a bool now.
+ (MenuWriteAs): check if file could really be saved and revert to the
+ old name if not.
+ (MenuWriteAs): removing old autosavefile if existant.
+
+ * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
+ before Goto toggle declaration, because of compiler warning.
+
+ * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
+
+ * src/lyxfunc.C (MenuNew): small fix.
+
+ * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
+
+ * src/bufferlist.C (newFile):
+ * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
+
+ * src/lyxrc.C: added new_ask_filename tag
+
+2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/lyx.fd: removed code pertaining to form_ref
+ * src/lyx.[Ch]: ditto
+ * src/lyx_cb.C: ditto
+ * src/lyx_gui.C: ditto
+ * src/lyx_gui_misc.C: ditto
+
+ * src/BufferView_pimpl.C (restorePosition): update buffer only
+ if file has changed
+
+ * src/commandtags.h (LFUN_REFTOGGLE): removed
+ (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
+ (LFUN_REFGOTO): renamed LFUN_REF_GOTO
+ (LFUN_REFBACK): renamed LFUN_REF_BACK
+
+ * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
+ * src/menus.C: ditto
+ * src/lyxfunc.C (Dispatch): ditto.
+ InsertRef dialog is now GUI-independent.
+
+ * src/texrow.C: added using std::endl;
+
+ * src/insets/insetref.[Ch]: strip out large amounts of code.
+ The inset is now a container and this functionality is now
+ managed by a new FormRef dialog
+
+ * src/frontends/Dialogs.h (showRef, createRef): new signals
+
+ * src/frontends/xforms/FormIndex.[Ch],
+ src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
+ when setting dialog's min/max size
+ * src/frontends/xforms/FormIndex.[Ch]: ditto
+
+ * src/frontends/xforms/FormRef.[Ch],
+ src/frontends/xforms/forms/form_ref.fd: new xforms
+ implementation of an InsetRef dialog
+
+ * src/graphics/GraphicsCache.[Ch]: small changes to compile with
+ DEC cxx
+
+ * src/graphics/XPM_Renderer.C (isImageFormatOK):
+ ios::nocreate is not part of the standard. Removed.
+
+2000-08-07 Baruch Even <baruch.even@writeme.com>
+
+ * src/graphics/Renderer.h:
+ * src/graphics/Renderer.C: Added base class for rendering of different
+ image formats into Pixmaps.
+
+ * src/graphics/XPM_Renderer.h:
+ * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
+ in a different class.
+
+ * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
+ easily add support for other formats.
+
+ * src/insets/figinset.C: plugged a leak of an X resource.
+
+2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/CutAndPaste.[Ch]: make all metods static.
+
+ * development/Code_rules/Rules: more work, added section on
+ Exceptions, and a References section.
+
+ * a lot of header files: work to make doc++ able to generate the
+ source documentation, some workarounds of doc++ problems. Doc++ is
+ now able to generate the documentation.
+
+2000-08-07 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.C (recomputeTextInsets): removed function
+
+ * src/tabular.C (SetWidthOfMulticolCell):
+ (SetWidthOfCell):
+ (calculate_width_of_column_NMC): fixed return value so that it really
+ only returns true if the column-width has changed (there where
+ problems with muliticolumn-cells in this column).
+
+2000-08-04 Juergen Vigna <jug@sad.it>
+
+ * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
+ also on the scrollstatus of the inset.
+ (workAreaMotionNotify): ditto.
+
+ * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
+
+2000-08-01 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.C (resetPos): scroll tabular automatically.
+
+ * src/commandtags.h:
+ * src/LyXAction.C (init):
+ * src/insets/inset.C (LocalDispatch): added support for
+ LFUN_SCROLL_INSET.
+
+ * src/insets/inset.C (scroll): new functions.
+
+ * src/insets/insettext.C (removeNewlines): new function.
+ (SetAutoBreakRows): removes forced newlines in the text of the
+ paragraph if autoBreakRows is set to false.
+
+ * src/tabular.C (Latex): generates a parbox around the cell contents
+ if needed.
+
+ * src/frontends/xforms/FormTabular.C (local_update): removed
+ the radio_useparbox button.
+
+ * src/tabular.C (UseParbox): new function
+
+2000-08-06 Baruch Even <baruch.even@writeme.com>
+
+ * src/graphics/GraphicsCache.h:
+ * src/graphics/GraphicsCache.C:
+ * src/graphics/GraphicsCacheItem.h:
+ * src/graphics/GraphicsCacheItem.C: Made them to actually do something
+ usefull.
+
+ * src/insets/insetgraphics.h:
+ * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
+ drawing of the inline image.
+
+ * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
+ into the wrong position.
+
+ * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
+ launched.
+
+2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/translator.h: move all typedefs to public section
+
+ * src/support/filetools.C (MakeLatexName): return string const
+ (QuoteName): ditto
+ (TmpFileName): ditto
+ (FileOpenSearch): ditto
+ (FileSearch): ditto
+ (LibFileSearch): ditto
+ (i18nLibFileSearch): ditto
+ (GetEnv): ditto
+ (GetEnvPath): ditto
+ (CreateTmpDir): ditto
+ (CreateBufferTmpDir): ditto
+ (CreateLyXTmpDir): ditto
+ (GetCWD): ditto
+ (OnlyPath): ditto
+ (MakeAbsPath): ditto
+ (AddName): ditto
+ (OnlyFilename): ditto
+ (ExpandPath): ditto
+ (NormalizePath): ditto
+ (CleanupPath): ditto
+ (GetFileContents): ditto
+ (ReplaceEnvironmentPath): ditto
+ (MakeRelPath): ditto
+ (AddPath): ditto
+ (ChangeExtension): ditto
+ (MakeDisplayPath): ditto
+ (do_popen): return cmdret const
+ (findtexfile): return string const
+
+ * src/support/DebugStream.h: add some /// to please doc++
+
+ * src/frontends/DialogBase.h (endif): add some /// to please doc++
+
+ * src/texrow.C (same_rownumber): functor to use with find_if
+ (getIdFromRow): rewritten to use find_if and to not update the
+ positions. return true if row is found
+ (increasePos): new method, use to update positions
+
+ * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
+
+ * src/lyxlex_pimpl.C (verifyTable): new method
+ (pushTable): use it
+ (Pimpl): use it
+ (GetString): return string const
+ (pushTable): rewrite to use std::stack
+ (popTable): ditto
+ (setFile): better check
+ (setStream): ditto
+
+ * src/lyxlex.h: make LyXLex noncopyable
+
+ * src/lyxlex.C (text): return char const * const
+ (GetString): return string const
+ (getLongString): return string const
+
+ * src/lyx_gui_misc.C (askForText): return pair<...> const
+
+ * src/lastfiles.[Ch] (operator): return string const
+
+ * src/buffer.C (parseSingleLyXformat2Token): pass string to
+ istringstream not char const *.
+ move token.end() out of loop.
+ (readFile): move initializaton of token
+
+ * src/BufferView2.C (insertErrors): run texrow.increasePos if
+ getIdFromRow is successful.
+
+ * lib/bind/emacs.bind: don't include menus bind
+
+ * development/Code_rules/Rules: the beginnings of making this
+ better and covering more of the unwritten rules that we have.
+
+ * development/Code_rules/Recommendations: a couple of wording
+ changes.
+
+2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/support/strerror.c: remove C++ comment.
+
+2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
+ LFUN_INDEX_INSERT_LAST
+
+ * src/texrow.C (getIdFromRow): changed from const_iterator to
+ iterator, allowing code to compile with DEC cxx
+
+ * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
+ stores part of the class, as suggested by Allan. Will allow
+ multiple LyXViews.
+ (apply): test to apply uses InsetCommandParams operator!=
+
+ * src/frontends/xforms/FormIndex.C: moved set_minsize into build
+ (apply): test to apply uses InsetCommandParams operator!=
+
+ * src/frontends/xforms/FormToc.[Ch]: made vector<string>
+ stores part of the class.
+ (update): removed limits on min/max size.
+
+ * src/frontends/xforms/FormUrl.C: moved set_minsize into build
+ (apply): test to apply uses InsetCommandParams operator!=
+
+ * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
+ (Read, Write, scanCommand, getCommand): moved functionality
+ into InsetCommandParams.
+ (Clone): removed
+ (getScreenLabel): made pure virtual
+ new InsetCommandParams operators== and !=
+
+ * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
+ c-tors based on InsetCommandParams. Removed others.
+ * src/insets/insetinclude.[Ch]: ditto
+ * src/insets/insetlabel.[Ch]: ditto
+ * src/insets/insetparent.[Ch]: ditto
+ * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
+
+ * src/buffer.C (parseSingleLyXformat2Token, readInset): all
+ insets derived from InsetCommand created using similar c-tors
+ based on InsetCommandParams
+ * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
+ * src/menus.C (ShowRefsMenu): ditto
+ * src/paragraph.C (Clone): ditto
+ * src/text2.C (SetCounter): ditto
+ * src/lyxfunc.C (Dispatch) ditto
+ Also recreated old InsetIndex behaviour exactly. Can now
+ index-insert at the start of a paragraph and index-insert-last
+ without launching the pop-up.
+
+2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * lib/lyxrc.example: mark te pdf options as non functional.
+
+ * src/support/lstrings.C (strToInt): move initalization of tmpstr
+ (isStrDbl): move tmpstr.end() out of loop.
+ (strToDbl): move intialization of tmpstr
+ (lowercase): return string const and move tmp.end() out of loop.
+ (uppercase): return string const and move tmp.edn() out of loop.
+ (prefixIs): add assertion
+ (suffixIs): ditto
+ (contains): ditto
+ (contains): ditto
+ (contains): ditto
+ (containsOnly): ditto
+ (containsOnly): ditto
+ (containsOnly): ditto
+ (countChar): make last arg char not char const
+ (token): return string const
+ (subst): return string const, move tmp.end() out of loop.
+ (subst): return string const, add assertion
+ (strip): return string const
+ (frontStrip): return string const, add assertion
+ (frontStrip): return string const
+ (split): ditto
+ (split): ditto
+ (rsplit): ditto
+
+ * src/support/lstrings.C: add inclde "LAssert.h"
+ (isStrInt): move tmpstr.end() out of loop.
+
+ * src/frontends/xforms/Toolbar_pimpl.C (activate): move
+ toollist.end() out of loop.
+ (deactivate): move toollist.end() out of loop.
+ (update): move toollist.end() out of loop.
+ (updateLayoutList): move tc.end() out of loop.
+ (add): move toollist.end() out of loop.
+
+ * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
+ md.end() out of loop.
+
+ * src/texrow.h: make getIdFromRow const, make rowlist mutable.
+
+ * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
+ of loop.
+
+ * src/paragraph.C (Erase): move fontlist.end() out of loop.
+ (Erase): move insetlist.end() out of loop.
+
+ * src/lyx_sendfax_main.C: make show_logfile static and to take a
+ ref to const string as first arg. Move initialization of some
+ variables, whitespace changes.
+
+ * src/kbmap.C (defkey): move table.end() out of loop.
+ (kb_keymap): move table.end() out of loop.
+ (findbinding): move table.end() out of loop.
+
+ * src/MenuBackend.C (hasMenu): move end() out of loop.
+ (getMenu): move end() out of loop.
+ (getMenu): move menulist_.end() out of loop.
+
+ * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
+
+ * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
+ out of loop.
+
+ * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
+ (getFromLyXName): move infotab.end() out of loop.
+
+ * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
+ -fvtable-thunks -ffunction-sections -fdata-sections
+
+2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
+ FORMS_H_LOCATION.
+
+2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
+
+ * src/frontends/xforms/FormCitation.[Ch],
+ src/frontends/xforms/FormIndex.[Ch],
+ src/frontends/xforms/FormToc.[Ch],
+ src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
+
+2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/commandtags.h: renamed, created some flags for citation
+ and index
+
+ * src/lyx_gui_misc.C: stripped out old FD_index_form code
+
+ * src/lyxfunc.C (dispatch): use signals to insert index entry
+
+ * src/frontends/Dialogs.h: new signal createIndex
+
+ * src/frontends/xforms/FormCommand.[Ch],
+ src/frontends/xforms/FormCitation.[Ch],
+ src/frontends/xforms/FormToc.[Ch],
+ src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
+
+ * src/insets/insetindex.[Ch]: GUI-independent
+
+ * src/frontends/xforms/FormIndex.[Ch],
+ * src/frontends/xforms/forms/form_index.fd: xforms implementation
+ of the Index dialog
+
+2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
+ before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
+
+2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/insets/insetref.C (Latex): rewrite so that there is now
+ question that a initialization is requested.
+
+ * src/insets/insetcommand.h: reenable the hide signal
+
+2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
+ fix handling of shortcuts (many bugs :)
+ (add_lastfiles): ditto.
+
+ * lib/ui/default.ui: fix a few shortcuts.
+
+2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
+
+ * Makefile.am: Fix ``rpmdist'' target to return the exit
+ status of the ``rpm'' command, instead of the last command in
+ the chain (the ``rm lyx.xpm'' command, which always returns
+ success).
+
+2000-08-02 Allan Rae <rae@lyx.org>
+
+ * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
+ * src/frontends/xforms/FormCitation.C (FormCitation): ditto
+ * src/frontends/xforms/FormToc.C (FormToc): ditto
+
+ * src/frontends/xforms/Makefile.am: A few forgotten files
+
+ * src/frontends/xforms/FormCommand.C (showInset): The rest of the
+ Signals-not-copyable-problem Lars' started commenting out.
+
+ * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
+
+2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/insets/insetcommand.h: Signals is not copyable so anoter
+ scheme for automatic hiding of forms must be used.
+
+ * src/frontends/xforms/FormCitation.h: don't inerit from
+ noncopyable, FormCommand already does that.
+ * src/frontends/xforms/FormToc.h: ditto
+ * src/frontends/xforms/FormUrl.h: ditto
+
+ * src/frontends/xforms/FormCitation.C: add include <algorithm>
+
+2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/insets/insetcommand.h (hide): new SigC::Signal0
+ (d-tor) new virtual destructor emits hide signal
+
+ * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
+ * src/insets/inseturl.[Ch] (hide, d-tor): ditto
+
+ * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
+ LOF and LOT. Inset is now GUI-independent
+
+ * src/insets/insetloa.[Ch]: redundant
+ * src/insets/insetlof.[Ch]: ditto
+ * src/insets/insetlot.[Ch]: ditto
+
+ * src/frontends/xforms/forms/form_url.fd: tweaked!
+ * src/frontends/xforms/forms/form_citation.fd: ditto
+
+ * src/frontends/xforms/FormCommand.[Ch]: new base class to those
+ dialogs dealing with InsetCommand insets
+
+ * src/frontends/xforms/FormCitation.[Ch]: now makes use of
+ FormCommand base class
+ * src/frontends/xforms/FormUrl.[Ch]: ditto
+
+ * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
+ of the TOC dialog
+ * src/frontends/xforms/FormToc.[Ch]: ditto
+
+ * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
+ passed a generic InsetCommand pointer
+ * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
+
+ * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
+ and modified InsetTOC class
+ * src/buffer.C: ditto
+
+ * forms/lyx.fd: strip out old FD_form_toc code
+ * src/lyx_gui_misc.C: ditto
+ * src/lyx_gui.C: ditto
+ * src/lyx_cb.C: ditto
+ * src/lyx.[Ch]: ditto
+
+2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/utility.hpp: tr -d '\r'
+
+2000-08-01 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.h: removed initFeatures() as it's not needed.
+
+ * src/commandtags.h:
+ * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
+ LFUN_TABULAR_FEATURES.
+
+ * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
+ LFUN_LAYOUT_TABULAR.
+
+ * src/insets/insettabular.C (getStatus): implemented helper function.
+
+ * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
+
+2000-07-31 Juergen Vigna <jug@sad.it>
+
+ * src/text.C (draw): fixed screen update problem for text-insets.
+
+ * src/text2.C (SetParagrpah): call an update of the inset-owner when
+ something changed probably this has to be added in various other
+ functions too.
+
+ * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
+
+2000-07-31 Baruch Even <baruch.even@writeme.com>
+
+ * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
+ templates to satisfy compaq cxx.
+
+
+2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/translator.h (equal_1st_in_pair::operator()): take
+ const ref pair_type as arg.
+ (equal_2nd_in_pair::operator()): ditto
+ (Translator::~Translator): remove empty d-tor.
+
+ * src/graphics/GraphicsCache.C: move include config.h to top, also
+ put initialization of GraphicsCache::singleton here.
+ (~GraphicsCache): move here
+ (addFile): take const ref as arg
+ (removeFile): ditto
+
+ * src/lyxlex_pimpl.C (setFile): comment in old behaviour
+
+ * src/BufferView2.C (insertLyXFile): change te with/without header
+ check slightly.
+
+2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/frontends/xforms/FormGraphics.C (apply): add some
+ static_cast. Not very nice, but required by compaq cxx.
+
+ * src/frontends/xforms/RadioButtonGroup.h: include header
+ <utility> instead of <pair.h>
+
+ * src/insets/insetgraphicsParams.C: add using directive.
+ (readResize): change return type to void.
+ (readOrigin): ditto.
+
+ * src/lyxfunc.C (getStatus): add missing break for build-program
+ function; add test for Literate for export functions.
+
+ * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
+ entries in Options menu.
+
+2000-07-31 Baruch Even <baruch.even@writeme.com>
+
+ * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
+ protect against auto-allocation; release icon when needed.
+
+2000-07-31 Matej Cepl <CeplM@seznam.cz>
+
+ * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
+ on usual typewriter.
+
+ * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
+ earlier czech.kmap), useful only for programming.
+
+2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/frontends/xforms/FormCitation.h: fix conditioning around
+ #pragma.
+
+2000-07-31 Juergen Vigna <jug@sad.it>
+
+ * src/frontends/xforms/FormTabular.C (local_update): changed
+ radio_linebreaks to radio_useparbox and added radio_useminipage.
+
+ * src/tabular.C: made support for using minipages/parboxes.
+
+ * src/bufferlist.C (QwriteAll): small fix for asking for save.
+
+ * src/insets/insetgraphics.C (draw): just draw the inset so that the
+ cursor is visible.
+ (descent): so the cursor is in the middle.
+ (width): bit smaller box.
+
+ * src/insets/insetgraphics.h: added display() function.
+
+2000-07-31 Baruch Even <baruch.even@writeme.com>
+
+ * src/frontends/Dialogs.h: Added showGraphics signals.
+
+ * src/frontends/xforms/forms/form_graphics.fd: Added file, the
+ xforms form definition of the graphics dialog.
+
+ * src/frontends/xforms/FormGraphics.h:
+ * src/frontends/xforms/FormGraphics.C: Added files, the
+ GUIndependent code of InsetGraphics
+
+ * src/insets/insetgraphics.h:
+ * src/insets/insetgraphics.C: Major writing to make it work.
+
+ * src/insets/insetgraphicsParams.h:
+ * src/insets/insetgraphicsParams.C: Added files, parameter passing
+ struct between InsetGraphics and GUI.
+
+ * src/LaTeXFeatures.h:
+ * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
+ support for graphicx package.
+
+ * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
+ for the graphics inset.
+
+ * src/support/translator.h: Added file, used in
+ InsetGraphicsParams. this is a template to translate between two
+ types.
+
+ * src/frontends/xforms/RadioButtonGroup.h:
+ * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
+ way to easily control a radio button group.
+
+2000-07-28 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.C (LocalDispatch):
+ (TabularFeatures): added support for lyx-functions of tabular features.
+ (cellstart): refixed this function after someone wrongly changed it.
+
+ * src/commandtags.h:
+ * src/LyXAction.C (init): added support for tabular-features
+
+2000-07-28 Allan Rae <rae@lyx.org>
+
+ * src/frontends/xforms/FormPreferences.C (build): Setup input return
+ checking. NOTE: It seems that pressing ESC to cancel the dialog also
+ triggers the callback for input checking. As a result we sometimes get
+ "LyX: This shouldn't happen..." printed to cerr.
+ (input): Started using status variable since I only free() on
+ destruction. Some input checking for paths and font sizes.
+
+ * src/frontends/xforms/FormPreferences.h: Use status to control
+ activation of Ok and Apply
+
+ * src/frontends/xforms/forms/form_preferences.fd: Setup input return
+ callback. Also resized to stop segfaults with 0.88. The problem is
+ that xforms-0.88 requires the folder to be wide enough to fit all the
+ tabs. If it isn't it causes all sorts of problems.
+
+ * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
+
+ * src/frontends/xforms/forms/README: Reflect reality.
+
+ * src/frontends/xforms/forms/fdfix.sh: Clean up comments
+ * src/frontends/xforms/forms/makefile: ditto.
+
+ * src/commandtags.h: Get access to new Preferences dialog
+ * src/LyXAction.C: ditto
+ * src/lyxfunc.C: ditto
+ * lib/ui/default.ui: ditto
+
+2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
+
+ * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
+ few files.
+
+ * src/frontends/xforms/form_url.[Ch]: added.
+
+2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/insets/insetbib.h: fixed bug in previous commit
+
+ * src/frontends/xforms/FormUrl.h: ditto
+
+ * src/frontends/xforms/FormPrint.h: ditto
+
+ * src/frontends/xforms/FormPreferences.h: ditto
+
+ * src/frontends/xforms/FormCopyright.h: ditto
+
+ * src/frontends/xforms/FormCitation.C: ditto
+
+ * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
+ private copyconstructor and private default contructor
+
+ * src/support/Makefile.am: add utility.hpp
+
+ * src/support/utility.hpp: new file from boost
+
+ * src/insets/insetbib.h: set owner in clone
+
+ * src/frontends/xforms/FormCitation.C: added missing include
+ algorithm
+
+ * src/insets/form_url.[Ch]: removed
+
+2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
+
+ * development/lyx.spec.in
+ * Makefile.am: Fix buglet for LyX RPM generation resulting from
+ file/directory re-organization.
+
+2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/insets/insetcommand.[Ch]: moved the string data and
+ associated manipulation methods into a new stand-alone class
+ InsetCommandParams. This class has two additional methods
+ getAsString() and setFromString() allowing the contents to be
+ moved around as a single string.
+ (addContents) method removed.
+ (setContents) method no longer virtual.
+
+ * src/buffer.C (readInset): made use of new InsetCitation,
+ InsetUrl constructors based on InsetCommandParams.
+
+ * src/commandtags.h: add LFUN_INSERT_URL
+
+ * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
+ independent InsetUrl and use InsetCommandParams to extract
+ string info and create new Insets.
+
+ * src/frontends/Dialogs.h: add signals showUrl, createUrl.
+
+ * src/frontends/xforms/FormCitation.C (apply): uses
+ InsetCommandParams.
+
+ * src/frontends/xforms/form_url.C
+ * src/frontends/xforms/form_url.h
+ * src/frontends/xforms/FormUrl.h
+ * src/frontends/xforms/FormUrl.C
+ * src/frontends/xforms/forms/form_url.fd: new files
+
+ * src/insets/insetcite.[Ch]: removed unused constructors.
+
+ * src/insets/insetinclude.[Ch]: no longer store filename
+
+ * src/insets/inseturl.[Ch]: GUI-independent.
+
+2000-07-26 Juergen Vigna <jug@sad.it>
+ * renamed frontend from gtk to gnome as it is that what is realized
+ and did the necessary changes in the files.
+
+2000-07-26 Marko Vendelin <markov@ioc.ee>
+ * autogen.sh
+ * configure.in: cleaning up gnome configuration scripts
+
+2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
+ shortcuts syndrom by redrawing them explicitely (a better solution
+ would be appreciated).
+
+ * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
+
+ * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
+ the button.
+
+ * src/lyx_cb.C (MenuExport): change html export to do the right
+ thing depending of the document type (instead of having
+ html-linuxdoc and html-docbook).
+ * src/lyxfunc.C (getStatus): update for html
+ * lib/ui/default.ui: simplify due to the above change.
+ * src/menus.C (ShowFileMenu): update too (in case we need it).
+
+ * src/MenuBackend.C (read): if a menu is defined twice, add the
+ new entries to the exiting one.
+
+2000-07-26 Juergen Vigna <jug@sad.it>
+
+ * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
+
+ * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
+ and return a bool if it did actual save the file.
+ (AutoSave): don't autosave a unnamed doc.
+
+ * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
+ check if this is an UNNAMED new file and react to it.
+ (newFile): set buffer to unnamed and change to not mark a new
+ buffer dirty if I didn't do anything with it.
+
+ * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
+
+2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/frontends/Menubar.h: make "struct Pimpl;" public + the
+ friend as per Angus's patch posted to lyx-devel.
+
+ * src/ext_l10n.h: updated
+
+ * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
+ gettext on the style string right before inserting them into the
+ combox.
+
+ * autogen.sh: add code to extract style strings form layout files,
+ not good enough yet.
+
+ * src/frontends/gtk/.cvsignore: add MAKEFILE
+
+ * src/MenuBackend.C (read): run the label strings through gettext
+ before storing them in the containers.
+
+ * src/ext_l10n.h: new file
+
+ * autogen.sh : generate the ext_l10n.h file here
+
+2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
+ arguments.
+
+ * lib/ui/default.ui: fix a couple of typos.
+
+ * config/gnome/gtk.m4: added (and added to the list of files in
+ autogen.sh).
+
+ * src/insets/insetinclude.C (unique_id): fix when we are using
+ lyxstring instead of basic_string<>.
+ * src/insets/insettext.C (LocalDispatch): ditto.
+ * src/support/filetools.C: ditto.
+
+ * lib/configure.m4: create the ui/ directory if necessary.
+
+ * src/LyXView.[Ch] (updateToolbar): new method.
+
+ * src/BufferView_pimpl.C (buffer): update the toolbar when
+ opening/closing buffer.
+
+2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/LyXAction.C (getActionName): enhance to return also the name
+ and options of pseudo-actions.
+ (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
+
+ * lib/ui/default.ui: use OptItem in the vc submenu (intented just
+ as an example of what is possible). Used in File->Build too (more
+ useful) and in the import/export menus (to mimick the complicated
+ handling of linuxdoc and friends). Try to update all the entries.
+
+ * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
+ optional entries.
+
+ * src/MenuBackend.C (read): Parse the new OptItem tag.
+
+ * src/MenuBackend.h: Add a new optional_ data member (used if the
+ entry should be omitted when the lyxfunc is disabled).
+
+ * src/frontends/xforms/Menubar_pimpl.C (string_width): new
+ function, used as a shortcut.
+ (create_submenu): align correctly the shortcuts on the widest
+ entry.
+
+ * src/MenuBackend.h: MenuItem.label() only returns the label of
+ the menu without shortcut; new method shortcut().
+
+2000-07-14 Marko Vendelin <markov@ioc.ee>
+
+ * src/frontends/gtk/Dialogs.C:
+ * src/frontends/gtk/FormCopyright.C:
+ * src/frontends/gtk/FormCopyright.h:
+ * src/frontends/gtk/Makefile.am: added these source-files for the
+ Gtk/Gnome support of the Copyright-Dialog.
+
+ * src/main.C: added Gnome::Main initialization if using
+ Gtk/Gnome frontend-GUI.
+
+ * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
+ frontend-GUI.
+ * config/gnome/aclocal-include.m4
+ * config/gnome/compiler-flags.m4
+ * config/gnome/curses.m4
+ * config/gnome/gnome--.m4
+ * config/gnome/gnome-bonobo-check.m4
+ * config/gnome/gnome-common.m4
+ * config/gnome/gnome-fileutils.m4
+ * config/gnome/gnome-ghttp-check.m4
+ * config/gnome/gnome-gnorba-check.m4
+ * config/gnome/gnome-guile-checks.m4
+ * config/gnome/gnome-libgtop-check.m4
+ * config/gnome/gnome-objc-checks.m4
+ * config/gnome/gnome-orbit-check.m4
+ * config/gnome/gnome-print-check.m4
+ * config/gnome/gnome-pthread-check.m4
+ * config/gnome/gnome-support.m4
+ * config/gnome/gnome-undelfs.m4
+ * config/gnome/gnome-vfs.m4
+ * config/gnome/gnome-x-checks.m4
+ * config/gnome/gnome-xml-check.m4
+ * config/gnome/gnome.m4
+ * config/gnome/gperf-check.m4
+ * config/gnome/gtk--.m4
+ * config/gnome/linger.m4
+ * config/gnome/need-declaration.m4: added configuration scripts
+ for Gtk/Gnome frontend-GUI
+
+ * configure.in: added support for the --with-frontend=gtk option
+
+ * autogen.sh: added config/gnome/* to list of config-files
+
+ * acconfig.h: added define for GTKGUI-support
+
+ * config/lyxinclude.m4: added --with-frontend[=value] option value
+ for Gtk/Gnome frontend-GUI support.
+
+2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
+ can be used.
+ (suffixIs): ditto
+
+ * src/paragraph.C (GetChar): remove non-const version
+
+ * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
+ (search_kw): use it.
+
+ * src/lyx_main.C (init): if "preferences" exist, read that instead
+ of "lyxrc".
+ (ReadRcFile): return bool if the file could be read ok.
+ (ReadUIFile): add a check to see if lex file is set ok.
+
+ * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
+ bastring can be used instead of lyxstring (still uses the old code
+ if std::string is good enough or if lyxstring is used.)
+
+ * src/encoding.C: make the arrays static, move ininle functions
+ here
+ * src/encoding.h: from here.
+
+ * src/buffer.C: have last_isnet_read as a file scope variable for now.
+ (parseSingleLyXformat2Token): move inset parsing to separate method
+ (readInset): new private method
+
+ * src/Variables.h: remove virtual from get().
+
+ * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
+ access to NEW_INSETS and NEW_TABULAR
+
+ * src/MenuBackend.h: remove superfluous forward declaration of
+ MenuItem. Add documentations tags "///", remove empty MenuItem
+ destructor, remove private default contructor.
+
+ * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
+ (add): return *this
+ (read): more string mlabel and mname to where they are used
+ (read): remove unused variables mlabel and mname
+ (defaults): unconditional clear, make menusetup take advantage of
+ add returning Menu &.
+
+ * src/LyXView.h: define NEW_MENUBAR as default
+
+ * src/LyXAction.C: include lyxparagraph.h temporary to get access
+ to NEW_INSETS and NEW_TABULAR.
+ (init): commetn out some funcs that is obsolete when NEW_INSETS is
+ defined. Change some of the "xxxx-inset-insert" functions names to
+ "xxxx-insert".
+
+ * several files: more enahncements to NEW_INSETS and the resulting
+ LyXParagraph code.
+
+ * lib/lyxrc.example (\date_insert_format): move to misc section
+
+ * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
+ bastring and use AC_CACHE_CHECK.
+ (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
+ the system have the newest methods. uses AC_CACHE_CHECK
+ (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
+ (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
+ (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
+
+ * configure.in: add LYX_CXX_GOOD_STD_STRING
+
+ * acinclude.m4: recreated
+
+2000-07-24 Amir Karger
+
+ * README: add Hebrew, Arabic kmaps
+ * ANNOUNCE: typo
+
+2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/buffer.C (writeFileAscii): Define actcell as an int instead
+ of int*.
+
+2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * Lot of files: add pragma interface/implementation.
+
+ * src/lyx_main.C (ReadUFile): new method. Read the UI file.
+
+ * lib/ui/default.ui: new file (ans new directory). Contains the
+ default menu and toolbar.
+
+ * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
+ global space. Toolbars are now read (as menus) in ui files.
+
+ * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
+
+ * src/lyxfunc.C (getStatus): do not exit immediately if a command
+ is disabled because the document is read-only. We want to have the
+ toggle state of the function anyway.
+ (getStatus): add code for LFUN_VC* functions (mimicking what is
+ done in old-style menus)
+
+ * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
+ LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
+
+ * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
+ * src/BufferView_pimpl.C: ditto.
+ * src/lyxfunc.C: ditto.
+
+ * src/LyXView.h: add a define NEW_MENUBAR (commented out by
+ default). This replaces old-style menus by new ones.
+
+ * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
+ MenuItem. Contain the data structure of a menu.
+
+ * src/insets/insettext.C: use LyXView::setLayout instead of
+ accessing directly the toolbar combox.
+ * src/lyxfunc.C (Dispatch): ditto.
+
+ * src/LyXView.C (setLayout): new method, which just calls
+ Toolbar::setLayout().
+ (updateLayoutChoice): move part of this method in Toolbar.
+
+ * src/toolbar.[Ch]: removed.
+
+ * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
+ implementation the toolbar.
+
+ * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
+ the toolbar. It might make sense to merge it with ToolbarDefaults
+ later.
+ (setLayout): new function.
+ (updateLayoutList): ditto.
+ (openLayoutList): ditto.
+
+ * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
+ xforms implementation of the toolbar.
+ (get_toolbar_func): comment out, since I do not
+ know what it is good for.
+
+ * src/ToolbarDefaults.h: Add the ItemType enum.
+
+ * src/support/StrPool.[Ch]: new class. Acts as a reference holder
+ for a list of allocated C strings. Used in Menubar xforms
+ implementation to avoid memory leaks.
+
+ * src/support/lstrings.[Ch] (uppercase): new version taking and
+ returning a char.
+ (lowercase): ditto.
+
+ * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
+ * lib/bind/emacs.bind: ditto.
+
+2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
+ forward decl of LyXView.
+
+ * src/toolbar.C (toolbarItem): moved from toolbar.h
+ (toolbarItem::clean): ditto
+ (toolbarItem::~toolbarItem): ditto
+ (toolbarItem::operator): ditto
+
+ * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
+
+ * src/paragraph.h: control the NEW_TABULAR define from here
+
+ * src/buffer.C: remove define USE_PARSE_FUNCTION, change
+ USE_TABULAR_INSETS to NEW_TABULAR
+
+ * src/ToolbarDefaults.C: add include "lyxlex.h"
+
+ * files using the old table/tabular: use NEW_TABULAR to control
+ compilation of old tabular stuff.
+
+ * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
+ to correct place.
+
+ * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
+ planemet in reading of old style floats, fix the \end_deeper
+ problem when reading old style floats.
+
+2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
+
+2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
+
+ * lib/bind/sciword.bind: updated.
+
+2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
+ layout write problem
+
+2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/Makefile.am (INCLUDES): remove image directory from include
+ path.
+
+ * src/bullet_forms.C (create_form_form_bullet): small cleanup.
+ * src/bullet_forms_cb.C (BulletPanelCB): ditto.
+
+ * src/LyXView.C (create_form_form_main): read the application icon
+ from the disk.
+
+ * lib/images/*.xpm: change the icons to use transparent color for
+ background.
+
+ * src/toolbar.C (update): change the color of the button when it
+ is toggled on.
+
+2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
+ setting explicitely the minibuffer.
+ * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
+
+ * src/LyXView.C (showState): new function. Shows font information
+ in minibuffer and update toolbar state.
+ (LyXView): call Toolbar::update after creating the
+ view.
+
+ * src/toolbar.C: change toollist to be a vector instead of a
+ linked list.
+ (BubbleTimerCB): get help string directly from the callback
+ argument of the corresponding icon (which is the action)
+ (set): remove unnecessary ugliness.
+ (update): new function. update the icons (depressed, disabled)
+ depending of the status of the corresponding action.
+
+ * src/toolbar.h: remove help in toolbarItem
+
+2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/Painter.C (text): Added code for using symbol glyphs from
+ iso10646 fonts. Currently diabled.
+
+ * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
+ symbol_encoding.
+
+ * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
+ magyar,turkish and usorbian.
+
+ * src/paragraph.C (isMultiLingual): Made more efficient.
+
+ * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
+ keyboard.
+
+ * src/mathed/math_symbols.C (math_insert_greek): Changed to use
+ LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
+ Also changed the prototype to "bool math_insert_greek(char)".
+
+2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * lots of files: apply the NEW_INSETS on all code that will not be
+ needed when we move to use the new insets. Enable the define in
+ lyxparagrah.h to try it.
+
+ * src/insets/insettabular.C (cellstart): change to be a static
+ inline function
+ (InsetTabular): initialize buffer in the initializer list.
+
+2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/xforms/FormPrint.[Ch] : moved #include
+ form_print.h out of the header file. Replaced with forward
+ declarations of the relevant struct.
+
+ * src/frontends/xforms/FormPreferences.[Ch] : ditto for
+ form_preferences.h.
+
+ * src/commandtags.h: do not include "debug.h" which does not
+ belong there. #include it in some other places because of this
+ change.
+
+2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/insets/insetcaption.C: add a couple "using" directives.
+
+ * src/toolbar.C (add): get the help text directly from lyxaction.
+ (getPixmap): nuked.
+ (setPixmap): new function. Loads from disk and sets a pixmap on a
+ botton; the name of the pixmap file is derived from the command
+ name.
+
+ * src/toolbar.h: remove members isBitmap and pixmap from
+ toobarItem struct.
+
+ * lib/images/*.xbm *_bw.xpm: remove (not used any more).
+ * lib/images/: move many files from images/banner.xpm.
+
+ * src/lyx_gui.C (create_forms): read banner pixmap from file.
+
+ * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
+ * src/toolbar.C: ditto.
+ * configure.in: ditto.
+ * INSTALL: document.
+
+ * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
+ the spellchecker popup is closed from the WM.
+
+2000-07-19 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insetfloat.C (Write): small fix because we use the
+ insetname for the type now!
+
+2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/xforms/forms/form_citation.fd: object sizes are
+ now set here
+
+ * src/frontends/Dialogs.h: removed hideCitation signal
+
+ * src/insets/insetcite.h: added hide signal
+
+ * src/insets/insetcite.C (~InsetCitation): emits new signal
+ (getScreenLabel): "intelligent" label should now fit on the screen!
+
+ * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
+
+ * src/frontends/xforms/FormCitation.C (showInset): connects
+ hide() to the inset's hide signal
+ (show): modified to use fl_set_object_position rather than
+ fl_set_object_geometry wherever possible
+
+2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/insets/lyxinset.h: add caption code
+
+ * src/insets/insetfloat.C (type): new method
+
+ * src/insets/insetcaption.C (Write): new method
+ (Read): new method
+ (LyxCode): new method
+
+ * src/text2.C (SetCounter): revert Jürgens code, but use his idea
+ to get it right together with using the FloatList.
+
+ * src/commandtags.h: add LFUN_INSET_CAPTION
+ * src/lyxfunc.C (Dispatch): handle it
+
+ * src/buffer.C (parseSingleLyXformat2Token): add code to read a
+ caption inset.
+
+ * src/Variables.[Ch]: make expand take a const reference, remove
+ the destructor, some whitespace changes.
+
+ * src/LyXAction.C (init): add caption-inset-insert
+
+ * src/FloatList.C (FloatList): update the default floats a bit.
+
+2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/Variables.[Ch]: new files. Intended to be used for language
+ specific strings (like \chaptername) and filename substitution in
+ commands.
+
+ * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
+ kmap files.
+ * lib/kbd/american.kmap: update
+
+ * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
+
+ * src/bufferparams.[Ch]: remove member allowAccents.
+
+ * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
+
+ * src/LaTeXLog.C: use the log_form.h header.
+ * src/lyx_gui.C: ditto.
+ * src/lyx_gui_misc.C: ditto.
+ * src/lyxvc.h: ditto.
+
+ * forms/log_form.fd: new file, created from latexoptions.fd. I
+ kept the log popup and nuked the options form.
+
+ * src/{la,}texoptions.[Ch]: removed.
+ * src/lyx_cb.C (LaTeXOptions): ditto
+
+ * src/lyx_gui.C (create_forms): do not handle the
+ fd_latex_options form.
+
+2000-07-18 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
+ name of the inset so that it can be requested outside (text2.C).
+
+ * src/text2.C (SetCounter): modified so it sees insetfloat for caption
+ labels.
+
+2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/mathed/formula.h (ConvertFont): constify
+
+ * src/mathed/formula.C (Read): add warning if \end_inset is not
+ found on expected place.
+
+ * src/insets/lyxinset.h (ConvertFont): consify
+
+ * src/insets/insetquotes.C (ConvertFont): constify
+ * src/insets/insetquotes.h: ditto
+
+ * src/insets/insetinfo.h: add labelfont
+
+ * src/insets/insetinfo.C (InsetInfo): set the labelfont
+ (ascent): use labelfont
+ (descent): likewise
+ (width): likewise
+ (draw): likewise
+ (Write): make .lyx file a bit nicer
+
+ * src/insets/insetfloat.C (Write): simplify somewhat...
+ (Read): add warning if arg is not found
+
+ * src/insets/insetcollapsable.C: add using std::max
+ (Read): move string token and add warning in arg is not found
+ (draw): use std::max to get the right ty
+ (getMaxWidth): simplify by using std::max
+
+ * src/insets/insetsection.h: new file
+ * src/insets/insetsection.C: new file
+ * src/insets/insetcaption.h: new file
+ * src/insets/insetcaption.C: new file
+
+ * src/insets/inset.C (ConvertFont): constify signature
+
+ * src/insets/Makefile.am (libinsets_la_SOURCES): add
+ insetcaption.[Ch] and insetsection.[Ch]
+
+ * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
+ uses to use LABEL_COUNTER_CHAPTER instead.
+ * src/text2.C (SetCounter): here
+
+ * src/counters.h: new file
+ * src/counters.C: new file
+ * src/Sectioning.h: new file
+ * src/Sectioning.C: new file
+
+ * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
+
+2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
+ not always in "."!
+
+ * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
+ the last argument.
+
+2000-07-17 Juergen Vigna <jug@sad.it>
+
+ * src/tabular.C (Validate): check if array-package is needed.
+ (SetVAlignment): added support for vertical alignment.
+ (SetLTFoot): better support for longtable header/footers
+ (Latex): modified to support added features.
+
+ * src/LaTeXFeatures.[Ch]: added array-package.
+
+2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
+
+ * src/lyx_gui.C (LyXGUI): make sure that the height is large
+ enough.
+
+2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
+
+ * configure.in: do not forget to put a space after -isystem.
+
+2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * lib/kbd/arabic.kmap: a few fixes.
+
+2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * some whitespace chagnes to a number of files.
+
+ * src/support/DebugStream.h: change to make it easier for
+ doc++ to parse correctly.
+ * src/support/lyxstring.h: ditto
+
+ * src/mathed/math_utils.C (compara): change to have only one
+ operator()
+ (MathedLookupBOP): change because of the above.
+
+ * src/mathed/math_delim.C (math_deco_compare): change to have only
+ one operator()
+ (search_deco): change becasue of the above.
+
+ * src/insets/insettabular.C (DrawCellSelection): use std::swap
+ instead of manually coded one.
+
+ * src/insets/insetquotes.C (Read): read the \end_inset too
+
+ * src/insets/insetlatex.h: remove file
+ * src/insets/insetlatex.C: remove file
+
+ * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
+ constructor
+ (InsetPrintIndex): remove destructor
+
+ * src/insets/insetinclude.h: remove default constructor
+
+ * src/insets/insetfloat.C: work to make it work better
+
+ * src/insets/inseterror.[Ch] (InsetError): remove default constructor
+
+ * src/insets/insetcite.h (InsetCitation): remove default constructor
+
+ * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
+
+ * src/text.C (GetColumnNearX): comment out some currently unused code.
+
+ * src/paragraph.C (writeFile): move some initializations closer to
+ first use.
+ (CutIntoMinibuffer): small change to use new matchIT operator
+ (Erase): ditto
+ (Erase): ditto
+ (InsertChar): ditto
+ (InsertInset): ditto
+ (GetInset): ditto
+ (GetInset): ditto
+ (InsetIterator): ditto
+ (Erase): small change to use new matchFT operator
+ (InsertChar): ditto
+ (GetFontSettings): ditto
+ (HighestFontInRange): ditto
+ (SetFont): ditto
+
+ * src/lyxparagraph.h: some chars changed to value_type
+ (matchIT): because of some stronger checking (perhaps too strong)
+ in SGI STL, the two operator() unified to one.
+ (matchFT): ditto
+
+ * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
+
+ * src/buffer.C (parseSingleLyXformat2Token): static string to hold
+ the last inset read added
+ (parseSingleLyXformat2Token): some more (future) compability code added
+ (parseSingleLyXformat2Token): warning about solitary \end_inset added
+ (parseSingleLyXformat2Token): set last_inset_read
+ (parseSingleLyXformat2Token): more code to read new "Float" correctly
+ (parseSingleLyXformat2Token): don't double intializw string next_token
+
+ * src/TextCache.C (text_fits::operator()): add const's to the signature
+ (has_buffer::operator()): ditto
+
+ * src/Floating.h: add some comments on the class
+
+ * src/FloatList.[Ch] (typeExist): new method
+ (getType): ditto
+
+ * src/BackStack.h: added default constructor, wanted by Gcc.
+
+2000-07-14 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
+
+ * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
+
+ * src/insets/insettabular.C (resizeLyXText): need this to be able to
+ do a redraw when the window is resized!
+ (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
+
+ * src/insets/insettext.C (resizeLyXText): added function to correctly
+ being able to resize the LyXWindow.
+
+ * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
+
+2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
+ crashes when closing dialog to a deleted inset.
+
+ * src/insets/insetcite.[Ch] (Edit) : the return of this former
+ method! Now similar to other insets.
+
+2000-07-13 Juergen Vigna <jug@sad.it>
+
+ * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
+
+ * lib/examples/Literate.lyx: small patch!
+
+ * src/insets/insetbib.C (Read): added this function because of wrong
+ Write (without [begin|end]_inset).
+
2000-07-11 Juergen Vigna <jug@sad.it>
* src/BufferView2.C (open_new_inset): changed to a bool returnvalue
* src/lyx_main.C (commandLineHelp): remove -display from command
line help.
+2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
+
+ * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
+ Also put in Makefile rules for building the ``listerrors''
+ program for parsing errors from literate programs written in LyX.
+
+ * lib/build-listerrors: Added small shell script as part of compile
+ process. This builds a working ``listerrors'' binary if noweb is
+ installed and either 1) the VNC X server is installed on the machine,
+ or 2) the user is compiling from within a GUI. The existence of a GUI
+ is necessary to use the ``lyx --export'' feature for now. This
+ hack can be removed once ``lyx --export'' no longer requires a GUI to
+ function.
+
+2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
+
+ * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
+ now passed back correctly from gcc and placed "under" error
+ buttons in a Literate LyX source.
+
2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
* src/text.C (GetColumnNearX): Better behavior when a RTL