(string2type): added a bunch of this functions per type.
(Write): use type2string and write columns first.
(type2string): added a bunch of this functions per type.
(string2type): added a bunch of this functions per type.
(Write): use type2string and write columns first.
(type2string): added a bunch of this functions per type.
* src/insets/insettabular.C (LocalDispatch): When dispatching
LFUN_TAB/LFUN_SHIFT_TAB, if the insettext of the old cell was
* src/insets/insettabular.C (LocalDispatch): When dispatching
LFUN_TAB/LFUN_SHIFT_TAB, if the insettext of the old cell was
(moveLeft, moveRight): Fixed for RTL tabulars.
(moveNextCell, movePrevCell): Ditto.
(isRightToLeft): New method.
(moveLeft, moveRight): Fixed for RTL tabulars.
(moveNextCell, movePrevCell): Ditto.
(isRightToLeft): New method.
non-dispatched function in the locking inset.
(Edit): If the inset is empty set the language of the current font
to the language to the surronding text (this code was moved from
non-dispatched function in the locking inset.
(Edit): If the inset is empty set the language of the current font
to the language to the surronding text (this code was moved from
inserting text).
(moveRight, moveLeft): Fixed for RTL text.
(checkAndActivateInset): Fixed.
inserting text).
(moveRight, moveLeft): Fixed for RTL text.
(checkAndActivateInset): Fixed.
* src/tabular.C (OldFormatRead): Use ALL_INHERIT font as the base font.
2001-01-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/tabular.C (OldFormatRead): Use ALL_INHERIT font as the base font.
2001-01-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_panel.C (deco_cb): check the decoration index is
2001-01-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_panel.C (deco_cb): check the decoration index is
* src/frontends/xforms/FormPreferences.C (feedback): apply
formatting to the translated string, not to the original one.
* src/frontends/xforms/FormPreferences.C (feedback): apply
formatting to the translated string, not to the original one.
* src/gettext.C (_): translate empty string with empty string.
* src/frontends/xforms/FormCopyright.C (build): use _() instead of
* src/gettext.C (_): translate empty string with empty string.
* src/frontends/xforms/FormCopyright.C (build): use _() instead of
* lib/configure.cmd: update OS/2 support files.
2001-01-02 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (pasteSelection): rewritten correctly.
* lib/configure.cmd: update OS/2 support files.
2001-01-02 Juergen Vigna <jug@sad.it>
* src/insets/insettabular.C (pasteSelection): rewritten correctly.
(TeXBottomHLine): fixed Lars new code.
* src/insets/insettext.C (LocalDispatch): added support for math_greek.
(TeXBottomHLine): fixed Lars new code.
* src/insets/insettext.C (LocalDispatch): added support for math_greek.
2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/FileInfo.h: move unistd.h to after sys/types.h and
2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/FileInfo.h: move unistd.h to after sys/types.h and
* src/WorkArea.C (work_area_handler): simplify the key/keysym
handling for XForms 0.89, this might have rendered some cases
unusable. I have at least deadkeys, accent-xxx and KP_x working.
* src/WorkArea.C (work_area_handler): simplify the key/keysym
handling for XForms 0.89, this might have rendered some cases
unusable. I have at least deadkeys, accent-xxx and KP_x working.
* src/support/copy.C: don't include filetools.h
* lib/images: revert to old banner, drop the cucumber.
* src/support/copy.C: don't include filetools.h
* lib/images: revert to old banner, drop the cucumber.
2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
* src/converter.C (Formats::View): Change the current directory to
the directory of the file.
2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
* src/converter.C (Formats::View): Change the current directory to
the directory of the file.
2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/kbsequence.C (addkey): also clear sequence and modifiers if
2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/kbsequence.C (addkey): also clear sequence and modifiers if
* src/sp_form.C: fix the font size of some text entries
* src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
* src/sp_form.C: fix the font size of some text entries
* src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
* src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
bind file if it has not been done yet.
* src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
bind file if it has not been done yet.
changing from display math to eqnarray (however, the label
do not appear at the first line, as one might expects, but at the
second line).
changing from display math to eqnarray (however, the label
do not appear at the first line, as one might expects, but at the
second line).
have a label, the old label is used as default value.
Also, if the label is changed, then all references to the label
are changed.
have a label, the old label is used as default value.
Also, if the label is changed, then all references to the label
are changed.
* src/converter.C (Add): Remove $$i when setting latex_command.
* src/text.C (IsBoundary): Return false when pos = 0.
* src/converter.C (Add): Remove $$i when setting latex_command.
* src/text.C (IsBoundary): Return false when pos = 0.
* lib/ui/default.ui: put TOC at the beginning of the TOC menu.
* src/lyxfunc.C (getStatus): disable insertion of floats in a
* lib/ui/default.ui: put TOC at the beginning of the TOC menu.
* src/lyxfunc.C (getStatus): disable insertion of floats in a
* src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
confused now! And if you think I'm going to do this in
./forms/fdfix.sh with its "sed -e" declarations, then think again!
* src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
confused now! And if you think I'm going to do this in
./forms/fdfix.sh with its "sed -e" declarations, then think again!
2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
* src/frontends/xforms/Menubar_pimpl.C (openByName): check that
the menu exists in the current menubar before opening it.
* src/frontends/xforms/Menubar_pimpl.C (openByName): check that
the menu exists in the current menubar before opening it.
* src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
action value by offsetting actions by a large constant (so that
* src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
action value by offsetting actions by a large constant (so that
* src/frontends/kde/dlg/emptytable.C:
* src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
default parameters (from Angus Leeming)
* src/frontends/kde/dlg/emptytable.C:
* src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
default parameters (from Angus Leeming)
* src/frontends/kde/dlg/moc/.cvsignore:
* src/frontends/kde/dlg/.cvsignore:
* src/frontends/kde/moc/.cvsignore: fix the library name
* src/frontends/kde/dlg/moc/.cvsignore:
* src/frontends/kde/dlg/.cvsignore:
* src/frontends/kde/moc/.cvsignore: fix the library name
* src/buffer.C: bring up a dialog if we load a document
with an un-installed text class, rather than just complain
on the console.
* src/buffer.C: bring up a dialog if we load a document
with an un-installed text class, rather than just complain
on the console.
2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
* src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
* src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
* src/frontends/xforms/FormCitation.C (c-tor):
* src/frontends/xforms/FormCopyright.C (c-tor):
* src/frontends/xforms/FormError.C (c-tor):
* src/frontends/xforms/FormCitation.C (c-tor):
* src/frontends/xforms/FormCopyright.C (c-tor):
* src/frontends/xforms/FormError.C (c-tor):
to check for systems where mkstemp() is available but not declared
in headers. The new autoconf macro lyx_CHECK_DECL can be used
to check for declarations in headers.
to check for systems where mkstemp() is available but not declared
in headers. The new autoconf macro lyx_CHECK_DECL can be used
to check for declarations in headers.
2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
* forms/bibforms.fd: tiny fix to get it to run with fdesign.
2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
* forms/bibforms.fd: tiny fix to get it to run with fdesign.
* src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
* src/frontends/gnome/Makefile.am: updated list of XForms object files
* src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
* src/frontends/gnome/Makefile.am: updated list of XForms object files
2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
* src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
* src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
* config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
* src/screen.C (setCursorColor): new method. Sets the color of the
* config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
* src/screen.C (setCursorColor): new method. Sets the color of the
present. The problem appears to lie in ColorHandler, because I can
change the color using LColor.SetColor(). Similarly, when reading in a
preferences file with some set_color instances, I'll get a warning
present. The problem appears to lie in ColorHandler, because I can
change the color using LColor.SetColor(). Similarly, when reading in a
preferences file with some set_color instances, I'll get a warning
Bad lyxrc set_color for sea green
Once the buffer is loaded, however, I can happily change to this color.
Bad lyxrc set_color for sea green
Once the buffer is loaded, however, I can happily change to this color.
Finally, it appears that I have to set the color of "inset frame"
explicitly, or it oscillates from "black" to "indian red" with each
successive "Apply".
Finally, it appears that I have to set the color of "inset frame"
explicitly, or it oscillates from "black" to "indian red" with each
successive "Apply".
* src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
* lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
* src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
* lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
* src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
match the requirements from the standard better. This is required
* src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
match the requirements from the standard better. This is required
FormPreferences.h, to match initalizaton order.
* several files: constify more local variables.
FormPreferences.h, to match initalizaton order.
* several files: constify more local variables.
* src/buffer.C: remove some commented functions.
* src/DepTable.C (remove_files_with_extension): temporary
* src/buffer.C: remove some commented functions.
* src/DepTable.C (remove_files_with_extension): temporary
* src/filedlg.C (find): ditto
* src/Variables.C (set): ditto
* src/LyXAction.C (searchActionArg): ditto
* src/filedlg.C (find): ditto
* src/Variables.C (set): ditto
* src/LyXAction.C (searchActionArg): ditto
* src/support/tempname.C (make_tempfile): new function, wrapper
around mkstemp and mktemp. Only mkstemp has been tested.
(tempName): call it.
* src/support/tempname.C (make_tempfile): new function, wrapper
around mkstemp and mktemp. Only mkstemp has been tested.
(tempName): call it.
* default.ui: capitalized some menu items to improve shortcuts.
2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* default.ui: capitalized some menu items to improve shortcuts.
2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
* src/frontends/xforms/FormUrl.C (FormUrl): ditto
* src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
* src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
* src/frontends/xforms/FormUrl.C (FormUrl): ditto
* src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
* forms/layout_forms.h.patch: make the patch more correct and more appalyable
* config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
* forms/layout_forms.h.patch: make the patch more correct and more appalyable
* config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
(LYX_PROG_CXX): change 2.97 rules to include the -f.. that
libstdc++ is compiled with.
2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
(LYX_PROG_CXX): change 2.97 rules to include the -f.. that
libstdc++ is compiled with.
2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
* lib/layouts/docbook-book.layout
* lib/layouts/docbook.layout
* lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
those paragraphs are expresse as SGML comments <!-- -->.
* src/LaTeXFeatures.h
* lib/layouts/docbook-book.layout
* lib/layouts/docbook.layout
* lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
those paragraphs are expresse as SGML comments <!-- -->.
* src/LaTeXFeatures.h
parameter, this allows to express all the include files as relative
paths to the master buffer. The verbatim insert works as the other
include file modes.
* src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
is a SGML comment.
parameter, this allows to express all the include files as relative
paths to the master buffer. The verbatim insert works as the other
include file modes.
* src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
is a SGML comment.
to master path.
(MakeDocBookFile): top_element is always written. Some clean up, as
sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
to master path.
(MakeDocBookFile): top_element is always written. Some clean up, as
sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
(Validate): use the relative path for the filename.
* src/insets/insetlabel.C (DocBook): write end tag, for XML
(Validate): use the relative path for the filename.
* src/insets/insetlabel.C (DocBook): write end tag, for XML
* README.OS2: quick update to the OS/2 port.
2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* README.OS2: quick update to the OS/2 port.
2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
(compare_converter): add "int" as return type.
* src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
(compare_converter): add "int" as return type.
* src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
mapping exist. Ie, call XformColor::read().
* src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
mapping exist. Ie, call XformColor::read().
* src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
(XformColor::read, XformColor::write) : new methods that
input/output any changes to the cform GUI colors.
(XformColor::read, XformColor::write) : new methods that
input/output any changes to the cform GUI colors.
export to some format (the new code uses only the shortest path).
However, it is still possible to choose between pdflatex/ps2pdf
for creating a PDF file, by defining two PDF formats: pdf & pdf2.
export to some format (the new code uses only the shortest path).
However, it is still possible to choose between pdflatex/ps2pdf
for creating a PDF file, by defining two PDF formats: pdf & pdf2.
2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/Color.C: include <algorithm> and <cmath>
2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/Color.C: include <algorithm> and <cmath>
subsequently opened dialogs will, of course, also have the new
color scheme. Cannot yet save (or load) the choices to file, so
they are lost when exiting LyX.
subsequently opened dialogs will, of course, also have the new
color scheme. Cannot yet save (or load) the choices to file, so
they are lost when exiting LyX.
* src/frontends/Dialogs.h:
* src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
Used to trigger a redraw of any dialogs connected to it because,
* src/frontends/Dialogs.h:
* src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
Used to trigger a redraw of any dialogs connected to it because,
(SetParagraphData): set cache.second to 0 after deleting it!
(getLyXText): check if cache.second is not 0 if finding it.
(SetParagraphData): set cache.second to 0 after deleting it!
(getLyXText): check if cache.second is not 0 if finding it.
* src/lyxlex.[Ch]:
* src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
replace the default '#' comment character.
* src/lyxlex.[Ch]:
* src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
replace the default '#' comment character.
* src/insets/insetexternal.C (InsetExternal): use lyx::tempName
* src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
* src/insets/insetexternal.C (InsetExternal): use lyx::tempName
* src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
* src/mathed/math_panel.C:
use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
all "daughter" dialogs now have identical "feel".
* src/mathed/math_panel.C:
use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
all "daughter" dialogs now have identical "feel".
2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
* src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
* src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
* src/support/filetools.[Ch] (DirList): new function. Not at all sure
if this is the best way to do this.
* src/support/filetools.[Ch] (DirList): new function. Not at all sure
if this is the best way to do this.
2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
* many files: change formatting to be a bit more uniform for
if,while,for,switch statements, remove some parantesis not needed.
* many files: change formatting to be a bit more uniform for
if,while,for,switch statements, remove some parantesis not needed.
2000-11-03 John Levon <moz@compsoc.man.ac.uk>
* config/kde.m4: make config more robust when KDEDIR is set
2000-11-03 John Levon <moz@compsoc.man.ac.uk>
* config/kde.m4: make config more robust when KDEDIR is set
2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
2000-11-03 Rob Lahaye <lahaye@postech.edu>
* lib/ui/default.ui: update again the menu layout (fix some
2000-11-03 Rob Lahaye <lahaye@postech.edu>
* lib/ui/default.ui: update again the menu layout (fix some
2000-11-02 Lior Silberman <lior@Princeton.EDU>
* lib/examples/*.lyx : '\language default' => '\language english'
2000-11-02 Lior Silberman <lior@Princeton.EDU>
* lib/examples/*.lyx : '\language default' => '\language english'
* src/frontends/xforms/FormPreferences.[Ch]:
* src/frontends/xforms/forms/form_preferences.fd: lots and lots!
* src/frontends/xforms/FormPreferences.[Ch]:
* src/frontends/xforms/forms/form_preferences.fd: lots and lots!
Tidied some forms up, made two of form_tabular's tabs more
self-consistent, fixed Jean-Marc's size problem in form_preferences,
fixed translation problem with "Column".
Tidied some forms up, made two of form_tabular's tabs more
self-consistent, fixed Jean-Marc's size problem in form_preferences,
fixed translation problem with "Column".
2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/minibuffer.h: use Timeout instead of the xforms timer
2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/minibuffer.h: use Timeout instead of the xforms timer
(setTimer) rewrite for the Timeout, change to unsigned arg
(set): change to unsigned timer arg
(TimerCB): remove
(setTimer) rewrite for the Timeout, change to unsigned arg
(set): change to unsigned timer arg
(TimerCB): remove
(C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
(peek_event): use a switch statement
(add): don't use fl_add_timer.
(C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
(peek_event): use a switch statement
(add): don't use fl_add_timer.
2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/filetools.C (MakeRelPath): change some types to
2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/filetools.C (MakeRelPath): change some types to
* src/frontends/ButtonPolicies.h (operator<<): new operator for
ButtonPolicy::SMInput and ButtonPolicy::State.
* src/frontends/ButtonPolicies.h (operator<<): new operator for
ButtonPolicy::SMInput and ButtonPolicy::State.
* src/FontInfo.C (getFontname): initialize error to 10000.0
2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
* src/FontInfo.C (getFontname): initialize error to 10000.0
2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormPreferences.[Ch]:
* src/frontends/xforms/forms/form_preferences.fd: added spell checker,
TeX encoding and default paper size sections.
* src/frontends/xforms/FormPreferences.[Ch]:
* src/frontends/xforms/forms/form_preferences.fd: added spell checker,
TeX encoding and default paper size sections.
2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/frontends/xforms/FormTabularCreate.C: add missing #pragma
2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/frontends/xforms/FormTabularCreate.C: add missing #pragma
* src/frontends/xforms/FormError.C (disconnect): use erase() to
make the message_ empty.
(FormError): don't initialize message_ in initializer list.
2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
* src/frontends/xforms/FormError.C (disconnect): use erase() to
make the message_ empty.
(FormError): don't initialize message_ in initializer list.
2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
* src/buffer.C: removed redundant using directive.
* src/frontends/DialogBase.h: revert to original definition of
* src/buffer.C: removed redundant using directive.
* src/frontends/DialogBase.h: revert to original definition of
* src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
stuff into two classes, one for each dialog, requires a new
element in the dialogs vector, FormTabularCreate.
* src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
stuff into two classes, one for each dialog, requires a new
element in the dialogs vector, FormTabularCreate.
don't need to worry about "update or hide?".
* src/frontends/xforms/FormError.C (showInset): add connection
don't need to worry about "update or hide?".
* src/frontends/xforms/FormError.C (showInset): add connection
* src/frontends/xforms/FormTabular.[Ch]: split into two classes,
one for each dialog. FormTabular now contains main tabular dialog
* src/frontends/xforms/FormTabular.[Ch]: split into two classes,
one for each dialog. FormTabular now contains main tabular dialog
* src/frontends/xforms/FormTabularCreate.[Ch]:
* src/frontends/xforms/forms/form_tabular_create.fd: the create
* src/frontends/xforms/FormTabularCreate.[Ch]:
* src/frontends/xforms/forms/form_tabular_create.fd: the create
a char only if real_current_font was changed.
2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
a char only if real_current_font was changed.
2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/Menubar_pimpl.C: small changes so that they
compile without "conversion to integral type of smaller size"
warnings.
* src/frontends/xforms/Menubar_pimpl.C: small changes so that they
compile without "conversion to integral type of smaller size"
warnings.
2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/lyxfunctional.h (void_class_fun_t): fix name of
2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/lyxfunctional.h (void_class_fun_t): fix name of
* src/support/lyxfunctional.h: version of class_fun for void
returns added, const versions of back_inseter_fun and compare_fun
* src/support/lyxfunctional.h: version of class_fun for void
returns added, const versions of back_inseter_fun and compare_fun
* src/frontends/gnome/FormToc.C
* src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
appropriate.
* src/frontends/gnome/FormToc.C
* src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
appropriate.
* src/frontends/gnome/Menubar_pimpl.C
* src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
fill the menus.
* src/frontends/gnome/Menubar_pimpl.C
* src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
fill the menus.
* src/minibuffer.C (peek_event): Added action when mouse clicks to
clear the minibuffer and prepare to enter a command.
* src/minibuffer.C (peek_event): Added action when mouse clicks to
clear the minibuffer and prepare to enter a command.
(build, update, apply): New inputs in various tabfolders
* src/frontends/xforms/FormToc.C: use new button policy.
* src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
dialogs that either can't use any existing policy or where it just
(build, update, apply): New inputs in various tabfolders
* src/frontends/xforms/FormToc.C: use new button policy.
* src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
dialogs that either can't use any existing policy or where it just
- * src/BufferView_pimpl.C (buffer):
- * src/frontends/kde/FormCopyright.h (update):
- * src/frontends/kde/FormCitation.[Ch] (update):
- * src/frontends/kde/FormIndex.[Ch] (update):
- * src/frontends/kde/FormPrint.[Ch] (update):
- * src/frontends/kde/FormRef.[Ch] (update):
- * src/frontends/kde/FormToc.[Ch] (update):
- * src/frontends/kde/FormUrl.[Ch] (update):
- * src/frontends/gnome/FormCopyright.h (update):
- * src/frontends/gnome/FormCitation.[Ch] (update):
- * src/frontends/gnome/FormError.[Ch] (update):
- * src/frontends/gnome/FormIndex.[Ch] (update):
- * src/frontends/gnome/FormPrint.[Ch] (update):
- * src/frontends/gnome/FormRef.h (update):
- * src/frontends/gnome/FormToc.[Ch] (update):
- * src/frontends/gnome/FormUrl.[Ch] (update):
+ * src/BufferView_pimpl.C (buffer):
+ * src/frontends/kde/FormCopyright.h (update):
+ * src/frontends/kde/FormCitation.[Ch] (update):
+ * src/frontends/kde/FormIndex.[Ch] (update):
+ * src/frontends/kde/FormPrint.[Ch] (update):
+ * src/frontends/kde/FormRef.[Ch] (update):
+ * src/frontends/kde/FormToc.[Ch] (update):
+ * src/frontends/kde/FormUrl.[Ch] (update):
+ * src/frontends/gnome/FormCopyright.h (update):
+ * src/frontends/gnome/FormCitation.[Ch] (update):
+ * src/frontends/gnome/FormError.[Ch] (update):
+ * src/frontends/gnome/FormIndex.[Ch] (update):
+ * src/frontends/gnome/FormPrint.[Ch] (update):
+ * src/frontends/gnome/FormRef.h (update):
+ * src/frontends/gnome/FormToc.[Ch] (update):
+ * src/frontends/gnome/FormUrl.[Ch] (update):
* src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
to updateBufferDependent and DialogBase
* src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
to updateBufferDependent and DialogBase
- * src/frontends/xforms/FormError.[Ch]:
- * src/frontends/xforms/FormGraphics.[Ch]:
- * src/frontends/xforms/FormIndex.[Ch]:
+ * src/frontends/xforms/FormError.[Ch]:
+ * src/frontends/xforms/FormGraphics.[Ch]:
+ * src/frontends/xforms/FormIndex.[Ch]:
* src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
and fixed readOnly handling.
* src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
and fixed readOnly handling.
* src/frontends/xforms/FormInset.[Ch]:
* src/frontends/xforms/FormBase.[hC]: modifications to use the new
form of updateBufferDependent.
* src/frontends/xforms/FormInset.[Ch]:
* src/frontends/xforms/FormBase.[hC]: modifications to use the new
form of updateBufferDependent.
got more confusing. Hence the decision to make everyone have an
update(bool). An alternative might have been to override show() in
FormBaseB[DI] and that would allow the different and appropriate
got more confusing. Hence the decision to make everyone have an
update(bool). An alternative might have been to override show() in
FormBaseB[DI] and that would allow the different and appropriate
* src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
true == buffer change occurred. I decided against using a default
* src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
true == buffer change occurred. I decided against using a default
2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxtext.h (bidi_level): change return type to
2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxtext.h (bidi_level): change return type to
* src/lyxparagraph.h: change size_type to
TextContainer::difference_type. This should really be
TextContainer::size_type, but we need currently to support signed
* src/lyxparagraph.h: change size_type to
TextContainer::difference_type. This should really be
TextContainer::size_type, but we need currently to support signed
* src/frontends/gnome/FormRef.h
* src/frontends/gnome/FormError.C
* src/frontends/gnome/Makefile.am
* src/frontends/gnome/FormRef.h
* src/frontends/gnome/FormError.C
* src/frontends/gnome/Makefile.am
* src/filedlg.C (GroupCache::find): de-inlined the function, makes
compiling on egcs 1.1.2 possible.
* src/filedlg.C (GroupCache::find): de-inlined the function, makes
compiling on egcs 1.1.2 possible.
* src/filedlg.C (comp_direntry::operator() ): ditto.
2000-08-31 Baruch Even <baruch.even@writeme.com>
* src/filedlg.C (comp_direntry::operator() ): ditto.
2000-08-31 Baruch Even <baruch.even@writeme.com>
* src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
* src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
* src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
* src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
* config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
that -pedantic is not used for gcc 2.97 (cvs gcc)
* config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
that -pedantic is not used for gcc 2.97 (cvs gcc)
a readable directory. It doesn't need to be writeable.
(build, delete, update, apply): New inputs in the various tabfolders
a readable directory. It doesn't need to be writeable.
(build, delete, update, apply): New inputs in the various tabfolders
* src/frontends/xforms/FormPreferences.h: New tabfolder and added
several new entries to existing folders. Shuffled some existing stuff
* src/frontends/xforms/FormPreferences.h: New tabfolder and added
several new entries to existing folders. Shuffled some existing stuff
* src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
Should probably rework PrinterParams as well. Note that the switch to
collated is effectively the same as !unsorted so changing PrinterParams
* src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
Should probably rework PrinterParams as well. Note that the switch to
collated is effectively the same as !unsorted so changing PrinterParams
I'll rewrite this later, after 1.1.6 probably, to keep a single
LyXRC but two instances of a LyXRCStruct.
I'll rewrite this later, after 1.1.6 probably, to keep a single
LyXRC but two instances of a LyXRCStruct.
* src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
* src/lyxfont.C (latexWriteStartChanges): ditto.
* src/paragraph.C (validate,TeXOnePar): ditto.
* src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
* src/lyxfont.C (latexWriteStartChanges): ditto.
* src/paragraph.C (validate,TeXOnePar): ditto.
* src/lyxfont.C (update): Restored deleted code.
* src/frontends/xforms/FormDocument.C (build): Made the combox taller
* src/lyxfont.C (update): Restored deleted code.
* src/frontends/xforms/FormDocument.C (build): Made the combox taller
(cursorNext): added LyXText parameter to function.
* src/insets/insettabular.C (LocalDispatch): activate cell inset on
(cursorNext): added LyXText parameter to function.
* src/insets/insettabular.C (LocalDispatch): activate cell inset on
(print_n_chars): new functions to realize the ascii export of tabulars.
2000-10-05 Juergen Vigna <jug@sad.it>
(print_n_chars): new functions to realize the ascii export of tabulars.
2000-10-05 Juergen Vigna <jug@sad.it>
* src/frontends/xforms/FormParagraph.[Ch]
* src/frontends/xforms/forms/form_paragraph.fd: now derived from
FormBase.
* src/frontends/xforms/FormParagraph.[Ch]
* src/frontends/xforms/forms/form_paragraph.fd: now derived from
FormBase.
* lib/bind/menus.bind: remove real menu entries from there.
* src/spellchecker.C: make sure we only include strings.h when
* lib/bind/menus.bind: remove real menu entries from there.
* src/spellchecker.C: make sure we only include strings.h when
2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
* src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
function. It enlarges the maximum number of pup when needed.
2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
* src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
function. It enlarges the maximum number of pup when needed.
2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
* lib/layouts/amsart.layout: include lyxmacros.inc, so that
LyX-Code is defined.
* lib/layouts/amsbook.layout: ditto.
* lib/layouts/amsart.layout: include lyxmacros.inc, so that
LyX-Code is defined.
* lib/layouts/amsbook.layout: ditto.
surronding paragraph on inserting the first character.
* various files: changed use of BufferView::the_locking_inset.
surronding paragraph on inserting the first character.
* various files: changed use of BufferView::the_locking_inset.
* src/insets/figinset.C (Preview): Use Formats::View.
* lib/configure.m4: Add sgml->dvi converter to lyxrc.default
* src/insets/figinset.C (Preview): Use Formats::View.
* lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfunc.C (Dispatch): move declaration of text variable at
2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfunc.C (Dispatch): move declaration of text variable at
* src/frontends/xforms/FormRef.[Ch]:
* src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
with Allan's naming policy
* src/frontends/xforms/FormRef.[Ch]:
* src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
with Allan's naming policy
* src/frontends/kde/FormRef.h:
* src/frontends/kde/FormToc.h:
* src/frontends/kde/FormUrl.h: fix remaining users of
* src/frontends/kde/FormRef.h:
* src/frontends/kde/FormToc.h:
* src/frontends/kde/FormUrl.h: fix remaining users of
2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
* several files: type changes to reduce the number of warnings and
2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
* several files: type changes to reduce the number of warnings and
2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/images/*: rename a bunch of icons to match Dekel converter
2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/images/*: rename a bunch of icons to match Dekel converter
* lib/layouts/docbook-book.layout: new docbook book layout.
* lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
* lib/layouts/docbook-book.layout: new docbook book layout.
* lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
* lib/layouts/manpage.layout: Same as above. Style SubSection removed.
* src/insets/figinset.C (DocBook):fixed small typo.
* lib/layouts/manpage.layout: Same as above. Style SubSection removed.
* src/insets/figinset.C (DocBook):fixed small typo.
2000-09-29 Allan Rae <rae@lyx.org>
* src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2000-09-29 Allan Rae <rae@lyx.org>
* src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
* src/BufferView.C (fitCursor): added LyXText parameter.
* src/insets/insettabular.C (draw): small draw fix.
* src/tabular.C: right setting of left/right celllines.
* src/BufferView.C (fitCursor): added LyXText parameter.
* src/insets/insettabular.C (draw): small draw fix.
* src/tabular.C: right setting of left/right celllines.
* src/insets/insetquotes.C: removed use of current_view.
* src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
* src/insets/insetquotes.C: removed use of current_view.
* src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
(writeFileAscii): use now asciiParagraph.
* various inset files: added the linelen parameter to the Ascii-func.
(writeFileAscii): use now asciiParagraph.
* various inset files: added the linelen parameter to the Ascii-func.
* src/support/unlink.C src/support/remove.C src/support/mkdir.C:
new files use the everwhere possible.
* src/support/unlink.C src/support/remove.C src/support/mkdir.C:
new files use the everwhere possible.
* src/PaperLayout.C: removed file
* src/ParagraphExtra.C: likewise
* src/bullet_forms.C: likewise
* src/bullet_forms.h: likewise
* src/bullet_forms_cb.C: likewise
* src/PaperLayout.C: removed file
* src/ParagraphExtra.C: likewise
* src/bullet_forms.C: likewise
* src/bullet_forms.h: likewise
* src/bullet_forms_cb.C: likewise
* src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
* src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
* several files: remove all traces of the old fd_form_paragraph,
and functions belonging to that.
* several files: remove all traces of the old fd_form_paragraph,
and functions belonging to that.
* several files: remove all traces of the old fd_form_document,
and functions belonging to that.
* several files: remove all traces of the old fd_form_document,
and functions belonging to that.
* forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
(e): be a bit more outspoken when patching
(updatesrc): only move files if changed.
* forms/layout_forms.h.patch: regenerated
* forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
(e): be a bit more outspoken when patching
(updatesrc): only move files if changed.
* forms/layout_forms.h.patch: regenerated
* forms/layout_forms.fd: remove form_document and form_paragraph
and form_quotes and form_paper and form_table_options and
* forms/layout_forms.fd: remove form_document and form_paragraph
and form_quotes and form_paper and form_table_options and
* forms/bullet_forms.C.patch: removed file
* forms/bullet_forms.fd: likewise
* forms/bullet_forms.h.patch: likewise
* forms/bullet_forms.C.patch: removed file
* forms/bullet_forms.fd: likewise
* forms/bullet_forms.h.patch: likewise
* development/Code_rules/Rules: added a section on switch
statements. Updated some comment to xforms 0.88.
* development/Code_rules/Rules: added a section on switch
statements. Updated some comment to xforms 0.88.
- * src/frontends/kde/Dialogs.C (Dialogs):
- * src/frontends/gnome/Dialogs.C (Dialogs):
- * src/frontends/kde/Makefile.am:
+ * src/frontends/kde/Dialogs.C (Dialogs):
+ * src/frontends/gnome/Dialogs.C (Dialogs):
+ * src/frontends/kde/Makefile.am:
* src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
* src/frontends/xforms/forms/makefile: added form_paragraph.fd.
* src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
* src/frontends/xforms/forms/makefile: added form_paragraph.fd.
* src/frontends/xforms/FormParagraph.h:
* src/frontends/xforms/form_paragraph.C:
* src/frontends/xforms/form_paragraph.h:
* src/frontends/xforms/FormParagraph.h:
* src/frontends/xforms/form_paragraph.C:
* src/frontends/xforms/form_paragraph.h:
accelerators
* src/frontends/gnome/FormCitation.C
* src/frontends/gnome/FormCitation.h
* src/frontends/gnome/Makefile.am
accelerators
* src/frontends/gnome/FormCitation.C
* src/frontends/gnome/FormCitation.h
* src/frontends/gnome/Makefile.am
* src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
large TOC.
2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
* src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
large TOC.
2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
* src/frontends/xforms/FormError.[Ch]
* src/frontends/xforms/forms/form_error.fd: new files. Xforms
implementation of InsetError dialog.
* src/frontends/xforms/FormError.[Ch]
* src/frontends/xforms/forms/form_error.fd: new files. Xforms
implementation of InsetError dialog.
* src/insets/inseterror.[Ch]: rendered GUI-independent.
* src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
* src/insets/inseterror.[Ch]: rendered GUI-independent.
* src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
* src/frontends/kde/FormRef.h: removed trailing comma from enums.
2000-09-19 Marko Vendelin <markov@ioc.ee>
* src/frontends/kde/FormRef.h: removed trailing comma from enums.
2000-09-19 Marko Vendelin <markov@ioc.ee>
* src/frontends/gnome/Menubar_pimpl.C
* src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
Toc, ViewFormats, UpdateFormats, and ExportFormats.
* src/frontends/gnome/mainapp.C
* src/frontends/gnome/Menubar_pimpl.C
* src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
Toc, ViewFormats, UpdateFormats, and ExportFormats.
* src/frontends/gnome/mainapp.C
methods are static. constify a bit remove unneded using + headers.
* src/tabular.C: some more const to local vars move some loop vars
methods are static. constify a bit remove unneded using + headers.
* src/tabular.C: some more const to local vars move some loop vars
* src/spellchecker.C: added some c_str after some word for pspell
* src/frontends/GUIRunTime.h: add new static method setDefaults
* src/spellchecker.C: added some c_str after some word for pspell
* src/frontends/GUIRunTime.h: add new static method setDefaults
- * src/frontends/xforms/GUIRunTime.C (setDefaults):
- * src/frontends/kde/GUIRunTime.C (setDefaults):
+ * src/frontends/xforms/GUIRunTime.C (setDefaults):
+ * src/frontends/kde/GUIRunTime.C (setDefaults):
* src/frontends/gnome/GUIRunTime.C (setDefaults): new method
* src/mathed/math_cursor.C (MacroModeClose): don't call SetName
* src/frontends/gnome/GUIRunTime.C (setDefaults): new method
* src/mathed/math_cursor.C (MacroModeClose): don't call SetName
* several files: remove all commented code with relation to
HAVE_SSTREAM beeing false. We now only support stringstream and
* several files: remove all commented code with relation to
HAVE_SSTREAM beeing false. We now only support stringstream and
2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfunc.C: construct correctly the automatic new file
2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfunc.C: construct correctly the automatic new file
* src/frontends/kde/FormToc.h: corrected definition of doTree.
* src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
* src/frontends/kde/FormToc.h: corrected definition of doTree.
* src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/buffer.C (pop_tag): revert for the second time a change by
2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/buffer.C (pop_tag): revert for the second time a change by
* src/Lsstream.h src/support/sstream.h: new files.
* also commented out all cases where strstream were used.
* src/Lsstream.h src/support/sstream.h: new files.
* also commented out all cases where strstream were used.
* a lot of files: get rid of "char const *" and "char *" is as
many places as possible. We only want to use them in interaction
with system of other libraries, not inside lyx.
* a lot of files: get rid of "char const *" and "char *" is as
many places as possible. We only want to use them in interaction
with system of other libraries, not inside lyx.
* a lot of files: return const object is not of pod type. This
helps ensure that temporary objects is not modified. And fits well
with "programming by contract".
* a lot of files: return const object is not of pod type. This
helps ensure that temporary objects is not modified. And fits well
with "programming by contract".
2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxlex_pimpl.C (setFile): change error message to debug
2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxlex_pimpl.C (setFile): change error message to debug
* src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
directory!
(easyParse): Fixed to work with new export code.
* src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
directory!
(easyParse): Fixed to work with new export code.
- * src/frontends/gnome/GUIRunTime.C (initApplication):
- * src/frontends/kde/GUIRunTime.C (initApplication):
- * src/frontends/xforms/GUIRunTime.C (initApplication):
+ * src/frontends/gnome/GUIRunTime.C (initApplication):
+ * src/frontends/kde/GUIRunTime.C (initApplication):
+ * src/frontends/xforms/GUIRunTime.C (initApplication):
* src/frontends/GUIRunTime.h: added new function initApplication.
* src/spellchecker.C (sc_accept_word): change to add_to_session.
* src/frontends/GUIRunTime.h: added new function initApplication.
* src/spellchecker.C (sc_accept_word): change to add_to_session.
* src/frontends/gnome/diainsertcitation_callbacks.h
* src/frontends/gnome/diainsertcitation_interface.c
* src/frontends/gnome/diainsertcitation_interface.h
* src/frontends/gnome/diainsertcitation_callbacks.h
* src/frontends/gnome/diainsertcitation_interface.c
* src/frontends/gnome/diainsertcitation_interface.h
* src/frontends/xforms/Menubar_pimpl.C: added two using directives
so that code compiles with DEC cxx.
* src/frontends/xforms/Menubar_pimpl.C: added two using directives
so that code compiles with DEC cxx.
* src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
to work correctly! Also now supports the additional elements
neeeded by natbib.
* src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
to work correctly! Also now supports the additional elements
neeeded by natbib.
* src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
RunDocBook, MenuExport.
* src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
RunDocBook, MenuExport.
* src/commandtags.h
* src/LyXAction.C: Define new lyx-function: buffer-update.
Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
when NEW_EXPORT is defined.
* src/commandtags.h
* src/LyXAction.C: Define new lyx-function: buffer-update.
Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
when NEW_EXPORT is defined.
* src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
* src/buffer.C: up te LYX_FORMAT to 2.17
* src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
* src/buffer.C: up te LYX_FORMAT to 2.17
* src/frontends/gnome/GUIRunTime.C: new file
* src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
* src/frontends/gnome/GUIRunTime.C: new file
* src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
* src/frontends/GUIRunTime.h: removed constructor and destructor,
small change to documetentation.
* src/frontends/GUIRunTime.h: removed constructor and destructor,
small change to documetentation.
* src/frontends/gnome/diainsertindex_interface.h
* src/frontends/gnome/diatoc_interface.h
* src/frontends/gnome/diatoc_interface.c
* src/frontends/gnome/diainsertindex_interface.h
* src/frontends/gnome/diatoc_interface.h
* src/frontends/gnome/diatoc_interface.c
Insert Index dialogs implementation for Gnome frontend
* src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
Insert Index dialogs implementation for Gnome frontend
* src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
* src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
new Pimpl is correct
(runTime): new method calss the real frontends runtime func.
* src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
new Pimpl is correct
(runTime): new method calss the real frontends runtime func.
* src/frontends/GUIRunTime.[Ch]:
* src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
* src/frontends/kde/GUIRunTime_pimpl.[Ch]:
* src/frontends/GUIRunTime.[Ch]:
* src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
* src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/WorkArea.C (work_area_handler): more work to get te
2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/WorkArea.C (work_area_handler): more work to get te
* src/frontends/gnome/diaprint_callbacks.c
* src/frontends/gnome/diaprint_callbacks.h
* src/frontends/gnome/diaprint_interface.c
* src/frontends/gnome/diaprint_callbacks.c
* src/frontends/gnome/diaprint_callbacks.h
* src/frontends/gnome/diaprint_interface.c
* src/frontends/gnome/dialogs/diainserturl.glade
* src/frontends/gnome/FormUrl.C
* src/frontends/gnome/FormUrl.h
* src/frontends/gnome/dialogs/diainserturl.glade
* src/frontends/gnome/FormUrl.C
* src/frontends/gnome/FormUrl.h
* src/frontends/gnome/Makefile.am: added Print, Insert Url and
all other dialogs. Copy all unimplemented dialogs from Xforms
frontend
* src/frontends/gnome/Makefile.am: added Print, Insert Url and
all other dialogs. Copy all unimplemented dialogs from Xforms
frontend
* src/lyx_cb.C: ditto + code from here moved to make
screen-font-update. And people wonder why progress on GUII is
slow. Look at how scattered this stuff was! It takes forever
* src/lyx_cb.C: ditto + code from here moved to make
screen-font-update. And people wonder why progress on GUII is
slow. Look at how scattered this stuff was! It takes forever
* forms/fdfix.sh: Fixup the spacing after commas.
* forms/makefile: Remove date from generated files. Fewer clashes now.
* forms/fdfix.sh: Fixup the spacing after commas.
* forms/makefile: Remove date from generated files. Fewer clashes now.
* src/insets/insetgraphics.C: Changed from using a signal notification
to polling when image is not loaded.
* src/insets/insetgraphics.C: Changed from using a signal notification
to polling when image is not loaded.
* src/frontends/gnome/Menubar_pimpl.C
* src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
implementation: new files
* src/frontends/gnome/Menubar_pimpl.C
* src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
implementation: new files
Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
* src/LyXView.C: calls Menubar::update to update the state
of menu items
* src/frontends/gnome/Makefile.am: added new files
Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
* src/LyXView.C: calls Menubar::update to update the state
of menu items
* src/frontends/gnome/Makefile.am: added new files
* src/frontends/Makefile.am: added frontend compiler options
2000-08-08 Juergen Vigna <jug@sad.it>
* src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
* src/frontends/Makefile.am: added frontend compiler options
2000-08-08 Juergen Vigna <jug@sad.it>
* src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
* src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
documents if exiting without saving.
* src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
documents if exiting without saving.
* src/insets/insetref.[Ch]: strip out large amounts of code.
The inset is now a container and this functionality is now
managed by a new FormRef dialog
* src/insets/insetref.[Ch]: strip out large amounts of code.
The inset is now a container and this functionality is now
managed by a new FormRef dialog
* src/frontends/Dialogs.h (showRef, createRef): new signals
* src/frontends/xforms/FormIndex.[Ch],
* src/frontends/Dialogs.h (showRef, createRef): new signals
* src/frontends/xforms/FormIndex.[Ch],
* development/Code_rules/Rules: more work, added section on
Exceptions, and a References section.
* development/Code_rules/Rules: more work, added section on
Exceptions, and a References section.
(calculate_width_of_column_NMC): fixed return value so that it really
only returns true if the column-width has changed (there where
problems with muliticolumn-cells in this column).
(calculate_width_of_column_NMC): fixed return value so that it really
only returns true if the column-width has changed (there where
problems with muliticolumn-cells in this column).
* src/lastfiles.[Ch] (operator): return string const
* src/buffer.C (parseSingleLyXformat2Token): pass string to
* src/lastfiles.[Ch] (operator): return string const
* src/buffer.C (parseSingleLyXformat2Token): pass string to
better and covering more of the unwritten rules that we have.
* development/Code_rules/Recommendations: a couple of wording
better and covering more of the unwritten rules that we have.
* development/Code_rules/Recommendations: a couple of wording
* src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
c-tors based on InsetCommandParams. Removed others.
* src/insets/insetinclude.[Ch]: ditto
* src/insets/insetlabel.[Ch]: ditto
* src/insets/insetparent.[Ch]: ditto
* src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
* src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
c-tors based on InsetCommandParams. Removed others.
* src/insets/insetinclude.[Ch]: ditto
* src/insets/insetlabel.[Ch]: ditto
* src/insets/insetparent.[Ch]: ditto
* src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
* src/buffer.C (parseSingleLyXformat2Token, readInset): all
insets derived from InsetCommand created using similar c-tors
based on InsetCommandParams
* src/buffer.C (parseSingleLyXformat2Token, readInset): all
insets derived from InsetCommand created using similar c-tors
based on InsetCommandParams
(getFromLyXName): move infotab.end() out of loop.
* config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
(getFromLyXName): move infotab.end() out of loop.
* config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
* src/lyx_gui_misc.C: stripped out old FD_index_form code
* src/lyxfunc.C (dispatch): use signals to insert index entry
* src/lyx_gui_misc.C: stripped out old FD_index_form code
* src/lyxfunc.C (dispatch): use signals to insert index entry
* src/frontends/Dialogs.h: new signal createIndex
* src/frontends/xforms/FormCommand.[Ch],
* src/frontends/Dialogs.h: new signal createIndex
* src/frontends/xforms/FormCommand.[Ch],
* src/frontends/xforms/FormIndex.[Ch],
* src/frontends/xforms/forms/form_index.fd: xforms implementation
of the Index dialog
* src/frontends/xforms/FormIndex.[Ch],
* src/frontends/xforms/forms/form_index.fd: xforms implementation
of the Index dialog
before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/insets/insetref.C (Latex): rewrite so that there is now
2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/insets/insetref.C (Latex): rewrite so that there is now
* src/insets/insetloa.[Ch]: redundant
* src/insets/insetlof.[Ch]: ditto
* src/insets/insetlot.[Ch]: ditto
* src/insets/insetloa.[Ch]: redundant
* src/insets/insetlof.[Ch]: ditto
* src/insets/insetlot.[Ch]: ditto
* src/frontends/xforms/forms/form_url.fd: tweaked!
* src/frontends/xforms/forms/form_citation.fd: ditto
* src/frontends/xforms/forms/form_url.fd: tweaked!
* src/frontends/xforms/forms/form_citation.fd: ditto
2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/translator.h (equal_1st_in_pair::operator()): take
2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/translator.h (equal_1st_in_pair::operator()): take
- * src/insets/insetgraphicsParams.C: add using directive.
- (readResize): change return type to void.
+ * src/insets/insetgraphicsParams.C: add using directive.
+ (readResize): change return type to void.
2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/FormCitation.h: fix conditioning around
2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/frontends/xforms/FormCitation.h: fix conditioning around
* src/frontends/xforms/forms/form_graphics.fd: Added file, the
xforms form definition of the graphics dialog.
* src/frontends/xforms/forms/form_graphics.fd: Added file, the
xforms form definition of the graphics dialog.
* src/frontends/xforms/FormGraphics.C: Added files, the
GUIndependent code of InsetGraphics
* src/frontends/xforms/FormGraphics.C: Added files, the
GUIndependent code of InsetGraphics
* src/insets/insetgraphicsParams.C: Added files, parameter passing
struct between InsetGraphics and GUI.
* src/LaTeXFeatures.h:
* src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
* src/insets/insetgraphicsParams.C: Added files, parameter passing
struct between InsetGraphics and GUI.
* src/LaTeXFeatures.h:
* src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
* src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
way to easily control a radio button group.
2000-07-28 Juergen Vigna <jug@sad.it>
* src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
way to easily control a radio button group.
2000-07-28 Juergen Vigna <jug@sad.it>
(TabularFeatures): added support for lyx-functions of tabular features.
(cellstart): refixed this function after someone wrongly changed it.
(TabularFeatures): added support for lyx-functions of tabular features.
(cellstart): refixed this function after someone wrongly changed it.
checking. NOTE: It seems that pressing ESC to cancel the dialog also
triggers the callback for input checking. As a result we sometimes get
"LyX: This shouldn't happen..." printed to cerr.
checking. NOTE: It seems that pressing ESC to cancel the dialog also
triggers the callback for input checking. As a result we sometimes get
"LyX: This shouldn't happen..." printed to cerr.
2000-07-26 Juergen Vigna <jug@sad.it>
* renamed frontend from gtk to gnome as it is that what is realized
and did the necessary changes in the files.
2000-07-26 Juergen Vigna <jug@sad.it>
* renamed frontend from gtk to gnome as it is that what is realized
and did the necessary changes in the files.
* src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
gettext on the style string right before inserting them into the
* src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
gettext on the style string right before inserting them into the
* src/frontends/gtk/.cvsignore: add MAKEFILE
* src/MenuBackend.C (read): run the label strings through gettext
before storing them in the containers.
* src/frontends/gtk/.cvsignore: add MAKEFILE
* src/MenuBackend.C (read): run the label strings through gettext
before storing them in the containers.
* autogen.sh : generate the ext_l10n.h file here
2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
* autogen.sh : generate the ext_l10n.h file here
2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
function, used as a shortcut.
(create_submenu): align correctly the shortcuts on the widest
entry.
function, used as a shortcut.
(create_submenu): align correctly the shortcuts on the widest
entry.
* src/MenuBackend.h: MenuItem.label() only returns the label of
the menu without shortcut; new method shortcut().
* src/MenuBackend.h: MenuItem.label() only returns the label of
the menu without shortcut; new method shortcut().
MenuItem. Add documentations tags "///", remove empty MenuItem
destructor, remove private default contructor.
MenuItem. Add documentations tags "///", remove empty MenuItem
destructor, remove private default contructor.
(add): return *this
(read): more string mlabel and mname to where they are used
(read): remove unused variables mlabel and mname
(add): return *this
(read): more string mlabel and mname to where they are used
(read): remove unused variables mlabel and mname
- the system have the newest methods. uses AC_CACHE_CHECK
- (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
- (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
+ the system have the newest methods. uses AC_CACHE_CHECK
+ (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
+ (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* Lot of files: add pragma interface/implementation.
2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* Lot of files: add pragma interface/implementation.
* src/lyx_main.C (ReadUFile): new method. Read the UI file.
* lib/ui/default.ui: new file (ans new directory). Contains the
default menu and toolbar.
* src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
* src/lyx_main.C (ReadUFile): new method. Read the UI file.
* lib/ui/default.ui: new file (ans new directory). Contains the
default menu and toolbar.
* src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
* src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
* src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
* src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
* src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
* src/LyXView.h: add a define NEW_MENUBAR (commented out by
default). This replaces old-style menus by new ones.
* src/LyXView.h: add a define NEW_MENUBAR (commented out by
default). This replaces old-style menus by new ones.
* src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
MenuItem. Contain the data structure of a menu.
* src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
MenuItem. Contain the data structure of a menu.
* src/lyxfunc.C (Dispatch): ditto.
* src/LyXView.C (setLayout): new method, which just calls
* src/lyxfunc.C (Dispatch): ditto.
* src/LyXView.C (setLayout): new method, which just calls
* src/frontend/Toolbar.[Ch]: new files. The abstract interface of
the toolbar. It might make sense to merge it with ToolbarDefaults
* src/frontend/Toolbar.[Ch]: new files. The abstract interface of
the toolbar. It might make sense to merge it with ToolbarDefaults
* src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
xforms implementation of the toolbar.
(get_toolbar_func): comment out, since I do not
* src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
xforms implementation of the toolbar.
(get_toolbar_func): comment out, since I do not
* src/ToolbarDefaults.h: Add the ItemType enum.
* src/support/StrPool.[Ch]: new class. Acts as a reference holder
* src/ToolbarDefaults.h: Add the ItemType enum.
* src/support/StrPool.[Ch]: new class. Acts as a reference holder
* src/ToolbarDefaults.C: add include "lyxlex.h"
* files using the old table/tabular: use NEW_TABULAR to control
* src/ToolbarDefaults.C: add include "lyxlex.h"
* files using the old table/tabular: use NEW_TABULAR to control
* src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
to correct place.
* src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
planemet in reading of old style floats, fix the \end_deeper
* src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
to correct place.
* src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
planemet in reading of old style floats, fix the \end_deeper
2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/Makefile.am (INCLUDES): remove image directory from include
2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/Makefile.am (INCLUDES): remove image directory from include
* src/bullet_forms.C (create_form_form_bullet): small cleanup.
* src/bullet_forms_cb.C (BulletPanelCB): ditto.
* src/bullet_forms.C (create_form_form_bullet): small cleanup.
* src/bullet_forms_cb.C (BulletPanelCB): ditto.
* src/LyXView.C (showState): new function. Shows font information
in minibuffer and update toolbar state.
(LyXView): call Toolbar::update after creating the
* src/LyXView.C (showState): new function. Shows font information
in minibuffer and update toolbar state.
(LyXView): call Toolbar::update after creating the
* src/toolbar.C: change toollist to be a vector instead of a
linked list.
(BubbleTimerCB): get help string directly from the callback
* src/toolbar.C: change toollist to be a vector instead of a
linked list.
(BubbleTimerCB): get help string directly from the callback
(set): remove unnecessary ugliness.
(update): new function. update the icons (depressed, disabled)
depending of the status of the corresponding action.
(set): remove unnecessary ugliness.
(update): new function. update the icons (depressed, disabled)
depending of the status of the corresponding action.
* lots of files: apply the NEW_INSETS on all code that will not be
needed when we move to use the new insets. Enable the define in
lyxparagrah.h to try it.
* lots of files: apply the NEW_INSETS on all code that will not be
needed when we move to use the new insets. Enable the define in
lyxparagrah.h to try it.
* src/insets/insettabular.C (cellstart): change to be a static
inline function
(InsetTabular): initialize buffer in the initializer list.
* src/insets/insettabular.C (cellstart): change to be a static
inline function
(InsetTabular): initialize buffer in the initializer list.
* src/commandtags.h: do not include "debug.h" which does not
belong there. #include it in some other places because of this
* src/commandtags.h: do not include "debug.h" which does not
belong there. #include it in some other places because of this
(getPixmap): nuked.
(setPixmap): new function. Loads from disk and sets a pixmap on a
botton; the name of the pixmap file is derived from the command
(getPixmap): nuked.
(setPixmap): new function. Loads from disk and sets a pixmap on a
botton; the name of the pixmap file is derived from the command
* lib/images/*.xbm *_bw.xpm: remove (not used any more).
* lib/images/: move many files from images/banner.xpm.
* lib/images/*.xbm *_bw.xpm: remove (not used any more).
* lib/images/: move many files from images/banner.xpm.
* src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
the spellchecker popup is closed from the WM.
* src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
the spellchecker popup is closed from the WM.
hide() to the inset's hide signal
(show): modified to use fl_set_object_position rather than
fl_set_object_geometry wherever possible
hide() to the inset's hide signal
(show): modified to use fl_set_object_position rather than
fl_set_object_geometry wherever possible
* src/Variables.[Ch]: new files. Intended to be used for language
specific strings (like \chaptername) and filename substitution in
* src/Variables.[Ch]: new files. Intended to be used for language
specific strings (like \chaptername) and filename substitution in
2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
* src/lyx_gui.C (LyXGUI): make sure that the height is large
2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
* src/lyx_gui.C (LyXGUI): make sure that the height is large
* src/support/DebugStream.h: change to make it easier for
doc++ to parse correctly.
* src/support/lyxstring.h: ditto
* src/support/DebugStream.h: change to make it easier for
doc++ to parse correctly.
* src/support/lyxstring.h: ditto
* src/insets/insettext.C (draw): set the status of the bv->text to
CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
* src/insets/insettext.C (draw): set the status of the bv->text to
CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
* src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
citation dialog from main code and placed it in src/frontends/xforms.
Dialog launched through signals instead of callbacks
* src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
citation dialog from main code and placed it in src/frontends/xforms.
Dialog launched through signals instead of callbacks
2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
* src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
* src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
* src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
(TransformChar): Changed to work correctly with Arabic points.
* src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
(TransformChar): Changed to work correctly with Arabic points.
(DocBook): new export methods.
* src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
(DocBook): new export methods.
* src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
- * src/insets/insettext.C (LocalDispatch):
- * src/insets/insetmarginal.h:
- * src/insets/insetlist.h:
- * src/insets/insetfoot.h:
- * src/insets/insetfloat.h:
+ * src/insets/insettext.C (LocalDispatch):
+ * src/insets/insetmarginal.h:
+ * src/insets/insetlist.h:
+ * src/insets/insetfoot.h:
+ * src/insets/insetfloat.h:
* src/insets/insetert.h: add a missing std:: qualifier.
2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/lyxsum.C (sum): '\0' teminate file read when using
* src/insets/insetert.h: add a missing std:: qualifier.
2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/lyxsum.C (sum): '\0' teminate file read when using
* src/lyxfunc.C (Dispatch): cases for new insets/commands
* src/Makefile.am (lyx_SOURCES): add the new files
* src/lyxfunc.C (Dispatch): cases for new insets/commands
* src/Makefile.am (lyx_SOURCES): add the new files
* src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
* src/commandtags.h: ditto
* src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
* src/commandtags.h: ditto
* src/LaTeXFeatures.h: add a std::set of used floattypes
* src/LaTeXFeatures.C (getPackages): add basic support for float.sty
* src/LaTeXFeatures.h: add a std::set of used floattypes
* src/LaTeXFeatures.C (getPackages): add basic support for float.sty
* src/FloatList.[Ch] src/Floating.h: new files
* src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
* src/FloatList.[Ch] src/Floating.h: new files
* src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
* src/lyx_cb.C (TableApplyCB): ditto
* src/text.C: ditto
* src/text2.C: ditto
* src/buffer.C (SimpleLinuxDocOnePar): ditto
(parseSingleLyXformat2Token): ditto + add code for
backwards compability for old float styles + add code for new insets
* src/lyx_cb.C (TableApplyCB): ditto
* src/text.C: ditto
* src/text2.C: ditto
* src/buffer.C (SimpleLinuxDocOnePar): ditto
(parseSingleLyXformat2Token): ditto + add code for
backwards compability for old float styles + add code for new insets
* src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
method
(InsertInset(size_type, Inset *, LyXFont)): new method
* src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
method
(InsertInset(size_type, Inset *, LyXFont)): new method
with a LyXFont(ALL_INHERIT).
(InsetInset(size_type, Inset*)): changed to use InsetChar to
insert the META_INSET.
with a LyXFont(ALL_INHERIT).
(InsetInset(size_type, Inset*)): changed to use InsetChar to
insert the META_INSET.
* src/LyXAction.C: new lyxfunc "set-color".
* src/LColor.[Ch] (setColor): new method to set colors from a lyxname
* src/LyXAction.C: new lyxfunc "set-color".
* src/LColor.[Ch] (setColor): new method to set colors from a lyxname
(UpdateTimerCB): remove
* src/BufferView_pimpl.h: inherit from SigC::Object
* src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
signal instead of callback
(UpdateTimerCB): remove
* src/BufferView_pimpl.h: inherit from SigC::Object
* src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
signal instead of callback
2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/BufferView_pimpl.C: changes because of the one below
* src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/BufferView_pimpl.C: changes because of the one below
* src/screen.[Ch]: Made the lyxscreen take LyXText as argument
* src/vspace.C (nextToken): use stringfunctions instead of sscanf.
* src/insets/insettext.C (SetParagraphData):
* src/vspace.C (nextToken): use stringfunctions instead of sscanf.
* src/insets/insettext.C (SetParagraphData):
to work around a bug with the Makefiles when doing ``make lyxrpm''.
This should be fine, however, since we generally don't want to be
verbose when making an RPM.
to work around a bug with the Makefiles when doing ``make lyxrpm''.
This should be fine, however, since we generally don't want to be
verbose when making an RPM.
2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
* lib/scripts/fig2pstex.py: New file
2000-06-16 Juergen Vigna <jug@sad.it>
2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
* lib/scripts/fig2pstex.py: New file
2000-06-16 Juergen Vigna <jug@sad.it>
* src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
(LocalDispatch): Changed all functions to use LyXText.
* src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
(LocalDispatch): Changed all functions to use LyXText.
* src/insets/insettabular.C (update): added implementation
* src/insets/lyxinset.h: added update function
* src/insets/insettabular.C (update): added implementation
* src/insets/lyxinset.h: added update function
* src/text.C (SelectNextWord): protect against null pointers with
old-style string streams. (fix from Paul Theo Gonciari
* src/text.C (SelectNextWord): protect against null pointers with
old-style string streams. (fix from Paul Theo Gonciari
* src/insets/ExternalTemplate.C: add a "using" directive.
* src/lyx_main.h: remove the act_ struct, which seems unused
* src/insets/ExternalTemplate.C: add a "using" directive.
* src/lyx_main.h: remove the act_ struct, which seems unused
* src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
and the Dispatch methods that used it.
* src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
and the Dispatch methods that used it.
* src/LString.h: JMarc's <string> header fix
* src/PrinterParams.h: Used string for most data to remove some
* src/LString.h: JMarc's <string> header fix
* src/PrinterParams.h: Used string for most data to remove some
appending the ints to a string for output.
* src/buffer.C (Dispatch): Added a couple of braces to fix an error
appending the ints to a string for output.
* src/buffer.C (Dispatch): Added a couple of braces to fix an error
* src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
extern "C" callback instead of static member functions. Hopefully,
* src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
extern "C" callback instead of static member functions. Hopefully,
forms/form_copyright.fd yet. Breaking one of my own rules already.
* src/commandtags.h: New xtl-based LFUN's no description in LyXAction
forms/form_copyright.fd yet. Breaking one of my own rules already.
* src/commandtags.h: New xtl-based LFUN's no description in LyXAction
install and uninstall all work even if builddir != srcdir. Still
have a new sigc++ minidist update to come.
install and uninstall all work even if builddir != srcdir. Still
have a new sigc++ minidist update to come.
* config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
Many mods to get builddir != srcdir working.
* config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
Many mods to get builddir != srcdir working.
* sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
for building on NT and so we can do the builddir != srcdir stuff.
* sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
for building on NT and so we can do the builddir != srcdir stuff.
system supplied library compilation.
* sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
system supplied library compilation.
* sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
- Added a 'mini' distribution of libsigc++. If you feel the urge to
- change something in these directories - Resist it. If you can't
+ Added a 'mini' distribution of libsigc++. If you feel the urge to
+ change something in these directories - Resist it. If you can't
resist the urge then you should modify the following script and rebuild
the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
all happen. Still uses a hacked version of libsigc++'s configure.in.
I'm quite happy with the results. I'm not sure the extra work to turn
the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
resist the urge then you should modify the following script and rebuild
the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
all happen. Still uses a hacked version of libsigc++'s configure.in.
I'm quite happy with the results. I'm not sure the extra work to turn
the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
headaches.
I haven't tested the following important make targets: install, dist.
Not ready for prime time but very close. Maybe 1.1.5.
headaches.
I haven't tested the following important make targets: install, dist.
Not ready for prime time but very close. Maybe 1.1.5.
* src/support/LSubstring.C (operator): simplify
* src/lyxtext.h: removed bparams, use buffer_->params instead
* src/support/LSubstring.C (operator): simplify
* src/lyxtext.h: removed bparams, use buffer_->params instead
* src/lyxrow.h: make Row a real class, move all variables to
private and use accessors.
* src/lyxrow.h: make Row a real class, move all variables to
private and use accessors.
(SimpleTeXOneTablePar): ditto
(TeXContTableRows): ditto
(SimpleTeXSpecialChars): ditto
(SimpleTeXOneTablePar): ditto
(TeXContTableRows): ditto
(SimpleTeXSpecialChars): ditto
* src/lyxcursor.h: make LyXCursor a real class, move all variables
to private and use accessors.
* src/lyxcursor.h: make LyXCursor a real class, move all variables
to private and use accessors.
(beforeChange): change for new timer
* src/BufferView.h (cursorToggleCB): removed last paramter because
(beforeChange): change for new timer
* src/BufferView.h (cursorToggleCB): removed last paramter because
* lib/reLyX/configure.in (VERSION): avoid using a previously
generated reLyX wrapper to find out $prefix.
* lib/reLyX/configure.in (VERSION): avoid using a previously
generated reLyX wrapper to find out $prefix.
* lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
translation of the Tutorial (Dooteo)
* lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
translation of the Tutorial (Dooteo)
2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
Do not call to SetCursor when the paragraph is a closed footnote!
2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
Do not call to SetCursor when the paragraph is a closed footnote!
2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
the math panels when switching buffers (unless new buffer is readonly).
* src/BufferView.C (NoSavedPositions)
the math panels when switching buffers (unless new buffer is readonly).
* src/BufferView.C (NoSavedPositions)
2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfunc.C (doImportHelper): do not create the file before
2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfunc.C (doImportHelper): do not create the file before
(doImportASCIIasLines): create a new file before doing the insert.
(doImportASCIIasParagraphs): ditto.
(doImportASCIIasLines): create a new file before doing the insert.
(doImportASCIIasParagraphs): ditto.
* src/lyx_gui.C: remove all the color-related ressources, which
are not used anymore.
* src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
* src/lyx_gui.C: remove all the color-related ressources, which
are not used anymore.
* src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
* src/text2.C (InsertStringA): Fix a bug with insertion into table
2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
* src/text2.C (InsertStringA): Fix a bug with insertion into table
* src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
text is Hebrew.
2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
* src/text.C (draw): draw bars under foreign language words.
* src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
text is Hebrew.
2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
* src/text.C (draw): draw bars under foreign language words.
* src/bufferview_funcs.C (ToggleAndShow): ditto
2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/bufferview_funcs.C (ToggleAndShow): ditto
2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
is done in all other functions, and seems reasonable.
(DeleteWordForward): do not jump over non-word stuff, since
CursorRightOneWord() already does it.
is done in all other functions, and seems reasonable.
(DeleteWordForward): do not jump over non-word stuff, since
CursorRightOneWord() already does it.
Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
DeleteWordBackward, since they seem safe to me (since selection is
set to "true") DeleteEmptyParagraphMechanism does nothing.
Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
DeleteWordBackward, since they seem safe to me (since selection is
set to "true") DeleteEmptyParagraphMechanism does nothing.
* src/menus.C (Add_to_toc_menu): Limit the number of popups, and
the number of items per popup.
(Add_to_refs_menu): Ditto.
* src/menus.C (Add_to_toc_menu): Limit the number of popups, and
the number of items per popup.
(Add_to_refs_menu): Ditto.
2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxparagraph.h: renamed ClearParagraph() to
2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxparagraph.h: renamed ClearParagraph() to
* src/insets/insettabular.C (TabularFeatures): added missing features.
* src/tabular.C (DeleteColumn):
* src/insets/insettabular.C (TabularFeatures): added missing features.
* src/tabular.C (DeleteColumn):
* src/ColorHandler.C (getGCForeground): put more test into _()
* lib/examples/eu_splash.lyx: new file (Basque translation) from
* src/ColorHandler.C (getGCForeground): put more test into _()
* lib/examples/eu_splash.lyx: new file (Basque translation) from
* layouts/hollywood.layout, broadway.layout : move Dialogue to top
of list, change all references to Environment to Command
* layouts/hollywood.layout, broadway.layout : move Dialogue to top
of list, change all references to Environment to Command
\uppercase to interiorshot and exteriorshot to force uppecase.
* tex/broadway.cls : rewrite environments as commands. Tweak
whitespace.
\uppercase to interiorshot and exteriorshot to force uppecase.
* tex/broadway.cls : rewrite environments as commands. Tweak
whitespace.
* src/BufferView2.C (ChangeRefs): New method.
* src/buffer.C (getLabelList): New method. It replaces the old
* src/BufferView2.C (ChangeRefs): New method.
* src/buffer.C (getLabelList): New method. It replaces the old
string.
* src/insets/insetinclude.C (getLabelList): New method. Replaces
the old getLabel() and GetNumberOfLabels() methods.
* src/insets/insetlabel.C (getLabelList): ditto
* src/mathed/formula.C (getLabelList): ditto
string.
* src/insets/insetinclude.C (getLabelList): New method. Replaces
the old getLabel() and GetNumberOfLabels() methods.
* src/insets/insetlabel.C (getLabelList): ditto
* src/mathed/formula.C (getLabelList): ditto
* src/paragraph.C (String): New method.
* src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
* src/paragraph.C (String): New method.
* src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
- Uses the new getTocList() method.
- TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
+ Uses the new getTocList() method.
+ TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
which automatically updates the contents of the browser.
(RefUpdateCB): Use the new getLabelList method.
* src/lyxfunc.C (Dispatch): Give an error if the label is not found.
which automatically updates the contents of the browser.
(RefUpdateCB): Use the new getLabelList method.
* src/lyxfunc.C (Dispatch): Give an error if the label is not found.
* src/BufferView2.C (gotoLabel) Use the new getLabelList method.
* src/spellchecker.C: Added using std::reverse;
* src/BufferView2.C (gotoLabel) Use the new getLabelList method.
* src/spellchecker.C: Added using std::reverse;
more options on scene numbering and less whitespace (from Garst)
* src/insets/insetbib.C (getKeys): make sure that we are in the
more options on scene numbering and less whitespace (from Garst)
* src/insets/insetbib.C (getKeys): make sure that we are in the
(draw): fixed cursor position and drawing so that the cursor is
visible when before the tabular-inset.
(draw): fixed cursor position and drawing so that the cursor is
visible when before the tabular-inset.
2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
* src/lyxfunc.C: changed all places where insertInset was used so
that now if it couldn't be inserted it is deleted!
* src/lyxfunc.C: changed all places where insertInset was used so
that now if it couldn't be inserted it is deleted!
* src/TableLayout.C: added support for new tabular-inset!
* src/BufferView2.C (insertInset): this now returns a bool if the
inset was really inserted!!!
* src/TableLayout.C: added support for new tabular-inset!
* src/BufferView2.C (insertInset): this now returns a bool if the
inset was really inserted!!!
* src/mathed/formula.C (Read): read also the \end_inset here!
2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
* src/mathed/formula.C (Read): read also the \end_inset here!
2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
- * src/buffer.C (makeLaTeXFile): Always add "american" to
- the UsedLanguages list if document language is RTL.
+ * src/buffer.C (makeLaTeXFile): Always add "american" to
+ the UsedLanguages list if document language is RTL.
* src/lyxlookup.C (isDeadEvent): use a switch statement instead of
a chain of "if". Return false when deadkeys are not handled.
* src/lyxlookup.C (isDeadEvent): use a switch statement instead of
a chain of "if". Return false when deadkeys are not handled.
* src/lyx_main.C (LyX): adapted the code for default bindings.
* src/kbmap.C (defaultKeyBindings): new method. Performs the default
bindings for basic functionality (except deadkeys).
(deadKeyBindings): new method. Performs the bindings of deadkeys.
* src/lyx_main.C (LyX): adapted the code for default bindings.
* src/kbmap.C (defaultKeyBindings): new method. Performs the default
bindings for basic functionality (except deadkeys).
(deadKeyBindings): new method. Performs the bindings of deadkeys.
several methods: handle override_x_deadkeys.
* src/lyxrc.h: remove the "bindings" map, which did not make much
sense anyway. New variable override_x_deadkeys, defaulting to "true".
several methods: handle override_x_deadkeys.
* src/lyxrc.h: remove the "bindings" map, which did not make much
sense anyway. New variable override_x_deadkeys, defaulting to "true".
2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfont.C (stateText): use a saner method to determine
whether the font is "default". Seems to fix the crash with DEC
2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfont.C (stateText): use a saner method to determine
whether the font is "default". Seems to fix the crash with DEC
* src/text.C (draw): do not display an exclamation mark in the
margin for margin notes. This is confusing, ugly and
* src/text.C (draw): do not display an exclamation mark in the
margin for margin notes. This is confusing, ugly and
2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
* src/text.C (GetVisibleRow): Improved drawing of vertical lines
2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
* src/text.C (GetVisibleRow): Improved drawing of vertical lines
frame, and outside the frame.
* src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
frame, and outside the frame.
* src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/insets/insetspecialchar.C (Read): allow command == '~' for
2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/insets/insetspecialchar.C (Read): allow command == '~' for
* src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
* src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
* src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
* src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
* src/insets/figinset.C (various): Use IsFileReadable() to make
sure that the file actually exist. Relying on ghostscripts errors
* src/insets/figinset.C (various): Use IsFileReadable() to make
sure that the file actually exist. Relying on ghostscripts errors
2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
* intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
* intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
* src/menus.C: revert the change of naming (Figure->Graphic...)
from 2000-04-11. It was incomplete and bad.
* src/menus.C: revert the change of naming (Figure->Graphic...)
from 2000-04-11. It was incomplete and bad.
(DrawOneRow): change second arg to long (from long &)
(screen_refresh_y): remove var
(scree_refresh_row): ditto
(DrawOneRow): change second arg to long (from long &)
(screen_refresh_y): remove var
(scree_refresh_row): ditto
* src/lyxrow.h: change baseline to usigned int from unsigned
short, this brings some implicit/unsigned issues out in the open.
* src/lyxrow.h: change baseline to usigned int from unsigned
short, this brings some implicit/unsigned issues out in the open.
* src/lyxtext.h src/text.C src/text2.C: removed support for the
currentrow, currentrow_y optimization. This did not help a lot and
if we want to do this kind of optimization we should rather use
* src/lyxtext.h src/text.C src/text2.C: removed support for the
currentrow, currentrow_y optimization. This did not help a lot and
if we want to do this kind of optimization we should rather use
* src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
buffer spacing and klyx spacing support.
* src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
buffer spacing and klyx spacing support.
* src/buffer.C (writeFileAscii,RoffAsciiTable)
* src/paragraph.C (RoffContTableRows): Use the Ascii() methods
instead of Latex()
* src/text2.C (ToggleFree): Disabled implicit word selection when
there is a change in the language
* src/buffer.C (writeFileAscii,RoffAsciiTable)
* src/paragraph.C (RoffContTableRows): Use the Ascii() methods
instead of Latex()
* src/text2.C (ToggleFree): Disabled implicit word selection when
there is a change in the language
* src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
no output was generated for end-of-sentence inset.
* src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
no output was generated for end-of-sentence inset.
(copySelection): Fixed with selection from right to left.
(draw): now the rows are not recalculated at every draw.
(computeTextRows): for now reset the inset-owner here (this is
(copySelection): Fixed with selection from right to left.
(draw): now the rows are not recalculated at every draw.
(computeTextRows): for now reset the inset-owner here (this is
* src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
Changed parameters of various functions and added LockInsetInInset().
* src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
Changed parameters of various functions and added LockInsetInInset().
- * src/insets/insetcollapsable.h:
- * src/insets/insetcollapsable.C:
- * src/insets/insetfoot.h:
- * src/insets/insetfoot.C:
- * src/insets/insetert.h:
+ * src/insets/insetcollapsable.h:
+ * src/insets/insetcollapsable.C:
+ * src/insets/insetfoot.h:
+ * src/insets/insetfoot.C:
+ * src/insets/insetert.h:
* src/insets/lyxinset.h: inserted inset_owner and some more changes so
that insets in insets are supported right.
* src/insets/lyxinset.h: inserted inset_owner and some more changes so
that insets in insets are supported right.
* src/table.C: lots of changes for use with inset tabular (and cleanup)
* src/paragraph.C: some small fixes
* src/table.C: lots of changes for use with inset tabular (and cleanup)
* src/paragraph.C: some small fixes
* src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
* src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
* src/LyXAction.C: insert code for InsetTabular.
* src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
* src/LyXAction.C: insert code for InsetTabular.
* src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
* NEWS: updated for prerelease of 1.1.5. Please comment and send
patches for things that should be in or should be changed.
* src/* [insetfiles]: change "usigned char fragile" to bool
fragile. There was only one point that could that be questioned
and that is commented in formulamacro.C. Grep for "CHECK".
* NEWS: updated for prerelease of 1.1.5. Please comment and send
patches for things that should be in or should be changed.
* src/* [insetfiles]: change "usigned char fragile" to bool
fragile. There was only one point that could that be questioned
and that is commented in formulamacro.C. Grep for "CHECK".
* src/CutAndPaste.C (getBufferTextClass): unused func, removed.
(DeleteBuffer): take it out of CutAndPaste and make it static.
* src/CutAndPaste.C (getBufferTextClass): unused func, removed.
(DeleteBuffer): take it out of CutAndPaste and make it static.
2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/lyx_cb.[Ch]: made several functions take a BufferView* arg
2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/lyx_cb.[Ch]: made several functions take a BufferView* arg
* src/paragraph.C (writeFile): output the spacing parameter too.
(validate): set the correct features if spacing is used in the
* src/paragraph.C (writeFile): output the spacing parameter too.
(validate): set the correct features if spacing is used in the
(Clear): set spacing to default
(MakeSameLayout): spacing too
(HasSameLayout): spacing too
(Clear): set spacing to default
(MakeSameLayout): spacing too
(HasSameLayout): spacing too
* src/lyxserver.C (callback): fix dispatch of functions
* src/insets/insetlatexaccent.C (checkContents): turn bogus
* src/lyxserver.C (callback): fix dispatch of functions
* src/insets/insetlatexaccent.C (checkContents): turn bogus
* src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
"Table" to "Table Box", "Float" to "Floating Material"; deletes
* src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
"Table" to "Table Box", "Float" to "Floating Material"; deletes
2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
documented the change so that the workaround can be nuked later.
2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
documented the change so that the workaround can be nuked later.
* src/lyxlex_pimpl.C (next): do not re-declare the default value
of arguments.
* src/buffer.C (getLatexName): ditto
* src/lyxlex_pimpl.C (next): do not re-declare the default value
of arguments.
* src/buffer.C (getLatexName): ditto
* src/lyx_cb.C (DocumentApplyCB): When changing the language of the
document, the language of existing text is changed (unless the
document is multi-lingual)
* src/lyx_cb.C (DocumentApplyCB): When changing the language of the
document, the language of existing text is changed (unless the
document is multi-lingual)
* src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
* A lot of files: A rewrite of the Right-to-Left support.
* src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
* A lot of files: A rewrite of the Right-to-Left support.
Cloned insets.
(init): now set the inset_owner in paragraph.C
(LocalDispatch): added some resetPos() in the right position
Cloned insets.
(init): now set the inset_owner in paragraph.C
(LocalDispatch): added some resetPos() in the right position
(pasteSelection): changed to use the new CutAndPaste-Class.
* src/insets/lyxinset.h: inserted new function InsertInsetAllowed
(pasteSelection): changed to use the new CutAndPaste-Class.
* src/insets/lyxinset.h: inserted new function InsertInsetAllowed
(PasteSelection): redone (also with #ifdef) so that now this uses
the CutAndPaste-Class.
(SwitchLayoutsBetweenClasses): removed here and implemented in the
CutAndPaste-Class.
(PasteSelection): redone (also with #ifdef) so that now this uses
the CutAndPaste-Class.
(SwitchLayoutsBetweenClasses): removed here and implemented in the
CutAndPaste-Class.
may happen that an inset is not inserted in the paragraph.
(InsertInsetAllowed): this checks if it is allowed to insert an
inset in this paragraph.
may happen that an inset is not inserted in the paragraph.
(InsertInsetAllowed): this checks if it is allowed to insert an
inset in this paragraph.
* src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
functions from BufferView to BufferView::Pimpl to ease maintence.
* src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
functions from BufferView to BufferView::Pimpl to ease maintence.
* src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
correctly. Also use SetCursorIntern instead of SetCursor.
* src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
correctly. Also use SetCursorIntern instead of SetCursor.
ptrdiff_t. Add std:: modifiers to streams.
* src/font.C: include the <cctype> header, for islower() and
ptrdiff_t. Add std:: modifiers to streams.
* src/font.C: include the <cctype> header, for islower() and
2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/font.[Ch]: new files. Contains the metric functions for
fonts, takes a LyXFont as parameter. Better separation of concepts.
2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/font.[Ch]: new files. Contains the metric functions for
fonts, takes a LyXFont as parameter. Better separation of concepts.
2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/*.h: removed all use of "using" from header files use
2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/*.h: removed all use of "using" from header files use
* src/text.C (Backspace): Small fix for the a | a Backspace problem
2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
* src/text.C (Backspace): Small fix for the a | a Backspace problem
2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/text.C (Backspace): hopefully fix the dreaded backaspace
2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/text.C (Backspace): hopefully fix the dreaded backaspace
* src/BufferView.C (checkInsetHit): Now hopefully fixed all the
problems with clicking on insets (last famous words ;)
* src/BufferView.C (checkInsetHit): Now hopefully fixed all the
problems with clicking on insets (last famous words ;)
(width): Changed to have a bit of space before and after the inset so
that the blinking cursor can be seen (otherwise it was hidden)
(width): Changed to have a bit of space before and after the inset so
that the blinking cursor can be seen (otherwise it was hidden)
* src/FontLoader.C: sensible defaults if no fonts are needed
* src/lyx_cb.C: New function ShowMessage (writes either to the
* src/FontLoader.C: sensible defaults if no fonts are needed
* src/lyx_cb.C: New function ShowMessage (writes either to the
* lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
define the additional title elements and then include
* lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
define the additional title elements and then include
* src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
file would be imported at start, if the filename where of a sgml file.
* src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
* src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
file would be imported at start, if the filename where of a sgml file.
* src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
* src/lyxfont.h Replaced the member variable bits.direction by the
member variable lang. Made many changes in other files.
2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
* src/lyxfont.h Replaced the member variable bits.direction by the
member variable lang. Made many changes in other files.
format for Hebrew documents)
* src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
format for Hebrew documents)
* src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
will cause entering into mathmode.
If auto_mathmode is "rtl" then this behavior will be active only
when writing right-to-left text.
will cause entering into mathmode.
If auto_mathmode is "rtl" then this behavior will be active only
when writing right-to-left text.
* src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
also initialize the toplevel_keymap with the default bindings from
* src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
also initialize the toplevel_keymap with the default bindings from
* src/buffer.C (Buffer): remove lyxrc from the parameters.
* all files using lyxrc: have lyxrc as a real variable and not a
pointer. remove all extern LyXRC * lyxrc. The equiv to this is
done in lyxrc.h.
* src/buffer.C (Buffer): remove lyxrc from the parameters.
* all files using lyxrc: have lyxrc as a real variable and not a
pointer. remove all extern LyXRC * lyxrc. The equiv to this is
done in lyxrc.h.
* src/lyxrc.C: remove double call to defaultKeyBindings
* src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
toolbar defauls using lyxlex. Remove enums, structs, functions
* src/lyxrc.C: remove double call to defaultKeyBindings
* src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
toolbar defauls using lyxlex. Remove enums, structs, functions
* src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
toolbar defaults. Also store default keybindings in a map.
* src/ToolbarDefaults.[Ch]: New file. This class is used for
* src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
toolbar defaults. Also store default keybindings in a map.
* src/ToolbarDefaults.[Ch]: New file. This class is used for
* src/language.[Ch]: New files. Used for holding the information
about each language. Now! Use this new language map enhance it and
* src/language.[Ch]: New files. Used for holding the information
about each language. Now! Use this new language map enhance it and
* screen.C (ShowCursor): Removed duplicate code.
(ShowManualCursor): Support for 3 cursor shapes: Bar (default),
L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
* screen.C (ShowCursor): Removed duplicate code.
(ShowManualCursor): Support for 3 cursor shapes: Bar (default),
L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
* All files with a USE_OSTREAM_ONLY within: removed all code that
was unused when USE_OSTREAM_ONLY is defined.
* All files with a USE_OSTREAM_ONLY within: removed all code that
was unused when USE_OSTREAM_ONLY is defined.
* src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
of any less. Removed header and using.
* src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
of any less. Removed header and using.
* src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
know it is right to return InsetFoot* too, but cxx does not like
* src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
know it is right to return InsetFoot* too, but cxx does not like
(Latex): Add free_spacing boolean to inset::Latex()
* src/mathed/formula.h (Latex): Added free_spacing boolean arg.
(Latex): Add free_spacing boolean to inset::Latex()
* src/mathed/formula.h (Latex): Added free_spacing boolean arg.
* src/insets/lyxinset.h: Changed definition of the inset::Latex()
virtual function to include the free_spacing boolean from
the containing paragraph's style.
* src/insets/inseturl.C, src/insets/inseturl.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/lyxinset.h: Changed definition of the inset::Latex()
virtual function to include the free_spacing boolean from
the containing paragraph's style.
* src/insets/inseturl.C, src/insets/inseturl.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insettext.C, src/insets/insettext.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insettext.C, src/insets/insettext.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
Added free_spacing boolean and made sure that if in a free_spacing
paragraph, that we output normal space if there is a protected space.
* src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
Added free_spacing boolean and made sure that if in a free_spacing
paragraph, that we output normal space if there is a protected space.
* src/insets/insetref.C, src/insets/insetref.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetref.C, src/insets/insetref.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetparent.C, src/insets/insetparent.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetparent.C, src/insets/insetparent.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/inseterror.C, src/insets/inseterror.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/inseterror.C, src/insets/inseterror.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
Added free_spacing boolean arg to match inset.h
* src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
free_spacing boolean arg to match inset.h
* src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
free_spacing boolean arg to match inset.h
* src/insets/figinset.C, src/insets/figinset.h (Latex): Added
free_spacing boolean arg to match inset.h
* src/insets/figinset.C, src/insets/figinset.h (Latex): Added
free_spacing boolean arg to match inset.h
* src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
ignore free_spacing paragraphs. The user's spaces are left
* src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
ignore free_spacing paragraphs. The user's spaces are left
* src/text.C (InsertChar): Fixed the free_spacing layout
attribute behavior. Now, if free_spacing is set, you can
add multiple spaces in a paragraph with impunity (and they
get output verbatim).
(SelectSelectedWord): Added dummy argument to inset::Latex()
call.
* src/text.C (InsertChar): Fixed the free_spacing layout
attribute behavior. Now, if free_spacing is set, you can
add multiple spaces in a paragraph with impunity (and they
get output verbatim).
(SelectSelectedWord): Added dummy argument to inset::Latex()
call.
* src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
paragraph layouts now only input a simple space instead.
Special character insets don't make any sense in free-spacing
paragraphs.
* src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
paragraph layouts now only input a simple space instead.
Special character insets don't make any sense in free-spacing
paragraphs.
* src/buffer.C (parseSingleLyXformat2Token): Code to convert
hard-spaces in the *input* file to simple spaces if the layout
is free-spacing. This converts old files which had to have
* src/buffer.C (parseSingleLyXformat2Token): Code to convert
hard-spaces in the *input* file to simple spaces if the layout
is free-spacing. This converts old files which had to have
reworked inset::Latex(...) methods. The inset::Latex() code
ensures that hard-spaces in free-spacing paragraphs get output
as spaces (rather than "~").
reworked inset::Latex(...) methods. The inset::Latex() code
ensures that hard-spaces in free-spacing paragraphs get output
as spaces (rather than "~").
* src/mathed/math_delim.C (draw): draw the empty placeholder
delims with a onoffdash line.
(struct math_deco_compare): struct that holds the "functors" used
for the sort and the binary search in math_deco_table.
(class init_deco_table): class used for initial sort of the
* src/mathed/math_delim.C (draw): draw the empty placeholder
delims with a onoffdash line.
(struct math_deco_compare): struct that holds the "functors" used
for the sort and the binary search in math_deco_table.
(class init_deco_table): class used for initial sort of the
* src/lyxlex.C (printTable): changed to take a ostream as paramter
and to not flush the stream as often as it used to.
* src/lyxlex.C (printTable): changed to take a ostream as paramter
and to not flush the stream as often as it used to.
(sorted): template function used for checking if a sequence is
sorted or not. Two versions with and without user supplied
compare. Uses same compare as std::sort.
(sorted): template function used for checking if a sequence is
sorted or not. Two versions with and without user supplied
compare. Uses same compare as std::sort.
* src/support/lyxmanip.h: rewrite the newlineanDepth ostream
manipulator to use a scheme that does not require library support.
This is also the way it is done in the new GNU libstdc++. Should
* src/support/lyxmanip.h: rewrite the newlineanDepth ostream
manipulator to use a scheme that does not require library support.
This is also the way it is done in the new GNU libstdc++. Should
2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/mathed/math_inset.h (Write(ostream & os): add a space at the
2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/mathed/math_inset.h (Write(ostream & os): add a space at the
* src/mathed (all files concerned with file writing): apply the
USE_OSTREAM_ONLY changes to mathed too.
* src/mathed (all files concerned with file writing): apply the
USE_OSTREAM_ONLY changes to mathed too.
* src/support/DebugStream.h: make the constructor explicit.
* src/lyxfont.C (latexWriteStartChanges): small bug related to
* src/support/DebugStream.h: make the constructor explicit.
* src/lyxfont.C (latexWriteStartChanges): small bug related to
stringstreams. mathed output is still not adapted to iostreams.
This change can be turned off by commenting out all the occurences
of the "#define USE_OSTREAM_ONLY 1" lines.
stringstreams. mathed output is still not adapted to iostreams.
This change can be turned off by commenting out all the occurences
of the "#define USE_OSTREAM_ONLY 1" lines.
* src/WorkArea.C (createPixmap): don't output debug messages.
(WorkArea): don't output debug messages.
* lib/lyxrc.example: added a comment about the new variable
* src/WorkArea.C (createPixmap): don't output debug messages.
(WorkArea): don't output debug messages.
* lib/lyxrc.example: added a comment about the new variable
* development/Code_rules/Rules: Added some more commente about how
to build class interfaces and on how better encapsulation can be
* development/Code_rules/Rules: Added some more commente about how
to build class interfaces and on how better encapsulation can be
* all insets and some code that use them: I have conditionalized
removed the Latex(string & out, ...) this means that only the
Latex(ostream &, ...) will be used. This is a work in progress to
* all insets and some code that use them: I have conditionalized
removed the Latex(string & out, ...) this means that only the
Latex(ostream &, ...) will be used. This is a work in progress to
* src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
directly instead of going through a func. One very bad thing: a
* src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
directly instead of going through a func. One very bad thing: a
* src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
string instead of char[]. Also changed to static.
* src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
string instead of char[]. Also changed to static.
* src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
current_view and global variables. both classes has changed names
and LyXFindReplace is not inherited from SearchForm.
* src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
current_view and global variables. both classes has changed names
and LyXFindReplace is not inherited from SearchForm.
2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
* some things that I should comment but the local pub says head to
2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
* some things that I should comment but the local pub says head to
* src/LyXView.C: use correct type for global variable
current_layout. (LyXTextClass::size_type)
* some code to get the new insetgraphics closer to working I'd be
grateful for any help.
* src/LyXView.C: use correct type for global variable
current_layout. (LyXTextClass::size_type)
* some code to get the new insetgraphics closer to working I'd be
grateful for any help.
* src/BufferView2.C (insertInset): use the return type of
NumberOfLayout properly. (also changes in other files)
* src/BufferView2.C (insertInset): use the return type of
NumberOfLayout properly. (also changes in other files)
with out using protected spaces or multiple hfills. Now it is
"label" for left justified, "\hfill label\hfill" for center, and
"\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
with out using protected spaces or multiple hfills. Now it is
"label" for left justified, "\hfill label\hfill" for center, and
"\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
* lib/lyxrc.example: fix description of \date_insert_format
* lib/layouts/llncs.layout: new layout, contributed by Martin
* lib/lyxrc.example: fix description of \date_insert_format
* lib/layouts/llncs.layout: new layout, contributed by Martin
2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/insettext.C (LocalDispatch): remove extra break
2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/insets/insettext.C (LocalDispatch): remove extra break
* src/insets/insetert.[Ch] (Clone): change return value to Inset*
* src/insets/insettext.[Ch] (Clone): change return value to Inset*
* src/insets/insetert.[Ch] (Clone): change return value to Inset*
* src/insets/insettext.[Ch] (Clone): change return value to Inset*
* src/bufferlist.[Ch] (updateInset): remove func, not needed.
* several files: use the new interface to the "updateinsetlist"
* src/bufferlist.[Ch] (updateInset): remove func, not needed.
* several files: use the new interface to the "updateinsetlist"
* src/WorkArea.C (work_area_handler): call BufferView::doubleClick
on doubleclick.
(work_area_handler): call BufferView::trippleClick on trippleclick.
* src/BufferView.C (doubleClick): new function, selects word on
* src/WorkArea.C (work_area_handler): call BufferView::doubleClick
on doubleclick.
(work_area_handler): call BufferView::trippleClick on trippleclick.
* src/BufferView.C (doubleClick): new function, selects word on
(trippleClick): new function, selects line on trippleclick.
2000-02-22 Allan Rae <rae@lyx.org>
(trippleClick): new function, selects line on trippleclick.
2000-02-22 Allan Rae <rae@lyx.org>
* src/bufferparams.C (getDocumentDirection): move this function
here from text.C
* src/paragraph.C (getParDirection): move this function here from
* src/bufferparams.C (getDocumentDirection): move this function
here from text.C
* src/paragraph.C (getParDirection): move this function here from
2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
* WorkArea, Painter, LyXScreen: Fixed the crash that occured on
resize due to wrong pixmap beeing used. Also took the opurtunity
to make the LyXScreen stateless on regard to WorkArea and some
general cleanup in the same files.
2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
* WorkArea, Painter, LyXScreen: Fixed the crash that occured on
resize due to wrong pixmap beeing used. Also took the opurtunity
to make the LyXScreen stateless on regard to WorkArea and some
general cleanup in the same files.
2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/Makefile.am: add missing direction.h
* src/PainterBase.h: made the width functions const.
2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/Makefile.am: add missing direction.h
* src/PainterBase.h: made the width functions const.
* src/insets/insetcommand.C (draw): draw Editable as buttons.
* src/insets/insetlatexaccent.C (draw): make the accents draw
better, at present this will only work well with iso8859-1.
* src/insets/insetcommand.C (draw): draw Editable as buttons.
* src/insets/insetlatexaccent.C (draw): make the accents draw
better, at present this will only work well with iso8859-1.
workarea. (Code that are not active when NEW_WA is defined.)
* Make the uses of XSync not conditionalized on define USE_XSYNC.
workarea. (Code that are not active when NEW_WA is defined.)
* Make the uses of XSync not conditionalized on define USE_XSYNC.
2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
* lib/lyxrc.example: document \view_dvi_paper_option
* src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
* lib/lyxrc.example: document \view_dvi_paper_option
* src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
* src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
char const *, int, LyXFont)
* src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
char const *, int, LyXFont)
- (text(int, int, string, LyXFont)): ditto
+ (text(int, int, string, LyXFont)): ditto
* src/text.C src/mathed/math_cursor.C: nailed and fixed the
drawing of mathframe, hfills, protected space, table lines. I have
* src/text.C src/mathed/math_cursor.C: nailed and fixed the
drawing of mathframe, hfills, protected space, table lines. I have
2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/PainterBase.C (ellipse, circle): do not specify the default
2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/PainterBase.C (ellipse, circle): do not specify the default
with USE_PAINTER defined (do this in config.h f.ex.) There are
still some rought edges, and I'd like some help to clear those
out. It looks stable (loads and displays the Userguide very well).
with USE_PAINTER defined (do this in config.h f.ex.) There are
still some rought edges, and I'd like some help to clear those
out. It looks stable (loads and displays the Userguide very well).
2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyx_gui.C (create_forms): make combo box taller (from Dekel
2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyx_gui.C (create_forms): make combo box taller (from Dekel
* lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
hebrew supports files from Dekel Tsur.
* lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
hebrew supports files from Dekel Tsur.
* several places: don't check if a pointer is 0 if you are going
to delete it.
* src/text.C: remove some dead code.
* src/insets/figinset.C: remove some dead code
* several places: don't check if a pointer is 0 if you are going
to delete it.
* src/text.C: remove some dead code.
* src/insets/figinset.C: remove some dead code
* src/buffer.C: move the BufferView funcs to BufferView2.C
remove all support for insetlatexdel
remove support for oldpapersize stuff
made some member funcs const
* src/kbmap.C: use a std::list to store the bindings in.
* src/buffer.C: move the BufferView funcs to BufferView2.C
remove all support for insetlatexdel
remove support for oldpapersize stuff
made some member funcs const
* src/kbmap.C: use a std::list to store the bindings in.
* src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
only have one copy in the binary of this table.
* src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
only have one copy in the binary of this table.
* hebrew patch: moved some functions from LyXText to more
appropriate places. (LyXParagraph, BufferParams, LyXFont)
* hebrew patch: moved some functions from LyXText to more
appropriate places. (LyXParagraph, BufferParams, LyXFont)
* src/TextCache.[Ch]: new file. Holds the textcache.
* src/BufferView.C: changes to use the new TextCache interface.
(waitForX): remove the now unused code.
* src/TextCache.[Ch]: new file. Holds the textcache.
* src/BufferView.C: changes to use the new TextCache interface.
(waitForX): remove the now unused code.
* src/BackStack.h: remove some commented code
* lib/bind/emacs.bind: remove binding for buffer-previous
* src/BackStack.h: remove some commented code
* lib/bind/emacs.bind: remove binding for buffer-previous
* po/it.po: updated a bit the italian po file and also changed the
'file nuovo' for newfile to 'filenuovo' without a space, this did
annoy me a lot :)
* po/it.po: updated a bit the italian po file and also changed the
'file nuovo' for newfile to 'filenuovo' without a space, this did
annoy me a lot :)
* src/lyxrc.C (LyXRC): added support for a default insert_date_format
for the new insert_date command.
* src/lyxrc.C (LyXRC): added support for a default insert_date_format
for the new insert_date command.
* lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
that I removed earlier... It is really needed.
* lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
that I removed earlier... It is really needed.
* lib/configure.m4: fix a bug with unreadable layout files.
* src/table.C (calculate_width_of_column): add "using std::max"
* lib/configure.m4: fix a bug with unreadable layout files.
* src/table.C (calculate_width_of_column): add "using std::max"
to allocate memory for figures and bitmaps.
(DoneFigures): use delete[] instead of free to deallocate memory
for figures and bitmaps.
to allocate memory for figures and bitmaps.
(DoneFigures): use delete[] instead of free to deallocate memory
for figures and bitmaps.
(getfigdata): use new/delete[] instead of malloc/free
(RegisterFigure): ditto
* some files: moved some declarations closer to first use, small
whitespace changes use preincrement instead of postincrement where
it does not make a difference.
(getfigdata): use new/delete[] instead of malloc/free
(RegisterFigure): ditto
* some files: moved some declarations closer to first use, small
whitespace changes use preincrement instead of postincrement where
it does not make a difference.
* src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
std::sort and std::lower_bound instead of qsort and handwritten
* src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
std::sort and std::lower_bound instead of qsort and handwritten
* src/buffer.C (makeLaTeXFile): we do not need the user name here.
(makeLinuxDocFile): do not put date and user name in linuxdoc
* src/buffer.C (makeLaTeXFile): we do not need the user name here.
(makeLinuxDocFile): do not put date and user name in linuxdoc
* src/support/lyxlib.h (kill): change first argument to long int,
since that's what solaris uses.
* src/support/lyxlib.h (kill): change first argument to long int,
since that's what solaris uses.
* src/texrow.C (getIdFromRow): actually return something useful in
id and pos. Hopefully fixes the bug with positionning of errorbox
* src/texrow.C (getIdFromRow): actually return something useful in
id and pos. Hopefully fixes the bug with positionning of errorbox
* src/lyx_main.C (easyParse): output an error and exit if an
incorrect command line option has been given.
* src/lyx_main.C (easyParse): output an error and exit if an
incorrect command line option has been given.
* src/bufferlist.C (write): fix mismatched allocation/deletion,
where a "struct utimbuf" is allocated with "new" and deleted with
* src/bufferlist.C (write): fix mismatched allocation/deletion,
where a "struct utimbuf" is allocated with "new" and deleted with
2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/text2.C (CutSelection): don't delete double spaces.
(PasteSelection): ditto
(CopySelection): ditto
2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/text2.C (CutSelection): don't delete double spaces.
(PasteSelection): ditto
(CopySelection): ditto
* src/text.C (Backspace): don't delete double spaces.
* src/lyxlex.C (next): fix a bug that were only present with
* src/text.C (Backspace): don't delete double spaces.
* src/lyxlex.C (next): fix a bug that were only present with
* src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
and add a tmp->text.resize. The LyXParagraph constructor does the
resize for us.
* src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
and add a tmp->text.resize. The LyXParagraph constructor does the
resize for us.
which was bogus for several reasons.
* src/LaTeX.C (scanAux): fix the regular expression used to scan
which was bogus for several reasons.
* src/LaTeX.C (scanAux): fix the regular expression used to scan
(runBibTeX): ditto.
* autogen.sh: do not use "type -path" (what's that anyway?).
* src/support/filetools.C (findtexfile): remove extraneous space
which caused a kpsewhich warning (at least with kpathsea version
(runBibTeX): ditto.
* autogen.sh: do not use "type -path" (what's that anyway?).
* src/support/filetools.C (findtexfile): remove extraneous space
which caused a kpsewhich warning (at least with kpathsea version
\view_pdf_command., \pdf_to_ps_command
* lib/configure.m4: added search for PDF viewer, and search for
\view_pdf_command., \pdf_to_ps_command
* lib/configure.m4: added search for PDF viewer, and search for
(lyxrc.defaults output): add \pdflatex_command,
\view_pdf_command and \pdf_to_ps_command.
(lyxrc.defaults output): add \pdflatex_command,
\view_pdf_command and \pdf_to_ps_command.
problems with both compilers I tried. See comments in the file.
* lib/reLyX/configure.in: do not define LYX_DIR. support flag
problems with both compilers I tried. See comments in the file.
* lib/reLyX/configure.in: do not define LYX_DIR. support flag
* po/*: updated to gettext 0.10.35, tried to add our own required
modifications. Please verify.
* po/*: updated to gettext 0.10.35, tried to add our own required
modifications. Please verify.
* src/support/lstrings.C (tostr): go at fixing the problem with
cxx and stringstream. When stringstream is used return
oss.str().c_str() so that problems with lyxstring and basic_string
* src/support/lstrings.C (tostr): go at fixing the problem with
cxx and stringstream. When stringstream is used return
oss.str().c_str() so that problems with lyxstring and basic_string
* config/lyxinclude.m4: new file, this is the lyx created m4
macros, used in making acinclude.m4.
* config/lyxinclude.m4: new file, this is the lyx created m4
macros, used in making acinclude.m4.
Generate acinlucde from files in config. Actually cat
lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
easier to upgrade .m4 files that really are external.
Generate acinlucde from files in config. Actually cat
lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
easier to upgrade .m4 files that really are external.
* src/lyx_cb.C: began some work to remove the dependency a lot of
functions have on BufferView::text, even if not really needed.
(GetCurrentTextClass): removed this func, it only hid the
* src/lyx_cb.C: began some work to remove the dependency a lot of
functions have on BufferView::text, even if not really needed.
(GetCurrentTextClass): removed this func, it only hid the
* buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
from Buffer to BufferView.
* buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
from Buffer to BufferView.
* acinclude.m4: include libtool.m4 from libtool 1.3.4.
* config/ltmain.sh: updated to version 1.3.4 of libtool
* acinclude.m4: include libtool.m4 from libtool 1.3.4.
* config/ltmain.sh: updated to version 1.3.4 of libtool
2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/BufferView.C: first go at a TextCache to speed up switching
2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/BufferView.C: first go at a TextCache to speed up switching
* lib/examples/nl_voorbeeld_ruw.lyx: ditto.
* lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
* lib/examples/nl_opsommingstekens.lyx: new translation from Tino
Meinen.
* lib/examples/nl_voorbeeld_ruw.lyx: ditto.
* lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
* lib/examples/nl_opsommingstekens.lyx: new translation from Tino
Meinen.
* src/mathed/math_defs.h (MathedRowSt): make sure that all
members of the struct are correctly initialized to 0 (detected by
* src/mathed/math_defs.h (MathedRowSt): make sure that all
members of the struct are correctly initialized to 0 (detected by
* src/lyxrc.C (LyXRC): ditto for print_adapt_output.
* src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
* src/lyxrc.C (LyXRC): ditto for print_adapt_output.
* src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
* src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
src/mathed/formula.C (LocalDispatch): askForText changes
* src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
src/mathed/formula.C (LocalDispatch): askForText changes
know when a user has cancelled input. Fixes annoying problems with
inserting labels and version control.
know when a user has cancelled input. Fixes annoying problems with
inserting labels and version control.
(getStream): new function, returns an istream
(getFile): deleted funtion
(IsOK): return is.good();
(getStream): new function, returns an istream
(getFile): deleted funtion
(IsOK): return is.good();
* src/lyxlex.C (LyXLex): delete file and owns_file
(setFile): open an filebuf and assign that to a istream instead of
using FILE*
* src/lyxlex.C (LyXLex): delete file and owns_file
(setFile): open an filebuf and assign that to a istream instead of
using FILE*
config.h.in to the AC_DEFINE_UNQUOTED() call.
(LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
needs char * as argument (because Solaris 7 declares it like
config.h.in to the AC_DEFINE_UNQUOTED() call.
(LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
needs char * as argument (because Solaris 7 declares it like
1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/bind/fi_menus.bind: new file, from
1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* lib/bind/fi_menus.bind: new file, from
* src/buffer.C (getBibkeyList): pass the parameter delim to
InsetInclude::getKeys and InsetBibtex::getKeys.
* src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
is passed to Buffer::getBibkeyList
* src/buffer.C (getBibkeyList): pass the parameter delim to
InsetInclude::getKeys and InsetBibtex::getKeys.
* src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
is passed to Buffer::getBibkeyList
* src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
instead of the hardcoded comma.
* src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
instead of the hardcoded comma.
* src/insets/insetbib.C (getKeys): ditto
* src/debug.C (showTags): make sure that the output is correctly
* src/insets/insetbib.C (getKeys): ditto
* src/debug.C (showTags): make sure that the output is correctly
* src/layout.h (LyXTextClass): added typedef for const_iterator
(LyXTextClassList): added typedef for const_iterator + member
* src/layout.h (LyXTextClass): added typedef for const_iterator
(LyXTextClassList): added typedef for const_iterator + member
* src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
what version of this func to use. Also made to return unsigned int.
* src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
what version of this func to use. Also made to return unsigned int.
1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
and a subscript would give bad display (patch from Dekel Tsur
1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
and a subscript would give bad display (patch from Dekel Tsur
input from JMarc. Now use preprocessor to find the header.
Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
(LYX_PATH_HEADER): My, so far, failed attempt to generalize
input from JMarc. Now use preprocessor to find the header.
Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
(LYX_PATH_HEADER): My, so far, failed attempt to generalize
1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
* The global MiniBuffer * minibuffer variable is dead.
1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
* The global MiniBuffer * minibuffer variable is dead.
* The global FD_form_main * fd_form_main variable is dead.
1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* The global FD_form_main * fd_form_main variable is dead.
1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/LyXAction.h: change the explaination of the ReadOnly
attribute: is indicates that the function _can_ be used.
* src/LyXAction.C (init): find-replace _can_ be used in read-only
* src/LyXAction.h: change the explaination of the ReadOnly
attribute: is indicates that the function _can_ be used.
* src/LyXAction.C (init): find-replace _can_ be used in read-only
1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfont.C (ascent): Make sure that char is _always_ used as
1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyxfont.C (ascent): Make sure that char is _always_ used as
* configure.in: suppress --with-debug; add --enable-assertions
* acinclude.m4: various changes in alignment of help strings.
* configure.in: suppress --with-debug; add --enable-assertions
* acinclude.m4: various changes in alignment of help strings.
1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/kbmap.C: commented out the use of the hash map in kb_map,
1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/kbmap.C: commented out the use of the hash map in kb_map,
* lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
for escaping should not be used. We can discuss if the string
should be enclosed in f.ex. [] instead of "".
* lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
for escaping should not be used. We can discuss if the string
should be enclosed in f.ex. [] instead of "".
stl_string_fwd.h is around and try to determine it's location.
Major improvement over previous SGI STL 3.2 compatability.
Three small problems remain with this function due to my zero
stl_string_fwd.h is around and try to determine it's location.
Major improvement over previous SGI STL 3.2 compatability.
Three small problems remain with this function due to my zero
1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/broken_const.h, config/hack-gcc, config/README: removed
1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/broken_const.h, config/hack-gcc, config/README: removed
* acconfig.h: remove all trace of BROKEN_CONST define
* src/buffer.C (makeDocBookFile): update version number in output
* acconfig.h: remove all trace of BROKEN_CONST define
* src/buffer.C (makeDocBookFile): update version number in output
* src/debug.h: moved some code to debug.C
* src/debug.C: new file. Contains code to set and show debug
* src/debug.h: moved some code to debug.C
* src/debug.C: new file. Contains code to set and show debug
* src/layout.C: remove 'break' after 'continue' in switch
statements, since these cannot be reached.
* src/layout.C: remove 'break' after 'continue' in switch
statements, since these cannot be reached.
* src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
(in_word_set): hash() -> math_hash()
* src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
(in_word_set): hash() -> math_hash()
* acconfig.h: Added a test for whether we are using exceptions in the
current compilation run. If so USING_EXCEPTIONS is defined.
* acconfig.h: Added a test for whether we are using exceptions in the
current compilation run. If so USING_EXCEPTIONS is defined.
* Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
* intl/Makefile.in (MKINSTALLDIRS): ditto
* Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
* intl/Makefile.in (MKINSTALLDIRS): ditto
* a lot of files: compiled with -Wold-style-cast, changed most of
the reported offenders to C++ style casts. Did not change the
* a lot of files: compiled with -Wold-style-cast, changed most of
the reported offenders to C++ style casts. Did not change the
between buffer contents and buffer view. One side effect is that
the BufferView needs a rebreak when swiching buffers, if we want
to avoid this we can add a cache that holds pointers to LyXText's
between buffer contents and buffer view. One side effect is that
the BufferView needs a rebreak when swiching buffers, if we want
to avoid this we can add a cache that holds pointers to LyXText's
* lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
example files from Tino Meinen.
* lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
example files from Tino Meinen.
* src/lyxfont.[Ch]: removed latexWriteStartChanges, and
latexWriteEndChanges, they were not used.
* src/lyxfont.[Ch]: removed latexWriteStartChanges, and
latexWriteEndChanges, they were not used.
* src/layout.h (operator<<): output operator for PageSides
* src/mathed/math_iter.C (my_memcpy): slightly changed.
* some example files: loaded in LyX 1.0.4 and saved again to update
* src/layout.h (operator<<): output operator for PageSides
* src/mathed/math_iter.C (my_memcpy): slightly changed.
* some example files: loaded in LyX 1.0.4 and saved again to update
* a lot of files: did the change to use fstream/iostream for all
writing of files. Done with a close look at Andre Poenitz's patch.
* some files: whitespace changes.
* a lot of files: did the change to use fstream/iostream for all
writing of files. Done with a close look at Andre Poenitz's patch.
* some files: whitespace changes.
1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_iter.C (my_memcpy): new function. Since the
1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/mathed/math_iter.C (my_memcpy): new function. Since the
* lib/configure.m4 (SEARCH_PROG): make it work when the PATH
elements contain spaces; display the list of programs that are
tried.
* lib/configure.m4 (SEARCH_PROG): make it work when the PATH
elements contain spaces; display the list of programs that are
tried.
1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/mathed/formula.C (LocalDispatch): fix small whitspace bug
1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/mathed/formula.C (LocalDispatch): fix small whitspace bug
(write): new function. opens a ofstream and pass that to output
(output): new function, takes a ostream and writes the lyxrc
elemts to it. uses a dummy switch to make sure no elements are
(write): new function. opens a ofstream and pass that to output
(output): new function, takes a ostream and writes the lyxrc
elemts to it. uses a dummy switch to make sure no elements are
* commandtags.h, src/LyXAction.C (init): new function:
"preferences-save", saves the lyxrc entries into .lyx/preferences.
This file is not read automatically but you can add \input
preferences to your lyxrc if you want to. We need to discuss how
* commandtags.h, src/LyXAction.C (init): new function:
"preferences-save", saves the lyxrc entries into .lyx/preferences.
This file is not read automatically but you can add \input
preferences to your lyxrc if you want to. We need to discuss how
* src/LaTeX.C (runBibTeX): use regex to match for the needed lines
in .aux, also remove .bib and .bst files from dependencies when
* src/LaTeX.C (runBibTeX): use regex to match for the needed lines
in .aux, also remove .bib and .bst files from dependencies when
* lib/lyxrc.example: Default for accept_compound is false not no.
* images/*: changed to be const, however I have som misgivings
* lib/lyxrc.example: Default for accept_compound is false not no.
* images/*: changed to be const, however I have som misgivings
* lib/configure.m4: new file (was config/lib_configure.m4)
* configure.in: do not test for rtti, since we do not use it.
* lib/configure.m4: new file (was config/lib_configure.m4)
* configure.in: do not test for rtti, since we do not use it.
1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/lyxstring.C (lyxstring::Srep): Changed to use a
doubling of allocated space scheme. This makes it faster for large
1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/lyxstring.C (lyxstring::Srep): Changed to use a
doubling of allocated space scheme. This makes it faster for large
* src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
for changes in bibtex database or style.
(runBibTeX): remove all .bib and .bst files from dep before we
* src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
for changes in bibtex database or style.
(runBibTeX): remove all .bib and .bst files from dep before we
(run): use scanAuc in when dep file already exist.
* src/DepTable.C (remove_files_with_extension): new method
(exist): new method
(run): use scanAuc in when dep file already exist.
* src/DepTable.C (remove_files_with_extension): new method
(exist): new method
* src/debug.h (value): fix the code that parses debug levels.
* src/debug.h: add new debug type ACTION, reserved for LyXAction
* src/debug.h (value): fix the code that parses debug levels.
* src/debug.h: add new debug type ACTION, reserved for LyXAction
red), but done for the sake of correctness.
* src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
red), but done for the sake of correctness.
* src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
* src/insets/inseterror.h, src/insets/inseturl.h,
src/insets/insetinfo.h, src/insets/figinset.h,
* src/insets/inseterror.h, src/insets/inseturl.h,
src/insets/insetinfo.h, src/insets/figinset.h,
* src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
src/insets/insetbib.C, src/support/filetools.C: add `using'
* src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
src/insets/insetbib.C, src/support/filetools.C: add `using'
* src/lyxfunc.C (Dispatch): make sure nothing bad happens when
doing 'Insert index of last word' at the beginning of a paragraph.
* src/lyxfunc.C (Dispatch): make sure nothing bad happens when
doing 'Insert index of last word' at the beginning of a paragraph.
* src/insets/figinset.C (runqueue): use a ofstream to output the
gs/ps file. Might need some setpresicion or setw. However I can
see no problem with the current code.
* src/insets/figinset.C (runqueue): use a ofstream to output the
gs/ps file. Might need some setpresicion or setw. However I can
see no problem with the current code.
* src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
findtexfile from LaTeX to filetools.
* src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
findtexfile from LaTeX to filetools.
* src/ImportNoweb.C (documentclass): rewrote to use ifstream
instead of FilePtr. Needs to be verified by a literate user.
* src/ImportNoweb.C (documentclass): rewrote to use ifstream
instead of FilePtr. Needs to be verified by a literate user.
* src/mathed/math_defs.h: made the mathaligns be in a enum instead
of defines.
(MathIsInset ++): changed several macros to be inline functions
* src/mathed/math_defs.h: made the mathaligns be in a enum instead
of defines.
(MathIsInset ++): changed several macros to be inline functions
* src/insets/Makefile.am: changed to use libtool
* src/insets/.cvsignore: added *.lo, .libs and libinsets.la
* src/undo.[Ch] : added empty() and changed some of the method
names.
* src/insets/Makefile.am: changed to use libtool
* src/insets/.cvsignore: added *.lo, .libs and libinsets.la
* src/undo.[Ch] : added empty() and changed some of the method
names.
* src/texrow.[Ch]: rewrote to store texrow's in a std::list.
* src/lyxparagraph.h: use id() and id(...) instead of getID and
* src/texrow.[Ch]: rewrote to store texrow's in a std::list.
* src/lyxparagraph.h: use id() and id(...) instead of getID and
lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
* src/buffer.C (writeFile): Do not add a comment on top of .lyx
lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
* src/buffer.C (writeFile): Do not add a comment on top of .lyx
* configure.in: Use LYX_GNU_GETTEXT.
* acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
* configure.in: Use LYX_GNU_GETTEXT.
* acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/LSubstring.[Ch]: made the second arg of most of the
1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/LSubstring.[Ch]: made the second arg of most of the
* src/mathed/math_parser.C (LexInitCodes): small bug introduced by
me fixed.
* src/support/lyxstring.[Ch] (swap): added missing member function
* src/mathed/math_parser.C (LexInitCodes): small bug introduced by
me fixed.
* src/support/lyxstring.[Ch] (swap): added missing member function
* src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
NEW_TEXT and have now only code that was included when this was
* src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
NEW_TEXT and have now only code that was included when this was
* src/intl.C (LCombo): use static_cast
(LCombo2): ditto
(DispatchCallback): ditto
* src/definitions.h: removed whole file
* src/intl.C (LCombo): use static_cast
(LCombo2): ditto
(DispatchCallback): ditto
* src/definitions.h: removed whole file
* src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
* src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
* src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
* src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
and to make the whole class assignable.
* src/bufferparams.C (Copy): removed this functions, use a default
and to make the whole class assignable.
* src/bufferparams.C (Copy): removed this functions, use a default
* src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
isLiterate const.
* src/buffer.C (readLyXformat2): commend out all that have with
oldpapersize to do. also comment out all that hve to do with
* src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
isLiterate const.
* src/buffer.C (readLyXformat2): commend out all that have with
oldpapersize to do. also comment out all that hve to do with
(setOldPaperStuff): commented out
* src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
(setOldPaperStuff): commented out
* src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
* src/mathed/math_panel.C (button_cb): use static_cast
* src/insets/Makefile.am (insets_o_SOURCES): removed
* src/mathed/math_panel.C (button_cb): use static_cast
* src/insets/Makefile.am (insets_o_SOURCES): removed
* src/support/lyxstring.C (helper): use the unsigned long
specifier, UL, instead of a static_cast.
* src/support/lyxstring.C (helper): use the unsigned long
specifier, UL, instead of a static_cast.
* src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
link line, so that Irix users (for example) can set it explicitely to
"-n32".
* src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
link line, so that Irix users (for example) can set it explicitely to
"-n32".
* src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
it can be overidden at make time (static or dynamic link, for
example).
* src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
it can be overidden at make time (static or dynamic link, for
example).
-
- * src/vc-backend.C, src/LaTeXFeatures.h,
- src/support/LRegex.C, src/support/LRegex.h: add a few "using"
+
+ * src/vc-backend.C, src/LaTeXFeatures.h,
+ src/support/LRegex.C, src/support/LRegex.h: add a few "using"
statements to bring templates to global namespace.
1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/lyxstring.C (operator[] const): make it standard
statements to bring templates to global namespace.
1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/lyxstring.C (operator[] const): make it standard
* src/minibuffer.C (Init): changed to reflect that more
information is given from the lyxvc and need not be provided here.
* src/lyxvc.[Ch]: rewrote to use the vc-backend.
* src/minibuffer.C (Init): changed to reflect that more
information is given from the lyxvc and need not be provided here.
* src/lyxvc.[Ch]: rewrote to use the vc-backend.
* src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
* src/LyXView.C (UpdateTimerCB): use static_cast
* src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
* src/LyXView.C (UpdateTimerCB): use static_cast
* src/vc-backend.[Ch]: new files. The backends for vc handling,
have no support for RCS and partial support for CVS, will be
improved later.
* src/vc-backend.[Ch]: new files. The backends for vc handling,
have no support for RCS and partial support for CVS, will be
improved later.
* src/mathed/math_symbols.C (math_insert_symbol): use static_cast
* src/support/LSubstring.[Ch]: new files. These implement a
* src/mathed/math_symbols.C (math_insert_symbol): use static_cast
* src/support/LSubstring.[Ch]: new files. These implement a
* src/support/LRegex.[Ch]: a regex class that can be used to pick
out patterns and subpatterns of strings. It is used by LSubstring
and also by vc-backend.C
* src/support/LRegex.[Ch]: a regex class that can be used to pick
out patterns and subpatterns of strings. It is used by LSubstring
and also by vc-backend.C
* src/support/lyxstring.C: went over all the assertions used and
tried to correct the wrong ones and flag which of them is required
by the standard. some bugs found because of this. Also removed a
* src/support/lyxstring.C: went over all the assertions used and
tried to correct the wrong ones and flag which of them is required
by the standard. some bugs found because of this. Also removed a
* src/bufferlist.C: use a vector to store the buffers in. This is
an internal change and should not affect any other thing.
* src/bufferlist.C: use a vector to store the buffers in. This is
an internal change and should not affect any other thing.
1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/layout.C (less_textclass_desc): functor for use in sorting
1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/layout.C (less_textclass_desc): functor for use in sorting
* src/support/filetools.C (SpaceLess): new version of the
SpaceLess functions. What problems does this one give? Please
report.
* src/support/filetools.C (SpaceLess): new version of the
SpaceLess functions. What problems does this one give? Please
report.
two versions of find where this has not been done yet.
* src/support/lyxlib.h: add missing int return type to
two versions of find where this has not been done yet.
* src/support/lyxlib.h: add missing int return type to
* src/menus.C (ShowFileMenu): disable exporting to html if no
html export command is present.
* config/lib_configure.m4: add a test for an HTML converter. The
programs checked for are, in this order: tth, latex2html and
* src/menus.C (ShowFileMenu): disable exporting to html if no
html export command is present.
* config/lib_configure.m4: add a test for an HTML converter. The
programs checked for are, in this order: tth, latex2html and
add "quotes" around \screen_font_xxx font setting examples to help
people who use fonts with spaces in their names.
add "quotes" around \screen_font_xxx font setting examples to help
people who use fonts with spaces in their names.
- * src/support/syscall.C (Systemcalls::kill):
- src/support/filetools.C (PutEnv, PutEnvPath):
- src/lyx_cb.C (addNewlineAndDepth):
+ * src/support/syscall.C (Systemcalls::kill):
+ src/support/filetools.C (PutEnv, PutEnvPath):
+ src/lyx_cb.C (addNewlineAndDepth):
limited and made accessor functions instead a lot of code changed
becuase of this. Also instead of returning pointers often a const
reference is returned instead.
limited and made accessor functions instead a lot of code changed
becuase of this. Also instead of returning pointers often a const
reference is returned instead.
* src/form1.C (create_form_Figure): added a couple fo "no-c-format"
* src/Makefile.am (dist-hook): added used to remove the CVS from
* src/form1.C (create_form_Figure): added a couple fo "no-c-format"
* src/Makefile.am (dist-hook): added used to remove the CVS from
(LyXTextClassList::Style): bug fix. do the right thing if layout
is to big.
(LyXTextClassList::NumberOfLayout): new acces to layoutlist.
(LyXTextClassList::Style): bug fix. do the right thing if layout
is to big.
(LyXTextClassList::NumberOfLayout): new acces to layoutlist.
std::container to store textclasses and layouts in.
Simplified, removed a lot of code. Make all classes
assignable. Further simplifications and review of type
std::container to store textclasses and layouts in.
Simplified, removed a lot of code. Make all classes
assignable. Further simplifications and review of type
* src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
lastfiles to create the lastfiles partr of the menu.
* src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
lastfiles to create the lastfiles partr of the menu.
(C_InsetInfo_CloseInfoCB): forward the ob parameter
(CloseInfoCB): static_cast from ob->u_vdata instead.
(Edit): removed bogus arg from fl_set_object_shortcut, set to 1
(C_InsetInfo_CloseInfoCB): forward the ob parameter
(CloseInfoCB): static_cast from ob->u_vdata instead.
(Edit): removed bogus arg from fl_set_object_shortcut, set to 1
* src/insets/inseterror.C (Edit): pass object in u_vdata instead
(C_InsetError_CloseErrorCB): forward the ob parameter
* src/insets/inseterror.C (Edit): pass object in u_vdata instead
(C_InsetError_CloseErrorCB): forward the ob parameter
* src/BackStack.h: rewrote to use std::stack. made BackStackItem
and removed now defunct constructor and deconstructor.
* src/BufferView.h: have backstack as a object not as a pointer.
* src/BackStack.h: rewrote to use std::stack. made BackStackItem
and removed now defunct constructor and deconstructor.
* src/BufferView.h: have backstack as a object not as a pointer.
* acinclude.m4 (VERSION): new rules for when a version is
development, added also a variable for prerelease.
(warnings): we set with_warnings=yes for prereleases
* acinclude.m4 (VERSION): new rules for when a version is
development, added also a variable for prerelease.
(warnings): we set with_warnings=yes for prereleases
- (lyx_opt): prereleases compile with same optimization as development
- (CXXFLAGS): only use pedantic if we are a development version
+ (lyx_opt): prereleases compile with same optimization as development
+ (CXXFLAGS): only use pedantic if we are a development version
* src/lyxvc.C +
* src/menus.C: fixed various resize issues. So now forms can be
resized savely or not be resized at all.
* src/lyxvc.C +
* src/menus.C: fixed various resize issues. So now forms can be
resized savely or not be resized at all.
* forms/form_url.fd +
* src/insets/form_url.[Ch]: added because it's cleaner and easier
to modify IMO.
* src/insets/Makefile.am: added files form_url.[Ch]
* forms/form_url.fd +
* src/insets/form_url.[Ch]: added because it's cleaner and easier
to modify IMO.
* src/insets/Makefile.am: added files form_url.[Ch]
1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* INSTALL: it is now possible to compile LyX with digital C++ 6.1
1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* INSTALL: it is now possible to compile LyX with digital C++ 6.1
* src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
* src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
* src/support/lyxstring.h: declare struct Srep as friend of
lyxstring, since DEC cxx complains otherwise.
* src/support/lyxstring.h: declare struct Srep as friend of
lyxstring, since DEC cxx complains otherwise.
* src/spellchecker.C (create_ispell_pipe): removed old #warning,
the code has shown itself to work
(create_ispell_pipe): removed another warning, added a comment
* src/spellchecker.C (create_ispell_pipe): removed old #warning,
the code has shown itself to work
(create_ispell_pipe): removed another warning, added a comment
(LYX_PROG_CXX): added -pedantic to g++ compile options when
with-warnings, removed the __STRING_ANSI__ hack, seems to not be
(LYX_PROG_CXX): added -pedantic to g++ compile options when
with-warnings, removed the __STRING_ANSI__ hack, seems to not be
* src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
the form cannot be resized under it limits (fixes a segfault)
* src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
the form cannot be resized under it limits (fixes a segfault)
* src/lyx.C (create_form_form_ref) +
* forms/lyx.fd: Changed Gravity on name input field so that it is
resized correctly.
* src/lyx.C (create_form_form_ref) +
* forms/lyx.fd: Changed Gravity on name input field so that it is
resized correctly.
* acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
whether <fstream> provides the latest standard features, or if we
have an oldstyle library (like in egcs).
* acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
whether <fstream> provides the latest standard features, or if we
have an oldstyle library (like in egcs).
conditional compile of lyxstring.Ch
* acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
conditional compile of lyxstring.Ch
* acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
- stupid check, but it is a lot better than the bastring hack.
- (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
+ stupid check, but it is a lot better than the bastring hack.
+ (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
* src/chset.C (encodeString): use a char temporary instead
* src/table.C (TexEndOfCell): added tostr around
* src/chset.C (encodeString): use a char temporary instead
* src/table.C (TexEndOfCell): added tostr around
* src/insets/insetbib.C (setCounter): added tostr around counter.
* src/support/lyxstring.h: added an operator+=(int) to catch more
* src/insets/insetbib.C (setCounter): added tostr around counter.
* src/support/lyxstring.h: added an operator+=(int) to catch more
* src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
(lyxstring): We DON'T allow NULL pointers.
* src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
(lyxstring): We DON'T allow NULL pointers.
* many files: change all callback functions to "C" linkage
functions to please strict C++ compilers like DEC cxx 6.1 in mode
* many files: change all callback functions to "C" linkage
functions to please strict C++ compilers like DEC cxx 6.1 in mode
The case of callbacks which are static class members is
trickier, since we have to make C wrappers around them (see
InsetError, InsetInfo and InsetUrl). The same holds for friends. I
The case of callbacks which are static class members is
trickier, since we have to make C wrappers around them (see
InsetError, InsetInfo and InsetUrl). The same holds for friends. I
1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
* src/DepTable.[Ch]: rewritten to store the dependencies in a map
instead, use fstreams for io of the depfile, removed unneeded
* src/DepTable.[Ch]: rewritten to store the dependencies in a map
instead, use fstreams for io of the depfile, removed unneeded
* src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
vector instead, removed all functions and variables that is not in
* src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
vector instead, removed all functions and variables that is not in
* src/cheader/: new directory, populated with cname headers from
libstdc++-2.8.1. They are a bit old, but probably good enough for
what we want (support compilers who lack them).
* src/cheader/: new directory, populated with cname headers from
libstdc++-2.8.1. They are a bit old, but probably good enough for
what we want (support compilers who lack them).
* src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
from includes. It turns out is was stupid.
* src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
from includes. It turns out is was stupid.
* lib/Makefile.am (dist-hook): added dist-hook so that
documentation files will be included when doing a make
dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
* lib/Makefile.am (dist-hook): added dist-hook so that
documentation files will be included when doing a make
dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
* all files that used to use pathstack: uses now Path instead.
This change was a lot easier than expected.
* all files that used to use pathstack: uses now Path instead.
This change was a lot easier than expected.
1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/DebugStream.[Ch]: remove the explicit std:: before
streams classes and types, add the proper 'using' statements when
MODERN_STL is defined.
1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
* src/support/DebugStream.[Ch]: remove the explicit std:: before
streams classes and types, add the proper 'using' statements when
MODERN_STL is defined.
* src/debug.h: move the << operator definition after the inclusion
of DebugStream.h
* src/support/filetools.C: include "LAssert.h", which is needed
* src/debug.h: move the << operator definition after the inclusion
of DebugStream.h
* src/support/filetools.C: include "LAssert.h", which is needed
* src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
include "debug.h" to define a proper ostream.
* src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
include "debug.h" to define a proper ostream.
* lib/bind/*.bind: Added short-cut for buffer-export html
* src/lyxrc.*: Added support for new \tth_command
* lib/bind/*.bind: Added short-cut for buffer-export html
* src/lyxrc.*: Added support for new \tth_command
* lib/lyxrc.example: Added stuff for new \tth_command
1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
* lib/lyxrc.example: Added stuff for new \tth_command
1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
* lib/reLyX/configure.in: declare a config aux dir; set package
name to lyx (not sure what the best solution is); generate noweb2lyx.
* lib/reLyX/configure.in: declare a config aux dir; set package
name to lyx (not sure what the best solution is); generate noweb2lyx.
* src/support/filetools.C (FileOpenSearch): Fixed a bug where
when in the PATH was something like /usr/bin;;/bin (note: the ;;)
it returned without continuing to search the path.
* src/support/filetools.C (FileOpenSearch): Fixed a bug where
when in the PATH was something like /usr/bin;;/bin (note: the ;;)
it returned without continuing to search the path.
1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/insets/insetquotes.C (Draw): Simplified a gread deal. This
1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/insets/insetquotes.C (Draw): Simplified a gread deal. This
outputting enums to lyxerr. This as thus eliminated a lot of
explicit casts and has made the code clearer. Among the enums
affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
outputting enums to lyxerr. This as thus eliminated a lot of
explicit casts and has made the code clearer. Among the enums
affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
* configure.in (Check for programs): Added a check for kpsewhich,
the latex generation will use this later to better the dicovery of
* configure.in (Check for programs): Added a check for kpsewhich,
the latex generation will use this later to better the dicovery of
* lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
* src/bufferparams.C (BufferParams): default input encoding is now
* lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
* src/bufferparams.C (BufferParams): default input encoding is now
* acconfig.h: make sure that const is not defined (to empty) when
we are compiling C++. Remove commented out code using SIZEOF_xx
macros.
* acconfig.h: make sure that const is not defined (to empty) when
we are compiling C++. Remove commented out code using SIZEOF_xx
macros.
* configure.in : move the test for const and inline as late as
possible so that these C tests do not interefere with C++ ones.
Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
* configure.in : move the test for const and inline as late as
possible so that these C tests do not interefere with C++ ones.
Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
* Most files: finished the change from the old error code to use
DebugStream for all lyxerr debugging. Only minor changes remain
* Most files: finished the change from the old error code to use
DebugStream for all lyxerr debugging. Only minor changes remain
1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/table.C (DocBookEndOfCell): commented out two unused variables
1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
* src/table.C (DocBookEndOfCell): commented out two unused variables
* src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
insed a if clause with type string::size_type.
* src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
insed a if clause with type string::size_type.
* most files: removed the RCS tags. With them we had to recompile
a lot of files after a simple cvs commit. Also we have never used
* most files: removed the RCS tags. With them we had to recompile
a lot of files after a simple cvs commit. Also we have never used
new subdir. More files moved to support.
* imported som of the functions from repository lyx, filetools
new subdir. More files moved to support.
* imported som of the functions from repository lyx, filetools
* ran tags-query-replace on LString -> string, corrected the bogus
cases. Tried to make use of lstrings.[hC], debugged a lot. There
is still some errors in there. This is errors where too much or
too litle get deleted from strings (string::erase, string::substr,
string::replace), there can also be some off by one errors, or
just plain wrong use of functions from lstrings. Viewing of quotes
* ran tags-query-replace on LString -> string, corrected the bogus
cases. Tried to make use of lstrings.[hC], debugged a lot. There
is still some errors in there. This is errors where too much or
too litle get deleted from strings (string::erase, string::substr,
string::replace), there can also be some off by one errors, or
just plain wrong use of functions from lstrings. Viewing of quotes
* LyX is now running fairly well with string, but there are
certainly some bugs yet (see above) also string is quite different
from LString among others in that it does not allow null pointers
passed in and will abort if it gets any.
* LyX is now running fairly well with string, but there are
certainly some bugs yet (see above) also string is quite different
from LString among others in that it does not allow null pointers
passed in and will abort if it gets any.
* Added the revtex4 files I forgot when setting up the repository.
1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
* Added the revtex4 files I forgot when setting up the repository.
1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>