+2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/frontends/ButtonPolicies.h: remove the LOstream and remove
+ the two recently added operator<< for SMInput and State.
+
+ * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
+ SMI_TOTAL to int.
+ (OkCancelPolicy): ditto
+ (OkCancelReadOnlyPolicy): ditto
+ (NoRepeatedApplyReadOnlyPolicy): ditto
+ (OkApplyCancelReadOnlyPolicy): ditto
+ (OkApplyCancelPolicy): ditto
+ (NoRepeatedApplyPolicy): ditto
+
+2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
+ add the usual std:: qualifiers.
+
+2000-10-25 Juergen Vigna <jug@sad.it>
+
+ * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
+
+2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/filetools.C (MakeRelPath): change some types to
+ string::size_type
+
+ * src/frontends/ButtonPolicies.h (operator<<): new operator for
+ ButtonPolicy::SMInput and ButtonPolicy::State.
+
+ * src/FontLoader.C (reset): small cleanup
+ (unload): small cleanup
+
+ * src/FontInfo.C (getFontname): initialize error to 10000.0
+
+2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/xforms/FormPreferences.[Ch]:
+ * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
+ TeX encoding and default paper size sections.
+
+2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
+ implementation
+
+ * src/frontends/xforms/FormError.C (disconnect): use erase() to
+ make the message_ empty.
+ (FormError): don't initialize message_ in initializer list.
+
+2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
+
+2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
+
+2000-10-24 John Levon <moz@compsoc.man.ac.uk>
+
+ * src/frontends/kde/*data.[Ch]: _("") is not
+ allowed
+
+2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/buffer.C: removed redundant using directive.
+
+ * src/frontends/DialogBase.h: revert to original definition of
+ update().
+
+ * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
+ stuff into two classes, one for each dialog, requires a new
+ element in the dialogs vector, FormTabularCreate.
+
+ * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
+ definition.
+
+ * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
+ method. Continues Allan's idea, but means that derived classes
+ don't need to worry about "update or hide?".
+
+ * src/frontends/xforms/FormError.C (showInset): add connection
+ again ;-)
+
+ * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
+ one for each dialog. FormTabular now contains main tabular dialog
+ only.
+
+ * src/frontends/xforms/FormTabularCreate.[Ch]:
+ * src/frontends/xforms/forms/form_tabular_create.fd: the create
+ dialog.
+
+ * src/frontends/xforms/FormGraphics.[Ch]:
+ * src/frontends/xforms/forms/form_graphics.fd
+ * src/frontends/xforms/FormTabular.[Ch]:
+ * src/frontends/xforms/forms/form_tabular.fd: made daughter
+ classes of FormInset.
+
+ * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
+ class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
+
+ * src/frontends/xforms/Makefile.am:
+ * src/frontends/xforms/forms/makefile: added new files.
+
+ * src/insets/insettabular.[Ch]: removed (Dialogs *) member
+ variable. added Signal0 hide signal, in keeping with other GUI-I
+ insets.
+
+ * src/support/lstrings.h: removed redundant std:: qualifier as
+ it's already declared in Lsstream.h.
+
+2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
+ open a new display.
+ (runqueue): ditto.
+
+2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/tabular.C (Ascii): minimize scope of cell.
+
+ * src/BufferView2.C (nextWord): return string() instead of 0;
+
+2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/converter.h: add a std:: qualifier
+
+2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
+
+ * src/importer.[Ch]: New files. Used for importing files into LyX.
+
+ * src/lyxfunc.C (doImport): Use the new Importer class.
+
+ * src/converter.h: Add shortcut member to the Format class.
+ Used for holding the menu shortcut.
+
+ * src/converter.C and other files: Made a distinction between
+ format name and format extension. New formats can be defined using
+ the \format lyxrc tag.
+ Added two new converter flags: latex and disable.
+
+2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/support/lyxlib.h: unify namespace/struct implementation.
+ Remove extra declarations.
+
+ * src/support/chdir.C (chdir): remove version taking char const *
+ argument.
+ * src/support/rename.C: ditto.
+ * src/support/lyxsum.C: ditto.
+
+2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/xforms/FormBase.[Ch]:
+ * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
+ read the xforms manual to discover that fl_set_form_minsize()/maxsize()
+ work only for the next call to fl_show_form(). The correct place to set
+ them, therefore is in connect() immediately BEFORE fl_show_form(). Now
+ done. FormBase also stores minw_, minh_ itself. All dialogs derived
+ from FormBase have the minimum size set; no more stupid crashes with
+ tabbed folders etc.
+
+2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * lib/ui/default.ui: fix shortcut for Insert->Include File.
+
+2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
+
+ * src/support/lyxlib.h: changed second argument of mkdir to
+ unsigned long int (unsigned int would probably have been enough,
+ but...). Removed <sys/types.h> header.
+ * src/support/mkdir.C (mkdir): ditto.
+
+ * NEWS: update.
+
+2000-10-19 Juergen Vigna <jug@sad.it>
+
+ * src/lyxfunc.C (MenuNew): small fix (form John)
+
+ * src/screen.C (Update): removed unneeded code.
+
+ * src/tabular.C (Ascii): refixed int != uint bug!
+
+ * src/support/lyxlib.h: added sys/types.h include for now permits
+ compiling, but I don't like this!
+
+2000-10-18 Juergen Vigna <jug@sad.it>
+
+ * src/text2.C (ClearSelection): if we clear the selection we need
+ more refresh so set the status apropriately
+
+ * src/insets/insettext.C (draw): hopefully finally fixed draw
+ problems!
+
+2000-10-12 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettext.C (draw): another small fix and make a block
+ so that variables are localized.
+
+2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/support/lstrings.C (lowercase, uppercase):
+ use explicit casts to remove compiler warnings.
+
+ * src/support/LRegex.C (Impl):
+ * src/support/StrPool.C (add):
+ * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
+ (AddPath, MakeDisplayPath):
+ * src/support/lstrings.C (prefixIs, subst):
+ use correct type to remove compiler warnings.
+
+ * src/support/lstrings.[Ch] (countChar): returns string::size_type.
+
+ * src/support/lyxlib.h:
+ * src/support/mkdir.C (mkdir): change parameter to mode_t for
+ portability and to remove compiler warning with DEC cxx.
+
+ * src/support/FileInfo.[Ch] (flagRWX): ditto.
+
+2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/minibuffer.C (peek_event): retun 1 when there has been a
+ mouseclick in the minibuffer.
+
+ * NEWS: updated.
+
+2000-10-17 John Levon <moz@compsoc.man.ac.uk>
+
+ * src/frontends/xforms/FormParagraph.C: more space above/below
+ fixes
+
+2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
+
+ * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
+ a char only if real_current_font was changed.
+
+2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * NEWS: update somewhat for 1.1.6
+
+ * lib/ui/default.ui: clean up.
+
+2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * lib/CREDITS: clean up
+
+2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/combox.[Ch] (select): changed argument back to int
+ * src/combox.C (peek_event): removed num_bytes as it is declared but
+ never referenced.
+
+ * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
+ modified calls to Combox::select() to remove warnings about type
+ conversion.
+
+ * src/insets/insetbutton.C (width): explicit cast to remove warning
+ about type conversion.
+
+ * src/insets/insetcite.C (getScreenLabel): use string::size_type not
+ size_t.
+
+ * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
+ sel_pos_end, refering to cursor position are changed to
+ LyXParagraph::size_type.
+
+ * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
+ consistent with LyXCursor::pos().
+ (inset_pos): changed to LyXParagraph::size_type for same reason.
+
+ * src/insets/insettext.C (resizeLyXText): changed some temporary
+ variables refing to cursor position to LyXParagraph::size_type.
+
+2000-10-16 John Levon <moz@compsoc.man.ac.uk>
+
+ * src/frontends/kde/<various>: The Great Renaming,
+ add FormParagraph
+
+2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
+
+2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
+ 0 when there are no arguments.
+
+2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/insets/insetbib.C: re-introduce current_view as a temporary fix
+ to segfaults when pressing Ok in InsetBibtex dialog.
+
+2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * forms/layout_forms.fd:
+ * src/layout_forms.C (create_form_form_character): small change to use
+ labelframe rather than engraved frame + text
+
+ * src/lyx_gui.C (create_forms): initialise choice_language with some
+ arbitrary value to prevent segfault when dialog is shown.
+
+2000-10-16 Baruch Even <baruch.even@writeme.com>
+
+ * src/converter.C (runLaTeX, scanLog): Added a warning when there
+ is no resulting file. This pertains only to LaTeX output.
+
+2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
+
+ * src/text.C (Backspace): Make sure that the row of the cursor is
+ rebreaked.
+
+ * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
+ a char.
+
+ * src/lyx_gui.C (init): Prevent a crash when only one font from
+ menu/popup fonts is not found.
+
+ * lib/lyxrc.example: Add an example for binding a key for language
+ switching.
+
+2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
+
+ * src/converter.C (GetReachable): Changed the returned type to
+ vector<FormatPair>
+ (IsReachable): New method
+
+ * src/MenuBackend.C (expand): Handle formats that appear more
+ than once
+
+2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/frontends/support/Makefile.am
+ (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
+ not in SOURCES.
+
+ * lib/CREDITS: add Garst Reese.
+
+ * src/support/snprintf.h: add extern "C" {} around the definitions.
+
+ * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
+
+2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/combox.[Ch]:
+ * src/frontends/xforms/FormDocument.C:
+ * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
+ compile without "conversion to integral type of smaller size"
+ warnings.
+
+2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
+
+ * src/text.C (GetColumnNearX): Fixed disabled code.
+
+2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * configure.in (CPPFLAGS): add snprintf and vsnprintf to
+ AC_CHECK_FUNCS
+
+ * src/support/snprintf.[ch]: new files
+
+2000-10-13 John Levon <moz@compsoc.man.ac.uk>
+
+ * src/frontends/kde/formprintdialog.C: add
+ file browser for selecting postscript output
+
+ * src/frontends/kde/formprintdialogdata.C:
+ * src/frontends/kde/formprintdialogdata.h: re-generate
+ correctly
+
+2000-10-13 John Levon <moz@compsoc.man.ac.uk>
+
+ * src/frontends/gnome/Makefile.am:
+ * src/frontends/kde/Makefile.am: FormCommand.C
+ disappeared from xforms
+
+ * src/frontends/kde/FormCitation.C:
+ * src/frontends/kde/FormIndex.C: read-only
+ correctness
+
+2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/support/lyxfunctional.h (void_class_fun_t): fix name of
+ constructor.
+
+ * src/bufferlist.C: add using directive.
+
+2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/lyxfunctional.h: version of class_fun for void
+ returns added, const versions of back_inseter_fun and compare_fun
+ added.
+
+2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/xforms/FormInset.C (showInset): fix typo.
+
+2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * ChangeLog: cleanup.
+
+ * lib/CREDITS: update to add all the contributors we've forgotten.
+ I have obviously missed some, so tell me whether there were
+ errors.
+
+2000-10-13 Marko Vendelin <markov@ioc.ee>
+
+ * src/frontends/gnome/FormCitation.C
+ * src/frontends/gnome/FormCitation.h
+ * src/frontends/gnome/FormError.C
+ * src/frontends/gnome/FormIndex.C
+ * src/frontends/gnome/FormRef.C
+ * src/frontends/gnome/FormRef.h
+ * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
+
+ * src/frontends/gnome/FormCitation.C
+ * src/frontends/gnome/FormCopyright.C
+ * src/frontends/gnome/FormError.C
+ * src/frontends/gnome/FormIndex.C
+ * src/frontends/gnome/FormRef.C
+ * src/frontends/gnome/FormToc.C
+ * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
+ appropriate.
+
+ * src/frontends/gnome/Menubar_pimpl.C
+ * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
+ fill the menus.
+
+2000-10-11 Baruch Even <baruch.even@writeme.com>
+
+ * src/minibuffer.h:
+ * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
+ to convey its real action.
+
+ * src/minibuffer.C (peek_event): Added action when mouse clicks to
+ clear the minibuffer and prepare to enter a command.
+
+ * src/mathed/formula.C (LocalDispatch): Changed to conform with
+ the rename from ExecCommand to PrepareForCommand.
+ * src/lyxfunc.C (Dispatch): ditto.
+
+2000-10-11 Baruch Even <baruch.even@writeme.com>
+
+ * src/buffer.C (writeFile): Added test for errors on writing, this
+ catches all errors and not only file system full errors as intended.
+
+2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
+
+ * src/lyx_gui.C (create_forms): better fix for crash with
+ translated interface.
+
+2000-10-12 John Levon <moz@compsoc.man.ac.uk>
+
+ * src/frontends/kde/Makefile.am:
+ * src/frontends/kde/FormCopyright.C:
+ * src/frontends/kde/formcopyrightdialog.C:
+ * src/frontends/kde/formcopyrightdialog.h:
+ * src/frontends/kde/formcopyrightdialogdata.C:
+ * src/frontends/kde/formcopyrightdialogdata.h:
+ * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
+ * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
+ copyright to use qtarch
+
+2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
+
+ * src/encoding.C (read): Fixed bug that caused an error message at
+ the end of the file.
+
+ * po/Makefile.in.in: Fixed rule for ext_l10n.h
+
+ * lib/lyxrc.example: Fixed hebrew example.
+
+2000-10-13 Allan Rae <rae@lyx.org>
+
+ * src/frontends/xforms/FormPreferences.C (input): reworking the
+ checking
+ (build, update, apply): New inputs in various tabfolders
+
+ * src/frontends/xforms/FormToc.C: use new button policy.
+ * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
+ dialogs that either can't use any existing policy or where it just
+ doesn't care.
+
+ * src/frontends/xforms/FormTabular.h: removed copyright notice that
+ said it was mine.
+
+ * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
+ added a bool parameter which is ignored.
+
+ * src/buffer.C (setReadonly):
+ * src/BufferView_pimpl.C (buffer):
+ * src/frontends/kde/FormCopyright.h (update):
+ * src/frontends/kde/FormCitation.[Ch] (update):
+ * src/frontends/kde/FormIndex.[Ch] (update):
+ * src/frontends/kde/FormPrint.[Ch] (update):
+ * src/frontends/kde/FormRef.[Ch] (update):
+ * src/frontends/kde/FormToc.[Ch] (update):
+ * src/frontends/kde/FormUrl.[Ch] (update):
+ * src/frontends/gnome/FormCopyright.h (update):
+ * src/frontends/gnome/FormCitation.[Ch] (update):
+ * src/frontends/gnome/FormError.[Ch] (update):
+ * src/frontends/gnome/FormIndex.[Ch] (update):
+ * src/frontends/gnome/FormPrint.[Ch] (update):
+ * src/frontends/gnome/FormRef.h (update):
+ * src/frontends/gnome/FormToc.[Ch] (update):
+ * src/frontends/gnome/FormUrl.[Ch] (update):
+ * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
+ to updateBufferDependent and DialogBase
+
+ * src/frontends/xforms/FormCitation.[hC]:
+ * src/frontends/xforms/FormDocument.[hC]: also removed restore()
+ * src/frontends/xforms/FormError.[Ch]:
+ * src/frontends/xforms/FormGraphics.[Ch]:
+ * src/frontends/xforms/FormIndex.[Ch]:
+ * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
+ and fixed readOnly handling.
+ * src/frontends/xforms/FormPrint.[Ch]:
+ * src/frontends/xforms/FormRef.[Ch]:
+ * src/frontends/xforms/FormTabular.[Ch]:
+ * src/frontends/xforms/FormToc.[Ch]:
+ * src/frontends/xforms/FormUrl.[Ch]:
+ * src/frontends/xforms/FormInset.[Ch]:
+ * src/frontends/xforms/FormBase.[hC]: modifications to use the new
+ form of updateBufferDependent.
+
+ * src/frontends/xforms/FormBase.C (hide): only call disconnect()
+ if form()->visible just in case someone does stuff to the form in a
+ derived class.
+
+ * src/frontends/DialogBase.h (enum): removed enum since we can now use
+ the buttoncontroller for everything the enum used to be used for.
+ (update) It would seem we need to force all dialogs to use a bool
+ parameter or have two update functions. I chose to go with one.
+ I did try removing update() from here and FormBase and defining the
+ appropriate update signatures in FormBaseB[DI] but then ran into the
+ problem of the update() call in FormBase::show(). Whatever I did
+ to get around that would require another function and that just
+ got more confusing. Hence the decision to make everyone have an
+ update(bool). An alternative might have been to override show() in
+ FormBaseB[DI] and that would allow the different and appropriate
+ update signatures.
+
+ * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
+ true == buffer change occurred. I decided against using a default
+ template parameter since not all compilers support that at present.
+
+2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
+ army knife" by removing functionality.
+ (clearStore): removed. All such housekeeping on hide()ing the dialog
+ is to be carried out by overloaded disconnect() methods.
+ (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
+ superceded by Baruch's neat test (FormGraphics) to update an existing
+ dialog if a new signal is recieved rather than block all new signals
+ until it is closed.
+ (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
+ only to Inset dialogs.
+ (FormBaseBI, FormBaseBD): new classes derived from FormBase for
+ "Buffer Independent" and "Buffer Dependent" dialogs respectively.
+
+ * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
+
+ * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
+ as a base class to all inset dialogs. Used solely to connect/disconnect
+ the Inset::hide signal and to define what action to take on receipt of
+ a UpdateBufferDependent signal.
+ (FormCommand): now derived from FormInset.
+
+ * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
+ disconnect().
+
+ * src/frontends/xforms/FormCopyright.[Ch]:
+ * src/frontends/xforms/FormPreferences.[Ch]:
+ now derived from FormBaseBI.
+
+ * src/frontends/xforms/FormDocument.[Ch]:
+ * src/frontends/xforms/FormParagraph.[Ch]:
+ * src/frontends/xforms/FormPrint.[Ch]:
+ now derived from FormBaseBD.
+
+ * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
+
+ * src/frontends/xforms/FormCitation.[Ch]:
+ * src/frontends/xforms/FormError.[Ch]:
+ * src/frontends/xforms/FormRef.[Ch]:
+ * src/frontends/xforms/FormToc.[Ch]:
+ (clearStore): reworked as disconnect().
+
+ * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
+ FormInset.[Ch].
+
+2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/converter.C (runLaTeX): constify buffer argument
+ (scanLog): ditto.
+
+ * src/frontends/support/Makefile.am (INCLUDES): fix.
+
+ * src/buffer.h: add std:: qualifier
+ * src/insets/figinset.C (addpidwait): ditto
+ * src/MenuBackend.C: ditto
+ * src/buffer.C: ditto
+ * src/bufferlist.C: ditto
+ * src/layout.C: ditto
+ * src/lyxfunc.C: ditto
+
+2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/lyxtext.h (bidi_level): change return type to
+ LyXParagraph::size_type.
+
+ * src/lyxparagraph.h: change size_type to
+ TextContainer::difference_type. This should really be
+ TextContainer::size_type, but we need currently to support signed
+ values.
+
+2000-10-11 Marko Vendelin <markov@ioc.ee>
+ * src/frontends/gnome/FormError.h
+ * src/frontends/gnome/FormRef.C
+ * src/frontends/gnome/FormRef.h
+ * src/frontends/gnome/FormError.C
+ * src/frontends/gnome/Makefile.am
+ * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
+ to Gnome frontend. Both dialogs use "action" area.
+
+2000-10-12 Baruch Even <baruch.even@writeme.com>
+
+ * src/graphics/GraphicsCacheItem_pimpl.C:
+ * src/graphics/Renderer.C:
+ * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
+ It now compiles.
+
+2000-10-12 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettext.C (draw): fixed drawing bug (specifically
+ visible when selecting).
+
+ * development/Code_rules/Rules: fixed some typos.
+
+2000-10-09 Baruch Even <baruch.even@writeme.com>
+
+ * src/filedlg.C (GroupCache::find): de-inlined the function, makes
+ compiling on egcs 1.1.2 possible.
+
+ * src/filedlg.C (comp_direntry::operator() ): ditto.
+
+2000-08-31 Baruch Even <baruch.even@writeme.com>
+
+ * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
+ Buffer parameter.
+
+ * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
+ transient it now only gets freed when the object is destructed.
+
+2000-08-24 Baruch Even <baruch.even@writeme.com>
+
+ * src/frontends/FormGraphics.h:
+ * src/frontends/FormGraphics.C: Changed to use ButtonController and
+ ButtonPolicies.
+
+2000-08-20 Baruch Even <baruch.even@writeme.com>
+
+ * src/insets/insetgraphics.C:
+ (draw): Added messages to the drawn rectangle to report status.
+ (updateInset): Disabled the use of the inline graphics,
+ (draw): ditto.
+
+2000-08-17 Baruch Even <baruch.even@writeme.com>
+
+ * src/frontends/support: Directory added for the support of GUII LyX.
+
+ * src/frontends/support/LyXImage.h:
+ * src/frontends/support/LyXImage.C: Base class for GUII holding of
+ images.
+
+ * src/frontends/support/LyXImage_X.h:
+ * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
+ version of LyXImage, this uses the Xlib Pixmap.
+
+ * src/PainterBase.h:
+ * src/PainterBase.C:
+ * src/Painter.h:
+ * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
+ replacement to Pixmap.
+
+ * src/insets/insetgraphics.h:
+ * src/insets/insetgraphics.C:
+ * src/graphics/GraphicsCacheItem.h:
+ * src/graphics/GraphicsCacheItem.C:
+ * src/graphics/GraphicsCacheItem_pimpl.h:
+ * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
+ instead of Pixmap.
+
+ * src/graphics/GraphicsCacheItem.h:
+ * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
+ another copy of the object.
+
+ * src/insets/insetgraphics.C (Clone): Changed to create a second copy
+ of cacheHandle, this fixed a bug that sent LyX crashing.
+
+ * src/graphics/XPM_Renderer.h:
+ * src/graphics/XPM_Renderer.C:
+ * src/graphics/EPS_Renderer.h:
+ * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
+
+2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/lyxfunc.C (processKeySym): only handle the
+ lockinginset/inset stuff if we have a buffer and text loaded...
+
+ * lib/Makefile.am (EXTRA_DIST): add encodings and languages
+
+2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/lyxfunctional.h: add operator= that takes a reference
+
+ * src/lyxserver.C (mkfifo): make first arg const
+
+ * src/layout.h: renamed name(...) to setName(...) to work around
+ bugs in egcs.
+
+ * src/buffer.C (setFileName): had to change name of function to
+ work around bugs in egcs. (renamed from fileName)
+
+2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/translator.h: move helper template classes to
+ lyxfunctional.h, include "support/lyxfunctional.h"
+
+ * src/support/lyxmanip.h: add delaration of fmt
+
+ * src/support/lyxfunctional.h: new file
+ (class_fun_t): new template class
+ (class_fun): helper template function
+ (back_insert_fun_iterator): new template class
+ (back_inserter_fun): helper template function
+ (compare_memfun_t): new template class
+ (compare_memfun): helper template function
+ (equal_1st_in_pair): moved here from translator
+ (equal_2nd_in_pair): moved here from translator
+
+ * src/support/fmt.C: new file
+ (fmt): new func, can be used for a printf substitute when still
+ using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
+
+ * src/support/StrPool.C: add some comments
+
+ * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
+ lyxfunctional.h
+
+ * src/insets/figinset.C (addpidwait): use std::copy with
+ ostream_iterator to fill the pidwaitlist
+
+ * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
+
+ * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
+ c_str()
+
+ * src/frontends/xforms/Menubar_pimpl.C: make several file scope
+ variables static
+
+ * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
+
+ * src/frontends/xforms/FormDocument.C (build): remove c_str()
+ (class_update): ditto
+ (BulletPanel): ditto
+ (CheckChoiceClass): move initialization of tc and tct
+
+ * src/tabular.C: remove current_view
+ (OldFormatRead): similar to right below [istream::ignore]
+
+ * src/lyxlex_pimpl.C (next): add code for faster skipping of
+ chars, unfortunately this is buggy on gcc 2.95.2, so currently
+ unused [istream::ignore]
+
+ * src/lyxfunc.C: include "support/lyxfunctional.h"
+ (getInsetByCode): use std::find_if and compare_memfun
+
+ * src/lyxfont.C (stateText): remove c_str()
+
+ * src/lyx_main.C (setDebuggingLevel): make static
+ (commandLineHelp): make static
+
+ * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
+ Screen* together with fl_get_display() and fl_screen
+
+ * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
+ togheter with fl_get_display() and fl_screen
+ (create_forms): remove c_str()
+
+ * src/layout.C: include "support/lyxfunctional.h"
+ (hasLayout): use std::find_if and compare_memfun
+ (GetLayout): use std::find_if and comapre_memfun
+ (delete_layout): use std::remove_if and compare_memfun
+ (NumberOfClass): use std:.find_if and compare_memfun
+
+ * src/gettext.h: change for the new functions
+
+ * src/gettext.C: new file, make _(char const * str) and _(string
+ const & str) real functions.
+
+ * src/font.C (width): rewrite slightly to avoid one extra variable
+
+ * src/debug.C: initialize Debug::ANY here
+
+ * src/commandtags.h: update number comments
+
+ * src/combox.h (get): make const func
+ (empty): make const
+ (getline): make const
+
+ * src/combox.C (input_cb): handle case where fl_get_input can
+ return NULL
+
+ * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
+ "support/lyxfunctional.h", remove current_view variable.
+ (resize): use std::for_each with std::mem_fun
+ (getFileNames): use std::copy with back_inserter_fun
+ (getBuffer): change arg type to unsigned int
+ (emergencyWriteAll): call emergencyWrite with std::for_each and
+ class_fun.
+ (emergencyWrite): new method, the for loop in emergencyWriteAll
+ has been unrolled.
+ (exists): use std::find_if with compare_memfun
+ (getBuffer): use std::find_if and compare_memfun
+
+ * src/buffer.h: add typedefs for iterator_category, value_type
+ difference_type, pointer and reference for inset_iterator
+ add postfix ++ for inset_iterator
+ make inset_iterator::getPos() const
+
+ * src/buffer.C: added support/lyxmanip.h
+ (readFile): use lyxerr << fmt instead of printf
+ (makeLaTeXFile): use std::copy to write out encodings
+
+ * src/Painter.C (text): rewrite slightly to avoid extra font variable
+
+ * src/MenuBackend.C (read): remove c_str(), as well as strdup and
+ free and the char * temp.
+ (hasMenu): use std::find_if and compare_memfun
+ (getMenu): ditto
+
+ * src/Makefile.am (lyx_SOURCES): added gettext.C
+
+ * src/LyXAction.C (retrieveActionArg): clear the arg, use
+ string::insert small change to avoid temporary
+
+ * src/LColor.C (getGUIName): remove c_str()
+
+ * several files: change all occurrences of fl_display to
+ fl_get_display()
+
+ * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
+ that -pedantic is not used for gcc 2.97 (cvs gcc)
+
+ * boost/Makefile.am: begin slowly to prepare for a real boost lib
+
+2000-10-11 Allan Rae <rae@lyx.org>
+
+ * src/frontends/xforms/FormPreferences.C (input): template path must be
+ a readable directory. It doesn't need to be writeable.
+ (build, delete, update, apply): New inputs in the various tabfolders
+
+ * src/frontends/xforms/forms/form_preferences.fd:
+ * src/frontends/xforms/FormPreferences.h: New tabfolder and added
+ several new entries to existing folders. Shuffled some existing stuff
+ around.
+
+ * src/frontends/xforms/forms/form_print.fd:
+ * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
+ Should probably rework PrinterParams as well. Note that the switch to
+ collated is effectively the same as !unsorted so changing PrinterParams
+ will require a lot of fiddly changes to reverse the existing logic.
+
+ * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
+
+2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
+
+2000-10-10 Allan Rae <rae@lyx.org>
+
+ * src/lyxrc.[Ch]:
+ * src/lyxfunc.C (Dispatch):
+ * src/lyx_gui.C:
+ * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
+ member of LyXRC
+
+ * src/lyxrc.C (output): Only write the differences between system lyxrc
+ and the users settings.
+
+ * src/lyx_main.C:
+ * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
+ system_lyxrc.
+ I'll rewrite this later, after 1.1.6 probably, to keep a single
+ LyXRC but two instances of a LyXRCStruct.
+
+2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * lib/Makefile.am (pkgdata_DATA): add encoding and languages
+
+ * src/tabular.h: add a few std:: qualifiers.
+
+ * src/encoding.C: add using directive.
+ * src/language.C: ditto.
+
+ * src/insets/insetquotes.C (Validate): use languages->lang()
+ instead of only language.
+
+2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
+
+ * lib/languages: New file.
+
+ * lib/encodings: New file.
+
+ * src/language.C (Languages): New class.
+ (read): New method. Reads the languages from the 'languages' file.
+
+ * src/encoding.C (Encodings): New class.
+ (read): New method. Reads the encodings from the 'encodings' file.
+
+ * src/lyx_main.C (init): Call to LyXSetStyle() after languages
+ initialization.
+
+ * src/bufferparams.h and a lot of files: Deleted the member language,
+ and renamed language_info to language
+
+ * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
+ * src/lyxfont.C (latexWriteStartChanges): ditto.
+ * src/paragraph.C (validate,TeXOnePar): ditto.
+
+ * src/lyxfont.C (update): Restored deleted code.
+
+ * src/frontends/xforms/FormDocument.C (build): Made the combox taller
+
+2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/BufferView_pimpl.C (buffer): cleaned up a little.
+
+ * src/insets/figinset.[Ch]:
+ * src/insets/insetinclude.[Ch]:
+ * src/insets/insetinclude.[Ch]:
+ * src/insets/insetparent.[Ch]:
+ * src/insets/insetref.[Ch]:
+ * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
+
+ * src/insets/*.[Ch]:
+ * src/mathed/formula.[Ch]:
+ * src/mathed/formulamacro.C (Clone): passed Buffer const &.
+
+ * src/buffer.C (parseSingleLyXformat2Token, readInset):
+ * src/lyx_cb.C (FigureApplyCB):
+ * src/lyxfunc.C (getStatus, Dispatch):
+ * src/frontends/xforms/FormTabular.C: use modified c-tors to some
+ insets.
+
+ * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
+
+ * src/converter.[Ch] (Formats::View):
+ * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
+
+ * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
+ *current_view->buffer(). This will change later, but this patch is way
+ big enough already!
+
+2000-10-09 Juergen Vigna <jug@sad.it>
+
+ * src/text.C (GetRow): small fix.
+
+ * src/BufferView_pimpl.C (cursorPrevious):
+ (cursorNext): added LyXText parameter to function.
+
+ * src/insets/insettabular.C (LocalDispatch): activate cell inset on
+ keypress depending on cursor position.
+
+2000-10-06 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.C (Ascii): finally call right ascii-function.
+ (copySelection): redone this function and also copy ascii representa-
+ tion to clipboard.
+
+ * src/tabular.C (Ascii):
+ (AsciiPrintCell):
+ (AsciiBottomHLine):
+ (AsciiTopHLine):
+ (print_n_chars): new functions to realize the ascii export of tabulars.
+
+2000-10-05 Juergen Vigna <jug@sad.it>
+
+ * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
+ if we don't have a buffer.
+
+2000-10-10 Allan Rae <rae@lyx.org>
+
+ * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
+ with closing dialog. It seems that nested tabfolders require hiding
+ of inner tabfolders before hiding the dialog itself. Actually all I
+ did was hide the active outer folder.
+
+ * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
+ unless there really is a buffer. hideBufferDependent is called
+ instead.
+
+ * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
+ POTFILES.in stays in $(srcdir).
+
+2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
+
+ * lib/lyxrc.example: Few changes.
+
+2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/BufferView_pimpl.C (buffer): only need one the
+ updateBufferDependent signal to be emitted once! Moved to the end of
+ the method to allow bv_->text to be updated first.
+
+ * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
+ and hSignal_ with Dialogs * and BufferDependency variables.
+ New Buffer * parent_, initialised when the dialog is launched. Used to
+ check whether to update() or hide() dialog in the new, private
+ updateOrHide() method that is connected to the updateBufferDependent
+ signal. Daughter classes dictate what to do using the
+ ChangedBufferAction enum, passed to the c-tor.
+
+ * src/frontends/xforms/FormCitation.C:
+ * src/frontends/xforms/FormCommand.C:
+ * src/frontends/xforms/FormCopyright.C:
+ * src/frontends/xforms/FormDocument.C:
+ * src/frontends/xforms/FormError.C:
+ * src/frontends/xforms/FormIndex.C:
+ * src/frontends/xforms/FormPreferences.C:
+ * src/frontends/xforms/FormPrint.C:
+ * src/frontends/xforms/FormRef.C:
+ * src/frontends/xforms/FormToc.C:
+ * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
+ c-tor.
+
+ * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
+ ChangedBufferAction enum.
+
+ * src/frontends/xforms/FormParagraph.[Ch]
+ * src/frontends/xforms/forms/form_paragraph.fd: now derived from
+ FormBase.
+
+2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * lib/bind/cua.bind: fix a bit.
+ * lib/bind/emacs.bind: ditto.
+
+ * lib/bind/menus.bind: remove real menu entries from there.
+
+ * src/spellchecker.C: make sure we only include strings.h when
+ _AIX is defined.
+
+2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
+
+ * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
+ function. It enlarges the maximum number of pup when needed.
+ (add_toc2): Open a new menu if maximum number of items per menu has
+ reached.
+
+2000-10-05 John Levon <moz@compsoc.man.ac.uk>
+
+ * src/frontends/kde/FormPrint.C: fix error reporting
+
+ * src/frontends/xforms/FormDocument.C: fix compiler
+ warnings
+
+ * lib/.cvsignore: add Literate.nw
+
+2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
+
+ * buffer.C
+ * bufferview_funcs.[Ch]
+ * lyxfont.[Ch]
+ * text.C
+ * text2.C: Add support for numbers in RTL text.
+
+2000-10-06 Allan Rae <rae@lyx.org>
+
+ * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
+ to be gettext.m4 friendly again. ext_l10n.h is now
+ generated into $top_srcdir instead of $top_builddir
+ so that lyx.pot will be built correctly -- without
+ duplicate parsing of ext_l10n.h.
+
+2000-10-04 John Levon <moz@compsoc.man.ac.uk>
+
+ * src/frontends/kde/FormCitation.C: make the dialog
+ behave more sensibly
+
+2000-10-03 John Levon <moz@compsoc.man.ac.uk>
+
+ * config/kde.m4: fix consecutive ./configure runs,
+ look for qtarch, fix library order
+
+ * src/frontends/kde/Makefile.am: tidy up,
+ add Print dialog, add .dlg dependencies
+
+ * src/frontends/kde/FormPrint.C:
+ * src/frontends/kde/FormPrint.h:
+ * src/frontends/kde/formprintdialog.C:
+ * src/frontends/kde/formprintdialog.h:
+ * src/frontends/kde/formprintdialogdata.C:
+ * src/frontends/kde/formprintdialogdata.h:
+ * src/frontends/kde/dlg/formprintdialog.dlg: add
+ print dialog
+
+ * src/frontends/kde/dlg/README: Added explanatory readme
+
+ * src/frontends/kde/dlg/checkinitorder.pl: small perl
+ script to double-check qtarch's output
+
+ * src/frontends/kde/formindexdialog.C:
+ * src/frontends/kde/formindexdialogdata.C:
+ * src/frontends/kde/formindexdialogdata.h:
+ * src/frontends/kde/dlg/formindexdialog.dlg: update
+ for qtarch, minor fixes
+
+2000-10-05 Allan Rae <rae@lyx.org>
+
+ * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
+ dialogs when switching buffers update them instead. It's up to each
+ dialog to decide if it should still be visible or not.
+ update() should return a bool to control visiblity within show().
+ Or perhaps better to set a member variable and use that to control
+ visibility.
+
+ * lib/build-listerrors: create an empty "listerrors" file just to stop
+ make trying to regenerate it all the time if you don't have noweb
+ installed.
+
+ * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
+
+ * po/Makefile.in.in (ext_l10n.h): added a rule to build
+ $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
+ is built before src/ and ext_l10n.h isn't actually needed to build lyx.
+ (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
+ to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
+
+ * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
+
+2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
+ deleting buffer. Closes all buffer-dependent dialogs.
+
+ * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
+ FL_OBJECT * also.
+ * src/frontends/xforms/FormCitation.[Ch]:
+ * src/frontends/xforms/FormPreferences.[Ch]:
+ * src/frontends/xforms/FormPrint.[Ch]:
+ * src/frontends/xforms/FormRef.[Ch]:
+ * src/frontends/xforms/FormUrl.[Ch]: ditto
+
+ * src/frontends/xforms/FormDocument.[Ch]:
+ * src/frontends/xforms/forms/form_document.C.patch:
+ * src/frontends/xforms/forms/form_document.fd: all input callbacks now
+ pass through a single input() function.
+
+2000-10-04 John Levon <moz@compsoc.man.ac.uk>
+
+ * lib/build-listerrors: return status as OK
+
+2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
+
+ * lib/lyxrc.example: Updated to new export code
+
+2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
+ LexAlpha.
+
+ * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
+ character.
+
+ * lib/layouts/amsart.layout: include lyxmacros.inc, so that
+ LyX-Code is defined.
+ * lib/layouts/amsbook.layout: ditto.
+
+ * boost/Makefile.am: fix typo.
+
+ * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
+ Menu::expand.
+ (add_lastfiles): removed.
+ (add_documents): removed.
+ (add_formats): removed.
+
+ * src/frontends/Menubar.C: remove useless "using" directive.
+
+ * src/MenuBackend.h: add a new MenuItem constructor.
+
+ * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
+ xforms frontend.
+
+2000-10-04 Allan Rae <rae@lyx.org>
+
+ * lib/Makefile.am (listerrors):
+ * lib/build-listerrors: make $builddir != $srcdir compiles work again.
+ I haven't got notangle installed so Kayvan please test. The output
+ should end up in $builddir. This also allows people who don't have
+ noweb installed to complete the make process without error.
+
+ * src/frontends/xforms/FormCommand.[Ch] (showInset):
+ * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
+ by JMarc's picky compiler.
+
+2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+
+ * src/insets/insettabular.C (setPos): change for loop to not use
+ sequencing operator. Please check this Jürgen.
+
+ * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
+ instead of 'c'
+ * src/insets/insetcite.C (getScreenLabel): ditto
+ * src/support/filetools.C (QuoteName): ditto
+ (ChangeExtension): ditto
+
+ * src/BufferView_pimpl.C (scrollCB): make heigt int
+
+ * src/BufferView2.C (insertInset): comment out unused arg
+
+ * boost/Makefile.am (EXTRADIST): new variable
+
+2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
+
+ * src/exporter.C (IsExportable): Fixed
+
+ * lib/configure.m4: Small fix
+
+2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
+
+ * src/insets/insetbutton.C (width): Changed to work with no GUI.
+ * src/insets/insetbib.C (bibitemWidest): ditto.
+ * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
+
+2000-10-03 Juergen Vigna <jug@sad.it>
+
+ * src/BufferView2.C (theLockingInset): removed const because of
+ Agnus's compile problems.
+
+ * src/insets/insettext.C (LocalDispatch): set the language of the
+ surronding paragraph on inserting the first character.
+
+ * various files: changed use of BufferView::the_locking_inset.
+
+ * src/BufferView2.C (theLockingInset):
+ (theLockingInset): new functions.
+
+ * src/BufferView.h: removed the_locking_inset.
+
+ * src/lyxtext.h: added the_locking_inset
+
+ * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
+
+ * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
+
+2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
+ * src/mathed/math_cursor.C (IsAlpha): ditto.
+ * src/mathed/math_inset.C (strnew): ditto.
+ * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
+ (IMetrics): cxp set but never used; removed.
+ * src/insets/figinset.C (InitFigures): removed redundant for loop, now
+ that the variable in question has been removed also!
+
+
+ * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
+ using the Buffer * passed to Latex(), using the BufferView * passed to
+ bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
+
+ * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
+ Linuxdoc() and DocBook() rather than the stored Buffer * master.
+
+ * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
+ * src/buffer.C (readInset): used new InsetBibtex c-tor
+ * (getBibkeyList): used new InsetBibtex::getKeys
+
+2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
+
+ * lib/configure.m4
+ * lib/build-listerrors
+ * src/converter.C
+ * src/exporter.C: Add literate programming support to the export code
+
+ * src/buffer.C
+ * src/lyx_cb.C: Remove old literate code.
+
+ * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
+ variables.
+
+ * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
+ * src/converter.C (View, Convert): Use QuoteName.
+
+ * src/insets/figinset.C (Preview): Use Formats::View.
+
+ * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
+
+2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/lyxfunc.C (Dispatch): move declaration of text variable at
+ the top of the function, because compaq cxx complains that the
+ "goto exit_with_message" when the function is disabled bypasses
+ its initialization.
+ (MenuNew): try a better fix for the generation of new file names.
+ This time, I used AddName() instead of AddPath(), hoping Juergen
+ will be happier :)
+
+2000-10-03 Allan Rae <rae@lyx.org>
+
+ * src/frontends/xforms/forms/form_preferences.fd:
+ * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
+ nested tabfolders has begun. The old "Miscellaneous" was renamed as
+ "Look and Feel"->"General" but will need to be split up further into
+ general output and general input tabs. Current plan is for four outer
+ tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
+ stuff; "Inputs" for input and import configuration; "Outputs" for
+ output and export configuration; and one more whatever is left over
+ called "General". The leftovers at present look like being which
+ viewers to use, spellchecker, language support and might be better
+ named "Support". I've put "Paths" in "Inputs" for the moment as this
+ seems reasonable for now at least.
+ One problem remains: X error kills LyX when you close Preferences.
+
+2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
+ qualifier from form()
+ * src/frontends/xforms/FormCitation.[Ch]:
+ * src/frontends/xforms/FormCopyright.[Ch]:
+ * src/frontends/xforms/FormDocument.[Ch]:
+ * src/frontends/xforms/FormError.[Ch]:
+ * src/frontends/xforms/FormIndex.[Ch]:
+ * src/frontends/xforms/FormPreferences.[Ch]:
+ * src/frontends/xforms/FormPrint.[Ch]:
+ * src/frontends/xforms/FormRef.[Ch]:
+ * src/frontends/xforms/FormToc.[Ch]:
+ * src/frontends/xforms/FormUrl.[Ch]: ditto.
+
+ * src/frontends/xforms/FormCitation.[Ch]:
+ * src/frontends/xforms/FormIndex.[Ch]:
+ * src/frontends/xforms/FormRef.[Ch]:
+ * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
+ with Allan's naming policy
+
+ * src/frontends/xforms/FormCitation.C: some static casts to remove
+ compiler warnings.
+
+2000-10-02 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.C (LocalDispatch): fixed selection code,
+ now you can type or do stuff inside the table-cell also when in dummy
+ position, fixed visible cursor.
+
+ * src/insets/insettext.C (Edit): fixing cursor-view position.
+
+ * src/lyxfunc.C (Dispatch): use * text variable so that it can
+ be used for equal functions in lyxfunc and insettext.
+
+ * src/text.C (GetVisibleRow): fixed a small clear_area bug.
+
+2000-10-02 John Levon <moz@compsoc.man.ac.uk>
+
+ * src/frontends/gnome/FormCitation.h:
+ * src/frontends/gnome/FormCopyright.h:
+ * src/frontends/gnome/FormIndex.h:
+ * src/frontends/gnome/FormPrint.h:
+ * src/frontends/gnome/FormToc.h:
+ * src/frontends/gnome/FormUrl.h:
+ * src/frontends/kde/FormCitation.h:
+ * src/frontends/kde/FormCopyright.h:
+ * src/frontends/kde/FormIndex.h:
+ * src/frontends/kde/FormRef.h:
+ * src/frontends/kde/FormToc.h:
+ * src/frontends/kde/FormUrl.h: fix remaining users of
+ support/utility.hpp
+
+2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/buffer.C (linuxDocHandleFootnote): remove const modifier
+ from depth argument.
+ (DocBookHandleCaption): ditto.
+ (DocBookHandleFootnote): ditto.
+ (SimpleDocBookOnePar): ditto.
+
+ * src/frontends/xforms/FormDocument.h (form): remove extra
+ FormDocument:: qualifier.
+
+ * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
+ destructor.
+ * sigc++/handle.h: ditto.
+
+ * src/lyx_gui_misc.C: add "using" directive.
+
+ * src/cheaders/cstddef: new file, needed by the boost library (for
+ compaq cxx).
+
+2000-10-02 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettext.C (SetFont): better support.
+
+ * src/insets/insettabular.C (draw): fixed drawing of single cell.
+
+ * src/screen.C (DrawOneRow): some uint refixes!
+
+2000-10-02 Allan Rae <rae@lyx.org>
+
+ * boost/.cvsignore: ignore Makefile as well
+
+ * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
+ LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
+
+ * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
+ Left this one out by accident.
+
+ * src/frontends/xforms/FormBase.h (restore): default to calling
+ update() since that will restore the original/currently-applied values.
+ Any input() triggered error messages will require the derived classes
+ to redefine restore().
+
+ * src/frontends/xforms/FormDocument.C: initialize a few variables to
+ avoid a segfault. combo_doc_class is the main concern.
+
+2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
+
+ * Simplify build-listerrors in view of GUI-less export ability!
+
+2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
+
+ * src/lyx_main.C (easyParse): Disable gui when exporting
+
+ * src/insets/figinset.C:
+ * src/LaTeX.C
+ * src/converter.C
+ * src/lyx_gui_misc.C
+ * src/tabular.C: Changes to allow no-gui.
+
+2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/utility.hpp: removed file
+ * src/support/block.h: removed file
+
+ * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
+ and utility.hpp
+
+ * src/mathed/formula.C: add support/lyxlib.h
+ * src/mathed/formulamacro.C: ditto
+
+ * src/bufferparams.h: use boost/array.hpp instead of support/block.h
+ * src/lyxparagraph.h: ditto
+
+ * src/Makefile.am (BOOST_INCLUDES): the boost include dir
+ * src/frontends/Makefile.am (INCLUDES): ditto
+ * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
+ * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
+ * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
+ * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
+ * src/insets/Makefile.am (BOOST_INCLUDES): ditto
+ * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
+
+ * src/BufferView.h: use boost/utility.hpp
+ * src/LColor.h: ditto
+ * src/LaTeX.h: ditto
+ * src/LyXAction.h: ditto
+ * src/LyXView.h: ditto
+ * src/bufferlist.h: ditto
+ * src/lastfiles.h: ditto
+ * src/layout.h: ditto
+ * src/lyx_gui.h: ditto
+ * src/lyx_main.h: ditto
+ * src/lyxlex.h: ditto
+ * src/lyxrc.h: ditto
+ * src/frontends/ButtonPolicies.h: ditto
+ * src/frontends/Dialogs.h: ditto
+ * src/frontends/xforms/FormBase.h: ditto
+ * src/frontends/xforms/FormGraphics.h: ditto
+ * src/frontends/xforms/FormParagraph.h: ditto
+ * src/frontends/xforms/FormTabular.h: ditto
+ * src/graphics/GraphicsCache.h: ditto
+ * src/graphics/Renderer.h: ditto
+ * src/insets/ExternalTemplate.h: ditto
+ * src/insets/insetcommand.h: ditto
+ * src/support/path.h: ditto
+
+ * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
+ and introduce clause for 2.97.
+
+ * boost/libs/README: new file
+
+ * boost/boost/utility.hpp: new file
+
+ * boost/boost/config.hpp: new file
+
+ * boost/boost/array.hpp: new file
+
+ * boost/Makefile.am: new file
+
+ * boost/.cvsignore: new file
+
+ * configure.in (AC_OUTPUT): add boost/Makefile
+
+ * Makefile.am (SUBDIRS): add boost
+
+2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
+
+ * src/support/lstrings.C (suffixIs): Fixed.
+
+2000-10-01 Allan Rae <rae@lyx.org>
+
+ * src/PrinterParams.h: moved things around to avoid the "can't
+ inline call" warning.
+
+ * src/frontends/xforms/RadioButtonGroup.h: turned a comment
+ into doc++ documentation.
+
+ * src/frontends/xforms/FormCommand.[Ch]: support button policy
+
+ * src/frontends/xforms/FormRef.C: make use of button controller
+ * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
+ cleaned up button controller usage.
+ * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
+ * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
+ use the button controller
+
+ * src/frontends/xforms/forms/*.fd: and associated generated files
+ updated to reflect changes to FormBase. Some other FormXxxx files
+ also got minor updates to reflect changes to FormBase.
+
+ * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
+ (hide): made virtual.
+ (input): return a bool. true == valid input
+ (RestoreCB, restore): new
+ (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
+ Changes to allow derived dialogs to use a ButtonController and
+ make sense when doing so: OK button calls ok() and so on.
+
+ * src/frontends/xforms/ButtonController.h (class ButtonController):
+ Switch from template implementation to taking Policy parameter.
+ Allows FormBase to provide a ButtonController for any dialog.
+
+ * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
+ Probably should rename connect and disconnect.
+ (apply): use the radio button groups
+ (form): needed by FormBase
+ (build): setup the radio button groups
+
+2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * several files: type changes to reduce the number of warnings and
+ to unify type hangling a bit. Still much to do.
+
+2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * lib/images/*: rename a bunch of icons to match Dekel converter
+ changes.
+
+ * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
+ last parameter.
+
+ * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
+
+ * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
+ virtual destructor
+ * sigc++/handle.h: ditto for class Handle.
+
+2000-09-27 John Levon <moz@compsoc.man.ac.uk>
+
+ * config/kde.m4: make Qt fail immediately if Qt2 is picked up
+
+2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
+
+ * src/intl.C (InitKeyMapper): Correct the value of n due to the
+ removal of the "default" language.
+
+ * src/combox.h (getline): Check that sel > 0
+
+2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
+
+ * lib/examples/docbook_example.lyx
+ * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
+
+ * lib/layouts/docbook-book.layout: new docbook book layout.
+
+ * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
+
+ * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
+
+ * src/insets/figinset.C (DocBook):fixed small typo.
+
+ * src/insets/insetinclude.C (DocBook): new export for verbatim type.
+
+ * src/insets/insetinclude.h: string include_label doesn't need to be
+ mutable.
+
+2000-09-29 Allan Rae <rae@lyx.org>
+
+ * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
+ Allow derived type to control connection and disconnection from signals
+ of its choice if desired.
+
+2000-09-28 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettabular.C (update): fixed cursor setting when
+ the_locking_inset changed.
+ (draw): made this a bit cleaner.
+ (InsetButtonPress): fixed!
+
+ * various files: added LyXText Parameter to fitCursor call.
+
+ * src/BufferView.C (fitCursor): added LyXText parameter.
+
+ * src/insets/insettabular.C (draw): small draw fix.
+
+ * src/tabular.C: right setting of left/right celllines.
+
+ * src/tabular.[Ch]: fixed various types in funcions and structures.
+ * src/insets/insettabular.C: ditto
+ * src/frontends/xforms/FormTabular.C: ditto
+
+2000-09-28 Allan Rae <rae@lyx.org>
+
+ * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
+ that the #ifdef's had been applied to part of what should have been
+ a complete condition. It's possible there are other tests that
+ were specific to tables that are also wrong now that InsetTabular is
+ being used. Now we need to fix the output of '\n' after a table in a
+ float for the same reason as the original condition:
+ "don't insert this if we would be adding it before or after a table
+ in a float. This little trick is needed in order to allow use of
+ tables in \subfigures or \subtables."
+ Juergen can you check this?
+
+2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/insets/insettext.C (Ascii): return numer of '\n' in the text
+ output to the ostream.
+
+ * several files: fixed types based on warnings from cxx
+
+2000-09-26 John Levon <moz@compsoc.man.ac.uk>
+
+ * src/frontends/kde/Makefile.am: fix rule for
+ formindexdialogdata_moc.C
+
+ * src/.cvsignore: add ext_l10n.h to ignore
+
+ * acconfig.h: stop messing with __STRICT_ANSI__
+ * config/gnome.m4: remove option to set -ansi
+ * config/kde.m4: remove option to set -ansi
+ * config/lyxinclude.m4: don't set -ansi
+
+2000-09-27 Juergen Vigna <jug@sad.it>
+
+ * various files: remove "default" language check.
+
+ * src/insets/insetquotes.C: removed use of current_view.
+
+ * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
+ the one should have red ears by now!
+
+ * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
+ in more then one paragraph. Fixed cursor-movement/selection.
+
+ * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
+ paragraphs inside a text inset.
+
+ * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
+ text-inset if this owner is an inset.
+
+2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/Bullet.h: changed type of font, character and size to int
+
+ * src/buffer.C (asciiParagraph): remove actcell and fname1.
+
+ * src/insets/inseturl.[Ch]:
+ * src/insets/insetref.[Ch]:
+ * src/insets/insetlabel.[Ch]: add linelen to Ascii
+
+2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
+
+ * src/buffer.C (readFile): block-if statement rearranged to minimise
+ bloat. Patch does not reverse Jean-Marc's change ;-)
+
+ * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
+ Class rewritten to store pointers to hide/update signals directly,
+ rather than Dialogs *. Also defined an enum to ease use. All xforms
+ forms can now be derived from this class.
+
+ * src/frontends/xforms/FormCommand.[Ch]
+ * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
+
+ * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
+ out of header file.
+
+ * src/frontends/xforms/forms/form_citation.fd
+ * src/frontends/xforms/forms/form_copyright.fd
+ * src/frontends/xforms/forms/form_error.fd
+ * src/frontends/xforms/forms/form_index.fd
+ * src/frontends/xforms/forms/form_ref.fd
+ * src/frontends/xforms/forms/form_toc.fd
+ * src/frontends/xforms/forms/form_url.fd: remamed callbacks
+
+ * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
+
+ * src/insets/insetfoot.C: removed redundent using directive.
+
+2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * lib/layouts/siamltex.layout: new textclass for SIAM journals,
+ from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
+
+ * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
+ created in the constructors in different groups. Then set() just
+ have to show the groups as needed. This fixes the redraw problems
+ (and is how the old menu code worked).
+
+ * src/support/lyxlib.h: declare the methods as static when we do
+ not have namespaces.
+
+2000-09-26 Juergen Vigna <jug@sad.it>
+
+ * src/buffer.C (asciiParagraph): new function.
+ (writeFileAscii): new function with parameter ostream.
+ (writeFileAscii): use now asciiParagraph.
+
+ * various inset files: added the linelen parameter to the Ascii-func.
+
+ * src/tabular.C (Write): fixed error in writing file introduced by
+ the last changes from Lars.
+
+ * lib/bind/menus.bind: removed not supported functions.
+
+ * src/insets/insettext.C (Ascii): implemented this function.
+
+ * src/insets/lyxinset.h (Ascii): added linelen parameter.
+
+ * src/tabular.C (write_attribute[int,string,bool]): new functions.
+ (Write): use of the write_attribute functions.
+
+ * src/bufferlist.C (close): fixed reasking question!
+
+2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
+
+ * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
+ new files use the everwhere possible.
+
+ * several files:
+ * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
+ src/log_form.C src/lyx.C:
+ regenerated
+
+ * src/buffer.C (runLaTeX): remove func
+
+ * src/PaperLayout.C: removed file
+ * src/ParagraphExtra.C: likewise
+ * src/bullet_forms.C: likewise
+ * src/bullet_forms.h: likewise
+ * src/bullet_forms_cb.C: likewise
+
+ * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
+ ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
+ bullet_forms_cb.C
+
+ * several files: remove all traces of the old fd_form_paragraph,
+ and functions belonging to that.
+
+ * several files: remove all traces of the old fd_form_document,
+ and functions belonging to that.
+
+ * several files: constify local variables were possible.
+
+ * several files: remove all code that was dead when NEW_EXPORT was
+ defined
+
+ * several files: removed string::c_str in as many places as
+ possible.
+
+ * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
+ (e): be a bit more outspoken when patching
+ (updatesrc): only move files if changed.
+
+ * forms/layout_forms.h.patch: regenerated
+
+ * forms/layout_forms.fd: remove form_document and form_paragraph
+ and form_quotes and form_paper and form_table_options and
+ form_paragraph_extra
+
+ * forms/form1.fd: remove form_table
+
+ * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
+ the fdui->... rewrite. Update some comments to xforms 0.88
+
+ * forms/bullet_forms.C.patch: removed file
+ * forms/bullet_forms.fd: likewise
+ * forms/bullet_forms.h.patch: likewise
+
+ * development/Code_rules/Rules: added a section on switch
+ statements. Updated some comment to xforms 0.88.
+
+2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/buffer.C (readFile): make sure that the whole version number
+ is read after \lyxformat (even when it contains a comma)
+
+ * lib/ui/default.ui: change shortcut of math menu to M-a.
+
+2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/vspace.C (nextToken): use isStrDbl() to check for proper
+ double values.
+
+ * src/LyXView.C (updateWindowTitle): show the full files name in
+ window title, limited to 30 characters.
+
+ * src/support/lyxstring.C (lyxstring): fix it correctly this time.
+ When a number of characters has been given, we should not assume
+ that the string is 0-terminated.
+
+ * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
+ calls (fixes some memory leaks)
+
+ * src/intl.[Ch]: add a destructor for Intl, in order to delete the
+ trans member on exit.
+
+2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
+
+ * src/converter.C (GetReachable): fix typo.
+
+ * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
+ understand ',' instead of '.'.
+ (GetInteger): rewrite to use strToInt().
+
+2000-09-26 Juergen Vigna <jug@sad.it>
+
+ * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
+ better visibility and error-message on wrong VSpace input.
+
+ * src/language.C (initL): added english again.
+
+2000-09-25 Juergen Vigna <jug@sad.it>
+
+ * src/frontends/kde/Dialogs.C (Dialogs):
+ * src/frontends/gnome/Dialogs.C (Dialogs):
+ * src/frontends/kde/Makefile.am:
+ * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
+
+ * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
+
+ * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
+
+ * src/frontends/xforms/Makefile.am: added files for FormParagraph.
+
+ * src/frontends/xforms/FormParagraph.C:
+ * src/frontends/xforms/FormParagraph.h:
+ * src/frontends/xforms/form_paragraph.C:
+ * src/frontends/xforms/form_paragraph.h:
+ * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
+ paragraph layout.
+
+ * src/lyxfunc.C (Dispatch): call the new layout paragraph.
+
+ * src/tabular.C (OldFormatRead): forgot to delete the temporary
+ Paragraph-Data after use.
+
+ * src/insets/insettext.C (LocalDispatch): don't set the layout on
+ non breakable paragraphs.
+
+2000-09-25 Garst R. Reese <reese@isn.net>
+
+ * src/language.C (initL): added missing language_country codes.
+
+2000-09-25 Juergen Vigna <jug@sad.it>
+
+ * src/insets/insettext.C (InsetText):
+ (deleteLyXText): remove the not released LyXText structure!
+
+2000-09-24 Marko Vendelin <markov@ioc.ee>
+
+ * src/frontends/gnome/mainapp.C
+ * src/frontends/gnome/mainapp.h: added support for keyboard
+ accelerators
+
+ * src/frontends/gnome/FormCitation.C
+ * src/frontends/gnome/FormCitation.h
+ * src/frontends/gnome/Makefile.am
+ * src/frontends/gnome/pixbutton.h: completed the rewrite of
+ FormCitation to use "action area" in mainapp window
+
+ * src/frontends/gnome/Menubar_pimpl.C
+ * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
+ large TOC.
+
+2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
+
+ * src/mathed/formula.C (MathFuncInset::Metrics): Use default
+ width/descent/ascent values if name is empty.
+ (mathed_string_height): Use std::max.
+