1 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
5 * src/lyxfunc.C (getStatus): disable insertion of floats in a
8 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
10 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build): changed
11 filter for screen fonts input filter from int to float
13 * src/frontends/xforms/input_validators.c: removed.
14 * src/frontends/xforms/input_validators.C: new file. Can now call C++
15 functions from within the filter functions.
17 * src/frontends/xforms/input_validators.[Ch]
18 (fl_unsigned_float_filter): new filter function.
20 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get confused
21 now! And if you think I'm going to do this in ./forms/fdfix.sh with
22 its "sed -e" declarations, then think again!
24 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
26 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
28 * src/WorkArea.C (work_area_handler): don't handle button requests
29 if xbutton.button == 0
31 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
33 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
34 It creates a lot of interesting problems.
36 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
38 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
39 the menu exists in the current menubar before opening it.
41 * src/MenuBackend.C (hasSubmenu): new method.
43 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
44 action value by offsetting actions by a large constant (so that
45 bogs choice result will be less than this constant).
47 * lib/bind/fi_menus.bind: more cleanup to menus.
48 * lib/bind/sciword.bind: ditto.
49 * lib/bind/xemacs.bind: ditto.
50 * lib/bind/emacs.bind: ditto.
51 * lib/bind/pt_menus.bind: ditto.
52 * lib/bind/hu_menus.bind: ditto.
54 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
56 * INSTALL: update PROBLEMS section.
58 * src/lyxlookup.h: remove condition on xforms version, since we
59 should not include it if not appropriate.
61 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
63 * src/LColor.C: "latex text" -> "latex inset" (from
66 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
68 * src/frontends/kde/FormTabularCreate.C:
69 * src/frontends/kde/citationdlg.C:
70 * src/frontends/kde/copyrightdlg.C:
71 * src/frontends/kde/paradlg.C:
72 * src/frontends/kde/paraextradlg.C:
73 * src/frontends/kde/parageneraldlg.C:
74 * src/frontends/kde/printdlg.C:
75 * src/frontends/kde/refdlg.C:
76 * src/frontends/kde/tabcreatedlg.C:
77 * src/frontends/kde/tocdlg.C:
78 * src/frontends/kde/urldlg.C: add necessary headers
81 * src/frontends/kde/dlg/emptytable.C:
82 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
83 default parameters (from Angus Leeming)
85 * src/frontends/kde/dlg/moc/.cvsignore:
86 * src/frontends/kde/dlg/.cvsignore:
87 * src/frontends/kde/moc/.cvsignore: fix the library name
90 * src/frontends/kde/paradlg.C:
91 * src/frontends/kde/parageneraldlg.C:
92 * src/frontends/kde/dlg/para.dlg:
93 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
95 * src/frontends/kde/dlg/README: clarified qtarch version
97 * src/frontends/kde/dlg/Makefile.am: removed the
98 dlg rules as they created spontaneous rebuilds
99 (not a good idea as it requires qtarch)
101 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
103 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
104 fixlevel along with xforms version.
106 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
107 xforms version is strictly less than 0.89.5.
108 * src/lyx_gui.C (LyXGUI): ditto.
109 * src/LyXView.C (show): ditto.
111 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
113 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
114 movement in inset in RTL text.
115 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
116 (workAreaButtonRelease): Do not open a float when there is a selection.
118 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
120 * src/spellchecker.C (RunSpellChecker): Open all floats before
123 * src/text.C (InsertChar): Consider "," as a part of a number
124 (for LTR numbers in RTL text code).
125 (IsBoundary): Fixed (and simplified).
126 (InsertChar): Recalculate cursor boundary.
129 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
131 * src/spellchecker.C: fix figures with pspell enabled
133 * src/insets/figinset.C: workaround for gs hang xforms bug
135 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
137 * lib/bind/??_menus.bind: comment out the entries corresponding to
138 real menus. They should be eventually removed, but I'll let the
139 language maintainers do that.
141 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
143 * src/frontends/kde/parageneraldlg.C:
144 * src/frontends/kde/parageneraldlg.h: don't use
145 a derived class for SpaceAbove/Below
147 * src/frontends/kde/dlg/README: add some info
149 * src/frontends/kde/dlg/*: update data files, update
152 * src/frontends/kde/dlg/moc/Makefile.am: add
155 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
157 * configure.in: add new KDE Makefiles
158 * src/vspace.h: return GlueLength not a normal one
159 * src/support/lstrings.h:
160 * src/support/lstrings.C: add isStrUnsignedInt(),
163 * src/frontends/kde/*: big reorganisation, update
164 FormParagraph, add FormTabCreate
166 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
168 * lib/ui/default.ui: small grammatical change.
170 * src/frontends/xforms/xform_macros.h: removed.
172 * src/frontends/xforms/FormBase.C:
173 * src/frontends/xforms/FormPreferences.C:
174 * src/frontends/xforms/Makefile.am: changes associated with removing
175 xform_macros.h. Should make Lars' debugging a little easier.
177 * src/frontends/xforms/FormPreferences.C:
178 * src/frontends/xforms/FormPreferences.h:
179 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
180 longer use X11 color name database. HSV and RGB dials/sliders.
181 Please let this be the end of this!
183 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
185 * Several files: Allow compilation when the compiler doesn't
188 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
191 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
192 command line options.
194 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
196 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
197 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
200 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
202 * src/frontends/xforms/FormRef.C (updateBrowser):
203 * src/frontends/xforms/forms/form_ref.fd: try clicking on
204 different insets with the sort key active. Now apply this patch!
206 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
208 * src/frontends/xforms/FormPrint.C: set to valid()
209 when we update from the passed parameters.
211 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
213 * src/LColor.C (getFromGUIName): internationalise the comparison.
215 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
216 FormPreferences choice.
218 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
221 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
223 * src/lyxrc.C: more detail for the printer program config
226 * src/LColor.C: ert->latex text. LColor needs a big revamp
227 but will have to wait till after 1.1.6
229 * src/buffer.C: bring up a dialog if we load a document
230 with an un-installed text class, rather than just complain
233 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
235 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
236 the browser form for a combox in a tabbed folder. Bug fix courtesy of
237 Steve Lamont <spl@ncmir.ucsd.edu>.
239 * src/frontends/xforms/FormDocument.C (build):
240 * src/frontends/xforms/FormPreferences.C (Language::build):
241 pass tabfolders to Combox::add() in order to use this work around.
243 * src/frontends/xforms/FormCitation.C (connect): remove max size
245 (update): sort list of bibliography keys.
247 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
249 No max size limitation. Same popup for new and existing insets. Fixes
250 bugs reported by Rob Lahaye.
252 * src/frontends/xforms/FormCitation.C (c-tor):
253 * src/frontends/xforms/FormCopyright.C (c-tor):
254 * src/frontends/xforms/FormError.C (c-tor):
255 * src/frontends/xforms/FormGraphics.C (c-tor):
256 * src/frontends/xforms/FormIndex.C (c-tor):
257 * src/frontends/xforms/FormRef.C (c-tor):
258 * src/frontends/xforms/FormToc.C (c-tor):
259 * src/frontends/xforms/FormUrl.C (c-tor):
260 use correct policy for ButtonController.
262 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
264 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
267 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
269 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
270 Some resizing changes.
272 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
274 * configure.in: fix typo
276 * lib/languages: add ukraninian and change no to no_NO
278 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
280 * src/bufferview_funcs.C (FontSize): use setLyXSize
282 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
284 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
285 to check for systems where mkstemp() is available but not declared
286 in headers. The new autoconf macro lyx_CHECK_DECL can be used
287 to check for declarations in headers.
289 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
291 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
293 * forms/makefile: added bibforms.fd, include_form.fd.
294 Removed lyx_sendfax.fd.
296 * src/LaTeXLog.C (ShowLatexLog):
297 * src/LyXAction.C (init):
298 * src/bufferparams.C (readLanguage): altered messages as suggested by
301 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
304 * src/credits.C: made fd_form_credits non-static, so that it can be
305 redrawn should the xforms colors be re-mapped.
306 * src/spellchecker.C ditto fd_form_spell_options.
308 * src/filedlg.[Ch] (redraw):
309 * src/intl.[Ch] (redraw):
310 * src/lyxfr0.[Ch] (redraw):
311 * src/insets/figinset.[Ch] (redraw):
312 * src/insets/insetexternal.[Ch] (redraw):
313 new methods, connected to Dialogs::redrawGUI.
315 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
316 to be connected to Dialogs::redrawGUI.
318 * src/frontends/xforms/FormCitation.C (build):
319 * src/frontends/xforms/FormCopyright.C (build):
320 * src/frontends/xforms/FormError.C (build):
321 * src/frontends/xforms/FormGraphics.C (build):
322 * src/frontends/xforms/FormIndex.C (build):
323 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
324 * src/frontends/xforms/FormToc.C (build):
325 * src/frontends/xforms/FormUrl.C (build):
326 use the ButtonController correctly.
328 * src/frontends/xforms/FormCopyright.C (build):
329 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
330 the .fd file and into build().
332 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
334 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
336 * src/frontends/xforms/forms/form_citation.fd:
337 * src/frontends/xforms/forms/form_copyright.fd:
338 * src/frontends/xforms/forms/form_error.fd:
339 * src/frontends/xforms/forms/form_graphics.fd:
340 * src/frontends/xforms/forms/form_index.fd:
341 * src/frontends/xforms/forms/form_toc.fd:
342 * src/frontends/xforms/forms/form_url.fd:
343 renamed some of the objects. Named others explicitly for the first time.
344 Added Restore and Apply buttons where appropriate.
346 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
349 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
351 * src/version.h: try the pre2 again
353 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
355 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
357 * src/frontends/kde/FormParagraph.C: added using directive.
359 * src/frontends/kde/paradlg.C: added config.h and using directive.
361 * src/frontends/kde/paradlg.h: added std::qualifier.
363 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
365 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
367 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
369 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
371 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
373 * src/version.h: set back to 1.1.6cvs
375 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
377 * src/version.h: set to 1.1.6pre2
379 2000-11-20 Marko Vendelin <markov@ioc.ee>
381 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
383 * src/frontends/gnome/Makefile.am: updated list of XForms object files
385 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
387 * src/LColor.C (init):
388 * src/lyxrc.C (getDescription): changed some comments as suggested by
391 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
392 disconnect the redrawGUI signal in best-practice fashion.
394 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
395 long_opts_tab to reflect the change in name of this tabfolder, as
396 suggested by John Levon.
397 (connect, disconnect): new methods. Don't do much at present other than
398 ensuring that we can't resize the dialog. This just makes xforms go
400 (lots of methods in Colors): made void rather than bool. The idea is
401 to have an isOk() function that keeps track of whether any input is
402 genuinely invalid and should therefore block Save, Apply.
403 Easier to manipulate the counters rapidly.
404 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
405 compiler will like this code. Much cleaner way of doing things.
407 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
409 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
410 rather than simple counters, following suggestion by John Levon.
412 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
413 than engraved frame + text.
415 * src/frontends/xforms/forms/makefile: removed spurious command.
417 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
419 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
421 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
424 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
426 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
427 see what Lars has changed and what is just white space!
428 Now used X directly to ascertain the RGB color associated with the
430 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
432 Added some sort capability.
433 The X11 color name database input is only displayed if the database
434 isn't found in the standard place.
435 Got rid of struct compare_converter; it wasn't used.
436 Probably some other stuff that I've forgotten.
438 * src/frontends/xforms/FormPreferences.h: changed the names of some
439 methods in the Colors struct. Added a couple of structs to help sort
440 colors by name and by RGBColor.
442 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
443 functions into a new class RWInfo.
445 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
446 The dialog is now almost navigable using the keyboard. Unfortunately,
447 the cursor has to be inside a browser for it to be activated. There is
448 no visual feedback for the key shortcuts to the arrow keys (use
449 Alt-appropriate arrow key, Alt-x).
451 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
454 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
455 xform_helpers.[Ch]. See above.
457 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
459 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
461 * src/screen.C (setCursorColor): new method. Sets the color of the
463 (ShowManualCursor): call it.
464 Constify some local variables.
466 * src/LColor.[Ch] (LColor): add entry for cursor
467 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
470 2000-11-19 Juergen Vigna <jug@sad.it>
472 * src/insets/insettabular.C (draw): fixed text border redraw problem.
473 (calculate_dimensions_of_cells): try to boost up when inserting chars.
475 2000-11-15 Rob Lahaye <lahaye@postech.edu>
477 * lib/ui/default.ui: OptItem used for Fax entry
479 2000-11-17 Matej Cepl <cepl@bigfoot.com>
481 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
483 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
485 * src/vspace.C (nextToken): fix so it can handle length phrases like
486 "10mm+-20mm", "40inplus16mmminus10cm" etc.
488 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
490 * src/frontends/xforms/FormPreferences.C: constify several variables
491 (BrowserLyX): rewrite to not need the choice variable
492 (Modify): rewrite to not need the choide variable
493 (compare_converter): make operator const
495 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
496 correct the writing of \set_color
497 (getDescription): return a const string
499 * src/kbsequence.[Ch] (addkey): remove dead code
501 * src/Painter.C (text): remove some commented code
503 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
505 * src/ColorHandler.[Ch]: removed some header files from .h file.
506 Included LColor.h in .C file.
508 * src/LColor.[Ch]: made class copyable so that I could create a
509 system_lcolor instance.
511 * src/Painter.h: removed LColor.h.
513 * src/lyx_gui.C (create_forms): used AddName.
515 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
516 of user preferences/lyxrc file.
518 * src/lyxrc.C (output): output changes to lcolor.
520 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
522 Moved class xformColor to files xform_helpers.[Ch]. These files,
523 Color.[Ch], could now be moved into src if they would be useful to
526 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
527 Also moved FormPreferences::browseFile here as it can be used by any
528 xform dialog with a "Browse" button. FormGraphics is a perfect example.
530 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
531 ReadableFile): changed the FormPreferences methods a little and moved
532 them here as they'll be useful elsewhere also.
534 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
535 Removed some header files and used forward declarations instead.
537 Removed some methods as they'll be useful elsewhere (see above).
539 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
540 Can also now modify the LyX LColors. However, for reasons that I don't
541 yet understand, it appears that we can use
542 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
543 present. The problem appears to lie in ColorHandler, because I can
544 change the color using LColor.SetColor(). Similarly, when reading in a
545 preferences file with some set_color instances, I'll get a warning
546 like: Color sea green is undefined or may not be redefined
547 Bad lyxrc set_color for sea green
549 Once the buffer is loaded, however, I can happily change to this color.
551 Finally, it appears that I have to set the color of "inset frame"
552 explicitly, or it oscillates from "black" to "indian red" with each
555 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
557 * ANNOUNCE: corrected a spelling mistake.
559 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
562 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
564 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
566 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
569 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
570 match the requirements from the standard better. This is required
571 to work with gnu libstdc++-v3
573 * src/frontends/xforms/FormPreferences.C: add explict pair
574 arguments to browse calls. include support/lyxmanip.h remvoe
575 extern fmt. whitespace changes. reorder variables in
576 FormPreferences.h, to match initalizaton order.
578 * several files: constify more local variables.
580 * src/buffer.C: remove some commented functions.
582 * src/DepTable.C (remove_files_with_extension): temporary
583 work around for gcc 2.97
584 * src/filedlg.C (find): ditto
585 * src/Variables.C (set): ditto
586 * src/LyXAction.C (searchActionArg): ditto
587 (retrieveActionArg): ditto
589 * configure.in: check for mktemp too
591 * UPGRADING: prepare for 1.1.6
593 * Makefile.am (lgbtags): add backup tags for when etags are
594 different than usual.
596 * ANNOUNCE: prepare for 1.1.6
598 * src/support/tempname.C (make_tempfile): new function, wrapper
599 around mkstemp and mktemp. Only mkstemp has been tested.
602 2000-11-14 Rob Lahaye <lahaye@postech.edu>
604 * default.ui: capitalized some menu items to improve shortcuts.
606 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
608 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
610 * src/frontends/xforms/Dialogs.C: add "using" directive.
612 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
614 * src/filedlg.C (Select): highlight suggested file in browser, if
617 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
618 each tab folder is encapsulated in its own class.
619 The Language keymaps are now chosen using a text input and a
620 browser button, rather than a Combox.
621 All the browser buttons are now functional, although LyXFileDlg
622 still needs to be modified to make it straighhtforward to return a
623 directory if that is what is desired.
625 * src/frontends/xforms/forms/form_preferences.fd: use text input
626 and browse button to input the Language keymaps. Add a few
627 callbacks for the browse buttons.
629 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
631 * src/support/tempname.C (tempName): small changes to make it
632 safer. remove the '.' before XXXXXX
634 * src/support/filetools.C (TmpFileName): remove func
637 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
638 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
639 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
640 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
642 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
645 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
648 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
649 for bp (this fixes a reproducible hard crash)
651 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
654 * src/frontends/xforms/FormBase.h: make bp_ private
655 (FormBaseBI): remove default for bp
658 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
661 * src/frontends/xforms/Color.C (RGBColor): made several vars
662 const, changed initialization of j to allow it to be const
665 * several files: added const to local variables.
667 * src/lyx_cb.C: removed several function prototypes and moved them
671 (UpdateLayoutPreamble):
673 (MenuInsertLabel): add BufferView as arguemnt
674 (LayoutsCB): make tmp const
676 * src/layout_forms.h: regenerated
678 * src/debug.C: add Debug::FILES
679 (showLevel) (showTags): translate the desc
681 * src/debug.h: add FILES as debug target
683 * src/bufferlist.C: use current_view as an interim measure becuase
684 of added arguments to MenuWrite and MenuWriteAs
686 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
688 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
690 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
691 libstdc++ is compiled with.
693 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
695 * lib/layouts/docbook-book.layout
696 * lib/layouts/docbook.layout
697 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
698 those paragraphs are expresse as SGML comments <!-- -->.
700 * src/LaTeXFeatures.h
701 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
702 parameter, this allows to express all the include files as relative
703 paths to the master buffer. The verbatim insert works as the other
706 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
708 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
710 (MakeDocBookFile): top_element is always written. Some clean up, as
711 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
713 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
714 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
715 a reference is written instead of the name.
716 (Validate): use the relative path for the filename.
718 * src/insets/insetlabel.C (DocBook): write end tag, for XML
721 * src/support/filetools.h
722 * src/support/filetools.C (IsSGMLFilename): added.
725 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
727 * development/OS2/quick_fix.patch:
729 * README.OS2: quick update to the OS/2 port.
731 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
733 * src/converter.C: add "using" directive.
735 * src/frontends/xforms/FormPreferences.C: add "using" directive.
736 (compare_converter): add "int" as return type.
738 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
741 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
743 * src/lyx_gui.C (create_forms): map the xform colours, should a
744 mapping exist. Ie, call XformColor::read().
746 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
747 and struct HSV as HSVColor.
748 (XformColor::read, XformColor::write) : new methods that
749 input/output any changes to the cform GUI colors.
751 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
754 * src/frontends/xforms/FormPreferences.C Lots of little changes
755 associated with the changed name of the RGB and HSV structs. Can
756 now save changes to xforms GUI to file. Commented out
757 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
758 used currently anyway.
760 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
762 * src/converter.C: A lot of changes:
763 - It is no longer possible to choose between two or more ways to
764 export to some format (the new code uses only the shortest path).
765 However, it is still possible to choose between pdflatex/ps2pdf
766 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
767 - Added several methods that makes the FormPreferences code simpler.
768 - Changed the tokens $$FName and $$OutName to $$i and $$o.
770 * src/exporter.C (Export): lyxrc.use_pdf is set before
771 makeLaTeXFile is called. This works but not very nice.
773 * src/frontends/xforms/FormPreferences.C: The formats/converters
774 tabs are now fully functional.
776 * src/buffer.C (getTocList): Add numbers to the captions.
778 * lib/lyxrc.example: Removed fax section
780 * src/support/rename.C (rename): Delete the old file if lyx::copy
783 2000-11-13 Rob Lahaye <lahaye@postech.edu>
785 * lib/ui/default.ui: minor polishing.
787 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
789 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
792 * lib/Makefile.am (DOCINST): do not install everything in the
793 documentation directory.
795 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
797 * src/bufferlist.C (newFile): set the filename to the constructed
800 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
801 constructed "newfileXX.lyx" name to the dialog
803 * src/frontends/DialogBase.h: make update() non-abstract so
804 KDE doesn't need to implement two update methods for every form
806 * src/frontends/kde/Makefile.am: add missing xforms objects
809 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
811 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
813 * src/frontends/xforms/Color.[Ch]: new files, defining the color
814 structs RGB and HSV. May not be the best place for these files.
815 Perhaps move them into src ?
817 * src/frontends/xforms/Makefile.am: added new files.
819 * src/frontends/xforms/forms/form_preferences.fd:
820 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
821 replaced all instances of "colour" with "color"!
823 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
826 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
827 tab. Can now alter the colors of the xform's GUI on the fly. With
828 the aid of a single static Signal (see below), can "Apply" these
829 changes to all currently open dialogs. (Well, to all of the NEW
830 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
831 subsequently opened dialogs will, of course, also have the new
832 color scheme. Cannot yet save (or load) the choices to file, so
833 they are lost when exiting LyX.
835 * src/frontends/Dialogs.h:
836 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
837 Used to trigger a redraw of any dialogs connected to it because,
838 for example, the GUI colours have been re-mapped.
840 * src/frontends/xforms/FormBase.[Ch]:
841 * src/frontends/xforms/FormDocument.[Ch]:
842 * src/frontends/xforms/FormParagraph.[Ch]:
843 * src/frontends/xforms/FormPreferences.[Ch]:
844 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
845 method, to be connected to Dialogs::redrawGUI. Method must be
846 virtual, because dialogs with tabbed folders need to redraw the
847 forms of each tab folder.
849 * src/LyXView.C (d-tor):
850 * src/frontends/xforms/FormBase.C (d-tor): connected
851 Dialogs::redrawGUI signal to redraw().
853 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
854 removed Assert, because it is identical to that in FormBase.
856 2000-11-10 Rob Lahaye <lahaye@postech.edu>
858 * lib/ui/default.ui: minor polishing.
860 2000-11-10 Juergen Vigna <jug@sad.it>
862 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
863 (deleteLyXText): ditto
865 * src/insets/insettabular.C (InsetButtonPress): don't clear the
866 selection on mouse-button-3.
868 * src/insets/insettabular.h: new function clearSelection(), use this
869 functions inside insettabular.C.
871 * src/insets/insettabular.C (TabularFeatures): clear the selection
872 on remove_row/column.
874 * src/insets/inset.C (scroll): fixed some scroll stuff.
876 * src/insets/insettabular.C (draw): fixed another minor draw problem.
878 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
880 * lib/CREDITS: add Yves Bastide
882 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
884 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
885 check whether C library functions are in the global namespace.
887 * configure.in: calls it.
889 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
892 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
894 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
895 iterators to prevent crash.
897 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
899 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
901 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
902 shortcut for xforms CB to the preemptive or post-handler function.
904 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
905 removed the HIDDEN_TIMER as it's no longer used.
906 Various other small changes.
908 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
909 preemptive handler to obtain feedback, rather than the post-handler.
910 (ColoursLoadBrowser): find "black" and "white" based on RGB values
912 Formats tab is now complete. Converters tab is nearly so.
914 2000-11-09 Juergen Vigna <jug@sad.it>
916 * src/insets/insettext.C (~InsetText):
919 (SetParagraphData): set cache.second to 0 after deleting it!
920 (getLyXText): check if cache.second is not 0 if finding it.
922 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
924 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
925 lyxlex to parse the rgb.txt file.
928 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
929 replace the default '#' comment character.
931 * src/support/tempname.C: add "using" directive
932 * src/frontends/ButtonPolicies.C: ditto.
934 * src/support/filetools.C (DirList): add an explicit cast to avoid
935 a compile error (probably not the right fix)
937 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
939 * src/support/filetools.C (DirList): implement using system functions
941 * src/support/tempname.C: new file
943 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
945 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
947 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
950 * src/frontends/xforms/ButtonController.C: new file
952 * src/os2_defines.h: remove getcwd define
954 * src/lyxvc.C: include support/lyxlib.h
955 (showLog): use lyx::tempName
957 * src/lyx_cb.C: comment out includes that we don't need
958 (AutoSave): use lyx::tempName
960 * src/filedlg.C: include support/lyxlib.h
961 (Reread): use lyx::getcwd
963 * src/converter.C: include support/filetools.h
964 (add_options): change to static inline, make tail const
965 (Add): make old_viewer const
966 (GetAllFormats): make it a const method, use const_iterator
967 (enable): make static inline
968 (SplitFormat): make using_format const
970 * src/LaTeX.C (run): use lyx::getcwd
972 * configure.in: check for mkstemp as well
974 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
976 * src/converter.[Ch] (GetAllCommands): new method.
978 * src/support/filetools.[Ch] (DirList): new method.
980 * src/frontends/xforms/FormPreferences.C: started (just!) adding
981 functionality to the converters tab.
982 The formats tab is now nearly complete.
983 The kbmap choices in Languages tab now display the contents of
984 system_lyxdir/kbd/*.kmap in readable form.
986 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
987 Moved some variables into the class.
989 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
990 inactive tab folder to FL_COL1. Haven't yet worked out how to change
991 colour of active folder to lighter grey instead. Any takers?
992 (form_colours): added an "Apply" button.
993 (form_converters): added a "Flags" input field.
994 (form_formats): added a "Shortcut" input field. Note that we can't use
995 names such as "input_shortcut" as this buggers up the sed script stuff.
997 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1005 * src/lyx_sendfax_main.C:
1008 * src/spellchecker.C:
1009 * src/insets/figinset.C:
1010 * src/insets/insetbib.C:
1011 * src/insets/insetexternal.C:
1012 * src/insets/insetinclude.C:
1013 * src/insets/insetinfo.C:
1014 * src/mathed/math_panel.C:
1015 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1016 all "daughter" dialogs now have identical "feel".
1018 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1020 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1021 used (and was only used in one place prior to this patch. Incorrectly!)
1023 * src/frontends/xforms/FormDocument.C: changed some instances of
1024 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1025 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1026 for options_->input_float_placement. This fixes a bug reported by
1029 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1030 functionality into d-tor.
1032 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1033 input of numerals also.
1035 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1036 fl_set_form_atclose(). Can now close dialog from window manager,
1037 fixing a bug reported by Rob Lahaye.
1039 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1041 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1042 are no longer dark. Haven't yet worked out how to lighten the colour of
1043 the active tabfolder. Any ideas anybody?
1044 Adjusted Colours tab a little.
1045 Added Shortcut field to converters tab. Note that we can't create an
1046 fdesign label like "input_shortcut" as this buggers up the sed-script
1049 * src/frontends/xforms/FormPreferences.[Ch]:
1050 (feedback): fixed crash due to to ob=0.
1051 (LanguagesXXX): the kbmap choices now contain the files
1052 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1053 be replaced by an input with a file browse button, but since the browse
1054 buttons don'y yet work, this'll do for the moment.
1055 (FormatsXXX): think that this is now nearly fully functional.
1056 Some points/questions though:
1057 1. Does "Apply" remove formats if no longer present?
1058 2. I think that the browser should list the GUI names rather than the
1060 3. Must ensure that we can't delete Formats used by an existing
1063 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1064 if this is the best way to do this.
1066 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1068 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1070 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1071 for variable assignment.
1073 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1075 * src/lib/ui/default.ui: added sub/superscripts to menu as
1076 Insert->Special characters and cleaned-up the file a bit
1078 2000-11-07 Allan Rae <rae@lyx.org>
1080 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1081 ob isn't 0 before using it. See comments in function.
1083 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1085 * src/frontends/xforms/form_*.C: regenerated
1087 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1089 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1091 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1092 compiling with gcc-2.96
1094 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1096 * src/support/lyxstring.C: add a couple "using" directives.
1098 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1099 a .c_str() here too for good measure.
1100 * src/Spacing.C (set): ditto.
1101 * src/lyxfunc.C (Dispatch): ditto.
1103 * src/insets/insettabular.C (copySelection): change .str() to
1104 .str().c_str() to fix problems with lyxstring.
1105 * src/support/filetools.C (GetFileContents): ditto.
1106 * src/buffer.C (asciiParagraph): ditto.
1107 * src/paragraph.C (String): ditto.
1109 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1110 * lib/bind/sciword.bind: ditto.
1112 * src/LyXAction.C (init): remove "symbol-insert" function, which
1113 shared LFUN_INSERT_MATH with "math-insert".
1115 * lib/configure.m4: == is not a valid operator for command test.
1117 * src/lyxrc.C: add using directive.
1119 * src/converter.h: add std:: qualifier.
1121 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1123 * src/converter.[Ch] and other files: Change the Format class to a
1124 real class, and create two instances: formats and system_format.
1126 * src/lyxrc.C (output): Output the difference between formats and
1129 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1130 (buildFormats): Insert formats into browser.
1131 (inputFormats): Made the browser and add button functional.
1132 (applyFormats): Update formats from format_vec.
1134 * src/converter.C: Changed all (*it). to it->
1135 (Format::dummy): New method.
1136 (Format::importer): New format flag.
1137 (Formats::GetAllFormats): New method.
1138 (Formats::Add): Delete format from the map if prettyname is empty.
1139 (Converter::Convert): Print an error message if moving the file fails.
1140 (Converter::GetReachableTo): New method
1142 * src/MenuBackend.[Ch]: Add support for importformats tag.
1144 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1146 * lib/configure.m4: Add word->tex and ps->fax converters.
1148 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1149 Return fax to file menu.
1153 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1155 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1158 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1161 * src/lyxfunc.C (processKeyEvent): removed
1163 * src/bufferlist.C (emergencyWrite): removed the out commented
1164 emergency write code.
1166 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1168 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1170 * many files: change formatting to be a bit more uniform for
1171 if,while,for,switch statements, remove some parantesis not needed.
1174 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1176 * config/kde.m4: make config more robust when KDEDIR is set
1178 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1180 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1181 not returned a pixmap for "math-insert".
1183 * src/LyXAction.C (init): sort the entries a bit.
1185 2000-11-03 Juergen Vigna <jug@sad.it>
1187 * src/insets/insettabular.h: added fixed number to update codes so
1188 that update is only in one direction.
1190 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1193 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1194 before call to edit because of redraw.
1196 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1198 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1200 * lib/ui/default.ui: Populate "edit_float" menu
1202 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1204 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1205 "floats-operate". The name is ugly (and the func also), but this
1206 is just a band-aid until we switch to new insets.
1208 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1210 * lib/ui/default.ui: update again the menu layout (fix some
1213 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1215 * src/MenuBackend.h (fulllabel): new method.
1217 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1218 the menu shortcuts of a menu are unique and whether they
1219 correspond to a letter of the label.
1220 (expand): call checkShortcuts when debugging.
1222 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1224 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1226 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1228 * lib/examples/*.lyx : '\language default' => '\language english'
1230 * lib/examples/it_splash.lyx : except where it should be italian
1232 * lib/templates/*.lyx : the same
1234 * doc/*.lyx* : the same
1236 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1238 * lib/bind/menus.bind: remove the Layout menu entries, which I
1239 somehow forgot earlier.
1241 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1243 * lib/ui/old-default.ui: keep the old one here for reference (to
1246 * lib/ui/default.ui: update the menu layout
1248 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1250 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1251 Can now Apply to different insets without closing the dialog.
1253 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1254 Can't actually DO anything with them yet, but I'd like a little
1257 * src/frontends/xforms/input_validators.[ch]
1258 (fl_lowercase_filter): new.
1260 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1262 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1263 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1265 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1267 2000-11-02 Juergen Vigna <jug@sad.it>
1269 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1270 on char insertion as it has already be updated by bv->updateInset().
1272 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1273 if an inset inside was updated.
1275 * lib/configure.cmd: commented out fax-search code
1277 2000-11-01 Yves Bastide <stid@acm.org>
1279 * src/tabular.C (OldFormatRead): set tabular language to the
1282 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1284 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1285 class names with non-letter characters (from Yves Bastide).
1287 * lib/ui/default.ui: change Item to OptItem in import menu.
1288 Comment out fax stuff.
1290 * lib/configure.m4: comment out fax-related stuff.
1292 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1294 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1295 useful xforms helper functions. At present contains only formatted().
1296 Input a string and it returns it with line breaks so that in fits
1299 * src/frontends/xforms/Makefile.am: add new files.
1301 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1302 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1305 * src/frontends/xforms/FormPreferences.[Ch]:
1306 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1307 but lots of little clean ups. Removed enum State. Make use of
1308 formatted(). Constify lots of methods. Perhaps best of all: removed
1309 requirement for that horrible reinterpret_cast from pointer to long in
1312 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1314 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1315 conditionalize build on xforms < 0.89
1317 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1319 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1321 * src/LyXAction.C (init): comment out fax
1323 * src/lyxrc.h: comment out the fax enums
1324 comment out the fax variables
1326 * src/commandtags.h: comment out LFUN_FAX
1328 * src/lyxrc.C: disable fax variables.
1329 (read): disable parsing of fax variables
1330 (output): disable writing of fax variables
1331 (getFeedback): now description for fax variables
1333 * src/lyxfunc.C: comment out MenuFax
1334 (Dispatch): disable LFUN_FAX
1336 * src/lyx_cb.C (MenuFax): comment out
1338 * src/WorkArea.C: add <cctype>
1339 (work_area_handler): better key handling, should be ok now.
1340 for accented chars + etc
1342 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1343 lyx_sendfax.h and lyx_sendfax_man.C
1345 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1346 (show): don't call InitLyXLookup when using xforms 0.89
1348 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1350 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1352 * src/support/filetools.C (GetFileContents): close to dummy change
1354 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1356 * src/trans.C (AddDeadkey): workaround stupid compilers.
1358 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1360 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1361 of two-sided document.
1363 2000-10-31 Juergen Vigna <jug@sad.it>
1365 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1367 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1368 xposition to the Edit call.
1370 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1372 * src/trans.C (AddDeadkey): cast explicitly to char.
1374 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1376 * src/tabular.C (AsciiBottomHLine): simplify?
1377 (AsciiTopHLine): simplify?
1378 (print_n_chars): simplify
1379 (DocBook): remove most of the << endl; we should flush the stream
1380 as seldom as possible.
1382 (TeXBottomHLine): ditto
1383 (TeXTopHLine): ditto
1385 (write_attribute): try a templified version.
1386 (set_row_column_number_info): lesson scope of variables
1388 * src/support/lstrings.h (tostr): new specialization of tostr
1390 * src/trans.C (AddDeadkey): slightly cleaner fix.
1392 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1394 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1395 '%%' in Toc menu labels.
1398 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1399 font_norm is iso10646-1.
1401 * src/font.C (ascent): Fixed for 16bit fonts
1402 (descent,lbearing,rbearing): ditto
1404 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1406 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1407 (getFeedback): new static method.
1409 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1410 Now use combox rather than choice to display languages.
1411 Feedback is now output using a new timer callback mechanism, identical
1412 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1414 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1416 * src/minibuffer.C: fix for older compilers
1418 2000-10-30 Juergen Vigna <jug@sad.it>
1420 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1421 has to be Left of the inset otherwise LyXText won't find it!
1423 * src/BufferView2.C (open_new_inset): delete the inset if it can
1426 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1428 * lyx.man: fix typo.
1430 2000-10-29 Marko Vendelin <markov@ioc.ee>
1431 * src/frontends/gnome/FormCitation.C
1432 * src/frontends/gnome/FormCitation.h
1433 * src/frontends/gnome/FormCopyright.C
1434 * src/frontends/gnome/FormCopyright.h
1435 * src/frontends/gnome/FormError.C
1436 * src/frontends/gnome/FormError.h
1437 * src/frontends/gnome/FormIndex.C
1438 * src/frontends/gnome/FormIndex.h
1439 * src/frontends/gnome/FormPrint.C
1440 * src/frontends/gnome/FormPrint.h
1441 * src/frontends/gnome/FormRef.C
1442 * src/frontends/gnome/FormRef.h
1443 * src/frontends/gnome/FormToc.C
1444 * src/frontends/gnome/FormToc.h
1445 * src/frontends/gnome/FormUrl.C
1446 * src/frontends/gnome/FormUrl.h
1447 * src/frontends/gnome/Menubar_pimpl.C
1448 * src/frontends/gnome/mainapp.C
1449 * src/frontends/gnome/mainapp.h
1450 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1451 changing update() to updateSlot() where appropriate
1453 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1455 * src/frontends/xforms/FormPreferences.[Ch]:
1456 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1459 2000-10-28 Juergen Vigna <jug@sad.it>
1461 * src/insets/insettabular.C (draw): fixed drawing bug.
1463 * src/insets/insettext.C (clear):
1465 (SetParagraphData): clearing the TEXT buffers when deleting the
1466 paragraphs used by it.
1468 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1470 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1472 2000-10-27 Juergen Vigna <jug@sad.it>
1474 * src/tabular.C (~LyXTabular): removed not needed anymore.
1476 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1479 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1481 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1484 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1487 * src/frontends/xforms/FormPreferences.[Ch]:
1488 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1489 Reorganised as modules based on tabs. Much easier to follow the
1490 flow and to add new tabs. Added warning and feedback messages.
1493 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1495 * src/tabular.h (DocBook): add std:: qualifier.
1497 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1499 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1500 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1503 * insettabular.C (DocBook): uses the tabular methods to export
1506 * src/insets/insettext.h
1507 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1509 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1511 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1514 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1515 moved misplaced AllowInput two lines up.
1517 * src/buffer.C (readFile): compare float with float, not with int
1519 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1521 * src/minibuffer.C: add "using SigC::slot" statement.
1523 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1525 * src/frontends/xforms/forms/README: updated section about make.
1527 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1528 Tidied some forms up, made two of form_tabular's tabs more
1529 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1530 fixed translation problem with "Column".
1532 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1534 * src/minibuffer.h: use Timeout instead of the xforms timer
1536 (setTimer) rewrite for the Timeout, change to unsigned arg
1537 (set): change to unsigned timer arg
1540 * src/minibuffer.C (TimerCB): removed func
1541 (C_MiniBuffer_TimerCB): removed func
1542 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1543 (peek_event): use a switch statement
1544 (add): don't use fl_add_timer.
1545 (Set): rewrite to use the Timeout
1548 * src/Timeout.[Ch] (setType): return a Timeout &
1549 (setTimeout): ditto, change to unsigned arg for timeout
1551 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1553 * src/mathed/formula.C (mathed_string_width): Use string instead
1554 of a constant size char array.
1556 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1558 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1559 the two recently added operator<< for SMInput and State.
1561 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1563 (OkCancelPolicy): ditto
1564 (OkCancelReadOnlyPolicy): ditto
1565 (NoRepeatedApplyReadOnlyPolicy): ditto
1566 (OkApplyCancelReadOnlyPolicy): ditto
1567 (OkApplyCancelPolicy): ditto
1568 (NoRepeatedApplyPolicy): ditto
1570 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1572 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1573 add the usual std:: qualifiers.
1575 2000-10-25 Juergen Vigna <jug@sad.it>
1577 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1579 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1581 * src/support/filetools.C (MakeRelPath): change some types to
1584 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1585 ButtonPolicy::SMInput and ButtonPolicy::State.
1587 * src/FontLoader.C (reset): small cleanup
1588 (unload): small cleanup
1590 * src/FontInfo.C (getFontname): initialize error to 10000.0
1592 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1594 * src/frontends/xforms/FormPreferences.[Ch]:
1595 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1596 TeX encoding and default paper size sections.
1598 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1600 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1603 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1604 make the message_ empty.
1605 (FormError): don't initialize message_ in initializer list.
1607 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1609 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1611 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1613 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1615 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1617 * src/frontends/kde/*data.[Ch]: _("") is not
1620 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1622 * src/buffer.C: removed redundant using directive.
1624 * src/frontends/DialogBase.h: revert to original definition of
1627 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1628 stuff into two classes, one for each dialog, requires a new
1629 element in the dialogs vector, FormTabularCreate.
1631 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1634 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1635 method. Continues Allan's idea, but means that derived classes
1636 don't need to worry about "update or hide?".
1638 * src/frontends/xforms/FormError.C (showInset): add connection
1641 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1642 one for each dialog. FormTabular now contains main tabular dialog
1645 * src/frontends/xforms/FormTabularCreate.[Ch]:
1646 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1649 * src/frontends/xforms/FormGraphics.[Ch]:
1650 * src/frontends/xforms/forms/form_graphics.fd
1651 * src/frontends/xforms/FormTabular.[Ch]:
1652 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1653 classes of FormInset.
1655 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1656 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1658 * src/frontends/xforms/Makefile.am:
1659 * src/frontends/xforms/forms/makefile: added new files.
1661 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1662 variable. added Signal0 hide signal, in keeping with other GUI-I
1665 * src/support/lstrings.h: removed redundant std:: qualifier as
1666 it's already declared in Lsstream.h.
1668 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1670 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1674 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1676 * src/tabular.C (Ascii): minimize scope of cell.
1678 * src/BufferView2.C (nextWord): return string() instead of 0;
1680 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1682 * src/converter.h: add a std:: qualifier
1684 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1686 * src/importer.[Ch]: New files. Used for importing files into LyX.
1688 * src/lyxfunc.C (doImport): Use the new Importer class.
1690 * src/converter.h: Add shortcut member to the Format class.
1691 Used for holding the menu shortcut.
1693 * src/converter.C and other files: Made a distinction between
1694 format name and format extension. New formats can be defined using
1695 the \format lyxrc tag.
1696 Added two new converter flags: latex and disable.
1698 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1700 * src/support/lyxlib.h: unify namespace/struct implementation.
1701 Remove extra declarations.
1703 * src/support/chdir.C (chdir): remove version taking char const *
1705 * src/support/rename.C: ditto.
1706 * src/support/lyxsum.C: ditto.
1708 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1710 * src/frontends/xforms/FormBase.[Ch]:
1711 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1712 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1713 work only for the next call to fl_show_form(). The correct place to set
1714 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1715 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1716 from FormBase have the minimum size set; no more stupid crashes with
1719 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1721 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1723 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1725 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1727 * src/support/lyxlib.h: changed second argument of mkdir to
1728 unsigned long int (unsigned int would probably have been enough,
1729 but...). Removed <sys/types.h> header.
1730 * src/support/mkdir.C (mkdir): ditto.
1734 2000-10-19 Juergen Vigna <jug@sad.it>
1736 * src/lyxfunc.C (MenuNew): small fix (form John)
1738 * src/screen.C (Update): removed unneeded code.
1740 * src/tabular.C (Ascii): refixed int != uint bug!
1742 * src/support/lyxlib.h: added sys/types.h include for now permits
1743 compiling, but I don't like this!
1745 2000-10-18 Juergen Vigna <jug@sad.it>
1747 * src/text2.C (ClearSelection): if we clear the selection we need
1748 more refresh so set the status apropriately
1750 * src/insets/insettext.C (draw): hopefully finally fixed draw
1753 2000-10-12 Juergen Vigna <jug@sad.it>
1755 * src/insets/insettext.C (draw): another small fix and make a block
1756 so that variables are localized.
1758 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1760 * src/support/lstrings.C (lowercase, uppercase):
1761 use explicit casts to remove compiler warnings.
1763 * src/support/LRegex.C (Impl):
1764 * src/support/StrPool.C (add):
1765 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1766 (AddPath, MakeDisplayPath):
1767 * src/support/lstrings.C (prefixIs, subst):
1768 use correct type to remove compiler warnings.
1770 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1772 * src/support/lyxlib.h:
1773 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1774 portability and to remove compiler warning with DEC cxx.
1776 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1778 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1780 * src/minibuffer.C (peek_event): retun 1 when there has been a
1781 mouseclick in the minibuffer.
1785 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1787 * src/frontends/xforms/FormParagraph.C: more space above/below
1790 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1792 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1793 a char only if real_current_font was changed.
1795 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1797 * NEWS: update somewhat for 1.1.6
1799 * lib/ui/default.ui: clean up.
1801 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1803 * lib/CREDITS: clean up
1805 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1807 * src/combox.[Ch] (select): changed argument back to int
1808 * src/combox.C (peek_event): removed num_bytes as it is declared but
1811 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1812 modified calls to Combox::select() to remove warnings about type
1815 * src/insets/insetbutton.C (width): explicit cast to remove warning
1816 about type conversion.
1818 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1821 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1822 sel_pos_end, refering to cursor position are changed to
1823 LyXParagraph::size_type.
1825 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1826 consistent with LyXCursor::pos().
1827 (inset_pos): changed to LyXParagraph::size_type for same reason.
1829 * src/insets/insettext.C (resizeLyXText): changed some temporary
1830 variables refing to cursor position to LyXParagraph::size_type.
1832 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1834 * src/frontends/kde/<various>: The Great Renaming,
1837 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1839 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1841 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1843 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1844 0 when there are no arguments.
1846 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1848 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1849 to segfaults when pressing Ok in InsetBibtex dialog.
1851 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1853 * forms/layout_forms.fd:
1854 * src/layout_forms.C (create_form_form_character): small change to use
1855 labelframe rather than engraved frame + text
1857 * src/lyx_gui.C (create_forms): initialise choice_language with some
1858 arbitrary value to prevent segfault when dialog is shown.
1860 2000-10-16 Baruch Even <baruch.even@writeme.com>
1862 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1863 is no resulting file. This pertains only to LaTeX output.
1865 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1867 * src/text.C (Backspace): Make sure that the row of the cursor is
1870 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1873 * src/lyx_gui.C (init): Prevent a crash when only one font from
1874 menu/popup fonts is not found.
1876 * lib/lyxrc.example: Add an example for binding a key for language
1879 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1881 * src/converter.C (GetReachable): Changed the returned type to
1883 (IsReachable): New method
1885 * src/MenuBackend.C (expand): Handle formats that appear more
1888 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1890 * src/frontends/support/Makefile.am
1891 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1894 * lib/CREDITS: add Garst Reese.
1896 * src/support/snprintf.h: add extern "C" {} around the definitions.
1898 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1900 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1903 * src/frontends/xforms/FormDocument.C:
1904 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1905 compile without "conversion to integral type of smaller size"
1908 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1910 * src/text.C (GetColumnNearX): Fixed disabled code.
1912 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1914 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1917 * src/support/snprintf.[ch]: new files
1919 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1921 * src/frontends/kde/formprintdialog.C: add
1922 file browser for selecting postscript output
1924 * src/frontends/kde/formprintdialogdata.C:
1925 * src/frontends/kde/formprintdialogdata.h: re-generate
1928 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1930 * src/frontends/gnome/Makefile.am:
1931 * src/frontends/kde/Makefile.am: FormCommand.C
1932 disappeared from xforms
1934 * src/frontends/kde/FormCitation.C:
1935 * src/frontends/kde/FormIndex.C: read-only
1938 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1940 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1943 * src/bufferlist.C: add using directive.
1945 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1947 * src/support/lyxfunctional.h: version of class_fun for void
1948 returns added, const versions of back_inseter_fun and compare_fun
1951 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1953 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1955 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1957 * ChangeLog: cleanup.
1959 * lib/CREDITS: update to add all the contributors we've forgotten.
1960 I have obviously missed some, so tell me whether there were
1963 2000-10-13 Marko Vendelin <markov@ioc.ee>
1965 * src/frontends/gnome/FormCitation.C
1966 * src/frontends/gnome/FormCitation.h
1967 * src/frontends/gnome/FormError.C
1968 * src/frontends/gnome/FormIndex.C
1969 * src/frontends/gnome/FormRef.C
1970 * src/frontends/gnome/FormRef.h
1971 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1973 * src/frontends/gnome/FormCitation.C
1974 * src/frontends/gnome/FormCopyright.C
1975 * src/frontends/gnome/FormError.C
1976 * src/frontends/gnome/FormIndex.C
1977 * src/frontends/gnome/FormRef.C
1978 * src/frontends/gnome/FormToc.C
1979 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1982 * src/frontends/gnome/Menubar_pimpl.C
1983 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1986 2000-10-11 Baruch Even <baruch.even@writeme.com>
1989 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1990 to convey its real action.
1992 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1993 clear the minibuffer and prepare to enter a command.
1995 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1996 the rename from ExecCommand to PrepareForCommand.
1997 * src/lyxfunc.C (Dispatch): ditto.
1999 2000-10-11 Baruch Even <baruch.even@writeme.com>
2001 * src/buffer.C (writeFile): Added test for errors on writing, this
2002 catches all errors and not only file system full errors as intended.
2004 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2006 * src/lyx_gui.C (create_forms): better fix for crash with
2007 translated interface.
2009 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2011 * src/frontends/kde/Makefile.am:
2012 * src/frontends/kde/FormCopyright.C:
2013 * src/frontends/kde/formcopyrightdialog.C:
2014 * src/frontends/kde/formcopyrightdialog.h:
2015 * src/frontends/kde/formcopyrightdialogdata.C:
2016 * src/frontends/kde/formcopyrightdialogdata.h:
2017 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2018 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2019 copyright to use qtarch
2021 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2023 * src/encoding.C (read): Fixed bug that caused an error message at
2024 the end of the file.
2026 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2028 * lib/lyxrc.example: Fixed hebrew example.
2030 2000-10-13 Allan Rae <rae@lyx.org>
2032 * src/frontends/xforms/FormPreferences.C (input): reworking the
2034 (build, update, apply): New inputs in various tabfolders
2036 * src/frontends/xforms/FormToc.C: use new button policy.
2037 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2038 dialogs that either can't use any existing policy or where it just
2041 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2044 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2045 added a bool parameter which is ignored.
2047 * src/buffer.C (setReadonly):
2048 * src/BufferView_pimpl.C (buffer):
2049 * src/frontends/kde/FormCopyright.h (update):
2050 * src/frontends/kde/FormCitation.[Ch] (update):
2051 * src/frontends/kde/FormIndex.[Ch] (update):
2052 * src/frontends/kde/FormPrint.[Ch] (update):
2053 * src/frontends/kde/FormRef.[Ch] (update):
2054 * src/frontends/kde/FormToc.[Ch] (update):
2055 * src/frontends/kde/FormUrl.[Ch] (update):
2056 * src/frontends/gnome/FormCopyright.h (update):
2057 * src/frontends/gnome/FormCitation.[Ch] (update):
2058 * src/frontends/gnome/FormError.[Ch] (update):
2059 * src/frontends/gnome/FormIndex.[Ch] (update):
2060 * src/frontends/gnome/FormPrint.[Ch] (update):
2061 * src/frontends/gnome/FormRef.h (update):
2062 * src/frontends/gnome/FormToc.[Ch] (update):
2063 * src/frontends/gnome/FormUrl.[Ch] (update):
2064 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2065 to updateBufferDependent and DialogBase
2067 * src/frontends/xforms/FormCitation.[hC]:
2068 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2069 * src/frontends/xforms/FormError.[Ch]:
2070 * src/frontends/xforms/FormGraphics.[Ch]:
2071 * src/frontends/xforms/FormIndex.[Ch]:
2072 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2073 and fixed readOnly handling.
2074 * src/frontends/xforms/FormPrint.[Ch]:
2075 * src/frontends/xforms/FormRef.[Ch]:
2076 * src/frontends/xforms/FormTabular.[Ch]:
2077 * src/frontends/xforms/FormToc.[Ch]:
2078 * src/frontends/xforms/FormUrl.[Ch]:
2079 * src/frontends/xforms/FormInset.[Ch]:
2080 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2081 form of updateBufferDependent.
2083 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2084 if form()->visible just in case someone does stuff to the form in a
2087 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2088 the buttoncontroller for everything the enum used to be used for.
2089 (update) It would seem we need to force all dialogs to use a bool
2090 parameter or have two update functions. I chose to go with one.
2091 I did try removing update() from here and FormBase and defining the
2092 appropriate update signatures in FormBaseB[DI] but then ran into the
2093 problem of the update() call in FormBase::show(). Whatever I did
2094 to get around that would require another function and that just
2095 got more confusing. Hence the decision to make everyone have an
2096 update(bool). An alternative might have been to override show() in
2097 FormBaseB[DI] and that would allow the different and appropriate
2100 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2101 true == buffer change occurred. I decided against using a default
2102 template parameter since not all compilers support that at present.
2104 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2106 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2107 army knife" by removing functionality.
2108 (clearStore): removed. All such housekeeping on hide()ing the dialog
2109 is to be carried out by overloaded disconnect() methods.
2110 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2111 superceded by Baruch's neat test (FormGraphics) to update an existing
2112 dialog if a new signal is recieved rather than block all new signals
2114 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2115 only to Inset dialogs.
2116 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2117 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2119 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2121 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2122 as a base class to all inset dialogs. Used solely to connect/disconnect
2123 the Inset::hide signal and to define what action to take on receipt of
2124 a UpdateBufferDependent signal.
2125 (FormCommand): now derived from FormInset.
2127 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2130 * src/frontends/xforms/FormCopyright.[Ch]:
2131 * src/frontends/xforms/FormPreferences.[Ch]:
2132 now derived from FormBaseBI.
2134 * src/frontends/xforms/FormDocument.[Ch]:
2135 * src/frontends/xforms/FormParagraph.[Ch]:
2136 * src/frontends/xforms/FormPrint.[Ch]:
2137 now derived from FormBaseBD.
2139 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2141 * src/frontends/xforms/FormCitation.[Ch]:
2142 * src/frontends/xforms/FormError.[Ch]:
2143 * src/frontends/xforms/FormRef.[Ch]:
2144 * src/frontends/xforms/FormToc.[Ch]:
2145 (clearStore): reworked as disconnect().
2147 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2150 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2152 * src/converter.C (runLaTeX): constify buffer argument
2155 * src/frontends/support/Makefile.am (INCLUDES): fix.
2157 * src/buffer.h: add std:: qualifier
2158 * src/insets/figinset.C (addpidwait): ditto
2159 * src/MenuBackend.C: ditto
2160 * src/buffer.C: ditto
2161 * src/bufferlist.C: ditto
2162 * src/layout.C: ditto
2163 * src/lyxfunc.C: ditto
2165 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2167 * src/lyxtext.h (bidi_level): change return type to
2168 LyXParagraph::size_type.
2170 * src/lyxparagraph.h: change size_type to
2171 TextContainer::difference_type. This should really be
2172 TextContainer::size_type, but we need currently to support signed
2175 2000-10-11 Marko Vendelin <markov@ioc.ee>
2176 * src/frontends/gnome/FormError.h
2177 * src/frontends/gnome/FormRef.C
2178 * src/frontends/gnome/FormRef.h
2179 * src/frontends/gnome/FormError.C
2180 * src/frontends/gnome/Makefile.am
2181 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2182 to Gnome frontend. Both dialogs use "action" area.
2184 2000-10-12 Baruch Even <baruch.even@writeme.com>
2186 * src/graphics/GraphicsCacheItem_pimpl.C:
2187 * src/graphics/Renderer.C:
2188 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2191 2000-10-12 Juergen Vigna <jug@sad.it>
2193 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2194 visible when selecting).
2196 * development/Code_rules/Rules: fixed some typos.
2198 2000-10-09 Baruch Even <baruch.even@writeme.com>
2200 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2201 compiling on egcs 1.1.2 possible.
2203 * src/filedlg.C (comp_direntry::operator() ): ditto.
2205 2000-08-31 Baruch Even <baruch.even@writeme.com>
2207 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2210 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2211 transient it now only gets freed when the object is destructed.
2213 2000-08-24 Baruch Even <baruch.even@writeme.com>
2215 * src/frontends/FormGraphics.h:
2216 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2219 2000-08-20 Baruch Even <baruch.even@writeme.com>
2221 * src/insets/insetgraphics.C:
2222 (draw): Added messages to the drawn rectangle to report status.
2223 (updateInset): Disabled the use of the inline graphics,
2226 2000-08-17 Baruch Even <baruch.even@writeme.com>
2228 * src/frontends/support: Directory added for the support of GUII LyX.
2230 * src/frontends/support/LyXImage.h:
2231 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2234 * src/frontends/support/LyXImage_X.h:
2235 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2236 version of LyXImage, this uses the Xlib Pixmap.
2238 * src/PainterBase.h:
2239 * src/PainterBase.C:
2241 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2242 replacement to Pixmap.
2244 * src/insets/insetgraphics.h:
2245 * src/insets/insetgraphics.C:
2246 * src/graphics/GraphicsCacheItem.h:
2247 * src/graphics/GraphicsCacheItem.C:
2248 * src/graphics/GraphicsCacheItem_pimpl.h:
2249 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2252 * src/graphics/GraphicsCacheItem.h:
2253 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2254 another copy of the object.
2256 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2257 of cacheHandle, this fixed a bug that sent LyX crashing.
2259 * src/graphics/XPM_Renderer.h:
2260 * src/graphics/XPM_Renderer.C:
2261 * src/graphics/EPS_Renderer.h:
2262 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2264 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2266 * src/lyxfunc.C (processKeySym): only handle the
2267 lockinginset/inset stuff if we have a buffer and text loaded...
2269 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2271 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2273 * src/support/lyxfunctional.h: add operator= that takes a reference
2275 * src/lyxserver.C (mkfifo): make first arg const
2277 * src/layout.h: renamed name(...) to setName(...) to work around
2280 * src/buffer.C (setFileName): had to change name of function to
2281 work around bugs in egcs. (renamed from fileName)
2283 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2285 * src/support/translator.h: move helper template classes to
2286 lyxfunctional.h, include "support/lyxfunctional.h"
2288 * src/support/lyxmanip.h: add delaration of fmt
2290 * src/support/lyxfunctional.h: new file
2291 (class_fun_t): new template class
2292 (class_fun): helper template function
2293 (back_insert_fun_iterator): new template class
2294 (back_inserter_fun): helper template function
2295 (compare_memfun_t): new template class
2296 (compare_memfun): helper template function
2297 (equal_1st_in_pair): moved here from translator
2298 (equal_2nd_in_pair): moved here from translator
2300 * src/support/fmt.C: new file
2301 (fmt): new func, can be used for a printf substitute when still
2302 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2304 * src/support/StrPool.C: add some comments
2306 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2309 * src/insets/figinset.C (addpidwait): use std::copy with
2310 ostream_iterator to fill the pidwaitlist
2312 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2314 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2317 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2320 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2322 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2323 (class_update): ditto
2324 (BulletPanel): ditto
2325 (CheckChoiceClass): move initialization of tc and tct
2327 * src/tabular.C: remove current_view
2328 (OldFormatRead): similar to right below [istream::ignore]
2330 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2331 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2332 unused [istream::ignore]
2334 * src/lyxfunc.C: include "support/lyxfunctional.h"
2335 (getInsetByCode): use std::find_if and compare_memfun
2337 * src/lyxfont.C (stateText): remove c_str()
2339 * src/lyx_main.C (setDebuggingLevel): make static
2340 (commandLineHelp): make static
2342 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2343 Screen* together with fl_get_display() and fl_screen
2345 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2346 togheter with fl_get_display() and fl_screen
2347 (create_forms): remove c_str()
2349 * src/layout.C: include "support/lyxfunctional.h"
2350 (hasLayout): use std::find_if and compare_memfun
2351 (GetLayout): use std::find_if and comapre_memfun
2352 (delete_layout): use std::remove_if and compare_memfun
2353 (NumberOfClass): use std:.find_if and compare_memfun
2355 * src/gettext.h: change for the new functions
2357 * src/gettext.C: new file, make _(char const * str) and _(string
2358 const & str) real functions.
2360 * src/font.C (width): rewrite slightly to avoid one extra variable
2362 * src/debug.C: initialize Debug::ANY here
2364 * src/commandtags.h: update number comments
2366 * src/combox.h (get): make const func
2368 (getline): make const
2370 * src/combox.C (input_cb): handle case where fl_get_input can
2373 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2374 "support/lyxfunctional.h", remove current_view variable.
2375 (resize): use std::for_each with std::mem_fun
2376 (getFileNames): use std::copy with back_inserter_fun
2377 (getBuffer): change arg type to unsigned int
2378 (emergencyWriteAll): call emergencyWrite with std::for_each and
2380 (emergencyWrite): new method, the for loop in emergencyWriteAll
2382 (exists): use std::find_if with compare_memfun
2383 (getBuffer): use std::find_if and compare_memfun
2385 * src/buffer.h: add typedefs for iterator_category, value_type
2386 difference_type, pointer and reference for inset_iterator
2387 add postfix ++ for inset_iterator
2388 make inset_iterator::getPos() const
2390 * src/buffer.C: added support/lyxmanip.h
2391 (readFile): use lyxerr << fmt instead of printf
2392 (makeLaTeXFile): use std::copy to write out encodings
2394 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2396 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2397 free and the char * temp.
2398 (hasMenu): use std::find_if and compare_memfun
2401 * src/Makefile.am (lyx_SOURCES): added gettext.C
2403 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2404 string::insert small change to avoid temporary
2406 * src/LColor.C (getGUIName): remove c_str()
2408 * several files: change all occurrences of fl_display to
2411 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2412 that -pedantic is not used for gcc 2.97 (cvs gcc)
2414 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2416 2000-10-11 Allan Rae <rae@lyx.org>
2418 * src/frontends/xforms/FormPreferences.C (input): template path must be
2419 a readable directory. It doesn't need to be writeable.
2420 (build, delete, update, apply): New inputs in the various tabfolders
2422 * src/frontends/xforms/forms/form_preferences.fd:
2423 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2424 several new entries to existing folders. Shuffled some existing stuff
2427 * src/frontends/xforms/forms/form_print.fd:
2428 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2429 Should probably rework PrinterParams as well. Note that the switch to
2430 collated is effectively the same as !unsorted so changing PrinterParams
2431 will require a lot of fiddly changes to reverse the existing logic.
2433 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2435 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2437 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2439 2000-10-10 Allan Rae <rae@lyx.org>
2442 * src/lyxfunc.C (Dispatch):
2444 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2447 * src/lyxrc.C (output): Only write the differences between system lyxrc
2448 and the users settings.
2451 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2453 I'll rewrite this later, after 1.1.6 probably, to keep a single
2454 LyXRC but two instances of a LyXRCStruct.
2456 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2458 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2460 * src/tabular.h: add a few std:: qualifiers.
2462 * src/encoding.C: add using directive.
2463 * src/language.C: ditto.
2465 * src/insets/insetquotes.C (Validate): use languages->lang()
2466 instead of only language.
2468 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2470 * lib/languages: New file.
2472 * lib/encodings: New file.
2474 * src/language.C (Languages): New class.
2475 (read): New method. Reads the languages from the 'languages' file.
2477 * src/encoding.C (Encodings): New class.
2478 (read): New method. Reads the encodings from the 'encodings' file.
2480 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2483 * src/bufferparams.h and a lot of files: Deleted the member language,
2484 and renamed language_info to language
2486 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2487 * src/lyxfont.C (latexWriteStartChanges): ditto.
2488 * src/paragraph.C (validate,TeXOnePar): ditto.
2490 * src/lyxfont.C (update): Restored deleted code.
2492 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2494 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2496 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2498 * src/insets/figinset.[Ch]:
2499 * src/insets/insetinclude.[Ch]:
2500 * src/insets/insetinclude.[Ch]:
2501 * src/insets/insetparent.[Ch]:
2502 * src/insets/insetref.[Ch]:
2503 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2505 * src/insets/*.[Ch]:
2506 * src/mathed/formula.[Ch]:
2507 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2509 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2510 * src/lyx_cb.C (FigureApplyCB):
2511 * src/lyxfunc.C (getStatus, Dispatch):
2512 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2515 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2517 * src/converter.[Ch] (Formats::View):
2518 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2520 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2521 *current_view->buffer(). This will change later, but this patch is way
2524 2000-10-09 Juergen Vigna <jug@sad.it>
2526 * src/text.C (GetRow): small fix.
2528 * src/BufferView_pimpl.C (cursorPrevious):
2529 (cursorNext): added LyXText parameter to function.
2531 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2532 keypress depending on cursor position.
2534 2000-10-06 Juergen Vigna <jug@sad.it>
2536 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2537 (copySelection): redone this function and also copy ascii representa-
2540 * src/tabular.C (Ascii):
2544 (print_n_chars): new functions to realize the ascii export of tabulars.
2546 2000-10-05 Juergen Vigna <jug@sad.it>
2548 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2549 if we don't have a buffer.
2551 2000-10-10 Allan Rae <rae@lyx.org>
2553 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2554 with closing dialog. It seems that nested tabfolders require hiding
2555 of inner tabfolders before hiding the dialog itself. Actually all I
2556 did was hide the active outer folder.
2558 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2559 unless there really is a buffer. hideBufferDependent is called
2562 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2563 POTFILES.in stays in $(srcdir).
2565 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2567 * lib/lyxrc.example: Few changes.
2569 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2571 * src/BufferView_pimpl.C (buffer): only need one the
2572 updateBufferDependent signal to be emitted once! Moved to the end of
2573 the method to allow bv_->text to be updated first.
2575 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2576 and hSignal_ with Dialogs * and BufferDependency variables.
2577 New Buffer * parent_, initialised when the dialog is launched. Used to
2578 check whether to update() or hide() dialog in the new, private
2579 updateOrHide() method that is connected to the updateBufferDependent
2580 signal. Daughter classes dictate what to do using the
2581 ChangedBufferAction enum, passed to the c-tor.
2583 * src/frontends/xforms/FormCitation.C:
2584 * src/frontends/xforms/FormCommand.C:
2585 * src/frontends/xforms/FormCopyright.C:
2586 * src/frontends/xforms/FormDocument.C:
2587 * src/frontends/xforms/FormError.C:
2588 * src/frontends/xforms/FormIndex.C:
2589 * src/frontends/xforms/FormPreferences.C:
2590 * src/frontends/xforms/FormPrint.C:
2591 * src/frontends/xforms/FormRef.C:
2592 * src/frontends/xforms/FormToc.C:
2593 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2596 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2597 ChangedBufferAction enum.
2599 * src/frontends/xforms/FormParagraph.[Ch]
2600 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2603 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2605 * lib/bind/cua.bind: fix a bit.
2606 * lib/bind/emacs.bind: ditto.
2608 * lib/bind/menus.bind: remove real menu entries from there.
2610 * src/spellchecker.C: make sure we only include strings.h when
2613 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2615 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2616 function. It enlarges the maximum number of pup when needed.
2617 (add_toc2): Open a new menu if maximum number of items per menu has
2620 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2622 * src/frontends/kde/FormPrint.C: fix error reporting
2624 * src/frontends/xforms/FormDocument.C: fix compiler
2627 * lib/.cvsignore: add Literate.nw
2629 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2632 * bufferview_funcs.[Ch]
2635 * text2.C: Add support for numbers in RTL text.
2637 2000-10-06 Allan Rae <rae@lyx.org>
2639 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2640 to be gettext.m4 friendly again. ext_l10n.h is now
2641 generated into $top_srcdir instead of $top_builddir
2642 so that lyx.pot will be built correctly -- without
2643 duplicate parsing of ext_l10n.h.
2645 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2647 * src/frontends/kde/FormCitation.C: make the dialog
2648 behave more sensibly
2650 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2652 * config/kde.m4: fix consecutive ./configure runs,
2653 look for qtarch, fix library order
2655 * src/frontends/kde/Makefile.am: tidy up,
2656 add Print dialog, add .dlg dependencies
2658 * src/frontends/kde/FormPrint.C:
2659 * src/frontends/kde/FormPrint.h:
2660 * src/frontends/kde/formprintdialog.C:
2661 * src/frontends/kde/formprintdialog.h:
2662 * src/frontends/kde/formprintdialogdata.C:
2663 * src/frontends/kde/formprintdialogdata.h:
2664 * src/frontends/kde/dlg/formprintdialog.dlg: add
2667 * src/frontends/kde/dlg/README: Added explanatory readme
2669 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2670 script to double-check qtarch's output
2672 * src/frontends/kde/formindexdialog.C:
2673 * src/frontends/kde/formindexdialogdata.C:
2674 * src/frontends/kde/formindexdialogdata.h:
2675 * src/frontends/kde/dlg/formindexdialog.dlg: update
2676 for qtarch, minor fixes
2678 2000-10-05 Allan Rae <rae@lyx.org>
2680 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2681 dialogs when switching buffers update them instead. It's up to each
2682 dialog to decide if it should still be visible or not.
2683 update() should return a bool to control visiblity within show().
2684 Or perhaps better to set a member variable and use that to control
2687 * lib/build-listerrors: create an empty "listerrors" file just to stop
2688 make trying to regenerate it all the time if you don't have noweb
2691 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2693 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2694 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2695 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2696 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2697 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2699 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2701 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2703 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2704 deleting buffer. Closes all buffer-dependent dialogs.
2706 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2708 * src/frontends/xforms/FormCitation.[Ch]:
2709 * src/frontends/xforms/FormPreferences.[Ch]:
2710 * src/frontends/xforms/FormPrint.[Ch]:
2711 * src/frontends/xforms/FormRef.[Ch]:
2712 * src/frontends/xforms/FormUrl.[Ch]: ditto
2714 * src/frontends/xforms/FormDocument.[Ch]:
2715 * src/frontends/xforms/forms/form_document.C.patch:
2716 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2717 pass through a single input() function.
2719 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2721 * lib/build-listerrors: return status as OK
2723 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2725 * lib/lyxrc.example: Updated to new export code
2727 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2729 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2732 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2735 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2736 LyX-Code is defined.
2737 * lib/layouts/amsbook.layout: ditto.
2739 * boost/Makefile.am: fix typo.
2741 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2743 (add_lastfiles): removed.
2744 (add_documents): removed.
2745 (add_formats): removed.
2747 * src/frontends/Menubar.C: remove useless "using" directive.
2749 * src/MenuBackend.h: add a new MenuItem constructor.
2751 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2754 2000-10-04 Allan Rae <rae@lyx.org>
2756 * lib/Makefile.am (listerrors):
2757 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2758 I haven't got notangle installed so Kayvan please test. The output
2759 should end up in $builddir. This also allows people who don't have
2760 noweb installed to complete the make process without error.
2762 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2763 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2764 by JMarc's picky compiler.
2766 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2769 * src/insets/insettabular.C (setPos): change for loop to not use
2770 sequencing operator. Please check this Jürgen.
2772 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2774 * src/insets/insetcite.C (getScreenLabel): ditto
2775 * src/support/filetools.C (QuoteName): ditto
2776 (ChangeExtension): ditto
2778 * src/BufferView_pimpl.C (scrollCB): make heigt int
2780 * src/BufferView2.C (insertInset): comment out unused arg
2782 * boost/Makefile.am (EXTRADIST): new variable
2784 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2786 * src/exporter.C (IsExportable): Fixed
2788 * lib/configure.m4: Small fix
2790 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2792 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2793 * src/insets/insetbib.C (bibitemWidest): ditto.
2794 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2796 2000-10-03 Juergen Vigna <jug@sad.it>
2798 * src/BufferView2.C (theLockingInset): removed const because of
2799 Agnus's compile problems.
2801 * src/insets/insettext.C (LocalDispatch): set the language of the
2802 surronding paragraph on inserting the first character.
2804 * various files: changed use of BufferView::the_locking_inset.
2806 * src/BufferView2.C (theLockingInset):
2807 (theLockingInset): new functions.
2809 * src/BufferView.h: removed the_locking_inset.
2811 * src/lyxtext.h: added the_locking_inset
2813 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2815 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2817 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2819 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2820 * src/mathed/math_cursor.C (IsAlpha): ditto.
2821 * src/mathed/math_inset.C (strnew): ditto.
2822 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2823 (IMetrics): cxp set but never used; removed.
2824 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2825 that the variable in question has been removed also!
2828 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2829 using the Buffer * passed to Latex(), using the BufferView * passed to
2830 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2832 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2833 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2835 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2836 * src/buffer.C (readInset): used new InsetBibtex c-tor
2837 * (getBibkeyList): used new InsetBibtex::getKeys
2839 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2842 * lib/build-listerrors
2844 * src/exporter.C: Add literate programming support to the export code
2847 * src/lyx_cb.C: Remove old literate code.
2849 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2852 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2853 * src/converter.C (View, Convert): Use QuoteName.
2855 * src/insets/figinset.C (Preview): Use Formats::View.
2857 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2859 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2861 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2862 the top of the function, because compaq cxx complains that the
2863 "goto exit_with_message" when the function is disabled bypasses
2865 (MenuNew): try a better fix for the generation of new file names.
2866 This time, I used AddName() instead of AddPath(), hoping Juergen
2869 2000-10-03 Allan Rae <rae@lyx.org>
2871 * src/frontends/xforms/forms/form_preferences.fd:
2872 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2873 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2874 "Look and Feel"->"General" but will need to be split up further into
2875 general output and general input tabs. Current plan is for four outer
2876 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2877 stuff; "Inputs" for input and import configuration; "Outputs" for
2878 output and export configuration; and one more whatever is left over
2879 called "General". The leftovers at present look like being which
2880 viewers to use, spellchecker, language support and might be better
2881 named "Support". I've put "Paths" in "Inputs" for the moment as this
2882 seems reasonable for now at least.
2883 One problem remains: X error kills LyX when you close Preferences.
2885 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2887 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2888 qualifier from form()
2889 * src/frontends/xforms/FormCitation.[Ch]:
2890 * src/frontends/xforms/FormCopyright.[Ch]:
2891 * src/frontends/xforms/FormDocument.[Ch]:
2892 * src/frontends/xforms/FormError.[Ch]:
2893 * src/frontends/xforms/FormIndex.[Ch]:
2894 * src/frontends/xforms/FormPreferences.[Ch]:
2895 * src/frontends/xforms/FormPrint.[Ch]:
2896 * src/frontends/xforms/FormRef.[Ch]:
2897 * src/frontends/xforms/FormToc.[Ch]:
2898 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2900 * src/frontends/xforms/FormCitation.[Ch]:
2901 * src/frontends/xforms/FormIndex.[Ch]:
2902 * src/frontends/xforms/FormRef.[Ch]:
2903 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2904 with Allan's naming policy
2906 * src/frontends/xforms/FormCitation.C: some static casts to remove
2909 2000-10-02 Juergen Vigna <jug@sad.it>
2911 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2912 now you can type or do stuff inside the table-cell also when in dummy
2913 position, fixed visible cursor.
2915 * src/insets/insettext.C (Edit): fixing cursor-view position.
2917 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2918 be used for equal functions in lyxfunc and insettext.
2920 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2922 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2924 * src/frontends/gnome/FormCitation.h:
2925 * src/frontends/gnome/FormCopyright.h:
2926 * src/frontends/gnome/FormIndex.h:
2927 * src/frontends/gnome/FormPrint.h:
2928 * src/frontends/gnome/FormToc.h:
2929 * src/frontends/gnome/FormUrl.h:
2930 * src/frontends/kde/FormCitation.h:
2931 * src/frontends/kde/FormCopyright.h:
2932 * src/frontends/kde/FormIndex.h:
2933 * src/frontends/kde/FormRef.h:
2934 * src/frontends/kde/FormToc.h:
2935 * src/frontends/kde/FormUrl.h: fix remaining users of
2938 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2940 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2941 from depth argument.
2942 (DocBookHandleCaption): ditto.
2943 (DocBookHandleFootnote): ditto.
2944 (SimpleDocBookOnePar): ditto.
2946 * src/frontends/xforms/FormDocument.h (form): remove extra
2947 FormDocument:: qualifier.
2949 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2951 * sigc++/handle.h: ditto.
2953 * src/lyx_gui_misc.C: add "using" directive.
2955 * src/cheaders/cstddef: new file, needed by the boost library (for
2958 2000-10-02 Juergen Vigna <jug@sad.it>
2960 * src/insets/insettext.C (SetFont): better support.
2962 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2964 * src/screen.C (DrawOneRow): some uint refixes!
2966 2000-10-02 Allan Rae <rae@lyx.org>
2968 * boost/.cvsignore: ignore Makefile as well
2970 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2971 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2973 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2974 Left this one out by accident.
2976 * src/frontends/xforms/FormBase.h (restore): default to calling
2977 update() since that will restore the original/currently-applied values.
2978 Any input() triggered error messages will require the derived classes
2979 to redefine restore().
2981 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2982 avoid a segfault. combo_doc_class is the main concern.
2984 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2986 * Simplify build-listerrors in view of GUI-less export ability!
2988 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2990 * src/lyx_main.C (easyParse): Disable gui when exporting
2992 * src/insets/figinset.C:
2995 * src/lyx_gui_misc.C
2996 * src/tabular.C: Changes to allow no-gui.
2998 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3000 * src/support/utility.hpp: removed file
3001 * src/support/block.h: removed file
3003 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3006 * src/mathed/formula.C: add support/lyxlib.h
3007 * src/mathed/formulamacro.C: ditto
3009 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3010 * src/lyxparagraph.h: ditto
3012 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3013 * src/frontends/Makefile.am (INCLUDES): ditto
3014 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3015 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3016 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3017 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3018 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3019 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3021 * src/BufferView.h: use boost/utility.hpp
3022 * src/LColor.h: ditto
3023 * src/LaTeX.h: ditto
3024 * src/LyXAction.h: ditto
3025 * src/LyXView.h: ditto
3026 * src/bufferlist.h: ditto
3027 * src/lastfiles.h: ditto
3028 * src/layout.h: ditto
3029 * src/lyx_gui.h: ditto
3030 * src/lyx_main.h: ditto
3031 * src/lyxlex.h: ditto
3032 * src/lyxrc.h: ditto
3033 * src/frontends/ButtonPolicies.h: ditto
3034 * src/frontends/Dialogs.h: ditto
3035 * src/frontends/xforms/FormBase.h: ditto
3036 * src/frontends/xforms/FormGraphics.h: ditto
3037 * src/frontends/xforms/FormParagraph.h: ditto
3038 * src/frontends/xforms/FormTabular.h: ditto
3039 * src/graphics/GraphicsCache.h: ditto
3040 * src/graphics/Renderer.h: ditto
3041 * src/insets/ExternalTemplate.h: ditto
3042 * src/insets/insetcommand.h: ditto
3043 * src/support/path.h: ditto
3045 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3046 and introduce clause for 2.97.
3048 * boost/libs/README: new file
3050 * boost/boost/utility.hpp: new file
3052 * boost/boost/config.hpp: new file
3054 * boost/boost/array.hpp: new file
3056 * boost/Makefile.am: new file
3058 * boost/.cvsignore: new file
3060 * configure.in (AC_OUTPUT): add boost/Makefile
3062 * Makefile.am (SUBDIRS): add boost
3064 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3066 * src/support/lstrings.C (suffixIs): Fixed.
3068 2000-10-01 Allan Rae <rae@lyx.org>
3070 * src/PrinterParams.h: moved things around to avoid the "can't
3071 inline call" warning.
3073 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3074 into doc++ documentation.
3076 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3078 * src/frontends/xforms/FormRef.C: make use of button controller
3079 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3080 cleaned up button controller usage.
3081 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3082 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3083 use the button controller
3085 * src/frontends/xforms/forms/*.fd: and associated generated files
3086 updated to reflect changes to FormBase. Some other FormXxxx files
3087 also got minor updates to reflect changes to FormBase.
3089 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3090 (hide): made virtual.
3091 (input): return a bool. true == valid input
3092 (RestoreCB, restore): new
3093 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3094 Changes to allow derived dialogs to use a ButtonController and
3095 make sense when doing so: OK button calls ok() and so on.
3097 * src/frontends/xforms/ButtonController.h (class ButtonController):
3098 Switch from template implementation to taking Policy parameter.
3099 Allows FormBase to provide a ButtonController for any dialog.
3101 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3102 Probably should rename connect and disconnect.
3103 (apply): use the radio button groups
3104 (form): needed by FormBase
3105 (build): setup the radio button groups
3107 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3109 * several files: type changes to reduce the number of warnings and
3110 to unify type hangling a bit. Still much to do.
3112 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3114 * lib/images/*: rename a bunch of icons to match Dekel converter
3117 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3120 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3122 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3124 * sigc++/handle.h: ditto for class Handle.
3126 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3128 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3130 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3132 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3133 removal of the "default" language.
3135 * src/combox.h (getline): Check that sel > 0
3137 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3139 * lib/examples/docbook_example.lyx
3140 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3142 * lib/layouts/docbook-book.layout: new docbook book layout.
3144 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3146 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3148 * src/insets/figinset.C (DocBook):fixed small typo.
3150 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3152 * src/insets/insetinclude.h: string include_label doesn't need to be
3155 2000-09-29 Allan Rae <rae@lyx.org>
3157 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3158 Allow derived type to control connection and disconnection from signals
3159 of its choice if desired.
3161 2000-09-28 Juergen Vigna <jug@sad.it>
3163 * src/insets/insettabular.C (update): fixed cursor setting when
3164 the_locking_inset changed.
3165 (draw): made this a bit cleaner.
3166 (InsetButtonPress): fixed!
3168 * various files: added LyXText Parameter to fitCursor call.
3170 * src/BufferView.C (fitCursor): added LyXText parameter.
3172 * src/insets/insettabular.C (draw): small draw fix.
3174 * src/tabular.C: right setting of left/right celllines.
3176 * src/tabular.[Ch]: fixed various types in funcions and structures.
3177 * src/insets/insettabular.C: ditto
3178 * src/frontends/xforms/FormTabular.C: ditto
3180 2000-09-28 Allan Rae <rae@lyx.org>
3182 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3183 that the #ifdef's had been applied to part of what should have been
3184 a complete condition. It's possible there are other tests that
3185 were specific to tables that are also wrong now that InsetTabular is
3186 being used. Now we need to fix the output of '\n' after a table in a
3187 float for the same reason as the original condition:
3188 "don't insert this if we would be adding it before or after a table
3189 in a float. This little trick is needed in order to allow use of
3190 tables in \subfigures or \subtables."
3191 Juergen can you check this?
3193 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3195 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3196 output to the ostream.
3198 * several files: fixed types based on warnings from cxx
3200 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3202 * src/frontends/kde/Makefile.am: fix rule for
3203 formindexdialogdata_moc.C
3205 * src/.cvsignore: add ext_l10n.h to ignore
3207 * acconfig.h: stop messing with __STRICT_ANSI__
3208 * config/gnome.m4: remove option to set -ansi
3209 * config/kde.m4: remove option to set -ansi
3210 * config/lyxinclude.m4: don't set -ansi
3212 2000-09-27 Juergen Vigna <jug@sad.it>
3214 * various files: remove "default" language check.
3216 * src/insets/insetquotes.C: removed use of current_view.
3218 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3219 the one should have red ears by now!
3221 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3222 in more then one paragraph. Fixed cursor-movement/selection.
3224 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3225 paragraphs inside a text inset.
3227 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3228 text-inset if this owner is an inset.
3230 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3232 * src/Bullet.h: changed type of font, character and size to int
3234 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3236 * src/insets/inseturl.[Ch]:
3237 * src/insets/insetref.[Ch]:
3238 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3240 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3242 * src/buffer.C (readFile): block-if statement rearranged to minimise
3243 bloat. Patch does not reverse Jean-Marc's change ;-)
3245 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3246 Class rewritten to store pointers to hide/update signals directly,
3247 rather than Dialogs *. Also defined an enum to ease use. All xforms
3248 forms can now be derived from this class.
3250 * src/frontends/xforms/FormCommand.[Ch]
3251 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3253 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3256 * src/frontends/xforms/forms/form_citation.fd
3257 * src/frontends/xforms/forms/form_copyright.fd
3258 * src/frontends/xforms/forms/form_error.fd
3259 * src/frontends/xforms/forms/form_index.fd
3260 * src/frontends/xforms/forms/form_ref.fd
3261 * src/frontends/xforms/forms/form_toc.fd
3262 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3264 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3266 * src/insets/insetfoot.C: removed redundent using directive.
3268 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3270 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3271 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3273 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3274 created in the constructors in different groups. Then set() just
3275 have to show the groups as needed. This fixes the redraw problems
3276 (and is how the old menu code worked).
3278 * src/support/lyxlib.h: declare the methods as static when we do
3279 not have namespaces.
3281 2000-09-26 Juergen Vigna <jug@sad.it>
3283 * src/buffer.C (asciiParagraph): new function.
3284 (writeFileAscii): new function with parameter ostream.
3285 (writeFileAscii): use now asciiParagraph.
3287 * various inset files: added the linelen parameter to the Ascii-func.
3289 * src/tabular.C (Write): fixed error in writing file introduced by
3290 the last changes from Lars.
3292 * lib/bind/menus.bind: removed not supported functions.
3294 * src/insets/insettext.C (Ascii): implemented this function.
3296 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3298 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3299 (Write): use of the write_attribute functions.
3301 * src/bufferlist.C (close): fixed reasking question!
3303 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3305 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3306 new files use the everwhere possible.
3309 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3310 src/log_form.C src/lyx.C:
3313 * src/buffer.C (runLaTeX): remove func
3315 * src/PaperLayout.C: removed file
3316 * src/ParagraphExtra.C: likewise
3317 * src/bullet_forms.C: likewise
3318 * src/bullet_forms.h: likewise
3319 * src/bullet_forms_cb.C: likewise
3321 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3322 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3325 * several files: remove all traces of the old fd_form_paragraph,
3326 and functions belonging to that.
3328 * several files: remove all traces of the old fd_form_document,
3329 and functions belonging to that.
3331 * several files: constify local variables were possible.
3333 * several files: remove all code that was dead when NEW_EXPORT was
3336 * several files: removed string::c_str in as many places as
3339 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3340 (e): be a bit more outspoken when patching
3341 (updatesrc): only move files if changed.
3343 * forms/layout_forms.h.patch: regenerated
3345 * forms/layout_forms.fd: remove form_document and form_paragraph
3346 and form_quotes and form_paper and form_table_options and
3347 form_paragraph_extra
3349 * forms/form1.fd: remove form_table
3351 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3352 the fdui->... rewrite. Update some comments to xforms 0.88
3354 * forms/bullet_forms.C.patch: removed file
3355 * forms/bullet_forms.fd: likewise
3356 * forms/bullet_forms.h.patch: likewise
3358 * development/Code_rules/Rules: added a section on switch
3359 statements. Updated some comment to xforms 0.88.
3361 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3363 * src/buffer.C (readFile): make sure that the whole version number
3364 is read after \lyxformat (even when it contains a comma)
3366 * lib/ui/default.ui: change shortcut of math menu to M-a.
3368 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3370 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3373 * src/LyXView.C (updateWindowTitle): show the full files name in
3374 window title, limited to 30 characters.
3376 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3377 When a number of characters has been given, we should not assume
3378 that the string is 0-terminated.
3380 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3381 calls (fixes some memory leaks)
3383 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3384 trans member on exit.
3386 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3388 * src/converter.C (GetReachable): fix typo.
3390 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3391 understand ',' instead of '.'.
3392 (GetInteger): rewrite to use strToInt().
3394 2000-09-26 Juergen Vigna <jug@sad.it>
3396 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3397 better visibility and error-message on wrong VSpace input.
3399 * src/language.C (initL): added english again.
3401 2000-09-25 Juergen Vigna <jug@sad.it>
3403 * src/frontends/kde/Dialogs.C (Dialogs):
3404 * src/frontends/gnome/Dialogs.C (Dialogs):
3405 * src/frontends/kde/Makefile.am:
3406 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3408 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3410 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3412 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3414 * src/frontends/xforms/FormParagraph.C:
3415 * src/frontends/xforms/FormParagraph.h:
3416 * src/frontends/xforms/form_paragraph.C:
3417 * src/frontends/xforms/form_paragraph.h:
3418 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3421 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3423 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3424 Paragraph-Data after use.
3426 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3427 non breakable paragraphs.
3429 2000-09-25 Garst R. Reese <reese@isn.net>
3431 * src/language.C (initL): added missing language_country codes.
3433 2000-09-25 Juergen Vigna <jug@sad.it>
3435 * src/insets/insettext.C (InsetText):
3436 (deleteLyXText): remove the not released LyXText structure!
3438 2000-09-24 Marko Vendelin <markov@ioc.ee>
3440 * src/frontends/gnome/mainapp.C
3441 * src/frontends/gnome/mainapp.h: added support for keyboard
3444 * src/frontends/gnome/FormCitation.C
3445 * src/frontends/gnome/FormCitation.h
3446 * src/frontends/gnome/Makefile.am
3447 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3448 FormCitation to use "action area" in mainapp window
3450 * src/frontends/gnome/Menubar_pimpl.C
3451 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3454 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3456 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3457 width/descent/ascent values if name is empty.
3458 (mathed_string_height): Use std::max.
3460 2000-09-25 Allan Rae <rae@lyx.org>
3462 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3463 segfault. This will be completely redesigned soon.
3465 * sigc++: updated libsigc++. Fixes struct timespec bug.
3467 * development/tools/makeLyXsigc.sh: .cvsignore addition
3469 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3471 * several files: removed almost all traces of the old table
3474 * src/TableLayout.C: removed file
3476 2000-09-22 Juergen Vigna <jug@sad.it>
3478 * src/frontends/kde/Dialogs.C: added credits forms.
3480 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3482 * src/frontends/gnome/Dialogs.C: added some forms.
3484 * src/spellchecker.C (init_spell_checker): set language in pspell code
3485 (RunSpellChecker): some modifications for setting language string.
3487 * src/language.[Ch]: added language_country code.
3489 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3491 * src/frontends/Dialogs.h: added new signal showError.
3492 Rearranged existing signals in some sort of alphabetical order.
3494 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3495 FormError.[Ch], form_error.[Ch]
3496 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3497 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3499 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3500 dialogs. I think that this can be used as the base to all these
3503 * src/frontends/xforms/FormError.[Ch]
3504 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3505 implementation of InsetError dialog.
3507 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3509 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3510 * src/frontends/kde/Makefile.am: ditto
3512 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3514 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3515 macrobf. This fixes a bug of invisible text.
3517 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3519 * lib/doc/LaTeXConfig.lyx.in: updated.
3521 * src/language.C (initL): remove language "francais" and change a
3522 bit the names of the two other french variations.
3524 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3525 string that may not be 0-terminated.
3527 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3529 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3531 2000-09-20 Marko Vendelin <markov@ioc.ee>
3533 * src/frontends/gnome/FormCitation.C
3534 * src/frontends/gnome/FormIndex.C
3535 * src/frontends/gnome/FormToc.C
3536 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3537 the variable initialization to shut up the warnings
3539 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3541 * src/table.[Ch]: deleted files
3543 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3546 2000-09-18 Juergen Vigna <jug@sad.it>
3548 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3549 problems with selection. Inserted new LFUN_PASTESELECTION.
3550 (InsetButtonPress): inserted handling of middle mouse-button paste.
3552 * src/spellchecker.C: changed word to word.c_str().
3554 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3556 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3557 included in the ``make dist'' tarball.
3559 2000-09-15 Juergen Vigna <jug@sad.it>
3561 * src/CutAndPaste.C (cutSelection): small fix return the right
3562 end position after cut inside one paragraph only.
3564 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3565 we are locked as otherwise we don't have a valid cursor position!
3567 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3569 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3571 * src/frontends/kde/FormRef.C: added using directive.
3572 * src/frontends/kde/FormToc.C: ditto
3574 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3576 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3578 2000-09-19 Marko Vendelin <markov@ioc.ee>
3580 * src/frontends/gnome/Menubar_pimpl.C
3581 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3582 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3584 * src/frontends/gnome/mainapp.C
3585 * src/frontends/gnome/mainapp.h: support for menu update used
3588 * src/frontends/gnome/mainapp.C
3589 * src/frontends/gnome/mainapp.h: support for "action" area in the
3590 main window. This area is used by small simple dialogs, such as
3593 * src/frontends/gnome/FormIndex.C
3594 * src/frontends/gnome/FormIndex.h
3595 * src/frontends/gnome/FormUrl.C
3596 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3599 * src/frontends/gnome/FormCitation.C
3600 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3601 action area. Only "Insert new citation" is implemented.
3603 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3605 * src/buffer.C (Dispatch): fix call to Dispatch
3606 * src/insets/insetref.C (Edit): likewise
3607 * src/insets/insetparent.C (Edit): likewise
3608 * src/insets/insetinclude.C (include_cb): likewise
3609 * src/frontends/xforms/FormUrl.C (apply): likewise
3610 * src/frontends/xforms/FormToc.C (apply): likewise
3611 * src/frontends/xforms/FormRef.C (apply): likewise
3612 * src/frontends/xforms/FormIndex.C (apply): likewise
3613 * src/frontends/xforms/FormCitation.C (apply): likewise
3614 * src/lyxserver.C (callback): likewise
3615 * src/lyxfunc.C (processKeySym): likewise
3616 (Dispatch): likewise
3617 (Dispatch): likewise
3618 * src/lyx_cb.C (LayoutsCB): likewise
3620 * Makefile.am (sourcedoc): small change
3622 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3624 * src/main.C (main): Don't make an empty GUIRunTime object. all
3625 methods are static. constify a bit remove unneded using + headers.
3627 * src/tabular.C: some more const to local vars move some loop vars
3629 * src/spellchecker.C: added some c_str after some word for pspell
3631 * src/frontends/GUIRunTime.h: add new static method setDefaults
3632 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3633 * src/frontends/kde/GUIRunTime.C (setDefaults):
3634 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3636 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3637 with strnew in arg, use correct emptystring when calling SetName.
3639 * several files: remove all commented code with relation to
3640 HAVE_SSTREAM beeing false. We now only support stringstream and
3643 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3645 * src/lyxfunc.C: construct correctly the automatic new file
3648 * src/text2.C (IsStringInText): change type of variable i to shut
3651 * src/support/sstream.h: do not use namespaces if the compiler
3652 does not support them.
3654 2000-09-15 Marko Vendelin <markov@ioc.ee>
3655 * src/frontends/gnome/FormCitation.C
3656 * src/frontends/gnome/FormCitation.h
3657 * src/frontends/gnome/diainsertcitation_interface.c
3658 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3659 regexp support to FormCitation [Gnome].
3661 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3664 * configure.in: remove unused KDE/GTKGUI define
3666 * src/frontends/kde/FormRef.C
3667 * src/frontends/kde/FormRef.h
3668 * src/frontends/kde/formrefdialog.C
3669 * src/frontends/kde/formrefdialog.h: double click will
3670 go to reference, now it is possible to change a cross-ref
3673 * src/frontends/kde/FormToc.C
3674 * src/frontends/kde/FormToc.h
3675 * src/frontends/kde/formtocdialog.C
3676 * src/frontends/kde/formtocdialog.h: add a depth
3679 * src/frontends/kde/Makefile.am: add QtLyXView.h
3682 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3684 * src/frontends/kde/FormCitation.h: added some using directives.
3686 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3688 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3691 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3694 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3696 * src/buffer.C (pop_tag): revert for the second time a change by
3697 Lars, who seems to really hate having non-local loop variables :)
3699 * src/Lsstream.h: add "using" statements.
3701 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3702 * src/buffer.C (writeFile): ditto
3704 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3706 * src/buffer.C (writeFile): try to fix the locale modified format
3707 number to always be as we want it.
3709 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3710 in XForms 0.89. C-space is now working again.
3712 * src/Lsstream.h src/support/sstream.h: new files.
3714 * also commented out all cases where strstream were used.
3716 * src/Bullet.h (c_str): remove method.
3718 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3720 * a lot of files: get rid of "char const *" and "char *" is as
3721 many places as possible. We only want to use them in interaction
3722 with system of other libraries, not inside lyx.
3724 * a lot of files: return const object is not of pod type. This
3725 helps ensure that temporary objects is not modified. And fits well
3726 with "programming by contract".
3728 * configure.in: check for the locale header too
3730 * Makefile.am (sourcedoc): new tag for generation of doc++
3733 2000-09-14 Juergen Vigna <jug@sad.it>
3735 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3736 callback to check which combo called it and do the right action.
3738 * src/combox.C (combo_cb): added combo * to the callbacks.
3739 (Hide): moved call of callback after Ungrab of the pointer.
3741 * src/intl.h: removed LCombo2 function.
3743 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3744 function as this can now be handled in one function.
3746 * src/combox.h: added Combox * to callback prototype.
3748 * src/frontends/xforms/Toolbar_pimpl.C:
3749 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3751 2000-09-14 Garst Reese <reese@isn.net>
3753 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3754 moved usepackage{xxx}'s to beginning of file. Changed left margin
3755 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3756 underlining from title. Thanks to John Culleton for useful suggestions.
3758 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3760 * src/lyxlex_pimpl.C (setFile): change error message to debug
3763 2000-09-13 Juergen Vigna <jug@sad.it>
3765 * src/frontends/xforms/FormDocument.C: implemented choice_class
3766 as combox and give callback to combo_language so OK/Apply is activated
3769 * src/bufferlist.C (newFile): small fix so already named files
3770 (via an open call) are not requested to be named again on the
3773 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3775 * src/frontends/kde/Makefile.am
3776 * src/frontends/kde/FormRef.C
3777 * src/frontends/kde/FormRef.h
3778 * src/frontends/kde/formrefdialog.C
3779 * src/frontends/kde/formrefdialog.h: implement
3782 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3784 * src/frontends/kde/formtocdialog.C
3785 * src/frontends/kde/formtocdialog.h
3786 * src/frontends/kde/FormToc.C
3787 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3789 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3791 * src/frontends/kde/FormCitation.C: fix thinko
3792 where we didn't always display the reference text
3795 * src/frontends/kde/formurldialog.C
3796 * src/frontends/kde/formurldialog.h
3797 * src/frontends/kde/FormUrl.C
3798 * src/frontends/kde/FormUrl.h: minor cleanups
3800 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3802 * src/frontends/kde/Makefile.am
3803 * src/frontends/kde/FormToc.C
3804 * src/frontends/kde/FormToc.h
3805 * src/frontends/kde/FormCitation.C
3806 * src/frontends/kde/FormCitation.h
3807 * src/frontends/kde/FormIndex.C
3808 * src/frontends/kde/FormIndex.h
3809 * src/frontends/kde/formtocdialog.C
3810 * src/frontends/kde/formtocdialog.h
3811 * src/frontends/kde/formcitationdialog.C
3812 * src/frontends/kde/formcitationdialog.h
3813 * src/frontends/kde/formindexdialog.C
3814 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3816 2000-09-12 Juergen Vigna <jug@sad.it>
3818 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3821 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3823 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3826 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3828 * src/converter.C (Add, Convert): Added support for converter flags:
3829 needaux, resultdir, resultfile.
3830 (Convert): Added new parameter view_file.
3831 (dvips_options): Fixed letter paper option.
3833 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3834 (Export, GetExportableFormats, GetViewableFormats): Added support
3837 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3839 (easyParse): Fixed to work with new export code.
3841 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3844 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3846 * lib/bind/*.bind: Replaced
3847 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3848 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3850 2000-09-11 Juergen Vigna <jug@sad.it>
3852 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3854 * src/main.C (main): now GUII defines global guiruntime!
3856 * src/frontends/gnome/GUIRunTime.C (initApplication):
3857 * src/frontends/kde/GUIRunTime.C (initApplication):
3858 * src/frontends/xforms/GUIRunTime.C (initApplication):
3859 * src/frontends/GUIRunTime.h: added new function initApplication.
3861 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3863 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3865 2000-09-08 Juergen Vigna <jug@sad.it>
3867 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3868 we have already "Reset".
3870 * src/language.C (initL): inserted "default" language and made this
3871 THE default language (and not american!)
3873 * src/paragraph.C: inserted handling of "default" language!
3875 * src/lyxfont.C: ditto
3879 * src/paragraph.C: output the \\par only if we have a following
3880 paragraph otherwise it's not needed.
3882 2000-09-05 Juergen Vigna <jug@sad.it>
3884 * config/pspell.m4: added entry to lyx-flags
3886 * src/spellchecker.C: modified version from Kevin for using pspell
3888 2000-09-01 Marko Vendelin <markov@ioc.ee>
3889 * src/frontends/gnome/Makefile.am
3890 * src/frontends/gnome/FormCitation.C
3891 * src/frontends/gnome/FormCitation.h
3892 * src/frontends/gnome/diainsertcitation_callbacks.c
3893 * src/frontends/gnome/diainsertcitation_callbacks.h
3894 * src/frontends/gnome/diainsertcitation_interface.c
3895 * src/frontends/gnome/diainsertcitation_interface.h
3896 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3897 dialog for Gnome frontend
3899 * src/main.C: Gnome libraries require keeping application name
3900 and its version as strings
3902 * src/frontends/gnome/mainapp.C: Change the name of the main window
3903 from GnomeLyX to PACKAGE
3905 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3907 * src/frontends/Liason.C: add "using: declaration.
3909 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3911 * src/mathed/math_macro.C (Metrics): Set the size of the template
3913 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3915 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3917 * src/converter.C (add_options): New function.
3918 (SetViewer): Change $$FName into '$$FName'.
3919 (View): Add options when running xdvi
3920 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3921 (Convert): The 3rd parameter is now the desired filename. Converts
3922 calls to lyx::rename if necessary.
3923 Add options when running dvips.
3924 (dvi_papersize,dvips_options): New methods.
3926 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3928 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3929 using a call to Converter::dvips_options.
3930 Fixed to work with nex export code.
3932 * src/support/copy.C
3933 * src/support/rename.C: New files
3935 * src/support/syscall.h
3936 * src/support/syscall.C: Added Starttype SystemDontWait.
3938 * lib/ui/default.ui: Changed to work with new export code
3940 * lib/configure.m4: Changed to work with new export code
3942 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3944 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3946 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3947 so that code compiles with DEC cxx.
3949 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3950 to work correctly! Also now supports the additional elements
3953 2000-09-01 Allan Rae <rae@lyx.org>
3955 * src/frontends/ButtonPolicies.C: renamed all the references to
3956 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3958 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3959 since it's a const not a type.
3961 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3963 2000-08-31 Juergen Vigna <jug@sad.it>
3965 * src/insets/figinset.C: Various changes to look if the filename has
3966 an extension and if not add it for inline previewing.
3968 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3970 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3971 make buttonStatus and isReadOnly be const methods. (also reflect
3972 this in derived classes.)
3974 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3975 (nextState): change to be static inline, pass the StateMachine as
3977 (PreferencesPolicy): remove casts
3978 (OkCancelPolicy): remvoe casts
3979 (OkCancelReadOnlyPolicy): remove casts
3980 (NoRepeatedApplyReadOnlyPolicy): remove casts
3981 (OkApplyCancelReadOnlyPolicy): remove casts
3982 (OkApplyCancelPolicy): remove casts
3983 (NoRepeatedApplyPolicy): remove casts
3985 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3987 * src/converter.C: added some using directives
3989 * src/frontends/ButtonPolicies.C: changes to overcome
3990 "need lvalue" error with DEC c++
3992 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3993 to WMHideCB for DEC c++
3995 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3997 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3998 to BulletBMTableCB for DEC c++
4000 2000-08-31 Allan Rae <rae@lyx.org>
4002 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4003 character dialog separately from old document dialogs combo_language.
4006 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4008 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4009 Removed LFUN_REF_CREATE.
4011 * src/MenuBackend.C: Added new tags: toc and references
4013 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4014 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4016 (add_toc, add_references): New methods.
4017 (create_submenu): Handle correctly the case when there is a
4018 seperator after optional menu items.
4020 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4021 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4022 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4024 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4026 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4028 * src/converter.[Ch]: New file for converting between different
4031 * src/export.[Ch]: New file for exporting a LyX file to different
4034 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4035 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4036 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4037 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4038 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4039 RunDocBook, MenuExport.
4041 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4042 Exporter::Preview methods if NEW_EXPORT is defined.
4044 * src/buffer.C (Dispatch): Use Exporter::Export.
4046 * src/lyxrc.C: Added new tags: \converter and \viewer.
4049 * src/LyXAction.C: Define new lyx-function: buffer-update.
4050 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4051 when NEW_EXPORT is defined.
4053 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4055 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4057 * lib/ui/default.ui: Added submenus "view" and "update" to the
4060 * src/filetools.C (GetExtension): New function.
4062 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4064 2000-08-29 Allan Rae <rae@lyx.org>
4066 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4068 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4069 (EnableDocumentLayout): removed
4070 (DisableDocumentLayout): removed
4071 (build): make use of ButtonController's read-only handling to
4072 de/activate various objects. Replaces both of the above functions.
4074 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4075 (readOnly): was read_only
4076 (refresh): fixed dumb mistakes with read_only_ handling
4078 * src/frontends/xforms/forms/form_document.fd:
4079 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4080 tabbed dialogs so the tabs look more like tabs and so its easier to
4081 work out which is the current tab.
4083 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4084 segfault with form_table
4086 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4088 2000-08-28 Juergen Vigna <jug@sad.it>
4090 * acconfig.h: added USE_PSPELL.
4092 * src/config.h.in: added USE_PSPELL.
4094 * autogen.sh: added pspell.m4
4096 * config/pspell.m4: new file.
4098 * src/spellchecker.C: implemented support for pspell libary.
4100 2000-08-25 Juergen Vigna <jug@sad.it>
4102 * src/LyXAction.C (init): renamed LFUN_TABLE to
4103 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4105 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4107 * src/lyxscreen.h: add force_clear variable and fuction to force
4108 a clear area when redrawing in LyXText.
4110 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4112 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4114 * some whitespace and comment changes.
4116 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4118 * src/buffer.C: up te LYX_FORMAT to 2.17
4120 2000-08-23 Juergen Vigna <jug@sad.it>
4122 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4125 * src/insets/insettabular.C (pasteSelection): delete the insets
4126 LyXText as it is not valid anymore.
4127 (copySelection): new function.
4128 (pasteSelection): new function.
4129 (cutSelection): new function.
4130 (LocalDispatch): implemented cut/copy/paste of cell selections.
4132 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4133 don't have a LyXText.
4135 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4137 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4140 2000-08-22 Juergen Vigna <jug@sad.it>
4142 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4143 ifdef form_table out if NEW_TABULAR.
4145 2000-08-21 Juergen Vigna <jug@sad.it>
4147 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4148 (draw): fixed draw position so that the cursor is positioned in the
4150 (InsetMotionNotify): hide/show cursor so the position is updated.
4151 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4152 using cellstart() function where it should be used.
4154 * src/insets/insettext.C (draw): ditto.
4156 * src/tabular.C: fixed initialization of some missing variables and
4157 made BoxType into an enum.
4159 2000-08-22 Marko Vendelin <markov@ioc.ee>
4160 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4161 stock menu item using action numerical value, not its string
4165 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4167 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4168 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4170 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4172 * src/frontends/xforms/GUIRunTime.C: new file
4174 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4175 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4177 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4179 * src/frontends/kde/GUIRunTime.C: new file
4181 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4182 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4184 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4186 * src/frontends/gnome/GUIRunTime.C: new file
4188 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4191 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4192 small change to documetentation.
4194 * src/frontends/GUIRunTime.C: removed file
4196 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4198 * src/lyxparagraph.h: enable NEW_TABULAR as default
4200 * src/lyxfunc.C (processKeySym): remove some commented code
4202 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4203 NEW_TABULAR around the fd_form_table_options.
4205 * src/lyx_gui.C (runTime): call the static member function as
4206 GUIRunTime::runTime().
4208 2000-08-21 Allan Rae <rae@lyx.org>
4210 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4213 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4215 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4217 2000-08-21 Allan Rae <rae@lyx.org>
4219 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4220 keep Garst happy ;-)
4221 * src/frontends/xforms/FormPreferences.C (build): use setOK
4222 * src/frontends/xforms/FormDocument.C (build): use setOK
4223 (FormDocument): use the appropriate policy.
4225 2000-08-21 Allan Rae <rae@lyx.org>
4227 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4228 automatic [de]activation of arbitrary objects when in a read-only state.
4230 * src/frontends/ButtonPolicies.h: More documentation
4231 (isReadOnly): added to support the above.
4233 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4235 2000-08-18 Juergen Vigna <jug@sad.it>
4237 * src/insets/insettabular.C (getStatus): changed to return func_status.
4239 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4240 display toggle menu entries if they are.
4242 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4243 new document layout now.
4245 * src/lyxfunc.C: ditto
4247 * src/lyx_gui_misc.C: ditto
4249 * src/lyx_gui.C: ditto
4251 * lib/ui/default.ui: removed paper and quotes layout as they are now
4252 all in the document layout tabbed folder.
4254 * src/frontends/xforms/forms/form_document.fd: added Restore
4255 button and callbacks for all inputs for Allan's ButtonPolicy.
4257 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4258 (CheckChoiceClass): added missing params setting on class change.
4259 (UpdateLayoutDocument): added for updating the layout on params.
4260 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4261 (FormDocument): Implemented Allan's ButtonPolicy with the
4264 2000-08-17 Allan Rae <rae@lyx.org>
4266 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4267 so we can at least see the credits again.
4269 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4270 controller calls for the appropriate callbacks. Note that since Ok
4271 calls apply followed by cancel, and apply isn't a valid input for the
4272 APPLIED state, the bc_ calls have to be made in the static callback not
4273 within each of the real callbacks.
4275 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4276 (setOk): renamed from setOkay()
4278 2000-08-17 Juergen Vigna <jug@sad.it>
4280 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4281 in the implementation part.
4282 (composeUIInfo): don't show optional menu-items.
4284 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4286 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4288 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4289 text-state when in a text-inset.
4291 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4293 2000-08-17 Marko Vendelin <markov@ioc.ee>
4294 * src/frontends/gnome/FormIndex.C
4295 * src/frontends/gnome/FormIndex.h
4296 * src/frontends/gnome/FormToc.C
4297 * src/frontends/gnome/FormToc.h
4298 * src/frontends/gnome/dialogs
4299 * src/frontends/gnome/diatoc_callbacks.c
4300 * src/frontends/gnome/diatoc_callbacks.h
4301 * src/frontends/gnome/diainsertindex_callbacks.h
4302 * src/frontends/gnome/diainsertindex_callbacks.c
4303 * src/frontends/gnome/diainsertindex_interface.c
4304 * src/frontends/gnome/diainsertindex_interface.h
4305 * src/frontends/gnome/diatoc_interface.h
4306 * src/frontends/gnome/diatoc_interface.c
4307 * src/frontends/gnome/Makefile.am: Table of Contents and
4308 Insert Index dialogs implementation for Gnome frontend
4310 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4312 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4314 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4317 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4319 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4320 destructor. Don't definde if you don't need it
4321 (processEvents): made static, non-blocking events processing for
4323 (runTime): static method. event loop for xforms
4324 * similar as above for kde and gnome.
4326 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4327 new Pimpl is correct
4328 (runTime): new method calss the real frontends runtime func.
4330 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4332 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4334 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4336 2000-08-16 Juergen Vigna <jug@sad.it>
4338 * src/lyx_gui.C (runTime): added GUII RunTime support.
4340 * src/frontends/Makefile.am:
4341 * src/frontends/GUIRunTime.[Ch]:
4342 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4343 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4344 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4346 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4348 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4349 as this is already set in ${FRONTEND_INCLUDE} if needed.
4351 * configure.in (CPPFLAGS): setting the include dir for the frontend
4352 directory and don't set FRONTEND=xforms for now as this is executed
4355 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4357 * src/frontends/kde/Makefile.am:
4358 * src/frontends/kde/FormUrl.C:
4359 * src/frontends/kde/FormUrl.h:
4360 * src/frontends/kde/formurldialog.h:
4361 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4363 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4365 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4367 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4369 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4372 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4374 * src/WorkArea.C (work_area_handler): more work to get te
4375 FL_KEYBOARD to work with xforms 0.88 too, please test.
4377 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4379 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4381 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4384 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4386 * src/Timeout.h: remove Qt::emit hack.
4388 * several files: changes to allo doc++ compilation
4390 * src/lyxfunc.C (processKeySym): new method
4391 (processKeyEvent): comment out if FL_REVISION < 89
4393 * src/WorkArea.C: change some debugging levels.
4394 (WorkArea): set wantkey to FL_KEY_ALL
4395 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4396 clearer code and the use of compose with XForms 0.89. Change to
4397 use signals instead of calling methods in bufferview directly.
4399 * src/Painter.C: change some debugging levels.
4401 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4404 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4405 (workAreaKeyPress): new method
4407 2000-08-14 Juergen Vigna <jug@sad.it>
4409 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4411 * config/kde.m4: addes some features
4413 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4414 include missing xforms dialogs.
4416 * src/Timeout.h: a hack to be able to compile with qt/kde.
4418 * sigc++/.cvsignore: added acinclude.m4
4420 * lib/.cvsignore: added listerros
4422 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4423 xforms tree as objects are needed for other frontends.
4425 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4426 linking with not yet implemented xforms objects.
4428 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4430 2000-08-14 Baruch Even <baruch.even@writeme.com>
4432 * src/frontends/xforms/FormGraphics.h:
4433 * src/frontends/xforms/FormGraphics.C:
4434 * src/frontends/xforms/RadioButtonGroup.h:
4435 * src/frontends/xforms/RadioButtonGroup.C:
4436 * src/insets/insetgraphics.h:
4437 * src/insets/insetgraphics.C:
4438 * src/insets/insetgraphicsParams.h:
4439 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4440 instead of spaces, and various other indentation issues to make the
4441 sources more consistent.
4443 2000-08-14 Marko Vendelin <markov@ioc.ee>
4445 * src/frontends/gnome/dialogs/diaprint.glade
4446 * src/frontends/gnome/FormPrint.C
4447 * src/frontends/gnome/FormPrint.h
4448 * src/frontends/gnome/diaprint_callbacks.c
4449 * src/frontends/gnome/diaprint_callbacks.h
4450 * src/frontends/gnome/diaprint_interface.c
4451 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4454 * src/frontends/gnome/dialogs/diainserturl.glade
4455 * src/frontends/gnome/FormUrl.C
4456 * src/frontends/gnome/FormUrl.h
4457 * src/frontends/gnome/diainserturl_callbacks.c
4458 * src/frontends/gnome/diainserturl_callbacks.h
4459 * src/frontends/gnome/diainserturl_interface.c
4460 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4461 Gnome implementation
4463 * src/frontends/gnome/Dialogs.C
4464 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4465 all other dialogs. Copy all unimplemented dialogs from Xforms
4468 * src/frontends/gnome/support.c
4469 * src/frontends/gnome/support.h: support files generated by Glade
4473 * config/gnome.m4: Gnome configuration scripts
4475 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4476 configure --help message
4478 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4479 only if there are no events pendling in Gnome/Gtk. This enhances
4480 the performance of menus.
4483 2000-08-14 Allan Rae <rae@lyx.org>
4485 * lib/Makefile.am: listerrors cleaning
4487 * lib/listerrors: removed -- generated file
4488 * acinclude.m4: ditto
4489 * sigc++/acinclude.m4: ditto
4491 * src/frontends/xforms/forms/form_citation.fd:
4492 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4495 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4496 `updatesrc` and now we have a `test` target that does what `updatesrc`
4497 used to do. I didn't like having an install target that wasn't related
4500 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4501 on all except FormGraphics. This may yet happen. Followed by a major
4502 cleanup including using FL_TRANSIENT for most of the dialogs. More
4503 changes to come when the ButtonController below is introduced.
4505 * src/frontends/xforms/ButtonController.h: New file for managing up to
4506 four buttons on a dialog according to an externally defined policy.
4507 * src/frontends/xforms/Makefile.am: added above
4509 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4510 Apply and Cancel/Close buttons and everything in between and beyond.
4511 * src/frontends/Makefile.am: added above.
4513 * src/frontends/xforms/forms/form_preferences.fd:
4514 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4515 and removed variable 'status' as a result. Fixed the set_minsize thing.
4516 Use the new screen-font-update after checking screen fonts were changed
4517 Added a "Restore" button to restore the original lyxrc values while
4518 editing. This restores everything not just the last input changed.
4519 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4521 * src/LyXAction.C: screen-font-update added for updating buffers after
4522 screen font settings have been changed.
4523 * src/commandtags.h: ditto
4524 * src/lyxfunc.C: ditto
4526 * forms/lyx.fd: removed screen fonts dialog.
4527 * src/lyx_gui.C: ditto
4528 * src/menus.[Ch]: ditto
4529 * src/lyx.[Ch]: ditto
4530 * src/lyx_cb.C: ditto + code from here moved to make
4531 screen-font-update. And people wonder why progress on GUII is
4532 slow. Look at how scattered this stuff was! It takes forever
4535 * forms/fdfix.sh: Fixup the spacing after commas.
4536 * forms/makefile: Remove date from generated files. Fewer clashes now.
4537 * forms/bullet_forms.C.patch: included someones handwritten changes
4539 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4540 once I've discovered why LyXRC was made noncopyable.
4541 * src/lyx_main.C: ditto
4543 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4545 * src/frontends/xforms/forms/fdfix.sh:
4546 * src/frontends/xforms/forms/fdfixh.sed:
4547 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4548 * src/frontends/xforms/Form*.[hC]:
4549 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4550 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4551 provide a destructor for the struct FD_form_xxxx. Another version of
4552 the set_[max|min]size workaround and a few other cleanups. Actually,
4553 Angus' patch from 20000809.
4555 2000-08-13 Baruch Even <baruch.even@writeme.com>
4557 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4560 2000-08-11 Juergen Vigna <jug@sad.it>
4562 * src/insets/insetgraphics.C (InsetGraphics): changing init
4563 order because of warnings.
4565 * src/frontends/xforms/forms/makefile: adding patching .C with
4568 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4569 from .C.patch to .c.patch
4571 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4572 order because of warning.
4574 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4576 * src/frontends/Liason.C (setMinibuffer): new helper function
4578 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4580 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4582 * lib/ui/default.ui: commented out PaperLayout entry
4584 * src/frontends/xforms/form_document.[Ch]: new added files
4586 * src/frontends/xforms/FormDocument.[Ch]: ditto
4588 * src/frontends/xforms/forms/form_document.fd: ditto
4590 * src/frontends/xforms/forms/form_document.C.patch: ditto
4592 2000-08-10 Juergen Vigna <jug@sad.it>
4594 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4595 (InsetGraphics): initialized cacheHandle to 0.
4596 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4598 2000-08-10 Baruch Even <baruch.even@writeme.com>
4600 * src/graphics/GraphicsCache.h:
4601 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4602 correctly as a cache.
4604 * src/graphics/GraphicsCacheItem.h:
4605 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4608 * src/graphics/GraphicsCacheItem_pimpl.h:
4609 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4612 * src/insets/insetgraphics.h:
4613 * src/insets/insetgraphics.C: Changed from using a signal notification
4614 to polling when image is not loaded.
4616 2000-08-10 Allan Rae <rae@lyx.org>
4618 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4619 that there are two functions that have to been taken out of line by
4620 hand and aren't taken care of in the script. (Just a reminder note)
4622 * sigc++/macros/*.h.m4: Updated as above.
4624 2000-08-09 Juergen Vigna <jug@sad.it>
4626 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4628 * src/insets/insettabular.C: make drawing of single cell smarter.
4630 2000-08-09 Marko Vendelin <markov@ioc.ee>
4631 * src/frontends/gnome/Menubar_pimpl.C
4632 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4633 implementation: new files
4635 * src/frontends/gnome/mainapp.C
4636 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4639 * src/main.C: create Gnome main window
4641 * src/frontends/xforms/Menubar_pimpl.h
4642 * src/frontends/Menubar.C
4643 * src/frontends/Menubar.h: added method Menubar::update that calls
4644 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4646 * src/LyXView.C: calls Menubar::update to update the state
4649 * src/frontends/gnome/Makefile.am: added new files
4651 * src/frontends/Makefile.am: added frontend compiler options
4653 2000-08-08 Juergen Vigna <jug@sad.it>
4655 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4657 * src/bufferlist.C (close):
4658 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4659 documents if exiting without saving.
4661 * src/buffer.C (save): use removeAutosaveFile()
4663 * src/support/filetools.C (removeAutosaveFile): new function.
4665 * src/lyx_cb.C (MenuWrite): returns a bool now.
4666 (MenuWriteAs): check if file could really be saved and revert to the
4668 (MenuWriteAs): removing old autosavefile if existant.
4670 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4671 before Goto toggle declaration, because of compiler warning.
4673 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4675 * src/lyxfunc.C (MenuNew): small fix.
4677 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4679 * src/bufferlist.C (newFile):
4680 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4682 * src/lyxrc.C: added new_ask_filename tag
4684 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4686 * src/lyx.fd: removed code pertaining to form_ref
4687 * src/lyx.[Ch]: ditto
4688 * src/lyx_cb.C: ditto
4689 * src/lyx_gui.C: ditto
4690 * src/lyx_gui_misc.C: ditto
4692 * src/BufferView_pimpl.C (restorePosition): update buffer only
4695 * src/commandtags.h (LFUN_REFTOGGLE): removed
4696 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4697 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4698 (LFUN_REFBACK): renamed LFUN_REF_BACK
4700 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4701 * src/menus.C: ditto
4702 * src/lyxfunc.C (Dispatch): ditto.
4703 InsertRef dialog is now GUI-independent.
4705 * src/texrow.C: added using std::endl;
4707 * src/insets/insetref.[Ch]: strip out large amounts of code.
4708 The inset is now a container and this functionality is now
4709 managed by a new FormRef dialog
4711 * src/frontends/Dialogs.h (showRef, createRef): new signals
4713 * src/frontends/xforms/FormIndex.[Ch],
4714 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4715 when setting dialog's min/max size
4716 * src/frontends/xforms/FormIndex.[Ch]: ditto
4718 * src/frontends/xforms/FormRef.[Ch],
4719 src/frontends/xforms/forms/form_ref.fd: new xforms
4720 implementation of an InsetRef dialog
4722 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4725 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4726 ios::nocreate is not part of the standard. Removed.
4728 2000-08-07 Baruch Even <baruch.even@writeme.com>
4730 * src/graphics/Renderer.h:
4731 * src/graphics/Renderer.C: Added base class for rendering of different
4732 image formats into Pixmaps.
4734 * src/graphics/XPM_Renderer.h:
4735 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4736 in a different class.
4738 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4739 easily add support for other formats.
4741 * src/insets/figinset.C: plugged a leak of an X resource.
4743 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4745 * src/CutAndPaste.[Ch]: make all metods static.
4747 * development/Code_rules/Rules: more work, added section on
4748 Exceptions, and a References section.
4750 * a lot of header files: work to make doc++ able to generate the
4751 source documentation, some workarounds of doc++ problems. Doc++ is
4752 now able to generate the documentation.
4754 2000-08-07 Juergen Vigna <jug@sad.it>
4756 * src/insets/insettabular.C (recomputeTextInsets): removed function
4758 * src/tabular.C (SetWidthOfMulticolCell):
4760 (calculate_width_of_column_NMC): fixed return value so that it really
4761 only returns true if the column-width has changed (there where
4762 problems with muliticolumn-cells in this column).
4764 2000-08-04 Juergen Vigna <jug@sad.it>
4766 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4767 also on the scrollstatus of the inset.
4768 (workAreaMotionNotify): ditto.
4770 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4772 2000-08-01 Juergen Vigna <jug@sad.it>
4774 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4776 * src/commandtags.h:
4777 * src/LyXAction.C (init):
4778 * src/insets/inset.C (LocalDispatch): added support for
4781 * src/insets/inset.C (scroll): new functions.
4783 * src/insets/insettext.C (removeNewlines): new function.
4784 (SetAutoBreakRows): removes forced newlines in the text of the
4785 paragraph if autoBreakRows is set to false.
4787 * src/tabular.C (Latex): generates a parbox around the cell contents
4790 * src/frontends/xforms/FormTabular.C (local_update): removed
4791 the radio_useparbox button.
4793 * src/tabular.C (UseParbox): new function
4795 2000-08-06 Baruch Even <baruch.even@writeme.com>
4797 * src/graphics/GraphicsCache.h:
4798 * src/graphics/GraphicsCache.C:
4799 * src/graphics/GraphicsCacheItem.h:
4800 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4803 * src/insets/insetgraphics.h:
4804 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4805 and the drawing of the inline image.
4807 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4808 loaded into the wrong position.
4810 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4813 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4815 * src/support/translator.h: move all typedefs to public section
4817 * src/support/filetools.C (MakeLatexName): return string const
4819 (TmpFileName): ditto
4820 (FileOpenSearch): ditto
4822 (LibFileSearch): ditto
4823 (i18nLibFileSearch): ditto
4826 (CreateTmpDir): ditto
4827 (CreateBufferTmpDir): ditto
4828 (CreateLyXTmpDir): ditto
4831 (MakeAbsPath): ditto
4833 (OnlyFilename): ditto
4835 (NormalizePath): ditto
4836 (CleanupPath): ditto
4837 (GetFileContents): ditto
4838 (ReplaceEnvironmentPath): ditto
4839 (MakeRelPath): ditto
4841 (ChangeExtension): ditto
4842 (MakeDisplayPath): ditto
4843 (do_popen): return cmdret const
4844 (findtexfile): return string const
4846 * src/support/DebugStream.h: add some /// to please doc++
4848 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4850 * src/texrow.C (same_rownumber): functor to use with find_if
4851 (getIdFromRow): rewritten to use find_if and to not update the
4852 positions. return true if row is found
4853 (increasePos): new method, use to update positions
4855 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4857 * src/lyxlex_pimpl.C (verifyTable): new method
4860 (GetString): return string const
4861 (pushTable): rewrite to use std::stack
4863 (setFile): better check
4866 * src/lyxlex.h: make LyXLex noncopyable
4868 * src/lyxlex.C (text): return char const * const
4869 (GetString): return string const
4870 (getLongString): return string const
4872 * src/lyx_gui_misc.C (askForText): return pair<...> const
4874 * src/lastfiles.[Ch] (operator): return string const
4876 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4877 istringstream not char const *.
4878 move token.end() out of loop.
4879 (readFile): move initializaton of token
4881 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4882 getIdFromRow is successful.
4884 * lib/bind/emacs.bind: don't include menus bind
4886 * development/Code_rules/Rules: the beginnings of making this
4887 better and covering more of the unwritten rules that we have.
4889 * development/Code_rules/Recommendations: a couple of wording
4892 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4894 * src/support/strerror.c: remove C++ comment.
4896 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4898 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4899 LFUN_INDEX_INSERT_LAST
4901 * src/texrow.C (getIdFromRow): changed from const_iterator to
4902 iterator, allowing code to compile with DEC cxx
4904 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4905 stores part of the class, as suggested by Allan. Will allow
4907 (apply): test to apply uses InsetCommandParams operator!=
4909 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4910 (apply): test to apply uses InsetCommandParams operator!=
4912 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4913 stores part of the class.
4914 (update): removed limits on min/max size.
4916 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4917 (apply): test to apply uses InsetCommandParams operator!=
4919 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4920 (Read, Write, scanCommand, getCommand): moved functionality
4921 into InsetCommandParams.
4923 (getScreenLabel): made pure virtual
4924 new InsetCommandParams operators== and !=
4926 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4927 c-tors based on InsetCommandParams. Removed others.
4928 * src/insets/insetinclude.[Ch]: ditto
4929 * src/insets/insetlabel.[Ch]: ditto
4930 * src/insets/insetparent.[Ch]: ditto
4931 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4933 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4934 insets derived from InsetCommand created using similar c-tors
4935 based on InsetCommandParams
4936 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4937 * src/menus.C (ShowRefsMenu): ditto
4938 * src/paragraph.C (Clone): ditto
4939 * src/text2.C (SetCounter): ditto
4940 * src/lyxfunc.C (Dispatch) ditto
4941 Also recreated old InsetIndex behaviour exactly. Can now
4942 index-insert at the start of a paragraph and index-insert-last
4943 without launching the pop-up.
4945 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4947 * lib/lyxrc.example: mark te pdf options as non functional.
4949 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4950 (isStrDbl): move tmpstr.end() out of loop.
4951 (strToDbl): move intialization of tmpstr
4952 (lowercase): return string const and move tmp.end() out of loop.
4953 (uppercase): return string const and move tmp.edn() out of loop.
4954 (prefixIs): add assertion
4959 (containsOnly): ditto
4960 (containsOnly): ditto
4961 (containsOnly): ditto
4962 (countChar): make last arg char not char const
4963 (token): return string const
4964 (subst): return string const, move tmp.end() out of loop.
4965 (subst): return string const, add assertion
4966 (strip): return string const
4967 (frontStrip): return string const, add assertion
4968 (frontStrip): return string const
4973 * src/support/lstrings.C: add inclde "LAssert.h"
4974 (isStrInt): move tmpstr.end() out of loop.
4976 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4977 toollist.end() out of loop.
4978 (deactivate): move toollist.end() out of loop.
4979 (update): move toollist.end() out of loop.
4980 (updateLayoutList): move tc.end() out of loop.
4981 (add): move toollist.end() out of loop.
4983 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4984 md.end() out of loop.
4986 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4988 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4991 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4992 (Erase): move insetlist.end() out of loop.
4994 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4995 ref to const string as first arg. Move initialization of some
4996 variables, whitespace changes.
4998 * src/kbmap.C (defkey): move table.end() out of loop.
4999 (kb_keymap): move table.end() out of loop.
5000 (findbinding): move table.end() out of loop.
5002 * src/MenuBackend.C (hasMenu): move end() out of loop.
5003 (getMenu): move end() out of loop.
5004 (getMenu): move menulist_.end() out of loop.
5006 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5008 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5011 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5012 (getFromLyXName): move infotab.end() out of loop.
5014 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5015 -fvtable-thunks -ffunction-sections -fdata-sections
5017 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5019 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5022 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5024 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5026 * src/frontends/xforms/FormCitation.[Ch],
5027 src/frontends/xforms/FormIndex.[Ch],
5028 src/frontends/xforms/FormToc.[Ch],
5029 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5031 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5033 * src/commandtags.h: renamed, created some flags for citation
5036 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5038 * src/lyxfunc.C (dispatch): use signals to insert index entry
5040 * src/frontends/Dialogs.h: new signal createIndex
5042 * src/frontends/xforms/FormCommand.[Ch],
5043 src/frontends/xforms/FormCitation.[Ch],
5044 src/frontends/xforms/FormToc.[Ch],
5045 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5047 * src/insets/insetindex.[Ch]: GUI-independent
5049 * src/frontends/xforms/FormIndex.[Ch],
5050 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5053 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5055 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5056 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5058 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5060 * src/insets/insetref.C (Latex): rewrite so that there is now
5061 question that a initialization is requested.
5063 * src/insets/insetcommand.h: reenable the hide signal
5065 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5067 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5068 fix handling of shortcuts (many bugs :)
5069 (add_lastfiles): ditto.
5071 * lib/ui/default.ui: fix a few shortcuts.
5073 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5075 * Makefile.am: Fix ``rpmdist'' target to return the exit
5076 status of the ``rpm'' command, instead of the last command in
5077 the chain (the ``rm lyx.xpm'' command, which always returns
5080 2000-08-02 Allan Rae <rae@lyx.org>
5082 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5083 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5084 * src/frontends/xforms/FormToc.C (FormToc): ditto
5086 * src/frontends/xforms/Makefile.am: A few forgotten files
5088 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5089 Signals-not-copyable-problem Lars' started commenting out.
5091 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5093 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5095 * src/insets/insetcommand.h: Signals is not copyable so anoter
5096 scheme for automatic hiding of forms must be used.
5098 * src/frontends/xforms/FormCitation.h: don't inerit from
5099 noncopyable, FormCommand already does that.
5100 * src/frontends/xforms/FormToc.h: ditto
5101 * src/frontends/xforms/FormUrl.h: ditto
5103 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5105 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5107 * src/insets/insetcommand.h (hide): new SigC::Signal0
5108 (d-tor) new virtual destructor emits hide signal
5110 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5111 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5113 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5114 LOF and LOT. Inset is now GUI-independent
5116 * src/insets/insetloa.[Ch]: redundant
5117 * src/insets/insetlof.[Ch]: ditto
5118 * src/insets/insetlot.[Ch]: ditto
5120 * src/frontends/xforms/forms/form_url.fd: tweaked!
5121 * src/frontends/xforms/forms/form_citation.fd: ditto
5123 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5124 dialogs dealing with InsetCommand insets
5126 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5127 FormCommand base class
5128 * src/frontends/xforms/FormUrl.[Ch]: ditto
5130 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5132 * src/frontends/xforms/FormToc.[Ch]: ditto
5134 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5135 passed a generic InsetCommand pointer
5136 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5138 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5139 and modified InsetTOC class
5140 * src/buffer.C: ditto
5142 * forms/lyx.fd: strip out old FD_form_toc code
5143 * src/lyx_gui_misc.C: ditto
5144 * src/lyx_gui.C: ditto
5145 * src/lyx_cb.C: ditto
5146 * src/lyx.[Ch]: ditto
5148 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5150 * src/support/utility.hpp: tr -d '\r'
5152 2000-08-01 Juergen Vigna <jug@sad.it>
5154 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5156 * src/commandtags.h:
5157 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5158 LFUN_TABULAR_FEATURES.
5160 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5161 LFUN_LAYOUT_TABULAR.
5163 * src/insets/insettabular.C (getStatus): implemented helper function.
5165 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5167 2000-07-31 Juergen Vigna <jug@sad.it>
5169 * src/text.C (draw): fixed screen update problem for text-insets.
5171 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5172 something changed probably this has to be added in various other
5175 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5177 2000-07-31 Baruch Even <baruch.even@writeme.com>
5179 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5180 templates to satisfy compaq cxx.
5183 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5185 * src/support/translator.h (equal_1st_in_pair::operator()): take
5186 const ref pair_type as arg.
5187 (equal_2nd_in_pair::operator()): ditto
5188 (Translator::~Translator): remove empty d-tor.
5190 * src/graphics/GraphicsCache.C: move include config.h to top, also
5191 put initialization of GraphicsCache::singleton here.
5192 (~GraphicsCache): move here
5193 (addFile): take const ref as arg
5196 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5198 * src/BufferView2.C (insertLyXFile): change te with/without header
5201 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5203 * src/frontends/xforms/FormGraphics.C (apply): add some
5204 static_cast. Not very nice, but required by compaq cxx.
5206 * src/frontends/xforms/RadioButtonGroup.h: include header
5207 <utility> instead of <pair.h>
5209 * src/insets/insetgraphicsParams.C: add using directive.
5210 (readResize): change return type to void.
5211 (readOrigin): ditto.
5213 * src/lyxfunc.C (getStatus): add missing break for build-program
5214 function; add test for Literate for export functions.
5216 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5217 entries in Options menu.
5219 2000-07-31 Baruch Even <baruch.even@writeme.com>
5221 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5222 protect against auto-allocation; release icon when needed.
5224 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5226 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5227 on usual typewriter.
5229 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5230 earlier czech.kmap), useful only for programming.
5232 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5234 * src/frontends/xforms/FormCitation.h: fix conditioning around
5237 2000-07-31 Juergen Vigna <jug@sad.it>
5239 * src/frontends/xforms/FormTabular.C (local_update): changed
5240 radio_linebreaks to radio_useparbox and added radio_useminipage.
5242 * src/tabular.C: made support for using minipages/parboxes.
5244 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5246 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5248 (descent): so the cursor is in the middle.
5249 (width): bit smaller box.
5251 * src/insets/insetgraphics.h: added display() function.
5253 2000-07-31 Baruch Even <baruch.even@writeme.com>
5255 * src/frontends/Dialogs.h: Added showGraphics signals.
5257 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5258 xforms form definition of the graphics dialog.
5260 * src/frontends/xforms/FormGraphics.h:
5261 * src/frontends/xforms/FormGraphics.C: Added files, the
5262 GUIndependent code of InsetGraphics
5264 * src/insets/insetgraphics.h:
5265 * src/insets/insetgraphics.C: Major writing to make it work.
5267 * src/insets/insetgraphicsParams.h:
5268 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5269 struct between InsetGraphics and GUI.
5271 * src/LaTeXFeatures.h:
5272 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5273 support for graphicx package.
5275 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5276 for the graphics inset.
5278 * src/support/translator.h: Added file, used in
5279 InsetGraphicsParams. this is a template to translate between two
5282 * src/frontends/xforms/RadioButtonGroup.h:
5283 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5284 way to easily control a radio button group.
5286 2000-07-28 Juergen Vigna <jug@sad.it>
5288 * src/insets/insettabular.C (LocalDispatch):
5289 (TabularFeatures): added support for lyx-functions of tabular features.
5290 (cellstart): refixed this function after someone wrongly changed it.
5292 * src/commandtags.h:
5293 * src/LyXAction.C (init): added support for tabular-features
5295 2000-07-28 Allan Rae <rae@lyx.org>
5297 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5298 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5299 triggers the callback for input checking. As a result we sometimes get
5300 "LyX: This shouldn't happen..." printed to cerr.
5301 (input): Started using status variable since I only free() on
5302 destruction. Some input checking for paths and font sizes.
5304 * src/frontends/xforms/FormPreferences.h: Use status to control
5305 activation of Ok and Apply
5307 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5308 callback. Also resized to stop segfaults with 0.88. The problem is
5309 that xforms-0.88 requires the folder to be wide enough to fit all the
5310 tabs. If it isn't it causes all sorts of problems.
5312 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5314 * src/frontends/xforms/forms/README: Reflect reality.
5316 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5317 * src/frontends/xforms/forms/makefile: ditto.
5319 * src/commandtags.h: Get access to new Preferences dialog
5320 * src/LyXAction.C: ditto
5321 * src/lyxfunc.C: ditto
5322 * lib/ui/default.ui: ditto
5324 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5326 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5328 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5331 * src/frontends/xforms/form_url.[Ch]: added.
5333 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5335 * src/insets/insetbib.h: fixed bug in previous commit
5337 * src/frontends/xforms/FormUrl.h: ditto
5339 * src/frontends/xforms/FormPrint.h: ditto
5341 * src/frontends/xforms/FormPreferences.h: ditto
5343 * src/frontends/xforms/FormCopyright.h: ditto
5345 * src/frontends/xforms/FormCitation.C: ditto
5347 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5348 private copyconstructor and private default contructor
5350 * src/support/Makefile.am: add utility.hpp
5352 * src/support/utility.hpp: new file from boost
5354 * src/insets/insetbib.h: set owner in clone
5356 * src/frontends/xforms/FormCitation.C: added missing include
5359 * src/insets/form_url.[Ch]: removed
5361 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5363 * development/lyx.spec.in
5364 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5365 file/directory re-organization.
5367 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5369 * src/insets/insetcommand.[Ch]: moved the string data and
5370 associated manipulation methods into a new stand-alone class
5371 InsetCommandParams. This class has two additional methods
5372 getAsString() and setFromString() allowing the contents to be
5373 moved around as a single string.
5374 (addContents) method removed.
5375 (setContents) method no longer virtual.
5377 * src/buffer.C (readInset): made use of new InsetCitation,
5378 InsetUrl constructors based on InsetCommandParams.
5380 * src/commandtags.h: add LFUN_INSERT_URL
5382 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5383 independent InsetUrl and use InsetCommandParams to extract
5384 string info and create new Insets.
5386 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5388 * src/frontends/xforms/FormCitation.C (apply): uses
5391 * src/frontends/xforms/form_url.C
5392 * src/frontends/xforms/form_url.h
5393 * src/frontends/xforms/FormUrl.h
5394 * src/frontends/xforms/FormUrl.C
5395 * src/frontends/xforms/forms/form_url.fd: new files
5397 * src/insets/insetcite.[Ch]: removed unused constructors.
5399 * src/insets/insetinclude.[Ch]: no longer store filename
5401 * src/insets/inseturl.[Ch]: GUI-independent.
5403 2000-07-26 Juergen Vigna <jug@sad.it>
5404 * renamed frontend from gtk to gnome as it is that what is realized
5405 and did the necessary changes in the files.
5407 2000-07-26 Marko Vendelin <markov@ioc.ee>
5409 * configure.in: cleaning up gnome configuration scripts
5411 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5413 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5414 shortcuts syndrom by redrawing them explicitely (a better solution
5415 would be appreciated).
5417 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5419 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5422 * src/lyx_cb.C (MenuExport): change html export to do the right
5423 thing depending of the document type (instead of having
5424 html-linuxdoc and html-docbook).
5425 * src/lyxfunc.C (getStatus): update for html
5426 * lib/ui/default.ui: simplify due to the above change.
5427 * src/menus.C (ShowFileMenu): update too (in case we need it).
5429 * src/MenuBackend.C (read): if a menu is defined twice, add the
5430 new entries to the exiting one.
5432 2000-07-26 Juergen Vigna <jug@sad.it>
5434 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5436 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5437 and return a bool if it did actual save the file.
5438 (AutoSave): don't autosave a unnamed doc.
5440 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5441 check if this is an UNNAMED new file and react to it.
5442 (newFile): set buffer to unnamed and change to not mark a new
5443 buffer dirty if I didn't do anything with it.
5445 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5447 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5449 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5450 friend as per Angus's patch posted to lyx-devel.
5452 * src/ext_l10n.h: updated
5454 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5455 gettext on the style string right before inserting them into the
5458 * autogen.sh: add code to extract style strings form layout files,
5459 not good enough yet.
5461 * src/frontends/gtk/.cvsignore: add MAKEFILE
5463 * src/MenuBackend.C (read): run the label strings through gettext
5464 before storing them in the containers.
5466 * src/ext_l10n.h: new file
5468 * autogen.sh : generate the ext_l10n.h file here
5470 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5472 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5475 * lib/ui/default.ui: fix a couple of typos.
5477 * config/gnome/gtk.m4: added (and added to the list of files in
5480 * src/insets/insetinclude.C (unique_id): fix when we are using
5481 lyxstring instead of basic_string<>.
5482 * src/insets/insettext.C (LocalDispatch): ditto.
5483 * src/support/filetools.C: ditto.
5485 * lib/configure.m4: create the ui/ directory if necessary.
5487 * src/LyXView.[Ch] (updateToolbar): new method.
5489 * src/BufferView_pimpl.C (buffer): update the toolbar when
5490 opening/closing buffer.
5492 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5494 * src/LyXAction.C (getActionName): enhance to return also the name
5495 and options of pseudo-actions.
5496 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5498 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5499 as an example of what is possible). Used in File->Build too (more
5500 useful) and in the import/export menus (to mimick the complicated
5501 handling of linuxdoc and friends). Try to update all the entries.
5503 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5506 * src/MenuBackend.C (read): Parse the new OptItem tag.
5508 * src/MenuBackend.h: Add a new optional_ data member (used if the
5509 entry should be omitted when the lyxfunc is disabled).
5511 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5512 function, used as a shortcut.
5513 (create_submenu): align correctly the shortcuts on the widest
5516 * src/MenuBackend.h: MenuItem.label() only returns the label of
5517 the menu without shortcut; new method shortcut().
5519 2000-07-14 Marko Vendelin <markov@ioc.ee>
5521 * src/frontends/gtk/Dialogs.C:
5522 * src/frontends/gtk/FormCopyright.C:
5523 * src/frontends/gtk/FormCopyright.h:
5524 * src/frontends/gtk/Makefile.am: added these source-files for the
5525 Gtk/Gnome support of the Copyright-Dialog.
5527 * src/main.C: added Gnome::Main initialization if using
5528 Gtk/Gnome frontend-GUI.
5530 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5532 * config/gnome/aclocal-include.m4
5533 * config/gnome/compiler-flags.m4
5534 * config/gnome/curses.m4
5535 * config/gnome/gnome--.m4
5536 * config/gnome/gnome-bonobo-check.m4
5537 * config/gnome/gnome-common.m4
5538 * config/gnome/gnome-fileutils.m4
5539 * config/gnome/gnome-ghttp-check.m4
5540 * config/gnome/gnome-gnorba-check.m4
5541 * config/gnome/gnome-guile-checks.m4
5542 * config/gnome/gnome-libgtop-check.m4
5543 * config/gnome/gnome-objc-checks.m4
5544 * config/gnome/gnome-orbit-check.m4
5545 * config/gnome/gnome-print-check.m4
5546 * config/gnome/gnome-pthread-check.m4
5547 * config/gnome/gnome-support.m4
5548 * config/gnome/gnome-undelfs.m4
5549 * config/gnome/gnome-vfs.m4
5550 * config/gnome/gnome-x-checks.m4
5551 * config/gnome/gnome-xml-check.m4
5552 * config/gnome/gnome.m4
5553 * config/gnome/gperf-check.m4
5554 * config/gnome/gtk--.m4
5555 * config/gnome/linger.m4
5556 * config/gnome/need-declaration.m4: added configuration scripts
5557 for Gtk/Gnome frontend-GUI
5559 * configure.in: added support for the --with-frontend=gtk option
5561 * autogen.sh: added config/gnome/* to list of config-files
5563 * acconfig.h: added define for GTKGUI-support
5565 * config/lyxinclude.m4: added --with-frontend[=value] option value
5566 for Gtk/Gnome frontend-GUI support.
5568 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5570 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5574 * src/paragraph.C (GetChar): remove non-const version
5576 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5577 (search_kw): use it.
5579 * src/lyx_main.C (init): if "preferences" exist, read that instead
5581 (ReadRcFile): return bool if the file could be read ok.
5582 (ReadUIFile): add a check to see if lex file is set ok.
5584 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5585 bastring can be used instead of lyxstring (still uses the old code
5586 if std::string is good enough or if lyxstring is used.)
5588 * src/encoding.C: make the arrays static, move ininle functions
5590 * src/encoding.h: from here.
5592 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5593 (parseSingleLyXformat2Token): move inset parsing to separate method
5594 (readInset): new private method
5596 * src/Variables.h: remove virtual from get().
5598 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5599 access to NEW_INSETS and NEW_TABULAR
5601 * src/MenuBackend.h: remove superfluous forward declaration of
5602 MenuItem. Add documentations tags "///", remove empty MenuItem
5603 destructor, remove private default contructor.
5605 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5607 (read): more string mlabel and mname to where they are used
5608 (read): remove unused variables mlabel and mname
5609 (defaults): unconditional clear, make menusetup take advantage of
5610 add returning Menu &.
5612 * src/LyXView.h: define NEW_MENUBAR as default
5614 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5615 to NEW_INSETS and NEW_TABULAR.
5616 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5617 defined. Change some of the "xxxx-inset-insert" functions names to
5620 * several files: more enahncements to NEW_INSETS and the resulting
5623 * lib/lyxrc.example (\date_insert_format): move to misc section
5625 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5626 bastring and use AC_CACHE_CHECK.
5627 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5628 the system have the newest methods. uses AC_CACHE_CHECK
5629 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5630 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5631 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5633 * configure.in: add LYX_CXX_GOOD_STD_STRING
5635 * acinclude.m4: recreated
5637 2000-07-24 Amir Karger <karger@lyx.org>
5639 * README: add Hebrew, Arabic kmaps
5642 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5644 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5647 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5649 * Lot of files: add pragma interface/implementation.
5651 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5653 * lib/ui/default.ui: new file (ans new directory). Contains the
5654 default menu and toolbar.
5656 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5657 global space. Toolbars are now read (as menus) in ui files.
5659 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5661 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5662 is disabled because the document is read-only. We want to have the
5663 toggle state of the function anyway.
5664 (getStatus): add code for LFUN_VC* functions (mimicking what is
5665 done in old-style menus)
5667 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5668 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5670 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5671 * src/BufferView_pimpl.C: ditto.
5672 * src/lyxfunc.C: ditto.
5674 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5675 default). This replaces old-style menus by new ones.
5677 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5678 MenuItem. Contain the data structure of a menu.
5680 * src/insets/insettext.C: use LyXView::setLayout instead of
5681 accessing directly the toolbar combox.
5682 * src/lyxfunc.C (Dispatch): ditto.
5684 * src/LyXView.C (setLayout): new method, which just calls
5685 Toolbar::setLayout().
5686 (updateLayoutChoice): move part of this method in Toolbar.
5688 * src/toolbar.[Ch]: removed.
5690 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5691 implementation the toolbar.
5693 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5694 the toolbar. It might make sense to merge it with ToolbarDefaults
5696 (setLayout): new function.
5697 (updateLayoutList): ditto.
5698 (openLayoutList): ditto.
5700 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5701 xforms implementation of the toolbar.
5702 (get_toolbar_func): comment out, since I do not
5703 know what it is good for.
5705 * src/ToolbarDefaults.h: Add the ItemType enum.
5707 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5708 for a list of allocated C strings. Used in Menubar xforms
5709 implementation to avoid memory leaks.
5711 * src/support/lstrings.[Ch] (uppercase): new version taking and
5715 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5716 * lib/bind/emacs.bind: ditto.
5718 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5720 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5721 forward decl of LyXView.
5723 * src/toolbar.C (toolbarItem): moved from toolbar.h
5724 (toolbarItem::clean): ditto
5725 (toolbarItem::~toolbarItem): ditto
5726 (toolbarItem::operator): ditto
5728 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5730 * src/paragraph.h: control the NEW_TABULAR define from here
5732 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5733 USE_TABULAR_INSETS to NEW_TABULAR
5735 * src/ToolbarDefaults.C: add include "lyxlex.h"
5737 * files using the old table/tabular: use NEW_TABULAR to control
5738 compilation of old tabular stuff.
5740 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5743 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5744 planemet in reading of old style floats, fix the \end_deeper
5745 problem when reading old style floats.
5747 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5749 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5751 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5753 * lib/bind/sciword.bind: updated.
5755 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5757 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5758 layout write problem
5760 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5762 * src/Makefile.am (INCLUDES): remove image directory from include
5765 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5766 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5768 * src/LyXView.C (create_form_form_main): read the application icon
5771 * lib/images/*.xpm: change the icons to use transparent color for
5774 * src/toolbar.C (update): change the color of the button when it
5777 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5779 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5780 setting explicitely the minibuffer.
5781 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5783 * src/LyXView.C (showState): new function. Shows font information
5784 in minibuffer and update toolbar state.
5785 (LyXView): call Toolbar::update after creating the
5788 * src/toolbar.C: change toollist to be a vector instead of a
5790 (BubbleTimerCB): get help string directly from the callback
5791 argument of the corresponding icon (which is the action)
5792 (set): remove unnecessary ugliness.
5793 (update): new function. update the icons (depressed, disabled)
5794 depending of the status of the corresponding action.
5796 * src/toolbar.h: remove help in toolbarItem
5798 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5800 * src/Painter.C (text): Added code for using symbol glyphs from
5801 iso10646 fonts. Currently diabled.
5803 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5806 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5807 magyar,turkish and usorbian.
5809 * src/paragraph.C (isMultiLingual): Made more efficient.
5811 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5814 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5815 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5816 Also changed the prototype to "bool math_insert_greek(char)".
5818 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5820 * lots of files: apply the NEW_INSETS on all code that will not be
5821 needed when we move to use the new insets. Enable the define in
5822 lyxparagrah.h to try it.
5824 * src/insets/insettabular.C (cellstart): change to be a static
5826 (InsetTabular): initialize buffer in the initializer list.
5828 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5830 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5831 form_print.h out of the header file. Replaced with forward
5832 declarations of the relevant struct.
5834 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5837 * src/commandtags.h: do not include "debug.h" which does not
5838 belong there. #include it in some other places because of this
5841 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5843 * src/insets/insetcaption.C: add a couple "using" directives.
5845 * src/toolbar.C (add): get the help text directly from lyxaction.
5847 (setPixmap): new function. Loads from disk and sets a pixmap on a
5848 botton; the name of the pixmap file is derived from the command
5851 * src/toolbar.h: remove members isBitmap and pixmap from
5854 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5855 * lib/images/: move many files from images/banner.xpm.
5857 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5859 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5860 * src/toolbar.C: ditto.
5861 * configure.in: ditto.
5862 * INSTALL: document.
5864 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5865 the spellchecker popup is closed from the WM.
5867 2000-07-19 Juergen Vigna <jug@sad.it>
5869 * src/insets/insetfloat.C (Write): small fix because we use the
5870 insetname for the type now!
5872 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5874 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5877 * src/frontends/Dialogs.h: removed hideCitation signal
5879 * src/insets/insetcite.h: added hide signal
5881 * src/insets/insetcite.C (~InsetCitation): emits new signal
5882 (getScreenLabel): "intelligent" label should now fit on the screen!
5884 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5886 * src/frontends/xforms/FormCitation.C (showInset): connects
5887 hide() to the inset's hide signal
5888 (show): modified to use fl_set_object_position rather than
5889 fl_set_object_geometry wherever possible
5891 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5893 * src/insets/lyxinset.h: add caption code
5895 * src/insets/insetfloat.C (type): new method
5897 * src/insets/insetcaption.C (Write): new method
5899 (LyxCode): new method
5901 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5902 to get it right together with using the FloatList.
5904 * src/commandtags.h: add LFUN_INSET_CAPTION
5905 * src/lyxfunc.C (Dispatch): handle it
5907 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5910 * src/Variables.[Ch]: make expand take a const reference, remove
5911 the destructor, some whitespace changes.
5913 * src/LyXAction.C (init): add caption-inset-insert
5915 * src/FloatList.C (FloatList): update the default floats a bit.
5917 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5919 * src/Variables.[Ch]: new files. Intended to be used for language
5920 specific strings (like \chaptername) and filename substitution in
5923 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5925 * lib/kbd/american.kmap: update
5927 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5929 * src/bufferparams.[Ch]: remove member allowAccents.
5931 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5933 * src/LaTeXLog.C: use the log_form.h header.
5934 * src/lyx_gui.C: ditto.
5935 * src/lyx_gui_misc.C: ditto.
5936 * src/lyxvc.h: ditto.
5938 * forms/log_form.fd: new file, created from latexoptions.fd. I
5939 kept the log popup and nuked the options form.
5941 * src/{la,}texoptions.[Ch]: removed.
5942 * src/lyx_cb.C (LaTeXOptions): ditto
5944 * src/lyx_gui.C (create_forms): do not handle the
5945 fd_latex_options form.
5947 2000-07-18 Juergen Vigna <jug@sad.it>
5949 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5950 name of the inset so that it can be requested outside (text2.C).
5952 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5955 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5957 * src/mathed/formula.h (ConvertFont): constify
5959 * src/mathed/formula.C (Read): add warning if \end_inset is not
5960 found on expected place.
5962 * src/insets/lyxinset.h (ConvertFont): consify
5964 * src/insets/insetquotes.C (ConvertFont): constify
5965 * src/insets/insetquotes.h: ditto
5967 * src/insets/insetinfo.h: add labelfont
5969 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5970 (ascent): use labelfont
5974 (Write): make .lyx file a bit nicer
5976 * src/insets/insetfloat.C (Write): simplify somewhat...
5977 (Read): add warning if arg is not found
5979 * src/insets/insetcollapsable.C: add using std::max
5980 (Read): move string token and add warning in arg is not found
5981 (draw): use std::max to get the right ty
5982 (getMaxWidth): simplify by using std::max
5984 * src/insets/insetsection.h: new file
5985 * src/insets/insetsection.C: new file
5986 * src/insets/insetcaption.h: new file
5987 * src/insets/insetcaption.C: new file
5989 * src/insets/inset.C (ConvertFont): constify signature
5991 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5992 insetcaption.[Ch] and insetsection.[Ch]
5994 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5995 uses to use LABEL_COUNTER_CHAPTER instead.
5996 * src/text2.C (SetCounter): here
5998 * src/counters.h: new file
5999 * src/counters.C: new file
6000 * src/Sectioning.h: new file
6001 * src/Sectioning.C: new file
6003 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6005 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6007 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6010 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6013 2000-07-17 Juergen Vigna <jug@sad.it>
6015 * src/tabular.C (Validate): check if array-package is needed.
6016 (SetVAlignment): added support for vertical alignment.
6017 (SetLTFoot): better support for longtable header/footers
6018 (Latex): modified to support added features.
6020 * src/LaTeXFeatures.[Ch]: added array-package.
6022 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6024 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6027 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6029 * configure.in: do not forget to put a space after -isystem.
6031 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6033 * lib/kbd/arabic.kmap: a few fixes.
6035 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6037 * some whitespace chagnes to a number of files.
6039 * src/support/DebugStream.h: change to make it easier for
6040 doc++ to parse correctly.
6041 * src/support/lyxstring.h: ditto
6043 * src/mathed/math_utils.C (compara): change to have only one
6045 (MathedLookupBOP): change because of the above.
6047 * src/mathed/math_delim.C (math_deco_compare): change to have only
6049 (search_deco): change becasue of the above.
6051 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6052 instead of manually coded one.
6054 * src/insets/insetquotes.C (Read): read the \end_inset too
6056 * src/insets/insetlatex.h: remove file
6057 * src/insets/insetlatex.C: remove file
6059 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6061 (InsetPrintIndex): remove destructor
6063 * src/insets/insetinclude.h: remove default constructor
6065 * src/insets/insetfloat.C: work to make it work better
6067 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6069 * src/insets/insetcite.h (InsetCitation): remove default constructor
6071 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6073 * src/text.C (GetColumnNearX): comment out some currently unused code.
6075 * src/paragraph.C (writeFile): move some initializations closer to
6077 (CutIntoMinibuffer): small change to use new matchIT operator
6081 (InsertInset): ditto
6084 (InsetIterator): ditto
6085 (Erase): small change to use new matchFT operator
6087 (GetFontSettings): ditto
6088 (HighestFontInRange): ditto
6091 * src/lyxparagraph.h: some chars changed to value_type
6092 (matchIT): because of some stronger checking (perhaps too strong)
6093 in SGI STL, the two operator() unified to one.
6096 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6098 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6099 the last inset read added
6100 (parseSingleLyXformat2Token): some more (future) compability code added
6101 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6102 (parseSingleLyXformat2Token): set last_inset_read
6103 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6104 (parseSingleLyXformat2Token): don't double intializw string next_token
6106 * src/TextCache.C (text_fits::operator()): add const's to the signature
6107 (has_buffer::operator()): ditto
6109 * src/Floating.h: add some comments on the class
6111 * src/FloatList.[Ch] (typeExist): new method
6114 * src/BackStack.h: added default constructor, wanted by Gcc.
6116 2000-07-14 Juergen Vigna <jug@sad.it>
6118 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6120 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6122 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6123 do a redraw when the window is resized!
6124 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6126 * src/insets/insettext.C (resizeLyXText): added function to correctly
6127 being able to resize the LyXWindow.
6129 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6131 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6133 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6134 crashes when closing dialog to a deleted inset.
6136 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6137 method! Now similar to other insets.
6139 2000-07-13 Juergen Vigna <jug@sad.it>
6141 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6143 * lib/examples/Literate.lyx: small patch!
6145 * src/insets/insetbib.C (Read): added this function because of wrong
6146 Write (without [begin|end]_inset).
6148 2000-07-11 Juergen Vigna <jug@sad.it>
6150 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6151 as the insertInset could not be good!
6153 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6154 the bool param should not be last.
6156 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6158 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6159 did submit that to Karl).
6161 * configure.in: use -isystem instead of -I for X headers. This
6162 fixes a problem on solaris with a recent gcc;
6163 put the front-end code after the X detection code;
6164 configure in sigc++ before lib/
6166 * src/lyx_main.C (commandLineHelp): remove -display from command
6169 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6171 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6172 Also put in Makefile rules for building the ``listerrors''
6173 program for parsing errors from literate programs written in LyX.
6175 * lib/build-listerrors: Added small shell script as part of compile
6176 process. This builds a working ``listerrors'' binary if noweb is
6177 installed and either 1) the VNC X server is installed on the machine,
6178 or 2) the user is compiling from within a GUI. The existence of a GUI
6179 is necessary to use the ``lyx --export'' feature for now. This
6180 hack can be removed once ``lyx --export'' no longer requires a GUI to
6183 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6185 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6186 now passed back correctly from gcc and placed "under" error
6187 buttons in a Literate LyX source.
6189 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6191 * src/text.C (GetColumnNearX): Better behavior when a RTL
6192 paragraph is ended by LTR text.
6194 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6197 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6199 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6200 true when clipboard is empty.
6202 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6204 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6205 row of the paragraph.
6206 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6207 to prevent calculation of bidi tables
6209 2000-07-07 Juergen Vigna <jug@sad.it>
6211 * src/screen.C (ToggleSelection): added y_offset and x_offset
6214 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6217 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6219 * src/insets/insettext.C: fixed Layout-Display!
6221 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6223 * configure.in: add check for strings.h header.
6225 * src/spellchecker.C: include <strings.h> in order to have a
6226 definition for bzero().
6228 2000-07-07 Juergen Vigna <jug@sad.it>
6230 * src/insets/insettext.C (draw): set the status of the bv->text to
6231 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6233 * src/screen.C (DrawOneRow):
6234 (DrawFromTo): redraw the actual row if something has changed in it
6237 * src/text.C (draw): call an update of the toplevel-inset if something
6238 has changed inside while drawing.
6240 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6242 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6244 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6245 processing inside class.
6247 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6248 processing inside class.
6250 * src/insets/insetindex.h new struct Holder, consistent with other
6253 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6254 citation dialog from main code and placed it in src/frontends/xforms.
6255 Dialog launched through signals instead of callbacks
6257 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6259 * lyx.man: update the options description.
6261 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6263 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6264 handle neg values, set min width to 590, add doc about -display
6266 2000-07-05 Juergen Vigna <jug@sad.it>
6268 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6269 calls to BufferView *.
6271 * src/insets/insettext.C (checkAndActivateInset): small fix non
6272 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6274 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6275 their \end_inset token!
6277 2000-07-04 edscott <edscott@imp.mx>
6279 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6280 lib/lyxrc.example: added option \wheel_jump
6282 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6284 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6285 remove support for -width,-height,-xpos and -ypos.
6287 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6289 * src/encoding.[Ch]: New files.
6291 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6292 (text): Call to the underline() method only when needed.
6294 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6296 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6297 encoding(s) for the document.
6299 * src/bufferparams.C (BufferParams): Changed default value of
6302 * src/language.C (newLang): Removed.
6303 (items[]): Added encoding information for all defined languages.
6305 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6306 encoding choice button.
6308 * src/lyxrc.h (font_norm_type): New member variable.
6309 (set_font_norm_type): New method.
6311 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6312 paragraphs with different encodings.
6314 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6315 (TransformChar): Changed to work correctly with Arabic points.
6316 (draw): Added support for drawing Arabic points.
6317 (draw): Removed code for drawing underbars (this is done by
6320 * src/support/textutils.h (IsPrintableNonspace): New function.
6322 * src/BufferView_pimpl.h: Added "using SigC::Object".
6323 * src/LyXView.h: ditto.
6325 * src/insets/insetinclude.h (include_label): Changed to mutable.
6327 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6329 * src/mathed/math_iter.h: remove empty destructor
6331 * src/mathed/math_cursor.h: remove empty destructor
6333 * src/insets/lyxinset.h: add THEOREM_CODE
6335 * src/insets/insettheorem.[Ch]: new files
6337 * src/insets/insetminipage.C: (InsertInset): remove
6339 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6341 (InsertInset): remove
6343 * src/insets/insetlist.C: (InsertList): remove
6345 * src/insets/insetfootlike.[Ch]: new files
6347 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6350 (InsertInset): ditto
6352 * src/insets/insetert.C: remove include Painter.h, reindent
6353 (InsertInset): move to header
6355 * src/insets/insetcollapsable.h: remove explicit from default
6356 contructor, remove empty destructor, add InsertInset
6358 * src/insets/insetcollapsable.C (InsertInset): new func
6360 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6362 * src/vspace.h: add explicit to constructor
6364 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6365 \textcompwordmark, please test this.
6367 * src/lyxrc.C: set ascii_linelen to 65 by default
6369 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6371 * src/commandtags.h: add LFUN_INSET_THEOREM
6373 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6374 (makeLinuxDocFile): remove _some_ of the nice logic
6375 (makeDocBookFile): ditto
6377 * src/Painter.[Ch]: (~Painter): removed
6379 * src/LyXAction.C (init): entry for insettheorem added
6381 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6383 (deplog): code to detect files generated by LaTeX, needs testing
6386 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6388 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6390 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6392 * src/LaTeX.C (deplog): Add a check for files that are going to be
6393 created by the first latex run, part of the project to remove the
6396 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6397 contents to the extension list.
6399 2000-07-04 Juergen Vigna <jug@sad.it>
6401 * src/text.C (NextBreakPoint): added support for needFullRow()
6403 * src/insets/lyxinset.h: added needFullRow()
6405 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6408 * src/insets/insettext.C: lots of changes for update!
6410 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6412 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6414 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6416 * src/insets/insetinclude.C (InsetInclude): fixed
6417 initialization of include_label.
6418 (unique_id): now returns a string.
6420 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6422 * src/LaTeXFeatures.h: new member IncludedFiles, for
6423 a map of key, included file name.
6425 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6426 with the included files for inclusion in SGML preamble,
6427 i. e., linuxdoc and docbook.
6430 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6431 nice (is the generated linuxdoc code to be exported?), that
6432 allows to remove column, and only_body that will be true for
6433 slave documents. Insets are allowed inside SGML font type.
6434 New handling of the SGML preamble for included files.
6435 (makeDocBookFile): the same for docbook.
6437 * src/insets/insetinclude.h:
6438 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6440 (DocBook): new export methods.
6442 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6443 and makeDocBookFile.
6445 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6446 formats to export with command line argument -x.
6448 2000-06-29 Juergen Vigna <jug@sad.it>
6450 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6451 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6453 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6454 region could already been cleared by an inset!
6456 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6458 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6461 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6463 (cursorToggle): remove special handling of lyx focus.
6465 2000-06-28 Juergen Vigna <jug@sad.it>
6467 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6470 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6472 * src/insets/insetindex.C (Edit): add a callback when popup is
6475 * src/insets/insettext.C (LocalDispatch):
6476 * src/insets/insetmarginal.h:
6477 * src/insets/insetlist.h:
6478 * src/insets/insetfoot.h:
6479 * src/insets/insetfloat.h:
6480 * src/insets/insetert.h: add a missing std:: qualifier.
6482 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6484 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6487 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6489 * src/insets/insettext.C (Read): remove tmptok unused variable
6490 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6491 (InsertInset): change for new InsetInset code
6493 * src/insets/insettext.h: add TEXT inline method
6495 * src/insets/insettext.C: remove TEXT macro
6497 * src/insets/insetmarginal.C (Write): new method
6498 (Latex): change output slightly
6500 * src/insets/insetfoot.C (Write): new method
6501 (Latex): change output slightly (don't use endl when no need)
6503 * src/insets/insetert.C (Write): new method
6505 * src/insets/insetcollapsable.h: make button_length, button_top_y
6506 and button_bottm_y protected.
6508 * src/insets/insetcollapsable.C (Write): simplify code by using
6509 tostr. Also do not output the float name, the children class
6510 should to that to get control over own arguments
6512 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6513 src/insets/insetminipage.[Ch]:
6516 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6518 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6520 * src/Makefile.am (lyx_SOURCES): add the new files
6522 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6523 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6524 * src/commandtags.h: ditto
6526 * src/LaTeXFeatures.h: add a std::set of used floattypes
6528 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6530 * src/FloatList.[Ch] src/Floating.h: new files
6532 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6534 * src/lyx_cb.C (TableApplyCB): ditto
6536 * src/text2.C: ditto
6537 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6538 (parseSingleLyXformat2Token): ditto + add code for
6539 backwards compability for old float styles + add code for new insets
6541 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6543 (InsertInset(size_type, Inset *, LyXFont)): new method
6544 (InsetChar(size_type, char)): changed to use the other InsetChar
6545 with a LyXFont(ALL_INHERIT).
6546 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6547 insert the META_INSET.
6549 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6551 * sigc++/thread.h (Threads): from here
6553 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6554 definition out of line
6555 * sigc++/scope.h: from here
6557 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6559 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6560 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6562 * Makefile.am (bindist): new target.
6564 * INSTALL: add instructions for doing a binary distribution.
6566 * development/tools/README.bin.example: update a bit.
6568 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6571 * lib/lyxrc.example: new lyxrc tag \set_color.
6573 * src/lyxfunc.C (Dispatch):
6574 * src/commandtags.h:
6575 * src/LyXAction.C: new lyxfunc "set-color".
6577 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6578 and an x11name given as strings.
6580 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6581 cache when a color is changed.
6583 2000-06-26 Juergen Vigna <jug@sad.it>
6585 * src/lyxrow.C (width): added this functions and variable.
6587 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6590 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6592 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6594 * images/undo_bw.xpm: new icon.
6595 * images/redo_bw.xpm: ditto.
6597 * configure.in (INSTALL_SCRIPT): change value to
6598 ${INSTALL} to avoid failures of install-script target.
6599 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6601 * src/BufferView.h: add a magic "friend" declaration to please
6604 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6606 * forms/cite.fd: modified to allow resizing without messing
6609 * src/insetcite.C: Uses code from cite.fd almost without
6611 User can now resize dialog in the x-direction.
6612 Resizing the dialog in the y-direction is prevented, as the
6613 code does this intelligently already.
6615 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6617 * INSTALL: remove obsolete entry in "problems" section.
6619 * lib/examples/sl_*.lyx: update of the slovenian examples.
6621 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6623 2000-06-23 Juergen Vigna <jug@sad.it>
6625 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6627 * src/buffer.C (resize): delete the LyXText of textinsets.
6629 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6631 * src/insets/lyxinset.h: added another parameter 'cleared' to
6632 the draw() function.
6634 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6635 unlocking inset in inset.
6637 2000-06-22 Juergen Vigna <jug@sad.it>
6639 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6640 of insets and moved first to LyXText.
6642 * src/mathed/formulamacro.[Ch]:
6643 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6645 2000-06-21 Juergen Vigna <jug@sad.it>
6647 * src/text.C (GetVisibleRow): look if I should clear the area or not
6648 using Inset::doClearArea() function.
6650 * src/insets/lyxinset.h: added doClearArea() function and
6651 modified draw(Painter &, ...) to draw(BufferView *, ...)
6653 * src/text2.C (UpdateInset): return bool insted of int
6655 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6657 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6658 combox in the character popup
6660 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6661 BufferParams const & params
6663 2000-06-20 Juergen Vigna <jug@sad.it>
6665 * src/insets/insettext.C (SetParagraphData): set insetowner on
6668 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6670 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6671 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6673 (form_main_): remove
6675 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6676 (create_form_form_main): remove FD_form_main stuff, connect to
6677 autosave_timeout signal
6679 * src/LyXView.[Ch] (getMainForm): remove
6680 (UpdateTimerCB): remove
6681 * src/BufferView_pimpl.h: inherit from SigC::Object
6683 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6684 signal instead of callback
6686 * src/BufferView.[Ch] (cursorToggleCB): remove
6688 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6690 * src/BufferView_pimpl.C: changes because of the one below
6692 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6693 instead of storing a pointer to a LyXText.
6695 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6697 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6699 * src/lyxparagraph.h
6701 * src/paragraph.C: Changed fontlist to a sorted vector.
6703 2000-06-19 Juergen Vigna <jug@sad.it>
6705 * src/BufferView.h: added screen() function.
6707 * src/insets/insettext.C (LocalDispatch): some selection code
6710 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6712 * src/insets/insettext.C (SetParagraphData):
6714 (InsetText): fixes for multiple paragraphs.
6716 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6718 * development/lyx.spec.in: Call configure with ``--without-warnings''
6719 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6720 This should be fine, however, since we generally don't want to be
6721 verbose when making an RPM.
6723 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6725 * lib/scripts/fig2pstex.py: New file
6727 2000-06-16 Juergen Vigna <jug@sad.it>
6729 * src/insets/insettabular.C (UpdateLocal):
6730 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6731 (LocalDispatch): Changed all functions to use LyXText.
6733 2000-06-15 Juergen Vigna <jug@sad.it>
6735 * src/text.C (SetHeightOfRow): call inset::update before requesting
6738 * src/insets/insettext.C (update):
6739 * src/insets/insettabular.C (update): added implementation
6741 * src/insets/lyxinset.h: added update function
6743 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6745 * src/text.C (SelectNextWord): protect against null pointers with
6746 old-style string streams. (fix from Paul Theo Gonciari
6749 * src/cite.[Ch]: remove erroneous files.
6751 * lib/configure.m4: update the list of created directories.
6753 * src/lyxrow.C: include <config.h>
6754 * src/lyxcursor.C: ditto.
6756 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6758 * lib/examples/decimal.lyx: new example file from Mike.
6760 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6761 to find template definitions (from Dekel)
6763 * src/frontends/.cvsignore: add a few things.
6765 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6767 * src/Timeout.C (TimeOut): remove default argument.
6769 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6772 * src/insets/ExternalTemplate.C: add a "using" directive.
6774 * src/lyx_main.h: remove the act_ struct, which seems unused
6777 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6779 * LyX Developers Meeting: All files changed, due to random C++ (by
6780 coincidence) code generator script.
6782 - external inset (cool!)
6783 - initial online editing of preferences
6784 - insettabular breaks insettext(s contents)
6786 - some DocBook fixes
6787 - example files update
6788 - other cool stuff, create a diff and look for yourself.
6790 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6792 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6793 -1 this is a non-line-breaking textinset.
6795 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6796 if there is no width set.
6798 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6800 * Lots of files: Merged the dialogbase branch.
6802 2000-06-09 Allan Rae <rae@lyx.org>
6804 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6805 and the Dispatch methods that used it.
6807 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6808 access to functions formerly kept in Dispatch.
6810 2000-05-19 Allan Rae <rae@lyx.org>
6812 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6813 made to_page and count_copies integers again. from_page remains a
6814 string however because I want to allow entry of a print range like
6815 "1,4,22-25" using this field.
6817 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6818 and printer-params-get. These aren't useful from the minibuffer but
6819 could be used by a script/LyXServer app provided it passes a suitable
6820 auto_mem_buffer. I guess I should take a look at how the LyXServer
6821 works and make it support xtl buffers.
6823 * sigc++/: updated to libsigc++-1.0.1
6825 * src/xtl/: updated to xtl-1.3.pl.11
6827 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6828 those changes done to the files in src/ are actually recreated when
6829 they get regenerated. Please don't ever accept a patch that changes a
6830 dialog unless that patch includes the changes to the corresponding *.fd
6833 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6834 stringOnlyContains, renamed it and generalised it.
6836 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6837 branch. Removed the remaining old form_print code.
6839 2000-04-26 Allan Rae <rae@lyx.org>
6841 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6842 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6844 2000-04-25 Allan Rae <rae@lyx.org>
6846 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6847 against a base of xtl-1.3.pl.4
6849 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6850 filter the Id: entries so they still show the xtl version number
6853 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6854 into the src/xtl code. Patch still pending with José (XTL)
6856 2000-04-24 Allan Rae <rae@lyx.org>
6858 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6859 both more generic and much safer. Use the new template functions.
6860 * src/buffer.[Ch] (Dispatch): ditto.
6862 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6863 and mem buffer more intelligently. Also a little general cleanup.
6866 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6867 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6868 * src/xtl/Makefile.am: ditto.
6869 * src/xtl/.cvsignore: ditto.
6870 * src/Makefile.am: ditto.
6872 * src/PrinterParams.h: Removed the macros member functions. Added a
6873 testInvariant member function. A bit of tidying up and commenting.
6874 Included Angus's idea for fixing operation with egcs-1.1.2.
6876 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6877 cool expansion of XTL's mem_buffer to support automatic memory
6878 management within the buffer itself. Removed the various macros and
6879 replaced them with template functions that use either auto_mem_buffer
6880 or mem_buffer depending on a #define. The mem_buffer support will
6881 disappear as soon as the auto_mem_buffer is confirmed to be good on
6882 other platforms/compilers. That is, it's there so you've got something
6885 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6886 effectively forked XTL. However I expect José will include my code
6887 into the next major release. Also fixed a memory leak.
6888 * src/xtl/text.h: ditto.
6889 * src/xtl/xdr.h: ditto.
6890 * src/xtl/giop.h: ditto.
6892 2000-04-16 Allan Rae <rae@lyx.org>
6894 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6895 by autogen.sh and removed by maintainer-clean anyway.
6896 * .cvsignore, sigc++/.cvsignore: Support the above.
6898 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6900 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6902 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6903 macros, renamed static callback-target member functions to suit new
6904 scheme and made them public.
6905 * src/frontends/xforms/forms/form_print.fd: ditto.
6906 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6908 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6911 * src/xtl/: New directory containing a minimal distribution of XTL.
6912 This is XTL-1.3.pl.4.
6914 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6916 2000-04-15 Allan Rae <rae@lyx.org>
6918 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6920 * sigc++/: Updated to libsigc++-1.0.0
6922 2000-04-14 Allan Rae <rae@lyx.org>
6924 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6925 use the generic ones in future. I'll modify my conversion script.
6927 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6929 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6930 (CloseAllBufferRelatedDialogs): Renamed.
6931 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6933 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6934 of the generic ones. These are the same ones my conversion script
6937 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6938 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6939 * src/buffer.C (Dispatch): ditto
6941 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6942 functions for updating and hiding buffer dependent dialogs.
6943 * src/BufferView.C (buffer): ditto
6944 * src/buffer.C (setReadonly): ditto
6945 * src/lyxfunc.C (CloseBuffer): ditto
6947 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6948 Dialogs.h, and hence all the SigC stuff, into every file that includes
6949 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6951 * src/BufferView2.C: reduce the number of headers included by buffer.h
6953 2000-04-11 Allan Rae <rae@lyx.org>
6955 * src/frontends/xforms/xform_macros.h: A small collection of macros
6956 for building C callbacks.
6958 * src/frontends/xforms/Makefile.am: Added above file.
6960 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6961 scheme again. This time it should work for JMarc. If this is
6962 successful I'll revise my conversion script to automate some of this.
6963 The static member functions in the class also have to be public for
6964 this scheme will work. If the scheme works (it's almost identical to
6965 the way BufferView::cursorToggleCB is handled so it should work) then
6966 FormCopyright and FormPrint will be ready for inclusion into the main
6967 trunk immediately after 1.1.5 is released -- provided we're prepared
6968 for complaints about lame compilers not handling XTL.
6970 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6972 2000-04-07 Allan Rae <rae@lyx.org>
6974 * config/lyxinclude.m4: A bit more tidying up (Angus)
6976 * src/LString.h: JMarc's <string> header fix
6978 * src/PrinterParams.h: Used string for most data to remove some
6979 ugly code in the Print dialog and avoid even uglier code when
6980 appending the ints to a string for output.
6982 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6983 and moved "default:" back to the end of switch statement. Cleaned
6984 up the printing so it uses the right function calls and so the
6985 "print to file" option actually puts the file in the right directory.
6987 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6989 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6990 and Ok+Apply button control into a separate method: input (Angus).
6991 (input) Cleaned it up and improved it to be very thorough now.
6992 (All CB) static_cast used instead of C style cast (Angus). This will
6993 probably change again once we've worked out how to keep gcc-2.8.1 happy
6994 with real C callbacks.
6995 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6996 ignore some of the bool settings and has random numbers instead. Needs
6997 some more investigation. Added other input length checks and checking
6998 of file and printer names.
7000 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7001 would link (Angus). Seems the old code doesn't compile with the pragma
7002 statement either. Separated callback entries from internal methods.
7004 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7006 2000-03-17 Allan Rae <rae@lyx.org>
7008 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7009 need it? Maybe it could go in Dialogs instead? I could make it a
7010 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7011 values to get the bool return value.
7012 (Dispatch): New overloaded method for xtl support.
7014 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7015 extern "C" callback instead of static member functions. Hopefully,
7016 JMarc will be able to compile this. I haven't changed
7017 forms/form_copyright.fd yet. Breaking one of my own rules already.
7019 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7020 because they aren't useful from the minibuffer. Maybe a LyXServer
7021 might want a help message though?
7023 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7025 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7026 xtl which needs both rtti and exceptions.
7028 * src/support/Makefile.am:
7029 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7031 * src/frontends/xforms/input_validators.[ch]: input filters and
7032 validators. These conrol what keys are valid in input boxes.
7033 Use them and write some more. Much better idea than waiting till
7034 after the user has pressed Ok to say that the input fields don't make
7037 * src/frontends/xforms/Makefile.am:
7038 * src/frontends/xforms/forms/form_print.fd:
7039 * src/frontends/xforms/forms/makefile:
7040 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7041 new scheme. Still have to make sure I haven't missed anything from
7042 the current implementation.
7044 * src/Makefile.am, src/PrinterParams.h: New data store.
7046 * other files: Added a couple of copyright notices.
7048 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7050 * src/insets/insetbib.h: move Holder struct in public space.
7052 * src/frontends/include/DialogBase.h: use SigC:: only when
7053 SIGC_CXX_NAMESPACES is defined.
7054 * src/frontends/include/Dialogs.h: ditto.
7056 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7058 * src/frontends/xforms/FormCopyright.[Ch]: do not
7059 mention SigC:: explicitely.
7061 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7063 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7064 deals with testing KDE in main configure.in
7065 * configure.in: ditto.
7067 2000-02-22 Allan Rae <rae@lyx.org>
7069 * Lots of files: Merged from HEAD
7071 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7072 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7074 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7076 * sigc++/: new minidist.
7078 2000-02-14 Allan Rae <rae@lyx.org>
7080 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7082 2000-02-08 Juergen Vigna <jug@sad.it>
7084 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7085 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7087 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7088 for this port and so it is much easier for other people to port
7089 dialogs in a common development environment.
7091 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7092 the QT/KDE implementation.
7094 * src/frontends/kde/Dialogs.C:
7095 * src/frontends/kde/FormCopyright.C:
7096 * src/frontends/kde/FormCopyright.h:
7097 * src/frontends/kde/Makefile.am:
7098 * src/frontends/kde/formcopyrightdialog.C:
7099 * src/frontends/kde/formcopyrightdialog.h:
7100 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7101 for the kde support of the Copyright-Dialog.
7103 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7104 subdir-substitution instead of hardcoded 'xforms' as we now have also
7107 * src/frontends/include/DialogBase.h (Object): just commented the
7108 label after #endif (nasty warning and I don't like warnings ;)
7110 * src/main.C (main): added KApplication initialization if using
7113 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7114 For now only the KDE event-loop is added if frontend==kde.
7116 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7118 * configure.in: added support for the --with-frontend[=value] option
7120 * autogen.sh: added kde.m4 file to list of config-files
7122 * acconfig.h: added define for KDEGUI-support
7124 * config/kde.m4: added configuration functions for KDE-port
7126 * config/lyxinclude.m4: added --with-frontend[=value] option with
7127 support for xforms and KDE.
7129 2000-02-08 Allan Rae <rae@lyx.org>
7131 * all Makefile.am: Fixed up so the make targets dist, distclean,
7132 install and uninstall all work even if builddir != srcdir. Still
7133 have a new sigc++ minidist update to come.
7135 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7137 2000-02-01 Allan Rae <rae@lyx.org>
7139 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7140 Many mods to get builddir != srcdir working.
7142 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7143 for building on NT and so we can do the builddir != srcdir stuff.
7145 2000-01-30 Allan Rae <rae@lyx.org>
7147 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7148 This will stay in "rae" branch. We probably don't really need it in
7149 the main trunk as anyone who wants to help programming it should get
7150 a full library installed also. So they can check both included and
7151 system supplied library compilation.
7153 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7154 Added a 'mini' distribution of libsigc++. If you feel the urge to
7155 change something in these directories - Resist it. If you can't
7156 resist the urge then you should modify the following script and rebuild
7157 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7158 all happen. Still uses a hacked version of libsigc++'s configure.in.
7159 I'm quite happy with the results. I'm not sure the extra work to turn
7160 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7161 worth the trouble and would probably lead to extra maintenance
7163 I haven't tested the following important make targets: install, dist.
7164 Not ready for prime time but very close. Maybe 1.1.5.
7166 * development/tools/makeLyXsigc.sh: A shell script to automatically
7167 generate our mini-dist of libsigc++. It can only be used with a CVS
7168 checkout of libsigc++ not a tarball distribution. It's well commented.
7169 This will end up as part of the libsigc++ distribution so other apps
7170 can easily have an included mini-dist. If someone makes mods to the
7171 sigc++ subpackage without modifying this script to generate those
7172 changes I'll be very upset!
7174 * src/frontends/: Started the gui/system indep structure.
7176 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7177 to access the gui-indep dialogs are in this class. Much improved
7178 design compared to previous revision. Lars, please refrain from
7179 moving this header into src/ like you did with Popups.h last time.
7181 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7183 * src/frontends/xforms/: Started the gui-indep system with a single
7184 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7187 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7188 Here you'll find a very useful makefile and automated fdfix.sh that
7189 makes updating dailogs a no-brainer -- provided you follow the rules
7190 set out in the README. I'm thinking about adding another script to
7191 automatically generate skeleton code for a new dialog given just the
7194 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7195 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7196 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7198 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7200 * src/support/LSubstring.C (operator): simplify
7202 * src/lyxtext.h: removed bparams, use buffer_->params instead
7204 * src/lyxrow.h: make Row a real class, move all variables to
7205 private and use accessors.
7207 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7209 (isRightToLeftPar): ditto
7210 (ChangeLanguage): ditto
7211 (isMultiLingual): ditto
7214 (SimpleTeXOnePar): ditto
7215 (TeXEnvironment): ditto
7216 (GetEndLabel): ditto
7218 (SetOnlyLayout): ditto
7219 (BreakParagraph): ditto
7220 (BreakParagraphConservative): ditto
7221 (GetFontSettings): ditto
7223 (CopyIntoMinibuffer): ditto
7224 (CutIntoMinibuffer): ditto
7225 (PasteParagraph): ditto
7226 (SetPExtraType): ditto
7227 (UnsetPExtraType): ditto
7228 (DocBookContTableRows): ditto
7229 (SimpleDocBookOneTablePar): ditto
7231 (TeXFootnote): ditto
7232 (SimpleTeXOneTablePar): ditto
7233 (TeXContTableRows): ditto
7234 (SimpleTeXSpecialChars): ditto
7237 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7238 to private and use accessors.
7240 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7241 this, we did not use it anymore and has not been for ages. Just a
7242 waste of cpu cycles.
7244 * src/language.h: make Language a real class, move all variables
7245 to private and use accessors.
7247 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7248 (create_view): remove
7249 (update): some changes for new timer
7250 (cursorToggle): use new timer
7251 (beforeChange): change for new timer
7253 * src/BufferView.h (cursorToggleCB): removed last paramter because
7256 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7257 (cursorToggleCB): change because of new timer code
7259 * lib/CREDITS: updated own mailaddress
7261 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7263 * src/support/filetools.C (PutEnv): fix the code in case neither
7264 putenv() nor setenv() have been found.
7266 * INSTALL: mention the install-strip Makefile target.
7268 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7269 read-only documents.
7271 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7273 * lib/reLyX/configure.in (VERSION): avoid using a previously
7274 generated reLyX wrapper to find out $prefix.
7276 * lib/examples/eu_adibide_lyx-atua.lyx:
7277 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7278 translation of the Tutorial (Dooteo)
7280 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7282 * forms/cite.fd: new citation dialog
7284 * src/insetcite.[Ch]: the new citation dialog is moved into
7287 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7290 * src/insets/insetcommand.h: data members made private.
7292 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7294 * LyX 1.1.5 released
7296 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7298 * src/version.h (LYX_RELEASE): to 1.1.5
7300 * src/spellchecker.C (RunSpellChecker): return false if the
7301 spellchecker dies upon creation.
7303 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7305 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7306 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7310 * lib/CREDITS: update entry for Martin Vermeer.
7312 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7314 * src/text.C (draw): Draw foreign language bars at the bottom of
7315 the row instead of at the baseline.
7317 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7319 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7321 * lib/bind/de_menus.bind: updated
7323 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7325 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7327 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7329 * src/menus.C (Limit_string_length): New function
7330 (ShowTocMenu): Limit the number of items/length of items in the
7333 * src/paragraph.C (String): Correct result for a paragraph inside
7336 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7338 * src/bufferlist.C (close): test of buf->getuser() == NULL
7340 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7342 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7343 Do not call to SetCursor when the paragraph is a closed footnote!
7345 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7347 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7350 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7352 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7355 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7356 reference popup, that activates the reference-back action
7358 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7360 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7361 the menus. Also fixed a bug.
7363 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7364 the math panels when switching buffers (unless new buffer is readonly).
7366 * src/BufferView.C (NoSavedPositions)
7367 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7369 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7371 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7372 less of dvi dirty or not.
7374 * src/trans_mgr.[Ch] (insert): change first parameter to string
7377 * src/chset.[Ch] (encodeString): add const to first parameter
7379 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7381 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7385 * src/LaTeX.C (deplog): better searching for dependency files in
7386 the latex log. Uses now regexps.
7388 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7389 instead of the box hack or \hfill.
7391 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7393 * src/lyxfunc.C (doImportHelper): do not create the file before
7394 doing the actual import.
7395 (doImportASCIIasLines): create a new file before doing the insert.
7396 (doImportASCIIasParagraphs): ditto.
7398 * lib/lyxrc.example: remove mention of non-existing commands
7400 * lyx.man: remove mention of color-related switches.
7402 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7404 * src/lyx_gui.C: remove all the color-related ressources, which
7405 are not used anymore.
7407 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7410 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7412 * src/lyxrc.C (read): Add a missing break in the switch
7414 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7416 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7418 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7421 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7423 * src/text.C (draw): draw bars under foreign language words.
7425 * src/LColor.[Ch]: add LColor::language
7427 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7429 * src/lyxcursor.h (boundary): New member variable
7431 * src/text.C (IsBoundary): New methods
7433 * src/text.C: Use the above for currect cursor movement when there
7434 is both RTL & LTR text.
7436 * src/text2.C: ditto
7438 * src/bufferview_funcs.C (ToggleAndShow): ditto
7440 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7442 * src/text.C (DeleteLineForward): set selection to true to avoid
7443 that DeleteEmptyParagraphMechanism does some magic. This is how it
7444 is done in all other functions, and seems reasonable.
7445 (DeleteWordForward): do not jump over non-word stuff, since
7446 CursorRightOneWord() already does it.
7448 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7449 DeleteWordBackward, since they seem safe to me (since selection is
7450 set to "true") DeleteEmptyParagraphMechanism does nothing.
7452 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7454 * src/lyx_main.C (easyParse): simplify the code by factoring the
7455 part that removes parameters from the command line.
7456 (LyX): check wether wrong command line options have been given.
7458 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7460 * src/lyx_main.C : add support for specifying user LyX
7461 directory via command line option -userdir.
7463 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7465 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7466 the number of items per popup.
7467 (Add_to_refs_menu): Ditto.
7469 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7471 * src/lyxparagraph.h: renamed ClearParagraph() to
7472 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7473 textclass as parameter, and do nothing if free_spacing is
7474 true. This fixes part of the line-delete-forward problems.
7476 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7477 (pasteSelection): ditto.
7478 (SwitchLayoutsBetweenClasses): more translatable strings.
7480 * src/text2.C (CutSelection): use StripLeadingSpaces.
7481 (PasteSelection): ditto.
7482 (DeleteEmptyParagraphMechanism): ditto.
7484 2000-05-26 Juergen Vigna <jug@sad.it>
7486 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7487 is not needed in tabular insets.
7489 * src/insets/insettabular.C (TabularFeatures): added missing features.
7491 * src/tabular.C (DeleteColumn):
7493 (AppendRow): implemented this functions
7494 (cellsturct::operator=): clone the inset too;
7496 2000-05-23 Juergen Vigna <jug@sad.it>
7498 * src/insets/insettabular.C (LocalDispatch): better selection support
7499 when having multicolumn-cells.
7501 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7503 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7505 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7507 * src/ColorHandler.C (getGCForeground): put more test into _()
7509 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7512 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7515 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7517 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7518 there are no labels, or when buffer is readonly.
7520 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7521 there are no labels, buffer is SGML, or when buffer is readonly.
7523 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7525 * src/LColor.C (LColor): change a couple of grey40 to grey60
7526 (LColor): rewore initalization to make compiles go some magnitude
7528 (getGUIName): don't use gettext until we need the string.
7530 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7532 * src/Bullet.[Ch]: Fixed a small bug.
7534 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7536 * src/paragraph.C (String): Several fixes/improvements
7538 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7540 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7542 * src/paragraph.C (String): give more correct output.
7544 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7546 * src/lyxfont.C (stateText) Do not output the language if it is
7547 eqaul to the language of the document.
7549 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7550 between two paragraphs with the same language.
7552 * src/paragraph.C (getParLanguage) Return a correct answer for an
7553 empty dummy paragraph.
7555 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7558 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7561 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7562 the menus/popup, if requested fonts are unavailable.
7564 2000-05-22 Juergen Vigna <jug@sad.it>
7566 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7567 movement support (Up/Down/Tab/Shift-Tab).
7568 (LocalDispatch): added also preliminari cursor-selection.
7570 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7572 * src/paragraph.C (PasteParagraph): Hopefully now right!
7574 2000-05-22 Garst R. Reese <reese@isn.net>
7576 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7577 of list, change all references to Environment to Command
7578 * tex/hollywood.cls : rewrite environments as commands, add
7579 \uppercase to interiorshot and exteriorshot to force uppecase.
7580 * tex/broadway.cls : rewrite environments as commands. Tweak
7583 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7585 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7586 size of items: use a constant intead of the hardcoded 40, and more
7587 importantly do not remove the %m and %x tags added at the end.
7588 (Add_to_refs_menu): use vector::size_type instead of
7589 unsigned int as basic types for the variables. _Please_ do not
7590 assume that size_t is equal to unsigned int. On an alpha, this is
7591 unsigned long, which is _not_ the same.
7593 * src/language.C (initL): remove language "hungarian", since it
7594 seems that "magyar" is better.
7596 2000-05-22 Juergen Vigna <jug@sad.it>
7598 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7600 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7603 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7604 next was deleted but not set to 0.
7606 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7608 * src/language.C (initL): change the initialization of languages
7609 so that compiles goes _fast_.
7611 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7614 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7616 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7620 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7622 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7624 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7628 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7631 * src/insets/insetlo*.[Ch]: Made editable
7633 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7635 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7636 the current selection.
7638 * src/BufferView_pimpl.C (stuffClipboard): new method
7640 * src/BufferView.C (stuffClipboard): new method
7642 * src/paragraph.C (String): new method
7644 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7645 LColor::ignore when lyxname is not found.
7647 * src/BufferView.C (pasteSelection): new method
7649 * src/BufferView_pimpl.C (pasteSelection): new method
7651 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7653 * src/WorkArea.C (request_clipboard_cb): new static function
7654 (getClipboard): new method
7655 (putClipboard): new method
7657 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7659 * LyX 1.1.5pre2 released
7661 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7663 * src/vspace.C (operator=): removed
7664 (operator=): removed
7666 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7668 * src/layout.C (NumberOfClass): manually set the type in make_pair
7669 (NumberOfLayout): ditto
7671 * src/language.C: use the Language constructor for ignore_lang
7673 * src/language.h: add constructors to struct Language
7675 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7677 * src/text2.C (SetCursorIntern): comment out #warning
7679 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7681 * src/mathed/math_iter.h: initialize sx and sw to 0
7683 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7685 * forms/lyx.fd: Redesign of form_ref
7687 * src/LaTeXFeatures.[Ch]
7691 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7694 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7695 and Buffer::inset_iterator.
7697 * src/menus.C: Added new menus: TOC and Refs.
7699 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7701 * src/buffer.C (getTocList): New method.
7703 * src/BufferView2.C (ChangeRefs): New method.
7705 * src/buffer.C (getLabelList): New method. It replaces the old
7706 getReferenceList. The return type is vector<string> instead of
7709 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7710 the old getLabel() and GetNumberOfLabels() methods.
7711 * src/insets/insetlabel.C (getLabelList): ditto
7712 * src/mathed/formula.C (getLabelList): ditto
7714 * src/paragraph.C (String): New method.
7716 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7717 Uses the new getTocList() method.
7718 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7719 which automatically updates the contents of the browser.
7720 (RefUpdateCB): Use the new getLabelList method.
7722 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7724 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7726 * src/spellchecker.C: Added using std::reverse;
7728 2000-05-19 Juergen Vigna <jug@sad.it>
7730 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7732 * src/insets/insettext.C (computeTextRows): small fix for display of
7733 1 character after a newline.
7735 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7738 2000-05-18 Juergen Vigna <jug@sad.it>
7740 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7741 when changing width of column.
7743 * src/tabular.C (set_row_column_number_info): setting of
7744 autobreak rows if necessary.
7746 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7748 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7750 * src/vc-backend.*: renamed stat() to status() and vcstat to
7751 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7752 compilation broke. The new name seems more relevant, anyway.
7754 2000-05-17 Juergen Vigna <jug@sad.it>
7756 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7757 which was wrong if the removing caused removing of rows!
7759 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7760 (pushToken): new function.
7762 * src/text2.C (CutSelection): fix problem discovered with purify
7764 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7766 * src/debug.C (showTags): enlarge the first column, now that we
7767 have 6-digits debug codes.
7769 * lib/layouts/hollywood.layout:
7770 * lib/tex/hollywood.cls:
7771 * lib/tex/brodway.cls:
7772 * lib/layouts/brodway.layout: more commands and fewer
7773 environments. Preambles moved in the .cls files. Broadway now has
7774 more options on scene numbering and less whitespace (from Garst)
7776 * src/insets/insetbib.C (getKeys): make sure that we are in the
7777 document directory, in case the bib file is there.
7779 * src/insets/insetbib.C (Latex): revert bogus change.
7781 2000-05-16 Juergen Vigna <jug@sad.it>
7783 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7784 the TabularLayout on cursor move.
7786 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7788 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7791 (draw): fixed cursor position and drawing so that the cursor is
7792 visible when before the tabular-inset.
7794 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7795 when creating from old insettext.
7797 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7799 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7801 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7802 * lib/tex/brodway.cls: ditto
7804 * lib/layouts/brodway.layout: change alignment of parenthical
7807 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7809 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7810 versions 0.88 and 0.89 are supported.
7812 2000-05-15 Juergen Vigna <jug@sad.it>
7814 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7817 * src/insets/insettext.C (computeTextRows): redone completely this
7818 function in a much cleaner way, because of problems when having a
7820 (draw): added a frame border when the inset is locked.
7821 (SetDrawLockedFrame): this sets if we draw the border or not.
7822 (SetFrameColor): this sets the frame color (default=insetframe).
7824 * src/insets/lyxinset.h: added x() and y() functions which return
7825 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7826 function which is needed to see if we have a locking inset of some
7827 type in this inset (needed for now in insettabular).
7829 * src/vspace.C (inPixels): the same function also without a BufferView
7830 parameter as so it is easier to use it in some ocasions.
7832 * src/lyxfunc.C: changed all places where insertInset was used so
7833 that now if it couldn't be inserted it is deleted!
7835 * src/TabularLayout.C:
7836 * src/TableLayout.C: added support for new tabular-inset!
7838 * src/BufferView2.C (insertInset): this now returns a bool if the
7839 inset was really inserted!!!
7841 * src/tabular.C (GetLastCellInRow):
7842 (GetFirstCellInRow): new helper functions.
7843 (Latex): implemented for new tabular class.
7847 (TeXTopHLine): new Latex() helper functions.
7849 2000-05-12 Juergen Vigna <jug@sad.it>
7851 * src/mathed/formulamacro.C (Read):
7852 * src/mathed/formula.C (Read): read also the \end_inset here!
7854 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7856 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7857 crush when saving formulae with unbalanced parenthesis.
7859 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7861 * src/layout.C: Add new keyword "endlabelstring" to layout file
7863 * src/text.C (GetVisibleRow): Draw endlabel string.
7865 * lib/layouts/broadway.layout
7866 * lib/layouts/hollywood.layout: Added endlabel for the
7867 Parenthetical layout.
7869 * lib/layouts/heb-article.layout: Do not use slanted font shape
7870 for Theorem like environments.
7872 * src/buffer.C (makeLaTeXFile): Always add "american" to
7873 the UsedLanguages list if document language is RTL.
7875 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7877 * add addendum to README.OS2 and small patch (from SMiyata)
7879 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7881 * many files: correct the calls to ChangeExtension().
7883 * src/support/filetools.C (ChangeExtension): remove the no_path
7884 argument, which does not belong there. Use OnlyFileName() instead.
7886 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7887 files when LaTeXing a non-nice latex file.
7889 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7890 a chain of "if". Return false when deadkeys are not handled.
7892 * src/lyx_main.C (LyX): adapted the code for default bindings.
7894 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7895 bindings for basic functionality (except deadkeys).
7896 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7898 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7899 several methods: handle override_x_deadkeys.
7901 * src/lyxrc.h: remove the "bindings" map, which did not make much
7902 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7904 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7906 * src/lyxfont.C (stateText): use a saner method to determine
7907 whether the font is "default". Seems to fix the crash with DEC
7910 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7912 2000-05-08 Juergen Vigna <jug@sad.it>
7914 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7915 TabularLayoutMenu with mouse-button-3
7916 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7918 * src/TabularLayout.C: added this file for having a Layout for
7921 2000-05-05 Juergen Vigna <jug@sad.it>
7923 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7924 recalculating inset-widths.
7925 (TabularFeatures): activated this function so that I can change
7926 tabular-features via menu.
7928 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7929 that I can test some functions with the Table menu.
7931 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7933 * src/lyxfont.C (stateText): guard against stupid c++libs.
7935 * src/tabular.C: add using std::vector
7936 some whitespace changes, + removed som autogenerated code.
7938 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7940 2000-05-05 Juergen Vigna <jug@sad.it>
7942 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7943 row, columns and cellstructures.
7945 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7947 * lib/lyxrc.example: remove obsolete entries.
7949 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7950 reading of protected_separator for free_spacing.
7952 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7954 * src/text.C (draw): do not display an exclamation mark in the
7955 margin for margin notes. This is confusing, ugly and
7958 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7959 AMS math' is checked.
7961 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7962 name to see whether including the amsmath package is needed.
7964 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7966 * src/paragraph.C (validate): Compute UsedLanguages correctly
7967 (don't insert the american language if it doesn't appear in the
7970 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7971 The argument of \thanks{} command is considered moving argument
7973 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7976 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7978 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7979 for appendix/minipage/depth. The lines can be now both in the footnote
7980 frame, and outside the frame.
7982 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7985 2000-05-05 Juergen Vigna <jug@sad.it>
7987 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7988 neede only in tabular.[Ch].
7990 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7992 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7994 (Write): write '~' for PROTECTED_SEPARATOR
7996 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7998 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8001 * src/mathed/formula.C (drawStr): rename size to siz.
8003 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8004 possibly fix a bug by not changing the pflags = flags to piflags =
8007 2000-05-05 Juergen Vigna <jug@sad.it>
8009 * src/insets/insetbib.C: moved using directive
8011 * src/ImportNoweb.C: small fix for being able to compile (missing
8014 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8016 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8017 to use clear, since we don't depend on this in the code. Add test
8020 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8022 * (various *.C files): add using std::foo directives to please dec
8025 * replace calls to string::clear() to string::erase() (Angus)
8027 * src/cheaders/cmath: modified to provide std::abs.
8029 2000-05-04 Juergen Vigna <jug@sad.it>
8031 * src/insets/insettext.C: Prepared all for inserting of multiple
8032 paragraphs. Still display stuff to do (alignment and other things),
8033 but I would like to use LyXText to do this when we cleaned out the
8034 table-support stuff.
8036 * src/insets/insettabular.C: Changed lot of stuff and added lots
8037 of functionality still a lot to do.
8039 * src/tabular.C: Various functions changed name and moved to be
8040 const functions. Added new Read and Write functions and changed
8041 lots of things so it works good with tabular-insets (also removed
8042 some stuff which is not needed anymore * hacks *).
8044 * src/lyxcursor.h: added operators == and != which just look if
8045 par and pos are (not) equal.
8047 * src/buffer.C (latexParagraphs): inserted this function to latex
8048 all paragraphs form par to endpar as then I can use this too for
8051 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8052 so that I can call this to from text insets with their own cursor.
8054 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8055 output off all paragraphs (because of the fix below)!
8057 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8058 the very last paragraph (this could be also the last paragraph of an
8061 * src/texrow.h: added rows() call which returns the count-variable.
8063 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8065 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8067 * lib/configure.m4: better autodetection of DocBook tools.
8069 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8071 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8073 * src/lyx_cb.C: add using std::reverse;
8075 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8078 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8079 selected files. Should fix repeated errors from generated files.
8081 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8083 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8085 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8086 the spellchecker popup.
8088 * lib/lyxrc.example: Removed the \number_inset section
8090 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8092 * src/insets/figinset.C (various): Use IsFileReadable() to make
8093 sure that the file actually exist. Relying on ghostscripts errors
8094 is a bad idea since they can lead to X server crashes.
8096 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8098 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8101 * lib/lyxrc.example: smallish typo in description of
8102 \view_dvi_paper_option
8104 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8107 * src/lyxfunc.C: doImportHelper to factor out common code of the
8108 various import methods. New functions doImportASCIIasLines,
8109 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8110 doImportLinuxDoc for the format specific parts.
8113 * buffer.C: Dispatch returns now a bool to indicate success
8116 * lyx_gui.C: Add getLyXView() for member access
8118 * lyx_main.C: Change logic for batch commands: First try
8119 Buffer::Dispatch (possibly without GUI), if that fails, use
8122 * lyx_main.C: Add support for --import command line switch.
8123 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8124 Available Formats: Everything accepted by 'buffer-import <format>'
8126 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8128 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8131 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8132 documents will be reformatted upon reentry.
8134 2000-04-27 Juergen Vigna <jug@sad.it>
8136 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8137 correctly only last pos this was a bug.
8139 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8141 * release of lyx-1.1.5pre1
8143 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8145 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8147 * src/menus.C: revert the change of naming (Figure->Graphic...)
8148 from 2000-04-11. It was incomplete and bad.
8150 * src/LColor.[Ch]: add LColor::depthbar.
8151 * src/text.C (GetVisibleRow): use it.
8153 * README: update the languages list.
8155 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8157 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8160 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8162 * README: remove sections that were just wrong.
8164 * src/text2.C (GetRowNearY): remove currentrow code
8166 * src/text.C (GetRow): remove currentrow code
8168 * src/screen.C (Update): rewritten a bit.
8169 (SmallUpdate): removed func
8171 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8173 (FullRebreak): return bool
8174 (currentrow): remove var
8175 (currentrow_y): ditto
8177 * src/lyxscreen.h (Draw): change arg to unsigned long
8178 (FitCursor): return bool
8179 (FitManualCursor): ditto
8180 (Smallpdate): remove func
8181 (first): change to unsigned long
8182 (DrawOneRow): change second arg to long (from long &)
8183 (screen_refresh_y): remove var
8184 (scree_refresh_row): ditto
8186 * src/lyxrow.h: change baseline to usigned int from unsigned
8187 short, this brings some implicit/unsigned issues out in the open.
8189 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8191 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8192 instead of smallUpdate.
8194 * src/lyxcursor.h: change y to unsigned long
8196 * src/buffer.h: don't call updateScrollbar after fitcursor
8198 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8199 where they are used. Removed "\\direction", this was not present
8200 in 1.1.4 and is already obsolete. Commented out some code that I
8201 believe to never be called.
8202 (runLiterate): don't call updateScrollbar after fitCursor
8204 (buildProgram): ditto
8207 * src/WorkArea.h (workWidth): change return val to unsigned
8210 (redraw): remove the button redraws
8211 (setScrollbarValue): change for scrollbar
8212 (getScrollbarValue): change for scrollbar
8213 (getScrollbarBounds): change for scrollbar
8215 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8216 (C_WorkArea_down_cb): removed func
8217 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8218 (resize): change for scrollbar
8219 (setScrollbar): ditto
8220 (setScrollbarBounds): ditto
8221 (setScrollbarIncrements): ditto
8222 (up_cb): removed func
8223 (down_cb): removed func
8224 (scroll_cb): change for scrollbar
8225 (work_area_handler): ditto
8227 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8228 when FitCursor did something.
8229 (updateScrollbar): some unsigned changes
8230 (downCB): removed func
8231 (scrollUpOnePage): removed func
8232 (scrollDownOnePage): remvoed func
8233 (workAreaMotionNotify): don't call screen->FitCursor but use
8234 fitCursor instead. and bool return val
8235 (workAreaButtonPress): ditto
8236 (workAreaButtonRelease): some unsigned changes
8237 (checkInsetHit): ditto
8238 (workAreaExpose): ditto
8239 (update): parts rewritten, comments about the signed char arg added
8240 (smallUpdate): removed func
8241 (cursorPrevious): call needed updateScrollbar
8244 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8247 * src/BufferView.[Ch] (upCB): removed func
8248 (downCB): removed func
8249 (smallUpdate): removed func
8251 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8253 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8254 currentrow, currentrow_y optimization. This did not help a lot and
8255 if we want to do this kind of optimization we should rather use
8256 cursor.row instead of the currentrow.
8258 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8259 buffer spacing and klyx spacing support.
8261 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8263 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8266 2000-04-26 Juergen Vigna <jug@sad.it>
8268 * src/insets/figinset.C: fixes to Lars sstream changes!
8270 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8272 * A lot of files: Added Ascii(ostream &) methods to all inset
8273 classes. Used when exporting to ASCII.
8275 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8276 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8279 * src/text2.C (ToggleFree): Disabled implicit word selection when
8280 there is a change in the language
8282 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8283 no output was generated for end-of-sentence inset.
8285 * src/insets/lyxinset.h
8288 * src/paragraph.C: Removed the insetnumber code
8290 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8292 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8294 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8295 no_babel and no_epsfig completely from the file.
8296 (parseSingleLyXformat2Token): add handling for per-paragraph
8297 spacing as written by klyx.
8299 * src/insets/figinset.C: applied patch by Andre. Made it work with
8302 2000-04-20 Juergen Vigna <jug@sad.it>
8304 * src/insets/insettext.C (cutSelection):
8305 (copySelection): Fixed with selection from right to left.
8306 (draw): now the rows are not recalculated at every draw.
8307 (computeTextRows): for now reset the inset-owner here (this is
8308 important for an undo or copy where the inset-owner is not set
8311 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8312 motion to the_locking_inset screen->first was forgotten, this was
8313 not important till we got multiline insets.
8315 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8317 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8318 code seems to be alright (it is code changed by Dekel, and the
8319 intent is indeed that all macros should be defined \protect'ed)
8321 * NEWS: a bit of reorganisation of the new user-visible features.
8323 2000-04-19 Juergen Vigna <jug@sad.it>
8325 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8326 position. Set the inset_owner of the used paragraph so that it knows
8327 that it is inside an inset. Fixed cursor handling with mouse and
8328 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8329 and cleanups to make TextInsets work better.
8331 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8332 Changed parameters of various functions and added LockInsetInInset().
8334 * src/insets/insettext.C:
8336 * src/insets/insetcollapsable.h:
8337 * src/insets/insetcollapsable.C:
8338 * src/insets/insetfoot.h:
8339 * src/insets/insetfoot.C:
8340 * src/insets/insetert.h:
8341 * src/insets/insetert.C: cleaned up the code so that it works now
8342 correctly with insettext.
8344 * src/insets/inset.C:
8345 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8346 that insets in insets are supported right.
8349 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8351 * src/paragraph.C: some small fixes
8353 * src/debug.h: inserted INSETS debug info
8355 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8356 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8358 * src/commandtags.h:
8359 * src/LyXAction.C: insert code for InsetTabular.
8361 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8362 not Button1MotionMask.
8363 (workAreaButtonRelease): send always a InsetButtonRelease event to
8365 (checkInsetHit): some setCursor fixes (always with insets).
8367 * src/BufferView2.C (lockInset): returns a bool now and extended for
8368 locking insets inside insets.
8369 (showLockedInsetCursor): it is important to have the cursor always
8370 before the locked inset.
8371 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8373 * src/BufferView.h: made lockInset return a bool.
8375 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8377 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8378 that is used also internally but can be called as public to have back
8379 a cursor pos which is not set internally.
8380 (SetCursorIntern): Changed to use above function.
8382 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8384 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8389 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8390 patches for things that should be in or should be changed.
8392 * src/* [insetfiles]: change "usigned char fragile" to bool
8393 fragile. There was only one point that could that be questioned
8394 and that is commented in formulamacro.C. Grep for "CHECK".
8396 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8397 (DeleteBuffer): take it out of CutAndPaste and make it static.
8399 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8401 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8402 output the spacing envir commands. Also the new commands used in
8403 the LaTeX output makes the result better.
8405 * src/Spacing.C (writeEnvirBegin): new method
8406 (writeEnvirEnd): new method
8408 2000-04-18 Juergen Vigna <jug@sad.it>
8410 * src/CutAndPaste.C: made textclass a static member of the class
8411 as otherwise it is not accesed right!!!
8413 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8415 * forms/layout_forms.fd
8416 * src/layout_forms.h
8417 * src/layout_forms.C (create_form_form_character)
8418 * src/lyx_cb.C (UserFreeFont)
8419 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8420 documents (in the layout->character popup).
8422 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8424 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8425 \spell_command was in fact not honored (from Kevin Atkinson).
8427 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8430 * src/lyx_gui.h: make lyxViews private (Angus)
8432 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8434 * src/mathed/math_write.C
8435 (MathMatrixInset::Write) Put \protect before \begin{array} and
8436 \end{array} if fragile
8437 (MathParInset::Write): Put \protect before \\ if fragile
8439 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8441 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8442 initialization if the LyXColorHandler must be done after the
8443 connections to the XServer has been established.
8445 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8446 get the background pixel from the lyxColorhandler so that the
8447 figures are rendered with the correct background color.
8448 (NextToken): removed functions.
8449 (GetPSSizes): use ifs >> string instead of NextToken.
8451 * src/Painter.[Ch]: the color cache moved out of this file.
8453 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8456 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8458 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8459 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8461 * src/BufferView.C (enterView): new func
8462 (leaveView): new func
8464 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8466 (leaveView): new func, undefines xterm cursor when approp.
8468 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8469 (AllowInput): delete the Workarea cursor handling from this func.
8471 * src/Painter.C (underline): draw a slimer underline in most cases.
8473 * src/lyx_main.C (error_handler): use extern "C"
8475 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8477 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8478 sent directly to me.
8480 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8481 to the list by Dekel.
8483 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8486 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8487 methods from lyx_cb.here.
8489 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8492 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8494 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8495 instead of using current_view directly.
8497 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8499 * src/LyXAction.C (init): add the paragraph-spacing command.
8501 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8503 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8505 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8506 different from the documents.
8508 * src/text.C (SetHeightOfRow): take paragraph spacing into
8509 account, paragraph spacing takes precedence over buffer spacing
8510 (GetVisibleRow): ditto
8512 * src/paragraph.C (writeFile): output the spacing parameter too.
8513 (validate): set the correct features if spacing is used in the
8515 (Clear): set spacing to default
8516 (MakeSameLayout): spacing too
8517 (HasSameLayout): spacing too
8518 (SetLayout): spacing too
8519 (TeXOnePar): output the spacing commands
8521 * src/lyxparagraph.h: added a spacing variable for use with
8522 per-paragraph spacing.
8524 * src/Spacing.h: add a Default spacing and a method to check if
8525 the current spacing is default. also added an operator==
8527 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8530 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8532 * src/lyxserver.C (callback): fix dispatch of functions
8534 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8535 printf() into lyxerr call.
8537 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8540 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8541 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8542 the "Float" from each of the subitems.
8543 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8545 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8546 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8547 documented the change so that the workaround can be nuked later.
8549 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8552 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8554 * src/buffer.C (getLatexName): ditto
8555 (setReadonly): ditto
8557 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8559 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8560 avoid some uses of current_view. Added also a bufferParams()
8561 method to get at this.
8563 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8565 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8567 * src/lyxparagraph.[Ch]: removed
8568 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8569 with operators used by lower_bound and
8570 upper_bound in InsetTable's
8571 Make struct InsetTable private again. Used matchpos.
8573 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8575 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8576 document, the language of existing text is changed (unless the
8577 document is multi-lingual)
8579 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8581 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8583 * A lot of files: A rewrite of the Right-to-Left support.
8585 2000-04-10 Juergen Vigna <jug@sad.it>
8587 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8588 misplaced cursor when inset in inset is locked.
8590 * src/insets/insettext.C (LocalDispatch): small fix so that a
8591 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8593 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8594 footnote font should be decreased in size twice when displaying.
8596 * src/insets/insettext.C (GetDrawFont): inserted this function as
8597 the drawing-font may differ from the real paragraph font.
8599 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8600 insets (inset in inset!).
8602 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8603 function here because we don't want footnotes inside footnotes.
8605 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8607 (init): now set the inset_owner in paragraph.C
8608 (LocalDispatch): added some resetPos() in the right position
8611 (pasteSelection): changed to use the new CutAndPaste-Class.
8613 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8614 which tells if it is allowed to insert another inset inside this one.
8616 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8617 SwitchLayoutsBetweenClasses.
8619 * src/text2.C (InsertInset): checking of the new paragraph-function
8621 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8622 is not needed anymore here!
8625 (PasteSelection): redone (also with #ifdef) so that now this uses
8626 the CutAndPaste-Class.
8627 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8630 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8631 from/to text/insets.
8633 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8634 so that the paragraph knows if it is inside an (text)-inset.
8635 (InsertFromMinibuffer): changed return-value to bool as now it
8636 may happen that an inset is not inserted in the paragraph.
8637 (InsertInsetAllowed): this checks if it is allowed to insert an
8638 inset in this paragraph.
8640 (BreakParagraphConservative):
8641 (BreakParagraph) : small change for the above change of the return
8642 value of InsertFromMinibuffer.
8644 * src/lyxparagraph.h: added inset_owner and the functions to handle
8645 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8647 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8649 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8650 functions from BufferView to BufferView::Pimpl to ease maintence.
8652 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8653 correctly. Also use SetCursorIntern instead of SetCursor.
8655 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8658 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8660 * src/WorkArea.C (belowMouse): manually implement below mouse.
8662 * src/*: Add "explicit" on several constructors, I added probably
8663 some unneeded ones. A couple of changes to code because of this.
8665 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8666 implementation and private parts from the users of BufferView. Not
8669 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8670 implementation and private parts from the users of LyXLex. Not
8673 * src/BufferView_pimpl.[Ch]: new files
8675 * src/lyxlex_pimpl.[Ch]: new files
8677 * src/LyXView.[Ch]: some inline functions move out-of-line
8679 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8681 * src/lyxparagraph.h: make struct InsetTable public.
8683 * src/support/lyxstring.h: change lyxstring::difference_type to be
8684 ptrdiff_t. Add std:: modifiers to streams.
8686 * src/font.C: include the <cctype> header, for islower() and
8689 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8691 * src/font.[Ch]: new files. Contains the metric functions for
8692 fonts, takes a LyXFont as parameter. Better separation of concepts.
8694 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8695 changes because of this.
8697 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8699 * src/*: compile with -Winline and move functions that don't
8702 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8705 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8707 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8708 (various files changed because of this)
8710 * src/Painter.C (text): fixed the drawing of smallcaps.
8712 * src/lyxfont.[Ch] (drawText): removed unused member func.
8715 * src/*.C: added needed "using" statements and "std::" qualifiers.
8717 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8719 * src/*.h: removed all use of "using" from header files use
8720 qualifier std:: instead.
8722 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8724 * src/text.C (Backspace): some additional cleanups (we already
8725 know whether cursor.pos is 0 or not).
8727 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8728 automake does not provide one).
8730 * src/bmtable.h: replace C++ comments with C comments.
8732 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8734 * src/screen.C (ShowCursor): Change the shape of the cursor if
8735 the current language is not equal to the language of the document.
8736 (If the cursor change its shape unexpectedly, then you've found a bug)
8738 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8741 * src/insets/insetnumber.[Ch]: New files.
8743 * src/LyXAction.C (init)
8744 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8747 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8749 * src/lyxparagraph.h
8750 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8751 (the vector is kept sorted).
8753 * src/text.C (GetVisibleRow): Draw selection correctly when there
8754 is both LTR and RTL text.
8756 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8757 which is much faster.
8759 * src/text.C (GetVisibleRow and other): Do not draw the last space
8760 in a row if the direction of the last letter is not equal to the
8761 direction of the paragraph.
8763 * src/lyxfont.C (latexWriteStartChanges):
8764 Check that font language is not equal to basefont language.
8765 (latexWriteEndChanges): ditto
8767 * src/lyx_cb.C (StyleReset): Don't change the language while using
8768 the font-default command.
8770 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8771 empty paragraph before a footnote.
8773 * src/insets/insetcommand.C (draw): Increase x correctly.
8775 * src/screen.C (ShowCursor): Change cursor shape if
8776 current language != document language.
8778 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8780 2000-03-31 Juergen Vigna <jug@sad.it>
8782 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8783 (Clone): changed mode how the paragraph-data is copied to the
8784 new clone-paragraph.
8786 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8787 GetInset(pos) with no inset anymore there (in inset UNDO)
8789 * src/insets/insetcommand.C (draw): small fix as here x is
8790 incremented not as much as width() returns (2 before, 2 behind = 4)
8792 2000-03-30 Juergen Vigna <jug@sad.it>
8794 * src/insets/insettext.C (InsetText): small fix in initialize
8795 widthOffset (should not be done in the init() function)
8797 2000-03-29 Amir Karger <karger@lyx.org>
8799 * lib/examples/it_ItemizeBullets.lyx: translation by
8802 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8804 2000-03-29 Juergen Vigna <jug@sad.it>
8806 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8808 * src/insets/insetfoot.C (Clone): small change as for the below
8809 new init function in the text-inset
8811 * src/insets/insettext.C (init): new function as I've seen that
8812 clone did not copy the Paragraph-Data!
8813 (LocalDispatch): Added code so that now we have some sort of Undo
8814 functionality (well actually we HAVE Undo ;)
8816 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8818 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8820 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8823 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8825 * src/main.C: added a runtime check that verifies that the xforms
8826 header used when building LyX and the library used when running
8827 LyX match. Exit with a message if they don't match. This is a
8828 version number check only.
8830 * src/buffer.C (save): Don't allocate memory on the heap for
8831 struct utimbuf times.
8833 * *: some using changes, use iosfwd instead of the real headers.
8835 * src/lyxfont.C use char const * instead of string for the static
8836 strings. Rewrite some functions to use sstream.
8838 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8840 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8843 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8845 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8846 of Geodesy (from Martin Vermeer)
8848 * lib/layouts/svjour.inc: include file for the Springer svjour
8849 class. It can be used to support journals other than JoG.
8851 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8852 Miskiewicz <misiek@pld.org.pl>)
8853 * lib/reLyX/Makefile.am: ditto.
8855 2000-03-27 Juergen Vigna <jug@sad.it>
8857 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8858 also some modifications with operations on selected text.
8860 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8861 problems with clicking on insets (last famous words ;)
8863 * src/insets/insetcommand.C (draw):
8864 (width): Changed to have a bit of space before and after the inset so
8865 that the blinking cursor can be seen (otherwise it was hidden)
8867 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8869 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8870 would not be added to the link list when an installed gettext (not
8871 part of libc) is found.
8873 2000-03-24 Juergen Vigna <jug@sad.it>
8875 * src/insets/insetcollapsable.C (Edit):
8876 * src/mathed/formula.C (InsetButtonRelease):
8877 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8880 * src/BufferView.C (workAreaButtonPress):
8881 (workAreaButtonRelease):
8882 (checkInsetHit): Finally fixed the clicking on insets be handled
8885 * src/insets/insetert.C (Edit): inserted this call so that ERT
8886 insets work always with LaTeX-font
8888 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8890 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8891 caused lyx to startup with no GUI in place, causing in a crash
8892 upon startup when called with arguments.
8894 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8896 * src/FontLoader.C: better initialization of dummyXFontStruct.
8898 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8900 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8901 for linuxdoc and docbook import and export format options.
8903 * lib/lyxrc.example Example of default values for the previous flags.
8905 * src/lyx_cb.C Use those flags instead of the hardwired values for
8906 linuxdoc and docbook export.
8908 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8911 * src/menus.C Added menus entries for the new import/exports formats.
8913 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8915 * src/lyxrc.*: Added support for running without Gui
8918 * src/FontLoader.C: sensible defaults if no fonts are needed
8920 * src/lyx_cb.C: New function ShowMessage (writes either to the
8921 minibuffer or cout in case of no gui
8922 New function AskOverwrite for common stuff
8923 Consequently various changes to call these functions
8925 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8926 wild guess at sensible screen resolution when having no gui
8928 * src/lyxfont.C: no gui, no fonts... set some defaults
8930 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8932 * src/LColor.C: made the command inset background a bit lighter.
8934 2000-03-20 Hartmut Goebel <goebel@noris.net>
8936 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8937 stdstruct.inc. Koma-Script added some title elements which
8938 otherwise have been listed below "bibliography". This split allows
8939 adding title elements to where they belong.
8941 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8942 define the additional title elements and then include
8945 * many other layout files: changed to include stdtitle.inc just
8946 before stdstruct.inc.
8948 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8950 * src/buffer.C: (save) Added the option to store all backup files
8951 in a single directory
8953 * src/lyxrc.[Ch]: Added variable \backupdir_path
8955 * lib/lyxrc.example: Added descriptions of recently added variables
8957 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8958 bibtex inset, not closing the bibtex popup when deleting the inset)
8960 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8962 * src/lyx_cb.C: add a couple using directives.
8964 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8965 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8966 import based on the filename.
8968 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8969 file would be imported at start, if the filename where of a sgml file.
8971 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8973 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8975 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8976 * src/lyxfont.h Replaced the member variable bits.direction by the
8977 member variable lang. Made many changes in other files.
8978 This allows having a multi-lingual document
8980 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8981 that change the current language to <l>.
8982 Removed the command "font-rtl"
8984 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8985 format for Hebrew documents)
8987 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8988 When auto_mathmode is "true", pressing a digit key in normal mode
8989 will cause entering into mathmode.
8990 If auto_mathmode is "rtl" then this behavior will be active only
8991 when writing right-to-left text.
8993 * src/text2.C (InsertStringA) The string is inserted using the
8996 * src/paragraph.C (GetEndLabel) Gives a correct result for
8997 footnote paragraphs.
8999 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9001 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9003 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9004 front of PasteParagraph. Never insert a ' '. This should at least
9005 fix some cause for the segfaults that we have been experiencing,
9006 it also fixes backspace behaviour slightly. (Phu!)
9008 * src/support/lstrings.C (compare_no_case): some change to make it
9009 compile with gcc 2.95.2 and stdlibc++-v3
9011 * src/text2.C (MeltFootnoteEnvironment): change type o
9012 first_footnote_par_is_not_empty to bool.
9014 * src/lyxparagraph.h: make text private. Changes in other files
9016 (fitToSize): new function
9017 (setContentsFromPar): new function
9018 (clearContents): new function
9019 (SetChar): new function
9021 * src/paragraph.C (readSimpleWholeFile): deleted.
9023 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9024 the file, just use a simple string instead. Also read the file in
9025 a more maintainable manner.
9027 * src/text2.C (InsertStringA): deleted.
9028 (InsertStringB): deleted.
9030 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9032 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9033 RedoParagraphs from the doublespace handling part, just set status
9034 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9035 done, but perhaps not like this.)
9037 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9039 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9040 character when inserting an inset.
9042 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9044 * src/bufferparams.C (readLanguage): now takes "default" into
9047 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9048 also initialize the toplevel_keymap with the default bindings from
9051 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9053 * all files using lyxrc: have lyxrc as a real variable and not a
9054 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9057 * src/lyxrc.C: remove double call to defaultKeyBindings
9059 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9060 toolbar defauls using lyxlex. Remove enums, structs, functions
9063 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9064 toolbar defaults. Also store default keybindings in a map.
9066 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9067 storing the toolbar defaults without any xforms dependencies.
9069 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9070 applied. Changed to use iterators.
9072 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9074 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9075 systems that don't have LINGUAS set to begin with.
9077 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9079 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9080 the list by Dekel Tsur.
9082 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9084 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9085 * src/insets/form_graphics.C: ditto.
9087 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9089 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9091 * src/bufferparams.C (readLanguage): use the new language map
9093 * src/intl.C (InitKeyMapper): use the new language map
9095 * src/lyx_gui.C (create_forms): use the new language map
9097 * src/language.[Ch]: New files. Used for holding the information
9098 about each language. Now! Use this new language map enhance it and
9099 make it really usable for our needs.
9101 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9103 * screen.C (ShowCursor): Removed duplicate code.
9104 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9105 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9107 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9110 * src/text.C Added TransformChar method. Used for rendering Arabic
9111 text correctly (change the glyphs of the letter according to the
9112 position in the word)
9117 * src/lyxrc.C Added lyxrc command {language_command_begin,
9118 language_command_end,language_command_ltr,language_command_rtl,
9119 language_package} which allows the use of either arabtex or Omega
9122 * src/lyx_gui.C (init)
9124 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9125 to use encoding for menu fonts which is different than the encoding
9128 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9129 do not load the babel package.
9130 To write an English document with Hebrew/Arabic, change the document
9131 language to "english".
9133 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9134 (alphaCounter): changed to return char
9135 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9137 * lib/lyxrc.example Added examples for Hebrew/Arabic
9140 * src/layout.C Added layout command endlabeltype
9142 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9144 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9146 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9148 * src/mathed/math_delim.C (search_deco): return a
9149 math_deco_struct* instead of index.
9151 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9153 * All files with a USE_OSTREAM_ONLY within: removed all code that
9154 was unused when USE_OSTREAM_ONLY is defined.
9156 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9157 of any less. Removed header and using.
9159 * src/text.C (GetVisibleRow): draw the string "Page Break
9160 (top/bottom)" on screen when drawing a pagebreak line.
9162 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9164 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9166 * src/mathed/math_macro.C (draw): do some cast magic.
9169 * src/mathed/math_defs.h: change byte* argument to byte const*.
9171 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9173 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9174 know it is right to return InsetFoot* too, but cxx does not like
9177 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9179 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9181 * src/mathed/math_delim.C: change == to proper assignment.
9183 2000-03-09 Juergen Vigna <jug@sad.it>
9185 * src/insets/insettext.C (setPos): fixed various cursor positioning
9186 problems (via mouse and cursor-keys)
9187 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9188 inset (still a small display problem but it works ;)
9190 * src/insets/insetcollapsable.C (draw): added button_top_y and
9191 button_bottom_y to have correct values for clicking on the inset.
9193 * src/support/lyxalgo.h: commented out 'using std::less'
9195 2000-03-08 Juergen Vigna <jug@sad.it>
9197 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9198 Button-Release event closes as it is alos the Release-Event
9201 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9203 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9205 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9206 can add multiple spaces in Scrap (literate programming) styles...
9207 which, by the way, is how I got hooked on LyX to begin with.
9209 * src/mathed/formula.C (Write): Added dummy variable to an
9210 inset::Latex() call.
9211 (Latex): Add free_spacing boolean to inset::Latex()
9213 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9215 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9216 virtual function to include the free_spacing boolean from
9217 the containing paragraph's style.
9219 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9220 Added free_spacing boolean arg to match inset.h
9222 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9223 Added free_spacing boolean arg to match inset.h
9225 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9226 Added free_spacing boolean and made sure that if in a free_spacing
9227 paragraph, that we output normal space if there is a protected space.
9229 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9230 Added free_spacing boolean arg to match inset.h
9232 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9233 Added free_spacing boolean arg to match inset.h
9235 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9236 Added free_spacing boolean arg to match inset.h
9238 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9239 Added free_spacing boolean arg to match inset.h
9241 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9242 Added free_spacing boolean arg to match inset.h
9244 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9245 free_spacing boolean arg to match inset.h
9247 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9248 Added free_spacing boolean arg to match inset.h
9250 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9251 Added free_spacing boolean arg to match inset.h
9253 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9254 Added free_spacing boolean arg to match inset.h
9256 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9257 Added free_spacing boolean arg to match inset.h
9259 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9260 Added free_spacing boolean arg to match inset.h
9262 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9263 free_spacing boolean arg to match inset.h
9265 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9266 free_spacing boolean arg to match inset.h
9268 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9269 ignore free_spacing paragraphs. The user's spaces are left
9272 * src/text.C (InsertChar): Fixed the free_spacing layout
9273 attribute behavior. Now, if free_spacing is set, you can
9274 add multiple spaces in a paragraph with impunity (and they
9275 get output verbatim).
9276 (SelectSelectedWord): Added dummy argument to inset::Latex()
9279 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9282 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9283 paragraph layouts now only input a simple space instead.
9284 Special character insets don't make any sense in free-spacing
9287 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9288 hard-spaces in the *input* file to simple spaces if the layout
9289 is free-spacing. This converts old files which had to have
9290 hard-spaces in free-spacing layouts where a simple space was
9292 (writeFileAscii): Added free_spacing check to pass to the newly
9293 reworked inset::Latex(...) methods. The inset::Latex() code
9294 ensures that hard-spaces in free-spacing paragraphs get output
9295 as spaces (rather than "~").
9297 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9299 * src/mathed/math_delim.C (draw): draw the empty placeholder
9300 delims with a onoffdash line.
9301 (struct math_deco_compare): struct that holds the "functors" used
9302 for the sort and the binary search in math_deco_table.
9303 (class init_deco_table): class used for initial sort of the
9305 (search_deco): use lower_bound to do a binary search in the
9308 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9310 * src/lyxrc.C: a small secret thingie...
9312 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9313 and to not flush the stream as often as it used to.
9315 * src/support/lyxalgo.h: new file
9316 (sorted): template function used for checking if a sequence is
9317 sorted or not. Two versions with and without user supplied
9318 compare. Uses same compare as std::sort.
9320 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9321 it and give warning on lyxerr.
9323 (struct compare_tags): struct with function operators used for
9324 checking if sorted, sorting and lower_bound.
9325 (search_kw): use lower_bound instead of manually implemented
9328 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9330 * src/insets/insetcollapsable.h: fix Clone() declaration.
9331 * src/insets/insetfoot.h: ditto.
9333 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9335 2000-03-08 Juergen Vigna <jug@sad.it>
9337 * src/insets/lyxinset.h: added owner call which tells us if
9338 this inset is inside another inset. Changed also the return-type
9339 of Editable to an enum so it tells clearer what the return-value is.
9341 * src/insets/insettext.C (computeTextRows): fixed computing of
9342 textinsets which split automatically on more rows.
9344 * src/insets/insetert.[Ch]: changed this to be of BaseType
9347 * src/insets/insetfoot.[Ch]: added footnote inset
9349 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9350 collapsable insets (like footnote, ert, ...)
9352 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9354 * src/lyxdraw.h: remvoe file
9356 * src/lyxdraw.C: remove file
9358 * src/insets/insettext.C: added <algorithm>.
9360 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9362 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9363 (matrix_cb): case MM_OK use string stream
9365 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9368 * src/mathed/math_macro.C (draw): use string stream
9369 (Metrics): use string stream
9371 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9372 directly to the ostream.
9374 * src/vspace.C (asString): use string stream.
9375 (asString): use string stream
9376 (asLatexString): use string stream
9378 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9379 setting Spacing::Other.
9381 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9382 sprintf when creating the stretch vale.
9384 * src/text2.C (alphaCounter): changed to return a string and to
9385 not use a static variable internally. Also fixed a one-off bug.
9386 (SetCounter): changed the drawing of the labels to use string
9387 streams instead of sprintf.
9389 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9390 manipulator to use a scheme that does not require library support.
9391 This is also the way it is done in the new GNU libstdc++. Should
9392 work with DEC cxx now.
9394 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9396 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9397 end. This fixes a bug.
9399 * src/mathed (all files concerned with file writing): apply the
9400 USE_OSTREAM_ONLY changes to mathed too.
9402 * src/support/DebugStream.h: make the constructor explicit.
9404 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9405 count and ostream squashed.
9407 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9409 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9411 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9412 ostringstream uses STL strings, and we might not.
9414 * src/insets/insetspecialchar.C: add using directive.
9415 * src/insets/insettext.C: ditto.
9417 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9419 * lib/layouts/seminar.layout: feeble attempt at a layout for
9420 seminar.cls, far from completet and could really use some looking
9421 at from people used to write layout files.
9423 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9424 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9425 a lot nicer and works nicely with ostreams.
9427 * src/mathed/formula.C (draw): a slightly different solution that
9428 the one posted to the list, but I think this one works too. (font
9429 size wrong in headers.)
9431 * src/insets/insettext.C (computeTextRows): some fiddling on
9432 Jürgens turf, added some comments that he should read.
9434 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9435 used and it gave compiler warnings.
9436 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9439 * src/lyx_gui.C (create_forms): do the right thing when
9440 show_banner is true/false.
9442 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9443 show_banner is false.
9445 * most file writing files: Now use iostreams to do almost all of
9446 the writing. Also instead of passing string &, we now use
9447 stringstreams. mathed output is still not adapted to iostreams.
9448 This change can be turned off by commenting out all the occurences
9449 of the "#define USE_OSTREAM_ONLY 1" lines.
9451 * src/WorkArea.C (createPixmap): don't output debug messages.
9452 (WorkArea): don't output debug messages.
9454 * lib/lyxrc.example: added a comment about the new variable
9457 * development/Code_rules/Rules: Added some more commente about how
9458 to build class interfaces and on how better encapsulation can be
9461 2000-03-03 Juergen Vigna <jug@sad.it>
9463 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9464 automatically with the width of the LyX-Window
9466 * src/insets/insettext.C (computeTextRows): fixed update bug in
9467 displaying text-insets (scrollvalues where not initialized!)
9469 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9471 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9472 id in the check of the result from lower_bound is not enough since
9473 lower_bound can return last too, and then res->id will not be a
9476 * all insets and some code that use them: I have conditionalized
9477 removed the Latex(string & out, ...) this means that only the
9478 Latex(ostream &, ...) will be used. This is a work in progress to
9479 move towards using streams for all output of files.
9481 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9484 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9486 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9487 routine (this fixes bug where greek letters were surrounded by too
9490 * src/support/filetools.C (findtexfile): change a bit the search
9491 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9492 no longer passed to kpsewhich, we may have to change that later.
9494 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9495 warning options to avoid problems with X header files (from Angus
9497 * acinclude.m4: regenerated.
9499 2000-03-02 Juergen Vigna <jug@sad.it>
9501 * src/insets/insettext.C (WriteParagraphData): Using the
9502 par->writeFile() function for writing paragraph-data.
9503 (Read): Using buffer->parseSingleLyXformat2Token()-function
9504 for parsing paragraph data!
9506 * src/buffer.C (readLyXformat2): removed all parse data and using
9507 the new parseSingleLyXformat2Token()-function.
9508 (parseSingleLyXformat2Token): added this function to parse (read)
9509 lyx-file-format (this is called also from text-insets now!)
9511 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9513 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9516 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9517 directly instead of going through a func. One very bad thing: a
9518 static LyXFindReplace, but I don't know where to place it.
9520 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9521 string instead of char[]. Also changed to static.
9522 (GetSelectionOrWordAtCursor): changed to static inline
9523 (SetSelectionOverLenChars): ditto.
9525 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9526 current_view and global variables. both classes has changed names
9527 and LyXFindReplace is not inherited from SearchForm.
9529 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9530 fl_form_search form.
9532 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9534 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9536 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9537 bound (from Kayvan).
9539 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9541 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9543 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9545 * some things that I should comment but the local pub says head to
9548 * comment out all code that belongs to the Roff code for Ascii
9549 export of tables. (this is unused)
9551 * src/LyXView.C: use correct type for global variable
9552 current_layout. (LyXTextClass::size_type)
9554 * some code to get the new insetgraphics closer to working I'd be
9555 grateful for any help.
9557 * src/BufferView2.C (insertInset): use the return type of
9558 NumberOfLayout properly. (also changes in other files)
9560 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9561 this as a test. I want to know what breaks because of this.
9563 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9565 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9567 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9568 to use a \makebox in the label, this allows proper justification
9569 with out using protected spaces or multiple hfills. Now it is
9570 "label" for left justified, "\hfill label\hfill" for center, and
9571 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9572 should be changed accordingly.
9574 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9576 * src/lyxtext.h: change SetLayout() to take a
9577 LyXTextClass::size_type instead of a char (when there is more than
9578 127 layouts in a class); also change type of copylayouttype.
9579 * src/text2.C (SetLayout): ditto.
9580 * src/LyXView.C (updateLayoutChoice): ditto.
9582 * src/LaTeX.C (scanLogFile): errors where the line number was not
9583 given just after the '!'-line were ignored (from Dekel Tsur).
9585 * lib/lyxrc.example: fix description of \date_insert_format
9587 * lib/layouts/llncs.layout: new layout, contributed by Martin
9590 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9592 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9593 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9594 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9595 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9596 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9597 paragraph.C, text.C, text2.C)
9599 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9601 * src/insets/insettext.C (LocalDispatch): remove extra break
9604 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9605 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9607 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9608 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9610 * src/insets/insetbib.h: move InsetBibkey::Holder and
9611 InsetCitation::Holder in public space.
9613 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9615 * src/insets/insettext.h: small change to get the new files from
9616 Juergen to compile (use "string", not "class string").
9618 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9619 const & as parameter to LocalDispatch, use LyXFont const & as
9620 paramter to some other func. This also had impacto on lyxinsets.h
9621 and the two mathed insets.
9623 2000-02-24 Juergen Vigna <jug@sad.it>
9626 * src/commandtags.h:
9628 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9632 * src/BufferView2.C: added/updated code for various inset-functions
9634 * src/insets/insetert.[Ch]: added implementation of InsetERT
9636 * src/insets/insettext.[Ch]: added implementation of InsetText
9638 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9639 (draw): added preliminary code for inset scrolling not finshed yet
9641 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9642 as it is in lyxfunc.C now
9644 * src/insets/lyxinset.h: Added functions for text-insets
9646 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9648 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9649 BufferView and reimplement the list as a queue put inside its own
9652 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9654 * several files: use the new interface to the "updateinsetlist"
9656 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9658 (work_area_handler): call BufferView::trippleClick on trippleclick.
9660 * src/BufferView.C (doubleClick): new function, selects word on
9662 (trippleClick): new function, selects line on trippleclick.
9664 2000-02-22 Allan Rae <rae@lyx.org>
9666 * lib/bind/xemacs.bind: buffer-previous not supported
9668 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9670 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9673 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9675 * src/bufferlist.C: get rid of current_view from this file
9677 * src/spellchecker.C: get rid of current_view from this file
9679 * src/vspace.C: get rid of current_view from this file
9680 (inPixels): added BufferView parameter for this func
9681 (asLatexCommand): added a BufferParams for this func
9683 * src/text.C src/text2.C: get rid of current_view from these
9686 * src/lyxfont.C (getFontDirection): move this function here from
9689 * src/bufferparams.C (getDocumentDirection): move this function
9692 * src/paragraph.C (getParDirection): move this function here from
9694 (getLetterDirection): ditto
9696 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9698 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9699 resize due to wrong pixmap beeing used. Also took the opurtunity
9700 to make the LyXScreen stateless on regard to WorkArea and some
9701 general cleanup in the same files.
9703 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9705 * src/Makefile.am: add missing direction.h
9707 * src/PainterBase.h: made the width functions const.
9709 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9712 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9714 * src/insets/insetlatexaccent.C (draw): make the accents draw
9715 better, at present this will only work well with iso8859-1.
9717 * several files: remove the old drawing code, now we use the new
9720 * several files: remove support for mono_video, reverse_video and
9723 2000-02-17 Juergen Vigna <jug@sad.it>
9725 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9726 int ** as we have to return the pointer, otherwise we have only
9727 NULL pointers in the returning function.
9729 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9731 * src/LaTeX.C (operator()): quote file name when running latex.
9733 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9735 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9736 (bubble tip), this removes our special handling of this.
9738 * Remove all code that is unused now that we have the new
9739 workarea. (Code that are not active when NEW_WA is defined.)
9741 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9743 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9745 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9746 nonexisting layout; correctly redirect obsoleted layouts.
9748 * lib/lyxrc.example: document \view_dvi_paper_option
9750 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9753 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9754 (PreviewDVI): handle the view_dvi_paper_option variable.
9755 [Both from Roland Krause]
9757 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9759 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9760 char const *, int, LyXFont)
9761 (text(int, int, string, LyXFont)): ditto
9763 * src/text.C (InsertCharInTable): attempt to fix the double-space
9764 feature in tables too.
9765 (BackspaceInTable): ditto.
9766 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9768 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9770 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9772 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9773 newly found text in textcache to this.
9774 (buffer): set the owner of the text put into the textcache to 0
9776 * src/insets/figinset.C (draw): fixed the drawing of figures with
9779 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9780 drawing of mathframe, hfills, protected space, table lines. I have
9781 now no outstanding drawing problems with the new Painter code.
9783 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9785 * src/PainterBase.C (ellipse, circle): do not specify the default
9788 * src/LColor.h: add using directive.
9790 * src/Painter.[Ch]: change return type of methods from Painter& to
9791 PainterBase&. Add a using directive.
9793 * src/WorkArea.C: wrap xforms callbacks in C functions
9796 * lib/layouts/foils.layout: font fix and simplifications from Carl
9799 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9801 * a lot of files: The Painter, LColor and WorkArea from the old
9802 devel branch has been ported to lyx-devel. Some new files and a
9803 lot of #ifdeffed code. The new workarea is enabled by default, but
9804 if you want to test the new Painter and LColor you have to compile
9805 with USE_PAINTER defined (do this in config.h f.ex.) There are
9806 still some rought edges, and I'd like some help to clear those
9807 out. It looks stable (loads and displays the Userguide very well).
9810 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9812 * src/buffer.C (pop_tag): revert to the previous implementation
9813 (use a global variable for both loops).
9815 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9817 * src/lyxrc.C (LyXRC): change slightly default date format.
9819 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9820 there is an English text with a footnote that starts with a Hebrew
9821 paragraph, or vice versa.
9822 (TeXFootnote): ditto.
9824 * src/text.C (LeftMargin): allow for negative values for
9825 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9828 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9829 for input encoding (cyrillic)
9831 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9833 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9836 * src/toolbar.C (set): ditto
9837 * src/insets/insetbib.C (create_form_citation_form): ditto
9839 * lib/CREDITS: added Dekel Tsur.
9841 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9842 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9843 hebrew supports files from Dekel Tsur.
9845 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9846 <tzafrir@technion.ac.il>
9848 * src/lyxrc.C: put \date_insert_format at the right place.
9850 * src/buffer.C (makeLaTeXFile): fix the handling of
9851 BufferParams::sides when writing out latex files.
9853 * src/BufferView2.C: add a "using" directive.
9855 * src/support/lyxsum.C (sum): when we use lyxstring,
9856 ostringstream::str needs an additional .c_str().
9858 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9860 * src/support/filetools.C (ChangeExtension): patch from Etienne
9863 * src/TextCache.C (show): remove const_cast and make second
9864 parameter non-const LyXText *.
9866 * src/TextCache.h: use non const LyXText in show.
9868 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9871 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9873 * src/support/lyxsum.C: rework to be more flexible.
9875 * several places: don't check if a pointer is 0 if you are going
9878 * src/text.C: remove some dead code.
9880 * src/insets/figinset.C: remove some dead code
9882 * src/buffer.C: move the BufferView funcs to BufferView2.C
9883 remove all support for insetlatexdel
9884 remove support for oldpapersize stuff
9885 made some member funcs const
9887 * src/kbmap.C: use a std::list to store the bindings in.
9889 * src/BufferView2.C: new file
9891 * src/kbsequence.[Ch]: new files
9893 * src/LyXAction.C + others: remove all trace of buffer-previous
9895 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9896 only have one copy in the binary of this table.
9898 * hebrew patch: moved some functions from LyXText to more
9899 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9901 * several files: remove support for XForms older than 0.88
9903 remove some #if 0 #endif code
9905 * src/TextCache.[Ch]: new file. Holds the textcache.
9907 * src/BufferView.C: changes to use the new TextCache interface.
9908 (waitForX): remove the now unused code.
9910 * src/BackStack.h: remove some commented code
9912 * lib/bind/emacs.bind: remove binding for buffer-previous
9914 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9916 * applied the hebrew patch.
9918 * src/lyxrow.h: make sure that all Row variables are initialized.
9920 * src/text2.C (TextHandleUndo): comment out a delete, this might
9921 introduce a memory leak, but should also help us to not try to
9922 read freed memory. We need to look at this one.
9924 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9925 (LyXParagraph): initalize footnotekind.
9927 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9928 forgot this when applying the patch. Please heed the warnings.
9930 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9931 (aka. reformat problem)
9933 * src/bufferlist.C (exists): made const, and use const_iterator
9934 (isLoaded): new func.
9935 (release): use std::find to find the correct buffer.
9937 * src/bufferlist.h: made getState a const func.
9938 made empty a const func.
9939 made exists a const func.
9942 2000-02-01 Juergen Vigna <jug@sad.it>
9944 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9946 * po/it.po: updated a bit the italian po file and also changed the
9947 'file nuovo' for newfile to 'filenuovo' without a space, this did
9950 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9951 for the new insert_date command.
9953 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9954 from jdblair, to insert a date into the current text conforming to
9955 a strftime format (for now only considering the locale-set and not
9956 the document-language).
9958 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9960 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9961 Bounds Read error seen by purify. The problem was that islower is
9962 a macros which takes an unsigned char and uses it as an index for
9963 in array of characters properties (and is thus subject to the
9967 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9968 correctly the paper sides radio buttons.
9969 (UpdateDocumentButtons): ditto.
9971 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9973 * src/kbmap.C (getsym + others): change to return unsigned int,
9974 returning a long can give problems on 64 bit systems. (I assume
9975 that int is 32bit on 64bit systems)
9977 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9979 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9980 LyXLookupString to be zero-terminated. Really fixes problems seen
9983 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9985 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9986 write a (char*)0 to the lyxerr stream.
9988 * src/lastfiles.C: move algorithm before the using statemets.
9990 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9992 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9993 complains otherwise).
9994 * src/table.C: ditto
9996 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9999 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10000 that I removed earlier... It is really needed.
10002 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10004 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10006 * INSTALL: update xforms home page URL.
10008 * lib/configure.m4: fix a bug with unreadable layout files.
10010 * src/table.C (calculate_width_of_column): add "using std::max"
10013 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10015 * several files: marked several lines with "DEL LINE", this is
10016 lines that can be deleted without changing anything.
10017 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10018 checks this anyway */
10021 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10023 * src/DepTable.C (update): add a "+" at the end when the checksum
10024 is different. (debugging string only)
10026 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10027 the next inset to not be displayed. This should also fix the list
10028 of labels in the "Insert Crossreference" dialog.
10030 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10032 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10033 when regex was not found.
10035 * src/support/lstrings.C (lowercase): use handcoded transform always.
10038 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10039 old_cursor.par->prev could be 0.
10041 * several files: changed post inc/dec to pre inc/dec
10043 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10044 write the lastfiles to file.
10046 * src/BufferView.C (buffer): only show TextCache info when debugging
10048 (resizeCurrentBuffer): ditto
10049 (workAreaExpose): ditto
10051 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10053 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10055 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10056 a bit better by removing the special case for \i and \j.
10058 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10060 * src/lyx_main.C (easyParse): remove test for bad comand line
10061 options, since this broke all xforms-related parsing.
10063 * src/kbmap.C (getsym): set return type to unsigned long, as
10064 declared in header. On an alpha, long is _not_ the same as int.
10066 * src/support/LOstream.h: add a "using std::flush;"
10068 * src/insets/figinset.C: ditto.
10070 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10072 * src/bufferlist.C (write): use blinding fast file copy instead of
10073 "a char at a time", now we are doing it the C++ way.
10075 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10076 std::list<int> instead.
10077 (addpidwait): reflect move to std::list<int>
10078 (sigchldchecker): ditto
10080 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10083 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10084 that obviously was wrong...
10086 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10087 c, this avoids warnings with purify and islower.
10089 * src/insets/figinset.C: rename struct queue to struct
10090 queue_element and rewrite to use a std::queue. gsqueue is now a
10091 std::queue<queue_element>
10092 (runqueue): reflect move to std::queue
10095 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10096 we would get "1" "0" instead of "true" "false. Also make the tostr
10099 2000-01-21 Juergen Vigna <jug@sad.it>
10101 * src/buffer.C (writeFileAscii): Disabled code for special groff
10102 handling of tabulars till I fix this in table.C
10104 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10106 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10108 * src/support/lyxlib.h: ditto.
10110 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10112 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10113 and 'j' look better. This might fix the "macron" bug that has been
10116 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10117 functions as one template function. Delete the old versions.
10119 * src/support/lyxsum.C: move using std::ifstream inside
10122 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10125 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10127 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10129 * src/insets/figinset.C (InitFigures): use new instead of malloc
10130 to allocate memory for figures and bitmaps.
10131 (DoneFigures): use delete[] instead of free to deallocate memory
10132 for figures and bitmaps.
10133 (runqueue): use new to allocate
10134 (getfigdata): use new/delete[] instead of malloc/free
10135 (RegisterFigure): ditto
10137 * some files: moved some declarations closer to first use, small
10138 whitespace changes use preincrement instead of postincrement where
10139 it does not make a difference.
10141 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10142 step on the way to use stl::containers for key maps.
10144 * src/bufferlist.h: add a typedef for const_iterator and const
10145 versions of begin and end.
10147 * src/bufferlist.[Ch]: change name of member variable _state to
10148 state_. (avoid reserved names)
10150 (getFileNames): returns the filenames of the buffers in a vector.
10152 * configure.in (ALL_LINGUAS): added ro
10154 * src/support/putenv.C: new file
10156 * src/support/mkdir.C: new file
10158 2000-01-20 Allan Rae <rae@lyx.org>
10160 * lib/layouts/IEEEtran.layout: Added several theorem environments
10162 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10163 couple of minor additions.
10165 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10166 (except for those in footnotes of course)
10168 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10170 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10172 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10173 std::sort and std::lower_bound instead of qsort and handwritten
10175 (struct compara): struct that holds the functors used by std::sort
10176 and std::lower_bound in MathedLookupBOP.
10178 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10180 * src/support/LAssert.h: do not do partial specialization. We do
10181 not really need it.
10183 * src/support/lyxlib.h: note that lyx::getUserName() and
10184 lyx::date() are not in use right now. Should these be suppressed?
10186 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10187 (makeLinuxDocFile): do not put date and user name in linuxdoc
10190 * src/support/lyxlib.h (kill): change first argument to long int,
10191 since that's what solaris uses.
10193 * src/support/kill.C (kill): fix declaration to match prototype.
10195 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10196 actually check whether namespaces are supported. This is not what
10199 * src/support/lyxsum.C: add a using directive.
10201 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10203 * src/support/kill.C: if we have namespace support we don't have
10204 to include lyxlib.h.
10206 * src/support/lyxlib.h: use namespace lyx if supported.
10208 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10210 * src/support/date.C: new file
10212 * src/support/chdir.C: new file
10214 * src/support/getUserName.C: new file
10216 * src/support/getcwd.C: new file
10218 * src/support/abort.C: new file
10220 * src/support/kill.C: new file
10222 * src/support/lyxlib.h: moved all the functions in this file
10223 insede struct lyx. Added also kill and abort to this struct. This
10224 is a way to avoid the "kill is not defined in <csignal>", we make
10225 C++ wrappers for functions that are not ANSI C or ANSI C++.
10227 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10228 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10229 lyx it has been renamed to sum.
10231 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10233 * src/text.C: add using directives for std::min and std::max.
10235 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10237 * src/texrow.C (getIdFromRow): actually return something useful in
10238 id and pos. Hopefully fixes the bug with positionning of errorbox
10241 * src/lyx_main.C (easyParse): output an error and exit if an
10242 incorrect command line option has been given.
10244 * src/spellchecker.C (ispell_check_word): document a memory leak.
10246 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10247 where a "struct utimbuf" is allocated with "new" and deleted with
10250 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10252 * src/text2.C (CutSelection): don't delete double spaces.
10253 (PasteSelection): ditto
10254 (CopySelection): ditto
10256 * src/text.C (Backspace): don't delete double spaces.
10258 * src/lyxlex.C (next): fix a bug that were only present with
10259 conformant std::istream::get to read comment lines, use
10260 std::istream::getline instead. This seems to fix the problem.
10262 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10264 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10265 allowed to insert space before space" editing problem. Please read
10266 commends at the beginning of the function. Comments about usage
10269 * src/text.C (InsertChar): fix for the "not allowed to insert
10270 space before space" editing problem.
10272 * src/text2.C (DeleteEmptyParagraphMechanism): when
10273 IsEmptyTableRow can only return false this last "else if" will
10274 always be a no-op. Commented out.
10276 * src/text.C (RedoParagraph): As far as I can understand tmp
10277 cursor is not really needed.
10279 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10280 present it could only return false anyway.
10281 (several functions): Did something not so smart...added a const
10282 specifier on a lot of methods.
10284 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10285 and add a tmp->text.resize. The LyXParagraph constructor does the
10287 (BreakParagraphConservative): ditto
10289 * src/support/path.h (Path): add a define so that the wrong usage
10290 "Path("/tmp") will be flagged as a compilation error:
10291 "`unnamed_Path' undeclared (first use this function)"
10293 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10295 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10296 which was bogus for several reasons.
10298 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10300 (runBibTeX): ditto.
10302 * autogen.sh: do not use "type -path" (what's that anyway?).
10304 * src/support/filetools.C (findtexfile): remove extraneous space
10305 which caused a kpsewhich warning (at least with kpathsea version
10308 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10310 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10312 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10314 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10316 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10318 * src/paragraph.C (BreakParagraph): do not reserve space on text
10319 if we don't need to (otherwise, if pos_end < pos, we end up
10320 reserving huge amounts of memory due to bad unsigned karma).
10321 (BreakParagraphConservative): ditto, although I have not seen
10322 evidence the bug can happen here.
10324 * src/lyxparagraph.h: add a using std::list.
10326 2000-01-11 Juergen Vigna <jug@sad.it>
10328 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10329 could not be found.
10331 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10333 * src/vc-backend.C (doVCCommand): change to be static and take one
10334 more parameter: the path to chdir too be fore executing the command.
10335 (retrive): new function equiv to "co -r"
10337 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10338 file_not_found_hook is true.
10340 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10342 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10343 if a file is readwrite,readonly...anything else.
10345 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10347 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10348 (CreatePostscript): name change from MenuRunDVIPS (or something)
10349 (PreviewPostscript): name change from MenuPreviewPS
10350 (PreviewDVI): name change from MenuPreviewDVI
10352 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10353 \view_pdf_command., \pdf_to_ps_command
10355 * lib/configure.m4: added search for PDF viewer, and search for
10356 PDF to PS converter.
10357 (lyxrc.defaults output): add \pdflatex_command,
10358 \view_pdf_command and \pdf_to_ps_command.
10360 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10362 * src/bufferlist.C (write): we don't use blocksize for anything so
10365 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10367 * src/support/block.h: disable operator T* (), since it causes
10368 problems with both compilers I tried. See comments in the file.
10370 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10373 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10374 variable LYX_DIR_10x to LYX_DIR_11x.
10376 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10378 * INSTALL: document --with-lyxname.
10381 * configure.in: new configure flag --with-lyxname which allows to
10382 choose the name under which lyx is installed. Default is "lyx", of
10383 course. It used to be possible to do this with --program-suffix,
10384 but the later has in fact a different meaning for autoconf.
10386 * src/support/lstrings.h (lstrchr): reformat a bit.
10388 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10389 * src/mathed/math_defs.h: ditto.
10391 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10393 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10394 true, decides if we create a backup file or not when saving. New
10395 tag and variable \pdf_mode, defaults to false. New tag and
10396 variable \pdflatex_command, defaults to pdflatex. New tag and
10397 variable \view_pdf_command, defaults to xpdf. New tag and variable
10398 \pdf_to_ps_command, defaults to pdf2ps.
10400 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10402 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10403 does not have a BufferView.
10404 (unlockInset): ditto + don't access the_locking_inset if the
10405 buffer does not have a BufferView.
10407 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10408 certain circumstances so that we don't continue a keyboard
10409 operation long after the key was released. Try f.ex. to load a
10410 large document, press PageDown for some seconds and then release
10411 it. Before this change the document would contine to scroll for
10412 some time, with this change it stops imidiatly.
10414 * src/support/block.h: don't allocate more space than needed. As
10415 long as we don't try to write to the arr[x] in a array_type arr[x]
10416 it is perfectly ok. (if you write to it you might segfault).
10417 added operator value_type*() so that is possible to pass the array
10418 to functions expecting a C-pointer.
10420 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10423 * intl/*: updated to gettext 0.10.35, tried to add our own
10424 required modifications. Please verify.
10426 * po/*: updated to gettext 0.10.35, tried to add our own required
10427 modifications. Please verify.
10429 * src/support/lstrings.C (tostr): go at fixing the problem with
10430 cxx and stringstream. When stringstream is used return
10431 oss.str().c_str() so that problems with lyxstring and basic_string
10432 are avoided. Note that the best solution would be for cxx to use
10433 basic_string all the way, but it is not conformant yet. (it seems)
10435 * src/lyx_cb.C + other files: moved several global functions to
10436 class BufferView, some have been moved to BufferView.[Ch] others
10437 are still located in lyx_cb.C. Code changes because of this. (part
10438 of "get rid of current_view project".)
10440 * src/buffer.C + other files: moved several Buffer functions to
10441 class BufferView, the functions are still present in buffer.C.
10442 Code changes because of this.
10444 * config/lcmessage.m4: updated to most recent. used when creating
10447 * config/progtest.m4: updated to most recent. used when creating
10450 * config/gettext.m4: updated to most recent. applied patch for
10453 * config/gettext.m4.patch: new file that shows what changes we
10454 have done to the local copy of gettext.m4.
10456 * config/libtool.m4: new file, used in creation of acinclude.m4
10458 * config/lyxinclude.m4: new file, this is the lyx created m4
10459 macros, used in making acinclude.m4.
10461 * autogen.sh: GNU m4 discovered as a separate task not as part of
10462 the lib/configure creation.
10463 Generate acinlucde from files in config. Actually cat
10464 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10465 easier to upgrade .m4 files that really are external.
10467 * src/Spacing.h: moved using std::istringstream to right after
10468 <sstream>. This should fix the problem seen with some compilers.
10470 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10472 * src/lyx_cb.C: began some work to remove the dependency a lot of
10473 functions have on BufferView::text, even if not really needed.
10474 (GetCurrentTextClass): removed this func, it only hid the
10477 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10478 forgot this in last commit.
10480 * src/Bullet.C (bulletEntry): use static char const *[] for the
10481 tables, becuase of this the return arg had to change to string.
10482 (bulletSize): ditto
10483 (~Bullet): removed unneeded destructor
10485 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10486 (insetSleep): moved from Buffer
10487 (insetWakeup): moved from Buffer
10488 (insetUnlock): moved from Buffer
10490 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10491 from Buffer to BufferView.
10493 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10495 * config/ltmain.sh: updated to version 1.3.4 of libtool
10497 * config/ltconfig: updated to version 1.3.4 of libtool
10499 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10502 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10503 Did I get that right?
10505 * src/lyxlex.h: add a "using" directive or two.
10506 * src/Spacing.h: ditto.
10507 * src/insets/figinset.C: ditto.
10508 * src/support/filetools.C: ditto.
10509 * src/support/lstrings.C: ditto.
10510 * src/BufferView.C: ditto.
10511 * src/bufferlist.C: ditto.
10512 * src/lyx_cb.C: ditto.
10513 * src/lyxlex.C: ditto.
10515 * NEWS: add some changes for 1.1.4.
10517 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10519 * src/BufferView.C: first go at a TextCache to speed up switching
10522 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10524 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10525 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10526 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10527 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10530 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10531 members of the struct are correctly initialized to 0 (detected by
10533 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10534 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10536 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10537 pidwait, since it was allocated with "new". This was potentially
10538 very bad. Thanks to Michael Schmitt for running purify for us.
10541 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10543 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10545 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10547 1999-12-30 Allan Rae <rae@lyx.org>
10549 * lib/templates/IEEEtran.lyx: minor change
10551 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10552 src/mathed/formula.C (LocalDispatch): askForText changes
10554 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10555 know when a user has cancelled input. Fixes annoying problems with
10556 inserting labels and version control.
10558 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10560 * src/support/lstrings.C (tostr): rewritten to use strstream and
10563 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10565 * src/support/filetools.C (IsFileWriteable): use fstream to check
10566 (IsDirWriteable): use fileinfo to check
10568 * src/support/filetools.h (FilePtr): whole class deleted
10570 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10572 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10574 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10576 * src/bufferlist.C (write): use ifstream and ofstream instead of
10579 * src/Spacing.h: use istrstream instead of sscanf
10581 * src/mathed/math_defs.h: change first arg to istream from FILE*
10583 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10585 * src/mathed/math_parser.C: have yyis to be an istream
10586 (LexGetArg): use istream (yyis)
10588 (mathed_parse): ditto
10589 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10591 * src/mathed/formula.C (Read): rewritten to use istream
10593 * src/mathed/formulamacro.C (Read): rewritten to use istream
10595 * src/lyxlex.h (~LyXLex): deleted desturctor
10596 (getStream): new function, returns an istream
10597 (getFile): deleted funtion
10598 (IsOK): return is.good();
10600 * src/lyxlex.C (LyXLex): delete file and owns_file
10601 (setFile): open an filebuf and assign that to a istream instead of
10603 (setStream): new function, takes an istream as arg.
10604 (setFile): deleted function
10605 (EatLine): rewritten us use istream instead of FILE*
10609 * src/table.C (LyXTable): use istream instead of FILE*
10610 (Read): rewritten to take an istream instead of FILE*
10612 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10614 * src/buffer.C (Dispatch): remove an extraneous break statement.
10616 * src/support/filetools.C (QuoteName): change to do simple
10617 'quoting'. More work is necessary. Also changed to do nothing
10618 under emx (needs fix too).
10619 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10621 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10622 config.h.in to the AC_DEFINE_UNQUOTED() call.
10623 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10624 needs char * as argument (because Solaris 7 declares it like
10627 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10628 remove definition of BZERO.
10630 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10632 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10633 defined, "lyxregex.h" if not.
10635 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10637 (REGEX): new variable that is set to regex.c lyxregex.h when
10638 AM_CONDITIONAL USE_REGEX is set.
10639 (libsupport_la_SOURCES): add $(REGEX)
10641 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10644 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10647 * configure.in: add call to LYX_REGEX
10649 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10650 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10652 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10654 * lib/bind/fi_menus.bind: new file, from
10655 pauli.virtanen@saunalahti.fi.
10657 * src/buffer.C (getBibkeyList): pass the parameter delim to
10658 InsetInclude::getKeys and InsetBibtex::getKeys.
10660 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10661 is passed to Buffer::getBibkeyList
10663 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10664 instead of the hardcoded comma.
10666 * src/insets/insetbib.C (getKeys): make sure that there are not
10667 leading blanks in bibtex keys. Normal latex does not care, but
10668 harvard.sty seems to dislike blanks at the beginning of citation
10669 keys. In particular, the retturn value of the function is
10671 * INSTALL: make it clear that libstdc++ is needed and that gcc
10672 2.7.x probably does not work.
10674 * src/support/filetools.C (findtexfile): make debug message go to
10676 * src/insets/insetbib.C (getKeys): ditto
10678 * src/debug.C (showTags): make sure that the output is correctly
10681 * configure.in: add a comment for TWO_COLOR_ICON define.
10683 * acconfig.h: remove all the entries that already defined in
10684 configure.in or acinclude.m4.
10686 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10687 to avoid user name, date and copyright.
10689 1999-12-21 Juergen Vigna <jug@sad.it>
10691 * src/table.C (Read): Now read bogus row format informations
10692 if the format is < 5 so that afterwards the table can
10693 be read by lyx but without any format-info. Fixed the
10694 crash we experienced when not doing this.
10696 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10698 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10699 (RedoDrawingOfParagraph): ditto
10700 (RedoParagraphs): ditto
10701 (RemoveTableRow): ditto
10703 * src/text.C (Fill): rename arg paperwidth -> paper_width
10705 * src/buffer.C (insertLyXFile): rename var filename -> fname
10706 (writeFile): rename arg filename -> fname
10707 (writeFileAscii): ditto
10708 (makeLaTeXFile): ditto
10709 (makeLinuxDocFile): ditto
10710 (makeDocBookFile): ditto
10712 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10715 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10717 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10720 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10721 compiled by a C compiler not C++.
10723 * src/layout.h (LyXTextClass): added typedef for const_iterator
10724 (LyXTextClassList): added typedef for const_iterator + member
10725 functions begin and end.
10727 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10728 iterators to fill the choice_class.
10729 (updateLayoutChoice): rewritten to use iterators to fill the
10730 layoutlist in the toolbar.
10732 * src/BufferView.h (BufferView::work_area_width): removed unused
10735 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10737 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10738 (sgmlCloseTag): ditto
10740 * src/support/lstrings.h: return type of countChar changed to
10743 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10744 what version of this func to use. Also made to return unsigned int.
10746 * configure.in: call LYX_STD_COUNT
10748 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10749 conforming std::count.
10751 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10753 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10754 and a subscript would give bad display (patch from Dekel Tsur
10755 <dekel@math.tau.ac.il>).
10757 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10759 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10762 * src/chset.h: add a few 'using' directives
10764 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10765 triggered when no buffer is active
10767 * src/layout.C: removed `break' after `return' in switch(), since
10770 * src/lyx_main.C (init): make sure LyX can be ran in place even
10771 when libtool has done its magic with shared libraries. Fix the
10772 test for the case when the system directory has not been found.
10774 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10775 name for the latex file.
10776 (MenuMakeHTML): ditto
10778 * src/buffer.h: add an optional boolean argument, which is passed
10779 to ChangeExtension.
10781 1999-12-20 Allan Rae <rae@lyx.org>
10783 * lib/templates/IEEEtran.lyx: small correction and update.
10785 * configure.in: Attempted to use LYX_PATH_HEADER
10787 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10789 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10790 input from JMarc. Now use preprocessor to find the header.
10791 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10792 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10793 LYX_STL_STRING_FWD. See comments in file.
10795 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10797 * The global MiniBuffer * minibuffer variable is dead.
10799 * The global FD_form_main * fd_form_main variable is dead.
10801 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10803 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10805 * src/table.h: add the LOstream.h header
10806 * src/debug.h: ditto
10808 * src/LyXAction.h: change the explaination of the ReadOnly
10809 attribute: is indicates that the function _can_ be used.
10811 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10814 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10816 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10822 * src/paragraph.C (GetWord): assert on pos>=0
10825 * src/support/lyxstring.C: condition the use of an invariant on
10827 * src/support/lyxstring.h: ditto
10829 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10830 Use LAssert.h instead of plain assert().
10832 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10834 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10835 * src/support/filetools.C: ditto
10837 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10840 * INSTALL: document the new configure flags
10842 * configure.in: suppress --with-debug; add --enable-assertions
10844 * acinclude.m4: various changes in alignment of help strings.
10846 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10848 * src/kbmap.C: commented out the use of the hash map in kb_map,
10849 beginning of movement to a stl::container.
10851 * several files: removed code that was not in effect when
10852 MOVE_TEXT was defined.
10854 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10855 for escaping should not be used. We can discuss if the string
10856 should be enclosed in f.ex. [] instead of "".
10858 * src/trans_mgr.C (insert): use the new returned value from
10859 encodeString to get deadkeys and keymaps done correctly.
10861 * src/chset.C (encodeString): changed to return a pair, to tell
10862 what to use if we know the string.
10864 * src/lyxscreen.h (fillArc): new function.
10866 * src/FontInfo.C (resize): rewritten to use more std::string like
10867 structore, especially string::replace.
10869 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10872 * configure.in (chmod +x some scripts): remove config/gcc-hack
10874 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10876 * src/buffer.C (writeFile): change once again the top comment in a
10877 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10878 instead of an hardcoded version number.
10879 (makeDocBookFile): ditto
10881 * src/version.h: add new define LYX_DOCVERSION
10883 * po/de.po: update from Pit Sütterlin
10884 * lib/bind/de_menus.bind: ditto.
10886 * src/lyxfunc.C (Dispatch): call MenuExport()
10887 * src/buffer.C (Dispatch): ditto
10889 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10890 LyXFunc::Dispatch().
10891 (MenuExport): new function, moved from
10892 LyXFunc::Dispatch().
10894 * src/trans_mgr.C (insert): small cleanup
10895 * src/chset.C (loadFile): ditto
10897 * lib/kbd/iso8859-1.cdef: add missing backslashes
10899 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10901 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10902 help with placing the manually drawn accents better.
10904 (Draw): x2 and hg changed to float to minimize rounding errors and
10905 help place the accents better.
10907 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10908 unsigned short to char is just wrong...cast the char to unsigned
10909 char instead so that the two values can compare sanely. This
10910 should also make the display of insetlatexaccents better and
10911 perhaps also some other insets.
10913 (lbearing): new function
10916 1999-12-15 Allan Rae <rae@lyx.org>
10918 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10919 header that provides a wrapper around the very annoying SGI STL header
10922 * src/support/lyxstring.C, src/LString.h:
10923 removed old SGI-STL-compatability attempts.
10925 * configure.in: Use LYX_STL_STRING_FWD.
10927 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10928 stl_string_fwd.h is around and try to determine it's location.
10929 Major improvement over previous SGI STL 3.2 compatability.
10930 Three small problems remain with this function due to my zero
10931 knowledge of autoconf. JMarc and lgb see the comments in the code.
10933 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10935 * src/broken_const.h, config/hack-gcc, config/README: removed
10937 * configure.in: remove --with-gcc-hack option; do not call
10940 * INSTALL: remove documentation of --with-broken-const and
10943 * acconfig.h: remove all trace of BROKEN_CONST define
10945 * src/buffer.C (makeDocBookFile): update version number in output
10947 (SimpleDocBookOnePar): fix an assert when trying to a character
10948 access beyond string length
10951 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10953 * po/de.po: fix the Export menu
10955 * lyx.man: update the description of -dbg
10957 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10958 (commandLineHelp): updated
10959 (easyParse): show list of available debug levels if -dbg is passed
10962 * src/Makefile.am: add debug.C
10964 * src/debug.h: moved some code to debug.C
10966 * src/debug.C: new file. Contains code to set and show debug
10969 * src/layout.C: remove 'break' after 'continue' in switch
10970 statements, since these cannot be reached.
10972 1999-12-13 Allan Rae <rae@lyx.org>
10974 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10975 (in_word_set): hash() -> math_hash()
10977 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10979 * acconfig.h: Added a test for whether we are using exceptions in the
10980 current compilation run. If so USING_EXCEPTIONS is defined.
10982 * config.in: Check for existance of stl_string_fwd.h
10983 * src/LString.h: If compiling --with-included-string and SGI's
10984 STL version 3.2 is present (see above test) we need to block their
10985 forward declaration of string and supply a __get_c_string().
10986 However, it turns out this is only necessary if compiling with
10987 exceptions enabled so I've a bit more to add yet.
10989 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10990 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10991 src/support/LRegex.h, src/undo.h:
10992 Shuffle the order of the included files a little to ensure that
10993 LString.h gets included before anything that includes stl_string_fwd.h
10995 * src/support/lyxstring.C: We need to #include LString.h instead of
10996 lyxstring.h to get the necessary definition of __get_c_string.
10997 (__get_c_string): New function. This is defined static just like SGI's
10998 although why they need to do this I'm not sure. Perhaps it should be
10999 in lstrings.C instead.
11001 * lib/templates/IEEEtran.lyx: New template file.
11003 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11005 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11006 * intl/Makefile.in (MKINSTALLDIRS): ditto
11008 * src/LyXAction.C (init): changed to hold the LFUN data in a
11009 automatic array in stead of in callso to newFunc, this speeds up
11010 compilation a lot. Also all the memory used by the array is
11011 returned when the init is completed.
11013 * a lot of files: compiled with -Wold-style-cast, changed most of
11014 the reported offenders to C++ style casts. Did not change the
11015 offenders in C files.
11017 * src/trans.h (Match): change argument type to unsigned int.
11019 * src/support/DebugStream.C: fix some types on the streambufs so
11020 that it works on a conforming implementation.
11022 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11024 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11026 * src/support/lyxstring.C: remove the inline added earlier since
11027 they cause a bunch of unsatisfied symbols when linking with dec
11028 cxx. Cxx likes to have the body of inlines at the place where they
11031 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11032 accessing negative bounds in array. This fixes the crash when
11033 inserting accented characters.
11034 * src/trans.h (Match): ditto
11036 * src/buffer.C (Dispatch): since this is a void, it should not try
11037 to return anything...
11039 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11041 * src/buffer.h: removed the two friends from Buffer. Some changes
11042 because of this. Buffer::getFileName and Buffer::setFileName
11043 renamed to Buffer::fileName() and Buffer::fileName(...).
11045 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11047 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11048 and Buffer::update(short) to BufferView. This move is currently
11049 controlled by a define MOVE_TEXT, this will be removed when all
11050 shows to be ok. This move paves the way for better separation
11051 between buffer contents and buffer view. One side effect is that
11052 the BufferView needs a rebreak when swiching buffers, if we want
11053 to avoid this we can add a cache that holds pointers to LyXText's
11054 that is not currently in use.
11056 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11059 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11061 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11063 * lyx_main.C: new command line option -x (or --execute) and
11064 -e (or --export). Now direct conversion from .lyx to .tex
11065 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11066 Unfortunately, X is still needed and the GUI pops up during the
11069 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11071 * src/Spacing.C: add a using directive to bring stream stuff into
11073 * src/paragraph.C: ditto
11074 * src/buffer.C: ditto
11076 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11077 from Lars' announcement).
11079 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11080 example files from Tino Meinen.
11082 1999-12-06 Allan Rae <rae@lyx.org>
11084 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11086 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11088 * src/support/lyxstring.C: added a lot of inline for no good
11091 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11092 latexWriteEndChanges, they were not used.
11094 * src/layout.h (operator<<): output operator for PageSides
11096 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11098 * some example files: loaded in LyX 1.0.4 and saved again to update
11099 certain constructs (table format)
11101 * a lot of files: did the change to use fstream/iostream for all
11102 writing of files. Done with a close look at Andre Poenitz's patch.
11104 * some files: whitespace changes.
11106 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11108 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11109 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11110 architecture, we provide our own. It is used unconditionnally, but
11111 I do not think this is a performance problem. Thanks to Angus
11112 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11113 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11115 (GetInset): use my_memcpy.
11119 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11120 it is easier to understand, but it uses less TeX-only constructs now.
11122 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11123 elements contain spaces
11125 * lib/configure: regenerated
11127 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11128 elements contain spaces; display the list of programs that are
11131 * autogen.sh: make sure lib/configure is executable
11133 * lib/examples/*: rename the tutorial examples to begin with the
11134 two-letters language code.
11136 * src/lyxfunc.C (getStatus): do not query current font if no
11139 * src/lyx_cb.C (RunScript): use QuoteName
11140 (MenuRunDvips): ditto
11141 (PrintApplyCB): ditto
11143 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11144 around argument, so that it works well with the current shell.
11145 Does not work properly with OS/2 shells currently.
11147 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11148 * src/LyXSendto.C (SendtoApplyCB): ditto
11149 * src/lyxfunc.C (Dispatch): ditto
11150 * src/buffer.C (runLaTeX): ditto
11151 (runLiterate): ditto
11152 (buildProgram): ditto
11154 * src/lyx_cb.C (RunScript): ditto
11155 (MenuMakeLaTeX): ditto
11157 * src/buffer.h (getLatexName): new method
11159 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11161 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11163 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11164 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11165 (create_math_panel): ditto
11167 * src/lyxfunc.C (getStatus): re-activate the code which gets
11168 current font and cursor; add test for export to html.
11170 * src/lyxrc.C (read): remove unreachable break statements; add a
11173 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11175 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11177 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11178 introduced by faulty regex.
11179 * src/buffer.C: ditto
11180 * src/lastfiles.C: ditto
11181 * src/paragraph.C: ditto
11182 * src/table.C: ditto
11183 * src/vspace.C: ditto
11184 * src/insets/figinset.C: ditto
11185 Note: most of these is absolutely harmless, except the one in
11186 src/mathed formula.C.
11188 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11190 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11191 operation, yielding correct results for the reLyX command.
11193 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11195 * src/support/filetools.C (ExpandPath): removed an over eager
11197 (ReplaceEnvironmentPath): ditto
11199 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11200 shows that we are doing something fishy in our code...
11201 (BubblePost): ditto
11204 * src/lyxrc.C (read): use a double switch trick to get more help
11205 from the compiler. (the same trick is used in layout.C)
11206 (write): new function. opens a ofstream and pass that to output
11207 (output): new function, takes a ostream and writes the lyxrc
11208 elemts to it. uses a dummy switch to make sure no elements are
11211 * src/lyxlex.h: added a struct pushpophelper for use in functions
11212 with more than one exit point.
11214 * src/lyxlex.[Ch] (GetInteger): made it const
11218 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11220 * src/layout.[hC] : LayoutTags splitted into several enums, new
11221 methods created, better error handling cleaner use of lyxlex. Read
11224 * src/bmtable.[Ch]: change some member prototypes because of the
11225 image const changes.
11227 * commandtags.h, src/LyXAction.C (init): new function:
11228 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11229 This file is not read automatically but you can add \input
11230 preferences to your lyxrc if you want to. We need to discuss how
11233 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11234 in .aux, also remove .bib and .bst files from dependencies when
11237 * src/BufferView.C, src/LyXView.C: add const_cast several places
11238 because of changes to images.
11240 * lib/images/*: same change as for images/*
11242 * lib/lyxrc.example: Default for accept_compound is false not no.
11244 * images/*: changed to be const, however I have som misgivings
11245 about this change so it might be changed back.
11247 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11249 * lib/configure, po/POTFILES.in: regenerated
11251 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11253 * config/lib_configure.m4: removed
11255 * lib/configure.m4: new file (was config/lib_configure.m4)
11257 * configure.in: do not test for rtti, since we do not use it.
11259 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11261 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11262 doubling of allocated space scheme. This makes it faster for large
11263 strings end to use less memory for small strings. xtra rememoved.
11265 * src/insets/figinset.C (waitalarm): commented out.
11266 (GhostscriptMsg): use static_cast
11267 (GhostscriptMsg): use new instead of malloc to allocate memory for
11268 cmap. also delete the memory after use.
11270 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11272 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11273 for changes in bibtex database or style.
11274 (runBibTeX): remove all .bib and .bst files from dep before we
11276 (run): use scanAuc in when dep file already exist.
11278 * src/DepTable.C (remove_files_with_extension): new method
11279 (exist): new method
11281 * src/DepTable.[Ch]: made many of the methods const.
11283 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11285 * src/bufferparams.C: make sure that the default textclass is
11286 "article". It used to be the first one by description order, but
11287 now the first one is "docbook".
11289 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11290 string; call Debug::value.
11291 (easyParse): pass complete argument to setDebuggingLevel().
11293 * src/debug.h (value): fix the code that parses debug levels.
11295 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11298 * src/LyXAction.C: use Debug::ACTION as debug channel.
11300 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11302 * NEWS: updated for the future 1.1.3 release.
11304 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11305 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11306 it should. This is of course a controversial change (since many
11307 people will find that their lyx workscreen is suddenly full of
11308 red), but done for the sake of correctness.
11310 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11311 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11313 * src/insets/inseterror.h, src/insets/inseturl.h,
11314 src/insets/insetinfo.h, src/insets/figinset.h,
11315 src/mathed/formulamacro.h, src/mathed/math_macro.h
11316 (EditMessage): add a missing const and add _() to make sure that
11317 translation happens
11319 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11320 src/insets/insetbib.C, src/support/filetools.C: add `using'
11321 directives for cxx.
11323 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11324 doing 'Insert index of last word' at the beginning of a paragraph.
11326 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11328 * several files: white-space changes.
11330 * src/mathed/formula.C: removed IsAlpha and IsDigit
11332 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11333 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11336 * src/insets/figinset.C (GetPSSizes): don't break when
11337 "EndComments" is seen. But break when a boundingbox is read.
11339 * all classes inherited from Inset: return value of Clone
11340 changed back to Inset *.
11342 * all classes inherited form MathInset: return value of Clone
11343 changed back to MathedInset *.
11345 * src/insets/figinset.C (runqueue): use a ofstream to output the
11346 gs/ps file. Might need some setpresicion or setw. However I can
11347 see no problem with the current code.
11348 (runqueue): use sleep instead of the alarm/signal code. I just
11349 can't see the difference.
11351 * src/paragraph.C (LyXParagraph): reserve space in the new
11352 paragraph and resize the inserted paragraph to just fit.
11354 * src/lyxfunc.h (operator|=): added operator for func_status.
11356 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11357 check for readable file.
11359 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11360 check for readable file.
11361 (MenuMakeLinuxDoc): ditto
11362 (MenuMakeDocBook): ditto
11363 (MenuMakeAscii): ditto
11364 (InsertAsciiFile): split the test for openable and readable
11366 * src/bmtable.C (draw_bitmaptable): use
11367 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11369 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11370 findtexfile from LaTeX to filetools.
11372 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11373 instead of FilePtr. Needs to be verified by a literate user.
11375 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11377 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11378 (EditMessage): likewise.
11380 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11381 respectively as \textasciitilde and \textasciicircum.
11383 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11385 * src/support/lyxstring.h: made the methods that take iterators
11386 use const_iterator.
11388 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11389 (regexMatch): made is use the real regex class.
11391 * src/support/Makefile.am: changed to use libtool
11393 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11395 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11397 (MathIsInset ++): changed several macros to be inline functions
11400 * src/mathed/Makefile.am: changed to use libtool
11402 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11404 * src/insets/inset* : Clone changed to const and return type is
11405 the true insettype not just Inset*.
11407 * src/insets/Makefile.am: changed to use libtool
11409 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11411 * src/undo.[Ch] : added empty() and changed some of the method
11414 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11416 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11417 setID use block<> for the bullets array, added const several places.
11419 * src/lyxfunc.C (getStatus): new function
11421 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11422 LyXAction, added const to several funtions.
11424 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11425 a std::map, and to store the dir items in a vector.
11427 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11430 * src/LyXView.[Ch] + other files : changed currentView to view.
11432 * src/LyXAction.[Ch] : ported from the old devel branch.
11434 * src/.cvsignore: added .libs and a.out
11436 * configure.in : changes to use libtool.
11438 * acinclude.m4 : inserted libtool.m4
11440 * .cvsignore: added libtool
11442 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11444 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11445 file name in insets and mathed directories (otherwise the
11446 dependency is not taken in account under cygwin).
11448 * src/text2.C (InsertString[AB]): make sure that we do not try to
11449 read characters past the string length.
11451 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11453 * lib/doc/LaTeXConfig.lyx.in,
11454 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11456 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11457 file saying who created them and when this heppened; this is
11458 useless and annoys tools like cvs.
11460 * lib/layouts/g-brief-{en,de}.layout,
11461 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11462 from Thomas Hartkens <thomas@hartkens.de>.
11464 * src/{insets,mathed}/Makefile.am: do not declare an empty
11465 LDFLAGS, so that it can be set at configure time (useful on Irix
11468 * lib/reLyX/configure.in: make sure that the prefix is set
11469 correctly in LYX_DIR.
11471 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11473 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11474 be used by 'command-sequence' this allows to bind a key to a
11475 sequence of LyX-commands
11476 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11478 * src/LyXAction.C: add "command-sequence"
11480 * src/LyXFunction.C: handling of "command-sequence"
11482 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11483 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11485 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11487 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11489 * src/buffer.C (writeFile): Do not output a comment giving user
11490 and date at the beginning of a .lyx file. This is useless and
11491 annoys cvs anyway; update version number to 1.1.
11493 * src/Makefile.am (LYX_DIR): add this definition, so that a
11494 default path is hardcoded in LyX.
11496 * configure.in: Use LYX_GNU_GETTEXT.
11498 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11499 AM_GNU_GETTEXT with a bug fixed.
11501 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11503 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11505 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11506 which is used to point to LyX data is now LYX_DIR_11x.
11508 * lyx.man: convert to a unix text file; small updates.
11510 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11512 * src/support/LSubstring.[Ch]: made the second arg of most of the
11513 constructors be a const reference.
11515 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11518 * src/support/lyxstring.[Ch] (swap): added missing member function
11519 and specialization of swap(str, str);
11521 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11523 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11524 trace of the old one.
11526 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11527 put the member definitions in undo.C.
11529 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11530 NEW_TEXT and have now only code that was included when this was
11533 * src/intl.C (LCombo): use static_cast
11535 (DispatchCallback): ditto
11537 * src/definitions.h: removed whole file
11539 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11541 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11542 parsing and stores in a std:map. a regex defines the file format.
11543 removed unneeded members.
11545 * src/bufferparams.h: added several enums from definitions.h here.
11546 Removed unsused destructor. Changed some types to use proper enum
11547 types. use block to have the temp_bullets and user_defined_bullets
11548 and to make the whole class assignable.
11550 * src/bufferparams.C (Copy): removed this functions, use a default
11551 assignment instead.
11553 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11556 * src/buffer.C (readLyXformat2): commend out all that have with
11557 oldpapersize to do. also comment out all that hve to do with
11558 insetlatex and insetlatexdel.
11559 (setOldPaperStuff): commented out
11561 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11563 * src/LyXAction.C: remove use of inset-latex-insert
11565 * src/mathed/math_panel.C (button_cb): use static_cast
11567 * src/insets/Makefile.am (insets_o_SOURCES): removed
11570 * src/support/lyxstring.C (helper): use the unsigned long
11571 specifier, UL, instead of a static_cast.
11573 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11575 * src/support/block.h: new file. to be used as a c-style array in
11576 classes, so that the class can be assignable.
11578 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11580 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11581 NULL, make sure to return an empty string (it is not possible to
11582 set a string to NULL).
11584 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11586 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11588 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11590 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11591 link line, so that Irix users (for example) can set it explicitely to
11594 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11595 it can be overidden at make time (static or dynamic link, for
11598 * src/vc-backend.C, src/LaTeXFeatures.h,
11599 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11600 statements to bring templates to global namespace.
11602 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11604 * src/support/lyxstring.C (operator[] const): make it standard
11607 * src/minibuffer.C (Init): changed to reflect that more
11608 information is given from the lyxvc and need not be provided here.
11610 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11612 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11614 * src/LyXView.C (UpdateTimerCB): use static_cast
11615 (KeyPressMask_raw_callback): ditto
11617 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11618 buffer_, a lot of changes because of this. currentBuffer() ->
11619 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11620 also changes to other files because of this.
11622 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11624 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11625 have no support for RCS and partial support for CVS, will be
11628 * src/insets/ several files: changes because of function name
11629 changes in Bufferview and LyXView.
11631 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11633 * src/support/LSubstring.[Ch]: new files. These implement a
11634 Substring that can be very convenient to use. i.e. is this
11636 string a = "Mary had a little sheep";
11637 Substring(a, "sheep") = "lamb";
11638 a is now "Mary has a little lamb".
11640 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11641 out patterns and subpatterns of strings. It is used by LSubstring
11642 and also by vc-backend.C
11644 * src/support/lyxstring.C: went over all the assertions used and
11645 tried to correct the wrong ones and flag which of them is required
11646 by the standard. some bugs found because of this. Also removed a
11647 couple of assertions.
11649 * src/support/Makefile.am (libsupport_a_SOURCES): added
11650 LSubstring.[Ch] and LRegex.[Ch]
11652 * src/support/FileInfo.h: have struct stat buf as an object and
11653 not a pointer to one, some changes because of this.
11655 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11656 information in layout when adding the layouts preamble to the
11657 textclass preamble.
11659 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11662 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11663 because of bug in OS/2.
11665 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11667 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11668 \verbatim@font instead of \ttfamily, so that it can be redefined.
11670 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11671 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11672 src/layout.h, src/text2.C: add 'using' directive to bring the
11673 STL templates we need from the std:: namespace to the global one.
11674 Needed by DEC cxx in strict ansi mode.
11676 * src/support/LIstream.h,src/support/LOstream.h,
11677 src/support/lyxstring.h,src/table.h,
11678 src/lyxlookup.h: do not include <config.h> in header
11679 files. This should be done in the .C files only.
11681 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11685 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11687 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11688 from Kayvan to fix the tth invokation.
11690 * development/lyx.spec.in: updates from Kayvan to reflect the
11691 changes of file names.
11693 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11695 * src/text2.C (InsertStringB): use std::copy
11696 (InsertStringA): use std::copy
11698 * src/bufferlist.C: use a vector to store the buffers in. This is
11699 an internal change and should not affect any other thing.
11701 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11704 * src/text.C (Fill): fix potential bug, one off bug.
11706 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11708 * src/Makefile.am (lyx_main.o): add more files it depends on.
11710 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11712 * src/support/lyxstring.C: use size_t for the reference count,
11713 size, reserved memory and xtra.
11714 (internal_compare): new private member function. Now the compare
11715 functions should work for std::strings that have embedded '\0'
11717 (compare): all compare functions rewritten to use
11720 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11722 * src/support/lyxstring.C (compare): pass c_str()
11723 (compare): pass c_str
11724 (compare): pass c_str
11726 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11728 * src/support/DebugStream.C: <config.h> was not included correctly.
11730 * lib/configure: forgot to re-generate it :( I'll make this file
11731 auto generated soon.
11733 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11735 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11738 * src/support/lyxstring.C: some changes from length() to rep->sz.
11739 avoids a function call.
11741 * src/support/filetools.C (SpaceLess): yet another version of the
11742 algorithm...now per Jean-Marc's suggestions.
11744 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11746 * src/layout.C (less_textclass_desc): functor for use in sorting
11748 (LyXTextClass::Read): sort the textclasses after reading.
11750 * src/support/filetools.C (SpaceLess): new version of the
11751 SpaceLess functions. What problems does this one give? Please
11754 * images/banner_bw.xbm: made the arrays unsigned char *
11756 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11758 * src/support/lyxstring.C (find): remove bogus assertion in the
11759 two versions of find where this has not been done yet.
11761 * src/support/lyxlib.h: add missing int return type to
11764 * src/menus.C (ShowFileMenu): disable exporting to html if no
11765 html export command is present.
11767 * config/lib_configure.m4: add a test for an HTML converter. The
11768 programs checked for are, in this order: tth, latex2html and
11771 * lib/configure: generated from config/lib_configure.m4.
11773 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11774 html converter. The parameters are now passed through $$FName and
11775 $$OutName, instead of standard input/output.
11777 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11779 * lib/lyxrc.example: update description of \html_command.
11780 add "quotes" around \screen_font_xxx font setting examples to help
11781 people who use fonts with spaces in their names.
11783 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11785 * Distribution files: updates for v1.1.2
11787 * src/support/lyxstring.C (find): remove bogus assert and return
11788 npos for the same condition.
11790 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11792 * added patch for OS/2 from SMiyata.
11794 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11796 * src/text2.C (CutSelection): make space_wrapped a bool
11797 (CutSelection): dont declare int i until we have to.
11798 (alphaCounter): return a char const *.
11800 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11802 * src/support/syscall.C (Systemcalls::kill):
11803 src/support/filetools.C (PutEnv, PutEnvPath):
11804 src/lyx_cb.C (addNewlineAndDepth):
11805 src/FontInfo.C (FontInfo::resize): condition some #warning
11806 directives with WITH_WARNINGS.
11809 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11811 * src/layout.[Ch] + several files: access to class variables
11812 limited and made accessor functions instead a lot of code changed
11813 becuase of this. Also instead of returning pointers often a const
11814 reference is returned instead.
11816 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11818 * src/Makefile.am (dist-hook): added used to remove the CVS from
11819 cheaders upon creating a dist
11820 (EXTRA_DIST): added cheaders
11822 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11823 a character not as a small integer.
11825 * src/support/lyxstring.C (find): removed Assert and added i >=
11826 rep->sz to the first if.
11828 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11830 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11831 src/LyXView.C src/buffer.C src/bufferparams.C
11832 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11833 src/text2.C src/insets/insetinclude.C:
11834 lyxlayout renamed to textclasslist.
11836 * src/layout.C: some lyxerr changes.
11838 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11839 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11840 (LyXLayoutList): removed all traces of this class.
11841 (LyXTextClass::Read): rewrote LT_STYLE
11842 (LyXTextClass::hasLayout): new function
11843 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11844 both const and nonconst version.
11845 (LyXTextClass::delete_layout): new function.
11846 (LyXTextClassList::Style): bug fix. do the right thing if layout
11848 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11849 (LyXTextClassList::NameOfLayout): ditto
11850 (LyXTextClassList::Load): ditto
11852 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11854 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11856 * src/LyXAction.C (LookupFunc): added a workaround for sun
11857 compiler, on the other hand...we don't know if the current code
11858 compiles on sun at all...
11860 * src/support/filetools.C (CleanupPath): subst fix
11862 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11865 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11866 complained about this one?
11868 * src/insets/insetinclude.C (Latex): subst fix
11870 * src/insets/insetbib.C (getKeys): subst fix
11872 * src/LyXSendto.C (SendtoApplyCB): subst fix
11874 * src/lyx_main.C (init): subst fix
11876 * src/layout.C (Read): subst fix
11878 * src/lyx_sendfax_main.C (button_send): subst fix
11880 * src/buffer.C (RoffAsciiTable): subst fix
11882 * src/lyx_cb.C (MenuFax): subst fix
11883 (PrintApplyCB): subst fix
11885 1999-10-26 Juergen Vigna <jug@sad.it>
11887 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11889 (Read): Cleaned up this code so now we read only format vestion >= 5
11891 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11893 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11894 come nobody has complained about this one?
11896 * src/insets/insetinclude.C (Latex): subst fix
11898 * src/insets/insetbib.C (getKeys): subst fix
11900 * src/lyx_main.C (init): subst fix
11902 * src/layout.C (Read): subst fix
11904 * src/buffer.C (RoffAsciiTable): subst fix
11906 * src/lyx_cb.C (MenuFax): subst fix.
11908 * src/layout.[hC] + some other files: rewrote to use
11909 std::container to store textclasses and layouts in.
11910 Simplified, removed a lot of code. Make all classes
11911 assignable. Further simplifications and review of type
11912 use still to be one.
11914 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11915 lastfiles to create the lastfiles partr of the menu.
11917 * src/lastfiles.[Ch]: rewritten to use deque to store the
11918 lastfiles in. Uses fstream for reading and writing. Simplifies
11921 * src/support/syscall.C: remove explicit cast.
11923 * src/BufferView.C (CursorToggleCB): removed code snippets that
11924 were commented out.
11925 use explicat C++ style casts instead of C style casts. also use
11926 u_vdata instea of passing pointers in longs.
11928 * src/PaperLayout.C: removed code snippets that were commented out.
11930 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11932 * src/lyx_main.C: removed code snippets that wer commented out.
11934 * src/paragraph.C: removed code snippets that were commented out.
11936 * src/lyxvc.C (logClose): use static_cast
11938 (viewLog): remove explicit cast to void*
11939 (showLog): removed old commented code
11941 * src/menus.C: use static_cast instead of C style casts. use
11942 u_vdata instead of u_ldata. remove explicit cast to (long) for
11943 pointers. Removed old code that was commented out.
11945 * src/insets/inset.C: removed old commented func
11947 * src/insets/insetref.C (InsetRef): removed old code that had been
11948 commented out for a long time.
11950 (escape): removed C style cast
11952 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11954 * src/insets/insetlatex.C (Draw): removed old commented code
11955 (Read): rewritten to use string
11957 * src/insets/insetlabel.C (escape): removed C style cast
11959 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11961 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11962 old commented code.
11964 * src/insets/insetinclude.h: removed a couple of stupid bools
11966 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11967 (Clone): remove C style cast
11968 (getKeys): changed list to lst because of std::list
11970 * src/insets/inseterror.C (Draw): removed som old commented code.
11972 * src/insets/insetcommand.C (Draw): removed some old commented code.
11974 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11975 commented out forever.
11976 (bibitem_cb): use static_cast instead of C style cast
11977 use of vdata changed to u_vdata.
11979 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11981 (CloseUrlCB): use static_cast instead of C style cast.
11982 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11984 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11985 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11986 (CloseInfoCB): static_cast from ob->u_vdata instead.
11987 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11990 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11991 (C_InsetError_CloseErrorCB): forward the ob parameter
11992 (CloseErrorCB): static_cast from ob->u_vdata instead.
11994 * src/vspace.h: include LString.h since we use string in this class.
11996 * src/vspace.C (lyx_advance): changed name from advance because of
11997 nameclash with stl. And since we cannot use namespaces yet...I
11998 used a lyx_ prefix instead. Expect this to change when we begin
12001 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12003 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12004 and removed now defunct constructor and deconstructor.
12006 * src/BufferView.h: have backstack as a object not as a pointer.
12007 removed initialization from constructor. added include for BackStack
12009 * development/lyx.spec.in (%build): add CFLAGS also.
12011 * src/screen.C (drawFrame): removed another warning.
12013 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12015 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12016 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12017 README and ANNOUNCE a bit for the next release. More work is
12020 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12021 unbreakable if we are in freespacing mode (LyX-Code), but not in
12024 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12026 * src/BackStack.h: fixed initialization order in constructor
12028 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12030 * acinclude.m4 (VERSION): new rules for when a version is
12031 development, added also a variable for prerelease.
12032 (warnings): we set with_warnings=yes for prereleases
12033 (lyx_opt): prereleases compile with same optimization as development
12034 (CXXFLAGS): only use pedantic if we are a development version
12036 * src/BufferView.C (restorePosition): don't do anything if the
12037 backstack is empty.
12039 * src/BackStack.h: added member empty, use this to test if there
12040 is anything to pop...
12042 1999-10-25 Juergen Vigna <jug@sad.it>
12045 * forms/layout_forms.fd +
12046 * forms/latexoptions.fd +
12047 * lyx.fd: changed for various form resize issues
12049 * src/mathed/math_panel.C +
12050 * src/insets/inseterror.C +
12051 * src/insets/insetinfo.C +
12052 * src/insets/inseturl.C +
12053 * src/insets/inseturl.h +
12055 * src/LyXSendto.C +
12056 * src/PaperLayout.C +
12057 * src/ParagraphExtra.C +
12058 * src/TableLayout.C +
12060 * src/layout_forms.C +
12067 * src/menus.C: fixed various resize issues. So now forms can be
12068 resized savely or not be resized at all.
12070 * forms/form_url.fd +
12071 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12074 * src/insets/Makefile.am: added files form_url.[Ch]
12076 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12078 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12079 (and presumably 6.2).
12081 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12082 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12083 remaining static member callbacks.
12085 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12088 * src/support/lyxstring.h: declare struct Srep as friend of
12089 lyxstring, since DEC cxx complains otherwise.
12091 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12093 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12095 * src/LaTeX.C (run): made run_bibtex also depend on files with
12097 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12098 are put into the dependency file.
12100 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12101 the code has shown itself to work
12102 (create_ispell_pipe): removed another warning, added a comment
12105 * src/minibuffer.C (ExecutingCB): removed code that has been
12106 commented out a long time
12108 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12109 out code + a warning.
12111 * src/support/lyxstring.h: comment out the three private
12112 operators, when compiling with string ansi conforming compilers
12113 they make problems.
12115 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12117 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12118 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12121 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12124 * src/mathed/math_panel.C (create_math_panel): remove explicit
12127 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12130 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12131 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12132 to XCreatePixmapFromBitmapData
12133 (fl_set_bmtable_data): change the last argument to be unsigned
12135 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12136 and bh to be unsigned int, remove explicit casts in call to
12137 XReadBitmapFileData.
12139 * images/arrows.xbm: made the arrays unsigned char *
12140 * images/varsz.xbm: ditto
12141 * images/misc.xbm: ditto
12142 * images/greek.xbm: ditto
12143 * images/dots.xbm: ditto
12144 * images/brel.xbm: ditto
12145 * images/bop.xbm: ditto
12147 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12149 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12150 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12151 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12153 (LYX_CXX_CHEADERS): added <clocale> to the test.
12155 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12157 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12159 * src/support/lyxstring.C (append): fixed something that must be a
12160 bug, rep->assign was used instead of rep->append.
12162 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12165 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12166 lyx insert double chars. Fix spotted by Kayvan.
12168 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12170 * Fixed the tth support. I messed up with the Emacs patch apply feature
12171 and omitted the changes in lyxrc.C.
12173 1999-10-22 Juergen Vigna <jug@sad.it>
12175 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12177 * src/lyx_cb.C (MenuInsertRef) +
12178 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12179 the form cannot be resized under it limits (fixes a segfault)
12181 * src/lyx.C (create_form_form_ref) +
12182 * forms/lyx.fd: Changed Gravity on name input field so that it is
12185 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12187 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12188 <ostream> and <istream>.
12190 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12191 whether <fstream> provides the latest standard features, or if we
12192 have an oldstyle library (like in egcs).
12193 (LYX_CXX_STL_STRING): fix the test.
12195 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12196 code on MODERN_STL_STREAM.
12198 * src/support/lyxstring.h: use L{I,O}stream.h.
12200 * src/support/L{I,O}stream.h: new files, designed to setup
12201 correctly streams for our use
12202 - includes the right header depending on STL capabilities
12203 - puts std::ostream and std::endl (for LOStream.h) or
12204 std::istream (LIStream.h) in toplevel namespace.
12206 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12208 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12209 was a bib file that had been changed we ensure that bibtex is run.
12210 (runBibTeX): enhanced to extract the names of the bib files and
12211 getting their absolute path and enter them into the dep file.
12212 (findtexfile): static func that is used to look for tex-files,
12213 checks for absolute patchs and tries also with kpsewhich.
12214 Alternative ways of finding the correct files are wanted. Will
12216 (do_popen): function that runs a command using popen and returns
12217 the whole output of that command in a string. Should be moved to
12220 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12221 file with extension ext has changed.
12223 * src/insets/figinset.C: added ifdef guards around the fl_free
12224 code that jug commented out. Now it is commented out when
12225 compiling with XForms == 0.89.
12227 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12228 to lyxstring.C, and only keep a forward declaration in
12229 lyxstring.h. Simplifies the header file a bit and should help a
12230 bit on compile time too. Also changes to Srep will not mandate a
12231 recompile of code just using string.
12232 (~lyxstring): definition moved here since it uses srep.
12233 (size): definition moved here since it uses srep.
12235 * src/support/lyxstring.h: removed a couple of "inline" that should
12238 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12240 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12243 1999-10-21 Juergen Vigna <jug@sad.it>
12245 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12246 set to left if I just remove the width entry (or it is empty).
12248 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12249 paragraph when having dummy paragraphs.
12251 1999-10-20 Juergen Vigna <jug@sad.it>
12253 * src/insets/figinset.C: just commented some fl_free_form calls
12254 and added warnings so that this calls should be activated later
12255 again. This avoids for now a segfault, but we have a memory leak!
12257 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12258 'const char * argument' to 'string argument', this should
12259 fix some Asserts() in lyxstring.C.
12261 * src/lyxfunc.h: Removed the function argAsString(const char *)
12262 as it is not used anymore.
12264 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12266 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12269 * src/Literate.h: some funcs moved from public to private to make
12270 interface clearer. Unneeded args removed.
12272 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12274 (scanBuildLogFile): ditto
12276 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12277 normal TeX Error. Still room for improvement.
12279 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12281 * src/buffer.C (insertErrors): changes to make the error
12282 desctription show properly.
12284 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12287 * src/support/lyxstring.C (helper): changed to use
12288 sizeof(object->rep->ref).
12289 (operator>>): changed to use a pointer instead.
12291 * src/support/lyxstring.h: changed const reference & to value_type
12292 const & lets see if that helps.
12294 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12296 * Makefile.am (rpmdist): fixed to have non static package and
12299 * src/support/lyxstring.C: removed the compilation guards
12301 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12304 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12305 conditional compile of lyxstring.Ch
12307 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12308 stupid check, but it is a lot better than the bastring hack.
12309 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12311 * several files: changed string::erase into string::clear. Not
12314 * src/chset.C (encodeString): use a char temporary instead
12316 * src/table.C (TexEndOfCell): added tostr around
12317 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12318 (TexEndOfCell): ditto
12319 (TexEndOfCell): ditto
12320 (TexEndOfCell): ditto
12321 (DocBookEndOfCell): ditto
12322 (DocBookEndOfCell): ditto
12323 (DocBookEndOfCell): ditto
12324 (DocBookEndOfCell): ditto
12326 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12328 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12330 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12331 (MenuBuildProg): added tostr around ret
12332 (MenuRunChktex): added tostr around ret
12333 (DocumentApplyCB): added tostr around ret
12335 * src/chset.C (encodeString): added tostr around t->ic
12337 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12338 (makeLaTeXFile): added tostr around tocdepth
12339 (makeLaTeXFile): added tostr around ftcound - 1
12341 * src/insets/insetbib.C (setCounter): added tostr around counter.
12343 * src/support/lyxstring.h: added an operator+=(int) to catch more
12346 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12347 (lyxstring): We DON'T allow NULL pointers.
12349 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12351 * src/mathed/math_macro.C (MathMacroArgument::Write,
12352 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12353 when writing them out.
12355 * src/LString.C: remove, since it is not used anymore.
12357 * src/support/lyxstring.C: condition the content to
12358 USE_INCLUDED_STRING macro.
12360 * src/mathed/math_symbols.C, src/support/lstrings.C,
12361 src/support/lyxstring.C: add `using' directive to specify what
12362 we need in <algorithm>. I do not think that we need to
12363 conditionalize this, but any thought is appreciated.
12365 * many files: change all callback functions to "C" linkage
12366 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12367 strict_ansi. Those who were static are now global.
12368 The case of callbacks which are static class members is
12369 trickier, since we have to make C wrappers around them (see
12370 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12371 did not finish this yet, since it defeats the purpose of
12372 encapsulation, and I am not sure what the best route is.
12374 1999-10-19 Juergen Vigna <jug@sad.it>
12376 * src/support/lyxstring.C (lyxstring): we permit to have a null
12377 pointer as assignment value and just don't assign it.
12379 * src/vspace.C (nextToken): corrected this function substituting
12380 find_first(_not)_of with find_last_of.
12382 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12383 (TableOptCloseCB) (TableSpeCloseCB):
12384 inserted fl_set_focus call for problem with fl_hide_form() in
12387 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12389 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12392 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12394 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12395 LyXLex::next() and not eatline() to get its argument.
12397 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12399 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12400 instead, use fstreams for io of the depfile, removed unneeded
12401 functions and variables.
12403 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12404 vector instead, removed all functions and variables that is not in
12407 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12409 * src/buffer.C (insertErrors): use new interface to TeXError
12411 * Makefile.am (rpmdist): added a rpmdist target
12413 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12414 per Kayvan's instructions.
12416 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12418 * src/Makefile.am: add a definition for localedir, so that locales
12419 are found after installation (Kayvan)
12421 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12423 * development/.cvsignore: new file.
12425 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12427 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12428 C++ compiler provides wrappers for C headers and use our alternate
12431 * configure.in: use LYX_CXX_CHEADERS.
12433 * src/cheader/: new directory, populated with cname headers from
12434 libstdc++-2.8.1. They are a bit old, but probably good enough for
12435 what we want (support compilers who lack them).
12437 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12438 from includes. It turns out is was stupid.
12440 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12442 * lib/Makefile.am (install-data-local): forgot a ';'
12443 (install-data-local): forgot a '\'
12444 (libinstalldirs): needed after all. reintroduced.
12446 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12448 * configure.in (AC_OUTPUT): added lyx.spec
12450 * development/lyx.spec: removed file
12452 * development/lyx.spec.in: new file
12454 * po/*.po: merged with lyx.pot becuase of make distcheck
12456 * lib/Makefile.am (dist-hook): added dist-hook so that
12457 documentation files will be included when doing a make
12458 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12459 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12461 more: tried to make install do the right thing, exclude CVS dirs
12464 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12465 Path would fit in more nicely.
12467 * all files that used to use pathstack: uses now Path instead.
12468 This change was a lot easier than expected.
12470 * src/support/path.h: new file
12472 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12474 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12476 * src/support/lyxstring.C (getline): Default arg was given for
12479 * Configure.cmd: removed file
12481 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12483 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12484 streams classes and types, add the proper 'using' statements when
12485 MODERN_STL is defined.
12487 * src/debug.h: move the << operator definition after the inclusion
12490 * src/support/filetools.C: include "LAssert.h", which is needed
12493 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12496 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12497 include "debug.h" to define a proper ostream.
12499 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12501 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12502 method to the SystemCall class which can kill a process, but it's
12503 not fully implemented yet.
12505 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12507 * src/support/FileInfo.h: Better documentation
12509 * src/lyxfunc.C: Added support for buffer-export html
12511 * src/menus.C: Added Export->As HTML...
12513 * lib/bind/*.bind: Added short-cut for buffer-export html
12515 * src/lyxrc.*: Added support for new \tth_command
12517 * lib/lyxrc.example: Added stuff for new \tth_command
12519 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12521 * lib/Makefile.am (IMAGES): removed images/README
12522 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12523 installes in correct place. Check permisions is installed
12526 * src/LaTeX.C: some no-op changes moved declaration of some
12529 * src/LaTeX.h (LATEX_H): changed include guard name
12531 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12533 * lib/reLyX/Makefile.am: install noweb2lyx.
12535 * lib/Makefile.am: install configure.
12537 * lib/reLyX/configure.in: declare a config aux dir; set package
12538 name to lyx (not sure what the best solution is); generate noweb2lyx.
12540 * lib/layouts/egs.layout: fix the bibliography layout.
12542 1999-10-08 Jürgen Vigna <jug@sad.it>
12544 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12545 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12546 it returned without continuing to search the path.
12548 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12550 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12551 also fixes a bug. It is not allowed to do tricks with std::strings
12552 like: string a("hei"); &a[e]; this will not give what you
12553 think... Any reason for the complexity in this func?
12555 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12557 * Updated README and INSTALL a bit, mostly to check that my
12558 CVS rights are correctly set up.
12560 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12562 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12563 does not allow '\0' chars but lyxstring and std::string does.
12565 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12567 * autogen.sh (AUTOCONF): let the autogen script create the
12568 POTFILES.in file too. POTFILES.in should perhaps now not be
12569 included in the cvs module.
12571 * some more files changed to use C++ includes instead of C ones.
12573 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12575 (Reread): added tostr to nlink. buggy output otherwise.
12576 (Reread): added a string() around szMode when assigning to Buffer,
12577 without this I got a log of garbled info strings.
12579 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12582 * I have added several ostream & operator<<(ostream &, some_type)
12583 functions. This has been done to avoid casting and warnings when
12584 outputting enums to lyxerr. This as thus eliminated a lot of
12585 explicit casts and has made the code clearer. Among the enums
12586 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12587 mathed enums, some font enum the Debug::type enum.
12589 * src/support/lyxstring.h (clear): missing method. equivalent of
12592 * all files that contained "stderr": rewrote constructs that used
12593 stderr to use lyxerr instead. (except bmtable)
12595 * src/support/DebugStream.h (level): and the passed t with
12596 Debug::ANY to avoid spurious bits set.
12598 * src/debug.h (Debug::type value): made it accept strings of the
12599 type INFO,INIT,KEY.
12601 * configure.in (Check for programs): Added a check for kpsewhich,
12602 the latex generation will use this later to better the dicovery of
12605 * src/BufferView.C (create_view): we don't need to cast this to
12606 (void*) that is done automatically.
12607 (WorkAreaButtonPress): removed some dead code.
12609 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12611 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12612 is not overwritten when translated (David Sua'rez de Lis).
12614 * lib/CREDITS: Added David Sua'rez de Lis
12616 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12618 * src/bufferparams.C (BufferParams): default input encoding is now
12621 * acinclude.m4 (cross_compiling): comment out macro
12622 LYX_GXX_STRENGTH_REDUCE.
12624 * acconfig.h: make sure that const is not defined (to empty) when
12625 we are compiling C++. Remove commented out code using SIZEOF_xx
12628 * configure.in : move the test for const and inline as late as
12629 possible so that these C tests do not interefere with C++ ones.
12630 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12631 has not been proven.
12633 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12635 * src/table.C (getDocBookAlign): remove bad default value for
12636 isColumn parameter.
12638 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12640 (ShowFileMenu2): ditto.
12642 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12643 of files to ignore.
12645 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12647 * Most files: finished the change from the old error code to use
12648 DebugStream for all lyxerr debugging. Only minor changes remain
12649 (e.g. the setting of debug levels using strings instead of number)
12651 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12653 * src/layout.C (Add): Changed to use compare_no_case instead of
12656 * src/FontInfo.C: changed loop variable type too string::size_type.
12658 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12660 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12661 set ETAGS_ARGS to --c++
12663 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12665 * src/table.C (DocBookEndOfCell): commented out two unused variables
12667 * src/paragraph.C: commented out four unused variables.
12669 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12670 insed a if clause with type string::size_type.
12672 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12675 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12677 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12678 variable, also changed loop to go from 0 to lenght + 1, instead of
12679 -1 to length. This should be correct.
12681 * src/LaTeX.C (scanError): use string::size_type as loop variable
12684 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12685 (l.896) since y_tmp and row was not used anyway.
12687 * src/insets/insetref.C (escape): use string::size_type as loop
12690 * src/insets/insetquotes.C (Width): use string::size_type as loop
12692 (Draw): use string::size_type as loop variable type.
12694 * src/insets/insetlatexaccent.C (checkContents): use
12695 string::size_type as loop variable type.
12697 * src/insets/insetlabel.C (escape): use string::size_type as loop
12700 * src/insets/insetinfo.C: added an extern for current_view.
12702 * src/insets/insetcommand.C (scanCommand): use string::size_type
12703 as loop variable type.
12705 * most files: removed the RCS tags. With them we had to recompile
12706 a lot of files after a simple cvs commit. Also we have never used
12707 them for anything meaningful.
12709 * most files: tags-query-replace NULL 0. As adviced several plases
12710 we now use "0" instead of "NULL" in our code.
12712 * src/support/filetools.C (SpaceLess): use string::size_type as
12713 loop variable type.
12715 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12717 * src/paragraph.C: fixed up some more string stuff.
12719 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12721 * src/support/filetools.h: make modestr a std::string.
12723 * src/filetools.C (GetEnv): made ch really const.
12725 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12726 made code that used these use max/min from <algorithm> instead.
12728 * changed several c library include files to their equivalent c++
12729 library include files. All is not changed yet.
12731 * created a support subdir in src, put lyxstring and lstrings
12732 there + the extra files atexit, fileblock, strerror. Created
12733 Makefile.am. edited configure.in and src/Makefile.am to use this
12734 new subdir. More files moved to support.
12736 * imported som of the functions from repository lyx, filetools
12738 * ran tags-query-replace on LString -> string, corrected the bogus
12739 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12740 is still some errors in there. This is errors where too much or
12741 too litle get deleted from strings (string::erase, string::substr,
12742 string::replace), there can also be some off by one errors, or
12743 just plain wrong use of functions from lstrings. Viewing of quotes
12746 * LyX is now running fairly well with string, but there are
12747 certainly some bugs yet (see above) also string is quite different
12748 from LString among others in that it does not allow null pointers
12749 passed in and will abort if it gets any.
12751 * Added the revtex4 files I forgot when setting up the repository.
12753 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12755 * All over: Tried to clean everything up so that only the files
12756 that we really need are included in the cvs repository.
12757 * Switched to use automake.
12758 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12759 * Install has not been checked.
12761 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12763 * po/pt.po: Three errors:
12764 l.533 and l.538 format specification error
12765 l. 402 duplicate entry, I just deleted it.