1 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
3 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
4 Can now Apply to different insets without closing the dialog.
6 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
7 Can't actually DO anything with them yet, but I'd like a little
10 * src/frontends/xforms/input_validators.[ch] (fl_lowercase_filter): new.
12 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
14 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
15 of MATH_CODE. This fixes a bug with math-macros in RTL text.
17 * src/text.C (PrepareToPrint): Show math-macros block aligned.
19 2000-11-02 Juergen Vigna <jug@sad.it>
21 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
22 on char insertion as it has already be updated by bv->updateInset().
24 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
25 if an inset inside was updated.
27 * lib/configure.cmd: commented out fax-search code
29 2000-11-01 Yves Bastide <stid@acm.org>
31 * src/tabular.C (OldFormatRead): set tabular language to the
34 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
36 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
37 class names with non-letter characters (from Yves Bastide).
39 * lib/ui/default.ui: change Item to OptItem in import menu.
40 Comment out fax stuff.
42 * lib/configure.m4: comment out fax-related stuff.
44 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
46 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
47 useful xforms helper functions. At present contains only formatted().
48 Input a string and it returns it with line breaks so that in fits
51 * src/frontends/xforms/Makefile.am: add new files.
53 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
54 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
57 * src/frontends/xforms/FormPreferences.[Ch]:
58 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
59 but lots of little clean ups. Removed enum State. Make use of
60 formatted(). Constify lots of methods. Perhaps best of all: removed
61 requirement for that horrible reinterpret_cast from pointer to long in
64 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
66 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
67 conditionalize build on xforms < 0.89
69 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
71 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
73 * src/LyXAction.C (init): comment out fax
75 * src/lyxrc.h: comment out the fax enums
76 comment out the fax variables
78 * src/commandtags.h: comment out LFUN_FAX
80 * src/lyxrc.C: disable fax variables.
81 (read): disable parsing of fax variables
82 (output): disable writing of fax variables
83 (getFeedback): now description for fax variables
85 * src/lyxfunc.C: comment out MenuFax
86 (Dispatch): disable LFUN_FAX
88 * src/lyx_cb.C (MenuFax): comment out
90 * src/WorkArea.C: add <cctype>
91 (work_area_handler): better key handling, should be ok now.
92 for accented chars + etc
94 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
95 lyx_sendfax.h and lyx_sendfax_man.C
97 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
98 (show): don't call InitLyXLookup when using xforms 0.89
100 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
102 * src/trans.C (AddDeadkey): better fix, the other one could crash...
104 * src/support/filetools.C (GetFileContents): close to dummy change
106 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
108 * src/trans.C (AddDeadkey): workaround stupid compilers.
110 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
112 * src/frontends/xforms/FormDocument.C (class_update): fix setting
113 of two-sided document.
115 2000-10-31 Juergen Vigna <jug@sad.it>
117 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
119 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
120 xposition to the Edit call.
122 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
124 * src/trans.C (AddDeadkey): cast explicitly to char.
126 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
128 * src/tabular.C (AsciiBottomHLine): simplify?
129 (AsciiTopHLine): simplify?
130 (print_n_chars): simplify
131 (DocBook): remove most of the << endl; we should flush the stream
132 as seldom as possible.
134 (TeXBottomHLine): ditto
137 (write_attribute): try a templified version.
138 (set_row_column_number_info): lesson scope of variables
140 * src/support/lstrings.h (tostr): new specialization of tostr
142 * src/trans.C (AddDeadkey): slightly cleaner fix.
144 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
146 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
147 '%%' in Toc menu labels.
150 * src/insets/insetlatexaccent.C (draw): Correct rendering when
151 font_norm is iso10646-1.
153 * src/font.C (ascent): Fixed for 16bit fonts
154 (descent,lbearing,rbearing): ditto
156 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
158 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
159 (getFeedback): new static method.
161 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
162 Now use combox rather than choice to display languages.
163 Feedback is now output using a new timer callback mechanism, identical
164 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
166 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
168 * src/minibuffer.C: fix for older compilers
170 2000-10-30 Juergen Vigna <jug@sad.it>
172 * src/insets/insettext.C (InsertInset): fixed this as the cursor
173 has to be Left of the inset otherwise LyXText won't find it!
175 * src/BufferView2.C (open_new_inset): delete the inset if it can
178 2000-10-30 Rob Lahaye <lahaye@postech.edu>
182 2000-10-29 Marko Vendelin <markov@ioc.ee>
183 * src/frontends/gnome/FormCitation.C
184 * src/frontends/gnome/FormCitation.h
185 * src/frontends/gnome/FormCopyright.C
186 * src/frontends/gnome/FormCopyright.h
187 * src/frontends/gnome/FormError.C
188 * src/frontends/gnome/FormError.h
189 * src/frontends/gnome/FormIndex.C
190 * src/frontends/gnome/FormIndex.h
191 * src/frontends/gnome/FormPrint.C
192 * src/frontends/gnome/FormPrint.h
193 * src/frontends/gnome/FormRef.C
194 * src/frontends/gnome/FormRef.h
195 * src/frontends/gnome/FormToc.C
196 * src/frontends/gnome/FormToc.h
197 * src/frontends/gnome/FormUrl.C
198 * src/frontends/gnome/FormUrl.h
199 * src/frontends/gnome/Menubar_pimpl.C
200 * src/frontends/gnome/mainapp.C
201 * src/frontends/gnome/mainapp.h
202 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
203 changing update() to updateSlot() where appropriate
205 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
207 * src/frontends/xforms/FormPreferences.[Ch]:
208 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
211 2000-10-28 Juergen Vigna <jug@sad.it>
213 * src/insets/insettabular.C (draw): fixed drawing bug.
215 * src/insets/insettext.C (clear):
217 (SetParagraphData): clearing the TEXT buffers when deleting the
218 paragraphs used by it.
220 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
222 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
224 2000-10-27 Juergen Vigna <jug@sad.it>
226 * src/tabular.C (~LyXTabular): removed not needed anymore.
228 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
231 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
233 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
236 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
239 * src/frontends/xforms/FormPreferences.[Ch]:
240 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
241 Reorganised as modules based on tabs. Much easier to follow the
242 flow and to add new tabs. Added warning and feedback messages.
245 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
247 * src/tabular.h (DocBook): add std:: qualifier.
249 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
251 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
252 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
255 * insettabular.C (DocBook): uses the tabular methods to export
258 * src/insets/insettext.h
259 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
261 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
263 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
266 * src/lyxfunc.C (MenuNew): lessen the scope of fname
267 moved misplaced AllowInput two lines up.
269 * src/buffer.C (readFile): compare float with float, not with int
271 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
273 * src/minibuffer.C: add "using SigC::slot" statement.
275 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
277 * src/frontends/xforms/forms/README: updated section about make.
279 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
280 Tidied some forms up, made two of form_tabular's tabs more
281 self-consistent, fixed Jean-Marc's size problem in form_preferences,
282 fixed translation problem with "Column".
284 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
286 * src/minibuffer.h: use Timeout instead of the xforms timer
288 (setTimer) rewrite for the Timeout, change to unsigned arg
289 (set): change to unsigned timer arg
292 * src/minibuffer.C (TimerCB): removed func
293 (C_MiniBuffer_TimerCB): removed func
294 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
295 (peek_event): use a switch statement
296 (add): don't use fl_add_timer.
297 (Set): rewrite to use the Timeout
300 * src/Timeout.[Ch] (setType): return a Timeout &
301 (setTimeout): ditto, change to unsigned arg for timeout
303 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
305 * src/mathed/formula.C (mathed_string_width): Use string instead
306 of a constant size char array.
308 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
310 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
311 the two recently added operator<< for SMInput and State.
313 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
315 (OkCancelPolicy): ditto
316 (OkCancelReadOnlyPolicy): ditto
317 (NoRepeatedApplyReadOnlyPolicy): ditto
318 (OkApplyCancelReadOnlyPolicy): ditto
319 (OkApplyCancelPolicy): ditto
320 (NoRepeatedApplyPolicy): ditto
322 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
324 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
325 add the usual std:: qualifiers.
327 2000-10-25 Juergen Vigna <jug@sad.it>
329 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
331 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
333 * src/support/filetools.C (MakeRelPath): change some types to
336 * src/frontends/ButtonPolicies.h (operator<<): new operator for
337 ButtonPolicy::SMInput and ButtonPolicy::State.
339 * src/FontLoader.C (reset): small cleanup
340 (unload): small cleanup
342 * src/FontInfo.C (getFontname): initialize error to 10000.0
344 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
346 * src/frontends/xforms/FormPreferences.[Ch]:
347 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
348 TeX encoding and default paper size sections.
350 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
352 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
355 * src/frontends/xforms/FormError.C (disconnect): use erase() to
356 make the message_ empty.
357 (FormError): don't initialize message_ in initializer list.
359 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
361 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
363 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
365 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
367 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
369 * src/frontends/kde/*data.[Ch]: _("") is not
372 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
374 * src/buffer.C: removed redundant using directive.
376 * src/frontends/DialogBase.h: revert to original definition of
379 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
380 stuff into two classes, one for each dialog, requires a new
381 element in the dialogs vector, FormTabularCreate.
383 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
386 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
387 method. Continues Allan's idea, but means that derived classes
388 don't need to worry about "update or hide?".
390 * src/frontends/xforms/FormError.C (showInset): add connection
393 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
394 one for each dialog. FormTabular now contains main tabular dialog
397 * src/frontends/xforms/FormTabularCreate.[Ch]:
398 * src/frontends/xforms/forms/form_tabular_create.fd: the create
401 * src/frontends/xforms/FormGraphics.[Ch]:
402 * src/frontends/xforms/forms/form_graphics.fd
403 * src/frontends/xforms/FormTabular.[Ch]:
404 * src/frontends/xforms/forms/form_tabular.fd: made daughter
405 classes of FormInset.
407 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
408 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
410 * src/frontends/xforms/Makefile.am:
411 * src/frontends/xforms/forms/makefile: added new files.
413 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
414 variable. added Signal0 hide signal, in keeping with other GUI-I
417 * src/support/lstrings.h: removed redundant std:: qualifier as
418 it's already declared in Lsstream.h.
420 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
422 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
426 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
428 * src/tabular.C (Ascii): minimize scope of cell.
430 * src/BufferView2.C (nextWord): return string() instead of 0;
432 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
434 * src/converter.h: add a std:: qualifier
436 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
438 * src/importer.[Ch]: New files. Used for importing files into LyX.
440 * src/lyxfunc.C (doImport): Use the new Importer class.
442 * src/converter.h: Add shortcut member to the Format class.
443 Used for holding the menu shortcut.
445 * src/converter.C and other files: Made a distinction between
446 format name and format extension. New formats can be defined using
447 the \format lyxrc tag.
448 Added two new converter flags: latex and disable.
450 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
452 * src/support/lyxlib.h: unify namespace/struct implementation.
453 Remove extra declarations.
455 * src/support/chdir.C (chdir): remove version taking char const *
457 * src/support/rename.C: ditto.
458 * src/support/lyxsum.C: ditto.
460 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
462 * src/frontends/xforms/FormBase.[Ch]:
463 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
464 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
465 work only for the next call to fl_show_form(). The correct place to set
466 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
467 done. FormBase also stores minw_, minh_ itself. All dialogs derived
468 from FormBase have the minimum size set; no more stupid crashes with
471 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
473 * lib/ui/default.ui: fix shortcut for Insert->Include File.
475 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
477 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
479 * src/support/lyxlib.h: changed second argument of mkdir to
480 unsigned long int (unsigned int would probably have been enough,
481 but...). Removed <sys/types.h> header.
482 * src/support/mkdir.C (mkdir): ditto.
486 2000-10-19 Juergen Vigna <jug@sad.it>
488 * src/lyxfunc.C (MenuNew): small fix (form John)
490 * src/screen.C (Update): removed unneeded code.
492 * src/tabular.C (Ascii): refixed int != uint bug!
494 * src/support/lyxlib.h: added sys/types.h include for now permits
495 compiling, but I don't like this!
497 2000-10-18 Juergen Vigna <jug@sad.it>
499 * src/text2.C (ClearSelection): if we clear the selection we need
500 more refresh so set the status apropriately
502 * src/insets/insettext.C (draw): hopefully finally fixed draw
505 2000-10-12 Juergen Vigna <jug@sad.it>
507 * src/insets/insettext.C (draw): another small fix and make a block
508 so that variables are localized.
510 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
512 * src/support/lstrings.C (lowercase, uppercase):
513 use explicit casts to remove compiler warnings.
515 * src/support/LRegex.C (Impl):
516 * src/support/StrPool.C (add):
517 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
518 (AddPath, MakeDisplayPath):
519 * src/support/lstrings.C (prefixIs, subst):
520 use correct type to remove compiler warnings.
522 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
524 * src/support/lyxlib.h:
525 * src/support/mkdir.C (mkdir): change parameter to mode_t for
526 portability and to remove compiler warning with DEC cxx.
528 * src/support/FileInfo.[Ch] (flagRWX): ditto.
530 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
532 * src/minibuffer.C (peek_event): retun 1 when there has been a
533 mouseclick in the minibuffer.
537 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
539 * src/frontends/xforms/FormParagraph.C: more space above/below
542 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
544 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
545 a char only if real_current_font was changed.
547 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
549 * NEWS: update somewhat for 1.1.6
551 * lib/ui/default.ui: clean up.
553 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
555 * lib/CREDITS: clean up
557 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
559 * src/combox.[Ch] (select): changed argument back to int
560 * src/combox.C (peek_event): removed num_bytes as it is declared but
563 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
564 modified calls to Combox::select() to remove warnings about type
567 * src/insets/insetbutton.C (width): explicit cast to remove warning
568 about type conversion.
570 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
573 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
574 sel_pos_end, refering to cursor position are changed to
575 LyXParagraph::size_type.
577 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
578 consistent with LyXCursor::pos().
579 (inset_pos): changed to LyXParagraph::size_type for same reason.
581 * src/insets/insettext.C (resizeLyXText): changed some temporary
582 variables refing to cursor position to LyXParagraph::size_type.
584 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
586 * src/frontends/kde/<various>: The Great Renaming,
589 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
591 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
593 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
595 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
596 0 when there are no arguments.
598 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
600 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
601 to segfaults when pressing Ok in InsetBibtex dialog.
603 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
605 * forms/layout_forms.fd:
606 * src/layout_forms.C (create_form_form_character): small change to use
607 labelframe rather than engraved frame + text
609 * src/lyx_gui.C (create_forms): initialise choice_language with some
610 arbitrary value to prevent segfault when dialog is shown.
612 2000-10-16 Baruch Even <baruch.even@writeme.com>
614 * src/converter.C (runLaTeX, scanLog): Added a warning when there
615 is no resulting file. This pertains only to LaTeX output.
617 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
619 * src/text.C (Backspace): Make sure that the row of the cursor is
622 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
625 * src/lyx_gui.C (init): Prevent a crash when only one font from
626 menu/popup fonts is not found.
628 * lib/lyxrc.example: Add an example for binding a key for language
631 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
633 * src/converter.C (GetReachable): Changed the returned type to
635 (IsReachable): New method
637 * src/MenuBackend.C (expand): Handle formats that appear more
640 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
642 * src/frontends/support/Makefile.am
643 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
646 * lib/CREDITS: add Garst Reese.
648 * src/support/snprintf.h: add extern "C" {} around the definitions.
650 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
652 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
655 * src/frontends/xforms/FormDocument.C:
656 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
657 compile without "conversion to integral type of smaller size"
660 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
662 * src/text.C (GetColumnNearX): Fixed disabled code.
664 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
666 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
669 * src/support/snprintf.[ch]: new files
671 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
673 * src/frontends/kde/formprintdialog.C: add
674 file browser for selecting postscript output
676 * src/frontends/kde/formprintdialogdata.C:
677 * src/frontends/kde/formprintdialogdata.h: re-generate
680 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
682 * src/frontends/gnome/Makefile.am:
683 * src/frontends/kde/Makefile.am: FormCommand.C
684 disappeared from xforms
686 * src/frontends/kde/FormCitation.C:
687 * src/frontends/kde/FormIndex.C: read-only
690 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
692 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
695 * src/bufferlist.C: add using directive.
697 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
699 * src/support/lyxfunctional.h: version of class_fun for void
700 returns added, const versions of back_inseter_fun and compare_fun
703 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
705 * src/frontends/xforms/FormInset.C (showInset): fix typo.
707 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
709 * ChangeLog: cleanup.
711 * lib/CREDITS: update to add all the contributors we've forgotten.
712 I have obviously missed some, so tell me whether there were
715 2000-10-13 Marko Vendelin <markov@ioc.ee>
717 * src/frontends/gnome/FormCitation.C
718 * src/frontends/gnome/FormCitation.h
719 * src/frontends/gnome/FormError.C
720 * src/frontends/gnome/FormIndex.C
721 * src/frontends/gnome/FormRef.C
722 * src/frontends/gnome/FormRef.h
723 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
725 * src/frontends/gnome/FormCitation.C
726 * src/frontends/gnome/FormCopyright.C
727 * src/frontends/gnome/FormError.C
728 * src/frontends/gnome/FormIndex.C
729 * src/frontends/gnome/FormRef.C
730 * src/frontends/gnome/FormToc.C
731 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
734 * src/frontends/gnome/Menubar_pimpl.C
735 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
738 2000-10-11 Baruch Even <baruch.even@writeme.com>
741 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
742 to convey its real action.
744 * src/minibuffer.C (peek_event): Added action when mouse clicks to
745 clear the minibuffer and prepare to enter a command.
747 * src/mathed/formula.C (LocalDispatch): Changed to conform with
748 the rename from ExecCommand to PrepareForCommand.
749 * src/lyxfunc.C (Dispatch): ditto.
751 2000-10-11 Baruch Even <baruch.even@writeme.com>
753 * src/buffer.C (writeFile): Added test for errors on writing, this
754 catches all errors and not only file system full errors as intended.
756 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
758 * src/lyx_gui.C (create_forms): better fix for crash with
759 translated interface.
761 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
763 * src/frontends/kde/Makefile.am:
764 * src/frontends/kde/FormCopyright.C:
765 * src/frontends/kde/formcopyrightdialog.C:
766 * src/frontends/kde/formcopyrightdialog.h:
767 * src/frontends/kde/formcopyrightdialogdata.C:
768 * src/frontends/kde/formcopyrightdialogdata.h:
769 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
770 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
771 copyright to use qtarch
773 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
775 * src/encoding.C (read): Fixed bug that caused an error message at
778 * po/Makefile.in.in: Fixed rule for ext_l10n.h
780 * lib/lyxrc.example: Fixed hebrew example.
782 2000-10-13 Allan Rae <rae@lyx.org>
784 * src/frontends/xforms/FormPreferences.C (input): reworking the
786 (build, update, apply): New inputs in various tabfolders
788 * src/frontends/xforms/FormToc.C: use new button policy.
789 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
790 dialogs that either can't use any existing policy or where it just
793 * src/frontends/xforms/FormTabular.h: removed copyright notice that
796 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
797 added a bool parameter which is ignored.
799 * src/buffer.C (setReadonly):
800 * src/BufferView_pimpl.C (buffer):
801 * src/frontends/kde/FormCopyright.h (update):
802 * src/frontends/kde/FormCitation.[Ch] (update):
803 * src/frontends/kde/FormIndex.[Ch] (update):
804 * src/frontends/kde/FormPrint.[Ch] (update):
805 * src/frontends/kde/FormRef.[Ch] (update):
806 * src/frontends/kde/FormToc.[Ch] (update):
807 * src/frontends/kde/FormUrl.[Ch] (update):
808 * src/frontends/gnome/FormCopyright.h (update):
809 * src/frontends/gnome/FormCitation.[Ch] (update):
810 * src/frontends/gnome/FormError.[Ch] (update):
811 * src/frontends/gnome/FormIndex.[Ch] (update):
812 * src/frontends/gnome/FormPrint.[Ch] (update):
813 * src/frontends/gnome/FormRef.h (update):
814 * src/frontends/gnome/FormToc.[Ch] (update):
815 * src/frontends/gnome/FormUrl.[Ch] (update):
816 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
817 to updateBufferDependent and DialogBase
819 * src/frontends/xforms/FormCitation.[hC]:
820 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
821 * src/frontends/xforms/FormError.[Ch]:
822 * src/frontends/xforms/FormGraphics.[Ch]:
823 * src/frontends/xforms/FormIndex.[Ch]:
824 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
825 and fixed readOnly handling.
826 * src/frontends/xforms/FormPrint.[Ch]:
827 * src/frontends/xforms/FormRef.[Ch]:
828 * src/frontends/xforms/FormTabular.[Ch]:
829 * src/frontends/xforms/FormToc.[Ch]:
830 * src/frontends/xforms/FormUrl.[Ch]:
831 * src/frontends/xforms/FormInset.[Ch]:
832 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
833 form of updateBufferDependent.
835 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
836 if form()->visible just in case someone does stuff to the form in a
839 * src/frontends/DialogBase.h (enum): removed enum since we can now use
840 the buttoncontroller for everything the enum used to be used for.
841 (update) It would seem we need to force all dialogs to use a bool
842 parameter or have two update functions. I chose to go with one.
843 I did try removing update() from here and FormBase and defining the
844 appropriate update signatures in FormBaseB[DI] but then ran into the
845 problem of the update() call in FormBase::show(). Whatever I did
846 to get around that would require another function and that just
847 got more confusing. Hence the decision to make everyone have an
848 update(bool). An alternative might have been to override show() in
849 FormBaseB[DI] and that would allow the different and appropriate
852 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
853 true == buffer change occurred. I decided against using a default
854 template parameter since not all compilers support that at present.
856 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
858 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
859 army knife" by removing functionality.
860 (clearStore): removed. All such housekeeping on hide()ing the dialog
861 is to be carried out by overloaded disconnect() methods.
862 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
863 superceded by Baruch's neat test (FormGraphics) to update an existing
864 dialog if a new signal is recieved rather than block all new signals
866 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
867 only to Inset dialogs.
868 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
869 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
871 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
873 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
874 as a base class to all inset dialogs. Used solely to connect/disconnect
875 the Inset::hide signal and to define what action to take on receipt of
876 a UpdateBufferDependent signal.
877 (FormCommand): now derived from FormInset.
879 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
882 * src/frontends/xforms/FormCopyright.[Ch]:
883 * src/frontends/xforms/FormPreferences.[Ch]:
884 now derived from FormBaseBI.
886 * src/frontends/xforms/FormDocument.[Ch]:
887 * src/frontends/xforms/FormParagraph.[Ch]:
888 * src/frontends/xforms/FormPrint.[Ch]:
889 now derived from FormBaseBD.
891 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
893 * src/frontends/xforms/FormCitation.[Ch]:
894 * src/frontends/xforms/FormError.[Ch]:
895 * src/frontends/xforms/FormRef.[Ch]:
896 * src/frontends/xforms/FormToc.[Ch]:
897 (clearStore): reworked as disconnect().
899 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
902 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
904 * src/converter.C (runLaTeX): constify buffer argument
907 * src/frontends/support/Makefile.am (INCLUDES): fix.
909 * src/buffer.h: add std:: qualifier
910 * src/insets/figinset.C (addpidwait): ditto
911 * src/MenuBackend.C: ditto
912 * src/buffer.C: ditto
913 * src/bufferlist.C: ditto
914 * src/layout.C: ditto
915 * src/lyxfunc.C: ditto
917 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
919 * src/lyxtext.h (bidi_level): change return type to
920 LyXParagraph::size_type.
922 * src/lyxparagraph.h: change size_type to
923 TextContainer::difference_type. This should really be
924 TextContainer::size_type, but we need currently to support signed
927 2000-10-11 Marko Vendelin <markov@ioc.ee>
928 * src/frontends/gnome/FormError.h
929 * src/frontends/gnome/FormRef.C
930 * src/frontends/gnome/FormRef.h
931 * src/frontends/gnome/FormError.C
932 * src/frontends/gnome/Makefile.am
933 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
934 to Gnome frontend. Both dialogs use "action" area.
936 2000-10-12 Baruch Even <baruch.even@writeme.com>
938 * src/graphics/GraphicsCacheItem_pimpl.C:
939 * src/graphics/Renderer.C:
940 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
943 2000-10-12 Juergen Vigna <jug@sad.it>
945 * src/insets/insettext.C (draw): fixed drawing bug (specifically
946 visible when selecting).
948 * development/Code_rules/Rules: fixed some typos.
950 2000-10-09 Baruch Even <baruch.even@writeme.com>
952 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
953 compiling on egcs 1.1.2 possible.
955 * src/filedlg.C (comp_direntry::operator() ): ditto.
957 2000-08-31 Baruch Even <baruch.even@writeme.com>
959 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
962 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
963 transient it now only gets freed when the object is destructed.
965 2000-08-24 Baruch Even <baruch.even@writeme.com>
967 * src/frontends/FormGraphics.h:
968 * src/frontends/FormGraphics.C: Changed to use ButtonController and
971 2000-08-20 Baruch Even <baruch.even@writeme.com>
973 * src/insets/insetgraphics.C:
974 (draw): Added messages to the drawn rectangle to report status.
975 (updateInset): Disabled the use of the inline graphics,
978 2000-08-17 Baruch Even <baruch.even@writeme.com>
980 * src/frontends/support: Directory added for the support of GUII LyX.
982 * src/frontends/support/LyXImage.h:
983 * src/frontends/support/LyXImage.C: Base class for GUII holding of
986 * src/frontends/support/LyXImage_X.h:
987 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
988 version of LyXImage, this uses the Xlib Pixmap.
993 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
994 replacement to Pixmap.
996 * src/insets/insetgraphics.h:
997 * src/insets/insetgraphics.C:
998 * src/graphics/GraphicsCacheItem.h:
999 * src/graphics/GraphicsCacheItem.C:
1000 * src/graphics/GraphicsCacheItem_pimpl.h:
1001 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1004 * src/graphics/GraphicsCacheItem.h:
1005 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1006 another copy of the object.
1008 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1009 of cacheHandle, this fixed a bug that sent LyX crashing.
1011 * src/graphics/XPM_Renderer.h:
1012 * src/graphics/XPM_Renderer.C:
1013 * src/graphics/EPS_Renderer.h:
1014 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1016 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1018 * src/lyxfunc.C (processKeySym): only handle the
1019 lockinginset/inset stuff if we have a buffer and text loaded...
1021 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1023 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1025 * src/support/lyxfunctional.h: add operator= that takes a reference
1027 * src/lyxserver.C (mkfifo): make first arg const
1029 * src/layout.h: renamed name(...) to setName(...) to work around
1032 * src/buffer.C (setFileName): had to change name of function to
1033 work around bugs in egcs. (renamed from fileName)
1035 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1037 * src/support/translator.h: move helper template classes to
1038 lyxfunctional.h, include "support/lyxfunctional.h"
1040 * src/support/lyxmanip.h: add delaration of fmt
1042 * src/support/lyxfunctional.h: new file
1043 (class_fun_t): new template class
1044 (class_fun): helper template function
1045 (back_insert_fun_iterator): new template class
1046 (back_inserter_fun): helper template function
1047 (compare_memfun_t): new template class
1048 (compare_memfun): helper template function
1049 (equal_1st_in_pair): moved here from translator
1050 (equal_2nd_in_pair): moved here from translator
1052 * src/support/fmt.C: new file
1053 (fmt): new func, can be used for a printf substitute when still
1054 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1056 * src/support/StrPool.C: add some comments
1058 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1061 * src/insets/figinset.C (addpidwait): use std::copy with
1062 ostream_iterator to fill the pidwaitlist
1064 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1066 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1069 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1072 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1074 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1075 (class_update): ditto
1076 (BulletPanel): ditto
1077 (CheckChoiceClass): move initialization of tc and tct
1079 * src/tabular.C: remove current_view
1080 (OldFormatRead): similar to right below [istream::ignore]
1082 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1083 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1084 unused [istream::ignore]
1086 * src/lyxfunc.C: include "support/lyxfunctional.h"
1087 (getInsetByCode): use std::find_if and compare_memfun
1089 * src/lyxfont.C (stateText): remove c_str()
1091 * src/lyx_main.C (setDebuggingLevel): make static
1092 (commandLineHelp): make static
1094 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1095 Screen* together with fl_get_display() and fl_screen
1097 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1098 togheter with fl_get_display() and fl_screen
1099 (create_forms): remove c_str()
1101 * src/layout.C: include "support/lyxfunctional.h"
1102 (hasLayout): use std::find_if and compare_memfun
1103 (GetLayout): use std::find_if and comapre_memfun
1104 (delete_layout): use std::remove_if and compare_memfun
1105 (NumberOfClass): use std:.find_if and compare_memfun
1107 * src/gettext.h: change for the new functions
1109 * src/gettext.C: new file, make _(char const * str) and _(string
1110 const & str) real functions.
1112 * src/font.C (width): rewrite slightly to avoid one extra variable
1114 * src/debug.C: initialize Debug::ANY here
1116 * src/commandtags.h: update number comments
1118 * src/combox.h (get): make const func
1120 (getline): make const
1122 * src/combox.C (input_cb): handle case where fl_get_input can
1125 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1126 "support/lyxfunctional.h", remove current_view variable.
1127 (resize): use std::for_each with std::mem_fun
1128 (getFileNames): use std::copy with back_inserter_fun
1129 (getBuffer): change arg type to unsigned int
1130 (emergencyWriteAll): call emergencyWrite with std::for_each and
1132 (emergencyWrite): new method, the for loop in emergencyWriteAll
1134 (exists): use std::find_if with compare_memfun
1135 (getBuffer): use std::find_if and compare_memfun
1137 * src/buffer.h: add typedefs for iterator_category, value_type
1138 difference_type, pointer and reference for inset_iterator
1139 add postfix ++ for inset_iterator
1140 make inset_iterator::getPos() const
1142 * src/buffer.C: added support/lyxmanip.h
1143 (readFile): use lyxerr << fmt instead of printf
1144 (makeLaTeXFile): use std::copy to write out encodings
1146 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1148 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1149 free and the char * temp.
1150 (hasMenu): use std::find_if and compare_memfun
1153 * src/Makefile.am (lyx_SOURCES): added gettext.C
1155 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1156 string::insert small change to avoid temporary
1158 * src/LColor.C (getGUIName): remove c_str()
1160 * several files: change all occurrences of fl_display to
1163 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1164 that -pedantic is not used for gcc 2.97 (cvs gcc)
1166 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1168 2000-10-11 Allan Rae <rae@lyx.org>
1170 * src/frontends/xforms/FormPreferences.C (input): template path must be
1171 a readable directory. It doesn't need to be writeable.
1172 (build, delete, update, apply): New inputs in the various tabfolders
1174 * src/frontends/xforms/forms/form_preferences.fd:
1175 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1176 several new entries to existing folders. Shuffled some existing stuff
1179 * src/frontends/xforms/forms/form_print.fd:
1180 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1181 Should probably rework PrinterParams as well. Note that the switch to
1182 collated is effectively the same as !unsorted so changing PrinterParams
1183 will require a lot of fiddly changes to reverse the existing logic.
1185 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1187 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1189 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1191 2000-10-10 Allan Rae <rae@lyx.org>
1194 * src/lyxfunc.C (Dispatch):
1196 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1199 * src/lyxrc.C (output): Only write the differences between system lyxrc
1200 and the users settings.
1203 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1205 I'll rewrite this later, after 1.1.6 probably, to keep a single
1206 LyXRC but two instances of a LyXRCStruct.
1208 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1210 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1212 * src/tabular.h: add a few std:: qualifiers.
1214 * src/encoding.C: add using directive.
1215 * src/language.C: ditto.
1217 * src/insets/insetquotes.C (Validate): use languages->lang()
1218 instead of only language.
1220 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1222 * lib/languages: New file.
1224 * lib/encodings: New file.
1226 * src/language.C (Languages): New class.
1227 (read): New method. Reads the languages from the 'languages' file.
1229 * src/encoding.C (Encodings): New class.
1230 (read): New method. Reads the encodings from the 'encodings' file.
1232 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1235 * src/bufferparams.h and a lot of files: Deleted the member language,
1236 and renamed language_info to language
1238 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1239 * src/lyxfont.C (latexWriteStartChanges): ditto.
1240 * src/paragraph.C (validate,TeXOnePar): ditto.
1242 * src/lyxfont.C (update): Restored deleted code.
1244 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1246 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1248 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1250 * src/insets/figinset.[Ch]:
1251 * src/insets/insetinclude.[Ch]:
1252 * src/insets/insetinclude.[Ch]:
1253 * src/insets/insetparent.[Ch]:
1254 * src/insets/insetref.[Ch]:
1255 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1257 * src/insets/*.[Ch]:
1258 * src/mathed/formula.[Ch]:
1259 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1261 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1262 * src/lyx_cb.C (FigureApplyCB):
1263 * src/lyxfunc.C (getStatus, Dispatch):
1264 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1267 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1269 * src/converter.[Ch] (Formats::View):
1270 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1272 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1273 *current_view->buffer(). This will change later, but this patch is way
1276 2000-10-09 Juergen Vigna <jug@sad.it>
1278 * src/text.C (GetRow): small fix.
1280 * src/BufferView_pimpl.C (cursorPrevious):
1281 (cursorNext): added LyXText parameter to function.
1283 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1284 keypress depending on cursor position.
1286 2000-10-06 Juergen Vigna <jug@sad.it>
1288 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1289 (copySelection): redone this function and also copy ascii representa-
1292 * src/tabular.C (Ascii):
1296 (print_n_chars): new functions to realize the ascii export of tabulars.
1298 2000-10-05 Juergen Vigna <jug@sad.it>
1300 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1301 if we don't have a buffer.
1303 2000-10-10 Allan Rae <rae@lyx.org>
1305 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1306 with closing dialog. It seems that nested tabfolders require hiding
1307 of inner tabfolders before hiding the dialog itself. Actually all I
1308 did was hide the active outer folder.
1310 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1311 unless there really is a buffer. hideBufferDependent is called
1314 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1315 POTFILES.in stays in $(srcdir).
1317 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1319 * lib/lyxrc.example: Few changes.
1321 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1323 * src/BufferView_pimpl.C (buffer): only need one the
1324 updateBufferDependent signal to be emitted once! Moved to the end of
1325 the method to allow bv_->text to be updated first.
1327 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1328 and hSignal_ with Dialogs * and BufferDependency variables.
1329 New Buffer * parent_, initialised when the dialog is launched. Used to
1330 check whether to update() or hide() dialog in the new, private
1331 updateOrHide() method that is connected to the updateBufferDependent
1332 signal. Daughter classes dictate what to do using the
1333 ChangedBufferAction enum, passed to the c-tor.
1335 * src/frontends/xforms/FormCitation.C:
1336 * src/frontends/xforms/FormCommand.C:
1337 * src/frontends/xforms/FormCopyright.C:
1338 * src/frontends/xforms/FormDocument.C:
1339 * src/frontends/xforms/FormError.C:
1340 * src/frontends/xforms/FormIndex.C:
1341 * src/frontends/xforms/FormPreferences.C:
1342 * src/frontends/xforms/FormPrint.C:
1343 * src/frontends/xforms/FormRef.C:
1344 * src/frontends/xforms/FormToc.C:
1345 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1348 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1349 ChangedBufferAction enum.
1351 * src/frontends/xforms/FormParagraph.[Ch]
1352 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1355 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1357 * lib/bind/cua.bind: fix a bit.
1358 * lib/bind/emacs.bind: ditto.
1360 * lib/bind/menus.bind: remove real menu entries from there.
1362 * src/spellchecker.C: make sure we only include strings.h when
1365 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1367 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1368 function. It enlarges the maximum number of pup when needed.
1369 (add_toc2): Open a new menu if maximum number of items per menu has
1372 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1374 * src/frontends/kde/FormPrint.C: fix error reporting
1376 * src/frontends/xforms/FormDocument.C: fix compiler
1379 * lib/.cvsignore: add Literate.nw
1381 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1384 * bufferview_funcs.[Ch]
1387 * text2.C: Add support for numbers in RTL text.
1389 2000-10-06 Allan Rae <rae@lyx.org>
1391 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1392 to be gettext.m4 friendly again. ext_l10n.h is now
1393 generated into $top_srcdir instead of $top_builddir
1394 so that lyx.pot will be built correctly -- without
1395 duplicate parsing of ext_l10n.h.
1397 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1399 * src/frontends/kde/FormCitation.C: make the dialog
1400 behave more sensibly
1402 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1404 * config/kde.m4: fix consecutive ./configure runs,
1405 look for qtarch, fix library order
1407 * src/frontends/kde/Makefile.am: tidy up,
1408 add Print dialog, add .dlg dependencies
1410 * src/frontends/kde/FormPrint.C:
1411 * src/frontends/kde/FormPrint.h:
1412 * src/frontends/kde/formprintdialog.C:
1413 * src/frontends/kde/formprintdialog.h:
1414 * src/frontends/kde/formprintdialogdata.C:
1415 * src/frontends/kde/formprintdialogdata.h:
1416 * src/frontends/kde/dlg/formprintdialog.dlg: add
1419 * src/frontends/kde/dlg/README: Added explanatory readme
1421 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1422 script to double-check qtarch's output
1424 * src/frontends/kde/formindexdialog.C:
1425 * src/frontends/kde/formindexdialogdata.C:
1426 * src/frontends/kde/formindexdialogdata.h:
1427 * src/frontends/kde/dlg/formindexdialog.dlg: update
1428 for qtarch, minor fixes
1430 2000-10-05 Allan Rae <rae@lyx.org>
1432 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1433 dialogs when switching buffers update them instead. It's up to each
1434 dialog to decide if it should still be visible or not.
1435 update() should return a bool to control visiblity within show().
1436 Or perhaps better to set a member variable and use that to control
1439 * lib/build-listerrors: create an empty "listerrors" file just to stop
1440 make trying to regenerate it all the time if you don't have noweb
1443 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1445 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1446 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1447 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1448 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1449 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1451 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1453 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1455 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1456 deleting buffer. Closes all buffer-dependent dialogs.
1458 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1460 * src/frontends/xforms/FormCitation.[Ch]:
1461 * src/frontends/xforms/FormPreferences.[Ch]:
1462 * src/frontends/xforms/FormPrint.[Ch]:
1463 * src/frontends/xforms/FormRef.[Ch]:
1464 * src/frontends/xforms/FormUrl.[Ch]: ditto
1466 * src/frontends/xforms/FormDocument.[Ch]:
1467 * src/frontends/xforms/forms/form_document.C.patch:
1468 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1469 pass through a single input() function.
1471 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1473 * lib/build-listerrors: return status as OK
1475 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1477 * lib/lyxrc.example: Updated to new export code
1479 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1481 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1484 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1487 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1488 LyX-Code is defined.
1489 * lib/layouts/amsbook.layout: ditto.
1491 * boost/Makefile.am: fix typo.
1493 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1495 (add_lastfiles): removed.
1496 (add_documents): removed.
1497 (add_formats): removed.
1499 * src/frontends/Menubar.C: remove useless "using" directive.
1501 * src/MenuBackend.h: add a new MenuItem constructor.
1503 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1506 2000-10-04 Allan Rae <rae@lyx.org>
1508 * lib/Makefile.am (listerrors):
1509 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1510 I haven't got notangle installed so Kayvan please test. The output
1511 should end up in $builddir. This also allows people who don't have
1512 noweb installed to complete the make process without error.
1514 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1515 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1516 by JMarc's picky compiler.
1518 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1521 * src/insets/insettabular.C (setPos): change for loop to not use
1522 sequencing operator. Please check this Jürgen.
1524 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1526 * src/insets/insetcite.C (getScreenLabel): ditto
1527 * src/support/filetools.C (QuoteName): ditto
1528 (ChangeExtension): ditto
1530 * src/BufferView_pimpl.C (scrollCB): make heigt int
1532 * src/BufferView2.C (insertInset): comment out unused arg
1534 * boost/Makefile.am (EXTRADIST): new variable
1536 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1538 * src/exporter.C (IsExportable): Fixed
1540 * lib/configure.m4: Small fix
1542 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1544 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1545 * src/insets/insetbib.C (bibitemWidest): ditto.
1546 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1548 2000-10-03 Juergen Vigna <jug@sad.it>
1550 * src/BufferView2.C (theLockingInset): removed const because of
1551 Agnus's compile problems.
1553 * src/insets/insettext.C (LocalDispatch): set the language of the
1554 surronding paragraph on inserting the first character.
1556 * various files: changed use of BufferView::the_locking_inset.
1558 * src/BufferView2.C (theLockingInset):
1559 (theLockingInset): new functions.
1561 * src/BufferView.h: removed the_locking_inset.
1563 * src/lyxtext.h: added the_locking_inset
1565 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1567 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1569 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1571 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1572 * src/mathed/math_cursor.C (IsAlpha): ditto.
1573 * src/mathed/math_inset.C (strnew): ditto.
1574 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1575 (IMetrics): cxp set but never used; removed.
1576 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1577 that the variable in question has been removed also!
1580 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1581 using the Buffer * passed to Latex(), using the BufferView * passed to
1582 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1584 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1585 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1587 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1588 * src/buffer.C (readInset): used new InsetBibtex c-tor
1589 * (getBibkeyList): used new InsetBibtex::getKeys
1591 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1594 * lib/build-listerrors
1596 * src/exporter.C: Add literate programming support to the export code
1599 * src/lyx_cb.C: Remove old literate code.
1601 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1604 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1605 * src/converter.C (View, Convert): Use QuoteName.
1607 * src/insets/figinset.C (Preview): Use Formats::View.
1609 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1611 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1613 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1614 the top of the function, because compaq cxx complains that the
1615 "goto exit_with_message" when the function is disabled bypasses
1617 (MenuNew): try a better fix for the generation of new file names.
1618 This time, I used AddName() instead of AddPath(), hoping Juergen
1621 2000-10-03 Allan Rae <rae@lyx.org>
1623 * src/frontends/xforms/forms/form_preferences.fd:
1624 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1625 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1626 "Look and Feel"->"General" but will need to be split up further into
1627 general output and general input tabs. Current plan is for four outer
1628 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1629 stuff; "Inputs" for input and import configuration; "Outputs" for
1630 output and export configuration; and one more whatever is left over
1631 called "General". The leftovers at present look like being which
1632 viewers to use, spellchecker, language support and might be better
1633 named "Support". I've put "Paths" in "Inputs" for the moment as this
1634 seems reasonable for now at least.
1635 One problem remains: X error kills LyX when you close Preferences.
1637 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1639 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1640 qualifier from form()
1641 * src/frontends/xforms/FormCitation.[Ch]:
1642 * src/frontends/xforms/FormCopyright.[Ch]:
1643 * src/frontends/xforms/FormDocument.[Ch]:
1644 * src/frontends/xforms/FormError.[Ch]:
1645 * src/frontends/xforms/FormIndex.[Ch]:
1646 * src/frontends/xforms/FormPreferences.[Ch]:
1647 * src/frontends/xforms/FormPrint.[Ch]:
1648 * src/frontends/xforms/FormRef.[Ch]:
1649 * src/frontends/xforms/FormToc.[Ch]:
1650 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1652 * src/frontends/xforms/FormCitation.[Ch]:
1653 * src/frontends/xforms/FormIndex.[Ch]:
1654 * src/frontends/xforms/FormRef.[Ch]:
1655 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1656 with Allan's naming policy
1658 * src/frontends/xforms/FormCitation.C: some static casts to remove
1661 2000-10-02 Juergen Vigna <jug@sad.it>
1663 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1664 now you can type or do stuff inside the table-cell also when in dummy
1665 position, fixed visible cursor.
1667 * src/insets/insettext.C (Edit): fixing cursor-view position.
1669 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1670 be used for equal functions in lyxfunc and insettext.
1672 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1674 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1676 * src/frontends/gnome/FormCitation.h:
1677 * src/frontends/gnome/FormCopyright.h:
1678 * src/frontends/gnome/FormIndex.h:
1679 * src/frontends/gnome/FormPrint.h:
1680 * src/frontends/gnome/FormToc.h:
1681 * src/frontends/gnome/FormUrl.h:
1682 * src/frontends/kde/FormCitation.h:
1683 * src/frontends/kde/FormCopyright.h:
1684 * src/frontends/kde/FormIndex.h:
1685 * src/frontends/kde/FormRef.h:
1686 * src/frontends/kde/FormToc.h:
1687 * src/frontends/kde/FormUrl.h: fix remaining users of
1690 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1692 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1693 from depth argument.
1694 (DocBookHandleCaption): ditto.
1695 (DocBookHandleFootnote): ditto.
1696 (SimpleDocBookOnePar): ditto.
1698 * src/frontends/xforms/FormDocument.h (form): remove extra
1699 FormDocument:: qualifier.
1701 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1703 * sigc++/handle.h: ditto.
1705 * src/lyx_gui_misc.C: add "using" directive.
1707 * src/cheaders/cstddef: new file, needed by the boost library (for
1710 2000-10-02 Juergen Vigna <jug@sad.it>
1712 * src/insets/insettext.C (SetFont): better support.
1714 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1716 * src/screen.C (DrawOneRow): some uint refixes!
1718 2000-10-02 Allan Rae <rae@lyx.org>
1720 * boost/.cvsignore: ignore Makefile as well
1722 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1723 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1725 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1726 Left this one out by accident.
1728 * src/frontends/xforms/FormBase.h (restore): default to calling
1729 update() since that will restore the original/currently-applied values.
1730 Any input() triggered error messages will require the derived classes
1731 to redefine restore().
1733 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1734 avoid a segfault. combo_doc_class is the main concern.
1736 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1738 * Simplify build-listerrors in view of GUI-less export ability!
1740 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1742 * src/lyx_main.C (easyParse): Disable gui when exporting
1744 * src/insets/figinset.C:
1747 * src/lyx_gui_misc.C
1748 * src/tabular.C: Changes to allow no-gui.
1750 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1752 * src/support/utility.hpp: removed file
1753 * src/support/block.h: removed file
1755 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1758 * src/mathed/formula.C: add support/lyxlib.h
1759 * src/mathed/formulamacro.C: ditto
1761 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1762 * src/lyxparagraph.h: ditto
1764 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1765 * src/frontends/Makefile.am (INCLUDES): ditto
1766 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1767 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1768 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1769 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1770 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1771 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1773 * src/BufferView.h: use boost/utility.hpp
1774 * src/LColor.h: ditto
1775 * src/LaTeX.h: ditto
1776 * src/LyXAction.h: ditto
1777 * src/LyXView.h: ditto
1778 * src/bufferlist.h: ditto
1779 * src/lastfiles.h: ditto
1780 * src/layout.h: ditto
1781 * src/lyx_gui.h: ditto
1782 * src/lyx_main.h: ditto
1783 * src/lyxlex.h: ditto
1784 * src/lyxrc.h: ditto
1785 * src/frontends/ButtonPolicies.h: ditto
1786 * src/frontends/Dialogs.h: ditto
1787 * src/frontends/xforms/FormBase.h: ditto
1788 * src/frontends/xforms/FormGraphics.h: ditto
1789 * src/frontends/xforms/FormParagraph.h: ditto
1790 * src/frontends/xforms/FormTabular.h: ditto
1791 * src/graphics/GraphicsCache.h: ditto
1792 * src/graphics/Renderer.h: ditto
1793 * src/insets/ExternalTemplate.h: ditto
1794 * src/insets/insetcommand.h: ditto
1795 * src/support/path.h: ditto
1797 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1798 and introduce clause for 2.97.
1800 * boost/libs/README: new file
1802 * boost/boost/utility.hpp: new file
1804 * boost/boost/config.hpp: new file
1806 * boost/boost/array.hpp: new file
1808 * boost/Makefile.am: new file
1810 * boost/.cvsignore: new file
1812 * configure.in (AC_OUTPUT): add boost/Makefile
1814 * Makefile.am (SUBDIRS): add boost
1816 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1818 * src/support/lstrings.C (suffixIs): Fixed.
1820 2000-10-01 Allan Rae <rae@lyx.org>
1822 * src/PrinterParams.h: moved things around to avoid the "can't
1823 inline call" warning.
1825 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1826 into doc++ documentation.
1828 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1830 * src/frontends/xforms/FormRef.C: make use of button controller
1831 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1832 cleaned up button controller usage.
1833 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1834 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1835 use the button controller
1837 * src/frontends/xforms/forms/*.fd: and associated generated files
1838 updated to reflect changes to FormBase. Some other FormXxxx files
1839 also got minor updates to reflect changes to FormBase.
1841 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1842 (hide): made virtual.
1843 (input): return a bool. true == valid input
1844 (RestoreCB, restore): new
1845 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1846 Changes to allow derived dialogs to use a ButtonController and
1847 make sense when doing so: OK button calls ok() and so on.
1849 * src/frontends/xforms/ButtonController.h (class ButtonController):
1850 Switch from template implementation to taking Policy parameter.
1851 Allows FormBase to provide a ButtonController for any dialog.
1853 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1854 Probably should rename connect and disconnect.
1855 (apply): use the radio button groups
1856 (form): needed by FormBase
1857 (build): setup the radio button groups
1859 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1861 * several files: type changes to reduce the number of warnings and
1862 to unify type hangling a bit. Still much to do.
1864 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1866 * lib/images/*: rename a bunch of icons to match Dekel converter
1869 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1872 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1874 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1876 * sigc++/handle.h: ditto for class Handle.
1878 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1880 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1882 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1884 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1885 removal of the "default" language.
1887 * src/combox.h (getline): Check that sel > 0
1889 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1891 * lib/examples/docbook_example.lyx
1892 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1894 * lib/layouts/docbook-book.layout: new docbook book layout.
1896 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1898 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1900 * src/insets/figinset.C (DocBook):fixed small typo.
1902 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1904 * src/insets/insetinclude.h: string include_label doesn't need to be
1907 2000-09-29 Allan Rae <rae@lyx.org>
1909 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1910 Allow derived type to control connection and disconnection from signals
1911 of its choice if desired.
1913 2000-09-28 Juergen Vigna <jug@sad.it>
1915 * src/insets/insettabular.C (update): fixed cursor setting when
1916 the_locking_inset changed.
1917 (draw): made this a bit cleaner.
1918 (InsetButtonPress): fixed!
1920 * various files: added LyXText Parameter to fitCursor call.
1922 * src/BufferView.C (fitCursor): added LyXText parameter.
1924 * src/insets/insettabular.C (draw): small draw fix.
1926 * src/tabular.C: right setting of left/right celllines.
1928 * src/tabular.[Ch]: fixed various types in funcions and structures.
1929 * src/insets/insettabular.C: ditto
1930 * src/frontends/xforms/FormTabular.C: ditto
1932 2000-09-28 Allan Rae <rae@lyx.org>
1934 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1935 that the #ifdef's had been applied to part of what should have been
1936 a complete condition. It's possible there are other tests that
1937 were specific to tables that are also wrong now that InsetTabular is
1938 being used. Now we need to fix the output of '\n' after a table in a
1939 float for the same reason as the original condition:
1940 "don't insert this if we would be adding it before or after a table
1941 in a float. This little trick is needed in order to allow use of
1942 tables in \subfigures or \subtables."
1943 Juergen can you check this?
1945 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1947 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1948 output to the ostream.
1950 * several files: fixed types based on warnings from cxx
1952 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1954 * src/frontends/kde/Makefile.am: fix rule for
1955 formindexdialogdata_moc.C
1957 * src/.cvsignore: add ext_l10n.h to ignore
1959 * acconfig.h: stop messing with __STRICT_ANSI__
1960 * config/gnome.m4: remove option to set -ansi
1961 * config/kde.m4: remove option to set -ansi
1962 * config/lyxinclude.m4: don't set -ansi
1964 2000-09-27 Juergen Vigna <jug@sad.it>
1966 * various files: remove "default" language check.
1968 * src/insets/insetquotes.C: removed use of current_view.
1970 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1971 the one should have red ears by now!
1973 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1974 in more then one paragraph. Fixed cursor-movement/selection.
1976 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1977 paragraphs inside a text inset.
1979 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1980 text-inset if this owner is an inset.
1982 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1984 * src/Bullet.h: changed type of font, character and size to int
1986 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1988 * src/insets/inseturl.[Ch]:
1989 * src/insets/insetref.[Ch]:
1990 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1992 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1994 * src/buffer.C (readFile): block-if statement rearranged to minimise
1995 bloat. Patch does not reverse Jean-Marc's change ;-)
1997 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1998 Class rewritten to store pointers to hide/update signals directly,
1999 rather than Dialogs *. Also defined an enum to ease use. All xforms
2000 forms can now be derived from this class.
2002 * src/frontends/xforms/FormCommand.[Ch]
2003 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2005 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2008 * src/frontends/xforms/forms/form_citation.fd
2009 * src/frontends/xforms/forms/form_copyright.fd
2010 * src/frontends/xforms/forms/form_error.fd
2011 * src/frontends/xforms/forms/form_index.fd
2012 * src/frontends/xforms/forms/form_ref.fd
2013 * src/frontends/xforms/forms/form_toc.fd
2014 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2016 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2018 * src/insets/insetfoot.C: removed redundent using directive.
2020 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2022 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2023 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2025 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2026 created in the constructors in different groups. Then set() just
2027 have to show the groups as needed. This fixes the redraw problems
2028 (and is how the old menu code worked).
2030 * src/support/lyxlib.h: declare the methods as static when we do
2031 not have namespaces.
2033 2000-09-26 Juergen Vigna <jug@sad.it>
2035 * src/buffer.C (asciiParagraph): new function.
2036 (writeFileAscii): new function with parameter ostream.
2037 (writeFileAscii): use now asciiParagraph.
2039 * various inset files: added the linelen parameter to the Ascii-func.
2041 * src/tabular.C (Write): fixed error in writing file introduced by
2042 the last changes from Lars.
2044 * lib/bind/menus.bind: removed not supported functions.
2046 * src/insets/insettext.C (Ascii): implemented this function.
2048 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2050 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2051 (Write): use of the write_attribute functions.
2053 * src/bufferlist.C (close): fixed reasking question!
2055 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2057 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2058 new files use the everwhere possible.
2061 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2062 src/log_form.C src/lyx.C:
2065 * src/buffer.C (runLaTeX): remove func
2067 * src/PaperLayout.C: removed file
2068 * src/ParagraphExtra.C: likewise
2069 * src/bullet_forms.C: likewise
2070 * src/bullet_forms.h: likewise
2071 * src/bullet_forms_cb.C: likewise
2073 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2074 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2077 * several files: remove all traces of the old fd_form_paragraph,
2078 and functions belonging to that.
2080 * several files: remove all traces of the old fd_form_document,
2081 and functions belonging to that.
2083 * several files: constify local variables were possible.
2085 * several files: remove all code that was dead when NEW_EXPORT was
2088 * several files: removed string::c_str in as many places as
2091 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2092 (e): be a bit more outspoken when patching
2093 (updatesrc): only move files if changed.
2095 * forms/layout_forms.h.patch: regenerated
2097 * forms/layout_forms.fd: remove form_document and form_paragraph
2098 and form_quotes and form_paper and form_table_options and
2099 form_paragraph_extra
2101 * forms/form1.fd: remove form_table
2103 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2104 the fdui->... rewrite. Update some comments to xforms 0.88
2106 * forms/bullet_forms.C.patch: removed file
2107 * forms/bullet_forms.fd: likewise
2108 * forms/bullet_forms.h.patch: likewise
2110 * development/Code_rules/Rules: added a section on switch
2111 statements. Updated some comment to xforms 0.88.
2113 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2115 * src/buffer.C (readFile): make sure that the whole version number
2116 is read after \lyxformat (even when it contains a comma)
2118 * lib/ui/default.ui: change shortcut of math menu to M-a.
2120 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2122 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2125 * src/LyXView.C (updateWindowTitle): show the full files name in
2126 window title, limited to 30 characters.
2128 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2129 When a number of characters has been given, we should not assume
2130 that the string is 0-terminated.
2132 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2133 calls (fixes some memory leaks)
2135 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2136 trans member on exit.
2138 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2140 * src/converter.C (GetReachable): fix typo.
2142 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2143 understand ',' instead of '.'.
2144 (GetInteger): rewrite to use strToInt().
2146 2000-09-26 Juergen Vigna <jug@sad.it>
2148 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2149 better visibility and error-message on wrong VSpace input.
2151 * src/language.C (initL): added english again.
2153 2000-09-25 Juergen Vigna <jug@sad.it>
2155 * src/frontends/kde/Dialogs.C (Dialogs):
2156 * src/frontends/gnome/Dialogs.C (Dialogs):
2157 * src/frontends/kde/Makefile.am:
2158 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2160 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2162 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2164 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2166 * src/frontends/xforms/FormParagraph.C:
2167 * src/frontends/xforms/FormParagraph.h:
2168 * src/frontends/xforms/form_paragraph.C:
2169 * src/frontends/xforms/form_paragraph.h:
2170 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2173 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2175 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2176 Paragraph-Data after use.
2178 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2179 non breakable paragraphs.
2181 2000-09-25 Garst R. Reese <reese@isn.net>
2183 * src/language.C (initL): added missing language_country codes.
2185 2000-09-25 Juergen Vigna <jug@sad.it>
2187 * src/insets/insettext.C (InsetText):
2188 (deleteLyXText): remove the not released LyXText structure!
2190 2000-09-24 Marko Vendelin <markov@ioc.ee>
2192 * src/frontends/gnome/mainapp.C
2193 * src/frontends/gnome/mainapp.h: added support for keyboard
2196 * src/frontends/gnome/FormCitation.C
2197 * src/frontends/gnome/FormCitation.h
2198 * src/frontends/gnome/Makefile.am
2199 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2200 FormCitation to use "action area" in mainapp window
2202 * src/frontends/gnome/Menubar_pimpl.C
2203 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2206 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2208 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2209 width/descent/ascent values if name is empty.
2210 (mathed_string_height): Use std::max.
2212 2000-09-25 Allan Rae <rae@lyx.org>
2214 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2215 segfault. This will be completely redesigned soon.
2217 * sigc++: updated libsigc++. Fixes struct timespec bug.
2219 * development/tools/makeLyXsigc.sh: .cvsignore addition
2221 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2223 * several files: removed almost all traces of the old table
2226 * src/TableLayout.C: removed file
2228 2000-09-22 Juergen Vigna <jug@sad.it>
2230 * src/frontends/kde/Dialogs.C: added credits forms.
2232 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2234 * src/frontends/gnome/Dialogs.C: added some forms.
2236 * src/spellchecker.C (init_spell_checker): set language in pspell code
2237 (RunSpellChecker): some modifications for setting language string.
2239 * src/language.[Ch]: added language_country code.
2241 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2243 * src/frontends/Dialogs.h: added new signal showError.
2244 Rearranged existing signals in some sort of alphabetical order.
2246 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2247 FormError.[Ch], form_error.[Ch]
2248 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2249 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2251 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2252 dialogs. I think that this can be used as the base to all these
2255 * src/frontends/xforms/FormError.[Ch]
2256 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2257 implementation of InsetError dialog.
2259 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2261 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2262 * src/frontends/kde/Makefile.am: ditto
2264 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2266 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2267 macrobf. This fixes a bug of invisible text.
2269 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2271 * lib/doc/LaTeXConfig.lyx.in: updated.
2273 * src/language.C (initL): remove language "francais" and change a
2274 bit the names of the two other french variations.
2276 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2277 string that may not be 0-terminated.
2279 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2281 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2283 2000-09-20 Marko Vendelin <markov@ioc.ee>
2285 * src/frontends/gnome/FormCitation.C
2286 * src/frontends/gnome/FormIndex.C
2287 * src/frontends/gnome/FormToc.C
2288 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2289 the variable initialization to shut up the warnings
2291 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2293 * src/table.[Ch]: deleted files
2295 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2298 2000-09-18 Juergen Vigna <jug@sad.it>
2300 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2301 problems with selection. Inserted new LFUN_PASTESELECTION.
2302 (InsetButtonPress): inserted handling of middle mouse-button paste.
2304 * src/spellchecker.C: changed word to word.c_str().
2306 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2308 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2309 included in the ``make dist'' tarball.
2311 2000-09-15 Juergen Vigna <jug@sad.it>
2313 * src/CutAndPaste.C (cutSelection): small fix return the right
2314 end position after cut inside one paragraph only.
2316 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2317 we are locked as otherwise we don't have a valid cursor position!
2319 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2321 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2323 * src/frontends/kde/FormRef.C: added using directive.
2324 * src/frontends/kde/FormToc.C: ditto
2326 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2328 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2330 2000-09-19 Marko Vendelin <markov@ioc.ee>
2332 * src/frontends/gnome/Menubar_pimpl.C
2333 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2334 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2336 * src/frontends/gnome/mainapp.C
2337 * src/frontends/gnome/mainapp.h: support for menu update used
2340 * src/frontends/gnome/mainapp.C
2341 * src/frontends/gnome/mainapp.h: support for "action" area in the
2342 main window. This area is used by small simple dialogs, such as
2345 * src/frontends/gnome/FormIndex.C
2346 * src/frontends/gnome/FormIndex.h
2347 * src/frontends/gnome/FormUrl.C
2348 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2351 * src/frontends/gnome/FormCitation.C
2352 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2353 action area. Only "Insert new citation" is implemented.
2355 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2357 * src/buffer.C (Dispatch): fix call to Dispatch
2358 * src/insets/insetref.C (Edit): likewise
2359 * src/insets/insetparent.C (Edit): likewise
2360 * src/insets/insetinclude.C (include_cb): likewise
2361 * src/frontends/xforms/FormUrl.C (apply): likewise
2362 * src/frontends/xforms/FormToc.C (apply): likewise
2363 * src/frontends/xforms/FormRef.C (apply): likewise
2364 * src/frontends/xforms/FormIndex.C (apply): likewise
2365 * src/frontends/xforms/FormCitation.C (apply): likewise
2366 * src/lyxserver.C (callback): likewise
2367 * src/lyxfunc.C (processKeySym): likewise
2368 (Dispatch): likewise
2369 (Dispatch): likewise
2370 * src/lyx_cb.C (LayoutsCB): likewise
2372 * Makefile.am (sourcedoc): small change
2374 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2376 * src/main.C (main): Don't make an empty GUIRunTime object. all
2377 methods are static. constify a bit remove unneded using + headers.
2379 * src/tabular.C: some more const to local vars move some loop vars
2381 * src/spellchecker.C: added some c_str after some word for pspell
2383 * src/frontends/GUIRunTime.h: add new static method setDefaults
2384 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2385 * src/frontends/kde/GUIRunTime.C (setDefaults):
2386 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2388 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2389 with strnew in arg, use correct emptystring when calling SetName.
2391 * several files: remove all commented code with relation to
2392 HAVE_SSTREAM beeing false. We now only support stringstream and
2395 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2397 * src/lyxfunc.C: construct correctly the automatic new file
2400 * src/text2.C (IsStringInText): change type of variable i to shut
2403 * src/support/sstream.h: do not use namespaces if the compiler
2404 does not support them.
2406 2000-09-15 Marko Vendelin <markov@ioc.ee>
2407 * src/frontends/gnome/FormCitation.C
2408 * src/frontends/gnome/FormCitation.h
2409 * src/frontends/gnome/diainsertcitation_interface.c
2410 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2411 regexp support to FormCitation [Gnome].
2413 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2416 * configure.in: remove unused KDE/GTKGUI define
2418 * src/frontends/kde/FormRef.C
2419 * src/frontends/kde/FormRef.h
2420 * src/frontends/kde/formrefdialog.C
2421 * src/frontends/kde/formrefdialog.h: double click will
2422 go to reference, now it is possible to change a cross-ref
2425 * src/frontends/kde/FormToc.C
2426 * src/frontends/kde/FormToc.h
2427 * src/frontends/kde/formtocdialog.C
2428 * src/frontends/kde/formtocdialog.h: add a depth
2431 * src/frontends/kde/Makefile.am: add QtLyXView.h
2434 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2436 * src/frontends/kde/FormCitation.h: added some using directives.
2438 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2440 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2443 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2446 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2448 * src/buffer.C (pop_tag): revert for the second time a change by
2449 Lars, who seems to really hate having non-local loop variables :)
2451 * src/Lsstream.h: add "using" statements.
2453 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2454 * src/buffer.C (writeFile): ditto
2456 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2458 * src/buffer.C (writeFile): try to fix the locale modified format
2459 number to always be as we want it.
2461 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2462 in XForms 0.89. C-space is now working again.
2464 * src/Lsstream.h src/support/sstream.h: new files.
2466 * also commented out all cases where strstream were used.
2468 * src/Bullet.h (c_str): remove method.
2470 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2472 * a lot of files: get rid of "char const *" and "char *" is as
2473 many places as possible. We only want to use them in interaction
2474 with system of other libraries, not inside lyx.
2476 * a lot of files: return const object is not of pod type. This
2477 helps ensure that temporary objects is not modified. And fits well
2478 with "programming by contract".
2480 * configure.in: check for the locale header too
2482 * Makefile.am (sourcedoc): new tag for generation of doc++
2485 2000-09-14 Juergen Vigna <jug@sad.it>
2487 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2488 callback to check which combo called it and do the right action.
2490 * src/combox.C (combo_cb): added combo * to the callbacks.
2491 (Hide): moved call of callback after Ungrab of the pointer.
2493 * src/intl.h: removed LCombo2 function.
2495 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2496 function as this can now be handled in one function.
2498 * src/combox.h: added Combox * to callback prototype.
2500 * src/frontends/xforms/Toolbar_pimpl.C:
2501 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2503 2000-09-14 Garst Reese <reese@isn.net>
2505 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2506 moved usepackage{xxx}'s to beginning of file. Changed left margin
2507 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2508 underlining from title. Thanks to John Culleton for useful suggestions.
2510 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2512 * src/lyxlex_pimpl.C (setFile): change error message to debug
2515 2000-09-13 Juergen Vigna <jug@sad.it>
2517 * src/frontends/xforms/FormDocument.C: implemented choice_class
2518 as combox and give callback to combo_language so OK/Apply is activated
2521 * src/bufferlist.C (newFile): small fix so already named files
2522 (via an open call) are not requested to be named again on the
2525 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2527 * src/frontends/kde/Makefile.am
2528 * src/frontends/kde/FormRef.C
2529 * src/frontends/kde/FormRef.h
2530 * src/frontends/kde/formrefdialog.C
2531 * src/frontends/kde/formrefdialog.h: implement
2534 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2536 * src/frontends/kde/formtocdialog.C
2537 * src/frontends/kde/formtocdialog.h
2538 * src/frontends/kde/FormToc.C
2539 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2541 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2543 * src/frontends/kde/FormCitation.C: fix thinko
2544 where we didn't always display the reference text
2547 * src/frontends/kde/formurldialog.C
2548 * src/frontends/kde/formurldialog.h
2549 * src/frontends/kde/FormUrl.C
2550 * src/frontends/kde/FormUrl.h: minor cleanups
2552 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2554 * src/frontends/kde/Makefile.am
2555 * src/frontends/kde/FormToc.C
2556 * src/frontends/kde/FormToc.h
2557 * src/frontends/kde/FormCitation.C
2558 * src/frontends/kde/FormCitation.h
2559 * src/frontends/kde/FormIndex.C
2560 * src/frontends/kde/FormIndex.h
2561 * src/frontends/kde/formtocdialog.C
2562 * src/frontends/kde/formtocdialog.h
2563 * src/frontends/kde/formcitationdialog.C
2564 * src/frontends/kde/formcitationdialog.h
2565 * src/frontends/kde/formindexdialog.C
2566 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2568 2000-09-12 Juergen Vigna <jug@sad.it>
2570 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2573 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2575 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2578 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2580 * src/converter.C (Add, Convert): Added support for converter flags:
2581 needaux, resultdir, resultfile.
2582 (Convert): Added new parameter view_file.
2583 (dvips_options): Fixed letter paper option.
2585 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2586 (Export, GetExportableFormats, GetViewableFormats): Added support
2589 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2591 (easyParse): Fixed to work with new export code.
2593 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2596 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2598 * lib/bind/*.bind: Replaced
2599 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2600 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2602 2000-09-11 Juergen Vigna <jug@sad.it>
2604 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2606 * src/main.C (main): now GUII defines global guiruntime!
2608 * src/frontends/gnome/GUIRunTime.C (initApplication):
2609 * src/frontends/kde/GUIRunTime.C (initApplication):
2610 * src/frontends/xforms/GUIRunTime.C (initApplication):
2611 * src/frontends/GUIRunTime.h: added new function initApplication.
2613 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2615 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2617 2000-09-08 Juergen Vigna <jug@sad.it>
2619 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2620 we have already "Reset".
2622 * src/language.C (initL): inserted "default" language and made this
2623 THE default language (and not american!)
2625 * src/paragraph.C: inserted handling of "default" language!
2627 * src/lyxfont.C: ditto
2631 * src/paragraph.C: output the \\par only if we have a following
2632 paragraph otherwise it's not needed.
2634 2000-09-05 Juergen Vigna <jug@sad.it>
2636 * config/pspell.m4: added entry to lyx-flags
2638 * src/spellchecker.C: modified version from Kevin for using pspell
2640 2000-09-01 Marko Vendelin <markov@ioc.ee>
2641 * src/frontends/gnome/Makefile.am
2642 * src/frontends/gnome/FormCitation.C
2643 * src/frontends/gnome/FormCitation.h
2644 * src/frontends/gnome/diainsertcitation_callbacks.c
2645 * src/frontends/gnome/diainsertcitation_callbacks.h
2646 * src/frontends/gnome/diainsertcitation_interface.c
2647 * src/frontends/gnome/diainsertcitation_interface.h
2648 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2649 dialog for Gnome frontend
2651 * src/main.C: Gnome libraries require keeping application name
2652 and its version as strings
2654 * src/frontends/gnome/mainapp.C: Change the name of the main window
2655 from GnomeLyX to PACKAGE
2657 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2659 * src/frontends/Liason.C: add "using: declaration.
2661 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2663 * src/mathed/math_macro.C (Metrics): Set the size of the template
2665 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2667 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2669 * src/converter.C (add_options): New function.
2670 (SetViewer): Change $$FName into '$$FName'.
2671 (View): Add options when running xdvi
2672 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2673 (Convert): The 3rd parameter is now the desired filename. Converts
2674 calls to lyx::rename if necessary.
2675 Add options when running dvips.
2676 (dvi_papersize,dvips_options): New methods.
2678 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2680 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2681 using a call to Converter::dvips_options.
2682 Fixed to work with nex export code.
2684 * src/support/copy.C
2685 * src/support/rename.C: New files
2687 * src/support/syscall.h
2688 * src/support/syscall.C: Added Starttype SystemDontWait.
2690 * lib/ui/default.ui: Changed to work with new export code
2692 * lib/configure.m4: Changed to work with new export code
2694 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2696 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2698 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2699 so that code compiles with DEC cxx.
2701 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2702 to work correctly! Also now supports the additional elements
2705 2000-09-01 Allan Rae <rae@lyx.org>
2707 * src/frontends/ButtonPolicies.C: renamed all the references to
2708 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2710 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2711 since it's a const not a type.
2713 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2715 2000-08-31 Juergen Vigna <jug@sad.it>
2717 * src/insets/figinset.C: Various changes to look if the filename has
2718 an extension and if not add it for inline previewing.
2720 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2722 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2723 make buttonStatus and isReadOnly be const methods. (also reflect
2724 this in derived classes.)
2726 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2727 (nextState): change to be static inline, pass the StateMachine as
2729 (PreferencesPolicy): remove casts
2730 (OkCancelPolicy): remvoe casts
2731 (OkCancelReadOnlyPolicy): remove casts
2732 (NoRepeatedApplyReadOnlyPolicy): remove casts
2733 (OkApplyCancelReadOnlyPolicy): remove casts
2734 (OkApplyCancelPolicy): remove casts
2735 (NoRepeatedApplyPolicy): remove casts
2737 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2739 * src/converter.C: added some using directives
2741 * src/frontends/ButtonPolicies.C: changes to overcome
2742 "need lvalue" error with DEC c++
2744 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2745 to WMHideCB for DEC c++
2747 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2749 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2750 to BulletBMTableCB for DEC c++
2752 2000-08-31 Allan Rae <rae@lyx.org>
2754 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2755 character dialog separately from old document dialogs combo_language.
2758 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2760 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2761 Removed LFUN_REF_CREATE.
2763 * src/MenuBackend.C: Added new tags: toc and references
2765 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2766 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2768 (add_toc, add_references): New methods.
2769 (create_submenu): Handle correctly the case when there is a
2770 seperator after optional menu items.
2772 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2773 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2774 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2776 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2778 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2780 * src/converter.[Ch]: New file for converting between different
2783 * src/export.[Ch]: New file for exporting a LyX file to different
2786 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2787 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2788 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2789 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2790 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2791 RunDocBook, MenuExport.
2793 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2794 Exporter::Preview methods if NEW_EXPORT is defined.
2796 * src/buffer.C (Dispatch): Use Exporter::Export.
2798 * src/lyxrc.C: Added new tags: \converter and \viewer.
2801 * src/LyXAction.C: Define new lyx-function: buffer-update.
2802 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2803 when NEW_EXPORT is defined.
2805 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2807 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2809 * lib/ui/default.ui: Added submenus "view" and "update" to the
2812 * src/filetools.C (GetExtension): New function.
2814 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2816 2000-08-29 Allan Rae <rae@lyx.org>
2818 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2820 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2821 (EnableDocumentLayout): removed
2822 (DisableDocumentLayout): removed
2823 (build): make use of ButtonController's read-only handling to
2824 de/activate various objects. Replaces both of the above functions.
2826 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2827 (readOnly): was read_only
2828 (refresh): fixed dumb mistakes with read_only_ handling
2830 * src/frontends/xforms/forms/form_document.fd:
2831 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2832 tabbed dialogs so the tabs look more like tabs and so its easier to
2833 work out which is the current tab.
2835 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2836 segfault with form_table
2838 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2840 2000-08-28 Juergen Vigna <jug@sad.it>
2842 * acconfig.h: added USE_PSPELL.
2844 * src/config.h.in: added USE_PSPELL.
2846 * autogen.sh: added pspell.m4
2848 * config/pspell.m4: new file.
2850 * src/spellchecker.C: implemented support for pspell libary.
2852 2000-08-25 Juergen Vigna <jug@sad.it>
2854 * src/LyXAction.C (init): renamed LFUN_TABLE to
2855 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2857 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2859 * src/lyxscreen.h: add force_clear variable and fuction to force
2860 a clear area when redrawing in LyXText.
2862 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2864 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2866 * some whitespace and comment changes.
2868 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2870 * src/buffer.C: up te LYX_FORMAT to 2.17
2872 2000-08-23 Juergen Vigna <jug@sad.it>
2874 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2877 * src/insets/insettabular.C (pasteSelection): delete the insets
2878 LyXText as it is not valid anymore.
2879 (copySelection): new function.
2880 (pasteSelection): new function.
2881 (cutSelection): new function.
2882 (LocalDispatch): implemented cut/copy/paste of cell selections.
2884 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2885 don't have a LyXText.
2887 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2889 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2892 2000-08-22 Juergen Vigna <jug@sad.it>
2894 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2895 ifdef form_table out if NEW_TABULAR.
2897 2000-08-21 Juergen Vigna <jug@sad.it>
2899 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2900 (draw): fixed draw position so that the cursor is positioned in the
2902 (InsetMotionNotify): hide/show cursor so the position is updated.
2903 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2904 using cellstart() function where it should be used.
2906 * src/insets/insettext.C (draw): ditto.
2908 * src/tabular.C: fixed initialization of some missing variables and
2909 made BoxType into an enum.
2911 2000-08-22 Marko Vendelin <markov@ioc.ee>
2912 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2913 stock menu item using action numerical value, not its string
2917 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2919 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2920 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2922 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2924 * src/frontends/xforms/GUIRunTime.C: new file
2926 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2927 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2929 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2931 * src/frontends/kde/GUIRunTime.C: new file
2933 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2934 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2936 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2938 * src/frontends/gnome/GUIRunTime.C: new file
2940 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2943 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2944 small change to documetentation.
2946 * src/frontends/GUIRunTime.C: removed file
2948 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2950 * src/lyxparagraph.h: enable NEW_TABULAR as default
2952 * src/lyxfunc.C (processKeySym): remove some commented code
2954 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2955 NEW_TABULAR around the fd_form_table_options.
2957 * src/lyx_gui.C (runTime): call the static member function as
2958 GUIRunTime::runTime().
2960 2000-08-21 Allan Rae <rae@lyx.org>
2962 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2965 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2967 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2969 2000-08-21 Allan Rae <rae@lyx.org>
2971 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2972 keep Garst happy ;-)
2973 * src/frontends/xforms/FormPreferences.C (build): use setOK
2974 * src/frontends/xforms/FormDocument.C (build): use setOK
2975 (FormDocument): use the appropriate policy.
2977 2000-08-21 Allan Rae <rae@lyx.org>
2979 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2980 automatic [de]activation of arbitrary objects when in a read-only state.
2982 * src/frontends/ButtonPolicies.h: More documentation
2983 (isReadOnly): added to support the above.
2985 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2987 2000-08-18 Juergen Vigna <jug@sad.it>
2989 * src/insets/insettabular.C (getStatus): changed to return func_status.
2991 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2992 display toggle menu entries if they are.
2994 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2995 new document layout now.
2997 * src/lyxfunc.C: ditto
2999 * src/lyx_gui_misc.C: ditto
3001 * src/lyx_gui.C: ditto
3003 * lib/ui/default.ui: removed paper and quotes layout as they are now
3004 all in the document layout tabbed folder.
3006 * src/frontends/xforms/forms/form_document.fd: added Restore
3007 button and callbacks for all inputs for Allan's ButtonPolicy.
3009 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3010 (CheckChoiceClass): added missing params setting on class change.
3011 (UpdateLayoutDocument): added for updating the layout on params.
3012 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3013 (FormDocument): Implemented Allan's ButtonPolicy with the
3016 2000-08-17 Allan Rae <rae@lyx.org>
3018 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3019 so we can at least see the credits again.
3021 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3022 controller calls for the appropriate callbacks. Note that since Ok
3023 calls apply followed by cancel, and apply isn't a valid input for the
3024 APPLIED state, the bc_ calls have to be made in the static callback not
3025 within each of the real callbacks.
3027 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3028 (setOk): renamed from setOkay()
3030 2000-08-17 Juergen Vigna <jug@sad.it>
3032 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3033 in the implementation part.
3034 (composeUIInfo): don't show optional menu-items.
3036 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3038 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3040 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3041 text-state when in a text-inset.
3043 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3045 2000-08-17 Marko Vendelin <markov@ioc.ee>
3046 * src/frontends/gnome/FormIndex.C
3047 * src/frontends/gnome/FormIndex.h
3048 * src/frontends/gnome/FormToc.C
3049 * src/frontends/gnome/FormToc.h
3050 * src/frontends/gnome/dialogs
3051 * src/frontends/gnome/diatoc_callbacks.c
3052 * src/frontends/gnome/diatoc_callbacks.h
3053 * src/frontends/gnome/diainsertindex_callbacks.h
3054 * src/frontends/gnome/diainsertindex_callbacks.c
3055 * src/frontends/gnome/diainsertindex_interface.c
3056 * src/frontends/gnome/diainsertindex_interface.h
3057 * src/frontends/gnome/diatoc_interface.h
3058 * src/frontends/gnome/diatoc_interface.c
3059 * src/frontends/gnome/Makefile.am: Table of Contents and
3060 Insert Index dialogs implementation for Gnome frontend
3062 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3064 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3066 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3069 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3071 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3072 destructor. Don't definde if you don't need it
3073 (processEvents): made static, non-blocking events processing for
3075 (runTime): static method. event loop for xforms
3076 * similar as above for kde and gnome.
3078 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3079 new Pimpl is correct
3080 (runTime): new method calss the real frontends runtime func.
3082 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3084 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3086 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3088 2000-08-16 Juergen Vigna <jug@sad.it>
3090 * src/lyx_gui.C (runTime): added GUII RunTime support.
3092 * src/frontends/Makefile.am:
3093 * src/frontends/GUIRunTime.[Ch]:
3094 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3095 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3096 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3098 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3100 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3101 as this is already set in ${FRONTEND_INCLUDE} if needed.
3103 * configure.in (CPPFLAGS): setting the include dir for the frontend
3104 directory and don't set FRONTEND=xforms for now as this is executed
3107 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3109 * src/frontends/kde/Makefile.am:
3110 * src/frontends/kde/FormUrl.C:
3111 * src/frontends/kde/FormUrl.h:
3112 * src/frontends/kde/formurldialog.h:
3113 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3115 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3117 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3119 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3121 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3124 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3126 * src/WorkArea.C (work_area_handler): more work to get te
3127 FL_KEYBOARD to work with xforms 0.88 too, please test.
3129 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3131 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3133 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3136 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3138 * src/Timeout.h: remove Qt::emit hack.
3140 * several files: changes to allo doc++ compilation
3142 * src/lyxfunc.C (processKeySym): new method
3143 (processKeyEvent): comment out if FL_REVISION < 89
3145 * src/WorkArea.C: change some debugging levels.
3146 (WorkArea): set wantkey to FL_KEY_ALL
3147 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3148 clearer code and the use of compose with XForms 0.89. Change to
3149 use signals instead of calling methods in bufferview directly.
3151 * src/Painter.C: change some debugging levels.
3153 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3156 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3157 (workAreaKeyPress): new method
3159 2000-08-14 Juergen Vigna <jug@sad.it>
3161 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3163 * config/kde.m4: addes some features
3165 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3166 include missing xforms dialogs.
3168 * src/Timeout.h: a hack to be able to compile with qt/kde.
3170 * sigc++/.cvsignore: added acinclude.m4
3172 * lib/.cvsignore: added listerros
3174 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3175 xforms tree as objects are needed for other frontends.
3177 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3178 linking with not yet implemented xforms objects.
3180 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3182 2000-08-14 Baruch Even <baruch.even@writeme.com>
3184 * src/frontends/xforms/FormGraphics.h:
3185 * src/frontends/xforms/FormGraphics.C:
3186 * src/frontends/xforms/RadioButtonGroup.h:
3187 * src/frontends/xforms/RadioButtonGroup.C:
3188 * src/insets/insetgraphics.h:
3189 * src/insets/insetgraphics.C:
3190 * src/insets/insetgraphicsParams.h:
3191 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3192 instead of spaces, and various other indentation issues to make the
3193 sources more consistent.
3195 2000-08-14 Marko Vendelin <markov@ioc.ee>
3197 * src/frontends/gnome/dialogs/diaprint.glade
3198 * src/frontends/gnome/FormPrint.C
3199 * src/frontends/gnome/FormPrint.h
3200 * src/frontends/gnome/diaprint_callbacks.c
3201 * src/frontends/gnome/diaprint_callbacks.h
3202 * src/frontends/gnome/diaprint_interface.c
3203 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3206 * src/frontends/gnome/dialogs/diainserturl.glade
3207 * src/frontends/gnome/FormUrl.C
3208 * src/frontends/gnome/FormUrl.h
3209 * src/frontends/gnome/diainserturl_callbacks.c
3210 * src/frontends/gnome/diainserturl_callbacks.h
3211 * src/frontends/gnome/diainserturl_interface.c
3212 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3213 Gnome implementation
3215 * src/frontends/gnome/Dialogs.C
3216 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3217 all other dialogs. Copy all unimplemented dialogs from Xforms
3220 * src/frontends/gnome/support.c
3221 * src/frontends/gnome/support.h: support files generated by Glade
3225 * config/gnome.m4: Gnome configuration scripts
3227 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3228 configure --help message
3230 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3231 only if there are no events pendling in Gnome/Gtk. This enhances
3232 the performance of menus.
3235 2000-08-14 Allan Rae <rae@lyx.org>
3237 * lib/Makefile.am: listerrors cleaning
3239 * lib/listerrors: removed -- generated file
3240 * acinclude.m4: ditto
3241 * sigc++/acinclude.m4: ditto
3243 * src/frontends/xforms/forms/form_citation.fd:
3244 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3247 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3248 `updatesrc` and now we have a `test` target that does what `updatesrc`
3249 used to do. I didn't like having an install target that wasn't related
3252 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3253 on all except FormGraphics. This may yet happen. Followed by a major
3254 cleanup including using FL_TRANSIENT for most of the dialogs. More
3255 changes to come when the ButtonController below is introduced.
3257 * src/frontends/xforms/ButtonController.h: New file for managing up to
3258 four buttons on a dialog according to an externally defined policy.
3259 * src/frontends/xforms/Makefile.am: added above
3261 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3262 Apply and Cancel/Close buttons and everything in between and beyond.
3263 * src/frontends/Makefile.am: added above.
3265 * src/frontends/xforms/forms/form_preferences.fd:
3266 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3267 and removed variable 'status' as a result. Fixed the set_minsize thing.
3268 Use the new screen-font-update after checking screen fonts were changed
3269 Added a "Restore" button to restore the original lyxrc values while
3270 editing. This restores everything not just the last input changed.
3271 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3273 * src/LyXAction.C: screen-font-update added for updating buffers after
3274 screen font settings have been changed.
3275 * src/commandtags.h: ditto
3276 * src/lyxfunc.C: ditto
3278 * forms/lyx.fd: removed screen fonts dialog.
3279 * src/lyx_gui.C: ditto
3280 * src/menus.[Ch]: ditto
3281 * src/lyx.[Ch]: ditto
3282 * src/lyx_cb.C: ditto + code from here moved to make
3283 screen-font-update. And people wonder why progress on GUII is
3284 slow. Look at how scattered this stuff was! It takes forever
3287 * forms/fdfix.sh: Fixup the spacing after commas.
3288 * forms/makefile: Remove date from generated files. Fewer clashes now.
3289 * forms/bullet_forms.C.patch: included someones handwritten changes
3291 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3292 once I've discovered why LyXRC was made noncopyable.
3293 * src/lyx_main.C: ditto
3295 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3297 * src/frontends/xforms/forms/fdfix.sh:
3298 * src/frontends/xforms/forms/fdfixh.sed:
3299 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3300 * src/frontends/xforms/Form*.[hC]:
3301 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3302 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3303 provide a destructor for the struct FD_form_xxxx. Another version of
3304 the set_[max|min]size workaround and a few other cleanups. Actually,
3305 Angus' patch from 20000809.
3307 2000-08-13 Baruch Even <baruch.even@writeme.com>
3309 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3312 2000-08-11 Juergen Vigna <jug@sad.it>
3314 * src/insets/insetgraphics.C (InsetGraphics): changing init
3315 order because of warnings.
3317 * src/frontends/xforms/forms/makefile: adding patching .C with
3320 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3321 from .C.patch to .c.patch
3323 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3324 order because of warning.
3326 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3328 * src/frontends/Liason.C (setMinibuffer): new helper function
3330 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3332 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3334 * lib/ui/default.ui: commented out PaperLayout entry
3336 * src/frontends/xforms/form_document.[Ch]: new added files
3338 * src/frontends/xforms/FormDocument.[Ch]: ditto
3340 * src/frontends/xforms/forms/form_document.fd: ditto
3342 * src/frontends/xforms/forms/form_document.C.patch: ditto
3344 2000-08-10 Juergen Vigna <jug@sad.it>
3346 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3347 (InsetGraphics): initialized cacheHandle to 0.
3348 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3350 2000-08-10 Baruch Even <baruch.even@writeme.com>
3352 * src/graphics/GraphicsCache.h:
3353 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3354 correctly as a cache.
3356 * src/graphics/GraphicsCacheItem.h:
3357 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3360 * src/graphics/GraphicsCacheItem_pimpl.h:
3361 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3364 * src/insets/insetgraphics.h:
3365 * src/insets/insetgraphics.C: Changed from using a signal notification
3366 to polling when image is not loaded.
3368 2000-08-10 Allan Rae <rae@lyx.org>
3370 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3371 that there are two functions that have to been taken out of line by
3372 hand and aren't taken care of in the script. (Just a reminder note)
3374 * sigc++/macros/*.h.m4: Updated as above.
3376 2000-08-09 Juergen Vigna <jug@sad.it>
3378 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3380 * src/insets/insettabular.C: make drawing of single cell smarter.
3382 2000-08-09 Marko Vendelin <markov@ioc.ee>
3383 * src/frontends/gnome/Menubar_pimpl.C
3384 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3385 implementation: new files
3387 * src/frontends/gnome/mainapp.C
3388 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3391 * src/main.C: create Gnome main window
3393 * src/frontends/xforms/Menubar_pimpl.h
3394 * src/frontends/Menubar.C
3395 * src/frontends/Menubar.h: added method Menubar::update that calls
3396 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3398 * src/LyXView.C: calls Menubar::update to update the state
3401 * src/frontends/gnome/Makefile.am: added new files
3403 * src/frontends/Makefile.am: added frontend compiler options
3405 2000-08-08 Juergen Vigna <jug@sad.it>
3407 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3409 * src/bufferlist.C (close):
3410 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3411 documents if exiting without saving.
3413 * src/buffer.C (save): use removeAutosaveFile()
3415 * src/support/filetools.C (removeAutosaveFile): new function.
3417 * src/lyx_cb.C (MenuWrite): returns a bool now.
3418 (MenuWriteAs): check if file could really be saved and revert to the
3420 (MenuWriteAs): removing old autosavefile if existant.
3422 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3423 before Goto toggle declaration, because of compiler warning.
3425 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3427 * src/lyxfunc.C (MenuNew): small fix.
3429 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3431 * src/bufferlist.C (newFile):
3432 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3434 * src/lyxrc.C: added new_ask_filename tag
3436 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3438 * src/lyx.fd: removed code pertaining to form_ref
3439 * src/lyx.[Ch]: ditto
3440 * src/lyx_cb.C: ditto
3441 * src/lyx_gui.C: ditto
3442 * src/lyx_gui_misc.C: ditto
3444 * src/BufferView_pimpl.C (restorePosition): update buffer only
3447 * src/commandtags.h (LFUN_REFTOGGLE): removed
3448 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3449 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3450 (LFUN_REFBACK): renamed LFUN_REF_BACK
3452 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3453 * src/menus.C: ditto
3454 * src/lyxfunc.C (Dispatch): ditto.
3455 InsertRef dialog is now GUI-independent.
3457 * src/texrow.C: added using std::endl;
3459 * src/insets/insetref.[Ch]: strip out large amounts of code.
3460 The inset is now a container and this functionality is now
3461 managed by a new FormRef dialog
3463 * src/frontends/Dialogs.h (showRef, createRef): new signals
3465 * src/frontends/xforms/FormIndex.[Ch],
3466 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3467 when setting dialog's min/max size
3468 * src/frontends/xforms/FormIndex.[Ch]: ditto
3470 * src/frontends/xforms/FormRef.[Ch],
3471 src/frontends/xforms/forms/form_ref.fd: new xforms
3472 implementation of an InsetRef dialog
3474 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3477 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3478 ios::nocreate is not part of the standard. Removed.
3480 2000-08-07 Baruch Even <baruch.even@writeme.com>
3482 * src/graphics/Renderer.h:
3483 * src/graphics/Renderer.C: Added base class for rendering of different
3484 image formats into Pixmaps.
3486 * src/graphics/XPM_Renderer.h:
3487 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3488 in a different class.
3490 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3491 easily add support for other formats.
3493 * src/insets/figinset.C: plugged a leak of an X resource.
3495 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3497 * src/CutAndPaste.[Ch]: make all metods static.
3499 * development/Code_rules/Rules: more work, added section on
3500 Exceptions, and a References section.
3502 * a lot of header files: work to make doc++ able to generate the
3503 source documentation, some workarounds of doc++ problems. Doc++ is
3504 now able to generate the documentation.
3506 2000-08-07 Juergen Vigna <jug@sad.it>
3508 * src/insets/insettabular.C (recomputeTextInsets): removed function
3510 * src/tabular.C (SetWidthOfMulticolCell):
3512 (calculate_width_of_column_NMC): fixed return value so that it really
3513 only returns true if the column-width has changed (there where
3514 problems with muliticolumn-cells in this column).
3516 2000-08-04 Juergen Vigna <jug@sad.it>
3518 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3519 also on the scrollstatus of the inset.
3520 (workAreaMotionNotify): ditto.
3522 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3524 2000-08-01 Juergen Vigna <jug@sad.it>
3526 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3528 * src/commandtags.h:
3529 * src/LyXAction.C (init):
3530 * src/insets/inset.C (LocalDispatch): added support for
3533 * src/insets/inset.C (scroll): new functions.
3535 * src/insets/insettext.C (removeNewlines): new function.
3536 (SetAutoBreakRows): removes forced newlines in the text of the
3537 paragraph if autoBreakRows is set to false.
3539 * src/tabular.C (Latex): generates a parbox around the cell contents
3542 * src/frontends/xforms/FormTabular.C (local_update): removed
3543 the radio_useparbox button.
3545 * src/tabular.C (UseParbox): new function
3547 2000-08-06 Baruch Even <baruch.even@writeme.com>
3549 * src/graphics/GraphicsCache.h:
3550 * src/graphics/GraphicsCache.C:
3551 * src/graphics/GraphicsCacheItem.h:
3552 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3555 * src/insets/insetgraphics.h:
3556 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3557 and the drawing of the inline image.
3559 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3560 loaded into the wrong position.
3562 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3565 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3567 * src/support/translator.h: move all typedefs to public section
3569 * src/support/filetools.C (MakeLatexName): return string const
3571 (TmpFileName): ditto
3572 (FileOpenSearch): ditto
3574 (LibFileSearch): ditto
3575 (i18nLibFileSearch): ditto
3578 (CreateTmpDir): ditto
3579 (CreateBufferTmpDir): ditto
3580 (CreateLyXTmpDir): ditto
3583 (MakeAbsPath): ditto
3585 (OnlyFilename): ditto
3587 (NormalizePath): ditto
3588 (CleanupPath): ditto
3589 (GetFileContents): ditto
3590 (ReplaceEnvironmentPath): ditto
3591 (MakeRelPath): ditto
3593 (ChangeExtension): ditto
3594 (MakeDisplayPath): ditto
3595 (do_popen): return cmdret const
3596 (findtexfile): return string const
3598 * src/support/DebugStream.h: add some /// to please doc++
3600 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3602 * src/texrow.C (same_rownumber): functor to use with find_if
3603 (getIdFromRow): rewritten to use find_if and to not update the
3604 positions. return true if row is found
3605 (increasePos): new method, use to update positions
3607 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3609 * src/lyxlex_pimpl.C (verifyTable): new method
3612 (GetString): return string const
3613 (pushTable): rewrite to use std::stack
3615 (setFile): better check
3618 * src/lyxlex.h: make LyXLex noncopyable
3620 * src/lyxlex.C (text): return char const * const
3621 (GetString): return string const
3622 (getLongString): return string const
3624 * src/lyx_gui_misc.C (askForText): return pair<...> const
3626 * src/lastfiles.[Ch] (operator): return string const
3628 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3629 istringstream not char const *.
3630 move token.end() out of loop.
3631 (readFile): move initializaton of token
3633 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3634 getIdFromRow is successful.
3636 * lib/bind/emacs.bind: don't include menus bind
3638 * development/Code_rules/Rules: the beginnings of making this
3639 better and covering more of the unwritten rules that we have.
3641 * development/Code_rules/Recommendations: a couple of wording
3644 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3646 * src/support/strerror.c: remove C++ comment.
3648 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3650 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3651 LFUN_INDEX_INSERT_LAST
3653 * src/texrow.C (getIdFromRow): changed from const_iterator to
3654 iterator, allowing code to compile with DEC cxx
3656 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3657 stores part of the class, as suggested by Allan. Will allow
3659 (apply): test to apply uses InsetCommandParams operator!=
3661 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3662 (apply): test to apply uses InsetCommandParams operator!=
3664 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3665 stores part of the class.
3666 (update): removed limits on min/max size.
3668 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3669 (apply): test to apply uses InsetCommandParams operator!=
3671 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3672 (Read, Write, scanCommand, getCommand): moved functionality
3673 into InsetCommandParams.
3675 (getScreenLabel): made pure virtual
3676 new InsetCommandParams operators== and !=
3678 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3679 c-tors based on InsetCommandParams. Removed others.
3680 * src/insets/insetinclude.[Ch]: ditto
3681 * src/insets/insetlabel.[Ch]: ditto
3682 * src/insets/insetparent.[Ch]: ditto
3683 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3685 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3686 insets derived from InsetCommand created using similar c-tors
3687 based on InsetCommandParams
3688 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3689 * src/menus.C (ShowRefsMenu): ditto
3690 * src/paragraph.C (Clone): ditto
3691 * src/text2.C (SetCounter): ditto
3692 * src/lyxfunc.C (Dispatch) ditto
3693 Also recreated old InsetIndex behaviour exactly. Can now
3694 index-insert at the start of a paragraph and index-insert-last
3695 without launching the pop-up.
3697 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3699 * lib/lyxrc.example: mark te pdf options as non functional.
3701 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3702 (isStrDbl): move tmpstr.end() out of loop.
3703 (strToDbl): move intialization of tmpstr
3704 (lowercase): return string const and move tmp.end() out of loop.
3705 (uppercase): return string const and move tmp.edn() out of loop.
3706 (prefixIs): add assertion
3711 (containsOnly): ditto
3712 (containsOnly): ditto
3713 (containsOnly): ditto
3714 (countChar): make last arg char not char const
3715 (token): return string const
3716 (subst): return string const, move tmp.end() out of loop.
3717 (subst): return string const, add assertion
3718 (strip): return string const
3719 (frontStrip): return string const, add assertion
3720 (frontStrip): return string const
3725 * src/support/lstrings.C: add inclde "LAssert.h"
3726 (isStrInt): move tmpstr.end() out of loop.
3728 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3729 toollist.end() out of loop.
3730 (deactivate): move toollist.end() out of loop.
3731 (update): move toollist.end() out of loop.
3732 (updateLayoutList): move tc.end() out of loop.
3733 (add): move toollist.end() out of loop.
3735 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3736 md.end() out of loop.
3738 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3740 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3743 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3744 (Erase): move insetlist.end() out of loop.
3746 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3747 ref to const string as first arg. Move initialization of some
3748 variables, whitespace changes.
3750 * src/kbmap.C (defkey): move table.end() out of loop.
3751 (kb_keymap): move table.end() out of loop.
3752 (findbinding): move table.end() out of loop.
3754 * src/MenuBackend.C (hasMenu): move end() out of loop.
3755 (getMenu): move end() out of loop.
3756 (getMenu): move menulist_.end() out of loop.
3758 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3760 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3763 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3764 (getFromLyXName): move infotab.end() out of loop.
3766 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3767 -fvtable-thunks -ffunction-sections -fdata-sections
3769 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3771 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3774 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3776 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3778 * src/frontends/xforms/FormCitation.[Ch],
3779 src/frontends/xforms/FormIndex.[Ch],
3780 src/frontends/xforms/FormToc.[Ch],
3781 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3783 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3785 * src/commandtags.h: renamed, created some flags for citation
3788 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3790 * src/lyxfunc.C (dispatch): use signals to insert index entry
3792 * src/frontends/Dialogs.h: new signal createIndex
3794 * src/frontends/xforms/FormCommand.[Ch],
3795 src/frontends/xforms/FormCitation.[Ch],
3796 src/frontends/xforms/FormToc.[Ch],
3797 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3799 * src/insets/insetindex.[Ch]: GUI-independent
3801 * src/frontends/xforms/FormIndex.[Ch],
3802 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3805 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3807 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3808 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3810 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3812 * src/insets/insetref.C (Latex): rewrite so that there is now
3813 question that a initialization is requested.
3815 * src/insets/insetcommand.h: reenable the hide signal
3817 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3819 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3820 fix handling of shortcuts (many bugs :)
3821 (add_lastfiles): ditto.
3823 * lib/ui/default.ui: fix a few shortcuts.
3825 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3827 * Makefile.am: Fix ``rpmdist'' target to return the exit
3828 status of the ``rpm'' command, instead of the last command in
3829 the chain (the ``rm lyx.xpm'' command, which always returns
3832 2000-08-02 Allan Rae <rae@lyx.org>
3834 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3835 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3836 * src/frontends/xforms/FormToc.C (FormToc): ditto
3838 * src/frontends/xforms/Makefile.am: A few forgotten files
3840 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3841 Signals-not-copyable-problem Lars' started commenting out.
3843 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3845 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3847 * src/insets/insetcommand.h: Signals is not copyable so anoter
3848 scheme for automatic hiding of forms must be used.
3850 * src/frontends/xforms/FormCitation.h: don't inerit from
3851 noncopyable, FormCommand already does that.
3852 * src/frontends/xforms/FormToc.h: ditto
3853 * src/frontends/xforms/FormUrl.h: ditto
3855 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3857 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3859 * src/insets/insetcommand.h (hide): new SigC::Signal0
3860 (d-tor) new virtual destructor emits hide signal
3862 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3863 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3865 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3866 LOF and LOT. Inset is now GUI-independent
3868 * src/insets/insetloa.[Ch]: redundant
3869 * src/insets/insetlof.[Ch]: ditto
3870 * src/insets/insetlot.[Ch]: ditto
3872 * src/frontends/xforms/forms/form_url.fd: tweaked!
3873 * src/frontends/xforms/forms/form_citation.fd: ditto
3875 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3876 dialogs dealing with InsetCommand insets
3878 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3879 FormCommand base class
3880 * src/frontends/xforms/FormUrl.[Ch]: ditto
3882 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3884 * src/frontends/xforms/FormToc.[Ch]: ditto
3886 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3887 passed a generic InsetCommand pointer
3888 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3890 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3891 and modified InsetTOC class
3892 * src/buffer.C: ditto
3894 * forms/lyx.fd: strip out old FD_form_toc code
3895 * src/lyx_gui_misc.C: ditto
3896 * src/lyx_gui.C: ditto
3897 * src/lyx_cb.C: ditto
3898 * src/lyx.[Ch]: ditto
3900 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3902 * src/support/utility.hpp: tr -d '\r'
3904 2000-08-01 Juergen Vigna <jug@sad.it>
3906 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3908 * src/commandtags.h:
3909 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3910 LFUN_TABULAR_FEATURES.
3912 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3913 LFUN_LAYOUT_TABULAR.
3915 * src/insets/insettabular.C (getStatus): implemented helper function.
3917 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3919 2000-07-31 Juergen Vigna <jug@sad.it>
3921 * src/text.C (draw): fixed screen update problem for text-insets.
3923 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3924 something changed probably this has to be added in various other
3927 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3929 2000-07-31 Baruch Even <baruch.even@writeme.com>
3931 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3932 templates to satisfy compaq cxx.
3935 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3937 * src/support/translator.h (equal_1st_in_pair::operator()): take
3938 const ref pair_type as arg.
3939 (equal_2nd_in_pair::operator()): ditto
3940 (Translator::~Translator): remove empty d-tor.
3942 * src/graphics/GraphicsCache.C: move include config.h to top, also
3943 put initialization of GraphicsCache::singleton here.
3944 (~GraphicsCache): move here
3945 (addFile): take const ref as arg
3948 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3950 * src/BufferView2.C (insertLyXFile): change te with/without header
3953 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3955 * src/frontends/xforms/FormGraphics.C (apply): add some
3956 static_cast. Not very nice, but required by compaq cxx.
3958 * src/frontends/xforms/RadioButtonGroup.h: include header
3959 <utility> instead of <pair.h>
3961 * src/insets/insetgraphicsParams.C: add using directive.
3962 (readResize): change return type to void.
3963 (readOrigin): ditto.
3965 * src/lyxfunc.C (getStatus): add missing break for build-program
3966 function; add test for Literate for export functions.
3968 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3969 entries in Options menu.
3971 2000-07-31 Baruch Even <baruch.even@writeme.com>
3973 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3974 protect against auto-allocation; release icon when needed.
3976 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3978 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3979 on usual typewriter.
3981 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3982 earlier czech.kmap), useful only for programming.
3984 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3986 * src/frontends/xforms/FormCitation.h: fix conditioning around
3989 2000-07-31 Juergen Vigna <jug@sad.it>
3991 * src/frontends/xforms/FormTabular.C (local_update): changed
3992 radio_linebreaks to radio_useparbox and added radio_useminipage.
3994 * src/tabular.C: made support for using minipages/parboxes.
3996 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3998 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4000 (descent): so the cursor is in the middle.
4001 (width): bit smaller box.
4003 * src/insets/insetgraphics.h: added display() function.
4005 2000-07-31 Baruch Even <baruch.even@writeme.com>
4007 * src/frontends/Dialogs.h: Added showGraphics signals.
4009 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4010 xforms form definition of the graphics dialog.
4012 * src/frontends/xforms/FormGraphics.h:
4013 * src/frontends/xforms/FormGraphics.C: Added files, the
4014 GUIndependent code of InsetGraphics
4016 * src/insets/insetgraphics.h:
4017 * src/insets/insetgraphics.C: Major writing to make it work.
4019 * src/insets/insetgraphicsParams.h:
4020 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4021 struct between InsetGraphics and GUI.
4023 * src/LaTeXFeatures.h:
4024 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4025 support for graphicx package.
4027 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4028 for the graphics inset.
4030 * src/support/translator.h: Added file, used in
4031 InsetGraphicsParams. this is a template to translate between two
4034 * src/frontends/xforms/RadioButtonGroup.h:
4035 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4036 way to easily control a radio button group.
4038 2000-07-28 Juergen Vigna <jug@sad.it>
4040 * src/insets/insettabular.C (LocalDispatch):
4041 (TabularFeatures): added support for lyx-functions of tabular features.
4042 (cellstart): refixed this function after someone wrongly changed it.
4044 * src/commandtags.h:
4045 * src/LyXAction.C (init): added support for tabular-features
4047 2000-07-28 Allan Rae <rae@lyx.org>
4049 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4050 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4051 triggers the callback for input checking. As a result we sometimes get
4052 "LyX: This shouldn't happen..." printed to cerr.
4053 (input): Started using status variable since I only free() on
4054 destruction. Some input checking for paths and font sizes.
4056 * src/frontends/xforms/FormPreferences.h: Use status to control
4057 activation of Ok and Apply
4059 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4060 callback. Also resized to stop segfaults with 0.88. The problem is
4061 that xforms-0.88 requires the folder to be wide enough to fit all the
4062 tabs. If it isn't it causes all sorts of problems.
4064 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4066 * src/frontends/xforms/forms/README: Reflect reality.
4068 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4069 * src/frontends/xforms/forms/makefile: ditto.
4071 * src/commandtags.h: Get access to new Preferences dialog
4072 * src/LyXAction.C: ditto
4073 * src/lyxfunc.C: ditto
4074 * lib/ui/default.ui: ditto
4076 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4078 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4080 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4083 * src/frontends/xforms/form_url.[Ch]: added.
4085 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4087 * src/insets/insetbib.h: fixed bug in previous commit
4089 * src/frontends/xforms/FormUrl.h: ditto
4091 * src/frontends/xforms/FormPrint.h: ditto
4093 * src/frontends/xforms/FormPreferences.h: ditto
4095 * src/frontends/xforms/FormCopyright.h: ditto
4097 * src/frontends/xforms/FormCitation.C: ditto
4099 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4100 private copyconstructor and private default contructor
4102 * src/support/Makefile.am: add utility.hpp
4104 * src/support/utility.hpp: new file from boost
4106 * src/insets/insetbib.h: set owner in clone
4108 * src/frontends/xforms/FormCitation.C: added missing include
4111 * src/insets/form_url.[Ch]: removed
4113 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4115 * development/lyx.spec.in
4116 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4117 file/directory re-organization.
4119 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4121 * src/insets/insetcommand.[Ch]: moved the string data and
4122 associated manipulation methods into a new stand-alone class
4123 InsetCommandParams. This class has two additional methods
4124 getAsString() and setFromString() allowing the contents to be
4125 moved around as a single string.
4126 (addContents) method removed.
4127 (setContents) method no longer virtual.
4129 * src/buffer.C (readInset): made use of new InsetCitation,
4130 InsetUrl constructors based on InsetCommandParams.
4132 * src/commandtags.h: add LFUN_INSERT_URL
4134 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4135 independent InsetUrl and use InsetCommandParams to extract
4136 string info and create new Insets.
4138 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4140 * src/frontends/xforms/FormCitation.C (apply): uses
4143 * src/frontends/xforms/form_url.C
4144 * src/frontends/xforms/form_url.h
4145 * src/frontends/xforms/FormUrl.h
4146 * src/frontends/xforms/FormUrl.C
4147 * src/frontends/xforms/forms/form_url.fd: new files
4149 * src/insets/insetcite.[Ch]: removed unused constructors.
4151 * src/insets/insetinclude.[Ch]: no longer store filename
4153 * src/insets/inseturl.[Ch]: GUI-independent.
4155 2000-07-26 Juergen Vigna <jug@sad.it>
4156 * renamed frontend from gtk to gnome as it is that what is realized
4157 and did the necessary changes in the files.
4159 2000-07-26 Marko Vendelin <markov@ioc.ee>
4161 * configure.in: cleaning up gnome configuration scripts
4163 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4165 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4166 shortcuts syndrom by redrawing them explicitely (a better solution
4167 would be appreciated).
4169 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4171 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4174 * src/lyx_cb.C (MenuExport): change html export to do the right
4175 thing depending of the document type (instead of having
4176 html-linuxdoc and html-docbook).
4177 * src/lyxfunc.C (getStatus): update for html
4178 * lib/ui/default.ui: simplify due to the above change.
4179 * src/menus.C (ShowFileMenu): update too (in case we need it).
4181 * src/MenuBackend.C (read): if a menu is defined twice, add the
4182 new entries to the exiting one.
4184 2000-07-26 Juergen Vigna <jug@sad.it>
4186 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4188 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4189 and return a bool if it did actual save the file.
4190 (AutoSave): don't autosave a unnamed doc.
4192 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4193 check if this is an UNNAMED new file and react to it.
4194 (newFile): set buffer to unnamed and change to not mark a new
4195 buffer dirty if I didn't do anything with it.
4197 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4199 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4201 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4202 friend as per Angus's patch posted to lyx-devel.
4204 * src/ext_l10n.h: updated
4206 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4207 gettext on the style string right before inserting them into the
4210 * autogen.sh: add code to extract style strings form layout files,
4211 not good enough yet.
4213 * src/frontends/gtk/.cvsignore: add MAKEFILE
4215 * src/MenuBackend.C (read): run the label strings through gettext
4216 before storing them in the containers.
4218 * src/ext_l10n.h: new file
4220 * autogen.sh : generate the ext_l10n.h file here
4222 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4224 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4227 * lib/ui/default.ui: fix a couple of typos.
4229 * config/gnome/gtk.m4: added (and added to the list of files in
4232 * src/insets/insetinclude.C (unique_id): fix when we are using
4233 lyxstring instead of basic_string<>.
4234 * src/insets/insettext.C (LocalDispatch): ditto.
4235 * src/support/filetools.C: ditto.
4237 * lib/configure.m4: create the ui/ directory if necessary.
4239 * src/LyXView.[Ch] (updateToolbar): new method.
4241 * src/BufferView_pimpl.C (buffer): update the toolbar when
4242 opening/closing buffer.
4244 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4246 * src/LyXAction.C (getActionName): enhance to return also the name
4247 and options of pseudo-actions.
4248 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4250 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4251 as an example of what is possible). Used in File->Build too (more
4252 useful) and in the import/export menus (to mimick the complicated
4253 handling of linuxdoc and friends). Try to update all the entries.
4255 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4258 * src/MenuBackend.C (read): Parse the new OptItem tag.
4260 * src/MenuBackend.h: Add a new optional_ data member (used if the
4261 entry should be omitted when the lyxfunc is disabled).
4263 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4264 function, used as a shortcut.
4265 (create_submenu): align correctly the shortcuts on the widest
4268 * src/MenuBackend.h: MenuItem.label() only returns the label of
4269 the menu without shortcut; new method shortcut().
4271 2000-07-14 Marko Vendelin <markov@ioc.ee>
4273 * src/frontends/gtk/Dialogs.C:
4274 * src/frontends/gtk/FormCopyright.C:
4275 * src/frontends/gtk/FormCopyright.h:
4276 * src/frontends/gtk/Makefile.am: added these source-files for the
4277 Gtk/Gnome support of the Copyright-Dialog.
4279 * src/main.C: added Gnome::Main initialization if using
4280 Gtk/Gnome frontend-GUI.
4282 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4284 * config/gnome/aclocal-include.m4
4285 * config/gnome/compiler-flags.m4
4286 * config/gnome/curses.m4
4287 * config/gnome/gnome--.m4
4288 * config/gnome/gnome-bonobo-check.m4
4289 * config/gnome/gnome-common.m4
4290 * config/gnome/gnome-fileutils.m4
4291 * config/gnome/gnome-ghttp-check.m4
4292 * config/gnome/gnome-gnorba-check.m4
4293 * config/gnome/gnome-guile-checks.m4
4294 * config/gnome/gnome-libgtop-check.m4
4295 * config/gnome/gnome-objc-checks.m4
4296 * config/gnome/gnome-orbit-check.m4
4297 * config/gnome/gnome-print-check.m4
4298 * config/gnome/gnome-pthread-check.m4
4299 * config/gnome/gnome-support.m4
4300 * config/gnome/gnome-undelfs.m4
4301 * config/gnome/gnome-vfs.m4
4302 * config/gnome/gnome-x-checks.m4
4303 * config/gnome/gnome-xml-check.m4
4304 * config/gnome/gnome.m4
4305 * config/gnome/gperf-check.m4
4306 * config/gnome/gtk--.m4
4307 * config/gnome/linger.m4
4308 * config/gnome/need-declaration.m4: added configuration scripts
4309 for Gtk/Gnome frontend-GUI
4311 * configure.in: added support for the --with-frontend=gtk option
4313 * autogen.sh: added config/gnome/* to list of config-files
4315 * acconfig.h: added define for GTKGUI-support
4317 * config/lyxinclude.m4: added --with-frontend[=value] option value
4318 for Gtk/Gnome frontend-GUI support.
4320 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4322 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4326 * src/paragraph.C (GetChar): remove non-const version
4328 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4329 (search_kw): use it.
4331 * src/lyx_main.C (init): if "preferences" exist, read that instead
4333 (ReadRcFile): return bool if the file could be read ok.
4334 (ReadUIFile): add a check to see if lex file is set ok.
4336 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4337 bastring can be used instead of lyxstring (still uses the old code
4338 if std::string is good enough or if lyxstring is used.)
4340 * src/encoding.C: make the arrays static, move ininle functions
4342 * src/encoding.h: from here.
4344 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4345 (parseSingleLyXformat2Token): move inset parsing to separate method
4346 (readInset): new private method
4348 * src/Variables.h: remove virtual from get().
4350 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4351 access to NEW_INSETS and NEW_TABULAR
4353 * src/MenuBackend.h: remove superfluous forward declaration of
4354 MenuItem. Add documentations tags "///", remove empty MenuItem
4355 destructor, remove private default contructor.
4357 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4359 (read): more string mlabel and mname to where they are used
4360 (read): remove unused variables mlabel and mname
4361 (defaults): unconditional clear, make menusetup take advantage of
4362 add returning Menu &.
4364 * src/LyXView.h: define NEW_MENUBAR as default
4366 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4367 to NEW_INSETS and NEW_TABULAR.
4368 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4369 defined. Change some of the "xxxx-inset-insert" functions names to
4372 * several files: more enahncements to NEW_INSETS and the resulting
4375 * lib/lyxrc.example (\date_insert_format): move to misc section
4377 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4378 bastring and use AC_CACHE_CHECK.
4379 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4380 the system have the newest methods. uses AC_CACHE_CHECK
4381 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4382 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4383 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4385 * configure.in: add LYX_CXX_GOOD_STD_STRING
4387 * acinclude.m4: recreated
4389 2000-07-24 Amir Karger <karger@lyx.org>
4391 * README: add Hebrew, Arabic kmaps
4394 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4396 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4399 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4401 * Lot of files: add pragma interface/implementation.
4403 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4405 * lib/ui/default.ui: new file (ans new directory). Contains the
4406 default menu and toolbar.
4408 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4409 global space. Toolbars are now read (as menus) in ui files.
4411 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4413 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4414 is disabled because the document is read-only. We want to have the
4415 toggle state of the function anyway.
4416 (getStatus): add code for LFUN_VC* functions (mimicking what is
4417 done in old-style menus)
4419 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4420 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4422 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4423 * src/BufferView_pimpl.C: ditto.
4424 * src/lyxfunc.C: ditto.
4426 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4427 default). This replaces old-style menus by new ones.
4429 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4430 MenuItem. Contain the data structure of a menu.
4432 * src/insets/insettext.C: use LyXView::setLayout instead of
4433 accessing directly the toolbar combox.
4434 * src/lyxfunc.C (Dispatch): ditto.
4436 * src/LyXView.C (setLayout): new method, which just calls
4437 Toolbar::setLayout().
4438 (updateLayoutChoice): move part of this method in Toolbar.
4440 * src/toolbar.[Ch]: removed.
4442 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4443 implementation the toolbar.
4445 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4446 the toolbar. It might make sense to merge it with ToolbarDefaults
4448 (setLayout): new function.
4449 (updateLayoutList): ditto.
4450 (openLayoutList): ditto.
4452 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4453 xforms implementation of the toolbar.
4454 (get_toolbar_func): comment out, since I do not
4455 know what it is good for.
4457 * src/ToolbarDefaults.h: Add the ItemType enum.
4459 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4460 for a list of allocated C strings. Used in Menubar xforms
4461 implementation to avoid memory leaks.
4463 * src/support/lstrings.[Ch] (uppercase): new version taking and
4467 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4468 * lib/bind/emacs.bind: ditto.
4470 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4472 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4473 forward decl of LyXView.
4475 * src/toolbar.C (toolbarItem): moved from toolbar.h
4476 (toolbarItem::clean): ditto
4477 (toolbarItem::~toolbarItem): ditto
4478 (toolbarItem::operator): ditto
4480 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4482 * src/paragraph.h: control the NEW_TABULAR define from here
4484 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4485 USE_TABULAR_INSETS to NEW_TABULAR
4487 * src/ToolbarDefaults.C: add include "lyxlex.h"
4489 * files using the old table/tabular: use NEW_TABULAR to control
4490 compilation of old tabular stuff.
4492 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4495 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4496 planemet in reading of old style floats, fix the \end_deeper
4497 problem when reading old style floats.
4499 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4501 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4503 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4505 * lib/bind/sciword.bind: updated.
4507 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4509 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4510 layout write problem
4512 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4514 * src/Makefile.am (INCLUDES): remove image directory from include
4517 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4518 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4520 * src/LyXView.C (create_form_form_main): read the application icon
4523 * lib/images/*.xpm: change the icons to use transparent color for
4526 * src/toolbar.C (update): change the color of the button when it
4529 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4531 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4532 setting explicitely the minibuffer.
4533 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4535 * src/LyXView.C (showState): new function. Shows font information
4536 in minibuffer and update toolbar state.
4537 (LyXView): call Toolbar::update after creating the
4540 * src/toolbar.C: change toollist to be a vector instead of a
4542 (BubbleTimerCB): get help string directly from the callback
4543 argument of the corresponding icon (which is the action)
4544 (set): remove unnecessary ugliness.
4545 (update): new function. update the icons (depressed, disabled)
4546 depending of the status of the corresponding action.
4548 * src/toolbar.h: remove help in toolbarItem
4550 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4552 * src/Painter.C (text): Added code for using symbol glyphs from
4553 iso10646 fonts. Currently diabled.
4555 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4558 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4559 magyar,turkish and usorbian.
4561 * src/paragraph.C (isMultiLingual): Made more efficient.
4563 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4566 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4567 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4568 Also changed the prototype to "bool math_insert_greek(char)".
4570 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4572 * lots of files: apply the NEW_INSETS on all code that will not be
4573 needed when we move to use the new insets. Enable the define in
4574 lyxparagrah.h to try it.
4576 * src/insets/insettabular.C (cellstart): change to be a static
4578 (InsetTabular): initialize buffer in the initializer list.
4580 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4582 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4583 form_print.h out of the header file. Replaced with forward
4584 declarations of the relevant struct.
4586 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4589 * src/commandtags.h: do not include "debug.h" which does not
4590 belong there. #include it in some other places because of this
4593 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4595 * src/insets/insetcaption.C: add a couple "using" directives.
4597 * src/toolbar.C (add): get the help text directly from lyxaction.
4599 (setPixmap): new function. Loads from disk and sets a pixmap on a
4600 botton; the name of the pixmap file is derived from the command
4603 * src/toolbar.h: remove members isBitmap and pixmap from
4606 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4607 * lib/images/: move many files from images/banner.xpm.
4609 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4611 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4612 * src/toolbar.C: ditto.
4613 * configure.in: ditto.
4614 * INSTALL: document.
4616 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4617 the spellchecker popup is closed from the WM.
4619 2000-07-19 Juergen Vigna <jug@sad.it>
4621 * src/insets/insetfloat.C (Write): small fix because we use the
4622 insetname for the type now!
4624 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4626 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4629 * src/frontends/Dialogs.h: removed hideCitation signal
4631 * src/insets/insetcite.h: added hide signal
4633 * src/insets/insetcite.C (~InsetCitation): emits new signal
4634 (getScreenLabel): "intelligent" label should now fit on the screen!
4636 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4638 * src/frontends/xforms/FormCitation.C (showInset): connects
4639 hide() to the inset's hide signal
4640 (show): modified to use fl_set_object_position rather than
4641 fl_set_object_geometry wherever possible
4643 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4645 * src/insets/lyxinset.h: add caption code
4647 * src/insets/insetfloat.C (type): new method
4649 * src/insets/insetcaption.C (Write): new method
4651 (LyxCode): new method
4653 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4654 to get it right together with using the FloatList.
4656 * src/commandtags.h: add LFUN_INSET_CAPTION
4657 * src/lyxfunc.C (Dispatch): handle it
4659 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4662 * src/Variables.[Ch]: make expand take a const reference, remove
4663 the destructor, some whitespace changes.
4665 * src/LyXAction.C (init): add caption-inset-insert
4667 * src/FloatList.C (FloatList): update the default floats a bit.
4669 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4671 * src/Variables.[Ch]: new files. Intended to be used for language
4672 specific strings (like \chaptername) and filename substitution in
4675 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4677 * lib/kbd/american.kmap: update
4679 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4681 * src/bufferparams.[Ch]: remove member allowAccents.
4683 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4685 * src/LaTeXLog.C: use the log_form.h header.
4686 * src/lyx_gui.C: ditto.
4687 * src/lyx_gui_misc.C: ditto.
4688 * src/lyxvc.h: ditto.
4690 * forms/log_form.fd: new file, created from latexoptions.fd. I
4691 kept the log popup and nuked the options form.
4693 * src/{la,}texoptions.[Ch]: removed.
4694 * src/lyx_cb.C (LaTeXOptions): ditto
4696 * src/lyx_gui.C (create_forms): do not handle the
4697 fd_latex_options form.
4699 2000-07-18 Juergen Vigna <jug@sad.it>
4701 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4702 name of the inset so that it can be requested outside (text2.C).
4704 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4707 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4709 * src/mathed/formula.h (ConvertFont): constify
4711 * src/mathed/formula.C (Read): add warning if \end_inset is not
4712 found on expected place.
4714 * src/insets/lyxinset.h (ConvertFont): consify
4716 * src/insets/insetquotes.C (ConvertFont): constify
4717 * src/insets/insetquotes.h: ditto
4719 * src/insets/insetinfo.h: add labelfont
4721 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4722 (ascent): use labelfont
4726 (Write): make .lyx file a bit nicer
4728 * src/insets/insetfloat.C (Write): simplify somewhat...
4729 (Read): add warning if arg is not found
4731 * src/insets/insetcollapsable.C: add using std::max
4732 (Read): move string token and add warning in arg is not found
4733 (draw): use std::max to get the right ty
4734 (getMaxWidth): simplify by using std::max
4736 * src/insets/insetsection.h: new file
4737 * src/insets/insetsection.C: new file
4738 * src/insets/insetcaption.h: new file
4739 * src/insets/insetcaption.C: new file
4741 * src/insets/inset.C (ConvertFont): constify signature
4743 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4744 insetcaption.[Ch] and insetsection.[Ch]
4746 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4747 uses to use LABEL_COUNTER_CHAPTER instead.
4748 * src/text2.C (SetCounter): here
4750 * src/counters.h: new file
4751 * src/counters.C: new file
4752 * src/Sectioning.h: new file
4753 * src/Sectioning.C: new file
4755 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4757 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4759 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4762 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4765 2000-07-17 Juergen Vigna <jug@sad.it>
4767 * src/tabular.C (Validate): check if array-package is needed.
4768 (SetVAlignment): added support for vertical alignment.
4769 (SetLTFoot): better support for longtable header/footers
4770 (Latex): modified to support added features.
4772 * src/LaTeXFeatures.[Ch]: added array-package.
4774 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4776 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4779 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4781 * configure.in: do not forget to put a space after -isystem.
4783 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4785 * lib/kbd/arabic.kmap: a few fixes.
4787 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4789 * some whitespace chagnes to a number of files.
4791 * src/support/DebugStream.h: change to make it easier for
4792 doc++ to parse correctly.
4793 * src/support/lyxstring.h: ditto
4795 * src/mathed/math_utils.C (compara): change to have only one
4797 (MathedLookupBOP): change because of the above.
4799 * src/mathed/math_delim.C (math_deco_compare): change to have only
4801 (search_deco): change becasue of the above.
4803 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4804 instead of manually coded one.
4806 * src/insets/insetquotes.C (Read): read the \end_inset too
4808 * src/insets/insetlatex.h: remove file
4809 * src/insets/insetlatex.C: remove file
4811 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4813 (InsetPrintIndex): remove destructor
4815 * src/insets/insetinclude.h: remove default constructor
4817 * src/insets/insetfloat.C: work to make it work better
4819 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4821 * src/insets/insetcite.h (InsetCitation): remove default constructor
4823 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4825 * src/text.C (GetColumnNearX): comment out some currently unused code.
4827 * src/paragraph.C (writeFile): move some initializations closer to
4829 (CutIntoMinibuffer): small change to use new matchIT operator
4833 (InsertInset): ditto
4836 (InsetIterator): ditto
4837 (Erase): small change to use new matchFT operator
4839 (GetFontSettings): ditto
4840 (HighestFontInRange): ditto
4843 * src/lyxparagraph.h: some chars changed to value_type
4844 (matchIT): because of some stronger checking (perhaps too strong)
4845 in SGI STL, the two operator() unified to one.
4848 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4850 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4851 the last inset read added
4852 (parseSingleLyXformat2Token): some more (future) compability code added
4853 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4854 (parseSingleLyXformat2Token): set last_inset_read
4855 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4856 (parseSingleLyXformat2Token): don't double intializw string next_token
4858 * src/TextCache.C (text_fits::operator()): add const's to the signature
4859 (has_buffer::operator()): ditto
4861 * src/Floating.h: add some comments on the class
4863 * src/FloatList.[Ch] (typeExist): new method
4866 * src/BackStack.h: added default constructor, wanted by Gcc.
4868 2000-07-14 Juergen Vigna <jug@sad.it>
4870 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4872 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4874 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4875 do a redraw when the window is resized!
4876 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4878 * src/insets/insettext.C (resizeLyXText): added function to correctly
4879 being able to resize the LyXWindow.
4881 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4883 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4885 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4886 crashes when closing dialog to a deleted inset.
4888 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4889 method! Now similar to other insets.
4891 2000-07-13 Juergen Vigna <jug@sad.it>
4893 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4895 * lib/examples/Literate.lyx: small patch!
4897 * src/insets/insetbib.C (Read): added this function because of wrong
4898 Write (without [begin|end]_inset).
4900 2000-07-11 Juergen Vigna <jug@sad.it>
4902 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4903 as the insertInset could not be good!
4905 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4906 the bool param should not be last.
4908 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4910 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4911 did submit that to Karl).
4913 * configure.in: use -isystem instead of -I for X headers. This
4914 fixes a problem on solaris with a recent gcc;
4915 put the front-end code after the X detection code;
4916 configure in sigc++ before lib/
4918 * src/lyx_main.C (commandLineHelp): remove -display from command
4921 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4923 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4924 Also put in Makefile rules for building the ``listerrors''
4925 program for parsing errors from literate programs written in LyX.
4927 * lib/build-listerrors: Added small shell script as part of compile
4928 process. This builds a working ``listerrors'' binary if noweb is
4929 installed and either 1) the VNC X server is installed on the machine,
4930 or 2) the user is compiling from within a GUI. The existence of a GUI
4931 is necessary to use the ``lyx --export'' feature for now. This
4932 hack can be removed once ``lyx --export'' no longer requires a GUI to
4935 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4937 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4938 now passed back correctly from gcc and placed "under" error
4939 buttons in a Literate LyX source.
4941 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4943 * src/text.C (GetColumnNearX): Better behavior when a RTL
4944 paragraph is ended by LTR text.
4946 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4949 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4951 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4952 true when clipboard is empty.
4954 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4956 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4957 row of the paragraph.
4958 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4959 to prevent calculation of bidi tables
4961 2000-07-07 Juergen Vigna <jug@sad.it>
4963 * src/screen.C (ToggleSelection): added y_offset and x_offset
4966 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4969 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4971 * src/insets/insettext.C: fixed Layout-Display!
4973 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4975 * configure.in: add check for strings.h header.
4977 * src/spellchecker.C: include <strings.h> in order to have a
4978 definition for bzero().
4980 2000-07-07 Juergen Vigna <jug@sad.it>
4982 * src/insets/insettext.C (draw): set the status of the bv->text to
4983 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4985 * src/screen.C (DrawOneRow):
4986 (DrawFromTo): redraw the actual row if something has changed in it
4989 * src/text.C (draw): call an update of the toplevel-inset if something
4990 has changed inside while drawing.
4992 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4994 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4996 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4997 processing inside class.
4999 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5000 processing inside class.
5002 * src/insets/insetindex.h new struct Holder, consistent with other
5005 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5006 citation dialog from main code and placed it in src/frontends/xforms.
5007 Dialog launched through signals instead of callbacks
5009 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5011 * lyx.man: update the options description.
5013 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5015 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5016 handle neg values, set min width to 590, add doc about -display
5018 2000-07-05 Juergen Vigna <jug@sad.it>
5020 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5021 calls to BufferView *.
5023 * src/insets/insettext.C (checkAndActivateInset): small fix non
5024 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5026 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5027 their \end_inset token!
5029 2000-07-04 edscott <edscott@imp.mx>
5031 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5032 lib/lyxrc.example: added option \wheel_jump
5034 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5036 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5037 remove support for -width,-height,-xpos and -ypos.
5039 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5041 * src/encoding.[Ch]: New files.
5043 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5044 (text): Call to the underline() method only when needed.
5046 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5048 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5049 encoding(s) for the document.
5051 * src/bufferparams.C (BufferParams): Changed default value of
5054 * src/language.C (newLang): Removed.
5055 (items[]): Added encoding information for all defined languages.
5057 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5058 encoding choice button.
5060 * src/lyxrc.h (font_norm_type): New member variable.
5061 (set_font_norm_type): New method.
5063 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5064 paragraphs with different encodings.
5066 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5067 (TransformChar): Changed to work correctly with Arabic points.
5068 (draw): Added support for drawing Arabic points.
5069 (draw): Removed code for drawing underbars (this is done by
5072 * src/support/textutils.h (IsPrintableNonspace): New function.
5074 * src/BufferView_pimpl.h: Added "using SigC::Object".
5075 * src/LyXView.h: ditto.
5077 * src/insets/insetinclude.h (include_label): Changed to mutable.
5079 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5081 * src/mathed/math_iter.h: remove empty destructor
5083 * src/mathed/math_cursor.h: remove empty destructor
5085 * src/insets/lyxinset.h: add THEOREM_CODE
5087 * src/insets/insettheorem.[Ch]: new files
5089 * src/insets/insetminipage.C: (InsertInset): remove
5091 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5093 (InsertInset): remove
5095 * src/insets/insetlist.C: (InsertList): remove
5097 * src/insets/insetfootlike.[Ch]: new files
5099 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5102 (InsertInset): ditto
5104 * src/insets/insetert.C: remove include Painter.h, reindent
5105 (InsertInset): move to header
5107 * src/insets/insetcollapsable.h: remove explicit from default
5108 contructor, remove empty destructor, add InsertInset
5110 * src/insets/insetcollapsable.C (InsertInset): new func
5112 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5114 * src/vspace.h: add explicit to constructor
5116 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5117 \textcompwordmark, please test this.
5119 * src/lyxrc.C: set ascii_linelen to 65 by default
5121 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5123 * src/commandtags.h: add LFUN_INSET_THEOREM
5125 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5126 (makeLinuxDocFile): remove _some_ of the nice logic
5127 (makeDocBookFile): ditto
5129 * src/Painter.[Ch]: (~Painter): removed
5131 * src/LyXAction.C (init): entry for insettheorem added
5133 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5135 (deplog): code to detect files generated by LaTeX, needs testing
5138 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5140 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5142 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5144 * src/LaTeX.C (deplog): Add a check for files that are going to be
5145 created by the first latex run, part of the project to remove the
5148 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5149 contents to the extension list.
5151 2000-07-04 Juergen Vigna <jug@sad.it>
5153 * src/text.C (NextBreakPoint): added support for needFullRow()
5155 * src/insets/lyxinset.h: added needFullRow()
5157 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5160 * src/insets/insettext.C: lots of changes for update!
5162 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5164 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5166 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5168 * src/insets/insetinclude.C (InsetInclude): fixed
5169 initialization of include_label.
5170 (unique_id): now returns a string.
5172 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5174 * src/LaTeXFeatures.h: new member IncludedFiles, for
5175 a map of key, included file name.
5177 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5178 with the included files for inclusion in SGML preamble,
5179 i. e., linuxdoc and docbook.
5182 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5183 nice (is the generated linuxdoc code to be exported?), that
5184 allows to remove column, and only_body that will be true for
5185 slave documents. Insets are allowed inside SGML font type.
5186 New handling of the SGML preamble for included files.
5187 (makeDocBookFile): the same for docbook.
5189 * src/insets/insetinclude.h:
5190 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5192 (DocBook): new export methods.
5194 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5195 and makeDocBookFile.
5197 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5198 formats to export with command line argument -x.
5200 2000-06-29 Juergen Vigna <jug@sad.it>
5202 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5203 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5205 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5206 region could already been cleared by an inset!
5208 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5210 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5213 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5215 (cursorToggle): remove special handling of lyx focus.
5217 2000-06-28 Juergen Vigna <jug@sad.it>
5219 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5222 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5224 * src/insets/insetindex.C (Edit): add a callback when popup is
5227 * src/insets/insettext.C (LocalDispatch):
5228 * src/insets/insetmarginal.h:
5229 * src/insets/insetlist.h:
5230 * src/insets/insetfoot.h:
5231 * src/insets/insetfloat.h:
5232 * src/insets/insetert.h: add a missing std:: qualifier.
5234 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5236 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5239 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5241 * src/insets/insettext.C (Read): remove tmptok unused variable
5242 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5243 (InsertInset): change for new InsetInset code
5245 * src/insets/insettext.h: add TEXT inline method
5247 * src/insets/insettext.C: remove TEXT macro
5249 * src/insets/insetmarginal.C (Write): new method
5250 (Latex): change output slightly
5252 * src/insets/insetfoot.C (Write): new method
5253 (Latex): change output slightly (don't use endl when no need)
5255 * src/insets/insetert.C (Write): new method
5257 * src/insets/insetcollapsable.h: make button_length, button_top_y
5258 and button_bottm_y protected.
5260 * src/insets/insetcollapsable.C (Write): simplify code by using
5261 tostr. Also do not output the float name, the children class
5262 should to that to get control over own arguments
5264 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5265 src/insets/insetminipage.[Ch]:
5268 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5270 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5272 * src/Makefile.am (lyx_SOURCES): add the new files
5274 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5275 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5276 * src/commandtags.h: ditto
5278 * src/LaTeXFeatures.h: add a std::set of used floattypes
5280 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5282 * src/FloatList.[Ch] src/Floating.h: new files
5284 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5286 * src/lyx_cb.C (TableApplyCB): ditto
5288 * src/text2.C: ditto
5289 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5290 (parseSingleLyXformat2Token): ditto + add code for
5291 backwards compability for old float styles + add code for new insets
5293 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5295 (InsertInset(size_type, Inset *, LyXFont)): new method
5296 (InsetChar(size_type, char)): changed to use the other InsetChar
5297 with a LyXFont(ALL_INHERIT).
5298 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5299 insert the META_INSET.
5301 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5303 * sigc++/thread.h (Threads): from here
5305 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5306 definition out of line
5307 * sigc++/scope.h: from here
5309 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5311 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5312 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5314 * Makefile.am (bindist): new target.
5316 * INSTALL: add instructions for doing a binary distribution.
5318 * development/tools/README.bin.example: update a bit.
5320 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5323 * lib/lyxrc.example: new lyxrc tag \set_color.
5325 * src/lyxfunc.C (Dispatch):
5326 * src/commandtags.h:
5327 * src/LyXAction.C: new lyxfunc "set-color".
5329 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5330 and an x11name given as strings.
5332 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5333 cache when a color is changed.
5335 2000-06-26 Juergen Vigna <jug@sad.it>
5337 * src/lyxrow.C (width): added this functions and variable.
5339 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5342 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5344 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5346 * images/undo_bw.xpm: new icon.
5347 * images/redo_bw.xpm: ditto.
5349 * configure.in (INSTALL_SCRIPT): change value to
5350 ${INSTALL} to avoid failures of install-script target.
5351 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5353 * src/BufferView.h: add a magic "friend" declaration to please
5356 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5358 * forms/cite.fd: modified to allow resizing without messing
5361 * src/insetcite.C: Uses code from cite.fd almost without
5363 User can now resize dialog in the x-direction.
5364 Resizing the dialog in the y-direction is prevented, as the
5365 code does this intelligently already.
5367 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5369 * INSTALL: remove obsolete entry in "problems" section.
5371 * lib/examples/sl_*.lyx: update of the slovenian examples.
5373 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5375 2000-06-23 Juergen Vigna <jug@sad.it>
5377 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5379 * src/buffer.C (resize): delete the LyXText of textinsets.
5381 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5383 * src/insets/lyxinset.h: added another parameter 'cleared' to
5384 the draw() function.
5386 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5387 unlocking inset in inset.
5389 2000-06-22 Juergen Vigna <jug@sad.it>
5391 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5392 of insets and moved first to LyXText.
5394 * src/mathed/formulamacro.[Ch]:
5395 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5397 2000-06-21 Juergen Vigna <jug@sad.it>
5399 * src/text.C (GetVisibleRow): look if I should clear the area or not
5400 using Inset::doClearArea() function.
5402 * src/insets/lyxinset.h: added doClearArea() function and
5403 modified draw(Painter &, ...) to draw(BufferView *, ...)
5405 * src/text2.C (UpdateInset): return bool insted of int
5407 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5409 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5410 combox in the character popup
5412 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5413 BufferParams const & params
5415 2000-06-20 Juergen Vigna <jug@sad.it>
5417 * src/insets/insettext.C (SetParagraphData): set insetowner on
5420 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5422 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5423 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5425 (form_main_): remove
5427 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5428 (create_form_form_main): remove FD_form_main stuff, connect to
5429 autosave_timeout signal
5431 * src/LyXView.[Ch] (getMainForm): remove
5432 (UpdateTimerCB): remove
5433 * src/BufferView_pimpl.h: inherit from SigC::Object
5435 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5436 signal instead of callback
5438 * src/BufferView.[Ch] (cursorToggleCB): remove
5440 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5442 * src/BufferView_pimpl.C: changes because of the one below
5444 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5445 instead of storing a pointer to a LyXText.
5447 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5449 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5451 * src/lyxparagraph.h
5453 * src/paragraph.C: Changed fontlist to a sorted vector.
5455 2000-06-19 Juergen Vigna <jug@sad.it>
5457 * src/BufferView.h: added screen() function.
5459 * src/insets/insettext.C (LocalDispatch): some selection code
5462 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5464 * src/insets/insettext.C (SetParagraphData):
5466 (InsetText): fixes for multiple paragraphs.
5468 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5470 * development/lyx.spec.in: Call configure with ``--without-warnings''
5471 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5472 This should be fine, however, since we generally don't want to be
5473 verbose when making an RPM.
5475 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5477 * lib/scripts/fig2pstex.py: New file
5479 2000-06-16 Juergen Vigna <jug@sad.it>
5481 * src/insets/insettabular.C (UpdateLocal):
5482 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5483 (LocalDispatch): Changed all functions to use LyXText.
5485 2000-06-15 Juergen Vigna <jug@sad.it>
5487 * src/text.C (SetHeightOfRow): call inset::update before requesting
5490 * src/insets/insettext.C (update):
5491 * src/insets/insettabular.C (update): added implementation
5493 * src/insets/lyxinset.h: added update function
5495 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5497 * src/text.C (SelectNextWord): protect against null pointers with
5498 old-style string streams. (fix from Paul Theo Gonciari
5501 * src/cite.[Ch]: remove erroneous files.
5503 * lib/configure.m4: update the list of created directories.
5505 * src/lyxrow.C: include <config.h>
5506 * src/lyxcursor.C: ditto.
5508 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5510 * lib/examples/decimal.lyx: new example file from Mike.
5512 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5513 to find template definitions (from Dekel)
5515 * src/frontends/.cvsignore: add a few things.
5517 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5519 * src/Timeout.C (TimeOut): remove default argument.
5521 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5524 * src/insets/ExternalTemplate.C: add a "using" directive.
5526 * src/lyx_main.h: remove the act_ struct, which seems unused
5529 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5531 * LyX Developers Meeting: All files changed, due to random C++ (by
5532 coincidence) code generator script.
5534 - external inset (cool!)
5535 - initial online editing of preferences
5536 - insettabular breaks insettext(s contents)
5538 - some DocBook fixes
5539 - example files update
5540 - other cool stuff, create a diff and look for yourself.
5542 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5544 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5545 -1 this is a non-line-breaking textinset.
5547 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5548 if there is no width set.
5550 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5552 * Lots of files: Merged the dialogbase branch.
5554 2000-06-09 Allan Rae <rae@lyx.org>
5556 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5557 and the Dispatch methods that used it.
5559 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5560 access to functions formerly kept in Dispatch.
5562 2000-05-19 Allan Rae <rae@lyx.org>
5564 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5565 made to_page and count_copies integers again. from_page remains a
5566 string however because I want to allow entry of a print range like
5567 "1,4,22-25" using this field.
5569 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5570 and printer-params-get. These aren't useful from the minibuffer but
5571 could be used by a script/LyXServer app provided it passes a suitable
5572 auto_mem_buffer. I guess I should take a look at how the LyXServer
5573 works and make it support xtl buffers.
5575 * sigc++/: updated to libsigc++-1.0.1
5577 * src/xtl/: updated to xtl-1.3.pl.11
5579 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5580 those changes done to the files in src/ are actually recreated when
5581 they get regenerated. Please don't ever accept a patch that changes a
5582 dialog unless that patch includes the changes to the corresponding *.fd
5585 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5586 stringOnlyContains, renamed it and generalised it.
5588 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5589 branch. Removed the remaining old form_print code.
5591 2000-04-26 Allan Rae <rae@lyx.org>
5593 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5594 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5596 2000-04-25 Allan Rae <rae@lyx.org>
5598 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5599 against a base of xtl-1.3.pl.4
5601 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5602 filter the Id: entries so they still show the xtl version number
5605 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5606 into the src/xtl code. Patch still pending with José (XTL)
5608 2000-04-24 Allan Rae <rae@lyx.org>
5610 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5611 both more generic and much safer. Use the new template functions.
5612 * src/buffer.[Ch] (Dispatch): ditto.
5614 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5615 and mem buffer more intelligently. Also a little general cleanup.
5618 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5619 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5620 * src/xtl/Makefile.am: ditto.
5621 * src/xtl/.cvsignore: ditto.
5622 * src/Makefile.am: ditto.
5624 * src/PrinterParams.h: Removed the macros member functions. Added a
5625 testInvariant member function. A bit of tidying up and commenting.
5626 Included Angus's idea for fixing operation with egcs-1.1.2.
5628 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5629 cool expansion of XTL's mem_buffer to support automatic memory
5630 management within the buffer itself. Removed the various macros and
5631 replaced them with template functions that use either auto_mem_buffer
5632 or mem_buffer depending on a #define. The mem_buffer support will
5633 disappear as soon as the auto_mem_buffer is confirmed to be good on
5634 other platforms/compilers. That is, it's there so you've got something
5637 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5638 effectively forked XTL. However I expect José will include my code
5639 into the next major release. Also fixed a memory leak.
5640 * src/xtl/text.h: ditto.
5641 * src/xtl/xdr.h: ditto.
5642 * src/xtl/giop.h: ditto.
5644 2000-04-16 Allan Rae <rae@lyx.org>
5646 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5647 by autogen.sh and removed by maintainer-clean anyway.
5648 * .cvsignore, sigc++/.cvsignore: Support the above.
5650 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5652 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5654 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5655 macros, renamed static callback-target member functions to suit new
5656 scheme and made them public.
5657 * src/frontends/xforms/forms/form_print.fd: ditto.
5658 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5660 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5663 * src/xtl/: New directory containing a minimal distribution of XTL.
5664 This is XTL-1.3.pl.4.
5666 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5668 2000-04-15 Allan Rae <rae@lyx.org>
5670 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5672 * sigc++/: Updated to libsigc++-1.0.0
5674 2000-04-14 Allan Rae <rae@lyx.org>
5676 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5677 use the generic ones in future. I'll modify my conversion script.
5679 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5681 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5682 (CloseAllBufferRelatedDialogs): Renamed.
5683 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5685 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5686 of the generic ones. These are the same ones my conversion script
5689 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5690 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5691 * src/buffer.C (Dispatch): ditto
5693 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5694 functions for updating and hiding buffer dependent dialogs.
5695 * src/BufferView.C (buffer): ditto
5696 * src/buffer.C (setReadonly): ditto
5697 * src/lyxfunc.C (CloseBuffer): ditto
5699 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5700 Dialogs.h, and hence all the SigC stuff, into every file that includes
5701 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5703 * src/BufferView2.C: reduce the number of headers included by buffer.h
5705 2000-04-11 Allan Rae <rae@lyx.org>
5707 * src/frontends/xforms/xform_macros.h: A small collection of macros
5708 for building C callbacks.
5710 * src/frontends/xforms/Makefile.am: Added above file.
5712 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5713 scheme again. This time it should work for JMarc. If this is
5714 successful I'll revise my conversion script to automate some of this.
5715 The static member functions in the class also have to be public for
5716 this scheme will work. If the scheme works (it's almost identical to
5717 the way BufferView::cursorToggleCB is handled so it should work) then
5718 FormCopyright and FormPrint will be ready for inclusion into the main
5719 trunk immediately after 1.1.5 is released -- provided we're prepared
5720 for complaints about lame compilers not handling XTL.
5722 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5724 2000-04-07 Allan Rae <rae@lyx.org>
5726 * config/lyxinclude.m4: A bit more tidying up (Angus)
5728 * src/LString.h: JMarc's <string> header fix
5730 * src/PrinterParams.h: Used string for most data to remove some
5731 ugly code in the Print dialog and avoid even uglier code when
5732 appending the ints to a string for output.
5734 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5735 and moved "default:" back to the end of switch statement. Cleaned
5736 up the printing so it uses the right function calls and so the
5737 "print to file" option actually puts the file in the right directory.
5739 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5741 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5742 and Ok+Apply button control into a separate method: input (Angus).
5743 (input) Cleaned it up and improved it to be very thorough now.
5744 (All CB) static_cast used instead of C style cast (Angus). This will
5745 probably change again once we've worked out how to keep gcc-2.8.1 happy
5746 with real C callbacks.
5747 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5748 ignore some of the bool settings and has random numbers instead. Needs
5749 some more investigation. Added other input length checks and checking
5750 of file and printer names.
5752 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5753 would link (Angus). Seems the old code doesn't compile with the pragma
5754 statement either. Separated callback entries from internal methods.
5756 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5758 2000-03-17 Allan Rae <rae@lyx.org>
5760 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5761 need it? Maybe it could go in Dialogs instead? I could make it a
5762 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5763 values to get the bool return value.
5764 (Dispatch): New overloaded method for xtl support.
5766 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5767 extern "C" callback instead of static member functions. Hopefully,
5768 JMarc will be able to compile this. I haven't changed
5769 forms/form_copyright.fd yet. Breaking one of my own rules already.
5771 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5772 because they aren't useful from the minibuffer. Maybe a LyXServer
5773 might want a help message though?
5775 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5777 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5778 xtl which needs both rtti and exceptions.
5780 * src/support/Makefile.am:
5781 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5783 * src/frontends/xforms/input_validators.[ch]: input filters and
5784 validators. These conrol what keys are valid in input boxes.
5785 Use them and write some more. Much better idea than waiting till
5786 after the user has pressed Ok to say that the input fields don't make
5789 * src/frontends/xforms/Makefile.am:
5790 * src/frontends/xforms/forms/form_print.fd:
5791 * src/frontends/xforms/forms/makefile:
5792 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5793 new scheme. Still have to make sure I haven't missed anything from
5794 the current implementation.
5796 * src/Makefile.am, src/PrinterParams.h: New data store.
5798 * other files: Added a couple of copyright notices.
5800 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5802 * src/insets/insetbib.h: move Holder struct in public space.
5804 * src/frontends/include/DialogBase.h: use SigC:: only when
5805 SIGC_CXX_NAMESPACES is defined.
5806 * src/frontends/include/Dialogs.h: ditto.
5808 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5810 * src/frontends/xforms/FormCopyright.[Ch]: do not
5811 mention SigC:: explicitely.
5813 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5815 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5816 deals with testing KDE in main configure.in
5817 * configure.in: ditto.
5819 2000-02-22 Allan Rae <rae@lyx.org>
5821 * Lots of files: Merged from HEAD
5823 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5824 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5826 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5828 * sigc++/: new minidist.
5830 2000-02-14 Allan Rae <rae@lyx.org>
5832 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5834 2000-02-08 Juergen Vigna <jug@sad.it>
5836 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5837 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5839 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5840 for this port and so it is much easier for other people to port
5841 dialogs in a common development environment.
5843 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5844 the QT/KDE implementation.
5846 * src/frontends/kde/Dialogs.C:
5847 * src/frontends/kde/FormCopyright.C:
5848 * src/frontends/kde/FormCopyright.h:
5849 * src/frontends/kde/Makefile.am:
5850 * src/frontends/kde/formcopyrightdialog.C:
5851 * src/frontends/kde/formcopyrightdialog.h:
5852 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5853 for the kde support of the Copyright-Dialog.
5855 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5856 subdir-substitution instead of hardcoded 'xforms' as we now have also
5859 * src/frontends/include/DialogBase.h (Object): just commented the
5860 label after #endif (nasty warning and I don't like warnings ;)
5862 * src/main.C (main): added KApplication initialization if using
5865 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5866 For now only the KDE event-loop is added if frontend==kde.
5868 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5870 * configure.in: added support for the --with-frontend[=value] option
5872 * autogen.sh: added kde.m4 file to list of config-files
5874 * acconfig.h: added define for KDEGUI-support
5876 * config/kde.m4: added configuration functions for KDE-port
5878 * config/lyxinclude.m4: added --with-frontend[=value] option with
5879 support for xforms and KDE.
5881 2000-02-08 Allan Rae <rae@lyx.org>
5883 * all Makefile.am: Fixed up so the make targets dist, distclean,
5884 install and uninstall all work even if builddir != srcdir. Still
5885 have a new sigc++ minidist update to come.
5887 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5889 2000-02-01 Allan Rae <rae@lyx.org>
5891 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5892 Many mods to get builddir != srcdir working.
5894 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5895 for building on NT and so we can do the builddir != srcdir stuff.
5897 2000-01-30 Allan Rae <rae@lyx.org>
5899 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5900 This will stay in "rae" branch. We probably don't really need it in
5901 the main trunk as anyone who wants to help programming it should get
5902 a full library installed also. So they can check both included and
5903 system supplied library compilation.
5905 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5906 Added a 'mini' distribution of libsigc++. If you feel the urge to
5907 change something in these directories - Resist it. If you can't
5908 resist the urge then you should modify the following script and rebuild
5909 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5910 all happen. Still uses a hacked version of libsigc++'s configure.in.
5911 I'm quite happy with the results. I'm not sure the extra work to turn
5912 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5913 worth the trouble and would probably lead to extra maintenance
5915 I haven't tested the following important make targets: install, dist.
5916 Not ready for prime time but very close. Maybe 1.1.5.
5918 * development/tools/makeLyXsigc.sh: A shell script to automatically
5919 generate our mini-dist of libsigc++. It can only be used with a CVS
5920 checkout of libsigc++ not a tarball distribution. It's well commented.
5921 This will end up as part of the libsigc++ distribution so other apps
5922 can easily have an included mini-dist. If someone makes mods to the
5923 sigc++ subpackage without modifying this script to generate those
5924 changes I'll be very upset!
5926 * src/frontends/: Started the gui/system indep structure.
5928 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5929 to access the gui-indep dialogs are in this class. Much improved
5930 design compared to previous revision. Lars, please refrain from
5931 moving this header into src/ like you did with Popups.h last time.
5933 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5935 * src/frontends/xforms/: Started the gui-indep system with a single
5936 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5939 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5940 Here you'll find a very useful makefile and automated fdfix.sh that
5941 makes updating dailogs a no-brainer -- provided you follow the rules
5942 set out in the README. I'm thinking about adding another script to
5943 automatically generate skeleton code for a new dialog given just the
5946 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5947 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5948 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5950 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5952 * src/support/LSubstring.C (operator): simplify
5954 * src/lyxtext.h: removed bparams, use buffer_->params instead
5956 * src/lyxrow.h: make Row a real class, move all variables to
5957 private and use accessors.
5959 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5961 (isRightToLeftPar): ditto
5962 (ChangeLanguage): ditto
5963 (isMultiLingual): ditto
5966 (SimpleTeXOnePar): ditto
5967 (TeXEnvironment): ditto
5968 (GetEndLabel): ditto
5970 (SetOnlyLayout): ditto
5971 (BreakParagraph): ditto
5972 (BreakParagraphConservative): ditto
5973 (GetFontSettings): ditto
5975 (CopyIntoMinibuffer): ditto
5976 (CutIntoMinibuffer): ditto
5977 (PasteParagraph): ditto
5978 (SetPExtraType): ditto
5979 (UnsetPExtraType): ditto
5980 (DocBookContTableRows): ditto
5981 (SimpleDocBookOneTablePar): ditto
5983 (TeXFootnote): ditto
5984 (SimpleTeXOneTablePar): ditto
5985 (TeXContTableRows): ditto
5986 (SimpleTeXSpecialChars): ditto
5989 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5990 to private and use accessors.
5992 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5993 this, we did not use it anymore and has not been for ages. Just a
5994 waste of cpu cycles.
5996 * src/language.h: make Language a real class, move all variables
5997 to private and use accessors.
5999 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6000 (create_view): remove
6001 (update): some changes for new timer
6002 (cursorToggle): use new timer
6003 (beforeChange): change for new timer
6005 * src/BufferView.h (cursorToggleCB): removed last paramter because
6008 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6009 (cursorToggleCB): change because of new timer code
6011 * lib/CREDITS: updated own mailaddress
6013 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6015 * src/support/filetools.C (PutEnv): fix the code in case neither
6016 putenv() nor setenv() have been found.
6018 * INSTALL: mention the install-strip Makefile target.
6020 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6021 read-only documents.
6023 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6025 * lib/reLyX/configure.in (VERSION): avoid using a previously
6026 generated reLyX wrapper to find out $prefix.
6028 * lib/examples/eu_adibide_lyx-atua.lyx:
6029 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6030 translation of the Tutorial (Dooteo)
6032 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6034 * forms/cite.fd: new citation dialog
6036 * src/insetcite.[Ch]: the new citation dialog is moved into
6039 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6042 * src/insets/insetcommand.h: data members made private.
6044 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6046 * LyX 1.1.5 released
6048 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6050 * src/version.h (LYX_RELEASE): to 1.1.5
6052 * src/spellchecker.C (RunSpellChecker): return false if the
6053 spellchecker dies upon creation.
6055 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6057 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6058 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6062 * lib/CREDITS: update entry for Martin Vermeer.
6064 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6066 * src/text.C (draw): Draw foreign language bars at the bottom of
6067 the row instead of at the baseline.
6069 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6071 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6073 * lib/bind/de_menus.bind: updated
6075 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6077 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6079 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6081 * src/menus.C (Limit_string_length): New function
6082 (ShowTocMenu): Limit the number of items/length of items in the
6085 * src/paragraph.C (String): Correct result for a paragraph inside
6088 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6090 * src/bufferlist.C (close): test of buf->getuser() == NULL
6092 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6094 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6095 Do not call to SetCursor when the paragraph is a closed footnote!
6097 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6099 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6102 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6104 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6107 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6108 reference popup, that activates the reference-back action
6110 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6112 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6113 the menus. Also fixed a bug.
6115 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6116 the math panels when switching buffers (unless new buffer is readonly).
6118 * src/BufferView.C (NoSavedPositions)
6119 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6121 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6123 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6124 less of dvi dirty or not.
6126 * src/trans_mgr.[Ch] (insert): change first parameter to string
6129 * src/chset.[Ch] (encodeString): add const to first parameter
6131 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6133 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6137 * src/LaTeX.C (deplog): better searching for dependency files in
6138 the latex log. Uses now regexps.
6140 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6141 instead of the box hack or \hfill.
6143 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6145 * src/lyxfunc.C (doImportHelper): do not create the file before
6146 doing the actual import.
6147 (doImportASCIIasLines): create a new file before doing the insert.
6148 (doImportASCIIasParagraphs): ditto.
6150 * lib/lyxrc.example: remove mention of non-existing commands
6152 * lyx.man: remove mention of color-related switches.
6154 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6156 * src/lyx_gui.C: remove all the color-related ressources, which
6157 are not used anymore.
6159 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6162 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6164 * src/lyxrc.C (read): Add a missing break in the switch
6166 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6168 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6170 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6173 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6175 * src/text.C (draw): draw bars under foreign language words.
6177 * src/LColor.[Ch]: add LColor::language
6179 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6181 * src/lyxcursor.h (boundary): New member variable
6183 * src/text.C (IsBoundary): New methods
6185 * src/text.C: Use the above for currect cursor movement when there
6186 is both RTL & LTR text.
6188 * src/text2.C: ditto
6190 * src/bufferview_funcs.C (ToggleAndShow): ditto
6192 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6194 * src/text.C (DeleteLineForward): set selection to true to avoid
6195 that DeleteEmptyParagraphMechanism does some magic. This is how it
6196 is done in all other functions, and seems reasonable.
6197 (DeleteWordForward): do not jump over non-word stuff, since
6198 CursorRightOneWord() already does it.
6200 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6201 DeleteWordBackward, since they seem safe to me (since selection is
6202 set to "true") DeleteEmptyParagraphMechanism does nothing.
6204 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6206 * src/lyx_main.C (easyParse): simplify the code by factoring the
6207 part that removes parameters from the command line.
6208 (LyX): check wether wrong command line options have been given.
6210 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6212 * src/lyx_main.C : add support for specifying user LyX
6213 directory via command line option -userdir.
6215 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6217 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6218 the number of items per popup.
6219 (Add_to_refs_menu): Ditto.
6221 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6223 * src/lyxparagraph.h: renamed ClearParagraph() to
6224 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6225 textclass as parameter, and do nothing if free_spacing is
6226 true. This fixes part of the line-delete-forward problems.
6228 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6229 (pasteSelection): ditto.
6230 (SwitchLayoutsBetweenClasses): more translatable strings.
6232 * src/text2.C (CutSelection): use StripLeadingSpaces.
6233 (PasteSelection): ditto.
6234 (DeleteEmptyParagraphMechanism): ditto.
6236 2000-05-26 Juergen Vigna <jug@sad.it>
6238 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6239 is not needed in tabular insets.
6241 * src/insets/insettabular.C (TabularFeatures): added missing features.
6243 * src/tabular.C (DeleteColumn):
6245 (AppendRow): implemented this functions
6246 (cellsturct::operator=): clone the inset too;
6248 2000-05-23 Juergen Vigna <jug@sad.it>
6250 * src/insets/insettabular.C (LocalDispatch): better selection support
6251 when having multicolumn-cells.
6253 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6255 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6257 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6259 * src/ColorHandler.C (getGCForeground): put more test into _()
6261 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6264 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6267 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6269 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6270 there are no labels, or when buffer is readonly.
6272 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6273 there are no labels, buffer is SGML, or when buffer is readonly.
6275 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6277 * src/LColor.C (LColor): change a couple of grey40 to grey60
6278 (LColor): rewore initalization to make compiles go some magnitude
6280 (getGUIName): don't use gettext until we need the string.
6282 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6284 * src/Bullet.[Ch]: Fixed a small bug.
6286 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6288 * src/paragraph.C (String): Several fixes/improvements
6290 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6292 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6294 * src/paragraph.C (String): give more correct output.
6296 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6298 * src/lyxfont.C (stateText) Do not output the language if it is
6299 eqaul to the language of the document.
6301 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6302 between two paragraphs with the same language.
6304 * src/paragraph.C (getParLanguage) Return a correct answer for an
6305 empty dummy paragraph.
6307 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6310 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6313 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6314 the menus/popup, if requested fonts are unavailable.
6316 2000-05-22 Juergen Vigna <jug@sad.it>
6318 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6319 movement support (Up/Down/Tab/Shift-Tab).
6320 (LocalDispatch): added also preliminari cursor-selection.
6322 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6324 * src/paragraph.C (PasteParagraph): Hopefully now right!
6326 2000-05-22 Garst R. Reese <reese@isn.net>
6328 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6329 of list, change all references to Environment to Command
6330 * tex/hollywood.cls : rewrite environments as commands, add
6331 \uppercase to interiorshot and exteriorshot to force uppecase.
6332 * tex/broadway.cls : rewrite environments as commands. Tweak
6335 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6337 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6338 size of items: use a constant intead of the hardcoded 40, and more
6339 importantly do not remove the %m and %x tags added at the end.
6340 (Add_to_refs_menu): use vector::size_type instead of
6341 unsigned int as basic types for the variables. _Please_ do not
6342 assume that size_t is equal to unsigned int. On an alpha, this is
6343 unsigned long, which is _not_ the same.
6345 * src/language.C (initL): remove language "hungarian", since it
6346 seems that "magyar" is better.
6348 2000-05-22 Juergen Vigna <jug@sad.it>
6350 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6352 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6355 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6356 next was deleted but not set to 0.
6358 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6360 * src/language.C (initL): change the initialization of languages
6361 so that compiles goes _fast_.
6363 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6366 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6368 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6372 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6374 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6376 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6380 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6383 * src/insets/insetlo*.[Ch]: Made editable
6385 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6387 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6388 the current selection.
6390 * src/BufferView_pimpl.C (stuffClipboard): new method
6392 * src/BufferView.C (stuffClipboard): new method
6394 * src/paragraph.C (String): new method
6396 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6397 LColor::ignore when lyxname is not found.
6399 * src/BufferView.C (pasteSelection): new method
6401 * src/BufferView_pimpl.C (pasteSelection): new method
6403 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6405 * src/WorkArea.C (request_clipboard_cb): new static function
6406 (getClipboard): new method
6407 (putClipboard): new method
6409 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6411 * LyX 1.1.5pre2 released
6413 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6415 * src/vspace.C (operator=): removed
6416 (operator=): removed
6418 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6420 * src/layout.C (NumberOfClass): manually set the type in make_pair
6421 (NumberOfLayout): ditto
6423 * src/language.C: use the Language constructor for ignore_lang
6425 * src/language.h: add constructors to struct Language
6427 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6429 * src/text2.C (SetCursorIntern): comment out #warning
6431 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6433 * src/mathed/math_iter.h: initialize sx and sw to 0
6435 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6437 * forms/lyx.fd: Redesign of form_ref
6439 * src/LaTeXFeatures.[Ch]
6443 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6446 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6447 and Buffer::inset_iterator.
6449 * src/menus.C: Added new menus: TOC and Refs.
6451 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6453 * src/buffer.C (getTocList): New method.
6455 * src/BufferView2.C (ChangeRefs): New method.
6457 * src/buffer.C (getLabelList): New method. It replaces the old
6458 getReferenceList. The return type is vector<string> instead of
6461 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6462 the old getLabel() and GetNumberOfLabels() methods.
6463 * src/insets/insetlabel.C (getLabelList): ditto
6464 * src/mathed/formula.C (getLabelList): ditto
6466 * src/paragraph.C (String): New method.
6468 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6469 Uses the new getTocList() method.
6470 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6471 which automatically updates the contents of the browser.
6472 (RefUpdateCB): Use the new getLabelList method.
6474 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6476 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6478 * src/spellchecker.C: Added using std::reverse;
6480 2000-05-19 Juergen Vigna <jug@sad.it>
6482 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6484 * src/insets/insettext.C (computeTextRows): small fix for display of
6485 1 character after a newline.
6487 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6490 2000-05-18 Juergen Vigna <jug@sad.it>
6492 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6493 when changing width of column.
6495 * src/tabular.C (set_row_column_number_info): setting of
6496 autobreak rows if necessary.
6498 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6500 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6502 * src/vc-backend.*: renamed stat() to status() and vcstat to
6503 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6504 compilation broke. The new name seems more relevant, anyway.
6506 2000-05-17 Juergen Vigna <jug@sad.it>
6508 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6509 which was wrong if the removing caused removing of rows!
6511 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6512 (pushToken): new function.
6514 * src/text2.C (CutSelection): fix problem discovered with purify
6516 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6518 * src/debug.C (showTags): enlarge the first column, now that we
6519 have 6-digits debug codes.
6521 * lib/layouts/hollywood.layout:
6522 * lib/tex/hollywood.cls:
6523 * lib/tex/brodway.cls:
6524 * lib/layouts/brodway.layout: more commands and fewer
6525 environments. Preambles moved in the .cls files. Broadway now has
6526 more options on scene numbering and less whitespace (from Garst)
6528 * src/insets/insetbib.C (getKeys): make sure that we are in the
6529 document directory, in case the bib file is there.
6531 * src/insets/insetbib.C (Latex): revert bogus change.
6533 2000-05-16 Juergen Vigna <jug@sad.it>
6535 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6536 the TabularLayout on cursor move.
6538 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6540 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6543 (draw): fixed cursor position and drawing so that the cursor is
6544 visible when before the tabular-inset.
6546 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6547 when creating from old insettext.
6549 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6551 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6553 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6554 * lib/tex/brodway.cls: ditto
6556 * lib/layouts/brodway.layout: change alignment of parenthical
6559 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6561 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6562 versions 0.88 and 0.89 are supported.
6564 2000-05-15 Juergen Vigna <jug@sad.it>
6566 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6569 * src/insets/insettext.C (computeTextRows): redone completely this
6570 function in a much cleaner way, because of problems when having a
6572 (draw): added a frame border when the inset is locked.
6573 (SetDrawLockedFrame): this sets if we draw the border or not.
6574 (SetFrameColor): this sets the frame color (default=insetframe).
6576 * src/insets/lyxinset.h: added x() and y() functions which return
6577 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6578 function which is needed to see if we have a locking inset of some
6579 type in this inset (needed for now in insettabular).
6581 * src/vspace.C (inPixels): the same function also without a BufferView
6582 parameter as so it is easier to use it in some ocasions.
6584 * src/lyxfunc.C: changed all places where insertInset was used so
6585 that now if it couldn't be inserted it is deleted!
6587 * src/TabularLayout.C:
6588 * src/TableLayout.C: added support for new tabular-inset!
6590 * src/BufferView2.C (insertInset): this now returns a bool if the
6591 inset was really inserted!!!
6593 * src/tabular.C (GetLastCellInRow):
6594 (GetFirstCellInRow): new helper functions.
6595 (Latex): implemented for new tabular class.
6599 (TeXTopHLine): new Latex() helper functions.
6601 2000-05-12 Juergen Vigna <jug@sad.it>
6603 * src/mathed/formulamacro.C (Read):
6604 * src/mathed/formula.C (Read): read also the \end_inset here!
6606 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6608 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6609 crush when saving formulae with unbalanced parenthesis.
6611 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6613 * src/layout.C: Add new keyword "endlabelstring" to layout file
6615 * src/text.C (GetVisibleRow): Draw endlabel string.
6617 * lib/layouts/broadway.layout
6618 * lib/layouts/hollywood.layout: Added endlabel for the
6619 Parenthetical layout.
6621 * lib/layouts/heb-article.layout: Do not use slanted font shape
6622 for Theorem like environments.
6624 * src/buffer.C (makeLaTeXFile): Always add "american" to
6625 the UsedLanguages list if document language is RTL.
6627 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6629 * add addendum to README.OS2 and small patch (from SMiyata)
6631 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6633 * many files: correct the calls to ChangeExtension().
6635 * src/support/filetools.C (ChangeExtension): remove the no_path
6636 argument, which does not belong there. Use OnlyFileName() instead.
6638 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6639 files when LaTeXing a non-nice latex file.
6641 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6642 a chain of "if". Return false when deadkeys are not handled.
6644 * src/lyx_main.C (LyX): adapted the code for default bindings.
6646 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6647 bindings for basic functionality (except deadkeys).
6648 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6650 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6651 several methods: handle override_x_deadkeys.
6653 * src/lyxrc.h: remove the "bindings" map, which did not make much
6654 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6656 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6658 * src/lyxfont.C (stateText): use a saner method to determine
6659 whether the font is "default". Seems to fix the crash with DEC
6662 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6664 2000-05-08 Juergen Vigna <jug@sad.it>
6666 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6667 TabularLayoutMenu with mouse-button-3
6668 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6670 * src/TabularLayout.C: added this file for having a Layout for
6673 2000-05-05 Juergen Vigna <jug@sad.it>
6675 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6676 recalculating inset-widths.
6677 (TabularFeatures): activated this function so that I can change
6678 tabular-features via menu.
6680 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6681 that I can test some functions with the Table menu.
6683 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6685 * src/lyxfont.C (stateText): guard against stupid c++libs.
6687 * src/tabular.C: add using std::vector
6688 some whitespace changes, + removed som autogenerated code.
6690 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6692 2000-05-05 Juergen Vigna <jug@sad.it>
6694 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6695 row, columns and cellstructures.
6697 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6699 * lib/lyxrc.example: remove obsolete entries.
6701 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6702 reading of protected_separator for free_spacing.
6704 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6706 * src/text.C (draw): do not display an exclamation mark in the
6707 margin for margin notes. This is confusing, ugly and
6710 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6711 AMS math' is checked.
6713 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6714 name to see whether including the amsmath package is needed.
6716 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6718 * src/paragraph.C (validate): Compute UsedLanguages correctly
6719 (don't insert the american language if it doesn't appear in the
6722 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6723 The argument of \thanks{} command is considered moving argument
6725 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6728 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6730 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6731 for appendix/minipage/depth. The lines can be now both in the footnote
6732 frame, and outside the frame.
6734 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6737 2000-05-05 Juergen Vigna <jug@sad.it>
6739 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6740 neede only in tabular.[Ch].
6742 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6744 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6746 (Write): write '~' for PROTECTED_SEPARATOR
6748 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6750 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6753 * src/mathed/formula.C (drawStr): rename size to siz.
6755 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6756 possibly fix a bug by not changing the pflags = flags to piflags =
6759 2000-05-05 Juergen Vigna <jug@sad.it>
6761 * src/insets/insetbib.C: moved using directive
6763 * src/ImportNoweb.C: small fix for being able to compile (missing
6766 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6768 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6769 to use clear, since we don't depend on this in the code. Add test
6772 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6774 * (various *.C files): add using std::foo directives to please dec
6777 * replace calls to string::clear() to string::erase() (Angus)
6779 * src/cheaders/cmath: modified to provide std::abs.
6781 2000-05-04 Juergen Vigna <jug@sad.it>
6783 * src/insets/insettext.C: Prepared all for inserting of multiple
6784 paragraphs. Still display stuff to do (alignment and other things),
6785 but I would like to use LyXText to do this when we cleaned out the
6786 table-support stuff.
6788 * src/insets/insettabular.C: Changed lot of stuff and added lots
6789 of functionality still a lot to do.
6791 * src/tabular.C: Various functions changed name and moved to be
6792 const functions. Added new Read and Write functions and changed
6793 lots of things so it works good with tabular-insets (also removed
6794 some stuff which is not needed anymore * hacks *).
6796 * src/lyxcursor.h: added operators == and != which just look if
6797 par and pos are (not) equal.
6799 * src/buffer.C (latexParagraphs): inserted this function to latex
6800 all paragraphs form par to endpar as then I can use this too for
6803 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6804 so that I can call this to from text insets with their own cursor.
6806 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6807 output off all paragraphs (because of the fix below)!
6809 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6810 the very last paragraph (this could be also the last paragraph of an
6813 * src/texrow.h: added rows() call which returns the count-variable.
6815 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6817 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6819 * lib/configure.m4: better autodetection of DocBook tools.
6821 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6823 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6825 * src/lyx_cb.C: add using std::reverse;
6827 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6830 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6831 selected files. Should fix repeated errors from generated files.
6833 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6835 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6837 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6838 the spellchecker popup.
6840 * lib/lyxrc.example: Removed the \number_inset section
6842 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6844 * src/insets/figinset.C (various): Use IsFileReadable() to make
6845 sure that the file actually exist. Relying on ghostscripts errors
6846 is a bad idea since they can lead to X server crashes.
6848 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6850 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6853 * lib/lyxrc.example: smallish typo in description of
6854 \view_dvi_paper_option
6856 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6859 * src/lyxfunc.C: doImportHelper to factor out common code of the
6860 various import methods. New functions doImportASCIIasLines,
6861 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6862 doImportLinuxDoc for the format specific parts.
6865 * buffer.C: Dispatch returns now a bool to indicate success
6868 * lyx_gui.C: Add getLyXView() for member access
6870 * lyx_main.C: Change logic for batch commands: First try
6871 Buffer::Dispatch (possibly without GUI), if that fails, use
6874 * lyx_main.C: Add support for --import command line switch.
6875 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6876 Available Formats: Everything accepted by 'buffer-import <format>'
6878 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6880 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6883 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6884 documents will be reformatted upon reentry.
6886 2000-04-27 Juergen Vigna <jug@sad.it>
6888 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6889 correctly only last pos this was a bug.
6891 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6893 * release of lyx-1.1.5pre1
6895 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6897 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6899 * src/menus.C: revert the change of naming (Figure->Graphic...)
6900 from 2000-04-11. It was incomplete and bad.
6902 * src/LColor.[Ch]: add LColor::depthbar.
6903 * src/text.C (GetVisibleRow): use it.
6905 * README: update the languages list.
6907 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6909 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6912 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6914 * README: remove sections that were just wrong.
6916 * src/text2.C (GetRowNearY): remove currentrow code
6918 * src/text.C (GetRow): remove currentrow code
6920 * src/screen.C (Update): rewritten a bit.
6921 (SmallUpdate): removed func
6923 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6925 (FullRebreak): return bool
6926 (currentrow): remove var
6927 (currentrow_y): ditto
6929 * src/lyxscreen.h (Draw): change arg to unsigned long
6930 (FitCursor): return bool
6931 (FitManualCursor): ditto
6932 (Smallpdate): remove func
6933 (first): change to unsigned long
6934 (DrawOneRow): change second arg to long (from long &)
6935 (screen_refresh_y): remove var
6936 (scree_refresh_row): ditto
6938 * src/lyxrow.h: change baseline to usigned int from unsigned
6939 short, this brings some implicit/unsigned issues out in the open.
6941 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6943 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6944 instead of smallUpdate.
6946 * src/lyxcursor.h: change y to unsigned long
6948 * src/buffer.h: don't call updateScrollbar after fitcursor
6950 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6951 where they are used. Removed "\\direction", this was not present
6952 in 1.1.4 and is already obsolete. Commented out some code that I
6953 believe to never be called.
6954 (runLiterate): don't call updateScrollbar after fitCursor
6956 (buildProgram): ditto
6959 * src/WorkArea.h (workWidth): change return val to unsigned
6962 (redraw): remove the button redraws
6963 (setScrollbarValue): change for scrollbar
6964 (getScrollbarValue): change for scrollbar
6965 (getScrollbarBounds): change for scrollbar
6967 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6968 (C_WorkArea_down_cb): removed func
6969 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6970 (resize): change for scrollbar
6971 (setScrollbar): ditto
6972 (setScrollbarBounds): ditto
6973 (setScrollbarIncrements): ditto
6974 (up_cb): removed func
6975 (down_cb): removed func
6976 (scroll_cb): change for scrollbar
6977 (work_area_handler): ditto
6979 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6980 when FitCursor did something.
6981 (updateScrollbar): some unsigned changes
6982 (downCB): removed func
6983 (scrollUpOnePage): removed func
6984 (scrollDownOnePage): remvoed func
6985 (workAreaMotionNotify): don't call screen->FitCursor but use
6986 fitCursor instead. and bool return val
6987 (workAreaButtonPress): ditto
6988 (workAreaButtonRelease): some unsigned changes
6989 (checkInsetHit): ditto
6990 (workAreaExpose): ditto
6991 (update): parts rewritten, comments about the signed char arg added
6992 (smallUpdate): removed func
6993 (cursorPrevious): call needed updateScrollbar
6996 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6999 * src/BufferView.[Ch] (upCB): removed func
7000 (downCB): removed func
7001 (smallUpdate): removed func
7003 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7005 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7006 currentrow, currentrow_y optimization. This did not help a lot and
7007 if we want to do this kind of optimization we should rather use
7008 cursor.row instead of the currentrow.
7010 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7011 buffer spacing and klyx spacing support.
7013 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7015 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7018 2000-04-26 Juergen Vigna <jug@sad.it>
7020 * src/insets/figinset.C: fixes to Lars sstream changes!
7022 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7024 * A lot of files: Added Ascii(ostream &) methods to all inset
7025 classes. Used when exporting to ASCII.
7027 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7028 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7031 * src/text2.C (ToggleFree): Disabled implicit word selection when
7032 there is a change in the language
7034 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7035 no output was generated for end-of-sentence inset.
7037 * src/insets/lyxinset.h
7040 * src/paragraph.C: Removed the insetnumber code
7042 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7044 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7046 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7047 no_babel and no_epsfig completely from the file.
7048 (parseSingleLyXformat2Token): add handling for per-paragraph
7049 spacing as written by klyx.
7051 * src/insets/figinset.C: applied patch by Andre. Made it work with
7054 2000-04-20 Juergen Vigna <jug@sad.it>
7056 * src/insets/insettext.C (cutSelection):
7057 (copySelection): Fixed with selection from right to left.
7058 (draw): now the rows are not recalculated at every draw.
7059 (computeTextRows): for now reset the inset-owner here (this is
7060 important for an undo or copy where the inset-owner is not set
7063 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7064 motion to the_locking_inset screen->first was forgotten, this was
7065 not important till we got multiline insets.
7067 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7069 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7070 code seems to be alright (it is code changed by Dekel, and the
7071 intent is indeed that all macros should be defined \protect'ed)
7073 * NEWS: a bit of reorganisation of the new user-visible features.
7075 2000-04-19 Juergen Vigna <jug@sad.it>
7077 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7078 position. Set the inset_owner of the used paragraph so that it knows
7079 that it is inside an inset. Fixed cursor handling with mouse and
7080 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7081 and cleanups to make TextInsets work better.
7083 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7084 Changed parameters of various functions and added LockInsetInInset().
7086 * src/insets/insettext.C:
7088 * src/insets/insetcollapsable.h:
7089 * src/insets/insetcollapsable.C:
7090 * src/insets/insetfoot.h:
7091 * src/insets/insetfoot.C:
7092 * src/insets/insetert.h:
7093 * src/insets/insetert.C: cleaned up the code so that it works now
7094 correctly with insettext.
7096 * src/insets/inset.C:
7097 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7098 that insets in insets are supported right.
7101 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7103 * src/paragraph.C: some small fixes
7105 * src/debug.h: inserted INSETS debug info
7107 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7108 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7110 * src/commandtags.h:
7111 * src/LyXAction.C: insert code for InsetTabular.
7113 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7114 not Button1MotionMask.
7115 (workAreaButtonRelease): send always a InsetButtonRelease event to
7117 (checkInsetHit): some setCursor fixes (always with insets).
7119 * src/BufferView2.C (lockInset): returns a bool now and extended for
7120 locking insets inside insets.
7121 (showLockedInsetCursor): it is important to have the cursor always
7122 before the locked inset.
7123 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7125 * src/BufferView.h: made lockInset return a bool.
7127 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7129 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7130 that is used also internally but can be called as public to have back
7131 a cursor pos which is not set internally.
7132 (SetCursorIntern): Changed to use above function.
7134 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7136 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7141 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7142 patches for things that should be in or should be changed.
7144 * src/* [insetfiles]: change "usigned char fragile" to bool
7145 fragile. There was only one point that could that be questioned
7146 and that is commented in formulamacro.C. Grep for "CHECK".
7148 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7149 (DeleteBuffer): take it out of CutAndPaste and make it static.
7151 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7153 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7154 output the spacing envir commands. Also the new commands used in
7155 the LaTeX output makes the result better.
7157 * src/Spacing.C (writeEnvirBegin): new method
7158 (writeEnvirEnd): new method
7160 2000-04-18 Juergen Vigna <jug@sad.it>
7162 * src/CutAndPaste.C: made textclass a static member of the class
7163 as otherwise it is not accesed right!!!
7165 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7167 * forms/layout_forms.fd
7168 * src/layout_forms.h
7169 * src/layout_forms.C (create_form_form_character)
7170 * src/lyx_cb.C (UserFreeFont)
7171 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7172 documents (in the layout->character popup).
7174 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7176 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7177 \spell_command was in fact not honored (from Kevin Atkinson).
7179 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7182 * src/lyx_gui.h: make lyxViews private (Angus)
7184 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7186 * src/mathed/math_write.C
7187 (MathMatrixInset::Write) Put \protect before \begin{array} and
7188 \end{array} if fragile
7189 (MathParInset::Write): Put \protect before \\ if fragile
7191 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7193 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7194 initialization if the LyXColorHandler must be done after the
7195 connections to the XServer has been established.
7197 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7198 get the background pixel from the lyxColorhandler so that the
7199 figures are rendered with the correct background color.
7200 (NextToken): removed functions.
7201 (GetPSSizes): use ifs >> string instead of NextToken.
7203 * src/Painter.[Ch]: the color cache moved out of this file.
7205 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7208 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7210 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7211 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7213 * src/BufferView.C (enterView): new func
7214 (leaveView): new func
7216 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7218 (leaveView): new func, undefines xterm cursor when approp.
7220 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7221 (AllowInput): delete the Workarea cursor handling from this func.
7223 * src/Painter.C (underline): draw a slimer underline in most cases.
7225 * src/lyx_main.C (error_handler): use extern "C"
7227 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7229 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7230 sent directly to me.
7232 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7233 to the list by Dekel.
7235 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7238 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7239 methods from lyx_cb.here.
7241 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7244 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7246 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7247 instead of using current_view directly.
7249 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7251 * src/LyXAction.C (init): add the paragraph-spacing command.
7253 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7255 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7257 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7258 different from the documents.
7260 * src/text.C (SetHeightOfRow): take paragraph spacing into
7261 account, paragraph spacing takes precedence over buffer spacing
7262 (GetVisibleRow): ditto
7264 * src/paragraph.C (writeFile): output the spacing parameter too.
7265 (validate): set the correct features if spacing is used in the
7267 (Clear): set spacing to default
7268 (MakeSameLayout): spacing too
7269 (HasSameLayout): spacing too
7270 (SetLayout): spacing too
7271 (TeXOnePar): output the spacing commands
7273 * src/lyxparagraph.h: added a spacing variable for use with
7274 per-paragraph spacing.
7276 * src/Spacing.h: add a Default spacing and a method to check if
7277 the current spacing is default. also added an operator==
7279 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7282 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7284 * src/lyxserver.C (callback): fix dispatch of functions
7286 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7287 printf() into lyxerr call.
7289 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7292 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7293 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7294 the "Float" from each of the subitems.
7295 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7297 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7298 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7299 documented the change so that the workaround can be nuked later.
7301 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7304 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7306 * src/buffer.C (getLatexName): ditto
7307 (setReadonly): ditto
7309 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7311 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7312 avoid some uses of current_view. Added also a bufferParams()
7313 method to get at this.
7315 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7317 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7319 * src/lyxparagraph.[Ch]: removed
7320 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7321 with operators used by lower_bound and
7322 upper_bound in InsetTable's
7323 Make struct InsetTable private again. Used matchpos.
7325 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7327 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7328 document, the language of existing text is changed (unless the
7329 document is multi-lingual)
7331 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7333 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7335 * A lot of files: A rewrite of the Right-to-Left support.
7337 2000-04-10 Juergen Vigna <jug@sad.it>
7339 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7340 misplaced cursor when inset in inset is locked.
7342 * src/insets/insettext.C (LocalDispatch): small fix so that a
7343 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7345 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7346 footnote font should be decreased in size twice when displaying.
7348 * src/insets/insettext.C (GetDrawFont): inserted this function as
7349 the drawing-font may differ from the real paragraph font.
7351 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7352 insets (inset in inset!).
7354 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7355 function here because we don't want footnotes inside footnotes.
7357 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7359 (init): now set the inset_owner in paragraph.C
7360 (LocalDispatch): added some resetPos() in the right position
7363 (pasteSelection): changed to use the new CutAndPaste-Class.
7365 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7366 which tells if it is allowed to insert another inset inside this one.
7368 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7369 SwitchLayoutsBetweenClasses.
7371 * src/text2.C (InsertInset): checking of the new paragraph-function
7373 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7374 is not needed anymore here!
7377 (PasteSelection): redone (also with #ifdef) so that now this uses
7378 the CutAndPaste-Class.
7379 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7382 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7383 from/to text/insets.
7385 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7386 so that the paragraph knows if it is inside an (text)-inset.
7387 (InsertFromMinibuffer): changed return-value to bool as now it
7388 may happen that an inset is not inserted in the paragraph.
7389 (InsertInsetAllowed): this checks if it is allowed to insert an
7390 inset in this paragraph.
7392 (BreakParagraphConservative):
7393 (BreakParagraph) : small change for the above change of the return
7394 value of InsertFromMinibuffer.
7396 * src/lyxparagraph.h: added inset_owner and the functions to handle
7397 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7399 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7401 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7402 functions from BufferView to BufferView::Pimpl to ease maintence.
7404 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7405 correctly. Also use SetCursorIntern instead of SetCursor.
7407 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7410 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7412 * src/WorkArea.C (belowMouse): manually implement below mouse.
7414 * src/*: Add "explicit" on several constructors, I added probably
7415 some unneeded ones. A couple of changes to code because of this.
7417 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7418 implementation and private parts from the users of BufferView. Not
7421 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7422 implementation and private parts from the users of LyXLex. Not
7425 * src/BufferView_pimpl.[Ch]: new files
7427 * src/lyxlex_pimpl.[Ch]: new files
7429 * src/LyXView.[Ch]: some inline functions move out-of-line
7431 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7433 * src/lyxparagraph.h: make struct InsetTable public.
7435 * src/support/lyxstring.h: change lyxstring::difference_type to be
7436 ptrdiff_t. Add std:: modifiers to streams.
7438 * src/font.C: include the <cctype> header, for islower() and
7441 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7443 * src/font.[Ch]: new files. Contains the metric functions for
7444 fonts, takes a LyXFont as parameter. Better separation of concepts.
7446 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7447 changes because of this.
7449 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7451 * src/*: compile with -Winline and move functions that don't
7454 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7457 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7459 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7460 (various files changed because of this)
7462 * src/Painter.C (text): fixed the drawing of smallcaps.
7464 * src/lyxfont.[Ch] (drawText): removed unused member func.
7467 * src/*.C: added needed "using" statements and "std::" qualifiers.
7469 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7471 * src/*.h: removed all use of "using" from header files use
7472 qualifier std:: instead.
7474 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7476 * src/text.C (Backspace): some additional cleanups (we already
7477 know whether cursor.pos is 0 or not).
7479 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7480 automake does not provide one).
7482 * src/bmtable.h: replace C++ comments with C comments.
7484 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7486 * src/screen.C (ShowCursor): Change the shape of the cursor if
7487 the current language is not equal to the language of the document.
7488 (If the cursor change its shape unexpectedly, then you've found a bug)
7490 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7493 * src/insets/insetnumber.[Ch]: New files.
7495 * src/LyXAction.C (init)
7496 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7499 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7501 * src/lyxparagraph.h
7502 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7503 (the vector is kept sorted).
7505 * src/text.C (GetVisibleRow): Draw selection correctly when there
7506 is both LTR and RTL text.
7508 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7509 which is much faster.
7511 * src/text.C (GetVisibleRow and other): Do not draw the last space
7512 in a row if the direction of the last letter is not equal to the
7513 direction of the paragraph.
7515 * src/lyxfont.C (latexWriteStartChanges):
7516 Check that font language is not equal to basefont language.
7517 (latexWriteEndChanges): ditto
7519 * src/lyx_cb.C (StyleReset): Don't change the language while using
7520 the font-default command.
7522 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7523 empty paragraph before a footnote.
7525 * src/insets/insetcommand.C (draw): Increase x correctly.
7527 * src/screen.C (ShowCursor): Change cursor shape if
7528 current language != document language.
7530 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7532 2000-03-31 Juergen Vigna <jug@sad.it>
7534 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7535 (Clone): changed mode how the paragraph-data is copied to the
7536 new clone-paragraph.
7538 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7539 GetInset(pos) with no inset anymore there (in inset UNDO)
7541 * src/insets/insetcommand.C (draw): small fix as here x is
7542 incremented not as much as width() returns (2 before, 2 behind = 4)
7544 2000-03-30 Juergen Vigna <jug@sad.it>
7546 * src/insets/insettext.C (InsetText): small fix in initialize
7547 widthOffset (should not be done in the init() function)
7549 2000-03-29 Amir Karger <karger@lyx.org>
7551 * lib/examples/it_ItemizeBullets.lyx: translation by
7554 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7556 2000-03-29 Juergen Vigna <jug@sad.it>
7558 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7560 * src/insets/insetfoot.C (Clone): small change as for the below
7561 new init function in the text-inset
7563 * src/insets/insettext.C (init): new function as I've seen that
7564 clone did not copy the Paragraph-Data!
7565 (LocalDispatch): Added code so that now we have some sort of Undo
7566 functionality (well actually we HAVE Undo ;)
7568 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7570 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7572 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7575 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7577 * src/main.C: added a runtime check that verifies that the xforms
7578 header used when building LyX and the library used when running
7579 LyX match. Exit with a message if they don't match. This is a
7580 version number check only.
7582 * src/buffer.C (save): Don't allocate memory on the heap for
7583 struct utimbuf times.
7585 * *: some using changes, use iosfwd instead of the real headers.
7587 * src/lyxfont.C use char const * instead of string for the static
7588 strings. Rewrite some functions to use sstream.
7590 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7592 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7595 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7597 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7598 of Geodesy (from Martin Vermeer)
7600 * lib/layouts/svjour.inc: include file for the Springer svjour
7601 class. It can be used to support journals other than JoG.
7603 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7604 Miskiewicz <misiek@pld.org.pl>)
7605 * lib/reLyX/Makefile.am: ditto.
7607 2000-03-27 Juergen Vigna <jug@sad.it>
7609 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7610 also some modifications with operations on selected text.
7612 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7613 problems with clicking on insets (last famous words ;)
7615 * src/insets/insetcommand.C (draw):
7616 (width): Changed to have a bit of space before and after the inset so
7617 that the blinking cursor can be seen (otherwise it was hidden)
7619 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7621 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7622 would not be added to the link list when an installed gettext (not
7623 part of libc) is found.
7625 2000-03-24 Juergen Vigna <jug@sad.it>
7627 * src/insets/insetcollapsable.C (Edit):
7628 * src/mathed/formula.C (InsetButtonRelease):
7629 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7632 * src/BufferView.C (workAreaButtonPress):
7633 (workAreaButtonRelease):
7634 (checkInsetHit): Finally fixed the clicking on insets be handled
7637 * src/insets/insetert.C (Edit): inserted this call so that ERT
7638 insets work always with LaTeX-font
7640 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7642 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7643 caused lyx to startup with no GUI in place, causing in a crash
7644 upon startup when called with arguments.
7646 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7648 * src/FontLoader.C: better initialization of dummyXFontStruct.
7650 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7652 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7653 for linuxdoc and docbook import and export format options.
7655 * lib/lyxrc.example Example of default values for the previous flags.
7657 * src/lyx_cb.C Use those flags instead of the hardwired values for
7658 linuxdoc and docbook export.
7660 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7663 * src/menus.C Added menus entries for the new import/exports formats.
7665 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7667 * src/lyxrc.*: Added support for running without Gui
7670 * src/FontLoader.C: sensible defaults if no fonts are needed
7672 * src/lyx_cb.C: New function ShowMessage (writes either to the
7673 minibuffer or cout in case of no gui
7674 New function AskOverwrite for common stuff
7675 Consequently various changes to call these functions
7677 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7678 wild guess at sensible screen resolution when having no gui
7680 * src/lyxfont.C: no gui, no fonts... set some defaults
7682 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7684 * src/LColor.C: made the command inset background a bit lighter.
7686 2000-03-20 Hartmut Goebel <goebel@noris.net>
7688 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7689 stdstruct.inc. Koma-Script added some title elements which
7690 otherwise have been listed below "bibliography". This split allows
7691 adding title elements to where they belong.
7693 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7694 define the additional title elements and then include
7697 * many other layout files: changed to include stdtitle.inc just
7698 before stdstruct.inc.
7700 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7702 * src/buffer.C: (save) Added the option to store all backup files
7703 in a single directory
7705 * src/lyxrc.[Ch]: Added variable \backupdir_path
7707 * lib/lyxrc.example: Added descriptions of recently added variables
7709 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7710 bibtex inset, not closing the bibtex popup when deleting the inset)
7712 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7714 * src/lyx_cb.C: add a couple using directives.
7716 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7717 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7718 import based on the filename.
7720 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7721 file would be imported at start, if the filename where of a sgml file.
7723 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7725 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7727 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7728 * src/lyxfont.h Replaced the member variable bits.direction by the
7729 member variable lang. Made many changes in other files.
7730 This allows having a multi-lingual document
7732 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7733 that change the current language to <l>.
7734 Removed the command "font-rtl"
7736 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7737 format for Hebrew documents)
7739 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7740 When auto_mathmode is "true", pressing a digit key in normal mode
7741 will cause entering into mathmode.
7742 If auto_mathmode is "rtl" then this behavior will be active only
7743 when writing right-to-left text.
7745 * src/text2.C (InsertStringA) The string is inserted using the
7748 * src/paragraph.C (GetEndLabel) Gives a correct result for
7749 footnote paragraphs.
7751 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7753 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7755 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7756 front of PasteParagraph. Never insert a ' '. This should at least
7757 fix some cause for the segfaults that we have been experiencing,
7758 it also fixes backspace behaviour slightly. (Phu!)
7760 * src/support/lstrings.C (compare_no_case): some change to make it
7761 compile with gcc 2.95.2 and stdlibc++-v3
7763 * src/text2.C (MeltFootnoteEnvironment): change type o
7764 first_footnote_par_is_not_empty to bool.
7766 * src/lyxparagraph.h: make text private. Changes in other files
7768 (fitToSize): new function
7769 (setContentsFromPar): new function
7770 (clearContents): new function
7771 (SetChar): new function
7773 * src/paragraph.C (readSimpleWholeFile): deleted.
7775 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7776 the file, just use a simple string instead. Also read the file in
7777 a more maintainable manner.
7779 * src/text2.C (InsertStringA): deleted.
7780 (InsertStringB): deleted.
7782 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7784 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7785 RedoParagraphs from the doublespace handling part, just set status
7786 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7787 done, but perhaps not like this.)
7789 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7791 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7792 character when inserting an inset.
7794 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7796 * src/bufferparams.C (readLanguage): now takes "default" into
7799 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7800 also initialize the toplevel_keymap with the default bindings from
7803 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7805 * all files using lyxrc: have lyxrc as a real variable and not a
7806 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7809 * src/lyxrc.C: remove double call to defaultKeyBindings
7811 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7812 toolbar defauls using lyxlex. Remove enums, structs, functions
7815 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7816 toolbar defaults. Also store default keybindings in a map.
7818 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7819 storing the toolbar defaults without any xforms dependencies.
7821 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7822 applied. Changed to use iterators.
7824 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7826 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7827 systems that don't have LINGUAS set to begin with.
7829 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7831 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7832 the list by Dekel Tsur.
7834 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7836 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7837 * src/insets/form_graphics.C: ditto.
7839 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7841 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7843 * src/bufferparams.C (readLanguage): use the new language map
7845 * src/intl.C (InitKeyMapper): use the new language map
7847 * src/lyx_gui.C (create_forms): use the new language map
7849 * src/language.[Ch]: New files. Used for holding the information
7850 about each language. Now! Use this new language map enhance it and
7851 make it really usable for our needs.
7853 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7855 * screen.C (ShowCursor): Removed duplicate code.
7856 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7857 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7859 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7862 * src/text.C Added TransformChar method. Used for rendering Arabic
7863 text correctly (change the glyphs of the letter according to the
7864 position in the word)
7869 * src/lyxrc.C Added lyxrc command {language_command_begin,
7870 language_command_end,language_command_ltr,language_command_rtl,
7871 language_package} which allows the use of either arabtex or Omega
7874 * src/lyx_gui.C (init)
7876 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7877 to use encoding for menu fonts which is different than the encoding
7880 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7881 do not load the babel package.
7882 To write an English document with Hebrew/Arabic, change the document
7883 language to "english".
7885 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7886 (alphaCounter): changed to return char
7887 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7889 * lib/lyxrc.example Added examples for Hebrew/Arabic
7892 * src/layout.C Added layout command endlabeltype
7894 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7896 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7898 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7900 * src/mathed/math_delim.C (search_deco): return a
7901 math_deco_struct* instead of index.
7903 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7905 * All files with a USE_OSTREAM_ONLY within: removed all code that
7906 was unused when USE_OSTREAM_ONLY is defined.
7908 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7909 of any less. Removed header and using.
7911 * src/text.C (GetVisibleRow): draw the string "Page Break
7912 (top/bottom)" on screen when drawing a pagebreak line.
7914 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7916 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7918 * src/mathed/math_macro.C (draw): do some cast magic.
7921 * src/mathed/math_defs.h: change byte* argument to byte const*.
7923 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7925 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7926 know it is right to return InsetFoot* too, but cxx does not like
7929 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7931 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7933 * src/mathed/math_delim.C: change == to proper assignment.
7935 2000-03-09 Juergen Vigna <jug@sad.it>
7937 * src/insets/insettext.C (setPos): fixed various cursor positioning
7938 problems (via mouse and cursor-keys)
7939 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7940 inset (still a small display problem but it works ;)
7942 * src/insets/insetcollapsable.C (draw): added button_top_y and
7943 button_bottom_y to have correct values for clicking on the inset.
7945 * src/support/lyxalgo.h: commented out 'using std::less'
7947 2000-03-08 Juergen Vigna <jug@sad.it>
7949 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7950 Button-Release event closes as it is alos the Release-Event
7953 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7955 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7957 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7958 can add multiple spaces in Scrap (literate programming) styles...
7959 which, by the way, is how I got hooked on LyX to begin with.
7961 * src/mathed/formula.C (Write): Added dummy variable to an
7962 inset::Latex() call.
7963 (Latex): Add free_spacing boolean to inset::Latex()
7965 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7967 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7968 virtual function to include the free_spacing boolean from
7969 the containing paragraph's style.
7971 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7972 Added free_spacing boolean arg to match inset.h
7974 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7975 Added free_spacing boolean arg to match inset.h
7977 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7978 Added free_spacing boolean and made sure that if in a free_spacing
7979 paragraph, that we output normal space if there is a protected space.
7981 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7982 Added free_spacing boolean arg to match inset.h
7984 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7985 Added free_spacing boolean arg to match inset.h
7987 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7988 Added free_spacing boolean arg to match inset.h
7990 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7991 Added free_spacing boolean arg to match inset.h
7993 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7994 Added free_spacing boolean arg to match inset.h
7996 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7997 free_spacing boolean arg to match inset.h
7999 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8000 Added free_spacing boolean arg to match inset.h
8002 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8003 Added free_spacing boolean arg to match inset.h
8005 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8006 Added free_spacing boolean arg to match inset.h
8008 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8009 Added free_spacing boolean arg to match inset.h
8011 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8012 Added free_spacing boolean arg to match inset.h
8014 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8015 free_spacing boolean arg to match inset.h
8017 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8018 free_spacing boolean arg to match inset.h
8020 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8021 ignore free_spacing paragraphs. The user's spaces are left
8024 * src/text.C (InsertChar): Fixed the free_spacing layout
8025 attribute behavior. Now, if free_spacing is set, you can
8026 add multiple spaces in a paragraph with impunity (and they
8027 get output verbatim).
8028 (SelectSelectedWord): Added dummy argument to inset::Latex()
8031 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8034 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8035 paragraph layouts now only input a simple space instead.
8036 Special character insets don't make any sense in free-spacing
8039 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8040 hard-spaces in the *input* file to simple spaces if the layout
8041 is free-spacing. This converts old files which had to have
8042 hard-spaces in free-spacing layouts where a simple space was
8044 (writeFileAscii): Added free_spacing check to pass to the newly
8045 reworked inset::Latex(...) methods. The inset::Latex() code
8046 ensures that hard-spaces in free-spacing paragraphs get output
8047 as spaces (rather than "~").
8049 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8051 * src/mathed/math_delim.C (draw): draw the empty placeholder
8052 delims with a onoffdash line.
8053 (struct math_deco_compare): struct that holds the "functors" used
8054 for the sort and the binary search in math_deco_table.
8055 (class init_deco_table): class used for initial sort of the
8057 (search_deco): use lower_bound to do a binary search in the
8060 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8062 * src/lyxrc.C: a small secret thingie...
8064 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8065 and to not flush the stream as often as it used to.
8067 * src/support/lyxalgo.h: new file
8068 (sorted): template function used for checking if a sequence is
8069 sorted or not. Two versions with and without user supplied
8070 compare. Uses same compare as std::sort.
8072 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8073 it and give warning on lyxerr.
8075 (struct compare_tags): struct with function operators used for
8076 checking if sorted, sorting and lower_bound.
8077 (search_kw): use lower_bound instead of manually implemented
8080 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8082 * src/insets/insetcollapsable.h: fix Clone() declaration.
8083 * src/insets/insetfoot.h: ditto.
8085 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8087 2000-03-08 Juergen Vigna <jug@sad.it>
8089 * src/insets/lyxinset.h: added owner call which tells us if
8090 this inset is inside another inset. Changed also the return-type
8091 of Editable to an enum so it tells clearer what the return-value is.
8093 * src/insets/insettext.C (computeTextRows): fixed computing of
8094 textinsets which split automatically on more rows.
8096 * src/insets/insetert.[Ch]: changed this to be of BaseType
8099 * src/insets/insetfoot.[Ch]: added footnote inset
8101 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8102 collapsable insets (like footnote, ert, ...)
8104 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8106 * src/lyxdraw.h: remvoe file
8108 * src/lyxdraw.C: remove file
8110 * src/insets/insettext.C: added <algorithm>.
8112 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8114 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8115 (matrix_cb): case MM_OK use string stream
8117 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8120 * src/mathed/math_macro.C (draw): use string stream
8121 (Metrics): use string stream
8123 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8124 directly to the ostream.
8126 * src/vspace.C (asString): use string stream.
8127 (asString): use string stream
8128 (asLatexString): use string stream
8130 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8131 setting Spacing::Other.
8133 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8134 sprintf when creating the stretch vale.
8136 * src/text2.C (alphaCounter): changed to return a string and to
8137 not use a static variable internally. Also fixed a one-off bug.
8138 (SetCounter): changed the drawing of the labels to use string
8139 streams instead of sprintf.
8141 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8142 manipulator to use a scheme that does not require library support.
8143 This is also the way it is done in the new GNU libstdc++. Should
8144 work with DEC cxx now.
8146 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8148 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8149 end. This fixes a bug.
8151 * src/mathed (all files concerned with file writing): apply the
8152 USE_OSTREAM_ONLY changes to mathed too.
8154 * src/support/DebugStream.h: make the constructor explicit.
8156 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8157 count and ostream squashed.
8159 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8161 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8163 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8164 ostringstream uses STL strings, and we might not.
8166 * src/insets/insetspecialchar.C: add using directive.
8167 * src/insets/insettext.C: ditto.
8169 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8171 * lib/layouts/seminar.layout: feeble attempt at a layout for
8172 seminar.cls, far from completet and could really use some looking
8173 at from people used to write layout files.
8175 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8176 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8177 a lot nicer and works nicely with ostreams.
8179 * src/mathed/formula.C (draw): a slightly different solution that
8180 the one posted to the list, but I think this one works too. (font
8181 size wrong in headers.)
8183 * src/insets/insettext.C (computeTextRows): some fiddling on
8184 Jürgens turf, added some comments that he should read.
8186 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8187 used and it gave compiler warnings.
8188 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8191 * src/lyx_gui.C (create_forms): do the right thing when
8192 show_banner is true/false.
8194 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8195 show_banner is false.
8197 * most file writing files: Now use iostreams to do almost all of
8198 the writing. Also instead of passing string &, we now use
8199 stringstreams. mathed output is still not adapted to iostreams.
8200 This change can be turned off by commenting out all the occurences
8201 of the "#define USE_OSTREAM_ONLY 1" lines.
8203 * src/WorkArea.C (createPixmap): don't output debug messages.
8204 (WorkArea): don't output debug messages.
8206 * lib/lyxrc.example: added a comment about the new variable
8209 * development/Code_rules/Rules: Added some more commente about how
8210 to build class interfaces and on how better encapsulation can be
8213 2000-03-03 Juergen Vigna <jug@sad.it>
8215 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8216 automatically with the width of the LyX-Window
8218 * src/insets/insettext.C (computeTextRows): fixed update bug in
8219 displaying text-insets (scrollvalues where not initialized!)
8221 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8223 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8224 id in the check of the result from lower_bound is not enough since
8225 lower_bound can return last too, and then res->id will not be a
8228 * all insets and some code that use them: I have conditionalized
8229 removed the Latex(string & out, ...) this means that only the
8230 Latex(ostream &, ...) will be used. This is a work in progress to
8231 move towards using streams for all output of files.
8233 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8236 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8238 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8239 routine (this fixes bug where greek letters were surrounded by too
8242 * src/support/filetools.C (findtexfile): change a bit the search
8243 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8244 no longer passed to kpsewhich, we may have to change that later.
8246 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8247 warning options to avoid problems with X header files (from Angus
8249 * acinclude.m4: regenerated.
8251 2000-03-02 Juergen Vigna <jug@sad.it>
8253 * src/insets/insettext.C (WriteParagraphData): Using the
8254 par->writeFile() function for writing paragraph-data.
8255 (Read): Using buffer->parseSingleLyXformat2Token()-function
8256 for parsing paragraph data!
8258 * src/buffer.C (readLyXformat2): removed all parse data and using
8259 the new parseSingleLyXformat2Token()-function.
8260 (parseSingleLyXformat2Token): added this function to parse (read)
8261 lyx-file-format (this is called also from text-insets now!)
8263 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8265 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8268 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8269 directly instead of going through a func. One very bad thing: a
8270 static LyXFindReplace, but I don't know where to place it.
8272 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8273 string instead of char[]. Also changed to static.
8274 (GetSelectionOrWordAtCursor): changed to static inline
8275 (SetSelectionOverLenChars): ditto.
8277 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8278 current_view and global variables. both classes has changed names
8279 and LyXFindReplace is not inherited from SearchForm.
8281 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8282 fl_form_search form.
8284 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8286 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8288 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8289 bound (from Kayvan).
8291 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8293 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8295 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8297 * some things that I should comment but the local pub says head to
8300 * comment out all code that belongs to the Roff code for Ascii
8301 export of tables. (this is unused)
8303 * src/LyXView.C: use correct type for global variable
8304 current_layout. (LyXTextClass::size_type)
8306 * some code to get the new insetgraphics closer to working I'd be
8307 grateful for any help.
8309 * src/BufferView2.C (insertInset): use the return type of
8310 NumberOfLayout properly. (also changes in other files)
8312 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8313 this as a test. I want to know what breaks because of this.
8315 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8317 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8319 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8320 to use a \makebox in the label, this allows proper justification
8321 with out using protected spaces or multiple hfills. Now it is
8322 "label" for left justified, "\hfill label\hfill" for center, and
8323 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8324 should be changed accordingly.
8326 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8328 * src/lyxtext.h: change SetLayout() to take a
8329 LyXTextClass::size_type instead of a char (when there is more than
8330 127 layouts in a class); also change type of copylayouttype.
8331 * src/text2.C (SetLayout): ditto.
8332 * src/LyXView.C (updateLayoutChoice): ditto.
8334 * src/LaTeX.C (scanLogFile): errors where the line number was not
8335 given just after the '!'-line were ignored (from Dekel Tsur).
8337 * lib/lyxrc.example: fix description of \date_insert_format
8339 * lib/layouts/llncs.layout: new layout, contributed by Martin
8342 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8344 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8345 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8346 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8347 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8348 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8349 paragraph.C, text.C, text2.C)
8351 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8353 * src/insets/insettext.C (LocalDispatch): remove extra break
8356 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8357 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8359 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8360 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8362 * src/insets/insetbib.h: move InsetBibkey::Holder and
8363 InsetCitation::Holder in public space.
8365 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8367 * src/insets/insettext.h: small change to get the new files from
8368 Juergen to compile (use "string", not "class string").
8370 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8371 const & as parameter to LocalDispatch, use LyXFont const & as
8372 paramter to some other func. This also had impacto on lyxinsets.h
8373 and the two mathed insets.
8375 2000-02-24 Juergen Vigna <jug@sad.it>
8378 * src/commandtags.h:
8380 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8384 * src/BufferView2.C: added/updated code for various inset-functions
8386 * src/insets/insetert.[Ch]: added implementation of InsetERT
8388 * src/insets/insettext.[Ch]: added implementation of InsetText
8390 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8391 (draw): added preliminary code for inset scrolling not finshed yet
8393 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8394 as it is in lyxfunc.C now
8396 * src/insets/lyxinset.h: Added functions for text-insets
8398 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8400 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8401 BufferView and reimplement the list as a queue put inside its own
8404 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8406 * several files: use the new interface to the "updateinsetlist"
8408 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8410 (work_area_handler): call BufferView::trippleClick on trippleclick.
8412 * src/BufferView.C (doubleClick): new function, selects word on
8414 (trippleClick): new function, selects line on trippleclick.
8416 2000-02-22 Allan Rae <rae@lyx.org>
8418 * lib/bind/xemacs.bind: buffer-previous not supported
8420 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8422 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8425 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8427 * src/bufferlist.C: get rid of current_view from this file
8429 * src/spellchecker.C: get rid of current_view from this file
8431 * src/vspace.C: get rid of current_view from this file
8432 (inPixels): added BufferView parameter for this func
8433 (asLatexCommand): added a BufferParams for this func
8435 * src/text.C src/text2.C: get rid of current_view from these
8438 * src/lyxfont.C (getFontDirection): move this function here from
8441 * src/bufferparams.C (getDocumentDirection): move this function
8444 * src/paragraph.C (getParDirection): move this function here from
8446 (getLetterDirection): ditto
8448 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8450 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8451 resize due to wrong pixmap beeing used. Also took the opurtunity
8452 to make the LyXScreen stateless on regard to WorkArea and some
8453 general cleanup in the same files.
8455 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8457 * src/Makefile.am: add missing direction.h
8459 * src/PainterBase.h: made the width functions const.
8461 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8464 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8466 * src/insets/insetlatexaccent.C (draw): make the accents draw
8467 better, at present this will only work well with iso8859-1.
8469 * several files: remove the old drawing code, now we use the new
8472 * several files: remove support for mono_video, reverse_video and
8475 2000-02-17 Juergen Vigna <jug@sad.it>
8477 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8478 int ** as we have to return the pointer, otherwise we have only
8479 NULL pointers in the returning function.
8481 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8483 * src/LaTeX.C (operator()): quote file name when running latex.
8485 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8487 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8488 (bubble tip), this removes our special handling of this.
8490 * Remove all code that is unused now that we have the new
8491 workarea. (Code that are not active when NEW_WA is defined.)
8493 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8495 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8497 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8498 nonexisting layout; correctly redirect obsoleted layouts.
8500 * lib/lyxrc.example: document \view_dvi_paper_option
8502 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8505 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8506 (PreviewDVI): handle the view_dvi_paper_option variable.
8507 [Both from Roland Krause]
8509 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8511 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8512 char const *, int, LyXFont)
8513 (text(int, int, string, LyXFont)): ditto
8515 * src/text.C (InsertCharInTable): attempt to fix the double-space
8516 feature in tables too.
8517 (BackspaceInTable): ditto.
8518 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8520 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8522 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8524 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8525 newly found text in textcache to this.
8526 (buffer): set the owner of the text put into the textcache to 0
8528 * src/insets/figinset.C (draw): fixed the drawing of figures with
8531 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8532 drawing of mathframe, hfills, protected space, table lines. I have
8533 now no outstanding drawing problems with the new Painter code.
8535 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8537 * src/PainterBase.C (ellipse, circle): do not specify the default
8540 * src/LColor.h: add using directive.
8542 * src/Painter.[Ch]: change return type of methods from Painter& to
8543 PainterBase&. Add a using directive.
8545 * src/WorkArea.C: wrap xforms callbacks in C functions
8548 * lib/layouts/foils.layout: font fix and simplifications from Carl
8551 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8553 * a lot of files: The Painter, LColor and WorkArea from the old
8554 devel branch has been ported to lyx-devel. Some new files and a
8555 lot of #ifdeffed code. The new workarea is enabled by default, but
8556 if you want to test the new Painter and LColor you have to compile
8557 with USE_PAINTER defined (do this in config.h f.ex.) There are
8558 still some rought edges, and I'd like some help to clear those
8559 out. It looks stable (loads and displays the Userguide very well).
8562 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8564 * src/buffer.C (pop_tag): revert to the previous implementation
8565 (use a global variable for both loops).
8567 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8569 * src/lyxrc.C (LyXRC): change slightly default date format.
8571 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8572 there is an English text with a footnote that starts with a Hebrew
8573 paragraph, or vice versa.
8574 (TeXFootnote): ditto.
8576 * src/text.C (LeftMargin): allow for negative values for
8577 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8580 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8581 for input encoding (cyrillic)
8583 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8585 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8588 * src/toolbar.C (set): ditto
8589 * src/insets/insetbib.C (create_form_citation_form): ditto
8591 * lib/CREDITS: added Dekel Tsur.
8593 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8594 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8595 hebrew supports files from Dekel Tsur.
8597 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8598 <tzafrir@technion.ac.il>
8600 * src/lyxrc.C: put \date_insert_format at the right place.
8602 * src/buffer.C (makeLaTeXFile): fix the handling of
8603 BufferParams::sides when writing out latex files.
8605 * src/BufferView2.C: add a "using" directive.
8607 * src/support/lyxsum.C (sum): when we use lyxstring,
8608 ostringstream::str needs an additional .c_str().
8610 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8612 * src/support/filetools.C (ChangeExtension): patch from Etienne
8615 * src/TextCache.C (show): remove const_cast and make second
8616 parameter non-const LyXText *.
8618 * src/TextCache.h: use non const LyXText in show.
8620 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8623 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8625 * src/support/lyxsum.C: rework to be more flexible.
8627 * several places: don't check if a pointer is 0 if you are going
8630 * src/text.C: remove some dead code.
8632 * src/insets/figinset.C: remove some dead code
8634 * src/buffer.C: move the BufferView funcs to BufferView2.C
8635 remove all support for insetlatexdel
8636 remove support for oldpapersize stuff
8637 made some member funcs const
8639 * src/kbmap.C: use a std::list to store the bindings in.
8641 * src/BufferView2.C: new file
8643 * src/kbsequence.[Ch]: new files
8645 * src/LyXAction.C + others: remove all trace of buffer-previous
8647 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8648 only have one copy in the binary of this table.
8650 * hebrew patch: moved some functions from LyXText to more
8651 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8653 * several files: remove support for XForms older than 0.88
8655 remove some #if 0 #endif code
8657 * src/TextCache.[Ch]: new file. Holds the textcache.
8659 * src/BufferView.C: changes to use the new TextCache interface.
8660 (waitForX): remove the now unused code.
8662 * src/BackStack.h: remove some commented code
8664 * lib/bind/emacs.bind: remove binding for buffer-previous
8666 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8668 * applied the hebrew patch.
8670 * src/lyxrow.h: make sure that all Row variables are initialized.
8672 * src/text2.C (TextHandleUndo): comment out a delete, this might
8673 introduce a memory leak, but should also help us to not try to
8674 read freed memory. We need to look at this one.
8676 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8677 (LyXParagraph): initalize footnotekind.
8679 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8680 forgot this when applying the patch. Please heed the warnings.
8682 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8683 (aka. reformat problem)
8685 * src/bufferlist.C (exists): made const, and use const_iterator
8686 (isLoaded): new func.
8687 (release): use std::find to find the correct buffer.
8689 * src/bufferlist.h: made getState a const func.
8690 made empty a const func.
8691 made exists a const func.
8694 2000-02-01 Juergen Vigna <jug@sad.it>
8696 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8698 * po/it.po: updated a bit the italian po file and also changed the
8699 'file nuovo' for newfile to 'filenuovo' without a space, this did
8702 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8703 for the new insert_date command.
8705 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8706 from jdblair, to insert a date into the current text conforming to
8707 a strftime format (for now only considering the locale-set and not
8708 the document-language).
8710 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8712 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8713 Bounds Read error seen by purify. The problem was that islower is
8714 a macros which takes an unsigned char and uses it as an index for
8715 in array of characters properties (and is thus subject to the
8719 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8720 correctly the paper sides radio buttons.
8721 (UpdateDocumentButtons): ditto.
8723 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8725 * src/kbmap.C (getsym + others): change to return unsigned int,
8726 returning a long can give problems on 64 bit systems. (I assume
8727 that int is 32bit on 64bit systems)
8729 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8731 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8732 LyXLookupString to be zero-terminated. Really fixes problems seen
8735 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8737 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8738 write a (char*)0 to the lyxerr stream.
8740 * src/lastfiles.C: move algorithm before the using statemets.
8742 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8744 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8745 complains otherwise).
8746 * src/table.C: ditto
8748 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8751 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8752 that I removed earlier... It is really needed.
8754 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8756 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8758 * INSTALL: update xforms home page URL.
8760 * lib/configure.m4: fix a bug with unreadable layout files.
8762 * src/table.C (calculate_width_of_column): add "using std::max"
8765 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8767 * several files: marked several lines with "DEL LINE", this is
8768 lines that can be deleted without changing anything.
8769 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8770 checks this anyway */
8773 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8775 * src/DepTable.C (update): add a "+" at the end when the checksum
8776 is different. (debugging string only)
8778 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8779 the next inset to not be displayed. This should also fix the list
8780 of labels in the "Insert Crossreference" dialog.
8782 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8784 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8785 when regex was not found.
8787 * src/support/lstrings.C (lowercase): use handcoded transform always.
8790 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8791 old_cursor.par->prev could be 0.
8793 * several files: changed post inc/dec to pre inc/dec
8795 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8796 write the lastfiles to file.
8798 * src/BufferView.C (buffer): only show TextCache info when debugging
8800 (resizeCurrentBuffer): ditto
8801 (workAreaExpose): ditto
8803 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8805 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8807 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8808 a bit better by removing the special case for \i and \j.
8810 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8812 * src/lyx_main.C (easyParse): remove test for bad comand line
8813 options, since this broke all xforms-related parsing.
8815 * src/kbmap.C (getsym): set return type to unsigned long, as
8816 declared in header. On an alpha, long is _not_ the same as int.
8818 * src/support/LOstream.h: add a "using std::flush;"
8820 * src/insets/figinset.C: ditto.
8822 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8824 * src/bufferlist.C (write): use blinding fast file copy instead of
8825 "a char at a time", now we are doing it the C++ way.
8827 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8828 std::list<int> instead.
8829 (addpidwait): reflect move to std::list<int>
8830 (sigchldchecker): ditto
8832 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8835 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8836 that obviously was wrong...
8838 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8839 c, this avoids warnings with purify and islower.
8841 * src/insets/figinset.C: rename struct queue to struct
8842 queue_element and rewrite to use a std::queue. gsqueue is now a
8843 std::queue<queue_element>
8844 (runqueue): reflect move to std::queue
8847 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8848 we would get "1" "0" instead of "true" "false. Also make the tostr
8851 2000-01-21 Juergen Vigna <jug@sad.it>
8853 * src/buffer.C (writeFileAscii): Disabled code for special groff
8854 handling of tabulars till I fix this in table.C
8856 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8858 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8860 * src/support/lyxlib.h: ditto.
8862 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8864 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8865 and 'j' look better. This might fix the "macron" bug that has been
8868 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8869 functions as one template function. Delete the old versions.
8871 * src/support/lyxsum.C: move using std::ifstream inside
8874 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8877 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8879 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8881 * src/insets/figinset.C (InitFigures): use new instead of malloc
8882 to allocate memory for figures and bitmaps.
8883 (DoneFigures): use delete[] instead of free to deallocate memory
8884 for figures and bitmaps.
8885 (runqueue): use new to allocate
8886 (getfigdata): use new/delete[] instead of malloc/free
8887 (RegisterFigure): ditto
8889 * some files: moved some declarations closer to first use, small
8890 whitespace changes use preincrement instead of postincrement where
8891 it does not make a difference.
8893 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8894 step on the way to use stl::containers for key maps.
8896 * src/bufferlist.h: add a typedef for const_iterator and const
8897 versions of begin and end.
8899 * src/bufferlist.[Ch]: change name of member variable _state to
8900 state_. (avoid reserved names)
8902 (getFileNames): returns the filenames of the buffers in a vector.
8904 * configure.in (ALL_LINGUAS): added ro
8906 * src/support/putenv.C: new file
8908 * src/support/mkdir.C: new file
8910 2000-01-20 Allan Rae <rae@lyx.org>
8912 * lib/layouts/IEEEtran.layout: Added several theorem environments
8914 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8915 couple of minor additions.
8917 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8918 (except for those in footnotes of course)
8920 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8922 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8924 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8925 std::sort and std::lower_bound instead of qsort and handwritten
8927 (struct compara): struct that holds the functors used by std::sort
8928 and std::lower_bound in MathedLookupBOP.
8930 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8932 * src/support/LAssert.h: do not do partial specialization. We do
8935 * src/support/lyxlib.h: note that lyx::getUserName() and
8936 lyx::date() are not in use right now. Should these be suppressed?
8938 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8939 (makeLinuxDocFile): do not put date and user name in linuxdoc
8942 * src/support/lyxlib.h (kill): change first argument to long int,
8943 since that's what solaris uses.
8945 * src/support/kill.C (kill): fix declaration to match prototype.
8947 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8948 actually check whether namespaces are supported. This is not what
8951 * src/support/lyxsum.C: add a using directive.
8953 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8955 * src/support/kill.C: if we have namespace support we don't have
8956 to include lyxlib.h.
8958 * src/support/lyxlib.h: use namespace lyx if supported.
8960 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8962 * src/support/date.C: new file
8964 * src/support/chdir.C: new file
8966 * src/support/getUserName.C: new file
8968 * src/support/getcwd.C: new file
8970 * src/support/abort.C: new file
8972 * src/support/kill.C: new file
8974 * src/support/lyxlib.h: moved all the functions in this file
8975 insede struct lyx. Added also kill and abort to this struct. This
8976 is a way to avoid the "kill is not defined in <csignal>", we make
8977 C++ wrappers for functions that are not ANSI C or ANSI C++.
8979 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8980 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8981 lyx it has been renamed to sum.
8983 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8985 * src/text.C: add using directives for std::min and std::max.
8987 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8989 * src/texrow.C (getIdFromRow): actually return something useful in
8990 id and pos. Hopefully fixes the bug with positionning of errorbox
8993 * src/lyx_main.C (easyParse): output an error and exit if an
8994 incorrect command line option has been given.
8996 * src/spellchecker.C (ispell_check_word): document a memory leak.
8998 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8999 where a "struct utimbuf" is allocated with "new" and deleted with
9002 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9004 * src/text2.C (CutSelection): don't delete double spaces.
9005 (PasteSelection): ditto
9006 (CopySelection): ditto
9008 * src/text.C (Backspace): don't delete double spaces.
9010 * src/lyxlex.C (next): fix a bug that were only present with
9011 conformant std::istream::get to read comment lines, use
9012 std::istream::getline instead. This seems to fix the problem.
9014 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9016 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9017 allowed to insert space before space" editing problem. Please read
9018 commends at the beginning of the function. Comments about usage
9021 * src/text.C (InsertChar): fix for the "not allowed to insert
9022 space before space" editing problem.
9024 * src/text2.C (DeleteEmptyParagraphMechanism): when
9025 IsEmptyTableRow can only return false this last "else if" will
9026 always be a no-op. Commented out.
9028 * src/text.C (RedoParagraph): As far as I can understand tmp
9029 cursor is not really needed.
9031 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9032 present it could only return false anyway.
9033 (several functions): Did something not so smart...added a const
9034 specifier on a lot of methods.
9036 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9037 and add a tmp->text.resize. The LyXParagraph constructor does the
9039 (BreakParagraphConservative): ditto
9041 * src/support/path.h (Path): add a define so that the wrong usage
9042 "Path("/tmp") will be flagged as a compilation error:
9043 "`unnamed_Path' undeclared (first use this function)"
9045 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9047 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9048 which was bogus for several reasons.
9050 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9054 * autogen.sh: do not use "type -path" (what's that anyway?).
9056 * src/support/filetools.C (findtexfile): remove extraneous space
9057 which caused a kpsewhich warning (at least with kpathsea version
9060 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9062 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9064 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9066 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9068 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9070 * src/paragraph.C (BreakParagraph): do not reserve space on text
9071 if we don't need to (otherwise, if pos_end < pos, we end up
9072 reserving huge amounts of memory due to bad unsigned karma).
9073 (BreakParagraphConservative): ditto, although I have not seen
9074 evidence the bug can happen here.
9076 * src/lyxparagraph.h: add a using std::list.
9078 2000-01-11 Juergen Vigna <jug@sad.it>
9080 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9083 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9085 * src/vc-backend.C (doVCCommand): change to be static and take one
9086 more parameter: the path to chdir too be fore executing the command.
9087 (retrive): new function equiv to "co -r"
9089 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9090 file_not_found_hook is true.
9092 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9094 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9095 if a file is readwrite,readonly...anything else.
9097 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9099 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9100 (CreatePostscript): name change from MenuRunDVIPS (or something)
9101 (PreviewPostscript): name change from MenuPreviewPS
9102 (PreviewDVI): name change from MenuPreviewDVI
9104 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9105 \view_pdf_command., \pdf_to_ps_command
9107 * lib/configure.m4: added search for PDF viewer, and search for
9108 PDF to PS converter.
9109 (lyxrc.defaults output): add \pdflatex_command,
9110 \view_pdf_command and \pdf_to_ps_command.
9112 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9114 * src/bufferlist.C (write): we don't use blocksize for anything so
9117 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9119 * src/support/block.h: disable operator T* (), since it causes
9120 problems with both compilers I tried. See comments in the file.
9122 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9125 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9126 variable LYX_DIR_10x to LYX_DIR_11x.
9128 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9130 * INSTALL: document --with-lyxname.
9133 * configure.in: new configure flag --with-lyxname which allows to
9134 choose the name under which lyx is installed. Default is "lyx", of
9135 course. It used to be possible to do this with --program-suffix,
9136 but the later has in fact a different meaning for autoconf.
9138 * src/support/lstrings.h (lstrchr): reformat a bit.
9140 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9141 * src/mathed/math_defs.h: ditto.
9143 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9145 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9146 true, decides if we create a backup file or not when saving. New
9147 tag and variable \pdf_mode, defaults to false. New tag and
9148 variable \pdflatex_command, defaults to pdflatex. New tag and
9149 variable \view_pdf_command, defaults to xpdf. New tag and variable
9150 \pdf_to_ps_command, defaults to pdf2ps.
9152 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9154 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9155 does not have a BufferView.
9156 (unlockInset): ditto + don't access the_locking_inset if the
9157 buffer does not have a BufferView.
9159 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9160 certain circumstances so that we don't continue a keyboard
9161 operation long after the key was released. Try f.ex. to load a
9162 large document, press PageDown for some seconds and then release
9163 it. Before this change the document would contine to scroll for
9164 some time, with this change it stops imidiatly.
9166 * src/support/block.h: don't allocate more space than needed. As
9167 long as we don't try to write to the arr[x] in a array_type arr[x]
9168 it is perfectly ok. (if you write to it you might segfault).
9169 added operator value_type*() so that is possible to pass the array
9170 to functions expecting a C-pointer.
9172 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9175 * intl/*: updated to gettext 0.10.35, tried to add our own
9176 required modifications. Please verify.
9178 * po/*: updated to gettext 0.10.35, tried to add our own required
9179 modifications. Please verify.
9181 * src/support/lstrings.C (tostr): go at fixing the problem with
9182 cxx and stringstream. When stringstream is used return
9183 oss.str().c_str() so that problems with lyxstring and basic_string
9184 are avoided. Note that the best solution would be for cxx to use
9185 basic_string all the way, but it is not conformant yet. (it seems)
9187 * src/lyx_cb.C + other files: moved several global functions to
9188 class BufferView, some have been moved to BufferView.[Ch] others
9189 are still located in lyx_cb.C. Code changes because of this. (part
9190 of "get rid of current_view project".)
9192 * src/buffer.C + other files: moved several Buffer functions to
9193 class BufferView, the functions are still present in buffer.C.
9194 Code changes because of this.
9196 * config/lcmessage.m4: updated to most recent. used when creating
9199 * config/progtest.m4: updated to most recent. used when creating
9202 * config/gettext.m4: updated to most recent. applied patch for
9205 * config/gettext.m4.patch: new file that shows what changes we
9206 have done to the local copy of gettext.m4.
9208 * config/libtool.m4: new file, used in creation of acinclude.m4
9210 * config/lyxinclude.m4: new file, this is the lyx created m4
9211 macros, used in making acinclude.m4.
9213 * autogen.sh: GNU m4 discovered as a separate task not as part of
9214 the lib/configure creation.
9215 Generate acinlucde from files in config. Actually cat
9216 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9217 easier to upgrade .m4 files that really are external.
9219 * src/Spacing.h: moved using std::istringstream to right after
9220 <sstream>. This should fix the problem seen with some compilers.
9222 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9224 * src/lyx_cb.C: began some work to remove the dependency a lot of
9225 functions have on BufferView::text, even if not really needed.
9226 (GetCurrentTextClass): removed this func, it only hid the
9229 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9230 forgot this in last commit.
9232 * src/Bullet.C (bulletEntry): use static char const *[] for the
9233 tables, becuase of this the return arg had to change to string.
9235 (~Bullet): removed unneeded destructor
9237 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9238 (insetSleep): moved from Buffer
9239 (insetWakeup): moved from Buffer
9240 (insetUnlock): moved from Buffer
9242 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9243 from Buffer to BufferView.
9245 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9247 * config/ltmain.sh: updated to version 1.3.4 of libtool
9249 * config/ltconfig: updated to version 1.3.4 of libtool
9251 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9254 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9255 Did I get that right?
9257 * src/lyxlex.h: add a "using" directive or two.
9258 * src/Spacing.h: ditto.
9259 * src/insets/figinset.C: ditto.
9260 * src/support/filetools.C: ditto.
9261 * src/support/lstrings.C: ditto.
9262 * src/BufferView.C: ditto.
9263 * src/bufferlist.C: ditto.
9264 * src/lyx_cb.C: ditto.
9265 * src/lyxlex.C: ditto.
9267 * NEWS: add some changes for 1.1.4.
9269 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9271 * src/BufferView.C: first go at a TextCache to speed up switching
9274 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9276 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9277 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9278 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9279 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9282 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9283 members of the struct are correctly initialized to 0 (detected by
9285 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9286 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9288 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9289 pidwait, since it was allocated with "new". This was potentially
9290 very bad. Thanks to Michael Schmitt for running purify for us.
9293 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9295 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9297 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9299 1999-12-30 Allan Rae <rae@lyx.org>
9301 * lib/templates/IEEEtran.lyx: minor change
9303 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9304 src/mathed/formula.C (LocalDispatch): askForText changes
9306 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9307 know when a user has cancelled input. Fixes annoying problems with
9308 inserting labels and version control.
9310 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9312 * src/support/lstrings.C (tostr): rewritten to use strstream and
9315 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9317 * src/support/filetools.C (IsFileWriteable): use fstream to check
9318 (IsDirWriteable): use fileinfo to check
9320 * src/support/filetools.h (FilePtr): whole class deleted
9322 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9324 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9326 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9328 * src/bufferlist.C (write): use ifstream and ofstream instead of
9331 * src/Spacing.h: use istrstream instead of sscanf
9333 * src/mathed/math_defs.h: change first arg to istream from FILE*
9335 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9337 * src/mathed/math_parser.C: have yyis to be an istream
9338 (LexGetArg): use istream (yyis)
9340 (mathed_parse): ditto
9341 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9343 * src/mathed/formula.C (Read): rewritten to use istream
9345 * src/mathed/formulamacro.C (Read): rewritten to use istream
9347 * src/lyxlex.h (~LyXLex): deleted desturctor
9348 (getStream): new function, returns an istream
9349 (getFile): deleted funtion
9350 (IsOK): return is.good();
9352 * src/lyxlex.C (LyXLex): delete file and owns_file
9353 (setFile): open an filebuf and assign that to a istream instead of
9355 (setStream): new function, takes an istream as arg.
9356 (setFile): deleted function
9357 (EatLine): rewritten us use istream instead of FILE*
9361 * src/table.C (LyXTable): use istream instead of FILE*
9362 (Read): rewritten to take an istream instead of FILE*
9364 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9366 * src/buffer.C (Dispatch): remove an extraneous break statement.
9368 * src/support/filetools.C (QuoteName): change to do simple
9369 'quoting'. More work is necessary. Also changed to do nothing
9370 under emx (needs fix too).
9371 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9373 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9374 config.h.in to the AC_DEFINE_UNQUOTED() call.
9375 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9376 needs char * as argument (because Solaris 7 declares it like
9379 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9380 remove definition of BZERO.
9382 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9384 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9385 defined, "lyxregex.h" if not.
9387 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9389 (REGEX): new variable that is set to regex.c lyxregex.h when
9390 AM_CONDITIONAL USE_REGEX is set.
9391 (libsupport_la_SOURCES): add $(REGEX)
9393 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9396 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9399 * configure.in: add call to LYX_REGEX
9401 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9402 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9404 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9406 * lib/bind/fi_menus.bind: new file, from
9407 pauli.virtanen@saunalahti.fi.
9409 * src/buffer.C (getBibkeyList): pass the parameter delim to
9410 InsetInclude::getKeys and InsetBibtex::getKeys.
9412 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9413 is passed to Buffer::getBibkeyList
9415 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9416 instead of the hardcoded comma.
9418 * src/insets/insetbib.C (getKeys): make sure that there are not
9419 leading blanks in bibtex keys. Normal latex does not care, but
9420 harvard.sty seems to dislike blanks at the beginning of citation
9421 keys. In particular, the retturn value of the function is
9423 * INSTALL: make it clear that libstdc++ is needed and that gcc
9424 2.7.x probably does not work.
9426 * src/support/filetools.C (findtexfile): make debug message go to
9428 * src/insets/insetbib.C (getKeys): ditto
9430 * src/debug.C (showTags): make sure that the output is correctly
9433 * configure.in: add a comment for TWO_COLOR_ICON define.
9435 * acconfig.h: remove all the entries that already defined in
9436 configure.in or acinclude.m4.
9438 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9439 to avoid user name, date and copyright.
9441 1999-12-21 Juergen Vigna <jug@sad.it>
9443 * src/table.C (Read): Now read bogus row format informations
9444 if the format is < 5 so that afterwards the table can
9445 be read by lyx but without any format-info. Fixed the
9446 crash we experienced when not doing this.
9448 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9450 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9451 (RedoDrawingOfParagraph): ditto
9452 (RedoParagraphs): ditto
9453 (RemoveTableRow): ditto
9455 * src/text.C (Fill): rename arg paperwidth -> paper_width
9457 * src/buffer.C (insertLyXFile): rename var filename -> fname
9458 (writeFile): rename arg filename -> fname
9459 (writeFileAscii): ditto
9460 (makeLaTeXFile): ditto
9461 (makeLinuxDocFile): ditto
9462 (makeDocBookFile): ditto
9464 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9467 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9469 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9472 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9473 compiled by a C compiler not C++.
9475 * src/layout.h (LyXTextClass): added typedef for const_iterator
9476 (LyXTextClassList): added typedef for const_iterator + member
9477 functions begin and end.
9479 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9480 iterators to fill the choice_class.
9481 (updateLayoutChoice): rewritten to use iterators to fill the
9482 layoutlist in the toolbar.
9484 * src/BufferView.h (BufferView::work_area_width): removed unused
9487 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9489 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9490 (sgmlCloseTag): ditto
9492 * src/support/lstrings.h: return type of countChar changed to
9495 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9496 what version of this func to use. Also made to return unsigned int.
9498 * configure.in: call LYX_STD_COUNT
9500 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9501 conforming std::count.
9503 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9505 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9506 and a subscript would give bad display (patch from Dekel Tsur
9507 <dekel@math.tau.ac.il>).
9509 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9511 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9514 * src/chset.h: add a few 'using' directives
9516 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9517 triggered when no buffer is active
9519 * src/layout.C: removed `break' after `return' in switch(), since
9522 * src/lyx_main.C (init): make sure LyX can be ran in place even
9523 when libtool has done its magic with shared libraries. Fix the
9524 test for the case when the system directory has not been found.
9526 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9527 name for the latex file.
9528 (MenuMakeHTML): ditto
9530 * src/buffer.h: add an optional boolean argument, which is passed
9533 1999-12-20 Allan Rae <rae@lyx.org>
9535 * lib/templates/IEEEtran.lyx: small correction and update.
9537 * configure.in: Attempted to use LYX_PATH_HEADER
9539 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9541 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9542 input from JMarc. Now use preprocessor to find the header.
9543 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9544 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9545 LYX_STL_STRING_FWD. See comments in file.
9547 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9549 * The global MiniBuffer * minibuffer variable is dead.
9551 * The global FD_form_main * fd_form_main variable is dead.
9553 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9555 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9557 * src/table.h: add the LOstream.h header
9558 * src/debug.h: ditto
9560 * src/LyXAction.h: change the explaination of the ReadOnly
9561 attribute: is indicates that the function _can_ be used.
9563 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9566 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9568 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9574 * src/paragraph.C (GetWord): assert on pos>=0
9577 * src/support/lyxstring.C: condition the use of an invariant on
9579 * src/support/lyxstring.h: ditto
9581 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9582 Use LAssert.h instead of plain assert().
9584 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9586 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9587 * src/support/filetools.C: ditto
9589 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9592 * INSTALL: document the new configure flags
9594 * configure.in: suppress --with-debug; add --enable-assertions
9596 * acinclude.m4: various changes in alignment of help strings.
9598 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9600 * src/kbmap.C: commented out the use of the hash map in kb_map,
9601 beginning of movement to a stl::container.
9603 * several files: removed code that was not in effect when
9604 MOVE_TEXT was defined.
9606 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9607 for escaping should not be used. We can discuss if the string
9608 should be enclosed in f.ex. [] instead of "".
9610 * src/trans_mgr.C (insert): use the new returned value from
9611 encodeString to get deadkeys and keymaps done correctly.
9613 * src/chset.C (encodeString): changed to return a pair, to tell
9614 what to use if we know the string.
9616 * src/lyxscreen.h (fillArc): new function.
9618 * src/FontInfo.C (resize): rewritten to use more std::string like
9619 structore, especially string::replace.
9621 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9624 * configure.in (chmod +x some scripts): remove config/gcc-hack
9626 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9628 * src/buffer.C (writeFile): change once again the top comment in a
9629 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9630 instead of an hardcoded version number.
9631 (makeDocBookFile): ditto
9633 * src/version.h: add new define LYX_DOCVERSION
9635 * po/de.po: update from Pit Sütterlin
9636 * lib/bind/de_menus.bind: ditto.
9638 * src/lyxfunc.C (Dispatch): call MenuExport()
9639 * src/buffer.C (Dispatch): ditto
9641 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9642 LyXFunc::Dispatch().
9643 (MenuExport): new function, moved from
9644 LyXFunc::Dispatch().
9646 * src/trans_mgr.C (insert): small cleanup
9647 * src/chset.C (loadFile): ditto
9649 * lib/kbd/iso8859-1.cdef: add missing backslashes
9651 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9653 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9654 help with placing the manually drawn accents better.
9656 (Draw): x2 and hg changed to float to minimize rounding errors and
9657 help place the accents better.
9659 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9660 unsigned short to char is just wrong...cast the char to unsigned
9661 char instead so that the two values can compare sanely. This
9662 should also make the display of insetlatexaccents better and
9663 perhaps also some other insets.
9665 (lbearing): new function
9668 1999-12-15 Allan Rae <rae@lyx.org>
9670 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9671 header that provides a wrapper around the very annoying SGI STL header
9674 * src/support/lyxstring.C, src/LString.h:
9675 removed old SGI-STL-compatability attempts.
9677 * configure.in: Use LYX_STL_STRING_FWD.
9679 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9680 stl_string_fwd.h is around and try to determine it's location.
9681 Major improvement over previous SGI STL 3.2 compatability.
9682 Three small problems remain with this function due to my zero
9683 knowledge of autoconf. JMarc and lgb see the comments in the code.
9685 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9687 * src/broken_const.h, config/hack-gcc, config/README: removed
9689 * configure.in: remove --with-gcc-hack option; do not call
9692 * INSTALL: remove documentation of --with-broken-const and
9695 * acconfig.h: remove all trace of BROKEN_CONST define
9697 * src/buffer.C (makeDocBookFile): update version number in output
9699 (SimpleDocBookOnePar): fix an assert when trying to a character
9700 access beyond string length
9703 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9705 * po/de.po: fix the Export menu
9707 * lyx.man: update the description of -dbg
9709 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9710 (commandLineHelp): updated
9711 (easyParse): show list of available debug levels if -dbg is passed
9714 * src/Makefile.am: add debug.C
9716 * src/debug.h: moved some code to debug.C
9718 * src/debug.C: new file. Contains code to set and show debug
9721 * src/layout.C: remove 'break' after 'continue' in switch
9722 statements, since these cannot be reached.
9724 1999-12-13 Allan Rae <rae@lyx.org>
9726 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9727 (in_word_set): hash() -> math_hash()
9729 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9731 * acconfig.h: Added a test for whether we are using exceptions in the
9732 current compilation run. If so USING_EXCEPTIONS is defined.
9734 * config.in: Check for existance of stl_string_fwd.h
9735 * src/LString.h: If compiling --with-included-string and SGI's
9736 STL version 3.2 is present (see above test) we need to block their
9737 forward declaration of string and supply a __get_c_string().
9738 However, it turns out this is only necessary if compiling with
9739 exceptions enabled so I've a bit more to add yet.
9741 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9742 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9743 src/support/LRegex.h, src/undo.h:
9744 Shuffle the order of the included files a little to ensure that
9745 LString.h gets included before anything that includes stl_string_fwd.h
9747 * src/support/lyxstring.C: We need to #include LString.h instead of
9748 lyxstring.h to get the necessary definition of __get_c_string.
9749 (__get_c_string): New function. This is defined static just like SGI's
9750 although why they need to do this I'm not sure. Perhaps it should be
9751 in lstrings.C instead.
9753 * lib/templates/IEEEtran.lyx: New template file.
9755 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9757 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9758 * intl/Makefile.in (MKINSTALLDIRS): ditto
9760 * src/LyXAction.C (init): changed to hold the LFUN data in a
9761 automatic array in stead of in callso to newFunc, this speeds up
9762 compilation a lot. Also all the memory used by the array is
9763 returned when the init is completed.
9765 * a lot of files: compiled with -Wold-style-cast, changed most of
9766 the reported offenders to C++ style casts. Did not change the
9767 offenders in C files.
9769 * src/trans.h (Match): change argument type to unsigned int.
9771 * src/support/DebugStream.C: fix some types on the streambufs so
9772 that it works on a conforming implementation.
9774 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9776 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9778 * src/support/lyxstring.C: remove the inline added earlier since
9779 they cause a bunch of unsatisfied symbols when linking with dec
9780 cxx. Cxx likes to have the body of inlines at the place where they
9783 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9784 accessing negative bounds in array. This fixes the crash when
9785 inserting accented characters.
9786 * src/trans.h (Match): ditto
9788 * src/buffer.C (Dispatch): since this is a void, it should not try
9789 to return anything...
9791 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9793 * src/buffer.h: removed the two friends from Buffer. Some changes
9794 because of this. Buffer::getFileName and Buffer::setFileName
9795 renamed to Buffer::fileName() and Buffer::fileName(...).
9797 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9799 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9800 and Buffer::update(short) to BufferView. This move is currently
9801 controlled by a define MOVE_TEXT, this will be removed when all
9802 shows to be ok. This move paves the way for better separation
9803 between buffer contents and buffer view. One side effect is that
9804 the BufferView needs a rebreak when swiching buffers, if we want
9805 to avoid this we can add a cache that holds pointers to LyXText's
9806 that is not currently in use.
9808 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9811 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9813 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9815 * lyx_main.C: new command line option -x (or --execute) and
9816 -e (or --export). Now direct conversion from .lyx to .tex
9817 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9818 Unfortunately, X is still needed and the GUI pops up during the
9821 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9823 * src/Spacing.C: add a using directive to bring stream stuff into
9825 * src/paragraph.C: ditto
9826 * src/buffer.C: ditto
9828 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9829 from Lars' announcement).
9831 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9832 example files from Tino Meinen.
9834 1999-12-06 Allan Rae <rae@lyx.org>
9836 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9838 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9840 * src/support/lyxstring.C: added a lot of inline for no good
9843 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9844 latexWriteEndChanges, they were not used.
9846 * src/layout.h (operator<<): output operator for PageSides
9848 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9850 * some example files: loaded in LyX 1.0.4 and saved again to update
9851 certain constructs (table format)
9853 * a lot of files: did the change to use fstream/iostream for all
9854 writing of files. Done with a close look at Andre Poenitz's patch.
9856 * some files: whitespace changes.
9858 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9860 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9861 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9862 architecture, we provide our own. It is used unconditionnally, but
9863 I do not think this is a performance problem. Thanks to Angus
9864 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9865 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9867 (GetInset): use my_memcpy.
9871 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9872 it is easier to understand, but it uses less TeX-only constructs now.
9874 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9875 elements contain spaces
9877 * lib/configure: regenerated
9879 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9880 elements contain spaces; display the list of programs that are
9883 * autogen.sh: make sure lib/configure is executable
9885 * lib/examples/*: rename the tutorial examples to begin with the
9886 two-letters language code.
9888 * src/lyxfunc.C (getStatus): do not query current font if no
9891 * src/lyx_cb.C (RunScript): use QuoteName
9892 (MenuRunDvips): ditto
9893 (PrintApplyCB): ditto
9895 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9896 around argument, so that it works well with the current shell.
9897 Does not work properly with OS/2 shells currently.
9899 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9900 * src/LyXSendto.C (SendtoApplyCB): ditto
9901 * src/lyxfunc.C (Dispatch): ditto
9902 * src/buffer.C (runLaTeX): ditto
9903 (runLiterate): ditto
9904 (buildProgram): ditto
9906 * src/lyx_cb.C (RunScript): ditto
9907 (MenuMakeLaTeX): ditto
9909 * src/buffer.h (getLatexName): new method
9911 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9913 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9915 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9916 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9917 (create_math_panel): ditto
9919 * src/lyxfunc.C (getStatus): re-activate the code which gets
9920 current font and cursor; add test for export to html.
9922 * src/lyxrc.C (read): remove unreachable break statements; add a
9925 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9927 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9929 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9930 introduced by faulty regex.
9931 * src/buffer.C: ditto
9932 * src/lastfiles.C: ditto
9933 * src/paragraph.C: ditto
9934 * src/table.C: ditto
9935 * src/vspace.C: ditto
9936 * src/insets/figinset.C: ditto
9937 Note: most of these is absolutely harmless, except the one in
9938 src/mathed formula.C.
9940 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9942 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9943 operation, yielding correct results for the reLyX command.
9945 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9947 * src/support/filetools.C (ExpandPath): removed an over eager
9949 (ReplaceEnvironmentPath): ditto
9951 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9952 shows that we are doing something fishy in our code...
9956 * src/lyxrc.C (read): use a double switch trick to get more help
9957 from the compiler. (the same trick is used in layout.C)
9958 (write): new function. opens a ofstream and pass that to output
9959 (output): new function, takes a ostream and writes the lyxrc
9960 elemts to it. uses a dummy switch to make sure no elements are
9963 * src/lyxlex.h: added a struct pushpophelper for use in functions
9964 with more than one exit point.
9966 * src/lyxlex.[Ch] (GetInteger): made it const
9970 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9972 * src/layout.[hC] : LayoutTags splitted into several enums, new
9973 methods created, better error handling cleaner use of lyxlex. Read
9976 * src/bmtable.[Ch]: change some member prototypes because of the
9977 image const changes.
9979 * commandtags.h, src/LyXAction.C (init): new function:
9980 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9981 This file is not read automatically but you can add \input
9982 preferences to your lyxrc if you want to. We need to discuss how
9985 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9986 in .aux, also remove .bib and .bst files from dependencies when
9989 * src/BufferView.C, src/LyXView.C: add const_cast several places
9990 because of changes to images.
9992 * lib/images/*: same change as for images/*
9994 * lib/lyxrc.example: Default for accept_compound is false not no.
9996 * images/*: changed to be const, however I have som misgivings
9997 about this change so it might be changed back.
9999 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10001 * lib/configure, po/POTFILES.in: regenerated
10003 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10005 * config/lib_configure.m4: removed
10007 * lib/configure.m4: new file (was config/lib_configure.m4)
10009 * configure.in: do not test for rtti, since we do not use it.
10011 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10013 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10014 doubling of allocated space scheme. This makes it faster for large
10015 strings end to use less memory for small strings. xtra rememoved.
10017 * src/insets/figinset.C (waitalarm): commented out.
10018 (GhostscriptMsg): use static_cast
10019 (GhostscriptMsg): use new instead of malloc to allocate memory for
10020 cmap. also delete the memory after use.
10022 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10024 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10025 for changes in bibtex database or style.
10026 (runBibTeX): remove all .bib and .bst files from dep before we
10028 (run): use scanAuc in when dep file already exist.
10030 * src/DepTable.C (remove_files_with_extension): new method
10031 (exist): new method
10033 * src/DepTable.[Ch]: made many of the methods const.
10035 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10037 * src/bufferparams.C: make sure that the default textclass is
10038 "article". It used to be the first one by description order, but
10039 now the first one is "docbook".
10041 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10042 string; call Debug::value.
10043 (easyParse): pass complete argument to setDebuggingLevel().
10045 * src/debug.h (value): fix the code that parses debug levels.
10047 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10050 * src/LyXAction.C: use Debug::ACTION as debug channel.
10052 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10054 * NEWS: updated for the future 1.1.3 release.
10056 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10057 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10058 it should. This is of course a controversial change (since many
10059 people will find that their lyx workscreen is suddenly full of
10060 red), but done for the sake of correctness.
10062 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10063 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10065 * src/insets/inseterror.h, src/insets/inseturl.h,
10066 src/insets/insetinfo.h, src/insets/figinset.h,
10067 src/mathed/formulamacro.h, src/mathed/math_macro.h
10068 (EditMessage): add a missing const and add _() to make sure that
10069 translation happens
10071 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10072 src/insets/insetbib.C, src/support/filetools.C: add `using'
10073 directives for cxx.
10075 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10076 doing 'Insert index of last word' at the beginning of a paragraph.
10078 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10080 * several files: white-space changes.
10082 * src/mathed/formula.C: removed IsAlpha and IsDigit
10084 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10085 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10088 * src/insets/figinset.C (GetPSSizes): don't break when
10089 "EndComments" is seen. But break when a boundingbox is read.
10091 * all classes inherited from Inset: return value of Clone
10092 changed back to Inset *.
10094 * all classes inherited form MathInset: return value of Clone
10095 changed back to MathedInset *.
10097 * src/insets/figinset.C (runqueue): use a ofstream to output the
10098 gs/ps file. Might need some setpresicion or setw. However I can
10099 see no problem with the current code.
10100 (runqueue): use sleep instead of the alarm/signal code. I just
10101 can't see the difference.
10103 * src/paragraph.C (LyXParagraph): reserve space in the new
10104 paragraph and resize the inserted paragraph to just fit.
10106 * src/lyxfunc.h (operator|=): added operator for func_status.
10108 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10109 check for readable file.
10111 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10112 check for readable file.
10113 (MenuMakeLinuxDoc): ditto
10114 (MenuMakeDocBook): ditto
10115 (MenuMakeAscii): ditto
10116 (InsertAsciiFile): split the test for openable and readable
10118 * src/bmtable.C (draw_bitmaptable): use
10119 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10121 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10122 findtexfile from LaTeX to filetools.
10124 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10125 instead of FilePtr. Needs to be verified by a literate user.
10127 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10129 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10130 (EditMessage): likewise.
10132 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10133 respectively as \textasciitilde and \textasciicircum.
10135 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10137 * src/support/lyxstring.h: made the methods that take iterators
10138 use const_iterator.
10140 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10141 (regexMatch): made is use the real regex class.
10143 * src/support/Makefile.am: changed to use libtool
10145 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10147 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10149 (MathIsInset ++): changed several macros to be inline functions
10152 * src/mathed/Makefile.am: changed to use libtool
10154 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10156 * src/insets/inset* : Clone changed to const and return type is
10157 the true insettype not just Inset*.
10159 * src/insets/Makefile.am: changed to use libtool
10161 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10163 * src/undo.[Ch] : added empty() and changed some of the method
10166 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10168 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10169 setID use block<> for the bullets array, added const several places.
10171 * src/lyxfunc.C (getStatus): new function
10173 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10174 LyXAction, added const to several funtions.
10176 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10177 a std::map, and to store the dir items in a vector.
10179 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10182 * src/LyXView.[Ch] + other files : changed currentView to view.
10184 * src/LyXAction.[Ch] : ported from the old devel branch.
10186 * src/.cvsignore: added .libs and a.out
10188 * configure.in : changes to use libtool.
10190 * acinclude.m4 : inserted libtool.m4
10192 * .cvsignore: added libtool
10194 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10196 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10197 file name in insets and mathed directories (otherwise the
10198 dependency is not taken in account under cygwin).
10200 * src/text2.C (InsertString[AB]): make sure that we do not try to
10201 read characters past the string length.
10203 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10205 * lib/doc/LaTeXConfig.lyx.in,
10206 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10208 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10209 file saying who created them and when this heppened; this is
10210 useless and annoys tools like cvs.
10212 * lib/layouts/g-brief-{en,de}.layout,
10213 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10214 from Thomas Hartkens <thomas@hartkens.de>.
10216 * src/{insets,mathed}/Makefile.am: do not declare an empty
10217 LDFLAGS, so that it can be set at configure time (useful on Irix
10220 * lib/reLyX/configure.in: make sure that the prefix is set
10221 correctly in LYX_DIR.
10223 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10225 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10226 be used by 'command-sequence' this allows to bind a key to a
10227 sequence of LyX-commands
10228 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10230 * src/LyXAction.C: add "command-sequence"
10232 * src/LyXFunction.C: handling of "command-sequence"
10234 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10235 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10237 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10239 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10241 * src/buffer.C (writeFile): Do not output a comment giving user
10242 and date at the beginning of a .lyx file. This is useless and
10243 annoys cvs anyway; update version number to 1.1.
10245 * src/Makefile.am (LYX_DIR): add this definition, so that a
10246 default path is hardcoded in LyX.
10248 * configure.in: Use LYX_GNU_GETTEXT.
10250 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10251 AM_GNU_GETTEXT with a bug fixed.
10253 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10255 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10257 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10258 which is used to point to LyX data is now LYX_DIR_11x.
10260 * lyx.man: convert to a unix text file; small updates.
10262 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10264 * src/support/LSubstring.[Ch]: made the second arg of most of the
10265 constructors be a const reference.
10267 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10270 * src/support/lyxstring.[Ch] (swap): added missing member function
10271 and specialization of swap(str, str);
10273 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10275 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10276 trace of the old one.
10278 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10279 put the member definitions in undo.C.
10281 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10282 NEW_TEXT and have now only code that was included when this was
10285 * src/intl.C (LCombo): use static_cast
10287 (DispatchCallback): ditto
10289 * src/definitions.h: removed whole file
10291 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10293 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10294 parsing and stores in a std:map. a regex defines the file format.
10295 removed unneeded members.
10297 * src/bufferparams.h: added several enums from definitions.h here.
10298 Removed unsused destructor. Changed some types to use proper enum
10299 types. use block to have the temp_bullets and user_defined_bullets
10300 and to make the whole class assignable.
10302 * src/bufferparams.C (Copy): removed this functions, use a default
10303 assignment instead.
10305 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10308 * src/buffer.C (readLyXformat2): commend out all that have with
10309 oldpapersize to do. also comment out all that hve to do with
10310 insetlatex and insetlatexdel.
10311 (setOldPaperStuff): commented out
10313 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10315 * src/LyXAction.C: remove use of inset-latex-insert
10317 * src/mathed/math_panel.C (button_cb): use static_cast
10319 * src/insets/Makefile.am (insets_o_SOURCES): removed
10322 * src/support/lyxstring.C (helper): use the unsigned long
10323 specifier, UL, instead of a static_cast.
10325 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10327 * src/support/block.h: new file. to be used as a c-style array in
10328 classes, so that the class can be assignable.
10330 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10332 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10333 NULL, make sure to return an empty string (it is not possible to
10334 set a string to NULL).
10336 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10338 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10340 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10342 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10343 link line, so that Irix users (for example) can set it explicitely to
10346 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10347 it can be overidden at make time (static or dynamic link, for
10350 * src/vc-backend.C, src/LaTeXFeatures.h,
10351 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10352 statements to bring templates to global namespace.
10354 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10356 * src/support/lyxstring.C (operator[] const): make it standard
10359 * src/minibuffer.C (Init): changed to reflect that more
10360 information is given from the lyxvc and need not be provided here.
10362 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10364 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10366 * src/LyXView.C (UpdateTimerCB): use static_cast
10367 (KeyPressMask_raw_callback): ditto
10369 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10370 buffer_, a lot of changes because of this. currentBuffer() ->
10371 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10372 also changes to other files because of this.
10374 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10376 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10377 have no support for RCS and partial support for CVS, will be
10380 * src/insets/ several files: changes because of function name
10381 changes in Bufferview and LyXView.
10383 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10385 * src/support/LSubstring.[Ch]: new files. These implement a
10386 Substring that can be very convenient to use. i.e. is this
10388 string a = "Mary had a little sheep";
10389 Substring(a, "sheep") = "lamb";
10390 a is now "Mary has a little lamb".
10392 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10393 out patterns and subpatterns of strings. It is used by LSubstring
10394 and also by vc-backend.C
10396 * src/support/lyxstring.C: went over all the assertions used and
10397 tried to correct the wrong ones and flag which of them is required
10398 by the standard. some bugs found because of this. Also removed a
10399 couple of assertions.
10401 * src/support/Makefile.am (libsupport_a_SOURCES): added
10402 LSubstring.[Ch] and LRegex.[Ch]
10404 * src/support/FileInfo.h: have struct stat buf as an object and
10405 not a pointer to one, some changes because of this.
10407 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10408 information in layout when adding the layouts preamble to the
10409 textclass preamble.
10411 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10414 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10415 because of bug in OS/2.
10417 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10419 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10420 \verbatim@font instead of \ttfamily, so that it can be redefined.
10422 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10423 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10424 src/layout.h, src/text2.C: add 'using' directive to bring the
10425 STL templates we need from the std:: namespace to the global one.
10426 Needed by DEC cxx in strict ansi mode.
10428 * src/support/LIstream.h,src/support/LOstream.h,
10429 src/support/lyxstring.h,src/table.h,
10430 src/lyxlookup.h: do not include <config.h> in header
10431 files. This should be done in the .C files only.
10433 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10437 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10439 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10440 from Kayvan to fix the tth invokation.
10442 * development/lyx.spec.in: updates from Kayvan to reflect the
10443 changes of file names.
10445 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10447 * src/text2.C (InsertStringB): use std::copy
10448 (InsertStringA): use std::copy
10450 * src/bufferlist.C: use a vector to store the buffers in. This is
10451 an internal change and should not affect any other thing.
10453 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10456 * src/text.C (Fill): fix potential bug, one off bug.
10458 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10460 * src/Makefile.am (lyx_main.o): add more files it depends on.
10462 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10464 * src/support/lyxstring.C: use size_t for the reference count,
10465 size, reserved memory and xtra.
10466 (internal_compare): new private member function. Now the compare
10467 functions should work for std::strings that have embedded '\0'
10469 (compare): all compare functions rewritten to use
10472 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10474 * src/support/lyxstring.C (compare): pass c_str()
10475 (compare): pass c_str
10476 (compare): pass c_str
10478 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10480 * src/support/DebugStream.C: <config.h> was not included correctly.
10482 * lib/configure: forgot to re-generate it :( I'll make this file
10483 auto generated soon.
10485 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10487 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10490 * src/support/lyxstring.C: some changes from length() to rep->sz.
10491 avoids a function call.
10493 * src/support/filetools.C (SpaceLess): yet another version of the
10494 algorithm...now per Jean-Marc's suggestions.
10496 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10498 * src/layout.C (less_textclass_desc): functor for use in sorting
10500 (LyXTextClass::Read): sort the textclasses after reading.
10502 * src/support/filetools.C (SpaceLess): new version of the
10503 SpaceLess functions. What problems does this one give? Please
10506 * images/banner_bw.xbm: made the arrays unsigned char *
10508 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10510 * src/support/lyxstring.C (find): remove bogus assertion in the
10511 two versions of find where this has not been done yet.
10513 * src/support/lyxlib.h: add missing int return type to
10516 * src/menus.C (ShowFileMenu): disable exporting to html if no
10517 html export command is present.
10519 * config/lib_configure.m4: add a test for an HTML converter. The
10520 programs checked for are, in this order: tth, latex2html and
10523 * lib/configure: generated from config/lib_configure.m4.
10525 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10526 html converter. The parameters are now passed through $$FName and
10527 $$OutName, instead of standard input/output.
10529 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10531 * lib/lyxrc.example: update description of \html_command.
10532 add "quotes" around \screen_font_xxx font setting examples to help
10533 people who use fonts with spaces in their names.
10535 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10537 * Distribution files: updates for v1.1.2
10539 * src/support/lyxstring.C (find): remove bogus assert and return
10540 npos for the same condition.
10542 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10544 * added patch for OS/2 from SMiyata.
10546 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10548 * src/text2.C (CutSelection): make space_wrapped a bool
10549 (CutSelection): dont declare int i until we have to.
10550 (alphaCounter): return a char const *.
10552 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10554 * src/support/syscall.C (Systemcalls::kill):
10555 src/support/filetools.C (PutEnv, PutEnvPath):
10556 src/lyx_cb.C (addNewlineAndDepth):
10557 src/FontInfo.C (FontInfo::resize): condition some #warning
10558 directives with WITH_WARNINGS.
10561 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10563 * src/layout.[Ch] + several files: access to class variables
10564 limited and made accessor functions instead a lot of code changed
10565 becuase of this. Also instead of returning pointers often a const
10566 reference is returned instead.
10568 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10570 * src/Makefile.am (dist-hook): added used to remove the CVS from
10571 cheaders upon creating a dist
10572 (EXTRA_DIST): added cheaders
10574 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10575 a character not as a small integer.
10577 * src/support/lyxstring.C (find): removed Assert and added i >=
10578 rep->sz to the first if.
10580 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10582 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10583 src/LyXView.C src/buffer.C src/bufferparams.C
10584 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10585 src/text2.C src/insets/insetinclude.C:
10586 lyxlayout renamed to textclasslist.
10588 * src/layout.C: some lyxerr changes.
10590 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10591 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10592 (LyXLayoutList): removed all traces of this class.
10593 (LyXTextClass::Read): rewrote LT_STYLE
10594 (LyXTextClass::hasLayout): new function
10595 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10596 both const and nonconst version.
10597 (LyXTextClass::delete_layout): new function.
10598 (LyXTextClassList::Style): bug fix. do the right thing if layout
10600 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10601 (LyXTextClassList::NameOfLayout): ditto
10602 (LyXTextClassList::Load): ditto
10604 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10606 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10608 * src/LyXAction.C (LookupFunc): added a workaround for sun
10609 compiler, on the other hand...we don't know if the current code
10610 compiles on sun at all...
10612 * src/support/filetools.C (CleanupPath): subst fix
10614 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10617 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10618 complained about this one?
10620 * src/insets/insetinclude.C (Latex): subst fix
10622 * src/insets/insetbib.C (getKeys): subst fix
10624 * src/LyXSendto.C (SendtoApplyCB): subst fix
10626 * src/lyx_main.C (init): subst fix
10628 * src/layout.C (Read): subst fix
10630 * src/lyx_sendfax_main.C (button_send): subst fix
10632 * src/buffer.C (RoffAsciiTable): subst fix
10634 * src/lyx_cb.C (MenuFax): subst fix
10635 (PrintApplyCB): subst fix
10637 1999-10-26 Juergen Vigna <jug@sad.it>
10639 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10641 (Read): Cleaned up this code so now we read only format vestion >= 5
10643 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10645 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10646 come nobody has complained about this one?
10648 * src/insets/insetinclude.C (Latex): subst fix
10650 * src/insets/insetbib.C (getKeys): subst fix
10652 * src/lyx_main.C (init): subst fix
10654 * src/layout.C (Read): subst fix
10656 * src/buffer.C (RoffAsciiTable): subst fix
10658 * src/lyx_cb.C (MenuFax): subst fix.
10660 * src/layout.[hC] + some other files: rewrote to use
10661 std::container to store textclasses and layouts in.
10662 Simplified, removed a lot of code. Make all classes
10663 assignable. Further simplifications and review of type
10664 use still to be one.
10666 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10667 lastfiles to create the lastfiles partr of the menu.
10669 * src/lastfiles.[Ch]: rewritten to use deque to store the
10670 lastfiles in. Uses fstream for reading and writing. Simplifies
10673 * src/support/syscall.C: remove explicit cast.
10675 * src/BufferView.C (CursorToggleCB): removed code snippets that
10676 were commented out.
10677 use explicat C++ style casts instead of C style casts. also use
10678 u_vdata instea of passing pointers in longs.
10680 * src/PaperLayout.C: removed code snippets that were commented out.
10682 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10684 * src/lyx_main.C: removed code snippets that wer commented out.
10686 * src/paragraph.C: removed code snippets that were commented out.
10688 * src/lyxvc.C (logClose): use static_cast
10690 (viewLog): remove explicit cast to void*
10691 (showLog): removed old commented code
10693 * src/menus.C: use static_cast instead of C style casts. use
10694 u_vdata instead of u_ldata. remove explicit cast to (long) for
10695 pointers. Removed old code that was commented out.
10697 * src/insets/inset.C: removed old commented func
10699 * src/insets/insetref.C (InsetRef): removed old code that had been
10700 commented out for a long time.
10702 (escape): removed C style cast
10704 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10706 * src/insets/insetlatex.C (Draw): removed old commented code
10707 (Read): rewritten to use string
10709 * src/insets/insetlabel.C (escape): removed C style cast
10711 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10713 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10714 old commented code.
10716 * src/insets/insetinclude.h: removed a couple of stupid bools
10718 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10719 (Clone): remove C style cast
10720 (getKeys): changed list to lst because of std::list
10722 * src/insets/inseterror.C (Draw): removed som old commented code.
10724 * src/insets/insetcommand.C (Draw): removed some old commented code.
10726 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10727 commented out forever.
10728 (bibitem_cb): use static_cast instead of C style cast
10729 use of vdata changed to u_vdata.
10731 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10733 (CloseUrlCB): use static_cast instead of C style cast.
10734 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10736 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10737 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10738 (CloseInfoCB): static_cast from ob->u_vdata instead.
10739 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10742 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10743 (C_InsetError_CloseErrorCB): forward the ob parameter
10744 (CloseErrorCB): static_cast from ob->u_vdata instead.
10746 * src/vspace.h: include LString.h since we use string in this class.
10748 * src/vspace.C (lyx_advance): changed name from advance because of
10749 nameclash with stl. And since we cannot use namespaces yet...I
10750 used a lyx_ prefix instead. Expect this to change when we begin
10753 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10755 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10756 and removed now defunct constructor and deconstructor.
10758 * src/BufferView.h: have backstack as a object not as a pointer.
10759 removed initialization from constructor. added include for BackStack
10761 * development/lyx.spec.in (%build): add CFLAGS also.
10763 * src/screen.C (drawFrame): removed another warning.
10765 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10767 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10768 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10769 README and ANNOUNCE a bit for the next release. More work is
10772 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10773 unbreakable if we are in freespacing mode (LyX-Code), but not in
10776 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10778 * src/BackStack.h: fixed initialization order in constructor
10780 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10782 * acinclude.m4 (VERSION): new rules for when a version is
10783 development, added also a variable for prerelease.
10784 (warnings): we set with_warnings=yes for prereleases
10785 (lyx_opt): prereleases compile with same optimization as development
10786 (CXXFLAGS): only use pedantic if we are a development version
10788 * src/BufferView.C (restorePosition): don't do anything if the
10789 backstack is empty.
10791 * src/BackStack.h: added member empty, use this to test if there
10792 is anything to pop...
10794 1999-10-25 Juergen Vigna <jug@sad.it>
10797 * forms/layout_forms.fd +
10798 * forms/latexoptions.fd +
10799 * lyx.fd: changed for various form resize issues
10801 * src/mathed/math_panel.C +
10802 * src/insets/inseterror.C +
10803 * src/insets/insetinfo.C +
10804 * src/insets/inseturl.C +
10805 * src/insets/inseturl.h +
10807 * src/LyXSendto.C +
10808 * src/PaperLayout.C +
10809 * src/ParagraphExtra.C +
10810 * src/TableLayout.C +
10812 * src/layout_forms.C +
10819 * src/menus.C: fixed various resize issues. So now forms can be
10820 resized savely or not be resized at all.
10822 * forms/form_url.fd +
10823 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10826 * src/insets/Makefile.am: added files form_url.[Ch]
10828 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10830 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10831 (and presumably 6.2).
10833 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10834 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10835 remaining static member callbacks.
10837 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10840 * src/support/lyxstring.h: declare struct Srep as friend of
10841 lyxstring, since DEC cxx complains otherwise.
10843 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10845 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10847 * src/LaTeX.C (run): made run_bibtex also depend on files with
10849 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10850 are put into the dependency file.
10852 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10853 the code has shown itself to work
10854 (create_ispell_pipe): removed another warning, added a comment
10857 * src/minibuffer.C (ExecutingCB): removed code that has been
10858 commented out a long time
10860 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10861 out code + a warning.
10863 * src/support/lyxstring.h: comment out the three private
10864 operators, when compiling with string ansi conforming compilers
10865 they make problems.
10867 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10869 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10870 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10873 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10876 * src/mathed/math_panel.C (create_math_panel): remove explicit
10879 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10882 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10883 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10884 to XCreatePixmapFromBitmapData
10885 (fl_set_bmtable_data): change the last argument to be unsigned
10887 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10888 and bh to be unsigned int, remove explicit casts in call to
10889 XReadBitmapFileData.
10891 * images/arrows.xbm: made the arrays unsigned char *
10892 * images/varsz.xbm: ditto
10893 * images/misc.xbm: ditto
10894 * images/greek.xbm: ditto
10895 * images/dots.xbm: ditto
10896 * images/brel.xbm: ditto
10897 * images/bop.xbm: ditto
10899 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10901 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10902 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10903 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10905 (LYX_CXX_CHEADERS): added <clocale> to the test.
10907 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10909 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10911 * src/support/lyxstring.C (append): fixed something that must be a
10912 bug, rep->assign was used instead of rep->append.
10914 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10917 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10918 lyx insert double chars. Fix spotted by Kayvan.
10920 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10922 * Fixed the tth support. I messed up with the Emacs patch apply feature
10923 and omitted the changes in lyxrc.C.
10925 1999-10-22 Juergen Vigna <jug@sad.it>
10927 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10929 * src/lyx_cb.C (MenuInsertRef) +
10930 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10931 the form cannot be resized under it limits (fixes a segfault)
10933 * src/lyx.C (create_form_form_ref) +
10934 * forms/lyx.fd: Changed Gravity on name input field so that it is
10937 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10939 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10940 <ostream> and <istream>.
10942 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10943 whether <fstream> provides the latest standard features, or if we
10944 have an oldstyle library (like in egcs).
10945 (LYX_CXX_STL_STRING): fix the test.
10947 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10948 code on MODERN_STL_STREAM.
10950 * src/support/lyxstring.h: use L{I,O}stream.h.
10952 * src/support/L{I,O}stream.h: new files, designed to setup
10953 correctly streams for our use
10954 - includes the right header depending on STL capabilities
10955 - puts std::ostream and std::endl (for LOStream.h) or
10956 std::istream (LIStream.h) in toplevel namespace.
10958 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10960 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10961 was a bib file that had been changed we ensure that bibtex is run.
10962 (runBibTeX): enhanced to extract the names of the bib files and
10963 getting their absolute path and enter them into the dep file.
10964 (findtexfile): static func that is used to look for tex-files,
10965 checks for absolute patchs and tries also with kpsewhich.
10966 Alternative ways of finding the correct files are wanted. Will
10968 (do_popen): function that runs a command using popen and returns
10969 the whole output of that command in a string. Should be moved to
10972 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10973 file with extension ext has changed.
10975 * src/insets/figinset.C: added ifdef guards around the fl_free
10976 code that jug commented out. Now it is commented out when
10977 compiling with XForms == 0.89.
10979 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10980 to lyxstring.C, and only keep a forward declaration in
10981 lyxstring.h. Simplifies the header file a bit and should help a
10982 bit on compile time too. Also changes to Srep will not mandate a
10983 recompile of code just using string.
10984 (~lyxstring): definition moved here since it uses srep.
10985 (size): definition moved here since it uses srep.
10987 * src/support/lyxstring.h: removed a couple of "inline" that should
10990 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10992 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10995 1999-10-21 Juergen Vigna <jug@sad.it>
10997 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10998 set to left if I just remove the width entry (or it is empty).
11000 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11001 paragraph when having dummy paragraphs.
11003 1999-10-20 Juergen Vigna <jug@sad.it>
11005 * src/insets/figinset.C: just commented some fl_free_form calls
11006 and added warnings so that this calls should be activated later
11007 again. This avoids for now a segfault, but we have a memory leak!
11009 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11010 'const char * argument' to 'string argument', this should
11011 fix some Asserts() in lyxstring.C.
11013 * src/lyxfunc.h: Removed the function argAsString(const char *)
11014 as it is not used anymore.
11016 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11018 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11021 * src/Literate.h: some funcs moved from public to private to make
11022 interface clearer. Unneeded args removed.
11024 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11026 (scanBuildLogFile): ditto
11028 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11029 normal TeX Error. Still room for improvement.
11031 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11033 * src/buffer.C (insertErrors): changes to make the error
11034 desctription show properly.
11036 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11039 * src/support/lyxstring.C (helper): changed to use
11040 sizeof(object->rep->ref).
11041 (operator>>): changed to use a pointer instead.
11043 * src/support/lyxstring.h: changed const reference & to value_type
11044 const & lets see if that helps.
11046 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11048 * Makefile.am (rpmdist): fixed to have non static package and
11051 * src/support/lyxstring.C: removed the compilation guards
11053 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11056 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11057 conditional compile of lyxstring.Ch
11059 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11060 stupid check, but it is a lot better than the bastring hack.
11061 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11063 * several files: changed string::erase into string::clear. Not
11066 * src/chset.C (encodeString): use a char temporary instead
11068 * src/table.C (TexEndOfCell): added tostr around
11069 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11070 (TexEndOfCell): ditto
11071 (TexEndOfCell): ditto
11072 (TexEndOfCell): ditto
11073 (DocBookEndOfCell): ditto
11074 (DocBookEndOfCell): ditto
11075 (DocBookEndOfCell): ditto
11076 (DocBookEndOfCell): ditto
11078 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11080 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11082 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11083 (MenuBuildProg): added tostr around ret
11084 (MenuRunChktex): added tostr around ret
11085 (DocumentApplyCB): added tostr around ret
11087 * src/chset.C (encodeString): added tostr around t->ic
11089 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11090 (makeLaTeXFile): added tostr around tocdepth
11091 (makeLaTeXFile): added tostr around ftcound - 1
11093 * src/insets/insetbib.C (setCounter): added tostr around counter.
11095 * src/support/lyxstring.h: added an operator+=(int) to catch more
11098 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11099 (lyxstring): We DON'T allow NULL pointers.
11101 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11103 * src/mathed/math_macro.C (MathMacroArgument::Write,
11104 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11105 when writing them out.
11107 * src/LString.C: remove, since it is not used anymore.
11109 * src/support/lyxstring.C: condition the content to
11110 USE_INCLUDED_STRING macro.
11112 * src/mathed/math_symbols.C, src/support/lstrings.C,
11113 src/support/lyxstring.C: add `using' directive to specify what
11114 we need in <algorithm>. I do not think that we need to
11115 conditionalize this, but any thought is appreciated.
11117 * many files: change all callback functions to "C" linkage
11118 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11119 strict_ansi. Those who were static are now global.
11120 The case of callbacks which are static class members is
11121 trickier, since we have to make C wrappers around them (see
11122 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11123 did not finish this yet, since it defeats the purpose of
11124 encapsulation, and I am not sure what the best route is.
11126 1999-10-19 Juergen Vigna <jug@sad.it>
11128 * src/support/lyxstring.C (lyxstring): we permit to have a null
11129 pointer as assignment value and just don't assign it.
11131 * src/vspace.C (nextToken): corrected this function substituting
11132 find_first(_not)_of with find_last_of.
11134 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11135 (TableOptCloseCB) (TableSpeCloseCB):
11136 inserted fl_set_focus call for problem with fl_hide_form() in
11139 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11141 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11144 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11146 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11147 LyXLex::next() and not eatline() to get its argument.
11149 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11151 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11152 instead, use fstreams for io of the depfile, removed unneeded
11153 functions and variables.
11155 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11156 vector instead, removed all functions and variables that is not in
11159 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11161 * src/buffer.C (insertErrors): use new interface to TeXError
11163 * Makefile.am (rpmdist): added a rpmdist target
11165 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11166 per Kayvan's instructions.
11168 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11170 * src/Makefile.am: add a definition for localedir, so that locales
11171 are found after installation (Kayvan)
11173 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11175 * development/.cvsignore: new file.
11177 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11179 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11180 C++ compiler provides wrappers for C headers and use our alternate
11183 * configure.in: use LYX_CXX_CHEADERS.
11185 * src/cheader/: new directory, populated with cname headers from
11186 libstdc++-2.8.1. They are a bit old, but probably good enough for
11187 what we want (support compilers who lack them).
11189 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11190 from includes. It turns out is was stupid.
11192 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11194 * lib/Makefile.am (install-data-local): forgot a ';'
11195 (install-data-local): forgot a '\'
11196 (libinstalldirs): needed after all. reintroduced.
11198 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11200 * configure.in (AC_OUTPUT): added lyx.spec
11202 * development/lyx.spec: removed file
11204 * development/lyx.spec.in: new file
11206 * po/*.po: merged with lyx.pot becuase of make distcheck
11208 * lib/Makefile.am (dist-hook): added dist-hook so that
11209 documentation files will be included when doing a make
11210 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11211 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11213 more: tried to make install do the right thing, exclude CVS dirs
11216 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11217 Path would fit in more nicely.
11219 * all files that used to use pathstack: uses now Path instead.
11220 This change was a lot easier than expected.
11222 * src/support/path.h: new file
11224 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11226 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11228 * src/support/lyxstring.C (getline): Default arg was given for
11231 * Configure.cmd: removed file
11233 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11235 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11236 streams classes and types, add the proper 'using' statements when
11237 MODERN_STL is defined.
11239 * src/debug.h: move the << operator definition after the inclusion
11242 * src/support/filetools.C: include "LAssert.h", which is needed
11245 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11248 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11249 include "debug.h" to define a proper ostream.
11251 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11253 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11254 method to the SystemCall class which can kill a process, but it's
11255 not fully implemented yet.
11257 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11259 * src/support/FileInfo.h: Better documentation
11261 * src/lyxfunc.C: Added support for buffer-export html
11263 * src/menus.C: Added Export->As HTML...
11265 * lib/bind/*.bind: Added short-cut for buffer-export html
11267 * src/lyxrc.*: Added support for new \tth_command
11269 * lib/lyxrc.example: Added stuff for new \tth_command
11271 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11273 * lib/Makefile.am (IMAGES): removed images/README
11274 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11275 installes in correct place. Check permisions is installed
11278 * src/LaTeX.C: some no-op changes moved declaration of some
11281 * src/LaTeX.h (LATEX_H): changed include guard name
11283 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11285 * lib/reLyX/Makefile.am: install noweb2lyx.
11287 * lib/Makefile.am: install configure.
11289 * lib/reLyX/configure.in: declare a config aux dir; set package
11290 name to lyx (not sure what the best solution is); generate noweb2lyx.
11292 * lib/layouts/egs.layout: fix the bibliography layout.
11294 1999-10-08 Jürgen Vigna <jug@sad.it>
11296 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11297 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11298 it returned without continuing to search the path.
11300 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11302 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11303 also fixes a bug. It is not allowed to do tricks with std::strings
11304 like: string a("hei"); &a[e]; this will not give what you
11305 think... Any reason for the complexity in this func?
11307 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11309 * Updated README and INSTALL a bit, mostly to check that my
11310 CVS rights are correctly set up.
11312 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11314 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11315 does not allow '\0' chars but lyxstring and std::string does.
11317 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11319 * autogen.sh (AUTOCONF): let the autogen script create the
11320 POTFILES.in file too. POTFILES.in should perhaps now not be
11321 included in the cvs module.
11323 * some more files changed to use C++ includes instead of C ones.
11325 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11327 (Reread): added tostr to nlink. buggy output otherwise.
11328 (Reread): added a string() around szMode when assigning to Buffer,
11329 without this I got a log of garbled info strings.
11331 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11334 * I have added several ostream & operator<<(ostream &, some_type)
11335 functions. This has been done to avoid casting and warnings when
11336 outputting enums to lyxerr. This as thus eliminated a lot of
11337 explicit casts and has made the code clearer. Among the enums
11338 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11339 mathed enums, some font enum the Debug::type enum.
11341 * src/support/lyxstring.h (clear): missing method. equivalent of
11344 * all files that contained "stderr": rewrote constructs that used
11345 stderr to use lyxerr instead. (except bmtable)
11347 * src/support/DebugStream.h (level): and the passed t with
11348 Debug::ANY to avoid spurious bits set.
11350 * src/debug.h (Debug::type value): made it accept strings of the
11351 type INFO,INIT,KEY.
11353 * configure.in (Check for programs): Added a check for kpsewhich,
11354 the latex generation will use this later to better the dicovery of
11357 * src/BufferView.C (create_view): we don't need to cast this to
11358 (void*) that is done automatically.
11359 (WorkAreaButtonPress): removed some dead code.
11361 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11363 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11364 is not overwritten when translated (David Sua'rez de Lis).
11366 * lib/CREDITS: Added David Sua'rez de Lis
11368 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11370 * src/bufferparams.C (BufferParams): default input encoding is now
11373 * acinclude.m4 (cross_compiling): comment out macro
11374 LYX_GXX_STRENGTH_REDUCE.
11376 * acconfig.h: make sure that const is not defined (to empty) when
11377 we are compiling C++. Remove commented out code using SIZEOF_xx
11380 * configure.in : move the test for const and inline as late as
11381 possible so that these C tests do not interefere with C++ ones.
11382 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11383 has not been proven.
11385 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11387 * src/table.C (getDocBookAlign): remove bad default value for
11388 isColumn parameter.
11390 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11392 (ShowFileMenu2): ditto.
11394 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11395 of files to ignore.
11397 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11399 * Most files: finished the change from the old error code to use
11400 DebugStream for all lyxerr debugging. Only minor changes remain
11401 (e.g. the setting of debug levels using strings instead of number)
11403 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11405 * src/layout.C (Add): Changed to use compare_no_case instead of
11408 * src/FontInfo.C: changed loop variable type too string::size_type.
11410 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11412 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11413 set ETAGS_ARGS to --c++
11415 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11417 * src/table.C (DocBookEndOfCell): commented out two unused variables
11419 * src/paragraph.C: commented out four unused variables.
11421 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11422 insed a if clause with type string::size_type.
11424 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11427 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11429 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11430 variable, also changed loop to go from 0 to lenght + 1, instead of
11431 -1 to length. This should be correct.
11433 * src/LaTeX.C (scanError): use string::size_type as loop variable
11436 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11437 (l.896) since y_tmp and row was not used anyway.
11439 * src/insets/insetref.C (escape): use string::size_type as loop
11442 * src/insets/insetquotes.C (Width): use string::size_type as loop
11444 (Draw): use string::size_type as loop variable type.
11446 * src/insets/insetlatexaccent.C (checkContents): use
11447 string::size_type as loop variable type.
11449 * src/insets/insetlabel.C (escape): use string::size_type as loop
11452 * src/insets/insetinfo.C: added an extern for current_view.
11454 * src/insets/insetcommand.C (scanCommand): use string::size_type
11455 as loop variable type.
11457 * most files: removed the RCS tags. With them we had to recompile
11458 a lot of files after a simple cvs commit. Also we have never used
11459 them for anything meaningful.
11461 * most files: tags-query-replace NULL 0. As adviced several plases
11462 we now use "0" instead of "NULL" in our code.
11464 * src/support/filetools.C (SpaceLess): use string::size_type as
11465 loop variable type.
11467 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11469 * src/paragraph.C: fixed up some more string stuff.
11471 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11473 * src/support/filetools.h: make modestr a std::string.
11475 * src/filetools.C (GetEnv): made ch really const.
11477 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11478 made code that used these use max/min from <algorithm> instead.
11480 * changed several c library include files to their equivalent c++
11481 library include files. All is not changed yet.
11483 * created a support subdir in src, put lyxstring and lstrings
11484 there + the extra files atexit, fileblock, strerror. Created
11485 Makefile.am. edited configure.in and src/Makefile.am to use this
11486 new subdir. More files moved to support.
11488 * imported som of the functions from repository lyx, filetools
11490 * ran tags-query-replace on LString -> string, corrected the bogus
11491 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11492 is still some errors in there. This is errors where too much or
11493 too litle get deleted from strings (string::erase, string::substr,
11494 string::replace), there can also be some off by one errors, or
11495 just plain wrong use of functions from lstrings. Viewing of quotes
11498 * LyX is now running fairly well with string, but there are
11499 certainly some bugs yet (see above) also string is quite different
11500 from LString among others in that it does not allow null pointers
11501 passed in and will abort if it gets any.
11503 * Added the revtex4 files I forgot when setting up the repository.
11505 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11507 * All over: Tried to clean everything up so that only the files
11508 that we really need are included in the cvs repository.
11509 * Switched to use automake.
11510 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11511 * Install has not been checked.
11513 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11515 * po/pt.po: Three errors:
11516 l.533 and l.538 format specification error
11517 l. 402 duplicate entry, I just deleted it.