1 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * lib/bind/??_menus.bind: comment out the entries corresponding to
4 real menus. They should be eventually removed, but I'll let the
5 language maintainers do that.
7 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
9 * src/frontends/kde/parageneraldlg.C:
10 * src/frontends/kde/parageneraldlg.h: don't use
11 a derived class for SpaceAbove/Below
13 * src/frontends/kde/dlg/README: add some info
15 * src/frontends/kde/dlg/*: update data files, update
18 * src/frontends/kde/dlg/moc/Makefile.am: add
21 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
23 * configure.in: add new KDE Makefiles
24 * src/vspace.h: return GlueLength not a normal one
25 * src/support/lstrings.h:
26 * src/support/lstrings.C: add isStrUnsignedInt(),
29 * src/frontends/kde/*: big reorganisation, update
30 FormParagraph, add FormTabCreate
32 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
34 * lib/ui/default.ui: small grammatical change.
36 * src/frontends/xforms/xform_macros.h: removed.
38 * src/frontends/xforms/FormBase.C:
39 * src/frontends/xforms/FormPreferences.C:
40 * src/frontends/xforms/Makefile.am: changes associated with removing
41 xform_macros.h. Should make Lars' debugging a little easier.
43 * src/frontends/xforms/FormPreferences.C:
44 * src/frontends/xforms/FormPreferences.h:
45 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
46 longer use X11 color name database. HSV and RGB dials/sliders.
47 Please let this be the end of this!
49 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
51 * Several files: Allow compilation when the compiler doesn't
54 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
57 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
60 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
62 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
63 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
66 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
68 * src/frontends/xforms/FormRef.C (updateBrowser):
69 * src/frontends/xforms/forms/form_ref.fd: try clicking on
70 different insets with the sort key active. Now apply this patch!
72 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
74 * src/frontends/xforms/FormPrint.C: set to valid()
75 when we update from the passed parameters.
77 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
79 * src/LColor.C (getFromGUIName): internationalise the comparison.
81 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
82 FormPreferences choice.
84 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
87 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
89 * src/lyxrc.C: more detail for the printer program config
92 * src/LColor.C: ert->latex text. LColor needs a big revamp
93 but will have to wait till after 1.1.6
95 * src/buffer.C: bring up a dialog if we load a document
96 with an un-installed text class, rather than just complain
99 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
101 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
102 the browser form for a combox in a tabbed folder. Bug fix courtesy of
103 Steve Lamont <spl@ncmir.ucsd.edu>.
105 * src/frontends/xforms/FormDocument.C (build):
106 * src/frontends/xforms/FormPreferences.C (Language::build):
107 pass tabfolders to Combox::add() in order to use this work around.
109 * src/frontends/xforms/FormCitation.C (connect): remove max size
111 (update): sort list of bibliography keys.
113 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
115 No max size limitation. Same popup for new and existing insets. Fixes
116 bugs reported by Rob Lahaye.
118 * src/frontends/xforms/FormCitation.C (c-tor):
119 * src/frontends/xforms/FormCopyright.C (c-tor):
120 * src/frontends/xforms/FormError.C (c-tor):
121 * src/frontends/xforms/FormGraphics.C (c-tor):
122 * src/frontends/xforms/FormIndex.C (c-tor):
123 * src/frontends/xforms/FormRef.C (c-tor):
124 * src/frontends/xforms/FormToc.C (c-tor):
125 * src/frontends/xforms/FormUrl.C (c-tor):
126 use correct policy for ButtonController.
128 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
130 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
133 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
135 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
136 Some resizing changes.
138 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
140 * configure.in: fix typo
142 * lib/languages: add ukraninian and change no to no_NO
144 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
146 * src/bufferview_funcs.C (FontSize): use setLyXSize
148 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
150 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
151 to check for systems where mkstemp() is available but not declared
152 in headers. The new autoconf macro lyx_CHECK_DECL can be used
153 to check for declarations in headers.
155 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
157 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
159 * forms/makefile: added bibforms.fd, include_form.fd.
160 Removed lyx_sendfax.fd.
162 * src/LaTeXLog.C (ShowLatexLog):
163 * src/LyXAction.C (init):
164 * src/bufferparams.C (readLanguage): altered messages as suggested by
167 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
170 * src/credits.C: made fd_form_credits non-static, so that it can be
171 redrawn should the xforms colors be re-mapped.
172 * src/spellchecker.C ditto fd_form_spell_options.
174 * src/filedlg.[Ch] (redraw):
175 * src/intl.[Ch] (redraw):
176 * src/lyxfr0.[Ch] (redraw):
177 * src/insets/figinset.[Ch] (redraw):
178 * src/insets/insetexternal.[Ch] (redraw):
179 new methods, connected to Dialogs::redrawGUI.
181 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
182 to be connected to Dialogs::redrawGUI.
184 * src/frontends/xforms/FormCitation.C (build):
185 * src/frontends/xforms/FormCopyright.C (build):
186 * src/frontends/xforms/FormError.C (build):
187 * src/frontends/xforms/FormGraphics.C (build):
188 * src/frontends/xforms/FormIndex.C (build):
189 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
190 * src/frontends/xforms/FormToc.C (build):
191 * src/frontends/xforms/FormUrl.C (build):
192 use the ButtonController correctly.
194 * src/frontends/xforms/FormCopyright.C (build):
195 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
196 the .fd file and into build().
198 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
200 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
202 * src/frontends/xforms/forms/form_citation.fd:
203 * src/frontends/xforms/forms/form_copyright.fd:
204 * src/frontends/xforms/forms/form_error.fd:
205 * src/frontends/xforms/forms/form_graphics.fd:
206 * src/frontends/xforms/forms/form_index.fd:
207 * src/frontends/xforms/forms/form_toc.fd:
208 * src/frontends/xforms/forms/form_url.fd:
209 renamed some of the objects. Named others explicitly for the first time.
210 Added Restore and Apply buttons where appropriate.
212 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
215 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
217 * src/version.h: try the pre2 again
219 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
221 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
223 * src/frontends/kde/FormParagraph.C: added using directive.
225 * src/frontends/kde/paradlg.C: added config.h and using directive.
227 * src/frontends/kde/paradlg.h: added std::qualifier.
229 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
231 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
233 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
235 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
237 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
239 * src/version.h: set back to 1.1.6cvs
241 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
243 * src/version.h: set to 1.1.6pre2
245 2000-11-20 Marko Vendelin <markov@ioc.ee>
247 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
249 * src/frontends/gnome/Makefile.am: updated list of XForms object files
251 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
253 * src/LColor.C (init):
254 * src/lyxrc.C (getDescription): changed some comments as suggested by
257 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
258 disconnect the redrawGUI signal in best-practice fashion.
260 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
261 long_opts_tab to reflect the change in name of this tabfolder, as
262 suggested by John Levon.
263 (connect, disconnect): new methods. Don't do much at present other than
264 ensuring that we can't resize the dialog. This just makes xforms go
266 (lots of methods in Colors): made void rather than bool. The idea is
267 to have an isOk() function that keeps track of whether any input is
268 genuinely invalid and should therefore block Save, Apply.
269 Easier to manipulate the counters rapidly.
270 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
271 compiler will like this code. Much cleaner way of doing things.
273 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
275 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
276 rather than simple counters, following suggestion by John Levon.
278 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
279 than engraved frame + text.
281 * src/frontends/xforms/forms/makefile: removed spurious command.
283 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
285 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
287 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
290 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
292 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
293 see what Lars has changed and what is just white space!
294 Now used X directly to ascertain the RGB color associated with the
296 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
298 Added some sort capability.
299 The X11 color name database input is only displayed if the database
300 isn't found in the standard place.
301 Got rid of struct compare_converter; it wasn't used.
302 Probably some other stuff that I've forgotten.
304 * src/frontends/xforms/FormPreferences.h: changed the names of some
305 methods in the Colors struct. Added a couple of structs to help sort
306 colors by name and by RGBColor.
308 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
309 functions into a new class RWInfo.
311 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
312 The dialog is now almost navigable using the keyboard. Unfortunately,
313 the cursor has to be inside a browser for it to be activated. There is
314 no visual feedback for the key shortcuts to the arrow keys (use
315 Alt-appropriate arrow key, Alt-x).
317 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
320 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
321 xform_helpers.[Ch]. See above.
323 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
325 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
327 * src/screen.C (setCursorColor): new method. Sets the color of the
329 (ShowManualCursor): call it.
330 Constify some local variables.
332 * src/LColor.[Ch] (LColor): add entry for cursor
333 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
336 2000-11-19 Juergen Vigna <jug@sad.it>
338 * src/insets/insettabular.C (draw): fixed text border redraw problem.
339 (calculate_dimensions_of_cells): try to boost up when inserting chars.
341 2000-11-15 Rob Lahaye <lahaye@postech.edu>
343 * lib/ui/default.ui: OptItem used for Fax entry
345 2000-11-17 Matej Cepl <cepl@bigfoot.com>
347 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
349 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
351 * src/vspace.C (nextToken): fix so it can handle length phrases like
352 "10mm+-20mm", "40inplus16mmminus10cm" etc.
354 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
356 * src/frontends/xforms/FormPreferences.C: constify several variables
357 (BrowserLyX): rewrite to not need the choice variable
358 (Modify): rewrite to not need the choide variable
359 (compare_converter): make operator const
361 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
362 correct the writing of \set_color
363 (getDescription): return a const string
365 * src/kbsequence.[Ch] (addkey): remove dead code
367 * src/Painter.C (text): remove some commented code
369 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
371 * src/ColorHandler.[Ch]: removed some header files from .h file.
372 Included LColor.h in .C file.
374 * src/LColor.[Ch]: made class copyable so that I could create a
375 system_lcolor instance.
377 * src/Painter.h: removed LColor.h.
379 * src/lyx_gui.C (create_forms): used AddName.
381 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
382 of user preferences/lyxrc file.
384 * src/lyxrc.C (output): output changes to lcolor.
386 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
388 Moved class xformColor to files xform_helpers.[Ch]. These files,
389 Color.[Ch], could now be moved into src if they would be useful to
392 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
393 Also moved FormPreferences::browseFile here as it can be used by any
394 xform dialog with a "Browse" button. FormGraphics is a perfect example.
396 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
397 ReadableFile): changed the FormPreferences methods a little and moved
398 them here as they'll be useful elsewhere also.
400 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
401 Removed some header files and used forward declarations instead.
403 Removed some methods as they'll be useful elsewhere (see above).
405 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
406 Can also now modify the LyX LColors. However, for reasons that I don't
407 yet understand, it appears that we can use
408 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
409 present. The problem appears to lie in ColorHandler, because I can
410 change the color using LColor.SetColor(). Similarly, when reading in a
411 preferences file with some set_color instances, I'll get a warning
412 like: Color sea green is undefined or may not be redefined
413 Bad lyxrc set_color for sea green
415 Once the buffer is loaded, however, I can happily change to this color.
417 Finally, it appears that I have to set the color of "inset frame"
418 explicitly, or it oscillates from "black" to "indian red" with each
421 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
423 * ANNOUNCE: corrected a spelling mistake.
425 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
428 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
430 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
432 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
435 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
436 match the requirements from the standard better. This is required
437 to work with gnu libstdc++-v3
439 * src/frontends/xforms/FormPreferences.C: add explict pair
440 arguments to browse calls. include support/lyxmanip.h remvoe
441 extern fmt. whitespace changes. reorder variables in
442 FormPreferences.h, to match initalizaton order.
444 * several files: constify more local variables.
446 * src/buffer.C: remove some commented functions.
448 * src/DepTable.C (remove_files_with_extension): temporary
449 work around for gcc 2.97
450 * src/filedlg.C (find): ditto
451 * src/Variables.C (set): ditto
452 * src/LyXAction.C (searchActionArg): ditto
453 (retrieveActionArg): ditto
455 * configure.in: check for mktemp too
457 * UPGRADING: prepare for 1.1.6
459 * Makefile.am (lgbtags): add backup tags for when etags are
460 different than usual.
462 * ANNOUNCE: prepare for 1.1.6
464 * src/support/tempname.C (make_tempfile): new function, wrapper
465 around mkstemp and mktemp. Only mkstemp has been tested.
468 2000-11-14 Rob Lahaye <lahaye@postech.edu>
470 * default.ui: capitalized some menu items to improve shortcuts.
472 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
474 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
476 * src/frontends/xforms/Dialogs.C: add "using" directive.
478 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
480 * src/filedlg.C (Select): highlight suggested file in browser, if
483 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
484 each tab folder is encapsulated in its own class.
485 The Language keymaps are now chosen using a text input and a
486 browser button, rather than a Combox.
487 All the browser buttons are now functional, although LyXFileDlg
488 still needs to be modified to make it straighhtforward to return a
489 directory if that is what is desired.
491 * src/frontends/xforms/forms/form_preferences.fd: use text input
492 and browse button to input the Language keymaps. Add a few
493 callbacks for the browse buttons.
495 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
497 * src/support/tempname.C (tempName): small changes to make it
498 safer. remove the '.' before XXXXXX
500 * src/support/filetools.C (TmpFileName): remove func
503 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
504 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
505 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
506 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
508 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
511 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
514 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
515 for bp (this fixes a reproducible hard crash)
517 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
520 * src/frontends/xforms/FormBase.h: make bp_ private
521 (FormBaseBI): remove default for bp
524 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
527 * src/frontends/xforms/Color.C (RGBColor): made several vars
528 const, changed initialization of j to allow it to be const
531 * several files: added const to local variables.
533 * src/lyx_cb.C: removed several function prototypes and moved them
537 (UpdateLayoutPreamble):
539 (MenuInsertLabel): add BufferView as arguemnt
540 (LayoutsCB): make tmp const
542 * src/layout_forms.h: regenerated
544 * src/debug.C: add Debug::FILES
545 (showLevel) (showTags): translate the desc
547 * src/debug.h: add FILES as debug target
549 * src/bufferlist.C: use current_view as an interim measure becuase
550 of added arguments to MenuWrite and MenuWriteAs
552 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
554 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
556 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
557 libstdc++ is compiled with.
559 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
561 * lib/layouts/docbook-book.layout
562 * lib/layouts/docbook.layout
563 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
564 those paragraphs are expresse as SGML comments <!-- -->.
566 * src/LaTeXFeatures.h
567 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
568 parameter, this allows to express all the include files as relative
569 paths to the master buffer. The verbatim insert works as the other
572 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
574 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
576 (MakeDocBookFile): top_element is always written. Some clean up, as
577 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
579 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
580 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
581 a reference is written instead of the name.
582 (Validate): use the relative path for the filename.
584 * src/insets/insetlabel.C (DocBook): write end tag, for XML
587 * src/support/filetools.h
588 * src/support/filetools.C (IsSGMLFilename): added.
591 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
593 * development/OS2/quick_fix.patch:
595 * README.OS2: quick update to the OS/2 port.
597 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
599 * src/converter.C: add "using" directive.
601 * src/frontends/xforms/FormPreferences.C: add "using" directive.
602 (compare_converter): add "int" as return type.
604 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
607 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
609 * src/lyx_gui.C (create_forms): map the xform colours, should a
610 mapping exist. Ie, call XformColor::read().
612 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
613 and struct HSV as HSVColor.
614 (XformColor::read, XformColor::write) : new methods that
615 input/output any changes to the cform GUI colors.
617 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
620 * src/frontends/xforms/FormPreferences.C Lots of little changes
621 associated with the changed name of the RGB and HSV structs. Can
622 now save changes to xforms GUI to file. Commented out
623 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
624 used currently anyway.
626 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
628 * src/converter.C: A lot of changes:
629 - It is no longer possible to choose between two or more ways to
630 export to some format (the new code uses only the shortest path).
631 However, it is still possible to choose between pdflatex/ps2pdf
632 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
633 - Added several methods that makes the FormPreferences code simpler.
634 - Changed the tokens $$FName and $$OutName to $$i and $$o.
636 * src/exporter.C (Export): lyxrc.use_pdf is set before
637 makeLaTeXFile is called. This works but not very nice.
639 * src/frontends/xforms/FormPreferences.C: The formats/converters
640 tabs are now fully functional.
642 * src/buffer.C (getTocList): Add numbers to the captions.
644 * lib/lyxrc.example: Removed fax section
646 * src/support/rename.C (rename): Delete the old file if lyx::copy
649 2000-11-13 Rob Lahaye <lahaye@postech.edu>
651 * lib/ui/default.ui: minor polishing.
653 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
655 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
658 * lib/Makefile.am (DOCINST): do not install everything in the
659 documentation directory.
661 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
663 * src/bufferlist.C (newFile): set the filename to the constructed
666 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
667 constructed "newfileXX.lyx" name to the dialog
669 * src/frontends/DialogBase.h: make update() non-abstract so
670 KDE doesn't need to implement two update methods for every form
672 * src/frontends/kde/Makefile.am: add missing xforms objects
675 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
677 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
679 * src/frontends/xforms/Color.[Ch]: new files, defining the color
680 structs RGB and HSV. May not be the best place for these files.
681 Perhaps move them into src ?
683 * src/frontends/xforms/Makefile.am: added new files.
685 * src/frontends/xforms/forms/form_preferences.fd:
686 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
687 replaced all instances of "colour" with "color"!
689 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
692 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
693 tab. Can now alter the colors of the xform's GUI on the fly. With
694 the aid of a single static Signal (see below), can "Apply" these
695 changes to all currently open dialogs. (Well, to all of the NEW
696 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
697 subsequently opened dialogs will, of course, also have the new
698 color scheme. Cannot yet save (or load) the choices to file, so
699 they are lost when exiting LyX.
701 * src/frontends/Dialogs.h:
702 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
703 Used to trigger a redraw of any dialogs connected to it because,
704 for example, the GUI colours have been re-mapped.
706 * src/frontends/xforms/FormBase.[Ch]:
707 * src/frontends/xforms/FormDocument.[Ch]:
708 * src/frontends/xforms/FormParagraph.[Ch]:
709 * src/frontends/xforms/FormPreferences.[Ch]:
710 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
711 method, to be connected to Dialogs::redrawGUI. Method must be
712 virtual, because dialogs with tabbed folders need to redraw the
713 forms of each tab folder.
715 * src/LyXView.C (d-tor):
716 * src/frontends/xforms/FormBase.C (d-tor): connected
717 Dialogs::redrawGUI signal to redraw().
719 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
720 removed Assert, because it is identical to that in FormBase.
722 2000-11-10 Rob Lahaye <lahaye@postech.edu>
724 * lib/ui/default.ui: minor polishing.
726 2000-11-10 Juergen Vigna <jug@sad.it>
728 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
729 (deleteLyXText): ditto
731 * src/insets/insettabular.C (InsetButtonPress): don't clear the
732 selection on mouse-button-3.
734 * src/insets/insettabular.h: new function clearSelection(), use this
735 functions inside insettabular.C.
737 * src/insets/insettabular.C (TabularFeatures): clear the selection
738 on remove_row/column.
740 * src/insets/inset.C (scroll): fixed some scroll stuff.
742 * src/insets/insettabular.C (draw): fixed another minor draw problem.
744 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
746 * lib/CREDITS: add Yves Bastide
748 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
750 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
751 check whether C library functions are in the global namespace.
753 * configure.in: calls it.
755 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
758 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
760 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
761 iterators to prevent crash.
763 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
765 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
767 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
768 shortcut for xforms CB to the preemptive or post-handler function.
770 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
771 removed the HIDDEN_TIMER as it's no longer used.
772 Various other small changes.
774 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
775 preemptive handler to obtain feedback, rather than the post-handler.
776 (ColoursLoadBrowser): find "black" and "white" based on RGB values
778 Formats tab is now complete. Converters tab is nearly so.
780 2000-11-09 Juergen Vigna <jug@sad.it>
782 * src/insets/insettext.C (~InsetText):
785 (SetParagraphData): set cache.second to 0 after deleting it!
786 (getLyXText): check if cache.second is not 0 if finding it.
788 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
790 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
791 lyxlex to parse the rgb.txt file.
794 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
795 replace the default '#' comment character.
797 * src/support/tempname.C: add "using" directive
798 * src/frontends/ButtonPolicies.C: ditto.
800 * src/support/filetools.C (DirList): add an explicit cast to avoid
801 a compile error (probably not the right fix)
803 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
805 * src/support/filetools.C (DirList): implement using system functions
807 * src/support/tempname.C: new file
809 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
811 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
813 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
816 * src/frontends/xforms/ButtonController.C: new file
818 * src/os2_defines.h: remove getcwd define
820 * src/lyxvc.C: include support/lyxlib.h
821 (showLog): use lyx::tempName
823 * src/lyx_cb.C: comment out includes that we don't need
824 (AutoSave): use lyx::tempName
826 * src/filedlg.C: include support/lyxlib.h
827 (Reread): use lyx::getcwd
829 * src/converter.C: include support/filetools.h
830 (add_options): change to static inline, make tail const
831 (Add): make old_viewer const
832 (GetAllFormats): make it a const method, use const_iterator
833 (enable): make static inline
834 (SplitFormat): make using_format const
836 * src/LaTeX.C (run): use lyx::getcwd
838 * configure.in: check for mkstemp as well
840 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
842 * src/converter.[Ch] (GetAllCommands): new method.
844 * src/support/filetools.[Ch] (DirList): new method.
846 * src/frontends/xforms/FormPreferences.C: started (just!) adding
847 functionality to the converters tab.
848 The formats tab is now nearly complete.
849 The kbmap choices in Languages tab now display the contents of
850 system_lyxdir/kbd/*.kmap in readable form.
852 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
853 Moved some variables into the class.
855 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
856 inactive tab folder to FL_COL1. Haven't yet worked out how to change
857 colour of active folder to lighter grey instead. Any takers?
858 (form_colours): added an "Apply" button.
859 (form_converters): added a "Flags" input field.
860 (form_formats): added a "Shortcut" input field. Note that we can't use
861 names such as "input_shortcut" as this buggers up the sed script stuff.
863 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
871 * src/lyx_sendfax_main.C:
874 * src/spellchecker.C:
875 * src/insets/figinset.C:
876 * src/insets/insetbib.C:
877 * src/insets/insetexternal.C:
878 * src/insets/insetinclude.C:
879 * src/insets/insetinfo.C:
880 * src/mathed/math_panel.C:
881 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
882 all "daughter" dialogs now have identical "feel".
884 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
886 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
887 used (and was only used in one place prior to this patch. Incorrectly!)
889 * src/frontends/xforms/FormDocument.C: changed some instances of
890 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
891 sense. Also added fl_set_input_return() for class_->input_doc_extra and
892 for options_->input_float_placement. This fixes a bug reported by
895 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
896 functionality into d-tor.
898 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
899 input of numerals also.
901 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
902 fl_set_form_atclose(). Can now close dialog from window manager,
903 fixing a bug reported by Rob Lahaye.
905 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
907 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
908 are no longer dark. Haven't yet worked out how to lighten the colour of
909 the active tabfolder. Any ideas anybody?
910 Adjusted Colours tab a little.
911 Added Shortcut field to converters tab. Note that we can't create an
912 fdesign label like "input_shortcut" as this buggers up the sed-script
915 * src/frontends/xforms/FormPreferences.[Ch]:
916 (feedback): fixed crash due to to ob=0.
917 (LanguagesXXX): the kbmap choices now contain the files
918 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
919 be replaced by an input with a file browse button, but since the browse
920 buttons don'y yet work, this'll do for the moment.
921 (FormatsXXX): think that this is now nearly fully functional.
922 Some points/questions though:
923 1. Does "Apply" remove formats if no longer present?
924 2. I think that the browser should list the GUI names rather than the
926 3. Must ensure that we can't delete Formats used by an existing
929 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
930 if this is the best way to do this.
932 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
934 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
936 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
937 for variable assignment.
939 2000-11-07 Rob Lahaye <lahaye@postech.edu>
941 * src/lib/ui/default.ui: added sub/superscripts to menu as
942 Insert->Special characters and cleaned-up the file a bit
944 2000-11-07 Allan Rae <rae@lyx.org>
946 * src/frontends/xforms/FormPreferences.C (feedback): make sure
947 ob isn't 0 before using it. See comments in function.
949 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
951 * src/frontends/xforms/form_*.C: regenerated
953 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
955 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
957 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
958 compiling with gcc-2.96
960 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
962 * src/support/lyxstring.C: add a couple "using" directives.
964 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
965 a .c_str() here too for good measure.
966 * src/Spacing.C (set): ditto.
967 * src/lyxfunc.C (Dispatch): ditto.
969 * src/insets/insettabular.C (copySelection): change .str() to
970 .str().c_str() to fix problems with lyxstring.
971 * src/support/filetools.C (GetFileContents): ditto.
972 * src/buffer.C (asciiParagraph): ditto.
973 * src/paragraph.C (String): ditto.
975 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
976 * lib/bind/sciword.bind: ditto.
978 * src/LyXAction.C (init): remove "symbol-insert" function, which
979 shared LFUN_INSERT_MATH with "math-insert".
981 * lib/configure.m4: == is not a valid operator for command test.
983 * src/lyxrc.C: add using directive.
985 * src/converter.h: add std:: qualifier.
987 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
989 * src/converter.[Ch] and other files: Change the Format class to a
990 real class, and create two instances: formats and system_format.
992 * src/lyxrc.C (output): Output the difference between formats and
995 * src/frontends/xforms/FormPreferences.C (input): Simplify.
996 (buildFormats): Insert formats into browser.
997 (inputFormats): Made the browser and add button functional.
998 (applyFormats): Update formats from format_vec.
1000 * src/converter.C: Changed all (*it). to it->
1001 (Format::dummy): New method.
1002 (Format::importer): New format flag.
1003 (Formats::GetAllFormats): New method.
1004 (Formats::Add): Delete format from the map if prettyname is empty.
1005 (Converter::Convert): Print an error message if moving the file fails.
1006 (Converter::GetReachableTo): New method
1008 * src/MenuBackend.[Ch]: Add support for importformats tag.
1010 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1012 * lib/configure.m4: Add word->tex and ps->fax converters.
1014 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1015 Return fax to file menu.
1019 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1021 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1024 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1027 * src/lyxfunc.C (processKeyEvent): removed
1029 * src/bufferlist.C (emergencyWrite): removed the out commented
1030 emergency write code.
1032 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1034 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1036 * many files: change formatting to be a bit more uniform for
1037 if,while,for,switch statements, remove some parantesis not needed.
1040 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1042 * config/kde.m4: make config more robust when KDEDIR is set
1044 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1046 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1047 not returned a pixmap for "math-insert".
1049 * src/LyXAction.C (init): sort the entries a bit.
1051 2000-11-03 Juergen Vigna <jug@sad.it>
1053 * src/insets/insettabular.h: added fixed number to update codes so
1054 that update is only in one direction.
1056 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1059 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1060 before call to edit because of redraw.
1062 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1064 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1066 * lib/ui/default.ui: Populate "edit_float" menu
1068 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1070 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1071 "floats-operate". The name is ugly (and the func also), but this
1072 is just a band-aid until we switch to new insets.
1074 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1076 * lib/ui/default.ui: update again the menu layout (fix some
1079 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1081 * src/MenuBackend.h (fulllabel): new method.
1083 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1084 the menu shortcuts of a menu are unique and whether they
1085 correspond to a letter of the label.
1086 (expand): call checkShortcuts when debugging.
1088 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1090 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1092 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1094 * lib/examples/*.lyx : '\language default' => '\language english'
1096 * lib/examples/it_splash.lyx : except where it should be italian
1098 * lib/templates/*.lyx : the same
1100 * doc/*.lyx* : the same
1102 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1104 * lib/bind/menus.bind: remove the Layout menu entries, which I
1105 somehow forgot earlier.
1107 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1109 * lib/ui/old-default.ui: keep the old one here for reference (to
1112 * lib/ui/default.ui: update the menu layout
1114 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1116 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1117 Can now Apply to different insets without closing the dialog.
1119 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1120 Can't actually DO anything with them yet, but I'd like a little
1123 * src/frontends/xforms/input_validators.[ch]
1124 (fl_lowercase_filter): new.
1126 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1128 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1129 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1131 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1133 2000-11-02 Juergen Vigna <jug@sad.it>
1135 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1136 on char insertion as it has already be updated by bv->updateInset().
1138 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1139 if an inset inside was updated.
1141 * lib/configure.cmd: commented out fax-search code
1143 2000-11-01 Yves Bastide <stid@acm.org>
1145 * src/tabular.C (OldFormatRead): set tabular language to the
1148 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1150 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1151 class names with non-letter characters (from Yves Bastide).
1153 * lib/ui/default.ui: change Item to OptItem in import menu.
1154 Comment out fax stuff.
1156 * lib/configure.m4: comment out fax-related stuff.
1158 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1160 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1161 useful xforms helper functions. At present contains only formatted().
1162 Input a string and it returns it with line breaks so that in fits
1165 * src/frontends/xforms/Makefile.am: add new files.
1167 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1168 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1171 * src/frontends/xforms/FormPreferences.[Ch]:
1172 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1173 but lots of little clean ups. Removed enum State. Make use of
1174 formatted(). Constify lots of methods. Perhaps best of all: removed
1175 requirement for that horrible reinterpret_cast from pointer to long in
1178 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1180 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1181 conditionalize build on xforms < 0.89
1183 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1185 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1187 * src/LyXAction.C (init): comment out fax
1189 * src/lyxrc.h: comment out the fax enums
1190 comment out the fax variables
1192 * src/commandtags.h: comment out LFUN_FAX
1194 * src/lyxrc.C: disable fax variables.
1195 (read): disable parsing of fax variables
1196 (output): disable writing of fax variables
1197 (getFeedback): now description for fax variables
1199 * src/lyxfunc.C: comment out MenuFax
1200 (Dispatch): disable LFUN_FAX
1202 * src/lyx_cb.C (MenuFax): comment out
1204 * src/WorkArea.C: add <cctype>
1205 (work_area_handler): better key handling, should be ok now.
1206 for accented chars + etc
1208 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1209 lyx_sendfax.h and lyx_sendfax_man.C
1211 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1212 (show): don't call InitLyXLookup when using xforms 0.89
1214 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1216 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1218 * src/support/filetools.C (GetFileContents): close to dummy change
1220 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1222 * src/trans.C (AddDeadkey): workaround stupid compilers.
1224 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1226 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1227 of two-sided document.
1229 2000-10-31 Juergen Vigna <jug@sad.it>
1231 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1233 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1234 xposition to the Edit call.
1236 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1238 * src/trans.C (AddDeadkey): cast explicitly to char.
1240 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1242 * src/tabular.C (AsciiBottomHLine): simplify?
1243 (AsciiTopHLine): simplify?
1244 (print_n_chars): simplify
1245 (DocBook): remove most of the << endl; we should flush the stream
1246 as seldom as possible.
1248 (TeXBottomHLine): ditto
1249 (TeXTopHLine): ditto
1251 (write_attribute): try a templified version.
1252 (set_row_column_number_info): lesson scope of variables
1254 * src/support/lstrings.h (tostr): new specialization of tostr
1256 * src/trans.C (AddDeadkey): slightly cleaner fix.
1258 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1260 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1261 '%%' in Toc menu labels.
1264 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1265 font_norm is iso10646-1.
1267 * src/font.C (ascent): Fixed for 16bit fonts
1268 (descent,lbearing,rbearing): ditto
1270 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1272 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1273 (getFeedback): new static method.
1275 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1276 Now use combox rather than choice to display languages.
1277 Feedback is now output using a new timer callback mechanism, identical
1278 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1280 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1282 * src/minibuffer.C: fix for older compilers
1284 2000-10-30 Juergen Vigna <jug@sad.it>
1286 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1287 has to be Left of the inset otherwise LyXText won't find it!
1289 * src/BufferView2.C (open_new_inset): delete the inset if it can
1292 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1294 * lyx.man: fix typo.
1296 2000-10-29 Marko Vendelin <markov@ioc.ee>
1297 * src/frontends/gnome/FormCitation.C
1298 * src/frontends/gnome/FormCitation.h
1299 * src/frontends/gnome/FormCopyright.C
1300 * src/frontends/gnome/FormCopyright.h
1301 * src/frontends/gnome/FormError.C
1302 * src/frontends/gnome/FormError.h
1303 * src/frontends/gnome/FormIndex.C
1304 * src/frontends/gnome/FormIndex.h
1305 * src/frontends/gnome/FormPrint.C
1306 * src/frontends/gnome/FormPrint.h
1307 * src/frontends/gnome/FormRef.C
1308 * src/frontends/gnome/FormRef.h
1309 * src/frontends/gnome/FormToc.C
1310 * src/frontends/gnome/FormToc.h
1311 * src/frontends/gnome/FormUrl.C
1312 * src/frontends/gnome/FormUrl.h
1313 * src/frontends/gnome/Menubar_pimpl.C
1314 * src/frontends/gnome/mainapp.C
1315 * src/frontends/gnome/mainapp.h
1316 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1317 changing update() to updateSlot() where appropriate
1319 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1321 * src/frontends/xforms/FormPreferences.[Ch]:
1322 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1325 2000-10-28 Juergen Vigna <jug@sad.it>
1327 * src/insets/insettabular.C (draw): fixed drawing bug.
1329 * src/insets/insettext.C (clear):
1331 (SetParagraphData): clearing the TEXT buffers when deleting the
1332 paragraphs used by it.
1334 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1336 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1338 2000-10-27 Juergen Vigna <jug@sad.it>
1340 * src/tabular.C (~LyXTabular): removed not needed anymore.
1342 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1345 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1347 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1350 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1353 * src/frontends/xforms/FormPreferences.[Ch]:
1354 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1355 Reorganised as modules based on tabs. Much easier to follow the
1356 flow and to add new tabs. Added warning and feedback messages.
1359 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1361 * src/tabular.h (DocBook): add std:: qualifier.
1363 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1365 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1366 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1369 * insettabular.C (DocBook): uses the tabular methods to export
1372 * src/insets/insettext.h
1373 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1375 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1377 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1380 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1381 moved misplaced AllowInput two lines up.
1383 * src/buffer.C (readFile): compare float with float, not with int
1385 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1387 * src/minibuffer.C: add "using SigC::slot" statement.
1389 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1391 * src/frontends/xforms/forms/README: updated section about make.
1393 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1394 Tidied some forms up, made two of form_tabular's tabs more
1395 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1396 fixed translation problem with "Column".
1398 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1400 * src/minibuffer.h: use Timeout instead of the xforms timer
1402 (setTimer) rewrite for the Timeout, change to unsigned arg
1403 (set): change to unsigned timer arg
1406 * src/minibuffer.C (TimerCB): removed func
1407 (C_MiniBuffer_TimerCB): removed func
1408 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1409 (peek_event): use a switch statement
1410 (add): don't use fl_add_timer.
1411 (Set): rewrite to use the Timeout
1414 * src/Timeout.[Ch] (setType): return a Timeout &
1415 (setTimeout): ditto, change to unsigned arg for timeout
1417 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1419 * src/mathed/formula.C (mathed_string_width): Use string instead
1420 of a constant size char array.
1422 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1424 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1425 the two recently added operator<< for SMInput and State.
1427 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1429 (OkCancelPolicy): ditto
1430 (OkCancelReadOnlyPolicy): ditto
1431 (NoRepeatedApplyReadOnlyPolicy): ditto
1432 (OkApplyCancelReadOnlyPolicy): ditto
1433 (OkApplyCancelPolicy): ditto
1434 (NoRepeatedApplyPolicy): ditto
1436 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1438 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1439 add the usual std:: qualifiers.
1441 2000-10-25 Juergen Vigna <jug@sad.it>
1443 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1445 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1447 * src/support/filetools.C (MakeRelPath): change some types to
1450 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1451 ButtonPolicy::SMInput and ButtonPolicy::State.
1453 * src/FontLoader.C (reset): small cleanup
1454 (unload): small cleanup
1456 * src/FontInfo.C (getFontname): initialize error to 10000.0
1458 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1460 * src/frontends/xforms/FormPreferences.[Ch]:
1461 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1462 TeX encoding and default paper size sections.
1464 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1466 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1469 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1470 make the message_ empty.
1471 (FormError): don't initialize message_ in initializer list.
1473 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1475 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1477 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1479 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1481 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1483 * src/frontends/kde/*data.[Ch]: _("") is not
1486 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1488 * src/buffer.C: removed redundant using directive.
1490 * src/frontends/DialogBase.h: revert to original definition of
1493 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1494 stuff into two classes, one for each dialog, requires a new
1495 element in the dialogs vector, FormTabularCreate.
1497 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1500 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1501 method. Continues Allan's idea, but means that derived classes
1502 don't need to worry about "update or hide?".
1504 * src/frontends/xforms/FormError.C (showInset): add connection
1507 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1508 one for each dialog. FormTabular now contains main tabular dialog
1511 * src/frontends/xforms/FormTabularCreate.[Ch]:
1512 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1515 * src/frontends/xforms/FormGraphics.[Ch]:
1516 * src/frontends/xforms/forms/form_graphics.fd
1517 * src/frontends/xforms/FormTabular.[Ch]:
1518 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1519 classes of FormInset.
1521 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1522 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1524 * src/frontends/xforms/Makefile.am:
1525 * src/frontends/xforms/forms/makefile: added new files.
1527 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1528 variable. added Signal0 hide signal, in keeping with other GUI-I
1531 * src/support/lstrings.h: removed redundant std:: qualifier as
1532 it's already declared in Lsstream.h.
1534 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1536 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1540 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1542 * src/tabular.C (Ascii): minimize scope of cell.
1544 * src/BufferView2.C (nextWord): return string() instead of 0;
1546 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1548 * src/converter.h: add a std:: qualifier
1550 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1552 * src/importer.[Ch]: New files. Used for importing files into LyX.
1554 * src/lyxfunc.C (doImport): Use the new Importer class.
1556 * src/converter.h: Add shortcut member to the Format class.
1557 Used for holding the menu shortcut.
1559 * src/converter.C and other files: Made a distinction between
1560 format name and format extension. New formats can be defined using
1561 the \format lyxrc tag.
1562 Added two new converter flags: latex and disable.
1564 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1566 * src/support/lyxlib.h: unify namespace/struct implementation.
1567 Remove extra declarations.
1569 * src/support/chdir.C (chdir): remove version taking char const *
1571 * src/support/rename.C: ditto.
1572 * src/support/lyxsum.C: ditto.
1574 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1576 * src/frontends/xforms/FormBase.[Ch]:
1577 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1578 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1579 work only for the next call to fl_show_form(). The correct place to set
1580 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1581 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1582 from FormBase have the minimum size set; no more stupid crashes with
1585 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1587 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1589 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1591 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1593 * src/support/lyxlib.h: changed second argument of mkdir to
1594 unsigned long int (unsigned int would probably have been enough,
1595 but...). Removed <sys/types.h> header.
1596 * src/support/mkdir.C (mkdir): ditto.
1600 2000-10-19 Juergen Vigna <jug@sad.it>
1602 * src/lyxfunc.C (MenuNew): small fix (form John)
1604 * src/screen.C (Update): removed unneeded code.
1606 * src/tabular.C (Ascii): refixed int != uint bug!
1608 * src/support/lyxlib.h: added sys/types.h include for now permits
1609 compiling, but I don't like this!
1611 2000-10-18 Juergen Vigna <jug@sad.it>
1613 * src/text2.C (ClearSelection): if we clear the selection we need
1614 more refresh so set the status apropriately
1616 * src/insets/insettext.C (draw): hopefully finally fixed draw
1619 2000-10-12 Juergen Vigna <jug@sad.it>
1621 * src/insets/insettext.C (draw): another small fix and make a block
1622 so that variables are localized.
1624 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1626 * src/support/lstrings.C (lowercase, uppercase):
1627 use explicit casts to remove compiler warnings.
1629 * src/support/LRegex.C (Impl):
1630 * src/support/StrPool.C (add):
1631 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1632 (AddPath, MakeDisplayPath):
1633 * src/support/lstrings.C (prefixIs, subst):
1634 use correct type to remove compiler warnings.
1636 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1638 * src/support/lyxlib.h:
1639 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1640 portability and to remove compiler warning with DEC cxx.
1642 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1644 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1646 * src/minibuffer.C (peek_event): retun 1 when there has been a
1647 mouseclick in the minibuffer.
1651 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1653 * src/frontends/xforms/FormParagraph.C: more space above/below
1656 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1658 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1659 a char only if real_current_font was changed.
1661 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1663 * NEWS: update somewhat for 1.1.6
1665 * lib/ui/default.ui: clean up.
1667 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1669 * lib/CREDITS: clean up
1671 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1673 * src/combox.[Ch] (select): changed argument back to int
1674 * src/combox.C (peek_event): removed num_bytes as it is declared but
1677 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1678 modified calls to Combox::select() to remove warnings about type
1681 * src/insets/insetbutton.C (width): explicit cast to remove warning
1682 about type conversion.
1684 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1687 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1688 sel_pos_end, refering to cursor position are changed to
1689 LyXParagraph::size_type.
1691 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1692 consistent with LyXCursor::pos().
1693 (inset_pos): changed to LyXParagraph::size_type for same reason.
1695 * src/insets/insettext.C (resizeLyXText): changed some temporary
1696 variables refing to cursor position to LyXParagraph::size_type.
1698 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1700 * src/frontends/kde/<various>: The Great Renaming,
1703 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1705 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1707 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1709 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1710 0 when there are no arguments.
1712 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1714 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1715 to segfaults when pressing Ok in InsetBibtex dialog.
1717 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1719 * forms/layout_forms.fd:
1720 * src/layout_forms.C (create_form_form_character): small change to use
1721 labelframe rather than engraved frame + text
1723 * src/lyx_gui.C (create_forms): initialise choice_language with some
1724 arbitrary value to prevent segfault when dialog is shown.
1726 2000-10-16 Baruch Even <baruch.even@writeme.com>
1728 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1729 is no resulting file. This pertains only to LaTeX output.
1731 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1733 * src/text.C (Backspace): Make sure that the row of the cursor is
1736 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1739 * src/lyx_gui.C (init): Prevent a crash when only one font from
1740 menu/popup fonts is not found.
1742 * lib/lyxrc.example: Add an example for binding a key for language
1745 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1747 * src/converter.C (GetReachable): Changed the returned type to
1749 (IsReachable): New method
1751 * src/MenuBackend.C (expand): Handle formats that appear more
1754 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1756 * src/frontends/support/Makefile.am
1757 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1760 * lib/CREDITS: add Garst Reese.
1762 * src/support/snprintf.h: add extern "C" {} around the definitions.
1764 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1766 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1769 * src/frontends/xforms/FormDocument.C:
1770 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1771 compile without "conversion to integral type of smaller size"
1774 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1776 * src/text.C (GetColumnNearX): Fixed disabled code.
1778 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1780 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1783 * src/support/snprintf.[ch]: new files
1785 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1787 * src/frontends/kde/formprintdialog.C: add
1788 file browser for selecting postscript output
1790 * src/frontends/kde/formprintdialogdata.C:
1791 * src/frontends/kde/formprintdialogdata.h: re-generate
1794 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1796 * src/frontends/gnome/Makefile.am:
1797 * src/frontends/kde/Makefile.am: FormCommand.C
1798 disappeared from xforms
1800 * src/frontends/kde/FormCitation.C:
1801 * src/frontends/kde/FormIndex.C: read-only
1804 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1806 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1809 * src/bufferlist.C: add using directive.
1811 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1813 * src/support/lyxfunctional.h: version of class_fun for void
1814 returns added, const versions of back_inseter_fun and compare_fun
1817 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1819 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1821 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1823 * ChangeLog: cleanup.
1825 * lib/CREDITS: update to add all the contributors we've forgotten.
1826 I have obviously missed some, so tell me whether there were
1829 2000-10-13 Marko Vendelin <markov@ioc.ee>
1831 * src/frontends/gnome/FormCitation.C
1832 * src/frontends/gnome/FormCitation.h
1833 * src/frontends/gnome/FormError.C
1834 * src/frontends/gnome/FormIndex.C
1835 * src/frontends/gnome/FormRef.C
1836 * src/frontends/gnome/FormRef.h
1837 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1839 * src/frontends/gnome/FormCitation.C
1840 * src/frontends/gnome/FormCopyright.C
1841 * src/frontends/gnome/FormError.C
1842 * src/frontends/gnome/FormIndex.C
1843 * src/frontends/gnome/FormRef.C
1844 * src/frontends/gnome/FormToc.C
1845 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1848 * src/frontends/gnome/Menubar_pimpl.C
1849 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1852 2000-10-11 Baruch Even <baruch.even@writeme.com>
1855 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1856 to convey its real action.
1858 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1859 clear the minibuffer and prepare to enter a command.
1861 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1862 the rename from ExecCommand to PrepareForCommand.
1863 * src/lyxfunc.C (Dispatch): ditto.
1865 2000-10-11 Baruch Even <baruch.even@writeme.com>
1867 * src/buffer.C (writeFile): Added test for errors on writing, this
1868 catches all errors and not only file system full errors as intended.
1870 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1872 * src/lyx_gui.C (create_forms): better fix for crash with
1873 translated interface.
1875 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1877 * src/frontends/kde/Makefile.am:
1878 * src/frontends/kde/FormCopyright.C:
1879 * src/frontends/kde/formcopyrightdialog.C:
1880 * src/frontends/kde/formcopyrightdialog.h:
1881 * src/frontends/kde/formcopyrightdialogdata.C:
1882 * src/frontends/kde/formcopyrightdialogdata.h:
1883 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1884 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1885 copyright to use qtarch
1887 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1889 * src/encoding.C (read): Fixed bug that caused an error message at
1890 the end of the file.
1892 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1894 * lib/lyxrc.example: Fixed hebrew example.
1896 2000-10-13 Allan Rae <rae@lyx.org>
1898 * src/frontends/xforms/FormPreferences.C (input): reworking the
1900 (build, update, apply): New inputs in various tabfolders
1902 * src/frontends/xforms/FormToc.C: use new button policy.
1903 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1904 dialogs that either can't use any existing policy or where it just
1907 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1910 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1911 added a bool parameter which is ignored.
1913 * src/buffer.C (setReadonly):
1914 * src/BufferView_pimpl.C (buffer):
1915 * src/frontends/kde/FormCopyright.h (update):
1916 * src/frontends/kde/FormCitation.[Ch] (update):
1917 * src/frontends/kde/FormIndex.[Ch] (update):
1918 * src/frontends/kde/FormPrint.[Ch] (update):
1919 * src/frontends/kde/FormRef.[Ch] (update):
1920 * src/frontends/kde/FormToc.[Ch] (update):
1921 * src/frontends/kde/FormUrl.[Ch] (update):
1922 * src/frontends/gnome/FormCopyright.h (update):
1923 * src/frontends/gnome/FormCitation.[Ch] (update):
1924 * src/frontends/gnome/FormError.[Ch] (update):
1925 * src/frontends/gnome/FormIndex.[Ch] (update):
1926 * src/frontends/gnome/FormPrint.[Ch] (update):
1927 * src/frontends/gnome/FormRef.h (update):
1928 * src/frontends/gnome/FormToc.[Ch] (update):
1929 * src/frontends/gnome/FormUrl.[Ch] (update):
1930 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1931 to updateBufferDependent and DialogBase
1933 * src/frontends/xforms/FormCitation.[hC]:
1934 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1935 * src/frontends/xforms/FormError.[Ch]:
1936 * src/frontends/xforms/FormGraphics.[Ch]:
1937 * src/frontends/xforms/FormIndex.[Ch]:
1938 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1939 and fixed readOnly handling.
1940 * src/frontends/xforms/FormPrint.[Ch]:
1941 * src/frontends/xforms/FormRef.[Ch]:
1942 * src/frontends/xforms/FormTabular.[Ch]:
1943 * src/frontends/xforms/FormToc.[Ch]:
1944 * src/frontends/xforms/FormUrl.[Ch]:
1945 * src/frontends/xforms/FormInset.[Ch]:
1946 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1947 form of updateBufferDependent.
1949 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1950 if form()->visible just in case someone does stuff to the form in a
1953 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1954 the buttoncontroller for everything the enum used to be used for.
1955 (update) It would seem we need to force all dialogs to use a bool
1956 parameter or have two update functions. I chose to go with one.
1957 I did try removing update() from here and FormBase and defining the
1958 appropriate update signatures in FormBaseB[DI] but then ran into the
1959 problem of the update() call in FormBase::show(). Whatever I did
1960 to get around that would require another function and that just
1961 got more confusing. Hence the decision to make everyone have an
1962 update(bool). An alternative might have been to override show() in
1963 FormBaseB[DI] and that would allow the different and appropriate
1966 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1967 true == buffer change occurred. I decided against using a default
1968 template parameter since not all compilers support that at present.
1970 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1972 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1973 army knife" by removing functionality.
1974 (clearStore): removed. All such housekeeping on hide()ing the dialog
1975 is to be carried out by overloaded disconnect() methods.
1976 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1977 superceded by Baruch's neat test (FormGraphics) to update an existing
1978 dialog if a new signal is recieved rather than block all new signals
1980 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1981 only to Inset dialogs.
1982 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1983 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1985 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1987 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1988 as a base class to all inset dialogs. Used solely to connect/disconnect
1989 the Inset::hide signal and to define what action to take on receipt of
1990 a UpdateBufferDependent signal.
1991 (FormCommand): now derived from FormInset.
1993 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1996 * src/frontends/xforms/FormCopyright.[Ch]:
1997 * src/frontends/xforms/FormPreferences.[Ch]:
1998 now derived from FormBaseBI.
2000 * src/frontends/xforms/FormDocument.[Ch]:
2001 * src/frontends/xforms/FormParagraph.[Ch]:
2002 * src/frontends/xforms/FormPrint.[Ch]:
2003 now derived from FormBaseBD.
2005 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2007 * src/frontends/xforms/FormCitation.[Ch]:
2008 * src/frontends/xforms/FormError.[Ch]:
2009 * src/frontends/xforms/FormRef.[Ch]:
2010 * src/frontends/xforms/FormToc.[Ch]:
2011 (clearStore): reworked as disconnect().
2013 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2016 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2018 * src/converter.C (runLaTeX): constify buffer argument
2021 * src/frontends/support/Makefile.am (INCLUDES): fix.
2023 * src/buffer.h: add std:: qualifier
2024 * src/insets/figinset.C (addpidwait): ditto
2025 * src/MenuBackend.C: ditto
2026 * src/buffer.C: ditto
2027 * src/bufferlist.C: ditto
2028 * src/layout.C: ditto
2029 * src/lyxfunc.C: ditto
2031 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2033 * src/lyxtext.h (bidi_level): change return type to
2034 LyXParagraph::size_type.
2036 * src/lyxparagraph.h: change size_type to
2037 TextContainer::difference_type. This should really be
2038 TextContainer::size_type, but we need currently to support signed
2041 2000-10-11 Marko Vendelin <markov@ioc.ee>
2042 * src/frontends/gnome/FormError.h
2043 * src/frontends/gnome/FormRef.C
2044 * src/frontends/gnome/FormRef.h
2045 * src/frontends/gnome/FormError.C
2046 * src/frontends/gnome/Makefile.am
2047 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2048 to Gnome frontend. Both dialogs use "action" area.
2050 2000-10-12 Baruch Even <baruch.even@writeme.com>
2052 * src/graphics/GraphicsCacheItem_pimpl.C:
2053 * src/graphics/Renderer.C:
2054 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2057 2000-10-12 Juergen Vigna <jug@sad.it>
2059 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2060 visible when selecting).
2062 * development/Code_rules/Rules: fixed some typos.
2064 2000-10-09 Baruch Even <baruch.even@writeme.com>
2066 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2067 compiling on egcs 1.1.2 possible.
2069 * src/filedlg.C (comp_direntry::operator() ): ditto.
2071 2000-08-31 Baruch Even <baruch.even@writeme.com>
2073 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2076 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2077 transient it now only gets freed when the object is destructed.
2079 2000-08-24 Baruch Even <baruch.even@writeme.com>
2081 * src/frontends/FormGraphics.h:
2082 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2085 2000-08-20 Baruch Even <baruch.even@writeme.com>
2087 * src/insets/insetgraphics.C:
2088 (draw): Added messages to the drawn rectangle to report status.
2089 (updateInset): Disabled the use of the inline graphics,
2092 2000-08-17 Baruch Even <baruch.even@writeme.com>
2094 * src/frontends/support: Directory added for the support of GUII LyX.
2096 * src/frontends/support/LyXImage.h:
2097 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2100 * src/frontends/support/LyXImage_X.h:
2101 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2102 version of LyXImage, this uses the Xlib Pixmap.
2104 * src/PainterBase.h:
2105 * src/PainterBase.C:
2107 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2108 replacement to Pixmap.
2110 * src/insets/insetgraphics.h:
2111 * src/insets/insetgraphics.C:
2112 * src/graphics/GraphicsCacheItem.h:
2113 * src/graphics/GraphicsCacheItem.C:
2114 * src/graphics/GraphicsCacheItem_pimpl.h:
2115 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2118 * src/graphics/GraphicsCacheItem.h:
2119 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2120 another copy of the object.
2122 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2123 of cacheHandle, this fixed a bug that sent LyX crashing.
2125 * src/graphics/XPM_Renderer.h:
2126 * src/graphics/XPM_Renderer.C:
2127 * src/graphics/EPS_Renderer.h:
2128 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2130 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2132 * src/lyxfunc.C (processKeySym): only handle the
2133 lockinginset/inset stuff if we have a buffer and text loaded...
2135 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2137 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2139 * src/support/lyxfunctional.h: add operator= that takes a reference
2141 * src/lyxserver.C (mkfifo): make first arg const
2143 * src/layout.h: renamed name(...) to setName(...) to work around
2146 * src/buffer.C (setFileName): had to change name of function to
2147 work around bugs in egcs. (renamed from fileName)
2149 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2151 * src/support/translator.h: move helper template classes to
2152 lyxfunctional.h, include "support/lyxfunctional.h"
2154 * src/support/lyxmanip.h: add delaration of fmt
2156 * src/support/lyxfunctional.h: new file
2157 (class_fun_t): new template class
2158 (class_fun): helper template function
2159 (back_insert_fun_iterator): new template class
2160 (back_inserter_fun): helper template function
2161 (compare_memfun_t): new template class
2162 (compare_memfun): helper template function
2163 (equal_1st_in_pair): moved here from translator
2164 (equal_2nd_in_pair): moved here from translator
2166 * src/support/fmt.C: new file
2167 (fmt): new func, can be used for a printf substitute when still
2168 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2170 * src/support/StrPool.C: add some comments
2172 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2175 * src/insets/figinset.C (addpidwait): use std::copy with
2176 ostream_iterator to fill the pidwaitlist
2178 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2180 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2183 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2186 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2188 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2189 (class_update): ditto
2190 (BulletPanel): ditto
2191 (CheckChoiceClass): move initialization of tc and tct
2193 * src/tabular.C: remove current_view
2194 (OldFormatRead): similar to right below [istream::ignore]
2196 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2197 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2198 unused [istream::ignore]
2200 * src/lyxfunc.C: include "support/lyxfunctional.h"
2201 (getInsetByCode): use std::find_if and compare_memfun
2203 * src/lyxfont.C (stateText): remove c_str()
2205 * src/lyx_main.C (setDebuggingLevel): make static
2206 (commandLineHelp): make static
2208 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2209 Screen* together with fl_get_display() and fl_screen
2211 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2212 togheter with fl_get_display() and fl_screen
2213 (create_forms): remove c_str()
2215 * src/layout.C: include "support/lyxfunctional.h"
2216 (hasLayout): use std::find_if and compare_memfun
2217 (GetLayout): use std::find_if and comapre_memfun
2218 (delete_layout): use std::remove_if and compare_memfun
2219 (NumberOfClass): use std:.find_if and compare_memfun
2221 * src/gettext.h: change for the new functions
2223 * src/gettext.C: new file, make _(char const * str) and _(string
2224 const & str) real functions.
2226 * src/font.C (width): rewrite slightly to avoid one extra variable
2228 * src/debug.C: initialize Debug::ANY here
2230 * src/commandtags.h: update number comments
2232 * src/combox.h (get): make const func
2234 (getline): make const
2236 * src/combox.C (input_cb): handle case where fl_get_input can
2239 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2240 "support/lyxfunctional.h", remove current_view variable.
2241 (resize): use std::for_each with std::mem_fun
2242 (getFileNames): use std::copy with back_inserter_fun
2243 (getBuffer): change arg type to unsigned int
2244 (emergencyWriteAll): call emergencyWrite with std::for_each and
2246 (emergencyWrite): new method, the for loop in emergencyWriteAll
2248 (exists): use std::find_if with compare_memfun
2249 (getBuffer): use std::find_if and compare_memfun
2251 * src/buffer.h: add typedefs for iterator_category, value_type
2252 difference_type, pointer and reference for inset_iterator
2253 add postfix ++ for inset_iterator
2254 make inset_iterator::getPos() const
2256 * src/buffer.C: added support/lyxmanip.h
2257 (readFile): use lyxerr << fmt instead of printf
2258 (makeLaTeXFile): use std::copy to write out encodings
2260 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2262 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2263 free and the char * temp.
2264 (hasMenu): use std::find_if and compare_memfun
2267 * src/Makefile.am (lyx_SOURCES): added gettext.C
2269 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2270 string::insert small change to avoid temporary
2272 * src/LColor.C (getGUIName): remove c_str()
2274 * several files: change all occurrences of fl_display to
2277 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2278 that -pedantic is not used for gcc 2.97 (cvs gcc)
2280 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2282 2000-10-11 Allan Rae <rae@lyx.org>
2284 * src/frontends/xforms/FormPreferences.C (input): template path must be
2285 a readable directory. It doesn't need to be writeable.
2286 (build, delete, update, apply): New inputs in the various tabfolders
2288 * src/frontends/xforms/forms/form_preferences.fd:
2289 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2290 several new entries to existing folders. Shuffled some existing stuff
2293 * src/frontends/xforms/forms/form_print.fd:
2294 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2295 Should probably rework PrinterParams as well. Note that the switch to
2296 collated is effectively the same as !unsorted so changing PrinterParams
2297 will require a lot of fiddly changes to reverse the existing logic.
2299 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2301 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2303 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2305 2000-10-10 Allan Rae <rae@lyx.org>
2308 * src/lyxfunc.C (Dispatch):
2310 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2313 * src/lyxrc.C (output): Only write the differences between system lyxrc
2314 and the users settings.
2317 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2319 I'll rewrite this later, after 1.1.6 probably, to keep a single
2320 LyXRC but two instances of a LyXRCStruct.
2322 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2324 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2326 * src/tabular.h: add a few std:: qualifiers.
2328 * src/encoding.C: add using directive.
2329 * src/language.C: ditto.
2331 * src/insets/insetquotes.C (Validate): use languages->lang()
2332 instead of only language.
2334 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2336 * lib/languages: New file.
2338 * lib/encodings: New file.
2340 * src/language.C (Languages): New class.
2341 (read): New method. Reads the languages from the 'languages' file.
2343 * src/encoding.C (Encodings): New class.
2344 (read): New method. Reads the encodings from the 'encodings' file.
2346 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2349 * src/bufferparams.h and a lot of files: Deleted the member language,
2350 and renamed language_info to language
2352 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2353 * src/lyxfont.C (latexWriteStartChanges): ditto.
2354 * src/paragraph.C (validate,TeXOnePar): ditto.
2356 * src/lyxfont.C (update): Restored deleted code.
2358 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2360 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2362 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2364 * src/insets/figinset.[Ch]:
2365 * src/insets/insetinclude.[Ch]:
2366 * src/insets/insetinclude.[Ch]:
2367 * src/insets/insetparent.[Ch]:
2368 * src/insets/insetref.[Ch]:
2369 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2371 * src/insets/*.[Ch]:
2372 * src/mathed/formula.[Ch]:
2373 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2375 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2376 * src/lyx_cb.C (FigureApplyCB):
2377 * src/lyxfunc.C (getStatus, Dispatch):
2378 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2381 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2383 * src/converter.[Ch] (Formats::View):
2384 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2386 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2387 *current_view->buffer(). This will change later, but this patch is way
2390 2000-10-09 Juergen Vigna <jug@sad.it>
2392 * src/text.C (GetRow): small fix.
2394 * src/BufferView_pimpl.C (cursorPrevious):
2395 (cursorNext): added LyXText parameter to function.
2397 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2398 keypress depending on cursor position.
2400 2000-10-06 Juergen Vigna <jug@sad.it>
2402 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2403 (copySelection): redone this function and also copy ascii representa-
2406 * src/tabular.C (Ascii):
2410 (print_n_chars): new functions to realize the ascii export of tabulars.
2412 2000-10-05 Juergen Vigna <jug@sad.it>
2414 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2415 if we don't have a buffer.
2417 2000-10-10 Allan Rae <rae@lyx.org>
2419 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2420 with closing dialog. It seems that nested tabfolders require hiding
2421 of inner tabfolders before hiding the dialog itself. Actually all I
2422 did was hide the active outer folder.
2424 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2425 unless there really is a buffer. hideBufferDependent is called
2428 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2429 POTFILES.in stays in $(srcdir).
2431 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2433 * lib/lyxrc.example: Few changes.
2435 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2437 * src/BufferView_pimpl.C (buffer): only need one the
2438 updateBufferDependent signal to be emitted once! Moved to the end of
2439 the method to allow bv_->text to be updated first.
2441 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2442 and hSignal_ with Dialogs * and BufferDependency variables.
2443 New Buffer * parent_, initialised when the dialog is launched. Used to
2444 check whether to update() or hide() dialog in the new, private
2445 updateOrHide() method that is connected to the updateBufferDependent
2446 signal. Daughter classes dictate what to do using the
2447 ChangedBufferAction enum, passed to the c-tor.
2449 * src/frontends/xforms/FormCitation.C:
2450 * src/frontends/xforms/FormCommand.C:
2451 * src/frontends/xforms/FormCopyright.C:
2452 * src/frontends/xforms/FormDocument.C:
2453 * src/frontends/xforms/FormError.C:
2454 * src/frontends/xforms/FormIndex.C:
2455 * src/frontends/xforms/FormPreferences.C:
2456 * src/frontends/xforms/FormPrint.C:
2457 * src/frontends/xforms/FormRef.C:
2458 * src/frontends/xforms/FormToc.C:
2459 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2462 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2463 ChangedBufferAction enum.
2465 * src/frontends/xforms/FormParagraph.[Ch]
2466 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2469 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2471 * lib/bind/cua.bind: fix a bit.
2472 * lib/bind/emacs.bind: ditto.
2474 * lib/bind/menus.bind: remove real menu entries from there.
2476 * src/spellchecker.C: make sure we only include strings.h when
2479 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2481 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2482 function. It enlarges the maximum number of pup when needed.
2483 (add_toc2): Open a new menu if maximum number of items per menu has
2486 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2488 * src/frontends/kde/FormPrint.C: fix error reporting
2490 * src/frontends/xforms/FormDocument.C: fix compiler
2493 * lib/.cvsignore: add Literate.nw
2495 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2498 * bufferview_funcs.[Ch]
2501 * text2.C: Add support for numbers in RTL text.
2503 2000-10-06 Allan Rae <rae@lyx.org>
2505 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2506 to be gettext.m4 friendly again. ext_l10n.h is now
2507 generated into $top_srcdir instead of $top_builddir
2508 so that lyx.pot will be built correctly -- without
2509 duplicate parsing of ext_l10n.h.
2511 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2513 * src/frontends/kde/FormCitation.C: make the dialog
2514 behave more sensibly
2516 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2518 * config/kde.m4: fix consecutive ./configure runs,
2519 look for qtarch, fix library order
2521 * src/frontends/kde/Makefile.am: tidy up,
2522 add Print dialog, add .dlg dependencies
2524 * src/frontends/kde/FormPrint.C:
2525 * src/frontends/kde/FormPrint.h:
2526 * src/frontends/kde/formprintdialog.C:
2527 * src/frontends/kde/formprintdialog.h:
2528 * src/frontends/kde/formprintdialogdata.C:
2529 * src/frontends/kde/formprintdialogdata.h:
2530 * src/frontends/kde/dlg/formprintdialog.dlg: add
2533 * src/frontends/kde/dlg/README: Added explanatory readme
2535 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2536 script to double-check qtarch's output
2538 * src/frontends/kde/formindexdialog.C:
2539 * src/frontends/kde/formindexdialogdata.C:
2540 * src/frontends/kde/formindexdialogdata.h:
2541 * src/frontends/kde/dlg/formindexdialog.dlg: update
2542 for qtarch, minor fixes
2544 2000-10-05 Allan Rae <rae@lyx.org>
2546 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2547 dialogs when switching buffers update them instead. It's up to each
2548 dialog to decide if it should still be visible or not.
2549 update() should return a bool to control visiblity within show().
2550 Or perhaps better to set a member variable and use that to control
2553 * lib/build-listerrors: create an empty "listerrors" file just to stop
2554 make trying to regenerate it all the time if you don't have noweb
2557 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2559 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2560 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2561 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2562 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2563 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2565 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2567 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2569 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2570 deleting buffer. Closes all buffer-dependent dialogs.
2572 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2574 * src/frontends/xforms/FormCitation.[Ch]:
2575 * src/frontends/xforms/FormPreferences.[Ch]:
2576 * src/frontends/xforms/FormPrint.[Ch]:
2577 * src/frontends/xforms/FormRef.[Ch]:
2578 * src/frontends/xforms/FormUrl.[Ch]: ditto
2580 * src/frontends/xforms/FormDocument.[Ch]:
2581 * src/frontends/xforms/forms/form_document.C.patch:
2582 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2583 pass through a single input() function.
2585 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2587 * lib/build-listerrors: return status as OK
2589 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2591 * lib/lyxrc.example: Updated to new export code
2593 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2595 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2598 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2601 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2602 LyX-Code is defined.
2603 * lib/layouts/amsbook.layout: ditto.
2605 * boost/Makefile.am: fix typo.
2607 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2609 (add_lastfiles): removed.
2610 (add_documents): removed.
2611 (add_formats): removed.
2613 * src/frontends/Menubar.C: remove useless "using" directive.
2615 * src/MenuBackend.h: add a new MenuItem constructor.
2617 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2620 2000-10-04 Allan Rae <rae@lyx.org>
2622 * lib/Makefile.am (listerrors):
2623 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2624 I haven't got notangle installed so Kayvan please test. The output
2625 should end up in $builddir. This also allows people who don't have
2626 noweb installed to complete the make process without error.
2628 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2629 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2630 by JMarc's picky compiler.
2632 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2635 * src/insets/insettabular.C (setPos): change for loop to not use
2636 sequencing operator. Please check this Jürgen.
2638 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2640 * src/insets/insetcite.C (getScreenLabel): ditto
2641 * src/support/filetools.C (QuoteName): ditto
2642 (ChangeExtension): ditto
2644 * src/BufferView_pimpl.C (scrollCB): make heigt int
2646 * src/BufferView2.C (insertInset): comment out unused arg
2648 * boost/Makefile.am (EXTRADIST): new variable
2650 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2652 * src/exporter.C (IsExportable): Fixed
2654 * lib/configure.m4: Small fix
2656 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2658 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2659 * src/insets/insetbib.C (bibitemWidest): ditto.
2660 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2662 2000-10-03 Juergen Vigna <jug@sad.it>
2664 * src/BufferView2.C (theLockingInset): removed const because of
2665 Agnus's compile problems.
2667 * src/insets/insettext.C (LocalDispatch): set the language of the
2668 surronding paragraph on inserting the first character.
2670 * various files: changed use of BufferView::the_locking_inset.
2672 * src/BufferView2.C (theLockingInset):
2673 (theLockingInset): new functions.
2675 * src/BufferView.h: removed the_locking_inset.
2677 * src/lyxtext.h: added the_locking_inset
2679 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2681 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2683 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2685 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2686 * src/mathed/math_cursor.C (IsAlpha): ditto.
2687 * src/mathed/math_inset.C (strnew): ditto.
2688 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2689 (IMetrics): cxp set but never used; removed.
2690 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2691 that the variable in question has been removed also!
2694 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2695 using the Buffer * passed to Latex(), using the BufferView * passed to
2696 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2698 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2699 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2701 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2702 * src/buffer.C (readInset): used new InsetBibtex c-tor
2703 * (getBibkeyList): used new InsetBibtex::getKeys
2705 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2708 * lib/build-listerrors
2710 * src/exporter.C: Add literate programming support to the export code
2713 * src/lyx_cb.C: Remove old literate code.
2715 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2718 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2719 * src/converter.C (View, Convert): Use QuoteName.
2721 * src/insets/figinset.C (Preview): Use Formats::View.
2723 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2725 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2727 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2728 the top of the function, because compaq cxx complains that the
2729 "goto exit_with_message" when the function is disabled bypasses
2731 (MenuNew): try a better fix for the generation of new file names.
2732 This time, I used AddName() instead of AddPath(), hoping Juergen
2735 2000-10-03 Allan Rae <rae@lyx.org>
2737 * src/frontends/xforms/forms/form_preferences.fd:
2738 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2739 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2740 "Look and Feel"->"General" but will need to be split up further into
2741 general output and general input tabs. Current plan is for four outer
2742 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2743 stuff; "Inputs" for input and import configuration; "Outputs" for
2744 output and export configuration; and one more whatever is left over
2745 called "General". The leftovers at present look like being which
2746 viewers to use, spellchecker, language support and might be better
2747 named "Support". I've put "Paths" in "Inputs" for the moment as this
2748 seems reasonable for now at least.
2749 One problem remains: X error kills LyX when you close Preferences.
2751 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2753 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2754 qualifier from form()
2755 * src/frontends/xforms/FormCitation.[Ch]:
2756 * src/frontends/xforms/FormCopyright.[Ch]:
2757 * src/frontends/xforms/FormDocument.[Ch]:
2758 * src/frontends/xforms/FormError.[Ch]:
2759 * src/frontends/xforms/FormIndex.[Ch]:
2760 * src/frontends/xforms/FormPreferences.[Ch]:
2761 * src/frontends/xforms/FormPrint.[Ch]:
2762 * src/frontends/xforms/FormRef.[Ch]:
2763 * src/frontends/xforms/FormToc.[Ch]:
2764 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2766 * src/frontends/xforms/FormCitation.[Ch]:
2767 * src/frontends/xforms/FormIndex.[Ch]:
2768 * src/frontends/xforms/FormRef.[Ch]:
2769 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2770 with Allan's naming policy
2772 * src/frontends/xforms/FormCitation.C: some static casts to remove
2775 2000-10-02 Juergen Vigna <jug@sad.it>
2777 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2778 now you can type or do stuff inside the table-cell also when in dummy
2779 position, fixed visible cursor.
2781 * src/insets/insettext.C (Edit): fixing cursor-view position.
2783 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2784 be used for equal functions in lyxfunc and insettext.
2786 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2788 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2790 * src/frontends/gnome/FormCitation.h:
2791 * src/frontends/gnome/FormCopyright.h:
2792 * src/frontends/gnome/FormIndex.h:
2793 * src/frontends/gnome/FormPrint.h:
2794 * src/frontends/gnome/FormToc.h:
2795 * src/frontends/gnome/FormUrl.h:
2796 * src/frontends/kde/FormCitation.h:
2797 * src/frontends/kde/FormCopyright.h:
2798 * src/frontends/kde/FormIndex.h:
2799 * src/frontends/kde/FormRef.h:
2800 * src/frontends/kde/FormToc.h:
2801 * src/frontends/kde/FormUrl.h: fix remaining users of
2804 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2806 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2807 from depth argument.
2808 (DocBookHandleCaption): ditto.
2809 (DocBookHandleFootnote): ditto.
2810 (SimpleDocBookOnePar): ditto.
2812 * src/frontends/xforms/FormDocument.h (form): remove extra
2813 FormDocument:: qualifier.
2815 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2817 * sigc++/handle.h: ditto.
2819 * src/lyx_gui_misc.C: add "using" directive.
2821 * src/cheaders/cstddef: new file, needed by the boost library (for
2824 2000-10-02 Juergen Vigna <jug@sad.it>
2826 * src/insets/insettext.C (SetFont): better support.
2828 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2830 * src/screen.C (DrawOneRow): some uint refixes!
2832 2000-10-02 Allan Rae <rae@lyx.org>
2834 * boost/.cvsignore: ignore Makefile as well
2836 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2837 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2839 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2840 Left this one out by accident.
2842 * src/frontends/xforms/FormBase.h (restore): default to calling
2843 update() since that will restore the original/currently-applied values.
2844 Any input() triggered error messages will require the derived classes
2845 to redefine restore().
2847 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2848 avoid a segfault. combo_doc_class is the main concern.
2850 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2852 * Simplify build-listerrors in view of GUI-less export ability!
2854 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2856 * src/lyx_main.C (easyParse): Disable gui when exporting
2858 * src/insets/figinset.C:
2861 * src/lyx_gui_misc.C
2862 * src/tabular.C: Changes to allow no-gui.
2864 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2866 * src/support/utility.hpp: removed file
2867 * src/support/block.h: removed file
2869 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2872 * src/mathed/formula.C: add support/lyxlib.h
2873 * src/mathed/formulamacro.C: ditto
2875 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2876 * src/lyxparagraph.h: ditto
2878 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2879 * src/frontends/Makefile.am (INCLUDES): ditto
2880 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2881 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2882 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2883 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2884 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2885 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2887 * src/BufferView.h: use boost/utility.hpp
2888 * src/LColor.h: ditto
2889 * src/LaTeX.h: ditto
2890 * src/LyXAction.h: ditto
2891 * src/LyXView.h: ditto
2892 * src/bufferlist.h: ditto
2893 * src/lastfiles.h: ditto
2894 * src/layout.h: ditto
2895 * src/lyx_gui.h: ditto
2896 * src/lyx_main.h: ditto
2897 * src/lyxlex.h: ditto
2898 * src/lyxrc.h: ditto
2899 * src/frontends/ButtonPolicies.h: ditto
2900 * src/frontends/Dialogs.h: ditto
2901 * src/frontends/xforms/FormBase.h: ditto
2902 * src/frontends/xforms/FormGraphics.h: ditto
2903 * src/frontends/xforms/FormParagraph.h: ditto
2904 * src/frontends/xforms/FormTabular.h: ditto
2905 * src/graphics/GraphicsCache.h: ditto
2906 * src/graphics/Renderer.h: ditto
2907 * src/insets/ExternalTemplate.h: ditto
2908 * src/insets/insetcommand.h: ditto
2909 * src/support/path.h: ditto
2911 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2912 and introduce clause for 2.97.
2914 * boost/libs/README: new file
2916 * boost/boost/utility.hpp: new file
2918 * boost/boost/config.hpp: new file
2920 * boost/boost/array.hpp: new file
2922 * boost/Makefile.am: new file
2924 * boost/.cvsignore: new file
2926 * configure.in (AC_OUTPUT): add boost/Makefile
2928 * Makefile.am (SUBDIRS): add boost
2930 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2932 * src/support/lstrings.C (suffixIs): Fixed.
2934 2000-10-01 Allan Rae <rae@lyx.org>
2936 * src/PrinterParams.h: moved things around to avoid the "can't
2937 inline call" warning.
2939 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2940 into doc++ documentation.
2942 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2944 * src/frontends/xforms/FormRef.C: make use of button controller
2945 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2946 cleaned up button controller usage.
2947 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2948 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2949 use the button controller
2951 * src/frontends/xforms/forms/*.fd: and associated generated files
2952 updated to reflect changes to FormBase. Some other FormXxxx files
2953 also got minor updates to reflect changes to FormBase.
2955 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2956 (hide): made virtual.
2957 (input): return a bool. true == valid input
2958 (RestoreCB, restore): new
2959 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2960 Changes to allow derived dialogs to use a ButtonController and
2961 make sense when doing so: OK button calls ok() and so on.
2963 * src/frontends/xforms/ButtonController.h (class ButtonController):
2964 Switch from template implementation to taking Policy parameter.
2965 Allows FormBase to provide a ButtonController for any dialog.
2967 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2968 Probably should rename connect and disconnect.
2969 (apply): use the radio button groups
2970 (form): needed by FormBase
2971 (build): setup the radio button groups
2973 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2975 * several files: type changes to reduce the number of warnings and
2976 to unify type hangling a bit. Still much to do.
2978 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2980 * lib/images/*: rename a bunch of icons to match Dekel converter
2983 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2986 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2988 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2990 * sigc++/handle.h: ditto for class Handle.
2992 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2994 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2996 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2998 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2999 removal of the "default" language.
3001 * src/combox.h (getline): Check that sel > 0
3003 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3005 * lib/examples/docbook_example.lyx
3006 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3008 * lib/layouts/docbook-book.layout: new docbook book layout.
3010 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3012 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3014 * src/insets/figinset.C (DocBook):fixed small typo.
3016 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3018 * src/insets/insetinclude.h: string include_label doesn't need to be
3021 2000-09-29 Allan Rae <rae@lyx.org>
3023 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3024 Allow derived type to control connection and disconnection from signals
3025 of its choice if desired.
3027 2000-09-28 Juergen Vigna <jug@sad.it>
3029 * src/insets/insettabular.C (update): fixed cursor setting when
3030 the_locking_inset changed.
3031 (draw): made this a bit cleaner.
3032 (InsetButtonPress): fixed!
3034 * various files: added LyXText Parameter to fitCursor call.
3036 * src/BufferView.C (fitCursor): added LyXText parameter.
3038 * src/insets/insettabular.C (draw): small draw fix.
3040 * src/tabular.C: right setting of left/right celllines.
3042 * src/tabular.[Ch]: fixed various types in funcions and structures.
3043 * src/insets/insettabular.C: ditto
3044 * src/frontends/xforms/FormTabular.C: ditto
3046 2000-09-28 Allan Rae <rae@lyx.org>
3048 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3049 that the #ifdef's had been applied to part of what should have been
3050 a complete condition. It's possible there are other tests that
3051 were specific to tables that are also wrong now that InsetTabular is
3052 being used. Now we need to fix the output of '\n' after a table in a
3053 float for the same reason as the original condition:
3054 "don't insert this if we would be adding it before or after a table
3055 in a float. This little trick is needed in order to allow use of
3056 tables in \subfigures or \subtables."
3057 Juergen can you check this?
3059 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3061 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3062 output to the ostream.
3064 * several files: fixed types based on warnings from cxx
3066 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3068 * src/frontends/kde/Makefile.am: fix rule for
3069 formindexdialogdata_moc.C
3071 * src/.cvsignore: add ext_l10n.h to ignore
3073 * acconfig.h: stop messing with __STRICT_ANSI__
3074 * config/gnome.m4: remove option to set -ansi
3075 * config/kde.m4: remove option to set -ansi
3076 * config/lyxinclude.m4: don't set -ansi
3078 2000-09-27 Juergen Vigna <jug@sad.it>
3080 * various files: remove "default" language check.
3082 * src/insets/insetquotes.C: removed use of current_view.
3084 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3085 the one should have red ears by now!
3087 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3088 in more then one paragraph. Fixed cursor-movement/selection.
3090 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3091 paragraphs inside a text inset.
3093 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3094 text-inset if this owner is an inset.
3096 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3098 * src/Bullet.h: changed type of font, character and size to int
3100 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3102 * src/insets/inseturl.[Ch]:
3103 * src/insets/insetref.[Ch]:
3104 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3106 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3108 * src/buffer.C (readFile): block-if statement rearranged to minimise
3109 bloat. Patch does not reverse Jean-Marc's change ;-)
3111 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3112 Class rewritten to store pointers to hide/update signals directly,
3113 rather than Dialogs *. Also defined an enum to ease use. All xforms
3114 forms can now be derived from this class.
3116 * src/frontends/xforms/FormCommand.[Ch]
3117 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3119 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3122 * src/frontends/xforms/forms/form_citation.fd
3123 * src/frontends/xforms/forms/form_copyright.fd
3124 * src/frontends/xforms/forms/form_error.fd
3125 * src/frontends/xforms/forms/form_index.fd
3126 * src/frontends/xforms/forms/form_ref.fd
3127 * src/frontends/xforms/forms/form_toc.fd
3128 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3130 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3132 * src/insets/insetfoot.C: removed redundent using directive.
3134 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3136 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3137 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3139 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3140 created in the constructors in different groups. Then set() just
3141 have to show the groups as needed. This fixes the redraw problems
3142 (and is how the old menu code worked).
3144 * src/support/lyxlib.h: declare the methods as static when we do
3145 not have namespaces.
3147 2000-09-26 Juergen Vigna <jug@sad.it>
3149 * src/buffer.C (asciiParagraph): new function.
3150 (writeFileAscii): new function with parameter ostream.
3151 (writeFileAscii): use now asciiParagraph.
3153 * various inset files: added the linelen parameter to the Ascii-func.
3155 * src/tabular.C (Write): fixed error in writing file introduced by
3156 the last changes from Lars.
3158 * lib/bind/menus.bind: removed not supported functions.
3160 * src/insets/insettext.C (Ascii): implemented this function.
3162 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3164 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3165 (Write): use of the write_attribute functions.
3167 * src/bufferlist.C (close): fixed reasking question!
3169 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3171 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3172 new files use the everwhere possible.
3175 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3176 src/log_form.C src/lyx.C:
3179 * src/buffer.C (runLaTeX): remove func
3181 * src/PaperLayout.C: removed file
3182 * src/ParagraphExtra.C: likewise
3183 * src/bullet_forms.C: likewise
3184 * src/bullet_forms.h: likewise
3185 * src/bullet_forms_cb.C: likewise
3187 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3188 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3191 * several files: remove all traces of the old fd_form_paragraph,
3192 and functions belonging to that.
3194 * several files: remove all traces of the old fd_form_document,
3195 and functions belonging to that.
3197 * several files: constify local variables were possible.
3199 * several files: remove all code that was dead when NEW_EXPORT was
3202 * several files: removed string::c_str in as many places as
3205 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3206 (e): be a bit more outspoken when patching
3207 (updatesrc): only move files if changed.
3209 * forms/layout_forms.h.patch: regenerated
3211 * forms/layout_forms.fd: remove form_document and form_paragraph
3212 and form_quotes and form_paper and form_table_options and
3213 form_paragraph_extra
3215 * forms/form1.fd: remove form_table
3217 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3218 the fdui->... rewrite. Update some comments to xforms 0.88
3220 * forms/bullet_forms.C.patch: removed file
3221 * forms/bullet_forms.fd: likewise
3222 * forms/bullet_forms.h.patch: likewise
3224 * development/Code_rules/Rules: added a section on switch
3225 statements. Updated some comment to xforms 0.88.
3227 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3229 * src/buffer.C (readFile): make sure that the whole version number
3230 is read after \lyxformat (even when it contains a comma)
3232 * lib/ui/default.ui: change shortcut of math menu to M-a.
3234 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3236 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3239 * src/LyXView.C (updateWindowTitle): show the full files name in
3240 window title, limited to 30 characters.
3242 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3243 When a number of characters has been given, we should not assume
3244 that the string is 0-terminated.
3246 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3247 calls (fixes some memory leaks)
3249 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3250 trans member on exit.
3252 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3254 * src/converter.C (GetReachable): fix typo.
3256 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3257 understand ',' instead of '.'.
3258 (GetInteger): rewrite to use strToInt().
3260 2000-09-26 Juergen Vigna <jug@sad.it>
3262 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3263 better visibility and error-message on wrong VSpace input.
3265 * src/language.C (initL): added english again.
3267 2000-09-25 Juergen Vigna <jug@sad.it>
3269 * src/frontends/kde/Dialogs.C (Dialogs):
3270 * src/frontends/gnome/Dialogs.C (Dialogs):
3271 * src/frontends/kde/Makefile.am:
3272 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3274 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3276 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3278 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3280 * src/frontends/xforms/FormParagraph.C:
3281 * src/frontends/xforms/FormParagraph.h:
3282 * src/frontends/xforms/form_paragraph.C:
3283 * src/frontends/xforms/form_paragraph.h:
3284 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3287 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3289 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3290 Paragraph-Data after use.
3292 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3293 non breakable paragraphs.
3295 2000-09-25 Garst R. Reese <reese@isn.net>
3297 * src/language.C (initL): added missing language_country codes.
3299 2000-09-25 Juergen Vigna <jug@sad.it>
3301 * src/insets/insettext.C (InsetText):
3302 (deleteLyXText): remove the not released LyXText structure!
3304 2000-09-24 Marko Vendelin <markov@ioc.ee>
3306 * src/frontends/gnome/mainapp.C
3307 * src/frontends/gnome/mainapp.h: added support for keyboard
3310 * src/frontends/gnome/FormCitation.C
3311 * src/frontends/gnome/FormCitation.h
3312 * src/frontends/gnome/Makefile.am
3313 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3314 FormCitation to use "action area" in mainapp window
3316 * src/frontends/gnome/Menubar_pimpl.C
3317 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3320 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3322 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3323 width/descent/ascent values if name is empty.
3324 (mathed_string_height): Use std::max.
3326 2000-09-25 Allan Rae <rae@lyx.org>
3328 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3329 segfault. This will be completely redesigned soon.
3331 * sigc++: updated libsigc++. Fixes struct timespec bug.
3333 * development/tools/makeLyXsigc.sh: .cvsignore addition
3335 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3337 * several files: removed almost all traces of the old table
3340 * src/TableLayout.C: removed file
3342 2000-09-22 Juergen Vigna <jug@sad.it>
3344 * src/frontends/kde/Dialogs.C: added credits forms.
3346 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3348 * src/frontends/gnome/Dialogs.C: added some forms.
3350 * src/spellchecker.C (init_spell_checker): set language in pspell code
3351 (RunSpellChecker): some modifications for setting language string.
3353 * src/language.[Ch]: added language_country code.
3355 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3357 * src/frontends/Dialogs.h: added new signal showError.
3358 Rearranged existing signals in some sort of alphabetical order.
3360 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3361 FormError.[Ch], form_error.[Ch]
3362 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3363 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3365 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3366 dialogs. I think that this can be used as the base to all these
3369 * src/frontends/xforms/FormError.[Ch]
3370 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3371 implementation of InsetError dialog.
3373 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3375 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3376 * src/frontends/kde/Makefile.am: ditto
3378 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3380 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3381 macrobf. This fixes a bug of invisible text.
3383 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3385 * lib/doc/LaTeXConfig.lyx.in: updated.
3387 * src/language.C (initL): remove language "francais" and change a
3388 bit the names of the two other french variations.
3390 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3391 string that may not be 0-terminated.
3393 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3395 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3397 2000-09-20 Marko Vendelin <markov@ioc.ee>
3399 * src/frontends/gnome/FormCitation.C
3400 * src/frontends/gnome/FormIndex.C
3401 * src/frontends/gnome/FormToc.C
3402 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3403 the variable initialization to shut up the warnings
3405 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3407 * src/table.[Ch]: deleted files
3409 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3412 2000-09-18 Juergen Vigna <jug@sad.it>
3414 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3415 problems with selection. Inserted new LFUN_PASTESELECTION.
3416 (InsetButtonPress): inserted handling of middle mouse-button paste.
3418 * src/spellchecker.C: changed word to word.c_str().
3420 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3422 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3423 included in the ``make dist'' tarball.
3425 2000-09-15 Juergen Vigna <jug@sad.it>
3427 * src/CutAndPaste.C (cutSelection): small fix return the right
3428 end position after cut inside one paragraph only.
3430 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3431 we are locked as otherwise we don't have a valid cursor position!
3433 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3435 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3437 * src/frontends/kde/FormRef.C: added using directive.
3438 * src/frontends/kde/FormToc.C: ditto
3440 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3442 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3444 2000-09-19 Marko Vendelin <markov@ioc.ee>
3446 * src/frontends/gnome/Menubar_pimpl.C
3447 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3448 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3450 * src/frontends/gnome/mainapp.C
3451 * src/frontends/gnome/mainapp.h: support for menu update used
3454 * src/frontends/gnome/mainapp.C
3455 * src/frontends/gnome/mainapp.h: support for "action" area in the
3456 main window. This area is used by small simple dialogs, such as
3459 * src/frontends/gnome/FormIndex.C
3460 * src/frontends/gnome/FormIndex.h
3461 * src/frontends/gnome/FormUrl.C
3462 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3465 * src/frontends/gnome/FormCitation.C
3466 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3467 action area. Only "Insert new citation" is implemented.
3469 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3471 * src/buffer.C (Dispatch): fix call to Dispatch
3472 * src/insets/insetref.C (Edit): likewise
3473 * src/insets/insetparent.C (Edit): likewise
3474 * src/insets/insetinclude.C (include_cb): likewise
3475 * src/frontends/xforms/FormUrl.C (apply): likewise
3476 * src/frontends/xforms/FormToc.C (apply): likewise
3477 * src/frontends/xforms/FormRef.C (apply): likewise
3478 * src/frontends/xforms/FormIndex.C (apply): likewise
3479 * src/frontends/xforms/FormCitation.C (apply): likewise
3480 * src/lyxserver.C (callback): likewise
3481 * src/lyxfunc.C (processKeySym): likewise
3482 (Dispatch): likewise
3483 (Dispatch): likewise
3484 * src/lyx_cb.C (LayoutsCB): likewise
3486 * Makefile.am (sourcedoc): small change
3488 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3490 * src/main.C (main): Don't make an empty GUIRunTime object. all
3491 methods are static. constify a bit remove unneded using + headers.
3493 * src/tabular.C: some more const to local vars move some loop vars
3495 * src/spellchecker.C: added some c_str after some word for pspell
3497 * src/frontends/GUIRunTime.h: add new static method setDefaults
3498 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3499 * src/frontends/kde/GUIRunTime.C (setDefaults):
3500 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3502 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3503 with strnew in arg, use correct emptystring when calling SetName.
3505 * several files: remove all commented code with relation to
3506 HAVE_SSTREAM beeing false. We now only support stringstream and
3509 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3511 * src/lyxfunc.C: construct correctly the automatic new file
3514 * src/text2.C (IsStringInText): change type of variable i to shut
3517 * src/support/sstream.h: do not use namespaces if the compiler
3518 does not support them.
3520 2000-09-15 Marko Vendelin <markov@ioc.ee>
3521 * src/frontends/gnome/FormCitation.C
3522 * src/frontends/gnome/FormCitation.h
3523 * src/frontends/gnome/diainsertcitation_interface.c
3524 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3525 regexp support to FormCitation [Gnome].
3527 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3530 * configure.in: remove unused KDE/GTKGUI define
3532 * src/frontends/kde/FormRef.C
3533 * src/frontends/kde/FormRef.h
3534 * src/frontends/kde/formrefdialog.C
3535 * src/frontends/kde/formrefdialog.h: double click will
3536 go to reference, now it is possible to change a cross-ref
3539 * src/frontends/kde/FormToc.C
3540 * src/frontends/kde/FormToc.h
3541 * src/frontends/kde/formtocdialog.C
3542 * src/frontends/kde/formtocdialog.h: add a depth
3545 * src/frontends/kde/Makefile.am: add QtLyXView.h
3548 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3550 * src/frontends/kde/FormCitation.h: added some using directives.
3552 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3554 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3557 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3560 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3562 * src/buffer.C (pop_tag): revert for the second time a change by
3563 Lars, who seems to really hate having non-local loop variables :)
3565 * src/Lsstream.h: add "using" statements.
3567 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3568 * src/buffer.C (writeFile): ditto
3570 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3572 * src/buffer.C (writeFile): try to fix the locale modified format
3573 number to always be as we want it.
3575 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3576 in XForms 0.89. C-space is now working again.
3578 * src/Lsstream.h src/support/sstream.h: new files.
3580 * also commented out all cases where strstream were used.
3582 * src/Bullet.h (c_str): remove method.
3584 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3586 * a lot of files: get rid of "char const *" and "char *" is as
3587 many places as possible. We only want to use them in interaction
3588 with system of other libraries, not inside lyx.
3590 * a lot of files: return const object is not of pod type. This
3591 helps ensure that temporary objects is not modified. And fits well
3592 with "programming by contract".
3594 * configure.in: check for the locale header too
3596 * Makefile.am (sourcedoc): new tag for generation of doc++
3599 2000-09-14 Juergen Vigna <jug@sad.it>
3601 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3602 callback to check which combo called it and do the right action.
3604 * src/combox.C (combo_cb): added combo * to the callbacks.
3605 (Hide): moved call of callback after Ungrab of the pointer.
3607 * src/intl.h: removed LCombo2 function.
3609 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3610 function as this can now be handled in one function.
3612 * src/combox.h: added Combox * to callback prototype.
3614 * src/frontends/xforms/Toolbar_pimpl.C:
3615 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3617 2000-09-14 Garst Reese <reese@isn.net>
3619 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3620 moved usepackage{xxx}'s to beginning of file. Changed left margin
3621 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3622 underlining from title. Thanks to John Culleton for useful suggestions.
3624 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3626 * src/lyxlex_pimpl.C (setFile): change error message to debug
3629 2000-09-13 Juergen Vigna <jug@sad.it>
3631 * src/frontends/xforms/FormDocument.C: implemented choice_class
3632 as combox and give callback to combo_language so OK/Apply is activated
3635 * src/bufferlist.C (newFile): small fix so already named files
3636 (via an open call) are not requested to be named again on the
3639 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3641 * src/frontends/kde/Makefile.am
3642 * src/frontends/kde/FormRef.C
3643 * src/frontends/kde/FormRef.h
3644 * src/frontends/kde/formrefdialog.C
3645 * src/frontends/kde/formrefdialog.h: implement
3648 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3650 * src/frontends/kde/formtocdialog.C
3651 * src/frontends/kde/formtocdialog.h
3652 * src/frontends/kde/FormToc.C
3653 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3655 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3657 * src/frontends/kde/FormCitation.C: fix thinko
3658 where we didn't always display the reference text
3661 * src/frontends/kde/formurldialog.C
3662 * src/frontends/kde/formurldialog.h
3663 * src/frontends/kde/FormUrl.C
3664 * src/frontends/kde/FormUrl.h: minor cleanups
3666 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3668 * src/frontends/kde/Makefile.am
3669 * src/frontends/kde/FormToc.C
3670 * src/frontends/kde/FormToc.h
3671 * src/frontends/kde/FormCitation.C
3672 * src/frontends/kde/FormCitation.h
3673 * src/frontends/kde/FormIndex.C
3674 * src/frontends/kde/FormIndex.h
3675 * src/frontends/kde/formtocdialog.C
3676 * src/frontends/kde/formtocdialog.h
3677 * src/frontends/kde/formcitationdialog.C
3678 * src/frontends/kde/formcitationdialog.h
3679 * src/frontends/kde/formindexdialog.C
3680 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3682 2000-09-12 Juergen Vigna <jug@sad.it>
3684 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3687 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3689 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3692 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3694 * src/converter.C (Add, Convert): Added support for converter flags:
3695 needaux, resultdir, resultfile.
3696 (Convert): Added new parameter view_file.
3697 (dvips_options): Fixed letter paper option.
3699 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3700 (Export, GetExportableFormats, GetViewableFormats): Added support
3703 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3705 (easyParse): Fixed to work with new export code.
3707 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3710 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3712 * lib/bind/*.bind: Replaced
3713 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3714 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3716 2000-09-11 Juergen Vigna <jug@sad.it>
3718 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3720 * src/main.C (main): now GUII defines global guiruntime!
3722 * src/frontends/gnome/GUIRunTime.C (initApplication):
3723 * src/frontends/kde/GUIRunTime.C (initApplication):
3724 * src/frontends/xforms/GUIRunTime.C (initApplication):
3725 * src/frontends/GUIRunTime.h: added new function initApplication.
3727 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3729 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3731 2000-09-08 Juergen Vigna <jug@sad.it>
3733 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3734 we have already "Reset".
3736 * src/language.C (initL): inserted "default" language and made this
3737 THE default language (and not american!)
3739 * src/paragraph.C: inserted handling of "default" language!
3741 * src/lyxfont.C: ditto
3745 * src/paragraph.C: output the \\par only if we have a following
3746 paragraph otherwise it's not needed.
3748 2000-09-05 Juergen Vigna <jug@sad.it>
3750 * config/pspell.m4: added entry to lyx-flags
3752 * src/spellchecker.C: modified version from Kevin for using pspell
3754 2000-09-01 Marko Vendelin <markov@ioc.ee>
3755 * src/frontends/gnome/Makefile.am
3756 * src/frontends/gnome/FormCitation.C
3757 * src/frontends/gnome/FormCitation.h
3758 * src/frontends/gnome/diainsertcitation_callbacks.c
3759 * src/frontends/gnome/diainsertcitation_callbacks.h
3760 * src/frontends/gnome/diainsertcitation_interface.c
3761 * src/frontends/gnome/diainsertcitation_interface.h
3762 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3763 dialog for Gnome frontend
3765 * src/main.C: Gnome libraries require keeping application name
3766 and its version as strings
3768 * src/frontends/gnome/mainapp.C: Change the name of the main window
3769 from GnomeLyX to PACKAGE
3771 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3773 * src/frontends/Liason.C: add "using: declaration.
3775 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3777 * src/mathed/math_macro.C (Metrics): Set the size of the template
3779 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3781 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3783 * src/converter.C (add_options): New function.
3784 (SetViewer): Change $$FName into '$$FName'.
3785 (View): Add options when running xdvi
3786 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3787 (Convert): The 3rd parameter is now the desired filename. Converts
3788 calls to lyx::rename if necessary.
3789 Add options when running dvips.
3790 (dvi_papersize,dvips_options): New methods.
3792 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3794 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3795 using a call to Converter::dvips_options.
3796 Fixed to work with nex export code.
3798 * src/support/copy.C
3799 * src/support/rename.C: New files
3801 * src/support/syscall.h
3802 * src/support/syscall.C: Added Starttype SystemDontWait.
3804 * lib/ui/default.ui: Changed to work with new export code
3806 * lib/configure.m4: Changed to work with new export code
3808 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3810 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3812 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3813 so that code compiles with DEC cxx.
3815 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3816 to work correctly! Also now supports the additional elements
3819 2000-09-01 Allan Rae <rae@lyx.org>
3821 * src/frontends/ButtonPolicies.C: renamed all the references to
3822 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3824 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3825 since it's a const not a type.
3827 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3829 2000-08-31 Juergen Vigna <jug@sad.it>
3831 * src/insets/figinset.C: Various changes to look if the filename has
3832 an extension and if not add it for inline previewing.
3834 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3836 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3837 make buttonStatus and isReadOnly be const methods. (also reflect
3838 this in derived classes.)
3840 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3841 (nextState): change to be static inline, pass the StateMachine as
3843 (PreferencesPolicy): remove casts
3844 (OkCancelPolicy): remvoe casts
3845 (OkCancelReadOnlyPolicy): remove casts
3846 (NoRepeatedApplyReadOnlyPolicy): remove casts
3847 (OkApplyCancelReadOnlyPolicy): remove casts
3848 (OkApplyCancelPolicy): remove casts
3849 (NoRepeatedApplyPolicy): remove casts
3851 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3853 * src/converter.C: added some using directives
3855 * src/frontends/ButtonPolicies.C: changes to overcome
3856 "need lvalue" error with DEC c++
3858 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3859 to WMHideCB for DEC c++
3861 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3863 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3864 to BulletBMTableCB for DEC c++
3866 2000-08-31 Allan Rae <rae@lyx.org>
3868 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3869 character dialog separately from old document dialogs combo_language.
3872 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3874 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3875 Removed LFUN_REF_CREATE.
3877 * src/MenuBackend.C: Added new tags: toc and references
3879 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3880 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3882 (add_toc, add_references): New methods.
3883 (create_submenu): Handle correctly the case when there is a
3884 seperator after optional menu items.
3886 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3887 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3888 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3890 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3892 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3894 * src/converter.[Ch]: New file for converting between different
3897 * src/export.[Ch]: New file for exporting a LyX file to different
3900 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3901 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3902 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3903 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3904 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3905 RunDocBook, MenuExport.
3907 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3908 Exporter::Preview methods if NEW_EXPORT is defined.
3910 * src/buffer.C (Dispatch): Use Exporter::Export.
3912 * src/lyxrc.C: Added new tags: \converter and \viewer.
3915 * src/LyXAction.C: Define new lyx-function: buffer-update.
3916 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3917 when NEW_EXPORT is defined.
3919 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3921 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3923 * lib/ui/default.ui: Added submenus "view" and "update" to the
3926 * src/filetools.C (GetExtension): New function.
3928 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3930 2000-08-29 Allan Rae <rae@lyx.org>
3932 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3934 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3935 (EnableDocumentLayout): removed
3936 (DisableDocumentLayout): removed
3937 (build): make use of ButtonController's read-only handling to
3938 de/activate various objects. Replaces both of the above functions.
3940 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3941 (readOnly): was read_only
3942 (refresh): fixed dumb mistakes with read_only_ handling
3944 * src/frontends/xforms/forms/form_document.fd:
3945 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3946 tabbed dialogs so the tabs look more like tabs and so its easier to
3947 work out which is the current tab.
3949 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3950 segfault with form_table
3952 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3954 2000-08-28 Juergen Vigna <jug@sad.it>
3956 * acconfig.h: added USE_PSPELL.
3958 * src/config.h.in: added USE_PSPELL.
3960 * autogen.sh: added pspell.m4
3962 * config/pspell.m4: new file.
3964 * src/spellchecker.C: implemented support for pspell libary.
3966 2000-08-25 Juergen Vigna <jug@sad.it>
3968 * src/LyXAction.C (init): renamed LFUN_TABLE to
3969 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3971 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3973 * src/lyxscreen.h: add force_clear variable and fuction to force
3974 a clear area when redrawing in LyXText.
3976 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3978 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3980 * some whitespace and comment changes.
3982 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3984 * src/buffer.C: up te LYX_FORMAT to 2.17
3986 2000-08-23 Juergen Vigna <jug@sad.it>
3988 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3991 * src/insets/insettabular.C (pasteSelection): delete the insets
3992 LyXText as it is not valid anymore.
3993 (copySelection): new function.
3994 (pasteSelection): new function.
3995 (cutSelection): new function.
3996 (LocalDispatch): implemented cut/copy/paste of cell selections.
3998 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3999 don't have a LyXText.
4001 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4003 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4006 2000-08-22 Juergen Vigna <jug@sad.it>
4008 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4009 ifdef form_table out if NEW_TABULAR.
4011 2000-08-21 Juergen Vigna <jug@sad.it>
4013 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4014 (draw): fixed draw position so that the cursor is positioned in the
4016 (InsetMotionNotify): hide/show cursor so the position is updated.
4017 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4018 using cellstart() function where it should be used.
4020 * src/insets/insettext.C (draw): ditto.
4022 * src/tabular.C: fixed initialization of some missing variables and
4023 made BoxType into an enum.
4025 2000-08-22 Marko Vendelin <markov@ioc.ee>
4026 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4027 stock menu item using action numerical value, not its string
4031 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4033 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4034 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4036 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4038 * src/frontends/xforms/GUIRunTime.C: new file
4040 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4041 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4043 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4045 * src/frontends/kde/GUIRunTime.C: new file
4047 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4048 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4050 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4052 * src/frontends/gnome/GUIRunTime.C: new file
4054 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4057 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4058 small change to documetentation.
4060 * src/frontends/GUIRunTime.C: removed file
4062 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4064 * src/lyxparagraph.h: enable NEW_TABULAR as default
4066 * src/lyxfunc.C (processKeySym): remove some commented code
4068 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4069 NEW_TABULAR around the fd_form_table_options.
4071 * src/lyx_gui.C (runTime): call the static member function as
4072 GUIRunTime::runTime().
4074 2000-08-21 Allan Rae <rae@lyx.org>
4076 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4079 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4081 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4083 2000-08-21 Allan Rae <rae@lyx.org>
4085 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4086 keep Garst happy ;-)
4087 * src/frontends/xforms/FormPreferences.C (build): use setOK
4088 * src/frontends/xforms/FormDocument.C (build): use setOK
4089 (FormDocument): use the appropriate policy.
4091 2000-08-21 Allan Rae <rae@lyx.org>
4093 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4094 automatic [de]activation of arbitrary objects when in a read-only state.
4096 * src/frontends/ButtonPolicies.h: More documentation
4097 (isReadOnly): added to support the above.
4099 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4101 2000-08-18 Juergen Vigna <jug@sad.it>
4103 * src/insets/insettabular.C (getStatus): changed to return func_status.
4105 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4106 display toggle menu entries if they are.
4108 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4109 new document layout now.
4111 * src/lyxfunc.C: ditto
4113 * src/lyx_gui_misc.C: ditto
4115 * src/lyx_gui.C: ditto
4117 * lib/ui/default.ui: removed paper and quotes layout as they are now
4118 all in the document layout tabbed folder.
4120 * src/frontends/xforms/forms/form_document.fd: added Restore
4121 button and callbacks for all inputs for Allan's ButtonPolicy.
4123 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4124 (CheckChoiceClass): added missing params setting on class change.
4125 (UpdateLayoutDocument): added for updating the layout on params.
4126 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4127 (FormDocument): Implemented Allan's ButtonPolicy with the
4130 2000-08-17 Allan Rae <rae@lyx.org>
4132 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4133 so we can at least see the credits again.
4135 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4136 controller calls for the appropriate callbacks. Note that since Ok
4137 calls apply followed by cancel, and apply isn't a valid input for the
4138 APPLIED state, the bc_ calls have to be made in the static callback not
4139 within each of the real callbacks.
4141 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4142 (setOk): renamed from setOkay()
4144 2000-08-17 Juergen Vigna <jug@sad.it>
4146 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4147 in the implementation part.
4148 (composeUIInfo): don't show optional menu-items.
4150 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4152 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4154 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4155 text-state when in a text-inset.
4157 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4159 2000-08-17 Marko Vendelin <markov@ioc.ee>
4160 * src/frontends/gnome/FormIndex.C
4161 * src/frontends/gnome/FormIndex.h
4162 * src/frontends/gnome/FormToc.C
4163 * src/frontends/gnome/FormToc.h
4164 * src/frontends/gnome/dialogs
4165 * src/frontends/gnome/diatoc_callbacks.c
4166 * src/frontends/gnome/diatoc_callbacks.h
4167 * src/frontends/gnome/diainsertindex_callbacks.h
4168 * src/frontends/gnome/diainsertindex_callbacks.c
4169 * src/frontends/gnome/diainsertindex_interface.c
4170 * src/frontends/gnome/diainsertindex_interface.h
4171 * src/frontends/gnome/diatoc_interface.h
4172 * src/frontends/gnome/diatoc_interface.c
4173 * src/frontends/gnome/Makefile.am: Table of Contents and
4174 Insert Index dialogs implementation for Gnome frontend
4176 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4178 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4180 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4183 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4185 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4186 destructor. Don't definde if you don't need it
4187 (processEvents): made static, non-blocking events processing for
4189 (runTime): static method. event loop for xforms
4190 * similar as above for kde and gnome.
4192 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4193 new Pimpl is correct
4194 (runTime): new method calss the real frontends runtime func.
4196 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4198 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4200 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4202 2000-08-16 Juergen Vigna <jug@sad.it>
4204 * src/lyx_gui.C (runTime): added GUII RunTime support.
4206 * src/frontends/Makefile.am:
4207 * src/frontends/GUIRunTime.[Ch]:
4208 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4209 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4210 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4212 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4214 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4215 as this is already set in ${FRONTEND_INCLUDE} if needed.
4217 * configure.in (CPPFLAGS): setting the include dir for the frontend
4218 directory and don't set FRONTEND=xforms for now as this is executed
4221 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4223 * src/frontends/kde/Makefile.am:
4224 * src/frontends/kde/FormUrl.C:
4225 * src/frontends/kde/FormUrl.h:
4226 * src/frontends/kde/formurldialog.h:
4227 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4229 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4231 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4233 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4235 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4238 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4240 * src/WorkArea.C (work_area_handler): more work to get te
4241 FL_KEYBOARD to work with xforms 0.88 too, please test.
4243 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4245 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4247 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4250 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4252 * src/Timeout.h: remove Qt::emit hack.
4254 * several files: changes to allo doc++ compilation
4256 * src/lyxfunc.C (processKeySym): new method
4257 (processKeyEvent): comment out if FL_REVISION < 89
4259 * src/WorkArea.C: change some debugging levels.
4260 (WorkArea): set wantkey to FL_KEY_ALL
4261 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4262 clearer code and the use of compose with XForms 0.89. Change to
4263 use signals instead of calling methods in bufferview directly.
4265 * src/Painter.C: change some debugging levels.
4267 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4270 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4271 (workAreaKeyPress): new method
4273 2000-08-14 Juergen Vigna <jug@sad.it>
4275 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4277 * config/kde.m4: addes some features
4279 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4280 include missing xforms dialogs.
4282 * src/Timeout.h: a hack to be able to compile with qt/kde.
4284 * sigc++/.cvsignore: added acinclude.m4
4286 * lib/.cvsignore: added listerros
4288 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4289 xforms tree as objects are needed for other frontends.
4291 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4292 linking with not yet implemented xforms objects.
4294 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4296 2000-08-14 Baruch Even <baruch.even@writeme.com>
4298 * src/frontends/xforms/FormGraphics.h:
4299 * src/frontends/xforms/FormGraphics.C:
4300 * src/frontends/xforms/RadioButtonGroup.h:
4301 * src/frontends/xforms/RadioButtonGroup.C:
4302 * src/insets/insetgraphics.h:
4303 * src/insets/insetgraphics.C:
4304 * src/insets/insetgraphicsParams.h:
4305 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4306 instead of spaces, and various other indentation issues to make the
4307 sources more consistent.
4309 2000-08-14 Marko Vendelin <markov@ioc.ee>
4311 * src/frontends/gnome/dialogs/diaprint.glade
4312 * src/frontends/gnome/FormPrint.C
4313 * src/frontends/gnome/FormPrint.h
4314 * src/frontends/gnome/diaprint_callbacks.c
4315 * src/frontends/gnome/diaprint_callbacks.h
4316 * src/frontends/gnome/diaprint_interface.c
4317 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4320 * src/frontends/gnome/dialogs/diainserturl.glade
4321 * src/frontends/gnome/FormUrl.C
4322 * src/frontends/gnome/FormUrl.h
4323 * src/frontends/gnome/diainserturl_callbacks.c
4324 * src/frontends/gnome/diainserturl_callbacks.h
4325 * src/frontends/gnome/diainserturl_interface.c
4326 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4327 Gnome implementation
4329 * src/frontends/gnome/Dialogs.C
4330 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4331 all other dialogs. Copy all unimplemented dialogs from Xforms
4334 * src/frontends/gnome/support.c
4335 * src/frontends/gnome/support.h: support files generated by Glade
4339 * config/gnome.m4: Gnome configuration scripts
4341 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4342 configure --help message
4344 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4345 only if there are no events pendling in Gnome/Gtk. This enhances
4346 the performance of menus.
4349 2000-08-14 Allan Rae <rae@lyx.org>
4351 * lib/Makefile.am: listerrors cleaning
4353 * lib/listerrors: removed -- generated file
4354 * acinclude.m4: ditto
4355 * sigc++/acinclude.m4: ditto
4357 * src/frontends/xforms/forms/form_citation.fd:
4358 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4361 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4362 `updatesrc` and now we have a `test` target that does what `updatesrc`
4363 used to do. I didn't like having an install target that wasn't related
4366 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4367 on all except FormGraphics. This may yet happen. Followed by a major
4368 cleanup including using FL_TRANSIENT for most of the dialogs. More
4369 changes to come when the ButtonController below is introduced.
4371 * src/frontends/xforms/ButtonController.h: New file for managing up to
4372 four buttons on a dialog according to an externally defined policy.
4373 * src/frontends/xforms/Makefile.am: added above
4375 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4376 Apply and Cancel/Close buttons and everything in between and beyond.
4377 * src/frontends/Makefile.am: added above.
4379 * src/frontends/xforms/forms/form_preferences.fd:
4380 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4381 and removed variable 'status' as a result. Fixed the set_minsize thing.
4382 Use the new screen-font-update after checking screen fonts were changed
4383 Added a "Restore" button to restore the original lyxrc values while
4384 editing. This restores everything not just the last input changed.
4385 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4387 * src/LyXAction.C: screen-font-update added for updating buffers after
4388 screen font settings have been changed.
4389 * src/commandtags.h: ditto
4390 * src/lyxfunc.C: ditto
4392 * forms/lyx.fd: removed screen fonts dialog.
4393 * src/lyx_gui.C: ditto
4394 * src/menus.[Ch]: ditto
4395 * src/lyx.[Ch]: ditto
4396 * src/lyx_cb.C: ditto + code from here moved to make
4397 screen-font-update. And people wonder why progress on GUII is
4398 slow. Look at how scattered this stuff was! It takes forever
4401 * forms/fdfix.sh: Fixup the spacing after commas.
4402 * forms/makefile: Remove date from generated files. Fewer clashes now.
4403 * forms/bullet_forms.C.patch: included someones handwritten changes
4405 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4406 once I've discovered why LyXRC was made noncopyable.
4407 * src/lyx_main.C: ditto
4409 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4411 * src/frontends/xforms/forms/fdfix.sh:
4412 * src/frontends/xforms/forms/fdfixh.sed:
4413 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4414 * src/frontends/xforms/Form*.[hC]:
4415 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4416 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4417 provide a destructor for the struct FD_form_xxxx. Another version of
4418 the set_[max|min]size workaround and a few other cleanups. Actually,
4419 Angus' patch from 20000809.
4421 2000-08-13 Baruch Even <baruch.even@writeme.com>
4423 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4426 2000-08-11 Juergen Vigna <jug@sad.it>
4428 * src/insets/insetgraphics.C (InsetGraphics): changing init
4429 order because of warnings.
4431 * src/frontends/xforms/forms/makefile: adding patching .C with
4434 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4435 from .C.patch to .c.patch
4437 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4438 order because of warning.
4440 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4442 * src/frontends/Liason.C (setMinibuffer): new helper function
4444 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4446 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4448 * lib/ui/default.ui: commented out PaperLayout entry
4450 * src/frontends/xforms/form_document.[Ch]: new added files
4452 * src/frontends/xforms/FormDocument.[Ch]: ditto
4454 * src/frontends/xforms/forms/form_document.fd: ditto
4456 * src/frontends/xforms/forms/form_document.C.patch: ditto
4458 2000-08-10 Juergen Vigna <jug@sad.it>
4460 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4461 (InsetGraphics): initialized cacheHandle to 0.
4462 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4464 2000-08-10 Baruch Even <baruch.even@writeme.com>
4466 * src/graphics/GraphicsCache.h:
4467 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4468 correctly as a cache.
4470 * src/graphics/GraphicsCacheItem.h:
4471 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4474 * src/graphics/GraphicsCacheItem_pimpl.h:
4475 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4478 * src/insets/insetgraphics.h:
4479 * src/insets/insetgraphics.C: Changed from using a signal notification
4480 to polling when image is not loaded.
4482 2000-08-10 Allan Rae <rae@lyx.org>
4484 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4485 that there are two functions that have to been taken out of line by
4486 hand and aren't taken care of in the script. (Just a reminder note)
4488 * sigc++/macros/*.h.m4: Updated as above.
4490 2000-08-09 Juergen Vigna <jug@sad.it>
4492 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4494 * src/insets/insettabular.C: make drawing of single cell smarter.
4496 2000-08-09 Marko Vendelin <markov@ioc.ee>
4497 * src/frontends/gnome/Menubar_pimpl.C
4498 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4499 implementation: new files
4501 * src/frontends/gnome/mainapp.C
4502 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4505 * src/main.C: create Gnome main window
4507 * src/frontends/xforms/Menubar_pimpl.h
4508 * src/frontends/Menubar.C
4509 * src/frontends/Menubar.h: added method Menubar::update that calls
4510 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4512 * src/LyXView.C: calls Menubar::update to update the state
4515 * src/frontends/gnome/Makefile.am: added new files
4517 * src/frontends/Makefile.am: added frontend compiler options
4519 2000-08-08 Juergen Vigna <jug@sad.it>
4521 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4523 * src/bufferlist.C (close):
4524 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4525 documents if exiting without saving.
4527 * src/buffer.C (save): use removeAutosaveFile()
4529 * src/support/filetools.C (removeAutosaveFile): new function.
4531 * src/lyx_cb.C (MenuWrite): returns a bool now.
4532 (MenuWriteAs): check if file could really be saved and revert to the
4534 (MenuWriteAs): removing old autosavefile if existant.
4536 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4537 before Goto toggle declaration, because of compiler warning.
4539 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4541 * src/lyxfunc.C (MenuNew): small fix.
4543 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4545 * src/bufferlist.C (newFile):
4546 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4548 * src/lyxrc.C: added new_ask_filename tag
4550 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4552 * src/lyx.fd: removed code pertaining to form_ref
4553 * src/lyx.[Ch]: ditto
4554 * src/lyx_cb.C: ditto
4555 * src/lyx_gui.C: ditto
4556 * src/lyx_gui_misc.C: ditto
4558 * src/BufferView_pimpl.C (restorePosition): update buffer only
4561 * src/commandtags.h (LFUN_REFTOGGLE): removed
4562 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4563 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4564 (LFUN_REFBACK): renamed LFUN_REF_BACK
4566 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4567 * src/menus.C: ditto
4568 * src/lyxfunc.C (Dispatch): ditto.
4569 InsertRef dialog is now GUI-independent.
4571 * src/texrow.C: added using std::endl;
4573 * src/insets/insetref.[Ch]: strip out large amounts of code.
4574 The inset is now a container and this functionality is now
4575 managed by a new FormRef dialog
4577 * src/frontends/Dialogs.h (showRef, createRef): new signals
4579 * src/frontends/xforms/FormIndex.[Ch],
4580 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4581 when setting dialog's min/max size
4582 * src/frontends/xforms/FormIndex.[Ch]: ditto
4584 * src/frontends/xforms/FormRef.[Ch],
4585 src/frontends/xforms/forms/form_ref.fd: new xforms
4586 implementation of an InsetRef dialog
4588 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4591 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4592 ios::nocreate is not part of the standard. Removed.
4594 2000-08-07 Baruch Even <baruch.even@writeme.com>
4596 * src/graphics/Renderer.h:
4597 * src/graphics/Renderer.C: Added base class for rendering of different
4598 image formats into Pixmaps.
4600 * src/graphics/XPM_Renderer.h:
4601 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4602 in a different class.
4604 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4605 easily add support for other formats.
4607 * src/insets/figinset.C: plugged a leak of an X resource.
4609 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4611 * src/CutAndPaste.[Ch]: make all metods static.
4613 * development/Code_rules/Rules: more work, added section on
4614 Exceptions, and a References section.
4616 * a lot of header files: work to make doc++ able to generate the
4617 source documentation, some workarounds of doc++ problems. Doc++ is
4618 now able to generate the documentation.
4620 2000-08-07 Juergen Vigna <jug@sad.it>
4622 * src/insets/insettabular.C (recomputeTextInsets): removed function
4624 * src/tabular.C (SetWidthOfMulticolCell):
4626 (calculate_width_of_column_NMC): fixed return value so that it really
4627 only returns true if the column-width has changed (there where
4628 problems with muliticolumn-cells in this column).
4630 2000-08-04 Juergen Vigna <jug@sad.it>
4632 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4633 also on the scrollstatus of the inset.
4634 (workAreaMotionNotify): ditto.
4636 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4638 2000-08-01 Juergen Vigna <jug@sad.it>
4640 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4642 * src/commandtags.h:
4643 * src/LyXAction.C (init):
4644 * src/insets/inset.C (LocalDispatch): added support for
4647 * src/insets/inset.C (scroll): new functions.
4649 * src/insets/insettext.C (removeNewlines): new function.
4650 (SetAutoBreakRows): removes forced newlines in the text of the
4651 paragraph if autoBreakRows is set to false.
4653 * src/tabular.C (Latex): generates a parbox around the cell contents
4656 * src/frontends/xforms/FormTabular.C (local_update): removed
4657 the radio_useparbox button.
4659 * src/tabular.C (UseParbox): new function
4661 2000-08-06 Baruch Even <baruch.even@writeme.com>
4663 * src/graphics/GraphicsCache.h:
4664 * src/graphics/GraphicsCache.C:
4665 * src/graphics/GraphicsCacheItem.h:
4666 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4669 * src/insets/insetgraphics.h:
4670 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4671 and the drawing of the inline image.
4673 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4674 loaded into the wrong position.
4676 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4679 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4681 * src/support/translator.h: move all typedefs to public section
4683 * src/support/filetools.C (MakeLatexName): return string const
4685 (TmpFileName): ditto
4686 (FileOpenSearch): ditto
4688 (LibFileSearch): ditto
4689 (i18nLibFileSearch): ditto
4692 (CreateTmpDir): ditto
4693 (CreateBufferTmpDir): ditto
4694 (CreateLyXTmpDir): ditto
4697 (MakeAbsPath): ditto
4699 (OnlyFilename): ditto
4701 (NormalizePath): ditto
4702 (CleanupPath): ditto
4703 (GetFileContents): ditto
4704 (ReplaceEnvironmentPath): ditto
4705 (MakeRelPath): ditto
4707 (ChangeExtension): ditto
4708 (MakeDisplayPath): ditto
4709 (do_popen): return cmdret const
4710 (findtexfile): return string const
4712 * src/support/DebugStream.h: add some /// to please doc++
4714 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4716 * src/texrow.C (same_rownumber): functor to use with find_if
4717 (getIdFromRow): rewritten to use find_if and to not update the
4718 positions. return true if row is found
4719 (increasePos): new method, use to update positions
4721 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4723 * src/lyxlex_pimpl.C (verifyTable): new method
4726 (GetString): return string const
4727 (pushTable): rewrite to use std::stack
4729 (setFile): better check
4732 * src/lyxlex.h: make LyXLex noncopyable
4734 * src/lyxlex.C (text): return char const * const
4735 (GetString): return string const
4736 (getLongString): return string const
4738 * src/lyx_gui_misc.C (askForText): return pair<...> const
4740 * src/lastfiles.[Ch] (operator): return string const
4742 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4743 istringstream not char const *.
4744 move token.end() out of loop.
4745 (readFile): move initializaton of token
4747 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4748 getIdFromRow is successful.
4750 * lib/bind/emacs.bind: don't include menus bind
4752 * development/Code_rules/Rules: the beginnings of making this
4753 better and covering more of the unwritten rules that we have.
4755 * development/Code_rules/Recommendations: a couple of wording
4758 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4760 * src/support/strerror.c: remove C++ comment.
4762 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4764 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4765 LFUN_INDEX_INSERT_LAST
4767 * src/texrow.C (getIdFromRow): changed from const_iterator to
4768 iterator, allowing code to compile with DEC cxx
4770 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4771 stores part of the class, as suggested by Allan. Will allow
4773 (apply): test to apply uses InsetCommandParams operator!=
4775 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4776 (apply): test to apply uses InsetCommandParams operator!=
4778 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4779 stores part of the class.
4780 (update): removed limits on min/max size.
4782 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4783 (apply): test to apply uses InsetCommandParams operator!=
4785 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4786 (Read, Write, scanCommand, getCommand): moved functionality
4787 into InsetCommandParams.
4789 (getScreenLabel): made pure virtual
4790 new InsetCommandParams operators== and !=
4792 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4793 c-tors based on InsetCommandParams. Removed others.
4794 * src/insets/insetinclude.[Ch]: ditto
4795 * src/insets/insetlabel.[Ch]: ditto
4796 * src/insets/insetparent.[Ch]: ditto
4797 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4799 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4800 insets derived from InsetCommand created using similar c-tors
4801 based on InsetCommandParams
4802 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4803 * src/menus.C (ShowRefsMenu): ditto
4804 * src/paragraph.C (Clone): ditto
4805 * src/text2.C (SetCounter): ditto
4806 * src/lyxfunc.C (Dispatch) ditto
4807 Also recreated old InsetIndex behaviour exactly. Can now
4808 index-insert at the start of a paragraph and index-insert-last
4809 without launching the pop-up.
4811 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4813 * lib/lyxrc.example: mark te pdf options as non functional.
4815 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4816 (isStrDbl): move tmpstr.end() out of loop.
4817 (strToDbl): move intialization of tmpstr
4818 (lowercase): return string const and move tmp.end() out of loop.
4819 (uppercase): return string const and move tmp.edn() out of loop.
4820 (prefixIs): add assertion
4825 (containsOnly): ditto
4826 (containsOnly): ditto
4827 (containsOnly): ditto
4828 (countChar): make last arg char not char const
4829 (token): return string const
4830 (subst): return string const, move tmp.end() out of loop.
4831 (subst): return string const, add assertion
4832 (strip): return string const
4833 (frontStrip): return string const, add assertion
4834 (frontStrip): return string const
4839 * src/support/lstrings.C: add inclde "LAssert.h"
4840 (isStrInt): move tmpstr.end() out of loop.
4842 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4843 toollist.end() out of loop.
4844 (deactivate): move toollist.end() out of loop.
4845 (update): move toollist.end() out of loop.
4846 (updateLayoutList): move tc.end() out of loop.
4847 (add): move toollist.end() out of loop.
4849 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4850 md.end() out of loop.
4852 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4854 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4857 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4858 (Erase): move insetlist.end() out of loop.
4860 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4861 ref to const string as first arg. Move initialization of some
4862 variables, whitespace changes.
4864 * src/kbmap.C (defkey): move table.end() out of loop.
4865 (kb_keymap): move table.end() out of loop.
4866 (findbinding): move table.end() out of loop.
4868 * src/MenuBackend.C (hasMenu): move end() out of loop.
4869 (getMenu): move end() out of loop.
4870 (getMenu): move menulist_.end() out of loop.
4872 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4874 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4877 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4878 (getFromLyXName): move infotab.end() out of loop.
4880 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4881 -fvtable-thunks -ffunction-sections -fdata-sections
4883 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4885 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4888 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4890 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4892 * src/frontends/xforms/FormCitation.[Ch],
4893 src/frontends/xforms/FormIndex.[Ch],
4894 src/frontends/xforms/FormToc.[Ch],
4895 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4897 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4899 * src/commandtags.h: renamed, created some flags for citation
4902 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4904 * src/lyxfunc.C (dispatch): use signals to insert index entry
4906 * src/frontends/Dialogs.h: new signal createIndex
4908 * src/frontends/xforms/FormCommand.[Ch],
4909 src/frontends/xforms/FormCitation.[Ch],
4910 src/frontends/xforms/FormToc.[Ch],
4911 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4913 * src/insets/insetindex.[Ch]: GUI-independent
4915 * src/frontends/xforms/FormIndex.[Ch],
4916 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4919 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4921 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4922 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4924 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4926 * src/insets/insetref.C (Latex): rewrite so that there is now
4927 question that a initialization is requested.
4929 * src/insets/insetcommand.h: reenable the hide signal
4931 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4933 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4934 fix handling of shortcuts (many bugs :)
4935 (add_lastfiles): ditto.
4937 * lib/ui/default.ui: fix a few shortcuts.
4939 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4941 * Makefile.am: Fix ``rpmdist'' target to return the exit
4942 status of the ``rpm'' command, instead of the last command in
4943 the chain (the ``rm lyx.xpm'' command, which always returns
4946 2000-08-02 Allan Rae <rae@lyx.org>
4948 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4949 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4950 * src/frontends/xforms/FormToc.C (FormToc): ditto
4952 * src/frontends/xforms/Makefile.am: A few forgotten files
4954 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4955 Signals-not-copyable-problem Lars' started commenting out.
4957 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4959 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4961 * src/insets/insetcommand.h: Signals is not copyable so anoter
4962 scheme for automatic hiding of forms must be used.
4964 * src/frontends/xforms/FormCitation.h: don't inerit from
4965 noncopyable, FormCommand already does that.
4966 * src/frontends/xforms/FormToc.h: ditto
4967 * src/frontends/xforms/FormUrl.h: ditto
4969 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4971 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4973 * src/insets/insetcommand.h (hide): new SigC::Signal0
4974 (d-tor) new virtual destructor emits hide signal
4976 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4977 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4979 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4980 LOF and LOT. Inset is now GUI-independent
4982 * src/insets/insetloa.[Ch]: redundant
4983 * src/insets/insetlof.[Ch]: ditto
4984 * src/insets/insetlot.[Ch]: ditto
4986 * src/frontends/xforms/forms/form_url.fd: tweaked!
4987 * src/frontends/xforms/forms/form_citation.fd: ditto
4989 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4990 dialogs dealing with InsetCommand insets
4992 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4993 FormCommand base class
4994 * src/frontends/xforms/FormUrl.[Ch]: ditto
4996 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4998 * src/frontends/xforms/FormToc.[Ch]: ditto
5000 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5001 passed a generic InsetCommand pointer
5002 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5004 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5005 and modified InsetTOC class
5006 * src/buffer.C: ditto
5008 * forms/lyx.fd: strip out old FD_form_toc code
5009 * src/lyx_gui_misc.C: ditto
5010 * src/lyx_gui.C: ditto
5011 * src/lyx_cb.C: ditto
5012 * src/lyx.[Ch]: ditto
5014 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5016 * src/support/utility.hpp: tr -d '\r'
5018 2000-08-01 Juergen Vigna <jug@sad.it>
5020 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5022 * src/commandtags.h:
5023 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5024 LFUN_TABULAR_FEATURES.
5026 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5027 LFUN_LAYOUT_TABULAR.
5029 * src/insets/insettabular.C (getStatus): implemented helper function.
5031 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5033 2000-07-31 Juergen Vigna <jug@sad.it>
5035 * src/text.C (draw): fixed screen update problem for text-insets.
5037 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5038 something changed probably this has to be added in various other
5041 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5043 2000-07-31 Baruch Even <baruch.even@writeme.com>
5045 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5046 templates to satisfy compaq cxx.
5049 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5051 * src/support/translator.h (equal_1st_in_pair::operator()): take
5052 const ref pair_type as arg.
5053 (equal_2nd_in_pair::operator()): ditto
5054 (Translator::~Translator): remove empty d-tor.
5056 * src/graphics/GraphicsCache.C: move include config.h to top, also
5057 put initialization of GraphicsCache::singleton here.
5058 (~GraphicsCache): move here
5059 (addFile): take const ref as arg
5062 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5064 * src/BufferView2.C (insertLyXFile): change te with/without header
5067 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5069 * src/frontends/xforms/FormGraphics.C (apply): add some
5070 static_cast. Not very nice, but required by compaq cxx.
5072 * src/frontends/xforms/RadioButtonGroup.h: include header
5073 <utility> instead of <pair.h>
5075 * src/insets/insetgraphicsParams.C: add using directive.
5076 (readResize): change return type to void.
5077 (readOrigin): ditto.
5079 * src/lyxfunc.C (getStatus): add missing break for build-program
5080 function; add test for Literate for export functions.
5082 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5083 entries in Options menu.
5085 2000-07-31 Baruch Even <baruch.even@writeme.com>
5087 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5088 protect against auto-allocation; release icon when needed.
5090 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5092 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5093 on usual typewriter.
5095 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5096 earlier czech.kmap), useful only for programming.
5098 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5100 * src/frontends/xforms/FormCitation.h: fix conditioning around
5103 2000-07-31 Juergen Vigna <jug@sad.it>
5105 * src/frontends/xforms/FormTabular.C (local_update): changed
5106 radio_linebreaks to radio_useparbox and added radio_useminipage.
5108 * src/tabular.C: made support for using minipages/parboxes.
5110 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5112 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5114 (descent): so the cursor is in the middle.
5115 (width): bit smaller box.
5117 * src/insets/insetgraphics.h: added display() function.
5119 2000-07-31 Baruch Even <baruch.even@writeme.com>
5121 * src/frontends/Dialogs.h: Added showGraphics signals.
5123 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5124 xforms form definition of the graphics dialog.
5126 * src/frontends/xforms/FormGraphics.h:
5127 * src/frontends/xforms/FormGraphics.C: Added files, the
5128 GUIndependent code of InsetGraphics
5130 * src/insets/insetgraphics.h:
5131 * src/insets/insetgraphics.C: Major writing to make it work.
5133 * src/insets/insetgraphicsParams.h:
5134 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5135 struct between InsetGraphics and GUI.
5137 * src/LaTeXFeatures.h:
5138 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5139 support for graphicx package.
5141 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5142 for the graphics inset.
5144 * src/support/translator.h: Added file, used in
5145 InsetGraphicsParams. this is a template to translate between two
5148 * src/frontends/xforms/RadioButtonGroup.h:
5149 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5150 way to easily control a radio button group.
5152 2000-07-28 Juergen Vigna <jug@sad.it>
5154 * src/insets/insettabular.C (LocalDispatch):
5155 (TabularFeatures): added support for lyx-functions of tabular features.
5156 (cellstart): refixed this function after someone wrongly changed it.
5158 * src/commandtags.h:
5159 * src/LyXAction.C (init): added support for tabular-features
5161 2000-07-28 Allan Rae <rae@lyx.org>
5163 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5164 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5165 triggers the callback for input checking. As a result we sometimes get
5166 "LyX: This shouldn't happen..." printed to cerr.
5167 (input): Started using status variable since I only free() on
5168 destruction. Some input checking for paths and font sizes.
5170 * src/frontends/xforms/FormPreferences.h: Use status to control
5171 activation of Ok and Apply
5173 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5174 callback. Also resized to stop segfaults with 0.88. The problem is
5175 that xforms-0.88 requires the folder to be wide enough to fit all the
5176 tabs. If it isn't it causes all sorts of problems.
5178 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5180 * src/frontends/xforms/forms/README: Reflect reality.
5182 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5183 * src/frontends/xforms/forms/makefile: ditto.
5185 * src/commandtags.h: Get access to new Preferences dialog
5186 * src/LyXAction.C: ditto
5187 * src/lyxfunc.C: ditto
5188 * lib/ui/default.ui: ditto
5190 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5192 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5194 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5197 * src/frontends/xforms/form_url.[Ch]: added.
5199 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5201 * src/insets/insetbib.h: fixed bug in previous commit
5203 * src/frontends/xforms/FormUrl.h: ditto
5205 * src/frontends/xforms/FormPrint.h: ditto
5207 * src/frontends/xforms/FormPreferences.h: ditto
5209 * src/frontends/xforms/FormCopyright.h: ditto
5211 * src/frontends/xforms/FormCitation.C: ditto
5213 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5214 private copyconstructor and private default contructor
5216 * src/support/Makefile.am: add utility.hpp
5218 * src/support/utility.hpp: new file from boost
5220 * src/insets/insetbib.h: set owner in clone
5222 * src/frontends/xforms/FormCitation.C: added missing include
5225 * src/insets/form_url.[Ch]: removed
5227 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5229 * development/lyx.spec.in
5230 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5231 file/directory re-organization.
5233 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5235 * src/insets/insetcommand.[Ch]: moved the string data and
5236 associated manipulation methods into a new stand-alone class
5237 InsetCommandParams. This class has two additional methods
5238 getAsString() and setFromString() allowing the contents to be
5239 moved around as a single string.
5240 (addContents) method removed.
5241 (setContents) method no longer virtual.
5243 * src/buffer.C (readInset): made use of new InsetCitation,
5244 InsetUrl constructors based on InsetCommandParams.
5246 * src/commandtags.h: add LFUN_INSERT_URL
5248 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5249 independent InsetUrl and use InsetCommandParams to extract
5250 string info and create new Insets.
5252 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5254 * src/frontends/xforms/FormCitation.C (apply): uses
5257 * src/frontends/xforms/form_url.C
5258 * src/frontends/xforms/form_url.h
5259 * src/frontends/xforms/FormUrl.h
5260 * src/frontends/xforms/FormUrl.C
5261 * src/frontends/xforms/forms/form_url.fd: new files
5263 * src/insets/insetcite.[Ch]: removed unused constructors.
5265 * src/insets/insetinclude.[Ch]: no longer store filename
5267 * src/insets/inseturl.[Ch]: GUI-independent.
5269 2000-07-26 Juergen Vigna <jug@sad.it>
5270 * renamed frontend from gtk to gnome as it is that what is realized
5271 and did the necessary changes in the files.
5273 2000-07-26 Marko Vendelin <markov@ioc.ee>
5275 * configure.in: cleaning up gnome configuration scripts
5277 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5279 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5280 shortcuts syndrom by redrawing them explicitely (a better solution
5281 would be appreciated).
5283 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5285 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5288 * src/lyx_cb.C (MenuExport): change html export to do the right
5289 thing depending of the document type (instead of having
5290 html-linuxdoc and html-docbook).
5291 * src/lyxfunc.C (getStatus): update for html
5292 * lib/ui/default.ui: simplify due to the above change.
5293 * src/menus.C (ShowFileMenu): update too (in case we need it).
5295 * src/MenuBackend.C (read): if a menu is defined twice, add the
5296 new entries to the exiting one.
5298 2000-07-26 Juergen Vigna <jug@sad.it>
5300 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5302 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5303 and return a bool if it did actual save the file.
5304 (AutoSave): don't autosave a unnamed doc.
5306 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5307 check if this is an UNNAMED new file and react to it.
5308 (newFile): set buffer to unnamed and change to not mark a new
5309 buffer dirty if I didn't do anything with it.
5311 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5313 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5315 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5316 friend as per Angus's patch posted to lyx-devel.
5318 * src/ext_l10n.h: updated
5320 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5321 gettext on the style string right before inserting them into the
5324 * autogen.sh: add code to extract style strings form layout files,
5325 not good enough yet.
5327 * src/frontends/gtk/.cvsignore: add MAKEFILE
5329 * src/MenuBackend.C (read): run the label strings through gettext
5330 before storing them in the containers.
5332 * src/ext_l10n.h: new file
5334 * autogen.sh : generate the ext_l10n.h file here
5336 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5338 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5341 * lib/ui/default.ui: fix a couple of typos.
5343 * config/gnome/gtk.m4: added (and added to the list of files in
5346 * src/insets/insetinclude.C (unique_id): fix when we are using
5347 lyxstring instead of basic_string<>.
5348 * src/insets/insettext.C (LocalDispatch): ditto.
5349 * src/support/filetools.C: ditto.
5351 * lib/configure.m4: create the ui/ directory if necessary.
5353 * src/LyXView.[Ch] (updateToolbar): new method.
5355 * src/BufferView_pimpl.C (buffer): update the toolbar when
5356 opening/closing buffer.
5358 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5360 * src/LyXAction.C (getActionName): enhance to return also the name
5361 and options of pseudo-actions.
5362 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5364 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5365 as an example of what is possible). Used in File->Build too (more
5366 useful) and in the import/export menus (to mimick the complicated
5367 handling of linuxdoc and friends). Try to update all the entries.
5369 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5372 * src/MenuBackend.C (read): Parse the new OptItem tag.
5374 * src/MenuBackend.h: Add a new optional_ data member (used if the
5375 entry should be omitted when the lyxfunc is disabled).
5377 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5378 function, used as a shortcut.
5379 (create_submenu): align correctly the shortcuts on the widest
5382 * src/MenuBackend.h: MenuItem.label() only returns the label of
5383 the menu without shortcut; new method shortcut().
5385 2000-07-14 Marko Vendelin <markov@ioc.ee>
5387 * src/frontends/gtk/Dialogs.C:
5388 * src/frontends/gtk/FormCopyright.C:
5389 * src/frontends/gtk/FormCopyright.h:
5390 * src/frontends/gtk/Makefile.am: added these source-files for the
5391 Gtk/Gnome support of the Copyright-Dialog.
5393 * src/main.C: added Gnome::Main initialization if using
5394 Gtk/Gnome frontend-GUI.
5396 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5398 * config/gnome/aclocal-include.m4
5399 * config/gnome/compiler-flags.m4
5400 * config/gnome/curses.m4
5401 * config/gnome/gnome--.m4
5402 * config/gnome/gnome-bonobo-check.m4
5403 * config/gnome/gnome-common.m4
5404 * config/gnome/gnome-fileutils.m4
5405 * config/gnome/gnome-ghttp-check.m4
5406 * config/gnome/gnome-gnorba-check.m4
5407 * config/gnome/gnome-guile-checks.m4
5408 * config/gnome/gnome-libgtop-check.m4
5409 * config/gnome/gnome-objc-checks.m4
5410 * config/gnome/gnome-orbit-check.m4
5411 * config/gnome/gnome-print-check.m4
5412 * config/gnome/gnome-pthread-check.m4
5413 * config/gnome/gnome-support.m4
5414 * config/gnome/gnome-undelfs.m4
5415 * config/gnome/gnome-vfs.m4
5416 * config/gnome/gnome-x-checks.m4
5417 * config/gnome/gnome-xml-check.m4
5418 * config/gnome/gnome.m4
5419 * config/gnome/gperf-check.m4
5420 * config/gnome/gtk--.m4
5421 * config/gnome/linger.m4
5422 * config/gnome/need-declaration.m4: added configuration scripts
5423 for Gtk/Gnome frontend-GUI
5425 * configure.in: added support for the --with-frontend=gtk option
5427 * autogen.sh: added config/gnome/* to list of config-files
5429 * acconfig.h: added define for GTKGUI-support
5431 * config/lyxinclude.m4: added --with-frontend[=value] option value
5432 for Gtk/Gnome frontend-GUI support.
5434 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5436 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5440 * src/paragraph.C (GetChar): remove non-const version
5442 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5443 (search_kw): use it.
5445 * src/lyx_main.C (init): if "preferences" exist, read that instead
5447 (ReadRcFile): return bool if the file could be read ok.
5448 (ReadUIFile): add a check to see if lex file is set ok.
5450 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5451 bastring can be used instead of lyxstring (still uses the old code
5452 if std::string is good enough or if lyxstring is used.)
5454 * src/encoding.C: make the arrays static, move ininle functions
5456 * src/encoding.h: from here.
5458 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5459 (parseSingleLyXformat2Token): move inset parsing to separate method
5460 (readInset): new private method
5462 * src/Variables.h: remove virtual from get().
5464 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5465 access to NEW_INSETS and NEW_TABULAR
5467 * src/MenuBackend.h: remove superfluous forward declaration of
5468 MenuItem. Add documentations tags "///", remove empty MenuItem
5469 destructor, remove private default contructor.
5471 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5473 (read): more string mlabel and mname to where they are used
5474 (read): remove unused variables mlabel and mname
5475 (defaults): unconditional clear, make menusetup take advantage of
5476 add returning Menu &.
5478 * src/LyXView.h: define NEW_MENUBAR as default
5480 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5481 to NEW_INSETS and NEW_TABULAR.
5482 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5483 defined. Change some of the "xxxx-inset-insert" functions names to
5486 * several files: more enahncements to NEW_INSETS and the resulting
5489 * lib/lyxrc.example (\date_insert_format): move to misc section
5491 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5492 bastring and use AC_CACHE_CHECK.
5493 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5494 the system have the newest methods. uses AC_CACHE_CHECK
5495 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5496 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5497 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5499 * configure.in: add LYX_CXX_GOOD_STD_STRING
5501 * acinclude.m4: recreated
5503 2000-07-24 Amir Karger <karger@lyx.org>
5505 * README: add Hebrew, Arabic kmaps
5508 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5510 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5513 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5515 * Lot of files: add pragma interface/implementation.
5517 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5519 * lib/ui/default.ui: new file (ans new directory). Contains the
5520 default menu and toolbar.
5522 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5523 global space. Toolbars are now read (as menus) in ui files.
5525 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5527 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5528 is disabled because the document is read-only. We want to have the
5529 toggle state of the function anyway.
5530 (getStatus): add code for LFUN_VC* functions (mimicking what is
5531 done in old-style menus)
5533 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5534 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5536 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5537 * src/BufferView_pimpl.C: ditto.
5538 * src/lyxfunc.C: ditto.
5540 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5541 default). This replaces old-style menus by new ones.
5543 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5544 MenuItem. Contain the data structure of a menu.
5546 * src/insets/insettext.C: use LyXView::setLayout instead of
5547 accessing directly the toolbar combox.
5548 * src/lyxfunc.C (Dispatch): ditto.
5550 * src/LyXView.C (setLayout): new method, which just calls
5551 Toolbar::setLayout().
5552 (updateLayoutChoice): move part of this method in Toolbar.
5554 * src/toolbar.[Ch]: removed.
5556 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5557 implementation the toolbar.
5559 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5560 the toolbar. It might make sense to merge it with ToolbarDefaults
5562 (setLayout): new function.
5563 (updateLayoutList): ditto.
5564 (openLayoutList): ditto.
5566 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5567 xforms implementation of the toolbar.
5568 (get_toolbar_func): comment out, since I do not
5569 know what it is good for.
5571 * src/ToolbarDefaults.h: Add the ItemType enum.
5573 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5574 for a list of allocated C strings. Used in Menubar xforms
5575 implementation to avoid memory leaks.
5577 * src/support/lstrings.[Ch] (uppercase): new version taking and
5581 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5582 * lib/bind/emacs.bind: ditto.
5584 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5586 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5587 forward decl of LyXView.
5589 * src/toolbar.C (toolbarItem): moved from toolbar.h
5590 (toolbarItem::clean): ditto
5591 (toolbarItem::~toolbarItem): ditto
5592 (toolbarItem::operator): ditto
5594 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5596 * src/paragraph.h: control the NEW_TABULAR define from here
5598 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5599 USE_TABULAR_INSETS to NEW_TABULAR
5601 * src/ToolbarDefaults.C: add include "lyxlex.h"
5603 * files using the old table/tabular: use NEW_TABULAR to control
5604 compilation of old tabular stuff.
5606 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5609 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5610 planemet in reading of old style floats, fix the \end_deeper
5611 problem when reading old style floats.
5613 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5615 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5617 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5619 * lib/bind/sciword.bind: updated.
5621 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5623 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5624 layout write problem
5626 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5628 * src/Makefile.am (INCLUDES): remove image directory from include
5631 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5632 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5634 * src/LyXView.C (create_form_form_main): read the application icon
5637 * lib/images/*.xpm: change the icons to use transparent color for
5640 * src/toolbar.C (update): change the color of the button when it
5643 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5645 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5646 setting explicitely the minibuffer.
5647 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5649 * src/LyXView.C (showState): new function. Shows font information
5650 in minibuffer and update toolbar state.
5651 (LyXView): call Toolbar::update after creating the
5654 * src/toolbar.C: change toollist to be a vector instead of a
5656 (BubbleTimerCB): get help string directly from the callback
5657 argument of the corresponding icon (which is the action)
5658 (set): remove unnecessary ugliness.
5659 (update): new function. update the icons (depressed, disabled)
5660 depending of the status of the corresponding action.
5662 * src/toolbar.h: remove help in toolbarItem
5664 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5666 * src/Painter.C (text): Added code for using symbol glyphs from
5667 iso10646 fonts. Currently diabled.
5669 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5672 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5673 magyar,turkish and usorbian.
5675 * src/paragraph.C (isMultiLingual): Made more efficient.
5677 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5680 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5681 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5682 Also changed the prototype to "bool math_insert_greek(char)".
5684 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5686 * lots of files: apply the NEW_INSETS on all code that will not be
5687 needed when we move to use the new insets. Enable the define in
5688 lyxparagrah.h to try it.
5690 * src/insets/insettabular.C (cellstart): change to be a static
5692 (InsetTabular): initialize buffer in the initializer list.
5694 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5696 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5697 form_print.h out of the header file. Replaced with forward
5698 declarations of the relevant struct.
5700 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5703 * src/commandtags.h: do not include "debug.h" which does not
5704 belong there. #include it in some other places because of this
5707 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5709 * src/insets/insetcaption.C: add a couple "using" directives.
5711 * src/toolbar.C (add): get the help text directly from lyxaction.
5713 (setPixmap): new function. Loads from disk and sets a pixmap on a
5714 botton; the name of the pixmap file is derived from the command
5717 * src/toolbar.h: remove members isBitmap and pixmap from
5720 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5721 * lib/images/: move many files from images/banner.xpm.
5723 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5725 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5726 * src/toolbar.C: ditto.
5727 * configure.in: ditto.
5728 * INSTALL: document.
5730 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5731 the spellchecker popup is closed from the WM.
5733 2000-07-19 Juergen Vigna <jug@sad.it>
5735 * src/insets/insetfloat.C (Write): small fix because we use the
5736 insetname for the type now!
5738 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5740 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5743 * src/frontends/Dialogs.h: removed hideCitation signal
5745 * src/insets/insetcite.h: added hide signal
5747 * src/insets/insetcite.C (~InsetCitation): emits new signal
5748 (getScreenLabel): "intelligent" label should now fit on the screen!
5750 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5752 * src/frontends/xforms/FormCitation.C (showInset): connects
5753 hide() to the inset's hide signal
5754 (show): modified to use fl_set_object_position rather than
5755 fl_set_object_geometry wherever possible
5757 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5759 * src/insets/lyxinset.h: add caption code
5761 * src/insets/insetfloat.C (type): new method
5763 * src/insets/insetcaption.C (Write): new method
5765 (LyxCode): new method
5767 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5768 to get it right together with using the FloatList.
5770 * src/commandtags.h: add LFUN_INSET_CAPTION
5771 * src/lyxfunc.C (Dispatch): handle it
5773 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5776 * src/Variables.[Ch]: make expand take a const reference, remove
5777 the destructor, some whitespace changes.
5779 * src/LyXAction.C (init): add caption-inset-insert
5781 * src/FloatList.C (FloatList): update the default floats a bit.
5783 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5785 * src/Variables.[Ch]: new files. Intended to be used for language
5786 specific strings (like \chaptername) and filename substitution in
5789 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5791 * lib/kbd/american.kmap: update
5793 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5795 * src/bufferparams.[Ch]: remove member allowAccents.
5797 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5799 * src/LaTeXLog.C: use the log_form.h header.
5800 * src/lyx_gui.C: ditto.
5801 * src/lyx_gui_misc.C: ditto.
5802 * src/lyxvc.h: ditto.
5804 * forms/log_form.fd: new file, created from latexoptions.fd. I
5805 kept the log popup and nuked the options form.
5807 * src/{la,}texoptions.[Ch]: removed.
5808 * src/lyx_cb.C (LaTeXOptions): ditto
5810 * src/lyx_gui.C (create_forms): do not handle the
5811 fd_latex_options form.
5813 2000-07-18 Juergen Vigna <jug@sad.it>
5815 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5816 name of the inset so that it can be requested outside (text2.C).
5818 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5821 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5823 * src/mathed/formula.h (ConvertFont): constify
5825 * src/mathed/formula.C (Read): add warning if \end_inset is not
5826 found on expected place.
5828 * src/insets/lyxinset.h (ConvertFont): consify
5830 * src/insets/insetquotes.C (ConvertFont): constify
5831 * src/insets/insetquotes.h: ditto
5833 * src/insets/insetinfo.h: add labelfont
5835 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5836 (ascent): use labelfont
5840 (Write): make .lyx file a bit nicer
5842 * src/insets/insetfloat.C (Write): simplify somewhat...
5843 (Read): add warning if arg is not found
5845 * src/insets/insetcollapsable.C: add using std::max
5846 (Read): move string token and add warning in arg is not found
5847 (draw): use std::max to get the right ty
5848 (getMaxWidth): simplify by using std::max
5850 * src/insets/insetsection.h: new file
5851 * src/insets/insetsection.C: new file
5852 * src/insets/insetcaption.h: new file
5853 * src/insets/insetcaption.C: new file
5855 * src/insets/inset.C (ConvertFont): constify signature
5857 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5858 insetcaption.[Ch] and insetsection.[Ch]
5860 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5861 uses to use LABEL_COUNTER_CHAPTER instead.
5862 * src/text2.C (SetCounter): here
5864 * src/counters.h: new file
5865 * src/counters.C: new file
5866 * src/Sectioning.h: new file
5867 * src/Sectioning.C: new file
5869 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5871 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5873 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5876 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5879 2000-07-17 Juergen Vigna <jug@sad.it>
5881 * src/tabular.C (Validate): check if array-package is needed.
5882 (SetVAlignment): added support for vertical alignment.
5883 (SetLTFoot): better support for longtable header/footers
5884 (Latex): modified to support added features.
5886 * src/LaTeXFeatures.[Ch]: added array-package.
5888 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5890 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5893 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5895 * configure.in: do not forget to put a space after -isystem.
5897 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5899 * lib/kbd/arabic.kmap: a few fixes.
5901 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5903 * some whitespace chagnes to a number of files.
5905 * src/support/DebugStream.h: change to make it easier for
5906 doc++ to parse correctly.
5907 * src/support/lyxstring.h: ditto
5909 * src/mathed/math_utils.C (compara): change to have only one
5911 (MathedLookupBOP): change because of the above.
5913 * src/mathed/math_delim.C (math_deco_compare): change to have only
5915 (search_deco): change becasue of the above.
5917 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5918 instead of manually coded one.
5920 * src/insets/insetquotes.C (Read): read the \end_inset too
5922 * src/insets/insetlatex.h: remove file
5923 * src/insets/insetlatex.C: remove file
5925 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5927 (InsetPrintIndex): remove destructor
5929 * src/insets/insetinclude.h: remove default constructor
5931 * src/insets/insetfloat.C: work to make it work better
5933 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5935 * src/insets/insetcite.h (InsetCitation): remove default constructor
5937 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5939 * src/text.C (GetColumnNearX): comment out some currently unused code.
5941 * src/paragraph.C (writeFile): move some initializations closer to
5943 (CutIntoMinibuffer): small change to use new matchIT operator
5947 (InsertInset): ditto
5950 (InsetIterator): ditto
5951 (Erase): small change to use new matchFT operator
5953 (GetFontSettings): ditto
5954 (HighestFontInRange): ditto
5957 * src/lyxparagraph.h: some chars changed to value_type
5958 (matchIT): because of some stronger checking (perhaps too strong)
5959 in SGI STL, the two operator() unified to one.
5962 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5964 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5965 the last inset read added
5966 (parseSingleLyXformat2Token): some more (future) compability code added
5967 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5968 (parseSingleLyXformat2Token): set last_inset_read
5969 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5970 (parseSingleLyXformat2Token): don't double intializw string next_token
5972 * src/TextCache.C (text_fits::operator()): add const's to the signature
5973 (has_buffer::operator()): ditto
5975 * src/Floating.h: add some comments on the class
5977 * src/FloatList.[Ch] (typeExist): new method
5980 * src/BackStack.h: added default constructor, wanted by Gcc.
5982 2000-07-14 Juergen Vigna <jug@sad.it>
5984 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5986 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5988 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5989 do a redraw when the window is resized!
5990 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5992 * src/insets/insettext.C (resizeLyXText): added function to correctly
5993 being able to resize the LyXWindow.
5995 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5997 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5999 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6000 crashes when closing dialog to a deleted inset.
6002 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6003 method! Now similar to other insets.
6005 2000-07-13 Juergen Vigna <jug@sad.it>
6007 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6009 * lib/examples/Literate.lyx: small patch!
6011 * src/insets/insetbib.C (Read): added this function because of wrong
6012 Write (without [begin|end]_inset).
6014 2000-07-11 Juergen Vigna <jug@sad.it>
6016 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6017 as the insertInset could not be good!
6019 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6020 the bool param should not be last.
6022 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6024 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6025 did submit that to Karl).
6027 * configure.in: use -isystem instead of -I for X headers. This
6028 fixes a problem on solaris with a recent gcc;
6029 put the front-end code after the X detection code;
6030 configure in sigc++ before lib/
6032 * src/lyx_main.C (commandLineHelp): remove -display from command
6035 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6037 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6038 Also put in Makefile rules for building the ``listerrors''
6039 program for parsing errors from literate programs written in LyX.
6041 * lib/build-listerrors: Added small shell script as part of compile
6042 process. This builds a working ``listerrors'' binary if noweb is
6043 installed and either 1) the VNC X server is installed on the machine,
6044 or 2) the user is compiling from within a GUI. The existence of a GUI
6045 is necessary to use the ``lyx --export'' feature for now. This
6046 hack can be removed once ``lyx --export'' no longer requires a GUI to
6049 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6051 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6052 now passed back correctly from gcc and placed "under" error
6053 buttons in a Literate LyX source.
6055 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6057 * src/text.C (GetColumnNearX): Better behavior when a RTL
6058 paragraph is ended by LTR text.
6060 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6063 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6065 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6066 true when clipboard is empty.
6068 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6070 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6071 row of the paragraph.
6072 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6073 to prevent calculation of bidi tables
6075 2000-07-07 Juergen Vigna <jug@sad.it>
6077 * src/screen.C (ToggleSelection): added y_offset and x_offset
6080 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6083 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6085 * src/insets/insettext.C: fixed Layout-Display!
6087 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6089 * configure.in: add check for strings.h header.
6091 * src/spellchecker.C: include <strings.h> in order to have a
6092 definition for bzero().
6094 2000-07-07 Juergen Vigna <jug@sad.it>
6096 * src/insets/insettext.C (draw): set the status of the bv->text to
6097 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6099 * src/screen.C (DrawOneRow):
6100 (DrawFromTo): redraw the actual row if something has changed in it
6103 * src/text.C (draw): call an update of the toplevel-inset if something
6104 has changed inside while drawing.
6106 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6108 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6110 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6111 processing inside class.
6113 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6114 processing inside class.
6116 * src/insets/insetindex.h new struct Holder, consistent with other
6119 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6120 citation dialog from main code and placed it in src/frontends/xforms.
6121 Dialog launched through signals instead of callbacks
6123 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6125 * lyx.man: update the options description.
6127 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6129 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6130 handle neg values, set min width to 590, add doc about -display
6132 2000-07-05 Juergen Vigna <jug@sad.it>
6134 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6135 calls to BufferView *.
6137 * src/insets/insettext.C (checkAndActivateInset): small fix non
6138 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6140 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6141 their \end_inset token!
6143 2000-07-04 edscott <edscott@imp.mx>
6145 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6146 lib/lyxrc.example: added option \wheel_jump
6148 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6150 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6151 remove support for -width,-height,-xpos and -ypos.
6153 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6155 * src/encoding.[Ch]: New files.
6157 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6158 (text): Call to the underline() method only when needed.
6160 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6162 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6163 encoding(s) for the document.
6165 * src/bufferparams.C (BufferParams): Changed default value of
6168 * src/language.C (newLang): Removed.
6169 (items[]): Added encoding information for all defined languages.
6171 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6172 encoding choice button.
6174 * src/lyxrc.h (font_norm_type): New member variable.
6175 (set_font_norm_type): New method.
6177 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6178 paragraphs with different encodings.
6180 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6181 (TransformChar): Changed to work correctly with Arabic points.
6182 (draw): Added support for drawing Arabic points.
6183 (draw): Removed code for drawing underbars (this is done by
6186 * src/support/textutils.h (IsPrintableNonspace): New function.
6188 * src/BufferView_pimpl.h: Added "using SigC::Object".
6189 * src/LyXView.h: ditto.
6191 * src/insets/insetinclude.h (include_label): Changed to mutable.
6193 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6195 * src/mathed/math_iter.h: remove empty destructor
6197 * src/mathed/math_cursor.h: remove empty destructor
6199 * src/insets/lyxinset.h: add THEOREM_CODE
6201 * src/insets/insettheorem.[Ch]: new files
6203 * src/insets/insetminipage.C: (InsertInset): remove
6205 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6207 (InsertInset): remove
6209 * src/insets/insetlist.C: (InsertList): remove
6211 * src/insets/insetfootlike.[Ch]: new files
6213 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6216 (InsertInset): ditto
6218 * src/insets/insetert.C: remove include Painter.h, reindent
6219 (InsertInset): move to header
6221 * src/insets/insetcollapsable.h: remove explicit from default
6222 contructor, remove empty destructor, add InsertInset
6224 * src/insets/insetcollapsable.C (InsertInset): new func
6226 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6228 * src/vspace.h: add explicit to constructor
6230 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6231 \textcompwordmark, please test this.
6233 * src/lyxrc.C: set ascii_linelen to 65 by default
6235 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6237 * src/commandtags.h: add LFUN_INSET_THEOREM
6239 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6240 (makeLinuxDocFile): remove _some_ of the nice logic
6241 (makeDocBookFile): ditto
6243 * src/Painter.[Ch]: (~Painter): removed
6245 * src/LyXAction.C (init): entry for insettheorem added
6247 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6249 (deplog): code to detect files generated by LaTeX, needs testing
6252 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6254 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6256 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6258 * src/LaTeX.C (deplog): Add a check for files that are going to be
6259 created by the first latex run, part of the project to remove the
6262 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6263 contents to the extension list.
6265 2000-07-04 Juergen Vigna <jug@sad.it>
6267 * src/text.C (NextBreakPoint): added support for needFullRow()
6269 * src/insets/lyxinset.h: added needFullRow()
6271 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6274 * src/insets/insettext.C: lots of changes for update!
6276 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6278 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6280 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6282 * src/insets/insetinclude.C (InsetInclude): fixed
6283 initialization of include_label.
6284 (unique_id): now returns a string.
6286 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6288 * src/LaTeXFeatures.h: new member IncludedFiles, for
6289 a map of key, included file name.
6291 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6292 with the included files for inclusion in SGML preamble,
6293 i. e., linuxdoc and docbook.
6296 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6297 nice (is the generated linuxdoc code to be exported?), that
6298 allows to remove column, and only_body that will be true for
6299 slave documents. Insets are allowed inside SGML font type.
6300 New handling of the SGML preamble for included files.
6301 (makeDocBookFile): the same for docbook.
6303 * src/insets/insetinclude.h:
6304 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6306 (DocBook): new export methods.
6308 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6309 and makeDocBookFile.
6311 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6312 formats to export with command line argument -x.
6314 2000-06-29 Juergen Vigna <jug@sad.it>
6316 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6317 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6319 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6320 region could already been cleared by an inset!
6322 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6324 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6327 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6329 (cursorToggle): remove special handling of lyx focus.
6331 2000-06-28 Juergen Vigna <jug@sad.it>
6333 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6336 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6338 * src/insets/insetindex.C (Edit): add a callback when popup is
6341 * src/insets/insettext.C (LocalDispatch):
6342 * src/insets/insetmarginal.h:
6343 * src/insets/insetlist.h:
6344 * src/insets/insetfoot.h:
6345 * src/insets/insetfloat.h:
6346 * src/insets/insetert.h: add a missing std:: qualifier.
6348 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6350 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6353 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6355 * src/insets/insettext.C (Read): remove tmptok unused variable
6356 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6357 (InsertInset): change for new InsetInset code
6359 * src/insets/insettext.h: add TEXT inline method
6361 * src/insets/insettext.C: remove TEXT macro
6363 * src/insets/insetmarginal.C (Write): new method
6364 (Latex): change output slightly
6366 * src/insets/insetfoot.C (Write): new method
6367 (Latex): change output slightly (don't use endl when no need)
6369 * src/insets/insetert.C (Write): new method
6371 * src/insets/insetcollapsable.h: make button_length, button_top_y
6372 and button_bottm_y protected.
6374 * src/insets/insetcollapsable.C (Write): simplify code by using
6375 tostr. Also do not output the float name, the children class
6376 should to that to get control over own arguments
6378 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6379 src/insets/insetminipage.[Ch]:
6382 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6384 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6386 * src/Makefile.am (lyx_SOURCES): add the new files
6388 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6389 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6390 * src/commandtags.h: ditto
6392 * src/LaTeXFeatures.h: add a std::set of used floattypes
6394 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6396 * src/FloatList.[Ch] src/Floating.h: new files
6398 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6400 * src/lyx_cb.C (TableApplyCB): ditto
6402 * src/text2.C: ditto
6403 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6404 (parseSingleLyXformat2Token): ditto + add code for
6405 backwards compability for old float styles + add code for new insets
6407 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6409 (InsertInset(size_type, Inset *, LyXFont)): new method
6410 (InsetChar(size_type, char)): changed to use the other InsetChar
6411 with a LyXFont(ALL_INHERIT).
6412 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6413 insert the META_INSET.
6415 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6417 * sigc++/thread.h (Threads): from here
6419 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6420 definition out of line
6421 * sigc++/scope.h: from here
6423 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6425 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6426 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6428 * Makefile.am (bindist): new target.
6430 * INSTALL: add instructions for doing a binary distribution.
6432 * development/tools/README.bin.example: update a bit.
6434 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6437 * lib/lyxrc.example: new lyxrc tag \set_color.
6439 * src/lyxfunc.C (Dispatch):
6440 * src/commandtags.h:
6441 * src/LyXAction.C: new lyxfunc "set-color".
6443 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6444 and an x11name given as strings.
6446 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6447 cache when a color is changed.
6449 2000-06-26 Juergen Vigna <jug@sad.it>
6451 * src/lyxrow.C (width): added this functions and variable.
6453 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6456 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6458 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6460 * images/undo_bw.xpm: new icon.
6461 * images/redo_bw.xpm: ditto.
6463 * configure.in (INSTALL_SCRIPT): change value to
6464 ${INSTALL} to avoid failures of install-script target.
6465 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6467 * src/BufferView.h: add a magic "friend" declaration to please
6470 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6472 * forms/cite.fd: modified to allow resizing without messing
6475 * src/insetcite.C: Uses code from cite.fd almost without
6477 User can now resize dialog in the x-direction.
6478 Resizing the dialog in the y-direction is prevented, as the
6479 code does this intelligently already.
6481 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6483 * INSTALL: remove obsolete entry in "problems" section.
6485 * lib/examples/sl_*.lyx: update of the slovenian examples.
6487 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6489 2000-06-23 Juergen Vigna <jug@sad.it>
6491 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6493 * src/buffer.C (resize): delete the LyXText of textinsets.
6495 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6497 * src/insets/lyxinset.h: added another parameter 'cleared' to
6498 the draw() function.
6500 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6501 unlocking inset in inset.
6503 2000-06-22 Juergen Vigna <jug@sad.it>
6505 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6506 of insets and moved first to LyXText.
6508 * src/mathed/formulamacro.[Ch]:
6509 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6511 2000-06-21 Juergen Vigna <jug@sad.it>
6513 * src/text.C (GetVisibleRow): look if I should clear the area or not
6514 using Inset::doClearArea() function.
6516 * src/insets/lyxinset.h: added doClearArea() function and
6517 modified draw(Painter &, ...) to draw(BufferView *, ...)
6519 * src/text2.C (UpdateInset): return bool insted of int
6521 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6523 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6524 combox in the character popup
6526 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6527 BufferParams const & params
6529 2000-06-20 Juergen Vigna <jug@sad.it>
6531 * src/insets/insettext.C (SetParagraphData): set insetowner on
6534 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6536 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6537 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6539 (form_main_): remove
6541 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6542 (create_form_form_main): remove FD_form_main stuff, connect to
6543 autosave_timeout signal
6545 * src/LyXView.[Ch] (getMainForm): remove
6546 (UpdateTimerCB): remove
6547 * src/BufferView_pimpl.h: inherit from SigC::Object
6549 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6550 signal instead of callback
6552 * src/BufferView.[Ch] (cursorToggleCB): remove
6554 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6556 * src/BufferView_pimpl.C: changes because of the one below
6558 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6559 instead of storing a pointer to a LyXText.
6561 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6563 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6565 * src/lyxparagraph.h
6567 * src/paragraph.C: Changed fontlist to a sorted vector.
6569 2000-06-19 Juergen Vigna <jug@sad.it>
6571 * src/BufferView.h: added screen() function.
6573 * src/insets/insettext.C (LocalDispatch): some selection code
6576 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6578 * src/insets/insettext.C (SetParagraphData):
6580 (InsetText): fixes for multiple paragraphs.
6582 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6584 * development/lyx.spec.in: Call configure with ``--without-warnings''
6585 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6586 This should be fine, however, since we generally don't want to be
6587 verbose when making an RPM.
6589 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6591 * lib/scripts/fig2pstex.py: New file
6593 2000-06-16 Juergen Vigna <jug@sad.it>
6595 * src/insets/insettabular.C (UpdateLocal):
6596 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6597 (LocalDispatch): Changed all functions to use LyXText.
6599 2000-06-15 Juergen Vigna <jug@sad.it>
6601 * src/text.C (SetHeightOfRow): call inset::update before requesting
6604 * src/insets/insettext.C (update):
6605 * src/insets/insettabular.C (update): added implementation
6607 * src/insets/lyxinset.h: added update function
6609 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6611 * src/text.C (SelectNextWord): protect against null pointers with
6612 old-style string streams. (fix from Paul Theo Gonciari
6615 * src/cite.[Ch]: remove erroneous files.
6617 * lib/configure.m4: update the list of created directories.
6619 * src/lyxrow.C: include <config.h>
6620 * src/lyxcursor.C: ditto.
6622 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6624 * lib/examples/decimal.lyx: new example file from Mike.
6626 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6627 to find template definitions (from Dekel)
6629 * src/frontends/.cvsignore: add a few things.
6631 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6633 * src/Timeout.C (TimeOut): remove default argument.
6635 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6638 * src/insets/ExternalTemplate.C: add a "using" directive.
6640 * src/lyx_main.h: remove the act_ struct, which seems unused
6643 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6645 * LyX Developers Meeting: All files changed, due to random C++ (by
6646 coincidence) code generator script.
6648 - external inset (cool!)
6649 - initial online editing of preferences
6650 - insettabular breaks insettext(s contents)
6652 - some DocBook fixes
6653 - example files update
6654 - other cool stuff, create a diff and look for yourself.
6656 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6658 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6659 -1 this is a non-line-breaking textinset.
6661 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6662 if there is no width set.
6664 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6666 * Lots of files: Merged the dialogbase branch.
6668 2000-06-09 Allan Rae <rae@lyx.org>
6670 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6671 and the Dispatch methods that used it.
6673 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6674 access to functions formerly kept in Dispatch.
6676 2000-05-19 Allan Rae <rae@lyx.org>
6678 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6679 made to_page and count_copies integers again. from_page remains a
6680 string however because I want to allow entry of a print range like
6681 "1,4,22-25" using this field.
6683 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6684 and printer-params-get. These aren't useful from the minibuffer but
6685 could be used by a script/LyXServer app provided it passes a suitable
6686 auto_mem_buffer. I guess I should take a look at how the LyXServer
6687 works and make it support xtl buffers.
6689 * sigc++/: updated to libsigc++-1.0.1
6691 * src/xtl/: updated to xtl-1.3.pl.11
6693 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6694 those changes done to the files in src/ are actually recreated when
6695 they get regenerated. Please don't ever accept a patch that changes a
6696 dialog unless that patch includes the changes to the corresponding *.fd
6699 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6700 stringOnlyContains, renamed it and generalised it.
6702 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6703 branch. Removed the remaining old form_print code.
6705 2000-04-26 Allan Rae <rae@lyx.org>
6707 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6708 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6710 2000-04-25 Allan Rae <rae@lyx.org>
6712 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6713 against a base of xtl-1.3.pl.4
6715 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6716 filter the Id: entries so they still show the xtl version number
6719 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6720 into the src/xtl code. Patch still pending with José (XTL)
6722 2000-04-24 Allan Rae <rae@lyx.org>
6724 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6725 both more generic and much safer. Use the new template functions.
6726 * src/buffer.[Ch] (Dispatch): ditto.
6728 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6729 and mem buffer more intelligently. Also a little general cleanup.
6732 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6733 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6734 * src/xtl/Makefile.am: ditto.
6735 * src/xtl/.cvsignore: ditto.
6736 * src/Makefile.am: ditto.
6738 * src/PrinterParams.h: Removed the macros member functions. Added a
6739 testInvariant member function. A bit of tidying up and commenting.
6740 Included Angus's idea for fixing operation with egcs-1.1.2.
6742 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6743 cool expansion of XTL's mem_buffer to support automatic memory
6744 management within the buffer itself. Removed the various macros and
6745 replaced them with template functions that use either auto_mem_buffer
6746 or mem_buffer depending on a #define. The mem_buffer support will
6747 disappear as soon as the auto_mem_buffer is confirmed to be good on
6748 other platforms/compilers. That is, it's there so you've got something
6751 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6752 effectively forked XTL. However I expect José will include my code
6753 into the next major release. Also fixed a memory leak.
6754 * src/xtl/text.h: ditto.
6755 * src/xtl/xdr.h: ditto.
6756 * src/xtl/giop.h: ditto.
6758 2000-04-16 Allan Rae <rae@lyx.org>
6760 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6761 by autogen.sh and removed by maintainer-clean anyway.
6762 * .cvsignore, sigc++/.cvsignore: Support the above.
6764 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6766 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6768 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6769 macros, renamed static callback-target member functions to suit new
6770 scheme and made them public.
6771 * src/frontends/xforms/forms/form_print.fd: ditto.
6772 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6774 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6777 * src/xtl/: New directory containing a minimal distribution of XTL.
6778 This is XTL-1.3.pl.4.
6780 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6782 2000-04-15 Allan Rae <rae@lyx.org>
6784 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6786 * sigc++/: Updated to libsigc++-1.0.0
6788 2000-04-14 Allan Rae <rae@lyx.org>
6790 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6791 use the generic ones in future. I'll modify my conversion script.
6793 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6795 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6796 (CloseAllBufferRelatedDialogs): Renamed.
6797 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6799 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6800 of the generic ones. These are the same ones my conversion script
6803 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6804 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6805 * src/buffer.C (Dispatch): ditto
6807 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6808 functions for updating and hiding buffer dependent dialogs.
6809 * src/BufferView.C (buffer): ditto
6810 * src/buffer.C (setReadonly): ditto
6811 * src/lyxfunc.C (CloseBuffer): ditto
6813 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6814 Dialogs.h, and hence all the SigC stuff, into every file that includes
6815 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6817 * src/BufferView2.C: reduce the number of headers included by buffer.h
6819 2000-04-11 Allan Rae <rae@lyx.org>
6821 * src/frontends/xforms/xform_macros.h: A small collection of macros
6822 for building C callbacks.
6824 * src/frontends/xforms/Makefile.am: Added above file.
6826 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6827 scheme again. This time it should work for JMarc. If this is
6828 successful I'll revise my conversion script to automate some of this.
6829 The static member functions in the class also have to be public for
6830 this scheme will work. If the scheme works (it's almost identical to
6831 the way BufferView::cursorToggleCB is handled so it should work) then
6832 FormCopyright and FormPrint will be ready for inclusion into the main
6833 trunk immediately after 1.1.5 is released -- provided we're prepared
6834 for complaints about lame compilers not handling XTL.
6836 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6838 2000-04-07 Allan Rae <rae@lyx.org>
6840 * config/lyxinclude.m4: A bit more tidying up (Angus)
6842 * src/LString.h: JMarc's <string> header fix
6844 * src/PrinterParams.h: Used string for most data to remove some
6845 ugly code in the Print dialog and avoid even uglier code when
6846 appending the ints to a string for output.
6848 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6849 and moved "default:" back to the end of switch statement. Cleaned
6850 up the printing so it uses the right function calls and so the
6851 "print to file" option actually puts the file in the right directory.
6853 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6855 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6856 and Ok+Apply button control into a separate method: input (Angus).
6857 (input) Cleaned it up and improved it to be very thorough now.
6858 (All CB) static_cast used instead of C style cast (Angus). This will
6859 probably change again once we've worked out how to keep gcc-2.8.1 happy
6860 with real C callbacks.
6861 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6862 ignore some of the bool settings and has random numbers instead. Needs
6863 some more investigation. Added other input length checks and checking
6864 of file and printer names.
6866 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6867 would link (Angus). Seems the old code doesn't compile with the pragma
6868 statement either. Separated callback entries from internal methods.
6870 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6872 2000-03-17 Allan Rae <rae@lyx.org>
6874 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6875 need it? Maybe it could go in Dialogs instead? I could make it a
6876 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6877 values to get the bool return value.
6878 (Dispatch): New overloaded method for xtl support.
6880 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6881 extern "C" callback instead of static member functions. Hopefully,
6882 JMarc will be able to compile this. I haven't changed
6883 forms/form_copyright.fd yet. Breaking one of my own rules already.
6885 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6886 because they aren't useful from the minibuffer. Maybe a LyXServer
6887 might want a help message though?
6889 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6891 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6892 xtl which needs both rtti and exceptions.
6894 * src/support/Makefile.am:
6895 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6897 * src/frontends/xforms/input_validators.[ch]: input filters and
6898 validators. These conrol what keys are valid in input boxes.
6899 Use them and write some more. Much better idea than waiting till
6900 after the user has pressed Ok to say that the input fields don't make
6903 * src/frontends/xforms/Makefile.am:
6904 * src/frontends/xforms/forms/form_print.fd:
6905 * src/frontends/xforms/forms/makefile:
6906 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6907 new scheme. Still have to make sure I haven't missed anything from
6908 the current implementation.
6910 * src/Makefile.am, src/PrinterParams.h: New data store.
6912 * other files: Added a couple of copyright notices.
6914 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6916 * src/insets/insetbib.h: move Holder struct in public space.
6918 * src/frontends/include/DialogBase.h: use SigC:: only when
6919 SIGC_CXX_NAMESPACES is defined.
6920 * src/frontends/include/Dialogs.h: ditto.
6922 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6924 * src/frontends/xforms/FormCopyright.[Ch]: do not
6925 mention SigC:: explicitely.
6927 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6929 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6930 deals with testing KDE in main configure.in
6931 * configure.in: ditto.
6933 2000-02-22 Allan Rae <rae@lyx.org>
6935 * Lots of files: Merged from HEAD
6937 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6938 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6940 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6942 * sigc++/: new minidist.
6944 2000-02-14 Allan Rae <rae@lyx.org>
6946 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6948 2000-02-08 Juergen Vigna <jug@sad.it>
6950 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6951 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6953 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6954 for this port and so it is much easier for other people to port
6955 dialogs in a common development environment.
6957 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6958 the QT/KDE implementation.
6960 * src/frontends/kde/Dialogs.C:
6961 * src/frontends/kde/FormCopyright.C:
6962 * src/frontends/kde/FormCopyright.h:
6963 * src/frontends/kde/Makefile.am:
6964 * src/frontends/kde/formcopyrightdialog.C:
6965 * src/frontends/kde/formcopyrightdialog.h:
6966 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6967 for the kde support of the Copyright-Dialog.
6969 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6970 subdir-substitution instead of hardcoded 'xforms' as we now have also
6973 * src/frontends/include/DialogBase.h (Object): just commented the
6974 label after #endif (nasty warning and I don't like warnings ;)
6976 * src/main.C (main): added KApplication initialization if using
6979 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6980 For now only the KDE event-loop is added if frontend==kde.
6982 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6984 * configure.in: added support for the --with-frontend[=value] option
6986 * autogen.sh: added kde.m4 file to list of config-files
6988 * acconfig.h: added define for KDEGUI-support
6990 * config/kde.m4: added configuration functions for KDE-port
6992 * config/lyxinclude.m4: added --with-frontend[=value] option with
6993 support for xforms and KDE.
6995 2000-02-08 Allan Rae <rae@lyx.org>
6997 * all Makefile.am: Fixed up so the make targets dist, distclean,
6998 install and uninstall all work even if builddir != srcdir. Still
6999 have a new sigc++ minidist update to come.
7001 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7003 2000-02-01 Allan Rae <rae@lyx.org>
7005 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7006 Many mods to get builddir != srcdir working.
7008 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7009 for building on NT and so we can do the builddir != srcdir stuff.
7011 2000-01-30 Allan Rae <rae@lyx.org>
7013 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7014 This will stay in "rae" branch. We probably don't really need it in
7015 the main trunk as anyone who wants to help programming it should get
7016 a full library installed also. So they can check both included and
7017 system supplied library compilation.
7019 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7020 Added a 'mini' distribution of libsigc++. If you feel the urge to
7021 change something in these directories - Resist it. If you can't
7022 resist the urge then you should modify the following script and rebuild
7023 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7024 all happen. Still uses a hacked version of libsigc++'s configure.in.
7025 I'm quite happy with the results. I'm not sure the extra work to turn
7026 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7027 worth the trouble and would probably lead to extra maintenance
7029 I haven't tested the following important make targets: install, dist.
7030 Not ready for prime time but very close. Maybe 1.1.5.
7032 * development/tools/makeLyXsigc.sh: A shell script to automatically
7033 generate our mini-dist of libsigc++. It can only be used with a CVS
7034 checkout of libsigc++ not a tarball distribution. It's well commented.
7035 This will end up as part of the libsigc++ distribution so other apps
7036 can easily have an included mini-dist. If someone makes mods to the
7037 sigc++ subpackage without modifying this script to generate those
7038 changes I'll be very upset!
7040 * src/frontends/: Started the gui/system indep structure.
7042 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7043 to access the gui-indep dialogs are in this class. Much improved
7044 design compared to previous revision. Lars, please refrain from
7045 moving this header into src/ like you did with Popups.h last time.
7047 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7049 * src/frontends/xforms/: Started the gui-indep system with a single
7050 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7053 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7054 Here you'll find a very useful makefile and automated fdfix.sh that
7055 makes updating dailogs a no-brainer -- provided you follow the rules
7056 set out in the README. I'm thinking about adding another script to
7057 automatically generate skeleton code for a new dialog given just the
7060 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7061 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7062 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7064 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7066 * src/support/LSubstring.C (operator): simplify
7068 * src/lyxtext.h: removed bparams, use buffer_->params instead
7070 * src/lyxrow.h: make Row a real class, move all variables to
7071 private and use accessors.
7073 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7075 (isRightToLeftPar): ditto
7076 (ChangeLanguage): ditto
7077 (isMultiLingual): ditto
7080 (SimpleTeXOnePar): ditto
7081 (TeXEnvironment): ditto
7082 (GetEndLabel): ditto
7084 (SetOnlyLayout): ditto
7085 (BreakParagraph): ditto
7086 (BreakParagraphConservative): ditto
7087 (GetFontSettings): ditto
7089 (CopyIntoMinibuffer): ditto
7090 (CutIntoMinibuffer): ditto
7091 (PasteParagraph): ditto
7092 (SetPExtraType): ditto
7093 (UnsetPExtraType): ditto
7094 (DocBookContTableRows): ditto
7095 (SimpleDocBookOneTablePar): ditto
7097 (TeXFootnote): ditto
7098 (SimpleTeXOneTablePar): ditto
7099 (TeXContTableRows): ditto
7100 (SimpleTeXSpecialChars): ditto
7103 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7104 to private and use accessors.
7106 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7107 this, we did not use it anymore and has not been for ages. Just a
7108 waste of cpu cycles.
7110 * src/language.h: make Language a real class, move all variables
7111 to private and use accessors.
7113 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7114 (create_view): remove
7115 (update): some changes for new timer
7116 (cursorToggle): use new timer
7117 (beforeChange): change for new timer
7119 * src/BufferView.h (cursorToggleCB): removed last paramter because
7122 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7123 (cursorToggleCB): change because of new timer code
7125 * lib/CREDITS: updated own mailaddress
7127 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7129 * src/support/filetools.C (PutEnv): fix the code in case neither
7130 putenv() nor setenv() have been found.
7132 * INSTALL: mention the install-strip Makefile target.
7134 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7135 read-only documents.
7137 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7139 * lib/reLyX/configure.in (VERSION): avoid using a previously
7140 generated reLyX wrapper to find out $prefix.
7142 * lib/examples/eu_adibide_lyx-atua.lyx:
7143 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7144 translation of the Tutorial (Dooteo)
7146 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7148 * forms/cite.fd: new citation dialog
7150 * src/insetcite.[Ch]: the new citation dialog is moved into
7153 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7156 * src/insets/insetcommand.h: data members made private.
7158 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7160 * LyX 1.1.5 released
7162 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7164 * src/version.h (LYX_RELEASE): to 1.1.5
7166 * src/spellchecker.C (RunSpellChecker): return false if the
7167 spellchecker dies upon creation.
7169 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7171 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7172 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7176 * lib/CREDITS: update entry for Martin Vermeer.
7178 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7180 * src/text.C (draw): Draw foreign language bars at the bottom of
7181 the row instead of at the baseline.
7183 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7185 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7187 * lib/bind/de_menus.bind: updated
7189 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7191 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7193 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7195 * src/menus.C (Limit_string_length): New function
7196 (ShowTocMenu): Limit the number of items/length of items in the
7199 * src/paragraph.C (String): Correct result for a paragraph inside
7202 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7204 * src/bufferlist.C (close): test of buf->getuser() == NULL
7206 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7208 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7209 Do not call to SetCursor when the paragraph is a closed footnote!
7211 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7213 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7216 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7218 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7221 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7222 reference popup, that activates the reference-back action
7224 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7226 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7227 the menus. Also fixed a bug.
7229 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7230 the math panels when switching buffers (unless new buffer is readonly).
7232 * src/BufferView.C (NoSavedPositions)
7233 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7235 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7237 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7238 less of dvi dirty or not.
7240 * src/trans_mgr.[Ch] (insert): change first parameter to string
7243 * src/chset.[Ch] (encodeString): add const to first parameter
7245 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7247 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7251 * src/LaTeX.C (deplog): better searching for dependency files in
7252 the latex log. Uses now regexps.
7254 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7255 instead of the box hack or \hfill.
7257 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7259 * src/lyxfunc.C (doImportHelper): do not create the file before
7260 doing the actual import.
7261 (doImportASCIIasLines): create a new file before doing the insert.
7262 (doImportASCIIasParagraphs): ditto.
7264 * lib/lyxrc.example: remove mention of non-existing commands
7266 * lyx.man: remove mention of color-related switches.
7268 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7270 * src/lyx_gui.C: remove all the color-related ressources, which
7271 are not used anymore.
7273 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7276 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7278 * src/lyxrc.C (read): Add a missing break in the switch
7280 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7282 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7284 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7287 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7289 * src/text.C (draw): draw bars under foreign language words.
7291 * src/LColor.[Ch]: add LColor::language
7293 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7295 * src/lyxcursor.h (boundary): New member variable
7297 * src/text.C (IsBoundary): New methods
7299 * src/text.C: Use the above for currect cursor movement when there
7300 is both RTL & LTR text.
7302 * src/text2.C: ditto
7304 * src/bufferview_funcs.C (ToggleAndShow): ditto
7306 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7308 * src/text.C (DeleteLineForward): set selection to true to avoid
7309 that DeleteEmptyParagraphMechanism does some magic. This is how it
7310 is done in all other functions, and seems reasonable.
7311 (DeleteWordForward): do not jump over non-word stuff, since
7312 CursorRightOneWord() already does it.
7314 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7315 DeleteWordBackward, since they seem safe to me (since selection is
7316 set to "true") DeleteEmptyParagraphMechanism does nothing.
7318 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7320 * src/lyx_main.C (easyParse): simplify the code by factoring the
7321 part that removes parameters from the command line.
7322 (LyX): check wether wrong command line options have been given.
7324 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7326 * src/lyx_main.C : add support for specifying user LyX
7327 directory via command line option -userdir.
7329 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7331 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7332 the number of items per popup.
7333 (Add_to_refs_menu): Ditto.
7335 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7337 * src/lyxparagraph.h: renamed ClearParagraph() to
7338 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7339 textclass as parameter, and do nothing if free_spacing is
7340 true. This fixes part of the line-delete-forward problems.
7342 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7343 (pasteSelection): ditto.
7344 (SwitchLayoutsBetweenClasses): more translatable strings.
7346 * src/text2.C (CutSelection): use StripLeadingSpaces.
7347 (PasteSelection): ditto.
7348 (DeleteEmptyParagraphMechanism): ditto.
7350 2000-05-26 Juergen Vigna <jug@sad.it>
7352 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7353 is not needed in tabular insets.
7355 * src/insets/insettabular.C (TabularFeatures): added missing features.
7357 * src/tabular.C (DeleteColumn):
7359 (AppendRow): implemented this functions
7360 (cellsturct::operator=): clone the inset too;
7362 2000-05-23 Juergen Vigna <jug@sad.it>
7364 * src/insets/insettabular.C (LocalDispatch): better selection support
7365 when having multicolumn-cells.
7367 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7369 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7371 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7373 * src/ColorHandler.C (getGCForeground): put more test into _()
7375 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7378 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7381 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7383 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7384 there are no labels, or when buffer is readonly.
7386 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7387 there are no labels, buffer is SGML, or when buffer is readonly.
7389 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7391 * src/LColor.C (LColor): change a couple of grey40 to grey60
7392 (LColor): rewore initalization to make compiles go some magnitude
7394 (getGUIName): don't use gettext until we need the string.
7396 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7398 * src/Bullet.[Ch]: Fixed a small bug.
7400 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7402 * src/paragraph.C (String): Several fixes/improvements
7404 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7406 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7408 * src/paragraph.C (String): give more correct output.
7410 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7412 * src/lyxfont.C (stateText) Do not output the language if it is
7413 eqaul to the language of the document.
7415 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7416 between two paragraphs with the same language.
7418 * src/paragraph.C (getParLanguage) Return a correct answer for an
7419 empty dummy paragraph.
7421 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7424 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7427 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7428 the menus/popup, if requested fonts are unavailable.
7430 2000-05-22 Juergen Vigna <jug@sad.it>
7432 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7433 movement support (Up/Down/Tab/Shift-Tab).
7434 (LocalDispatch): added also preliminari cursor-selection.
7436 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7438 * src/paragraph.C (PasteParagraph): Hopefully now right!
7440 2000-05-22 Garst R. Reese <reese@isn.net>
7442 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7443 of list, change all references to Environment to Command
7444 * tex/hollywood.cls : rewrite environments as commands, add
7445 \uppercase to interiorshot and exteriorshot to force uppecase.
7446 * tex/broadway.cls : rewrite environments as commands. Tweak
7449 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7451 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7452 size of items: use a constant intead of the hardcoded 40, and more
7453 importantly do not remove the %m and %x tags added at the end.
7454 (Add_to_refs_menu): use vector::size_type instead of
7455 unsigned int as basic types for the variables. _Please_ do not
7456 assume that size_t is equal to unsigned int. On an alpha, this is
7457 unsigned long, which is _not_ the same.
7459 * src/language.C (initL): remove language "hungarian", since it
7460 seems that "magyar" is better.
7462 2000-05-22 Juergen Vigna <jug@sad.it>
7464 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7466 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7469 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7470 next was deleted but not set to 0.
7472 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7474 * src/language.C (initL): change the initialization of languages
7475 so that compiles goes _fast_.
7477 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7480 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7482 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7486 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7488 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7490 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7494 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7497 * src/insets/insetlo*.[Ch]: Made editable
7499 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7501 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7502 the current selection.
7504 * src/BufferView_pimpl.C (stuffClipboard): new method
7506 * src/BufferView.C (stuffClipboard): new method
7508 * src/paragraph.C (String): new method
7510 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7511 LColor::ignore when lyxname is not found.
7513 * src/BufferView.C (pasteSelection): new method
7515 * src/BufferView_pimpl.C (pasteSelection): new method
7517 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7519 * src/WorkArea.C (request_clipboard_cb): new static function
7520 (getClipboard): new method
7521 (putClipboard): new method
7523 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7525 * LyX 1.1.5pre2 released
7527 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7529 * src/vspace.C (operator=): removed
7530 (operator=): removed
7532 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7534 * src/layout.C (NumberOfClass): manually set the type in make_pair
7535 (NumberOfLayout): ditto
7537 * src/language.C: use the Language constructor for ignore_lang
7539 * src/language.h: add constructors to struct Language
7541 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7543 * src/text2.C (SetCursorIntern): comment out #warning
7545 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7547 * src/mathed/math_iter.h: initialize sx and sw to 0
7549 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7551 * forms/lyx.fd: Redesign of form_ref
7553 * src/LaTeXFeatures.[Ch]
7557 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7560 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7561 and Buffer::inset_iterator.
7563 * src/menus.C: Added new menus: TOC and Refs.
7565 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7567 * src/buffer.C (getTocList): New method.
7569 * src/BufferView2.C (ChangeRefs): New method.
7571 * src/buffer.C (getLabelList): New method. It replaces the old
7572 getReferenceList. The return type is vector<string> instead of
7575 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7576 the old getLabel() and GetNumberOfLabels() methods.
7577 * src/insets/insetlabel.C (getLabelList): ditto
7578 * src/mathed/formula.C (getLabelList): ditto
7580 * src/paragraph.C (String): New method.
7582 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7583 Uses the new getTocList() method.
7584 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7585 which automatically updates the contents of the browser.
7586 (RefUpdateCB): Use the new getLabelList method.
7588 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7590 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7592 * src/spellchecker.C: Added using std::reverse;
7594 2000-05-19 Juergen Vigna <jug@sad.it>
7596 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7598 * src/insets/insettext.C (computeTextRows): small fix for display of
7599 1 character after a newline.
7601 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7604 2000-05-18 Juergen Vigna <jug@sad.it>
7606 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7607 when changing width of column.
7609 * src/tabular.C (set_row_column_number_info): setting of
7610 autobreak rows if necessary.
7612 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7614 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7616 * src/vc-backend.*: renamed stat() to status() and vcstat to
7617 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7618 compilation broke. The new name seems more relevant, anyway.
7620 2000-05-17 Juergen Vigna <jug@sad.it>
7622 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7623 which was wrong if the removing caused removing of rows!
7625 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7626 (pushToken): new function.
7628 * src/text2.C (CutSelection): fix problem discovered with purify
7630 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7632 * src/debug.C (showTags): enlarge the first column, now that we
7633 have 6-digits debug codes.
7635 * lib/layouts/hollywood.layout:
7636 * lib/tex/hollywood.cls:
7637 * lib/tex/brodway.cls:
7638 * lib/layouts/brodway.layout: more commands and fewer
7639 environments. Preambles moved in the .cls files. Broadway now has
7640 more options on scene numbering and less whitespace (from Garst)
7642 * src/insets/insetbib.C (getKeys): make sure that we are in the
7643 document directory, in case the bib file is there.
7645 * src/insets/insetbib.C (Latex): revert bogus change.
7647 2000-05-16 Juergen Vigna <jug@sad.it>
7649 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7650 the TabularLayout on cursor move.
7652 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7654 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7657 (draw): fixed cursor position and drawing so that the cursor is
7658 visible when before the tabular-inset.
7660 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7661 when creating from old insettext.
7663 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7665 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7667 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7668 * lib/tex/brodway.cls: ditto
7670 * lib/layouts/brodway.layout: change alignment of parenthical
7673 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7675 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7676 versions 0.88 and 0.89 are supported.
7678 2000-05-15 Juergen Vigna <jug@sad.it>
7680 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7683 * src/insets/insettext.C (computeTextRows): redone completely this
7684 function in a much cleaner way, because of problems when having a
7686 (draw): added a frame border when the inset is locked.
7687 (SetDrawLockedFrame): this sets if we draw the border or not.
7688 (SetFrameColor): this sets the frame color (default=insetframe).
7690 * src/insets/lyxinset.h: added x() and y() functions which return
7691 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7692 function which is needed to see if we have a locking inset of some
7693 type in this inset (needed for now in insettabular).
7695 * src/vspace.C (inPixels): the same function also without a BufferView
7696 parameter as so it is easier to use it in some ocasions.
7698 * src/lyxfunc.C: changed all places where insertInset was used so
7699 that now if it couldn't be inserted it is deleted!
7701 * src/TabularLayout.C:
7702 * src/TableLayout.C: added support for new tabular-inset!
7704 * src/BufferView2.C (insertInset): this now returns a bool if the
7705 inset was really inserted!!!
7707 * src/tabular.C (GetLastCellInRow):
7708 (GetFirstCellInRow): new helper functions.
7709 (Latex): implemented for new tabular class.
7713 (TeXTopHLine): new Latex() helper functions.
7715 2000-05-12 Juergen Vigna <jug@sad.it>
7717 * src/mathed/formulamacro.C (Read):
7718 * src/mathed/formula.C (Read): read also the \end_inset here!
7720 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7722 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7723 crush when saving formulae with unbalanced parenthesis.
7725 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7727 * src/layout.C: Add new keyword "endlabelstring" to layout file
7729 * src/text.C (GetVisibleRow): Draw endlabel string.
7731 * lib/layouts/broadway.layout
7732 * lib/layouts/hollywood.layout: Added endlabel for the
7733 Parenthetical layout.
7735 * lib/layouts/heb-article.layout: Do not use slanted font shape
7736 for Theorem like environments.
7738 * src/buffer.C (makeLaTeXFile): Always add "american" to
7739 the UsedLanguages list if document language is RTL.
7741 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7743 * add addendum to README.OS2 and small patch (from SMiyata)
7745 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7747 * many files: correct the calls to ChangeExtension().
7749 * src/support/filetools.C (ChangeExtension): remove the no_path
7750 argument, which does not belong there. Use OnlyFileName() instead.
7752 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7753 files when LaTeXing a non-nice latex file.
7755 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7756 a chain of "if". Return false when deadkeys are not handled.
7758 * src/lyx_main.C (LyX): adapted the code for default bindings.
7760 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7761 bindings for basic functionality (except deadkeys).
7762 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7764 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7765 several methods: handle override_x_deadkeys.
7767 * src/lyxrc.h: remove the "bindings" map, which did not make much
7768 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7770 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7772 * src/lyxfont.C (stateText): use a saner method to determine
7773 whether the font is "default". Seems to fix the crash with DEC
7776 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7778 2000-05-08 Juergen Vigna <jug@sad.it>
7780 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7781 TabularLayoutMenu with mouse-button-3
7782 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7784 * src/TabularLayout.C: added this file for having a Layout for
7787 2000-05-05 Juergen Vigna <jug@sad.it>
7789 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7790 recalculating inset-widths.
7791 (TabularFeatures): activated this function so that I can change
7792 tabular-features via menu.
7794 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7795 that I can test some functions with the Table menu.
7797 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7799 * src/lyxfont.C (stateText): guard against stupid c++libs.
7801 * src/tabular.C: add using std::vector
7802 some whitespace changes, + removed som autogenerated code.
7804 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7806 2000-05-05 Juergen Vigna <jug@sad.it>
7808 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7809 row, columns and cellstructures.
7811 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7813 * lib/lyxrc.example: remove obsolete entries.
7815 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7816 reading of protected_separator for free_spacing.
7818 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7820 * src/text.C (draw): do not display an exclamation mark in the
7821 margin for margin notes. This is confusing, ugly and
7824 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7825 AMS math' is checked.
7827 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7828 name to see whether including the amsmath package is needed.
7830 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7832 * src/paragraph.C (validate): Compute UsedLanguages correctly
7833 (don't insert the american language if it doesn't appear in the
7836 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7837 The argument of \thanks{} command is considered moving argument
7839 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7842 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7844 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7845 for appendix/minipage/depth. The lines can be now both in the footnote
7846 frame, and outside the frame.
7848 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7851 2000-05-05 Juergen Vigna <jug@sad.it>
7853 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7854 neede only in tabular.[Ch].
7856 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7858 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7860 (Write): write '~' for PROTECTED_SEPARATOR
7862 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7864 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7867 * src/mathed/formula.C (drawStr): rename size to siz.
7869 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7870 possibly fix a bug by not changing the pflags = flags to piflags =
7873 2000-05-05 Juergen Vigna <jug@sad.it>
7875 * src/insets/insetbib.C: moved using directive
7877 * src/ImportNoweb.C: small fix for being able to compile (missing
7880 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7882 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7883 to use clear, since we don't depend on this in the code. Add test
7886 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7888 * (various *.C files): add using std::foo directives to please dec
7891 * replace calls to string::clear() to string::erase() (Angus)
7893 * src/cheaders/cmath: modified to provide std::abs.
7895 2000-05-04 Juergen Vigna <jug@sad.it>
7897 * src/insets/insettext.C: Prepared all for inserting of multiple
7898 paragraphs. Still display stuff to do (alignment and other things),
7899 but I would like to use LyXText to do this when we cleaned out the
7900 table-support stuff.
7902 * src/insets/insettabular.C: Changed lot of stuff and added lots
7903 of functionality still a lot to do.
7905 * src/tabular.C: Various functions changed name and moved to be
7906 const functions. Added new Read and Write functions and changed
7907 lots of things so it works good with tabular-insets (also removed
7908 some stuff which is not needed anymore * hacks *).
7910 * src/lyxcursor.h: added operators == and != which just look if
7911 par and pos are (not) equal.
7913 * src/buffer.C (latexParagraphs): inserted this function to latex
7914 all paragraphs form par to endpar as then I can use this too for
7917 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7918 so that I can call this to from text insets with their own cursor.
7920 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7921 output off all paragraphs (because of the fix below)!
7923 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7924 the very last paragraph (this could be also the last paragraph of an
7927 * src/texrow.h: added rows() call which returns the count-variable.
7929 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7931 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7933 * lib/configure.m4: better autodetection of DocBook tools.
7935 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7937 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7939 * src/lyx_cb.C: add using std::reverse;
7941 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7944 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7945 selected files. Should fix repeated errors from generated files.
7947 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7949 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7951 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7952 the spellchecker popup.
7954 * lib/lyxrc.example: Removed the \number_inset section
7956 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7958 * src/insets/figinset.C (various): Use IsFileReadable() to make
7959 sure that the file actually exist. Relying on ghostscripts errors
7960 is a bad idea since they can lead to X server crashes.
7962 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7964 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7967 * lib/lyxrc.example: smallish typo in description of
7968 \view_dvi_paper_option
7970 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7973 * src/lyxfunc.C: doImportHelper to factor out common code of the
7974 various import methods. New functions doImportASCIIasLines,
7975 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7976 doImportLinuxDoc for the format specific parts.
7979 * buffer.C: Dispatch returns now a bool to indicate success
7982 * lyx_gui.C: Add getLyXView() for member access
7984 * lyx_main.C: Change logic for batch commands: First try
7985 Buffer::Dispatch (possibly without GUI), if that fails, use
7988 * lyx_main.C: Add support for --import command line switch.
7989 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7990 Available Formats: Everything accepted by 'buffer-import <format>'
7992 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7994 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7997 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7998 documents will be reformatted upon reentry.
8000 2000-04-27 Juergen Vigna <jug@sad.it>
8002 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8003 correctly only last pos this was a bug.
8005 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8007 * release of lyx-1.1.5pre1
8009 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8011 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8013 * src/menus.C: revert the change of naming (Figure->Graphic...)
8014 from 2000-04-11. It was incomplete and bad.
8016 * src/LColor.[Ch]: add LColor::depthbar.
8017 * src/text.C (GetVisibleRow): use it.
8019 * README: update the languages list.
8021 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8023 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8026 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8028 * README: remove sections that were just wrong.
8030 * src/text2.C (GetRowNearY): remove currentrow code
8032 * src/text.C (GetRow): remove currentrow code
8034 * src/screen.C (Update): rewritten a bit.
8035 (SmallUpdate): removed func
8037 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8039 (FullRebreak): return bool
8040 (currentrow): remove var
8041 (currentrow_y): ditto
8043 * src/lyxscreen.h (Draw): change arg to unsigned long
8044 (FitCursor): return bool
8045 (FitManualCursor): ditto
8046 (Smallpdate): remove func
8047 (first): change to unsigned long
8048 (DrawOneRow): change second arg to long (from long &)
8049 (screen_refresh_y): remove var
8050 (scree_refresh_row): ditto
8052 * src/lyxrow.h: change baseline to usigned int from unsigned
8053 short, this brings some implicit/unsigned issues out in the open.
8055 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8057 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8058 instead of smallUpdate.
8060 * src/lyxcursor.h: change y to unsigned long
8062 * src/buffer.h: don't call updateScrollbar after fitcursor
8064 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8065 where they are used. Removed "\\direction", this was not present
8066 in 1.1.4 and is already obsolete. Commented out some code that I
8067 believe to never be called.
8068 (runLiterate): don't call updateScrollbar after fitCursor
8070 (buildProgram): ditto
8073 * src/WorkArea.h (workWidth): change return val to unsigned
8076 (redraw): remove the button redraws
8077 (setScrollbarValue): change for scrollbar
8078 (getScrollbarValue): change for scrollbar
8079 (getScrollbarBounds): change for scrollbar
8081 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8082 (C_WorkArea_down_cb): removed func
8083 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8084 (resize): change for scrollbar
8085 (setScrollbar): ditto
8086 (setScrollbarBounds): ditto
8087 (setScrollbarIncrements): ditto
8088 (up_cb): removed func
8089 (down_cb): removed func
8090 (scroll_cb): change for scrollbar
8091 (work_area_handler): ditto
8093 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8094 when FitCursor did something.
8095 (updateScrollbar): some unsigned changes
8096 (downCB): removed func
8097 (scrollUpOnePage): removed func
8098 (scrollDownOnePage): remvoed func
8099 (workAreaMotionNotify): don't call screen->FitCursor but use
8100 fitCursor instead. and bool return val
8101 (workAreaButtonPress): ditto
8102 (workAreaButtonRelease): some unsigned changes
8103 (checkInsetHit): ditto
8104 (workAreaExpose): ditto
8105 (update): parts rewritten, comments about the signed char arg added
8106 (smallUpdate): removed func
8107 (cursorPrevious): call needed updateScrollbar
8110 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8113 * src/BufferView.[Ch] (upCB): removed func
8114 (downCB): removed func
8115 (smallUpdate): removed func
8117 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8119 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8120 currentrow, currentrow_y optimization. This did not help a lot and
8121 if we want to do this kind of optimization we should rather use
8122 cursor.row instead of the currentrow.
8124 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8125 buffer spacing and klyx spacing support.
8127 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8129 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8132 2000-04-26 Juergen Vigna <jug@sad.it>
8134 * src/insets/figinset.C: fixes to Lars sstream changes!
8136 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8138 * A lot of files: Added Ascii(ostream &) methods to all inset
8139 classes. Used when exporting to ASCII.
8141 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8142 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8145 * src/text2.C (ToggleFree): Disabled implicit word selection when
8146 there is a change in the language
8148 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8149 no output was generated for end-of-sentence inset.
8151 * src/insets/lyxinset.h
8154 * src/paragraph.C: Removed the insetnumber code
8156 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8158 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8160 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8161 no_babel and no_epsfig completely from the file.
8162 (parseSingleLyXformat2Token): add handling for per-paragraph
8163 spacing as written by klyx.
8165 * src/insets/figinset.C: applied patch by Andre. Made it work with
8168 2000-04-20 Juergen Vigna <jug@sad.it>
8170 * src/insets/insettext.C (cutSelection):
8171 (copySelection): Fixed with selection from right to left.
8172 (draw): now the rows are not recalculated at every draw.
8173 (computeTextRows): for now reset the inset-owner here (this is
8174 important for an undo or copy where the inset-owner is not set
8177 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8178 motion to the_locking_inset screen->first was forgotten, this was
8179 not important till we got multiline insets.
8181 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8183 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8184 code seems to be alright (it is code changed by Dekel, and the
8185 intent is indeed that all macros should be defined \protect'ed)
8187 * NEWS: a bit of reorganisation of the new user-visible features.
8189 2000-04-19 Juergen Vigna <jug@sad.it>
8191 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8192 position. Set the inset_owner of the used paragraph so that it knows
8193 that it is inside an inset. Fixed cursor handling with mouse and
8194 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8195 and cleanups to make TextInsets work better.
8197 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8198 Changed parameters of various functions and added LockInsetInInset().
8200 * src/insets/insettext.C:
8202 * src/insets/insetcollapsable.h:
8203 * src/insets/insetcollapsable.C:
8204 * src/insets/insetfoot.h:
8205 * src/insets/insetfoot.C:
8206 * src/insets/insetert.h:
8207 * src/insets/insetert.C: cleaned up the code so that it works now
8208 correctly with insettext.
8210 * src/insets/inset.C:
8211 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8212 that insets in insets are supported right.
8215 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8217 * src/paragraph.C: some small fixes
8219 * src/debug.h: inserted INSETS debug info
8221 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8222 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8224 * src/commandtags.h:
8225 * src/LyXAction.C: insert code for InsetTabular.
8227 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8228 not Button1MotionMask.
8229 (workAreaButtonRelease): send always a InsetButtonRelease event to
8231 (checkInsetHit): some setCursor fixes (always with insets).
8233 * src/BufferView2.C (lockInset): returns a bool now and extended for
8234 locking insets inside insets.
8235 (showLockedInsetCursor): it is important to have the cursor always
8236 before the locked inset.
8237 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8239 * src/BufferView.h: made lockInset return a bool.
8241 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8243 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8244 that is used also internally but can be called as public to have back
8245 a cursor pos which is not set internally.
8246 (SetCursorIntern): Changed to use above function.
8248 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8250 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8255 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8256 patches for things that should be in or should be changed.
8258 * src/* [insetfiles]: change "usigned char fragile" to bool
8259 fragile. There was only one point that could that be questioned
8260 and that is commented in formulamacro.C. Grep for "CHECK".
8262 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8263 (DeleteBuffer): take it out of CutAndPaste and make it static.
8265 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8267 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8268 output the spacing envir commands. Also the new commands used in
8269 the LaTeX output makes the result better.
8271 * src/Spacing.C (writeEnvirBegin): new method
8272 (writeEnvirEnd): new method
8274 2000-04-18 Juergen Vigna <jug@sad.it>
8276 * src/CutAndPaste.C: made textclass a static member of the class
8277 as otherwise it is not accesed right!!!
8279 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8281 * forms/layout_forms.fd
8282 * src/layout_forms.h
8283 * src/layout_forms.C (create_form_form_character)
8284 * src/lyx_cb.C (UserFreeFont)
8285 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8286 documents (in the layout->character popup).
8288 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8290 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8291 \spell_command was in fact not honored (from Kevin Atkinson).
8293 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8296 * src/lyx_gui.h: make lyxViews private (Angus)
8298 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8300 * src/mathed/math_write.C
8301 (MathMatrixInset::Write) Put \protect before \begin{array} and
8302 \end{array} if fragile
8303 (MathParInset::Write): Put \protect before \\ if fragile
8305 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8307 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8308 initialization if the LyXColorHandler must be done after the
8309 connections to the XServer has been established.
8311 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8312 get the background pixel from the lyxColorhandler so that the
8313 figures are rendered with the correct background color.
8314 (NextToken): removed functions.
8315 (GetPSSizes): use ifs >> string instead of NextToken.
8317 * src/Painter.[Ch]: the color cache moved out of this file.
8319 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8322 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8324 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8325 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8327 * src/BufferView.C (enterView): new func
8328 (leaveView): new func
8330 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8332 (leaveView): new func, undefines xterm cursor when approp.
8334 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8335 (AllowInput): delete the Workarea cursor handling from this func.
8337 * src/Painter.C (underline): draw a slimer underline in most cases.
8339 * src/lyx_main.C (error_handler): use extern "C"
8341 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8343 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8344 sent directly to me.
8346 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8347 to the list by Dekel.
8349 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8352 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8353 methods from lyx_cb.here.
8355 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8358 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8360 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8361 instead of using current_view directly.
8363 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8365 * src/LyXAction.C (init): add the paragraph-spacing command.
8367 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8369 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8371 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8372 different from the documents.
8374 * src/text.C (SetHeightOfRow): take paragraph spacing into
8375 account, paragraph spacing takes precedence over buffer spacing
8376 (GetVisibleRow): ditto
8378 * src/paragraph.C (writeFile): output the spacing parameter too.
8379 (validate): set the correct features if spacing is used in the
8381 (Clear): set spacing to default
8382 (MakeSameLayout): spacing too
8383 (HasSameLayout): spacing too
8384 (SetLayout): spacing too
8385 (TeXOnePar): output the spacing commands
8387 * src/lyxparagraph.h: added a spacing variable for use with
8388 per-paragraph spacing.
8390 * src/Spacing.h: add a Default spacing and a method to check if
8391 the current spacing is default. also added an operator==
8393 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8396 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8398 * src/lyxserver.C (callback): fix dispatch of functions
8400 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8401 printf() into lyxerr call.
8403 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8406 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8407 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8408 the "Float" from each of the subitems.
8409 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8411 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8412 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8413 documented the change so that the workaround can be nuked later.
8415 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8418 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8420 * src/buffer.C (getLatexName): ditto
8421 (setReadonly): ditto
8423 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8425 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8426 avoid some uses of current_view. Added also a bufferParams()
8427 method to get at this.
8429 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8431 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8433 * src/lyxparagraph.[Ch]: removed
8434 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8435 with operators used by lower_bound and
8436 upper_bound in InsetTable's
8437 Make struct InsetTable private again. Used matchpos.
8439 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8441 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8442 document, the language of existing text is changed (unless the
8443 document is multi-lingual)
8445 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8447 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8449 * A lot of files: A rewrite of the Right-to-Left support.
8451 2000-04-10 Juergen Vigna <jug@sad.it>
8453 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8454 misplaced cursor when inset in inset is locked.
8456 * src/insets/insettext.C (LocalDispatch): small fix so that a
8457 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8459 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8460 footnote font should be decreased in size twice when displaying.
8462 * src/insets/insettext.C (GetDrawFont): inserted this function as
8463 the drawing-font may differ from the real paragraph font.
8465 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8466 insets (inset in inset!).
8468 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8469 function here because we don't want footnotes inside footnotes.
8471 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8473 (init): now set the inset_owner in paragraph.C
8474 (LocalDispatch): added some resetPos() in the right position
8477 (pasteSelection): changed to use the new CutAndPaste-Class.
8479 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8480 which tells if it is allowed to insert another inset inside this one.
8482 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8483 SwitchLayoutsBetweenClasses.
8485 * src/text2.C (InsertInset): checking of the new paragraph-function
8487 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8488 is not needed anymore here!
8491 (PasteSelection): redone (also with #ifdef) so that now this uses
8492 the CutAndPaste-Class.
8493 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8496 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8497 from/to text/insets.
8499 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8500 so that the paragraph knows if it is inside an (text)-inset.
8501 (InsertFromMinibuffer): changed return-value to bool as now it
8502 may happen that an inset is not inserted in the paragraph.
8503 (InsertInsetAllowed): this checks if it is allowed to insert an
8504 inset in this paragraph.
8506 (BreakParagraphConservative):
8507 (BreakParagraph) : small change for the above change of the return
8508 value of InsertFromMinibuffer.
8510 * src/lyxparagraph.h: added inset_owner and the functions to handle
8511 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8513 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8515 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8516 functions from BufferView to BufferView::Pimpl to ease maintence.
8518 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8519 correctly. Also use SetCursorIntern instead of SetCursor.
8521 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8524 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8526 * src/WorkArea.C (belowMouse): manually implement below mouse.
8528 * src/*: Add "explicit" on several constructors, I added probably
8529 some unneeded ones. A couple of changes to code because of this.
8531 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8532 implementation and private parts from the users of BufferView. Not
8535 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8536 implementation and private parts from the users of LyXLex. Not
8539 * src/BufferView_pimpl.[Ch]: new files
8541 * src/lyxlex_pimpl.[Ch]: new files
8543 * src/LyXView.[Ch]: some inline functions move out-of-line
8545 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8547 * src/lyxparagraph.h: make struct InsetTable public.
8549 * src/support/lyxstring.h: change lyxstring::difference_type to be
8550 ptrdiff_t. Add std:: modifiers to streams.
8552 * src/font.C: include the <cctype> header, for islower() and
8555 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8557 * src/font.[Ch]: new files. Contains the metric functions for
8558 fonts, takes a LyXFont as parameter. Better separation of concepts.
8560 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8561 changes because of this.
8563 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8565 * src/*: compile with -Winline and move functions that don't
8568 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8571 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8573 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8574 (various files changed because of this)
8576 * src/Painter.C (text): fixed the drawing of smallcaps.
8578 * src/lyxfont.[Ch] (drawText): removed unused member func.
8581 * src/*.C: added needed "using" statements and "std::" qualifiers.
8583 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8585 * src/*.h: removed all use of "using" from header files use
8586 qualifier std:: instead.
8588 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8590 * src/text.C (Backspace): some additional cleanups (we already
8591 know whether cursor.pos is 0 or not).
8593 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8594 automake does not provide one).
8596 * src/bmtable.h: replace C++ comments with C comments.
8598 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8600 * src/screen.C (ShowCursor): Change the shape of the cursor if
8601 the current language is not equal to the language of the document.
8602 (If the cursor change its shape unexpectedly, then you've found a bug)
8604 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8607 * src/insets/insetnumber.[Ch]: New files.
8609 * src/LyXAction.C (init)
8610 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8613 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8615 * src/lyxparagraph.h
8616 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8617 (the vector is kept sorted).
8619 * src/text.C (GetVisibleRow): Draw selection correctly when there
8620 is both LTR and RTL text.
8622 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8623 which is much faster.
8625 * src/text.C (GetVisibleRow and other): Do not draw the last space
8626 in a row if the direction of the last letter is not equal to the
8627 direction of the paragraph.
8629 * src/lyxfont.C (latexWriteStartChanges):
8630 Check that font language is not equal to basefont language.
8631 (latexWriteEndChanges): ditto
8633 * src/lyx_cb.C (StyleReset): Don't change the language while using
8634 the font-default command.
8636 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8637 empty paragraph before a footnote.
8639 * src/insets/insetcommand.C (draw): Increase x correctly.
8641 * src/screen.C (ShowCursor): Change cursor shape if
8642 current language != document language.
8644 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8646 2000-03-31 Juergen Vigna <jug@sad.it>
8648 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8649 (Clone): changed mode how the paragraph-data is copied to the
8650 new clone-paragraph.
8652 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8653 GetInset(pos) with no inset anymore there (in inset UNDO)
8655 * src/insets/insetcommand.C (draw): small fix as here x is
8656 incremented not as much as width() returns (2 before, 2 behind = 4)
8658 2000-03-30 Juergen Vigna <jug@sad.it>
8660 * src/insets/insettext.C (InsetText): small fix in initialize
8661 widthOffset (should not be done in the init() function)
8663 2000-03-29 Amir Karger <karger@lyx.org>
8665 * lib/examples/it_ItemizeBullets.lyx: translation by
8668 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8670 2000-03-29 Juergen Vigna <jug@sad.it>
8672 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8674 * src/insets/insetfoot.C (Clone): small change as for the below
8675 new init function in the text-inset
8677 * src/insets/insettext.C (init): new function as I've seen that
8678 clone did not copy the Paragraph-Data!
8679 (LocalDispatch): Added code so that now we have some sort of Undo
8680 functionality (well actually we HAVE Undo ;)
8682 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8684 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8686 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8689 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8691 * src/main.C: added a runtime check that verifies that the xforms
8692 header used when building LyX and the library used when running
8693 LyX match. Exit with a message if they don't match. This is a
8694 version number check only.
8696 * src/buffer.C (save): Don't allocate memory on the heap for
8697 struct utimbuf times.
8699 * *: some using changes, use iosfwd instead of the real headers.
8701 * src/lyxfont.C use char const * instead of string for the static
8702 strings. Rewrite some functions to use sstream.
8704 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8706 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8709 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8711 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8712 of Geodesy (from Martin Vermeer)
8714 * lib/layouts/svjour.inc: include file for the Springer svjour
8715 class. It can be used to support journals other than JoG.
8717 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8718 Miskiewicz <misiek@pld.org.pl>)
8719 * lib/reLyX/Makefile.am: ditto.
8721 2000-03-27 Juergen Vigna <jug@sad.it>
8723 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8724 also some modifications with operations on selected text.
8726 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8727 problems with clicking on insets (last famous words ;)
8729 * src/insets/insetcommand.C (draw):
8730 (width): Changed to have a bit of space before and after the inset so
8731 that the blinking cursor can be seen (otherwise it was hidden)
8733 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8735 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8736 would not be added to the link list when an installed gettext (not
8737 part of libc) is found.
8739 2000-03-24 Juergen Vigna <jug@sad.it>
8741 * src/insets/insetcollapsable.C (Edit):
8742 * src/mathed/formula.C (InsetButtonRelease):
8743 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8746 * src/BufferView.C (workAreaButtonPress):
8747 (workAreaButtonRelease):
8748 (checkInsetHit): Finally fixed the clicking on insets be handled
8751 * src/insets/insetert.C (Edit): inserted this call so that ERT
8752 insets work always with LaTeX-font
8754 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8756 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8757 caused lyx to startup with no GUI in place, causing in a crash
8758 upon startup when called with arguments.
8760 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8762 * src/FontLoader.C: better initialization of dummyXFontStruct.
8764 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8766 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8767 for linuxdoc and docbook import and export format options.
8769 * lib/lyxrc.example Example of default values for the previous flags.
8771 * src/lyx_cb.C Use those flags instead of the hardwired values for
8772 linuxdoc and docbook export.
8774 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8777 * src/menus.C Added menus entries for the new import/exports formats.
8779 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8781 * src/lyxrc.*: Added support for running without Gui
8784 * src/FontLoader.C: sensible defaults if no fonts are needed
8786 * src/lyx_cb.C: New function ShowMessage (writes either to the
8787 minibuffer or cout in case of no gui
8788 New function AskOverwrite for common stuff
8789 Consequently various changes to call these functions
8791 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8792 wild guess at sensible screen resolution when having no gui
8794 * src/lyxfont.C: no gui, no fonts... set some defaults
8796 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8798 * src/LColor.C: made the command inset background a bit lighter.
8800 2000-03-20 Hartmut Goebel <goebel@noris.net>
8802 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8803 stdstruct.inc. Koma-Script added some title elements which
8804 otherwise have been listed below "bibliography". This split allows
8805 adding title elements to where they belong.
8807 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8808 define the additional title elements and then include
8811 * many other layout files: changed to include stdtitle.inc just
8812 before stdstruct.inc.
8814 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8816 * src/buffer.C: (save) Added the option to store all backup files
8817 in a single directory
8819 * src/lyxrc.[Ch]: Added variable \backupdir_path
8821 * lib/lyxrc.example: Added descriptions of recently added variables
8823 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8824 bibtex inset, not closing the bibtex popup when deleting the inset)
8826 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8828 * src/lyx_cb.C: add a couple using directives.
8830 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8831 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8832 import based on the filename.
8834 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8835 file would be imported at start, if the filename where of a sgml file.
8837 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8839 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8841 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8842 * src/lyxfont.h Replaced the member variable bits.direction by the
8843 member variable lang. Made many changes in other files.
8844 This allows having a multi-lingual document
8846 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8847 that change the current language to <l>.
8848 Removed the command "font-rtl"
8850 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8851 format for Hebrew documents)
8853 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8854 When auto_mathmode is "true", pressing a digit key in normal mode
8855 will cause entering into mathmode.
8856 If auto_mathmode is "rtl" then this behavior will be active only
8857 when writing right-to-left text.
8859 * src/text2.C (InsertStringA) The string is inserted using the
8862 * src/paragraph.C (GetEndLabel) Gives a correct result for
8863 footnote paragraphs.
8865 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8867 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8869 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8870 front of PasteParagraph. Never insert a ' '. This should at least
8871 fix some cause for the segfaults that we have been experiencing,
8872 it also fixes backspace behaviour slightly. (Phu!)
8874 * src/support/lstrings.C (compare_no_case): some change to make it
8875 compile with gcc 2.95.2 and stdlibc++-v3
8877 * src/text2.C (MeltFootnoteEnvironment): change type o
8878 first_footnote_par_is_not_empty to bool.
8880 * src/lyxparagraph.h: make text private. Changes in other files
8882 (fitToSize): new function
8883 (setContentsFromPar): new function
8884 (clearContents): new function
8885 (SetChar): new function
8887 * src/paragraph.C (readSimpleWholeFile): deleted.
8889 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8890 the file, just use a simple string instead. Also read the file in
8891 a more maintainable manner.
8893 * src/text2.C (InsertStringA): deleted.
8894 (InsertStringB): deleted.
8896 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8898 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8899 RedoParagraphs from the doublespace handling part, just set status
8900 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8901 done, but perhaps not like this.)
8903 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8905 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8906 character when inserting an inset.
8908 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8910 * src/bufferparams.C (readLanguage): now takes "default" into
8913 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8914 also initialize the toplevel_keymap with the default bindings from
8917 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8919 * all files using lyxrc: have lyxrc as a real variable and not a
8920 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8923 * src/lyxrc.C: remove double call to defaultKeyBindings
8925 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8926 toolbar defauls using lyxlex. Remove enums, structs, functions
8929 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8930 toolbar defaults. Also store default keybindings in a map.
8932 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8933 storing the toolbar defaults without any xforms dependencies.
8935 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8936 applied. Changed to use iterators.
8938 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8940 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8941 systems that don't have LINGUAS set to begin with.
8943 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8945 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8946 the list by Dekel Tsur.
8948 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8950 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8951 * src/insets/form_graphics.C: ditto.
8953 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8955 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8957 * src/bufferparams.C (readLanguage): use the new language map
8959 * src/intl.C (InitKeyMapper): use the new language map
8961 * src/lyx_gui.C (create_forms): use the new language map
8963 * src/language.[Ch]: New files. Used for holding the information
8964 about each language. Now! Use this new language map enhance it and
8965 make it really usable for our needs.
8967 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8969 * screen.C (ShowCursor): Removed duplicate code.
8970 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8971 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8973 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8976 * src/text.C Added TransformChar method. Used for rendering Arabic
8977 text correctly (change the glyphs of the letter according to the
8978 position in the word)
8983 * src/lyxrc.C Added lyxrc command {language_command_begin,
8984 language_command_end,language_command_ltr,language_command_rtl,
8985 language_package} which allows the use of either arabtex or Omega
8988 * src/lyx_gui.C (init)
8990 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8991 to use encoding for menu fonts which is different than the encoding
8994 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8995 do not load the babel package.
8996 To write an English document with Hebrew/Arabic, change the document
8997 language to "english".
8999 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9000 (alphaCounter): changed to return char
9001 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9003 * lib/lyxrc.example Added examples for Hebrew/Arabic
9006 * src/layout.C Added layout command endlabeltype
9008 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9010 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9012 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9014 * src/mathed/math_delim.C (search_deco): return a
9015 math_deco_struct* instead of index.
9017 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9019 * All files with a USE_OSTREAM_ONLY within: removed all code that
9020 was unused when USE_OSTREAM_ONLY is defined.
9022 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9023 of any less. Removed header and using.
9025 * src/text.C (GetVisibleRow): draw the string "Page Break
9026 (top/bottom)" on screen when drawing a pagebreak line.
9028 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9030 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9032 * src/mathed/math_macro.C (draw): do some cast magic.
9035 * src/mathed/math_defs.h: change byte* argument to byte const*.
9037 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9039 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9040 know it is right to return InsetFoot* too, but cxx does not like
9043 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9045 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9047 * src/mathed/math_delim.C: change == to proper assignment.
9049 2000-03-09 Juergen Vigna <jug@sad.it>
9051 * src/insets/insettext.C (setPos): fixed various cursor positioning
9052 problems (via mouse and cursor-keys)
9053 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9054 inset (still a small display problem but it works ;)
9056 * src/insets/insetcollapsable.C (draw): added button_top_y and
9057 button_bottom_y to have correct values for clicking on the inset.
9059 * src/support/lyxalgo.h: commented out 'using std::less'
9061 2000-03-08 Juergen Vigna <jug@sad.it>
9063 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9064 Button-Release event closes as it is alos the Release-Event
9067 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9069 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9071 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9072 can add multiple spaces in Scrap (literate programming) styles...
9073 which, by the way, is how I got hooked on LyX to begin with.
9075 * src/mathed/formula.C (Write): Added dummy variable to an
9076 inset::Latex() call.
9077 (Latex): Add free_spacing boolean to inset::Latex()
9079 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9081 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9082 virtual function to include the free_spacing boolean from
9083 the containing paragraph's style.
9085 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9086 Added free_spacing boolean arg to match inset.h
9088 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9089 Added free_spacing boolean arg to match inset.h
9091 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9092 Added free_spacing boolean and made sure that if in a free_spacing
9093 paragraph, that we output normal space if there is a protected space.
9095 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9096 Added free_spacing boolean arg to match inset.h
9098 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9099 Added free_spacing boolean arg to match inset.h
9101 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9102 Added free_spacing boolean arg to match inset.h
9104 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9105 Added free_spacing boolean arg to match inset.h
9107 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9108 Added free_spacing boolean arg to match inset.h
9110 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9111 free_spacing boolean arg to match inset.h
9113 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9114 Added free_spacing boolean arg to match inset.h
9116 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9117 Added free_spacing boolean arg to match inset.h
9119 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9120 Added free_spacing boolean arg to match inset.h
9122 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9123 Added free_spacing boolean arg to match inset.h
9125 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9126 Added free_spacing boolean arg to match inset.h
9128 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9129 free_spacing boolean arg to match inset.h
9131 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9132 free_spacing boolean arg to match inset.h
9134 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9135 ignore free_spacing paragraphs. The user's spaces are left
9138 * src/text.C (InsertChar): Fixed the free_spacing layout
9139 attribute behavior. Now, if free_spacing is set, you can
9140 add multiple spaces in a paragraph with impunity (and they
9141 get output verbatim).
9142 (SelectSelectedWord): Added dummy argument to inset::Latex()
9145 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9148 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9149 paragraph layouts now only input a simple space instead.
9150 Special character insets don't make any sense in free-spacing
9153 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9154 hard-spaces in the *input* file to simple spaces if the layout
9155 is free-spacing. This converts old files which had to have
9156 hard-spaces in free-spacing layouts where a simple space was
9158 (writeFileAscii): Added free_spacing check to pass to the newly
9159 reworked inset::Latex(...) methods. The inset::Latex() code
9160 ensures that hard-spaces in free-spacing paragraphs get output
9161 as spaces (rather than "~").
9163 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9165 * src/mathed/math_delim.C (draw): draw the empty placeholder
9166 delims with a onoffdash line.
9167 (struct math_deco_compare): struct that holds the "functors" used
9168 for the sort and the binary search in math_deco_table.
9169 (class init_deco_table): class used for initial sort of the
9171 (search_deco): use lower_bound to do a binary search in the
9174 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9176 * src/lyxrc.C: a small secret thingie...
9178 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9179 and to not flush the stream as often as it used to.
9181 * src/support/lyxalgo.h: new file
9182 (sorted): template function used for checking if a sequence is
9183 sorted or not. Two versions with and without user supplied
9184 compare. Uses same compare as std::sort.
9186 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9187 it and give warning on lyxerr.
9189 (struct compare_tags): struct with function operators used for
9190 checking if sorted, sorting and lower_bound.
9191 (search_kw): use lower_bound instead of manually implemented
9194 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9196 * src/insets/insetcollapsable.h: fix Clone() declaration.
9197 * src/insets/insetfoot.h: ditto.
9199 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9201 2000-03-08 Juergen Vigna <jug@sad.it>
9203 * src/insets/lyxinset.h: added owner call which tells us if
9204 this inset is inside another inset. Changed also the return-type
9205 of Editable to an enum so it tells clearer what the return-value is.
9207 * src/insets/insettext.C (computeTextRows): fixed computing of
9208 textinsets which split automatically on more rows.
9210 * src/insets/insetert.[Ch]: changed this to be of BaseType
9213 * src/insets/insetfoot.[Ch]: added footnote inset
9215 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9216 collapsable insets (like footnote, ert, ...)
9218 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9220 * src/lyxdraw.h: remvoe file
9222 * src/lyxdraw.C: remove file
9224 * src/insets/insettext.C: added <algorithm>.
9226 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9228 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9229 (matrix_cb): case MM_OK use string stream
9231 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9234 * src/mathed/math_macro.C (draw): use string stream
9235 (Metrics): use string stream
9237 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9238 directly to the ostream.
9240 * src/vspace.C (asString): use string stream.
9241 (asString): use string stream
9242 (asLatexString): use string stream
9244 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9245 setting Spacing::Other.
9247 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9248 sprintf when creating the stretch vale.
9250 * src/text2.C (alphaCounter): changed to return a string and to
9251 not use a static variable internally. Also fixed a one-off bug.
9252 (SetCounter): changed the drawing of the labels to use string
9253 streams instead of sprintf.
9255 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9256 manipulator to use a scheme that does not require library support.
9257 This is also the way it is done in the new GNU libstdc++. Should
9258 work with DEC cxx now.
9260 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9262 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9263 end. This fixes a bug.
9265 * src/mathed (all files concerned with file writing): apply the
9266 USE_OSTREAM_ONLY changes to mathed too.
9268 * src/support/DebugStream.h: make the constructor explicit.
9270 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9271 count and ostream squashed.
9273 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9275 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9277 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9278 ostringstream uses STL strings, and we might not.
9280 * src/insets/insetspecialchar.C: add using directive.
9281 * src/insets/insettext.C: ditto.
9283 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9285 * lib/layouts/seminar.layout: feeble attempt at a layout for
9286 seminar.cls, far from completet and could really use some looking
9287 at from people used to write layout files.
9289 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9290 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9291 a lot nicer and works nicely with ostreams.
9293 * src/mathed/formula.C (draw): a slightly different solution that
9294 the one posted to the list, but I think this one works too. (font
9295 size wrong in headers.)
9297 * src/insets/insettext.C (computeTextRows): some fiddling on
9298 Jürgens turf, added some comments that he should read.
9300 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9301 used and it gave compiler warnings.
9302 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9305 * src/lyx_gui.C (create_forms): do the right thing when
9306 show_banner is true/false.
9308 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9309 show_banner is false.
9311 * most file writing files: Now use iostreams to do almost all of
9312 the writing. Also instead of passing string &, we now use
9313 stringstreams. mathed output is still not adapted to iostreams.
9314 This change can be turned off by commenting out all the occurences
9315 of the "#define USE_OSTREAM_ONLY 1" lines.
9317 * src/WorkArea.C (createPixmap): don't output debug messages.
9318 (WorkArea): don't output debug messages.
9320 * lib/lyxrc.example: added a comment about the new variable
9323 * development/Code_rules/Rules: Added some more commente about how
9324 to build class interfaces and on how better encapsulation can be
9327 2000-03-03 Juergen Vigna <jug@sad.it>
9329 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9330 automatically with the width of the LyX-Window
9332 * src/insets/insettext.C (computeTextRows): fixed update bug in
9333 displaying text-insets (scrollvalues where not initialized!)
9335 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9337 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9338 id in the check of the result from lower_bound is not enough since
9339 lower_bound can return last too, and then res->id will not be a
9342 * all insets and some code that use them: I have conditionalized
9343 removed the Latex(string & out, ...) this means that only the
9344 Latex(ostream &, ...) will be used. This is a work in progress to
9345 move towards using streams for all output of files.
9347 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9350 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9352 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9353 routine (this fixes bug where greek letters were surrounded by too
9356 * src/support/filetools.C (findtexfile): change a bit the search
9357 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9358 no longer passed to kpsewhich, we may have to change that later.
9360 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9361 warning options to avoid problems with X header files (from Angus
9363 * acinclude.m4: regenerated.
9365 2000-03-02 Juergen Vigna <jug@sad.it>
9367 * src/insets/insettext.C (WriteParagraphData): Using the
9368 par->writeFile() function for writing paragraph-data.
9369 (Read): Using buffer->parseSingleLyXformat2Token()-function
9370 for parsing paragraph data!
9372 * src/buffer.C (readLyXformat2): removed all parse data and using
9373 the new parseSingleLyXformat2Token()-function.
9374 (parseSingleLyXformat2Token): added this function to parse (read)
9375 lyx-file-format (this is called also from text-insets now!)
9377 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9379 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9382 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9383 directly instead of going through a func. One very bad thing: a
9384 static LyXFindReplace, but I don't know where to place it.
9386 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9387 string instead of char[]. Also changed to static.
9388 (GetSelectionOrWordAtCursor): changed to static inline
9389 (SetSelectionOverLenChars): ditto.
9391 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9392 current_view and global variables. both classes has changed names
9393 and LyXFindReplace is not inherited from SearchForm.
9395 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9396 fl_form_search form.
9398 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9400 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9402 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9403 bound (from Kayvan).
9405 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9407 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9409 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9411 * some things that I should comment but the local pub says head to
9414 * comment out all code that belongs to the Roff code for Ascii
9415 export of tables. (this is unused)
9417 * src/LyXView.C: use correct type for global variable
9418 current_layout. (LyXTextClass::size_type)
9420 * some code to get the new insetgraphics closer to working I'd be
9421 grateful for any help.
9423 * src/BufferView2.C (insertInset): use the return type of
9424 NumberOfLayout properly. (also changes in other files)
9426 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9427 this as a test. I want to know what breaks because of this.
9429 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9431 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9433 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9434 to use a \makebox in the label, this allows proper justification
9435 with out using protected spaces or multiple hfills. Now it is
9436 "label" for left justified, "\hfill label\hfill" for center, and
9437 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9438 should be changed accordingly.
9440 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9442 * src/lyxtext.h: change SetLayout() to take a
9443 LyXTextClass::size_type instead of a char (when there is more than
9444 127 layouts in a class); also change type of copylayouttype.
9445 * src/text2.C (SetLayout): ditto.
9446 * src/LyXView.C (updateLayoutChoice): ditto.
9448 * src/LaTeX.C (scanLogFile): errors where the line number was not
9449 given just after the '!'-line were ignored (from Dekel Tsur).
9451 * lib/lyxrc.example: fix description of \date_insert_format
9453 * lib/layouts/llncs.layout: new layout, contributed by Martin
9456 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9458 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9459 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9460 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9461 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9462 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9463 paragraph.C, text.C, text2.C)
9465 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9467 * src/insets/insettext.C (LocalDispatch): remove extra break
9470 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9471 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9473 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9474 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9476 * src/insets/insetbib.h: move InsetBibkey::Holder and
9477 InsetCitation::Holder in public space.
9479 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9481 * src/insets/insettext.h: small change to get the new files from
9482 Juergen to compile (use "string", not "class string").
9484 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9485 const & as parameter to LocalDispatch, use LyXFont const & as
9486 paramter to some other func. This also had impacto on lyxinsets.h
9487 and the two mathed insets.
9489 2000-02-24 Juergen Vigna <jug@sad.it>
9492 * src/commandtags.h:
9494 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9498 * src/BufferView2.C: added/updated code for various inset-functions
9500 * src/insets/insetert.[Ch]: added implementation of InsetERT
9502 * src/insets/insettext.[Ch]: added implementation of InsetText
9504 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9505 (draw): added preliminary code for inset scrolling not finshed yet
9507 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9508 as it is in lyxfunc.C now
9510 * src/insets/lyxinset.h: Added functions for text-insets
9512 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9514 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9515 BufferView and reimplement the list as a queue put inside its own
9518 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9520 * several files: use the new interface to the "updateinsetlist"
9522 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9524 (work_area_handler): call BufferView::trippleClick on trippleclick.
9526 * src/BufferView.C (doubleClick): new function, selects word on
9528 (trippleClick): new function, selects line on trippleclick.
9530 2000-02-22 Allan Rae <rae@lyx.org>
9532 * lib/bind/xemacs.bind: buffer-previous not supported
9534 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9536 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9539 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9541 * src/bufferlist.C: get rid of current_view from this file
9543 * src/spellchecker.C: get rid of current_view from this file
9545 * src/vspace.C: get rid of current_view from this file
9546 (inPixels): added BufferView parameter for this func
9547 (asLatexCommand): added a BufferParams for this func
9549 * src/text.C src/text2.C: get rid of current_view from these
9552 * src/lyxfont.C (getFontDirection): move this function here from
9555 * src/bufferparams.C (getDocumentDirection): move this function
9558 * src/paragraph.C (getParDirection): move this function here from
9560 (getLetterDirection): ditto
9562 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9564 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9565 resize due to wrong pixmap beeing used. Also took the opurtunity
9566 to make the LyXScreen stateless on regard to WorkArea and some
9567 general cleanup in the same files.
9569 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9571 * src/Makefile.am: add missing direction.h
9573 * src/PainterBase.h: made the width functions const.
9575 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9578 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9580 * src/insets/insetlatexaccent.C (draw): make the accents draw
9581 better, at present this will only work well with iso8859-1.
9583 * several files: remove the old drawing code, now we use the new
9586 * several files: remove support for mono_video, reverse_video and
9589 2000-02-17 Juergen Vigna <jug@sad.it>
9591 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9592 int ** as we have to return the pointer, otherwise we have only
9593 NULL pointers in the returning function.
9595 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9597 * src/LaTeX.C (operator()): quote file name when running latex.
9599 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9601 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9602 (bubble tip), this removes our special handling of this.
9604 * Remove all code that is unused now that we have the new
9605 workarea. (Code that are not active when NEW_WA is defined.)
9607 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9609 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9611 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9612 nonexisting layout; correctly redirect obsoleted layouts.
9614 * lib/lyxrc.example: document \view_dvi_paper_option
9616 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9619 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9620 (PreviewDVI): handle the view_dvi_paper_option variable.
9621 [Both from Roland Krause]
9623 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9625 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9626 char const *, int, LyXFont)
9627 (text(int, int, string, LyXFont)): ditto
9629 * src/text.C (InsertCharInTable): attempt to fix the double-space
9630 feature in tables too.
9631 (BackspaceInTable): ditto.
9632 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9634 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9636 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9638 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9639 newly found text in textcache to this.
9640 (buffer): set the owner of the text put into the textcache to 0
9642 * src/insets/figinset.C (draw): fixed the drawing of figures with
9645 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9646 drawing of mathframe, hfills, protected space, table lines. I have
9647 now no outstanding drawing problems with the new Painter code.
9649 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9651 * src/PainterBase.C (ellipse, circle): do not specify the default
9654 * src/LColor.h: add using directive.
9656 * src/Painter.[Ch]: change return type of methods from Painter& to
9657 PainterBase&. Add a using directive.
9659 * src/WorkArea.C: wrap xforms callbacks in C functions
9662 * lib/layouts/foils.layout: font fix and simplifications from Carl
9665 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9667 * a lot of files: The Painter, LColor and WorkArea from the old
9668 devel branch has been ported to lyx-devel. Some new files and a
9669 lot of #ifdeffed code. The new workarea is enabled by default, but
9670 if you want to test the new Painter and LColor you have to compile
9671 with USE_PAINTER defined (do this in config.h f.ex.) There are
9672 still some rought edges, and I'd like some help to clear those
9673 out. It looks stable (loads and displays the Userguide very well).
9676 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9678 * src/buffer.C (pop_tag): revert to the previous implementation
9679 (use a global variable for both loops).
9681 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9683 * src/lyxrc.C (LyXRC): change slightly default date format.
9685 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9686 there is an English text with a footnote that starts with a Hebrew
9687 paragraph, or vice versa.
9688 (TeXFootnote): ditto.
9690 * src/text.C (LeftMargin): allow for negative values for
9691 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9694 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9695 for input encoding (cyrillic)
9697 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9699 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9702 * src/toolbar.C (set): ditto
9703 * src/insets/insetbib.C (create_form_citation_form): ditto
9705 * lib/CREDITS: added Dekel Tsur.
9707 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9708 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9709 hebrew supports files from Dekel Tsur.
9711 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9712 <tzafrir@technion.ac.il>
9714 * src/lyxrc.C: put \date_insert_format at the right place.
9716 * src/buffer.C (makeLaTeXFile): fix the handling of
9717 BufferParams::sides when writing out latex files.
9719 * src/BufferView2.C: add a "using" directive.
9721 * src/support/lyxsum.C (sum): when we use lyxstring,
9722 ostringstream::str needs an additional .c_str().
9724 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9726 * src/support/filetools.C (ChangeExtension): patch from Etienne
9729 * src/TextCache.C (show): remove const_cast and make second
9730 parameter non-const LyXText *.
9732 * src/TextCache.h: use non const LyXText in show.
9734 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9737 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9739 * src/support/lyxsum.C: rework to be more flexible.
9741 * several places: don't check if a pointer is 0 if you are going
9744 * src/text.C: remove some dead code.
9746 * src/insets/figinset.C: remove some dead code
9748 * src/buffer.C: move the BufferView funcs to BufferView2.C
9749 remove all support for insetlatexdel
9750 remove support for oldpapersize stuff
9751 made some member funcs const
9753 * src/kbmap.C: use a std::list to store the bindings in.
9755 * src/BufferView2.C: new file
9757 * src/kbsequence.[Ch]: new files
9759 * src/LyXAction.C + others: remove all trace of buffer-previous
9761 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9762 only have one copy in the binary of this table.
9764 * hebrew patch: moved some functions from LyXText to more
9765 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9767 * several files: remove support for XForms older than 0.88
9769 remove some #if 0 #endif code
9771 * src/TextCache.[Ch]: new file. Holds the textcache.
9773 * src/BufferView.C: changes to use the new TextCache interface.
9774 (waitForX): remove the now unused code.
9776 * src/BackStack.h: remove some commented code
9778 * lib/bind/emacs.bind: remove binding for buffer-previous
9780 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9782 * applied the hebrew patch.
9784 * src/lyxrow.h: make sure that all Row variables are initialized.
9786 * src/text2.C (TextHandleUndo): comment out a delete, this might
9787 introduce a memory leak, but should also help us to not try to
9788 read freed memory. We need to look at this one.
9790 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9791 (LyXParagraph): initalize footnotekind.
9793 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9794 forgot this when applying the patch. Please heed the warnings.
9796 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9797 (aka. reformat problem)
9799 * src/bufferlist.C (exists): made const, and use const_iterator
9800 (isLoaded): new func.
9801 (release): use std::find to find the correct buffer.
9803 * src/bufferlist.h: made getState a const func.
9804 made empty a const func.
9805 made exists a const func.
9808 2000-02-01 Juergen Vigna <jug@sad.it>
9810 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9812 * po/it.po: updated a bit the italian po file and also changed the
9813 'file nuovo' for newfile to 'filenuovo' without a space, this did
9816 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9817 for the new insert_date command.
9819 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9820 from jdblair, to insert a date into the current text conforming to
9821 a strftime format (for now only considering the locale-set and not
9822 the document-language).
9824 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9826 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9827 Bounds Read error seen by purify. The problem was that islower is
9828 a macros which takes an unsigned char and uses it as an index for
9829 in array of characters properties (and is thus subject to the
9833 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9834 correctly the paper sides radio buttons.
9835 (UpdateDocumentButtons): ditto.
9837 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9839 * src/kbmap.C (getsym + others): change to return unsigned int,
9840 returning a long can give problems on 64 bit systems. (I assume
9841 that int is 32bit on 64bit systems)
9843 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9845 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9846 LyXLookupString to be zero-terminated. Really fixes problems seen
9849 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9851 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9852 write a (char*)0 to the lyxerr stream.
9854 * src/lastfiles.C: move algorithm before the using statemets.
9856 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9858 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9859 complains otherwise).
9860 * src/table.C: ditto
9862 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9865 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9866 that I removed earlier... It is really needed.
9868 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9870 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9872 * INSTALL: update xforms home page URL.
9874 * lib/configure.m4: fix a bug with unreadable layout files.
9876 * src/table.C (calculate_width_of_column): add "using std::max"
9879 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9881 * several files: marked several lines with "DEL LINE", this is
9882 lines that can be deleted without changing anything.
9883 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9884 checks this anyway */
9887 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9889 * src/DepTable.C (update): add a "+" at the end when the checksum
9890 is different. (debugging string only)
9892 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9893 the next inset to not be displayed. This should also fix the list
9894 of labels in the "Insert Crossreference" dialog.
9896 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9898 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9899 when regex was not found.
9901 * src/support/lstrings.C (lowercase): use handcoded transform always.
9904 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9905 old_cursor.par->prev could be 0.
9907 * several files: changed post inc/dec to pre inc/dec
9909 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9910 write the lastfiles to file.
9912 * src/BufferView.C (buffer): only show TextCache info when debugging
9914 (resizeCurrentBuffer): ditto
9915 (workAreaExpose): ditto
9917 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9919 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9921 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9922 a bit better by removing the special case for \i and \j.
9924 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9926 * src/lyx_main.C (easyParse): remove test for bad comand line
9927 options, since this broke all xforms-related parsing.
9929 * src/kbmap.C (getsym): set return type to unsigned long, as
9930 declared in header. On an alpha, long is _not_ the same as int.
9932 * src/support/LOstream.h: add a "using std::flush;"
9934 * src/insets/figinset.C: ditto.
9936 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9938 * src/bufferlist.C (write): use blinding fast file copy instead of
9939 "a char at a time", now we are doing it the C++ way.
9941 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9942 std::list<int> instead.
9943 (addpidwait): reflect move to std::list<int>
9944 (sigchldchecker): ditto
9946 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9949 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9950 that obviously was wrong...
9952 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9953 c, this avoids warnings with purify and islower.
9955 * src/insets/figinset.C: rename struct queue to struct
9956 queue_element and rewrite to use a std::queue. gsqueue is now a
9957 std::queue<queue_element>
9958 (runqueue): reflect move to std::queue
9961 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9962 we would get "1" "0" instead of "true" "false. Also make the tostr
9965 2000-01-21 Juergen Vigna <jug@sad.it>
9967 * src/buffer.C (writeFileAscii): Disabled code for special groff
9968 handling of tabulars till I fix this in table.C
9970 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9972 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9974 * src/support/lyxlib.h: ditto.
9976 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9978 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9979 and 'j' look better. This might fix the "macron" bug that has been
9982 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9983 functions as one template function. Delete the old versions.
9985 * src/support/lyxsum.C: move using std::ifstream inside
9988 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9991 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9993 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9995 * src/insets/figinset.C (InitFigures): use new instead of malloc
9996 to allocate memory for figures and bitmaps.
9997 (DoneFigures): use delete[] instead of free to deallocate memory
9998 for figures and bitmaps.
9999 (runqueue): use new to allocate
10000 (getfigdata): use new/delete[] instead of malloc/free
10001 (RegisterFigure): ditto
10003 * some files: moved some declarations closer to first use, small
10004 whitespace changes use preincrement instead of postincrement where
10005 it does not make a difference.
10007 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10008 step on the way to use stl::containers for key maps.
10010 * src/bufferlist.h: add a typedef for const_iterator and const
10011 versions of begin and end.
10013 * src/bufferlist.[Ch]: change name of member variable _state to
10014 state_. (avoid reserved names)
10016 (getFileNames): returns the filenames of the buffers in a vector.
10018 * configure.in (ALL_LINGUAS): added ro
10020 * src/support/putenv.C: new file
10022 * src/support/mkdir.C: new file
10024 2000-01-20 Allan Rae <rae@lyx.org>
10026 * lib/layouts/IEEEtran.layout: Added several theorem environments
10028 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10029 couple of minor additions.
10031 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10032 (except for those in footnotes of course)
10034 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10036 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10038 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10039 std::sort and std::lower_bound instead of qsort and handwritten
10041 (struct compara): struct that holds the functors used by std::sort
10042 and std::lower_bound in MathedLookupBOP.
10044 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10046 * src/support/LAssert.h: do not do partial specialization. We do
10047 not really need it.
10049 * src/support/lyxlib.h: note that lyx::getUserName() and
10050 lyx::date() are not in use right now. Should these be suppressed?
10052 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10053 (makeLinuxDocFile): do not put date and user name in linuxdoc
10056 * src/support/lyxlib.h (kill): change first argument to long int,
10057 since that's what solaris uses.
10059 * src/support/kill.C (kill): fix declaration to match prototype.
10061 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10062 actually check whether namespaces are supported. This is not what
10065 * src/support/lyxsum.C: add a using directive.
10067 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10069 * src/support/kill.C: if we have namespace support we don't have
10070 to include lyxlib.h.
10072 * src/support/lyxlib.h: use namespace lyx if supported.
10074 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10076 * src/support/date.C: new file
10078 * src/support/chdir.C: new file
10080 * src/support/getUserName.C: new file
10082 * src/support/getcwd.C: new file
10084 * src/support/abort.C: new file
10086 * src/support/kill.C: new file
10088 * src/support/lyxlib.h: moved all the functions in this file
10089 insede struct lyx. Added also kill and abort to this struct. This
10090 is a way to avoid the "kill is not defined in <csignal>", we make
10091 C++ wrappers for functions that are not ANSI C or ANSI C++.
10093 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10094 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10095 lyx it has been renamed to sum.
10097 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10099 * src/text.C: add using directives for std::min and std::max.
10101 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10103 * src/texrow.C (getIdFromRow): actually return something useful in
10104 id and pos. Hopefully fixes the bug with positionning of errorbox
10107 * src/lyx_main.C (easyParse): output an error and exit if an
10108 incorrect command line option has been given.
10110 * src/spellchecker.C (ispell_check_word): document a memory leak.
10112 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10113 where a "struct utimbuf" is allocated with "new" and deleted with
10116 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10118 * src/text2.C (CutSelection): don't delete double spaces.
10119 (PasteSelection): ditto
10120 (CopySelection): ditto
10122 * src/text.C (Backspace): don't delete double spaces.
10124 * src/lyxlex.C (next): fix a bug that were only present with
10125 conformant std::istream::get to read comment lines, use
10126 std::istream::getline instead. This seems to fix the problem.
10128 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10130 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10131 allowed to insert space before space" editing problem. Please read
10132 commends at the beginning of the function. Comments about usage
10135 * src/text.C (InsertChar): fix for the "not allowed to insert
10136 space before space" editing problem.
10138 * src/text2.C (DeleteEmptyParagraphMechanism): when
10139 IsEmptyTableRow can only return false this last "else if" will
10140 always be a no-op. Commented out.
10142 * src/text.C (RedoParagraph): As far as I can understand tmp
10143 cursor is not really needed.
10145 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10146 present it could only return false anyway.
10147 (several functions): Did something not so smart...added a const
10148 specifier on a lot of methods.
10150 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10151 and add a tmp->text.resize. The LyXParagraph constructor does the
10153 (BreakParagraphConservative): ditto
10155 * src/support/path.h (Path): add a define so that the wrong usage
10156 "Path("/tmp") will be flagged as a compilation error:
10157 "`unnamed_Path' undeclared (first use this function)"
10159 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10161 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10162 which was bogus for several reasons.
10164 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10166 (runBibTeX): ditto.
10168 * autogen.sh: do not use "type -path" (what's that anyway?).
10170 * src/support/filetools.C (findtexfile): remove extraneous space
10171 which caused a kpsewhich warning (at least with kpathsea version
10174 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10176 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10178 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10180 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10182 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10184 * src/paragraph.C (BreakParagraph): do not reserve space on text
10185 if we don't need to (otherwise, if pos_end < pos, we end up
10186 reserving huge amounts of memory due to bad unsigned karma).
10187 (BreakParagraphConservative): ditto, although I have not seen
10188 evidence the bug can happen here.
10190 * src/lyxparagraph.h: add a using std::list.
10192 2000-01-11 Juergen Vigna <jug@sad.it>
10194 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10195 could not be found.
10197 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10199 * src/vc-backend.C (doVCCommand): change to be static and take one
10200 more parameter: the path to chdir too be fore executing the command.
10201 (retrive): new function equiv to "co -r"
10203 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10204 file_not_found_hook is true.
10206 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10208 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10209 if a file is readwrite,readonly...anything else.
10211 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10213 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10214 (CreatePostscript): name change from MenuRunDVIPS (or something)
10215 (PreviewPostscript): name change from MenuPreviewPS
10216 (PreviewDVI): name change from MenuPreviewDVI
10218 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10219 \view_pdf_command., \pdf_to_ps_command
10221 * lib/configure.m4: added search for PDF viewer, and search for
10222 PDF to PS converter.
10223 (lyxrc.defaults output): add \pdflatex_command,
10224 \view_pdf_command and \pdf_to_ps_command.
10226 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10228 * src/bufferlist.C (write): we don't use blocksize for anything so
10231 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10233 * src/support/block.h: disable operator T* (), since it causes
10234 problems with both compilers I tried. See comments in the file.
10236 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10239 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10240 variable LYX_DIR_10x to LYX_DIR_11x.
10242 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10244 * INSTALL: document --with-lyxname.
10247 * configure.in: new configure flag --with-lyxname which allows to
10248 choose the name under which lyx is installed. Default is "lyx", of
10249 course. It used to be possible to do this with --program-suffix,
10250 but the later has in fact a different meaning for autoconf.
10252 * src/support/lstrings.h (lstrchr): reformat a bit.
10254 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10255 * src/mathed/math_defs.h: ditto.
10257 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10259 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10260 true, decides if we create a backup file or not when saving. New
10261 tag and variable \pdf_mode, defaults to false. New tag and
10262 variable \pdflatex_command, defaults to pdflatex. New tag and
10263 variable \view_pdf_command, defaults to xpdf. New tag and variable
10264 \pdf_to_ps_command, defaults to pdf2ps.
10266 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10268 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10269 does not have a BufferView.
10270 (unlockInset): ditto + don't access the_locking_inset if the
10271 buffer does not have a BufferView.
10273 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10274 certain circumstances so that we don't continue a keyboard
10275 operation long after the key was released. Try f.ex. to load a
10276 large document, press PageDown for some seconds and then release
10277 it. Before this change the document would contine to scroll for
10278 some time, with this change it stops imidiatly.
10280 * src/support/block.h: don't allocate more space than needed. As
10281 long as we don't try to write to the arr[x] in a array_type arr[x]
10282 it is perfectly ok. (if you write to it you might segfault).
10283 added operator value_type*() so that is possible to pass the array
10284 to functions expecting a C-pointer.
10286 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10289 * intl/*: updated to gettext 0.10.35, tried to add our own
10290 required modifications. Please verify.
10292 * po/*: updated to gettext 0.10.35, tried to add our own required
10293 modifications. Please verify.
10295 * src/support/lstrings.C (tostr): go at fixing the problem with
10296 cxx and stringstream. When stringstream is used return
10297 oss.str().c_str() so that problems with lyxstring and basic_string
10298 are avoided. Note that the best solution would be for cxx to use
10299 basic_string all the way, but it is not conformant yet. (it seems)
10301 * src/lyx_cb.C + other files: moved several global functions to
10302 class BufferView, some have been moved to BufferView.[Ch] others
10303 are still located in lyx_cb.C. Code changes because of this. (part
10304 of "get rid of current_view project".)
10306 * src/buffer.C + other files: moved several Buffer functions to
10307 class BufferView, the functions are still present in buffer.C.
10308 Code changes because of this.
10310 * config/lcmessage.m4: updated to most recent. used when creating
10313 * config/progtest.m4: updated to most recent. used when creating
10316 * config/gettext.m4: updated to most recent. applied patch for
10319 * config/gettext.m4.patch: new file that shows what changes we
10320 have done to the local copy of gettext.m4.
10322 * config/libtool.m4: new file, used in creation of acinclude.m4
10324 * config/lyxinclude.m4: new file, this is the lyx created m4
10325 macros, used in making acinclude.m4.
10327 * autogen.sh: GNU m4 discovered as a separate task not as part of
10328 the lib/configure creation.
10329 Generate acinlucde from files in config. Actually cat
10330 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10331 easier to upgrade .m4 files that really are external.
10333 * src/Spacing.h: moved using std::istringstream to right after
10334 <sstream>. This should fix the problem seen with some compilers.
10336 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10338 * src/lyx_cb.C: began some work to remove the dependency a lot of
10339 functions have on BufferView::text, even if not really needed.
10340 (GetCurrentTextClass): removed this func, it only hid the
10343 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10344 forgot this in last commit.
10346 * src/Bullet.C (bulletEntry): use static char const *[] for the
10347 tables, becuase of this the return arg had to change to string.
10348 (bulletSize): ditto
10349 (~Bullet): removed unneeded destructor
10351 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10352 (insetSleep): moved from Buffer
10353 (insetWakeup): moved from Buffer
10354 (insetUnlock): moved from Buffer
10356 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10357 from Buffer to BufferView.
10359 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10361 * config/ltmain.sh: updated to version 1.3.4 of libtool
10363 * config/ltconfig: updated to version 1.3.4 of libtool
10365 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10368 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10369 Did I get that right?
10371 * src/lyxlex.h: add a "using" directive or two.
10372 * src/Spacing.h: ditto.
10373 * src/insets/figinset.C: ditto.
10374 * src/support/filetools.C: ditto.
10375 * src/support/lstrings.C: ditto.
10376 * src/BufferView.C: ditto.
10377 * src/bufferlist.C: ditto.
10378 * src/lyx_cb.C: ditto.
10379 * src/lyxlex.C: ditto.
10381 * NEWS: add some changes for 1.1.4.
10383 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10385 * src/BufferView.C: first go at a TextCache to speed up switching
10388 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10390 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10391 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10392 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10393 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10396 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10397 members of the struct are correctly initialized to 0 (detected by
10399 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10400 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10402 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10403 pidwait, since it was allocated with "new". This was potentially
10404 very bad. Thanks to Michael Schmitt for running purify for us.
10407 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10409 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10411 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10413 1999-12-30 Allan Rae <rae@lyx.org>
10415 * lib/templates/IEEEtran.lyx: minor change
10417 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10418 src/mathed/formula.C (LocalDispatch): askForText changes
10420 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10421 know when a user has cancelled input. Fixes annoying problems with
10422 inserting labels and version control.
10424 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10426 * src/support/lstrings.C (tostr): rewritten to use strstream and
10429 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10431 * src/support/filetools.C (IsFileWriteable): use fstream to check
10432 (IsDirWriteable): use fileinfo to check
10434 * src/support/filetools.h (FilePtr): whole class deleted
10436 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10438 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10440 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10442 * src/bufferlist.C (write): use ifstream and ofstream instead of
10445 * src/Spacing.h: use istrstream instead of sscanf
10447 * src/mathed/math_defs.h: change first arg to istream from FILE*
10449 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10451 * src/mathed/math_parser.C: have yyis to be an istream
10452 (LexGetArg): use istream (yyis)
10454 (mathed_parse): ditto
10455 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10457 * src/mathed/formula.C (Read): rewritten to use istream
10459 * src/mathed/formulamacro.C (Read): rewritten to use istream
10461 * src/lyxlex.h (~LyXLex): deleted desturctor
10462 (getStream): new function, returns an istream
10463 (getFile): deleted funtion
10464 (IsOK): return is.good();
10466 * src/lyxlex.C (LyXLex): delete file and owns_file
10467 (setFile): open an filebuf and assign that to a istream instead of
10469 (setStream): new function, takes an istream as arg.
10470 (setFile): deleted function
10471 (EatLine): rewritten us use istream instead of FILE*
10475 * src/table.C (LyXTable): use istream instead of FILE*
10476 (Read): rewritten to take an istream instead of FILE*
10478 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10480 * src/buffer.C (Dispatch): remove an extraneous break statement.
10482 * src/support/filetools.C (QuoteName): change to do simple
10483 'quoting'. More work is necessary. Also changed to do nothing
10484 under emx (needs fix too).
10485 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10487 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10488 config.h.in to the AC_DEFINE_UNQUOTED() call.
10489 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10490 needs char * as argument (because Solaris 7 declares it like
10493 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10494 remove definition of BZERO.
10496 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10498 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10499 defined, "lyxregex.h" if not.
10501 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10503 (REGEX): new variable that is set to regex.c lyxregex.h when
10504 AM_CONDITIONAL USE_REGEX is set.
10505 (libsupport_la_SOURCES): add $(REGEX)
10507 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10510 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10513 * configure.in: add call to LYX_REGEX
10515 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10516 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10518 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10520 * lib/bind/fi_menus.bind: new file, from
10521 pauli.virtanen@saunalahti.fi.
10523 * src/buffer.C (getBibkeyList): pass the parameter delim to
10524 InsetInclude::getKeys and InsetBibtex::getKeys.
10526 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10527 is passed to Buffer::getBibkeyList
10529 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10530 instead of the hardcoded comma.
10532 * src/insets/insetbib.C (getKeys): make sure that there are not
10533 leading blanks in bibtex keys. Normal latex does not care, but
10534 harvard.sty seems to dislike blanks at the beginning of citation
10535 keys. In particular, the retturn value of the function is
10537 * INSTALL: make it clear that libstdc++ is needed and that gcc
10538 2.7.x probably does not work.
10540 * src/support/filetools.C (findtexfile): make debug message go to
10542 * src/insets/insetbib.C (getKeys): ditto
10544 * src/debug.C (showTags): make sure that the output is correctly
10547 * configure.in: add a comment for TWO_COLOR_ICON define.
10549 * acconfig.h: remove all the entries that already defined in
10550 configure.in or acinclude.m4.
10552 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10553 to avoid user name, date and copyright.
10555 1999-12-21 Juergen Vigna <jug@sad.it>
10557 * src/table.C (Read): Now read bogus row format informations
10558 if the format is < 5 so that afterwards the table can
10559 be read by lyx but without any format-info. Fixed the
10560 crash we experienced when not doing this.
10562 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10564 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10565 (RedoDrawingOfParagraph): ditto
10566 (RedoParagraphs): ditto
10567 (RemoveTableRow): ditto
10569 * src/text.C (Fill): rename arg paperwidth -> paper_width
10571 * src/buffer.C (insertLyXFile): rename var filename -> fname
10572 (writeFile): rename arg filename -> fname
10573 (writeFileAscii): ditto
10574 (makeLaTeXFile): ditto
10575 (makeLinuxDocFile): ditto
10576 (makeDocBookFile): ditto
10578 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10581 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10583 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10586 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10587 compiled by a C compiler not C++.
10589 * src/layout.h (LyXTextClass): added typedef for const_iterator
10590 (LyXTextClassList): added typedef for const_iterator + member
10591 functions begin and end.
10593 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10594 iterators to fill the choice_class.
10595 (updateLayoutChoice): rewritten to use iterators to fill the
10596 layoutlist in the toolbar.
10598 * src/BufferView.h (BufferView::work_area_width): removed unused
10601 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10603 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10604 (sgmlCloseTag): ditto
10606 * src/support/lstrings.h: return type of countChar changed to
10609 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10610 what version of this func to use. Also made to return unsigned int.
10612 * configure.in: call LYX_STD_COUNT
10614 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10615 conforming std::count.
10617 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10619 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10620 and a subscript would give bad display (patch from Dekel Tsur
10621 <dekel@math.tau.ac.il>).
10623 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10625 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10628 * src/chset.h: add a few 'using' directives
10630 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10631 triggered when no buffer is active
10633 * src/layout.C: removed `break' after `return' in switch(), since
10636 * src/lyx_main.C (init): make sure LyX can be ran in place even
10637 when libtool has done its magic with shared libraries. Fix the
10638 test for the case when the system directory has not been found.
10640 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10641 name for the latex file.
10642 (MenuMakeHTML): ditto
10644 * src/buffer.h: add an optional boolean argument, which is passed
10645 to ChangeExtension.
10647 1999-12-20 Allan Rae <rae@lyx.org>
10649 * lib/templates/IEEEtran.lyx: small correction and update.
10651 * configure.in: Attempted to use LYX_PATH_HEADER
10653 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10655 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10656 input from JMarc. Now use preprocessor to find the header.
10657 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10658 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10659 LYX_STL_STRING_FWD. See comments in file.
10661 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10663 * The global MiniBuffer * minibuffer variable is dead.
10665 * The global FD_form_main * fd_form_main variable is dead.
10667 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10669 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10671 * src/table.h: add the LOstream.h header
10672 * src/debug.h: ditto
10674 * src/LyXAction.h: change the explaination of the ReadOnly
10675 attribute: is indicates that the function _can_ be used.
10677 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10680 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10682 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10688 * src/paragraph.C (GetWord): assert on pos>=0
10691 * src/support/lyxstring.C: condition the use of an invariant on
10693 * src/support/lyxstring.h: ditto
10695 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10696 Use LAssert.h instead of plain assert().
10698 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10700 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10701 * src/support/filetools.C: ditto
10703 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10706 * INSTALL: document the new configure flags
10708 * configure.in: suppress --with-debug; add --enable-assertions
10710 * acinclude.m4: various changes in alignment of help strings.
10712 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10714 * src/kbmap.C: commented out the use of the hash map in kb_map,
10715 beginning of movement to a stl::container.
10717 * several files: removed code that was not in effect when
10718 MOVE_TEXT was defined.
10720 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10721 for escaping should not be used. We can discuss if the string
10722 should be enclosed in f.ex. [] instead of "".
10724 * src/trans_mgr.C (insert): use the new returned value from
10725 encodeString to get deadkeys and keymaps done correctly.
10727 * src/chset.C (encodeString): changed to return a pair, to tell
10728 what to use if we know the string.
10730 * src/lyxscreen.h (fillArc): new function.
10732 * src/FontInfo.C (resize): rewritten to use more std::string like
10733 structore, especially string::replace.
10735 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10738 * configure.in (chmod +x some scripts): remove config/gcc-hack
10740 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10742 * src/buffer.C (writeFile): change once again the top comment in a
10743 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10744 instead of an hardcoded version number.
10745 (makeDocBookFile): ditto
10747 * src/version.h: add new define LYX_DOCVERSION
10749 * po/de.po: update from Pit Sütterlin
10750 * lib/bind/de_menus.bind: ditto.
10752 * src/lyxfunc.C (Dispatch): call MenuExport()
10753 * src/buffer.C (Dispatch): ditto
10755 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10756 LyXFunc::Dispatch().
10757 (MenuExport): new function, moved from
10758 LyXFunc::Dispatch().
10760 * src/trans_mgr.C (insert): small cleanup
10761 * src/chset.C (loadFile): ditto
10763 * lib/kbd/iso8859-1.cdef: add missing backslashes
10765 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10767 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10768 help with placing the manually drawn accents better.
10770 (Draw): x2 and hg changed to float to minimize rounding errors and
10771 help place the accents better.
10773 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10774 unsigned short to char is just wrong...cast the char to unsigned
10775 char instead so that the two values can compare sanely. This
10776 should also make the display of insetlatexaccents better and
10777 perhaps also some other insets.
10779 (lbearing): new function
10782 1999-12-15 Allan Rae <rae@lyx.org>
10784 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10785 header that provides a wrapper around the very annoying SGI STL header
10788 * src/support/lyxstring.C, src/LString.h:
10789 removed old SGI-STL-compatability attempts.
10791 * configure.in: Use LYX_STL_STRING_FWD.
10793 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10794 stl_string_fwd.h is around and try to determine it's location.
10795 Major improvement over previous SGI STL 3.2 compatability.
10796 Three small problems remain with this function due to my zero
10797 knowledge of autoconf. JMarc and lgb see the comments in the code.
10799 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10801 * src/broken_const.h, config/hack-gcc, config/README: removed
10803 * configure.in: remove --with-gcc-hack option; do not call
10806 * INSTALL: remove documentation of --with-broken-const and
10809 * acconfig.h: remove all trace of BROKEN_CONST define
10811 * src/buffer.C (makeDocBookFile): update version number in output
10813 (SimpleDocBookOnePar): fix an assert when trying to a character
10814 access beyond string length
10817 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10819 * po/de.po: fix the Export menu
10821 * lyx.man: update the description of -dbg
10823 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10824 (commandLineHelp): updated
10825 (easyParse): show list of available debug levels if -dbg is passed
10828 * src/Makefile.am: add debug.C
10830 * src/debug.h: moved some code to debug.C
10832 * src/debug.C: new file. Contains code to set and show debug
10835 * src/layout.C: remove 'break' after 'continue' in switch
10836 statements, since these cannot be reached.
10838 1999-12-13 Allan Rae <rae@lyx.org>
10840 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10841 (in_word_set): hash() -> math_hash()
10843 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10845 * acconfig.h: Added a test for whether we are using exceptions in the
10846 current compilation run. If so USING_EXCEPTIONS is defined.
10848 * config.in: Check for existance of stl_string_fwd.h
10849 * src/LString.h: If compiling --with-included-string and SGI's
10850 STL version 3.2 is present (see above test) we need to block their
10851 forward declaration of string and supply a __get_c_string().
10852 However, it turns out this is only necessary if compiling with
10853 exceptions enabled so I've a bit more to add yet.
10855 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10856 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10857 src/support/LRegex.h, src/undo.h:
10858 Shuffle the order of the included files a little to ensure that
10859 LString.h gets included before anything that includes stl_string_fwd.h
10861 * src/support/lyxstring.C: We need to #include LString.h instead of
10862 lyxstring.h to get the necessary definition of __get_c_string.
10863 (__get_c_string): New function. This is defined static just like SGI's
10864 although why they need to do this I'm not sure. Perhaps it should be
10865 in lstrings.C instead.
10867 * lib/templates/IEEEtran.lyx: New template file.
10869 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10871 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10872 * intl/Makefile.in (MKINSTALLDIRS): ditto
10874 * src/LyXAction.C (init): changed to hold the LFUN data in a
10875 automatic array in stead of in callso to newFunc, this speeds up
10876 compilation a lot. Also all the memory used by the array is
10877 returned when the init is completed.
10879 * a lot of files: compiled with -Wold-style-cast, changed most of
10880 the reported offenders to C++ style casts. Did not change the
10881 offenders in C files.
10883 * src/trans.h (Match): change argument type to unsigned int.
10885 * src/support/DebugStream.C: fix some types on the streambufs so
10886 that it works on a conforming implementation.
10888 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10890 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10892 * src/support/lyxstring.C: remove the inline added earlier since
10893 they cause a bunch of unsatisfied symbols when linking with dec
10894 cxx. Cxx likes to have the body of inlines at the place where they
10897 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10898 accessing negative bounds in array. This fixes the crash when
10899 inserting accented characters.
10900 * src/trans.h (Match): ditto
10902 * src/buffer.C (Dispatch): since this is a void, it should not try
10903 to return anything...
10905 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10907 * src/buffer.h: removed the two friends from Buffer. Some changes
10908 because of this. Buffer::getFileName and Buffer::setFileName
10909 renamed to Buffer::fileName() and Buffer::fileName(...).
10911 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10913 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10914 and Buffer::update(short) to BufferView. This move is currently
10915 controlled by a define MOVE_TEXT, this will be removed when all
10916 shows to be ok. This move paves the way for better separation
10917 between buffer contents and buffer view. One side effect is that
10918 the BufferView needs a rebreak when swiching buffers, if we want
10919 to avoid this we can add a cache that holds pointers to LyXText's
10920 that is not currently in use.
10922 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10925 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10927 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10929 * lyx_main.C: new command line option -x (or --execute) and
10930 -e (or --export). Now direct conversion from .lyx to .tex
10931 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10932 Unfortunately, X is still needed and the GUI pops up during the
10935 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10937 * src/Spacing.C: add a using directive to bring stream stuff into
10939 * src/paragraph.C: ditto
10940 * src/buffer.C: ditto
10942 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10943 from Lars' announcement).
10945 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10946 example files from Tino Meinen.
10948 1999-12-06 Allan Rae <rae@lyx.org>
10950 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10952 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10954 * src/support/lyxstring.C: added a lot of inline for no good
10957 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10958 latexWriteEndChanges, they were not used.
10960 * src/layout.h (operator<<): output operator for PageSides
10962 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10964 * some example files: loaded in LyX 1.0.4 and saved again to update
10965 certain constructs (table format)
10967 * a lot of files: did the change to use fstream/iostream for all
10968 writing of files. Done with a close look at Andre Poenitz's patch.
10970 * some files: whitespace changes.
10972 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10974 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10975 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10976 architecture, we provide our own. It is used unconditionnally, but
10977 I do not think this is a performance problem. Thanks to Angus
10978 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10979 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10981 (GetInset): use my_memcpy.
10985 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10986 it is easier to understand, but it uses less TeX-only constructs now.
10988 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10989 elements contain spaces
10991 * lib/configure: regenerated
10993 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10994 elements contain spaces; display the list of programs that are
10997 * autogen.sh: make sure lib/configure is executable
10999 * lib/examples/*: rename the tutorial examples to begin with the
11000 two-letters language code.
11002 * src/lyxfunc.C (getStatus): do not query current font if no
11005 * src/lyx_cb.C (RunScript): use QuoteName
11006 (MenuRunDvips): ditto
11007 (PrintApplyCB): ditto
11009 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11010 around argument, so that it works well with the current shell.
11011 Does not work properly with OS/2 shells currently.
11013 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11014 * src/LyXSendto.C (SendtoApplyCB): ditto
11015 * src/lyxfunc.C (Dispatch): ditto
11016 * src/buffer.C (runLaTeX): ditto
11017 (runLiterate): ditto
11018 (buildProgram): ditto
11020 * src/lyx_cb.C (RunScript): ditto
11021 (MenuMakeLaTeX): ditto
11023 * src/buffer.h (getLatexName): new method
11025 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11027 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11029 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11030 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11031 (create_math_panel): ditto
11033 * src/lyxfunc.C (getStatus): re-activate the code which gets
11034 current font and cursor; add test for export to html.
11036 * src/lyxrc.C (read): remove unreachable break statements; add a
11039 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11041 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11043 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11044 introduced by faulty regex.
11045 * src/buffer.C: ditto
11046 * src/lastfiles.C: ditto
11047 * src/paragraph.C: ditto
11048 * src/table.C: ditto
11049 * src/vspace.C: ditto
11050 * src/insets/figinset.C: ditto
11051 Note: most of these is absolutely harmless, except the one in
11052 src/mathed formula.C.
11054 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11056 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11057 operation, yielding correct results for the reLyX command.
11059 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11061 * src/support/filetools.C (ExpandPath): removed an over eager
11063 (ReplaceEnvironmentPath): ditto
11065 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11066 shows that we are doing something fishy in our code...
11067 (BubblePost): ditto
11070 * src/lyxrc.C (read): use a double switch trick to get more help
11071 from the compiler. (the same trick is used in layout.C)
11072 (write): new function. opens a ofstream and pass that to output
11073 (output): new function, takes a ostream and writes the lyxrc
11074 elemts to it. uses a dummy switch to make sure no elements are
11077 * src/lyxlex.h: added a struct pushpophelper for use in functions
11078 with more than one exit point.
11080 * src/lyxlex.[Ch] (GetInteger): made it const
11084 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11086 * src/layout.[hC] : LayoutTags splitted into several enums, new
11087 methods created, better error handling cleaner use of lyxlex. Read
11090 * src/bmtable.[Ch]: change some member prototypes because of the
11091 image const changes.
11093 * commandtags.h, src/LyXAction.C (init): new function:
11094 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11095 This file is not read automatically but you can add \input
11096 preferences to your lyxrc if you want to. We need to discuss how
11099 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11100 in .aux, also remove .bib and .bst files from dependencies when
11103 * src/BufferView.C, src/LyXView.C: add const_cast several places
11104 because of changes to images.
11106 * lib/images/*: same change as for images/*
11108 * lib/lyxrc.example: Default for accept_compound is false not no.
11110 * images/*: changed to be const, however I have som misgivings
11111 about this change so it might be changed back.
11113 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11115 * lib/configure, po/POTFILES.in: regenerated
11117 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11119 * config/lib_configure.m4: removed
11121 * lib/configure.m4: new file (was config/lib_configure.m4)
11123 * configure.in: do not test for rtti, since we do not use it.
11125 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11127 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11128 doubling of allocated space scheme. This makes it faster for large
11129 strings end to use less memory for small strings. xtra rememoved.
11131 * src/insets/figinset.C (waitalarm): commented out.
11132 (GhostscriptMsg): use static_cast
11133 (GhostscriptMsg): use new instead of malloc to allocate memory for
11134 cmap. also delete the memory after use.
11136 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11138 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11139 for changes in bibtex database or style.
11140 (runBibTeX): remove all .bib and .bst files from dep before we
11142 (run): use scanAuc in when dep file already exist.
11144 * src/DepTable.C (remove_files_with_extension): new method
11145 (exist): new method
11147 * src/DepTable.[Ch]: made many of the methods const.
11149 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11151 * src/bufferparams.C: make sure that the default textclass is
11152 "article". It used to be the first one by description order, but
11153 now the first one is "docbook".
11155 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11156 string; call Debug::value.
11157 (easyParse): pass complete argument to setDebuggingLevel().
11159 * src/debug.h (value): fix the code that parses debug levels.
11161 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11164 * src/LyXAction.C: use Debug::ACTION as debug channel.
11166 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11168 * NEWS: updated for the future 1.1.3 release.
11170 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11171 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11172 it should. This is of course a controversial change (since many
11173 people will find that their lyx workscreen is suddenly full of
11174 red), but done for the sake of correctness.
11176 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11177 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11179 * src/insets/inseterror.h, src/insets/inseturl.h,
11180 src/insets/insetinfo.h, src/insets/figinset.h,
11181 src/mathed/formulamacro.h, src/mathed/math_macro.h
11182 (EditMessage): add a missing const and add _() to make sure that
11183 translation happens
11185 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11186 src/insets/insetbib.C, src/support/filetools.C: add `using'
11187 directives for cxx.
11189 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11190 doing 'Insert index of last word' at the beginning of a paragraph.
11192 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11194 * several files: white-space changes.
11196 * src/mathed/formula.C: removed IsAlpha and IsDigit
11198 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11199 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11202 * src/insets/figinset.C (GetPSSizes): don't break when
11203 "EndComments" is seen. But break when a boundingbox is read.
11205 * all classes inherited from Inset: return value of Clone
11206 changed back to Inset *.
11208 * all classes inherited form MathInset: return value of Clone
11209 changed back to MathedInset *.
11211 * src/insets/figinset.C (runqueue): use a ofstream to output the
11212 gs/ps file. Might need some setpresicion or setw. However I can
11213 see no problem with the current code.
11214 (runqueue): use sleep instead of the alarm/signal code. I just
11215 can't see the difference.
11217 * src/paragraph.C (LyXParagraph): reserve space in the new
11218 paragraph and resize the inserted paragraph to just fit.
11220 * src/lyxfunc.h (operator|=): added operator for func_status.
11222 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11223 check for readable file.
11225 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11226 check for readable file.
11227 (MenuMakeLinuxDoc): ditto
11228 (MenuMakeDocBook): ditto
11229 (MenuMakeAscii): ditto
11230 (InsertAsciiFile): split the test for openable and readable
11232 * src/bmtable.C (draw_bitmaptable): use
11233 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11235 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11236 findtexfile from LaTeX to filetools.
11238 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11239 instead of FilePtr. Needs to be verified by a literate user.
11241 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11243 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11244 (EditMessage): likewise.
11246 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11247 respectively as \textasciitilde and \textasciicircum.
11249 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11251 * src/support/lyxstring.h: made the methods that take iterators
11252 use const_iterator.
11254 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11255 (regexMatch): made is use the real regex class.
11257 * src/support/Makefile.am: changed to use libtool
11259 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11261 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11263 (MathIsInset ++): changed several macros to be inline functions
11266 * src/mathed/Makefile.am: changed to use libtool
11268 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11270 * src/insets/inset* : Clone changed to const and return type is
11271 the true insettype not just Inset*.
11273 * src/insets/Makefile.am: changed to use libtool
11275 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11277 * src/undo.[Ch] : added empty() and changed some of the method
11280 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11282 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11283 setID use block<> for the bullets array, added const several places.
11285 * src/lyxfunc.C (getStatus): new function
11287 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11288 LyXAction, added const to several funtions.
11290 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11291 a std::map, and to store the dir items in a vector.
11293 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11296 * src/LyXView.[Ch] + other files : changed currentView to view.
11298 * src/LyXAction.[Ch] : ported from the old devel branch.
11300 * src/.cvsignore: added .libs and a.out
11302 * configure.in : changes to use libtool.
11304 * acinclude.m4 : inserted libtool.m4
11306 * .cvsignore: added libtool
11308 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11310 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11311 file name in insets and mathed directories (otherwise the
11312 dependency is not taken in account under cygwin).
11314 * src/text2.C (InsertString[AB]): make sure that we do not try to
11315 read characters past the string length.
11317 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11319 * lib/doc/LaTeXConfig.lyx.in,
11320 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11322 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11323 file saying who created them and when this heppened; this is
11324 useless and annoys tools like cvs.
11326 * lib/layouts/g-brief-{en,de}.layout,
11327 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11328 from Thomas Hartkens <thomas@hartkens.de>.
11330 * src/{insets,mathed}/Makefile.am: do not declare an empty
11331 LDFLAGS, so that it can be set at configure time (useful on Irix
11334 * lib/reLyX/configure.in: make sure that the prefix is set
11335 correctly in LYX_DIR.
11337 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11339 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11340 be used by 'command-sequence' this allows to bind a key to a
11341 sequence of LyX-commands
11342 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11344 * src/LyXAction.C: add "command-sequence"
11346 * src/LyXFunction.C: handling of "command-sequence"
11348 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11349 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11351 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11353 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11355 * src/buffer.C (writeFile): Do not output a comment giving user
11356 and date at the beginning of a .lyx file. This is useless and
11357 annoys cvs anyway; update version number to 1.1.
11359 * src/Makefile.am (LYX_DIR): add this definition, so that a
11360 default path is hardcoded in LyX.
11362 * configure.in: Use LYX_GNU_GETTEXT.
11364 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11365 AM_GNU_GETTEXT with a bug fixed.
11367 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11369 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11371 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11372 which is used to point to LyX data is now LYX_DIR_11x.
11374 * lyx.man: convert to a unix text file; small updates.
11376 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11378 * src/support/LSubstring.[Ch]: made the second arg of most of the
11379 constructors be a const reference.
11381 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11384 * src/support/lyxstring.[Ch] (swap): added missing member function
11385 and specialization of swap(str, str);
11387 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11389 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11390 trace of the old one.
11392 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11393 put the member definitions in undo.C.
11395 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11396 NEW_TEXT and have now only code that was included when this was
11399 * src/intl.C (LCombo): use static_cast
11401 (DispatchCallback): ditto
11403 * src/definitions.h: removed whole file
11405 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11407 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11408 parsing and stores in a std:map. a regex defines the file format.
11409 removed unneeded members.
11411 * src/bufferparams.h: added several enums from definitions.h here.
11412 Removed unsused destructor. Changed some types to use proper enum
11413 types. use block to have the temp_bullets and user_defined_bullets
11414 and to make the whole class assignable.
11416 * src/bufferparams.C (Copy): removed this functions, use a default
11417 assignment instead.
11419 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11422 * src/buffer.C (readLyXformat2): commend out all that have with
11423 oldpapersize to do. also comment out all that hve to do with
11424 insetlatex and insetlatexdel.
11425 (setOldPaperStuff): commented out
11427 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11429 * src/LyXAction.C: remove use of inset-latex-insert
11431 * src/mathed/math_panel.C (button_cb): use static_cast
11433 * src/insets/Makefile.am (insets_o_SOURCES): removed
11436 * src/support/lyxstring.C (helper): use the unsigned long
11437 specifier, UL, instead of a static_cast.
11439 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11441 * src/support/block.h: new file. to be used as a c-style array in
11442 classes, so that the class can be assignable.
11444 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11446 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11447 NULL, make sure to return an empty string (it is not possible to
11448 set a string to NULL).
11450 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11452 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11454 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11456 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11457 link line, so that Irix users (for example) can set it explicitely to
11460 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11461 it can be overidden at make time (static or dynamic link, for
11464 * src/vc-backend.C, src/LaTeXFeatures.h,
11465 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11466 statements to bring templates to global namespace.
11468 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11470 * src/support/lyxstring.C (operator[] const): make it standard
11473 * src/minibuffer.C (Init): changed to reflect that more
11474 information is given from the lyxvc and need not be provided here.
11476 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11478 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11480 * src/LyXView.C (UpdateTimerCB): use static_cast
11481 (KeyPressMask_raw_callback): ditto
11483 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11484 buffer_, a lot of changes because of this. currentBuffer() ->
11485 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11486 also changes to other files because of this.
11488 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11490 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11491 have no support for RCS and partial support for CVS, will be
11494 * src/insets/ several files: changes because of function name
11495 changes in Bufferview and LyXView.
11497 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11499 * src/support/LSubstring.[Ch]: new files. These implement a
11500 Substring that can be very convenient to use. i.e. is this
11502 string a = "Mary had a little sheep";
11503 Substring(a, "sheep") = "lamb";
11504 a is now "Mary has a little lamb".
11506 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11507 out patterns and subpatterns of strings. It is used by LSubstring
11508 and also by vc-backend.C
11510 * src/support/lyxstring.C: went over all the assertions used and
11511 tried to correct the wrong ones and flag which of them is required
11512 by the standard. some bugs found because of this. Also removed a
11513 couple of assertions.
11515 * src/support/Makefile.am (libsupport_a_SOURCES): added
11516 LSubstring.[Ch] and LRegex.[Ch]
11518 * src/support/FileInfo.h: have struct stat buf as an object and
11519 not a pointer to one, some changes because of this.
11521 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11522 information in layout when adding the layouts preamble to the
11523 textclass preamble.
11525 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11528 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11529 because of bug in OS/2.
11531 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11533 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11534 \verbatim@font instead of \ttfamily, so that it can be redefined.
11536 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11537 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11538 src/layout.h, src/text2.C: add 'using' directive to bring the
11539 STL templates we need from the std:: namespace to the global one.
11540 Needed by DEC cxx in strict ansi mode.
11542 * src/support/LIstream.h,src/support/LOstream.h,
11543 src/support/lyxstring.h,src/table.h,
11544 src/lyxlookup.h: do not include <config.h> in header
11545 files. This should be done in the .C files only.
11547 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11551 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11553 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11554 from Kayvan to fix the tth invokation.
11556 * development/lyx.spec.in: updates from Kayvan to reflect the
11557 changes of file names.
11559 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11561 * src/text2.C (InsertStringB): use std::copy
11562 (InsertStringA): use std::copy
11564 * src/bufferlist.C: use a vector to store the buffers in. This is
11565 an internal change and should not affect any other thing.
11567 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11570 * src/text.C (Fill): fix potential bug, one off bug.
11572 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11574 * src/Makefile.am (lyx_main.o): add more files it depends on.
11576 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11578 * src/support/lyxstring.C: use size_t for the reference count,
11579 size, reserved memory and xtra.
11580 (internal_compare): new private member function. Now the compare
11581 functions should work for std::strings that have embedded '\0'
11583 (compare): all compare functions rewritten to use
11586 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11588 * src/support/lyxstring.C (compare): pass c_str()
11589 (compare): pass c_str
11590 (compare): pass c_str
11592 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11594 * src/support/DebugStream.C: <config.h> was not included correctly.
11596 * lib/configure: forgot to re-generate it :( I'll make this file
11597 auto generated soon.
11599 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11601 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11604 * src/support/lyxstring.C: some changes from length() to rep->sz.
11605 avoids a function call.
11607 * src/support/filetools.C (SpaceLess): yet another version of the
11608 algorithm...now per Jean-Marc's suggestions.
11610 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11612 * src/layout.C (less_textclass_desc): functor for use in sorting
11614 (LyXTextClass::Read): sort the textclasses after reading.
11616 * src/support/filetools.C (SpaceLess): new version of the
11617 SpaceLess functions. What problems does this one give? Please
11620 * images/banner_bw.xbm: made the arrays unsigned char *
11622 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11624 * src/support/lyxstring.C (find): remove bogus assertion in the
11625 two versions of find where this has not been done yet.
11627 * src/support/lyxlib.h: add missing int return type to
11630 * src/menus.C (ShowFileMenu): disable exporting to html if no
11631 html export command is present.
11633 * config/lib_configure.m4: add a test for an HTML converter. The
11634 programs checked for are, in this order: tth, latex2html and
11637 * lib/configure: generated from config/lib_configure.m4.
11639 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11640 html converter. The parameters are now passed through $$FName and
11641 $$OutName, instead of standard input/output.
11643 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11645 * lib/lyxrc.example: update description of \html_command.
11646 add "quotes" around \screen_font_xxx font setting examples to help
11647 people who use fonts with spaces in their names.
11649 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11651 * Distribution files: updates for v1.1.2
11653 * src/support/lyxstring.C (find): remove bogus assert and return
11654 npos for the same condition.
11656 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11658 * added patch for OS/2 from SMiyata.
11660 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11662 * src/text2.C (CutSelection): make space_wrapped a bool
11663 (CutSelection): dont declare int i until we have to.
11664 (alphaCounter): return a char const *.
11666 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11668 * src/support/syscall.C (Systemcalls::kill):
11669 src/support/filetools.C (PutEnv, PutEnvPath):
11670 src/lyx_cb.C (addNewlineAndDepth):
11671 src/FontInfo.C (FontInfo::resize): condition some #warning
11672 directives with WITH_WARNINGS.
11675 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11677 * src/layout.[Ch] + several files: access to class variables
11678 limited and made accessor functions instead a lot of code changed
11679 becuase of this. Also instead of returning pointers often a const
11680 reference is returned instead.
11682 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11684 * src/Makefile.am (dist-hook): added used to remove the CVS from
11685 cheaders upon creating a dist
11686 (EXTRA_DIST): added cheaders
11688 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11689 a character not as a small integer.
11691 * src/support/lyxstring.C (find): removed Assert and added i >=
11692 rep->sz to the first if.
11694 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11696 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11697 src/LyXView.C src/buffer.C src/bufferparams.C
11698 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11699 src/text2.C src/insets/insetinclude.C:
11700 lyxlayout renamed to textclasslist.
11702 * src/layout.C: some lyxerr changes.
11704 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11705 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11706 (LyXLayoutList): removed all traces of this class.
11707 (LyXTextClass::Read): rewrote LT_STYLE
11708 (LyXTextClass::hasLayout): new function
11709 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11710 both const and nonconst version.
11711 (LyXTextClass::delete_layout): new function.
11712 (LyXTextClassList::Style): bug fix. do the right thing if layout
11714 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11715 (LyXTextClassList::NameOfLayout): ditto
11716 (LyXTextClassList::Load): ditto
11718 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11720 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11722 * src/LyXAction.C (LookupFunc): added a workaround for sun
11723 compiler, on the other hand...we don't know if the current code
11724 compiles on sun at all...
11726 * src/support/filetools.C (CleanupPath): subst fix
11728 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11731 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11732 complained about this one?
11734 * src/insets/insetinclude.C (Latex): subst fix
11736 * src/insets/insetbib.C (getKeys): subst fix
11738 * src/LyXSendto.C (SendtoApplyCB): subst fix
11740 * src/lyx_main.C (init): subst fix
11742 * src/layout.C (Read): subst fix
11744 * src/lyx_sendfax_main.C (button_send): subst fix
11746 * src/buffer.C (RoffAsciiTable): subst fix
11748 * src/lyx_cb.C (MenuFax): subst fix
11749 (PrintApplyCB): subst fix
11751 1999-10-26 Juergen Vigna <jug@sad.it>
11753 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11755 (Read): Cleaned up this code so now we read only format vestion >= 5
11757 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11759 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11760 come nobody has complained about this one?
11762 * src/insets/insetinclude.C (Latex): subst fix
11764 * src/insets/insetbib.C (getKeys): subst fix
11766 * src/lyx_main.C (init): subst fix
11768 * src/layout.C (Read): subst fix
11770 * src/buffer.C (RoffAsciiTable): subst fix
11772 * src/lyx_cb.C (MenuFax): subst fix.
11774 * src/layout.[hC] + some other files: rewrote to use
11775 std::container to store textclasses and layouts in.
11776 Simplified, removed a lot of code. Make all classes
11777 assignable. Further simplifications and review of type
11778 use still to be one.
11780 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11781 lastfiles to create the lastfiles partr of the menu.
11783 * src/lastfiles.[Ch]: rewritten to use deque to store the
11784 lastfiles in. Uses fstream for reading and writing. Simplifies
11787 * src/support/syscall.C: remove explicit cast.
11789 * src/BufferView.C (CursorToggleCB): removed code snippets that
11790 were commented out.
11791 use explicat C++ style casts instead of C style casts. also use
11792 u_vdata instea of passing pointers in longs.
11794 * src/PaperLayout.C: removed code snippets that were commented out.
11796 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11798 * src/lyx_main.C: removed code snippets that wer commented out.
11800 * src/paragraph.C: removed code snippets that were commented out.
11802 * src/lyxvc.C (logClose): use static_cast
11804 (viewLog): remove explicit cast to void*
11805 (showLog): removed old commented code
11807 * src/menus.C: use static_cast instead of C style casts. use
11808 u_vdata instead of u_ldata. remove explicit cast to (long) for
11809 pointers. Removed old code that was commented out.
11811 * src/insets/inset.C: removed old commented func
11813 * src/insets/insetref.C (InsetRef): removed old code that had been
11814 commented out for a long time.
11816 (escape): removed C style cast
11818 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11820 * src/insets/insetlatex.C (Draw): removed old commented code
11821 (Read): rewritten to use string
11823 * src/insets/insetlabel.C (escape): removed C style cast
11825 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11827 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11828 old commented code.
11830 * src/insets/insetinclude.h: removed a couple of stupid bools
11832 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11833 (Clone): remove C style cast
11834 (getKeys): changed list to lst because of std::list
11836 * src/insets/inseterror.C (Draw): removed som old commented code.
11838 * src/insets/insetcommand.C (Draw): removed some old commented code.
11840 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11841 commented out forever.
11842 (bibitem_cb): use static_cast instead of C style cast
11843 use of vdata changed to u_vdata.
11845 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11847 (CloseUrlCB): use static_cast instead of C style cast.
11848 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11850 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11851 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11852 (CloseInfoCB): static_cast from ob->u_vdata instead.
11853 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11856 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11857 (C_InsetError_CloseErrorCB): forward the ob parameter
11858 (CloseErrorCB): static_cast from ob->u_vdata instead.
11860 * src/vspace.h: include LString.h since we use string in this class.
11862 * src/vspace.C (lyx_advance): changed name from advance because of
11863 nameclash with stl. And since we cannot use namespaces yet...I
11864 used a lyx_ prefix instead. Expect this to change when we begin
11867 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11869 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11870 and removed now defunct constructor and deconstructor.
11872 * src/BufferView.h: have backstack as a object not as a pointer.
11873 removed initialization from constructor. added include for BackStack
11875 * development/lyx.spec.in (%build): add CFLAGS also.
11877 * src/screen.C (drawFrame): removed another warning.
11879 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11881 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11882 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11883 README and ANNOUNCE a bit for the next release. More work is
11886 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11887 unbreakable if we are in freespacing mode (LyX-Code), but not in
11890 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11892 * src/BackStack.h: fixed initialization order in constructor
11894 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11896 * acinclude.m4 (VERSION): new rules for when a version is
11897 development, added also a variable for prerelease.
11898 (warnings): we set with_warnings=yes for prereleases
11899 (lyx_opt): prereleases compile with same optimization as development
11900 (CXXFLAGS): only use pedantic if we are a development version
11902 * src/BufferView.C (restorePosition): don't do anything if the
11903 backstack is empty.
11905 * src/BackStack.h: added member empty, use this to test if there
11906 is anything to pop...
11908 1999-10-25 Juergen Vigna <jug@sad.it>
11911 * forms/layout_forms.fd +
11912 * forms/latexoptions.fd +
11913 * lyx.fd: changed for various form resize issues
11915 * src/mathed/math_panel.C +
11916 * src/insets/inseterror.C +
11917 * src/insets/insetinfo.C +
11918 * src/insets/inseturl.C +
11919 * src/insets/inseturl.h +
11921 * src/LyXSendto.C +
11922 * src/PaperLayout.C +
11923 * src/ParagraphExtra.C +
11924 * src/TableLayout.C +
11926 * src/layout_forms.C +
11933 * src/menus.C: fixed various resize issues. So now forms can be
11934 resized savely or not be resized at all.
11936 * forms/form_url.fd +
11937 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11940 * src/insets/Makefile.am: added files form_url.[Ch]
11942 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11944 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11945 (and presumably 6.2).
11947 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11948 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11949 remaining static member callbacks.
11951 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11954 * src/support/lyxstring.h: declare struct Srep as friend of
11955 lyxstring, since DEC cxx complains otherwise.
11957 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11959 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11961 * src/LaTeX.C (run): made run_bibtex also depend on files with
11963 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11964 are put into the dependency file.
11966 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11967 the code has shown itself to work
11968 (create_ispell_pipe): removed another warning, added a comment
11971 * src/minibuffer.C (ExecutingCB): removed code that has been
11972 commented out a long time
11974 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11975 out code + a warning.
11977 * src/support/lyxstring.h: comment out the three private
11978 operators, when compiling with string ansi conforming compilers
11979 they make problems.
11981 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11983 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11984 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11987 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11990 * src/mathed/math_panel.C (create_math_panel): remove explicit
11993 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11996 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11997 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11998 to XCreatePixmapFromBitmapData
11999 (fl_set_bmtable_data): change the last argument to be unsigned
12001 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12002 and bh to be unsigned int, remove explicit casts in call to
12003 XReadBitmapFileData.
12005 * images/arrows.xbm: made the arrays unsigned char *
12006 * images/varsz.xbm: ditto
12007 * images/misc.xbm: ditto
12008 * images/greek.xbm: ditto
12009 * images/dots.xbm: ditto
12010 * images/brel.xbm: ditto
12011 * images/bop.xbm: ditto
12013 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12015 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12016 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12017 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12019 (LYX_CXX_CHEADERS): added <clocale> to the test.
12021 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12023 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12025 * src/support/lyxstring.C (append): fixed something that must be a
12026 bug, rep->assign was used instead of rep->append.
12028 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12031 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12032 lyx insert double chars. Fix spotted by Kayvan.
12034 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12036 * Fixed the tth support. I messed up with the Emacs patch apply feature
12037 and omitted the changes in lyxrc.C.
12039 1999-10-22 Juergen Vigna <jug@sad.it>
12041 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12043 * src/lyx_cb.C (MenuInsertRef) +
12044 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12045 the form cannot be resized under it limits (fixes a segfault)
12047 * src/lyx.C (create_form_form_ref) +
12048 * forms/lyx.fd: Changed Gravity on name input field so that it is
12051 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12053 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12054 <ostream> and <istream>.
12056 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12057 whether <fstream> provides the latest standard features, or if we
12058 have an oldstyle library (like in egcs).
12059 (LYX_CXX_STL_STRING): fix the test.
12061 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12062 code on MODERN_STL_STREAM.
12064 * src/support/lyxstring.h: use L{I,O}stream.h.
12066 * src/support/L{I,O}stream.h: new files, designed to setup
12067 correctly streams for our use
12068 - includes the right header depending on STL capabilities
12069 - puts std::ostream and std::endl (for LOStream.h) or
12070 std::istream (LIStream.h) in toplevel namespace.
12072 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12074 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12075 was a bib file that had been changed we ensure that bibtex is run.
12076 (runBibTeX): enhanced to extract the names of the bib files and
12077 getting their absolute path and enter them into the dep file.
12078 (findtexfile): static func that is used to look for tex-files,
12079 checks for absolute patchs and tries also with kpsewhich.
12080 Alternative ways of finding the correct files are wanted. Will
12082 (do_popen): function that runs a command using popen and returns
12083 the whole output of that command in a string. Should be moved to
12086 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12087 file with extension ext has changed.
12089 * src/insets/figinset.C: added ifdef guards around the fl_free
12090 code that jug commented out. Now it is commented out when
12091 compiling with XForms == 0.89.
12093 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12094 to lyxstring.C, and only keep a forward declaration in
12095 lyxstring.h. Simplifies the header file a bit and should help a
12096 bit on compile time too. Also changes to Srep will not mandate a
12097 recompile of code just using string.
12098 (~lyxstring): definition moved here since it uses srep.
12099 (size): definition moved here since it uses srep.
12101 * src/support/lyxstring.h: removed a couple of "inline" that should
12104 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12106 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12109 1999-10-21 Juergen Vigna <jug@sad.it>
12111 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12112 set to left if I just remove the width entry (or it is empty).
12114 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12115 paragraph when having dummy paragraphs.
12117 1999-10-20 Juergen Vigna <jug@sad.it>
12119 * src/insets/figinset.C: just commented some fl_free_form calls
12120 and added warnings so that this calls should be activated later
12121 again. This avoids for now a segfault, but we have a memory leak!
12123 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12124 'const char * argument' to 'string argument', this should
12125 fix some Asserts() in lyxstring.C.
12127 * src/lyxfunc.h: Removed the function argAsString(const char *)
12128 as it is not used anymore.
12130 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12132 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12135 * src/Literate.h: some funcs moved from public to private to make
12136 interface clearer. Unneeded args removed.
12138 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12140 (scanBuildLogFile): ditto
12142 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12143 normal TeX Error. Still room for improvement.
12145 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12147 * src/buffer.C (insertErrors): changes to make the error
12148 desctription show properly.
12150 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12153 * src/support/lyxstring.C (helper): changed to use
12154 sizeof(object->rep->ref).
12155 (operator>>): changed to use a pointer instead.
12157 * src/support/lyxstring.h: changed const reference & to value_type
12158 const & lets see if that helps.
12160 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12162 * Makefile.am (rpmdist): fixed to have non static package and
12165 * src/support/lyxstring.C: removed the compilation guards
12167 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12170 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12171 conditional compile of lyxstring.Ch
12173 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12174 stupid check, but it is a lot better than the bastring hack.
12175 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12177 * several files: changed string::erase into string::clear. Not
12180 * src/chset.C (encodeString): use a char temporary instead
12182 * src/table.C (TexEndOfCell): added tostr around
12183 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12184 (TexEndOfCell): ditto
12185 (TexEndOfCell): ditto
12186 (TexEndOfCell): ditto
12187 (DocBookEndOfCell): ditto
12188 (DocBookEndOfCell): ditto
12189 (DocBookEndOfCell): ditto
12190 (DocBookEndOfCell): ditto
12192 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12194 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12196 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12197 (MenuBuildProg): added tostr around ret
12198 (MenuRunChktex): added tostr around ret
12199 (DocumentApplyCB): added tostr around ret
12201 * src/chset.C (encodeString): added tostr around t->ic
12203 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12204 (makeLaTeXFile): added tostr around tocdepth
12205 (makeLaTeXFile): added tostr around ftcound - 1
12207 * src/insets/insetbib.C (setCounter): added tostr around counter.
12209 * src/support/lyxstring.h: added an operator+=(int) to catch more
12212 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12213 (lyxstring): We DON'T allow NULL pointers.
12215 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12217 * src/mathed/math_macro.C (MathMacroArgument::Write,
12218 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12219 when writing them out.
12221 * src/LString.C: remove, since it is not used anymore.
12223 * src/support/lyxstring.C: condition the content to
12224 USE_INCLUDED_STRING macro.
12226 * src/mathed/math_symbols.C, src/support/lstrings.C,
12227 src/support/lyxstring.C: add `using' directive to specify what
12228 we need in <algorithm>. I do not think that we need to
12229 conditionalize this, but any thought is appreciated.
12231 * many files: change all callback functions to "C" linkage
12232 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12233 strict_ansi. Those who were static are now global.
12234 The case of callbacks which are static class members is
12235 trickier, since we have to make C wrappers around them (see
12236 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12237 did not finish this yet, since it defeats the purpose of
12238 encapsulation, and I am not sure what the best route is.
12240 1999-10-19 Juergen Vigna <jug@sad.it>
12242 * src/support/lyxstring.C (lyxstring): we permit to have a null
12243 pointer as assignment value and just don't assign it.
12245 * src/vspace.C (nextToken): corrected this function substituting
12246 find_first(_not)_of with find_last_of.
12248 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12249 (TableOptCloseCB) (TableSpeCloseCB):
12250 inserted fl_set_focus call for problem with fl_hide_form() in
12253 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12255 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12258 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12260 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12261 LyXLex::next() and not eatline() to get its argument.
12263 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12265 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12266 instead, use fstreams for io of the depfile, removed unneeded
12267 functions and variables.
12269 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12270 vector instead, removed all functions and variables that is not in
12273 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12275 * src/buffer.C (insertErrors): use new interface to TeXError
12277 * Makefile.am (rpmdist): added a rpmdist target
12279 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12280 per Kayvan's instructions.
12282 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12284 * src/Makefile.am: add a definition for localedir, so that locales
12285 are found after installation (Kayvan)
12287 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12289 * development/.cvsignore: new file.
12291 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12293 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12294 C++ compiler provides wrappers for C headers and use our alternate
12297 * configure.in: use LYX_CXX_CHEADERS.
12299 * src/cheader/: new directory, populated with cname headers from
12300 libstdc++-2.8.1. They are a bit old, but probably good enough for
12301 what we want (support compilers who lack them).
12303 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12304 from includes. It turns out is was stupid.
12306 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12308 * lib/Makefile.am (install-data-local): forgot a ';'
12309 (install-data-local): forgot a '\'
12310 (libinstalldirs): needed after all. reintroduced.
12312 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12314 * configure.in (AC_OUTPUT): added lyx.spec
12316 * development/lyx.spec: removed file
12318 * development/lyx.spec.in: new file
12320 * po/*.po: merged with lyx.pot becuase of make distcheck
12322 * lib/Makefile.am (dist-hook): added dist-hook so that
12323 documentation files will be included when doing a make
12324 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12325 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12327 more: tried to make install do the right thing, exclude CVS dirs
12330 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12331 Path would fit in more nicely.
12333 * all files that used to use pathstack: uses now Path instead.
12334 This change was a lot easier than expected.
12336 * src/support/path.h: new file
12338 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12340 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12342 * src/support/lyxstring.C (getline): Default arg was given for
12345 * Configure.cmd: removed file
12347 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12349 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12350 streams classes and types, add the proper 'using' statements when
12351 MODERN_STL is defined.
12353 * src/debug.h: move the << operator definition after the inclusion
12356 * src/support/filetools.C: include "LAssert.h", which is needed
12359 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12362 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12363 include "debug.h" to define a proper ostream.
12365 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12367 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12368 method to the SystemCall class which can kill a process, but it's
12369 not fully implemented yet.
12371 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12373 * src/support/FileInfo.h: Better documentation
12375 * src/lyxfunc.C: Added support for buffer-export html
12377 * src/menus.C: Added Export->As HTML...
12379 * lib/bind/*.bind: Added short-cut for buffer-export html
12381 * src/lyxrc.*: Added support for new \tth_command
12383 * lib/lyxrc.example: Added stuff for new \tth_command
12385 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12387 * lib/Makefile.am (IMAGES): removed images/README
12388 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12389 installes in correct place. Check permisions is installed
12392 * src/LaTeX.C: some no-op changes moved declaration of some
12395 * src/LaTeX.h (LATEX_H): changed include guard name
12397 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12399 * lib/reLyX/Makefile.am: install noweb2lyx.
12401 * lib/Makefile.am: install configure.
12403 * lib/reLyX/configure.in: declare a config aux dir; set package
12404 name to lyx (not sure what the best solution is); generate noweb2lyx.
12406 * lib/layouts/egs.layout: fix the bibliography layout.
12408 1999-10-08 Jürgen Vigna <jug@sad.it>
12410 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12411 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12412 it returned without continuing to search the path.
12414 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12416 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12417 also fixes a bug. It is not allowed to do tricks with std::strings
12418 like: string a("hei"); &a[e]; this will not give what you
12419 think... Any reason for the complexity in this func?
12421 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12423 * Updated README and INSTALL a bit, mostly to check that my
12424 CVS rights are correctly set up.
12426 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12428 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12429 does not allow '\0' chars but lyxstring and std::string does.
12431 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12433 * autogen.sh (AUTOCONF): let the autogen script create the
12434 POTFILES.in file too. POTFILES.in should perhaps now not be
12435 included in the cvs module.
12437 * some more files changed to use C++ includes instead of C ones.
12439 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12441 (Reread): added tostr to nlink. buggy output otherwise.
12442 (Reread): added a string() around szMode when assigning to Buffer,
12443 without this I got a log of garbled info strings.
12445 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12448 * I have added several ostream & operator<<(ostream &, some_type)
12449 functions. This has been done to avoid casting and warnings when
12450 outputting enums to lyxerr. This as thus eliminated a lot of
12451 explicit casts and has made the code clearer. Among the enums
12452 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12453 mathed enums, some font enum the Debug::type enum.
12455 * src/support/lyxstring.h (clear): missing method. equivalent of
12458 * all files that contained "stderr": rewrote constructs that used
12459 stderr to use lyxerr instead. (except bmtable)
12461 * src/support/DebugStream.h (level): and the passed t with
12462 Debug::ANY to avoid spurious bits set.
12464 * src/debug.h (Debug::type value): made it accept strings of the
12465 type INFO,INIT,KEY.
12467 * configure.in (Check for programs): Added a check for kpsewhich,
12468 the latex generation will use this later to better the dicovery of
12471 * src/BufferView.C (create_view): we don't need to cast this to
12472 (void*) that is done automatically.
12473 (WorkAreaButtonPress): removed some dead code.
12475 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12477 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12478 is not overwritten when translated (David Sua'rez de Lis).
12480 * lib/CREDITS: Added David Sua'rez de Lis
12482 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12484 * src/bufferparams.C (BufferParams): default input encoding is now
12487 * acinclude.m4 (cross_compiling): comment out macro
12488 LYX_GXX_STRENGTH_REDUCE.
12490 * acconfig.h: make sure that const is not defined (to empty) when
12491 we are compiling C++. Remove commented out code using SIZEOF_xx
12494 * configure.in : move the test for const and inline as late as
12495 possible so that these C tests do not interefere with C++ ones.
12496 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12497 has not been proven.
12499 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12501 * src/table.C (getDocBookAlign): remove bad default value for
12502 isColumn parameter.
12504 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12506 (ShowFileMenu2): ditto.
12508 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12509 of files to ignore.
12511 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12513 * Most files: finished the change from the old error code to use
12514 DebugStream for all lyxerr debugging. Only minor changes remain
12515 (e.g. the setting of debug levels using strings instead of number)
12517 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12519 * src/layout.C (Add): Changed to use compare_no_case instead of
12522 * src/FontInfo.C: changed loop variable type too string::size_type.
12524 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12526 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12527 set ETAGS_ARGS to --c++
12529 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12531 * src/table.C (DocBookEndOfCell): commented out two unused variables
12533 * src/paragraph.C: commented out four unused variables.
12535 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12536 insed a if clause with type string::size_type.
12538 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12541 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12543 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12544 variable, also changed loop to go from 0 to lenght + 1, instead of
12545 -1 to length. This should be correct.
12547 * src/LaTeX.C (scanError): use string::size_type as loop variable
12550 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12551 (l.896) since y_tmp and row was not used anyway.
12553 * src/insets/insetref.C (escape): use string::size_type as loop
12556 * src/insets/insetquotes.C (Width): use string::size_type as loop
12558 (Draw): use string::size_type as loop variable type.
12560 * src/insets/insetlatexaccent.C (checkContents): use
12561 string::size_type as loop variable type.
12563 * src/insets/insetlabel.C (escape): use string::size_type as loop
12566 * src/insets/insetinfo.C: added an extern for current_view.
12568 * src/insets/insetcommand.C (scanCommand): use string::size_type
12569 as loop variable type.
12571 * most files: removed the RCS tags. With them we had to recompile
12572 a lot of files after a simple cvs commit. Also we have never used
12573 them for anything meaningful.
12575 * most files: tags-query-replace NULL 0. As adviced several plases
12576 we now use "0" instead of "NULL" in our code.
12578 * src/support/filetools.C (SpaceLess): use string::size_type as
12579 loop variable type.
12581 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12583 * src/paragraph.C: fixed up some more string stuff.
12585 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12587 * src/support/filetools.h: make modestr a std::string.
12589 * src/filetools.C (GetEnv): made ch really const.
12591 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12592 made code that used these use max/min from <algorithm> instead.
12594 * changed several c library include files to their equivalent c++
12595 library include files. All is not changed yet.
12597 * created a support subdir in src, put lyxstring and lstrings
12598 there + the extra files atexit, fileblock, strerror. Created
12599 Makefile.am. edited configure.in and src/Makefile.am to use this
12600 new subdir. More files moved to support.
12602 * imported som of the functions from repository lyx, filetools
12604 * ran tags-query-replace on LString -> string, corrected the bogus
12605 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12606 is still some errors in there. This is errors where too much or
12607 too litle get deleted from strings (string::erase, string::substr,
12608 string::replace), there can also be some off by one errors, or
12609 just plain wrong use of functions from lstrings. Viewing of quotes
12612 * LyX is now running fairly well with string, but there are
12613 certainly some bugs yet (see above) also string is quite different
12614 from LString among others in that it does not allow null pointers
12615 passed in and will abort if it gets any.
12617 * Added the revtex4 files I forgot when setting up the repository.
12619 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12621 * All over: Tried to clean everything up so that only the files
12622 that we really need are included in the cvs repository.
12623 * Switched to use automake.
12624 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12625 * Install has not been checked.
12627 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12629 * po/pt.po: Three errors:
12630 l.533 and l.538 format specification error
12631 l. 402 duplicate entry, I just deleted it.