1 2000-12-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/frontends/xforms/FormPreferences.C (feedback): fix
4 description of RC_PRINTCOPIESFLAG and RC_PRINTCOLLCOPIESFLAG.
6 2000-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8 * src/support/FileInfo.h: move unistd.h to after sys/types.h and
11 * src/support/FileInfo.C: don't include sys/types. and sys/stat.h
13 * src/mathed/math_inset.h: move LString.h to be included first
15 * src/insets/insetfloat.C: adjust for change in private variable names
17 * src/frontends/xforms/xform_helpers.h : don't include config.h
19 * src/frontends/xforms/xform_helpers.C: adjust the order of
20 includes, some whitespace changes.
22 * src/trans.C (Load): constify filename and res
24 * src/text2.C (SetCounter): call Floating::name()
26 * src/screen.C: change to not use owner from WorkArea, but from
29 * src/lyxfunc.C: adjust because of changes in Intl.
31 * src/intl.h: make trans a object instead of pointer, inlucd
32 trans_mgr.h in this file.
33 (getTrans): return a reference to TransManager
35 * src/intl.C: don't include trans_mgr.h here
36 modify calls to trans to work on object instead of on pointer
38 * src/WorkArea.h: add using for Signal1
39 comment out forward decl of BufferView.
41 remove class variable owner_ and getter method for this.
43 * src/WorkArea.C: don't include BufferView.h
44 (WorkArea): change to not take a BufferView.h, use signals
46 (scroll_cb): emit signal
48 * src/LaTeXFeatures.C: include Floatlist.h
49 (getPackages): only load float.sty when needed
50 (getMacros): prepare for outputting the correct code to preamble.
52 * src/Floating.h: make all variables private + rename to var_.
53 (Floating): default ctor
54 (Floating): complex ctor to set a complete Floating
60 * src/FloatList.C (FloatList): use Floating's constructor
63 (newFloat): call type()
64 (defaultPlacement): call placement()
65 (operator): new operator
67 * src/BufferView_pimpl.C (Pimpl): modify call to WorkArea
68 (scrollUp): call pimpl's scrollCB
70 (pasteClipboard): constify clip
72 * src/BufferView2.C (insertLyXFile): constify fname, fi and c.
73 (insertErrors): constify desctext, errortext, msgtxt and errorrow
74 (open_new_inset): delete some commented code.
76 * src/BufferView.[Ch] (enterView): comment out
79 (workAreaMotionNotify): ditto
80 (workAreaButtonPress): ditto
83 (workAreaButtonRelease): ditto
84 (workAreaExpose): ditto
86 * config/lyxinclude.m4 (cross_compiling): small stuff to be able
87 to compile with cvs gcc (2.97).
89 2000-12-28 Dekel Tsur <dekelts@tau.ac.il>
91 * lib/ui/default.ui: menu structure cleanup.
93 * lib/languages: add description of entries.
95 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
97 * src/insets/ExternalTemplate.C (readTemplates): change debug
99 (readTemplate): use lyxlex.printError to report read errors.
102 * src/insets/insetexternal.C (Read): suppress debug message when
105 2000-12-21 Dekel Tsur <dekelts@tau.ac.il>
107 * src/insets/insetinclude.C (Ascii): New method. Currently
108 supports only verbatim input.
110 2000-12-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
112 * lib/bind/fi_menus.bind: update from Pauli Virtanen.
114 2000-12-22 Juergen Vigna <jug@sad.it>
116 * src/insets/insettabular.C (InsetButtonPress): do nothing if we
117 have a selection and button == 3.
118 (UpdateLocal): if what == INIT clear selection if existent!
119 (InsetButtonPress): don't activate the cell inset on button==3
121 (LocalDispatch): move curor up/down if exiting an inset which this
124 2000-12-20 Juergen Vigna <jug@sad.it>
126 * src/mathed/formula.C (LocalDispatch): return UNDISPATCHED when
127 calling for the math-panel (do not unlock the math-inset if locked)!
129 * src/text.C (GetVisibleRow): fixed drawing of depth lines inside
130 text-insets (with x-offset).
132 * src/tabular.C (TeXCellPreamble): fixed wrong output of special
133 alignment of multicolumn-cells.
135 2000-12-19 Juergen Vigna <jug@sad.it>
137 * src/lyxfunc.C (Dispatch):
138 * src/bufferview_funcs.C (changeDepth): implemented DEPTH functions
141 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
143 * src/WorkArea.C (work_area_handler): simplify the key/keysym
144 handling for XForms 0.89, this might have rendered some cases
145 unusable. I have at least deadkeys, accent-xxx and KP_x working.
146 Please report proplems.
148 * src/lyxfunc.C (processKeySym): make the self-insert handling
151 2000-12-18 Baruch Even <baruch.even@writeme.com>
153 * src/LaTeX.C (deplog): fix spelling errors
154 * src/text2.C (CutSelection): ditto
155 * src/lyxfunc.C (Dispatch): ditto
157 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
159 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
161 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
162 and h_align in default init.
163 adjust calls to MathedRowSt
165 * src/mathed/math_iter.C: adjust calls to MathedRowSt
166 * src/mathed/math_iter.h (getAD): ditto
168 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
169 methods setBaseline, ascent, descent
170 (class MathMatrixInset): remove method GetAlign, change h_align
173 * src/lyxfunc.C (processKeySym): discover the correct argument if
174 the action is LFUN_SELFINSERT
176 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
178 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
181 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
183 * src/support/copy.C: don't include filetools.h
185 * lib/images: revert to old banner, drop the cucumber.
187 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
189 * src/converter.C (Formats::View): Change the current directory to
190 the directory of the file.
192 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
194 * src/kbsequence.C (addkey): also clear sequence and modifiers if
197 * src/BufferView2.C (theLockingInset): return 0 if text is 0
199 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
201 * Many files: Fix RTL support for insettext.
203 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
205 * README: add mention of broken ghostscript versions, remove
206 reference to non-existent BUGS file
208 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
210 * src/support/lstrings.C (compare_no_case): small fix. When passed
211 length, should use it in the size comparison.
213 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
215 * src/insets/insetexternal.C (getScreenLabel): Return a default
216 value if the template label is empty.
218 * src/lyxlookup.C: do not condition on FL_REVISION.
221 * src/sp_form.C: fix the font size of some text entries
223 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
224 after TOC when there is no TOC.
226 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
227 bind file if it has not been done yet.
228 (read): remove local bindFile variable. Try to fix the handling of
229 RC_BIND and RC_BINDFILE.
231 * src/lyx_main.C (init): use readBindFileIfNeeded().
233 * lib/languages: Change description of german to "German (new
236 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
238 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
239 "Apply" buttons if arg is non-zero.
241 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
242 launching the popup if sufficient info is passed to
243 LFUN_CITATION_CREATE.
245 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
247 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
248 labels (disabled in 1.1.6).
250 * src/lyxrc.[Ch]: New variable label_init_length
252 * mathed/formula.C (LocalDispatch): Preserve the label when
253 changing from display math to eqnarray (however, the label
254 do not appear at the first line, as one might expects, but at the
256 (LocalDispatch): When inserting a label to a formula which already
257 have a label, the old label is used as default value.
258 Also, if the label is changed, then all references to the label
261 * src/mathed/math_iter.C (setLabel): Allow to set the label
262 even if it is empty. This is needed to allow deletion of a label
265 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
266 refernces only if the old label appears once in the document.
268 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
270 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
271 <gehlert@Rcs1.urz.tu-dresden.de>
273 * src/frontends/xforms/FormBase.C: comment out debug.h
275 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
276 code in xform_helpers instead.
277 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
279 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
280 Use N_(), rather than _() when creating strings to pass to browseFile()
281 because browseFile calls gettext() itself now.
283 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
284 display the filename correctly.
286 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
288 * src/converter.C (Move): New method. Used to move file or files
289 from temp dir to the output dir. (this fixes the bug that
290 exporting linuxdoc/docbook document to html would not move all
291 html file from temp directory).
293 * src/support/filetools.C (DirList): Fixed.
295 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
297 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
299 * src/converter.C (Add): Remove $$i when setting latex_command.
301 * src/text.C (IsBoundary): Return false when pos = 0.
303 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
305 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
307 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
309 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
310 need to empty the fields to turn off use of the geometry package!
312 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
314 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
315 (Buffer const &), not a (BufferParams const &) and so fix a crash
316 caused by using current_view before it had been initialised. Not
317 the best way to do this, but much easier than changing
318 Inset::Clone(Buffer const &) to Inset::Clone().
321 * src/tabular.C: changed call to CopyIntoMinibuffer().
323 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
325 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
327 * src/lyxfunc.C (getStatus): disable insertion of floats in a
330 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
332 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
333 changed filter for screen fonts input filter from int to float
335 * src/frontends/xforms/input_validators.c: removed.
336 * src/frontends/xforms/input_validators.C: new file. Can now call C++
337 functions from within the filter functions.
339 * src/frontends/xforms/input_validators.[Ch]
340 (fl_unsigned_float_filter): new filter function.
342 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
343 confused now! And if you think I'm going to do this in
344 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
346 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
348 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
350 * src/WorkArea.C (work_area_handler): don't handle button requests
351 if xbutton.button == 0
353 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
355 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
356 It creates a lot of interesting problems.
358 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
360 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
361 the menu exists in the current menubar before opening it.
363 * src/MenuBackend.C (hasSubmenu): new method.
365 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
366 action value by offsetting actions by a large constant (so that
367 bogs choice result will be less than this constant).
369 * lib/bind/fi_menus.bind: more cleanup to menus.
370 * lib/bind/sciword.bind: ditto.
371 * lib/bind/xemacs.bind: ditto.
372 * lib/bind/emacs.bind: ditto.
373 * lib/bind/pt_menus.bind: ditto.
374 * lib/bind/hu_menus.bind: ditto.
376 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
378 * INSTALL: update PROBLEMS section.
380 * src/lyxlookup.h: remove condition on xforms version, since we
381 should not include it if not appropriate.
383 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
385 * src/LColor.C: "latex text" -> "latex inset" (from
388 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
390 * src/frontends/kde/FormTabularCreate.C:
391 * src/frontends/kde/citationdlg.C:
392 * src/frontends/kde/copyrightdlg.C:
393 * src/frontends/kde/paradlg.C:
394 * src/frontends/kde/paraextradlg.C:
395 * src/frontends/kde/parageneraldlg.C:
396 * src/frontends/kde/printdlg.C:
397 * src/frontends/kde/refdlg.C:
398 * src/frontends/kde/tabcreatedlg.C:
399 * src/frontends/kde/tocdlg.C:
400 * src/frontends/kde/urldlg.C: add necessary headers
403 * src/frontends/kde/dlg/emptytable.C:
404 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
405 default parameters (from Angus Leeming)
407 * src/frontends/kde/dlg/moc/.cvsignore:
408 * src/frontends/kde/dlg/.cvsignore:
409 * src/frontends/kde/moc/.cvsignore: fix the library name
412 * src/frontends/kde/paradlg.C:
413 * src/frontends/kde/parageneraldlg.C:
414 * src/frontends/kde/dlg/para.dlg:
415 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
417 * src/frontends/kde/dlg/README: clarified qtarch version
419 * src/frontends/kde/dlg/Makefile.am: removed the
420 dlg rules as they created spontaneous rebuilds
421 (not a good idea as it requires qtarch)
423 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
425 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
426 fixlevel along with xforms version.
428 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
429 xforms version is strictly less than 0.89.5.
430 * src/lyx_gui.C (LyXGUI): ditto.
431 * src/LyXView.C (show): ditto.
433 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
435 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
436 movement in inset in RTL text.
437 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
438 (workAreaButtonRelease): Do not open a float when there is a selection.
440 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
442 * src/spellchecker.C (RunSpellChecker): Open all floats before
445 * src/text.C (InsertChar): Consider "," as a part of a number
446 (for LTR numbers in RTL text code).
447 (IsBoundary): Fixed (and simplified).
448 (InsertChar): Recalculate cursor boundary.
451 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
453 * src/spellchecker.C: fix figures with pspell enabled
455 * src/insets/figinset.C: workaround for gs hang xforms bug
457 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
459 * lib/bind/??_menus.bind: comment out the entries corresponding to
460 real menus. They should be eventually removed, but I'll let the
461 language maintainers do that.
463 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
465 * src/frontends/kde/parageneraldlg.C:
466 * src/frontends/kde/parageneraldlg.h: don't use
467 a derived class for SpaceAbove/Below
469 * src/frontends/kde/dlg/README: add some info
471 * src/frontends/kde/dlg/*: update data files, update
474 * src/frontends/kde/dlg/moc/Makefile.am: add
477 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
479 * configure.in: add new KDE Makefiles
480 * src/vspace.h: return GlueLength not a normal one
481 * src/support/lstrings.h:
482 * src/support/lstrings.C: add isStrUnsignedInt(),
485 * src/frontends/kde/*: big reorganisation, update
486 FormParagraph, add FormTabCreate
488 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
490 * lib/ui/default.ui: small grammatical change.
492 * src/frontends/xforms/xform_macros.h: removed.
494 * src/frontends/xforms/FormBase.C:
495 * src/frontends/xforms/FormPreferences.C:
496 * src/frontends/xforms/Makefile.am: changes associated with removing
497 xform_macros.h. Should make Lars' debugging a little easier.
499 * src/frontends/xforms/FormPreferences.C:
500 * src/frontends/xforms/FormPreferences.h:
501 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
502 longer use X11 color name database. HSV and RGB dials/sliders.
503 Please let this be the end of this!
505 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
507 * Several files: Allow compilation when the compiler doesn't
510 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
513 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
514 command line options.
516 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
518 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
519 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
522 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
524 * src/frontends/xforms/FormRef.C (updateBrowser):
525 * src/frontends/xforms/forms/form_ref.fd: try clicking on
526 different insets with the sort key active. Now apply this patch!
528 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
530 * src/frontends/xforms/FormPrint.C: set to valid()
531 when we update from the passed parameters.
533 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
535 * src/LColor.C (getFromGUIName): internationalise the comparison.
537 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
538 FormPreferences choice.
540 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
543 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
545 * src/lyxrc.C: more detail for the printer program config
548 * src/LColor.C: ert->latex text. LColor needs a big revamp
549 but will have to wait till after 1.1.6
551 * src/buffer.C: bring up a dialog if we load a document
552 with an un-installed text class, rather than just complain
555 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
557 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
558 the browser form for a combox in a tabbed folder. Bug fix courtesy of
559 Steve Lamont <spl@ncmir.ucsd.edu>.
561 * src/frontends/xforms/FormDocument.C (build):
562 * src/frontends/xforms/FormPreferences.C (Language::build):
563 pass tabfolders to Combox::add() in order to use this work around.
565 * src/frontends/xforms/FormCitation.C (connect): remove max size
567 (update): sort list of bibliography keys.
569 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
571 No max size limitation. Same popup for new and existing insets. Fixes
572 bugs reported by Rob Lahaye.
574 * src/frontends/xforms/FormCitation.C (c-tor):
575 * src/frontends/xforms/FormCopyright.C (c-tor):
576 * src/frontends/xforms/FormError.C (c-tor):
577 * src/frontends/xforms/FormGraphics.C (c-tor):
578 * src/frontends/xforms/FormIndex.C (c-tor):
579 * src/frontends/xforms/FormRef.C (c-tor):
580 * src/frontends/xforms/FormToc.C (c-tor):
581 * src/frontends/xforms/FormUrl.C (c-tor):
582 use correct policy for ButtonController.
584 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
586 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
589 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
591 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
592 Some resizing changes.
594 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
596 * configure.in: fix typo
598 * lib/languages: add ukraninian and change no to no_NO
600 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
602 * src/bufferview_funcs.C (FontSize): use setLyXSize
604 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
606 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
607 to check for systems where mkstemp() is available but not declared
608 in headers. The new autoconf macro lyx_CHECK_DECL can be used
609 to check for declarations in headers.
611 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
613 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
615 * forms/makefile: added bibforms.fd, include_form.fd.
616 Removed lyx_sendfax.fd.
618 * src/LaTeXLog.C (ShowLatexLog):
619 * src/LyXAction.C (init):
620 * src/bufferparams.C (readLanguage): altered messages as suggested by
623 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
626 * src/credits.C: made fd_form_credits non-static, so that it can be
627 redrawn should the xforms colors be re-mapped.
628 * src/spellchecker.C ditto fd_form_spell_options.
630 * src/filedlg.[Ch] (redraw):
631 * src/intl.[Ch] (redraw):
632 * src/lyxfr0.[Ch] (redraw):
633 * src/insets/figinset.[Ch] (redraw):
634 * src/insets/insetexternal.[Ch] (redraw):
635 new methods, connected to Dialogs::redrawGUI.
637 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
638 to be connected to Dialogs::redrawGUI.
640 * src/frontends/xforms/FormCitation.C (build):
641 * src/frontends/xforms/FormCopyright.C (build):
642 * src/frontends/xforms/FormError.C (build):
643 * src/frontends/xforms/FormGraphics.C (build):
644 * src/frontends/xforms/FormIndex.C (build):
645 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
646 * src/frontends/xforms/FormToc.C (build):
647 * src/frontends/xforms/FormUrl.C (build):
648 use the ButtonController correctly.
650 * src/frontends/xforms/FormCopyright.C (build):
651 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
652 the .fd file and into build().
654 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
656 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
658 * src/frontends/xforms/forms/form_citation.fd:
659 * src/frontends/xforms/forms/form_copyright.fd:
660 * src/frontends/xforms/forms/form_error.fd:
661 * src/frontends/xforms/forms/form_graphics.fd:
662 * src/frontends/xforms/forms/form_index.fd:
663 * src/frontends/xforms/forms/form_toc.fd:
664 * src/frontends/xforms/forms/form_url.fd:
665 renamed some of the objects. Named others explicitly for the first time.
666 Added Restore and Apply buttons where appropriate.
668 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
671 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
673 * src/version.h: try the pre2 again
675 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
677 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
679 * src/frontends/kde/FormParagraph.C: added using directive.
681 * src/frontends/kde/paradlg.C: added config.h and using directive.
683 * src/frontends/kde/paradlg.h: added std::qualifier.
685 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
687 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
689 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
691 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
693 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
695 * src/version.h: set back to 1.1.6cvs
697 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
699 * src/version.h: set to 1.1.6pre2
701 2000-11-20 Marko Vendelin <markov@ioc.ee>
703 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
705 * src/frontends/gnome/Makefile.am: updated list of XForms object files
707 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
709 * src/LColor.C (init):
710 * src/lyxrc.C (getDescription): changed some comments as suggested by
713 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
714 disconnect the redrawGUI signal in best-practice fashion.
716 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
717 long_opts_tab to reflect the change in name of this tabfolder, as
718 suggested by John Levon.
719 (connect, disconnect): new methods. Don't do much at present other than
720 ensuring that we can't resize the dialog. This just makes xforms go
722 (lots of methods in Colors): made void rather than bool. The idea is
723 to have an isOk() function that keeps track of whether any input is
724 genuinely invalid and should therefore block Save, Apply.
725 Easier to manipulate the counters rapidly.
726 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
727 compiler will like this code. Much cleaner way of doing things.
729 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
731 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
732 rather than simple counters, following suggestion by John Levon.
734 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
735 than engraved frame + text.
737 * src/frontends/xforms/forms/makefile: removed spurious command.
739 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
741 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
743 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
746 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
748 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
749 see what Lars has changed and what is just white space!
750 Now used X directly to ascertain the RGB color associated with the
752 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
754 Added some sort capability.
755 The X11 color name database input is only displayed if the database
756 isn't found in the standard place.
757 Got rid of struct compare_converter; it wasn't used.
758 Probably some other stuff that I've forgotten.
760 * src/frontends/xforms/FormPreferences.h: changed the names of some
761 methods in the Colors struct. Added a couple of structs to help sort
762 colors by name and by RGBColor.
764 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
765 functions into a new class RWInfo.
767 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
768 The dialog is now almost navigable using the keyboard. Unfortunately,
769 the cursor has to be inside a browser for it to be activated. There is
770 no visual feedback for the key shortcuts to the arrow keys (use
771 Alt-appropriate arrow key, Alt-x).
773 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
776 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
777 xform_helpers.[Ch]. See above.
779 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
781 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
783 * src/screen.C (setCursorColor): new method. Sets the color of the
785 (ShowManualCursor): call it.
786 Constify some local variables.
788 * src/LColor.[Ch] (LColor): add entry for cursor
789 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
792 2000-11-19 Juergen Vigna <jug@sad.it>
794 * src/insets/insettabular.C (draw): fixed text border redraw problem.
795 (calculate_dimensions_of_cells): try to boost up when inserting chars.
797 2000-11-15 Rob Lahaye <lahaye@postech.edu>
799 * lib/ui/default.ui: OptItem used for Fax entry
801 2000-11-17 Matej Cepl <cepl@bigfoot.com>
803 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
805 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
807 * src/vspace.C (nextToken): fix so it can handle length phrases like
808 "10mm+-20mm", "40inplus16mmminus10cm" etc.
810 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
812 * src/frontends/xforms/FormPreferences.C: constify several variables
813 (BrowserLyX): rewrite to not need the choice variable
814 (Modify): rewrite to not need the choide variable
815 (compare_converter): make operator const
817 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
818 correct the writing of \set_color
819 (getDescription): return a const string
821 * src/kbsequence.[Ch] (addkey): remove dead code
823 * src/Painter.C (text): remove some commented code
825 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
827 * src/ColorHandler.[Ch]: removed some header files from .h file.
828 Included LColor.h in .C file.
830 * src/LColor.[Ch]: made class copyable so that I could create a
831 system_lcolor instance.
833 * src/Painter.h: removed LColor.h.
835 * src/lyx_gui.C (create_forms): used AddName.
837 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
838 of user preferences/lyxrc file.
840 * src/lyxrc.C (output): output changes to lcolor.
842 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
844 Moved class xformColor to files xform_helpers.[Ch]. These files,
845 Color.[Ch], could now be moved into src if they would be useful to
848 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
849 Also moved FormPreferences::browseFile here as it can be used by any
850 xform dialog with a "Browse" button. FormGraphics is a perfect example.
852 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
853 ReadableFile): changed the FormPreferences methods a little and moved
854 them here as they'll be useful elsewhere also.
856 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
857 Removed some header files and used forward declarations instead.
859 Removed some methods as they'll be useful elsewhere (see above).
861 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
862 Can also now modify the LyX LColors. However, for reasons that I don't
863 yet understand, it appears that we can use
864 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
865 present. The problem appears to lie in ColorHandler, because I can
866 change the color using LColor.SetColor(). Similarly, when reading in a
867 preferences file with some set_color instances, I'll get a warning
868 like: Color sea green is undefined or may not be redefined
869 Bad lyxrc set_color for sea green
871 Once the buffer is loaded, however, I can happily change to this color.
873 Finally, it appears that I have to set the color of "inset frame"
874 explicitly, or it oscillates from "black" to "indian red" with each
877 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
879 * ANNOUNCE: corrected a spelling mistake.
881 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
884 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
886 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
888 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
891 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
892 match the requirements from the standard better. This is required
893 to work with gnu libstdc++-v3
895 * src/frontends/xforms/FormPreferences.C: add explict pair
896 arguments to browse calls. include support/lyxmanip.h remvoe
897 extern fmt. whitespace changes. reorder variables in
898 FormPreferences.h, to match initalizaton order.
900 * several files: constify more local variables.
902 * src/buffer.C: remove some commented functions.
904 * src/DepTable.C (remove_files_with_extension): temporary
905 work around for gcc 2.97
906 * src/filedlg.C (find): ditto
907 * src/Variables.C (set): ditto
908 * src/LyXAction.C (searchActionArg): ditto
909 (retrieveActionArg): ditto
911 * configure.in: check for mktemp too
913 * UPGRADING: prepare for 1.1.6
915 * Makefile.am (lgbtags): add backup tags for when etags are
916 different than usual.
918 * ANNOUNCE: prepare for 1.1.6
920 * src/support/tempname.C (make_tempfile): new function, wrapper
921 around mkstemp and mktemp. Only mkstemp has been tested.
924 2000-11-14 Rob Lahaye <lahaye@postech.edu>
926 * default.ui: capitalized some menu items to improve shortcuts.
928 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
930 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
932 * src/frontends/xforms/Dialogs.C: add "using" directive.
934 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
936 * src/filedlg.C (Select): highlight suggested file in browser, if
939 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
940 each tab folder is encapsulated in its own class.
941 The Language keymaps are now chosen using a text input and a
942 browser button, rather than a Combox.
943 All the browser buttons are now functional, although LyXFileDlg
944 still needs to be modified to make it straighhtforward to return a
945 directory if that is what is desired.
947 * src/frontends/xforms/forms/form_preferences.fd: use text input
948 and browse button to input the Language keymaps. Add a few
949 callbacks for the browse buttons.
951 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
953 * src/support/tempname.C (tempName): small changes to make it
954 safer. remove the '.' before XXXXXX
956 * src/support/filetools.C (TmpFileName): remove func
959 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
960 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
961 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
962 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
964 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
967 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
970 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
971 for bp (this fixes a reproducible hard crash)
973 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
976 * src/frontends/xforms/FormBase.h: make bp_ private
977 (FormBaseBI): remove default for bp
980 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
983 * src/frontends/xforms/Color.C (RGBColor): made several vars
984 const, changed initialization of j to allow it to be const
987 * several files: added const to local variables.
989 * src/lyx_cb.C: removed several function prototypes and moved them
993 (UpdateLayoutPreamble):
995 (MenuInsertLabel): add BufferView as arguemnt
996 (LayoutsCB): make tmp const
998 * src/layout_forms.h: regenerated
1000 * src/debug.C: add Debug::FILES
1001 (showLevel) (showTags): translate the desc
1003 * src/debug.h: add FILES as debug target
1005 * src/bufferlist.C: use current_view as an interim measure becuase
1006 of added arguments to MenuWrite and MenuWriteAs
1008 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
1010 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
1012 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
1013 libstdc++ is compiled with.
1015 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
1017 * lib/layouts/docbook-book.layout
1018 * lib/layouts/docbook.layout
1019 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
1020 those paragraphs are expresse as SGML comments <!-- -->.
1022 * src/LaTeXFeatures.h
1023 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
1024 parameter, this allows to express all the include files as relative
1025 paths to the master buffer. The verbatim insert works as the other
1028 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
1030 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
1032 (MakeDocBookFile): top_element is always written. Some clean up, as
1033 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
1035 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
1036 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
1037 a reference is written instead of the name.
1038 (Validate): use the relative path for the filename.
1040 * src/insets/insetlabel.C (DocBook): write end tag, for XML
1043 * src/support/filetools.h
1044 * src/support/filetools.C (IsSGMLFilename): added.
1047 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
1049 * development/OS2/quick_fix.patch:
1050 * lib/configure.cmd:
1051 * README.OS2: quick update to the OS/2 port.
1053 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1055 * src/converter.C: add "using" directive.
1057 * src/frontends/xforms/FormPreferences.C: add "using" directive.
1058 (compare_converter): add "int" as return type.
1060 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
1063 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
1065 * src/lyx_gui.C (create_forms): map the xform colours, should a
1066 mapping exist. Ie, call XformColor::read().
1068 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
1069 and struct HSV as HSVColor.
1070 (XformColor::read, XformColor::write) : new methods that
1071 input/output any changes to the cform GUI colors.
1073 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
1076 * src/frontends/xforms/FormPreferences.C Lots of little changes
1077 associated with the changed name of the RGB and HSV structs. Can
1078 now save changes to xforms GUI to file. Commented out
1079 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
1080 used currently anyway.
1082 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
1084 * src/converter.C: A lot of changes:
1085 - It is no longer possible to choose between two or more ways to
1086 export to some format (the new code uses only the shortest path).
1087 However, it is still possible to choose between pdflatex/ps2pdf
1088 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
1089 - Added several methods that makes the FormPreferences code simpler.
1090 - Changed the tokens $$FName and $$OutName to $$i and $$o.
1092 * src/exporter.C (Export): lyxrc.use_pdf is set before
1093 makeLaTeXFile is called. This works but not very nice.
1095 * src/frontends/xforms/FormPreferences.C: The formats/converters
1096 tabs are now fully functional.
1098 * src/buffer.C (getTocList): Add numbers to the captions.
1100 * lib/lyxrc.example: Removed fax section
1102 * src/support/rename.C (rename): Delete the old file if lyx::copy
1105 2000-11-13 Rob Lahaye <lahaye@postech.edu>
1107 * lib/ui/default.ui: minor polishing.
1109 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1111 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
1114 * lib/Makefile.am (DOCINST): do not install everything in the
1115 documentation directory.
1117 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
1119 * src/bufferlist.C (newFile): set the filename to the constructed
1122 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
1123 constructed "newfileXX.lyx" name to the dialog
1125 * src/frontends/DialogBase.h: make update() non-abstract so
1126 KDE doesn't need to implement two update methods for every form
1128 * src/frontends/kde/Makefile.am: add missing xforms objects
1131 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
1133 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
1135 * src/frontends/xforms/Color.[Ch]: new files, defining the color
1136 structs RGB and HSV. May not be the best place for these files.
1137 Perhaps move them into src ?
1139 * src/frontends/xforms/Makefile.am: added new files.
1141 * src/frontends/xforms/forms/form_preferences.fd:
1142 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1143 replaced all instances of "colour" with "color"!
1145 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1148 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1149 tab. Can now alter the colors of the xform's GUI on the fly. With
1150 the aid of a single static Signal (see below), can "Apply" these
1151 changes to all currently open dialogs. (Well, to all of the NEW
1152 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1153 subsequently opened dialogs will, of course, also have the new
1154 color scheme. Cannot yet save (or load) the choices to file, so
1155 they are lost when exiting LyX.
1157 * src/frontends/Dialogs.h:
1158 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1159 Used to trigger a redraw of any dialogs connected to it because,
1160 for example, the GUI colours have been re-mapped.
1162 * src/frontends/xforms/FormBase.[Ch]:
1163 * src/frontends/xforms/FormDocument.[Ch]:
1164 * src/frontends/xforms/FormParagraph.[Ch]:
1165 * src/frontends/xforms/FormPreferences.[Ch]:
1166 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1167 method, to be connected to Dialogs::redrawGUI. Method must be
1168 virtual, because dialogs with tabbed folders need to redraw the
1169 forms of each tab folder.
1171 * src/LyXView.C (d-tor):
1172 * src/frontends/xforms/FormBase.C (d-tor): connected
1173 Dialogs::redrawGUI signal to redraw().
1175 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1176 removed Assert, because it is identical to that in FormBase.
1178 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1180 * lib/ui/default.ui: minor polishing.
1182 2000-11-10 Juergen Vigna <jug@sad.it>
1184 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1185 (deleteLyXText): ditto
1187 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1188 selection on mouse-button-3.
1190 * src/insets/insettabular.h: new function clearSelection(), use this
1191 functions inside insettabular.C.
1193 * src/insets/insettabular.C (TabularFeatures): clear the selection
1194 on remove_row/column.
1196 * src/insets/inset.C (scroll): fixed some scroll stuff.
1198 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1200 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1202 * lib/CREDITS: add Yves Bastide
1204 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1206 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1207 check whether C library functions are in the global namespace.
1209 * configure.in: calls it.
1211 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1212 #ifndef __GLIBCPP__.
1214 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1216 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1217 iterators to prevent crash.
1219 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1221 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1223 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1224 shortcut for xforms CB to the preemptive or post-handler function.
1226 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1227 removed the HIDDEN_TIMER as it's no longer used.
1228 Various other small changes.
1230 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1231 preemptive handler to obtain feedback, rather than the post-handler.
1232 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1234 Formats tab is now complete. Converters tab is nearly so.
1236 2000-11-09 Juergen Vigna <jug@sad.it>
1238 * src/insets/insettext.C (~InsetText):
1241 (SetParagraphData): set cache.second to 0 after deleting it!
1242 (getLyXText): check if cache.second is not 0 if finding it.
1244 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1246 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1247 lyxlex to parse the rgb.txt file.
1250 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1251 replace the default '#' comment character.
1253 * src/support/tempname.C: add "using" directive
1254 * src/frontends/ButtonPolicies.C: ditto.
1256 * src/support/filetools.C (DirList): add an explicit cast to avoid
1257 a compile error (probably not the right fix)
1259 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1261 * src/support/filetools.C (DirList): implement using system functions
1263 * src/support/tempname.C: new file
1265 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1267 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1269 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1272 * src/frontends/xforms/ButtonController.C: new file
1274 * src/os2_defines.h: remove getcwd define
1276 * src/lyxvc.C: include support/lyxlib.h
1277 (showLog): use lyx::tempName
1279 * src/lyx_cb.C: comment out includes that we don't need
1280 (AutoSave): use lyx::tempName
1282 * src/filedlg.C: include support/lyxlib.h
1283 (Reread): use lyx::getcwd
1285 * src/converter.C: include support/filetools.h
1286 (add_options): change to static inline, make tail const
1287 (Add): make old_viewer const
1288 (GetAllFormats): make it a const method, use const_iterator
1289 (enable): make static inline
1290 (SplitFormat): make using_format const
1292 * src/LaTeX.C (run): use lyx::getcwd
1294 * configure.in: check for mkstemp as well
1296 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1298 * src/converter.[Ch] (GetAllCommands): new method.
1300 * src/support/filetools.[Ch] (DirList): new method.
1302 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1303 functionality to the converters tab.
1304 The formats tab is now nearly complete.
1305 The kbmap choices in Languages tab now display the contents of
1306 system_lyxdir/kbd/*.kmap in readable form.
1308 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1309 Moved some variables into the class.
1311 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1312 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1313 colour of active folder to lighter grey instead. Any takers?
1314 (form_colours): added an "Apply" button.
1315 (form_converters): added a "Flags" input field.
1316 (form_formats): added a "Shortcut" input field. Note that we can't use
1317 names such as "input_shortcut" as this buggers up the sed script stuff.
1319 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1327 * src/lyx_sendfax_main.C:
1330 * src/spellchecker.C:
1331 * src/insets/figinset.C:
1332 * src/insets/insetbib.C:
1333 * src/insets/insetexternal.C:
1334 * src/insets/insetinclude.C:
1335 * src/insets/insetinfo.C:
1336 * src/mathed/math_panel.C:
1337 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1338 all "daughter" dialogs now have identical "feel".
1340 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1342 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1343 used (and was only used in one place prior to this patch. Incorrectly!)
1345 * src/frontends/xforms/FormDocument.C: changed some instances of
1346 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1347 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1348 for options_->input_float_placement. This fixes a bug reported by
1351 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1352 functionality into d-tor.
1354 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1355 input of numerals also.
1357 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1358 fl_set_form_atclose(). Can now close dialog from window manager,
1359 fixing a bug reported by Rob Lahaye.
1361 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1363 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1364 are no longer dark. Haven't yet worked out how to lighten the colour of
1365 the active tabfolder. Any ideas anybody?
1366 Adjusted Colours tab a little.
1367 Added Shortcut field to converters tab. Note that we can't create an
1368 fdesign label like "input_shortcut" as this buggers up the sed-script
1371 * src/frontends/xforms/FormPreferences.[Ch]:
1372 (feedback): fixed crash due to to ob=0.
1373 (LanguagesXXX): the kbmap choices now contain the files
1374 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1375 be replaced by an input with a file browse button, but since the browse
1376 buttons don'y yet work, this'll do for the moment.
1377 (FormatsXXX): think that this is now nearly fully functional.
1378 Some points/questions though:
1379 1. Does "Apply" remove formats if no longer present?
1380 2. I think that the browser should list the GUI names rather than the
1382 3. Must ensure that we can't delete Formats used by an existing
1385 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1386 if this is the best way to do this.
1388 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1390 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1392 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1393 for variable assignment.
1395 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1397 * src/lib/ui/default.ui: added sub/superscripts to menu as
1398 Insert->Special characters and cleaned-up the file a bit
1400 2000-11-07 Allan Rae <rae@lyx.org>
1402 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1403 ob isn't 0 before using it. See comments in function.
1405 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1407 * src/frontends/xforms/form_*.C: regenerated
1409 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1411 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1413 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1414 compiling with gcc-2.96
1416 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1418 * src/support/lyxstring.C: add a couple "using" directives.
1420 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1421 a .c_str() here too for good measure.
1422 * src/Spacing.C (set): ditto.
1423 * src/lyxfunc.C (Dispatch): ditto.
1425 * src/insets/insettabular.C (copySelection): change .str() to
1426 .str().c_str() to fix problems with lyxstring.
1427 * src/support/filetools.C (GetFileContents): ditto.
1428 * src/buffer.C (asciiParagraph): ditto.
1429 * src/paragraph.C (String): ditto.
1431 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1432 * lib/bind/sciword.bind: ditto.
1434 * src/LyXAction.C (init): remove "symbol-insert" function, which
1435 shared LFUN_INSERT_MATH with "math-insert".
1437 * lib/configure.m4: == is not a valid operator for command test.
1439 * src/lyxrc.C: add using directive.
1441 * src/converter.h: add std:: qualifier.
1443 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1445 * src/converter.[Ch] and other files: Change the Format class to a
1446 real class, and create two instances: formats and system_format.
1448 * src/lyxrc.C (output): Output the difference between formats and
1451 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1452 (buildFormats): Insert formats into browser.
1453 (inputFormats): Made the browser and add button functional.
1454 (applyFormats): Update formats from format_vec.
1456 * src/converter.C: Changed all (*it). to it->
1457 (Format::dummy): New method.
1458 (Format::importer): New format flag.
1459 (Formats::GetAllFormats): New method.
1460 (Formats::Add): Delete format from the map if prettyname is empty.
1461 (Converter::Convert): Print an error message if moving the file fails.
1462 (Converter::GetReachableTo): New method
1464 * src/MenuBackend.[Ch]: Add support for importformats tag.
1466 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1468 * lib/configure.m4: Add word->tex and ps->fax converters.
1470 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1471 Return fax to file menu.
1475 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1477 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1480 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1483 * src/lyxfunc.C (processKeyEvent): removed
1485 * src/bufferlist.C (emergencyWrite): removed the out commented
1486 emergency write code.
1488 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1490 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1492 * many files: change formatting to be a bit more uniform for
1493 if,while,for,switch statements, remove some parantesis not needed.
1496 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1498 * config/kde.m4: make config more robust when KDEDIR is set
1500 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1502 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1503 not returned a pixmap for "math-insert".
1505 * src/LyXAction.C (init): sort the entries a bit.
1507 2000-11-03 Juergen Vigna <jug@sad.it>
1509 * src/insets/insettabular.h: added fixed number to update codes so
1510 that update is only in one direction.
1512 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1515 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1516 before call to edit because of redraw.
1518 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1520 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1522 * lib/ui/default.ui: Populate "edit_float" menu
1524 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1526 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1527 "floats-operate". The name is ugly (and the func also), but this
1528 is just a band-aid until we switch to new insets.
1530 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1532 * lib/ui/default.ui: update again the menu layout (fix some
1535 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1537 * src/MenuBackend.h (fulllabel): new method.
1539 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1540 the menu shortcuts of a menu are unique and whether they
1541 correspond to a letter of the label.
1542 (expand): call checkShortcuts when debugging.
1544 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1546 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1548 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1550 * lib/examples/*.lyx : '\language default' => '\language english'
1552 * lib/examples/it_splash.lyx : except where it should be italian
1554 * lib/templates/*.lyx : the same
1556 * doc/*.lyx* : the same
1558 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1560 * lib/bind/menus.bind: remove the Layout menu entries, which I
1561 somehow forgot earlier.
1563 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1565 * lib/ui/old-default.ui: keep the old one here for reference (to
1568 * lib/ui/default.ui: update the menu layout
1570 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1572 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1573 Can now Apply to different insets without closing the dialog.
1575 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1576 Can't actually DO anything with them yet, but I'd like a little
1579 * src/frontends/xforms/input_validators.[ch]
1580 (fl_lowercase_filter): new.
1582 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1584 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1585 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1587 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1589 2000-11-02 Juergen Vigna <jug@sad.it>
1591 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1592 on char insertion as it has already be updated by bv->updateInset().
1594 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1595 if an inset inside was updated.
1597 * lib/configure.cmd: commented out fax-search code
1599 2000-11-01 Yves Bastide <stid@acm.org>
1601 * src/tabular.C (OldFormatRead): set tabular language to the
1604 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1606 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1607 class names with non-letter characters (from Yves Bastide).
1609 * lib/ui/default.ui: change Item to OptItem in import menu.
1610 Comment out fax stuff.
1612 * lib/configure.m4: comment out fax-related stuff.
1614 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1616 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1617 useful xforms helper functions. At present contains only formatted().
1618 Input a string and it returns it with line breaks so that in fits
1621 * src/frontends/xforms/Makefile.am: add new files.
1623 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1624 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1627 * src/frontends/xforms/FormPreferences.[Ch]:
1628 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1629 but lots of little clean ups. Removed enum State. Make use of
1630 formatted(). Constify lots of methods. Perhaps best of all: removed
1631 requirement for that horrible reinterpret_cast from pointer to long in
1634 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1636 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1637 conditionalize build on xforms < 0.89
1639 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1641 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1643 * src/LyXAction.C (init): comment out fax
1645 * src/lyxrc.h: comment out the fax enums
1646 comment out the fax variables
1648 * src/commandtags.h: comment out LFUN_FAX
1650 * src/lyxrc.C: disable fax variables.
1651 (read): disable parsing of fax variables
1652 (output): disable writing of fax variables
1653 (getFeedback): now description for fax variables
1655 * src/lyxfunc.C: comment out MenuFax
1656 (Dispatch): disable LFUN_FAX
1658 * src/lyx_cb.C (MenuFax): comment out
1660 * src/WorkArea.C: add <cctype>
1661 (work_area_handler): better key handling, should be ok now.
1662 for accented chars + etc
1664 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1665 lyx_sendfax.h and lyx_sendfax_man.C
1667 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1668 (show): don't call InitLyXLookup when using xforms 0.89
1670 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1672 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1674 * src/support/filetools.C (GetFileContents): close to dummy change
1676 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1678 * src/trans.C (AddDeadkey): workaround stupid compilers.
1680 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1682 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1683 of two-sided document.
1685 2000-10-31 Juergen Vigna <jug@sad.it>
1687 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1689 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1690 xposition to the Edit call.
1692 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1694 * src/trans.C (AddDeadkey): cast explicitly to char.
1696 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1698 * src/tabular.C (AsciiBottomHLine): simplify?
1699 (AsciiTopHLine): simplify?
1700 (print_n_chars): simplify
1701 (DocBook): remove most of the << endl; we should flush the stream
1702 as seldom as possible.
1704 (TeXBottomHLine): ditto
1705 (TeXTopHLine): ditto
1707 (write_attribute): try a templified version.
1708 (set_row_column_number_info): lesson scope of variables
1710 * src/support/lstrings.h (tostr): new specialization of tostr
1712 * src/trans.C (AddDeadkey): slightly cleaner fix.
1714 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1716 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1717 '%%' in Toc menu labels.
1720 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1721 font_norm is iso10646-1.
1723 * src/font.C (ascent): Fixed for 16bit fonts
1724 (descent,lbearing,rbearing): ditto
1726 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1728 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1729 (getFeedback): new static method.
1731 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1732 Now use combox rather than choice to display languages.
1733 Feedback is now output using a new timer callback mechanism, identical
1734 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1736 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1738 * src/minibuffer.C: fix for older compilers
1740 2000-10-30 Juergen Vigna <jug@sad.it>
1742 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1743 has to be Left of the inset otherwise LyXText won't find it!
1745 * src/BufferView2.C (open_new_inset): delete the inset if it can
1748 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1750 * lyx.man: fix typo.
1752 2000-10-29 Marko Vendelin <markov@ioc.ee>
1753 * src/frontends/gnome/FormCitation.C
1754 * src/frontends/gnome/FormCitation.h
1755 * src/frontends/gnome/FormCopyright.C
1756 * src/frontends/gnome/FormCopyright.h
1757 * src/frontends/gnome/FormError.C
1758 * src/frontends/gnome/FormError.h
1759 * src/frontends/gnome/FormIndex.C
1760 * src/frontends/gnome/FormIndex.h
1761 * src/frontends/gnome/FormPrint.C
1762 * src/frontends/gnome/FormPrint.h
1763 * src/frontends/gnome/FormRef.C
1764 * src/frontends/gnome/FormRef.h
1765 * src/frontends/gnome/FormToc.C
1766 * src/frontends/gnome/FormToc.h
1767 * src/frontends/gnome/FormUrl.C
1768 * src/frontends/gnome/FormUrl.h
1769 * src/frontends/gnome/Menubar_pimpl.C
1770 * src/frontends/gnome/mainapp.C
1771 * src/frontends/gnome/mainapp.h
1772 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1773 changing update() to updateSlot() where appropriate
1775 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1777 * src/frontends/xforms/FormPreferences.[Ch]:
1778 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1781 2000-10-28 Juergen Vigna <jug@sad.it>
1783 * src/insets/insettabular.C (draw): fixed drawing bug.
1785 * src/insets/insettext.C (clear):
1787 (SetParagraphData): clearing the TEXT buffers when deleting the
1788 paragraphs used by it.
1790 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1792 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1794 2000-10-27 Juergen Vigna <jug@sad.it>
1796 * src/tabular.C (~LyXTabular): removed not needed anymore.
1798 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1801 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1803 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1806 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1809 * src/frontends/xforms/FormPreferences.[Ch]:
1810 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1811 Reorganised as modules based on tabs. Much easier to follow the
1812 flow and to add new tabs. Added warning and feedback messages.
1815 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1817 * src/tabular.h (DocBook): add std:: qualifier.
1819 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1821 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1822 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1825 * insettabular.C (DocBook): uses the tabular methods to export
1828 * src/insets/insettext.h
1829 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1831 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1833 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1836 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1837 moved misplaced AllowInput two lines up.
1839 * src/buffer.C (readFile): compare float with float, not with int
1841 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1843 * src/minibuffer.C: add "using SigC::slot" statement.
1845 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1847 * src/frontends/xforms/forms/README: updated section about make.
1849 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1850 Tidied some forms up, made two of form_tabular's tabs more
1851 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1852 fixed translation problem with "Column".
1854 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1856 * src/minibuffer.h: use Timeout instead of the xforms timer
1858 (setTimer) rewrite for the Timeout, change to unsigned arg
1859 (set): change to unsigned timer arg
1862 * src/minibuffer.C (TimerCB): removed func
1863 (C_MiniBuffer_TimerCB): removed func
1864 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1865 (peek_event): use a switch statement
1866 (add): don't use fl_add_timer.
1867 (Set): rewrite to use the Timeout
1870 * src/Timeout.[Ch] (setType): return a Timeout &
1871 (setTimeout): ditto, change to unsigned arg for timeout
1873 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1875 * src/mathed/formula.C (mathed_string_width): Use string instead
1876 of a constant size char array.
1878 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1880 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1881 the two recently added operator<< for SMInput and State.
1883 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1885 (OkCancelPolicy): ditto
1886 (OkCancelReadOnlyPolicy): ditto
1887 (NoRepeatedApplyReadOnlyPolicy): ditto
1888 (OkApplyCancelReadOnlyPolicy): ditto
1889 (OkApplyCancelPolicy): ditto
1890 (NoRepeatedApplyPolicy): ditto
1892 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1894 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1895 add the usual std:: qualifiers.
1897 2000-10-25 Juergen Vigna <jug@sad.it>
1899 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1901 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1903 * src/support/filetools.C (MakeRelPath): change some types to
1906 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1907 ButtonPolicy::SMInput and ButtonPolicy::State.
1909 * src/FontLoader.C (reset): small cleanup
1910 (unload): small cleanup
1912 * src/FontInfo.C (getFontname): initialize error to 10000.0
1914 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1916 * src/frontends/xforms/FormPreferences.[Ch]:
1917 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1918 TeX encoding and default paper size sections.
1920 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1922 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1925 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1926 make the message_ empty.
1927 (FormError): don't initialize message_ in initializer list.
1929 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1931 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1933 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1935 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1937 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1939 * src/frontends/kde/*data.[Ch]: _("") is not
1942 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1944 * src/buffer.C: removed redundant using directive.
1946 * src/frontends/DialogBase.h: revert to original definition of
1949 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1950 stuff into two classes, one for each dialog, requires a new
1951 element in the dialogs vector, FormTabularCreate.
1953 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1956 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1957 method. Continues Allan's idea, but means that derived classes
1958 don't need to worry about "update or hide?".
1960 * src/frontends/xforms/FormError.C (showInset): add connection
1963 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1964 one for each dialog. FormTabular now contains main tabular dialog
1967 * src/frontends/xforms/FormTabularCreate.[Ch]:
1968 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1971 * src/frontends/xforms/FormGraphics.[Ch]:
1972 * src/frontends/xforms/forms/form_graphics.fd
1973 * src/frontends/xforms/FormTabular.[Ch]:
1974 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1975 classes of FormInset.
1977 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1978 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1980 * src/frontends/xforms/Makefile.am:
1981 * src/frontends/xforms/forms/makefile: added new files.
1983 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1984 variable. added Signal0 hide signal, in keeping with other GUI-I
1987 * src/support/lstrings.h: removed redundant std:: qualifier as
1988 it's already declared in Lsstream.h.
1990 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1992 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1996 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1998 * src/tabular.C (Ascii): minimize scope of cell.
2000 * src/BufferView2.C (nextWord): return string() instead of 0;
2002 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2004 * src/converter.h: add a std:: qualifier
2006 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
2008 * src/importer.[Ch]: New files. Used for importing files into LyX.
2010 * src/lyxfunc.C (doImport): Use the new Importer class.
2012 * src/converter.h: Add shortcut member to the Format class.
2013 Used for holding the menu shortcut.
2015 * src/converter.C and other files: Made a distinction between
2016 format name and format extension. New formats can be defined using
2017 the \format lyxrc tag.
2018 Added two new converter flags: latex and disable.
2020 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2022 * src/support/lyxlib.h: unify namespace/struct implementation.
2023 Remove extra declarations.
2025 * src/support/chdir.C (chdir): remove version taking char const *
2027 * src/support/rename.C: ditto.
2028 * src/support/lyxsum.C: ditto.
2030 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
2032 * src/frontends/xforms/FormBase.[Ch]:
2033 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
2034 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
2035 work only for the next call to fl_show_form(). The correct place to set
2036 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
2037 done. FormBase also stores minw_, minh_ itself. All dialogs derived
2038 from FormBase have the minimum size set; no more stupid crashes with
2041 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2043 * lib/ui/default.ui: fix shortcut for Insert->Include File.
2045 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2047 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
2049 * src/support/lyxlib.h: changed second argument of mkdir to
2050 unsigned long int (unsigned int would probably have been enough,
2051 but...). Removed <sys/types.h> header.
2052 * src/support/mkdir.C (mkdir): ditto.
2056 2000-10-19 Juergen Vigna <jug@sad.it>
2058 * src/lyxfunc.C (MenuNew): small fix (form John)
2060 * src/screen.C (Update): removed unneeded code.
2062 * src/tabular.C (Ascii): refixed int != uint bug!
2064 * src/support/lyxlib.h: added sys/types.h include for now permits
2065 compiling, but I don't like this!
2067 2000-10-18 Juergen Vigna <jug@sad.it>
2069 * src/text2.C (ClearSelection): if we clear the selection we need
2070 more refresh so set the status apropriately
2072 * src/insets/insettext.C (draw): hopefully finally fixed draw
2075 2000-10-12 Juergen Vigna <jug@sad.it>
2077 * src/insets/insettext.C (draw): another small fix and make a block
2078 so that variables are localized.
2080 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
2082 * src/support/lstrings.C (lowercase, uppercase):
2083 use explicit casts to remove compiler warnings.
2085 * src/support/LRegex.C (Impl):
2086 * src/support/StrPool.C (add):
2087 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
2088 (AddPath, MakeDisplayPath):
2089 * src/support/lstrings.C (prefixIs, subst):
2090 use correct type to remove compiler warnings.
2092 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
2094 * src/support/lyxlib.h:
2095 * src/support/mkdir.C (mkdir): change parameter to mode_t for
2096 portability and to remove compiler warning with DEC cxx.
2098 * src/support/FileInfo.[Ch] (flagRWX): ditto.
2100 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2102 * src/minibuffer.C (peek_event): retun 1 when there has been a
2103 mouseclick in the minibuffer.
2107 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
2109 * src/frontends/xforms/FormParagraph.C: more space above/below
2112 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
2114 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2115 a char only if real_current_font was changed.
2117 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2119 * NEWS: update somewhat for 1.1.6
2121 * lib/ui/default.ui: clean up.
2123 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
2125 * lib/CREDITS: clean up
2127 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2129 * src/combox.[Ch] (select): changed argument back to int
2130 * src/combox.C (peek_event): removed num_bytes as it is declared but
2133 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
2134 modified calls to Combox::select() to remove warnings about type
2137 * src/insets/insetbutton.C (width): explicit cast to remove warning
2138 about type conversion.
2140 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2143 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2144 sel_pos_end, refering to cursor position are changed to
2145 LyXParagraph::size_type.
2147 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2148 consistent with LyXCursor::pos().
2149 (inset_pos): changed to LyXParagraph::size_type for same reason.
2151 * src/insets/insettext.C (resizeLyXText): changed some temporary
2152 variables refing to cursor position to LyXParagraph::size_type.
2154 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2156 * src/frontends/kde/<various>: The Great Renaming,
2159 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2161 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2163 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2165 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2166 0 when there are no arguments.
2168 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2170 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2171 to segfaults when pressing Ok in InsetBibtex dialog.
2173 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2175 * forms/layout_forms.fd:
2176 * src/layout_forms.C (create_form_form_character): small change to use
2177 labelframe rather than engraved frame + text
2179 * src/lyx_gui.C (create_forms): initialise choice_language with some
2180 arbitrary value to prevent segfault when dialog is shown.
2182 2000-10-16 Baruch Even <baruch.even@writeme.com>
2184 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2185 is no resulting file. This pertains only to LaTeX output.
2187 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2189 * src/text.C (Backspace): Make sure that the row of the cursor is
2192 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2195 * src/lyx_gui.C (init): Prevent a crash when only one font from
2196 menu/popup fonts is not found.
2198 * lib/lyxrc.example: Add an example for binding a key for language
2201 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2203 * src/converter.C (GetReachable): Changed the returned type to
2205 (IsReachable): New method
2207 * src/MenuBackend.C (expand): Handle formats that appear more
2210 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2212 * src/frontends/support/Makefile.am
2213 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2216 * lib/CREDITS: add Garst Reese.
2218 * src/support/snprintf.h: add extern "C" {} around the definitions.
2220 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2222 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2225 * src/frontends/xforms/FormDocument.C:
2226 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2227 compile without "conversion to integral type of smaller size"
2230 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2232 * src/text.C (GetColumnNearX): Fixed disabled code.
2234 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2236 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2239 * src/support/snprintf.[ch]: new files
2241 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2243 * src/frontends/kde/formprintdialog.C: add
2244 file browser for selecting postscript output
2246 * src/frontends/kde/formprintdialogdata.C:
2247 * src/frontends/kde/formprintdialogdata.h: re-generate
2250 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2252 * src/frontends/gnome/Makefile.am:
2253 * src/frontends/kde/Makefile.am: FormCommand.C
2254 disappeared from xforms
2256 * src/frontends/kde/FormCitation.C:
2257 * src/frontends/kde/FormIndex.C: read-only
2260 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2262 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2265 * src/bufferlist.C: add using directive.
2267 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2269 * src/support/lyxfunctional.h: version of class_fun for void
2270 returns added, const versions of back_inseter_fun and compare_fun
2273 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2275 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2277 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2279 * ChangeLog: cleanup.
2281 * lib/CREDITS: update to add all the contributors we've forgotten.
2282 I have obviously missed some, so tell me whether there were
2285 2000-10-13 Marko Vendelin <markov@ioc.ee>
2287 * src/frontends/gnome/FormCitation.C
2288 * src/frontends/gnome/FormCitation.h
2289 * src/frontends/gnome/FormError.C
2290 * src/frontends/gnome/FormIndex.C
2291 * src/frontends/gnome/FormRef.C
2292 * src/frontends/gnome/FormRef.h
2293 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2295 * src/frontends/gnome/FormCitation.C
2296 * src/frontends/gnome/FormCopyright.C
2297 * src/frontends/gnome/FormError.C
2298 * src/frontends/gnome/FormIndex.C
2299 * src/frontends/gnome/FormRef.C
2300 * src/frontends/gnome/FormToc.C
2301 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2304 * src/frontends/gnome/Menubar_pimpl.C
2305 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2308 2000-10-11 Baruch Even <baruch.even@writeme.com>
2311 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2312 to convey its real action.
2314 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2315 clear the minibuffer and prepare to enter a command.
2317 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2318 the rename from ExecCommand to PrepareForCommand.
2319 * src/lyxfunc.C (Dispatch): ditto.
2321 2000-10-11 Baruch Even <baruch.even@writeme.com>
2323 * src/buffer.C (writeFile): Added test for errors on writing, this
2324 catches all errors and not only file system full errors as intended.
2326 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2328 * src/lyx_gui.C (create_forms): better fix for crash with
2329 translated interface.
2331 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2333 * src/frontends/kde/Makefile.am:
2334 * src/frontends/kde/FormCopyright.C:
2335 * src/frontends/kde/formcopyrightdialog.C:
2336 * src/frontends/kde/formcopyrightdialog.h:
2337 * src/frontends/kde/formcopyrightdialogdata.C:
2338 * src/frontends/kde/formcopyrightdialogdata.h:
2339 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2340 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2341 copyright to use qtarch
2343 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2345 * src/encoding.C (read): Fixed bug that caused an error message at
2346 the end of the file.
2348 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2350 * lib/lyxrc.example: Fixed hebrew example.
2352 2000-10-13 Allan Rae <rae@lyx.org>
2354 * src/frontends/xforms/FormPreferences.C (input): reworking the
2356 (build, update, apply): New inputs in various tabfolders
2358 * src/frontends/xforms/FormToc.C: use new button policy.
2359 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2360 dialogs that either can't use any existing policy or where it just
2363 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2366 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2367 added a bool parameter which is ignored.
2369 * src/buffer.C (setReadonly):
2370 * src/BufferView_pimpl.C (buffer):
2371 * src/frontends/kde/FormCopyright.h (update):
2372 * src/frontends/kde/FormCitation.[Ch] (update):
2373 * src/frontends/kde/FormIndex.[Ch] (update):
2374 * src/frontends/kde/FormPrint.[Ch] (update):
2375 * src/frontends/kde/FormRef.[Ch] (update):
2376 * src/frontends/kde/FormToc.[Ch] (update):
2377 * src/frontends/kde/FormUrl.[Ch] (update):
2378 * src/frontends/gnome/FormCopyright.h (update):
2379 * src/frontends/gnome/FormCitation.[Ch] (update):
2380 * src/frontends/gnome/FormError.[Ch] (update):
2381 * src/frontends/gnome/FormIndex.[Ch] (update):
2382 * src/frontends/gnome/FormPrint.[Ch] (update):
2383 * src/frontends/gnome/FormRef.h (update):
2384 * src/frontends/gnome/FormToc.[Ch] (update):
2385 * src/frontends/gnome/FormUrl.[Ch] (update):
2386 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2387 to updateBufferDependent and DialogBase
2389 * src/frontends/xforms/FormCitation.[hC]:
2390 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2391 * src/frontends/xforms/FormError.[Ch]:
2392 * src/frontends/xforms/FormGraphics.[Ch]:
2393 * src/frontends/xforms/FormIndex.[Ch]:
2394 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2395 and fixed readOnly handling.
2396 * src/frontends/xforms/FormPrint.[Ch]:
2397 * src/frontends/xforms/FormRef.[Ch]:
2398 * src/frontends/xforms/FormTabular.[Ch]:
2399 * src/frontends/xforms/FormToc.[Ch]:
2400 * src/frontends/xforms/FormUrl.[Ch]:
2401 * src/frontends/xforms/FormInset.[Ch]:
2402 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2403 form of updateBufferDependent.
2405 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2406 if form()->visible just in case someone does stuff to the form in a
2409 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2410 the buttoncontroller for everything the enum used to be used for.
2411 (update) It would seem we need to force all dialogs to use a bool
2412 parameter or have two update functions. I chose to go with one.
2413 I did try removing update() from here and FormBase and defining the
2414 appropriate update signatures in FormBaseB[DI] but then ran into the
2415 problem of the update() call in FormBase::show(). Whatever I did
2416 to get around that would require another function and that just
2417 got more confusing. Hence the decision to make everyone have an
2418 update(bool). An alternative might have been to override show() in
2419 FormBaseB[DI] and that would allow the different and appropriate
2422 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2423 true == buffer change occurred. I decided against using a default
2424 template parameter since not all compilers support that at present.
2426 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2428 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2429 army knife" by removing functionality.
2430 (clearStore): removed. All such housekeeping on hide()ing the dialog
2431 is to be carried out by overloaded disconnect() methods.
2432 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2433 superceded by Baruch's neat test (FormGraphics) to update an existing
2434 dialog if a new signal is recieved rather than block all new signals
2436 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2437 only to Inset dialogs.
2438 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2439 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2441 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2443 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2444 as a base class to all inset dialogs. Used solely to connect/disconnect
2445 the Inset::hide signal and to define what action to take on receipt of
2446 a UpdateBufferDependent signal.
2447 (FormCommand): now derived from FormInset.
2449 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2452 * src/frontends/xforms/FormCopyright.[Ch]:
2453 * src/frontends/xforms/FormPreferences.[Ch]:
2454 now derived from FormBaseBI.
2456 * src/frontends/xforms/FormDocument.[Ch]:
2457 * src/frontends/xforms/FormParagraph.[Ch]:
2458 * src/frontends/xforms/FormPrint.[Ch]:
2459 now derived from FormBaseBD.
2461 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2463 * src/frontends/xforms/FormCitation.[Ch]:
2464 * src/frontends/xforms/FormError.[Ch]:
2465 * src/frontends/xforms/FormRef.[Ch]:
2466 * src/frontends/xforms/FormToc.[Ch]:
2467 (clearStore): reworked as disconnect().
2469 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2472 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2474 * src/converter.C (runLaTeX): constify buffer argument
2477 * src/frontends/support/Makefile.am (INCLUDES): fix.
2479 * src/buffer.h: add std:: qualifier
2480 * src/insets/figinset.C (addpidwait): ditto
2481 * src/MenuBackend.C: ditto
2482 * src/buffer.C: ditto
2483 * src/bufferlist.C: ditto
2484 * src/layout.C: ditto
2485 * src/lyxfunc.C: ditto
2487 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2489 * src/lyxtext.h (bidi_level): change return type to
2490 LyXParagraph::size_type.
2492 * src/lyxparagraph.h: change size_type to
2493 TextContainer::difference_type. This should really be
2494 TextContainer::size_type, but we need currently to support signed
2497 2000-10-11 Marko Vendelin <markov@ioc.ee>
2498 * src/frontends/gnome/FormError.h
2499 * src/frontends/gnome/FormRef.C
2500 * src/frontends/gnome/FormRef.h
2501 * src/frontends/gnome/FormError.C
2502 * src/frontends/gnome/Makefile.am
2503 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2504 to Gnome frontend. Both dialogs use "action" area.
2506 2000-10-12 Baruch Even <baruch.even@writeme.com>
2508 * src/graphics/GraphicsCacheItem_pimpl.C:
2509 * src/graphics/Renderer.C:
2510 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2513 2000-10-12 Juergen Vigna <jug@sad.it>
2515 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2516 visible when selecting).
2518 * development/Code_rules/Rules: fixed some typos.
2520 2000-10-09 Baruch Even <baruch.even@writeme.com>
2522 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2523 compiling on egcs 1.1.2 possible.
2525 * src/filedlg.C (comp_direntry::operator() ): ditto.
2527 2000-08-31 Baruch Even <baruch.even@writeme.com>
2529 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2532 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2533 transient it now only gets freed when the object is destructed.
2535 2000-08-24 Baruch Even <baruch.even@writeme.com>
2537 * src/frontends/FormGraphics.h:
2538 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2541 2000-08-20 Baruch Even <baruch.even@writeme.com>
2543 * src/insets/insetgraphics.C:
2544 (draw): Added messages to the drawn rectangle to report status.
2545 (updateInset): Disabled the use of the inline graphics,
2548 2000-08-17 Baruch Even <baruch.even@writeme.com>
2550 * src/frontends/support: Directory added for the support of GUII LyX.
2552 * src/frontends/support/LyXImage.h:
2553 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2556 * src/frontends/support/LyXImage_X.h:
2557 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2558 version of LyXImage, this uses the Xlib Pixmap.
2560 * src/PainterBase.h:
2561 * src/PainterBase.C:
2563 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2564 replacement to Pixmap.
2566 * src/insets/insetgraphics.h:
2567 * src/insets/insetgraphics.C:
2568 * src/graphics/GraphicsCacheItem.h:
2569 * src/graphics/GraphicsCacheItem.C:
2570 * src/graphics/GraphicsCacheItem_pimpl.h:
2571 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2574 * src/graphics/GraphicsCacheItem.h:
2575 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2576 another copy of the object.
2578 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2579 of cacheHandle, this fixed a bug that sent LyX crashing.
2581 * src/graphics/XPM_Renderer.h:
2582 * src/graphics/XPM_Renderer.C:
2583 * src/graphics/EPS_Renderer.h:
2584 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2586 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2588 * src/lyxfunc.C (processKeySym): only handle the
2589 lockinginset/inset stuff if we have a buffer and text loaded...
2591 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2593 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2595 * src/support/lyxfunctional.h: add operator= that takes a reference
2597 * src/lyxserver.C (mkfifo): make first arg const
2599 * src/layout.h: renamed name(...) to setName(...) to work around
2602 * src/buffer.C (setFileName): had to change name of function to
2603 work around bugs in egcs. (renamed from fileName)
2605 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2607 * src/support/translator.h: move helper template classes to
2608 lyxfunctional.h, include "support/lyxfunctional.h"
2610 * src/support/lyxmanip.h: add delaration of fmt
2612 * src/support/lyxfunctional.h: new file
2613 (class_fun_t): new template class
2614 (class_fun): helper template function
2615 (back_insert_fun_iterator): new template class
2616 (back_inserter_fun): helper template function
2617 (compare_memfun_t): new template class
2618 (compare_memfun): helper template function
2619 (equal_1st_in_pair): moved here from translator
2620 (equal_2nd_in_pair): moved here from translator
2622 * src/support/fmt.C: new file
2623 (fmt): new func, can be used for a printf substitute when still
2624 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2626 * src/support/StrPool.C: add some comments
2628 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2631 * src/insets/figinset.C (addpidwait): use std::copy with
2632 ostream_iterator to fill the pidwaitlist
2634 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2636 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2639 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2642 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2644 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2645 (class_update): ditto
2646 (BulletPanel): ditto
2647 (CheckChoiceClass): move initialization of tc and tct
2649 * src/tabular.C: remove current_view
2650 (OldFormatRead): similar to right below [istream::ignore]
2652 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2653 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2654 unused [istream::ignore]
2656 * src/lyxfunc.C: include "support/lyxfunctional.h"
2657 (getInsetByCode): use std::find_if and compare_memfun
2659 * src/lyxfont.C (stateText): remove c_str()
2661 * src/lyx_main.C (setDebuggingLevel): make static
2662 (commandLineHelp): make static
2664 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2665 Screen* together with fl_get_display() and fl_screen
2667 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2668 togheter with fl_get_display() and fl_screen
2669 (create_forms): remove c_str()
2671 * src/layout.C: include "support/lyxfunctional.h"
2672 (hasLayout): use std::find_if and compare_memfun
2673 (GetLayout): use std::find_if and comapre_memfun
2674 (delete_layout): use std::remove_if and compare_memfun
2675 (NumberOfClass): use std:.find_if and compare_memfun
2677 * src/gettext.h: change for the new functions
2679 * src/gettext.C: new file, make _(char const * str) and _(string
2680 const & str) real functions.
2682 * src/font.C (width): rewrite slightly to avoid one extra variable
2684 * src/debug.C: initialize Debug::ANY here
2686 * src/commandtags.h: update number comments
2688 * src/combox.h (get): make const func
2690 (getline): make const
2692 * src/combox.C (input_cb): handle case where fl_get_input can
2695 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2696 "support/lyxfunctional.h", remove current_view variable.
2697 (resize): use std::for_each with std::mem_fun
2698 (getFileNames): use std::copy with back_inserter_fun
2699 (getBuffer): change arg type to unsigned int
2700 (emergencyWriteAll): call emergencyWrite with std::for_each and
2702 (emergencyWrite): new method, the for loop in emergencyWriteAll
2704 (exists): use std::find_if with compare_memfun
2705 (getBuffer): use std::find_if and compare_memfun
2707 * src/buffer.h: add typedefs for iterator_category, value_type
2708 difference_type, pointer and reference for inset_iterator
2709 add postfix ++ for inset_iterator
2710 make inset_iterator::getPos() const
2712 * src/buffer.C: added support/lyxmanip.h
2713 (readFile): use lyxerr << fmt instead of printf
2714 (makeLaTeXFile): use std::copy to write out encodings
2716 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2718 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2719 free and the char * temp.
2720 (hasMenu): use std::find_if and compare_memfun
2723 * src/Makefile.am (lyx_SOURCES): added gettext.C
2725 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2726 string::insert small change to avoid temporary
2728 * src/LColor.C (getGUIName): remove c_str()
2730 * several files: change all occurrences of fl_display to
2733 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2734 that -pedantic is not used for gcc 2.97 (cvs gcc)
2736 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2738 2000-10-11 Allan Rae <rae@lyx.org>
2740 * src/frontends/xforms/FormPreferences.C (input): template path must be
2741 a readable directory. It doesn't need to be writeable.
2742 (build, delete, update, apply): New inputs in the various tabfolders
2744 * src/frontends/xforms/forms/form_preferences.fd:
2745 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2746 several new entries to existing folders. Shuffled some existing stuff
2749 * src/frontends/xforms/forms/form_print.fd:
2750 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2751 Should probably rework PrinterParams as well. Note that the switch to
2752 collated is effectively the same as !unsorted so changing PrinterParams
2753 will require a lot of fiddly changes to reverse the existing logic.
2755 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2757 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2759 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2761 2000-10-10 Allan Rae <rae@lyx.org>
2764 * src/lyxfunc.C (Dispatch):
2766 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2769 * src/lyxrc.C (output): Only write the differences between system lyxrc
2770 and the users settings.
2773 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2775 I'll rewrite this later, after 1.1.6 probably, to keep a single
2776 LyXRC but two instances of a LyXRCStruct.
2778 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2780 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2782 * src/tabular.h: add a few std:: qualifiers.
2784 * src/encoding.C: add using directive.
2785 * src/language.C: ditto.
2787 * src/insets/insetquotes.C (Validate): use languages->lang()
2788 instead of only language.
2790 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2792 * lib/languages: New file.
2794 * lib/encodings: New file.
2796 * src/language.C (Languages): New class.
2797 (read): New method. Reads the languages from the 'languages' file.
2799 * src/encoding.C (Encodings): New class.
2800 (read): New method. Reads the encodings from the 'encodings' file.
2802 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2805 * src/bufferparams.h and a lot of files: Deleted the member language,
2806 and renamed language_info to language
2808 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2809 * src/lyxfont.C (latexWriteStartChanges): ditto.
2810 * src/paragraph.C (validate,TeXOnePar): ditto.
2812 * src/lyxfont.C (update): Restored deleted code.
2814 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2816 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2818 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2820 * src/insets/figinset.[Ch]:
2821 * src/insets/insetinclude.[Ch]:
2822 * src/insets/insetinclude.[Ch]:
2823 * src/insets/insetparent.[Ch]:
2824 * src/insets/insetref.[Ch]:
2825 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2827 * src/insets/*.[Ch]:
2828 * src/mathed/formula.[Ch]:
2829 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2831 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2832 * src/lyx_cb.C (FigureApplyCB):
2833 * src/lyxfunc.C (getStatus, Dispatch):
2834 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2837 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2839 * src/converter.[Ch] (Formats::View):
2840 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2842 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2843 *current_view->buffer(). This will change later, but this patch is way
2846 2000-10-09 Juergen Vigna <jug@sad.it>
2848 * src/text.C (GetRow): small fix.
2850 * src/BufferView_pimpl.C (cursorPrevious):
2851 (cursorNext): added LyXText parameter to function.
2853 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2854 keypress depending on cursor position.
2856 2000-10-06 Juergen Vigna <jug@sad.it>
2858 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2859 (copySelection): redone this function and also copy ascii representa-
2862 * src/tabular.C (Ascii):
2866 (print_n_chars): new functions to realize the ascii export of tabulars.
2868 2000-10-05 Juergen Vigna <jug@sad.it>
2870 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2871 if we don't have a buffer.
2873 2000-10-10 Allan Rae <rae@lyx.org>
2875 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2876 with closing dialog. It seems that nested tabfolders require hiding
2877 of inner tabfolders before hiding the dialog itself. Actually all I
2878 did was hide the active outer folder.
2880 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2881 unless there really is a buffer. hideBufferDependent is called
2884 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2885 POTFILES.in stays in $(srcdir).
2887 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2889 * lib/lyxrc.example: Few changes.
2891 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2893 * src/BufferView_pimpl.C (buffer): only need one the
2894 updateBufferDependent signal to be emitted once! Moved to the end of
2895 the method to allow bv_->text to be updated first.
2897 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2898 and hSignal_ with Dialogs * and BufferDependency variables.
2899 New Buffer * parent_, initialised when the dialog is launched. Used to
2900 check whether to update() or hide() dialog in the new, private
2901 updateOrHide() method that is connected to the updateBufferDependent
2902 signal. Daughter classes dictate what to do using the
2903 ChangedBufferAction enum, passed to the c-tor.
2905 * src/frontends/xforms/FormCitation.C:
2906 * src/frontends/xforms/FormCommand.C:
2907 * src/frontends/xforms/FormCopyright.C:
2908 * src/frontends/xforms/FormDocument.C:
2909 * src/frontends/xforms/FormError.C:
2910 * src/frontends/xforms/FormIndex.C:
2911 * src/frontends/xforms/FormPreferences.C:
2912 * src/frontends/xforms/FormPrint.C:
2913 * src/frontends/xforms/FormRef.C:
2914 * src/frontends/xforms/FormToc.C:
2915 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2918 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2919 ChangedBufferAction enum.
2921 * src/frontends/xforms/FormParagraph.[Ch]
2922 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2925 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2927 * lib/bind/cua.bind: fix a bit.
2928 * lib/bind/emacs.bind: ditto.
2930 * lib/bind/menus.bind: remove real menu entries from there.
2932 * src/spellchecker.C: make sure we only include strings.h when
2935 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2937 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2938 function. It enlarges the maximum number of pup when needed.
2939 (add_toc2): Open a new menu if maximum number of items per menu has
2942 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2944 * src/frontends/kde/FormPrint.C: fix error reporting
2946 * src/frontends/xforms/FormDocument.C: fix compiler
2949 * lib/.cvsignore: add Literate.nw
2951 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2954 * bufferview_funcs.[Ch]
2957 * text2.C: Add support for numbers in RTL text.
2959 2000-10-06 Allan Rae <rae@lyx.org>
2961 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2962 to be gettext.m4 friendly again. ext_l10n.h is now
2963 generated into $top_srcdir instead of $top_builddir
2964 so that lyx.pot will be built correctly -- without
2965 duplicate parsing of ext_l10n.h.
2967 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2969 * src/frontends/kde/FormCitation.C: make the dialog
2970 behave more sensibly
2972 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2974 * config/kde.m4: fix consecutive ./configure runs,
2975 look for qtarch, fix library order
2977 * src/frontends/kde/Makefile.am: tidy up,
2978 add Print dialog, add .dlg dependencies
2980 * src/frontends/kde/FormPrint.C:
2981 * src/frontends/kde/FormPrint.h:
2982 * src/frontends/kde/formprintdialog.C:
2983 * src/frontends/kde/formprintdialog.h:
2984 * src/frontends/kde/formprintdialogdata.C:
2985 * src/frontends/kde/formprintdialogdata.h:
2986 * src/frontends/kde/dlg/formprintdialog.dlg: add
2989 * src/frontends/kde/dlg/README: Added explanatory readme
2991 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2992 script to double-check qtarch's output
2994 * src/frontends/kde/formindexdialog.C:
2995 * src/frontends/kde/formindexdialogdata.C:
2996 * src/frontends/kde/formindexdialogdata.h:
2997 * src/frontends/kde/dlg/formindexdialog.dlg: update
2998 for qtarch, minor fixes
3000 2000-10-05 Allan Rae <rae@lyx.org>
3002 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
3003 dialogs when switching buffers update them instead. It's up to each
3004 dialog to decide if it should still be visible or not.
3005 update() should return a bool to control visiblity within show().
3006 Or perhaps better to set a member variable and use that to control
3009 * lib/build-listerrors: create an empty "listerrors" file just to stop
3010 make trying to regenerate it all the time if you don't have noweb
3013 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
3015 * po/Makefile.in.in (ext_l10n.h): added a rule to build
3016 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
3017 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
3018 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
3019 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
3021 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
3023 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
3025 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
3026 deleting buffer. Closes all buffer-dependent dialogs.
3028 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
3030 * src/frontends/xforms/FormCitation.[Ch]:
3031 * src/frontends/xforms/FormPreferences.[Ch]:
3032 * src/frontends/xforms/FormPrint.[Ch]:
3033 * src/frontends/xforms/FormRef.[Ch]:
3034 * src/frontends/xforms/FormUrl.[Ch]: ditto
3036 * src/frontends/xforms/FormDocument.[Ch]:
3037 * src/frontends/xforms/forms/form_document.C.patch:
3038 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
3039 pass through a single input() function.
3041 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
3043 * lib/build-listerrors: return status as OK
3045 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
3047 * lib/lyxrc.example: Updated to new export code
3049 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3051 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
3054 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
3057 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
3058 LyX-Code is defined.
3059 * lib/layouts/amsbook.layout: ditto.
3061 * boost/Makefile.am: fix typo.
3063 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
3065 (add_lastfiles): removed.
3066 (add_documents): removed.
3067 (add_formats): removed.
3069 * src/frontends/Menubar.C: remove useless "using" directive.
3071 * src/MenuBackend.h: add a new MenuItem constructor.
3073 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
3076 2000-10-04 Allan Rae <rae@lyx.org>
3078 * lib/Makefile.am (listerrors):
3079 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
3080 I haven't got notangle installed so Kayvan please test. The output
3081 should end up in $builddir. This also allows people who don't have
3082 noweb installed to complete the make process without error.
3084 * src/frontends/xforms/FormCommand.[Ch] (showInset):
3085 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
3086 by JMarc's picky compiler.
3088 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3091 * src/insets/insettabular.C (setPos): change for loop to not use
3092 sequencing operator. Please check this Jürgen.
3094 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
3096 * src/insets/insetcite.C (getScreenLabel): ditto
3097 * src/support/filetools.C (QuoteName): ditto
3098 (ChangeExtension): ditto
3100 * src/BufferView_pimpl.C (scrollCB): make heigt int
3102 * src/BufferView2.C (insertInset): comment out unused arg
3104 * boost/Makefile.am (EXTRADIST): new variable
3106 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3108 * src/exporter.C (IsExportable): Fixed
3110 * lib/configure.m4: Small fix
3112 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
3114 * src/insets/insetbutton.C (width): Changed to work with no GUI.
3115 * src/insets/insetbib.C (bibitemWidest): ditto.
3116 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
3118 2000-10-03 Juergen Vigna <jug@sad.it>
3120 * src/BufferView2.C (theLockingInset): removed const because of
3121 Agnus's compile problems.
3123 * src/insets/insettext.C (LocalDispatch): set the language of the
3124 surronding paragraph on inserting the first character.
3126 * various files: changed use of BufferView::the_locking_inset.
3128 * src/BufferView2.C (theLockingInset):
3129 (theLockingInset): new functions.
3131 * src/BufferView.h: removed the_locking_inset.
3133 * src/lyxtext.h: added the_locking_inset
3135 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
3137 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
3139 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3141 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3142 * src/mathed/math_cursor.C (IsAlpha): ditto.
3143 * src/mathed/math_inset.C (strnew): ditto.
3144 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3145 (IMetrics): cxp set but never used; removed.
3146 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3147 that the variable in question has been removed also!
3150 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3151 using the Buffer * passed to Latex(), using the BufferView * passed to
3152 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3154 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3155 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3157 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3158 * src/buffer.C (readInset): used new InsetBibtex c-tor
3159 * (getBibkeyList): used new InsetBibtex::getKeys
3161 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3164 * lib/build-listerrors
3166 * src/exporter.C: Add literate programming support to the export code
3169 * src/lyx_cb.C: Remove old literate code.
3171 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3174 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3175 * src/converter.C (View, Convert): Use QuoteName.
3177 * src/insets/figinset.C (Preview): Use Formats::View.
3179 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3181 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3183 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3184 the top of the function, because compaq cxx complains that the
3185 "goto exit_with_message" when the function is disabled bypasses
3187 (MenuNew): try a better fix for the generation of new file names.
3188 This time, I used AddName() instead of AddPath(), hoping Juergen
3191 2000-10-03 Allan Rae <rae@lyx.org>
3193 * src/frontends/xforms/forms/form_preferences.fd:
3194 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3195 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3196 "Look and Feel"->"General" but will need to be split up further into
3197 general output and general input tabs. Current plan is for four outer
3198 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3199 stuff; "Inputs" for input and import configuration; "Outputs" for
3200 output and export configuration; and one more whatever is left over
3201 called "General". The leftovers at present look like being which
3202 viewers to use, spellchecker, language support and might be better
3203 named "Support". I've put "Paths" in "Inputs" for the moment as this
3204 seems reasonable for now at least.
3205 One problem remains: X error kills LyX when you close Preferences.
3207 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3209 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3210 qualifier from form()
3211 * src/frontends/xforms/FormCitation.[Ch]:
3212 * src/frontends/xforms/FormCopyright.[Ch]:
3213 * src/frontends/xforms/FormDocument.[Ch]:
3214 * src/frontends/xforms/FormError.[Ch]:
3215 * src/frontends/xforms/FormIndex.[Ch]:
3216 * src/frontends/xforms/FormPreferences.[Ch]:
3217 * src/frontends/xforms/FormPrint.[Ch]:
3218 * src/frontends/xforms/FormRef.[Ch]:
3219 * src/frontends/xforms/FormToc.[Ch]:
3220 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3222 * src/frontends/xforms/FormCitation.[Ch]:
3223 * src/frontends/xforms/FormIndex.[Ch]:
3224 * src/frontends/xforms/FormRef.[Ch]:
3225 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3226 with Allan's naming policy
3228 * src/frontends/xforms/FormCitation.C: some static casts to remove
3231 2000-10-02 Juergen Vigna <jug@sad.it>
3233 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3234 now you can type or do stuff inside the table-cell also when in dummy
3235 position, fixed visible cursor.
3237 * src/insets/insettext.C (Edit): fixing cursor-view position.
3239 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3240 be used for equal functions in lyxfunc and insettext.
3242 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3244 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3246 * src/frontends/gnome/FormCitation.h:
3247 * src/frontends/gnome/FormCopyright.h:
3248 * src/frontends/gnome/FormIndex.h:
3249 * src/frontends/gnome/FormPrint.h:
3250 * src/frontends/gnome/FormToc.h:
3251 * src/frontends/gnome/FormUrl.h:
3252 * src/frontends/kde/FormCitation.h:
3253 * src/frontends/kde/FormCopyright.h:
3254 * src/frontends/kde/FormIndex.h:
3255 * src/frontends/kde/FormRef.h:
3256 * src/frontends/kde/FormToc.h:
3257 * src/frontends/kde/FormUrl.h: fix remaining users of
3260 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3262 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3263 from depth argument.
3264 (DocBookHandleCaption): ditto.
3265 (DocBookHandleFootnote): ditto.
3266 (SimpleDocBookOnePar): ditto.
3268 * src/frontends/xforms/FormDocument.h (form): remove extra
3269 FormDocument:: qualifier.
3271 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3273 * sigc++/handle.h: ditto.
3275 * src/lyx_gui_misc.C: add "using" directive.
3277 * src/cheaders/cstddef: new file, needed by the boost library (for
3280 2000-10-02 Juergen Vigna <jug@sad.it>
3282 * src/insets/insettext.C (SetFont): better support.
3284 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3286 * src/screen.C (DrawOneRow): some uint refixes!
3288 2000-10-02 Allan Rae <rae@lyx.org>
3290 * boost/.cvsignore: ignore Makefile as well
3292 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3293 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3295 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3296 Left this one out by accident.
3298 * src/frontends/xforms/FormBase.h (restore): default to calling
3299 update() since that will restore the original/currently-applied values.
3300 Any input() triggered error messages will require the derived classes
3301 to redefine restore().
3303 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3304 avoid a segfault. combo_doc_class is the main concern.
3306 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3308 * Simplify build-listerrors in view of GUI-less export ability!
3310 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3312 * src/lyx_main.C (easyParse): Disable gui when exporting
3314 * src/insets/figinset.C:
3317 * src/lyx_gui_misc.C
3318 * src/tabular.C: Changes to allow no-gui.
3320 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3322 * src/support/utility.hpp: removed file
3323 * src/support/block.h: removed file
3325 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3328 * src/mathed/formula.C: add support/lyxlib.h
3329 * src/mathed/formulamacro.C: ditto
3331 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3332 * src/lyxparagraph.h: ditto
3334 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3335 * src/frontends/Makefile.am (INCLUDES): ditto
3336 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3337 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3338 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3339 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3340 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3341 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3343 * src/BufferView.h: use boost/utility.hpp
3344 * src/LColor.h: ditto
3345 * src/LaTeX.h: ditto
3346 * src/LyXAction.h: ditto
3347 * src/LyXView.h: ditto
3348 * src/bufferlist.h: ditto
3349 * src/lastfiles.h: ditto
3350 * src/layout.h: ditto
3351 * src/lyx_gui.h: ditto
3352 * src/lyx_main.h: ditto
3353 * src/lyxlex.h: ditto
3354 * src/lyxrc.h: ditto
3355 * src/frontends/ButtonPolicies.h: ditto
3356 * src/frontends/Dialogs.h: ditto
3357 * src/frontends/xforms/FormBase.h: ditto
3358 * src/frontends/xforms/FormGraphics.h: ditto
3359 * src/frontends/xforms/FormParagraph.h: ditto
3360 * src/frontends/xforms/FormTabular.h: ditto
3361 * src/graphics/GraphicsCache.h: ditto
3362 * src/graphics/Renderer.h: ditto
3363 * src/insets/ExternalTemplate.h: ditto
3364 * src/insets/insetcommand.h: ditto
3365 * src/support/path.h: ditto
3367 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3368 and introduce clause for 2.97.
3370 * boost/libs/README: new file
3372 * boost/boost/utility.hpp: new file
3374 * boost/boost/config.hpp: new file
3376 * boost/boost/array.hpp: new file
3378 * boost/Makefile.am: new file
3380 * boost/.cvsignore: new file
3382 * configure.in (AC_OUTPUT): add boost/Makefile
3384 * Makefile.am (SUBDIRS): add boost
3386 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3388 * src/support/lstrings.C (suffixIs): Fixed.
3390 2000-10-01 Allan Rae <rae@lyx.org>
3392 * src/PrinterParams.h: moved things around to avoid the "can't
3393 inline call" warning.
3395 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3396 into doc++ documentation.
3398 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3400 * src/frontends/xforms/FormRef.C: make use of button controller
3401 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3402 cleaned up button controller usage.
3403 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3404 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3405 use the button controller
3407 * src/frontends/xforms/forms/*.fd: and associated generated files
3408 updated to reflect changes to FormBase. Some other FormXxxx files
3409 also got minor updates to reflect changes to FormBase.
3411 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3412 (hide): made virtual.
3413 (input): return a bool. true == valid input
3414 (RestoreCB, restore): new
3415 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3416 Changes to allow derived dialogs to use a ButtonController and
3417 make sense when doing so: OK button calls ok() and so on.
3419 * src/frontends/xforms/ButtonController.h (class ButtonController):
3420 Switch from template implementation to taking Policy parameter.
3421 Allows FormBase to provide a ButtonController for any dialog.
3423 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3424 Probably should rename connect and disconnect.
3425 (apply): use the radio button groups
3426 (form): needed by FormBase
3427 (build): setup the radio button groups
3429 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3431 * several files: type changes to reduce the number of warnings and
3432 to unify type hangling a bit. Still much to do.
3434 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3436 * lib/images/*: rename a bunch of icons to match Dekel converter
3439 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3442 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3444 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3446 * sigc++/handle.h: ditto for class Handle.
3448 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3450 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3452 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3454 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3455 removal of the "default" language.
3457 * src/combox.h (getline): Check that sel > 0
3459 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3461 * lib/examples/docbook_example.lyx
3462 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3464 * lib/layouts/docbook-book.layout: new docbook book layout.
3466 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3468 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3470 * src/insets/figinset.C (DocBook):fixed small typo.
3472 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3474 * src/insets/insetinclude.h: string include_label doesn't need to be
3477 2000-09-29 Allan Rae <rae@lyx.org>
3479 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3480 Allow derived type to control connection and disconnection from signals
3481 of its choice if desired.
3483 2000-09-28 Juergen Vigna <jug@sad.it>
3485 * src/insets/insettabular.C (update): fixed cursor setting when
3486 the_locking_inset changed.
3487 (draw): made this a bit cleaner.
3488 (InsetButtonPress): fixed!
3490 * various files: added LyXText Parameter to fitCursor call.
3492 * src/BufferView.C (fitCursor): added LyXText parameter.
3494 * src/insets/insettabular.C (draw): small draw fix.
3496 * src/tabular.C: right setting of left/right celllines.
3498 * src/tabular.[Ch]: fixed various types in funcions and structures.
3499 * src/insets/insettabular.C: ditto
3500 * src/frontends/xforms/FormTabular.C: ditto
3502 2000-09-28 Allan Rae <rae@lyx.org>
3504 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3505 that the #ifdef's had been applied to part of what should have been
3506 a complete condition. It's possible there are other tests that
3507 were specific to tables that are also wrong now that InsetTabular is
3508 being used. Now we need to fix the output of '\n' after a table in a
3509 float for the same reason as the original condition:
3510 "don't insert this if we would be adding it before or after a table
3511 in a float. This little trick is needed in order to allow use of
3512 tables in \subfigures or \subtables."
3513 Juergen can you check this?
3515 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3517 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3518 output to the ostream.
3520 * several files: fixed types based on warnings from cxx
3522 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3524 * src/frontends/kde/Makefile.am: fix rule for
3525 formindexdialogdata_moc.C
3527 * src/.cvsignore: add ext_l10n.h to ignore
3529 * acconfig.h: stop messing with __STRICT_ANSI__
3530 * config/gnome.m4: remove option to set -ansi
3531 * config/kde.m4: remove option to set -ansi
3532 * config/lyxinclude.m4: don't set -ansi
3534 2000-09-27 Juergen Vigna <jug@sad.it>
3536 * various files: remove "default" language check.
3538 * src/insets/insetquotes.C: removed use of current_view.
3540 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3541 the one should have red ears by now!
3543 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3544 in more then one paragraph. Fixed cursor-movement/selection.
3546 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3547 paragraphs inside a text inset.
3549 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3550 text-inset if this owner is an inset.
3552 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3554 * src/Bullet.h: changed type of font, character and size to int
3556 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3558 * src/insets/inseturl.[Ch]:
3559 * src/insets/insetref.[Ch]:
3560 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3562 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3564 * src/buffer.C (readFile): block-if statement rearranged to minimise
3565 bloat. Patch does not reverse Jean-Marc's change ;-)
3567 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3568 Class rewritten to store pointers to hide/update signals directly,
3569 rather than Dialogs *. Also defined an enum to ease use. All xforms
3570 forms can now be derived from this class.
3572 * src/frontends/xforms/FormCommand.[Ch]
3573 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3575 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3578 * src/frontends/xforms/forms/form_citation.fd
3579 * src/frontends/xforms/forms/form_copyright.fd
3580 * src/frontends/xforms/forms/form_error.fd
3581 * src/frontends/xforms/forms/form_index.fd
3582 * src/frontends/xforms/forms/form_ref.fd
3583 * src/frontends/xforms/forms/form_toc.fd
3584 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3586 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3588 * src/insets/insetfoot.C: removed redundent using directive.
3590 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3592 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3593 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3595 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3596 created in the constructors in different groups. Then set() just
3597 have to show the groups as needed. This fixes the redraw problems
3598 (and is how the old menu code worked).
3600 * src/support/lyxlib.h: declare the methods as static when we do
3601 not have namespaces.
3603 2000-09-26 Juergen Vigna <jug@sad.it>
3605 * src/buffer.C (asciiParagraph): new function.
3606 (writeFileAscii): new function with parameter ostream.
3607 (writeFileAscii): use now asciiParagraph.
3609 * various inset files: added the linelen parameter to the Ascii-func.
3611 * src/tabular.C (Write): fixed error in writing file introduced by
3612 the last changes from Lars.
3614 * lib/bind/menus.bind: removed not supported functions.
3616 * src/insets/insettext.C (Ascii): implemented this function.
3618 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3620 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3621 (Write): use of the write_attribute functions.
3623 * src/bufferlist.C (close): fixed reasking question!
3625 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3627 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3628 new files use the everwhere possible.
3631 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3632 src/log_form.C src/lyx.C:
3635 * src/buffer.C (runLaTeX): remove func
3637 * src/PaperLayout.C: removed file
3638 * src/ParagraphExtra.C: likewise
3639 * src/bullet_forms.C: likewise
3640 * src/bullet_forms.h: likewise
3641 * src/bullet_forms_cb.C: likewise
3643 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3644 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3647 * several files: remove all traces of the old fd_form_paragraph,
3648 and functions belonging to that.
3650 * several files: remove all traces of the old fd_form_document,
3651 and functions belonging to that.
3653 * several files: constify local variables were possible.
3655 * several files: remove all code that was dead when NEW_EXPORT was
3658 * several files: removed string::c_str in as many places as
3661 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3662 (e): be a bit more outspoken when patching
3663 (updatesrc): only move files if changed.
3665 * forms/layout_forms.h.patch: regenerated
3667 * forms/layout_forms.fd: remove form_document and form_paragraph
3668 and form_quotes and form_paper and form_table_options and
3669 form_paragraph_extra
3671 * forms/form1.fd: remove form_table
3673 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3674 the fdui->... rewrite. Update some comments to xforms 0.88
3676 * forms/bullet_forms.C.patch: removed file
3677 * forms/bullet_forms.fd: likewise
3678 * forms/bullet_forms.h.patch: likewise
3680 * development/Code_rules/Rules: added a section on switch
3681 statements. Updated some comment to xforms 0.88.
3683 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3685 * src/buffer.C (readFile): make sure that the whole version number
3686 is read after \lyxformat (even when it contains a comma)
3688 * lib/ui/default.ui: change shortcut of math menu to M-a.
3690 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3692 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3695 * src/LyXView.C (updateWindowTitle): show the full files name in
3696 window title, limited to 30 characters.
3698 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3699 When a number of characters has been given, we should not assume
3700 that the string is 0-terminated.
3702 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3703 calls (fixes some memory leaks)
3705 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3706 trans member on exit.
3708 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3710 * src/converter.C (GetReachable): fix typo.
3712 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3713 understand ',' instead of '.'.
3714 (GetInteger): rewrite to use strToInt().
3716 2000-09-26 Juergen Vigna <jug@sad.it>
3718 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3719 better visibility and error-message on wrong VSpace input.
3721 * src/language.C (initL): added english again.
3723 2000-09-25 Juergen Vigna <jug@sad.it>
3725 * src/frontends/kde/Dialogs.C (Dialogs):
3726 * src/frontends/gnome/Dialogs.C (Dialogs):
3727 * src/frontends/kde/Makefile.am:
3728 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3730 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3732 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3734 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3736 * src/frontends/xforms/FormParagraph.C:
3737 * src/frontends/xforms/FormParagraph.h:
3738 * src/frontends/xforms/form_paragraph.C:
3739 * src/frontends/xforms/form_paragraph.h:
3740 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3743 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3745 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3746 Paragraph-Data after use.
3748 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3749 non breakable paragraphs.
3751 2000-09-25 Garst R. Reese <reese@isn.net>
3753 * src/language.C (initL): added missing language_country codes.
3755 2000-09-25 Juergen Vigna <jug@sad.it>
3757 * src/insets/insettext.C (InsetText):
3758 (deleteLyXText): remove the not released LyXText structure!
3760 2000-09-24 Marko Vendelin <markov@ioc.ee>
3762 * src/frontends/gnome/mainapp.C
3763 * src/frontends/gnome/mainapp.h: added support for keyboard
3766 * src/frontends/gnome/FormCitation.C
3767 * src/frontends/gnome/FormCitation.h
3768 * src/frontends/gnome/Makefile.am
3769 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3770 FormCitation to use "action area" in mainapp window
3772 * src/frontends/gnome/Menubar_pimpl.C
3773 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3776 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3778 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3779 width/descent/ascent values if name is empty.
3780 (mathed_string_height): Use std::max.
3782 2000-09-25 Allan Rae <rae@lyx.org>
3784 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3785 segfault. This will be completely redesigned soon.
3787 * sigc++: updated libsigc++. Fixes struct timespec bug.
3789 * development/tools/makeLyXsigc.sh: .cvsignore addition
3791 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3793 * several files: removed almost all traces of the old table
3796 * src/TableLayout.C: removed file
3798 2000-09-22 Juergen Vigna <jug@sad.it>
3800 * src/frontends/kde/Dialogs.C: added credits forms.
3802 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3804 * src/frontends/gnome/Dialogs.C: added some forms.
3806 * src/spellchecker.C (init_spell_checker): set language in pspell code
3807 (RunSpellChecker): some modifications for setting language string.
3809 * src/language.[Ch]: added language_country code.
3811 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3813 * src/frontends/Dialogs.h: added new signal showError.
3814 Rearranged existing signals in some sort of alphabetical order.
3816 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3817 FormError.[Ch], form_error.[Ch]
3818 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3819 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3821 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3822 dialogs. I think that this can be used as the base to all these
3825 * src/frontends/xforms/FormError.[Ch]
3826 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3827 implementation of InsetError dialog.
3829 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3831 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3832 * src/frontends/kde/Makefile.am: ditto
3834 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3836 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3837 macrobf. This fixes a bug of invisible text.
3839 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3841 * lib/doc/LaTeXConfig.lyx.in: updated.
3843 * src/language.C (initL): remove language "francais" and change a
3844 bit the names of the two other french variations.
3846 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3847 string that may not be 0-terminated.
3849 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3851 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3853 2000-09-20 Marko Vendelin <markov@ioc.ee>
3855 * src/frontends/gnome/FormCitation.C
3856 * src/frontends/gnome/FormIndex.C
3857 * src/frontends/gnome/FormToc.C
3858 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3859 the variable initialization to shut up the warnings
3861 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3863 * src/table.[Ch]: deleted files
3865 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3868 2000-09-18 Juergen Vigna <jug@sad.it>
3870 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3871 problems with selection. Inserted new LFUN_PASTESELECTION.
3872 (InsetButtonPress): inserted handling of middle mouse-button paste.
3874 * src/spellchecker.C: changed word to word.c_str().
3876 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3878 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3879 included in the ``make dist'' tarball.
3881 2000-09-15 Juergen Vigna <jug@sad.it>
3883 * src/CutAndPaste.C (cutSelection): small fix return the right
3884 end position after cut inside one paragraph only.
3886 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3887 we are locked as otherwise we don't have a valid cursor position!
3889 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3891 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3893 * src/frontends/kde/FormRef.C: added using directive.
3894 * src/frontends/kde/FormToc.C: ditto
3896 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3898 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3900 2000-09-19 Marko Vendelin <markov@ioc.ee>
3902 * src/frontends/gnome/Menubar_pimpl.C
3903 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3904 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3906 * src/frontends/gnome/mainapp.C
3907 * src/frontends/gnome/mainapp.h: support for menu update used
3910 * src/frontends/gnome/mainapp.C
3911 * src/frontends/gnome/mainapp.h: support for "action" area in the
3912 main window. This area is used by small simple dialogs, such as
3915 * src/frontends/gnome/FormIndex.C
3916 * src/frontends/gnome/FormIndex.h
3917 * src/frontends/gnome/FormUrl.C
3918 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3921 * src/frontends/gnome/FormCitation.C
3922 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3923 action area. Only "Insert new citation" is implemented.
3925 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3927 * src/buffer.C (Dispatch): fix call to Dispatch
3928 * src/insets/insetref.C (Edit): likewise
3929 * src/insets/insetparent.C (Edit): likewise
3930 * src/insets/insetinclude.C (include_cb): likewise
3931 * src/frontends/xforms/FormUrl.C (apply): likewise
3932 * src/frontends/xforms/FormToc.C (apply): likewise
3933 * src/frontends/xforms/FormRef.C (apply): likewise
3934 * src/frontends/xforms/FormIndex.C (apply): likewise
3935 * src/frontends/xforms/FormCitation.C (apply): likewise
3936 * src/lyxserver.C (callback): likewise
3937 * src/lyxfunc.C (processKeySym): likewise
3938 (Dispatch): likewise
3939 (Dispatch): likewise
3940 * src/lyx_cb.C (LayoutsCB): likewise
3942 * Makefile.am (sourcedoc): small change
3944 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3946 * src/main.C (main): Don't make an empty GUIRunTime object. all
3947 methods are static. constify a bit remove unneded using + headers.
3949 * src/tabular.C: some more const to local vars move some loop vars
3951 * src/spellchecker.C: added some c_str after some word for pspell
3953 * src/frontends/GUIRunTime.h: add new static method setDefaults
3954 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3955 * src/frontends/kde/GUIRunTime.C (setDefaults):
3956 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3958 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3959 with strnew in arg, use correct emptystring when calling SetName.
3961 * several files: remove all commented code with relation to
3962 HAVE_SSTREAM beeing false. We now only support stringstream and
3965 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3967 * src/lyxfunc.C: construct correctly the automatic new file
3970 * src/text2.C (IsStringInText): change type of variable i to shut
3973 * src/support/sstream.h: do not use namespaces if the compiler
3974 does not support them.
3976 2000-09-15 Marko Vendelin <markov@ioc.ee>
3977 * src/frontends/gnome/FormCitation.C
3978 * src/frontends/gnome/FormCitation.h
3979 * src/frontends/gnome/diainsertcitation_interface.c
3980 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3981 regexp support to FormCitation [Gnome].
3983 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3986 * configure.in: remove unused KDE/GTKGUI define
3988 * src/frontends/kde/FormRef.C
3989 * src/frontends/kde/FormRef.h
3990 * src/frontends/kde/formrefdialog.C
3991 * src/frontends/kde/formrefdialog.h: double click will
3992 go to reference, now it is possible to change a cross-ref
3995 * src/frontends/kde/FormToc.C
3996 * src/frontends/kde/FormToc.h
3997 * src/frontends/kde/formtocdialog.C
3998 * src/frontends/kde/formtocdialog.h: add a depth
4001 * src/frontends/kde/Makefile.am: add QtLyXView.h
4004 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
4006 * src/frontends/kde/FormCitation.h: added some using directives.
4008 * src/frontends/kde/FormToc.h: corrected definition of doTree.
4010 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
4013 * src/mathed/math_defs.h: redefine SetAlign to use string rather
4016 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4018 * src/buffer.C (pop_tag): revert for the second time a change by
4019 Lars, who seems to really hate having non-local loop variables :)
4021 * src/Lsstream.h: add "using" statements.
4023 * src/support/copy.C (copy): add a bunch of std:: qualifiers
4024 * src/buffer.C (writeFile): ditto
4026 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4028 * src/buffer.C (writeFile): try to fix the locale modified format
4029 number to always be as we want it.
4031 * src/WorkArea.C (work_area_handler): try to workaround the bugs
4032 in XForms 0.89. C-space is now working again.
4034 * src/Lsstream.h src/support/sstream.h: new files.
4036 * also commented out all cases where strstream were used.
4038 * src/Bullet.h (c_str): remove method.
4040 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
4042 * a lot of files: get rid of "char const *" and "char *" is as
4043 many places as possible. We only want to use them in interaction
4044 with system of other libraries, not inside lyx.
4046 * a lot of files: return const object is not of pod type. This
4047 helps ensure that temporary objects is not modified. And fits well
4048 with "programming by contract".
4050 * configure.in: check for the locale header too
4052 * Makefile.am (sourcedoc): new tag for generation of doc++
4055 2000-09-14 Juergen Vigna <jug@sad.it>
4057 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
4058 callback to check which combo called it and do the right action.
4060 * src/combox.C (combo_cb): added combo * to the callbacks.
4061 (Hide): moved call of callback after Ungrab of the pointer.
4063 * src/intl.h: removed LCombo2 function.
4065 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
4066 function as this can now be handled in one function.
4068 * src/combox.h: added Combox * to callback prototype.
4070 * src/frontends/xforms/Toolbar_pimpl.C:
4071 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
4073 2000-09-14 Garst Reese <reese@isn.net>
4075 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
4076 moved usepackage{xxx}'s to beginning of file. Changed left margin
4077 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
4078 underlining from title. Thanks to John Culleton for useful suggestions.
4080 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4082 * src/lyxlex_pimpl.C (setFile): change error message to debug
4085 2000-09-13 Juergen Vigna <jug@sad.it>
4087 * src/frontends/xforms/FormDocument.C: implemented choice_class
4088 as combox and give callback to combo_language so OK/Apply is activated
4091 * src/bufferlist.C (newFile): small fix so already named files
4092 (via an open call) are not requested to be named again on the
4095 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4097 * src/frontends/kde/Makefile.am
4098 * src/frontends/kde/FormRef.C
4099 * src/frontends/kde/FormRef.h
4100 * src/frontends/kde/formrefdialog.C
4101 * src/frontends/kde/formrefdialog.h: implement
4104 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
4106 * src/frontends/kde/formtocdialog.C
4107 * src/frontends/kde/formtocdialog.h
4108 * src/frontends/kde/FormToc.C
4109 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
4111 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
4113 * src/frontends/kde/FormCitation.C: fix thinko
4114 where we didn't always display the reference text
4117 * src/frontends/kde/formurldialog.C
4118 * src/frontends/kde/formurldialog.h
4119 * src/frontends/kde/FormUrl.C
4120 * src/frontends/kde/FormUrl.h: minor cleanups
4122 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
4124 * src/frontends/kde/Makefile.am
4125 * src/frontends/kde/FormToc.C
4126 * src/frontends/kde/FormToc.h
4127 * src/frontends/kde/FormCitation.C
4128 * src/frontends/kde/FormCitation.h
4129 * src/frontends/kde/FormIndex.C
4130 * src/frontends/kde/FormIndex.h
4131 * src/frontends/kde/formtocdialog.C
4132 * src/frontends/kde/formtocdialog.h
4133 * src/frontends/kde/formcitationdialog.C
4134 * src/frontends/kde/formcitationdialog.h
4135 * src/frontends/kde/formindexdialog.C
4136 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
4138 2000-09-12 Juergen Vigna <jug@sad.it>
4140 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4143 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4145 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4148 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4150 * src/converter.C (Add, Convert): Added support for converter flags:
4151 needaux, resultdir, resultfile.
4152 (Convert): Added new parameter view_file.
4153 (dvips_options): Fixed letter paper option.
4155 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4156 (Export, GetExportableFormats, GetViewableFormats): Added support
4159 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4161 (easyParse): Fixed to work with new export code.
4163 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4166 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4168 * lib/bind/*.bind: Replaced
4169 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4170 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4172 2000-09-11 Juergen Vigna <jug@sad.it>
4174 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4176 * src/main.C (main): now GUII defines global guiruntime!
4178 * src/frontends/gnome/GUIRunTime.C (initApplication):
4179 * src/frontends/kde/GUIRunTime.C (initApplication):
4180 * src/frontends/xforms/GUIRunTime.C (initApplication):
4181 * src/frontends/GUIRunTime.h: added new function initApplication.
4183 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4185 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4187 2000-09-08 Juergen Vigna <jug@sad.it>
4189 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4190 we have already "Reset".
4192 * src/language.C (initL): inserted "default" language and made this
4193 THE default language (and not american!)
4195 * src/paragraph.C: inserted handling of "default" language!
4197 * src/lyxfont.C: ditto
4201 * src/paragraph.C: output the \\par only if we have a following
4202 paragraph otherwise it's not needed.
4204 2000-09-05 Juergen Vigna <jug@sad.it>
4206 * config/pspell.m4: added entry to lyx-flags
4208 * src/spellchecker.C: modified version from Kevin for using pspell
4210 2000-09-01 Marko Vendelin <markov@ioc.ee>
4211 * src/frontends/gnome/Makefile.am
4212 * src/frontends/gnome/FormCitation.C
4213 * src/frontends/gnome/FormCitation.h
4214 * src/frontends/gnome/diainsertcitation_callbacks.c
4215 * src/frontends/gnome/diainsertcitation_callbacks.h
4216 * src/frontends/gnome/diainsertcitation_interface.c
4217 * src/frontends/gnome/diainsertcitation_interface.h
4218 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4219 dialog for Gnome frontend
4221 * src/main.C: Gnome libraries require keeping application name
4222 and its version as strings
4224 * src/frontends/gnome/mainapp.C: Change the name of the main window
4225 from GnomeLyX to PACKAGE
4227 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4229 * src/frontends/Liason.C: add "using: declaration.
4231 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4233 * src/mathed/math_macro.C (Metrics): Set the size of the template
4235 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4237 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4239 * src/converter.C (add_options): New function.
4240 (SetViewer): Change $$FName into '$$FName'.
4241 (View): Add options when running xdvi
4242 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4243 (Convert): The 3rd parameter is now the desired filename. Converts
4244 calls to lyx::rename if necessary.
4245 Add options when running dvips.
4246 (dvi_papersize,dvips_options): New methods.
4248 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4250 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4251 using a call to Converter::dvips_options.
4252 Fixed to work with nex export code.
4254 * src/support/copy.C
4255 * src/support/rename.C: New files
4257 * src/support/syscall.h
4258 * src/support/syscall.C: Added Starttype SystemDontWait.
4260 * lib/ui/default.ui: Changed to work with new export code
4262 * lib/configure.m4: Changed to work with new export code
4264 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4266 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4268 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4269 so that code compiles with DEC cxx.
4271 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4272 to work correctly! Also now supports the additional elements
4275 2000-09-01 Allan Rae <rae@lyx.org>
4277 * src/frontends/ButtonPolicies.C: renamed all the references to
4278 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4280 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4281 since it's a const not a type.
4283 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4285 2000-08-31 Juergen Vigna <jug@sad.it>
4287 * src/insets/figinset.C: Various changes to look if the filename has
4288 an extension and if not add it for inline previewing.
4290 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4292 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4293 make buttonStatus and isReadOnly be const methods. (also reflect
4294 this in derived classes.)
4296 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4297 (nextState): change to be static inline, pass the StateMachine as
4299 (PreferencesPolicy): remove casts
4300 (OkCancelPolicy): remvoe casts
4301 (OkCancelReadOnlyPolicy): remove casts
4302 (NoRepeatedApplyReadOnlyPolicy): remove casts
4303 (OkApplyCancelReadOnlyPolicy): remove casts
4304 (OkApplyCancelPolicy): remove casts
4305 (NoRepeatedApplyPolicy): remove casts
4307 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4309 * src/converter.C: added some using directives
4311 * src/frontends/ButtonPolicies.C: changes to overcome
4312 "need lvalue" error with DEC c++
4314 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4315 to WMHideCB for DEC c++
4317 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4319 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4320 to BulletBMTableCB for DEC c++
4322 2000-08-31 Allan Rae <rae@lyx.org>
4324 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4325 character dialog separately from old document dialogs combo_language.
4328 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4330 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4331 Removed LFUN_REF_CREATE.
4333 * src/MenuBackend.C: Added new tags: toc and references
4335 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4336 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4338 (add_toc, add_references): New methods.
4339 (create_submenu): Handle correctly the case when there is a
4340 seperator after optional menu items.
4342 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4343 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4344 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4346 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4348 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4350 * src/converter.[Ch]: New file for converting between different
4353 * src/export.[Ch]: New file for exporting a LyX file to different
4356 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4357 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4358 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4359 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4360 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4361 RunDocBook, MenuExport.
4363 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4364 Exporter::Preview methods if NEW_EXPORT is defined.
4366 * src/buffer.C (Dispatch): Use Exporter::Export.
4368 * src/lyxrc.C: Added new tags: \converter and \viewer.
4371 * src/LyXAction.C: Define new lyx-function: buffer-update.
4372 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4373 when NEW_EXPORT is defined.
4375 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4377 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4379 * lib/ui/default.ui: Added submenus "view" and "update" to the
4382 * src/filetools.C (GetExtension): New function.
4384 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4386 2000-08-29 Allan Rae <rae@lyx.org>
4388 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4390 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4391 (EnableDocumentLayout): removed
4392 (DisableDocumentLayout): removed
4393 (build): make use of ButtonController's read-only handling to
4394 de/activate various objects. Replaces both of the above functions.
4396 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4397 (readOnly): was read_only
4398 (refresh): fixed dumb mistakes with read_only_ handling
4400 * src/frontends/xforms/forms/form_document.fd:
4401 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4402 tabbed dialogs so the tabs look more like tabs and so its easier to
4403 work out which is the current tab.
4405 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4406 segfault with form_table
4408 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4410 2000-08-28 Juergen Vigna <jug@sad.it>
4412 * acconfig.h: added USE_PSPELL.
4414 * src/config.h.in: added USE_PSPELL.
4416 * autogen.sh: added pspell.m4
4418 * config/pspell.m4: new file.
4420 * src/spellchecker.C: implemented support for pspell libary.
4422 2000-08-25 Juergen Vigna <jug@sad.it>
4424 * src/LyXAction.C (init): renamed LFUN_TABLE to
4425 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4427 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4429 * src/lyxscreen.h: add force_clear variable and fuction to force
4430 a clear area when redrawing in LyXText.
4432 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4434 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4436 * some whitespace and comment changes.
4438 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4440 * src/buffer.C: up te LYX_FORMAT to 2.17
4442 2000-08-23 Juergen Vigna <jug@sad.it>
4444 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4447 * src/insets/insettabular.C (pasteSelection): delete the insets
4448 LyXText as it is not valid anymore.
4449 (copySelection): new function.
4450 (pasteSelection): new function.
4451 (cutSelection): new function.
4452 (LocalDispatch): implemented cut/copy/paste of cell selections.
4454 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4455 don't have a LyXText.
4457 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4459 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4462 2000-08-22 Juergen Vigna <jug@sad.it>
4464 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4465 ifdef form_table out if NEW_TABULAR.
4467 2000-08-21 Juergen Vigna <jug@sad.it>
4469 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4470 (draw): fixed draw position so that the cursor is positioned in the
4472 (InsetMotionNotify): hide/show cursor so the position is updated.
4473 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4474 using cellstart() function where it should be used.
4476 * src/insets/insettext.C (draw): ditto.
4478 * src/tabular.C: fixed initialization of some missing variables and
4479 made BoxType into an enum.
4481 2000-08-22 Marko Vendelin <markov@ioc.ee>
4482 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4483 stock menu item using action numerical value, not its string
4487 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4489 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4490 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4492 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4494 * src/frontends/xforms/GUIRunTime.C: new file
4496 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4497 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4499 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4501 * src/frontends/kde/GUIRunTime.C: new file
4503 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4504 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4506 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4508 * src/frontends/gnome/GUIRunTime.C: new file
4510 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4513 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4514 small change to documetentation.
4516 * src/frontends/GUIRunTime.C: removed file
4518 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4520 * src/lyxparagraph.h: enable NEW_TABULAR as default
4522 * src/lyxfunc.C (processKeySym): remove some commented code
4524 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4525 NEW_TABULAR around the fd_form_table_options.
4527 * src/lyx_gui.C (runTime): call the static member function as
4528 GUIRunTime::runTime().
4530 2000-08-21 Allan Rae <rae@lyx.org>
4532 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4535 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4537 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4539 2000-08-21 Allan Rae <rae@lyx.org>
4541 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4542 keep Garst happy ;-)
4543 * src/frontends/xforms/FormPreferences.C (build): use setOK
4544 * src/frontends/xforms/FormDocument.C (build): use setOK
4545 (FormDocument): use the appropriate policy.
4547 2000-08-21 Allan Rae <rae@lyx.org>
4549 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4550 automatic [de]activation of arbitrary objects when in a read-only state.
4552 * src/frontends/ButtonPolicies.h: More documentation
4553 (isReadOnly): added to support the above.
4555 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4557 2000-08-18 Juergen Vigna <jug@sad.it>
4559 * src/insets/insettabular.C (getStatus): changed to return func_status.
4561 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4562 display toggle menu entries if they are.
4564 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4565 new document layout now.
4567 * src/lyxfunc.C: ditto
4569 * src/lyx_gui_misc.C: ditto
4571 * src/lyx_gui.C: ditto
4573 * lib/ui/default.ui: removed paper and quotes layout as they are now
4574 all in the document layout tabbed folder.
4576 * src/frontends/xforms/forms/form_document.fd: added Restore
4577 button and callbacks for all inputs for Allan's ButtonPolicy.
4579 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4580 (CheckChoiceClass): added missing params setting on class change.
4581 (UpdateLayoutDocument): added for updating the layout on params.
4582 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4583 (FormDocument): Implemented Allan's ButtonPolicy with the
4586 2000-08-17 Allan Rae <rae@lyx.org>
4588 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4589 so we can at least see the credits again.
4591 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4592 controller calls for the appropriate callbacks. Note that since Ok
4593 calls apply followed by cancel, and apply isn't a valid input for the
4594 APPLIED state, the bc_ calls have to be made in the static callback not
4595 within each of the real callbacks.
4597 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4598 (setOk): renamed from setOkay()
4600 2000-08-17 Juergen Vigna <jug@sad.it>
4602 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4603 in the implementation part.
4604 (composeUIInfo): don't show optional menu-items.
4606 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4608 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4610 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4611 text-state when in a text-inset.
4613 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4615 2000-08-17 Marko Vendelin <markov@ioc.ee>
4616 * src/frontends/gnome/FormIndex.C
4617 * src/frontends/gnome/FormIndex.h
4618 * src/frontends/gnome/FormToc.C
4619 * src/frontends/gnome/FormToc.h
4620 * src/frontends/gnome/dialogs
4621 * src/frontends/gnome/diatoc_callbacks.c
4622 * src/frontends/gnome/diatoc_callbacks.h
4623 * src/frontends/gnome/diainsertindex_callbacks.h
4624 * src/frontends/gnome/diainsertindex_callbacks.c
4625 * src/frontends/gnome/diainsertindex_interface.c
4626 * src/frontends/gnome/diainsertindex_interface.h
4627 * src/frontends/gnome/diatoc_interface.h
4628 * src/frontends/gnome/diatoc_interface.c
4629 * src/frontends/gnome/Makefile.am: Table of Contents and
4630 Insert Index dialogs implementation for Gnome frontend
4632 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4634 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4636 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4639 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4641 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4642 destructor. Don't definde if you don't need it
4643 (processEvents): made static, non-blocking events processing for
4645 (runTime): static method. event loop for xforms
4646 * similar as above for kde and gnome.
4648 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4649 new Pimpl is correct
4650 (runTime): new method calss the real frontends runtime func.
4652 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4654 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4656 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4658 2000-08-16 Juergen Vigna <jug@sad.it>
4660 * src/lyx_gui.C (runTime): added GUII RunTime support.
4662 * src/frontends/Makefile.am:
4663 * src/frontends/GUIRunTime.[Ch]:
4664 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4665 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4666 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4668 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4670 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4671 as this is already set in ${FRONTEND_INCLUDE} if needed.
4673 * configure.in (CPPFLAGS): setting the include dir for the frontend
4674 directory and don't set FRONTEND=xforms for now as this is executed
4677 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4679 * src/frontends/kde/Makefile.am:
4680 * src/frontends/kde/FormUrl.C:
4681 * src/frontends/kde/FormUrl.h:
4682 * src/frontends/kde/formurldialog.h:
4683 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4685 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4687 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4689 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4691 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4694 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4696 * src/WorkArea.C (work_area_handler): more work to get te
4697 FL_KEYBOARD to work with xforms 0.88 too, please test.
4699 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4701 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4703 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4706 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4708 * src/Timeout.h: remove Qt::emit hack.
4710 * several files: changes to allo doc++ compilation
4712 * src/lyxfunc.C (processKeySym): new method
4713 (processKeyEvent): comment out if FL_REVISION < 89
4715 * src/WorkArea.C: change some debugging levels.
4716 (WorkArea): set wantkey to FL_KEY_ALL
4717 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4718 clearer code and the use of compose with XForms 0.89. Change to
4719 use signals instead of calling methods in bufferview directly.
4721 * src/Painter.C: change some debugging levels.
4723 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4726 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4727 (workAreaKeyPress): new method
4729 2000-08-14 Juergen Vigna <jug@sad.it>
4731 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4733 * config/kde.m4: addes some features
4735 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4736 include missing xforms dialogs.
4738 * src/Timeout.h: a hack to be able to compile with qt/kde.
4740 * sigc++/.cvsignore: added acinclude.m4
4742 * lib/.cvsignore: added listerros
4744 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4745 xforms tree as objects are needed for other frontends.
4747 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4748 linking with not yet implemented xforms objects.
4750 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4752 2000-08-14 Baruch Even <baruch.even@writeme.com>
4754 * src/frontends/xforms/FormGraphics.h:
4755 * src/frontends/xforms/FormGraphics.C:
4756 * src/frontends/xforms/RadioButtonGroup.h:
4757 * src/frontends/xforms/RadioButtonGroup.C:
4758 * src/insets/insetgraphics.h:
4759 * src/insets/insetgraphics.C:
4760 * src/insets/insetgraphicsParams.h:
4761 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4762 instead of spaces, and various other indentation issues to make the
4763 sources more consistent.
4765 2000-08-14 Marko Vendelin <markov@ioc.ee>
4767 * src/frontends/gnome/dialogs/diaprint.glade
4768 * src/frontends/gnome/FormPrint.C
4769 * src/frontends/gnome/FormPrint.h
4770 * src/frontends/gnome/diaprint_callbacks.c
4771 * src/frontends/gnome/diaprint_callbacks.h
4772 * src/frontends/gnome/diaprint_interface.c
4773 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4776 * src/frontends/gnome/dialogs/diainserturl.glade
4777 * src/frontends/gnome/FormUrl.C
4778 * src/frontends/gnome/FormUrl.h
4779 * src/frontends/gnome/diainserturl_callbacks.c
4780 * src/frontends/gnome/diainserturl_callbacks.h
4781 * src/frontends/gnome/diainserturl_interface.c
4782 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4783 Gnome implementation
4785 * src/frontends/gnome/Dialogs.C
4786 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4787 all other dialogs. Copy all unimplemented dialogs from Xforms
4790 * src/frontends/gnome/support.c
4791 * src/frontends/gnome/support.h: support files generated by Glade
4795 * config/gnome.m4: Gnome configuration scripts
4797 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4798 configure --help message
4800 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4801 only if there are no events pendling in Gnome/Gtk. This enhances
4802 the performance of menus.
4805 2000-08-14 Allan Rae <rae@lyx.org>
4807 * lib/Makefile.am: listerrors cleaning
4809 * lib/listerrors: removed -- generated file
4810 * acinclude.m4: ditto
4811 * sigc++/acinclude.m4: ditto
4813 * src/frontends/xforms/forms/form_citation.fd:
4814 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4817 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4818 `updatesrc` and now we have a `test` target that does what `updatesrc`
4819 used to do. I didn't like having an install target that wasn't related
4822 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4823 on all except FormGraphics. This may yet happen. Followed by a major
4824 cleanup including using FL_TRANSIENT for most of the dialogs. More
4825 changes to come when the ButtonController below is introduced.
4827 * src/frontends/xforms/ButtonController.h: New file for managing up to
4828 four buttons on a dialog according to an externally defined policy.
4829 * src/frontends/xforms/Makefile.am: added above
4831 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4832 Apply and Cancel/Close buttons and everything in between and beyond.
4833 * src/frontends/Makefile.am: added above.
4835 * src/frontends/xforms/forms/form_preferences.fd:
4836 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4837 and removed variable 'status' as a result. Fixed the set_minsize thing.
4838 Use the new screen-font-update after checking screen fonts were changed
4839 Added a "Restore" button to restore the original lyxrc values while
4840 editing. This restores everything not just the last input changed.
4841 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4843 * src/LyXAction.C: screen-font-update added for updating buffers after
4844 screen font settings have been changed.
4845 * src/commandtags.h: ditto
4846 * src/lyxfunc.C: ditto
4848 * forms/lyx.fd: removed screen fonts dialog.
4849 * src/lyx_gui.C: ditto
4850 * src/menus.[Ch]: ditto
4851 * src/lyx.[Ch]: ditto
4852 * src/lyx_cb.C: ditto + code from here moved to make
4853 screen-font-update. And people wonder why progress on GUII is
4854 slow. Look at how scattered this stuff was! It takes forever
4857 * forms/fdfix.sh: Fixup the spacing after commas.
4858 * forms/makefile: Remove date from generated files. Fewer clashes now.
4859 * forms/bullet_forms.C.patch: included someones handwritten changes
4861 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4862 once I've discovered why LyXRC was made noncopyable.
4863 * src/lyx_main.C: ditto
4865 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4867 * src/frontends/xforms/forms/fdfix.sh:
4868 * src/frontends/xforms/forms/fdfixh.sed:
4869 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4870 * src/frontends/xforms/Form*.[hC]:
4871 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4872 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4873 provide a destructor for the struct FD_form_xxxx. Another version of
4874 the set_[max|min]size workaround and a few other cleanups. Actually,
4875 Angus' patch from 20000809.
4877 2000-08-13 Baruch Even <baruch.even@writeme.com>
4879 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4882 2000-08-11 Juergen Vigna <jug@sad.it>
4884 * src/insets/insetgraphics.C (InsetGraphics): changing init
4885 order because of warnings.
4887 * src/frontends/xforms/forms/makefile: adding patching .C with
4890 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4891 from .C.patch to .c.patch
4893 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4894 order because of warning.
4896 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4898 * src/frontends/Liason.C (setMinibuffer): new helper function
4900 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4902 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4904 * lib/ui/default.ui: commented out PaperLayout entry
4906 * src/frontends/xforms/form_document.[Ch]: new added files
4908 * src/frontends/xforms/FormDocument.[Ch]: ditto
4910 * src/frontends/xforms/forms/form_document.fd: ditto
4912 * src/frontends/xforms/forms/form_document.C.patch: ditto
4914 2000-08-10 Juergen Vigna <jug@sad.it>
4916 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4917 (InsetGraphics): initialized cacheHandle to 0.
4918 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4920 2000-08-10 Baruch Even <baruch.even@writeme.com>
4922 * src/graphics/GraphicsCache.h:
4923 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4924 correctly as a cache.
4926 * src/graphics/GraphicsCacheItem.h:
4927 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4930 * src/graphics/GraphicsCacheItem_pimpl.h:
4931 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4934 * src/insets/insetgraphics.h:
4935 * src/insets/insetgraphics.C: Changed from using a signal notification
4936 to polling when image is not loaded.
4938 2000-08-10 Allan Rae <rae@lyx.org>
4940 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4941 that there are two functions that have to been taken out of line by
4942 hand and aren't taken care of in the script. (Just a reminder note)
4944 * sigc++/macros/*.h.m4: Updated as above.
4946 2000-08-09 Juergen Vigna <jug@sad.it>
4948 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4950 * src/insets/insettabular.C: make drawing of single cell smarter.
4952 2000-08-09 Marko Vendelin <markov@ioc.ee>
4953 * src/frontends/gnome/Menubar_pimpl.C
4954 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4955 implementation: new files
4957 * src/frontends/gnome/mainapp.C
4958 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4961 * src/main.C: create Gnome main window
4963 * src/frontends/xforms/Menubar_pimpl.h
4964 * src/frontends/Menubar.C
4965 * src/frontends/Menubar.h: added method Menubar::update that calls
4966 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4968 * src/LyXView.C: calls Menubar::update to update the state
4971 * src/frontends/gnome/Makefile.am: added new files
4973 * src/frontends/Makefile.am: added frontend compiler options
4975 2000-08-08 Juergen Vigna <jug@sad.it>
4977 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4979 * src/bufferlist.C (close):
4980 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4981 documents if exiting without saving.
4983 * src/buffer.C (save): use removeAutosaveFile()
4985 * src/support/filetools.C (removeAutosaveFile): new function.
4987 * src/lyx_cb.C (MenuWrite): returns a bool now.
4988 (MenuWriteAs): check if file could really be saved and revert to the
4990 (MenuWriteAs): removing old autosavefile if existant.
4992 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4993 before Goto toggle declaration, because of compiler warning.
4995 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4997 * src/lyxfunc.C (MenuNew): small fix.
4999 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
5001 * src/bufferlist.C (newFile):
5002 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
5004 * src/lyxrc.C: added new_ask_filename tag
5006 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
5008 * src/lyx.fd: removed code pertaining to form_ref
5009 * src/lyx.[Ch]: ditto
5010 * src/lyx_cb.C: ditto
5011 * src/lyx_gui.C: ditto
5012 * src/lyx_gui_misc.C: ditto
5014 * src/BufferView_pimpl.C (restorePosition): update buffer only
5017 * src/commandtags.h (LFUN_REFTOGGLE): removed
5018 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
5019 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
5020 (LFUN_REFBACK): renamed LFUN_REF_BACK
5022 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
5023 * src/menus.C: ditto
5024 * src/lyxfunc.C (Dispatch): ditto.
5025 InsertRef dialog is now GUI-independent.
5027 * src/texrow.C: added using std::endl;
5029 * src/insets/insetref.[Ch]: strip out large amounts of code.
5030 The inset is now a container and this functionality is now
5031 managed by a new FormRef dialog
5033 * src/frontends/Dialogs.h (showRef, createRef): new signals
5035 * src/frontends/xforms/FormIndex.[Ch],
5036 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
5037 when setting dialog's min/max size
5038 * src/frontends/xforms/FormIndex.[Ch]: ditto
5040 * src/frontends/xforms/FormRef.[Ch],
5041 src/frontends/xforms/forms/form_ref.fd: new xforms
5042 implementation of an InsetRef dialog
5044 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
5047 * src/graphics/XPM_Renderer.C (isImageFormatOK):
5048 ios::nocreate is not part of the standard. Removed.
5050 2000-08-07 Baruch Even <baruch.even@writeme.com>
5052 * src/graphics/Renderer.h:
5053 * src/graphics/Renderer.C: Added base class for rendering of different
5054 image formats into Pixmaps.
5056 * src/graphics/XPM_Renderer.h:
5057 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
5058 in a different class.
5060 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
5061 easily add support for other formats.
5063 * src/insets/figinset.C: plugged a leak of an X resource.
5065 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5067 * src/CutAndPaste.[Ch]: make all metods static.
5069 * development/Code_rules/Rules: more work, added section on
5070 Exceptions, and a References section.
5072 * a lot of header files: work to make doc++ able to generate the
5073 source documentation, some workarounds of doc++ problems. Doc++ is
5074 now able to generate the documentation.
5076 2000-08-07 Juergen Vigna <jug@sad.it>
5078 * src/insets/insettabular.C (recomputeTextInsets): removed function
5080 * src/tabular.C (SetWidthOfMulticolCell):
5082 (calculate_width_of_column_NMC): fixed return value so that it really
5083 only returns true if the column-width has changed (there where
5084 problems with muliticolumn-cells in this column).
5086 2000-08-04 Juergen Vigna <jug@sad.it>
5088 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
5089 also on the scrollstatus of the inset.
5090 (workAreaMotionNotify): ditto.
5092 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
5094 2000-08-01 Juergen Vigna <jug@sad.it>
5096 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
5098 * src/commandtags.h:
5099 * src/LyXAction.C (init):
5100 * src/insets/inset.C (LocalDispatch): added support for
5103 * src/insets/inset.C (scroll): new functions.
5105 * src/insets/insettext.C (removeNewlines): new function.
5106 (SetAutoBreakRows): removes forced newlines in the text of the
5107 paragraph if autoBreakRows is set to false.
5109 * src/tabular.C (Latex): generates a parbox around the cell contents
5112 * src/frontends/xforms/FormTabular.C (local_update): removed
5113 the radio_useparbox button.
5115 * src/tabular.C (UseParbox): new function
5117 2000-08-06 Baruch Even <baruch.even@writeme.com>
5119 * src/graphics/GraphicsCache.h:
5120 * src/graphics/GraphicsCache.C:
5121 * src/graphics/GraphicsCacheItem.h:
5122 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
5125 * src/insets/insetgraphics.h:
5126 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
5127 and the drawing of the inline image.
5129 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
5130 loaded into the wrong position.
5132 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
5135 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5137 * src/support/translator.h: move all typedefs to public section
5139 * src/support/filetools.C (MakeLatexName): return string const
5141 (TmpFileName): ditto
5142 (FileOpenSearch): ditto
5144 (LibFileSearch): ditto
5145 (i18nLibFileSearch): ditto
5148 (CreateTmpDir): ditto
5149 (CreateBufferTmpDir): ditto
5150 (CreateLyXTmpDir): ditto
5153 (MakeAbsPath): ditto
5155 (OnlyFilename): ditto
5157 (NormalizePath): ditto
5158 (CleanupPath): ditto
5159 (GetFileContents): ditto
5160 (ReplaceEnvironmentPath): ditto
5161 (MakeRelPath): ditto
5163 (ChangeExtension): ditto
5164 (MakeDisplayPath): ditto
5165 (do_popen): return cmdret const
5166 (findtexfile): return string const
5168 * src/support/DebugStream.h: add some /// to please doc++
5170 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5172 * src/texrow.C (same_rownumber): functor to use with find_if
5173 (getIdFromRow): rewritten to use find_if and to not update the
5174 positions. return true if row is found
5175 (increasePos): new method, use to update positions
5177 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5179 * src/lyxlex_pimpl.C (verifyTable): new method
5182 (GetString): return string const
5183 (pushTable): rewrite to use std::stack
5185 (setFile): better check
5188 * src/lyxlex.h: make LyXLex noncopyable
5190 * src/lyxlex.C (text): return char const * const
5191 (GetString): return string const
5192 (getLongString): return string const
5194 * src/lyx_gui_misc.C (askForText): return pair<...> const
5196 * src/lastfiles.[Ch] (operator): return string const
5198 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5199 istringstream not char const *.
5200 move token.end() out of loop.
5201 (readFile): move initializaton of token
5203 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5204 getIdFromRow is successful.
5206 * lib/bind/emacs.bind: don't include menus bind
5208 * development/Code_rules/Rules: the beginnings of making this
5209 better and covering more of the unwritten rules that we have.
5211 * development/Code_rules/Recommendations: a couple of wording
5214 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5216 * src/support/strerror.c: remove C++ comment.
5218 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5220 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5221 LFUN_INDEX_INSERT_LAST
5223 * src/texrow.C (getIdFromRow): changed from const_iterator to
5224 iterator, allowing code to compile with DEC cxx
5226 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5227 stores part of the class, as suggested by Allan. Will allow
5229 (apply): test to apply uses InsetCommandParams operator!=
5231 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5232 (apply): test to apply uses InsetCommandParams operator!=
5234 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5235 stores part of the class.
5236 (update): removed limits on min/max size.
5238 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5239 (apply): test to apply uses InsetCommandParams operator!=
5241 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5242 (Read, Write, scanCommand, getCommand): moved functionality
5243 into InsetCommandParams.
5245 (getScreenLabel): made pure virtual
5246 new InsetCommandParams operators== and !=
5248 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5249 c-tors based on InsetCommandParams. Removed others.
5250 * src/insets/insetinclude.[Ch]: ditto
5251 * src/insets/insetlabel.[Ch]: ditto
5252 * src/insets/insetparent.[Ch]: ditto
5253 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5255 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5256 insets derived from InsetCommand created using similar c-tors
5257 based on InsetCommandParams
5258 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5259 * src/menus.C (ShowRefsMenu): ditto
5260 * src/paragraph.C (Clone): ditto
5261 * src/text2.C (SetCounter): ditto
5262 * src/lyxfunc.C (Dispatch) ditto
5263 Also recreated old InsetIndex behaviour exactly. Can now
5264 index-insert at the start of a paragraph and index-insert-last
5265 without launching the pop-up.
5267 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5269 * lib/lyxrc.example: mark te pdf options as non functional.
5271 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5272 (isStrDbl): move tmpstr.end() out of loop.
5273 (strToDbl): move intialization of tmpstr
5274 (lowercase): return string const and move tmp.end() out of loop.
5275 (uppercase): return string const and move tmp.edn() out of loop.
5276 (prefixIs): add assertion
5281 (containsOnly): ditto
5282 (containsOnly): ditto
5283 (containsOnly): ditto
5284 (countChar): make last arg char not char const
5285 (token): return string const
5286 (subst): return string const, move tmp.end() out of loop.
5287 (subst): return string const, add assertion
5288 (strip): return string const
5289 (frontStrip): return string const, add assertion
5290 (frontStrip): return string const
5295 * src/support/lstrings.C: add inclde "LAssert.h"
5296 (isStrInt): move tmpstr.end() out of loop.
5298 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5299 toollist.end() out of loop.
5300 (deactivate): move toollist.end() out of loop.
5301 (update): move toollist.end() out of loop.
5302 (updateLayoutList): move tc.end() out of loop.
5303 (add): move toollist.end() out of loop.
5305 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5306 md.end() out of loop.
5308 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5310 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5313 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5314 (Erase): move insetlist.end() out of loop.
5316 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5317 ref to const string as first arg. Move initialization of some
5318 variables, whitespace changes.
5320 * src/kbmap.C (defkey): move table.end() out of loop.
5321 (kb_keymap): move table.end() out of loop.
5322 (findbinding): move table.end() out of loop.
5324 * src/MenuBackend.C (hasMenu): move end() out of loop.
5325 (getMenu): move end() out of loop.
5326 (getMenu): move menulist_.end() out of loop.
5328 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5330 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5333 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5334 (getFromLyXName): move infotab.end() out of loop.
5336 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5337 -fvtable-thunks -ffunction-sections -fdata-sections
5339 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5341 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5344 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5346 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5348 * src/frontends/xforms/FormCitation.[Ch],
5349 src/frontends/xforms/FormIndex.[Ch],
5350 src/frontends/xforms/FormToc.[Ch],
5351 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5353 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5355 * src/commandtags.h: renamed, created some flags for citation
5358 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5360 * src/lyxfunc.C (dispatch): use signals to insert index entry
5362 * src/frontends/Dialogs.h: new signal createIndex
5364 * src/frontends/xforms/FormCommand.[Ch],
5365 src/frontends/xforms/FormCitation.[Ch],
5366 src/frontends/xforms/FormToc.[Ch],
5367 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5369 * src/insets/insetindex.[Ch]: GUI-independent
5371 * src/frontends/xforms/FormIndex.[Ch],
5372 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5375 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5377 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5378 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5380 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5382 * src/insets/insetref.C (Latex): rewrite so that there is now
5383 question that a initialization is requested.
5385 * src/insets/insetcommand.h: reenable the hide signal
5387 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5389 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5390 fix handling of shortcuts (many bugs :)
5391 (add_lastfiles): ditto.
5393 * lib/ui/default.ui: fix a few shortcuts.
5395 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5397 * Makefile.am: Fix ``rpmdist'' target to return the exit
5398 status of the ``rpm'' command, instead of the last command in
5399 the chain (the ``rm lyx.xpm'' command, which always returns
5402 2000-08-02 Allan Rae <rae@lyx.org>
5404 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5405 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5406 * src/frontends/xforms/FormToc.C (FormToc): ditto
5408 * src/frontends/xforms/Makefile.am: A few forgotten files
5410 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5411 Signals-not-copyable-problem Lars' started commenting out.
5413 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5415 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5417 * src/insets/insetcommand.h: Signals is not copyable so anoter
5418 scheme for automatic hiding of forms must be used.
5420 * src/frontends/xforms/FormCitation.h: don't inerit from
5421 noncopyable, FormCommand already does that.
5422 * src/frontends/xforms/FormToc.h: ditto
5423 * src/frontends/xforms/FormUrl.h: ditto
5425 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5427 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5429 * src/insets/insetcommand.h (hide): new SigC::Signal0
5430 (d-tor) new virtual destructor emits hide signal
5432 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5433 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5435 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5436 LOF and LOT. Inset is now GUI-independent
5438 * src/insets/insetloa.[Ch]: redundant
5439 * src/insets/insetlof.[Ch]: ditto
5440 * src/insets/insetlot.[Ch]: ditto
5442 * src/frontends/xforms/forms/form_url.fd: tweaked!
5443 * src/frontends/xforms/forms/form_citation.fd: ditto
5445 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5446 dialogs dealing with InsetCommand insets
5448 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5449 FormCommand base class
5450 * src/frontends/xforms/FormUrl.[Ch]: ditto
5452 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5454 * src/frontends/xforms/FormToc.[Ch]: ditto
5456 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5457 passed a generic InsetCommand pointer
5458 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5460 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5461 and modified InsetTOC class
5462 * src/buffer.C: ditto
5464 * forms/lyx.fd: strip out old FD_form_toc code
5465 * src/lyx_gui_misc.C: ditto
5466 * src/lyx_gui.C: ditto
5467 * src/lyx_cb.C: ditto
5468 * src/lyx.[Ch]: ditto
5470 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5472 * src/support/utility.hpp: tr -d '\r'
5474 2000-08-01 Juergen Vigna <jug@sad.it>
5476 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5478 * src/commandtags.h:
5479 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5480 LFUN_TABULAR_FEATURES.
5482 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5483 LFUN_LAYOUT_TABULAR.
5485 * src/insets/insettabular.C (getStatus): implemented helper function.
5487 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5489 2000-07-31 Juergen Vigna <jug@sad.it>
5491 * src/text.C (draw): fixed screen update problem for text-insets.
5493 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5494 something changed probably this has to be added in various other
5497 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5499 2000-07-31 Baruch Even <baruch.even@writeme.com>
5501 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5502 templates to satisfy compaq cxx.
5505 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5507 * src/support/translator.h (equal_1st_in_pair::operator()): take
5508 const ref pair_type as arg.
5509 (equal_2nd_in_pair::operator()): ditto
5510 (Translator::~Translator): remove empty d-tor.
5512 * src/graphics/GraphicsCache.C: move include config.h to top, also
5513 put initialization of GraphicsCache::singleton here.
5514 (~GraphicsCache): move here
5515 (addFile): take const ref as arg
5518 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5520 * src/BufferView2.C (insertLyXFile): change te with/without header
5523 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5525 * src/frontends/xforms/FormGraphics.C (apply): add some
5526 static_cast. Not very nice, but required by compaq cxx.
5528 * src/frontends/xforms/RadioButtonGroup.h: include header
5529 <utility> instead of <pair.h>
5531 * src/insets/insetgraphicsParams.C: add using directive.
5532 (readResize): change return type to void.
5533 (readOrigin): ditto.
5535 * src/lyxfunc.C (getStatus): add missing break for build-program
5536 function; add test for Literate for export functions.
5538 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5539 entries in Options menu.
5541 2000-07-31 Baruch Even <baruch.even@writeme.com>
5543 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5544 protect against auto-allocation; release icon when needed.
5546 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5548 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5549 on usual typewriter.
5551 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5552 earlier czech.kmap), useful only for programming.
5554 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5556 * src/frontends/xforms/FormCitation.h: fix conditioning around
5559 2000-07-31 Juergen Vigna <jug@sad.it>
5561 * src/frontends/xforms/FormTabular.C (local_update): changed
5562 radio_linebreaks to radio_useparbox and added radio_useminipage.
5564 * src/tabular.C: made support for using minipages/parboxes.
5566 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5568 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5570 (descent): so the cursor is in the middle.
5571 (width): bit smaller box.
5573 * src/insets/insetgraphics.h: added display() function.
5575 2000-07-31 Baruch Even <baruch.even@writeme.com>
5577 * src/frontends/Dialogs.h: Added showGraphics signals.
5579 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5580 xforms form definition of the graphics dialog.
5582 * src/frontends/xforms/FormGraphics.h:
5583 * src/frontends/xforms/FormGraphics.C: Added files, the
5584 GUIndependent code of InsetGraphics
5586 * src/insets/insetgraphics.h:
5587 * src/insets/insetgraphics.C: Major writing to make it work.
5589 * src/insets/insetgraphicsParams.h:
5590 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5591 struct between InsetGraphics and GUI.
5593 * src/LaTeXFeatures.h:
5594 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5595 support for graphicx package.
5597 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5598 for the graphics inset.
5600 * src/support/translator.h: Added file, used in
5601 InsetGraphicsParams. this is a template to translate between two
5604 * src/frontends/xforms/RadioButtonGroup.h:
5605 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5606 way to easily control a radio button group.
5608 2000-07-28 Juergen Vigna <jug@sad.it>
5610 * src/insets/insettabular.C (LocalDispatch):
5611 (TabularFeatures): added support for lyx-functions of tabular features.
5612 (cellstart): refixed this function after someone wrongly changed it.
5614 * src/commandtags.h:
5615 * src/LyXAction.C (init): added support for tabular-features
5617 2000-07-28 Allan Rae <rae@lyx.org>
5619 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5620 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5621 triggers the callback for input checking. As a result we sometimes get
5622 "LyX: This shouldn't happen..." printed to cerr.
5623 (input): Started using status variable since I only free() on
5624 destruction. Some input checking for paths and font sizes.
5626 * src/frontends/xforms/FormPreferences.h: Use status to control
5627 activation of Ok and Apply
5629 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5630 callback. Also resized to stop segfaults with 0.88. The problem is
5631 that xforms-0.88 requires the folder to be wide enough to fit all the
5632 tabs. If it isn't it causes all sorts of problems.
5634 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5636 * src/frontends/xforms/forms/README: Reflect reality.
5638 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5639 * src/frontends/xforms/forms/makefile: ditto.
5641 * src/commandtags.h: Get access to new Preferences dialog
5642 * src/LyXAction.C: ditto
5643 * src/lyxfunc.C: ditto
5644 * lib/ui/default.ui: ditto
5646 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5648 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5650 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5653 * src/frontends/xforms/form_url.[Ch]: added.
5655 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5657 * src/insets/insetbib.h: fixed bug in previous commit
5659 * src/frontends/xforms/FormUrl.h: ditto
5661 * src/frontends/xforms/FormPrint.h: ditto
5663 * src/frontends/xforms/FormPreferences.h: ditto
5665 * src/frontends/xforms/FormCopyright.h: ditto
5667 * src/frontends/xforms/FormCitation.C: ditto
5669 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5670 private copyconstructor and private default contructor
5672 * src/support/Makefile.am: add utility.hpp
5674 * src/support/utility.hpp: new file from boost
5676 * src/insets/insetbib.h: set owner in clone
5678 * src/frontends/xforms/FormCitation.C: added missing include
5681 * src/insets/form_url.[Ch]: removed
5683 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5685 * development/lyx.spec.in
5686 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5687 file/directory re-organization.
5689 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5691 * src/insets/insetcommand.[Ch]: moved the string data and
5692 associated manipulation methods into a new stand-alone class
5693 InsetCommandParams. This class has two additional methods
5694 getAsString() and setFromString() allowing the contents to be
5695 moved around as a single string.
5696 (addContents) method removed.
5697 (setContents) method no longer virtual.
5699 * src/buffer.C (readInset): made use of new InsetCitation,
5700 InsetUrl constructors based on InsetCommandParams.
5702 * src/commandtags.h: add LFUN_INSERT_URL
5704 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5705 independent InsetUrl and use InsetCommandParams to extract
5706 string info and create new Insets.
5708 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5710 * src/frontends/xforms/FormCitation.C (apply): uses
5713 * src/frontends/xforms/form_url.C
5714 * src/frontends/xforms/form_url.h
5715 * src/frontends/xforms/FormUrl.h
5716 * src/frontends/xforms/FormUrl.C
5717 * src/frontends/xforms/forms/form_url.fd: new files
5719 * src/insets/insetcite.[Ch]: removed unused constructors.
5721 * src/insets/insetinclude.[Ch]: no longer store filename
5723 * src/insets/inseturl.[Ch]: GUI-independent.
5725 2000-07-26 Juergen Vigna <jug@sad.it>
5726 * renamed frontend from gtk to gnome as it is that what is realized
5727 and did the necessary changes in the files.
5729 2000-07-26 Marko Vendelin <markov@ioc.ee>
5731 * configure.in: cleaning up gnome configuration scripts
5733 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5735 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5736 shortcuts syndrom by redrawing them explicitely (a better solution
5737 would be appreciated).
5739 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5741 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5744 * src/lyx_cb.C (MenuExport): change html export to do the right
5745 thing depending of the document type (instead of having
5746 html-linuxdoc and html-docbook).
5747 * src/lyxfunc.C (getStatus): update for html
5748 * lib/ui/default.ui: simplify due to the above change.
5749 * src/menus.C (ShowFileMenu): update too (in case we need it).
5751 * src/MenuBackend.C (read): if a menu is defined twice, add the
5752 new entries to the exiting one.
5754 2000-07-26 Juergen Vigna <jug@sad.it>
5756 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5758 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5759 and return a bool if it did actual save the file.
5760 (AutoSave): don't autosave a unnamed doc.
5762 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5763 check if this is an UNNAMED new file and react to it.
5764 (newFile): set buffer to unnamed and change to not mark a new
5765 buffer dirty if I didn't do anything with it.
5767 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5769 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5771 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5772 friend as per Angus's patch posted to lyx-devel.
5774 * src/ext_l10n.h: updated
5776 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5777 gettext on the style string right before inserting them into the
5780 * autogen.sh: add code to extract style strings form layout files,
5781 not good enough yet.
5783 * src/frontends/gtk/.cvsignore: add MAKEFILE
5785 * src/MenuBackend.C (read): run the label strings through gettext
5786 before storing them in the containers.
5788 * src/ext_l10n.h: new file
5790 * autogen.sh : generate the ext_l10n.h file here
5792 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5794 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5797 * lib/ui/default.ui: fix a couple of typos.
5799 * config/gnome/gtk.m4: added (and added to the list of files in
5802 * src/insets/insetinclude.C (unique_id): fix when we are using
5803 lyxstring instead of basic_string<>.
5804 * src/insets/insettext.C (LocalDispatch): ditto.
5805 * src/support/filetools.C: ditto.
5807 * lib/configure.m4: create the ui/ directory if necessary.
5809 * src/LyXView.[Ch] (updateToolbar): new method.
5811 * src/BufferView_pimpl.C (buffer): update the toolbar when
5812 opening/closing buffer.
5814 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5816 * src/LyXAction.C (getActionName): enhance to return also the name
5817 and options of pseudo-actions.
5818 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5820 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5821 as an example of what is possible). Used in File->Build too (more
5822 useful) and in the import/export menus (to mimick the complicated
5823 handling of linuxdoc and friends). Try to update all the entries.
5825 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5828 * src/MenuBackend.C (read): Parse the new OptItem tag.
5830 * src/MenuBackend.h: Add a new optional_ data member (used if the
5831 entry should be omitted when the lyxfunc is disabled).
5833 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5834 function, used as a shortcut.
5835 (create_submenu): align correctly the shortcuts on the widest
5838 * src/MenuBackend.h: MenuItem.label() only returns the label of
5839 the menu without shortcut; new method shortcut().
5841 2000-07-14 Marko Vendelin <markov@ioc.ee>
5843 * src/frontends/gtk/Dialogs.C:
5844 * src/frontends/gtk/FormCopyright.C:
5845 * src/frontends/gtk/FormCopyright.h:
5846 * src/frontends/gtk/Makefile.am: added these source-files for the
5847 Gtk/Gnome support of the Copyright-Dialog.
5849 * src/main.C: added Gnome::Main initialization if using
5850 Gtk/Gnome frontend-GUI.
5852 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5854 * config/gnome/aclocal-include.m4
5855 * config/gnome/compiler-flags.m4
5856 * config/gnome/curses.m4
5857 * config/gnome/gnome--.m4
5858 * config/gnome/gnome-bonobo-check.m4
5859 * config/gnome/gnome-common.m4
5860 * config/gnome/gnome-fileutils.m4
5861 * config/gnome/gnome-ghttp-check.m4
5862 * config/gnome/gnome-gnorba-check.m4
5863 * config/gnome/gnome-guile-checks.m4
5864 * config/gnome/gnome-libgtop-check.m4
5865 * config/gnome/gnome-objc-checks.m4
5866 * config/gnome/gnome-orbit-check.m4
5867 * config/gnome/gnome-print-check.m4
5868 * config/gnome/gnome-pthread-check.m4
5869 * config/gnome/gnome-support.m4
5870 * config/gnome/gnome-undelfs.m4
5871 * config/gnome/gnome-vfs.m4
5872 * config/gnome/gnome-x-checks.m4
5873 * config/gnome/gnome-xml-check.m4
5874 * config/gnome/gnome.m4
5875 * config/gnome/gperf-check.m4
5876 * config/gnome/gtk--.m4
5877 * config/gnome/linger.m4
5878 * config/gnome/need-declaration.m4: added configuration scripts
5879 for Gtk/Gnome frontend-GUI
5881 * configure.in: added support for the --with-frontend=gtk option
5883 * autogen.sh: added config/gnome/* to list of config-files
5885 * acconfig.h: added define for GTKGUI-support
5887 * config/lyxinclude.m4: added --with-frontend[=value] option value
5888 for Gtk/Gnome frontend-GUI support.
5890 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5892 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5896 * src/paragraph.C (GetChar): remove non-const version
5898 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5899 (search_kw): use it.
5901 * src/lyx_main.C (init): if "preferences" exist, read that instead
5903 (ReadRcFile): return bool if the file could be read ok.
5904 (ReadUIFile): add a check to see if lex file is set ok.
5906 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5907 bastring can be used instead of lyxstring (still uses the old code
5908 if std::string is good enough or if lyxstring is used.)
5910 * src/encoding.C: make the arrays static, move ininle functions
5912 * src/encoding.h: from here.
5914 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5915 (parseSingleLyXformat2Token): move inset parsing to separate method
5916 (readInset): new private method
5918 * src/Variables.h: remove virtual from get().
5920 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5921 access to NEW_INSETS and NEW_TABULAR
5923 * src/MenuBackend.h: remove superfluous forward declaration of
5924 MenuItem. Add documentations tags "///", remove empty MenuItem
5925 destructor, remove private default contructor.
5927 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5929 (read): more string mlabel and mname to where they are used
5930 (read): remove unused variables mlabel and mname
5931 (defaults): unconditional clear, make menusetup take advantage of
5932 add returning Menu &.
5934 * src/LyXView.h: define NEW_MENUBAR as default
5936 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5937 to NEW_INSETS and NEW_TABULAR.
5938 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5939 defined. Change some of the "xxxx-inset-insert" functions names to
5942 * several files: more enahncements to NEW_INSETS and the resulting
5945 * lib/lyxrc.example (\date_insert_format): move to misc section
5947 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5948 bastring and use AC_CACHE_CHECK.
5949 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5950 the system have the newest methods. uses AC_CACHE_CHECK
5951 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5952 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5953 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5955 * configure.in: add LYX_CXX_GOOD_STD_STRING
5957 * acinclude.m4: recreated
5959 2000-07-24 Amir Karger <karger@lyx.org>
5961 * README: add Hebrew, Arabic kmaps
5964 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5966 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5969 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5971 * Lot of files: add pragma interface/implementation.
5973 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5975 * lib/ui/default.ui: new file (ans new directory). Contains the
5976 default menu and toolbar.
5978 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5979 global space. Toolbars are now read (as menus) in ui files.
5981 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5983 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5984 is disabled because the document is read-only. We want to have the
5985 toggle state of the function anyway.
5986 (getStatus): add code for LFUN_VC* functions (mimicking what is
5987 done in old-style menus)
5989 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5990 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5992 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5993 * src/BufferView_pimpl.C: ditto.
5994 * src/lyxfunc.C: ditto.
5996 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5997 default). This replaces old-style menus by new ones.
5999 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
6000 MenuItem. Contain the data structure of a menu.
6002 * src/insets/insettext.C: use LyXView::setLayout instead of
6003 accessing directly the toolbar combox.
6004 * src/lyxfunc.C (Dispatch): ditto.
6006 * src/LyXView.C (setLayout): new method, which just calls
6007 Toolbar::setLayout().
6008 (updateLayoutChoice): move part of this method in Toolbar.
6010 * src/toolbar.[Ch]: removed.
6012 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
6013 implementation the toolbar.
6015 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
6016 the toolbar. It might make sense to merge it with ToolbarDefaults
6018 (setLayout): new function.
6019 (updateLayoutList): ditto.
6020 (openLayoutList): ditto.
6022 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
6023 xforms implementation of the toolbar.
6024 (get_toolbar_func): comment out, since I do not
6025 know what it is good for.
6027 * src/ToolbarDefaults.h: Add the ItemType enum.
6029 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
6030 for a list of allocated C strings. Used in Menubar xforms
6031 implementation to avoid memory leaks.
6033 * src/support/lstrings.[Ch] (uppercase): new version taking and
6037 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
6038 * lib/bind/emacs.bind: ditto.
6040 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6042 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
6043 forward decl of LyXView.
6045 * src/toolbar.C (toolbarItem): moved from toolbar.h
6046 (toolbarItem::clean): ditto
6047 (toolbarItem::~toolbarItem): ditto
6048 (toolbarItem::operator): ditto
6050 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
6052 * src/paragraph.h: control the NEW_TABULAR define from here
6054 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
6055 USE_TABULAR_INSETS to NEW_TABULAR
6057 * src/ToolbarDefaults.C: add include "lyxlex.h"
6059 * files using the old table/tabular: use NEW_TABULAR to control
6060 compilation of old tabular stuff.
6062 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
6065 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
6066 planemet in reading of old style floats, fix the \end_deeper
6067 problem when reading old style floats.
6069 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6071 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
6073 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
6075 * lib/bind/sciword.bind: updated.
6077 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6079 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
6080 layout write problem
6082 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6084 * src/Makefile.am (INCLUDES): remove image directory from include
6087 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
6088 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
6090 * src/LyXView.C (create_form_form_main): read the application icon
6093 * lib/images/*.xpm: change the icons to use transparent color for
6096 * src/toolbar.C (update): change the color of the button when it
6099 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6101 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
6102 setting explicitely the minibuffer.
6103 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
6105 * src/LyXView.C (showState): new function. Shows font information
6106 in minibuffer and update toolbar state.
6107 (LyXView): call Toolbar::update after creating the
6110 * src/toolbar.C: change toollist to be a vector instead of a
6112 (BubbleTimerCB): get help string directly from the callback
6113 argument of the corresponding icon (which is the action)
6114 (set): remove unnecessary ugliness.
6115 (update): new function. update the icons (depressed, disabled)
6116 depending of the status of the corresponding action.
6118 * src/toolbar.h: remove help in toolbarItem
6120 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
6122 * src/Painter.C (text): Added code for using symbol glyphs from
6123 iso10646 fonts. Currently diabled.
6125 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
6128 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
6129 magyar,turkish and usorbian.
6131 * src/paragraph.C (isMultiLingual): Made more efficient.
6133 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
6136 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
6137 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
6138 Also changed the prototype to "bool math_insert_greek(char)".
6140 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6142 * lots of files: apply the NEW_INSETS on all code that will not be
6143 needed when we move to use the new insets. Enable the define in
6144 lyxparagrah.h to try it.
6146 * src/insets/insettabular.C (cellstart): change to be a static
6148 (InsetTabular): initialize buffer in the initializer list.
6150 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6152 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6153 form_print.h out of the header file. Replaced with forward
6154 declarations of the relevant struct.
6156 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6159 * src/commandtags.h: do not include "debug.h" which does not
6160 belong there. #include it in some other places because of this
6163 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6165 * src/insets/insetcaption.C: add a couple "using" directives.
6167 * src/toolbar.C (add): get the help text directly from lyxaction.
6169 (setPixmap): new function. Loads from disk and sets a pixmap on a
6170 botton; the name of the pixmap file is derived from the command
6173 * src/toolbar.h: remove members isBitmap and pixmap from
6176 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6177 * lib/images/: move many files from images/banner.xpm.
6179 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6181 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6182 * src/toolbar.C: ditto.
6183 * configure.in: ditto.
6184 * INSTALL: document.
6186 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6187 the spellchecker popup is closed from the WM.
6189 2000-07-19 Juergen Vigna <jug@sad.it>
6191 * src/insets/insetfloat.C (Write): small fix because we use the
6192 insetname for the type now!
6194 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6196 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6199 * src/frontends/Dialogs.h: removed hideCitation signal
6201 * src/insets/insetcite.h: added hide signal
6203 * src/insets/insetcite.C (~InsetCitation): emits new signal
6204 (getScreenLabel): "intelligent" label should now fit on the screen!
6206 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6208 * src/frontends/xforms/FormCitation.C (showInset): connects
6209 hide() to the inset's hide signal
6210 (show): modified to use fl_set_object_position rather than
6211 fl_set_object_geometry wherever possible
6213 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6215 * src/insets/lyxinset.h: add caption code
6217 * src/insets/insetfloat.C (type): new method
6219 * src/insets/insetcaption.C (Write): new method
6221 (LyxCode): new method
6223 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6224 to get it right together with using the FloatList.
6226 * src/commandtags.h: add LFUN_INSET_CAPTION
6227 * src/lyxfunc.C (Dispatch): handle it
6229 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6232 * src/Variables.[Ch]: make expand take a const reference, remove
6233 the destructor, some whitespace changes.
6235 * src/LyXAction.C (init): add caption-inset-insert
6237 * src/FloatList.C (FloatList): update the default floats a bit.
6239 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6241 * src/Variables.[Ch]: new files. Intended to be used for language
6242 specific strings (like \chaptername) and filename substitution in
6245 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6247 * lib/kbd/american.kmap: update
6249 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6251 * src/bufferparams.[Ch]: remove member allowAccents.
6253 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6255 * src/LaTeXLog.C: use the log_form.h header.
6256 * src/lyx_gui.C: ditto.
6257 * src/lyx_gui_misc.C: ditto.
6258 * src/lyxvc.h: ditto.
6260 * forms/log_form.fd: new file, created from latexoptions.fd. I
6261 kept the log popup and nuked the options form.
6263 * src/{la,}texoptions.[Ch]: removed.
6264 * src/lyx_cb.C (LaTeXOptions): ditto
6266 * src/lyx_gui.C (create_forms): do not handle the
6267 fd_latex_options form.
6269 2000-07-18 Juergen Vigna <jug@sad.it>
6271 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6272 name of the inset so that it can be requested outside (text2.C).
6274 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6277 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6279 * src/mathed/formula.h (ConvertFont): constify
6281 * src/mathed/formula.C (Read): add warning if \end_inset is not
6282 found on expected place.
6284 * src/insets/lyxinset.h (ConvertFont): consify
6286 * src/insets/insetquotes.C (ConvertFont): constify
6287 * src/insets/insetquotes.h: ditto
6289 * src/insets/insetinfo.h: add labelfont
6291 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6292 (ascent): use labelfont
6296 (Write): make .lyx file a bit nicer
6298 * src/insets/insetfloat.C (Write): simplify somewhat...
6299 (Read): add warning if arg is not found
6301 * src/insets/insetcollapsable.C: add using std::max
6302 (Read): move string token and add warning in arg is not found
6303 (draw): use std::max to get the right ty
6304 (getMaxWidth): simplify by using std::max
6306 * src/insets/insetsection.h: new file
6307 * src/insets/insetsection.C: new file
6308 * src/insets/insetcaption.h: new file
6309 * src/insets/insetcaption.C: new file
6311 * src/insets/inset.C (ConvertFont): constify signature
6313 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6314 insetcaption.[Ch] and insetsection.[Ch]
6316 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6317 uses to use LABEL_COUNTER_CHAPTER instead.
6318 * src/text2.C (SetCounter): here
6320 * src/counters.h: new file
6321 * src/counters.C: new file
6322 * src/Sectioning.h: new file
6323 * src/Sectioning.C: new file
6325 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6327 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6329 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6332 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6335 2000-07-17 Juergen Vigna <jug@sad.it>
6337 * src/tabular.C (Validate): check if array-package is needed.
6338 (SetVAlignment): added support for vertical alignment.
6339 (SetLTFoot): better support for longtable header/footers
6340 (Latex): modified to support added features.
6342 * src/LaTeXFeatures.[Ch]: added array-package.
6344 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6346 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6349 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6351 * configure.in: do not forget to put a space after -isystem.
6353 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6355 * lib/kbd/arabic.kmap: a few fixes.
6357 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6359 * some whitespace chagnes to a number of files.
6361 * src/support/DebugStream.h: change to make it easier for
6362 doc++ to parse correctly.
6363 * src/support/lyxstring.h: ditto
6365 * src/mathed/math_utils.C (compara): change to have only one
6367 (MathedLookupBOP): change because of the above.
6369 * src/mathed/math_delim.C (math_deco_compare): change to have only
6371 (search_deco): change becasue of the above.
6373 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6374 instead of manually coded one.
6376 * src/insets/insetquotes.C (Read): read the \end_inset too
6378 * src/insets/insetlatex.h: remove file
6379 * src/insets/insetlatex.C: remove file
6381 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6383 (InsetPrintIndex): remove destructor
6385 * src/insets/insetinclude.h: remove default constructor
6387 * src/insets/insetfloat.C: work to make it work better
6389 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6391 * src/insets/insetcite.h (InsetCitation): remove default constructor
6393 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6395 * src/text.C (GetColumnNearX): comment out some currently unused code.
6397 * src/paragraph.C (writeFile): move some initializations closer to
6399 (CutIntoMinibuffer): small change to use new matchIT operator
6403 (InsertInset): ditto
6406 (InsetIterator): ditto
6407 (Erase): small change to use new matchFT operator
6409 (GetFontSettings): ditto
6410 (HighestFontInRange): ditto
6413 * src/lyxparagraph.h: some chars changed to value_type
6414 (matchIT): because of some stronger checking (perhaps too strong)
6415 in SGI STL, the two operator() unified to one.
6418 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6420 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6421 the last inset read added
6422 (parseSingleLyXformat2Token): some more (future) compability code added
6423 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6424 (parseSingleLyXformat2Token): set last_inset_read
6425 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6426 (parseSingleLyXformat2Token): don't double intializw string next_token
6428 * src/TextCache.C (text_fits::operator()): add const's to the signature
6429 (has_buffer::operator()): ditto
6431 * src/Floating.h: add some comments on the class
6433 * src/FloatList.[Ch] (typeExist): new method
6436 * src/BackStack.h: added default constructor, wanted by Gcc.
6438 2000-07-14 Juergen Vigna <jug@sad.it>
6440 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6442 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6444 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6445 do a redraw when the window is resized!
6446 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6448 * src/insets/insettext.C (resizeLyXText): added function to correctly
6449 being able to resize the LyXWindow.
6451 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6453 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6455 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6456 crashes when closing dialog to a deleted inset.
6458 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6459 method! Now similar to other insets.
6461 2000-07-13 Juergen Vigna <jug@sad.it>
6463 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6465 * lib/examples/Literate.lyx: small patch!
6467 * src/insets/insetbib.C (Read): added this function because of wrong
6468 Write (without [begin|end]_inset).
6470 2000-07-11 Juergen Vigna <jug@sad.it>
6472 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6473 as the insertInset could not be good!
6475 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6476 the bool param should not be last.
6478 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6480 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6481 did submit that to Karl).
6483 * configure.in: use -isystem instead of -I for X headers. This
6484 fixes a problem on solaris with a recent gcc;
6485 put the front-end code after the X detection code;
6486 configure in sigc++ before lib/
6488 * src/lyx_main.C (commandLineHelp): remove -display from command
6491 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6493 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6494 Also put in Makefile rules for building the ``listerrors''
6495 program for parsing errors from literate programs written in LyX.
6497 * lib/build-listerrors: Added small shell script as part of compile
6498 process. This builds a working ``listerrors'' binary if noweb is
6499 installed and either 1) the VNC X server is installed on the machine,
6500 or 2) the user is compiling from within a GUI. The existence of a GUI
6501 is necessary to use the ``lyx --export'' feature for now. This
6502 hack can be removed once ``lyx --export'' no longer requires a GUI to
6505 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6507 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6508 now passed back correctly from gcc and placed "under" error
6509 buttons in a Literate LyX source.
6511 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6513 * src/text.C (GetColumnNearX): Better behavior when a RTL
6514 paragraph is ended by LTR text.
6516 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6519 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6521 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6522 true when clipboard is empty.
6524 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6526 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6527 row of the paragraph.
6528 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6529 to prevent calculation of bidi tables
6531 2000-07-07 Juergen Vigna <jug@sad.it>
6533 * src/screen.C (ToggleSelection): added y_offset and x_offset
6536 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6539 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6541 * src/insets/insettext.C: fixed Layout-Display!
6543 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6545 * configure.in: add check for strings.h header.
6547 * src/spellchecker.C: include <strings.h> in order to have a
6548 definition for bzero().
6550 2000-07-07 Juergen Vigna <jug@sad.it>
6552 * src/insets/insettext.C (draw): set the status of the bv->text to
6553 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6555 * src/screen.C (DrawOneRow):
6556 (DrawFromTo): redraw the actual row if something has changed in it
6559 * src/text.C (draw): call an update of the toplevel-inset if something
6560 has changed inside while drawing.
6562 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6564 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6566 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6567 processing inside class.
6569 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6570 processing inside class.
6572 * src/insets/insetindex.h new struct Holder, consistent with other
6575 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6576 citation dialog from main code and placed it in src/frontends/xforms.
6577 Dialog launched through signals instead of callbacks
6579 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6581 * lyx.man: update the options description.
6583 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6585 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6586 handle neg values, set min width to 590, add doc about -display
6588 2000-07-05 Juergen Vigna <jug@sad.it>
6590 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6591 calls to BufferView *.
6593 * src/insets/insettext.C (checkAndActivateInset): small fix non
6594 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6596 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6597 their \end_inset token!
6599 2000-07-04 edscott <edscott@imp.mx>
6601 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6602 lib/lyxrc.example: added option \wheel_jump
6604 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6606 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6607 remove support for -width,-height,-xpos and -ypos.
6609 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6611 * src/encoding.[Ch]: New files.
6613 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6614 (text): Call to the underline() method only when needed.
6616 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6618 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6619 encoding(s) for the document.
6621 * src/bufferparams.C (BufferParams): Changed default value of
6624 * src/language.C (newLang): Removed.
6625 (items[]): Added encoding information for all defined languages.
6627 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6628 encoding choice button.
6630 * src/lyxrc.h (font_norm_type): New member variable.
6631 (set_font_norm_type): New method.
6633 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6634 paragraphs with different encodings.
6636 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6637 (TransformChar): Changed to work correctly with Arabic points.
6638 (draw): Added support for drawing Arabic points.
6639 (draw): Removed code for drawing underbars (this is done by
6642 * src/support/textutils.h (IsPrintableNonspace): New function.
6644 * src/BufferView_pimpl.h: Added "using SigC::Object".
6645 * src/LyXView.h: ditto.
6647 * src/insets/insetinclude.h (include_label): Changed to mutable.
6649 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6651 * src/mathed/math_iter.h: remove empty destructor
6653 * src/mathed/math_cursor.h: remove empty destructor
6655 * src/insets/lyxinset.h: add THEOREM_CODE
6657 * src/insets/insettheorem.[Ch]: new files
6659 * src/insets/insetminipage.C: (InsertInset): remove
6661 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6663 (InsertInset): remove
6665 * src/insets/insetlist.C: (InsertList): remove
6667 * src/insets/insetfootlike.[Ch]: new files
6669 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6672 (InsertInset): ditto
6674 * src/insets/insetert.C: remove include Painter.h, reindent
6675 (InsertInset): move to header
6677 * src/insets/insetcollapsable.h: remove explicit from default
6678 contructor, remove empty destructor, add InsertInset
6680 * src/insets/insetcollapsable.C (InsertInset): new func
6682 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6684 * src/vspace.h: add explicit to constructor
6686 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6687 \textcompwordmark, please test this.
6689 * src/lyxrc.C: set ascii_linelen to 65 by default
6691 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6693 * src/commandtags.h: add LFUN_INSET_THEOREM
6695 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6696 (makeLinuxDocFile): remove _some_ of the nice logic
6697 (makeDocBookFile): ditto
6699 * src/Painter.[Ch]: (~Painter): removed
6701 * src/LyXAction.C (init): entry for insettheorem added
6703 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6705 (deplog): code to detect files generated by LaTeX, needs testing
6708 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6710 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6712 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6714 * src/LaTeX.C (deplog): Add a check for files that are going to be
6715 created by the first latex run, part of the project to remove the
6718 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6719 contents to the extension list.
6721 2000-07-04 Juergen Vigna <jug@sad.it>
6723 * src/text.C (NextBreakPoint): added support for needFullRow()
6725 * src/insets/lyxinset.h: added needFullRow()
6727 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6730 * src/insets/insettext.C: lots of changes for update!
6732 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6734 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6736 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6738 * src/insets/insetinclude.C (InsetInclude): fixed
6739 initialization of include_label.
6740 (unique_id): now returns a string.
6742 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6744 * src/LaTeXFeatures.h: new member IncludedFiles, for
6745 a map of key, included file name.
6747 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6748 with the included files for inclusion in SGML preamble,
6749 i. e., linuxdoc and docbook.
6752 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6753 nice (is the generated linuxdoc code to be exported?), that
6754 allows to remove column, and only_body that will be true for
6755 slave documents. Insets are allowed inside SGML font type.
6756 New handling of the SGML preamble for included files.
6757 (makeDocBookFile): the same for docbook.
6759 * src/insets/insetinclude.h:
6760 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6762 (DocBook): new export methods.
6764 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6765 and makeDocBookFile.
6767 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6768 formats to export with command line argument -x.
6770 2000-06-29 Juergen Vigna <jug@sad.it>
6772 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6773 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6775 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6776 region could already been cleared by an inset!
6778 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6780 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6783 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6785 (cursorToggle): remove special handling of lyx focus.
6787 2000-06-28 Juergen Vigna <jug@sad.it>
6789 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6792 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6794 * src/insets/insetindex.C (Edit): add a callback when popup is
6797 * src/insets/insettext.C (LocalDispatch):
6798 * src/insets/insetmarginal.h:
6799 * src/insets/insetlist.h:
6800 * src/insets/insetfoot.h:
6801 * src/insets/insetfloat.h:
6802 * src/insets/insetert.h: add a missing std:: qualifier.
6804 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6806 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6809 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6811 * src/insets/insettext.C (Read): remove tmptok unused variable
6812 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6813 (InsertInset): change for new InsetInset code
6815 * src/insets/insettext.h: add TEXT inline method
6817 * src/insets/insettext.C: remove TEXT macro
6819 * src/insets/insetmarginal.C (Write): new method
6820 (Latex): change output slightly
6822 * src/insets/insetfoot.C (Write): new method
6823 (Latex): change output slightly (don't use endl when no need)
6825 * src/insets/insetert.C (Write): new method
6827 * src/insets/insetcollapsable.h: make button_length, button_top_y
6828 and button_bottm_y protected.
6830 * src/insets/insetcollapsable.C (Write): simplify code by using
6831 tostr. Also do not output the float name, the children class
6832 should to that to get control over own arguments
6834 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6835 src/insets/insetminipage.[Ch]:
6838 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6840 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6842 * src/Makefile.am (lyx_SOURCES): add the new files
6844 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6845 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6846 * src/commandtags.h: ditto
6848 * src/LaTeXFeatures.h: add a std::set of used floattypes
6850 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6852 * src/FloatList.[Ch] src/Floating.h: new files
6854 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6856 * src/lyx_cb.C (TableApplyCB): ditto
6858 * src/text2.C: ditto
6859 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6860 (parseSingleLyXformat2Token): ditto + add code for
6861 backwards compability for old float styles + add code for new insets
6863 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6865 (InsertInset(size_type, Inset *, LyXFont)): new method
6866 (InsetChar(size_type, char)): changed to use the other InsetChar
6867 with a LyXFont(ALL_INHERIT).
6868 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6869 insert the META_INSET.
6871 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6873 * sigc++/thread.h (Threads): from here
6875 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6876 definition out of line
6877 * sigc++/scope.h: from here
6879 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6881 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6882 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6884 * Makefile.am (bindist): new target.
6886 * INSTALL: add instructions for doing a binary distribution.
6888 * development/tools/README.bin.example: update a bit.
6890 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6893 * lib/lyxrc.example: new lyxrc tag \set_color.
6895 * src/lyxfunc.C (Dispatch):
6896 * src/commandtags.h:
6897 * src/LyXAction.C: new lyxfunc "set-color".
6899 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6900 and an x11name given as strings.
6902 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6903 cache when a color is changed.
6905 2000-06-26 Juergen Vigna <jug@sad.it>
6907 * src/lyxrow.C (width): added this functions and variable.
6909 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6912 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6914 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6916 * images/undo_bw.xpm: new icon.
6917 * images/redo_bw.xpm: ditto.
6919 * configure.in (INSTALL_SCRIPT): change value to
6920 ${INSTALL} to avoid failures of install-script target.
6921 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6923 * src/BufferView.h: add a magic "friend" declaration to please
6926 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6928 * forms/cite.fd: modified to allow resizing without messing
6931 * src/insetcite.C: Uses code from cite.fd almost without
6933 User can now resize dialog in the x-direction.
6934 Resizing the dialog in the y-direction is prevented, as the
6935 code does this intelligently already.
6937 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6939 * INSTALL: remove obsolete entry in "problems" section.
6941 * lib/examples/sl_*.lyx: update of the slovenian examples.
6943 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6945 2000-06-23 Juergen Vigna <jug@sad.it>
6947 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6949 * src/buffer.C (resize): delete the LyXText of textinsets.
6951 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6953 * src/insets/lyxinset.h: added another parameter 'cleared' to
6954 the draw() function.
6956 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6957 unlocking inset in inset.
6959 2000-06-22 Juergen Vigna <jug@sad.it>
6961 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6962 of insets and moved first to LyXText.
6964 * src/mathed/formulamacro.[Ch]:
6965 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6967 2000-06-21 Juergen Vigna <jug@sad.it>
6969 * src/text.C (GetVisibleRow): look if I should clear the area or not
6970 using Inset::doClearArea() function.
6972 * src/insets/lyxinset.h: added doClearArea() function and
6973 modified draw(Painter &, ...) to draw(BufferView *, ...)
6975 * src/text2.C (UpdateInset): return bool insted of int
6977 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6979 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6980 combox in the character popup
6982 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6983 BufferParams const & params
6985 2000-06-20 Juergen Vigna <jug@sad.it>
6987 * src/insets/insettext.C (SetParagraphData): set insetowner on
6990 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6992 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6993 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6995 (form_main_): remove
6997 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6998 (create_form_form_main): remove FD_form_main stuff, connect to
6999 autosave_timeout signal
7001 * src/LyXView.[Ch] (getMainForm): remove
7002 (UpdateTimerCB): remove
7003 * src/BufferView_pimpl.h: inherit from SigC::Object
7005 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
7006 signal instead of callback
7008 * src/BufferView.[Ch] (cursorToggleCB): remove
7010 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7012 * src/BufferView_pimpl.C: changes because of the one below
7014 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
7015 instead of storing a pointer to a LyXText.
7017 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
7019 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
7021 * src/lyxparagraph.h
7023 * src/paragraph.C: Changed fontlist to a sorted vector.
7025 2000-06-19 Juergen Vigna <jug@sad.it>
7027 * src/BufferView.h: added screen() function.
7029 * src/insets/insettext.C (LocalDispatch): some selection code
7032 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
7034 * src/insets/insettext.C (SetParagraphData):
7036 (InsetText): fixes for multiple paragraphs.
7038 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
7040 * development/lyx.spec.in: Call configure with ``--without-warnings''
7041 to work around a bug with the Makefiles when doing ``make lyxrpm''.
7042 This should be fine, however, since we generally don't want to be
7043 verbose when making an RPM.
7045 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
7047 * lib/scripts/fig2pstex.py: New file
7049 2000-06-16 Juergen Vigna <jug@sad.it>
7051 * src/insets/insettabular.C (UpdateLocal):
7052 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
7053 (LocalDispatch): Changed all functions to use LyXText.
7055 2000-06-15 Juergen Vigna <jug@sad.it>
7057 * src/text.C (SetHeightOfRow): call inset::update before requesting
7060 * src/insets/insettext.C (update):
7061 * src/insets/insettabular.C (update): added implementation
7063 * src/insets/lyxinset.h: added update function
7065 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7067 * src/text.C (SelectNextWord): protect against null pointers with
7068 old-style string streams. (fix from Paul Theo Gonciari
7071 * src/cite.[Ch]: remove erroneous files.
7073 * lib/configure.m4: update the list of created directories.
7075 * src/lyxrow.C: include <config.h>
7076 * src/lyxcursor.C: ditto.
7078 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7080 * lib/examples/decimal.lyx: new example file from Mike.
7082 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
7083 to find template definitions (from Dekel)
7085 * src/frontends/.cvsignore: add a few things.
7087 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
7089 * src/Timeout.C (TimeOut): remove default argument.
7091 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
7094 * src/insets/ExternalTemplate.C: add a "using" directive.
7096 * src/lyx_main.h: remove the act_ struct, which seems unused
7099 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7101 * LyX Developers Meeting: All files changed, due to random C++ (by
7102 coincidence) code generator script.
7104 - external inset (cool!)
7105 - initial online editing of preferences
7106 - insettabular breaks insettext(s contents)
7108 - some DocBook fixes
7109 - example files update
7110 - other cool stuff, create a diff and look for yourself.
7112 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
7114 * src/insets/insettext.C (computeTextRows): if the maxWidth is
7115 -1 this is a non-line-breaking textinset.
7117 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
7118 if there is no width set.
7120 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7122 * Lots of files: Merged the dialogbase branch.
7124 2000-06-09 Allan Rae <rae@lyx.org>
7126 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
7127 and the Dispatch methods that used it.
7129 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
7130 access to functions formerly kept in Dispatch.
7132 2000-05-19 Allan Rae <rae@lyx.org>
7134 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
7135 made to_page and count_copies integers again. from_page remains a
7136 string however because I want to allow entry of a print range like
7137 "1,4,22-25" using this field.
7139 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7140 and printer-params-get. These aren't useful from the minibuffer but
7141 could be used by a script/LyXServer app provided it passes a suitable
7142 auto_mem_buffer. I guess I should take a look at how the LyXServer
7143 works and make it support xtl buffers.
7145 * sigc++/: updated to libsigc++-1.0.1
7147 * src/xtl/: updated to xtl-1.3.pl.11
7149 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7150 those changes done to the files in src/ are actually recreated when
7151 they get regenerated. Please don't ever accept a patch that changes a
7152 dialog unless that patch includes the changes to the corresponding *.fd
7155 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7156 stringOnlyContains, renamed it and generalised it.
7158 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7159 branch. Removed the remaining old form_print code.
7161 2000-04-26 Allan Rae <rae@lyx.org>
7163 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7164 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7166 2000-04-25 Allan Rae <rae@lyx.org>
7168 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7169 against a base of xtl-1.3.pl.4
7171 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7172 filter the Id: entries so they still show the xtl version number
7175 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7176 into the src/xtl code. Patch still pending with José (XTL)
7178 2000-04-24 Allan Rae <rae@lyx.org>
7180 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7181 both more generic and much safer. Use the new template functions.
7182 * src/buffer.[Ch] (Dispatch): ditto.
7184 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7185 and mem buffer more intelligently. Also a little general cleanup.
7188 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7189 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7190 * src/xtl/Makefile.am: ditto.
7191 * src/xtl/.cvsignore: ditto.
7192 * src/Makefile.am: ditto.
7194 * src/PrinterParams.h: Removed the macros member functions. Added a
7195 testInvariant member function. A bit of tidying up and commenting.
7196 Included Angus's idea for fixing operation with egcs-1.1.2.
7198 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7199 cool expansion of XTL's mem_buffer to support automatic memory
7200 management within the buffer itself. Removed the various macros and
7201 replaced them with template functions that use either auto_mem_buffer
7202 or mem_buffer depending on a #define. The mem_buffer support will
7203 disappear as soon as the auto_mem_buffer is confirmed to be good on
7204 other platforms/compilers. That is, it's there so you've got something
7207 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7208 effectively forked XTL. However I expect José will include my code
7209 into the next major release. Also fixed a memory leak.
7210 * src/xtl/text.h: ditto.
7211 * src/xtl/xdr.h: ditto.
7212 * src/xtl/giop.h: ditto.
7214 2000-04-16 Allan Rae <rae@lyx.org>
7216 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7217 by autogen.sh and removed by maintainer-clean anyway.
7218 * .cvsignore, sigc++/.cvsignore: Support the above.
7220 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7222 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7224 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7225 macros, renamed static callback-target member functions to suit new
7226 scheme and made them public.
7227 * src/frontends/xforms/forms/form_print.fd: ditto.
7228 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7230 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7233 * src/xtl/: New directory containing a minimal distribution of XTL.
7234 This is XTL-1.3.pl.4.
7236 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7238 2000-04-15 Allan Rae <rae@lyx.org>
7240 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7242 * sigc++/: Updated to libsigc++-1.0.0
7244 2000-04-14 Allan Rae <rae@lyx.org>
7246 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7247 use the generic ones in future. I'll modify my conversion script.
7249 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7251 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7252 (CloseAllBufferRelatedDialogs): Renamed.
7253 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7255 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7256 of the generic ones. These are the same ones my conversion script
7259 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7260 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7261 * src/buffer.C (Dispatch): ditto
7263 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7264 functions for updating and hiding buffer dependent dialogs.
7265 * src/BufferView.C (buffer): ditto
7266 * src/buffer.C (setReadonly): ditto
7267 * src/lyxfunc.C (CloseBuffer): ditto
7269 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7270 Dialogs.h, and hence all the SigC stuff, into every file that includes
7271 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7273 * src/BufferView2.C: reduce the number of headers included by buffer.h
7275 2000-04-11 Allan Rae <rae@lyx.org>
7277 * src/frontends/xforms/xform_macros.h: A small collection of macros
7278 for building C callbacks.
7280 * src/frontends/xforms/Makefile.am: Added above file.
7282 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7283 scheme again. This time it should work for JMarc. If this is
7284 successful I'll revise my conversion script to automate some of this.
7285 The static member functions in the class also have to be public for
7286 this scheme will work. If the scheme works (it's almost identical to
7287 the way BufferView::cursorToggleCB is handled so it should work) then
7288 FormCopyright and FormPrint will be ready for inclusion into the main
7289 trunk immediately after 1.1.5 is released -- provided we're prepared
7290 for complaints about lame compilers not handling XTL.
7292 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7294 2000-04-07 Allan Rae <rae@lyx.org>
7296 * config/lyxinclude.m4: A bit more tidying up (Angus)
7298 * src/LString.h: JMarc's <string> header fix
7300 * src/PrinterParams.h: Used string for most data to remove some
7301 ugly code in the Print dialog and avoid even uglier code when
7302 appending the ints to a string for output.
7304 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7305 and moved "default:" back to the end of switch statement. Cleaned
7306 up the printing so it uses the right function calls and so the
7307 "print to file" option actually puts the file in the right directory.
7309 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7311 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7312 and Ok+Apply button control into a separate method: input (Angus).
7313 (input) Cleaned it up and improved it to be very thorough now.
7314 (All CB) static_cast used instead of C style cast (Angus). This will
7315 probably change again once we've worked out how to keep gcc-2.8.1 happy
7316 with real C callbacks.
7317 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7318 ignore some of the bool settings and has random numbers instead. Needs
7319 some more investigation. Added other input length checks and checking
7320 of file and printer names.
7322 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7323 would link (Angus). Seems the old code doesn't compile with the pragma
7324 statement either. Separated callback entries from internal methods.
7326 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7328 2000-03-17 Allan Rae <rae@lyx.org>
7330 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7331 need it? Maybe it could go in Dialogs instead? I could make it a
7332 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7333 values to get the bool return value.
7334 (Dispatch): New overloaded method for xtl support.
7336 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7337 extern "C" callback instead of static member functions. Hopefully,
7338 JMarc will be able to compile this. I haven't changed
7339 forms/form_copyright.fd yet. Breaking one of my own rules already.
7341 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7342 because they aren't useful from the minibuffer. Maybe a LyXServer
7343 might want a help message though?
7345 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7347 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7348 xtl which needs both rtti and exceptions.
7350 * src/support/Makefile.am:
7351 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7353 * src/frontends/xforms/input_validators.[ch]: input filters and
7354 validators. These conrol what keys are valid in input boxes.
7355 Use them and write some more. Much better idea than waiting till
7356 after the user has pressed Ok to say that the input fields don't make
7359 * src/frontends/xforms/Makefile.am:
7360 * src/frontends/xforms/forms/form_print.fd:
7361 * src/frontends/xforms/forms/makefile:
7362 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7363 new scheme. Still have to make sure I haven't missed anything from
7364 the current implementation.
7366 * src/Makefile.am, src/PrinterParams.h: New data store.
7368 * other files: Added a couple of copyright notices.
7370 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7372 * src/insets/insetbib.h: move Holder struct in public space.
7374 * src/frontends/include/DialogBase.h: use SigC:: only when
7375 SIGC_CXX_NAMESPACES is defined.
7376 * src/frontends/include/Dialogs.h: ditto.
7378 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7380 * src/frontends/xforms/FormCopyright.[Ch]: do not
7381 mention SigC:: explicitely.
7383 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7385 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7386 deals with testing KDE in main configure.in
7387 * configure.in: ditto.
7389 2000-02-22 Allan Rae <rae@lyx.org>
7391 * Lots of files: Merged from HEAD
7393 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7394 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7396 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7398 * sigc++/: new minidist.
7400 2000-02-14 Allan Rae <rae@lyx.org>
7402 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7404 2000-02-08 Juergen Vigna <jug@sad.it>
7406 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7407 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7409 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7410 for this port and so it is much easier for other people to port
7411 dialogs in a common development environment.
7413 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7414 the QT/KDE implementation.
7416 * src/frontends/kde/Dialogs.C:
7417 * src/frontends/kde/FormCopyright.C:
7418 * src/frontends/kde/FormCopyright.h:
7419 * src/frontends/kde/Makefile.am:
7420 * src/frontends/kde/formcopyrightdialog.C:
7421 * src/frontends/kde/formcopyrightdialog.h:
7422 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7423 for the kde support of the Copyright-Dialog.
7425 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7426 subdir-substitution instead of hardcoded 'xforms' as we now have also
7429 * src/frontends/include/DialogBase.h (Object): just commented the
7430 label after #endif (nasty warning and I don't like warnings ;)
7432 * src/main.C (main): added KApplication initialization if using
7435 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7436 For now only the KDE event-loop is added if frontend==kde.
7438 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7440 * configure.in: added support for the --with-frontend[=value] option
7442 * autogen.sh: added kde.m4 file to list of config-files
7444 * acconfig.h: added define for KDEGUI-support
7446 * config/kde.m4: added configuration functions for KDE-port
7448 * config/lyxinclude.m4: added --with-frontend[=value] option with
7449 support for xforms and KDE.
7451 2000-02-08 Allan Rae <rae@lyx.org>
7453 * all Makefile.am: Fixed up so the make targets dist, distclean,
7454 install and uninstall all work even if builddir != srcdir. Still
7455 have a new sigc++ minidist update to come.
7457 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7459 2000-02-01 Allan Rae <rae@lyx.org>
7461 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7462 Many mods to get builddir != srcdir working.
7464 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7465 for building on NT and so we can do the builddir != srcdir stuff.
7467 2000-01-30 Allan Rae <rae@lyx.org>
7469 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7470 This will stay in "rae" branch. We probably don't really need it in
7471 the main trunk as anyone who wants to help programming it should get
7472 a full library installed also. So they can check both included and
7473 system supplied library compilation.
7475 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7476 Added a 'mini' distribution of libsigc++. If you feel the urge to
7477 change something in these directories - Resist it. If you can't
7478 resist the urge then you should modify the following script and rebuild
7479 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7480 all happen. Still uses a hacked version of libsigc++'s configure.in.
7481 I'm quite happy with the results. I'm not sure the extra work to turn
7482 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7483 worth the trouble and would probably lead to extra maintenance
7485 I haven't tested the following important make targets: install, dist.
7486 Not ready for prime time but very close. Maybe 1.1.5.
7488 * development/tools/makeLyXsigc.sh: A shell script to automatically
7489 generate our mini-dist of libsigc++. It can only be used with a CVS
7490 checkout of libsigc++ not a tarball distribution. It's well commented.
7491 This will end up as part of the libsigc++ distribution so other apps
7492 can easily have an included mini-dist. If someone makes mods to the
7493 sigc++ subpackage without modifying this script to generate those
7494 changes I'll be very upset!
7496 * src/frontends/: Started the gui/system indep structure.
7498 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7499 to access the gui-indep dialogs are in this class. Much improved
7500 design compared to previous revision. Lars, please refrain from
7501 moving this header into src/ like you did with Popups.h last time.
7503 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7505 * src/frontends/xforms/: Started the gui-indep system with a single
7506 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7509 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7510 Here you'll find a very useful makefile and automated fdfix.sh that
7511 makes updating dailogs a no-brainer -- provided you follow the rules
7512 set out in the README. I'm thinking about adding another script to
7513 automatically generate skeleton code for a new dialog given just the
7516 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7517 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7518 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7520 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7522 * src/support/LSubstring.C (operator): simplify
7524 * src/lyxtext.h: removed bparams, use buffer_->params instead
7526 * src/lyxrow.h: make Row a real class, move all variables to
7527 private and use accessors.
7529 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7531 (isRightToLeftPar): ditto
7532 (ChangeLanguage): ditto
7533 (isMultiLingual): ditto
7536 (SimpleTeXOnePar): ditto
7537 (TeXEnvironment): ditto
7538 (GetEndLabel): ditto
7540 (SetOnlyLayout): ditto
7541 (BreakParagraph): ditto
7542 (BreakParagraphConservative): ditto
7543 (GetFontSettings): ditto
7545 (CopyIntoMinibuffer): ditto
7546 (CutIntoMinibuffer): ditto
7547 (PasteParagraph): ditto
7548 (SetPExtraType): ditto
7549 (UnsetPExtraType): ditto
7550 (DocBookContTableRows): ditto
7551 (SimpleDocBookOneTablePar): ditto
7553 (TeXFootnote): ditto
7554 (SimpleTeXOneTablePar): ditto
7555 (TeXContTableRows): ditto
7556 (SimpleTeXSpecialChars): ditto
7559 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7560 to private and use accessors.
7562 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7563 this, we did not use it anymore and has not been for ages. Just a
7564 waste of cpu cycles.
7566 * src/language.h: make Language a real class, move all variables
7567 to private and use accessors.
7569 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7570 (create_view): remove
7571 (update): some changes for new timer
7572 (cursorToggle): use new timer
7573 (beforeChange): change for new timer
7575 * src/BufferView.h (cursorToggleCB): removed last paramter because
7578 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7579 (cursorToggleCB): change because of new timer code
7581 * lib/CREDITS: updated own mailaddress
7583 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7585 * src/support/filetools.C (PutEnv): fix the code in case neither
7586 putenv() nor setenv() have been found.
7588 * INSTALL: mention the install-strip Makefile target.
7590 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7591 read-only documents.
7593 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7595 * lib/reLyX/configure.in (VERSION): avoid using a previously
7596 generated reLyX wrapper to find out $prefix.
7598 * lib/examples/eu_adibide_lyx-atua.lyx:
7599 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7600 translation of the Tutorial (Dooteo)
7602 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7604 * forms/cite.fd: new citation dialog
7606 * src/insetcite.[Ch]: the new citation dialog is moved into
7609 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7612 * src/insets/insetcommand.h: data members made private.
7614 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7616 * LyX 1.1.5 released
7618 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7620 * src/version.h (LYX_RELEASE): to 1.1.5
7622 * src/spellchecker.C (RunSpellChecker): return false if the
7623 spellchecker dies upon creation.
7625 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7627 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7628 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7632 * lib/CREDITS: update entry for Martin Vermeer.
7634 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7636 * src/text.C (draw): Draw foreign language bars at the bottom of
7637 the row instead of at the baseline.
7639 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7641 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7643 * lib/bind/de_menus.bind: updated
7645 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7647 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7649 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7651 * src/menus.C (Limit_string_length): New function
7652 (ShowTocMenu): Limit the number of items/length of items in the
7655 * src/paragraph.C (String): Correct result for a paragraph inside
7658 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7660 * src/bufferlist.C (close): test of buf->getuser() == NULL
7662 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7664 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7665 Do not call to SetCursor when the paragraph is a closed footnote!
7667 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7669 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7672 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7674 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7677 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7678 reference popup, that activates the reference-back action
7680 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7682 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7683 the menus. Also fixed a bug.
7685 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7686 the math panels when switching buffers (unless new buffer is readonly).
7688 * src/BufferView.C (NoSavedPositions)
7689 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7691 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7693 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7694 less of dvi dirty or not.
7696 * src/trans_mgr.[Ch] (insert): change first parameter to string
7699 * src/chset.[Ch] (encodeString): add const to first parameter
7701 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7703 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7707 * src/LaTeX.C (deplog): better searching for dependency files in
7708 the latex log. Uses now regexps.
7710 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7711 instead of the box hack or \hfill.
7713 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7715 * src/lyxfunc.C (doImportHelper): do not create the file before
7716 doing the actual import.
7717 (doImportASCIIasLines): create a new file before doing the insert.
7718 (doImportASCIIasParagraphs): ditto.
7720 * lib/lyxrc.example: remove mention of non-existing commands
7722 * lyx.man: remove mention of color-related switches.
7724 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7726 * src/lyx_gui.C: remove all the color-related ressources, which
7727 are not used anymore.
7729 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7732 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7734 * src/lyxrc.C (read): Add a missing break in the switch
7736 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7738 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7740 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7743 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7745 * src/text.C (draw): draw bars under foreign language words.
7747 * src/LColor.[Ch]: add LColor::language
7749 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7751 * src/lyxcursor.h (boundary): New member variable
7753 * src/text.C (IsBoundary): New methods
7755 * src/text.C: Use the above for currect cursor movement when there
7756 is both RTL & LTR text.
7758 * src/text2.C: ditto
7760 * src/bufferview_funcs.C (ToggleAndShow): ditto
7762 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7764 * src/text.C (DeleteLineForward): set selection to true to avoid
7765 that DeleteEmptyParagraphMechanism does some magic. This is how it
7766 is done in all other functions, and seems reasonable.
7767 (DeleteWordForward): do not jump over non-word stuff, since
7768 CursorRightOneWord() already does it.
7770 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7771 DeleteWordBackward, since they seem safe to me (since selection is
7772 set to "true") DeleteEmptyParagraphMechanism does nothing.
7774 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7776 * src/lyx_main.C (easyParse): simplify the code by factoring the
7777 part that removes parameters from the command line.
7778 (LyX): check wether wrong command line options have been given.
7780 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7782 * src/lyx_main.C : add support for specifying user LyX
7783 directory via command line option -userdir.
7785 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7787 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7788 the number of items per popup.
7789 (Add_to_refs_menu): Ditto.
7791 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7793 * src/lyxparagraph.h: renamed ClearParagraph() to
7794 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7795 textclass as parameter, and do nothing if free_spacing is
7796 true. This fixes part of the line-delete-forward problems.
7798 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7799 (pasteSelection): ditto.
7800 (SwitchLayoutsBetweenClasses): more translatable strings.
7802 * src/text2.C (CutSelection): use StripLeadingSpaces.
7803 (PasteSelection): ditto.
7804 (DeleteEmptyParagraphMechanism): ditto.
7806 2000-05-26 Juergen Vigna <jug@sad.it>
7808 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7809 is not needed in tabular insets.
7811 * src/insets/insettabular.C (TabularFeatures): added missing features.
7813 * src/tabular.C (DeleteColumn):
7815 (AppendRow): implemented this functions
7816 (cellsturct::operator=): clone the inset too;
7818 2000-05-23 Juergen Vigna <jug@sad.it>
7820 * src/insets/insettabular.C (LocalDispatch): better selection support
7821 when having multicolumn-cells.
7823 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7825 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7827 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7829 * src/ColorHandler.C (getGCForeground): put more test into _()
7831 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7834 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7837 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7839 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7840 there are no labels, or when buffer is readonly.
7842 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7843 there are no labels, buffer is SGML, or when buffer is readonly.
7845 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7847 * src/LColor.C (LColor): change a couple of grey40 to grey60
7848 (LColor): rewore initalization to make compiles go some magnitude
7850 (getGUIName): don't use gettext until we need the string.
7852 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7854 * src/Bullet.[Ch]: Fixed a small bug.
7856 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7858 * src/paragraph.C (String): Several fixes/improvements
7860 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7862 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7864 * src/paragraph.C (String): give more correct output.
7866 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7868 * src/lyxfont.C (stateText) Do not output the language if it is
7869 eqaul to the language of the document.
7871 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7872 between two paragraphs with the same language.
7874 * src/paragraph.C (getParLanguage) Return a correct answer for an
7875 empty dummy paragraph.
7877 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7880 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7883 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7884 the menus/popup, if requested fonts are unavailable.
7886 2000-05-22 Juergen Vigna <jug@sad.it>
7888 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7889 movement support (Up/Down/Tab/Shift-Tab).
7890 (LocalDispatch): added also preliminari cursor-selection.
7892 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7894 * src/paragraph.C (PasteParagraph): Hopefully now right!
7896 2000-05-22 Garst R. Reese <reese@isn.net>
7898 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7899 of list, change all references to Environment to Command
7900 * tex/hollywood.cls : rewrite environments as commands, add
7901 \uppercase to interiorshot and exteriorshot to force uppecase.
7902 * tex/broadway.cls : rewrite environments as commands. Tweak
7905 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7907 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7908 size of items: use a constant intead of the hardcoded 40, and more
7909 importantly do not remove the %m and %x tags added at the end.
7910 (Add_to_refs_menu): use vector::size_type instead of
7911 unsigned int as basic types for the variables. _Please_ do not
7912 assume that size_t is equal to unsigned int. On an alpha, this is
7913 unsigned long, which is _not_ the same.
7915 * src/language.C (initL): remove language "hungarian", since it
7916 seems that "magyar" is better.
7918 2000-05-22 Juergen Vigna <jug@sad.it>
7920 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7922 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7925 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7926 next was deleted but not set to 0.
7928 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7930 * src/language.C (initL): change the initialization of languages
7931 so that compiles goes _fast_.
7933 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7936 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7938 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7942 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7944 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7946 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7950 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7953 * src/insets/insetlo*.[Ch]: Made editable
7955 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7957 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7958 the current selection.
7960 * src/BufferView_pimpl.C (stuffClipboard): new method
7962 * src/BufferView.C (stuffClipboard): new method
7964 * src/paragraph.C (String): new method
7966 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7967 LColor::ignore when lyxname is not found.
7969 * src/BufferView.C (pasteSelection): new method
7971 * src/BufferView_pimpl.C (pasteSelection): new method
7973 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7975 * src/WorkArea.C (request_clipboard_cb): new static function
7976 (getClipboard): new method
7977 (putClipboard): new method
7979 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7981 * LyX 1.1.5pre2 released
7983 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7985 * src/vspace.C (operator=): removed
7986 (operator=): removed
7988 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7990 * src/layout.C (NumberOfClass): manually set the type in make_pair
7991 (NumberOfLayout): ditto
7993 * src/language.C: use the Language constructor for ignore_lang
7995 * src/language.h: add constructors to struct Language
7997 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7999 * src/text2.C (SetCursorIntern): comment out #warning
8001 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
8003 * src/mathed/math_iter.h: initialize sx and sw to 0
8005 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8007 * forms/lyx.fd: Redesign of form_ref
8009 * src/LaTeXFeatures.[Ch]
8013 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
8016 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
8017 and Buffer::inset_iterator.
8019 * src/menus.C: Added new menus: TOC and Refs.
8021 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
8023 * src/buffer.C (getTocList): New method.
8025 * src/BufferView2.C (ChangeRefs): New method.
8027 * src/buffer.C (getLabelList): New method. It replaces the old
8028 getReferenceList. The return type is vector<string> instead of
8031 * src/insets/insetinclude.C (getLabelList): New method. Replaces
8032 the old getLabel() and GetNumberOfLabels() methods.
8033 * src/insets/insetlabel.C (getLabelList): ditto
8034 * src/mathed/formula.C (getLabelList): ditto
8036 * src/paragraph.C (String): New method.
8038 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
8039 Uses the new getTocList() method.
8040 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
8041 which automatically updates the contents of the browser.
8042 (RefUpdateCB): Use the new getLabelList method.
8044 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
8046 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
8048 * src/spellchecker.C: Added using std::reverse;
8050 2000-05-19 Juergen Vigna <jug@sad.it>
8052 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
8054 * src/insets/insettext.C (computeTextRows): small fix for display of
8055 1 character after a newline.
8057 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
8060 2000-05-18 Juergen Vigna <jug@sad.it>
8062 * src/insets/insettabular.C (TabularFeatures): fixed update of display
8063 when changing width of column.
8065 * src/tabular.C (set_row_column_number_info): setting of
8066 autobreak rows if necessary.
8068 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8070 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
8072 * src/vc-backend.*: renamed stat() to status() and vcstat to
8073 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
8074 compilation broke. The new name seems more relevant, anyway.
8076 2000-05-17 Juergen Vigna <jug@sad.it>
8078 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
8079 which was wrong if the removing caused removing of rows!
8081 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
8082 (pushToken): new function.
8084 * src/text2.C (CutSelection): fix problem discovered with purify
8086 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8088 * src/debug.C (showTags): enlarge the first column, now that we
8089 have 6-digits debug codes.
8091 * lib/layouts/hollywood.layout:
8092 * lib/tex/hollywood.cls:
8093 * lib/tex/brodway.cls:
8094 * lib/layouts/brodway.layout: more commands and fewer
8095 environments. Preambles moved in the .cls files. Broadway now has
8096 more options on scene numbering and less whitespace (from Garst)
8098 * src/insets/insetbib.C (getKeys): make sure that we are in the
8099 document directory, in case the bib file is there.
8101 * src/insets/insetbib.C (Latex): revert bogus change.
8103 2000-05-16 Juergen Vigna <jug@sad.it>
8105 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
8106 the TabularLayout on cursor move.
8108 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
8110 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
8113 (draw): fixed cursor position and drawing so that the cursor is
8114 visible when before the tabular-inset.
8116 * src/insets/insettext.C (init): drawLockedFrame was not initialized
8117 when creating from old insettext.
8119 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
8121 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8123 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
8124 * lib/tex/brodway.cls: ditto
8126 * lib/layouts/brodway.layout: change alignment of parenthical
8129 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8131 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
8132 versions 0.88 and 0.89 are supported.
8134 2000-05-15 Juergen Vigna <jug@sad.it>
8136 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
8139 * src/insets/insettext.C (computeTextRows): redone completely this
8140 function in a much cleaner way, because of problems when having a
8142 (draw): added a frame border when the inset is locked.
8143 (SetDrawLockedFrame): this sets if we draw the border or not.
8144 (SetFrameColor): this sets the frame color (default=insetframe).
8146 * src/insets/lyxinset.h: added x() and y() functions which return
8147 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8148 function which is needed to see if we have a locking inset of some
8149 type in this inset (needed for now in insettabular).
8151 * src/vspace.C (inPixels): the same function also without a BufferView
8152 parameter as so it is easier to use it in some ocasions.
8154 * src/lyxfunc.C: changed all places where insertInset was used so
8155 that now if it couldn't be inserted it is deleted!
8157 * src/TabularLayout.C:
8158 * src/TableLayout.C: added support for new tabular-inset!
8160 * src/BufferView2.C (insertInset): this now returns a bool if the
8161 inset was really inserted!!!
8163 * src/tabular.C (GetLastCellInRow):
8164 (GetFirstCellInRow): new helper functions.
8165 (Latex): implemented for new tabular class.
8169 (TeXTopHLine): new Latex() helper functions.
8171 2000-05-12 Juergen Vigna <jug@sad.it>
8173 * src/mathed/formulamacro.C (Read):
8174 * src/mathed/formula.C (Read): read also the \end_inset here!
8176 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8178 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8179 crush when saving formulae with unbalanced parenthesis.
8181 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8183 * src/layout.C: Add new keyword "endlabelstring" to layout file
8185 * src/text.C (GetVisibleRow): Draw endlabel string.
8187 * lib/layouts/broadway.layout
8188 * lib/layouts/hollywood.layout: Added endlabel for the
8189 Parenthetical layout.
8191 * lib/layouts/heb-article.layout: Do not use slanted font shape
8192 for Theorem like environments.
8194 * src/buffer.C (makeLaTeXFile): Always add "american" to
8195 the UsedLanguages list if document language is RTL.
8197 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8199 * add addendum to README.OS2 and small patch (from SMiyata)
8201 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8203 * many files: correct the calls to ChangeExtension().
8205 * src/support/filetools.C (ChangeExtension): remove the no_path
8206 argument, which does not belong there. Use OnlyFileName() instead.
8208 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8209 files when LaTeXing a non-nice latex file.
8211 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8212 a chain of "if". Return false when deadkeys are not handled.
8214 * src/lyx_main.C (LyX): adapted the code for default bindings.
8216 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8217 bindings for basic functionality (except deadkeys).
8218 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8220 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8221 several methods: handle override_x_deadkeys.
8223 * src/lyxrc.h: remove the "bindings" map, which did not make much
8224 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8226 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8228 * src/lyxfont.C (stateText): use a saner method to determine
8229 whether the font is "default". Seems to fix the crash with DEC
8232 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8234 2000-05-08 Juergen Vigna <jug@sad.it>
8236 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8237 TabularLayoutMenu with mouse-button-3
8238 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8240 * src/TabularLayout.C: added this file for having a Layout for
8243 2000-05-05 Juergen Vigna <jug@sad.it>
8245 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8246 recalculating inset-widths.
8247 (TabularFeatures): activated this function so that I can change
8248 tabular-features via menu.
8250 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8251 that I can test some functions with the Table menu.
8253 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8255 * src/lyxfont.C (stateText): guard against stupid c++libs.
8257 * src/tabular.C: add using std::vector
8258 some whitespace changes, + removed som autogenerated code.
8260 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8262 2000-05-05 Juergen Vigna <jug@sad.it>
8264 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8265 row, columns and cellstructures.
8267 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8269 * lib/lyxrc.example: remove obsolete entries.
8271 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8272 reading of protected_separator for free_spacing.
8274 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8276 * src/text.C (draw): do not display an exclamation mark in the
8277 margin for margin notes. This is confusing, ugly and
8280 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8281 AMS math' is checked.
8283 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8284 name to see whether including the amsmath package is needed.
8286 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8288 * src/paragraph.C (validate): Compute UsedLanguages correctly
8289 (don't insert the american language if it doesn't appear in the
8292 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8293 The argument of \thanks{} command is considered moving argument
8295 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8298 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8300 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8301 for appendix/minipage/depth. The lines can be now both in the footnote
8302 frame, and outside the frame.
8304 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8307 2000-05-05 Juergen Vigna <jug@sad.it>
8309 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8310 neede only in tabular.[Ch].
8312 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8314 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8316 (Write): write '~' for PROTECTED_SEPARATOR
8318 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8320 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8323 * src/mathed/formula.C (drawStr): rename size to siz.
8325 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8326 possibly fix a bug by not changing the pflags = flags to piflags =
8329 2000-05-05 Juergen Vigna <jug@sad.it>
8331 * src/insets/insetbib.C: moved using directive
8333 * src/ImportNoweb.C: small fix for being able to compile (missing
8336 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8338 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8339 to use clear, since we don't depend on this in the code. Add test
8342 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8344 * (various *.C files): add using std::foo directives to please dec
8347 * replace calls to string::clear() to string::erase() (Angus)
8349 * src/cheaders/cmath: modified to provide std::abs.
8351 2000-05-04 Juergen Vigna <jug@sad.it>
8353 * src/insets/insettext.C: Prepared all for inserting of multiple
8354 paragraphs. Still display stuff to do (alignment and other things),
8355 but I would like to use LyXText to do this when we cleaned out the
8356 table-support stuff.
8358 * src/insets/insettabular.C: Changed lot of stuff and added lots
8359 of functionality still a lot to do.
8361 * src/tabular.C: Various functions changed name and moved to be
8362 const functions. Added new Read and Write functions and changed
8363 lots of things so it works good with tabular-insets (also removed
8364 some stuff which is not needed anymore * hacks *).
8366 * src/lyxcursor.h: added operators == and != which just look if
8367 par and pos are (not) equal.
8369 * src/buffer.C (latexParagraphs): inserted this function to latex
8370 all paragraphs form par to endpar as then I can use this too for
8373 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8374 so that I can call this to from text insets with their own cursor.
8376 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8377 output off all paragraphs (because of the fix below)!
8379 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8380 the very last paragraph (this could be also the last paragraph of an
8383 * src/texrow.h: added rows() call which returns the count-variable.
8385 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8387 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8389 * lib/configure.m4: better autodetection of DocBook tools.
8391 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8393 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8395 * src/lyx_cb.C: add using std::reverse;
8397 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8400 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8401 selected files. Should fix repeated errors from generated files.
8403 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8405 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8407 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8408 the spellchecker popup.
8410 * lib/lyxrc.example: Removed the \number_inset section
8412 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8414 * src/insets/figinset.C (various): Use IsFileReadable() to make
8415 sure that the file actually exist. Relying on ghostscripts errors
8416 is a bad idea since they can lead to X server crashes.
8418 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8420 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8423 * lib/lyxrc.example: smallish typo in description of
8424 \view_dvi_paper_option
8426 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8429 * src/lyxfunc.C: doImportHelper to factor out common code of the
8430 various import methods. New functions doImportASCIIasLines,
8431 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8432 doImportLinuxDoc for the format specific parts.
8435 * buffer.C: Dispatch returns now a bool to indicate success
8438 * lyx_gui.C: Add getLyXView() for member access
8440 * lyx_main.C: Change logic for batch commands: First try
8441 Buffer::Dispatch (possibly without GUI), if that fails, use
8444 * lyx_main.C: Add support for --import command line switch.
8445 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8446 Available Formats: Everything accepted by 'buffer-import <format>'
8448 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8450 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8453 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8454 documents will be reformatted upon reentry.
8456 2000-04-27 Juergen Vigna <jug@sad.it>
8458 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8459 correctly only last pos this was a bug.
8461 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8463 * release of lyx-1.1.5pre1
8465 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8467 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8469 * src/menus.C: revert the change of naming (Figure->Graphic...)
8470 from 2000-04-11. It was incomplete and bad.
8472 * src/LColor.[Ch]: add LColor::depthbar.
8473 * src/text.C (GetVisibleRow): use it.
8475 * README: update the languages list.
8477 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8479 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8482 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8484 * README: remove sections that were just wrong.
8486 * src/text2.C (GetRowNearY): remove currentrow code
8488 * src/text.C (GetRow): remove currentrow code
8490 * src/screen.C (Update): rewritten a bit.
8491 (SmallUpdate): removed func
8493 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8495 (FullRebreak): return bool
8496 (currentrow): remove var
8497 (currentrow_y): ditto
8499 * src/lyxscreen.h (Draw): change arg to unsigned long
8500 (FitCursor): return bool
8501 (FitManualCursor): ditto
8502 (Smallpdate): remove func
8503 (first): change to unsigned long
8504 (DrawOneRow): change second arg to long (from long &)
8505 (screen_refresh_y): remove var
8506 (scree_refresh_row): ditto
8508 * src/lyxrow.h: change baseline to usigned int from unsigned
8509 short, this brings some implicit/unsigned issues out in the open.
8511 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8513 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8514 instead of smallUpdate.
8516 * src/lyxcursor.h: change y to unsigned long
8518 * src/buffer.h: don't call updateScrollbar after fitcursor
8520 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8521 where they are used. Removed "\\direction", this was not present
8522 in 1.1.4 and is already obsolete. Commented out some code that I
8523 believe to never be called.
8524 (runLiterate): don't call updateScrollbar after fitCursor
8526 (buildProgram): ditto
8529 * src/WorkArea.h (workWidth): change return val to unsigned
8532 (redraw): remove the button redraws
8533 (setScrollbarValue): change for scrollbar
8534 (getScrollbarValue): change for scrollbar
8535 (getScrollbarBounds): change for scrollbar
8537 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8538 (C_WorkArea_down_cb): removed func
8539 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8540 (resize): change for scrollbar
8541 (setScrollbar): ditto
8542 (setScrollbarBounds): ditto
8543 (setScrollbarIncrements): ditto
8544 (up_cb): removed func
8545 (down_cb): removed func
8546 (scroll_cb): change for scrollbar
8547 (work_area_handler): ditto
8549 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8550 when FitCursor did something.
8551 (updateScrollbar): some unsigned changes
8552 (downCB): removed func
8553 (scrollUpOnePage): removed func
8554 (scrollDownOnePage): remvoed func
8555 (workAreaMotionNotify): don't call screen->FitCursor but use
8556 fitCursor instead. and bool return val
8557 (workAreaButtonPress): ditto
8558 (workAreaButtonRelease): some unsigned changes
8559 (checkInsetHit): ditto
8560 (workAreaExpose): ditto
8561 (update): parts rewritten, comments about the signed char arg added
8562 (smallUpdate): removed func
8563 (cursorPrevious): call needed updateScrollbar
8566 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8569 * src/BufferView.[Ch] (upCB): removed func
8570 (downCB): removed func
8571 (smallUpdate): removed func
8573 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8575 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8576 currentrow, currentrow_y optimization. This did not help a lot and
8577 if we want to do this kind of optimization we should rather use
8578 cursor.row instead of the currentrow.
8580 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8581 buffer spacing and klyx spacing support.
8583 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8585 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8588 2000-04-26 Juergen Vigna <jug@sad.it>
8590 * src/insets/figinset.C: fixes to Lars sstream changes!
8592 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8594 * A lot of files: Added Ascii(ostream &) methods to all inset
8595 classes. Used when exporting to ASCII.
8597 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8598 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8601 * src/text2.C (ToggleFree): Disabled implicit word selection when
8602 there is a change in the language
8604 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8605 no output was generated for end-of-sentence inset.
8607 * src/insets/lyxinset.h
8610 * src/paragraph.C: Removed the insetnumber code
8612 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8614 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8616 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8617 no_babel and no_epsfig completely from the file.
8618 (parseSingleLyXformat2Token): add handling for per-paragraph
8619 spacing as written by klyx.
8621 * src/insets/figinset.C: applied patch by Andre. Made it work with
8624 2000-04-20 Juergen Vigna <jug@sad.it>
8626 * src/insets/insettext.C (cutSelection):
8627 (copySelection): Fixed with selection from right to left.
8628 (draw): now the rows are not recalculated at every draw.
8629 (computeTextRows): for now reset the inset-owner here (this is
8630 important for an undo or copy where the inset-owner is not set
8633 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8634 motion to the_locking_inset screen->first was forgotten, this was
8635 not important till we got multiline insets.
8637 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8639 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8640 code seems to be alright (it is code changed by Dekel, and the
8641 intent is indeed that all macros should be defined \protect'ed)
8643 * NEWS: a bit of reorganisation of the new user-visible features.
8645 2000-04-19 Juergen Vigna <jug@sad.it>
8647 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8648 position. Set the inset_owner of the used paragraph so that it knows
8649 that it is inside an inset. Fixed cursor handling with mouse and
8650 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8651 and cleanups to make TextInsets work better.
8653 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8654 Changed parameters of various functions and added LockInsetInInset().
8656 * src/insets/insettext.C:
8658 * src/insets/insetcollapsable.h:
8659 * src/insets/insetcollapsable.C:
8660 * src/insets/insetfoot.h:
8661 * src/insets/insetfoot.C:
8662 * src/insets/insetert.h:
8663 * src/insets/insetert.C: cleaned up the code so that it works now
8664 correctly with insettext.
8666 * src/insets/inset.C:
8667 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8668 that insets in insets are supported right.
8671 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8673 * src/paragraph.C: some small fixes
8675 * src/debug.h: inserted INSETS debug info
8677 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8678 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8680 * src/commandtags.h:
8681 * src/LyXAction.C: insert code for InsetTabular.
8683 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8684 not Button1MotionMask.
8685 (workAreaButtonRelease): send always a InsetButtonRelease event to
8687 (checkInsetHit): some setCursor fixes (always with insets).
8689 * src/BufferView2.C (lockInset): returns a bool now and extended for
8690 locking insets inside insets.
8691 (showLockedInsetCursor): it is important to have the cursor always
8692 before the locked inset.
8693 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8695 * src/BufferView.h: made lockInset return a bool.
8697 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8699 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8700 that is used also internally but can be called as public to have back
8701 a cursor pos which is not set internally.
8702 (SetCursorIntern): Changed to use above function.
8704 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8706 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8711 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8712 patches for things that should be in or should be changed.
8714 * src/* [insetfiles]: change "usigned char fragile" to bool
8715 fragile. There was only one point that could that be questioned
8716 and that is commented in formulamacro.C. Grep for "CHECK".
8718 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8719 (DeleteBuffer): take it out of CutAndPaste and make it static.
8721 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8723 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8724 output the spacing envir commands. Also the new commands used in
8725 the LaTeX output makes the result better.
8727 * src/Spacing.C (writeEnvirBegin): new method
8728 (writeEnvirEnd): new method
8730 2000-04-18 Juergen Vigna <jug@sad.it>
8732 * src/CutAndPaste.C: made textclass a static member of the class
8733 as otherwise it is not accesed right!!!
8735 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8737 * forms/layout_forms.fd
8738 * src/layout_forms.h
8739 * src/layout_forms.C (create_form_form_character)
8740 * src/lyx_cb.C (UserFreeFont)
8741 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8742 documents (in the layout->character popup).
8744 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8746 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8747 \spell_command was in fact not honored (from Kevin Atkinson).
8749 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8752 * src/lyx_gui.h: make lyxViews private (Angus)
8754 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8756 * src/mathed/math_write.C
8757 (MathMatrixInset::Write) Put \protect before \begin{array} and
8758 \end{array} if fragile
8759 (MathParInset::Write): Put \protect before \\ if fragile
8761 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8763 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8764 initialization if the LyXColorHandler must be done after the
8765 connections to the XServer has been established.
8767 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8768 get the background pixel from the lyxColorhandler so that the
8769 figures are rendered with the correct background color.
8770 (NextToken): removed functions.
8771 (GetPSSizes): use ifs >> string instead of NextToken.
8773 * src/Painter.[Ch]: the color cache moved out of this file.
8775 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8778 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8780 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8781 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8783 * src/BufferView.C (enterView): new func
8784 (leaveView): new func
8786 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8788 (leaveView): new func, undefines xterm cursor when approp.
8790 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8791 (AllowInput): delete the Workarea cursor handling from this func.
8793 * src/Painter.C (underline): draw a slimer underline in most cases.
8795 * src/lyx_main.C (error_handler): use extern "C"
8797 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8799 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8800 sent directly to me.
8802 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8803 to the list by Dekel.
8805 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8808 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8809 methods from lyx_cb.here.
8811 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8814 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8816 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8817 instead of using current_view directly.
8819 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8821 * src/LyXAction.C (init): add the paragraph-spacing command.
8823 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8825 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8827 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8828 different from the documents.
8830 * src/text.C (SetHeightOfRow): take paragraph spacing into
8831 account, paragraph spacing takes precedence over buffer spacing
8832 (GetVisibleRow): ditto
8834 * src/paragraph.C (writeFile): output the spacing parameter too.
8835 (validate): set the correct features if spacing is used in the
8837 (Clear): set spacing to default
8838 (MakeSameLayout): spacing too
8839 (HasSameLayout): spacing too
8840 (SetLayout): spacing too
8841 (TeXOnePar): output the spacing commands
8843 * src/lyxparagraph.h: added a spacing variable for use with
8844 per-paragraph spacing.
8846 * src/Spacing.h: add a Default spacing and a method to check if
8847 the current spacing is default. also added an operator==
8849 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8852 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8854 * src/lyxserver.C (callback): fix dispatch of functions
8856 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8857 printf() into lyxerr call.
8859 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8862 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8863 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8864 the "Float" from each of the subitems.
8865 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8867 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8868 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8869 documented the change so that the workaround can be nuked later.
8871 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8874 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8876 * src/buffer.C (getLatexName): ditto
8877 (setReadonly): ditto
8879 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8881 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8882 avoid some uses of current_view. Added also a bufferParams()
8883 method to get at this.
8885 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8887 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8889 * src/lyxparagraph.[Ch]: removed
8890 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8891 with operators used by lower_bound and
8892 upper_bound in InsetTable's
8893 Make struct InsetTable private again. Used matchpos.
8895 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8897 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8898 document, the language of existing text is changed (unless the
8899 document is multi-lingual)
8901 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8903 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8905 * A lot of files: A rewrite of the Right-to-Left support.
8907 2000-04-10 Juergen Vigna <jug@sad.it>
8909 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8910 misplaced cursor when inset in inset is locked.
8912 * src/insets/insettext.C (LocalDispatch): small fix so that a
8913 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8915 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8916 footnote font should be decreased in size twice when displaying.
8918 * src/insets/insettext.C (GetDrawFont): inserted this function as
8919 the drawing-font may differ from the real paragraph font.
8921 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8922 insets (inset in inset!).
8924 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8925 function here because we don't want footnotes inside footnotes.
8927 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8929 (init): now set the inset_owner in paragraph.C
8930 (LocalDispatch): added some resetPos() in the right position
8933 (pasteSelection): changed to use the new CutAndPaste-Class.
8935 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8936 which tells if it is allowed to insert another inset inside this one.
8938 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8939 SwitchLayoutsBetweenClasses.
8941 * src/text2.C (InsertInset): checking of the new paragraph-function
8943 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8944 is not needed anymore here!
8947 (PasteSelection): redone (also with #ifdef) so that now this uses
8948 the CutAndPaste-Class.
8949 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8952 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8953 from/to text/insets.
8955 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8956 so that the paragraph knows if it is inside an (text)-inset.
8957 (InsertFromMinibuffer): changed return-value to bool as now it
8958 may happen that an inset is not inserted in the paragraph.
8959 (InsertInsetAllowed): this checks if it is allowed to insert an
8960 inset in this paragraph.
8962 (BreakParagraphConservative):
8963 (BreakParagraph) : small change for the above change of the return
8964 value of InsertFromMinibuffer.
8966 * src/lyxparagraph.h: added inset_owner and the functions to handle
8967 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8969 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8971 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8972 functions from BufferView to BufferView::Pimpl to ease maintence.
8974 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8975 correctly. Also use SetCursorIntern instead of SetCursor.
8977 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8980 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8982 * src/WorkArea.C (belowMouse): manually implement below mouse.
8984 * src/*: Add "explicit" on several constructors, I added probably
8985 some unneeded ones. A couple of changes to code because of this.
8987 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8988 implementation and private parts from the users of BufferView. Not
8991 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8992 implementation and private parts from the users of LyXLex. Not
8995 * src/BufferView_pimpl.[Ch]: new files
8997 * src/lyxlex_pimpl.[Ch]: new files
8999 * src/LyXView.[Ch]: some inline functions move out-of-line
9001 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9003 * src/lyxparagraph.h: make struct InsetTable public.
9005 * src/support/lyxstring.h: change lyxstring::difference_type to be
9006 ptrdiff_t. Add std:: modifiers to streams.
9008 * src/font.C: include the <cctype> header, for islower() and
9011 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9013 * src/font.[Ch]: new files. Contains the metric functions for
9014 fonts, takes a LyXFont as parameter. Better separation of concepts.
9016 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
9017 changes because of this.
9019 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
9021 * src/*: compile with -Winline and move functions that don't
9024 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
9027 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9029 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
9030 (various files changed because of this)
9032 * src/Painter.C (text): fixed the drawing of smallcaps.
9034 * src/lyxfont.[Ch] (drawText): removed unused member func.
9037 * src/*.C: added needed "using" statements and "std::" qualifiers.
9039 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
9041 * src/*.h: removed all use of "using" from header files use
9042 qualifier std:: instead.
9044 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9046 * src/text.C (Backspace): some additional cleanups (we already
9047 know whether cursor.pos is 0 or not).
9049 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
9050 automake does not provide one).
9052 * src/bmtable.h: replace C++ comments with C comments.
9054 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
9056 * src/screen.C (ShowCursor): Change the shape of the cursor if
9057 the current language is not equal to the language of the document.
9058 (If the cursor change its shape unexpectedly, then you've found a bug)
9060 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
9063 * src/insets/insetnumber.[Ch]: New files.
9065 * src/LyXAction.C (init)
9066 * src/lyxfunc.C (dispatch): Add command number-inset-insert
9069 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
9071 * src/lyxparagraph.h
9072 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
9073 (the vector is kept sorted).
9075 * src/text.C (GetVisibleRow): Draw selection correctly when there
9076 is both LTR and RTL text.
9078 * src/paragraph.C (Clone): Use the assignment operator for cloning,
9079 which is much faster.
9081 * src/text.C (GetVisibleRow and other): Do not draw the last space
9082 in a row if the direction of the last letter is not equal to the
9083 direction of the paragraph.
9085 * src/lyxfont.C (latexWriteStartChanges):
9086 Check that font language is not equal to basefont language.
9087 (latexWriteEndChanges): ditto
9089 * src/lyx_cb.C (StyleReset): Don't change the language while using
9090 the font-default command.
9092 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
9093 empty paragraph before a footnote.
9095 * src/insets/insetcommand.C (draw): Increase x correctly.
9097 * src/screen.C (ShowCursor): Change cursor shape if
9098 current language != document language.
9100 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
9102 2000-03-31 Juergen Vigna <jug@sad.it>
9104 * src/paragraph.C (GetInset): commented out text[pos] = ' '
9105 (Clone): changed mode how the paragraph-data is copied to the
9106 new clone-paragraph.
9108 * src/lyxfunc.C (Dispatch): fixed small problem when calling
9109 GetInset(pos) with no inset anymore there (in inset UNDO)
9111 * src/insets/insetcommand.C (draw): small fix as here x is
9112 incremented not as much as width() returns (2 before, 2 behind = 4)
9114 2000-03-30 Juergen Vigna <jug@sad.it>
9116 * src/insets/insettext.C (InsetText): small fix in initialize
9117 widthOffset (should not be done in the init() function)
9119 2000-03-29 Amir Karger <karger@lyx.org>
9121 * lib/examples/it_ItemizeBullets.lyx: translation by
9124 * Implemented \textasciitilde and fixed a tiny bug in reLyX
9126 2000-03-29 Juergen Vigna <jug@sad.it>
9128 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
9130 * src/insets/insetfoot.C (Clone): small change as for the below
9131 new init function in the text-inset
9133 * src/insets/insettext.C (init): new function as I've seen that
9134 clone did not copy the Paragraph-Data!
9135 (LocalDispatch): Added code so that now we have some sort of Undo
9136 functionality (well actually we HAVE Undo ;)
9138 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9140 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9142 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9145 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9147 * src/main.C: added a runtime check that verifies that the xforms
9148 header used when building LyX and the library used when running
9149 LyX match. Exit with a message if they don't match. This is a
9150 version number check only.
9152 * src/buffer.C (save): Don't allocate memory on the heap for
9153 struct utimbuf times.
9155 * *: some using changes, use iosfwd instead of the real headers.
9157 * src/lyxfont.C use char const * instead of string for the static
9158 strings. Rewrite some functions to use sstream.
9160 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9162 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9165 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9167 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9168 of Geodesy (from Martin Vermeer)
9170 * lib/layouts/svjour.inc: include file for the Springer svjour
9171 class. It can be used to support journals other than JoG.
9173 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9174 Miskiewicz <misiek@pld.org.pl>)
9175 * lib/reLyX/Makefile.am: ditto.
9177 2000-03-27 Juergen Vigna <jug@sad.it>
9179 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9180 also some modifications with operations on selected text.
9182 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9183 problems with clicking on insets (last famous words ;)
9185 * src/insets/insetcommand.C (draw):
9186 (width): Changed to have a bit of space before and after the inset so
9187 that the blinking cursor can be seen (otherwise it was hidden)
9189 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9191 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9192 would not be added to the link list when an installed gettext (not
9193 part of libc) is found.
9195 2000-03-24 Juergen Vigna <jug@sad.it>
9197 * src/insets/insetcollapsable.C (Edit):
9198 * src/mathed/formula.C (InsetButtonRelease):
9199 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9202 * src/BufferView.C (workAreaButtonPress):
9203 (workAreaButtonRelease):
9204 (checkInsetHit): Finally fixed the clicking on insets be handled
9207 * src/insets/insetert.C (Edit): inserted this call so that ERT
9208 insets work always with LaTeX-font
9210 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9212 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9213 caused lyx to startup with no GUI in place, causing in a crash
9214 upon startup when called with arguments.
9216 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9218 * src/FontLoader.C: better initialization of dummyXFontStruct.
9220 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9222 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9223 for linuxdoc and docbook import and export format options.
9225 * lib/lyxrc.example Example of default values for the previous flags.
9227 * src/lyx_cb.C Use those flags instead of the hardwired values for
9228 linuxdoc and docbook export.
9230 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9233 * src/menus.C Added menus entries for the new import/exports formats.
9235 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9237 * src/lyxrc.*: Added support for running without Gui
9240 * src/FontLoader.C: sensible defaults if no fonts are needed
9242 * src/lyx_cb.C: New function ShowMessage (writes either to the
9243 minibuffer or cout in case of no gui
9244 New function AskOverwrite for common stuff
9245 Consequently various changes to call these functions
9247 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9248 wild guess at sensible screen resolution when having no gui
9250 * src/lyxfont.C: no gui, no fonts... set some defaults
9252 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9254 * src/LColor.C: made the command inset background a bit lighter.
9256 2000-03-20 Hartmut Goebel <goebel@noris.net>
9258 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9259 stdstruct.inc. Koma-Script added some title elements which
9260 otherwise have been listed below "bibliography". This split allows
9261 adding title elements to where they belong.
9263 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9264 define the additional title elements and then include
9267 * many other layout files: changed to include stdtitle.inc just
9268 before stdstruct.inc.
9270 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9272 * src/buffer.C: (save) Added the option to store all backup files
9273 in a single directory
9275 * src/lyxrc.[Ch]: Added variable \backupdir_path
9277 * lib/lyxrc.example: Added descriptions of recently added variables
9279 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9280 bibtex inset, not closing the bibtex popup when deleting the inset)
9282 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9284 * src/lyx_cb.C: add a couple using directives.
9286 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9287 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9288 import based on the filename.
9290 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9291 file would be imported at start, if the filename where of a sgml file.
9293 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9295 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9297 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9298 * src/lyxfont.h Replaced the member variable bits.direction by the
9299 member variable lang. Made many changes in other files.
9300 This allows having a multi-lingual document
9302 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9303 that change the current language to <l>.
9304 Removed the command "font-rtl"
9306 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9307 format for Hebrew documents)
9309 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9310 When auto_mathmode is "true", pressing a digit key in normal mode
9311 will cause entering into mathmode.
9312 If auto_mathmode is "rtl" then this behavior will be active only
9313 when writing right-to-left text.
9315 * src/text2.C (InsertStringA) The string is inserted using the
9318 * src/paragraph.C (GetEndLabel) Gives a correct result for
9319 footnote paragraphs.
9321 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9323 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9325 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9326 front of PasteParagraph. Never insert a ' '. This should at least
9327 fix some cause for the segfaults that we have been experiencing,
9328 it also fixes backspace behaviour slightly. (Phu!)
9330 * src/support/lstrings.C (compare_no_case): some change to make it
9331 compile with gcc 2.95.2 and stdlibc++-v3
9333 * src/text2.C (MeltFootnoteEnvironment): change type o
9334 first_footnote_par_is_not_empty to bool.
9336 * src/lyxparagraph.h: make text private. Changes in other files
9338 (fitToSize): new function
9339 (setContentsFromPar): new function
9340 (clearContents): new function
9341 (SetChar): new function
9343 * src/paragraph.C (readSimpleWholeFile): deleted.
9345 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9346 the file, just use a simple string instead. Also read the file in
9347 a more maintainable manner.
9349 * src/text2.C (InsertStringA): deleted.
9350 (InsertStringB): deleted.
9352 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9354 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9355 RedoParagraphs from the doublespace handling part, just set status
9356 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9357 done, but perhaps not like this.)
9359 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9361 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9362 character when inserting an inset.
9364 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9366 * src/bufferparams.C (readLanguage): now takes "default" into
9369 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9370 also initialize the toplevel_keymap with the default bindings from
9373 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9375 * all files using lyxrc: have lyxrc as a real variable and not a
9376 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9379 * src/lyxrc.C: remove double call to defaultKeyBindings
9381 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9382 toolbar defauls using lyxlex. Remove enums, structs, functions
9385 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9386 toolbar defaults. Also store default keybindings in a map.
9388 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9389 storing the toolbar defaults without any xforms dependencies.
9391 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9392 applied. Changed to use iterators.
9394 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9396 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9397 systems that don't have LINGUAS set to begin with.
9399 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9401 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9402 the list by Dekel Tsur.
9404 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9406 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9407 * src/insets/form_graphics.C: ditto.
9409 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9411 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9413 * src/bufferparams.C (readLanguage): use the new language map
9415 * src/intl.C (InitKeyMapper): use the new language map
9417 * src/lyx_gui.C (create_forms): use the new language map
9419 * src/language.[Ch]: New files. Used for holding the information
9420 about each language. Now! Use this new language map enhance it and
9421 make it really usable for our needs.
9423 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9425 * screen.C (ShowCursor): Removed duplicate code.
9426 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9427 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9429 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9432 * src/text.C Added TransformChar method. Used for rendering Arabic
9433 text correctly (change the glyphs of the letter according to the
9434 position in the word)
9439 * src/lyxrc.C Added lyxrc command {language_command_begin,
9440 language_command_end,language_command_ltr,language_command_rtl,
9441 language_package} which allows the use of either arabtex or Omega
9444 * src/lyx_gui.C (init)
9446 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9447 to use encoding for menu fonts which is different than the encoding
9450 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9451 do not load the babel package.
9452 To write an English document with Hebrew/Arabic, change the document
9453 language to "english".
9455 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9456 (alphaCounter): changed to return char
9457 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9459 * lib/lyxrc.example Added examples for Hebrew/Arabic
9462 * src/layout.C Added layout command endlabeltype
9464 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9466 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9468 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9470 * src/mathed/math_delim.C (search_deco): return a
9471 math_deco_struct* instead of index.
9473 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9475 * All files with a USE_OSTREAM_ONLY within: removed all code that
9476 was unused when USE_OSTREAM_ONLY is defined.
9478 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9479 of any less. Removed header and using.
9481 * src/text.C (GetVisibleRow): draw the string "Page Break
9482 (top/bottom)" on screen when drawing a pagebreak line.
9484 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9486 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9488 * src/mathed/math_macro.C (draw): do some cast magic.
9491 * src/mathed/math_defs.h: change byte* argument to byte const*.
9493 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9495 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9496 know it is right to return InsetFoot* too, but cxx does not like
9499 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9501 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9503 * src/mathed/math_delim.C: change == to proper assignment.
9505 2000-03-09 Juergen Vigna <jug@sad.it>
9507 * src/insets/insettext.C (setPos): fixed various cursor positioning
9508 problems (via mouse and cursor-keys)
9509 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9510 inset (still a small display problem but it works ;)
9512 * src/insets/insetcollapsable.C (draw): added button_top_y and
9513 button_bottom_y to have correct values for clicking on the inset.
9515 * src/support/lyxalgo.h: commented out 'using std::less'
9517 2000-03-08 Juergen Vigna <jug@sad.it>
9519 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9520 Button-Release event closes as it is alos the Release-Event
9523 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9525 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9527 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9528 can add multiple spaces in Scrap (literate programming) styles...
9529 which, by the way, is how I got hooked on LyX to begin with.
9531 * src/mathed/formula.C (Write): Added dummy variable to an
9532 inset::Latex() call.
9533 (Latex): Add free_spacing boolean to inset::Latex()
9535 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9537 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9538 virtual function to include the free_spacing boolean from
9539 the containing paragraph's style.
9541 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9542 Added free_spacing boolean arg to match inset.h
9544 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9545 Added free_spacing boolean arg to match inset.h
9547 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9548 Added free_spacing boolean and made sure that if in a free_spacing
9549 paragraph, that we output normal space if there is a protected space.
9551 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9552 Added free_spacing boolean arg to match inset.h
9554 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9555 Added free_spacing boolean arg to match inset.h
9557 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9558 Added free_spacing boolean arg to match inset.h
9560 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9561 Added free_spacing boolean arg to match inset.h
9563 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9564 Added free_spacing boolean arg to match inset.h
9566 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9567 free_spacing boolean arg to match inset.h
9569 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9570 Added free_spacing boolean arg to match inset.h
9572 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9573 Added free_spacing boolean arg to match inset.h
9575 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9576 Added free_spacing boolean arg to match inset.h
9578 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9579 Added free_spacing boolean arg to match inset.h
9581 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9582 Added free_spacing boolean arg to match inset.h
9584 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9585 free_spacing boolean arg to match inset.h
9587 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9588 free_spacing boolean arg to match inset.h
9590 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9591 ignore free_spacing paragraphs. The user's spaces are left
9594 * src/text.C (InsertChar): Fixed the free_spacing layout
9595 attribute behavior. Now, if free_spacing is set, you can
9596 add multiple spaces in a paragraph with impunity (and they
9597 get output verbatim).
9598 (SelectSelectedWord): Added dummy argument to inset::Latex()
9601 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9604 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9605 paragraph layouts now only input a simple space instead.
9606 Special character insets don't make any sense in free-spacing
9609 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9610 hard-spaces in the *input* file to simple spaces if the layout
9611 is free-spacing. This converts old files which had to have
9612 hard-spaces in free-spacing layouts where a simple space was
9614 (writeFileAscii): Added free_spacing check to pass to the newly
9615 reworked inset::Latex(...) methods. The inset::Latex() code
9616 ensures that hard-spaces in free-spacing paragraphs get output
9617 as spaces (rather than "~").
9619 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9621 * src/mathed/math_delim.C (draw): draw the empty placeholder
9622 delims with a onoffdash line.
9623 (struct math_deco_compare): struct that holds the "functors" used
9624 for the sort and the binary search in math_deco_table.
9625 (class init_deco_table): class used for initial sort of the
9627 (search_deco): use lower_bound to do a binary search in the
9630 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9632 * src/lyxrc.C: a small secret thingie...
9634 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9635 and to not flush the stream as often as it used to.
9637 * src/support/lyxalgo.h: new file
9638 (sorted): template function used for checking if a sequence is
9639 sorted or not. Two versions with and without user supplied
9640 compare. Uses same compare as std::sort.
9642 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9643 it and give warning on lyxerr.
9645 (struct compare_tags): struct with function operators used for
9646 checking if sorted, sorting and lower_bound.
9647 (search_kw): use lower_bound instead of manually implemented
9650 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9652 * src/insets/insetcollapsable.h: fix Clone() declaration.
9653 * src/insets/insetfoot.h: ditto.
9655 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9657 2000-03-08 Juergen Vigna <jug@sad.it>
9659 * src/insets/lyxinset.h: added owner call which tells us if
9660 this inset is inside another inset. Changed also the return-type
9661 of Editable to an enum so it tells clearer what the return-value is.
9663 * src/insets/insettext.C (computeTextRows): fixed computing of
9664 textinsets which split automatically on more rows.
9666 * src/insets/insetert.[Ch]: changed this to be of BaseType
9669 * src/insets/insetfoot.[Ch]: added footnote inset
9671 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9672 collapsable insets (like footnote, ert, ...)
9674 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9676 * src/lyxdraw.h: remvoe file
9678 * src/lyxdraw.C: remove file
9680 * src/insets/insettext.C: added <algorithm>.
9682 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9684 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9685 (matrix_cb): case MM_OK use string stream
9687 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9690 * src/mathed/math_macro.C (draw): use string stream
9691 (Metrics): use string stream
9693 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9694 directly to the ostream.
9696 * src/vspace.C (asString): use string stream.
9697 (asString): use string stream
9698 (asLatexString): use string stream
9700 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9701 setting Spacing::Other.
9703 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9704 sprintf when creating the stretch vale.
9706 * src/text2.C (alphaCounter): changed to return a string and to
9707 not use a static variable internally. Also fixed a one-off bug.
9708 (SetCounter): changed the drawing of the labels to use string
9709 streams instead of sprintf.
9711 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9712 manipulator to use a scheme that does not require library support.
9713 This is also the way it is done in the new GNU libstdc++. Should
9714 work with DEC cxx now.
9716 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9718 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9719 end. This fixes a bug.
9721 * src/mathed (all files concerned with file writing): apply the
9722 USE_OSTREAM_ONLY changes to mathed too.
9724 * src/support/DebugStream.h: make the constructor explicit.
9726 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9727 count and ostream squashed.
9729 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9731 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9733 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9734 ostringstream uses STL strings, and we might not.
9736 * src/insets/insetspecialchar.C: add using directive.
9737 * src/insets/insettext.C: ditto.
9739 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9741 * lib/layouts/seminar.layout: feeble attempt at a layout for
9742 seminar.cls, far from completet and could really use some looking
9743 at from people used to write layout files.
9745 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9746 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9747 a lot nicer and works nicely with ostreams.
9749 * src/mathed/formula.C (draw): a slightly different solution that
9750 the one posted to the list, but I think this one works too. (font
9751 size wrong in headers.)
9753 * src/insets/insettext.C (computeTextRows): some fiddling on
9754 Jürgens turf, added some comments that he should read.
9756 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9757 used and it gave compiler warnings.
9758 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9761 * src/lyx_gui.C (create_forms): do the right thing when
9762 show_banner is true/false.
9764 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9765 show_banner is false.
9767 * most file writing files: Now use iostreams to do almost all of
9768 the writing. Also instead of passing string &, we now use
9769 stringstreams. mathed output is still not adapted to iostreams.
9770 This change can be turned off by commenting out all the occurences
9771 of the "#define USE_OSTREAM_ONLY 1" lines.
9773 * src/WorkArea.C (createPixmap): don't output debug messages.
9774 (WorkArea): don't output debug messages.
9776 * lib/lyxrc.example: added a comment about the new variable
9779 * development/Code_rules/Rules: Added some more commente about how
9780 to build class interfaces and on how better encapsulation can be
9783 2000-03-03 Juergen Vigna <jug@sad.it>
9785 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9786 automatically with the width of the LyX-Window
9788 * src/insets/insettext.C (computeTextRows): fixed update bug in
9789 displaying text-insets (scrollvalues where not initialized!)
9791 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9793 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9794 id in the check of the result from lower_bound is not enough since
9795 lower_bound can return last too, and then res->id will not be a
9798 * all insets and some code that use them: I have conditionalized
9799 removed the Latex(string & out, ...) this means that only the
9800 Latex(ostream &, ...) will be used. This is a work in progress to
9801 move towards using streams for all output of files.
9803 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9806 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9808 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9809 routine (this fixes bug where greek letters were surrounded by too
9812 * src/support/filetools.C (findtexfile): change a bit the search
9813 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9814 no longer passed to kpsewhich, we may have to change that later.
9816 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9817 warning options to avoid problems with X header files (from Angus
9819 * acinclude.m4: regenerated.
9821 2000-03-02 Juergen Vigna <jug@sad.it>
9823 * src/insets/insettext.C (WriteParagraphData): Using the
9824 par->writeFile() function for writing paragraph-data.
9825 (Read): Using buffer->parseSingleLyXformat2Token()-function
9826 for parsing paragraph data!
9828 * src/buffer.C (readLyXformat2): removed all parse data and using
9829 the new parseSingleLyXformat2Token()-function.
9830 (parseSingleLyXformat2Token): added this function to parse (read)
9831 lyx-file-format (this is called also from text-insets now!)
9833 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9835 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9838 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9839 directly instead of going through a func. One very bad thing: a
9840 static LyXFindReplace, but I don't know where to place it.
9842 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9843 string instead of char[]. Also changed to static.
9844 (GetSelectionOrWordAtCursor): changed to static inline
9845 (SetSelectionOverLenChars): ditto.
9847 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9848 current_view and global variables. both classes has changed names
9849 and LyXFindReplace is not inherited from SearchForm.
9851 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9852 fl_form_search form.
9854 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9856 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9858 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9859 bound (from Kayvan).
9861 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9863 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9865 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9867 * some things that I should comment but the local pub says head to
9870 * comment out all code that belongs to the Roff code for Ascii
9871 export of tables. (this is unused)
9873 * src/LyXView.C: use correct type for global variable
9874 current_layout. (LyXTextClass::size_type)
9876 * some code to get the new insetgraphics closer to working I'd be
9877 grateful for any help.
9879 * src/BufferView2.C (insertInset): use the return type of
9880 NumberOfLayout properly. (also changes in other files)
9882 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9883 this as a test. I want to know what breaks because of this.
9885 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9887 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9889 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9890 to use a \makebox in the label, this allows proper justification
9891 with out using protected spaces or multiple hfills. Now it is
9892 "label" for left justified, "\hfill label\hfill" for center, and
9893 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9894 should be changed accordingly.
9896 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9898 * src/lyxtext.h: change SetLayout() to take a
9899 LyXTextClass::size_type instead of a char (when there is more than
9900 127 layouts in a class); also change type of copylayouttype.
9901 * src/text2.C (SetLayout): ditto.
9902 * src/LyXView.C (updateLayoutChoice): ditto.
9904 * src/LaTeX.C (scanLogFile): errors where the line number was not
9905 given just after the '!'-line were ignored (from Dekel Tsur).
9907 * lib/lyxrc.example: fix description of \date_insert_format
9909 * lib/layouts/llncs.layout: new layout, contributed by Martin
9912 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9914 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9915 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9916 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9917 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9918 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9919 paragraph.C, text.C, text2.C)
9921 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9923 * src/insets/insettext.C (LocalDispatch): remove extra break
9926 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9927 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9929 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9930 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9932 * src/insets/insetbib.h: move InsetBibkey::Holder and
9933 InsetCitation::Holder in public space.
9935 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9937 * src/insets/insettext.h: small change to get the new files from
9938 Juergen to compile (use "string", not "class string").
9940 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9941 const & as parameter to LocalDispatch, use LyXFont const & as
9942 paramter to some other func. This also had impacto on lyxinsets.h
9943 and the two mathed insets.
9945 2000-02-24 Juergen Vigna <jug@sad.it>
9948 * src/commandtags.h:
9950 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9954 * src/BufferView2.C: added/updated code for various inset-functions
9956 * src/insets/insetert.[Ch]: added implementation of InsetERT
9958 * src/insets/insettext.[Ch]: added implementation of InsetText
9960 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9961 (draw): added preliminary code for inset scrolling not finshed yet
9963 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9964 as it is in lyxfunc.C now
9966 * src/insets/lyxinset.h: Added functions for text-insets
9968 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9970 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9971 BufferView and reimplement the list as a queue put inside its own
9974 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9976 * several files: use the new interface to the "updateinsetlist"
9978 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9980 (work_area_handler): call BufferView::trippleClick on trippleclick.
9982 * src/BufferView.C (doubleClick): new function, selects word on
9984 (trippleClick): new function, selects line on trippleclick.
9986 2000-02-22 Allan Rae <rae@lyx.org>
9988 * lib/bind/xemacs.bind: buffer-previous not supported
9990 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9992 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9995 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9997 * src/bufferlist.C: get rid of current_view from this file
9999 * src/spellchecker.C: get rid of current_view from this file
10001 * src/vspace.C: get rid of current_view from this file
10002 (inPixels): added BufferView parameter for this func
10003 (asLatexCommand): added a BufferParams for this func
10005 * src/text.C src/text2.C: get rid of current_view from these
10008 * src/lyxfont.C (getFontDirection): move this function here from
10011 * src/bufferparams.C (getDocumentDirection): move this function
10014 * src/paragraph.C (getParDirection): move this function here from
10016 (getLetterDirection): ditto
10018 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
10020 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
10021 resize due to wrong pixmap beeing used. Also took the opurtunity
10022 to make the LyXScreen stateless on regard to WorkArea and some
10023 general cleanup in the same files.
10025 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10027 * src/Makefile.am: add missing direction.h
10029 * src/PainterBase.h: made the width functions const.
10031 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
10034 * src/insets/insetcommand.C (draw): draw Editable as buttons.
10036 * src/insets/insetlatexaccent.C (draw): make the accents draw
10037 better, at present this will only work well with iso8859-1.
10039 * several files: remove the old drawing code, now we use the new
10042 * several files: remove support for mono_video, reverse_video and
10045 2000-02-17 Juergen Vigna <jug@sad.it>
10047 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
10048 int ** as we have to return the pointer, otherwise we have only
10049 NULL pointers in the returning function.
10051 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10053 * src/LaTeX.C (operator()): quote file name when running latex.
10055 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10057 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
10058 (bubble tip), this removes our special handling of this.
10060 * Remove all code that is unused now that we have the new
10061 workarea. (Code that are not active when NEW_WA is defined.)
10063 * Make the uses of XSync not conditionalized on define USE_XSYNC.
10065 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10067 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
10068 nonexisting layout; correctly redirect obsoleted layouts.
10070 * lib/lyxrc.example: document \view_dvi_paper_option
10072 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
10075 * src/lyx_cb.C (RunScript): handle $$FName for command names.
10076 (PreviewDVI): handle the view_dvi_paper_option variable.
10077 [Both from Roland Krause]
10079 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10081 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
10082 char const *, int, LyXFont)
10083 (text(int, int, string, LyXFont)): ditto
10085 * src/text.C (InsertCharInTable): attempt to fix the double-space
10086 feature in tables too.
10087 (BackspaceInTable): ditto.
10088 (GetVisibleRow): make bottom pagebreak line be a onoff line.
10090 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10092 * src/text2.C (owner): only complain if owner_ is set and bv != 0
10094 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
10095 newly found text in textcache to this.
10096 (buffer): set the owner of the text put into the textcache to 0
10098 * src/insets/figinset.C (draw): fixed the drawing of figures with
10101 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
10102 drawing of mathframe, hfills, protected space, table lines. I have
10103 now no outstanding drawing problems with the new Painter code.
10105 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10107 * src/PainterBase.C (ellipse, circle): do not specify the default
10110 * src/LColor.h: add using directive.
10112 * src/Painter.[Ch]: change return type of methods from Painter& to
10113 PainterBase&. Add a using directive.
10115 * src/WorkArea.C: wrap xforms callbacks in C functions
10118 * lib/layouts/foils.layout: font fix and simplifications from Carl
10121 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10123 * a lot of files: The Painter, LColor and WorkArea from the old
10124 devel branch has been ported to lyx-devel. Some new files and a
10125 lot of #ifdeffed code. The new workarea is enabled by default, but
10126 if you want to test the new Painter and LColor you have to compile
10127 with USE_PAINTER defined (do this in config.h f.ex.) There are
10128 still some rought edges, and I'd like some help to clear those
10129 out. It looks stable (loads and displays the Userguide very well).
10132 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10134 * src/buffer.C (pop_tag): revert to the previous implementation
10135 (use a global variable for both loops).
10137 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
10139 * src/lyxrc.C (LyXRC): change slightly default date format.
10141 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10142 there is an English text with a footnote that starts with a Hebrew
10143 paragraph, or vice versa.
10144 (TeXFootnote): ditto.
10146 * src/text.C (LeftMargin): allow for negative values for
10147 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10150 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10151 for input encoding (cyrillic)
10153 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10155 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10158 * src/toolbar.C (set): ditto
10159 * src/insets/insetbib.C (create_form_citation_form): ditto
10161 * lib/CREDITS: added Dekel Tsur.
10163 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10164 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10165 hebrew supports files from Dekel Tsur.
10167 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10168 <tzafrir@technion.ac.il>
10170 * src/lyxrc.C: put \date_insert_format at the right place.
10172 * src/buffer.C (makeLaTeXFile): fix the handling of
10173 BufferParams::sides when writing out latex files.
10175 * src/BufferView2.C: add a "using" directive.
10177 * src/support/lyxsum.C (sum): when we use lyxstring,
10178 ostringstream::str needs an additional .c_str().
10180 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10182 * src/support/filetools.C (ChangeExtension): patch from Etienne
10185 * src/TextCache.C (show): remove const_cast and make second
10186 parameter non-const LyXText *.
10188 * src/TextCache.h: use non const LyXText in show.
10190 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10193 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10195 * src/support/lyxsum.C: rework to be more flexible.
10197 * several places: don't check if a pointer is 0 if you are going
10200 * src/text.C: remove some dead code.
10202 * src/insets/figinset.C: remove some dead code
10204 * src/buffer.C: move the BufferView funcs to BufferView2.C
10205 remove all support for insetlatexdel
10206 remove support for oldpapersize stuff
10207 made some member funcs const
10209 * src/kbmap.C: use a std::list to store the bindings in.
10211 * src/BufferView2.C: new file
10213 * src/kbsequence.[Ch]: new files
10215 * src/LyXAction.C + others: remove all trace of buffer-previous
10217 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10218 only have one copy in the binary of this table.
10220 * hebrew patch: moved some functions from LyXText to more
10221 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10223 * several files: remove support for XForms older than 0.88
10224 whitespace changes.
10225 remove some #if 0 #endif code
10227 * src/TextCache.[Ch]: new file. Holds the textcache.
10229 * src/BufferView.C: changes to use the new TextCache interface.
10230 (waitForX): remove the now unused code.
10232 * src/BackStack.h: remove some commented code
10234 * lib/bind/emacs.bind: remove binding for buffer-previous
10236 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10238 * applied the hebrew patch.
10240 * src/lyxrow.h: make sure that all Row variables are initialized.
10242 * src/text2.C (TextHandleUndo): comment out a delete, this might
10243 introduce a memory leak, but should also help us to not try to
10244 read freed memory. We need to look at this one.
10246 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10247 (LyXParagraph): initalize footnotekind.
10249 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10250 forgot this when applying the patch. Please heed the warnings.
10252 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10253 (aka. reformat problem)
10255 * src/bufferlist.C (exists): made const, and use const_iterator
10256 (isLoaded): new func.
10257 (release): use std::find to find the correct buffer.
10259 * src/bufferlist.h: made getState a const func.
10260 made empty a const func.
10261 made exists a const func.
10264 2000-02-01 Juergen Vigna <jug@sad.it>
10266 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10268 * po/it.po: updated a bit the italian po file and also changed the
10269 'file nuovo' for newfile to 'filenuovo' without a space, this did
10272 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10273 for the new insert_date command.
10275 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10276 from jdblair, to insert a date into the current text conforming to
10277 a strftime format (for now only considering the locale-set and not
10278 the document-language).
10280 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10282 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10283 Bounds Read error seen by purify. The problem was that islower is
10284 a macros which takes an unsigned char and uses it as an index for
10285 in array of characters properties (and is thus subject to the
10289 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10290 correctly the paper sides radio buttons.
10291 (UpdateDocumentButtons): ditto.
10293 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10295 * src/kbmap.C (getsym + others): change to return unsigned int,
10296 returning a long can give problems on 64 bit systems. (I assume
10297 that int is 32bit on 64bit systems)
10299 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10301 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10302 LyXLookupString to be zero-terminated. Really fixes problems seen
10303 by purify, I think.
10305 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10307 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10308 write a (char*)0 to the lyxerr stream.
10310 * src/lastfiles.C: move algorithm before the using statemets.
10312 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10314 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10315 complains otherwise).
10316 * src/table.C: ditto
10318 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10321 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10322 that I removed earlier... It is really needed.
10324 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10326 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10328 * INSTALL: update xforms home page URL.
10330 * lib/configure.m4: fix a bug with unreadable layout files.
10332 * src/table.C (calculate_width_of_column): add "using std::max"
10335 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10337 * several files: marked several lines with "DEL LINE", this is
10338 lines that can be deleted without changing anything.
10339 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10340 checks this anyway */
10343 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10345 * src/DepTable.C (update): add a "+" at the end when the checksum
10346 is different. (debugging string only)
10348 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10349 the next inset to not be displayed. This should also fix the list
10350 of labels in the "Insert Crossreference" dialog.
10352 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10354 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10355 when regex was not found.
10357 * src/support/lstrings.C (lowercase): use handcoded transform always.
10360 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10361 old_cursor.par->prev could be 0.
10363 * several files: changed post inc/dec to pre inc/dec
10365 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10366 write the lastfiles to file.
10368 * src/BufferView.C (buffer): only show TextCache info when debugging
10370 (resizeCurrentBuffer): ditto
10371 (workAreaExpose): ditto
10373 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10375 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10377 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10378 a bit better by removing the special case for \i and \j.
10380 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10382 * src/lyx_main.C (easyParse): remove test for bad comand line
10383 options, since this broke all xforms-related parsing.
10385 * src/kbmap.C (getsym): set return type to unsigned long, as
10386 declared in header. On an alpha, long is _not_ the same as int.
10388 * src/support/LOstream.h: add a "using std::flush;"
10390 * src/insets/figinset.C: ditto.
10392 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10394 * src/bufferlist.C (write): use blinding fast file copy instead of
10395 "a char at a time", now we are doing it the C++ way.
10397 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10398 std::list<int> instead.
10399 (addpidwait): reflect move to std::list<int>
10400 (sigchldchecker): ditto
10402 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10405 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10406 that obviously was wrong...
10408 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10409 c, this avoids warnings with purify and islower.
10411 * src/insets/figinset.C: rename struct queue to struct
10412 queue_element and rewrite to use a std::queue. gsqueue is now a
10413 std::queue<queue_element>
10414 (runqueue): reflect move to std::queue
10417 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10418 we would get "1" "0" instead of "true" "false. Also make the tostr
10421 2000-01-21 Juergen Vigna <jug@sad.it>
10423 * src/buffer.C (writeFileAscii): Disabled code for special groff
10424 handling of tabulars till I fix this in table.C
10426 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10428 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10430 * src/support/lyxlib.h: ditto.
10432 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10434 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10435 and 'j' look better. This might fix the "macron" bug that has been
10438 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10439 functions as one template function. Delete the old versions.
10441 * src/support/lyxsum.C: move using std::ifstream inside
10444 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10447 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10449 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10451 * src/insets/figinset.C (InitFigures): use new instead of malloc
10452 to allocate memory for figures and bitmaps.
10453 (DoneFigures): use delete[] instead of free to deallocate memory
10454 for figures and bitmaps.
10455 (runqueue): use new to allocate
10456 (getfigdata): use new/delete[] instead of malloc/free
10457 (RegisterFigure): ditto
10459 * some files: moved some declarations closer to first use, small
10460 whitespace changes use preincrement instead of postincrement where
10461 it does not make a difference.
10463 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10464 step on the way to use stl::containers for key maps.
10466 * src/bufferlist.h: add a typedef for const_iterator and const
10467 versions of begin and end.
10469 * src/bufferlist.[Ch]: change name of member variable _state to
10470 state_. (avoid reserved names)
10472 (getFileNames): returns the filenames of the buffers in a vector.
10474 * configure.in (ALL_LINGUAS): added ro
10476 * src/support/putenv.C: new file
10478 * src/support/mkdir.C: new file
10480 2000-01-20 Allan Rae <rae@lyx.org>
10482 * lib/layouts/IEEEtran.layout: Added several theorem environments
10484 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10485 couple of minor additions.
10487 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10488 (except for those in footnotes of course)
10490 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10492 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10494 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10495 std::sort and std::lower_bound instead of qsort and handwritten
10497 (struct compara): struct that holds the functors used by std::sort
10498 and std::lower_bound in MathedLookupBOP.
10500 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10502 * src/support/LAssert.h: do not do partial specialization. We do
10503 not really need it.
10505 * src/support/lyxlib.h: note that lyx::getUserName() and
10506 lyx::date() are not in use right now. Should these be suppressed?
10508 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10509 (makeLinuxDocFile): do not put date and user name in linuxdoc
10512 * src/support/lyxlib.h (kill): change first argument to long int,
10513 since that's what solaris uses.
10515 * src/support/kill.C (kill): fix declaration to match prototype.
10517 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10518 actually check whether namespaces are supported. This is not what
10521 * src/support/lyxsum.C: add a using directive.
10523 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10525 * src/support/kill.C: if we have namespace support we don't have
10526 to include lyxlib.h.
10528 * src/support/lyxlib.h: use namespace lyx if supported.
10530 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10532 * src/support/date.C: new file
10534 * src/support/chdir.C: new file
10536 * src/support/getUserName.C: new file
10538 * src/support/getcwd.C: new file
10540 * src/support/abort.C: new file
10542 * src/support/kill.C: new file
10544 * src/support/lyxlib.h: moved all the functions in this file
10545 insede struct lyx. Added also kill and abort to this struct. This
10546 is a way to avoid the "kill is not defined in <csignal>", we make
10547 C++ wrappers for functions that are not ANSI C or ANSI C++.
10549 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10550 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10551 lyx it has been renamed to sum.
10553 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10555 * src/text.C: add using directives for std::min and std::max.
10557 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10559 * src/texrow.C (getIdFromRow): actually return something useful in
10560 id and pos. Hopefully fixes the bug with positionning of errorbox
10563 * src/lyx_main.C (easyParse): output an error and exit if an
10564 incorrect command line option has been given.
10566 * src/spellchecker.C (ispell_check_word): document a memory leak.
10568 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10569 where a "struct utimbuf" is allocated with "new" and deleted with
10572 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10574 * src/text2.C (CutSelection): don't delete double spaces.
10575 (PasteSelection): ditto
10576 (CopySelection): ditto
10578 * src/text.C (Backspace): don't delete double spaces.
10580 * src/lyxlex.C (next): fix a bug that were only present with
10581 conformant std::istream::get to read comment lines, use
10582 std::istream::getline instead. This seems to fix the problem.
10584 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10586 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10587 allowed to insert space before space" editing problem. Please read
10588 commends at the beginning of the function. Comments about usage
10591 * src/text.C (InsertChar): fix for the "not allowed to insert
10592 space before space" editing problem.
10594 * src/text2.C (DeleteEmptyParagraphMechanism): when
10595 IsEmptyTableRow can only return false this last "else if" will
10596 always be a no-op. Commented out.
10598 * src/text.C (RedoParagraph): As far as I can understand tmp
10599 cursor is not really needed.
10601 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10602 present it could only return false anyway.
10603 (several functions): Did something not so smart...added a const
10604 specifier on a lot of methods.
10606 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10607 and add a tmp->text.resize. The LyXParagraph constructor does the
10609 (BreakParagraphConservative): ditto
10611 * src/support/path.h (Path): add a define so that the wrong usage
10612 "Path("/tmp") will be flagged as a compilation error:
10613 "`unnamed_Path' undeclared (first use this function)"
10615 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10617 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10618 which was bogus for several reasons.
10620 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10622 (runBibTeX): ditto.
10624 * autogen.sh: do not use "type -path" (what's that anyway?).
10626 * src/support/filetools.C (findtexfile): remove extraneous space
10627 which caused a kpsewhich warning (at least with kpathsea version
10630 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10632 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10634 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10636 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10638 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10640 * src/paragraph.C (BreakParagraph): do not reserve space on text
10641 if we don't need to (otherwise, if pos_end < pos, we end up
10642 reserving huge amounts of memory due to bad unsigned karma).
10643 (BreakParagraphConservative): ditto, although I have not seen
10644 evidence the bug can happen here.
10646 * src/lyxparagraph.h: add a using std::list.
10648 2000-01-11 Juergen Vigna <jug@sad.it>
10650 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10651 could not be found.
10653 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10655 * src/vc-backend.C (doVCCommand): change to be static and take one
10656 more parameter: the path to chdir too be fore executing the command.
10657 (retrive): new function equiv to "co -r"
10659 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10660 file_not_found_hook is true.
10662 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10664 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10665 if a file is readwrite,readonly...anything else.
10667 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10669 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10670 (CreatePostscript): name change from MenuRunDVIPS (or something)
10671 (PreviewPostscript): name change from MenuPreviewPS
10672 (PreviewDVI): name change from MenuPreviewDVI
10674 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10675 \view_pdf_command., \pdf_to_ps_command
10677 * lib/configure.m4: added search for PDF viewer, and search for
10678 PDF to PS converter.
10679 (lyxrc.defaults output): add \pdflatex_command,
10680 \view_pdf_command and \pdf_to_ps_command.
10682 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10684 * src/bufferlist.C (write): we don't use blocksize for anything so
10687 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10689 * src/support/block.h: disable operator T* (), since it causes
10690 problems with both compilers I tried. See comments in the file.
10692 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10695 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10696 variable LYX_DIR_10x to LYX_DIR_11x.
10698 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10700 * INSTALL: document --with-lyxname.
10703 * configure.in: new configure flag --with-lyxname which allows to
10704 choose the name under which lyx is installed. Default is "lyx", of
10705 course. It used to be possible to do this with --program-suffix,
10706 but the later has in fact a different meaning for autoconf.
10708 * src/support/lstrings.h (lstrchr): reformat a bit.
10710 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10711 * src/mathed/math_defs.h: ditto.
10713 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10715 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10716 true, decides if we create a backup file or not when saving. New
10717 tag and variable \pdf_mode, defaults to false. New tag and
10718 variable \pdflatex_command, defaults to pdflatex. New tag and
10719 variable \view_pdf_command, defaults to xpdf. New tag and variable
10720 \pdf_to_ps_command, defaults to pdf2ps.
10722 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10724 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10725 does not have a BufferView.
10726 (unlockInset): ditto + don't access the_locking_inset if the
10727 buffer does not have a BufferView.
10729 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10730 certain circumstances so that we don't continue a keyboard
10731 operation long after the key was released. Try f.ex. to load a
10732 large document, press PageDown for some seconds and then release
10733 it. Before this change the document would contine to scroll for
10734 some time, with this change it stops imidiatly.
10736 * src/support/block.h: don't allocate more space than needed. As
10737 long as we don't try to write to the arr[x] in a array_type arr[x]
10738 it is perfectly ok. (if you write to it you might segfault).
10739 added operator value_type*() so that is possible to pass the array
10740 to functions expecting a C-pointer.
10742 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10745 * intl/*: updated to gettext 0.10.35, tried to add our own
10746 required modifications. Please verify.
10748 * po/*: updated to gettext 0.10.35, tried to add our own required
10749 modifications. Please verify.
10751 * src/support/lstrings.C (tostr): go at fixing the problem with
10752 cxx and stringstream. When stringstream is used return
10753 oss.str().c_str() so that problems with lyxstring and basic_string
10754 are avoided. Note that the best solution would be for cxx to use
10755 basic_string all the way, but it is not conformant yet. (it seems)
10757 * src/lyx_cb.C + other files: moved several global functions to
10758 class BufferView, some have been moved to BufferView.[Ch] others
10759 are still located in lyx_cb.C. Code changes because of this. (part
10760 of "get rid of current_view project".)
10762 * src/buffer.C + other files: moved several Buffer functions to
10763 class BufferView, the functions are still present in buffer.C.
10764 Code changes because of this.
10766 * config/lcmessage.m4: updated to most recent. used when creating
10769 * config/progtest.m4: updated to most recent. used when creating
10772 * config/gettext.m4: updated to most recent. applied patch for
10775 * config/gettext.m4.patch: new file that shows what changes we
10776 have done to the local copy of gettext.m4.
10778 * config/libtool.m4: new file, used in creation of acinclude.m4
10780 * config/lyxinclude.m4: new file, this is the lyx created m4
10781 macros, used in making acinclude.m4.
10783 * autogen.sh: GNU m4 discovered as a separate task not as part of
10784 the lib/configure creation.
10785 Generate acinlucde from files in config. Actually cat
10786 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10787 easier to upgrade .m4 files that really are external.
10789 * src/Spacing.h: moved using std::istringstream to right after
10790 <sstream>. This should fix the problem seen with some compilers.
10792 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10794 * src/lyx_cb.C: began some work to remove the dependency a lot of
10795 functions have on BufferView::text, even if not really needed.
10796 (GetCurrentTextClass): removed this func, it only hid the
10799 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10800 forgot this in last commit.
10802 * src/Bullet.C (bulletEntry): use static char const *[] for the
10803 tables, becuase of this the return arg had to change to string.
10804 (bulletSize): ditto
10805 (~Bullet): removed unneeded destructor
10807 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10808 (insetSleep): moved from Buffer
10809 (insetWakeup): moved from Buffer
10810 (insetUnlock): moved from Buffer
10812 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10813 from Buffer to BufferView.
10815 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10817 * config/ltmain.sh: updated to version 1.3.4 of libtool
10819 * config/ltconfig: updated to version 1.3.4 of libtool
10821 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10824 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10825 Did I get that right?
10827 * src/lyxlex.h: add a "using" directive or two.
10828 * src/Spacing.h: ditto.
10829 * src/insets/figinset.C: ditto.
10830 * src/support/filetools.C: ditto.
10831 * src/support/lstrings.C: ditto.
10832 * src/BufferView.C: ditto.
10833 * src/bufferlist.C: ditto.
10834 * src/lyx_cb.C: ditto.
10835 * src/lyxlex.C: ditto.
10837 * NEWS: add some changes for 1.1.4.
10839 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10841 * src/BufferView.C: first go at a TextCache to speed up switching
10844 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10846 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10847 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10848 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10849 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10852 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10853 members of the struct are correctly initialized to 0 (detected by
10855 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10856 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10858 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10859 pidwait, since it was allocated with "new". This was potentially
10860 very bad. Thanks to Michael Schmitt for running purify for us.
10863 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10865 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10867 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10869 1999-12-30 Allan Rae <rae@lyx.org>
10871 * lib/templates/IEEEtran.lyx: minor change
10873 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10874 src/mathed/formula.C (LocalDispatch): askForText changes
10876 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10877 know when a user has cancelled input. Fixes annoying problems with
10878 inserting labels and version control.
10880 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10882 * src/support/lstrings.C (tostr): rewritten to use strstream and
10885 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10887 * src/support/filetools.C (IsFileWriteable): use fstream to check
10888 (IsDirWriteable): use fileinfo to check
10890 * src/support/filetools.h (FilePtr): whole class deleted
10892 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10894 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10896 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10898 * src/bufferlist.C (write): use ifstream and ofstream instead of
10901 * src/Spacing.h: use istrstream instead of sscanf
10903 * src/mathed/math_defs.h: change first arg to istream from FILE*
10905 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10907 * src/mathed/math_parser.C: have yyis to be an istream
10908 (LexGetArg): use istream (yyis)
10910 (mathed_parse): ditto
10911 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10913 * src/mathed/formula.C (Read): rewritten to use istream
10915 * src/mathed/formulamacro.C (Read): rewritten to use istream
10917 * src/lyxlex.h (~LyXLex): deleted desturctor
10918 (getStream): new function, returns an istream
10919 (getFile): deleted funtion
10920 (IsOK): return is.good();
10922 * src/lyxlex.C (LyXLex): delete file and owns_file
10923 (setFile): open an filebuf and assign that to a istream instead of
10925 (setStream): new function, takes an istream as arg.
10926 (setFile): deleted function
10927 (EatLine): rewritten us use istream instead of FILE*
10931 * src/table.C (LyXTable): use istream instead of FILE*
10932 (Read): rewritten to take an istream instead of FILE*
10934 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10936 * src/buffer.C (Dispatch): remove an extraneous break statement.
10938 * src/support/filetools.C (QuoteName): change to do simple
10939 'quoting'. More work is necessary. Also changed to do nothing
10940 under emx (needs fix too).
10941 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10943 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10944 config.h.in to the AC_DEFINE_UNQUOTED() call.
10945 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10946 needs char * as argument (because Solaris 7 declares it like
10949 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10950 remove definition of BZERO.
10952 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10954 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10955 defined, "lyxregex.h" if not.
10957 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10959 (REGEX): new variable that is set to regex.c lyxregex.h when
10960 AM_CONDITIONAL USE_REGEX is set.
10961 (libsupport_la_SOURCES): add $(REGEX)
10963 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10966 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10969 * configure.in: add call to LYX_REGEX
10971 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10972 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10974 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10976 * lib/bind/fi_menus.bind: new file, from
10977 pauli.virtanen@saunalahti.fi.
10979 * src/buffer.C (getBibkeyList): pass the parameter delim to
10980 InsetInclude::getKeys and InsetBibtex::getKeys.
10982 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10983 is passed to Buffer::getBibkeyList
10985 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10986 instead of the hardcoded comma.
10988 * src/insets/insetbib.C (getKeys): make sure that there are not
10989 leading blanks in bibtex keys. Normal latex does not care, but
10990 harvard.sty seems to dislike blanks at the beginning of citation
10991 keys. In particular, the retturn value of the function is
10993 * INSTALL: make it clear that libstdc++ is needed and that gcc
10994 2.7.x probably does not work.
10996 * src/support/filetools.C (findtexfile): make debug message go to
10998 * src/insets/insetbib.C (getKeys): ditto
11000 * src/debug.C (showTags): make sure that the output is correctly
11003 * configure.in: add a comment for TWO_COLOR_ICON define.
11005 * acconfig.h: remove all the entries that already defined in
11006 configure.in or acinclude.m4.
11008 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
11009 to avoid user name, date and copyright.
11011 1999-12-21 Juergen Vigna <jug@sad.it>
11013 * src/table.C (Read): Now read bogus row format informations
11014 if the format is < 5 so that afterwards the table can
11015 be read by lyx but without any format-info. Fixed the
11016 crash we experienced when not doing this.
11018 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
11020 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
11021 (RedoDrawingOfParagraph): ditto
11022 (RedoParagraphs): ditto
11023 (RemoveTableRow): ditto
11025 * src/text.C (Fill): rename arg paperwidth -> paper_width
11027 * src/buffer.C (insertLyXFile): rename var filename -> fname
11028 (writeFile): rename arg filename -> fname
11029 (writeFileAscii): ditto
11030 (makeLaTeXFile): ditto
11031 (makeLinuxDocFile): ditto
11032 (makeDocBookFile): ditto
11034 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
11037 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
11039 * src/bmtable.h: add extern "C" on this file when __cplusplus is
11042 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
11043 compiled by a C compiler not C++.
11045 * src/layout.h (LyXTextClass): added typedef for const_iterator
11046 (LyXTextClassList): added typedef for const_iterator + member
11047 functions begin and end.
11049 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
11050 iterators to fill the choice_class.
11051 (updateLayoutChoice): rewritten to use iterators to fill the
11052 layoutlist in the toolbar.
11054 * src/BufferView.h (BufferView::work_area_width): removed unused
11057 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
11059 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
11060 (sgmlCloseTag): ditto
11062 * src/support/lstrings.h: return type of countChar changed to
11065 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
11066 what version of this func to use. Also made to return unsigned int.
11068 * configure.in: call LYX_STD_COUNT
11070 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
11071 conforming std::count.
11073 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11075 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
11076 and a subscript would give bad display (patch from Dekel Tsur
11077 <dekel@math.tau.ac.il>).
11079 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
11081 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
11084 * src/chset.h: add a few 'using' directives
11086 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
11087 triggered when no buffer is active
11089 * src/layout.C: removed `break' after `return' in switch(), since
11092 * src/lyx_main.C (init): make sure LyX can be ran in place even
11093 when libtool has done its magic with shared libraries. Fix the
11094 test for the case when the system directory has not been found.
11096 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
11097 name for the latex file.
11098 (MenuMakeHTML): ditto
11100 * src/buffer.h: add an optional boolean argument, which is passed
11101 to ChangeExtension.
11103 1999-12-20 Allan Rae <rae@lyx.org>
11105 * lib/templates/IEEEtran.lyx: small correction and update.
11107 * configure.in: Attempted to use LYX_PATH_HEADER
11109 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
11111 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
11112 input from JMarc. Now use preprocessor to find the header.
11113 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
11114 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
11115 LYX_STL_STRING_FWD. See comments in file.
11117 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
11119 * The global MiniBuffer * minibuffer variable is dead.
11121 * The global FD_form_main * fd_form_main variable is dead.
11123 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11125 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
11127 * src/table.h: add the LOstream.h header
11128 * src/debug.h: ditto
11130 * src/LyXAction.h: change the explaination of the ReadOnly
11131 attribute: is indicates that the function _can_ be used.
11133 * src/LyXAction.C (init): find-replace _can_ be used in read-only
11136 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11138 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11144 * src/paragraph.C (GetWord): assert on pos>=0
11147 * src/support/lyxstring.C: condition the use of an invariant on
11149 * src/support/lyxstring.h: ditto
11151 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11152 Use LAssert.h instead of plain assert().
11154 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11156 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11157 * src/support/filetools.C: ditto
11159 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11162 * INSTALL: document the new configure flags
11164 * configure.in: suppress --with-debug; add --enable-assertions
11166 * acinclude.m4: various changes in alignment of help strings.
11168 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11170 * src/kbmap.C: commented out the use of the hash map in kb_map,
11171 beginning of movement to a stl::container.
11173 * several files: removed code that was not in effect when
11174 MOVE_TEXT was defined.
11176 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11177 for escaping should not be used. We can discuss if the string
11178 should be enclosed in f.ex. [] instead of "".
11180 * src/trans_mgr.C (insert): use the new returned value from
11181 encodeString to get deadkeys and keymaps done correctly.
11183 * src/chset.C (encodeString): changed to return a pair, to tell
11184 what to use if we know the string.
11186 * src/lyxscreen.h (fillArc): new function.
11188 * src/FontInfo.C (resize): rewritten to use more std::string like
11189 structore, especially string::replace.
11191 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11194 * configure.in (chmod +x some scripts): remove config/gcc-hack
11196 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11198 * src/buffer.C (writeFile): change once again the top comment in a
11199 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11200 instead of an hardcoded version number.
11201 (makeDocBookFile): ditto
11203 * src/version.h: add new define LYX_DOCVERSION
11205 * po/de.po: update from Pit Sütterlin
11206 * lib/bind/de_menus.bind: ditto.
11208 * src/lyxfunc.C (Dispatch): call MenuExport()
11209 * src/buffer.C (Dispatch): ditto
11211 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11212 LyXFunc::Dispatch().
11213 (MenuExport): new function, moved from
11214 LyXFunc::Dispatch().
11216 * src/trans_mgr.C (insert): small cleanup
11217 * src/chset.C (loadFile): ditto
11219 * lib/kbd/iso8859-1.cdef: add missing backslashes
11221 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11223 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11224 help with placing the manually drawn accents better.
11226 (Draw): x2 and hg changed to float to minimize rounding errors and
11227 help place the accents better.
11229 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11230 unsigned short to char is just wrong...cast the char to unsigned
11231 char instead so that the two values can compare sanely. This
11232 should also make the display of insetlatexaccents better and
11233 perhaps also some other insets.
11235 (lbearing): new function
11238 1999-12-15 Allan Rae <rae@lyx.org>
11240 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11241 header that provides a wrapper around the very annoying SGI STL header
11244 * src/support/lyxstring.C, src/LString.h:
11245 removed old SGI-STL-compatability attempts.
11247 * configure.in: Use LYX_STL_STRING_FWD.
11249 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11250 stl_string_fwd.h is around and try to determine it's location.
11251 Major improvement over previous SGI STL 3.2 compatability.
11252 Three small problems remain with this function due to my zero
11253 knowledge of autoconf. JMarc and lgb see the comments in the code.
11255 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11257 * src/broken_const.h, config/hack-gcc, config/README: removed
11259 * configure.in: remove --with-gcc-hack option; do not call
11262 * INSTALL: remove documentation of --with-broken-const and
11265 * acconfig.h: remove all trace of BROKEN_CONST define
11267 * src/buffer.C (makeDocBookFile): update version number in output
11269 (SimpleDocBookOnePar): fix an assert when trying to a character
11270 access beyond string length
11273 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11275 * po/de.po: fix the Export menu
11277 * lyx.man: update the description of -dbg
11279 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11280 (commandLineHelp): updated
11281 (easyParse): show list of available debug levels if -dbg is passed
11284 * src/Makefile.am: add debug.C
11286 * src/debug.h: moved some code to debug.C
11288 * src/debug.C: new file. Contains code to set and show debug
11291 * src/layout.C: remove 'break' after 'continue' in switch
11292 statements, since these cannot be reached.
11294 1999-12-13 Allan Rae <rae@lyx.org>
11296 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11297 (in_word_set): hash() -> math_hash()
11299 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11301 * acconfig.h: Added a test for whether we are using exceptions in the
11302 current compilation run. If so USING_EXCEPTIONS is defined.
11304 * config.in: Check for existance of stl_string_fwd.h
11305 * src/LString.h: If compiling --with-included-string and SGI's
11306 STL version 3.2 is present (see above test) we need to block their
11307 forward declaration of string and supply a __get_c_string().
11308 However, it turns out this is only necessary if compiling with
11309 exceptions enabled so I've a bit more to add yet.
11311 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11312 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11313 src/support/LRegex.h, src/undo.h:
11314 Shuffle the order of the included files a little to ensure that
11315 LString.h gets included before anything that includes stl_string_fwd.h
11317 * src/support/lyxstring.C: We need to #include LString.h instead of
11318 lyxstring.h to get the necessary definition of __get_c_string.
11319 (__get_c_string): New function. This is defined static just like SGI's
11320 although why they need to do this I'm not sure. Perhaps it should be
11321 in lstrings.C instead.
11323 * lib/templates/IEEEtran.lyx: New template file.
11325 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11327 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11328 * intl/Makefile.in (MKINSTALLDIRS): ditto
11330 * src/LyXAction.C (init): changed to hold the LFUN data in a
11331 automatic array in stead of in callso to newFunc, this speeds up
11332 compilation a lot. Also all the memory used by the array is
11333 returned when the init is completed.
11335 * a lot of files: compiled with -Wold-style-cast, changed most of
11336 the reported offenders to C++ style casts. Did not change the
11337 offenders in C files.
11339 * src/trans.h (Match): change argument type to unsigned int.
11341 * src/support/DebugStream.C: fix some types on the streambufs so
11342 that it works on a conforming implementation.
11344 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11346 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11348 * src/support/lyxstring.C: remove the inline added earlier since
11349 they cause a bunch of unsatisfied symbols when linking with dec
11350 cxx. Cxx likes to have the body of inlines at the place where they
11353 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11354 accessing negative bounds in array. This fixes the crash when
11355 inserting accented characters.
11356 * src/trans.h (Match): ditto
11358 * src/buffer.C (Dispatch): since this is a void, it should not try
11359 to return anything...
11361 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11363 * src/buffer.h: removed the two friends from Buffer. Some changes
11364 because of this. Buffer::getFileName and Buffer::setFileName
11365 renamed to Buffer::fileName() and Buffer::fileName(...).
11367 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11369 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11370 and Buffer::update(short) to BufferView. This move is currently
11371 controlled by a define MOVE_TEXT, this will be removed when all
11372 shows to be ok. This move paves the way for better separation
11373 between buffer contents and buffer view. One side effect is that
11374 the BufferView needs a rebreak when swiching buffers, if we want
11375 to avoid this we can add a cache that holds pointers to LyXText's
11376 that is not currently in use.
11378 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11381 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11383 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11385 * lyx_main.C: new command line option -x (or --execute) and
11386 -e (or --export). Now direct conversion from .lyx to .tex
11387 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11388 Unfortunately, X is still needed and the GUI pops up during the
11391 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11393 * src/Spacing.C: add a using directive to bring stream stuff into
11395 * src/paragraph.C: ditto
11396 * src/buffer.C: ditto
11398 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11399 from Lars' announcement).
11401 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11402 example files from Tino Meinen.
11404 1999-12-06 Allan Rae <rae@lyx.org>
11406 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11408 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11410 * src/support/lyxstring.C: added a lot of inline for no good
11413 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11414 latexWriteEndChanges, they were not used.
11416 * src/layout.h (operator<<): output operator for PageSides
11418 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11420 * some example files: loaded in LyX 1.0.4 and saved again to update
11421 certain constructs (table format)
11423 * a lot of files: did the change to use fstream/iostream for all
11424 writing of files. Done with a close look at Andre Poenitz's patch.
11426 * some files: whitespace changes.
11428 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11430 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11431 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11432 architecture, we provide our own. It is used unconditionnally, but
11433 I do not think this is a performance problem. Thanks to Angus
11434 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11435 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11437 (GetInset): use my_memcpy.
11441 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11442 it is easier to understand, but it uses less TeX-only constructs now.
11444 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11445 elements contain spaces
11447 * lib/configure: regenerated
11449 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11450 elements contain spaces; display the list of programs that are
11453 * autogen.sh: make sure lib/configure is executable
11455 * lib/examples/*: rename the tutorial examples to begin with the
11456 two-letters language code.
11458 * src/lyxfunc.C (getStatus): do not query current font if no
11461 * src/lyx_cb.C (RunScript): use QuoteName
11462 (MenuRunDvips): ditto
11463 (PrintApplyCB): ditto
11465 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11466 around argument, so that it works well with the current shell.
11467 Does not work properly with OS/2 shells currently.
11469 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11470 * src/LyXSendto.C (SendtoApplyCB): ditto
11471 * src/lyxfunc.C (Dispatch): ditto
11472 * src/buffer.C (runLaTeX): ditto
11473 (runLiterate): ditto
11474 (buildProgram): ditto
11476 * src/lyx_cb.C (RunScript): ditto
11477 (MenuMakeLaTeX): ditto
11479 * src/buffer.h (getLatexName): new method
11481 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11483 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11485 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11486 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11487 (create_math_panel): ditto
11489 * src/lyxfunc.C (getStatus): re-activate the code which gets
11490 current font and cursor; add test for export to html.
11492 * src/lyxrc.C (read): remove unreachable break statements; add a
11495 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11497 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11499 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11500 introduced by faulty regex.
11501 * src/buffer.C: ditto
11502 * src/lastfiles.C: ditto
11503 * src/paragraph.C: ditto
11504 * src/table.C: ditto
11505 * src/vspace.C: ditto
11506 * src/insets/figinset.C: ditto
11507 Note: most of these is absolutely harmless, except the one in
11508 src/mathed formula.C.
11510 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11512 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11513 operation, yielding correct results for the reLyX command.
11515 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11517 * src/support/filetools.C (ExpandPath): removed an over eager
11519 (ReplaceEnvironmentPath): ditto
11521 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11522 shows that we are doing something fishy in our code...
11523 (BubblePost): ditto
11526 * src/lyxrc.C (read): use a double switch trick to get more help
11527 from the compiler. (the same trick is used in layout.C)
11528 (write): new function. opens a ofstream and pass that to output
11529 (output): new function, takes a ostream and writes the lyxrc
11530 elemts to it. uses a dummy switch to make sure no elements are
11533 * src/lyxlex.h: added a struct pushpophelper for use in functions
11534 with more than one exit point.
11536 * src/lyxlex.[Ch] (GetInteger): made it const
11540 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11542 * src/layout.[hC] : LayoutTags splitted into several enums, new
11543 methods created, better error handling cleaner use of lyxlex. Read
11546 * src/bmtable.[Ch]: change some member prototypes because of the
11547 image const changes.
11549 * commandtags.h, src/LyXAction.C (init): new function:
11550 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11551 This file is not read automatically but you can add \input
11552 preferences to your lyxrc if you want to. We need to discuss how
11555 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11556 in .aux, also remove .bib and .bst files from dependencies when
11559 * src/BufferView.C, src/LyXView.C: add const_cast several places
11560 because of changes to images.
11562 * lib/images/*: same change as for images/*
11564 * lib/lyxrc.example: Default for accept_compound is false not no.
11566 * images/*: changed to be const, however I have som misgivings
11567 about this change so it might be changed back.
11569 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11571 * lib/configure, po/POTFILES.in: regenerated
11573 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11575 * config/lib_configure.m4: removed
11577 * lib/configure.m4: new file (was config/lib_configure.m4)
11579 * configure.in: do not test for rtti, since we do not use it.
11581 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11583 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11584 doubling of allocated space scheme. This makes it faster for large
11585 strings end to use less memory for small strings. xtra rememoved.
11587 * src/insets/figinset.C (waitalarm): commented out.
11588 (GhostscriptMsg): use static_cast
11589 (GhostscriptMsg): use new instead of malloc to allocate memory for
11590 cmap. also delete the memory after use.
11592 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11594 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11595 for changes in bibtex database or style.
11596 (runBibTeX): remove all .bib and .bst files from dep before we
11598 (run): use scanAuc in when dep file already exist.
11600 * src/DepTable.C (remove_files_with_extension): new method
11601 (exist): new method
11603 * src/DepTable.[Ch]: made many of the methods const.
11605 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11607 * src/bufferparams.C: make sure that the default textclass is
11608 "article". It used to be the first one by description order, but
11609 now the first one is "docbook".
11611 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11612 string; call Debug::value.
11613 (easyParse): pass complete argument to setDebuggingLevel().
11615 * src/debug.h (value): fix the code that parses debug levels.
11617 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11620 * src/LyXAction.C: use Debug::ACTION as debug channel.
11622 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11624 * NEWS: updated for the future 1.1.3 release.
11626 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11627 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11628 it should. This is of course a controversial change (since many
11629 people will find that their lyx workscreen is suddenly full of
11630 red), but done for the sake of correctness.
11632 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11633 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11635 * src/insets/inseterror.h, src/insets/inseturl.h,
11636 src/insets/insetinfo.h, src/insets/figinset.h,
11637 src/mathed/formulamacro.h, src/mathed/math_macro.h
11638 (EditMessage): add a missing const and add _() to make sure that
11639 translation happens
11641 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11642 src/insets/insetbib.C, src/support/filetools.C: add `using'
11643 directives for cxx.
11645 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11646 doing 'Insert index of last word' at the beginning of a paragraph.
11648 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11650 * several files: white-space changes.
11652 * src/mathed/formula.C: removed IsAlpha and IsDigit
11654 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11655 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11658 * src/insets/figinset.C (GetPSSizes): don't break when
11659 "EndComments" is seen. But break when a boundingbox is read.
11661 * all classes inherited from Inset: return value of Clone
11662 changed back to Inset *.
11664 * all classes inherited form MathInset: return value of Clone
11665 changed back to MathedInset *.
11667 * src/insets/figinset.C (runqueue): use a ofstream to output the
11668 gs/ps file. Might need some setpresicion or setw. However I can
11669 see no problem with the current code.
11670 (runqueue): use sleep instead of the alarm/signal code. I just
11671 can't see the difference.
11673 * src/paragraph.C (LyXParagraph): reserve space in the new
11674 paragraph and resize the inserted paragraph to just fit.
11676 * src/lyxfunc.h (operator|=): added operator for func_status.
11678 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11679 check for readable file.
11681 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11682 check for readable file.
11683 (MenuMakeLinuxDoc): ditto
11684 (MenuMakeDocBook): ditto
11685 (MenuMakeAscii): ditto
11686 (InsertAsciiFile): split the test for openable and readable
11688 * src/bmtable.C (draw_bitmaptable): use
11689 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11691 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11692 findtexfile from LaTeX to filetools.
11694 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11695 instead of FilePtr. Needs to be verified by a literate user.
11697 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11699 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11700 (EditMessage): likewise.
11702 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11703 respectively as \textasciitilde and \textasciicircum.
11705 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11707 * src/support/lyxstring.h: made the methods that take iterators
11708 use const_iterator.
11710 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11711 (regexMatch): made is use the real regex class.
11713 * src/support/Makefile.am: changed to use libtool
11715 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11717 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11719 (MathIsInset ++): changed several macros to be inline functions
11722 * src/mathed/Makefile.am: changed to use libtool
11724 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11726 * src/insets/inset* : Clone changed to const and return type is
11727 the true insettype not just Inset*.
11729 * src/insets/Makefile.am: changed to use libtool
11731 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11733 * src/undo.[Ch] : added empty() and changed some of the method
11736 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11738 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11739 setID use block<> for the bullets array, added const several places.
11741 * src/lyxfunc.C (getStatus): new function
11743 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11744 LyXAction, added const to several funtions.
11746 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11747 a std::map, and to store the dir items in a vector.
11749 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11752 * src/LyXView.[Ch] + other files : changed currentView to view.
11754 * src/LyXAction.[Ch] : ported from the old devel branch.
11756 * src/.cvsignore: added .libs and a.out
11758 * configure.in : changes to use libtool.
11760 * acinclude.m4 : inserted libtool.m4
11762 * .cvsignore: added libtool
11764 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11766 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11767 file name in insets and mathed directories (otherwise the
11768 dependency is not taken in account under cygwin).
11770 * src/text2.C (InsertString[AB]): make sure that we do not try to
11771 read characters past the string length.
11773 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11775 * lib/doc/LaTeXConfig.lyx.in,
11776 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11778 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11779 file saying who created them and when this heppened; this is
11780 useless and annoys tools like cvs.
11782 * lib/layouts/g-brief-{en,de}.layout,
11783 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11784 from Thomas Hartkens <thomas@hartkens.de>.
11786 * src/{insets,mathed}/Makefile.am: do not declare an empty
11787 LDFLAGS, so that it can be set at configure time (useful on Irix
11790 * lib/reLyX/configure.in: make sure that the prefix is set
11791 correctly in LYX_DIR.
11793 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11795 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11796 be used by 'command-sequence' this allows to bind a key to a
11797 sequence of LyX-commands
11798 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11800 * src/LyXAction.C: add "command-sequence"
11802 * src/LyXFunction.C: handling of "command-sequence"
11804 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11805 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11807 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11809 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11811 * src/buffer.C (writeFile): Do not output a comment giving user
11812 and date at the beginning of a .lyx file. This is useless and
11813 annoys cvs anyway; update version number to 1.1.
11815 * src/Makefile.am (LYX_DIR): add this definition, so that a
11816 default path is hardcoded in LyX.
11818 * configure.in: Use LYX_GNU_GETTEXT.
11820 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11821 AM_GNU_GETTEXT with a bug fixed.
11823 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11825 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11827 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11828 which is used to point to LyX data is now LYX_DIR_11x.
11830 * lyx.man: convert to a unix text file; small updates.
11832 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11834 * src/support/LSubstring.[Ch]: made the second arg of most of the
11835 constructors be a const reference.
11837 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11840 * src/support/lyxstring.[Ch] (swap): added missing member function
11841 and specialization of swap(str, str);
11843 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11845 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11846 trace of the old one.
11848 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11849 put the member definitions in undo.C.
11851 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11852 NEW_TEXT and have now only code that was included when this was
11855 * src/intl.C (LCombo): use static_cast
11857 (DispatchCallback): ditto
11859 * src/definitions.h: removed whole file
11861 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11863 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11864 parsing and stores in a std:map. a regex defines the file format.
11865 removed unneeded members.
11867 * src/bufferparams.h: added several enums from definitions.h here.
11868 Removed unsused destructor. Changed some types to use proper enum
11869 types. use block to have the temp_bullets and user_defined_bullets
11870 and to make the whole class assignable.
11872 * src/bufferparams.C (Copy): removed this functions, use a default
11873 assignment instead.
11875 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11878 * src/buffer.C (readLyXformat2): commend out all that have with
11879 oldpapersize to do. also comment out all that hve to do with
11880 insetlatex and insetlatexdel.
11881 (setOldPaperStuff): commented out
11883 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11885 * src/LyXAction.C: remove use of inset-latex-insert
11887 * src/mathed/math_panel.C (button_cb): use static_cast
11889 * src/insets/Makefile.am (insets_o_SOURCES): removed
11892 * src/support/lyxstring.C (helper): use the unsigned long
11893 specifier, UL, instead of a static_cast.
11895 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11897 * src/support/block.h: new file. to be used as a c-style array in
11898 classes, so that the class can be assignable.
11900 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11902 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11903 NULL, make sure to return an empty string (it is not possible to
11904 set a string to NULL).
11906 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11908 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11910 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11912 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11913 link line, so that Irix users (for example) can set it explicitely to
11916 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11917 it can be overidden at make time (static or dynamic link, for
11920 * src/vc-backend.C, src/LaTeXFeatures.h,
11921 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11922 statements to bring templates to global namespace.
11924 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11926 * src/support/lyxstring.C (operator[] const): make it standard
11929 * src/minibuffer.C (Init): changed to reflect that more
11930 information is given from the lyxvc and need not be provided here.
11932 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11934 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11936 * src/LyXView.C (UpdateTimerCB): use static_cast
11937 (KeyPressMask_raw_callback): ditto
11939 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11940 buffer_, a lot of changes because of this. currentBuffer() ->
11941 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11942 also changes to other files because of this.
11944 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11946 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11947 have no support for RCS and partial support for CVS, will be
11950 * src/insets/ several files: changes because of function name
11951 changes in Bufferview and LyXView.
11953 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11955 * src/support/LSubstring.[Ch]: new files. These implement a
11956 Substring that can be very convenient to use. i.e. is this
11958 string a = "Mary had a little sheep";
11959 Substring(a, "sheep") = "lamb";
11960 a is now "Mary has a little lamb".
11962 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11963 out patterns and subpatterns of strings. It is used by LSubstring
11964 and also by vc-backend.C
11966 * src/support/lyxstring.C: went over all the assertions used and
11967 tried to correct the wrong ones and flag which of them is required
11968 by the standard. some bugs found because of this. Also removed a
11969 couple of assertions.
11971 * src/support/Makefile.am (libsupport_a_SOURCES): added
11972 LSubstring.[Ch] and LRegex.[Ch]
11974 * src/support/FileInfo.h: have struct stat buf as an object and
11975 not a pointer to one, some changes because of this.
11977 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11978 information in layout when adding the layouts preamble to the
11979 textclass preamble.
11981 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11984 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11985 because of bug in OS/2.
11987 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11989 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11990 \verbatim@font instead of \ttfamily, so that it can be redefined.
11992 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11993 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11994 src/layout.h, src/text2.C: add 'using' directive to bring the
11995 STL templates we need from the std:: namespace to the global one.
11996 Needed by DEC cxx in strict ansi mode.
11998 * src/support/LIstream.h,src/support/LOstream.h,
11999 src/support/lyxstring.h,src/table.h,
12000 src/lyxlookup.h: do not include <config.h> in header
12001 files. This should be done in the .C files only.
12003 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
12007 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12009 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
12010 from Kayvan to fix the tth invokation.
12012 * development/lyx.spec.in: updates from Kayvan to reflect the
12013 changes of file names.
12015 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12017 * src/text2.C (InsertStringB): use std::copy
12018 (InsertStringA): use std::copy
12020 * src/bufferlist.C: use a vector to store the buffers in. This is
12021 an internal change and should not affect any other thing.
12023 * src/BufferView.C (waitForX): use XSync instead of the lengthy
12026 * src/text.C (Fill): fix potential bug, one off bug.
12028 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12030 * src/Makefile.am (lyx_main.o): add more files it depends on.
12032 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
12034 * src/support/lyxstring.C: use size_t for the reference count,
12035 size, reserved memory and xtra.
12036 (internal_compare): new private member function. Now the compare
12037 functions should work for std::strings that have embedded '\0'
12039 (compare): all compare functions rewritten to use
12042 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12044 * src/support/lyxstring.C (compare): pass c_str()
12045 (compare): pass c_str
12046 (compare): pass c_str
12048 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12050 * src/support/DebugStream.C: <config.h> was not included correctly.
12052 * lib/configure: forgot to re-generate it :( I'll make this file
12053 auto generated soon.
12055 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
12057 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
12060 * src/support/lyxstring.C: some changes from length() to rep->sz.
12061 avoids a function call.
12063 * src/support/filetools.C (SpaceLess): yet another version of the
12064 algorithm...now per Jean-Marc's suggestions.
12066 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12068 * src/layout.C (less_textclass_desc): functor for use in sorting
12070 (LyXTextClass::Read): sort the textclasses after reading.
12072 * src/support/filetools.C (SpaceLess): new version of the
12073 SpaceLess functions. What problems does this one give? Please
12076 * images/banner_bw.xbm: made the arrays unsigned char *
12078 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12080 * src/support/lyxstring.C (find): remove bogus assertion in the
12081 two versions of find where this has not been done yet.
12083 * src/support/lyxlib.h: add missing int return type to
12086 * src/menus.C (ShowFileMenu): disable exporting to html if no
12087 html export command is present.
12089 * config/lib_configure.m4: add a test for an HTML converter. The
12090 programs checked for are, in this order: tth, latex2html and
12093 * lib/configure: generated from config/lib_configure.m4.
12095 * src/lyxfunc.C (Dispatch): update and improve the execution of an
12096 html converter. The parameters are now passed through $$FName and
12097 $$OutName, instead of standard input/output.
12099 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
12101 * lib/lyxrc.example: update description of \html_command.
12102 add "quotes" around \screen_font_xxx font setting examples to help
12103 people who use fonts with spaces in their names.
12105 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12107 * Distribution files: updates for v1.1.2
12109 * src/support/lyxstring.C (find): remove bogus assert and return
12110 npos for the same condition.
12112 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12114 * added patch for OS/2 from SMiyata.
12116 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12118 * src/text2.C (CutSelection): make space_wrapped a bool
12119 (CutSelection): dont declare int i until we have to.
12120 (alphaCounter): return a char const *.
12122 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12124 * src/support/syscall.C (Systemcalls::kill):
12125 src/support/filetools.C (PutEnv, PutEnvPath):
12126 src/lyx_cb.C (addNewlineAndDepth):
12127 src/FontInfo.C (FontInfo::resize): condition some #warning
12128 directives with WITH_WARNINGS.
12131 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12133 * src/layout.[Ch] + several files: access to class variables
12134 limited and made accessor functions instead a lot of code changed
12135 becuase of this. Also instead of returning pointers often a const
12136 reference is returned instead.
12138 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12140 * src/Makefile.am (dist-hook): added used to remove the CVS from
12141 cheaders upon creating a dist
12142 (EXTRA_DIST): added cheaders
12144 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12145 a character not as a small integer.
12147 * src/support/lyxstring.C (find): removed Assert and added i >=
12148 rep->sz to the first if.
12150 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12152 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12153 src/LyXView.C src/buffer.C src/bufferparams.C
12154 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12155 src/text2.C src/insets/insetinclude.C:
12156 lyxlayout renamed to textclasslist.
12158 * src/layout.C: some lyxerr changes.
12160 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12161 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12162 (LyXLayoutList): removed all traces of this class.
12163 (LyXTextClass::Read): rewrote LT_STYLE
12164 (LyXTextClass::hasLayout): new function
12165 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12166 both const and nonconst version.
12167 (LyXTextClass::delete_layout): new function.
12168 (LyXTextClassList::Style): bug fix. do the right thing if layout
12170 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12171 (LyXTextClassList::NameOfLayout): ditto
12172 (LyXTextClassList::Load): ditto
12174 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12176 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12178 * src/LyXAction.C (LookupFunc): added a workaround for sun
12179 compiler, on the other hand...we don't know if the current code
12180 compiles on sun at all...
12182 * src/support/filetools.C (CleanupPath): subst fix
12184 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12187 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12188 complained about this one?
12190 * src/insets/insetinclude.C (Latex): subst fix
12192 * src/insets/insetbib.C (getKeys): subst fix
12194 * src/LyXSendto.C (SendtoApplyCB): subst fix
12196 * src/lyx_main.C (init): subst fix
12198 * src/layout.C (Read): subst fix
12200 * src/lyx_sendfax_main.C (button_send): subst fix
12202 * src/buffer.C (RoffAsciiTable): subst fix
12204 * src/lyx_cb.C (MenuFax): subst fix
12205 (PrintApplyCB): subst fix
12207 1999-10-26 Juergen Vigna <jug@sad.it>
12209 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12211 (Read): Cleaned up this code so now we read only format vestion >= 5
12213 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12215 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12216 come nobody has complained about this one?
12218 * src/insets/insetinclude.C (Latex): subst fix
12220 * src/insets/insetbib.C (getKeys): subst fix
12222 * src/lyx_main.C (init): subst fix
12224 * src/layout.C (Read): subst fix
12226 * src/buffer.C (RoffAsciiTable): subst fix
12228 * src/lyx_cb.C (MenuFax): subst fix.
12230 * src/layout.[hC] + some other files: rewrote to use
12231 std::container to store textclasses and layouts in.
12232 Simplified, removed a lot of code. Make all classes
12233 assignable. Further simplifications and review of type
12234 use still to be one.
12236 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12237 lastfiles to create the lastfiles partr of the menu.
12239 * src/lastfiles.[Ch]: rewritten to use deque to store the
12240 lastfiles in. Uses fstream for reading and writing. Simplifies
12243 * src/support/syscall.C: remove explicit cast.
12245 * src/BufferView.C (CursorToggleCB): removed code snippets that
12246 were commented out.
12247 use explicat C++ style casts instead of C style casts. also use
12248 u_vdata instea of passing pointers in longs.
12250 * src/PaperLayout.C: removed code snippets that were commented out.
12252 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12254 * src/lyx_main.C: removed code snippets that wer commented out.
12256 * src/paragraph.C: removed code snippets that were commented out.
12258 * src/lyxvc.C (logClose): use static_cast
12260 (viewLog): remove explicit cast to void*
12261 (showLog): removed old commented code
12263 * src/menus.C: use static_cast instead of C style casts. use
12264 u_vdata instead of u_ldata. remove explicit cast to (long) for
12265 pointers. Removed old code that was commented out.
12267 * src/insets/inset.C: removed old commented func
12269 * src/insets/insetref.C (InsetRef): removed old code that had been
12270 commented out for a long time.
12272 (escape): removed C style cast
12274 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12276 * src/insets/insetlatex.C (Draw): removed old commented code
12277 (Read): rewritten to use string
12279 * src/insets/insetlabel.C (escape): removed C style cast
12281 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12283 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12284 old commented code.
12286 * src/insets/insetinclude.h: removed a couple of stupid bools
12288 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12289 (Clone): remove C style cast
12290 (getKeys): changed list to lst because of std::list
12292 * src/insets/inseterror.C (Draw): removed som old commented code.
12294 * src/insets/insetcommand.C (Draw): removed some old commented code.
12296 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12297 commented out forever.
12298 (bibitem_cb): use static_cast instead of C style cast
12299 use of vdata changed to u_vdata.
12301 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12303 (CloseUrlCB): use static_cast instead of C style cast.
12304 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12306 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12307 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12308 (CloseInfoCB): static_cast from ob->u_vdata instead.
12309 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12312 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12313 (C_InsetError_CloseErrorCB): forward the ob parameter
12314 (CloseErrorCB): static_cast from ob->u_vdata instead.
12316 * src/vspace.h: include LString.h since we use string in this class.
12318 * src/vspace.C (lyx_advance): changed name from advance because of
12319 nameclash with stl. And since we cannot use namespaces yet...I
12320 used a lyx_ prefix instead. Expect this to change when we begin
12323 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12325 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12326 and removed now defunct constructor and deconstructor.
12328 * src/BufferView.h: have backstack as a object not as a pointer.
12329 removed initialization from constructor. added include for BackStack
12331 * development/lyx.spec.in (%build): add CFLAGS also.
12333 * src/screen.C (drawFrame): removed another warning.
12335 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12337 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12338 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12339 README and ANNOUNCE a bit for the next release. More work is
12342 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12343 unbreakable if we are in freespacing mode (LyX-Code), but not in
12346 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12348 * src/BackStack.h: fixed initialization order in constructor
12350 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12352 * acinclude.m4 (VERSION): new rules for when a version is
12353 development, added also a variable for prerelease.
12354 (warnings): we set with_warnings=yes for prereleases
12355 (lyx_opt): prereleases compile with same optimization as development
12356 (CXXFLAGS): only use pedantic if we are a development version
12358 * src/BufferView.C (restorePosition): don't do anything if the
12359 backstack is empty.
12361 * src/BackStack.h: added member empty, use this to test if there
12362 is anything to pop...
12364 1999-10-25 Juergen Vigna <jug@sad.it>
12367 * forms/layout_forms.fd +
12368 * forms/latexoptions.fd +
12369 * lyx.fd: changed for various form resize issues
12371 * src/mathed/math_panel.C +
12372 * src/insets/inseterror.C +
12373 * src/insets/insetinfo.C +
12374 * src/insets/inseturl.C +
12375 * src/insets/inseturl.h +
12377 * src/LyXSendto.C +
12378 * src/PaperLayout.C +
12379 * src/ParagraphExtra.C +
12380 * src/TableLayout.C +
12382 * src/layout_forms.C +
12389 * src/menus.C: fixed various resize issues. So now forms can be
12390 resized savely or not be resized at all.
12392 * forms/form_url.fd +
12393 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12396 * src/insets/Makefile.am: added files form_url.[Ch]
12398 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12400 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12401 (and presumably 6.2).
12403 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12404 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12405 remaining static member callbacks.
12407 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12410 * src/support/lyxstring.h: declare struct Srep as friend of
12411 lyxstring, since DEC cxx complains otherwise.
12413 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12415 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12417 * src/LaTeX.C (run): made run_bibtex also depend on files with
12419 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12420 are put into the dependency file.
12422 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12423 the code has shown itself to work
12424 (create_ispell_pipe): removed another warning, added a comment
12427 * src/minibuffer.C (ExecutingCB): removed code that has been
12428 commented out a long time
12430 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12431 out code + a warning.
12433 * src/support/lyxstring.h: comment out the three private
12434 operators, when compiling with string ansi conforming compilers
12435 they make problems.
12437 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12439 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12440 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12443 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12446 * src/mathed/math_panel.C (create_math_panel): remove explicit
12449 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12452 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12453 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12454 to XCreatePixmapFromBitmapData
12455 (fl_set_bmtable_data): change the last argument to be unsigned
12457 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12458 and bh to be unsigned int, remove explicit casts in call to
12459 XReadBitmapFileData.
12461 * images/arrows.xbm: made the arrays unsigned char *
12462 * images/varsz.xbm: ditto
12463 * images/misc.xbm: ditto
12464 * images/greek.xbm: ditto
12465 * images/dots.xbm: ditto
12466 * images/brel.xbm: ditto
12467 * images/bop.xbm: ditto
12469 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12471 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12472 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12473 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12475 (LYX_CXX_CHEADERS): added <clocale> to the test.
12477 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12479 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12481 * src/support/lyxstring.C (append): fixed something that must be a
12482 bug, rep->assign was used instead of rep->append.
12484 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12487 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12488 lyx insert double chars. Fix spotted by Kayvan.
12490 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12492 * Fixed the tth support. I messed up with the Emacs patch apply feature
12493 and omitted the changes in lyxrc.C.
12495 1999-10-22 Juergen Vigna <jug@sad.it>
12497 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12499 * src/lyx_cb.C (MenuInsertRef) +
12500 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12501 the form cannot be resized under it limits (fixes a segfault)
12503 * src/lyx.C (create_form_form_ref) +
12504 * forms/lyx.fd: Changed Gravity on name input field so that it is
12507 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12509 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12510 <ostream> and <istream>.
12512 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12513 whether <fstream> provides the latest standard features, or if we
12514 have an oldstyle library (like in egcs).
12515 (LYX_CXX_STL_STRING): fix the test.
12517 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12518 code on MODERN_STL_STREAM.
12520 * src/support/lyxstring.h: use L{I,O}stream.h.
12522 * src/support/L{I,O}stream.h: new files, designed to setup
12523 correctly streams for our use
12524 - includes the right header depending on STL capabilities
12525 - puts std::ostream and std::endl (for LOStream.h) or
12526 std::istream (LIStream.h) in toplevel namespace.
12528 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12530 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12531 was a bib file that had been changed we ensure that bibtex is run.
12532 (runBibTeX): enhanced to extract the names of the bib files and
12533 getting their absolute path and enter them into the dep file.
12534 (findtexfile): static func that is used to look for tex-files,
12535 checks for absolute patchs and tries also with kpsewhich.
12536 Alternative ways of finding the correct files are wanted. Will
12538 (do_popen): function that runs a command using popen and returns
12539 the whole output of that command in a string. Should be moved to
12542 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12543 file with extension ext has changed.
12545 * src/insets/figinset.C: added ifdef guards around the fl_free
12546 code that jug commented out. Now it is commented out when
12547 compiling with XForms == 0.89.
12549 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12550 to lyxstring.C, and only keep a forward declaration in
12551 lyxstring.h. Simplifies the header file a bit and should help a
12552 bit on compile time too. Also changes to Srep will not mandate a
12553 recompile of code just using string.
12554 (~lyxstring): definition moved here since it uses srep.
12555 (size): definition moved here since it uses srep.
12557 * src/support/lyxstring.h: removed a couple of "inline" that should
12560 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12562 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12565 1999-10-21 Juergen Vigna <jug@sad.it>
12567 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12568 set to left if I just remove the width entry (or it is empty).
12570 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12571 paragraph when having dummy paragraphs.
12573 1999-10-20 Juergen Vigna <jug@sad.it>
12575 * src/insets/figinset.C: just commented some fl_free_form calls
12576 and added warnings so that this calls should be activated later
12577 again. This avoids for now a segfault, but we have a memory leak!
12579 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12580 'const char * argument' to 'string argument', this should
12581 fix some Asserts() in lyxstring.C.
12583 * src/lyxfunc.h: Removed the function argAsString(const char *)
12584 as it is not used anymore.
12586 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12588 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12591 * src/Literate.h: some funcs moved from public to private to make
12592 interface clearer. Unneeded args removed.
12594 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12596 (scanBuildLogFile): ditto
12598 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12599 normal TeX Error. Still room for improvement.
12601 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12603 * src/buffer.C (insertErrors): changes to make the error
12604 desctription show properly.
12606 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12609 * src/support/lyxstring.C (helper): changed to use
12610 sizeof(object->rep->ref).
12611 (operator>>): changed to use a pointer instead.
12613 * src/support/lyxstring.h: changed const reference & to value_type
12614 const & lets see if that helps.
12616 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12618 * Makefile.am (rpmdist): fixed to have non static package and
12621 * src/support/lyxstring.C: removed the compilation guards
12623 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12626 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12627 conditional compile of lyxstring.Ch
12629 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12630 stupid check, but it is a lot better than the bastring hack.
12631 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12633 * several files: changed string::erase into string::clear. Not
12636 * src/chset.C (encodeString): use a char temporary instead
12638 * src/table.C (TexEndOfCell): added tostr around
12639 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12640 (TexEndOfCell): ditto
12641 (TexEndOfCell): ditto
12642 (TexEndOfCell): ditto
12643 (DocBookEndOfCell): ditto
12644 (DocBookEndOfCell): ditto
12645 (DocBookEndOfCell): ditto
12646 (DocBookEndOfCell): ditto
12648 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12650 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12652 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12653 (MenuBuildProg): added tostr around ret
12654 (MenuRunChktex): added tostr around ret
12655 (DocumentApplyCB): added tostr around ret
12657 * src/chset.C (encodeString): added tostr around t->ic
12659 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12660 (makeLaTeXFile): added tostr around tocdepth
12661 (makeLaTeXFile): added tostr around ftcound - 1
12663 * src/insets/insetbib.C (setCounter): added tostr around counter.
12665 * src/support/lyxstring.h: added an operator+=(int) to catch more
12668 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12669 (lyxstring): We DON'T allow NULL pointers.
12671 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12673 * src/mathed/math_macro.C (MathMacroArgument::Write,
12674 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12675 when writing them out.
12677 * src/LString.C: remove, since it is not used anymore.
12679 * src/support/lyxstring.C: condition the content to
12680 USE_INCLUDED_STRING macro.
12682 * src/mathed/math_symbols.C, src/support/lstrings.C,
12683 src/support/lyxstring.C: add `using' directive to specify what
12684 we need in <algorithm>. I do not think that we need to
12685 conditionalize this, but any thought is appreciated.
12687 * many files: change all callback functions to "C" linkage
12688 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12689 strict_ansi. Those who were static are now global.
12690 The case of callbacks which are static class members is
12691 trickier, since we have to make C wrappers around them (see
12692 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12693 did not finish this yet, since it defeats the purpose of
12694 encapsulation, and I am not sure what the best route is.
12696 1999-10-19 Juergen Vigna <jug@sad.it>
12698 * src/support/lyxstring.C (lyxstring): we permit to have a null
12699 pointer as assignment value and just don't assign it.
12701 * src/vspace.C (nextToken): corrected this function substituting
12702 find_first(_not)_of with find_last_of.
12704 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12705 (TableOptCloseCB) (TableSpeCloseCB):
12706 inserted fl_set_focus call for problem with fl_hide_form() in
12709 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12711 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12714 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12716 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12717 LyXLex::next() and not eatline() to get its argument.
12719 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12721 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12722 instead, use fstreams for io of the depfile, removed unneeded
12723 functions and variables.
12725 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12726 vector instead, removed all functions and variables that is not in
12729 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12731 * src/buffer.C (insertErrors): use new interface to TeXError
12733 * Makefile.am (rpmdist): added a rpmdist target
12735 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12736 per Kayvan's instructions.
12738 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12740 * src/Makefile.am: add a definition for localedir, so that locales
12741 are found after installation (Kayvan)
12743 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12745 * development/.cvsignore: new file.
12747 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12749 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12750 C++ compiler provides wrappers for C headers and use our alternate
12753 * configure.in: use LYX_CXX_CHEADERS.
12755 * src/cheader/: new directory, populated with cname headers from
12756 libstdc++-2.8.1. They are a bit old, but probably good enough for
12757 what we want (support compilers who lack them).
12759 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12760 from includes. It turns out is was stupid.
12762 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12764 * lib/Makefile.am (install-data-local): forgot a ';'
12765 (install-data-local): forgot a '\'
12766 (libinstalldirs): needed after all. reintroduced.
12768 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12770 * configure.in (AC_OUTPUT): added lyx.spec
12772 * development/lyx.spec: removed file
12774 * development/lyx.spec.in: new file
12776 * po/*.po: merged with lyx.pot becuase of make distcheck
12778 * lib/Makefile.am (dist-hook): added dist-hook so that
12779 documentation files will be included when doing a make
12780 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12781 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12783 more: tried to make install do the right thing, exclude CVS dirs
12786 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12787 Path would fit in more nicely.
12789 * all files that used to use pathstack: uses now Path instead.
12790 This change was a lot easier than expected.
12792 * src/support/path.h: new file
12794 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12796 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12798 * src/support/lyxstring.C (getline): Default arg was given for
12801 * Configure.cmd: removed file
12803 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12805 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12806 streams classes and types, add the proper 'using' statements when
12807 MODERN_STL is defined.
12809 * src/debug.h: move the << operator definition after the inclusion
12812 * src/support/filetools.C: include "LAssert.h", which is needed
12815 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12818 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12819 include "debug.h" to define a proper ostream.
12821 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12823 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12824 method to the SystemCall class which can kill a process, but it's
12825 not fully implemented yet.
12827 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12829 * src/support/FileInfo.h: Better documentation
12831 * src/lyxfunc.C: Added support for buffer-export html
12833 * src/menus.C: Added Export->As HTML...
12835 * lib/bind/*.bind: Added short-cut for buffer-export html
12837 * src/lyxrc.*: Added support for new \tth_command
12839 * lib/lyxrc.example: Added stuff for new \tth_command
12841 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12843 * lib/Makefile.am (IMAGES): removed images/README
12844 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12845 installes in correct place. Check permisions is installed
12848 * src/LaTeX.C: some no-op changes moved declaration of some
12851 * src/LaTeX.h (LATEX_H): changed include guard name
12853 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12855 * lib/reLyX/Makefile.am: install noweb2lyx.
12857 * lib/Makefile.am: install configure.
12859 * lib/reLyX/configure.in: declare a config aux dir; set package
12860 name to lyx (not sure what the best solution is); generate noweb2lyx.
12862 * lib/layouts/egs.layout: fix the bibliography layout.
12864 1999-10-08 Jürgen Vigna <jug@sad.it>
12866 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12867 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12868 it returned without continuing to search the path.
12870 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12872 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12873 also fixes a bug. It is not allowed to do tricks with std::strings
12874 like: string a("hei"); &a[e]; this will not give what you
12875 think... Any reason for the complexity in this func?
12877 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12879 * Updated README and INSTALL a bit, mostly to check that my
12880 CVS rights are correctly set up.
12882 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12884 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12885 does not allow '\0' chars but lyxstring and std::string does.
12887 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12889 * autogen.sh (AUTOCONF): let the autogen script create the
12890 POTFILES.in file too. POTFILES.in should perhaps now not be
12891 included in the cvs module.
12893 * some more files changed to use C++ includes instead of C ones.
12895 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12897 (Reread): added tostr to nlink. buggy output otherwise.
12898 (Reread): added a string() around szMode when assigning to Buffer,
12899 without this I got a log of garbled info strings.
12901 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12904 * I have added several ostream & operator<<(ostream &, some_type)
12905 functions. This has been done to avoid casting and warnings when
12906 outputting enums to lyxerr. This as thus eliminated a lot of
12907 explicit casts and has made the code clearer. Among the enums
12908 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12909 mathed enums, some font enum the Debug::type enum.
12911 * src/support/lyxstring.h (clear): missing method. equivalent of
12914 * all files that contained "stderr": rewrote constructs that used
12915 stderr to use lyxerr instead. (except bmtable)
12917 * src/support/DebugStream.h (level): and the passed t with
12918 Debug::ANY to avoid spurious bits set.
12920 * src/debug.h (Debug::type value): made it accept strings of the
12921 type INFO,INIT,KEY.
12923 * configure.in (Check for programs): Added a check for kpsewhich,
12924 the latex generation will use this later to better the dicovery of
12927 * src/BufferView.C (create_view): we don't need to cast this to
12928 (void*) that is done automatically.
12929 (WorkAreaButtonPress): removed some dead code.
12931 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12933 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12934 is not overwritten when translated (David Sua'rez de Lis).
12936 * lib/CREDITS: Added David Sua'rez de Lis
12938 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12940 * src/bufferparams.C (BufferParams): default input encoding is now
12943 * acinclude.m4 (cross_compiling): comment out macro
12944 LYX_GXX_STRENGTH_REDUCE.
12946 * acconfig.h: make sure that const is not defined (to empty) when
12947 we are compiling C++. Remove commented out code using SIZEOF_xx
12950 * configure.in : move the test for const and inline as late as
12951 possible so that these C tests do not interefere with C++ ones.
12952 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12953 has not been proven.
12955 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12957 * src/table.C (getDocBookAlign): remove bad default value for
12958 isColumn parameter.
12960 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12962 (ShowFileMenu2): ditto.
12964 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12965 of files to ignore.
12967 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12969 * Most files: finished the change from the old error code to use
12970 DebugStream for all lyxerr debugging. Only minor changes remain
12971 (e.g. the setting of debug levels using strings instead of number)
12973 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12975 * src/layout.C (Add): Changed to use compare_no_case instead of
12978 * src/FontInfo.C: changed loop variable type too string::size_type.
12980 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12982 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12983 set ETAGS_ARGS to --c++
12985 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12987 * src/table.C (DocBookEndOfCell): commented out two unused variables
12989 * src/paragraph.C: commented out four unused variables.
12991 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12992 insed a if clause with type string::size_type.
12994 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12997 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12999 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
13000 variable, also changed loop to go from 0 to lenght + 1, instead of
13001 -1 to length. This should be correct.
13003 * src/LaTeX.C (scanError): use string::size_type as loop variable
13006 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
13007 (l.896) since y_tmp and row was not used anyway.
13009 * src/insets/insetref.C (escape): use string::size_type as loop
13012 * src/insets/insetquotes.C (Width): use string::size_type as loop
13014 (Draw): use string::size_type as loop variable type.
13016 * src/insets/insetlatexaccent.C (checkContents): use
13017 string::size_type as loop variable type.
13019 * src/insets/insetlabel.C (escape): use string::size_type as loop
13022 * src/insets/insetinfo.C: added an extern for current_view.
13024 * src/insets/insetcommand.C (scanCommand): use string::size_type
13025 as loop variable type.
13027 * most files: removed the RCS tags. With them we had to recompile
13028 a lot of files after a simple cvs commit. Also we have never used
13029 them for anything meaningful.
13031 * most files: tags-query-replace NULL 0. As adviced several plases
13032 we now use "0" instead of "NULL" in our code.
13034 * src/support/filetools.C (SpaceLess): use string::size_type as
13035 loop variable type.
13037 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
13039 * src/paragraph.C: fixed up some more string stuff.
13041 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
13043 * src/support/filetools.h: make modestr a std::string.
13045 * src/filetools.C (GetEnv): made ch really const.
13047 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
13048 made code that used these use max/min from <algorithm> instead.
13050 * changed several c library include files to their equivalent c++
13051 library include files. All is not changed yet.
13053 * created a support subdir in src, put lyxstring and lstrings
13054 there + the extra files atexit, fileblock, strerror. Created
13055 Makefile.am. edited configure.in and src/Makefile.am to use this
13056 new subdir. More files moved to support.
13058 * imported som of the functions from repository lyx, filetools
13060 * ran tags-query-replace on LString -> string, corrected the bogus
13061 cases. Tried to make use of lstrings.[hC], debugged a lot. There
13062 is still some errors in there. This is errors where too much or
13063 too litle get deleted from strings (string::erase, string::substr,
13064 string::replace), there can also be some off by one errors, or
13065 just plain wrong use of functions from lstrings. Viewing of quotes
13068 * LyX is now running fairly well with string, but there are
13069 certainly some bugs yet (see above) also string is quite different
13070 from LString among others in that it does not allow null pointers
13071 passed in and will abort if it gets any.
13073 * Added the revtex4 files I forgot when setting up the repository.
13075 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
13077 * All over: Tried to clean everything up so that only the files
13078 that we really need are included in the cvs repository.
13079 * Switched to use automake.
13080 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
13081 * Install has not been checked.
13083 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
13085 * po/pt.po: Three errors:
13086 l.533 and l.538 format specification error
13087 l. 402 duplicate entry, I just deleted it.