1 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/support/translator.h: move helper template clsses to
4 lyxfunctional.h, inlcude 2support/lyxfunctional.h"
6 * src/support/lyxmanip.h: add delaration of fmt
8 * src/support/lyxfunctional.h: new file
9 (class_fun_t): new template class
10 (class_fun): helper template function
11 (back_insert_fun_iterator): new template class
12 (back_inserter_fun): helper template function
13 (compare_memfun_t): new template class
14 (compare_memfun): helper template function
15 (equal_1st_in_pair): moved here from translator
16 (equal_2nd_in_pair): moved here from translatro
18 * src/support/fmt.C: new file
19 (fmt): new func, can be used for a printf substute when still
20 using iostreams ex. lyxerr << fmg("Hello %s", "Jürgen") << endl;
22 * src/support/StrPool.C: add some comment
24 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
27 * src/insets/figinset.C (addpidwait): use std::copy with
28 ostream_iterator to fill the pidwaitlist
30 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
32 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
35 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
38 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
40 * src/frontends/xforms/FormDocument.C (build): remove c_str()
43 (CheckChoiceClass): move initialization of tc and tct
45 * src/tabular.C: remove current_view
46 (OldFormatRead): similar to right below [istream::ignore]
48 * src/lyxlex_pimpl.C (next): add code for faster skipping of
49 chars, unfortunately this is buggy on gcc 2.95.2, so currently
50 unused [istream::ignore]
52 * src/lyxfunc.C: include "support/lyxfunctional.h"
53 (getInsetByCode): use std::find_if and compare_memfun
55 * src/lyxfont.C (stateText): remove c_str()
57 * src/lyx_main.C (setDebuggingLevel): make static
58 (commandLineHelp): make static
60 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
61 Screen* together with fl_get_display() and fl_screen
63 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
64 togheter with fl_get_display() and fl_screen
65 (create_forms): remove c_str()
67 * src/layout.C: include "support/lyxfunctional.h"
68 (hasLayout): use std::find_if and compare_memfun
69 (GetLayout): use std::find_if and comapre_memfun
70 (delete_layout): use std::remove_if and compare_memfun
71 (NumberOfClass): use std:.find_if and compare_memfun
73 * src/gettext.h: change for the new functions
75 * src/gettext.C: new file, make _(char const * str) and _(string
76 const & str) real functions.
78 * src/font.C (width): rewrite slightly to avoid one extra variable
80 * src/debug.C: initialize Debug::ANY here
82 * src/commandtags.h: update number comments
84 * src/combox.h (get): make const func
88 * src/combox.C (input_cb): handle case where fl_get_input can
91 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
92 "support/lyxfunctional.h", remove currentview variable.
93 (resize): use std::for_each with std::mem_fun
94 (getFileNames): use std::copy with back_inserter_fun
95 (getBuffer): change arg type to unsigned int
96 (emergencyWriteAll): call emergencyWrite with std::for_each and
98 (emergencyWrite): new method, the for loop in emergencyWriteAll
100 (exists): use std::find_if with compare_memfun
101 (getBuffer): use std::find_if and compare_memfun
103 * src/buffer.h: add typedefs for iterator_category, value_type
104 difference_type, pointer and reference for inset_iterator
105 add postfix ++ for inset_iterator
106 make isnet_iterator::getPos() const
108 * src/buffer.C: added support/lyxmanip.h
109 (readFile): use lyxerr << fmt instead of printf
110 (makeLaTeXFile): use std::copy to write out encodings
113 * src/Painter.C (text): rewrite slightly to avoid extra font variable
115 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
116 free and the char * temp.
117 (hasMenu): use std::find_if and compare_memfun
120 * src/Makefile.am (lyx_SOURCES): added gettext.C
122 * src/LyXAction.C (retrieveActionArg): clear the arg, use
123 string::insert small change to avoid temporary
125 * src/LColor.C (getGUIName): remove c_str()
127 * several files: change all occurances of fl_display to
130 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
131 that -pedantid is not used for gcc 2.97 (cvs gcc)
133 * boost/Makefile.am: begin slowly to prepare for a real boost lib
135 2000-10-11 Allan Rae <rae@lyx.org>
137 * src/frontends/xforms/FormPreferences.C (input): template path must be
138 a readable directory. It doesn't need to be writeable.
139 (build, delete, update, apply): New inputs in the various tabfolders
141 * src/frontends/xforms/forms/form_preferences.fd:
142 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
143 several new entries to existing folders. Shuffled some existing stuff
146 * src/frontends/xforms/forms/form_print.fd:
147 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
148 Should probably rework PrinterParams as well. Note that the switch to
149 collated is effectively the same as !unsorted so changing PrinterParams
150 will require a lot of fiddly changes to reverse the existing logic.
152 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
154 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
156 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
158 2000-10-10 Allan Rae <rae@lyx.org>
161 * src/lyxfunc.C (Dispatch):
163 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
166 * src/lyxrc.C (output): Only write the differences between system lyxrc
167 and the users settings.
170 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
172 I'll rewrite this later, after 1.1.6 probably, to keep a single
173 LyXRC but two instances of a LyXRCStruct.
175 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
177 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
179 * src/tabular.h: add a few std:: qualifiers.
181 * src/encoding.C: add using directive.
182 * src/language.C: ditto.
184 * src/insets/insetquotes.C (Validate): use languages->lang()
185 instead of only language.
187 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
189 * lib/languages: New file.
191 * lib/encodings: New file.
193 * src/language.C (Languages): New class.
194 (read): New method. Reads the languages from the 'languages' file.
196 * src/encoding.C (Encodings): New class.
197 (read): New method. Reads the encodings from the 'encodings' file.
199 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
202 * src/bufferparams.h and a lot of files: Deleted the member language,
203 and renamed language_info to language
205 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
206 * src/lyxfont.C (latexWriteStartChanges): ditto.
207 * src/paragraph.C (validate,TeXOnePar): ditto.
209 * src/lyxfont.C (update): Restored deleted code.
211 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
213 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
215 * src/BufferView_pimpl.C (buffer): cleaned up a little.
217 * src/insets/figinset.[Ch]:
218 * src/insets/insetinclude.[Ch]:
219 * src/insets/insetinclude.[Ch]:
220 * src/insets/insetparent.[Ch]:
221 * src/insets/insetref.[Ch]:
222 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
225 * src/mathed/formula.[Ch]:
226 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
228 * src/buffer.C (parseSingleLyXformat2Token, readInset):
229 * src/lyx_cb.C (FigureApplyCB):
230 * src/lyxfunc.C (getStatus, Dispatch):
231 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
234 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
236 * src/converter.[Ch] (Formats::View):
237 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
239 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
240 *current_view->buffer(). This will change later, but this patch is way
243 2000-10-09 Juergen Vigna <jug@sad.it>
245 * src/text.C (GetRow): small fix.
247 * src/BufferView_pimpl.C (cursorPrevious):
248 (cursorNext): added LyXText parameter to function.
250 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
251 keypress depending on cursor position.
253 2000-10-06 Juergen Vigna <jug@sad.it>
255 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
256 (copySelection): redone this function and also copy ascii representa-
259 * src/tabular.C (Ascii):
263 (print_n_chars): new functions to realize the ascii export of tabulars.
265 2000-10-05 Juergen Vigna <jug@sad.it>
267 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
268 if we don't have a buffer.
270 2000-10-10 Allan Rae <rae@lyx.org>
272 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
273 with closing dialog. It seems that nested tabfolders require hiding
274 of inner tabfolders before hiding the dialog itself. Actually all I
275 did was hide the active outer folder.
277 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
278 unless there really is a buffer. hideBufferDependent is called
281 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
282 POTFILES.in stays in $(srcdir).
284 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
286 * lib/lyxrc.example: Few changes.
288 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
290 * src/BufferView_pimpl.C (buffer): only need one the
291 updateBufferDependent signal to be emitted once! Moved to the end of
292 the method to allow bv_->text to be updated first.
294 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
295 and hSignal_ with Dialogs * and BufferDependency variables.
296 New Buffer * parent_, initialised when the dialog is launched. Used to
297 check whether to update() or hide() dialog in the new, private
298 updateOrHide() method that is connected to the updateBufferDependent
299 signal. Daughter classes dictate what to do using the
300 ChangedBufferAction enum, passed to the c-tor.
302 * src/frontends/xforms/FormCitation.C:
303 * src/frontends/xforms/FormCommand.C:
304 * src/frontends/xforms/FormCopyright.C:
305 * src/frontends/xforms/FormDocument.C:
306 * src/frontends/xforms/FormError.C:
307 * src/frontends/xforms/FormIndex.C:
308 * src/frontends/xforms/FormPreferences.C:
309 * src/frontends/xforms/FormPrint.C:
310 * src/frontends/xforms/FormRef.C:
311 * src/frontends/xforms/FormToc.C:
312 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
315 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
316 ChangedBufferAction enum.
318 * src/frontends/xforms/FormParagraph.[Ch]
319 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
322 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
324 * lib/bind/cua.bind: fix a bit.
325 * lib/bind/emacs.bind: ditto.
327 * lib/bind/menus.bind: remove real menu entries from there.
329 * src/spellchecker.C: make sure we only include strings.h when
332 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
334 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
335 function. It enlarges the maximum number of pup when needed.
336 (add_toc2): Open a new menu if maximum number of items per menu has
339 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
341 * src/frontends/kde/FormPrint.C: fix error reporting
343 * src/frontends/xforms/FormDocument.C: fix compiler
346 * lib/.cvsignore: add Literate.nw
348 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
351 * bufferview_funcs.[Ch]
354 * text2.C: Add support for numbers in RTL text.
356 2000-10-06 Allan Rae <rae@lyx.org>
358 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
359 to be gettext.m4 friendly again. ext_l10n.h is now
360 generated into $top_srcdir instead of $top_builddir
361 so that lyx.pot will be built correctly -- without
362 duplicate parsing of ext_l10n.h.
364 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
366 * src/frontends/kde/FormCitation.C: make the dialog
369 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
371 * config/kde.m4: fix consecutive ./configure runs,
372 look for qtarch, fix library order
374 * src/frontends/kde/Makefile.am: tidy up,
375 add Print dialog, add .dlg dependencies
377 * src/frontends/kde/FormPrint.C:
378 * src/frontends/kde/FormPrint.h:
379 * src/frontends/kde/formprintdialog.C:
380 * src/frontends/kde/formprintdialog.h:
381 * src/frontends/kde/formprintdialogdata.C:
382 * src/frontends/kde/formprintdialogdata.h:
383 * src/frontends/kde/dlg/formprintdialog.dlg: add
386 * src/frontends/kde/dlg/README: Added explanatory readme
388 * src/frontends/kde/dlg/checkinitorder.pl: small perl
389 script to double-check qtarch's output
391 * src/frontends/kde/formindexdialog.C:
392 * src/frontends/kde/formindexdialogdata.C:
393 * src/frontends/kde/formindexdialogdata.h:
394 * src/frontends/kde/dlg/formindexdialog.dlg: update
395 for qtarch, minor fixes
397 2000-10-05 Allan Rae <rae@lyx.org>
399 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
400 dialogs when switching buffers update them instead. It's up to each
401 dialog to decide if it should still be visible or not.
402 update() should return a bool to control visiblity within show().
403 Or perhaps better to set a member variable and use that to control
406 * lib/build-listerrors: create an empty "listerrors" file just to stop
407 make trying to regenerate it all the time if you don't have noweb
410 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
412 * po/Makefile.in.in (ext_l10n.h): added a rule to build
413 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
414 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
415 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
416 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
418 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
420 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
422 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
423 deleting buffer. Closes all buffer-dependent dialogs.
425 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
427 * src/frontends/xforms/FormCitation.[Ch]:
428 * src/frontends/xforms/FormPreferences.[Ch]:
429 * src/frontends/xforms/FormPrint.[Ch]:
430 * src/frontends/xforms/FormRef.[Ch]:
431 * src/frontends/xforms/FormUrl.[Ch]: ditto
433 * src/frontends/xforms/FormDocument.[Ch]:
434 * src/frontends/xforms/forms/form_document.C.patch:
435 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
436 pass through a single input() function.
438 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
440 * lib/build-listerrors: return status as OK
442 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
444 * lib/lyxrc.example: Updated to new export code
446 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
448 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
451 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
454 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
456 * lib/layouts/amsbook.layout: ditto.
458 * boost/Makefile.am: fix typo.
460 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
462 (add_lastfiles): removed.
463 (add_documents): removed.
464 (add_formats): removed.
466 * src/frontends/Menubar.C: remove useless "using" directive.
468 * src/MenuBackend.h: add a new MenuItem constructor.
470 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
473 2000-10-04 Allan Rae <rae@lyx.org>
475 * lib/Makefile.am (listerrors):
476 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
477 I haven't got notangle installed so Kayvan please test. The output
478 should end up in $builddir. This also allows people who don't have
479 noweb installed to complete the make process without error.
481 * src/frontends/xforms/FormCommand.[Ch] (showInset):
482 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
483 by JMarc's picky compiler.
485 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
488 * src/insets/insettabular.C (setPos): change for loop to not use
489 sequencing operator. Please check this Jürgen.
491 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
493 * src/insets/insetcite.C (getScreenLabel): ditto
494 * src/support/filetools.C (QuoteName): ditto
495 (ChangeExtension): ditto
497 * src/BufferView_pimpl.C (scrollCB): make heigt int
499 * src/BufferView2.C (insertInset): comment out unused arg
501 * boost/Makefile.am (EXTRADIST): new variable
503 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
505 * src/exporter.C (IsExportable): Fixed
507 * lib/configure.m4: Small fix
509 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
511 * src/insets/insetbutton.C (width): Changed to work with no GUI.
512 * src/insets/insetbib.C (bibitemWidest): ditto.
513 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
515 2000-10-03 Juergen Vigna <jug@sad.it>
517 * src/BufferView2.C (theLockingInset): removed const because of
518 Agnus's compile problems.
520 * src/insets/insettext.C (LocalDispatch): set the language of the
521 surronding paragraph on inserting the first character.
523 * various files: changed use of BufferView::the_locking_inset.
525 * src/BufferView2.C (theLockingInset):
526 (theLockingInset): new functions.
528 * src/BufferView.h: removed the_locking_inset.
530 * src/lyxtext.h: added the_locking_inset
532 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
534 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
536 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
538 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
539 * src/mathed/math_cursor.C (IsAlpha): ditto.
540 * src/mathed/math_inset.C (strnew): ditto.
541 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
542 (IMetrics): cxp set but never used; removed.
543 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
544 that the variable in question has been removed also!
547 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
548 using the Buffer * passed to Latex(), using the BufferView * passed to
549 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
551 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
552 Linuxdoc() and DocBook() rather than the stored Buffer * master.
554 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
555 * src/buffer.C (readInset): used new InsetBibtex c-tor
556 * (getBibkeyList): used new InsetBibtex::getKeys
558 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
561 * lib/build-listerrors
563 * src/exporter.C: Add literate programming support to the export code
566 * src/lyx_cb.C: Remove old literate code.
568 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
571 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
572 * src/converter.C (View, Convert): Use QuoteName.
574 * src/insets/figinset.C (Preview): Use Formats::View.
576 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
578 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
580 * src/lyxfunc.C (Dispatch): move declaration of text variable at
581 the top of the function, because compaq cxx complains that the
582 "goto exit_with_message" when the function is disabled bypasses
584 (MenuNew): try a better fix for the generation of new file names.
585 This time, I used AddName() instead of AddPath(), hoping Juergen
588 2000-10-03 Allan Rae <rae@lyx.org>
590 * src/frontends/xforms/forms/form_preferences.fd:
591 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
592 nested tabfolders has begun. The old "Miscellaneous" was renamed as
593 "Look and Feel"->"General" but will need to be split up further into
594 general output and general input tabs. Current plan is for four outer
595 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
596 stuff; "Inputs" for input and import configuration; "Outputs" for
597 output and export configuration; and one more whatever is left over
598 called "General". The leftovers at present look like being which
599 viewers to use, spellchecker, language support and might be better
600 named "Support". I've put "Paths" in "Inputs" for the moment as this
601 seems reasonable for now at least.
602 One problem remains: X error kills LyX when you close Preferences.
604 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
606 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
607 qualifier from form()
608 * src/frontends/xforms/FormCitation.[Ch]:
609 * src/frontends/xforms/FormCopyright.[Ch]:
610 * src/frontends/xforms/FormDocument.[Ch]:
611 * src/frontends/xforms/FormError.[Ch]:
612 * src/frontends/xforms/FormIndex.[Ch]:
613 * src/frontends/xforms/FormPreferences.[Ch]:
614 * src/frontends/xforms/FormPrint.[Ch]:
615 * src/frontends/xforms/FormRef.[Ch]:
616 * src/frontends/xforms/FormToc.[Ch]:
617 * src/frontends/xforms/FormUrl.[Ch]: ditto.
619 * src/frontends/xforms/FormCitation.[Ch]:
620 * src/frontends/xforms/FormIndex.[Ch]:
621 * src/frontends/xforms/FormRef.[Ch]:
622 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
623 with Allan's naming policy
625 * src/frontends/xforms/FormCitation.C: some static casts to remove
628 2000-10-02 Juergen Vigna <jug@sad.it>
630 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
631 now you can type or do stuff inside the table-cell also when in dummy
632 position, fixed visible cursor.
634 * src/insets/insettext.C (Edit): fixing cursor-view position.
636 * src/lyxfunc.C (Dispatch): use * text variable so that it can
637 be used for equal functions in lyxfunc and insettext.
639 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
641 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
643 * src/frontends/gnome/FormCitation.h:
644 * src/frontends/gnome/FormCopyright.h:
645 * src/frontends/gnome/FormIndex.h:
646 * src/frontends/gnome/FormPrint.h:
647 * src/frontends/gnome/FormToc.h:
648 * src/frontends/gnome/FormUrl.h:
649 * src/frontends/kde/FormCitation.h:
650 * src/frontends/kde/FormCopyright.h:
651 * src/frontends/kde/FormIndex.h:
652 * src/frontends/kde/FormRef.h:
653 * src/frontends/kde/FormToc.h:
654 * src/frontends/kde/FormUrl.h: fix remaining users of
657 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
659 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
661 (DocBookHandleCaption): ditto.
662 (DocBookHandleFootnote): ditto.
663 (SimpleDocBookOnePar): ditto.
665 * src/frontends/xforms/FormDocument.h (form): remove extra
666 FormDocument:: qualifier.
668 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
670 * sigc++/handle.h: ditto.
672 * src/lyx_gui_misc.C: add "using" directive.
674 * src/cheaders/cstddef: new file, needed by the boost library (for
677 2000-10-02 Juergen Vigna <jug@sad.it>
679 * src/insets/insettext.C (SetFont): better support.
681 * src/insets/insettabular.C (draw): fixed drawing of single cell.
683 * src/screen.C (DrawOneRow): some uint refixes!
685 2000-10-02 Allan Rae <rae@lyx.org>
687 * boost/.cvsignore: ignore Makefile as well
689 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
690 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
692 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
693 Left this one out by accident.
695 * src/frontends/xforms/FormBase.h (restore): default to calling
696 update() since that will restore the original/currently-applied values.
697 Any input() triggered error messages will require the derived classes
698 to redefine restore().
700 * src/frontends/xforms/FormDocument.C: initialize a few variables to
701 avoid a segfault. combo_doc_class is the main concern.
703 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
705 * Simplify build-listerrors in view of GUI-less export ability!
707 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
709 * src/lyx_main.C (easyParse): Disable gui when exporting
711 * src/insets/figinset.C:
715 * src/tabular.C: Changes to allow no-gui.
717 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
719 * src/support/utility.hpp: removed file
720 * src/support/block.h: removed file
722 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
725 * src/mathed/formula.C: add support/lyxlib.h
726 * src/mathed/formulamacro.C: ditto
728 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
729 * src/lyxparagraph.h: ditto
731 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
732 * src/frontends/Makefile.am (INCLUDES): ditto
733 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
734 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
735 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
736 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
737 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
738 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
740 * src/BufferView.h: use boost/utility.hpp
741 * src/LColor.h: ditto
743 * src/LyXAction.h: ditto
744 * src/LyXView.h: ditto
745 * src/bufferlist.h: ditto
746 * src/lastfiles.h: ditto
747 * src/layout.h: ditto
748 * src/lyx_gui.h: ditto
749 * src/lyx_main.h: ditto
750 * src/lyxlex.h: ditto
752 * src/frontends/ButtonPolicies.h: ditto
753 * src/frontends/Dialogs.h: ditto
754 * src/frontends/xforms/FormBase.h: ditto
755 * src/frontends/xforms/FormGraphics.h: ditto
756 * src/frontends/xforms/FormParagraph.h: ditto
757 * src/frontends/xforms/FormTabular.h: ditto
758 * src/graphics/GraphicsCache.h: ditto
759 * src/graphics/Renderer.h: ditto
760 * src/insets/ExternalTemplate.h: ditto
761 * src/insets/insetcommand.h: ditto
762 * src/support/path.h: ditto
764 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
765 and introduce clause for 2.97.
767 * boost/libs/README: new file
769 * boost/boost/utility.hpp: new file
771 * boost/boost/config.hpp: new file
773 * boost/boost/array.hpp: new file
775 * boost/Makefile.am: new file
777 * boost/.cvsignore: new file
779 * configure.in (AC_OUTPUT): add boost/Makefile
781 * Makefile.am (SUBDIRS): add boost
783 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
785 * src/support/lstrings.C (suffixIs): Fixed.
787 2000-10-01 Allan Rae <rae@lyx.org>
789 * src/PrinterParams.h: moved things around to avoid the "can't
790 inline call" warning.
792 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
793 into doc++ documentation.
795 * src/frontends/xforms/FormCommand.[Ch]: support button policy
797 * src/frontends/xforms/FormRef.C: make use of button controller
798 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
799 cleaned up button controller usage.
800 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
801 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
802 use the button controller
804 * src/frontends/xforms/forms/*.fd: and associated generated files
805 updated to reflect changes to FormBase. Some other FormXxxx files
806 also got minor updates to reflect changes to FormBase.
808 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
809 (hide): made virtual.
810 (input): return a bool. true == valid input
811 (RestoreCB, restore): new
812 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
813 Changes to allow derived dialogs to use a ButtonController and
814 make sense when doing so: OK button calls ok() and so on.
816 * src/frontends/xforms/ButtonController.h (class ButtonController):
817 Switch from template implementation to taking Policy parameter.
818 Allows FormBase to provide a ButtonController for any dialog.
820 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
821 Probably should rename connect and disconnect.
822 (apply): use the radio button groups
823 (form): needed by FormBase
824 (build): setup the radio button groups
826 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
828 * several files: type changes to reduce the number of warnings and
829 to unify type hangling a bit. Still much to do.
831 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
833 * lib/images/*: rename a bunch of icons to match Dekel converter
836 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
839 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
841 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
843 * sigc++/handle.h: ditto for class Handle.
845 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
847 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
849 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
851 * src/intl.C (InitKeyMapper): Correct the value of n due to the
852 removal of the "default" language.
854 * src/combox.h (getline): Check that sel > 0
856 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
858 * lib/examples/docbook_example.lyx
859 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
861 * lib/layouts/docbook-book.layout: new docbook book layout.
863 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
865 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
867 * src/insets/figinset.C (DocBook):fixed small typo.
869 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
871 * src/insets/insetinclude.h: string include_label doesn't need to be
874 2000-09-29 Allan Rae <rae@lyx.org>
876 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
877 Allow derived type to control connection and disconnection from signals
878 of its choice if desired.
880 2000-09-28 Juergen Vigna <jug@sad.it>
882 * src/insets/insettabular.C (update): fixed cursor setting when
883 the_locking_inset changed.
884 (draw): made this a bit cleaner.
885 (InsetButtonPress): fixed!
887 * various files: added LyXText Parameter to fitCursor call.
889 * src/BufferView.C (fitCursor): added LyXText parameter.
891 * src/insets/insettabular.C (draw): small draw fix.
893 * src/tabular.C: right setting of left/right celllines.
895 * src/tabular.[Ch]: fixed various types in funcions and structures.
896 * src/insets/insettabular.C: ditto
897 * src/frontends/xforms/FormTabular.C: ditto
899 2000-09-28 Allan Rae <rae@lyx.org>
901 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
902 that the #ifdef's had been applied to part of what should have been
903 a complete condition. It's possible there are other tests that
904 were specific to tables that are also wrong now that InsetTabular is
905 being used. Now we need to fix the output of '\n' after a table in a
906 float for the same reason as the original condition:
907 "don't insert this if we would be adding it before or after a table
908 in a float. This little trick is needed in order to allow use of
909 tables in \subfigures or \subtables."
910 Juergen can you check this?
912 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
914 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
915 outputed to the ostream.
917 * several files: fixed types based on warnings from cxx
919 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
921 * src/frontends/kde/Makefile.am: fix rule for
922 formindexdialogdata_moc.C
924 * src/.cvsignore: add ext_l10n.h to ignore
926 * acconfig.h: stop messing with __STRICT_ANSI__
927 * config/gnome.m4: remove option to set -ansi
928 * config/kde.m4: remove option to set -ansi
929 * config/lyxinclude.m4: don't set -ansi
931 2000-09-27 Juergen Vigna <jug@sad.it>
933 * various files: remove "default" language check.
935 * src/insets/insetquotes.C: removed use of current_view.
937 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
938 the one should have red ears by now!
940 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
941 in more then one paragraph. Fixed cursor-movement/selection.
943 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
944 paragraphs inside a text inset.
946 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
947 text-inset if this owner is an inset.
949 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
951 * src/Bullet.h: changed type of font, character and size to int
953 * src/buffer.C (asciiParagraph): remove actcell and fname1.
955 * src/insets/inseturl.[Ch]:
956 * src/insets/insetref.[Ch]:
957 * src/insets/insetlabel.[Ch]: add linelen to Ascii
959 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
961 * src/buffer.C (readFile): block-if statement rearranged to minimise
962 bloat. Patch does not reverse Jean-Marc's change ;-)
964 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
965 Class rewritten to store pointers to hide/update signals directly,
966 rather than Dialogs *. Also defined an enum to ease use. All xforms
967 forms can now be derived from this class.
969 * src/frontends/xforms/FormCommand.[Ch]
970 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
972 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
975 * src/frontends/xforms/forms/form_citation.fd
976 * src/frontends/xforms/forms/form_copyright.fd
977 * src/frontends/xforms/forms/form_error.fd
978 * src/frontends/xforms/forms/form_index.fd
979 * src/frontends/xforms/forms/form_ref.fd
980 * src/frontends/xforms/forms/form_toc.fd
981 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
983 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
985 * src/insets/insetfoot.C: removed redundent using directive.
987 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
989 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
990 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
992 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
993 created in the constructors in different groups. Then set() just
994 have to show the groups as needed. This fixes the redraw problems
995 (and is how the old menu code worked).
997 * src/support/lyxlib.h: declare the methods as static when we do
1000 2000-09-26 Juergen Vigna <jug@sad.it>
1002 * src/buffer.C (asciiParagraph): new function.
1003 (writeFileAscii): new function with parameter ostream.
1004 (writeFileAscii): use now asciiParagraph.
1006 * various inset files: added the linelen parameter to the Ascii-func.
1008 * src/tabular.C (Write): fixed error in writing file introduced by
1009 the last changes from Lars.
1011 * lib/bind/menus.bind: removed not supported functions.
1013 * src/insets/insettext.C (Ascii): implemented this function.
1015 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1017 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1018 (Write): use of the write_attribute functions.
1020 * src/bufferlist.C (close): fixed reasking question!
1022 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1024 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1025 new files use the everwhere possible.
1028 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1029 src/log_form.C src/lyx.C:
1032 * src/buffer.C (runLaTeX): remove func
1034 * src/PaperLayout.C: removed file
1035 * src/ParagraphExtra.C: likewise
1036 * src/bullet_forms.C: likewise
1037 * src/bullet_forms.h: likewise
1038 * src/bullet_forms_cb.C: likewise
1040 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1041 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1044 * several files: remove all traces of the old fd_form_paragraph,
1045 and functions belonging to that.
1047 * several files: remove all traces of the old fd_form_document,
1048 and functions belonging to that.
1050 * several files: constify local variables were possible.
1052 * several files: remove all code that was dead when NEW_EXPORT was
1055 * several files: removed string::c_str in as many places as
1058 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1059 (e): be a bit more outspoken when patching
1060 (updatesrc): only move files if changed.
1062 * forms/layout_forms.h.patch: regenerated
1064 * forms/layout_forms.fd: remove form_document and form_paragraph
1065 and form_quotes and form_paper and form_table_options and
1066 form_paragraph_extra
1068 * forms/form1.fd: remove form_table
1070 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1071 the fdui->... rewrite. Update some comments to xforms 0.88
1073 * forms/bullet_forms.C.patch: removed file
1074 * forms/bullet_forms.fd: likewise
1075 * forms/bullet_forms.h.patch: likewise
1077 * development/Code_rules/Rules: added a section on switch
1078 statements. Updated some comment to xforms 0.88.
1080 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1082 * src/buffer.C (readFile): make sure that the whole version number
1083 is read after \lyxformat (even when it contains a comma)
1085 * lib/ui/default.ui: change shortcut of math menu to M-a.
1087 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1089 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1092 * src/LyXView.C (updateWindowTitle): show the full files name in
1093 window title, limited to 30 characters.
1095 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1096 When a number of characters has been given, we should not assume
1097 that the string is 0-terminated.
1099 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1100 calls (fixes some memory leaks)
1102 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1103 trans member on exit.
1105 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1107 * src/converter.C (GetReachable): fix typo.
1109 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1110 understand ',' instead of '.'.
1111 (GetInteger): rewrite to use strToInt().
1113 2000-09-26 Juergen Vigna <jug@sad.it>
1115 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1116 better visibility and error-message on wrong VSpace input.
1118 * src/language.C (initL): added english again.
1120 2000-09-25 Juergen Vigna <jug@sad.it>
1122 * src/frontends/kde/Dialogs.C (Dialogs):
1123 * src/frontends/gnome/Dialogs.C (Dialogs):
1124 * src/frontends/kde/Makefile.am:
1125 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1127 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1129 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1131 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1133 * src/frontends/xforms/FormParagraph.C:
1134 * src/frontends/xforms/FormParagraph.h:
1135 * src/frontends/xforms/form_paragraph.C:
1136 * src/frontends/xforms/form_paragraph.h:
1137 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1140 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1142 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1143 Paragraph-Data after use.
1145 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1146 non breakable paragraphs.
1148 2000-09-25 Garst R. Reese <reese@isn.net>
1150 * src/language.C (initL): added missing language_country codes.
1152 2000-09-25 Juergen Vigna <jug@sad.it>
1154 * src/insets/insettext.C (InsetText):
1155 (deleteLyXText): remove the not released LyXText structure!
1157 2000-09-24 Marko Vendelin <markov@ioc.ee>
1159 * src/frontends/gnome/mainapp.C
1160 * src/frontends/gnome/mainapp.h: added support for keyboard
1163 * src/frontends/gnome/FormCitation.C
1164 * src/frontends/gnome/FormCitation.h
1165 * src/frontends/gnome/Makefile.am
1166 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1167 FormCitation to use "action area" in mainapp window
1169 * src/frontends/gnome/Menubar_pimpl.C
1170 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1173 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1175 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1176 width/descent/ascent values if name is empty.
1177 (mathed_string_height): Use std::max.
1179 2000-09-25 Allan Rae <rae@lyx.org>
1181 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1182 segfault. This will be completely redesigned soon.
1184 * sigc++: updated libsigc++. Fixes struct timespec bug.
1186 * development/tools/makeLyXsigc.sh: .cvsignore addition
1188 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1190 * several files: removed almost all traces of the old table
1193 * src/TableLayout.C: removed file
1195 2000-09-22 Juergen Vigna <jug@sad.it>
1197 * src/frontends/kde/Dialogs.C: added credits forms.
1199 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1201 * src/frontends/gnome/Dialogs.C: added some forms.
1203 * src/spellchecker.C (init_spell_checker): set language in pspell code
1204 (RunSpellChecker): some modifications for setting language string.
1206 * src/language.[Ch]: added language_country code.
1208 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1210 * src/frontends/Dialogs.h: added new signal showError.
1211 Rearranged existing signals in some sort of alphabetical order.
1213 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1214 FormError.[Ch], form_error.[Ch]
1215 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1216 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1218 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1219 dialogs. I think that this can be used as the base to all these
1222 * src/frontends/xforms/FormError.[Ch]
1223 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1224 implementation of InsetError dialog.
1226 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1228 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1229 * src/frontends/kde/Makefile.am: ditto
1231 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1233 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1234 macrobf. This fixes a bug of invisible text.
1236 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1238 * lib/doc/LaTeXConfig.lyx.in: updated.
1240 * src/language.C (initL): remove language "francais" and change a
1241 bit the names of the two other french variations.
1243 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1244 string that may not be 0-terminated.
1246 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1248 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1250 2000-09-20 Marko Vendelin <markov@ioc.ee>
1252 * src/frontends/gnome/FormCitation.C
1253 * src/frontends/gnome/FormIndex.C
1254 * src/frontends/gnome/FormToc.C
1255 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1256 the variable initialization to shut up the warnings
1258 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1260 * src/table.[Ch]: deleted files
1262 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1265 2000-09-18 Juergen Vigna <jug@sad.it>
1267 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1268 problems with selection. Inserted new LFUN_PASTESELECTION.
1269 (InsetButtonPress): inserted handling of middle mouse-button paste.
1271 * src/spellchecker.C: changed word to word.c_str().
1273 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1275 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1276 included in the ``make dist'' tarball.
1278 2000-09-15 Juergen Vigna <jug@sad.it>
1280 * src/CutAndPaste.C (cutSelection): small fix return the right
1281 end position after cut inside one paragraph only.
1283 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1284 we are locked as otherwise we don't have a valid cursor position!
1286 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1288 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1290 * src/frontends/kde/FormRef.C: added using directive.
1291 * src/frontends/kde/FormToc.C: ditto
1293 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1295 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1297 2000-09-19 Marko Vendelin <markov@ioc.ee>
1299 * src/frontends/gnome/Menubar_pimpl.C
1300 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1301 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1303 * src/frontends/gnome/mainapp.C
1304 * src/frontends/gnome/mainapp.h: support for menu update used
1307 * src/frontends/gnome/mainapp.C
1308 * src/frontends/gnome/mainapp.h: support for "action" area in the
1309 main window. This area is used by small simple dialogs, such as
1312 * src/frontends/gnome/FormIndex.C
1313 * src/frontends/gnome/FormIndex.h
1314 * src/frontends/gnome/FormUrl.C
1315 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
1318 * src/frontends/gnome/FormCitation.C
1319 * src/frontends/gnome/FormCitation.h: rewrite to use main window
1320 action area. Only "Insert new citation" is implemented.
1322 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1324 * src/buffer.C (Dispatch): fix call to Dispatch
1325 * src/insets/insetref.C (Edit): likewise
1326 * src/insets/insetparent.C (Edit): likewise
1327 * src/insets/insetinclude.C (include_cb): likewise
1328 * src/frontends/xforms/FormUrl.C (apply): likewise
1329 * src/frontends/xforms/FormToc.C (apply): likewise
1330 * src/frontends/xforms/FormRef.C (apply): likewise
1331 * src/frontends/xforms/FormIndex.C (apply): likewise
1332 * src/frontends/xforms/FormCitation.C (apply): likewise
1333 * src/lyxserver.C (callback): likewise
1334 * src/lyxfunc.C (processKeySym): likewise
1335 (Dispatch): likewise
1336 (Dispatch): likewise
1337 * src/lyx_cb.C (LayoutsCB): likewise
1339 * Makefile.am (sourcedoc): small change
1341 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1343 * src/main.C (main): Don't make an empty GUIRunTime object. all
1344 methods are static. constify a bit remove unneded using + headers.
1346 * src/tabular.C: some more const to local vars move some loop vars
1348 * src/spellchecker.C: added some c_str after some word for pspell
1350 * src/frontends/GUIRunTime.h: add new static method setDefaults
1351 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1352 * src/frontends/kde/GUIRunTime.C (setDefaults):
1353 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1355 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1356 with strnew in arg, use correct emptystring when calling SetName.
1358 * several files: remove all commented code with relation to
1359 HAVE_SSTREAM beeing false. We now only support stringstream and
1362 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1364 * src/lyxfunc.C: construct correctly the automatic new file
1367 * src/text2.C (IsStringInText): change type of variable i to shut
1370 * src/support/sstream.h: do not use namespaces if the compiler
1371 does not support them.
1373 2000-09-15 Marko Vendelin <markov@ioc.ee>
1374 * src/frontends/gnome/FormCitation.C
1375 * src/frontends/gnome/FormCitation.h
1376 * src/frontends/gnome/diainsertcitation_interface.c
1377 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1378 regexp support to FormCitation [Gnome].
1380 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1383 * configure.in: remove unused KDE/GTKGUI define
1385 * src/frontends/kde/FormRef.C
1386 * src/frontends/kde/FormRef.h
1387 * src/frontends/kde/formrefdialog.C
1388 * src/frontends/kde/formrefdialog.h: double click will
1389 go to reference, now it is possible to change a cross-ref
1392 * src/frontends/kde/FormToc.C
1393 * src/frontends/kde/FormToc.h
1394 * src/frontends/kde/formtocdialog.C
1395 * src/frontends/kde/formtocdialog.h: add a depth
1398 * src/frontends/kde/Makefile.am: add QtLyXView.h
1401 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1403 * src/frontends/kde/FormCitation.h: added some using directives.
1405 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1407 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1410 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1413 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1415 * src/buffer.C (pop_tag): revert for the second time a change by
1416 Lars, who seems to really hate having non-local loop variables :)
1418 * src/Lsstream.h: add "using" statements.
1420 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1421 * src/buffer.C (writeFile): ditto
1423 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1425 * src/buffer.C (writeFile): try to fix the locale modified format
1426 number to always be as we want it.
1428 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1429 in XForms 0.89. C-space is now working again.
1431 * src/Lsstream.h src/support/sstream.h: new files.
1433 * also commented out all cases where strstream were used.
1435 * src/Bullet.h (c_str): remove method.
1437 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1439 * a lot of files: get rid of "char const *" and "char *" is as
1440 many places as possible. We only want to use them in interaction
1441 with system of other libraries, not inside lyx.
1443 * a lot of files: return const object is not of pod type. This
1444 helps ensure that temporary objects is not modified. And fits well
1445 with "programming by contract".
1447 * configure.in: check for the locale header too
1449 * Makefile.am (sourcedoc): new tag for generation of doc++
1452 2000-09-14 Juergen Vigna <jug@sad.it>
1454 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1455 callback to check which combo called it and do the right action.
1457 * src/combox.C (combo_cb): added combo * to the callbacks.
1458 (Hide): moved call of callback after Ungrab of the pointer.
1460 * src/intl.h: removed LCombo2 function.
1462 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1463 function as this can now be handled in one function.
1465 * src/combox.h: added Combox * to callback prototype.
1467 * src/frontends/xforms/Toolbar_pimpl.C:
1468 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1470 2000-09-14 Garst Reese <reese@isn.net>
1472 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1473 moved usepackage{xxx}'s to beginning of file. Changed left margin
1474 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1475 underlining from title. Thanks to John Culleton for useful suggestions.
1477 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1479 * src/lyxlex_pimpl.C (setFile): change error message to debug
1482 2000-09-13 Juergen Vigna <jug@sad.it>
1484 * src/frontends/xforms/FormDocument.C: implemented choice_class
1485 as combox and give callback to combo_language so OK/Apply is activated
1488 * src/bufferlist.C (newFile): small fix so already named files
1489 (via an open call) are not requested to be named again on the
1492 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1494 * src/frontends/kde/Makefile.am
1495 * src/frontends/kde/FormRef.C
1496 * src/frontends/kde/FormRef.h
1497 * src/frontends/kde/formrefdialog.C
1498 * src/frontends/kde/formrefdialog.h: implement
1501 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1503 * src/frontends/kde/formtocdialog.C
1504 * src/frontends/kde/formtocdialog.h
1505 * src/frontends/kde/FormToc.C
1506 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1508 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1510 * src/frontends/kde/FormCitation.C: fix thinko
1511 where we didn't always display the reference text
1514 * src/frontends/kde/formurldialog.C
1515 * src/frontends/kde/formurldialog.h
1516 * src/frontends/kde/FormUrl.C
1517 * src/frontends/kde/FormUrl.h: minor cleanups
1519 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
1521 * src/frontends/kde/Makefile.am
1522 * src/frontends/kde/FormToc.C
1523 * src/frontends/kde/FormToc.h
1524 * src/frontends/kde/FormCitation.C
1525 * src/frontends/kde/FormCitation.h
1526 * src/frontends/kde/FormIndex.C
1527 * src/frontends/kde/FormIndex.h
1528 * src/frontends/kde/formtocdialog.C
1529 * src/frontends/kde/formtocdialog.h
1530 * src/frontends/kde/formcitationdialog.C
1531 * src/frontends/kde/formcitationdialog.h
1532 * src/frontends/kde/formindexdialog.C
1533 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1535 2000-09-12 Juergen Vigna <jug@sad.it>
1537 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1540 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1542 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1545 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1547 * src/converter.C (Add, Convert): Added support for converter flags:
1548 needaux, resultdir, resultfile.
1549 (Convert): Added new parameter view_file.
1550 (dvips_options): Fixed letter paper option.
1552 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1553 (Export, GetExportableFormats, GetViewableFormats): Added support
1556 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1558 (easyParse): Fixed to work with new export code.
1560 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
1563 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
1565 * lib/bind/*.bind: Replaced
1566 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
1567 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
1569 2000-09-11 Juergen Vigna <jug@sad.it>
1571 * src/lyx_gui.C (runTime): uses global guiruntime variable.
1573 * src/main.C (main): now GUII defines global guiruntime!
1575 * src/frontends/gnome/GUIRunTime.C (initApplication):
1576 * src/frontends/kde/GUIRunTime.C (initApplication):
1577 * src/frontends/xforms/GUIRunTime.C (initApplication):
1578 * src/frontends/GUIRunTime.h: added new function initApplication.
1580 * src/spellchecker.C (sc_accept_word): change to add_to_session.
1582 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
1584 2000-09-08 Juergen Vigna <jug@sad.it>
1586 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1587 we have already "Reset".
1589 * src/language.C (initL): inserted "default" language and made this
1590 THE default language (and not american!)
1592 * src/paragraph.C: inserted handling of "default" language!
1594 * src/lyxfont.C: ditto
1598 * src/paragraph.C: output the \\par only if we have a following
1599 paragraph otherwise it's not needed.
1601 2000-09-05 Juergen Vigna <jug@sad.it>
1603 * config/pspell.m4: added entry to lyx-flags
1605 * src/spellchecker.C: modified version from Kevin for using pspell
1607 2000-09-01 Marko Vendelin <markov@ioc.ee>
1608 * src/frontends/gnome/Makefile.am
1609 * src/frontends/gnome/FormCitation.C
1610 * src/frontends/gnome/FormCitation.h
1611 * src/frontends/gnome/diainsertcitation_callbacks.c
1612 * src/frontends/gnome/diainsertcitation_callbacks.h
1613 * src/frontends/gnome/diainsertcitation_interface.c
1614 * src/frontends/gnome/diainsertcitation_interface.h
1615 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1616 dialog for Gnome frontend
1618 * src/main.C: Gnome libraries require keeping application name
1619 and its version as strings
1621 * src/frontends/gnome/mainapp.C: Change the name of the main window
1622 from GnomeLyX to PACKAGE
1624 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1626 * src/frontends/Liason.C: add "using: declaration.
1628 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1630 * src/mathed/math_macro.C (Metrics): Set the size of the template
1632 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1634 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1636 * src/converter.C (add_options): New function.
1637 (SetViewer): Change $$FName into '$$FName'.
1638 (View): Add options when running xdvi
1639 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
1640 (Convert): The 3rd parameter is now the desired filename. Converts
1641 calls to lyx::rename if necessary.
1642 Add options when running dvips.
1643 (dvi_papersize,dvips_options): New methods.
1645 * src/exporter.C (Export): Use getLatexName() instead of fileName().
1647 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
1648 using a call to Converter::dvips_options.
1649 Fixed to work with nex export code.
1651 * src/support/copy.C
1652 * src/support/rename.C: New files
1654 * src/support/syscall.h
1655 * src/support/syscall.C: Added Starttype SystemDontWait.
1657 * lib/ui/default.ui: Changed to work with new export code
1659 * lib/configure.m4: Changed to work with new export code
1661 * src/encoding.C: Changed latex name for iso8859_7 encoding.
1663 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
1665 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
1666 so that code compiles with DEC cxx.
1668 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
1669 to work correctly! Also now supports the additional elements
1672 2000-09-01 Allan Rae <rae@lyx.org>
1674 * src/frontends/ButtonPolicies.C: renamed all the references to
1675 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
1677 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
1678 since it's a const not a type.
1680 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
1682 2000-08-31 Juergen Vigna <jug@sad.it>
1684 * src/insets/figinset.C: Various changes to look if the filename has
1685 an extension and if not add it for inline previewing.
1687 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1689 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1690 make buttonStatus and isReadOnly be const methods. (also reflect
1691 this in derived classes.)
1693 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1694 (nextState): change to be static inline, pass the StateMachine as
1696 (PreferencesPolicy): remove casts
1697 (OkCancelPolicy): remvoe casts
1698 (OkCancelReadOnlyPolicy): remove casts
1699 (NoRepeatedApplyReadOnlyPolicy): remove casts
1700 (OkApplyCancelReadOnlyPolicy): remove casts
1701 (OkApplyCancelPolicy): remove casts
1702 (NoRepeatedApplyPolicy): remove casts
1704 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1706 * src/converter.C: added some using directives
1708 * src/frontends/ButtonPolicies.C: changes to overcome
1709 "need lvalue" error with DEC c++
1711 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1712 to WMHideCB for DEC c++
1714 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1716 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1717 to BulletBMTableCB for DEC c++
1719 2000-08-31 Allan Rae <rae@lyx.org>
1721 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1722 character dialog separately from old document dialogs combo_language.
1725 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1727 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1728 Removed LFUN_REF_CREATE.
1730 * src/MenuBackend.C: Added new tags: toc and references
1732 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1733 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1735 (add_toc, add_references): New methods.
1736 (create_submenu): Handle correctly the case when there is a
1737 seperator after optional menu items.
1739 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1740 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1741 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1743 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1745 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1747 * src/converter.[Ch]: New file for converting between different
1750 * src/export.[Ch]: New file for exporting a LyX file to different
1753 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1754 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1755 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1756 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1757 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1758 RunDocBook, MenuExport.
1760 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1761 Exporter::Preview methods if NEW_EXPORT is defined.
1763 * src/buffer.C (Dispatch): Use Exporter::Export.
1765 * src/lyxrc.C: Added new tags: \converter and \viewer.
1768 * src/LyXAction.C: Define new lyx-function: buffer-update.
1769 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1770 when NEW_EXPORT is defined.
1772 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1774 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1776 * lib/ui/default.ui: Added submenus "view" and "update" to the
1779 * src/filetools.C (GetExtension): New function.
1781 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1783 2000-08-29 Allan Rae <rae@lyx.org>
1785 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1787 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1788 (EnableDocumentLayout): removed
1789 (DisableDocumentLayout): removed
1790 (build): make use of ButtonController's read-only handling to
1791 de/activate various objects. Replaces both of the above functions.
1793 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1794 (readOnly): was read_only
1795 (refresh): fixed dumb mistakes with read_only_ handling
1797 * src/frontends/xforms/forms/form_document.fd:
1798 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1799 tabbed dialogs so the tabs look more like tabs and so its easier to
1800 work out which is the current tab.
1802 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1803 segfault with form_table
1805 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1807 2000-08-28 Juergen Vigna <jug@sad.it>
1809 * acconfig.h: added USE_PSPELL.
1811 * src/config.h.in: added USE_PSPELL.
1813 * autogen.sh: added pspell.m4
1815 * config/pspell.m4: new file.
1817 * src/spellchecker.C: implemented support for pspell libary.
1819 2000-08-25 Juergen Vigna <jug@sad.it>
1821 * src/LyXAction.C (init): renamed LFUN_TABLE to
1822 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1824 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1826 * src/lyxscreen.h: add force_clear variable and fuction to force
1827 a clear area when redrawing in LyXText.
1829 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1831 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1833 * some whitespace and comment changes.
1835 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1837 * src/buffer.C: up te LYX_FORMAT to 2.17
1839 2000-08-23 Juergen Vigna <jug@sad.it>
1841 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1844 * src/insets/insettabular.C (pasteSelection): delete the insets
1845 LyXText as it is not valid anymore.
1846 (copySelection): new function.
1847 (pasteSelection): new function.
1848 (cutSelection): new function.
1849 (LocalDispatch): implemented cut/copy/paste of cell selections.
1851 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1852 don't have a LyXText.
1854 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1856 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1859 2000-08-22 Juergen Vigna <jug@sad.it>
1861 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1862 ifdef form_table out if NEW_TABULAR.
1864 2000-08-21 Juergen Vigna <jug@sad.it>
1866 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1867 (draw): fixed draw position so that the cursor is positioned in the
1869 (InsetMotionNotify): hide/show cursor so the position is updated.
1870 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
1871 using cellstart() function where it should be used.
1873 * src/insets/insettext.C (draw): ditto.
1875 * src/tabular.C: fixed initialization of some missing variables and
1876 made BoxType into an enum.
1878 2000-08-22 Marko Vendelin <markov@ioc.ee>
1879 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
1880 stock menu item using action numerical value, not its string
1884 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
1886 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
1887 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
1889 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
1891 * src/frontends/xforms/GUIRunTime.C: new file
1893 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
1894 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1896 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
1898 * src/frontends/kde/GUIRunTime.C: new file
1900 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
1901 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
1903 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
1905 * src/frontends/gnome/GUIRunTime.C: new file
1907 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
1910 * src/frontends/GUIRunTime.h: removed constructor and destructor,
1911 small change to documetentation.
1913 * src/frontends/GUIRunTime.C: removed file
1915 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
1917 * src/lyxparagraph.h: enable NEW_TABULAR as default
1919 * src/lyxfunc.C (processKeySym): remove some commented code
1921 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1922 NEW_TABULAR around the fd_form_table_options.
1924 * src/lyx_gui.C (runTime): call the static member function as
1925 GUIRunTime::runTime().
1927 2000-08-21 Allan Rae <rae@lyx.org>
1929 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1932 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1934 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1936 2000-08-21 Allan Rae <rae@lyx.org>
1938 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1939 keep Garst happy ;-)
1940 * src/frontends/xforms/FormPreferences.C (build): use setOK
1941 * src/frontends/xforms/FormDocument.C (build): use setOK
1942 (FormDocument): use the appropriate policy.
1944 2000-08-21 Allan Rae <rae@lyx.org>
1946 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1947 automatic [de]activation of arbitrary objects when in a read-only state.
1949 * src/frontends/ButtonPolicies.h: More documentation
1950 (isReadOnly): added to support the above.
1952 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1954 2000-08-18 Juergen Vigna <jug@sad.it>
1956 * src/insets/insettabular.C (getStatus): changed to return func_status.
1958 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1959 display toggle menu entries if they are.
1961 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1962 new document layout now.
1964 * src/lyxfunc.C: ditto
1966 * src/lyx_gui_misc.C: ditto
1968 * src/lyx_gui.C: ditto
1970 * lib/ui/default.ui: removed paper and quotes layout as they are now
1971 all in the document layout tabbed folder.
1973 * src/frontends/xforms/forms/form_document.fd: added Restore
1974 button and callbacks for all inputs for Allan's ButtonPolicy.
1976 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1977 (CheckChoiceClass): added missing params setting on class change.
1978 (UpdateLayoutDocument): added for updating the layout on params.
1979 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1980 (FormDocument): Implemented Allan's ButtonPolicy with the
1983 2000-08-17 Allan Rae <rae@lyx.org>
1985 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1986 so we can at least see the credits again.
1988 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1989 controller calls for the appropriate callbacks. Note that since Ok
1990 calls apply followed by cancel, and apply isn't a valid input for the
1991 APPLIED state, the bc_ calls have to be made in the static callback not
1992 within each of the real callbacks.
1994 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1995 (setOk): renamed from setOkay()
1997 2000-08-17 Juergen Vigna <jug@sad.it>
1999 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2000 in the implementation part.
2001 (composeUIInfo): don't show optional menu-items.
2003 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2005 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2007 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2008 text-state when in a text-inset.
2010 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2012 2000-08-17 Marko Vendelin <markov@ioc.ee>
2013 * src/frontends/gnome/FormIndex.C
2014 * src/frontends/gnome/FormIndex.h
2015 * src/frontends/gnome/FormToc.C
2016 * src/frontends/gnome/FormToc.h
2017 * src/frontends/gnome/dialogs
2018 * src/frontends/gnome/diatoc_callbacks.c
2019 * src/frontends/gnome/diatoc_callbacks.h
2020 * src/frontends/gnome/diainsertindex_callbacks.h
2021 * src/frontends/gnome/diainsertindex_callbacks.c
2022 * src/frontends/gnome/diainsertindex_interface.c
2023 * src/frontends/gnome/diainsertindex_interface.h
2024 * src/frontends/gnome/diatoc_interface.h
2025 * src/frontends/gnome/diatoc_interface.c
2026 * src/frontends/gnome/Makefile.am: Table of Contents and
2027 Insert Index dialogs implementation for Gnome frontend
2029 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2031 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2033 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2036 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2038 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2039 destructor. Don't definde if you don't need it
2040 (processEvents): made static, non-blocking events processing for
2042 (runTime): static method. event loop for xforms
2043 * similar as above for kde and gnome.
2045 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2046 new Pimpl is correct
2047 (runTime): new method calss the real frontends runtime func.
2049 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2051 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2053 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2055 2000-08-16 Juergen Vigna <jug@sad.it>
2057 * src/lyx_gui.C (runTime): added GUII RunTime support.
2059 * src/frontends/Makefile.am:
2060 * src/frontends/GUIRunTime.[Ch]:
2061 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2062 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2063 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2065 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2067 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2068 as this is already set in ${FRONTEND_INCLUDE} if needed.
2070 * configure.in (CPPFLAGS): setting the include dir for the frontend
2071 directory and don't set FRONTEND=xforms for now as this is executed
2074 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2076 * src/frontends/kde/Makefile.am:
2077 * src/frontends/kde/FormUrl.C:
2078 * src/frontends/kde/FormUrl.h:
2079 * src/frontends/kde/formurldialog.h:
2080 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2082 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2084 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2086 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2088 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2091 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2093 * src/WorkArea.C (work_area_handler): more work to get te
2094 FL_KEYBOARD to work with xforms 0.88 too, please test.
2096 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2098 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2100 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2103 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2105 * src/Timeout.h: remove Qt::emit hack.
2107 * several files: changes to allo doc++ compilation
2109 * src/lyxfunc.C (processKeySym): new method
2110 (processKeyEvent): comment out if FL_REVISION < 89
2112 * src/WorkArea.C: change some debugging levels.
2113 (WorkArea): set wantkey to FL_KEY_ALL
2114 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2115 clearer code and the use of compose with XForms 0.89. Change to
2116 use signals instead of calling methods in bufferview directly.
2118 * src/Painter.C: change some debugging levels.
2120 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2123 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2124 (workAreaKeyPress): new method
2126 2000-08-14 Juergen Vigna <jug@sad.it>
2128 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2130 * config/kde.m4: addes some features
2132 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2133 include missing xforms dialogs.
2135 * src/Timeout.h: a hack to be able to compile with qt/kde.
2137 * sigc++/.cvsignore: added acinclude.m4
2139 * lib/.cvsignore: added listerros
2141 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2142 xforms tree as objects are needed for other frontends.
2144 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2145 linking with not yet implemented xforms objects.
2147 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2149 2000-08-14 Baruch Even <baruch.even@writeme.com>
2151 * src/frontends/xforms/FormGraphics.h:
2152 * src/frontends/xforms/FormGraphics.C:
2153 * src/frontends/xforms/RadioButtonGroup.h:
2154 * src/frontends/xforms/RadioButtonGroup.C:
2155 * src/insets/insetgraphics.h:
2156 * src/insets/insetgraphics.C:
2157 * src/insets/insetgraphicsParams.h:
2158 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2159 instead of spaces, and various other indentation issues to make the
2160 sources more consistent.
2162 2000-08-14 Marko Vendelin <markov@ioc.ee>
2164 * src/frontends/gnome/dialogs/diaprint.glade
2165 * src/frontends/gnome/FormPrint.C
2166 * src/frontends/gnome/FormPrint.h
2167 * src/frontends/gnome/diaprint_callbacks.c
2168 * src/frontends/gnome/diaprint_callbacks.h
2169 * src/frontends/gnome/diaprint_interface.c
2170 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2173 * src/frontends/gnome/dialogs/diainserturl.glade
2174 * src/frontends/gnome/FormUrl.C
2175 * src/frontends/gnome/FormUrl.h
2176 * src/frontends/gnome/diainserturl_callbacks.c
2177 * src/frontends/gnome/diainserturl_callbacks.h
2178 * src/frontends/gnome/diainserturl_interface.c
2179 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2180 Gnome implementation
2182 * src/frontends/gnome/Dialogs.C
2183 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2184 all other dialogs. Copy all unimplemented dialogs from Xforms
2187 * src/frontends/gnome/support.c
2188 * src/frontends/gnome/support.h: support files generated by Glade
2192 * config/gnome.m4: Gnome configuration scripts
2194 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2195 configure --help message
2197 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2198 only if there are no events pendling in Gnome/Gtk. This enhances
2199 the performance of menus.
2202 2000-08-14 Allan Rae <rae@lyx.org>
2204 * lib/Makefile.am: listerrors cleaning
2206 * lib/listerrors: removed -- generated file
2207 * acinclude.m4: ditto
2208 * sigc++/acinclude.m4: ditto
2210 * src/frontends/xforms/forms/form_citation.fd:
2211 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2214 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2215 `updatesrc` and now we have a `test` target that does what `updatesrc`
2216 used to do. I didn't like having an install target that wasn't related
2219 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2220 on all except FormGraphics. This may yet happen. Followed by a major
2221 cleanup including using FL_TRANSIENT for most of the dialogs. More
2222 changes to come when the ButtonController below is introduced.
2224 * src/frontends/xforms/ButtonController.h: New file for managing up to
2225 four buttons on a dialog according to an externally defined policy.
2226 * src/frontends/xforms/Makefile.am: added above
2228 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2229 Apply and Cancel/Close buttons and everything in between and beyond.
2230 * src/frontends/Makefile.am: added above.
2232 * src/frontends/xforms/forms/form_preferences.fd:
2233 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2234 and removed variable 'status' as a result. Fixed the set_minsize thing.
2235 Use the new screen-font-update after checking screen fonts were changed
2236 Added a "Restore" button to restore the original lyxrc values while
2237 editing. This restores everything not just the last input changed.
2238 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2240 * src/LyXAction.C: screen-font-update added for updating buffers after
2241 screen font settings have been changed.
2242 * src/commandtags.h: ditto
2243 * src/lyxfunc.C: ditto
2245 * forms/lyx.fd: removed screen fonts dialog.
2246 * src/lyx_gui.C: ditto
2247 * src/menus.[Ch]: ditto
2248 * src/lyx.[Ch]: ditto
2249 * src/lyx_cb.C: ditto + code from here moved to make
2250 screen-font-update. And people wonder why progress on GUII is
2251 slow. Look at how scattered this stuff was! It takes forever
2254 * forms/fdfix.sh: Fixup the spacing after commas.
2255 * forms/makefile: Remove date from generated files. Fewer clashes now.
2256 * forms/bullet_forms.C.patch: included someones handwritten changes
2258 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2259 once I've discovered why LyXRC was made noncopyable.
2260 * src/lyx_main.C: ditto
2262 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2264 * src/frontends/xforms/forms/fdfix.sh:
2265 * src/frontends/xforms/forms/fdfixh.sed:
2266 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2267 * src/frontends/xforms/Form*.[hC]:
2268 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2269 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2270 provide a destructor for the struct FD_form_xxxx. Another version of
2271 the set_[max|min]size workaround and a few other cleanups. Actually,
2272 Angus' patch from 20000809.
2274 2000-08-13 Baruch Even <baruch.even@writeme.com>
2276 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2279 2000-08-11 Juergen Vigna <jug@sad.it>
2281 * src/insets/insetgraphics.C (InsetGraphics): changing init
2282 order because of warnings.
2284 * src/frontends/xforms/forms/makefile: adding patching .C with
2287 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2288 from .C.patch to .c.patch
2290 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2291 order because of warning.
2293 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2295 * src/frontends/Liason.C (setMinibuffer): new helper function
2297 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2299 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2301 * lib/ui/default.ui: commented out PaperLayout entry
2303 * src/frontends/xforms/form_document.[Ch]: new added files
2305 * src/frontends/xforms/FormDocument.[Ch]: ditto
2307 * src/frontends/xforms/forms/form_document.fd: ditto
2309 * src/frontends/xforms/forms/form_document.C.patch: ditto
2311 2000-08-10 Juergen Vigna <jug@sad.it>
2313 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2314 (InsetGraphics): initialized cacheHandle to 0.
2315 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2317 2000-08-10 Baruch Even <baruch.even@writeme.com>
2319 * src/graphics/GraphicsCache.h:
2320 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2321 correctly as a cache.
2323 * src/graphics/GraphicsCacheItem.h:
2324 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2327 * src/graphics/GraphicsCacheItem_pimpl.h:
2328 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2331 * src/insets/insetgraphics.h:
2332 * src/insets/insetgraphics.C: Changed from using a signal notification
2333 to polling when image is not loaded.
2335 2000-08-10 Allan Rae <rae@lyx.org>
2337 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2338 that there are two functions that have to been taken out of line by
2339 hand and aren't taken care of in the script. (Just a reminder note)
2341 * sigc++/macros/*.h.m4: Updated as above.
2343 2000-08-09 Juergen Vigna <jug@sad.it>
2345 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2347 * src/insets/insettabular.C: make drawing of single cell smarter.
2349 2000-08-09 Marko Vendelin <markov@ioc.ee>
2350 * src/frontends/gnome/Menubar_pimpl.C
2351 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2352 implementation: new files
2354 * src/frontends/gnome/mainapp.C
2355 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2358 * src/main.C: create Gnome main window
2360 * src/frontends/xforms/Menubar_pimpl.h
2361 * src/frontends/Menubar.C
2362 * src/frontends/Menubar.h: added method Menubar::update that calls
2363 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2365 * src/LyXView.C: calls Menubar::update to update the state
2368 * src/frontends/gnome/Makefile.am: added new files
2370 * src/frontends/Makefile.am: added frontend compiler options
2372 2000-08-08 Juergen Vigna <jug@sad.it>
2374 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2376 * src/bufferlist.C (close):
2377 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2378 documents if exiting without saving.
2380 * src/buffer.C (save): use removeAutosaveFile()
2382 * src/support/filetools.C (removeAutosaveFile): new function.
2384 * src/lyx_cb.C (MenuWrite): returns a bool now.
2385 (MenuWriteAs): check if file could really be saved and revert to the
2387 (MenuWriteAs): removing old autosavefile if existant.
2389 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2390 before Goto toggle declaration, because of compiler warning.
2392 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2394 * src/lyxfunc.C (MenuNew): small fix.
2396 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2398 * src/bufferlist.C (newFile):
2399 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2401 * src/lyxrc.C: added new_ask_filename tag
2403 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2405 * src/lyx.fd: removed code pertaining to form_ref
2406 * src/lyx.[Ch]: ditto
2407 * src/lyx_cb.C: ditto
2408 * src/lyx_gui.C: ditto
2409 * src/lyx_gui_misc.C: ditto
2411 * src/BufferView_pimpl.C (restorePosition): update buffer only
2414 * src/commandtags.h (LFUN_REFTOGGLE): removed
2415 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2416 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2417 (LFUN_REFBACK): renamed LFUN_REF_BACK
2419 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2420 * src/menus.C: ditto
2421 * src/lyxfunc.C (Dispatch): ditto.
2422 InsertRef dialog is now GUI-independent.
2424 * src/texrow.C: added using std::endl;
2426 * src/insets/insetref.[Ch]: strip out large amounts of code.
2427 The inset is now a container and this functionality is now
2428 managed by a new FormRef dialog
2430 * src/frontends/Dialogs.h (showRef, createRef): new signals
2432 * src/frontends/xforms/FormIndex.[Ch],
2433 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2434 when setting dialog's min/max size
2435 * src/frontends/xforms/FormIndex.[Ch]: ditto
2437 * src/frontends/xforms/FormRef.[Ch],
2438 src/frontends/xforms/forms/form_ref.fd: new xforms
2439 implementation of an InsetRef dialog
2441 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2444 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2445 ios::nocreate is not part of the standard. Removed.
2447 2000-08-07 Baruch Even <baruch.even@writeme.com>
2449 * src/graphics/Renderer.h:
2450 * src/graphics/Renderer.C: Added base class for rendering of different
2451 image formats into Pixmaps.
2453 * src/graphics/XPM_Renderer.h:
2454 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2455 in a different class.
2457 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2458 easily add support for other formats.
2460 * src/insets/figinset.C: plugged a leak of an X resource.
2462 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2464 * src/CutAndPaste.[Ch]: make all metods static.
2466 * development/Code_rules/Rules: more work, added section on
2467 Exceptions, and a References section.
2469 * a lot of header files: work to make doc++ able to generate the
2470 source documentation, some workarounds of doc++ problems. Doc++ is
2471 now able to generate the documentation.
2473 2000-08-07 Juergen Vigna <jug@sad.it>
2475 * src/insets/insettabular.C (recomputeTextInsets): removed function
2477 * src/tabular.C (SetWidthOfMulticolCell):
2479 (calculate_width_of_column_NMC): fixed return value so that it really
2480 only returns true if the column-width has changed (there where
2481 problems with muliticolumn-cells in this column).
2483 2000-08-04 Juergen Vigna <jug@sad.it>
2485 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2486 also on the scrollstatus of the inset.
2487 (workAreaMotionNotify): ditto.
2489 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2491 2000-08-01 Juergen Vigna <jug@sad.it>
2493 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2495 * src/commandtags.h:
2496 * src/LyXAction.C (init):
2497 * src/insets/inset.C (LocalDispatch): added support for
2500 * src/insets/inset.C (scroll): new functions.
2502 * src/insets/insettext.C (removeNewlines): new function.
2503 (SetAutoBreakRows): removes forced newlines in the text of the
2504 paragraph if autoBreakRows is set to false.
2506 * src/tabular.C (Latex): generates a parbox around the cell contents
2509 * src/frontends/xforms/FormTabular.C (local_update): removed
2510 the radio_useparbox button.
2512 * src/tabular.C (UseParbox): new function
2514 2000-08-06 Baruch Even <baruch.even@writeme.com>
2516 * src/graphics/GraphicsCache.h:
2517 * src/graphics/GraphicsCache.C:
2518 * src/graphics/GraphicsCacheItem.h:
2519 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
2522 * src/insets/insetgraphics.h:
2523 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
2524 drawing of the inline image.
2526 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
2527 into the wrong position.
2529 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
2532 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2534 * src/support/translator.h: move all typedefs to public section
2536 * src/support/filetools.C (MakeLatexName): return string const
2538 (TmpFileName): ditto
2539 (FileOpenSearch): ditto
2541 (LibFileSearch): ditto
2542 (i18nLibFileSearch): ditto
2545 (CreateTmpDir): ditto
2546 (CreateBufferTmpDir): ditto
2547 (CreateLyXTmpDir): ditto
2550 (MakeAbsPath): ditto
2552 (OnlyFilename): ditto
2554 (NormalizePath): ditto
2555 (CleanupPath): ditto
2556 (GetFileContents): ditto
2557 (ReplaceEnvironmentPath): ditto
2558 (MakeRelPath): ditto
2560 (ChangeExtension): ditto
2561 (MakeDisplayPath): ditto
2562 (do_popen): return cmdret const
2563 (findtexfile): return string const
2565 * src/support/DebugStream.h: add some /// to please doc++
2567 * src/frontends/DialogBase.h (endif): add some /// to please doc++
2569 * src/texrow.C (same_rownumber): functor to use with find_if
2570 (getIdFromRow): rewritten to use find_if and to not update the
2571 positions. return true if row is found
2572 (increasePos): new method, use to update positions
2574 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
2576 * src/lyxlex_pimpl.C (verifyTable): new method
2579 (GetString): return string const
2580 (pushTable): rewrite to use std::stack
2582 (setFile): better check
2585 * src/lyxlex.h: make LyXLex noncopyable
2587 * src/lyxlex.C (text): return char const * const
2588 (GetString): return string const
2589 (getLongString): return string const
2591 * src/lyx_gui_misc.C (askForText): return pair<...> const
2593 * src/lastfiles.[Ch] (operator): return string const
2595 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2596 istringstream not char const *.
2597 move token.end() out of loop.
2598 (readFile): move initializaton of token
2600 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2601 getIdFromRow is successful.
2603 * lib/bind/emacs.bind: don't include menus bind
2605 * development/Code_rules/Rules: the beginnings of making this
2606 better and covering more of the unwritten rules that we have.
2608 * development/Code_rules/Recommendations: a couple of wording
2611 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2613 * src/support/strerror.c: remove C++ comment.
2615 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2617 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2618 LFUN_INDEX_INSERT_LAST
2620 * src/texrow.C (getIdFromRow): changed from const_iterator to
2621 iterator, allowing code to compile with DEC cxx
2623 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2624 stores part of the class, as suggested by Allan. Will allow
2626 (apply): test to apply uses InsetCommandParams operator!=
2628 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2629 (apply): test to apply uses InsetCommandParams operator!=
2631 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2632 stores part of the class.
2633 (update): removed limits on min/max size.
2635 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2636 (apply): test to apply uses InsetCommandParams operator!=
2638 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
2639 (Read, Write, scanCommand, getCommand): moved functionality
2640 into InsetCommandParams.
2642 (getScreenLabel): made pure virtual
2643 new InsetCommandParams operators== and !=
2645 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
2646 c-tors based on InsetCommandParams. Removed others.
2647 * src/insets/insetinclude.[Ch]: ditto
2648 * src/insets/insetlabel.[Ch]: ditto
2649 * src/insets/insetparent.[Ch]: ditto
2650 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
2652 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
2653 insets derived from InsetCommand created using similar c-tors
2654 based on InsetCommandParams
2655 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
2656 * src/menus.C (ShowRefsMenu): ditto
2657 * src/paragraph.C (Clone): ditto
2658 * src/text2.C (SetCounter): ditto
2659 * src/lyxfunc.C (Dispatch) ditto
2660 Also recreated old InsetIndex behaviour exactly. Can now
2661 index-insert at the start of a paragraph and index-insert-last
2662 without launching the pop-up.
2664 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2666 * lib/lyxrc.example: mark te pdf options as non functional.
2668 * src/support/lstrings.C (strToInt): move initalization of tmpstr
2669 (isStrDbl): move tmpstr.end() out of loop.
2670 (strToDbl): move intialization of tmpstr
2671 (lowercase): return string const and move tmp.end() out of loop.
2672 (uppercase): return string const and move tmp.edn() out of loop.
2673 (prefixIs): add assertion
2678 (containsOnly): ditto
2679 (containsOnly): ditto
2680 (containsOnly): ditto
2681 (countChar): make last arg char not char const
2682 (token): return string const
2683 (subst): return string const, move tmp.end() out of loop.
2684 (subst): return string const, add assertion
2685 (strip): return string const
2686 (frontStrip): return string const, add assertion
2687 (frontStrip): return string const
2692 * src/support/lstrings.C: add inclde "LAssert.h"
2693 (isStrInt): move tmpstr.end() out of loop.
2695 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2696 toollist.end() out of loop.
2697 (deactivate): move toollist.end() out of loop.
2698 (update): move toollist.end() out of loop.
2699 (updateLayoutList): move tc.end() out of loop.
2700 (add): move toollist.end() out of loop.
2702 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2703 md.end() out of loop.
2705 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2707 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2710 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2711 (Erase): move insetlist.end() out of loop.
2713 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2714 ref to const string as first arg. Move initialization of some
2715 variables, whitespace changes.
2717 * src/kbmap.C (defkey): move table.end() out of loop.
2718 (kb_keymap): move table.end() out of loop.
2719 (findbinding): move table.end() out of loop.
2721 * src/MenuBackend.C (hasMenu): move end() out of loop.
2722 (getMenu): move end() out of loop.
2723 (getMenu): move menulist_.end() out of loop.
2725 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2727 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2730 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2731 (getFromLyXName): move infotab.end() out of loop.
2733 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2734 -fvtable-thunks -ffunction-sections -fdata-sections
2736 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2738 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2741 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2743 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2745 * src/frontends/xforms/FormCitation.[Ch],
2746 src/frontends/xforms/FormIndex.[Ch],
2747 src/frontends/xforms/FormToc.[Ch],
2748 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2750 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2752 * src/commandtags.h: renamed, created some flags for citation
2755 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2757 * src/lyxfunc.C (dispatch): use signals to insert index entry
2759 * src/frontends/Dialogs.h: new signal createIndex
2761 * src/frontends/xforms/FormCommand.[Ch],
2762 src/frontends/xforms/FormCitation.[Ch],
2763 src/frontends/xforms/FormToc.[Ch],
2764 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2766 * src/insets/insetindex.[Ch]: GUI-independent
2768 * src/frontends/xforms/FormIndex.[Ch],
2769 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2772 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2774 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2775 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2777 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2779 * src/insets/insetref.C (Latex): rewrite so that there is now
2780 question that a initialization is requested.
2782 * src/insets/insetcommand.h: reenable the hide signal
2784 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2786 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2787 fix handling of shortcuts (many bugs :)
2788 (add_lastfiles): ditto.
2790 * lib/ui/default.ui: fix a few shortcuts.
2792 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2794 * Makefile.am: Fix ``rpmdist'' target to return the exit
2795 status of the ``rpm'' command, instead of the last command in
2796 the chain (the ``rm lyx.xpm'' command, which always returns
2799 2000-08-02 Allan Rae <rae@lyx.org>
2801 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2802 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2803 * src/frontends/xforms/FormToc.C (FormToc): ditto
2805 * src/frontends/xforms/Makefile.am: A few forgotten files
2807 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2808 Signals-not-copyable-problem Lars' started commenting out.
2810 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2812 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2814 * src/insets/insetcommand.h: Signals is not copyable so anoter
2815 scheme for automatic hiding of forms must be used.
2817 * src/frontends/xforms/FormCitation.h: don't inerit from
2818 noncopyable, FormCommand already does that.
2819 * src/frontends/xforms/FormToc.h: ditto
2820 * src/frontends/xforms/FormUrl.h: ditto
2822 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2824 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2826 * src/insets/insetcommand.h (hide): new SigC::Signal0
2827 (d-tor) new virtual destructor emits hide signal
2829 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2830 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2832 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2833 LOF and LOT. Inset is now GUI-independent
2835 * src/insets/insetloa.[Ch]: redundant
2836 * src/insets/insetlof.[Ch]: ditto
2837 * src/insets/insetlot.[Ch]: ditto
2839 * src/frontends/xforms/forms/form_url.fd: tweaked!
2840 * src/frontends/xforms/forms/form_citation.fd: ditto
2842 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2843 dialogs dealing with InsetCommand insets
2845 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2846 FormCommand base class
2847 * src/frontends/xforms/FormUrl.[Ch]: ditto
2849 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2851 * src/frontends/xforms/FormToc.[Ch]: ditto
2853 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2854 passed a generic InsetCommand pointer
2855 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2857 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2858 and modified InsetTOC class
2859 * src/buffer.C: ditto
2861 * forms/lyx.fd: strip out old FD_form_toc code
2862 * src/lyx_gui_misc.C: ditto
2863 * src/lyx_gui.C: ditto
2864 * src/lyx_cb.C: ditto
2865 * src/lyx.[Ch]: ditto
2867 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2869 * src/support/utility.hpp: tr -d '\r'
2871 2000-08-01 Juergen Vigna <jug@sad.it>
2873 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
2875 * src/commandtags.h:
2876 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
2877 LFUN_TABULAR_FEATURES.
2879 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
2880 LFUN_LAYOUT_TABULAR.
2882 * src/insets/insettabular.C (getStatus): implemented helper function.
2884 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
2886 2000-07-31 Juergen Vigna <jug@sad.it>
2888 * src/text.C (draw): fixed screen update problem for text-insets.
2890 * src/text2.C (SetParagrpah): call an update of the inset-owner when
2891 something changed probably this has to be added in various other
2894 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
2896 2000-07-31 Baruch Even <baruch.even@writeme.com>
2898 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
2899 templates to satisfy compaq cxx.
2902 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2904 * src/support/translator.h (equal_1st_in_pair::operator()): take
2905 const ref pair_type as arg.
2906 (equal_2nd_in_pair::operator()): ditto
2907 (Translator::~Translator): remove empty d-tor.
2909 * src/graphics/GraphicsCache.C: move include config.h to top, also
2910 put initialization of GraphicsCache::singleton here.
2911 (~GraphicsCache): move here
2912 (addFile): take const ref as arg
2915 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
2917 * src/BufferView2.C (insertLyXFile): change te with/without header
2920 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2922 * src/frontends/xforms/FormGraphics.C (apply): add some
2923 static_cast. Not very nice, but required by compaq cxx.
2925 * src/frontends/xforms/RadioButtonGroup.h: include header
2926 <utility> instead of <pair.h>
2928 * src/insets/insetgraphicsParams.C: add using directive.
2929 (readResize): change return type to void.
2930 (readOrigin): ditto.
2932 * src/lyxfunc.C (getStatus): add missing break for build-program
2933 function; add test for Literate for export functions.
2935 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2936 entries in Options menu.
2938 2000-07-31 Baruch Even <baruch.even@writeme.com>
2940 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2941 protect against auto-allocation; release icon when needed.
2943 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2945 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2946 on usual typewriter.
2948 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2949 earlier czech.kmap), useful only for programming.
2951 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2953 * src/frontends/xforms/FormCitation.h: fix conditioning around
2956 2000-07-31 Juergen Vigna <jug@sad.it>
2958 * src/frontends/xforms/FormTabular.C (local_update): changed
2959 radio_linebreaks to radio_useparbox and added radio_useminipage.
2961 * src/tabular.C: made support for using minipages/parboxes.
2963 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2965 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2967 (descent): so the cursor is in the middle.
2968 (width): bit smaller box.
2970 * src/insets/insetgraphics.h: added display() function.
2972 2000-07-31 Baruch Even <baruch.even@writeme.com>
2974 * src/frontends/Dialogs.h: Added showGraphics signals.
2976 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2977 xforms form definition of the graphics dialog.
2979 * src/frontends/xforms/FormGraphics.h:
2980 * src/frontends/xforms/FormGraphics.C: Added files, the
2981 GUIndependent code of InsetGraphics
2983 * src/insets/insetgraphics.h:
2984 * src/insets/insetgraphics.C: Major writing to make it work.
2986 * src/insets/insetgraphicsParams.h:
2987 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2988 struct between InsetGraphics and GUI.
2990 * src/LaTeXFeatures.h:
2991 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2992 support for graphicx package.
2994 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2995 for the graphics inset.
2997 * src/support/translator.h: Added file, used in
2998 InsetGraphicsParams. this is a template to translate between two
3001 * src/frontends/xforms/RadioButtonGroup.h:
3002 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3003 way to easily control a radio button group.
3005 2000-07-28 Juergen Vigna <jug@sad.it>
3007 * src/insets/insettabular.C (LocalDispatch):
3008 (TabularFeatures): added support for lyx-functions of tabular features.
3009 (cellstart): refixed this function after someone wrongly changed it.
3011 * src/commandtags.h:
3012 * src/LyXAction.C (init): added support for tabular-features
3014 2000-07-28 Allan Rae <rae@lyx.org>
3016 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3017 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3018 triggers the callback for input checking. As a result we sometimes get
3019 "LyX: This shouldn't happen..." printed to cerr.
3020 (input): Started using status variable since I only free() on
3021 destruction. Some input checking for paths and font sizes.
3023 * src/frontends/xforms/FormPreferences.h: Use status to control
3024 activation of Ok and Apply
3026 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3027 callback. Also resized to stop segfaults with 0.88. The problem is
3028 that xforms-0.88 requires the folder to be wide enough to fit all the
3029 tabs. If it isn't it causes all sorts of problems.
3031 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3033 * src/frontends/xforms/forms/README: Reflect reality.
3035 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3036 * src/frontends/xforms/forms/makefile: ditto.
3038 * src/commandtags.h: Get access to new Preferences dialog
3039 * src/LyXAction.C: ditto
3040 * src/lyxfunc.C: ditto
3041 * lib/ui/default.ui: ditto
3043 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3045 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3047 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3050 * src/frontends/xforms/form_url.[Ch]: added.
3052 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3054 * src/insets/insetbib.h: fixed bug in previous commit
3056 * src/frontends/xforms/FormUrl.h: ditto
3058 * src/frontends/xforms/FormPrint.h: ditto
3060 * src/frontends/xforms/FormPreferences.h: ditto
3062 * src/frontends/xforms/FormCopyright.h: ditto
3064 * src/frontends/xforms/FormCitation.C: ditto
3066 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3067 private copyconstructor and private default contructor
3069 * src/support/Makefile.am: add utility.hpp
3071 * src/support/utility.hpp: new file from boost
3073 * src/insets/insetbib.h: set owner in clone
3075 * src/frontends/xforms/FormCitation.C: added missing include
3078 * src/insets/form_url.[Ch]: removed
3080 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3082 * development/lyx.spec.in
3083 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3084 file/directory re-organization.
3086 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3088 * src/insets/insetcommand.[Ch]: moved the string data and
3089 associated manipulation methods into a new stand-alone class
3090 InsetCommandParams. This class has two additional methods
3091 getAsString() and setFromString() allowing the contents to be
3092 moved around as a single string.
3093 (addContents) method removed.
3094 (setContents) method no longer virtual.
3096 * src/buffer.C (readInset): made use of new InsetCitation,
3097 InsetUrl constructors based on InsetCommandParams.
3099 * src/commandtags.h: add LFUN_INSERT_URL
3101 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3102 independent InsetUrl and use InsetCommandParams to extract
3103 string info and create new Insets.
3105 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3107 * src/frontends/xforms/FormCitation.C (apply): uses
3110 * src/frontends/xforms/form_url.C
3111 * src/frontends/xforms/form_url.h
3112 * src/frontends/xforms/FormUrl.h
3113 * src/frontends/xforms/FormUrl.C
3114 * src/frontends/xforms/forms/form_url.fd: new files
3116 * src/insets/insetcite.[Ch]: removed unused constructors.
3118 * src/insets/insetinclude.[Ch]: no longer store filename
3120 * src/insets/inseturl.[Ch]: GUI-independent.
3122 2000-07-26 Juergen Vigna <jug@sad.it>
3123 * renamed frontend from gtk to gnome as it is that what is realized
3124 and did the necessary changes in the files.
3126 2000-07-26 Marko Vendelin <markov@ioc.ee>
3128 * configure.in: cleaning up gnome configuration scripts
3130 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3132 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3133 shortcuts syndrom by redrawing them explicitely (a better solution
3134 would be appreciated).
3136 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3138 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3141 * src/lyx_cb.C (MenuExport): change html export to do the right
3142 thing depending of the document type (instead of having
3143 html-linuxdoc and html-docbook).
3144 * src/lyxfunc.C (getStatus): update for html
3145 * lib/ui/default.ui: simplify due to the above change.
3146 * src/menus.C (ShowFileMenu): update too (in case we need it).
3148 * src/MenuBackend.C (read): if a menu is defined twice, add the
3149 new entries to the exiting one.
3151 2000-07-26 Juergen Vigna <jug@sad.it>
3153 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3155 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3156 and return a bool if it did actual save the file.
3157 (AutoSave): don't autosave a unnamed doc.
3159 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3160 check if this is an UNNAMED new file and react to it.
3161 (newFile): set buffer to unnamed and change to not mark a new
3162 buffer dirty if I didn't do anything with it.
3164 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3166 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3168 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3169 friend as per Angus's patch posted to lyx-devel.
3171 * src/ext_l10n.h: updated
3173 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3174 gettext on the style string right before inserting them into the
3177 * autogen.sh: add code to extract style strings form layout files,
3178 not good enough yet.
3180 * src/frontends/gtk/.cvsignore: add MAKEFILE
3182 * src/MenuBackend.C (read): run the label strings through gettext
3183 before storing them in the containers.
3185 * src/ext_l10n.h: new file
3187 * autogen.sh : generate the ext_l10n.h file here
3189 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3191 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3194 * lib/ui/default.ui: fix a couple of typos.
3196 * config/gnome/gtk.m4: added (and added to the list of files in
3199 * src/insets/insetinclude.C (unique_id): fix when we are using
3200 lyxstring instead of basic_string<>.
3201 * src/insets/insettext.C (LocalDispatch): ditto.
3202 * src/support/filetools.C: ditto.
3204 * lib/configure.m4: create the ui/ directory if necessary.
3206 * src/LyXView.[Ch] (updateToolbar): new method.
3208 * src/BufferView_pimpl.C (buffer): update the toolbar when
3209 opening/closing buffer.
3211 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3213 * src/LyXAction.C (getActionName): enhance to return also the name
3214 and options of pseudo-actions.
3215 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3217 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3218 as an example of what is possible). Used in File->Build too (more
3219 useful) and in the import/export menus (to mimick the complicated
3220 handling of linuxdoc and friends). Try to update all the entries.
3222 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3225 * src/MenuBackend.C (read): Parse the new OptItem tag.
3227 * src/MenuBackend.h: Add a new optional_ data member (used if the
3228 entry should be omitted when the lyxfunc is disabled).
3230 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3231 function, used as a shortcut.
3232 (create_submenu): align correctly the shortcuts on the widest
3235 * src/MenuBackend.h: MenuItem.label() only returns the label of
3236 the menu without shortcut; new method shortcut().
3238 2000-07-14 Marko Vendelin <markov@ioc.ee>
3240 * src/frontends/gtk/Dialogs.C:
3241 * src/frontends/gtk/FormCopyright.C:
3242 * src/frontends/gtk/FormCopyright.h:
3243 * src/frontends/gtk/Makefile.am: added these source-files for the
3244 Gtk/Gnome support of the Copyright-Dialog.
3246 * src/main.C: added Gnome::Main initialization if using
3247 Gtk/Gnome frontend-GUI.
3249 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3251 * config/gnome/aclocal-include.m4
3252 * config/gnome/compiler-flags.m4
3253 * config/gnome/curses.m4
3254 * config/gnome/gnome--.m4
3255 * config/gnome/gnome-bonobo-check.m4
3256 * config/gnome/gnome-common.m4
3257 * config/gnome/gnome-fileutils.m4
3258 * config/gnome/gnome-ghttp-check.m4
3259 * config/gnome/gnome-gnorba-check.m4
3260 * config/gnome/gnome-guile-checks.m4
3261 * config/gnome/gnome-libgtop-check.m4
3262 * config/gnome/gnome-objc-checks.m4
3263 * config/gnome/gnome-orbit-check.m4
3264 * config/gnome/gnome-print-check.m4
3265 * config/gnome/gnome-pthread-check.m4
3266 * config/gnome/gnome-support.m4
3267 * config/gnome/gnome-undelfs.m4
3268 * config/gnome/gnome-vfs.m4
3269 * config/gnome/gnome-x-checks.m4
3270 * config/gnome/gnome-xml-check.m4
3271 * config/gnome/gnome.m4
3272 * config/gnome/gperf-check.m4
3273 * config/gnome/gtk--.m4
3274 * config/gnome/linger.m4
3275 * config/gnome/need-declaration.m4: added configuration scripts
3276 for Gtk/Gnome frontend-GUI
3278 * configure.in: added support for the --with-frontend=gtk option
3280 * autogen.sh: added config/gnome/* to list of config-files
3282 * acconfig.h: added define for GTKGUI-support
3284 * config/lyxinclude.m4: added --with-frontend[=value] option value
3285 for Gtk/Gnome frontend-GUI support.
3287 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3289 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3293 * src/paragraph.C (GetChar): remove non-const version
3295 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3296 (search_kw): use it.
3298 * src/lyx_main.C (init): if "preferences" exist, read that instead
3300 (ReadRcFile): return bool if the file could be read ok.
3301 (ReadUIFile): add a check to see if lex file is set ok.
3303 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3304 bastring can be used instead of lyxstring (still uses the old code
3305 if std::string is good enough or if lyxstring is used.)
3307 * src/encoding.C: make the arrays static, move ininle functions
3309 * src/encoding.h: from here.
3311 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3312 (parseSingleLyXformat2Token): move inset parsing to separate method
3313 (readInset): new private method
3315 * src/Variables.h: remove virtual from get().
3317 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
3318 access to NEW_INSETS and NEW_TABULAR
3320 * src/MenuBackend.h: remove superfluous forward declaration of
3321 MenuItem. Add documentations tags "///", remove empty MenuItem
3322 destructor, remove private default contructor.
3324 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3326 (read): more string mlabel and mname to where they are used
3327 (read): remove unused variables mlabel and mname
3328 (defaults): unconditional clear, make menusetup take advantage of
3329 add returning Menu &.
3331 * src/LyXView.h: define NEW_MENUBAR as default
3333 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3334 to NEW_INSETS and NEW_TABULAR.
3335 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3336 defined. Change some of the "xxxx-inset-insert" functions names to
3339 * several files: more enahncements to NEW_INSETS and the resulting
3342 * lib/lyxrc.example (\date_insert_format): move to misc section
3344 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3345 bastring and use AC_CACHE_CHECK.
3346 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3347 the system have the newest methods. uses AC_CACHE_CHECK
3348 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3349 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3350 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3352 * configure.in: add LYX_CXX_GOOD_STD_STRING
3354 * acinclude.m4: recreated
3356 2000-07-24 Amir Karger
3358 * README: add Hebrew, Arabic kmaps
3361 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3363 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3366 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3368 * Lot of files: add pragma interface/implementation.
3370 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3372 * lib/ui/default.ui: new file (ans new directory). Contains the
3373 default menu and toolbar.
3375 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3376 global space. Toolbars are now read (as menus) in ui files.
3378 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3380 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3381 is disabled because the document is read-only. We want to have the
3382 toggle state of the function anyway.
3383 (getStatus): add code for LFUN_VC* functions (mimicking what is
3384 done in old-style menus)
3386 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3387 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3389 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3390 * src/BufferView_pimpl.C: ditto.
3391 * src/lyxfunc.C: ditto.
3393 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3394 default). This replaces old-style menus by new ones.
3396 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3397 MenuItem. Contain the data structure of a menu.
3399 * src/insets/insettext.C: use LyXView::setLayout instead of
3400 accessing directly the toolbar combox.
3401 * src/lyxfunc.C (Dispatch): ditto.
3403 * src/LyXView.C (setLayout): new method, which just calls
3404 Toolbar::setLayout().
3405 (updateLayoutChoice): move part of this method in Toolbar.
3407 * src/toolbar.[Ch]: removed.
3409 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3410 implementation the toolbar.
3412 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3413 the toolbar. It might make sense to merge it with ToolbarDefaults
3415 (setLayout): new function.
3416 (updateLayoutList): ditto.
3417 (openLayoutList): ditto.
3419 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3420 xforms implementation of the toolbar.
3421 (get_toolbar_func): comment out, since I do not
3422 know what it is good for.
3424 * src/ToolbarDefaults.h: Add the ItemType enum.
3426 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3427 for a list of allocated C strings. Used in Menubar xforms
3428 implementation to avoid memory leaks.
3430 * src/support/lstrings.[Ch] (uppercase): new version taking and
3434 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3435 * lib/bind/emacs.bind: ditto.
3437 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3439 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3440 forward decl of LyXView.
3442 * src/toolbar.C (toolbarItem): moved from toolbar.h
3443 (toolbarItem::clean): ditto
3444 (toolbarItem::~toolbarItem): ditto
3445 (toolbarItem::operator): ditto
3447 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3449 * src/paragraph.h: control the NEW_TABULAR define from here
3451 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3452 USE_TABULAR_INSETS to NEW_TABULAR
3454 * src/ToolbarDefaults.C: add include "lyxlex.h"
3456 * files using the old table/tabular: use NEW_TABULAR to control
3457 compilation of old tabular stuff.
3459 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3462 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3463 planemet in reading of old style floats, fix the \end_deeper
3464 problem when reading old style floats.
3466 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3468 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3470 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3472 * lib/bind/sciword.bind: updated.
3474 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3476 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3477 layout write problem
3479 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3481 * src/Makefile.am (INCLUDES): remove image directory from include
3484 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3485 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3487 * src/LyXView.C (create_form_form_main): read the application icon
3490 * lib/images/*.xpm: change the icons to use transparent color for
3493 * src/toolbar.C (update): change the color of the button when it
3496 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3498 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3499 setting explicitely the minibuffer.
3500 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3502 * src/LyXView.C (showState): new function. Shows font information
3503 in minibuffer and update toolbar state.
3504 (LyXView): call Toolbar::update after creating the
3507 * src/toolbar.C: change toollist to be a vector instead of a
3509 (BubbleTimerCB): get help string directly from the callback
3510 argument of the corresponding icon (which is the action)
3511 (set): remove unnecessary ugliness.
3512 (update): new function. update the icons (depressed, disabled)
3513 depending of the status of the corresponding action.
3515 * src/toolbar.h: remove help in toolbarItem
3517 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
3519 * src/Painter.C (text): Added code for using symbol glyphs from
3520 iso10646 fonts. Currently diabled.
3522 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
3525 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
3526 magyar,turkish and usorbian.
3528 * src/paragraph.C (isMultiLingual): Made more efficient.
3530 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
3533 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
3534 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3535 Also changed the prototype to "bool math_insert_greek(char)".
3537 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3539 * lots of files: apply the NEW_INSETS on all code that will not be
3540 needed when we move to use the new insets. Enable the define in
3541 lyxparagrah.h to try it.
3543 * src/insets/insettabular.C (cellstart): change to be a static
3545 (InsetTabular): initialize buffer in the initializer list.
3547 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3549 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3550 form_print.h out of the header file. Replaced with forward
3551 declarations of the relevant struct.
3553 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3556 * src/commandtags.h: do not include "debug.h" which does not
3557 belong there. #include it in some other places because of this
3560 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3562 * src/insets/insetcaption.C: add a couple "using" directives.
3564 * src/toolbar.C (add): get the help text directly from lyxaction.
3566 (setPixmap): new function. Loads from disk and sets a pixmap on a
3567 botton; the name of the pixmap file is derived from the command
3570 * src/toolbar.h: remove members isBitmap and pixmap from
3573 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
3574 * lib/images/: move many files from images/banner.xpm.
3576 * src/lyx_gui.C (create_forms): read banner pixmap from file.
3578 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
3579 * src/toolbar.C: ditto.
3580 * configure.in: ditto.
3581 * INSTALL: document.
3583 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
3584 the spellchecker popup is closed from the WM.
3586 2000-07-19 Juergen Vigna <jug@sad.it>
3588 * src/insets/insetfloat.C (Write): small fix because we use the
3589 insetname for the type now!
3591 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3593 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3596 * src/frontends/Dialogs.h: removed hideCitation signal
3598 * src/insets/insetcite.h: added hide signal
3600 * src/insets/insetcite.C (~InsetCitation): emits new signal
3601 (getScreenLabel): "intelligent" label should now fit on the screen!
3603 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3605 * src/frontends/xforms/FormCitation.C (showInset): connects
3606 hide() to the inset's hide signal
3607 (show): modified to use fl_set_object_position rather than
3608 fl_set_object_geometry wherever possible
3610 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3612 * src/insets/lyxinset.h: add caption code
3614 * src/insets/insetfloat.C (type): new method
3616 * src/insets/insetcaption.C (Write): new method
3618 (LyxCode): new method
3620 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3621 to get it right together with using the FloatList.
3623 * src/commandtags.h: add LFUN_INSET_CAPTION
3624 * src/lyxfunc.C (Dispatch): handle it
3626 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3629 * src/Variables.[Ch]: make expand take a const reference, remove
3630 the destructor, some whitespace changes.
3632 * src/LyXAction.C (init): add caption-inset-insert
3634 * src/FloatList.C (FloatList): update the default floats a bit.
3636 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3638 * src/Variables.[Ch]: new files. Intended to be used for language
3639 specific strings (like \chaptername) and filename substitution in
3642 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
3644 * lib/kbd/american.kmap: update
3646 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
3648 * src/bufferparams.[Ch]: remove member allowAccents.
3650 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
3652 * src/LaTeXLog.C: use the log_form.h header.
3653 * src/lyx_gui.C: ditto.
3654 * src/lyx_gui_misc.C: ditto.
3655 * src/lyxvc.h: ditto.
3657 * forms/log_form.fd: new file, created from latexoptions.fd. I
3658 kept the log popup and nuked the options form.
3660 * src/{la,}texoptions.[Ch]: removed.
3661 * src/lyx_cb.C (LaTeXOptions): ditto
3663 * src/lyx_gui.C (create_forms): do not handle the
3664 fd_latex_options form.
3666 2000-07-18 Juergen Vigna <jug@sad.it>
3668 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
3669 name of the inset so that it can be requested outside (text2.C).
3671 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
3674 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3676 * src/mathed/formula.h (ConvertFont): constify
3678 * src/mathed/formula.C (Read): add warning if \end_inset is not
3679 found on expected place.
3681 * src/insets/lyxinset.h (ConvertFont): consify
3683 * src/insets/insetquotes.C (ConvertFont): constify
3684 * src/insets/insetquotes.h: ditto
3686 * src/insets/insetinfo.h: add labelfont
3688 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3689 (ascent): use labelfont
3693 (Write): make .lyx file a bit nicer
3695 * src/insets/insetfloat.C (Write): simplify somewhat...
3696 (Read): add warning if arg is not found
3698 * src/insets/insetcollapsable.C: add using std::max
3699 (Read): move string token and add warning in arg is not found
3700 (draw): use std::max to get the right ty
3701 (getMaxWidth): simplify by using std::max
3703 * src/insets/insetsection.h: new file
3704 * src/insets/insetsection.C: new file
3705 * src/insets/insetcaption.h: new file
3706 * src/insets/insetcaption.C: new file
3708 * src/insets/inset.C (ConvertFont): constify signature
3710 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3711 insetcaption.[Ch] and insetsection.[Ch]
3713 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3714 uses to use LABEL_COUNTER_CHAPTER instead.
3715 * src/text2.C (SetCounter): here
3717 * src/counters.h: new file
3718 * src/counters.C: new file
3719 * src/Sectioning.h: new file
3720 * src/Sectioning.C: new file
3722 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3724 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3726 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3729 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3732 2000-07-17 Juergen Vigna <jug@sad.it>
3734 * src/tabular.C (Validate): check if array-package is needed.
3735 (SetVAlignment): added support for vertical alignment.
3736 (SetLTFoot): better support for longtable header/footers
3737 (Latex): modified to support added features.
3739 * src/LaTeXFeatures.[Ch]: added array-package.
3741 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3743 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3746 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3748 * configure.in: do not forget to put a space after -isystem.
3750 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3752 * lib/kbd/arabic.kmap: a few fixes.
3754 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3756 * some whitespace chagnes to a number of files.
3758 * src/support/DebugStream.h: change to make it easier for
3759 doc++ to parse correctly.
3760 * src/support/lyxstring.h: ditto
3762 * src/mathed/math_utils.C (compara): change to have only one
3764 (MathedLookupBOP): change because of the above.
3766 * src/mathed/math_delim.C (math_deco_compare): change to have only
3768 (search_deco): change becasue of the above.
3770 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3771 instead of manually coded one.
3773 * src/insets/insetquotes.C (Read): read the \end_inset too
3775 * src/insets/insetlatex.h: remove file
3776 * src/insets/insetlatex.C: remove file
3778 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3780 (InsetPrintIndex): remove destructor
3782 * src/insets/insetinclude.h: remove default constructor
3784 * src/insets/insetfloat.C: work to make it work better
3786 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3788 * src/insets/insetcite.h (InsetCitation): remove default constructor
3790 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3792 * src/text.C (GetColumnNearX): comment out some currently unused code.
3794 * src/paragraph.C (writeFile): move some initializations closer to
3796 (CutIntoMinibuffer): small change to use new matchIT operator
3800 (InsertInset): ditto
3803 (InsetIterator): ditto
3804 (Erase): small change to use new matchFT operator
3806 (GetFontSettings): ditto
3807 (HighestFontInRange): ditto
3810 * src/lyxparagraph.h: some chars changed to value_type
3811 (matchIT): because of some stronger checking (perhaps too strong)
3812 in SGI STL, the two operator() unified to one.
3815 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3817 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3818 the last inset read added
3819 (parseSingleLyXformat2Token): some more (future) compability code added
3820 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3821 (parseSingleLyXformat2Token): set last_inset_read
3822 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3823 (parseSingleLyXformat2Token): don't double intializw string next_token
3825 * src/TextCache.C (text_fits::operator()): add const's to the signature
3826 (has_buffer::operator()): ditto
3828 * src/Floating.h: add some comments on the class
3830 * src/FloatList.[Ch] (typeExist): new method
3833 * src/BackStack.h: added default constructor, wanted by Gcc.
3835 2000-07-14 Juergen Vigna <jug@sad.it>
3837 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3839 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3841 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3842 do a redraw when the window is resized!
3843 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3845 * src/insets/insettext.C (resizeLyXText): added function to correctly
3846 being able to resize the LyXWindow.
3848 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3850 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3852 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3853 crashes when closing dialog to a deleted inset.
3855 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3856 method! Now similar to other insets.
3858 2000-07-13 Juergen Vigna <jug@sad.it>
3860 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3862 * lib/examples/Literate.lyx: small patch!
3864 * src/insets/insetbib.C (Read): added this function because of wrong
3865 Write (without [begin|end]_inset).
3867 2000-07-11 Juergen Vigna <jug@sad.it>
3869 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
3870 as the insertInset could not be good!
3872 * src/screen.C (ToggleSelection): fixed toggle selection bug as
3873 the bool param should not be last.
3875 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3877 * sigc++/configure.in: fix bug in threading-related code (Yes, I
3878 did submit that to Karl).
3880 * configure.in: use -isystem instead of -I for X headers. This
3881 fixes a problem on solaris with a recent gcc;
3882 put the front-end code after the X detection code;
3883 configure in sigc++ before lib/
3885 * src/lyx_main.C (commandLineHelp): remove -display from command
3888 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
3890 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
3891 Also put in Makefile rules for building the ``listerrors''
3892 program for parsing errors from literate programs written in LyX.
3894 * lib/build-listerrors: Added small shell script as part of compile
3895 process. This builds a working ``listerrors'' binary if noweb is
3896 installed and either 1) the VNC X server is installed on the machine,
3897 or 2) the user is compiling from within a GUI. The existence of a GUI
3898 is necessary to use the ``lyx --export'' feature for now. This
3899 hack can be removed once ``lyx --export'' no longer requires a GUI to
3902 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
3904 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
3905 now passed back correctly from gcc and placed "under" error
3906 buttons in a Literate LyX source.
3908 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3910 * src/text.C (GetColumnNearX): Better behavior when a RTL
3911 paragraph is ended by LTR text.
3913 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
3916 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3918 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3919 true when clipboard is empty.
3921 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3923 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3924 row of the paragraph.
3925 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3926 to prevent calculation of bidi tables
3928 2000-07-07 Juergen Vigna <jug@sad.it>
3930 * src/screen.C (ToggleSelection): added y_offset and x_offset
3933 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3936 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3938 * src/insets/insettext.C: fixed Layout-Display!
3940 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3942 * configure.in: add check for strings.h header.
3944 * src/spellchecker.C: include <strings.h> in order to have a
3945 definition for bzero().
3947 2000-07-07 Juergen Vigna <jug@sad.it>
3949 * src/insets/insettext.C (draw): set the status of the bv->text to
3950 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3952 * src/screen.C (DrawOneRow):
3953 (DrawFromTo): redraw the actual row if something has changed in it
3956 * src/text.C (draw): call an update of the toplevel-inset if something
3957 has changed inside while drawing.
3959 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3961 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3963 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3964 processing inside class.
3966 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3967 processing inside class.
3969 * src/insets/insetindex.h new struct Holder, consistent with other
3972 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3973 citation dialog from main code and placed it in src/frontends/xforms.
3974 Dialog launched through signals instead of callbacks
3976 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3978 * lyx.man: update the options description.
3980 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3982 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3983 handle neg values, set min width to 590, add doc about -display
3985 2000-07-05 Juergen Vigna <jug@sad.it>
3987 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3988 calls to BufferView *.
3990 * src/insets/insettext.C (checkAndActivateInset): small fix non
3991 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3993 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3994 their \end_inset token!
3996 2000-07-04 edscott <edscott@imp.mx>
3998 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3999 lib/lyxrc.example: added option \wheel_jump
4001 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4003 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4004 remove support for -width,-height,-xpos and -ypos.
4006 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4008 * src/encoding.[Ch]: New files.
4010 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4011 (text): Call to the underline() method only when needed.
4013 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4015 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4016 encoding(s) for the document.
4018 * src/bufferparams.C (BufferParams): Changed default value of
4021 * src/language.C (newLang): Removed.
4022 (items[]): Added encoding information for all defined languages.
4024 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4025 encoding choice button.
4027 * src/lyxrc.h (font_norm_type): New member variable.
4028 (set_font_norm_type): New method.
4030 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4031 paragraphs with different encodings.
4033 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4034 (TransformChar): Changed to work correctly with Arabic points.
4035 (draw): Added support for drawing Arabic points.
4036 (draw): Removed code for drawing underbars (this is done by
4039 * src/support/textutils.h (IsPrintableNonspace): New function.
4041 * src/BufferView_pimpl.h: Added "using SigC::Object".
4042 * src/LyXView.h: ditto.
4044 * src/insets/insetinclude.h (include_label): Changed to mutable.
4046 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4048 * src/mathed/math_iter.h: remove empty destructor
4050 * src/mathed/math_cursor.h: remove empty destructor
4052 * src/insets/lyxinset.h: add THEOREM_CODE
4054 * src/insets/insettheorem.[Ch]: new files
4056 * src/insets/insetminipage.C: (InsertInset): remove
4058 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4060 (InsertInset): remove
4062 * src/insets/insetlist.C: (InsertList): remove
4064 * src/insets/insetfootlike.[Ch]: new files
4066 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4069 (InsertInset): ditto
4071 * src/insets/insetert.C: remove include Painter.h, reindent
4072 (InsertInset): move to header
4074 * src/insets/insetcollapsable.h: remove explicit from default
4075 contructor, remove empty destructor, add InsertInset
4077 * src/insets/insetcollapsable.C (InsertInset): new func
4079 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4081 * src/vspace.h: add explicit to constructor
4083 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4084 \textcompwordmark, please test this.
4086 * src/lyxrc.C: set ascii_linelen to 65 by default
4088 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4090 * src/commandtags.h: add LFUN_INSET_THEOREM
4092 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4093 (makeLinuxDocFile): remove _some_ of the nice logic
4094 (makeDocBookFile): ditto
4096 * src/Painter.[Ch]: (~Painter): removed
4098 * src/LyXAction.C (init): entry for insettheorem added
4100 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4102 (deplog): code to detect files generated by LaTeX, needs testing
4105 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4107 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4109 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4111 * src/LaTeX.C (deplog): Add a check for files that are going to be
4112 created by the first latex run, part of the project to remove the
4115 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4116 contents to the extension list.
4118 2000-07-04 Juergen Vigna <jug@sad.it>
4120 * src/text.C (NextBreakPoint): added support for needFullRow()
4122 * src/insets/lyxinset.h: added needFullRow()
4124 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4127 * src/insets/insettext.C: lots of changes for update!
4129 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4131 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4133 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4135 * src/insets/insetinclude.C (InsetInclude): fixed
4136 initialization of include_label.
4137 (unique_id): now returns a string.
4139 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4141 * src/LaTeXFeatures.h: new member IncludedFiles, for
4142 a map of key, included file name.
4144 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4145 with the included files for inclusion in SGML preamble,
4146 i. e., linuxdoc and docbook.
4149 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4150 nice (is the generated linuxdoc code to be exported?), that
4151 allows to remove column, and only_body that will be true for
4152 slave documents. Insets are allowed inside SGML font type.
4153 New handling of the SGML preamble for included files.
4154 (makeDocBookFile): the same for docbook.
4156 * src/insets/insetinclude.h:
4157 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4159 (DocBook): new export methods.
4161 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4162 and makeDocBookFile.
4164 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4165 formats to export with command line argument -x.
4167 2000-06-29 Juergen Vigna <jug@sad.it>
4169 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4170 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4172 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4173 region could already been cleared by an inset!
4175 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4177 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4180 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4182 (cursorToggle): remove special handling of lyx focus.
4184 2000-06-28 Juergen Vigna <jug@sad.it>
4186 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4189 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4191 * src/insets/insetindex.C (Edit): add a callback when popup is
4194 * src/insets/insettext.C (LocalDispatch):
4195 * src/insets/insetmarginal.h:
4196 * src/insets/insetlist.h:
4197 * src/insets/insetfoot.h:
4198 * src/insets/insetfloat.h:
4199 * src/insets/insetert.h: add a missing std:: qualifier.
4201 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4203 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4206 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4208 * src/insets/insettext.C (Read): remove tmptok unused variable
4209 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4210 (InsertInset): change for new InsetInset code
4212 * src/insets/insettext.h: add TEXT inline method
4214 * src/insets/insettext.C: remove TEXT macro
4216 * src/insets/insetmarginal.C (Write): new method
4217 (Latex): change output slightly
4219 * src/insets/insetfoot.C (Write): new method
4220 (Latex): change output slightly (don't use endl when no need)
4222 * src/insets/insetert.C (Write): new method
4224 * src/insets/insetcollapsable.h: make button_length, button_top_y
4225 and button_bottm_y protected.
4227 * src/insets/insetcollapsable.C (Write): simplify code by using
4228 tostr. Also do not output the float name, the children class
4229 should to that to get control over own arguments
4231 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4232 src/insets/insetminipage.[Ch]:
4235 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4237 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4239 * src/Makefile.am (lyx_SOURCES): add the new files
4241 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4242 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4243 * src/commandtags.h: ditto
4245 * src/LaTeXFeatures.h: add a std::set of used floattypes
4247 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4249 * src/FloatList.[Ch] src/Floating.h: new files
4251 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4253 * src/lyx_cb.C (TableApplyCB): ditto
4255 * src/text2.C: ditto
4256 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4257 (parseSingleLyXformat2Token): ditto + add code for
4258 backwards compability for old float styles + add code for new insets
4260 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4262 (InsertInset(size_type, Inset *, LyXFont)): new method
4263 (InsetChar(size_type, char)): changed to use the other InsetChar
4264 with a LyXFont(ALL_INHERIT).
4265 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4266 insert the META_INSET.
4268 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4270 * sigc++/thread.h (Threads): from here
4272 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4273 definition out of line
4274 * sigc++/scope.h: from here
4276 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4278 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4279 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4281 * Makefile.am (bindist): new target.
4283 * INSTALL: add instructions for doing a binary distribution.
4285 * development/tools/README.bin.example: update a bit.
4287 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4290 * lib/lyxrc.example: new lyxrc tag \set_color.
4292 * src/lyxfunc.C (Dispatch):
4293 * src/commandtags.h:
4294 * src/LyXAction.C: new lyxfunc "set-color".
4296 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4297 and an x11name given as strings.
4299 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4300 cache when a color is changed.
4302 2000-06-26 Juergen Vigna <jug@sad.it>
4304 * src/lyxrow.C (width): added this functions and variable.
4306 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4309 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4311 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4313 * images/undo_bw.xpm: new icon.
4314 * images/redo_bw.xpm: ditto.
4316 * configure.in (INSTALL_SCRIPT): change value to
4317 ${INSTALL} to avoid failures of install-script target.
4318 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
4320 * src/BufferView.h: add a magic "friend" declaration to please
4323 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4325 * forms/cite.fd: modified to allow resizing without messing
4328 * src/insetcite.C: Uses code from cite.fd almost without
4330 User can now resize dialog in the x-direction.
4331 Resizing the dialog in the y-direction is prevented, as the
4332 code does this intelligently already.
4334 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4336 * INSTALL: remove obsolete entry in "problems" section.
4338 * lib/examples/sl_*.lyx: update of the slovenian examples.
4340 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4342 2000-06-23 Juergen Vigna <jug@sad.it>
4344 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4346 * src/buffer.C (resize): delete the LyXText of textinsets.
4348 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4350 * src/insets/lyxinset.h: added another parameter 'cleared' to
4351 the draw() function.
4353 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4354 unlocking inset in inset.
4356 2000-06-22 Juergen Vigna <jug@sad.it>
4358 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4359 of insets and moved first to LyXText.
4361 * src/mathed/formulamacro.[Ch]:
4362 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4364 2000-06-21 Juergen Vigna <jug@sad.it>
4366 * src/text.C (GetVisibleRow): look if I should clear the area or not
4367 using Inset::doClearArea() function.
4369 * src/insets/lyxinset.h: added doClearArea() function and
4370 modified draw(Painter &, ...) to draw(BufferView *, ...)
4372 * src/text2.C (UpdateInset): return bool insted of int
4374 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4376 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4377 combox in the character popup
4379 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4380 BufferParams const & params
4382 2000-06-20 Juergen Vigna <jug@sad.it>
4384 * src/insets/insettext.C (SetParagraphData): set insetowner on
4387 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4389 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4390 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4392 (form_main_): remove
4394 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4395 (create_form_form_main): remove FD_form_main stuff, connect to
4396 autosave_timeout signal
4398 * src/LyXView.[Ch] (getMainForm): remove
4399 (UpdateTimerCB): remove
4400 * src/BufferView_pimpl.h: inherit from SigC::Object
4402 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4403 signal instead of callback
4405 * src/BufferView.[Ch] (cursorToggleCB): remove
4407 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4409 * src/BufferView_pimpl.C: changes because of the one below
4411 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4412 instead of storing a pointer to a LyXText.
4414 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4416 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4418 * src/lyxparagraph.h
4420 * src/paragraph.C: Changed fontlist to a sorted vector.
4422 2000-06-19 Juergen Vigna <jug@sad.it>
4424 * src/BufferView.h: added screen() function.
4426 * src/insets/insettext.C (LocalDispatch): some selection code
4429 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4431 * src/insets/insettext.C (SetParagraphData):
4433 (InsetText): fixes for multiple paragraphs.
4435 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4437 * development/lyx.spec.in: Call configure with ``--without-warnings''
4438 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4439 This should be fine, however, since we generally don't want to be
4440 verbose when making an RPM.
4442 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4444 * lib/scripts/fig2pstex.py: New file
4446 2000-06-16 Juergen Vigna <jug@sad.it>
4448 * src/insets/insettabular.C (UpdateLocal):
4449 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4450 (LocalDispatch): Changed all functions to use LyXText.
4452 2000-06-15 Juergen Vigna <jug@sad.it>
4454 * src/text.C (SetHeightOfRow): call inset::update before requesting
4457 * src/insets/insettext.C (update):
4458 * src/insets/insettabular.C (update): added implementation
4460 * src/insets/lyxinset.h: added update function
4462 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4464 * src/text.C (SelectNextWord): protect against null pointers with
4465 old-style string streams. (fix from Paul Theo Gonciari
4468 * src/cite.[Ch]: remove erroneous files.
4470 * lib/configure.m4: update the list of created directories.
4472 * src/lyxrow.C: include <config.h>
4473 * src/lyxcursor.C: ditto.
4475 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4477 * lib/examples/decimal.lyx: new example file from Mike.
4479 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4480 to find template definitions (from Dekel)
4482 * src/frontends/.cvsignore: add a few things.
4484 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4486 * src/Timeout.C (TimeOut): remove default argument.
4488 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4491 * src/insets/ExternalTemplate.C: add a "using" directive.
4493 * src/lyx_main.h: remove the act_ struct, which seems unused
4496 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4498 * LyX Developers Meeting: All files changed, due to random C++ (by
4499 coincidence) code generator script.
4501 - external inset (cool!)
4502 - initial online editing of preferences
4503 - insettabular breaks insettext(s contents)
4505 - some DocBook fixes
4506 - example files update
4507 - other cool stuff, create a diff and look for yourself.
4509 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4511 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4512 -1 this is a non-line-breaking textinset.
4514 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
4515 if there is no width set.
4517 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4519 * Lots of files: Merged the dialogbase branch.
4521 2000-06-09 Allan Rae <rae@lyx.org>
4523 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
4524 and the Dispatch methods that used it.
4526 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
4527 access to functions formerly kept in Dispatch.
4529 2000-05-19 Allan Rae <rae@lyx.org>
4531 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
4532 made to_page and count_copies integers again. from_page remains a
4533 string however because I want to allow entry of a print range like
4534 "1,4,22-25" using this field.
4536 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4537 and printer-params-get. These aren't useful from the minibuffer but
4538 could be used by a script/LyXServer app provided it passes a suitable
4539 auto_mem_buffer. I guess I should take a look at how the LyXServer
4540 works and make it support xtl buffers.
4542 * sigc++/: updated to libsigc++-1.0.1
4544 * src/xtl/: updated to xtl-1.3.pl.11
4546 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4547 those changes done to the files in src/ are actually recreated when
4548 they get regenerated. Please don't ever accept a patch that changes a
4549 dialog unless that patch includes the changes to the corresponding *.fd
4552 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4553 stringOnlyContains, renamed it and generalised it.
4555 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4556 branch. Removed the remaining old form_print code.
4558 2000-04-26 Allan Rae <rae@lyx.org>
4560 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
4561 trap I was trying to fix with the ID: fields in src/xtl/ :-)
4563 2000-04-25 Allan Rae <rae@lyx.org>
4565 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
4566 against a base of xtl-1.3.pl.4
4568 * development/tools/lxtl.sh: fixed a couple of silly typos and now
4569 filter the Id: entries so they still show the xtl version number
4572 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
4573 into the src/xtl code. Patch still pending with José (XTL)
4575 2000-04-24 Allan Rae <rae@lyx.org>
4577 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
4578 both more generic and much safer. Use the new template functions.
4579 * src/buffer.[Ch] (Dispatch): ditto.
4581 * src/frontends/xforms/FormPrint.C (update): Use new template functions
4582 and mem buffer more intelligently. Also a little general cleanup.
4585 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
4586 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4587 * src/xtl/Makefile.am: ditto.
4588 * src/xtl/.cvsignore: ditto.
4589 * src/Makefile.am: ditto.
4591 * src/PrinterParams.h: Removed the macros member functions. Added a
4592 testInvariant member function. A bit of tidying up and commenting.
4593 Included Angus's idea for fixing operation with egcs-1.1.2.
4595 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4596 cool expansion of XTL's mem_buffer to support automatic memory
4597 management within the buffer itself. Removed the various macros and
4598 replaced them with template functions that use either auto_mem_buffer
4599 or mem_buffer depending on a #define. The mem_buffer support will
4600 disappear as soon as the auto_mem_buffer is confirmed to be good on
4601 other platforms/compilers. That is, it's there so you've got something
4604 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4605 effectively forked XTL. However I expect José will include my code
4606 into the next major release. Also fixed a memory leak.
4607 * src/xtl/text.h: ditto.
4608 * src/xtl/xdr.h: ditto.
4609 * src/xtl/giop.h: ditto.
4611 2000-04-16 Allan Rae <rae@lyx.org>
4613 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4614 by autogen.sh and removed by maintainer-clean anyway.
4615 * .cvsignore, sigc++/.cvsignore: Support the above.
4617 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4619 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4621 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4622 macros, renamed static callback-target member functions to suit new
4623 scheme and made them public.
4624 * src/frontends/xforms/forms/form_print.fd: ditto.
4625 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4627 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4630 * src/xtl/: New directory containing a minimal distribution of XTL.
4631 This is XTL-1.3.pl.4.
4633 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4635 2000-04-15 Allan Rae <rae@lyx.org>
4637 * development/tools/makeLyXsigc.sh: Remove the library version numbers
4639 * sigc++/: Updated to libsigc++-1.0.0
4641 2000-04-14 Allan Rae <rae@lyx.org>
4643 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
4644 use the generic ones in future. I'll modify my conversion script.
4646 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
4648 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
4649 (CloseAllBufferRelatedDialogs): Renamed.
4650 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
4652 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
4653 of the generic ones. These are the same ones my conversion script
4656 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
4657 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
4658 * src/buffer.C (Dispatch): ditto
4660 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
4661 functions for updating and hiding buffer dependent dialogs.
4662 * src/BufferView.C (buffer): ditto
4663 * src/buffer.C (setReadonly): ditto
4664 * src/lyxfunc.C (CloseBuffer): ditto
4666 * src/buffer.h: Take setReadonly() out of line so I don't have to include
4667 Dialogs.h, and hence all the SigC stuff, into every file that includes
4668 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
4670 * src/BufferView2.C: reduce the number of headers included by buffer.h
4672 2000-04-11 Allan Rae <rae@lyx.org>
4674 * src/frontends/xforms/xform_macros.h: A small collection of macros
4675 for building C callbacks.
4677 * src/frontends/xforms/Makefile.am: Added above file.
4679 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
4680 scheme again. This time it should work for JMarc. If this is
4681 successful I'll revise my conversion script to automate some of this.
4682 The static member functions in the class also have to be public for
4683 this scheme will work. If the scheme works (it's almost identical to
4684 the way BufferView::cursorToggleCB is handled so it should work) then
4685 FormCopyright and FormPrint will be ready for inclusion into the main
4686 trunk immediately after 1.1.5 is released -- provided we're prepared
4687 for complaints about lame compilers not handling XTL.
4689 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4691 2000-04-07 Allan Rae <rae@lyx.org>
4693 * config/lyxinclude.m4: A bit more tidying up (Angus)
4695 * src/LString.h: JMarc's <string> header fix
4697 * src/PrinterParams.h: Used string for most data to remove some
4698 ugly code in the Print dialog and avoid even uglier code when
4699 appending the ints to a string for output.
4701 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4702 and moved "default:" back to the end of switch statement. Cleaned
4703 up the printing so it uses the right function calls and so the
4704 "print to file" option actually puts the file in the right directory.
4706 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4708 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4709 and Ok+Apply button control into a separate method: input (Angus).
4710 (input) Cleaned it up and improved it to be very thorough now.
4711 (All CB) static_cast used instead of C style cast (Angus). This will
4712 probably change again once we've worked out how to keep gcc-2.8.1 happy
4713 with real C callbacks.
4714 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4715 ignore some of the bool settings and has random numbers instead. Needs
4716 some more investigation. Added other input length checks and checking
4717 of file and printer names.
4719 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4720 would link (Angus). Seems the old code doesn't compile with the pragma
4721 statement either. Separated callback entries from internal methods.
4723 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4725 2000-03-17 Allan Rae <rae@lyx.org>
4727 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4728 need it? Maybe it could go in Dialogs instead? I could make it a
4729 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4730 values to get the bool return value.
4731 (Dispatch): New overloaded method for xtl support.
4733 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4734 extern "C" callback instead of static member functions. Hopefully,
4735 JMarc will be able to compile this. I haven't changed
4736 forms/form_copyright.fd yet. Breaking one of my own rules already.
4738 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4739 because they aren't useful from the minibuffer. Maybe a LyXServer
4740 might want a help message though?
4742 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4744 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4745 xtl which needs both rtti and exceptions.
4747 * src/support/Makefile.am:
4748 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4750 * src/frontends/xforms/input_validators.[ch]: input filters and
4751 validators. These conrol what keys are valid in input boxes.
4752 Use them and write some more. Much better idea than waiting till
4753 after the user has pressed Ok to say that the input fields don't make
4756 * src/frontends/xforms/Makefile.am:
4757 * src/frontends/xforms/forms/form_print.fd:
4758 * src/frontends/xforms/forms/makefile:
4759 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4760 new scheme. Still have to make sure I haven't missed anything from
4761 the current implementation.
4763 * src/Makefile.am, src/PrinterParams.h: New data store.
4765 * other files: Added a couple of copyright notices.
4767 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4769 * src/insets/insetbib.h: move Holder struct in public space.
4771 * src/frontends/include/DialogBase.h: use SigC:: only when
4772 SIGC_CXX_NAMESPACES is defined.
4773 * src/frontends/include/Dialogs.h: ditto.
4775 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4777 * src/frontends/xforms/FormCopyright.[Ch]: do not
4778 mention SigC:: explicitely.
4780 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4782 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4783 deals with testing KDE in main configure.in
4784 * configure.in: ditto.
4786 2000-02-22 Allan Rae <rae@lyx.org>
4788 * Lots of files: Merged from HEAD
4790 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4791 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4793 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4795 * sigc++/: new minidist.
4797 2000-02-14 Allan Rae <rae@lyx.org>
4799 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4801 2000-02-08 Juergen Vigna <jug@sad.it>
4803 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4804 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4806 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4807 for this port and so it is much easier for other people to port
4808 dialogs in a common development environment.
4810 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4811 the QT/KDE implementation.
4813 * src/frontends/kde/Dialogs.C:
4814 * src/frontends/kde/FormCopyright.C:
4815 * src/frontends/kde/FormCopyright.h:
4816 * src/frontends/kde/Makefile.am:
4817 * src/frontends/kde/formcopyrightdialog.C:
4818 * src/frontends/kde/formcopyrightdialog.h:
4819 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4820 for the kde support of the Copyright-Dialog.
4822 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4823 subdir-substitution instead of hardcoded 'xforms' as we now have also
4826 * src/frontends/include/DialogBase.h (Object): just commented the
4827 label after #endif (nasty warning and I don't like warnings ;)
4829 * src/main.C (main): added KApplication initialization if using
4832 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4833 For now only the KDE event-loop is added if frontend==kde.
4835 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4837 * configure.in: added support for the --with-frontend[=value] option
4839 * autogen.sh: added kde.m4 file to list of config-files
4841 * acconfig.h: added define for KDEGUI-support
4843 * config/kde.m4: added configuration functions for KDE-port
4845 * config/lyxinclude.m4: added --with-frontend[=value] option with
4846 support for xforms and KDE.
4848 2000-02-08 Allan Rae <rae@lyx.org>
4850 * all Makefile.am: Fixed up so the make targets dist, distclean,
4851 install and uninstall all work even if builddir != srcdir. Still
4852 have a new sigc++ minidist update to come.
4854 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4856 2000-02-01 Allan Rae <rae@lyx.org>
4858 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4859 Many mods to get builddir != srcdir working.
4861 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4862 for building on NT and so we can do the builddir != srcdir stuff.
4864 2000-01-30 Allan Rae <rae@lyx.org>
4866 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4867 This will stay in "rae" branch. We probably don't really need it in
4868 the main trunk as anyone who wants to help programming it should get
4869 a full library installed also. So they can check both included and
4870 system supplied library compilation.
4872 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
4873 Added a 'mini' distribution of libsigc++. If you feel the urge to
4874 change something in these directories - Resist it. If you can't
4875 resist the urge then you should modify the following script and rebuild
4876 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
4877 all happen. Still uses a hacked version of libsigc++'s configure.in.
4878 I'm quite happy with the results. I'm not sure the extra work to turn
4879 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
4880 worth the trouble and would probably lead to extra maintenance
4882 I haven't tested the following important make targets: install, dist.
4883 Not ready for prime time but very close. Maybe 1.1.5.
4885 * development/tools/makeLyXsigc.sh: A shell script to automatically
4886 generate our mini-dist of libsigc++. It can only be used with a CVS
4887 checkout of libsigc++ not a tarball distribution. It's well commented.
4888 This will end up as part of the libsigc++ distribution so other apps
4889 can easily have an included mini-dist. If someone makes mods to the
4890 sigc++ subpackage without modifying this script to generate those
4891 changes I'll be very upset!
4893 * src/frontends/: Started the gui/system indep structure.
4895 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
4896 to access the gui-indep dialogs are in this class. Much improved
4897 design compared to previous revision. Lars, please refrain from
4898 moving this header into src/ like you did with Popups.h last time.
4900 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
4902 * src/frontends/xforms/: Started the gui-indep system with a single
4903 dialog: FormCopyright. Initial testing of use of libsigc++ was very
4906 * src/frontends/xforms/forms: Repository for the xforms .fd files.
4907 Here you'll find a very useful makefile and automated fdfix.sh that
4908 makes updating dailogs a no-brainer -- provided you follow the rules
4909 set out in the README. I'm thinking about adding another script to
4910 automatically generate skeleton code for a new dialog given just the
4913 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
4914 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
4915 Made FormCopyright gui-indep and added a lyxfunc to get to it.
4917 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4919 * src/support/LSubstring.C (operator): simplify
4921 * src/lyxtext.h: removed bparams, use buffer_->params instead
4923 * src/lyxrow.h: make Row a real class, move all variables to
4924 private and use accessors.
4926 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4928 (isRightToLeftPar): ditto
4929 (ChangeLanguage): ditto
4930 (isMultiLingual): ditto
4933 (SimpleTeXOnePar): ditto
4934 (TeXEnvironment): ditto
4935 (GetEndLabel): ditto
4937 (SetOnlyLayout): ditto
4938 (BreakParagraph): ditto
4939 (BreakParagraphConservative): ditto
4940 (GetFontSettings): ditto
4942 (CopyIntoMinibuffer): ditto
4943 (CutIntoMinibuffer): ditto
4944 (PasteParagraph): ditto
4945 (SetPExtraType): ditto
4946 (UnsetPExtraType): ditto
4947 (DocBookContTableRows): ditto
4948 (SimpleDocBookOneTablePar): ditto
4950 (TeXFootnote): ditto
4951 (SimpleTeXOneTablePar): ditto
4952 (TeXContTableRows): ditto
4953 (SimpleTeXSpecialChars): ditto
4956 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4957 to private and use accessors.
4959 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4960 this, we did not use it anymore and has not been for ages. Just a
4961 waste of cpu cycles.
4963 * src/language.h: make Language a real class, move all variables
4964 to private and use accessors.
4966 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4967 (create_view): remove
4968 (update): some changes for new timer
4969 (cursorToggle): use new timer
4970 (beforeChange): change for new timer
4972 * src/BufferView.h (cursorToggleCB): removed last paramter because
4975 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4976 (cursorToggleCB): change because of new timer code
4978 * lib/CREDITS: updated own mailaddress
4980 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4982 * src/support/filetools.C (PutEnv): fix the code in case neither
4983 putenv() nor setenv() have been found.
4985 * INSTALL: mention the install-strip Makefile target.
4987 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4988 read-only documents.
4990 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4992 * lib/reLyX/configure.in (VERSION): avoid using a previously
4993 generated reLyX wrapper to find out $prefix.
4995 * lib/examples/eu_adibide_lyx-atua.lyx:
4996 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4997 translation of the Tutorial (Dooteo)
4999 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5001 * forms/cite.fd: new citation dialog
5003 * src/insetcite.[Ch]: the new citation dialog is moved into
5006 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5009 * src/insets/insetcommand.h: data members made private.
5011 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5013 * LyX 1.1.5 released
5015 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5017 * src/version.h (LYX_RELEASE): to 1.1.5
5019 * src/spellchecker.C (RunSpellChecker): return false if the
5020 spellchecker dies upon creation.
5022 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5024 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5025 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5029 * lib/CREDITS: update entry for Martin Vermeer.
5031 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5033 * src/text.C (draw): Draw foreign language bars at the bottom of
5034 the row instead of at the baseline.
5036 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5038 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5040 * lib/bind/de_menus.bind: updated
5042 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5044 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5046 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5048 * src/menus.C (Limit_string_length): New function
5049 (ShowTocMenu): Limit the number of items/length of items in the
5052 * src/paragraph.C (String): Correct result for a paragraph inside
5055 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5057 * src/bufferlist.C (close): test of buf->getuser() == NULL
5059 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5061 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5062 Do not call to SetCursor when the paragraph is a closed footnote!
5064 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5066 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5069 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5071 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5074 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5075 reference popup, that activates the reference-back action
5077 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5079 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5080 the menus. Also fixed a bug.
5082 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5083 the math panels when switching buffers (unless new buffer is readonly).
5085 * src/BufferView.C (NoSavedPositions)
5086 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5088 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5090 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5091 less of dvi dirty or not.
5093 * src/trans_mgr.[Ch] (insert): change first parameter to string
5096 * src/chset.[Ch] (encodeString): add const to first parameter
5098 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5100 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5104 * src/LaTeX.C (deplog): better searching for dependency files in
5105 the latex log. Uses now regexps.
5107 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5108 instead of the box hack or \hfill.
5110 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5112 * src/lyxfunc.C (doImportHelper): do not create the file before
5113 doing the actual import.
5114 (doImportASCIIasLines): create a new file before doing the insert.
5115 (doImportASCIIasParagraphs): ditto.
5117 * lib/lyxrc.example: remove mention of non-existing commands
5119 * lyx.man: remove mention of color-related switches.
5121 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5123 * src/lyx_gui.C: remove all the color-related ressources, which
5124 are not used anymore.
5126 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5129 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5131 * src/lyxrc.C (read): Add a missing break in the switch
5133 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5135 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5137 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5140 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5142 * src/text.C (draw): draw bars under foreign language words.
5144 * src/LColor.[Ch]: add LColor::language
5146 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5148 * src/lyxcursor.h (boundary): New member variable
5150 * src/text.C (IsBoundary): New methods
5152 * src/text.C: Use the above for currect cursor movement when there
5153 is both RTL & LTR text.
5155 * src/text2.C: ditto
5157 * src/bufferview_funcs.C (ToggleAndShow): ditto
5159 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5161 * src/text.C (DeleteLineForward): set selection to true to avoid
5162 that DeleteEmptyParagraphMechanism does some magic. This is how it
5163 is done in all other functions, and seems reasonable.
5164 (DeleteWordForward): do not jump over non-word stuff, since
5165 CursorRightOneWord() already does it.
5167 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5168 DeleteWordBackward, since they seem safe to me (since selection is
5169 set to "true") DeleteEmptyParagraphMechanism does nothing.
5171 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5173 * src/lyx_main.C (easyParse): simplify the code by factoring the
5174 part that removes parameters from the command line.
5175 (LyX): check wether wrong command line options have been given.
5177 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5179 * src/lyx_main.C : add support for specifying user LyX
5180 directory via command line option -userdir.
5182 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5184 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5185 the number of items per popup.
5186 (Add_to_refs_menu): Ditto.
5188 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5190 * src/lyxparagraph.h: renamed ClearParagraph() to
5191 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5192 textclass as parameter, and do nothing if free_spacing is
5193 true. This fixes part of the line-delete-forward problems.
5195 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5196 (pasteSelection): ditto.
5197 (SwitchLayoutsBetweenClasses): more translatable strings.
5199 * src/text2.C (CutSelection): use StripLeadingSpaces.
5200 (PasteSelection): ditto.
5201 (DeleteEmptyParagraphMechanism): ditto.
5203 2000-05-26 Juergen Vigna <jug@sad.it>
5205 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5206 is not needed in tabular insets.
5208 * src/insets/insettabular.C (TabularFeatures): added missing features.
5210 * src/tabular.C (DeleteColumn):
5212 (AppendRow): implemented this functions
5213 (cellsturct::operator=): clone the inset too;
5215 2000-05-23 Juergen Vigna <jug@sad.it>
5217 * src/insets/insettabular.C (LocalDispatch): better selection support
5218 when having multicolumn-cells.
5220 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5222 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5224 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5226 * src/ColorHandler.C (getGCForeground): put more test into _()
5228 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5231 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5234 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5236 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5237 there are no labels, or when buffer is readonly.
5239 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5240 there are no labels, buffer is SGML, or when buffer is readonly.
5242 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5244 * src/LColor.C (LColor): change a couple of grey40 to grey60
5245 (LColor): rewore initalization to make compiles go some magnitude
5247 (getGUIName): don't use gettext until we need the string.
5249 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5251 * src/Bullet.[Ch]: Fixed a small bug.
5253 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5255 * src/paragraph.C (String): Several fixes/improvements
5257 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5259 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5261 * src/paragraph.C (String): give more correct output.
5263 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5265 * src/lyxfont.C (stateText) Do not output the language if it is
5266 eqaul to the language of the document.
5268 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5269 between two paragraphs with the same language.
5271 * src/paragraph.C (getParLanguage) Return a correct answer for an
5272 empty dummy paragraph.
5274 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5277 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5280 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5281 the menus/popup, if requested fonts are unavailable.
5283 2000-05-22 Juergen Vigna <jug@sad.it>
5285 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5286 movement support (Up/Down/Tab/Shift-Tab).
5287 (LocalDispatch): added also preliminari cursor-selection.
5289 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5291 * src/paragraph.C (PasteParagraph): Hopefully now right!
5293 2000-05-22 Garst R. Reese <reese@isn.net>
5295 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5296 of list, change all references to Environment to Command
5297 * tex/hollywood.cls : rewrite environments as commands, add
5298 \uppercase to interiorshot and exteriorshot to force uppecase.
5299 * tex/broadway.cls : rewrite environments as commands. Tweak
5302 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5304 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5305 size of items: use a constant intead of the hardcoded 40, and more
5306 importantly do not remove the %m and %x tags added at the end.
5307 (Add_to_refs_menu): use vector::size_type instead of
5308 unsigned int as basic types for the variables. _Please_ do not
5309 assume that size_t is equal to unsigned int. On an alpha, this is
5310 unsigned long, which is _not_ the same.
5312 * src/language.C (initL): remove language "hungarian", since it
5313 seems that "magyar" is better.
5315 2000-05-22 Juergen Vigna <jug@sad.it>
5317 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
5319 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5322 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5323 next was deleted but not set to 0.
5325 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5327 * src/language.C (initL): change the initialization of languages
5328 so that compiles goes _fast_.
5330 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5333 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5335 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5339 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5341 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5343 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5347 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5350 * src/insets/insetlo*.[Ch]: Made editable
5352 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5354 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5355 the current selection.
5357 * src/BufferView_pimpl.C (stuffClipboard): new method
5359 * src/BufferView.C (stuffClipboard): new method
5361 * src/paragraph.C (String): new method
5363 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5364 LColor::ignore when lyxname is not found.
5366 * src/BufferView.C (pasteSelection): new method
5368 * src/BufferView_pimpl.C (pasteSelection): new method
5370 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5372 * src/WorkArea.C (request_clipboard_cb): new static function
5373 (getClipboard): new method
5374 (putClipboard): new method
5376 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5378 * LyX 1.1.5pre2 released
5380 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5382 * src/vspace.C (operator=): removed
5383 (operator=): removed
5385 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5387 * src/layout.C (NumberOfClass): manually set the type in make_pair
5388 (NumberOfLayout): ditto
5390 * src/language.C: use the Language constructor for ignore_lang
5392 * src/language.h: add constructors to struct Language
5394 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5396 * src/text2.C (SetCursorIntern): comment out #warning
5398 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5400 * src/mathed/math_iter.h: initialize sx and sw to 0
5402 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5404 * forms/lyx.fd: Redesign of form_ref
5406 * src/LaTeXFeatures.[Ch]
5410 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5413 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5414 and Buffer::inset_iterator.
5416 * src/menus.C: Added new menus: TOC and Refs.
5418 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5420 * src/buffer.C (getTocList): New method.
5422 * src/BufferView2.C (ChangeRefs): New method.
5424 * src/buffer.C (getLabelList): New method. It replaces the old
5425 getReferenceList. The return type is vector<string> instead of
5428 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5429 the old getLabel() and GetNumberOfLabels() methods.
5430 * src/insets/insetlabel.C (getLabelList): ditto
5431 * src/mathed/formula.C (getLabelList): ditto
5433 * src/paragraph.C (String): New method.
5435 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5436 Uses the new getTocList() method.
5437 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5438 which automatically updates the contents of the browser.
5439 (RefUpdateCB): Use the new getLabelList method.
5441 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5443 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5445 * src/spellchecker.C: Added using std::reverse;
5447 2000-05-19 Juergen Vigna <jug@sad.it>
5449 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5451 * src/insets/insettext.C (computeTextRows): small fix for display of
5452 1 character after a newline.
5454 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5457 2000-05-18 Juergen Vigna <jug@sad.it>
5459 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5460 when changing width of column.
5462 * src/tabular.C (set_row_column_number_info): setting of
5463 autobreak rows if necessary.
5465 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5467 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5469 * src/vc-backend.*: renamed stat() to status() and vcstat to
5470 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5471 compilation broke. The new name seems more relevant, anyway.
5473 2000-05-17 Juergen Vigna <jug@sad.it>
5475 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5476 which was wrong if the removing caused removing of rows!
5478 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5479 (pushToken): new function.
5481 * src/text2.C (CutSelection): fix problem discovered with purify
5483 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5485 * src/debug.C (showTags): enlarge the first column, now that we
5486 have 6-digits debug codes.
5488 * lib/layouts/hollywood.layout:
5489 * lib/tex/hollywood.cls:
5490 * lib/tex/brodway.cls:
5491 * lib/layouts/brodway.layout: more commands and fewer
5492 environments. Preambles moved in the .cls files. Broadway now has
5493 more options on scene numbering and less whitespace (from Garst)
5495 * src/insets/insetbib.C (getKeys): make sure that we are in the
5496 document directory, in case the bib file is there.
5498 * src/insets/insetbib.C (Latex): revert bogus change.
5500 2000-05-16 Juergen Vigna <jug@sad.it>
5502 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5503 the TabularLayout on cursor move.
5505 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5507 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5510 (draw): fixed cursor position and drawing so that the cursor is
5511 visible when before the tabular-inset.
5513 * src/insets/insettext.C (init): drawLockedFrame was not initialized
5514 when creating from old insettext.
5516 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
5518 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5520 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
5521 * lib/tex/brodway.cls: ditto
5523 * lib/layouts/brodway.layout: change alignment of parenthical
5526 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5528 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
5529 versions 0.88 and 0.89 are supported.
5531 2000-05-15 Juergen Vigna <jug@sad.it>
5533 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5536 * src/insets/insettext.C (computeTextRows): redone completely this
5537 function in a much cleaner way, because of problems when having a
5539 (draw): added a frame border when the inset is locked.
5540 (SetDrawLockedFrame): this sets if we draw the border or not.
5541 (SetFrameColor): this sets the frame color (default=insetframe).
5543 * src/insets/lyxinset.h: added x() and y() functions which return
5544 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5545 function which is needed to see if we have a locking inset of some
5546 type in this inset (needed for now in insettabular).
5548 * src/vspace.C (inPixels): the same function also without a BufferView
5549 parameter as so it is easier to use it in some ocasions.
5551 * src/lyxfunc.C: changed all places where insertInset was used so
5552 that now if it couldn't be inserted it is deleted!
5554 * src/TabularLayout.C:
5555 * src/TableLayout.C: added support for new tabular-inset!
5557 * src/BufferView2.C (insertInset): this now returns a bool if the
5558 inset was really inserted!!!
5560 * src/tabular.C (GetLastCellInRow):
5561 (GetFirstCellInRow): new helper functions.
5562 (Latex): implemented for new tabular class.
5566 (TeXTopHLine): new Latex() helper functions.
5568 2000-05-12 Juergen Vigna <jug@sad.it>
5570 * src/mathed/formulamacro.C (Read):
5571 * src/mathed/formula.C (Read): read also the \end_inset here!
5573 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5575 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
5576 crush when saving formulae with unbalanced parenthesis.
5578 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
5580 * src/layout.C: Add new keyword "endlabelstring" to layout file
5582 * src/text.C (GetVisibleRow): Draw endlabel string.
5584 * lib/layouts/broadway.layout
5585 * lib/layouts/hollywood.layout: Added endlabel for the
5586 Parenthetical layout.
5588 * lib/layouts/heb-article.layout: Do not use slanted font shape
5589 for Theorem like environments.
5591 * src/buffer.C (makeLaTeXFile): Always add "american" to
5592 the UsedLanguages list if document language is RTL.
5594 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5596 * add addendum to README.OS2 and small patch (from SMiyata)
5598 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5600 * many files: correct the calls to ChangeExtension().
5602 * src/support/filetools.C (ChangeExtension): remove the no_path
5603 argument, which does not belong there. Use OnlyFileName() instead.
5605 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5606 files when LaTeXing a non-nice latex file.
5608 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5609 a chain of "if". Return false when deadkeys are not handled.
5611 * src/lyx_main.C (LyX): adapted the code for default bindings.
5613 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5614 bindings for basic functionality (except deadkeys).
5615 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5617 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5618 several methods: handle override_x_deadkeys.
5620 * src/lyxrc.h: remove the "bindings" map, which did not make much
5621 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5623 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5625 * src/lyxfont.C (stateText): use a saner method to determine
5626 whether the font is "default". Seems to fix the crash with DEC
5629 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5631 2000-05-08 Juergen Vigna <jug@sad.it>
5633 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5634 TabularLayoutMenu with mouse-button-3
5635 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
5637 * src/TabularLayout.C: added this file for having a Layout for
5640 2000-05-05 Juergen Vigna <jug@sad.it>
5642 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
5643 recalculating inset-widths.
5644 (TabularFeatures): activated this function so that I can change
5645 tabular-features via menu.
5647 * src/menus.C (ShowEditMenu): inserted support for insettabular so
5648 that I can test some functions with the Table menu.
5650 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5652 * src/lyxfont.C (stateText): guard against stupid c++libs.
5654 * src/tabular.C: add using std::vector
5655 some whitespace changes, + removed som autogenerated code.
5657 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
5659 2000-05-05 Juergen Vigna <jug@sad.it>
5661 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
5662 row, columns and cellstructures.
5664 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5666 * lib/lyxrc.example: remove obsolete entries.
5668 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
5669 reading of protected_separator for free_spacing.
5671 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5673 * src/text.C (draw): do not display an exclamation mark in the
5674 margin for margin notes. This is confusing, ugly and
5677 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
5678 AMS math' is checked.
5680 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
5681 name to see whether including the amsmath package is needed.
5683 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5685 * src/paragraph.C (validate): Compute UsedLanguages correctly
5686 (don't insert the american language if it doesn't appear in the
5689 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5690 The argument of \thanks{} command is considered moving argument
5692 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5695 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5697 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5698 for appendix/minipage/depth. The lines can be now both in the footnote
5699 frame, and outside the frame.
5701 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5704 2000-05-05 Juergen Vigna <jug@sad.it>
5706 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5707 neede only in tabular.[Ch].
5709 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5711 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5713 (Write): write '~' for PROTECTED_SEPARATOR
5715 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5717 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5720 * src/mathed/formula.C (drawStr): rename size to siz.
5722 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5723 possibly fix a bug by not changing the pflags = flags to piflags =
5726 2000-05-05 Juergen Vigna <jug@sad.it>
5728 * src/insets/insetbib.C: moved using directive
5730 * src/ImportNoweb.C: small fix for being able to compile (missing
5733 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5735 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5736 to use clear, since we don't depend on this in the code. Add test
5739 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5741 * (various *.C files): add using std::foo directives to please dec
5744 * replace calls to string::clear() to string::erase() (Angus)
5746 * src/cheaders/cmath: modified to provide std::abs.
5748 2000-05-04 Juergen Vigna <jug@sad.it>
5750 * src/insets/insettext.C: Prepared all for inserting of multiple
5751 paragraphs. Still display stuff to do (alignment and other things),
5752 but I would like to use LyXText to do this when we cleaned out the
5753 table-support stuff.
5755 * src/insets/insettabular.C: Changed lot of stuff and added lots
5756 of functionality still a lot to do.
5758 * src/tabular.C: Various functions changed name and moved to be
5759 const functions. Added new Read and Write functions and changed
5760 lots of things so it works good with tabular-insets (also removed
5761 some stuff which is not needed anymore * hacks *).
5763 * src/lyxcursor.h: added operators == and != which just look if
5764 par and pos are (not) equal.
5766 * src/buffer.C (latexParagraphs): inserted this function to latex
5767 all paragraphs form par to endpar as then I can use this too for
5770 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5771 so that I can call this to from text insets with their own cursor.
5773 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5774 output off all paragraphs (because of the fix below)!
5776 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5777 the very last paragraph (this could be also the last paragraph of an
5780 * src/texrow.h: added rows() call which returns the count-variable.
5782 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5784 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5786 * lib/configure.m4: better autodetection of DocBook tools.
5788 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5790 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5792 * src/lyx_cb.C: add using std::reverse;
5794 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5797 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5798 selected files. Should fix repeated errors from generated files.
5800 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5802 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5804 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5805 the spellchecker popup.
5807 * lib/lyxrc.example: Removed the \number_inset section
5809 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5811 * src/insets/figinset.C (various): Use IsFileReadable() to make
5812 sure that the file actually exist. Relying on ghostscripts errors
5813 is a bad idea since they can lead to X server crashes.
5815 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5817 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5820 * lib/lyxrc.example: smallish typo in description of
5821 \view_dvi_paper_option
5823 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5826 * src/lyxfunc.C: doImportHelper to factor out common code of the
5827 various import methods. New functions doImportASCIIasLines,
5828 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5829 doImportLinuxDoc for the format specific parts.
5832 * buffer.C: Dispatch returns now a bool to indicate success
5835 * lyx_gui.C: Add getLyXView() for member access
5837 * lyx_main.C: Change logic for batch commands: First try
5838 Buffer::Dispatch (possibly without GUI), if that fails, use
5841 * lyx_main.C: Add support for --import command line switch.
5842 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5843 Available Formats: Everything accepted by 'buffer-import <format>'
5845 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5847 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5850 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5851 documents will be reformatted upon reentry.
5853 2000-04-27 Juergen Vigna <jug@sad.it>
5855 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5856 correctly only last pos this was a bug.
5858 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5860 * release of lyx-1.1.5pre1
5862 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5864 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5866 * src/menus.C: revert the change of naming (Figure->Graphic...)
5867 from 2000-04-11. It was incomplete and bad.
5869 * src/LColor.[Ch]: add LColor::depthbar.
5870 * src/text.C (GetVisibleRow): use it.
5872 * README: update the languages list.
5874 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5876 * src/text.C (GetVisibleRow): show the depth of paragraphs using
5879 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5881 * README: remove sections that were just wrong.
5883 * src/text2.C (GetRowNearY): remove currentrow code
5885 * src/text.C (GetRow): remove currentrow code
5887 * src/screen.C (Update): rewritten a bit.
5888 (SmallUpdate): removed func
5890 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
5892 (FullRebreak): return bool
5893 (currentrow): remove var
5894 (currentrow_y): ditto
5896 * src/lyxscreen.h (Draw): change arg to unsigned long
5897 (FitCursor): return bool
5898 (FitManualCursor): ditto
5899 (Smallpdate): remove func
5900 (first): change to unsigned long
5901 (DrawOneRow): change second arg to long (from long &)
5902 (screen_refresh_y): remove var
5903 (scree_refresh_row): ditto
5905 * src/lyxrow.h: change baseline to usigned int from unsigned
5906 short, this brings some implicit/unsigned issues out in the open.
5908 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
5910 (Dispatch): don't call updateScrollbar after fitCursor. Use update
5911 instead of smallUpdate.
5913 * src/lyxcursor.h: change y to unsigned long
5915 * src/buffer.h: don't call updateScrollbar after fitcursor
5917 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5918 where they are used. Removed "\\direction", this was not present
5919 in 1.1.4 and is already obsolete. Commented out some code that I
5920 believe to never be called.
5921 (runLiterate): don't call updateScrollbar after fitCursor
5923 (buildProgram): ditto
5926 * src/WorkArea.h (workWidth): change return val to unsigned
5929 (redraw): remove the button redraws
5930 (setScrollbarValue): change for scrollbar
5931 (getScrollbarValue): change for scrollbar
5932 (getScrollbarBounds): change for scrollbar
5934 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5935 (C_WorkArea_down_cb): removed func
5936 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5937 (resize): change for scrollbar
5938 (setScrollbar): ditto
5939 (setScrollbarBounds): ditto
5940 (setScrollbarIncrements): ditto
5941 (up_cb): removed func
5942 (down_cb): removed func
5943 (scroll_cb): change for scrollbar
5944 (work_area_handler): ditto
5946 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5947 when FitCursor did something.
5948 (updateScrollbar): some unsigned changes
5949 (downCB): removed func
5950 (scrollUpOnePage): removed func
5951 (scrollDownOnePage): remvoed func
5952 (workAreaMotionNotify): don't call screen->FitCursor but use
5953 fitCursor instead. and bool return val
5954 (workAreaButtonPress): ditto
5955 (workAreaButtonRelease): some unsigned changes
5956 (checkInsetHit): ditto
5957 (workAreaExpose): ditto
5958 (update): parts rewritten, comments about the signed char arg added
5959 (smallUpdate): removed func
5960 (cursorPrevious): call needed updateScrollbar
5963 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5966 * src/BufferView.[Ch] (upCB): removed func
5967 (downCB): removed func
5968 (smallUpdate): removed func
5970 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5972 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5973 currentrow, currentrow_y optimization. This did not help a lot and
5974 if we want to do this kind of optimization we should rather use
5975 cursor.row instead of the currentrow.
5977 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5978 buffer spacing and klyx spacing support.
5980 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5982 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5985 2000-04-26 Juergen Vigna <jug@sad.it>
5987 * src/insets/figinset.C: fixes to Lars sstream changes!
5989 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5991 * A lot of files: Added Ascii(ostream &) methods to all inset
5992 classes. Used when exporting to ASCII.
5994 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5995 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5998 * src/text2.C (ToggleFree): Disabled implicit word selection when
5999 there is a change in the language
6001 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6002 no output was generated for end-of-sentence inset.
6004 * src/insets/lyxinset.h
6007 * src/paragraph.C: Removed the insetnumber code
6009 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6011 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6013 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6014 no_babel and no_epsfig completely from the file.
6015 (parseSingleLyXformat2Token): add handling for per-paragraph
6016 spacing as written by klyx.
6018 * src/insets/figinset.C: applied patch by Andre. Made it work with
6021 2000-04-20 Juergen Vigna <jug@sad.it>
6023 * src/insets/insettext.C (cutSelection):
6024 (copySelection): Fixed with selection from right to left.
6025 (draw): now the rows are not recalculated at every draw.
6026 (computeTextRows): for now reset the inset-owner here (this is
6027 important for an undo or copy where the inset-owner is not set
6030 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6031 motion to the_locking_inset screen->first was forgotten, this was
6032 not important till we got multiline insets.
6034 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6036 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6037 code seems to be alright (it is code changed by Dekel, and the
6038 intent is indeed that all macros should be defined \protect'ed)
6040 * NEWS: a bit of reorganisation of the new user-visible features.
6042 2000-04-19 Juergen Vigna <jug@sad.it>
6044 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6045 position. Set the inset_owner of the used paragraph so that it knows
6046 that it is inside an inset. Fixed cursor handling with mouse and
6047 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6048 and cleanups to make TextInsets work better.
6050 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6051 Changed parameters of various functions and added LockInsetInInset().
6053 * src/insets/insettext.C:
6055 * src/insets/insetcollapsable.h:
6056 * src/insets/insetcollapsable.C:
6057 * src/insets/insetfoot.h:
6058 * src/insets/insetfoot.C:
6059 * src/insets/insetert.h:
6060 * src/insets/insetert.C: cleaned up the code so that it works now
6061 correctly with insettext.
6063 * src/insets/inset.C:
6064 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6065 that insets in insets are supported right.
6068 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6070 * src/paragraph.C: some small fixes
6072 * src/debug.h: inserted INSETS debug info
6074 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6075 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6077 * src/commandtags.h:
6078 * src/LyXAction.C: insert code for InsetTabular.
6080 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6081 not Button1MotionMask.
6082 (workAreaButtonRelease): send always a InsetButtonRelease event to
6084 (checkInsetHit): some setCursor fixes (always with insets).
6086 * src/BufferView2.C (lockInset): returns a bool now and extended for
6087 locking insets inside insets.
6088 (showLockedInsetCursor): it is important to have the cursor always
6089 before the locked inset.
6090 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6092 * src/BufferView.h: made lockInset return a bool.
6094 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6096 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6097 that is used also internally but can be called as public to have back
6098 a cursor pos which is not set internally.
6099 (SetCursorIntern): Changed to use above function.
6101 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6103 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6108 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6109 patches for things that should be in or should be changed.
6111 * src/* [insetfiles]: change "usigned char fragile" to bool
6112 fragile. There was only one point that could that be questioned
6113 and that is commented in formulamacro.C. Grep for "CHECK".
6115 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6116 (DeleteBuffer): take it out of CutAndPaste and make it static.
6118 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6120 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6121 output the spacing envir commands. Also the new commands used in
6122 the LaTeX output makes the result better.
6124 * src/Spacing.C (writeEnvirBegin): new method
6125 (writeEnvirEnd): new method
6127 2000-04-18 Juergen Vigna <jug@sad.it>
6129 * src/CutAndPaste.C: made textclass a static member of the class
6130 as otherwise it is not accesed right!!!
6132 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6134 * forms/layout_forms.fd
6135 * src/layout_forms.h
6136 * src/layout_forms.C (create_form_form_character)
6137 * src/lyx_cb.C (UserFreeFont)
6138 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6139 documents (in the layout->character popup).
6141 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6143 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6144 \spell_command was in fact not honored (from Kevin Atkinson).
6146 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6149 * src/lyx_gui.h: make lyxViews private (Angus)
6151 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6153 * src/mathed/math_write.C
6154 (MathMatrixInset::Write) Put \protect before \begin{array} and
6155 \end{array} if fragile
6156 (MathParInset::Write): Put \protect before \\ if fragile
6158 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6160 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6161 initialization if the LyXColorHandler must be done after the
6162 connections to the XServer has been established.
6164 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6165 get the background pixel from the lyxColorhandler so that the
6166 figures are rendered with the correct background color.
6167 (NextToken): removed functions.
6168 (GetPSSizes): use ifs >> string instead of NextToken.
6170 * src/Painter.[Ch]: the color cache moved out of this file.
6172 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6175 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6177 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6178 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6180 * src/BufferView.C (enterView): new func
6181 (leaveView): new func
6183 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6185 (leaveView): new func, undefines xterm cursor when approp.
6187 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6188 (AllowInput): delete the Workarea cursor handling from this func.
6190 * src/Painter.C (underline): draw a slimer underline in most cases.
6192 * src/lyx_main.C (error_handler): use extern "C"
6194 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6196 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6197 sent directly to me.
6199 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6200 to the list by Dekel.
6202 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6205 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6206 methods from lyx_cb.here.
6208 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6211 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6213 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6214 instead of using current_view directly.
6216 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6218 * src/LyXAction.C (init): add the paragraph-spacing command.
6220 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6222 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6224 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6225 different from the documents.
6227 * src/text.C (SetHeightOfRow): take paragraph spacing into
6228 account, paragraph spacing takes precedence over buffer spacing
6229 (GetVisibleRow): ditto
6231 * src/paragraph.C (writeFile): output the spacing parameter too.
6232 (validate): set the correct features if spacing is used in the
6234 (Clear): set spacing to default
6235 (MakeSameLayout): spacing too
6236 (HasSameLayout): spacing too
6237 (SetLayout): spacing too
6238 (TeXOnePar): output the spacing commands
6240 * src/lyxparagraph.h: added a spacing variable for use with
6241 per-paragraph spacing.
6243 * src/Spacing.h: add a Default spacing and a method to check if
6244 the current spacing is default. also added an operator==
6246 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6249 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6251 * src/lyxserver.C (callback): fix dispatch of functions
6253 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6254 printf() into lyxerr call.
6256 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6259 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6260 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6261 the "Float" from each of the subitems.
6262 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6264 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6265 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6266 documented the change so that the workaround can be nuked later.
6268 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6271 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6273 * src/buffer.C (getLatexName): ditto
6274 (setReadonly): ditto
6276 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6278 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6279 avoid some uses of current_view. Added also a bufferParams()
6280 method to get at this.
6282 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6284 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6286 * src/lyxparagraph.[Ch]: removed
6287 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6288 with operators used by lower_bound and
6289 upper_bound in InsetTable's
6290 Make struct InsetTable private again. Used matchpos.
6292 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6294 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6295 document, the language of existing text is changed (unless the
6296 document is multi-lingual)
6298 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6300 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6302 * A lot of files: A rewrite of the Right-to-Left support.
6304 2000-04-10 Juergen Vigna <jug@sad.it>
6306 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6307 misplaced cursor when inset in inset is locked.
6309 * src/insets/insettext.C (LocalDispatch): small fix so that a
6310 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6312 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6313 footnote font should be decreased in size twice when displaying.
6315 * src/insets/insettext.C (GetDrawFont): inserted this function as
6316 the drawing-font may differ from the real paragraph font.
6318 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
6319 insets (inset in inset!).
6321 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6322 function here because we don't want footnotes inside footnotes.
6324 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6326 (init): now set the inset_owner in paragraph.C
6327 (LocalDispatch): added some resetPos() in the right position
6330 (pasteSelection): changed to use the new CutAndPaste-Class.
6332 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6333 which tells if it is allowed to insert another inset inside this one.
6335 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6336 SwitchLayoutsBetweenClasses.
6338 * src/text2.C (InsertInset): checking of the new paragraph-function
6340 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6341 is not needed anymore here!
6344 (PasteSelection): redone (also with #ifdef) so that now this uses
6345 the CutAndPaste-Class.
6346 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6349 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6350 from/to text/insets.
6352 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6353 so that the paragraph knows if it is inside an (text)-inset.
6354 (InsertFromMinibuffer): changed return-value to bool as now it
6355 may happen that an inset is not inserted in the paragraph.
6356 (InsertInsetAllowed): this checks if it is allowed to insert an
6357 inset in this paragraph.
6359 (BreakParagraphConservative):
6360 (BreakParagraph) : small change for the above change of the return
6361 value of InsertFromMinibuffer.
6363 * src/lyxparagraph.h: added inset_owner and the functions to handle
6364 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6366 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6368 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6369 functions from BufferView to BufferView::Pimpl to ease maintence.
6371 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6372 correctly. Also use SetCursorIntern instead of SetCursor.
6374 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6377 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6379 * src/WorkArea.C (belowMouse): manually implement below mouse.
6381 * src/*: Add "explicit" on several constructors, I added probably
6382 some unneeded ones. A couple of changes to code because of this.
6384 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6385 implementation and private parts from the users of BufferView. Not
6388 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6389 implementation and private parts from the users of LyXLex. Not
6392 * src/BufferView_pimpl.[Ch]: new files
6394 * src/lyxlex_pimpl.[Ch]: new files
6396 * src/LyXView.[Ch]: some inline functions move out-of-line
6398 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6400 * src/lyxparagraph.h: make struct InsetTable public.
6402 * src/support/lyxstring.h: change lyxstring::difference_type to be
6403 ptrdiff_t. Add std:: modifiers to streams.
6405 * src/font.C: include the <cctype> header, for islower() and
6408 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6410 * src/font.[Ch]: new files. Contains the metric functions for
6411 fonts, takes a LyXFont as parameter. Better separation of concepts.
6413 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6414 changes because of this.
6416 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6418 * src/*: compile with -Winline and move functions that don't
6421 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6424 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6426 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6427 (various files changed because of this)
6429 * src/Painter.C (text): fixed the drawing of smallcaps.
6431 * src/lyxfont.[Ch] (drawText): removed unused member func.
6434 * src/*.C: added needed "using" statements and "std::" qualifiers.
6436 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6438 * src/*.h: removed all use of "using" from header files use
6439 qualifier std:: instead.
6441 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6443 * src/text.C (Backspace): some additional cleanups (we already
6444 know whether cursor.pos is 0 or not).
6446 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6447 automake does not provide one).
6449 * src/bmtable.h: replace C++ comments with C comments.
6451 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6453 * src/screen.C (ShowCursor): Change the shape of the cursor if
6454 the current language is not equal to the language of the document.
6455 (If the cursor change its shape unexpectedly, then you've found a bug)
6457 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6460 * src/insets/insetnumber.[Ch]: New files.
6462 * src/LyXAction.C (init)
6463 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6466 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6468 * src/lyxparagraph.h
6469 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6470 (the vector is kept sorted).
6472 * src/text.C (GetVisibleRow): Draw selection correctly when there
6473 is both LTR and RTL text.
6475 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6476 which is much faster.
6478 * src/text.C (GetVisibleRow and other): Do not draw the last space
6479 in a row if the direction of the last letter is not equal to the
6480 direction of the paragraph.
6482 * src/lyxfont.C (latexWriteStartChanges):
6483 Check that font language is not equal to basefont language.
6484 (latexWriteEndChanges): ditto
6486 * src/lyx_cb.C (StyleReset): Don't change the language while using
6487 the font-default command.
6489 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6490 empty paragraph before a footnote.
6492 * src/insets/insetcommand.C (draw): Increase x correctly.
6494 * src/screen.C (ShowCursor): Change cursor shape if
6495 current language != document language.
6497 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6499 2000-03-31 Juergen Vigna <jug@sad.it>
6501 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6502 (Clone): changed mode how the paragraph-data is copied to the
6503 new clone-paragraph.
6505 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6506 GetInset(pos) with no inset anymore there (in inset UNDO)
6508 * src/insets/insetcommand.C (draw): small fix as here x is
6509 incremented not as much as width() returns (2 before, 2 behind = 4)
6511 2000-03-30 Juergen Vigna <jug@sad.it>
6513 * src/insets/insettext.C (InsetText): small fix in initialize
6514 widthOffset (should not be done in the init() function)
6516 2000-03-29 Amir Karger <karger@lyx.org>
6518 * lib/examples/it_ItemizeBullets.lyx: translation by
6521 * Implemented \textasciitilde and fixed a tiny bug in reLyX
6523 2000-03-29 Juergen Vigna <jug@sad.it>
6525 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
6527 * src/insets/insetfoot.C (Clone): small change as for the below
6528 new init function in the text-inset
6530 * src/insets/insettext.C (init): new function as I've seen that
6531 clone did not copy the Paragraph-Data!
6532 (LocalDispatch): Added code so that now we have some sort of Undo
6533 functionality (well actually we HAVE Undo ;)
6535 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6537 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6539 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6542 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6544 * src/main.C: added a runtime check that verifies that the xforms
6545 header used when building LyX and the library used when running
6546 LyX match. Exit with a message if they don't match. This is a
6547 version number check only.
6549 * src/buffer.C (save): Don't allocate memory on the heap for
6550 struct utimbuf times.
6552 * *: some using changes, use iosfwd instead of the real headers.
6554 * src/lyxfont.C use char const * instead of string for the static
6555 strings. Rewrite some functions to use sstream.
6557 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6559 * src/text.C (Backspace): hopefully fix the dreaded backaspace
6562 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6564 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
6565 of Geodesy (from Martin Vermeer)
6567 * lib/layouts/svjour.inc: include file for the Springer svjour
6568 class. It can be used to support journals other than JoG.
6570 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
6571 Miskiewicz <misiek@pld.org.pl>)
6572 * lib/reLyX/Makefile.am: ditto.
6574 2000-03-27 Juergen Vigna <jug@sad.it>
6576 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
6577 also some modifications with operations on selected text.
6579 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
6580 problems with clicking on insets (last famous words ;)
6582 * src/insets/insetcommand.C (draw):
6583 (width): Changed to have a bit of space before and after the inset so
6584 that the blinking cursor can be seen (otherwise it was hidden)
6586 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6588 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6589 would not be added to the link list when an installed gettext (not
6590 part of libc) is found.
6592 2000-03-24 Juergen Vigna <jug@sad.it>
6594 * src/insets/insetcollapsable.C (Edit):
6595 * src/mathed/formula.C (InsetButtonRelease):
6596 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6599 * src/BufferView.C (workAreaButtonPress):
6600 (workAreaButtonRelease):
6601 (checkInsetHit): Finally fixed the clicking on insets be handled
6604 * src/insets/insetert.C (Edit): inserted this call so that ERT
6605 insets work always with LaTeX-font
6607 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6609 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6610 caused lyx to startup with no GUI in place, causing in a crash
6611 upon startup when called with arguments.
6613 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6615 * src/FontLoader.C: better initialization of dummyXFontStruct.
6617 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6619 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6620 for linuxdoc and docbook import and export format options.
6622 * lib/lyxrc.example Example of default values for the previous flags.
6624 * src/lyx_cb.C Use those flags instead of the hardwired values for
6625 linuxdoc and docbook export.
6627 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6630 * src/menus.C Added menus entries for the new import/exports formats.
6632 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6634 * src/lyxrc.*: Added support for running without Gui
6637 * src/FontLoader.C: sensible defaults if no fonts are needed
6639 * src/lyx_cb.C: New function ShowMessage (writes either to the
6640 minibuffer or cout in case of no gui
6641 New function AskOverwrite for common stuff
6642 Consequently various changes to call these functions
6644 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
6645 wild guess at sensible screen resolution when having no gui
6647 * src/lyxfont.C: no gui, no fonts... set some defaults
6649 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6651 * src/LColor.C: made the command inset background a bit lighter.
6653 2000-03-20 Hartmut Goebel <goebel@noris.net>
6655 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
6656 stdstruct.inc. Koma-Script added some title elements which
6657 otherwise have been listed below "bibliography". This split allows
6658 adding title elements to where they belong.
6660 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
6661 define the additional tilte elements and then include
6664 * many other layout files: changed to include stdtitle.inc just
6665 before stdstruct.inc.
6667 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
6669 * src/buffer.C: (save) Added the option to store all backup files
6670 in a single directory
6672 * src/lyxrc.[Ch]: Added variable \backupdir_path
6674 * lib/lyxrc.example: Added descriptions of recently added variables
6676 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
6677 bibtex inset, not closing the bibtex popup when deleting the inset)
6679 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6681 * src/lyx_cb.C: add a couple using directives.
6683 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6684 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6685 import based on the filename.
6687 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6688 file would be imported at start, if the filename where of a sgml file.
6690 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6692 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6694 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6695 * src/lyxfont.h Replaced the member variable bits.direction by the
6696 member variable lang. Made many changes in other files.
6697 This allows having a multi-lingual document
6699 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6700 that change the current language to <l>.
6701 Removed the command "font-rtl"
6703 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6704 format for Hebrew documents)
6706 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6707 When auto_mathmode is "true", pressing a digit key in normal mode
6708 will cause entering into mathmode.
6709 If auto_mathmode is "rtl" then this behavior will be active only
6710 when writing right-to-left text.
6712 * src/text2.C (InsertStringA) The string is inserted using the
6715 * src/paragraph.C (GetEndLabel) Gives a correct result for
6716 footnote paragraphs.
6718 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6720 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6722 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6723 front of PasteParagraph. Never insert a ' '. This should at least
6724 fix some cause for the segfaults that we have been experiencing,
6725 it also fixes backspace behaviour slightly. (Phu!)
6727 * src/support/lstrings.C (compare_no_case): some change to make it
6728 compile with gcc 2.95.2 and stdlibc++-v3
6730 * src/text2.C (MeltFootnoteEnvironment): change type o
6731 first_footnote_par_is_not_empty to bool.
6733 * src/lyxparagraph.h: make text private. Changes in other files
6735 (fitToSize): new function
6736 (setContentsFromPar): new function
6737 (clearContents): new function
6738 (SetChar): new function
6740 * src/paragraph.C (readSimpleWholeFile): deleted.
6742 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6743 the file, just use a simple string instead. Also read the file in
6744 a more maintainable manner.
6746 * src/text2.C (InsertStringA): deleted.
6747 (InsertStringB): deleted.
6749 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6751 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6752 RedoParagraphs from the doublespace handling part, just set status
6753 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6754 done, but perhaps not like this.)
6756 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6758 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6759 character when inserting an inset.
6761 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6763 * src/bufferparams.C (readLanguage): now takes "default" into
6766 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6767 also initialize the toplevel_keymap with the default bindings from
6770 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6772 * all files using lyxrc: have lyxrc as a real variable and not a
6773 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6776 * src/lyxrc.C: remove double call to defaultKeyBindings
6778 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6779 toolbar defauls using lyxlex. Remove enums, structs, functions
6782 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6783 toolbar defaults. Also store default keybindings in a map.
6785 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6786 storing the toolbar defaults without any xforms dependencies.
6788 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6789 applied. Changed to use iterators.
6791 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6793 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6794 systems that don't have LINGUAS set to begin with.
6796 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6798 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6799 the list by Dekel Tsur.
6801 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6803 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6804 * src/insets/form_graphics.C: ditto.
6806 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6808 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6810 * src/bufferparams.C (readLanguage): use the new language map
6812 * src/intl.C (InitKeyMapper): use the new language map
6814 * src/lyx_gui.C (create_forms): use the new language map
6816 * src/language.[Ch]: New files. Used for holding the information
6817 about each language. Now! Use this new language map enhance it and
6818 make it really usable for our needs.
6820 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6822 * screen.C (ShowCursor): Removed duplicate code.
6823 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6824 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6826 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6829 * src/text.C Added TransformChar method. Used for rendering Arabic
6830 text correctly (change the glyphs of the letter according to the
6831 position in the word)
6836 * src/lyxrc.C Added lyxrc command {language_command_begin,
6837 language_command_end,language_command_ltr,language_command_rtl,
6838 language_package} which allows the use of either arabtex or Omega
6841 * src/lyx_gui.C (init)
6843 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6844 to use encoding for menu fonts which is different than the encoding
6847 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6848 do not load the babel package.
6849 To write an English document with Hebrew/Arabic, change the document
6850 language to "english".
6852 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6853 (alphaCounter): changed to return char
6854 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6856 * lib/lyxrc.example Added examples for Hebrew/Arabic
6859 * src/layout.C Added layout command endlabeltype
6861 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6863 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6865 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6867 * src/mathed/math_delim.C (search_deco): return a
6868 math_deco_struct* instead of index.
6870 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6872 * All files with a USE_OSTREAM_ONLY within: removed all code that
6873 was unused when USE_OSTREAM_ONLY is defined.
6875 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
6876 of any less. Removed header and using.
6878 * src/text.C (GetVisibleRow): draw the string "Page Break
6879 (top/bottom)" on screen when drawing a pagebreak line.
6881 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6883 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
6885 * src/mathed/math_macro.C (draw): do some cast magic.
6888 * src/mathed/math_defs.h: change byte* argument to byte const*.
6890 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
6892 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
6893 know it is right to return InsetFoot* too, but cxx does not like
6896 * src/insets/insetcollapsable.[Ch] (Clone): make const.
6898 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
6900 * src/mathed/math_delim.C: change == to proper assignment.
6902 2000-03-09 Juergen Vigna <jug@sad.it>
6904 * src/insets/insettext.C (setPos): fixed various cursor positioning
6905 problems (via mouse and cursor-keys)
6906 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
6907 inset (still a small display problem but it works ;)
6909 * src/insets/insetcollapsable.C (draw): added button_top_y and
6910 button_bottom_y to have correct values for clicking on the inset.
6912 * src/support/lyxalgo.h: commented out 'using std::less'
6914 2000-03-08 Juergen Vigna <jug@sad.it>
6916 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
6917 Button-Release event closes as it is alos the Release-Event
6920 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6922 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6924 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6925 can add multiple spaces in Scrap (literate programming) styles...
6926 which, by the way, is how I got hooked on LyX to begin with.
6928 * src/mathed/formula.C (Write): Added dummy variable to an
6929 inset::Latex() call.
6930 (Latex): Add free_spacing boolean to inset::Latex()
6932 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6934 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6935 virtual function to include the free_spacing boolean from
6936 the containing paragraph's style.
6938 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6939 Added free_spacing boolean arg to match inset.h
6941 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6942 Added free_spacing boolean arg to match inset.h
6944 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6945 Added free_spacing boolean and made sure that if in a free_spacing
6946 paragraph, that we output normal space if there is a protected space.
6948 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6949 Added free_spacing boolean arg to match inset.h
6951 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6952 Added free_spacing boolean arg to match inset.h
6954 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6955 Added free_spacing boolean arg to match inset.h
6957 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6958 Added free_spacing boolean arg to match inset.h
6960 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6961 Added free_spacing boolean arg to match inset.h
6963 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6964 free_spacing boolean arg to match inset.h
6966 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6967 Added free_spacing boolean arg to match inset.h
6969 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6970 Added free_spacing boolean arg to match inset.h
6972 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6973 Added free_spacing boolean arg to match inset.h
6975 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6976 Added free_spacing boolean arg to match inset.h
6978 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6979 Added free_spacing boolean arg to match inset.h
6981 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6982 free_spacing boolean arg to match inset.h
6984 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6985 free_spacing boolean arg to match inset.h
6987 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6988 ignore free_spacing paragraphs. The user's spaces are left
6991 * src/text.C (InsertChar): Fixed the free_spacing layout
6992 attribute behavior. Now, if free_spacing is set, you can
6993 add multiple spaces in a paragraph with impunity (and they
6994 get output verbatim).
6995 (SelectSelectedWord): Added dummy argument to inset::Latex()
6998 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7001 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7002 paragraph layouts now only input a simple space instead.
7003 Special character insets don't make any sense in free-spacing
7006 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7007 hard-spaces in the *input* file to simple spaces if the layout
7008 is free-spacing. This converts old files which had to have
7009 hard-spaces in free-spacing layouts where a simple space was
7011 (writeFileAscii): Added free_spacing check to pass to the newly
7012 reworked inset::Latex(...) methods. The inset::Latex() code
7013 ensures that hard-spaces in free-spacing paragraphs get output
7014 as spaces (rather than "~").
7016 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7018 * src/mathed/math_delim.C (draw): draw the empty placeholder
7019 delims with a onoffdash line.
7020 (struct math_deco_compare): struct that holds the "functors" used
7021 for the sort and the binary search in math_deco_table.
7022 (class init_deco_table): class used for initial sort of the
7024 (search_deco): use lower_bound to do a binary search in the
7027 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7029 * src/lyxrc.C: a small secret thingie...
7031 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7032 and to not flush the stream as often as it used to.
7034 * src/support/lyxalgo.h: new file
7035 (sorted): template function used for checking if a sequence is
7036 sorted or not. Two versions with and without user supplied
7037 compare. Uses same compare as std::sort.
7039 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7040 it and give warning on lyxerr.
7042 (struct compare_tags): struct with function operators used for
7043 checking if sorted, sorting and lower_bound.
7044 (search_kw): use lower_bound instead of manually implemented
7047 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7049 * src/insets/insetcollapsable.h: fix Clone() declaration.
7050 * src/insets/insetfoot.h: ditto.
7052 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7054 2000-03-08 Juergen Vigna <jug@sad.it>
7056 * src/insets/lyxinset.h: added owner call which tells us if
7057 this inset is inside another inset. Changed also the return-type
7058 of Editable to an enum so it tells clearer what the return-value is.
7060 * src/insets/insettext.C (computeTextRows): fixed computing of
7061 textinsets which split automatically on more rows.
7063 * src/insets/insetert.[Ch]: changed this to be of BaseType
7066 * src/insets/insetfoot.[Ch]: added footnote inset
7068 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7069 collapsable insets (like footnote, ert, ...)
7071 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7073 * src/lyxdraw.h: remvoe file
7075 * src/lyxdraw.C: remove file
7077 * src/insets/insettext.C: added <algorithm>.
7079 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7081 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7082 (matrix_cb): case MM_OK use string stream
7084 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7087 * src/mathed/math_macro.C (draw): use string stream
7088 (Metrics): use string stream
7090 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7091 directly to the ostream.
7093 * src/vspace.C (asString): use string stream.
7094 (asString): use string stream
7095 (asLatexString): use string stream
7097 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7098 setting Spacing::Other.
7100 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7101 sprintf when creating the stretch vale.
7103 * src/text2.C (alphaCounter): changed to return a string and to
7104 not use a static variable internally. Also fixed a one-off bug.
7105 (SetCounter): changed the drawing of the labels to use string
7106 streams instead of sprintf.
7108 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7109 manipulator to use a scheme that does not require library support.
7110 This is also the way it is done in the new GNU libstdc++. Should
7111 work with DEC cxx now.
7113 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7115 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7116 end. This fixes a bug.
7118 * src/mathed (all files concerned with file writing): apply the
7119 USE_OSTREAM_ONLY changes to mathed too.
7121 * src/support/DebugStream.h: make the constructor explicit.
7123 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7124 count and ostream squashed.
7126 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7128 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7130 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7131 ostringstream uses STL strings, and we might not.
7133 * src/insets/insetspecialchar.C: add using directive.
7134 * src/insets/insettext.C: ditto.
7136 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7138 * lib/layouts/seminar.layout: feeble attempt at a layout for
7139 seminar.cls, far from completet and could really use some looking
7140 at from people used to write layout files.
7142 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7143 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7144 a lot nicer and works nicely with ostreams.
7146 * src/mathed/formula.C (draw): a slightly different solution that
7147 the one posted to the list, but I think this one works too. (font
7148 size wrong in headers.)
7150 * src/insets/insettext.C (computeTextRows): some fiddling on
7151 Jürgens turf, added some comments that he should read.
7153 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7154 used and it gave compiler warnings.
7155 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7158 * src/lyx_gui.C (create_forms): do the right thing when
7159 show_banner is true/false.
7161 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7162 show_banner is false.
7164 * most file writing files: Now use iostreams to do almost all of
7165 the writing. Also instead of passing string &, we now use
7166 stringstreams. mathed output is still not adapted to iostreams.
7167 This change can be turned off by commenting out all the occurences
7168 of the "#define USE_OSTREAM_ONLY 1" lines.
7170 * src/WorkArea.C (createPixmap): don't output debug messages.
7171 (WorkArea): don't output debug messages.
7173 * lib/lyxrc.example: added a comment about the new variable
7176 * development/Code_rules/Rules: Added some more commente about how
7177 to build class interfaces and on how better encapsulation can be
7180 2000-03-03 Juergen Vigna <jug@sad.it>
7182 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7183 automatically with the width of the LyX-Window
7185 * src/insets/insettext.C (computeTextRows): fixed update bug in
7186 displaying text-insets (scrollvalues where not initialized!)
7188 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7190 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7191 id in the check of the result from lower_bound is not enough since
7192 lower_bound can return last too, and then res->id will not be a
7195 * all insets and some code that use them: I have conditionalized
7196 removed the Latex(string & out, ...) this means that only the
7197 Latex(ostream &, ...) will be used. This is a work in progress to
7198 move towards using streams for all output of files.
7200 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7203 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7205 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7206 routine (this fixes bug where greek letters were surrounded by too
7209 * src/support/filetools.C (findtexfile): change a bit the search
7210 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7211 no longer passed to kpsewhich, we may have to change that later.
7213 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7214 warning options to avoid problems with X header files (from Angus
7216 * acinclude.m4: regenerated.
7218 2000-03-02 Juergen Vigna <jug@sad.it>
7220 * src/insets/insettext.C (WriteParagraphData): Using the
7221 par->writeFile() function for writing paragraph-data.
7222 (Read): Using buffer->parseSingleLyXformat2Token()-function
7223 for parsing paragraph data!
7225 * src/buffer.C (readLyXformat2): removed all parse data and using
7226 the new parseSingleLyXformat2Token()-function.
7227 (parseSingleLyXformat2Token): added this function to parse (read)
7228 lyx-file-format (this is called also from text-insets now!)
7230 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7232 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7235 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7236 directly instead of going through a func. One very bad thing: a
7237 static LyXFindReplace, but I don't know where to place it.
7239 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7240 string instead of char[]. Also changed to static.
7241 (GetSelectionOrWordAtCursor): changed to static inline
7242 (SetSelectionOverLenChars): ditto.
7244 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7245 current_view and global variables. both classes has changed names
7246 and LyXFindReplace is not inherited from SearchForm.
7248 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7249 fl_form_search form.
7251 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7253 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7255 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7256 bound (from Kayvan).
7258 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7260 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7262 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7264 * some things that I should comment but the local pub says head to
7267 * comment out all code that belongs to the Roff code for Ascii
7268 export of tables. (this is unused)
7270 * src/LyXView.C: use correct type for global variable
7271 current_layout. (LyXTextClass::size_type)
7273 * some code to get the new insetgraphics closer to working I'd be
7274 grateful for any help.
7276 * src/BufferView2.C (insertInset): use the return type of
7277 NumberOfLayout properly. (also changes in other files)
7279 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7280 this as a test. I want to know what breaks because of this.
7282 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7284 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7286 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7287 to use a \makebox in the label, this allows proper justification
7288 with out using protected spaces or multiple hfills. Now it is
7289 "label" for left justified, "\hfill label\hfill" for center, and
7290 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7291 should be changed accordingly.
7293 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7295 * src/lyxtext.h: change SetLayout() to take a
7296 LyXTextClass::size_type instead of a char (when there is more than
7297 127 layouts in a class); also change type of copylayouttype.
7298 * src/text2.C (SetLayout): ditto.
7299 * src/LyXView.C (updateLayoutChoice): ditto.
7301 * src/LaTeX.C (scanLogFile): errors where the line number was not
7302 given just after the '!'-line were ignored (from Dekel Tsur).
7304 * lib/lyxrc.example: fix description of \date_insert_format
7306 * lib/layouts/llncs.layout: new layout, contributed by Martin
7309 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7311 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7312 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7313 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7314 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7315 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
7316 paragraph.C, text.C, text2.C)
7318 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7320 * src/insets/insettext.C (LocalDispatch): remove extra break
7323 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7324 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7326 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7327 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7329 * src/insets/insetbib.h: move InsetBibkey::Holder and
7330 InsetCitation::Holder in public space.
7332 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7334 * src/insets/insettext.h: small change to get the new files from
7335 Juergen to compile (use "string", not "class string").
7337 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7338 const & as parameter to LocalDispatch, use LyXFont const & as
7339 paramter to some other func. This also had impacto on lyxinsets.h
7340 and the two mathed insets.
7342 2000-02-24 Juergen Vigna <jug@sad.it>
7345 * src/commandtags.h:
7347 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7351 * src/BufferView2.C: added/updated code for various inset-functions
7353 * src/insets/insetert.[Ch]: added implementation of InsetERT
7355 * src/insets/insettext.[Ch]: added implementation of InsetText
7357 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7358 (draw): added preliminary code for inset scrolling not finshed yet
7360 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7361 as it is in lyxfunc.C now
7363 * src/insets/lyxinset.h: Added functions for text-insets
7365 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7367 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7368 BufferView and reimplement the list as a queue put inside its own
7371 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7373 * several files: use the new interface to the "updateinsetlist"
7375 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7377 (work_area_handler): call BufferView::trippleClick on trippleclick.
7379 * src/BufferView.C (doubleClick): new function, selects word on
7381 (trippleClick): new function, selects line on trippleclick.
7383 2000-02-22 Allan Rae <rae@lyx.org>
7385 * lib/bind/xemacs.bind: buffer-previous not supported
7387 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7389 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7392 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7394 * src/bufferlist.C: get rid of current_view from this file
7396 * src/spellchecker.C: get rid of current_view from this file
7398 * src/vspace.C: get rid of current_view from this file
7399 (inPixels): added BufferView parameter for this func
7400 (asLatexCommand): added a BufferParams for this func
7402 * src/text.C src/text2.C: get rid of current_view from these
7405 * src/lyxfont.C (getFontDirection): move this function here from
7408 * src/bufferparams.C (getDocumentDirection): move this function
7411 * src/paragraph.C (getParDirection): move this function here from
7413 (getLetterDirection): ditto
7415 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7417 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7418 resize due to wrong pixmap beeing used. Also took the opurtunity
7419 to make the LyXScreen stateless on regard to WorkArea and some
7420 general cleanup in the same files.
7422 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7424 * src/Makefile.am: add missing direction.h
7426 * src/PainterBase.h: made the width functions const.
7428 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7431 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7433 * src/insets/insetlatexaccent.C (draw): make the accents draw
7434 better, at present this will only work well with iso8859-1.
7436 * several files: remove the old drawing code, now we use the new
7439 * several files: remove support for mono_video, reverse_video and
7442 2000-02-17 Juergen Vigna <jug@sad.it>
7444 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7445 int ** as we have to return the pointer, otherwise we have only
7446 NULL pointers in the returning function.
7448 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7450 * src/LaTeX.C (operator()): quote file name when running latex.
7452 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7454 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7455 (bubble tip), this removes our special handling of this.
7457 * Remove all code that is unused now that we have the new
7458 workarea. (Code that are not active when NEW_WA is defined.)
7460 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7462 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7464 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7465 nonexisting layout; correctly redirect obsoleted layouts.
7467 * lib/lyxrc.example: document \view_dvi_paper_option
7469 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7472 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7473 (PreviewDVI): handle the view_dvi_paper_option variable.
7474 [Both from Roland Krause]
7476 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7478 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7479 char const *, int, LyXFont)
7480 (text(int, int, string, LyXFont)): ditto
7482 * src/text.C (InsertCharInTable): attempt to fix the double-space
7483 feature in tables too.
7484 (BackspaceInTable): ditto.
7485 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7487 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7489 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7491 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7492 newly found text in textcache to this.
7493 (buffer): set the owner of the text put into the textcache to 0
7495 * src/insets/figinset.C (draw): fixed the drawing of figures with
7498 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7499 drawing of mathframe, hfills, protected space, table lines. I have
7500 now no outstanding drawing problems with the new Painter code.
7502 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7504 * src/PainterBase.C (ellipse, circle): do not specify the default
7507 * src/LColor.h: add using directive.
7509 * src/Painter.[Ch]: change return type of methods from Painter& to
7510 PainterBase&. Add a using directive.
7512 * src/WorkArea.C: wrap xforms callbacks in C functions
7515 * lib/layouts/foils.layout: font fix and simplifications from Carl
7518 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7520 * a lot of files: The Painter, LColor and WorkArea from the old
7521 devel branch has been ported to lyx-devel. Some new files and a
7522 lot of #ifdeffed code. The new workarea is enabled by default, but
7523 if you want to test the new Painter and LColor you have to compile
7524 with USE_PAINTER defined (do this in config.h f.ex.) There are
7525 still some rought edges, and I'd like some help to clear those
7526 out. It looks stable (loads and displays the Userguide very well).
7529 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7531 * src/buffer.C (pop_tag): revert to the previous implementation
7532 (use a global variable for both loops).
7534 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7536 * src/lyxrc.C (LyXRC): change slightly default date format.
7538 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7539 there is an English text with a footnote that starts with a Hebrew
7540 paragraph, or vice versa.
7541 (TeXFootnote): ditto.
7543 * src/text.C (LeftMargin): allow for negative values for
7544 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7547 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7548 for input encoding (cyrillic)
7550 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7552 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7555 * src/toolbar.C (set): ditto
7556 * src/insets/insetbib.C (create_form_citation_form): ditto
7558 * lib/CREDITS: added Dekel Tsur.
7560 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
7561 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
7562 hebrew supports files from Dekel Tsur.
7564 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
7565 <tzafrir@technion.ac.il>
7567 * src/lyxrc.C: put \date_insert_format at the right place.
7569 * src/buffer.C (makeLaTeXFile): fix the handling of
7570 BufferParams::sides when writing out latex files.
7572 * src/BufferView2.C: add a "using" directive.
7574 * src/support/lyxsum.C (sum): when we use lyxstring,
7575 ostringstream::str needs an additional .c_str().
7577 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7579 * src/support/filetools.C (ChangeExtension): patch from Etienne
7582 * src/TextCache.C (show): remove const_cast and make second
7583 parameter non-const LyXText *.
7585 * src/TextCache.h: use non const LyXText in show.
7587 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7590 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7592 * src/support/lyxsum.C: rework to be more flexible.
7594 * several places: don't check if a pointer is 0 if you are going
7597 * src/text.C: remove some dead code.
7599 * src/insets/figinset.C: remove some dead code
7601 * src/buffer.C: move the BufferView funcs to BufferView2.C
7602 remove all support for insetlatexdel
7603 remove support for oldpapersize stuff
7604 made some member funcs const
7606 * src/kbmap.C: use a std::list to store the bindings in.
7608 * src/BufferView2.C: new file
7610 * src/kbsequence.[Ch]: new files
7612 * src/LyXAction.C + others: remove all trace of buffer-previous
7614 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7615 only have one copy in the binary of this table.
7617 * hebrew patch: moved some functions from LyXText to more
7618 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7620 * several files: remove support for XForms older than 0.88
7622 remove some #if 0 #endif code
7624 * src/TextCache.[Ch]: new file. Holds the textcache.
7626 * src/BufferView.C: changes to use the new TextCache interface.
7627 (waitForX): remove the now unused code.
7629 * src/BackStack.h: remove some commented code
7631 * lib/bind/emacs.bind: remove binding for buffer-previous
7633 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7635 * applied the hebrew patch.
7637 * src/lyxrow.h: make sure that all Row variables are initialized.
7639 * src/text2.C (TextHandleUndo): comment out a delete, this might
7640 introduce a memory leak, but should also help us to not try to
7641 read freed memory. We need to look at this one.
7643 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
7644 (LyXParagraph): initalize footnotekind.
7646 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
7647 forgot this when applying the patch. Please heed the warnings.
7649 * src/BufferView.C (buffer): a fix for the buffer-reload problem
7650 (aka. reformat problem)
7652 * src/bufferlist.C (exists): made const, and use const_iterator
7653 (isLoaded): new func.
7654 (release): use std::find to find the correct buffer.
7656 * src/bufferlist.h: made getState a const func.
7657 made empty a const func.
7658 made exists a const func.
7661 2000-02-01 Juergen Vigna <jug@sad.it>
7663 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
7665 * po/it.po: updated a bit the italian po file and also changed the
7666 'file nuovo' for newfile to 'filenuovo' without a space, this did
7669 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
7670 for the new insert_date command.
7672 * src/lyxfunc.C (Dispatch): added support for a insert_date function
7673 from jdblair, to insert a date into the current text conforming to
7674 a strftime format (for now only considering the locale-set and not
7675 the document-language).
7677 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7679 * src/lyxfont.C (textWidth): hopefully better fix for the Array
7680 Bounds Read error seen by purify. The problem was that islower is
7681 a macros which takes an unsigned char and uses it as an index for
7682 in array of characters properties (and is thus subject to the
7686 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7687 correctly the paper sides radio buttons.
7688 (UpdateDocumentButtons): ditto.
7690 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7692 * src/kbmap.C (getsym + others): change to return unsigned int,
7693 returning a long can give problems on 64 bit systems. (I assume
7694 that int is 32bit on 64bit systems)
7696 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7698 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7699 LyXLookupString to be zero-terminated. Really fixes problems seen
7702 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7704 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7705 write a (char*)0 to the lyxerr stream.
7707 * src/lastfiles.C: move algorithm before the using statemets.
7709 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7711 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7712 complains otherwise).
7713 * src/table.C: ditto
7715 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7718 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7719 that I removed earlier... It is really needed.
7721 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7723 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7725 * INSTALL: update xforms home page URL.
7727 * lib/configure.m4: fix a bug with unreadable layout files.
7729 * src/table.C (calculate_width_of_column): add "using std::max"
7732 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7734 * several files: marked several lines with "DEL LINE", this is
7735 lines that can be deleted without changing anything.
7736 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7737 checks this anyway */
7740 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7742 * src/DepTable.C (update): add a "+" at the end when the checksum
7743 is different. (debugging string only)
7745 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7746 the next inset to not be displayed. This should also fix the list
7747 of labels in the "Insert Crossreference" dialog.
7749 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7751 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7752 when regex was not found.
7754 * src/support/lstrings.C (lowercase): use handcoded transform always.
7757 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7758 old_cursor.par->prev could be 0.
7760 * several files: changed post inc/dec to pre inc/dec
7762 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7763 write the lastfiles to file.
7765 * src/BufferView.C (buffer): only show TextCache info when debugging
7767 (resizeCurrentBuffer): ditto
7768 (workAreaExpose): ditto
7770 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7772 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7774 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7775 a bit better by removing the special case for \i and \j.
7777 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7779 * src/lyx_main.C (easyParse): remove test for bad comand line
7780 options, since this broke all xforms-related parsing.
7782 * src/kbmap.C (getsym): set return type to unsigned long, as
7783 declared in header. On an alpha, long is _not_ the same as int.
7785 * src/support/LOstream.h: add a "using std::flush;"
7787 * src/insets/figinset.C: ditto.
7789 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7791 * src/bufferlist.C (write): use blinding fast file copy instead of
7792 "a char at a time", now we are doing it the C++ way.
7794 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7795 std::list<int> instead.
7796 (addpidwait): reflect move to std::list<int>
7797 (sigchldchecker): ditto
7799 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7802 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7803 that obviously was wrong...
7805 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7806 c, this avoids warnings with purify and islower.
7808 * src/insets/figinset.C: rename struct queue to struct
7809 queue_element and rewrite to use a std::queue. gsqueue is now a
7810 std::queue<queue_element>
7811 (runqueue): reflect move to std::queue
7814 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7815 we would get "1" "0" instead of "true" "false. Also make the tostr
7818 2000-01-21 Juergen Vigna <jug@sad.it>
7820 * src/buffer.C (writeFileAscii): Disabled code for special groff
7821 handling of tabulars till I fix this in table.C
7823 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7825 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7827 * src/support/lyxlib.h: ditto.
7829 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7831 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7832 and 'j' look better. This might fix the "macron" bug that has been
7835 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7836 functions as one template function. Delete the old versions.
7838 * src/support/lyxsum.C: move using std::ifstream inside
7841 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7844 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7846 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7848 * src/insets/figinset.C (InitFigures): use new instead of malloc
7849 to allocate memory for figures and bitmaps.
7850 (DoneFigures): use delete[] instead of free to deallocate memory
7851 for figures and bitmaps.
7852 (runqueue): use new to allocate
7853 (getfigdata): use new/delete[] instead of malloc/free
7854 (RegisterFigure): ditto
7856 * some files: moved some declarations closer to first use, small
7857 whitespace changes use preincrement instead of postincrement where
7858 it does not make a difference.
7860 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7861 step on the way to use stl::containers for key maps.
7863 * src/bufferlist.h: add a typedef for const_iterator and const
7864 versions of begin and end.
7866 * src/bufferlist.[Ch]: change name of member variable _state to
7867 state_. (avoid reserved names)
7869 (getFileNames): returns the filenames of the buffers in a vector.
7871 * configure.in (ALL_LINGUAS): added ro
7873 * src/support/putenv.C: new file
7875 * src/support/mkdir.C: new file
7877 2000-01-20 Allan Rae <rae@lyx.org>
7879 * lib/layouts/IEEEtran.layout: Added several theorem environments
7881 * lib/templates/IEEEtran.lyx: Example theorem environments and a
7882 couple of minor additions.
7884 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
7885 (except for those in footnotes of course)
7887 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7889 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
7891 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
7892 std::sort and std::lower_bound instead of qsort and handwritten
7894 (struct compara): struct that holds the functors used by std::sort
7895 and std::lower_bound in MathedLookupBOP.
7897 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7899 * src/support/LAssert.h: do not do partial specialization. We do
7902 * src/support/lyxlib.h: note that lyx::getUserName() and
7903 lyx::date() are not in use right now. Should these be suppressed?
7905 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
7906 (makeLinuxDocFile): do not put date and user name in linuxdoc
7909 * src/support/lyxlib.h (kill): change first argument to long int,
7910 since that's what solaris uses.
7912 * src/support/kill.C (kill): fix declaration to match prototype.
7914 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
7915 actually check whether namespaces are supported. This is not what
7918 * src/support/lyxsum.C: add a using directive.
7920 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7922 * src/support/kill.C: if we have namespace support we don't have
7923 to include lyxlib.h.
7925 * src/support/lyxlib.h: use namespace lyx if supported.
7927 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7929 * src/support/date.C: new file
7931 * src/support/chdir.C: new file
7933 * src/support/getUserName.C: new file
7935 * src/support/getcwd.C: new file
7937 * src/support/abort.C: new file
7939 * src/support/kill.C: new file
7941 * src/support/lyxlib.h: moved all the functions in this file
7942 insede struct lyx. Added also kill and abort to this struct. This
7943 is a way to avoid the "kill is not defined in <csignal>", we make
7944 C++ wrappers for functions that are not ANSI C or ANSI C++.
7946 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7947 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7948 lyx it has been renamed to sum.
7950 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7952 * src/text.C: add using directives for std::min and std::max.
7954 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7956 * src/texrow.C (getIdFromRow): actually return something useful in
7957 id and pos. Hopefully fixes the bug with positionning of errorbox
7960 * src/lyx_main.C (easyParse): output an error and exit if an
7961 incorrect command line option has been given.
7963 * src/spellchecker.C (ispell_check_word): document a memory leak.
7965 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7966 where a "struct utimbuf" is allocated with "new" and deleted with
7969 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7971 * src/text2.C (CutSelection): don't delete double spaces.
7972 (PasteSelection): ditto
7973 (CopySelection): ditto
7975 * src/text.C (Backspace): don't delete double spaces.
7977 * src/lyxlex.C (next): fix a bug that were only present with
7978 conformant std::istream::get to read comment lines, use
7979 std::istream::getline instead. This seems to fix the problem.
7981 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7983 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7984 allowed to insert space before space" editing problem. Please read
7985 commends at the beginning of the function. Comments about usage
7988 * src/text.C (InsertChar): fix for the "not allowed to insert
7989 space before space" editing problem.
7991 * src/text2.C (DeleteEmptyParagraphMechanism): when
7992 IsEmptyTableRow can only return false this last "else if" will
7993 always be a no-op. Commented out.
7995 * src/text.C (RedoParagraph): As far as I can understand tmp
7996 cursor is not really needed.
7998 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7999 present it could only return false anyway.
8000 (several functions): Did something not so smart...added a const
8001 specifier on a lot of methods.
8003 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8004 and add a tmp->text.resize. The LyXParagraph constructor does the
8006 (BreakParagraphConservative): ditto
8008 * src/support/path.h (Path): add a define so that the wrong usage
8009 "Path("/tmp") will be flagged as a compilation error:
8010 "`unnamed_Path' undeclared (first use this function)"
8012 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8014 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8015 which was bogus for several reasons.
8017 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8021 * autogen.sh: do not use "type -path" (what's that anyway?).
8023 * src/support/filetools.C (findtexfile): remove extraneous space
8024 which caused a kpsewhich warning (at least with kpathsea version
8027 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8029 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8031 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8033 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8035 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8037 * src/paragraph.C (BreakParagraph): do not reserve space on text
8038 if we don't need to (otherwise, if pos_end < pos, we end up
8039 reserving huge amounts of memory due to bad unsigned karma).
8040 (BreakParagraphConservative): ditto, although I have not seen
8041 evidence the bug can happen here.
8043 * src/lyxparagraph.h: add a using std::list.
8045 2000-01-11 Juergen Vigna <jug@sad.it>
8047 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8050 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8052 * src/vc-backend.C (doVCCommand): change to be static and take one
8053 more parameter: the path to chdir too be fore executing the command.
8054 (retrive): new function equiv to "co -r"
8056 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8057 file_not_found_hook is true.
8059 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8061 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8062 if a file is readwrite,readonly...anything else.
8064 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8066 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8067 (CreatePostscript): name change from MenuRunDVIPS (or something)
8068 (PreviewPostscript): name change from MenuPreviewPS
8069 (PreviewDVI): name change from MenuPreviewDVI
8071 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8072 \view_pdf_command., \pdf_to_ps_command
8074 * lib/configure.m4: added search for PDF viewer, and search for
8075 PDF to PS converter.
8076 (lyxrc.defaults output): add \pdflatex_command,
8077 \view_pdf_command and \pdf_to_ps_command.
8079 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8081 * src/bufferlist.C (write): we don't use blocksize for anything so
8084 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8086 * src/support/block.h: disable operator T* (), since it causes
8087 problems with both compilers I tried. See comments in the file.
8089 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8092 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8093 variable LYX_DIR_10x to LYX_DIR_11x.
8095 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8097 * INSTALL: document --with-lyxname.
8100 * configure.in: new configure flag --with-lyxname which allows to
8101 choose the name under which lyx is installed. Default is "lyx", of
8102 course. It used to be possible to do this with --program-suffix,
8103 but the later has in fact a different meaning for autoconf.
8105 * src/support/lstrings.h (lstrchr): reformat a bit.
8107 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8108 * src/mathed/math_defs.h: ditto.
8110 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8112 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8113 true, decides if we create a backup file or not when saving. New
8114 tag and variable \pdf_mode, defaults to false. New tag and
8115 variable \pdflatex_command, defaults to pdflatex. New tag and
8116 variable \view_pdf_command, defaults to xpdf. New tag and variable
8117 \pdf_to_ps_command, defaults to pdf2ps.
8119 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8121 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8122 does not have a BufferView.
8123 (unlockInset): ditto + don't access the_locking_inset if the
8124 buffer does not have a BufferView.
8126 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8127 certain circumstances so that we don't continue a keyboard
8128 operation long after the key was released. Try f.ex. to load a
8129 large document, press PageDown for some seconds and then release
8130 it. Before this change the document would contine to scroll for
8131 some time, with this change it stops imidiatly.
8133 * src/support/block.h: don't allocate more space than needed. As
8134 long as we don't try to write to the arr[x] in a array_type arr[x]
8135 it is perfectly ok. (if you write to it you might segfault).
8136 added operator value_type*() so that is possible to pass the array
8137 to functions expecting a C-pointer.
8139 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8142 * intl/*: updated to gettext 0.10.35, tried to add our own
8143 required modifications. Please verify.
8145 * po/*: updated to gettext 0.10.35, tried to add our own required
8146 modifications. Please verify.
8148 * src/support/lstrings.C (tostr): go at fixing the problem with
8149 cxx and stringstream. When stringstream is used return
8150 oss.str().c_str() so that problems with lyxstring and basic_string
8151 are avoided. Note that the best solution would be for cxx to use
8152 basic_string all the way, but it is not conformant yet. (it seems)
8154 * src/lyx_cb.C + other files: moved several global functions to
8155 class BufferView, some have been moved to BufferView.[Ch] others
8156 are still located in lyx_cb.C. Code changes because of this. (part
8157 of "get rid of current_view project".)
8159 * src/buffer.C + other files: moved several Buffer functions to
8160 class BufferView, the functions are still present in buffer.C.
8161 Code changes because of this.
8163 * config/lcmessage.m4: updated to most recent. used when creating
8166 * config/progtest.m4: updated to most recent. used when creating
8169 * config/gettext.m4: updated to most recent. applied patch for
8172 * config/gettext.m4.patch: new file that shows what changes we
8173 have done to the local copy of gettext.m4.
8175 * config/libtool.m4: new file, used in creation of acinclude.m4
8177 * config/lyxinclude.m4: new file, this is the lyx created m4
8178 macros, used in making acinclude.m4.
8180 * autogen.sh: GNU m4 discovered as a separate task not as part of
8181 the lib/configure creation.
8182 Generate acinlucde from files in config. Actually cat
8183 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8184 easier to upgrade .m4 files that really are external.
8186 * src/Spacing.h: moved using std::istringstream to right after
8187 <sstream>. This should fix the problem seen with some compilers.
8189 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8191 * src/lyx_cb.C: began some work to remove the dependency a lot of
8192 functions have on BufferView::text, even if not really needed.
8193 (GetCurrentTextClass): removed this func, it only hid the
8196 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8197 forgot this in last commit.
8199 * src/Bullet.C (bulletEntry): use static char const *[] for the
8200 tables, becuase of this the return arg had to change to string.
8202 (~Bullet): removed unneeded destructor
8204 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8205 (insetSleep): moved from Buffer
8206 (insetWakeup): moved from Buffer
8207 (insetUnlock): moved from Buffer
8209 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8210 from Buffer to BufferView.
8212 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8214 * config/ltmain.sh: updated to version 1.3.4 of libtool
8216 * config/ltconfig: updated to version 1.3.4 of libtool
8218 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8221 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8222 Did I get that right?
8224 * src/lyxlex.h: add a "using" directive or two.
8225 * src/Spacing.h: ditto.
8226 * src/insets/figinset.C: ditto.
8227 * src/support/filetools.C: ditto.
8228 * src/support/lstrings.C: ditto.
8229 * src/BufferView.C: ditto.
8230 * src/bufferlist.C: ditto.
8231 * src/lyx_cb.C: ditto.
8232 * src/lyxlex.C: ditto.
8234 * NEWS: add some changes for 1.1.4.
8236 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8238 * src/BufferView.C: first go at a TextCache to speed up switching
8241 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8243 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8244 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8245 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8246 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8249 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8250 members of the struct are correctly initialized to 0 (detected by
8252 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8253 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8255 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8256 pidwait, since it was allocated with "new". This was potentially
8257 very bad. Thanks to Michael Schmitt for running purify for us.
8260 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8262 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8264 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8266 1999-12-30 Allan Rae <rae@lyx.org>
8268 * lib/templates/IEEEtran.lyx: minor change
8270 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8271 src/mathed/formula.C (LocalDispatch): askForText changes
8273 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8274 know when a user has cancelled input. Fixes annoying problems with
8275 inserting labels and version control.
8277 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8279 * src/support/lstrings.C (tostr): rewritten to use strstream and
8282 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8284 * src/support/filetools.C (IsFileWriteable): use fstream to check
8285 (IsDirWriteable): use fileinfo to check
8287 * src/support/filetools.h (FilePtr): whole class deleted
8289 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8291 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8293 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8295 * src/bufferlist.C (write): use ifstream and ofstream instead of
8298 * src/Spacing.h: use istrstream instead of sscanf
8300 * src/mathed/math_defs.h: change first arg to istream from FILE*
8302 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8304 * src/mathed/math_parser.C: have yyis to be an istream
8305 (LexGetArg): use istream (yyis)
8307 (mathed_parse): ditto
8308 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8310 * src/mathed/formula.C (Read): rewritten to use istream
8312 * src/mathed/formulamacro.C (Read): rewritten to use istream
8314 * src/lyxlex.h (~LyXLex): deleted desturctor
8315 (getStream): new function, returns an istream
8316 (getFile): deleted funtion
8317 (IsOK): return is.good();
8319 * src/lyxlex.C (LyXLex): delete file and owns_file
8320 (setFile): open an filebuf and assign that to a istream instead of
8322 (setStream): new function, takes an istream as arg.
8323 (setFile): deleted function
8324 (EatLine): rewritten us use istream instead of FILE*
8328 * src/table.C (LyXTable): use istream instead of FILE*
8329 (Read): rewritten to take an istream instead of FILE*
8331 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8333 * src/buffer.C (Dispatch): remove an extraneous break statement.
8335 * src/support/filetools.C (QuoteName): change to do simple
8336 'quoting'. More work is necessary. Also changed to do nothing
8337 under emx (needs fix too).
8338 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8340 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8341 config.h.in to the AC_DEFINE_UNQUOTED() call.
8342 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8343 needs char * as argument (because Solaris 7 declares it like
8346 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8347 remove definition of BZERO.
8349 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8351 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8352 defined, "lyxregex.h" if not.
8354 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8356 (REGEX): new variable that is set to regex.c lyxregex.h when
8357 AM_CONDITIONAL USE_REGEX is set.
8358 (libsupport_la_SOURCES): add $(REGEX)
8360 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8363 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8366 * configure.in: add call to LYX_REGEX
8368 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8369 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8371 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8373 * lib/bind/fi_menus.bind: new file, from
8374 pauli.virtanen@saunalahti.fi.
8376 * src/buffer.C (getBibkeyList): pass the parameter delim to
8377 InsetInclude::getKeys and InsetBibtex::getKeys.
8379 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8380 is passed to Buffer::getBibkeyList
8382 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8383 instead of the hardcoded comma.
8385 * src/insets/insetbib.C (getKeys): make sure that there are not
8386 leading blanks in bibtex keys. Normal latex does not care, but
8387 harvard.sty seems to dislike blanks at the beginning of citation
8388 keys. In particular, the retturn value of the function is
8390 * INSTALL: make it clear that libstdc++ is needed and that gcc
8391 2.7.x probably does not work.
8393 * src/support/filetools.C (findtexfile): make debug message go to
8395 * src/insets/insetbib.C (getKeys): ditto
8397 * src/debug.C (showTags): make sure that the output is correctly
8400 * configure.in: add a comment for TWO_COLOR_ICON define.
8402 * acconfig.h: remove all the entries that already defined in
8403 configure.in or acinclude.m4.
8405 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8406 to avoid user name, date and copyright.
8408 1999-12-21 Juergen Vigna <jug@sad.it>
8410 * src/table.C (Read): Now read bogus row format informations
8411 if the format is < 5 so that afterwards the table can
8412 be read by lyx but without any format-info. Fixed the
8413 crash we experienced when not doing this.
8415 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8417 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8418 (RedoDrawingOfParagraph): ditto
8419 (RedoParagraphs): ditto
8420 (RemoveTableRow): ditto
8422 * src/text.C (Fill): rename arg paperwidth -> paper_width
8424 * src/buffer.C (insertLyXFile): rename var filename -> fname
8425 (writeFile): rename arg filename -> fname
8426 (writeFileAscii): ditto
8427 (makeLaTeXFile): ditto
8428 (makeLinuxDocFile): ditto
8429 (makeDocBookFile): ditto
8431 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8434 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8436 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8439 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8440 compiled by a C compiler not C++.
8442 * src/layout.h (LyXTextClass): added typedef for const_iterator
8443 (LyXTextClassList): added typedef for const_iterator + member
8444 functions begin and end.
8446 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8447 iterators to fill the choice_class.
8448 (updateLayoutChoice): rewritten to use iterators to fill the
8449 layoutlist in the toolbar.
8451 * src/BufferView.h (BufferView::work_area_width): removed unused
8454 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8456 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8457 (sgmlCloseTag): ditto
8459 * src/support/lstrings.h: return type of countChar changed to
8462 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8463 what version of this func to use. Also made to return unsigned int.
8465 * configure.in: call LYX_STD_COUNT
8467 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8468 conforming std::count.
8470 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8472 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8473 and a subscript would give bad display (patch from Dekel Tsur
8474 <dekel@math.tau.ac.il>).
8476 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8478 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8481 * src/chset.h: add a few 'using' directives
8483 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8484 triggered when no buffer is active
8486 * src/layout.C: removed `break' after `return' in switch(), since
8489 * src/lyx_main.C (init): make sure LyX can be ran in place even
8490 when libtool has done its magic with shared libraries. Fix the
8491 test for the case when the system directory has not been found.
8493 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8494 name for the latex file.
8495 (MenuMakeHTML): ditto
8497 * src/buffer.h: add an optional boolean argument, which is passed
8500 1999-12-20 Allan Rae <rae@lyx.org>
8502 * lib/templates/IEEEtran.lyx: small correction and update.
8504 * configure.in: Attempted to use LYX_PATH_HEADER
8506 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8508 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8509 input from JMarc. Now use preprocessor to find the header.
8510 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8511 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8512 LYX_STL_STRING_FWD. See comments in file.
8514 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
8516 * The global MiniBuffer * minibuffer variable is dead.
8518 * The global FD_form_main * fd_form_main variable is dead.
8520 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8522 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
8524 * src/table.h: add the LOstream.h header
8525 * src/debug.h: ditto
8527 * src/LyXAction.h: change the explaination of the ReadOnly
8528 attribute: is indicates that the function _can_ be used.
8530 * src/LyXAction.C (init): find-replace _can_ be used in read-only
8533 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8535 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8541 * src/paragraph.C (GetWord): assert on pos>=0
8544 * src/support/lyxstring.C: condition the use of an invariant on
8546 * src/support/lyxstring.h: ditto
8548 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8549 Use LAssert.h instead of plain assert().
8551 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8553 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8554 * src/support/filetools.C: ditto
8556 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
8559 * INSTALL: document the new configure flags
8561 * configure.in: suppress --with-debug; add --enable-assertions
8563 * acinclude.m4: various changes in alignment of help strings.
8565 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8567 * src/kbmap.C: commented out the use of the hash map in kb_map,
8568 beginning of movement to a stl::container.
8570 * several files: removed code that was not in effect when
8571 MOVE_TEXT was defined.
8573 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
8574 for escaping should not be used. We can discuss if the string
8575 should be enclosed in f.ex. [] instead of "".
8577 * src/trans_mgr.C (insert): use the new returned value from
8578 encodeString to get deadkeys and keymaps done correctly.
8580 * src/chset.C (encodeString): changed to return a pair, to tell
8581 what to use if we know the string.
8583 * src/lyxscreen.h (fillArc): new function.
8585 * src/FontInfo.C (resize): rewritten to use more std::string like
8586 structore, especially string::replace.
8588 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8591 * configure.in (chmod +x some scripts): remove config/gcc-hack
8593 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8595 * src/buffer.C (writeFile): change once again the top comment in a
8596 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8597 instead of an hardcoded version number.
8598 (makeDocBookFile): ditto
8600 * src/version.h: add new define LYX_DOCVERSION
8602 * po/de.po: update from Pit Sütterlin
8603 * lib/bind/de_menus.bind: ditto.
8605 * src/lyxfunc.C (Dispatch): call MenuExport()
8606 * src/buffer.C (Dispatch): ditto
8608 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8609 LyXFunc::Dispatch().
8610 (MenuExport): new function, moved from
8611 LyXFunc::Dispatch().
8613 * src/trans_mgr.C (insert): small cleanup
8614 * src/chset.C (loadFile): ditto
8616 * lib/kbd/iso8859-1.cdef: add missing backslashes
8618 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8620 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8621 help with placing the manually drawn accents better.
8623 (Draw): x2 and hg changed to float to minimize rounding errors and
8624 help place the accents better.
8626 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8627 unsigned short to char is just wrong...cast the char to unsigned
8628 char instead so that the two values can compare sanely. This
8629 should also make the display of insetlatexaccents better and
8630 perhaps also some other insets.
8632 (lbearing): new function
8635 1999-12-15 Allan Rae <rae@lyx.org>
8637 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
8638 header that provides a wrapper around the very annoying SGI STL header
8641 * src/support/lyxstring.C, src/LString.h:
8642 removed old SGI-STL-compatability attempts.
8644 * configure.in: Use LYX_STL_STRING_FWD.
8646 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
8647 stl_string_fwd.h is around and try to determine it's location.
8648 Major improvement over previous SGI STL 3.2 compatability.
8649 Three small problems remain with this function due to my zero
8650 knowledge of autoconf. JMarc and lgb see the comments in the code.
8652 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8654 * src/broken_const.h, config/hack-gcc, config/README: removed
8656 * configure.in: remove --with-gcc-hack option; do not call
8659 * INSTALL: remove documentation of --with-broken-const and
8662 * acconfig.h: remove all trace of BROKEN_CONST define
8664 * src/buffer.C (makeDocBookFile): update version number in output
8666 (SimpleDocBookOnePar): fix an assert when trying to a character
8667 access beyond string length
8670 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8672 * po/de.po: fix the Export menu
8674 * lyx.man: update the description of -dbg
8676 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
8677 (commandLineHelp): updated
8678 (easyParse): show list of available debug levels if -dbg is passed
8681 * src/Makefile.am: add debug.C
8683 * src/debug.h: moved some code to debug.C
8685 * src/debug.C: new file. Contains code to set and show debug
8688 * src/layout.C: remove 'break' after 'continue' in switch
8689 statements, since these cannot be reached.
8691 1999-12-13 Allan Rae <rae@lyx.org>
8693 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8694 (in_word_set): hash() -> math_hash()
8696 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8698 * acconfig.h: Added a test for whether we are using exceptions in the
8699 current compilation run. If so USING_EXCEPTIONS is defined.
8701 * config.in: Check for existance of stl_string_fwd.h
8702 * src/LString.h: If compiling --with-included-string and SGI's
8703 STL version 3.2 is present (see above test) we need to block their
8704 forward declaration of string and supply a __get_c_string().
8705 However, it turns out this is only necessary if compiling with
8706 exceptions enabled so I've a bit more to add yet.
8708 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8709 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8710 src/support/LRegex.h, src/undo.h:
8711 Shuffle the order of the included files a little to ensure that
8712 LString.h gets included before anything that includes stl_string_fwd.h
8714 * src/support/lyxstring.C: We need to #include LString.h instead of
8715 lyxstring.h to get the necessary definition of __get_c_string.
8716 (__get_c_string): New function. This is defined static just like SGI's
8717 although why they need to do this I'm not sure. Perhaps it should be
8718 in lstrings.C instead.
8720 * lib/templates/IEEEtran.lyx: New template file.
8722 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8724 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8725 * intl/Makefile.in (MKINSTALLDIRS): ditto
8727 * src/LyXAction.C (init): changed to hold the LFUN data in a
8728 automatic array in stead of in callso to newFunc, this speeds up
8729 compilation a lot. Also all the memory used by the array is
8730 returned when the init is completed.
8732 * a lot of files: compiled with -Wold-style-cast, changed most of
8733 the reported offenders to C++ style casts. Did not change the
8734 offenders in C files.
8736 * src/trans.h (Match): change argument type to unsigned int.
8738 * src/support/DebugStream.C: fix some types on the streambufs so
8739 that it works on a conforming implementation.
8741 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8743 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8745 * src/support/lyxstring.C: remove the inline added earlier since
8746 they cause a bunch of unsatisfied symbols when linking with dec
8747 cxx. Cxx likes to have the body of inlines at the place where they
8750 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8751 accessing negative bounds in array. This fixes the crash when
8752 inserting accented characters.
8753 * src/trans.h (Match): ditto
8755 * src/buffer.C (Dispatch): since this is a void, it should not try
8756 to return anything...
8758 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8760 * src/buffer.h: removed the two friends from Buffer. Some changes
8761 because of this. Buffer::getFileName and Buffer::setFileName
8762 renamed to Buffer::fileName() and Buffer::fileName(...).
8764 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8766 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8767 and Buffer::update(short) to BufferView. This move is currently
8768 controlled by a define MOVE_TEXT, this will be removed when all
8769 shows to be ok. This move paves the way for better separation
8770 between buffer contents and buffer view. One side effect is that
8771 the BufferView needs a rebreak when swiching buffers, if we want
8772 to avoid this we can add a cache that holds pointers to LyXText's
8773 that is not currently in use.
8775 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8778 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8780 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8782 * lyx_main.C: new command line option -x (or --execute) and
8783 -e (or --export). Now direct conversion from .lyx to .tex
8784 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8785 Unfortunately, X is still needed and the GUI pops up during the
8788 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8790 * src/Spacing.C: add a using directive to bring stream stuff into
8792 * src/paragraph.C: ditto
8793 * src/buffer.C: ditto
8795 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8796 from Lars' announcement).
8798 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8799 example files from Tino Meinen.
8801 1999-12-06 Allan Rae <rae@lyx.org>
8803 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8805 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8807 * src/support/lyxstring.C: added a lot of inline for no good
8810 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8811 latexWriteEndChanges, they were not used.
8813 * src/layout.h (operator<<): output operator for PageSides
8815 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8817 * some example files: loaded in LyX 1.0.4 and saved again to update
8818 certain constructs (table format)
8820 * a lot of files: did the change to use fstream/iostream for all
8821 writing of files. Done with a close look at Andre Poenitz's patch.
8823 * some files: whitespace changes.
8825 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8827 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8828 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8829 architecture, we provide our own. It is used unconditionnally, but
8830 I do not think this is a performance problem. Thanks to Angus
8831 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8832 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8834 (GetInset): use my_memcpy.
8838 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8839 it is easier to understand, but it uses less TeX-only constructs now.
8841 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8842 elements contain spaces
8844 * lib/configure: regenerated
8846 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8847 elements contain spaces; display the list of programs that are
8850 * autogen.sh: make sure lib/configure is executable
8852 * lib/examples/*: rename the tutorial examples to begin with the
8853 two-letters language code.
8855 * src/lyxfunc.C (getStatus): do not query current font if no
8858 * src/lyx_cb.C (RunScript): use QuoteName
8859 (MenuRunDvips): ditto
8860 (PrintApplyCB): ditto
8862 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8863 around argument, so that it works well with the current shell.
8864 Does not work properly with OS/2 shells currently.
8866 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8867 * src/LyXSendto.C (SendtoApplyCB): ditto
8868 * src/lyxfunc.C (Dispatch): ditto
8869 * src/buffer.C (runLaTeX): ditto
8870 (runLiterate): ditto
8871 (buildProgram): ditto
8873 * src/lyx_cb.C (RunScript): ditto
8874 (MenuMakeLaTeX): ditto
8876 * src/buffer.h (getLatexName): new method
8878 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
8880 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8882 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
8883 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
8884 (create_math_panel): ditto
8886 * src/lyxfunc.C (getStatus): re-activate the code which gets
8887 current font and cursor; add test for export to html.
8889 * src/lyxrc.C (read): remove unreachable break statements; add a
8892 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
8894 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8896 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
8897 introduced by faulty regex.
8898 * src/buffer.C: ditto
8899 * src/lastfiles.C: ditto
8900 * src/paragraph.C: ditto
8901 * src/table.C: ditto
8902 * src/vspace.C: ditto
8903 * src/insets/figinset.C: ditto
8904 Note: most of these is absolutely harmless, except the one in
8905 src/mathed formula.C.
8907 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8909 * src/ImportNoweb.C (documentclass): fixed bounds for substr
8910 operation, yielding correct results for the reLyX command.
8912 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8914 * src/support/filetools.C (ExpandPath): removed an over eager
8916 (ReplaceEnvironmentPath): ditto
8918 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8919 shows that we are doing something fishy in our code...
8923 * src/lyxrc.C (read): use a double switch trick to get more help
8924 from the compiler. (the same trick is used in layout.C)
8925 (write): new function. opens a ofstream and pass that to output
8926 (output): new function, takes a ostream and writes the lyxrc
8927 elemts to it. uses a dummy switch to make sure no elements are
8930 * src/lyxlex.h: added a struct pushpophelper for use in functions
8931 with more than one exit point.
8933 * src/lyxlex.[Ch] (GetInteger): made it const
8937 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8939 * src/layout.[hC] : LayoutTags splitted into several enums, new
8940 methods created, better error handling cleaner use of lyxlex. Read
8943 * src/bmtable.[Ch]: change some member prototypes because of the
8944 image const changes.
8946 * commandtags.h, src/LyXAction.C (init): new function:
8947 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8948 This file is not read automatically but you can add \input
8949 preferences to your lyxrc if you want to. We need to discuss how
8952 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8953 in .aux, also remove .bib and .bst files from dependencies when
8956 * src/BufferView.C, src/LyXView.C: add const_cast several places
8957 because of changes to images.
8959 * lib/images/*: same change as for images/*
8961 * lib/lyxrc.example: Default for accept_compound is false not no.
8963 * images/*: changed to be const, however I have som misgivings
8964 about this change so it might be changed back.
8966 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8968 * lib/configure, po/POTFILES.in: regenerated
8970 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8972 * config/lib_configure.m4: removed
8974 * lib/configure.m4: new file (was config/lib_configure.m4)
8976 * configure.in: do not test for rtti, since we do not use it.
8978 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8980 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8981 doubling of allocated space scheme. This makes it faster for large
8982 strings end to use less memory for small strings. xtra rememoved.
8984 * src/insets/figinset.C (waitalarm): commented out.
8985 (GhostscriptMsg): use static_cast
8986 (GhostscriptMsg): use new instead of malloc to allocate memory for
8987 cmap. also delete the memory after use.
8989 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8991 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8992 for changes in bibtex database or style.
8993 (runBibTeX): remove all .bib and .bst files from dep before we
8995 (run): use scanAuc in when dep file already exist.
8997 * src/DepTable.C (remove_files_with_extension): new method
9000 * src/DepTable.[Ch]: made many of the methods const.
9002 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9004 * src/bufferparams.C: make sure that the default textclass is
9005 "article". It used to be the first one by description order, but
9006 now the first one is "docbook".
9008 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9009 string; call Debug::value.
9010 (easyParse): pass complete argument to setDebuggingLevel().
9012 * src/debug.h (value): fix the code that parses debug levels.
9014 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9017 * src/LyXAction.C: use Debug::ACTION as debug channel.
9019 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9021 * NEWS: updated for the future 1.1.3 release.
9023 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9024 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9025 it should. This is of course a controversial change (since many
9026 people will find that their lyx workscreen is suddenly full of
9027 red), but done for the sake of correctness.
9029 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9030 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9032 * src/insets/inseterror.h, src/insets/inseturl.h,
9033 src/insets/insetinfo.h, src/insets/figinset.h,
9034 src/mathed/formulamacro.h, src/mathed/math_macro.h
9035 (EditMessage): add a missing const and add _() to make sure that
9038 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9039 src/insets/insetbib.C, src/support/filetools.C: add `using'
9042 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9043 doing 'Insert index of last word' at the beginning of a paragraph.
9045 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9047 * several files: white-space changes.
9049 * src/mathed/formula.C: removed IsAlpha and IsDigit
9051 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9052 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9055 * src/insets/figinset.C (GetPSSizes): don't break when
9056 "EndComments" is seen. But break when a boundingbox is read.
9058 * all classes inherited from Inset: return value of Clone
9059 changed back to Inset *.
9061 * all classes inherited form MathInset: return value of Clone
9062 changed back to MathedInset *.
9064 * src/insets/figinset.C (runqueue): use a ofstream to output the
9065 gs/ps file. Might need some setpresicion or setw. However I can
9066 see no problem with the current code.
9067 (runqueue): use sleep instead of the alarm/signal code. I just
9068 can't see the difference.
9070 * src/paragraph.C (LyXParagraph): reserve space in the new
9071 paragraph and resize the inserted paragraph to just fit.
9073 * src/lyxfunc.h (operator|=): added operator for func_status.
9075 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9076 check for readable file.
9078 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9079 check for readable file.
9080 (MenuMakeLinuxDoc): ditto
9081 (MenuMakeDocBook): ditto
9082 (MenuMakeAscii): ditto
9083 (InsertAsciiFile): split the test for openable and readable
9085 * src/bmtable.C (draw_bitmaptable): use
9086 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9088 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9089 findtexfile from LaTeX to filetools.
9091 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9092 instead of FilePtr. Needs to be verified by a literate user.
9094 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9096 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9097 (EditMessage): likewise.
9099 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9100 respectively as \textasciitilde and \textasciicircum.
9102 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9104 * src/support/lyxstring.h: made the methods that take iterators
9107 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9108 (regexMatch): made is use the real regex class.
9110 * src/support/Makefile.am: changed to use libtool
9112 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9114 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9116 (MathIsInset ++): changed several macros to be inline functions
9119 * src/mathed/Makefile.am: changed to use libtool
9121 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9123 * src/insets/inset* : Clone changed to const and return type is
9124 the true insettype not just Inset*.
9126 * src/insets/Makefile.am: changed to use libtool
9128 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9130 * src/undo.[Ch] : added empty() and changed some of the method
9133 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9135 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9136 setID use block<> for the bullets array, added const several places.
9138 * src/lyxfunc.C (getStatus): new function
9140 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9141 LyXAction, added const to several funtions.
9143 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9144 a std::map, and to store the dir items in a vector.
9146 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9149 * src/LyXView.[Ch] + other files : changed currentView to view.
9151 * src/LyXAction.[Ch] : ported from the old devel branch.
9153 * src/.cvsignore: added .libs and a.out
9155 * configure.in : changes to use libtool.
9157 * acinclude.m4 : inserted libtool.m4
9159 * .cvsignore: added libtool
9161 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9163 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9164 file name in insets and mathed directories (otherwise the
9165 dependency is not taken in account under cygwin).
9167 * src/text2.C (InsertString[AB]): make sure that we do not try to
9168 read characters past the string length.
9170 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9172 * lib/doc/LaTeXConfig.lyx.in,
9173 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9175 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9176 file saying who created them and when this heppened; this is
9177 useless and annoys tools like cvs.
9179 * lib/layouts/g-brief-{en,de}.layout,
9180 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9181 from Thomas Hartkens <thomas@hartkens.de>.
9183 * src/{insets,mathed}/Makefile.am: do not declare an empty
9184 LDFLAGS, so that it can be set at configure time (useful on Irix
9187 * lib/reLyX/configure.in: make sure that the prefix is set
9188 correctly in LYX_DIR.
9190 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9192 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9193 be used by 'command-sequence' this allows to bind a key to a
9194 sequence of LyX-commands
9195 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9197 * src/LyXAction.C: add "command-sequence"
9199 * src/LyXFunction.C: handling of "command-sequence"
9201 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9202 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9204 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9206 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9208 * src/buffer.C (writeFile): Do not output a comment giving user
9209 and date at the beginning of a .lyx file. This is useless and
9210 annoys cvs anyway; update version number to 1.1.
9212 * src/Makefile.am (LYX_DIR): add this definition, so that a
9213 default path is hardcoded in LyX.
9215 * configure.in: Use LYX_GNU_GETTEXT.
9217 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9218 AM_GNU_GETTEXT with a bug fixed.
9220 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9222 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9224 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9225 which is used to point to LyX data is now LYX_DIR_11x.
9227 * lyx.man: convert to a unix text file; small updates.
9229 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9231 * src/support/LSubstring.[Ch]: made the second arg of most of the
9232 constructors be a const reference.
9234 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9237 * src/support/lyxstring.[Ch] (swap): added missing member function
9238 and specialization of swap(str, str);
9240 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9242 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9243 trace of the old one.
9245 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9246 put the member definitions in undo.C.
9248 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9249 NEW_TEXT and have now only code that was included when this was
9252 * src/intl.C (LCombo): use static_cast
9254 (DispatchCallback): ditto
9256 * src/definitions.h: removed whole file
9258 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9260 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9261 parsing and stores in a std:map. a regex defines the file format.
9262 removed unneeded members.
9264 * src/bufferparams.h: added several enums from definitions.h here.
9265 Removed unsused destructor. Changed some types to use proper enum
9266 types. use block to have the temp_bullets and user_defined_bullets
9267 and to make the whole class assignable.
9269 * src/bufferparams.C (Copy): removed this functions, use a default
9272 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9275 * src/buffer.C (readLyXformat2): commend out all that have with
9276 oldpapersize to do. also comment out all that hve to do with
9277 insetlatex and insetlatexdel.
9278 (setOldPaperStuff): commented out
9280 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9282 * src/LyXAction.C: remove use of inset-latex-insert
9284 * src/mathed/math_panel.C (button_cb): use static_cast
9286 * src/insets/Makefile.am (insets_o_SOURCES): removed
9289 * src/support/lyxstring.C (helper): use the unsigned long
9290 specifier, UL, instead of a static_cast.
9292 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9294 * src/support/block.h: new file. to be used as a c-style array in
9295 classes, so that the class can be assignable.
9297 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9299 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9300 NULL, make sure to return an empty string (it is not possible to
9301 set a string to NULL).
9303 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9305 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9307 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9309 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9310 link line, so that Irix users (for example) can set it explicitely to
9313 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9314 it can be overidden at make time (static or dynamic link, for
9317 * src/vc-backend.C, src/LaTeXFeatures.h,
9318 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
9319 statements to bring templates to global namespace.
9321 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9323 * src/support/lyxstring.C (operator[] const): make it standard
9326 * src/minibuffer.C (Init): changed to reflect that more
9327 information is given from the lyxvc and need not be provided here.
9329 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9331 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9333 * src/LyXView.C (UpdateTimerCB): use static_cast
9334 (KeyPressMask_raw_callback): ditto
9336 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9337 buffer_, a lot of changes because of this. currentBuffer() ->
9338 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9339 also changes to other files because of this.
9341 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9343 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9344 have no support for RCS and partial support for CVS, will be
9347 * src/insets/ several files: changes because of function name
9348 changes in Bufferview and LyXView.
9350 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9352 * src/support/LSubstring.[Ch]: new files. These implement a
9353 Substring that can be very convenient to use. i.e. is this
9355 string a = "Mary had a little sheep";
9356 Substring(a, "sheep") = "lamb";
9357 a is now "Mary has a little lamb".
9359 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9360 out patterns and subpatterns of strings. It is used by LSubstring
9361 and also by vc-backend.C
9363 * src/support/lyxstring.C: went over all the assertions used and
9364 tried to correct the wrong ones and flag which of them is required
9365 by the standard. some bugs found because of this. Also removed a
9366 couple of assertions.
9368 * src/support/Makefile.am (libsupport_a_SOURCES): added
9369 LSubstring.[Ch] and LRegex.[Ch]
9371 * src/support/FileInfo.h: have struct stat buf as an object and
9372 not a pointer to one, some changes because of this.
9374 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9375 information in layout when adding the layouts preamble to the
9378 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9381 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9382 because of bug in OS/2.
9384 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9386 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9387 \verbatim@font instead of \ttfamily, so that it can be redefined.
9389 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9390 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9391 src/layout.h, src/text2.C: add 'using' directive to bring the
9392 STL templates we need from the std:: namespace to the global one.
9393 Needed by DEC cxx in strict ansi mode.
9395 * src/support/LIstream.h,src/support/LOstream.h,
9396 src/support/lyxstring.h,src/table.h,
9397 src/lyxlookup.h: do not include <config.h> in header
9398 files. This should be done in the .C files only.
9400 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9404 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9406 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9407 from Kayvan to fix the tth invokation.
9409 * development/lyx.spec.in: updates from Kayvan to reflect the
9410 changes of file names.
9412 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9414 * src/text2.C (InsertStringB): use std::copy
9415 (InsertStringA): use std::copy
9417 * src/bufferlist.C: use a vector to store the buffers in. This is
9418 an internal change and should not affect any other thing.
9420 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9423 * src/text.C (Fill): fix potential bug, one off bug.
9425 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9427 * src/Makefile.am (lyx_main.o): add more files it depends on.
9429 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9431 * src/support/lyxstring.C: use size_t for the reference count,
9432 size, reserved memory and xtra.
9433 (internal_compare): new private member function. Now the compare
9434 functions should work for std::strings that have embedded '\0'
9436 (compare): all compare functions rewritten to use
9439 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9441 * src/support/lyxstring.C (compare): pass c_str()
9442 (compare): pass c_str
9443 (compare): pass c_str
9445 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9447 * src/support/DebugStream.C: <config.h> was not included correctly.
9449 * lib/configure: forgot to re-generate it :( I'll make this file
9450 auto generated soon.
9452 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9454 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9457 * src/support/lyxstring.C: some changes from length() to rep->sz.
9458 avoids a function call.
9460 * src/support/filetools.C (SpaceLess): yet another version of the
9461 algorithm...now per Jean-Marc's suggestions.
9463 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9465 * src/layout.C (less_textclass_desc): functor for use in sorting
9467 (LyXTextClass::Read): sort the textclasses after reading.
9469 * src/support/filetools.C (SpaceLess): new version of the
9470 SpaceLess functions. What problems does this one give? Please
9473 * images/banner_bw.xbm: made the arrays unsigned char *
9475 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9477 * src/support/lyxstring.C (find): remove bogus assertion in the
9478 two versions of find where this has not been done yet.
9480 * src/support/lyxlib.h: add missing int return type to
9483 * src/menus.C (ShowFileMenu): disable exporting to html if no
9484 html export command is present.
9486 * config/lib_configure.m4: add a test for an HTML converter. The
9487 programs checked for are, in this order: tth, latex2html and
9490 * lib/configure: generated from config/lib_configure.m4.
9492 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9493 html converter. The parameters are now passed through $$FName and
9494 $$OutName, instead of standard input/output.
9496 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9498 * lib/lyxrc.example: update description of \html_command.
9499 add "quotes" around \screen_font_xxx font setting examples to help
9500 people who use fonts with spaces in their names.
9502 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9504 * Distribution files: updates for v1.1.2
9506 * src/support/lyxstring.C (find): remove bogus assert and return
9507 npos for the same condition.
9509 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9511 * added patch for OS/2 from SMiyata.
9513 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9515 * src/text2.C (CutSelection): make space_wrapped a bool
9516 (CutSelection): dont declare int i until we have to.
9517 (alphaCounter): return a char const *.
9519 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9521 * src/support/syscall.C (Systemcalls::kill):
9522 src/support/filetools.C (PutEnv, PutEnvPath):
9523 src/lyx_cb.C (addNewlineAndDepth):
9524 src/FontInfo.C (FontInfo::resize): condition some #warning
9525 directives with WITH_WARNINGS.
9528 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9530 * src/layout.[Ch] + several files: access to class variables
9531 limited and made accessor functions instead a lot of code changed
9532 becuase of this. Also instead of returning pointers often a const
9533 reference is returned instead.
9535 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9537 * src/Makefile.am (dist-hook): added used to remove the CVS from
9538 cheaders upon creating a dist
9539 (EXTRA_DIST): added cheaders
9541 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9542 a character not as a small integer.
9544 * src/support/lyxstring.C (find): removed Assert and added i >=
9545 rep->sz to the first if.
9547 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9549 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9550 src/LyXView.C src/buffer.C src/bufferparams.C
9551 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9552 src/text2.C src/insets/insetinclude.C:
9553 lyxlayout renamed to textclasslist.
9555 * src/layout.C: some lyxerr changes.
9557 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9558 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
9559 (LyXLayoutList): removed all traces of this class.
9560 (LyXTextClass::Read): rewrote LT_STYLE
9561 (LyXTextClass::hasLayout): new function
9562 (LyXTextClass::GetLayout): rewritten to return an iterator + has
9563 both const and nonconst version.
9564 (LyXTextClass::delete_layout): new function.
9565 (LyXTextClassList::Style): bug fix. do the right thing if layout
9567 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
9568 (LyXTextClassList::NameOfLayout): ditto
9569 (LyXTextClassList::Load): ditto
9571 * src/buffer.C (makeLaTeXFile): new access to layoutlist
9573 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
9575 * src/LyXAction.C (LookupFunc): added a workaround for sun
9576 compiler, on the other hand...we don't know if the current code
9577 compiles on sun at all...
9579 * src/support/filetools.C (CleanupPath): subst fix
9581 * src/insets/insetbib.C (delDatabase): subst fix, this looks
9584 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
9585 complained about this one?
9587 * src/insets/insetinclude.C (Latex): subst fix
9589 * src/insets/insetbib.C (getKeys): subst fix
9591 * src/LyXSendto.C (SendtoApplyCB): subst fix
9593 * src/lyx_main.C (init): subst fix
9595 * src/layout.C (Read): subst fix
9597 * src/lyx_sendfax_main.C (button_send): subst fix
9599 * src/buffer.C (RoffAsciiTable): subst fix
9601 * src/lyx_cb.C (MenuFax): subst fix
9602 (PrintApplyCB): subst fix
9604 1999-10-26 Juergen Vigna <jug@sad.it>
9606 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9608 (Read): Cleaned up this code so now we read only format vestion >= 5
9610 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9612 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9613 come nobody has complained about this one?
9615 * src/insets/insetinclude.C (Latex): subst fix
9617 * src/insets/insetbib.C (getKeys): subst fix
9619 * src/lyx_main.C (init): subst fix
9621 * src/layout.C (Read): subst fix
9623 * src/buffer.C (RoffAsciiTable): subst fix
9625 * src/lyx_cb.C (MenuFax): subst fix.
9627 * src/layout.[hC] + some other files: rewrote to use
9628 std::container to store textclasses and layouts in.
9629 Simplified, removed a lot of code. Make all classes
9630 assignable. Further simplifications and review of type
9631 use still to be one.
9633 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9634 lastfiles to create the lastfiles partr of the menu.
9636 * src/lastfiles.[Ch]: rewritten to use deque to store the
9637 lastfiles in. Uses fstream for reading and writing. Simplifies
9640 * src/support/syscall.C: remove explicit cast.
9642 * src/BufferView.C (CursorToggleCB): removed code snippets that
9644 use explicat C++ style casts instead of C style casts. also use
9645 u_vdata instea of passing pointers in longs.
9647 * src/PaperLayout.C: removed code snippets that were commented out.
9649 * src/lyx_gui_misc.C: removed code snippets that were commented out.
9651 * src/lyx_main.C: removed code snippets that wer commented out.
9653 * src/paragraph.C: removed code snippets that were commented out.
9655 * src/lyxvc.C (logClose): use static_cast
9657 (viewLog): remove explicit cast to void*
9658 (showLog): removed old commented code
9660 * src/menus.C: use static_cast instead of C style casts. use
9661 u_vdata instead of u_ldata. remove explicit cast to (long) for
9662 pointers. Removed old code that was commented out.
9664 * src/insets/inset.C: removed old commented func
9666 * src/insets/insetref.C (InsetRef): removed old code that had been
9667 commented out for a long time.
9669 (escape): removed C style cast
9671 * src/insets/insetlatexaccent.C (Draw): removed old commented code
9673 * src/insets/insetlatex.C (Draw): removed old commented code
9674 (Read): rewritten to use string
9676 * src/insets/insetlabel.C (escape): removed C style cast
9678 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
9680 * src/insets/insetindex.C: use static_cast and u_vdata, removed
9683 * src/insets/insetinclude.h: removed a couple of stupid bools
9685 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9686 (Clone): remove C style cast
9687 (getKeys): changed list to lst because of std::list
9689 * src/insets/inseterror.C (Draw): removed som old commented code.
9691 * src/insets/insetcommand.C (Draw): removed some old commented code.
9693 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9694 commented out forever.
9695 (bibitem_cb): use static_cast instead of C style cast
9696 use of vdata changed to u_vdata.
9698 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9700 (CloseUrlCB): use static_cast instead of C style cast.
9701 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9703 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9704 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9705 (CloseInfoCB): static_cast from ob->u_vdata instead.
9706 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9709 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9710 (C_InsetError_CloseErrorCB): forward the ob parameter
9711 (CloseErrorCB): static_cast from ob->u_vdata instead.
9713 * src/vspace.h: include LString.h since we use string in this class.
9715 * src/vspace.C (lyx_advance): changed name from advance because of
9716 nameclash with stl. And since we cannot use namespaces yet...I
9717 used a lyx_ prefix instead. Expect this to change when we begin
9720 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9722 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9723 and removed now defunct constructor and deconstructor.
9725 * src/BufferView.h: have backstack as a object not as a pointer.
9726 removed initialization from constructor. added include for BackStack
9728 * development/lyx.spec.in (%build): add CFLAGS also.
9730 * src/screen.C (drawFrame): removed another warning.
9732 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9734 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9735 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9736 README and ANNOUNCE a bit for the next release. More work is
9739 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9740 unbreakable if we are in freespacing mode (LyX-Code), but not in
9743 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9745 * src/BackStack.h: fixed initialization order in constructor
9747 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9749 * acinclude.m4 (VERSION): new rules for when a version is
9750 development, added also a variable for prerelease.
9751 (warnings): we set with_warnings=yes for prereleases
9752 (lyx_opt): prereleases compile with same optimization as development
9753 (CXXFLAGS): only use pedantic if we are a development version
9755 * src/BufferView.C (restorePosition): don't do anything if the
9758 * src/BackStack.h: added member empty, use this to test if there
9759 is anything to pop...
9761 1999-10-25 Juergen Vigna <jug@sad.it>
9764 * forms/layout_forms.fd +
9765 * forms/latexoptions.fd +
9766 * lyx.fd: changed for various form resize issues
9768 * src/mathed/math_panel.C +
9769 * src/insets/inseterror.C +
9770 * src/insets/insetinfo.C +
9771 * src/insets/inseturl.C +
9772 * src/insets/inseturl.h +
9775 * src/PaperLayout.C +
9776 * src/ParagraphExtra.C +
9777 * src/TableLayout.C +
9779 * src/layout_forms.C +
9786 * src/menus.C: fixed various resize issues. So now forms can be
9787 resized savely or not be resized at all.
9789 * forms/form_url.fd +
9790 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9793 * src/insets/Makefile.am: added files form_url.[Ch]
9795 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9797 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9798 (and presumably 6.2).
9800 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9801 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9802 remaining static member callbacks.
9804 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9807 * src/support/lyxstring.h: declare struct Srep as friend of
9808 lyxstring, since DEC cxx complains otherwise.
9810 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9812 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9814 * src/LaTeX.C (run): made run_bibtex also depend on files with
9816 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9817 are put into the dependency file.
9819 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9820 the code has shown itself to work
9821 (create_ispell_pipe): removed another warning, added a comment
9824 * src/minibuffer.C (ExecutingCB): removed code that has been
9825 commented out a long time
9827 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9828 out code + a warning.
9830 * src/support/lyxstring.h: comment out the three private
9831 operators, when compiling with string ansi conforming compilers
9834 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9836 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9837 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9840 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9843 * src/mathed/math_panel.C (create_math_panel): remove explicit
9846 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9849 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9850 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9851 to XCreatePixmapFromBitmapData
9852 (fl_set_bmtable_data): change the last argument to be unsigned
9854 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9855 and bh to be unsigned int, remove explicit casts in call to
9856 XReadBitmapFileData.
9858 * images/arrows.xbm: made the arrays unsigned char *
9859 * images/varsz.xbm: ditto
9860 * images/misc.xbm: ditto
9861 * images/greek.xbm: ditto
9862 * images/dots.xbm: ditto
9863 * images/brel.xbm: ditto
9864 * images/bop.xbm: ditto
9866 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
9868 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
9869 (LYX_PROG_CXX): added -pedantic to g++ compile options when
9870 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
9872 (LYX_CXX_CHEADERS): added <clocale> to the test.
9874 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
9876 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
9878 * src/support/lyxstring.C (append): fixed something that must be a
9879 bug, rep->assign was used instead of rep->append.
9881 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
9884 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
9885 lyx insert double chars. Fix spotted by Kayvan.
9887 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9889 * Fixed the tth support. I messed up with the Emacs patch apply feature
9890 and omitted the changes in lyxrc.C.
9892 1999-10-22 Juergen Vigna <jug@sad.it>
9894 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
9896 * src/lyx_cb.C (MenuInsertRef) +
9897 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
9898 the form cannot be resized under it limits (fixes a segfault)
9900 * src/lyx.C (create_form_form_ref) +
9901 * forms/lyx.fd: Changed Gravity on name input field so that it is
9904 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9906 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
9907 <ostream> and <istream>.
9909 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
9910 whether <fstream> provides the latest standard features, or if we
9911 have an oldstyle library (like in egcs).
9912 (LYX_CXX_STL_STRING): fix the test.
9914 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
9915 code on MODERN_STL_STREAM.
9917 * src/support/lyxstring.h: use L{I,O}stream.h.
9919 * src/support/L{I,O}stream.h: new files, designed to setup
9920 correctly streams for our use
9921 - includes the right header depending on STL capabilities
9922 - puts std::ostream and std::endl (for LOStream.h) or
9923 std::istream (LIStream.h) in toplevel namespace.
9925 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9927 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9928 was a bib file that had been changed we ensure that bibtex is run.
9929 (runBibTeX): enhanced to extract the names of the bib files and
9930 getting their absolute path and enter them into the dep file.
9931 (findtexfile): static func that is used to look for tex-files,
9932 checks for absolute patchs and tries also with kpsewhich.
9933 Alternative ways of finding the correct files are wanted. Will
9935 (do_popen): function that runs a command using popen and returns
9936 the whole output of that command in a string. Should be moved to
9939 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9940 file with extension ext has changed.
9942 * src/insets/figinset.C: added ifdef guards around the fl_free
9943 code that jug commented out. Now it is commented out when
9944 compiling with XForms == 0.89.
9946 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9947 to lyxstring.C, and only keep a forward declaration in
9948 lyxstring.h. Simplifies the header file a bit and should help a
9949 bit on compile time too. Also changes to Srep will not mandate a
9950 recompile of code just using string.
9951 (~lyxstring): definition moved here since it uses srep.
9952 (size): definition moved here since it uses srep.
9954 * src/support/lyxstring.h: removed a couple of "inline" that should
9957 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9959 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9962 1999-10-21 Juergen Vigna <jug@sad.it>
9964 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9965 set to left if I just remove the width entry (or it is empty).
9967 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9968 paragraph when having dummy paragraphs.
9970 1999-10-20 Juergen Vigna <jug@sad.it>
9972 * src/insets/figinset.C: just commented some fl_free_form calls
9973 and added warnings so that this calls should be activated later
9974 again. This avoids for now a segfault, but we have a memory leak!
9976 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9977 'const char * argument' to 'string argument', this should
9978 fix some Asserts() in lyxstring.C.
9980 * src/lyxfunc.h: Removed the function argAsString(const char *)
9981 as it is not used anymore.
9983 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9985 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9988 * src/Literate.h: some funcs moved from public to private to make
9989 interface clearer. Unneeded args removed.
9991 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9993 (scanBuildLogFile): ditto
9995 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9996 normal TeX Error. Still room for improvement.
9998 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10000 * src/buffer.C (insertErrors): changes to make the error
10001 desctription show properly.
10003 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10006 * src/support/lyxstring.C (helper): changed to use
10007 sizeof(object->rep->ref).
10008 (operator>>): changed to use a pointer instead.
10010 * src/support/lyxstring.h: changed const reference & to value_type
10011 const & lets see if that helps.
10013 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10015 * Makefile.am (rpmdist): fixed to have non static package and
10018 * src/support/lyxstring.C: removed the compilation guards
10020 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10023 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10024 conditional compile of lyxstring.Ch
10026 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10027 stupid check, but it is a lot better than the bastring hack.
10028 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10030 * several files: changed string::erase into string::clear. Not
10033 * src/chset.C (encodeString): use a char temporary instead
10035 * src/table.C (TexEndOfCell): added tostr around
10036 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10037 (TexEndOfCell): ditto
10038 (TexEndOfCell): ditto
10039 (TexEndOfCell): ditto
10040 (DocBookEndOfCell): ditto
10041 (DocBookEndOfCell): ditto
10042 (DocBookEndOfCell): ditto
10043 (DocBookEndOfCell): ditto
10045 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10047 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10049 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10050 (MenuBuildProg): added tostr around ret
10051 (MenuRunChktex): added tostr around ret
10052 (DocumentApplyCB): added tostr around ret
10054 * src/chset.C (encodeString): added tostr around t->ic
10056 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10057 (makeLaTeXFile): added tostr around tocdepth
10058 (makeLaTeXFile): added tostr around ftcound - 1
10060 * src/insets/insetbib.C (setCounter): added tostr around counter.
10062 * src/support/lyxstring.h: added an operator+=(int) to catch more
10065 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10066 (lyxstring): We DON'T allow NULL pointers.
10068 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10070 * src/mathed/math_macro.C (MathMacroArgument::Write,
10071 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10072 when writing them out.
10074 * src/LString.C: remove, since it is not used anymore.
10076 * src/support/lyxstring.C: condition the content to
10077 USE_INCLUDED_STRING macro.
10079 * src/mathed/math_symbols.C, src/support/lstrings.C,
10080 src/support/lyxstring.C: add `using' directive to specify what
10081 we need in <algorithm>. I do not think that we need to
10082 conditionalize this, but any thought is appreciated.
10084 * many files: change all callback functions to "C" linkage
10085 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10086 strict_ansi. Those who were static are now global.
10087 The case of callbacks which are static class members is
10088 trickier, since we have to make C wrappers around them (see
10089 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10090 did not finish this yet, since it defeats the purpose of
10091 encapsulation, and I am not sure what the best route is.
10093 1999-10-19 Juergen Vigna <jug@sad.it>
10095 * src/support/lyxstring.C (lyxstring): we permit to have a null
10096 pointer as assignment value and just don't assign it.
10098 * src/vspace.C (nextToken): corrected this function substituting
10099 find_first(_not)_of with find_last_of.
10101 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10102 (TableOptCloseCB) (TableSpeCloseCB):
10103 inserted fl_set_focus call for problem with fl_hide_form() in
10106 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10108 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10111 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10113 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10114 LyXLex::next() and not eatline() to get its argument.
10116 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10118 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10119 instead, use fstreams for io of the depfile, removed unneeded
10120 functions and variables.
10122 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10123 vector instead, removed all functions and variables that is not in
10126 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10128 * src/buffer.C (insertErrors): use new interface to TeXError
10130 * Makefile.am (rpmdist): added a rpmdist target
10132 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10133 per Kayvan's instructions.
10135 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10137 * src/Makefile.am: add a definition for localedir, so that locales
10138 are found after installation (Kayvan)
10140 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10142 * development/.cvsignore: new file.
10144 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10146 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10147 C++ compiler provides wrappers for C headers and use our alternate
10150 * configure.in: use LYX_CXX_CHEADERS.
10152 * src/cheader/: new directory, populated with cname headers from
10153 libstdc++-2.8.1. They are a bit old, but probably good enough for
10154 what we want (support compilers who lack them).
10156 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10157 from includes. It turns out is was stupid.
10159 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10161 * lib/Makefile.am (install-data-local): forgot a ';'
10162 (install-data-local): forgot a '\'
10163 (libinstalldirs): needed after all. reintroduced.
10165 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10167 * configure.in (AC_OUTPUT): added lyx.spec
10169 * development/lyx.spec: removed file
10171 * development/lyx.spec.in: new file
10173 * po/*.po: merged with lyx.pot becuase of make distcheck
10175 * lib/Makefile.am (dist-hook): added dist-hook so that
10176 documentation files will be included when doing a make
10177 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10178 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10180 more: tried to make install do the right thing, exclude CVS dirs
10183 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10184 Path would fit in more nicely.
10186 * all files that used to use pathstack: uses now Path instead.
10187 This change was a lot easier than expected.
10189 * src/support/path.h: new file
10191 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10193 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10195 * src/support/lyxstring.C (getline): Default arg was given for
10198 * Configure.cmd: removed file
10200 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10202 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10203 streams classes and types, add the proper 'using' statements when
10204 MODERN_STL is defined.
10206 * src/debug.h: move the << operator definition after the inclusion
10209 * src/support/filetools.C: include "LAssert.h", which is needed
10212 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10215 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10216 include "debug.h" to define a proper ostream.
10218 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10220 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10221 method to the SystemCall class which can kill a process, but it's
10222 not fully implemented yet.
10224 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10226 * src/support/FileInfo.h: Better documentation
10228 * src/lyxfunc.C: Added support for buffer-export html
10230 * src/menus.C: Added Export->As HTML...
10232 * lib/bind/*.bind: Added short-cut for buffer-export html
10234 * src/lyxrc.*: Added support for new \tth_command
10236 * lib/lyxrc.example: Added stuff for new \tth_command
10238 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10240 * lib/Makefile.am (IMAGES): removed images/README
10241 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10242 installes in correct place. Check permisions is installed
10245 * src/LaTeX.C: some no-op changes moved declaration of some
10248 * src/LaTeX.h (LATEX_H): changed include guard name
10250 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10252 * lib/reLyX/Makefile.am: install noweb2lyx.
10254 * lib/Makefile.am: install configure.
10256 * lib/reLyX/configure.in: declare a config aux dir; set package
10257 name to lyx (not sure what the best solution is); generate noweb2lyx.
10259 * lib/layouts/egs.layout: fix the bibliography layout.
10261 1999-10-08 Jürgen Vigna <jug@sad.it>
10263 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10264 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10265 it returned without continuing to search the path.
10267 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10269 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10270 also fixes a bug. It is not allowed to do tricks with std::strings
10271 like: string a("hei"); &a[e]; this will not give what you
10272 think... Any reason for the complexity in this func?
10274 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10276 * Updated README and INSTALL a bit, mostly to check that my
10277 CVS rights are correctly set up.
10279 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10281 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10282 does not allow '\0' chars but lyxstring and std::string does.
10284 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10286 * autogen.sh (AUTOCONF): let the autogen script create the
10287 POTFILES.in file too. POTFILES.in should perhaps now not be
10288 included in the cvs module.
10290 * some more files changed to use C++ includes instead of C ones.
10292 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10294 (Reread): added tostr to nlink. buggy output otherwise.
10295 (Reread): added a string() around szMode when assigning to Buffer,
10296 without this I got a log of garbled info strings.
10298 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10301 * I have added several ostream & operator<<(ostream &, some_type)
10302 functions. This has been done to avoid casting and warnings when
10303 outputting enums to lyxerr. This as thus eliminated a lot of
10304 explicit casts and has made the code clearer. Among the enums
10305 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10306 mathed enums, some font enum the Debug::type enum.
10308 * src/support/lyxstring.h (clear): missing method. equivalent of
10311 * all files that contained "stderr": rewrote constructs that used
10312 stderr to use lyxerr instead. (except bmtable)
10314 * src/support/DebugStream.h (level): and the passed t with
10315 Debug::ANY to avoid spurious bits set.
10317 * src/debug.h (Debug::type value): made it accept strings of the
10318 type INFO,INIT,KEY.
10320 * configure.in (Check for programs): Added a check for kpsewhich,
10321 the latex generation will use this later to better the dicovery of
10324 * src/BufferView.C (create_view): we don't need to cast this to
10325 (void*) that is done automatically.
10326 (WorkAreaButtonPress): removed some dead code.
10328 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10330 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10331 is not overwritten when translated (David Sua'rez de Lis).
10333 * lib/CREDITS: Added David Sua'rez de Lis
10335 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10337 * src/bufferparams.C (BufferParams): default input encoding is now
10340 * acinclude.m4 (cross_compiling): comment out macro
10341 LYX_GXX_STRENGTH_REDUCE.
10343 * acconfig.h: make sure that const is not defined (to empty) when
10344 we are compiling C++. Remove commented out code using SIZEOF_xx
10347 * configure.in : move the test for const and inline as late as
10348 possible so that these C tests do not interefere with C++ ones.
10349 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10350 has not been proven.
10352 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10354 * src/table.C (getDocBookAlign): remove bad default value for
10355 isColumn parameter.
10357 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10359 (ShowFileMenu2): ditto.
10361 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10362 of files to ignore.
10364 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10366 * Most files: finished the change from the old error code to use
10367 DebugStream for all lyxerr debugging. Only minor changes remain
10368 (e.g. the setting of debug levels using strings instead of number)
10370 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10372 * src/layout.C (Add): Changed to use compare_no_case instead of
10375 * src/FontInfo.C: changed loop variable type too string::size_type.
10377 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10379 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10380 set ETAGS_ARGS to --c++
10382 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10384 * src/table.C (DocBookEndOfCell): commented out two unused variables
10386 * src/paragraph.C: commented out four unused variables.
10388 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10389 insed a if clause with type string::size_type.
10391 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10394 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10396 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10397 variable, also changed loop to go from 0 to lenght + 1, instead of
10398 -1 to length. This should be correct.
10400 * src/LaTeX.C (scanError): use string::size_type as loop variable
10403 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10404 (l.896) since y_tmp and row was not used anyway.
10406 * src/insets/insetref.C (escape): use string::size_type as loop
10409 * src/insets/insetquotes.C (Width): use string::size_type as loop
10411 (Draw): use string::size_type as loop variable type.
10413 * src/insets/insetlatexaccent.C (checkContents): use
10414 string::size_type as loop variable type.
10416 * src/insets/insetlabel.C (escape): use string::size_type as loop
10419 * src/insets/insetinfo.C: added an extern for current_view.
10421 * src/insets/insetcommand.C (scanCommand): use string::size_type
10422 as loop variable type.
10424 * most files: removed the RCS tags. With them we had to recompile
10425 a lot of files after a simple cvs commit. Also we have never used
10426 them for anything meaningful.
10428 * most files: tags-query-replace NULL 0. As adviced several plases
10429 we now use "0" instead of "NULL" in our code.
10431 * src/support/filetools.C (SpaceLess): use string::size_type as
10432 loop variable type.
10434 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10436 * src/paragraph.C: fixed up some more string stuff.
10438 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10440 * src/support/filetools.h: make modestr a std::string.
10442 * src/filetools.C (GetEnv): made ch really const.
10444 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10445 made code that used these use max/min from <algorithm> instead.
10447 * changed several c library include files to their equivalent c++
10448 library include files. All is not changed yet.
10450 * created a support subdir in src, put lyxstring and lstrings
10451 there + the extra files atexit, fileblock, strerror. Created
10452 Makefile.am. edited configure.in and src/Makefile.am to use this
10453 new subdir. More files moved to support.
10455 * imported som of the functions from repository lyx, filetools
10457 * ran tags-query-replace on LString -> string, corrected the bogus
10458 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10459 is still some errors in there. This is errors where too much or
10460 too litle get deleted from strings (string::erase, string::substr,
10461 string::replace), there can also be some off by one errors, or
10462 just plain wrong use of functions from lstrings. Viewing of quotes
10465 * LyX is now running fairly well with string, but there are
10466 certainly some bugs yet (see above) also string is quite different
10467 from LString among others in that it does not allow null pointers
10468 passed in and will abort if it gets any.
10470 * Added the revtex4 files I forgot when setting up the repository.
10472 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10474 * All over: Tried to clean everything up so that only the files
10475 that we really need are included in the cvs repository.
10476 * Switched to use automake.
10477 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10478 * Install has not been checked.
10480 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10482 * po/pt.po: Three errors:
10483 l.533 and l.538 format specification error
10484 l. 402 duplicate entry, I just deleted it.