1 2000-08-18 Juergen Vigna <jug@sad.it>
3 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4 new document layout now.
8 * src/lyx_gui_misc.C: ditto
10 * src/lyx_gui.C: ditto
12 * lib/ui/default.ui: removed paper and quotes layout as they are now
13 all in the document layout tabbed folder.
15 * src/frontends/xforms/forms/form_document.fd: added Restore
16 button and callbacks for all inputs for Allan's ButtonPolicy.
18 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
19 (CheckChoiceClass): added missing params setting on class change.
20 (UpdateLayoutDocument): added for updating the layout on params.
21 (build): forgot to RETURN_ALWAYS input_doc_spacing.
22 (FormDocument): Implemented Allan's ButtonPolicy with the
25 2000-08-17 Allan Rae <rae@lyx.org>
27 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
28 so we can at least see the credits again.
30 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
31 controller calls for the appropriate callbacks. Note that since Ok
32 calls apply followed by cancel, and apply isn't a valid input for the
33 APPLIED state, the bc_ calls have to be made in the static callback not
34 within each of the real callbacks.
36 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
37 (setOk): renamed from setOkay()
39 2000-08-17 Juergen Vigna <jug@sad.it>
41 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
42 in the implementation part.
43 (composeUIInfo): don't show optional menu-items.
45 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
47 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
49 * src/bufferview_funcs.C (CurrentState): fixed to show also the
50 text-state when in a text-inset.
52 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
54 2000-08-17 Marko Vendelin <markov@ioc.ee>
55 * src/frontends/gnome/FormIndex.C
56 * src/frontends/gnome/FormIndex.h
57 * src/frontends/gnome/FormToc.C
58 * src/frontends/gnome/FormToc.h
59 * src/frontends/gnome/dialogs
60 * src/frontends/gnome/diatoc_callbacks.c
61 * src/frontends/gnome/diatoc_callbacks.h
62 * src/frontends/gnome/diainsertindex_callbacks.h
63 * src/frontends/gnome/diainsertindex_callbacks.c
64 * src/frontends/gnome/diainsertindex_interface.c
65 * src/frontends/gnome/diainsertindex_interface.h
66 * src/frontends/gnome/diatoc_interface.h
67 * src/frontends/gnome/diatoc_interface.c
68 * src/frontends/gnome/Makefile.am: Table of Contents and
69 Insert Index dialogs implementation for Gnome frontend
71 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
73 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
75 * src/frontends/gnome/diainserturl_interface.c: make the dialog
78 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
80 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
81 destructor. Don't definde if you don't need it
82 (processEvents): made static, non-blocking events processing for
84 (runTime): static method. event loop for xforms
85 * similar as above for kde and gnome.
87 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
89 (runTime): new method calss the real frontends runtime func.
91 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
93 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
95 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
97 2000-08-16 Juergen Vigna <jug@sad.it>
99 * src/lyx_gui.C (runTime): added GUII RunTime support.
101 * src/frontends/Makefile.am:
102 * src/frontends/GUIRunTime.[Ch]:
103 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
104 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
105 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
107 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
109 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
110 as this is already set in ${FRONTEND_INCLUDE} if needed.
112 * configure.in (CPPFLAGS): setting the include dir for the frontend
113 directory and don't set FRONTEND=xforms for now as this is executed
116 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
118 * src/frontends/kde/Makefile.am:
119 * src/frontends/kde/FormUrl.C:
120 * src/frontends/kde/FormUrl.h:
121 * src/frontends/kde/formurldialog.h:
122 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
124 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
126 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
128 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
130 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
133 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
135 * src/WorkArea.C (work_area_handler): more work to get te
136 FL_KEYBOARD to work with xforms 0.88 too, please test.
138 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
140 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
142 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
145 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
147 * src/Timeout.h: remove Qt::emit hack.
149 * several files: changes to allo doc++ compilation
151 * src/lyxfunc.C (processKeySym): new method
152 (processKeyEvent): comment out if FL_REVISION < 89
154 * src/WorkArea.C: change some debugging levels.
155 (WorkArea): set wantkey to FL_KEY_ALL
156 (work_area_handler): enable the FL_KEYBOARD clause, this enables
157 clearer code and the use of compose with XForms 0.89. Change to
158 use signals instead of calling methods in bufferview directly.
160 * src/Painter.C: change some debugging levels.
162 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
165 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
166 (workAreaKeyPress): new method
168 2000-08-14 Juergen Vigna <jug@sad.it>
170 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
172 * config/kde.m4: addes some features
174 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
175 include missing xforms dialogs.
177 * src/Timeout.h: a hack to be able to compile with qt/kde.
179 * sigc++/.cvsignore: added acinclude.m4
181 * lib/.cvsignore: added listerros
183 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
184 xforms tree as objects are needed for other frontends.
186 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
187 linking with not yet implemented xforms objects.
189 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
191 2000-08-14 Baruch Even <baruch.even@writeme.com>
193 * src/frontends/xforms/FormGraphics.h:
194 * src/frontends/xforms/FormGraphics.C:
195 * src/frontends/xforms/RadioButtonGroup.h:
196 * src/frontends/xforms/RadioButtonGroup.C:
197 * src/insets/insetgraphics.h:
198 * src/insets/insetgraphics.C:
199 * src/insets/insetgraphicsParams.h:
200 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
201 instead of spaces, and various other indentation issues to make the
202 sources more consistent.
204 2000-08-14 Marko Vendelin <markov@ioc.ee>
206 * src/frontends/gnome/dialogs/diaprint.glade
207 * src/frontends/gnome/FormPrint.C
208 * src/frontends/gnome/FormPrint.h
209 * src/frontends/gnome/diaprint_callbacks.c
210 * src/frontends/gnome/diaprint_callbacks.h
211 * src/frontends/gnome/diaprint_interface.c
212 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
215 * src/frontends/gnome/dialogs/diainserturl.glade
216 * src/frontends/gnome/FormUrl.C
217 * src/frontends/gnome/FormUrl.h
218 * src/frontends/gnome/diainserturl_callbacks.c
219 * src/frontends/gnome/diainserturl_callbacks.h
220 * src/frontends/gnome/diainserturl_interface.c
221 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
224 * src/frontends/gnome/Dialogs.C
225 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
226 all other dialogs. Copy all unimplemented dialogs from Xforms
229 * src/frontends/gnome/support.c
230 * src/frontends/gnome/support.h: support files generated by Glade
234 * config/gnome.m4: Gnome configuration scripts
236 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
237 configure --help message
239 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
240 only if there are no events pendling in Gnome/Gtk. This enhances
241 the performance of menus.
244 2000-08-14 Allan Rae <rae@lyx.org>
246 * lib/Makefile.am: listerrors cleaning
248 * lib/listerrors: removed -- generated file
249 * acinclude.m4: ditto
250 * sigc++/acinclude.m4: ditto
252 * src/frontends/xforms/forms/form_citation.fd:
253 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
256 * src/frontends/xforms/forms/makefile: I renamed the `install` target
257 `updatesrc` and now we have a `test` target that does what `updatesrc`
258 used to do. I didn't like having an install target that wasn't related
261 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
262 on all except FormGraphics. This may yet happen. Followed by a major
263 cleanup including using FL_TRANSIENT for most of the dialogs. More
264 changes to come when the ButtonController below is introduced.
266 * src/frontends/xforms/ButtonController.h: New file for managing up to
267 four buttons on a dialog according to an externally defined policy.
268 * src/frontends/xforms/Makefile.am: added above
270 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
271 Apply and Cancel/Close buttons and everything in between and beyond.
272 * src/frontends/Makefile.am: added above.
274 * src/frontends/xforms/forms/form_preferences.fd:
275 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
276 and removed variable 'status' as a result. Fixed the set_minsize thing.
277 Use the new screen-font-update after checking screen fonts were changed
278 Added a "Restore" button to restore the original lyxrc values while
279 editing. This restores everything not just the last input changed.
280 That's still a tricky one. As is the "LyX: this shouldn't happen..."
282 * src/LyXAction.C: screen-font-update added for updating buffers after
283 screen font settings have been changed.
284 * src/commandtags.h: ditto
285 * src/lyxfunc.C: ditto
287 * forms/lyx.fd: removed screen fonts dialog.
288 * src/lyx_gui.C: ditto
289 * src/menus.[Ch]: ditto
290 * src/lyx.[Ch]: ditto
291 * src/lyx_cb.C: ditto + code from here moved to make
292 screen-font-update. And people wonder why progress on GUII is
293 slow. Look at how scattered this stuff was! It takes forever
296 * forms/fdfix.sh: Fixup the spacing after commas.
297 * forms/makefile: Remove date from generated files. Fewer clashes now.
298 * forms/bullet_forms.C.patch: included someones handwritten changes
300 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
301 once I've discovered why LyXRC was made noncopyable.
302 * src/lyx_main.C: ditto
304 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
306 * src/frontends/xforms/forms/fdfix.sh:
307 * src/frontends/xforms/forms/fdfixh.sed:
308 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
309 * src/frontends/xforms/Form*.[hC]:
310 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
311 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
312 provide a destructor for the struct FD_form_xxxx. Another version of
313 the set_[max|min]size workaround and a few other cleanups. Actually,
314 Angus' patch from 20000809.
316 2000-08-13 Baruch Even <baruch.even@writeme.com>
318 * src/insets/insetgraphics.C (Clone): Added several fields that needed
321 2000-08-11 Juergen Vigna <jug@sad.it>
323 * src/insets/insetgraphics.C (InsetGraphics): changing init
324 order because of warnings.
326 * src/frontends/xforms/forms/makefile: adding patching .C with
329 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
330 from .C.patch to .c.patch
332 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
333 order because of warning.
335 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
337 * src/frontends/Liason.C (setMinibuffer): new helper function
339 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
341 * src/lyxfunc.C (Dispatch): calling new Document-Layout
343 * lib/ui/default.ui: commented out PaperLayout entry
345 * src/frontends/xforms/form_document.[Ch]: new added files
347 * src/frontends/xforms/FormDocument.[Ch]: ditto
349 * src/frontends/xforms/forms/form_document.fd: ditto
351 * src/frontends/xforms/forms/form_document.C.patch: ditto
353 2000-08-10 Juergen Vigna <jug@sad.it>
355 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
356 (InsetGraphics): initialized cacheHandle to 0.
357 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
359 2000-08-10 Baruch Even <baruch.even@writeme.com>
361 * src/graphics/GraphicsCache.h:
362 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
363 correctly as a cache.
365 * src/graphics/GraphicsCacheItem.h:
366 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
369 * src/graphics/GraphicsCacheItem_pimpl.h:
370 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
373 * src/insets/insetgraphics.h:
374 * src/insets/insetgraphics.C: Changed from using a signal notification
375 to polling when image is not loaded.
377 2000-08-10 Allan Rae <rae@lyx.org>
379 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
380 that there are two functions that have to been taken out of line by
381 hand and aren't taken care of in the script. (Just a reminder note)
383 * sigc++/macros/*.h.m4: Updated as above.
385 2000-08-09 Juergen Vigna <jug@sad.it>
387 * src/insets/insettext.C (draw): small fix for clearing rectangle.
389 * src/insets/insettabular.C: make drawing of single cell smarter.
391 2000-08-09 Marko Vendelin <markov@ioc.ee>
392 * src/frontends/gnome/Menubar_pimpl.C
393 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
394 implementation: new files
396 * src/frontends/gnome/mainapp.C
397 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
400 * src/main.C: create Gnome main window
402 * src/frontends/xforms/Menubar_pimpl.h
403 * src/frontends/Menubar.C
404 * src/frontends/Menubar.h: added method Menubar::update that calls
405 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
407 * src/LyXView.C: calls Menubar::update to update the state
410 * src/frontends/gnome/Makefile.am: added new files
412 * src/frontends/Makefile.am: added frontend compiler options
414 2000-08-08 Juergen Vigna <jug@sad.it>
416 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
418 * src/bufferlist.C (close):
419 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
420 documents if exiting without saving.
422 * src/buffer.C (save): use removeAutosaveFile()
424 * src/support/filetools.C (removeAutosaveFile): new function.
426 * src/lyx_cb.C (MenuWrite): returns a bool now.
427 (MenuWriteAs): check if file could really be saved and revert to the
429 (MenuWriteAs): removing old autosavefile if existant.
431 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
432 before Goto toggle declaration, because of compiler warning.
434 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
436 * src/lyxfunc.C (MenuNew): small fix.
438 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
440 * src/bufferlist.C (newFile):
441 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
443 * src/lyxrc.C: added new_ask_filename tag
445 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
447 * src/lyx.fd: removed code pertaining to form_ref
448 * src/lyx.[Ch]: ditto
449 * src/lyx_cb.C: ditto
450 * src/lyx_gui.C: ditto
451 * src/lyx_gui_misc.C: ditto
453 * src/BufferView_pimpl.C (restorePosition): update buffer only
456 * src/commandtags.h (LFUN_REFTOGGLE): removed
457 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
458 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
459 (LFUN_REFBACK): renamed LFUN_REF_BACK
461 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
463 * src/lyxfunc.C (Dispatch): ditto.
464 InsertRef dialog is now GUI-independent.
466 * src/texrow.C: added using std::endl;
468 * src/insets/insetref.[Ch]: strip out large amounts of code.
469 The inset is now a container and this functionality is now
470 managed by a new FormRef dialog
472 * src/frontends/Dialogs.h (showRef, createRef): new signals
474 * src/frontends/xforms/FormIndex.[Ch],
475 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
476 when setting dialog's min/max size
477 * src/frontends/xforms/FormIndex.[Ch]: ditto
479 * src/frontends/xforms/FormRef.[Ch],
480 src/frontends/xforms/forms/form_ref.fd: new xforms
481 implementation of an InsetRef dialog
483 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
486 * src/graphics/XPM_Renderer.C (isImageFormatOK):
487 ios::nocreate is not part of the standard. Removed.
489 2000-08-07 Baruch Even <baruch.even@writeme.com>
491 * src/graphics/Renderer.h:
492 * src/graphics/Renderer.C: Added base class for rendering of different
493 image formats into Pixmaps.
495 * src/graphics/XPM_Renderer.h:
496 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
497 in a different class.
499 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
500 easily add support for other formats.
502 * src/insets/figinset.C: plugged a leak of an X resource.
504 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
506 * src/CutAndPaste.[Ch]: make all metods static.
508 * development/Code_rules/Rules: more work, added section on
509 Exceptions, and a References section.
511 * a lot of header files: work to make doc++ able to generate the
512 source documentation, some workarounds of doc++ problems. Doc++ is
513 now able to generate the documentation.
515 2000-08-07 Juergen Vigna <jug@sad.it>
517 * src/insets/insettabular.C (recomputeTextInsets): removed function
519 * src/tabular.C (SetWidthOfMulticolCell):
521 (calculate_width_of_column_NMC): fixed return value so that it really
522 only returns true if the column-width has changed (there where
523 problems with muliticolumn-cells in this column).
525 2000-08-04 Juergen Vigna <jug@sad.it>
527 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
528 also on the scrollstatus of the inset.
529 (workAreaMotionNotify): ditto.
531 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
533 2000-08-01 Juergen Vigna <jug@sad.it>
535 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
538 * src/LyXAction.C (init):
539 * src/insets/inset.C (LocalDispatch): added support for
542 * src/insets/inset.C (scroll): new functions.
544 * src/insets/insettext.C (removeNewlines): new function.
545 (SetAutoBreakRows): removes forced newlines in the text of the
546 paragraph if autoBreakRows is set to false.
548 * src/tabular.C (Latex): generates a parbox around the cell contents
551 * src/frontends/xforms/FormTabular.C (local_update): removed
552 the radio_useparbox button.
554 * src/tabular.C (UseParbox): new function
556 2000-08-06 Baruch Even <baruch.even@writeme.com>
558 * src/graphics/GraphicsCache.h:
559 * src/graphics/GraphicsCache.C:
560 * src/graphics/GraphicsCacheItem.h:
561 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
564 * src/insets/insetgraphics.h:
565 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
566 drawing of the inline image.
568 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
569 into the wrong position.
571 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
574 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
576 * src/support/translator.h: move all typedefs to public section
578 * src/support/filetools.C (MakeLatexName): return string const
581 (FileOpenSearch): ditto
583 (LibFileSearch): ditto
584 (i18nLibFileSearch): ditto
587 (CreateTmpDir): ditto
588 (CreateBufferTmpDir): ditto
589 (CreateLyXTmpDir): ditto
594 (OnlyFilename): ditto
596 (NormalizePath): ditto
598 (GetFileContents): ditto
599 (ReplaceEnvironmentPath): ditto
602 (ChangeExtension): ditto
603 (MakeDisplayPath): ditto
604 (do_popen): return cmdret const
605 (findtexfile): return string const
607 * src/support/DebugStream.h: add some /// to please doc++
609 * src/frontends/DialogBase.h (endif): add some /// to please doc++
611 * src/texrow.C (same_rownumber): functor to use with find_if
612 (getIdFromRow): rewritten to use find_if and to not update the
613 positions. return true if row is found
614 (increasePos): new method, use to update positions
616 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
618 * src/lyxlex_pimpl.C (verifyTable): new method
621 (GetString): return string const
622 (pushTable): rewrite to use std::stack
624 (setFile): better check
627 * src/lyxlex.h: make LyXLex noncopyable
629 * src/lyxlex.C (text): return char const * const
630 (GetString): return string const
631 (getLongString): return string const
633 * src/lyx_gui_misc.C (askForText): return pair<...> const
635 * src/lastfiles.[Ch] (operator): return string const
637 * src/buffer.C (parseSingleLyXformat2Token): pass string to
638 istringstream not char const *.
639 move token.end() out of loop.
640 (readFile): move initializaton of token
642 * src/BufferView2.C (insertErrors): run texrow.increasePos if
643 getIdFromRow is successful.
645 * lib/bind/emacs.bind: don't include menus bind
647 * development/Code_rules/Rules: the beginnings of making this
648 better and covering more of the unwritten rules that we have.
650 * development/Code_rules/Recommendations: a couple of wording
653 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
655 * src/support/strerror.c: remove C++ comment.
657 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
659 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
660 LFUN_INDEX_INSERT_LAST
662 * src/texrow.C (getIdFromRow): changed from const_iterator to
663 iterator, allowing code to compile with DEC cxx
665 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
666 stores part of the class, as suggested by Allan. Will allow
668 (apply): test to apply uses InsetCommandParams operator!=
670 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
671 (apply): test to apply uses InsetCommandParams operator!=
673 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
674 stores part of the class.
675 (update): removed limits on min/max size.
677 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
678 (apply): test to apply uses InsetCommandParams operator!=
680 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
681 (Read, Write, scanCommand, getCommand): moved functionality
682 into InsetCommandParams.
684 (getScreenLabel): made pure virtual
685 new InsetCommandParams operators== and !=
687 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
688 c-tors based on InsetCommandParams. Removed others.
689 * src/insets/insetinclude.[Ch]: ditto
690 * src/insets/insetlabel.[Ch]: ditto
691 * src/insets/insetparent.[Ch]: ditto
692 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
694 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
695 insets derived from InsetCommand created using similar c-tors
696 based on InsetCommandParams
697 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
698 * src/menus.C (ShowRefsMenu): ditto
699 * src/paragraph.C (Clone): ditto
700 * src/text2.C (SetCounter): ditto
701 * src/lyxfunc.C (Dispatch) ditto
702 Also recreated old InsetIndex behaviour exactly. Can now
703 index-insert at the start of a paragraph and index-insert-last
704 without launching the pop-up.
706 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
708 * lib/lyxrc.example: mark te pdf options as non functional.
710 * src/support/lstrings.C (strToInt): move initalization of tmpstr
711 (isStrDbl): move tmpstr.end() out of loop.
712 (strToDbl): move intialization of tmpstr
713 (lowercase): return string const and move tmp.end() out of loop.
714 (uppercase): return string const and move tmp.edn() out of loop.
715 (prefixIs): add assertion
720 (containsOnly): ditto
721 (containsOnly): ditto
722 (containsOnly): ditto
723 (countChar): make last arg char not char const
724 (token): return string const
725 (subst): return string const, move tmp.end() out of loop.
726 (subst): return string const, add assertion
727 (strip): return string const
728 (frontStrip): return string const, add assertion
729 (frontStrip): return string const
734 * src/support/lstrings.C: add inclde "LAssert.h"
735 (isStrInt): move tmpstr.end() out of loop.
737 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
738 toollist.end() out of loop.
739 (deactivate): move toollist.end() out of loop.
740 (update): move toollist.end() out of loop.
741 (updateLayoutList): move tc.end() out of loop.
742 (add): move toollist.end() out of loop.
744 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
745 md.end() out of loop.
747 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
749 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
752 * src/paragraph.C (Erase): move fontlist.end() out of loop.
753 (Erase): move insetlist.end() out of loop.
755 * src/lyx_sendfax_main.C: make show_logfile static and to take a
756 ref to const string as first arg. Move initialization of some
757 variables, whitespace changes.
759 * src/kbmap.C (defkey): move table.end() out of loop.
760 (kb_keymap): move table.end() out of loop.
761 (findbinding): move table.end() out of loop.
763 * src/MenuBackend.C (hasMenu): move end() out of loop.
764 (getMenu): move end() out of loop.
765 (getMenu): move menulist_.end() out of loop.
767 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
769 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
772 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
773 (getFromLyXName): move infotab.end() out of loop.
775 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
776 -fvtable-thunks -ffunction-sections -fdata-sections
778 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
780 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
783 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
785 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
787 * src/frontends/xforms/FormCitation.[Ch],
788 src/frontends/xforms/FormIndex.[Ch],
789 src/frontends/xforms/FormToc.[Ch],
790 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
792 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
794 * src/commandtags.h: renamed, created some flags for citation
797 * src/lyx_gui_misc.C: stripped out old FD_index_form code
799 * src/lyxfunc.C (dispatch): use signals to insert index entry
801 * src/frontends/Dialogs.h: new signal createIndex
803 * src/frontends/xforms/FormCommand.[Ch],
804 src/frontends/xforms/FormCitation.[Ch],
805 src/frontends/xforms/FormToc.[Ch],
806 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
808 * src/insets/insetindex.[Ch]: GUI-independent
810 * src/frontends/xforms/FormIndex.[Ch],
811 * src/frontends/xforms/forms/form_index.fd: xforms implementation
814 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
816 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
817 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
819 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
821 * src/insets/insetref.C (Latex): rewrite so that there is now
822 question that a initialization is requested.
824 * src/insets/insetcommand.h: reenable the hide signal
826 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
828 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
829 fix handling of shortcuts (many bugs :)
830 (add_lastfiles): ditto.
832 * lib/ui/default.ui: fix a few shortcuts.
834 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
836 * Makefile.am: Fix ``rpmdist'' target to return the exit
837 status of the ``rpm'' command, instead of the last command in
838 the chain (the ``rm lyx.xpm'' command, which always returns
841 2000-08-02 Allan Rae <rae@lyx.org>
843 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
844 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
845 * src/frontends/xforms/FormToc.C (FormToc): ditto
847 * src/frontends/xforms/Makefile.am: A few forgotten files
849 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
850 Signals-not-copyable-problem Lars' started commenting out.
852 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
854 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
856 * src/insets/insetcommand.h: Signals is not copyable so anoter
857 scheme for automatic hiding of forms must be used.
859 * src/frontends/xforms/FormCitation.h: don't inerit from
860 noncopyable, FormCommand already does that.
861 * src/frontends/xforms/FormToc.h: ditto
862 * src/frontends/xforms/FormUrl.h: ditto
864 * src/frontends/xforms/FormCitation.C: add include <algorithm>
866 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
868 * src/insets/insetcommand.h (hide): new SigC::Signal0
869 (d-tor) new virtual destructor emits hide signal
871 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
872 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
874 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
875 LOF and LOT. Inset is now GUI-independent
877 * src/insets/insetloa.[Ch]: redundant
878 * src/insets/insetlof.[Ch]: ditto
879 * src/insets/insetlot.[Ch]: ditto
881 * src/frontends/xforms/forms/form_url.fd: tweaked!
882 * src/frontends/xforms/forms/form_citation.fd: ditto
884 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
885 dialogs dealing with InsetCommand insets
887 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
888 FormCommand base class
889 * src/frontends/xforms/FormUrl.[Ch]: ditto
891 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
893 * src/frontends/xforms/FormToc.[Ch]: ditto
895 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
896 passed a generic InsetCommand pointer
897 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
899 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
900 and modified InsetTOC class
901 * src/buffer.C: ditto
903 * forms/lyx.fd: strip out old FD_form_toc code
904 * src/lyx_gui_misc.C: ditto
905 * src/lyx_gui.C: ditto
906 * src/lyx_cb.C: ditto
907 * src/lyx.[Ch]: ditto
909 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
911 * src/support/utility.hpp: tr -d '\r'
913 2000-08-01 Juergen Vigna <jug@sad.it>
915 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
918 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
919 LFUN_TABULAR_FEATURES.
921 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
924 * src/insets/insettabular.C (getStatus): implemented helper function.
926 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
928 2000-07-31 Juergen Vigna <jug@sad.it>
930 * src/text.C (draw): fixed screen update problem for text-insets.
932 * src/text2.C (SetParagrpah): call an update of the inset-owner when
933 something changed probably this has to be added in various other
936 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
938 2000-07-31 Baruch Even <baruch.even@writeme.com>
940 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
941 templates to satisfy compaq cxx.
944 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
946 * src/support/translator.h (equal_1st_in_pair::operator()): take
947 const ref pair_type as arg.
948 (equal_2nd_in_pair::operator()): ditto
949 (Translator::~Translator): remove empty d-tor.
951 * src/graphics/GraphicsCache.C: move include config.h to top, also
952 put initialization of GraphicsCache::singleton here.
953 (~GraphicsCache): move here
954 (addFile): take const ref as arg
957 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
959 * src/BufferView2.C (insertLyXFile): change te with/without header
962 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
964 * src/frontends/xforms/FormGraphics.C (apply): add some
965 static_cast. Not very nice, but required by compaq cxx.
967 * src/frontends/xforms/RadioButtonGroup.h: include header
968 <utility> instead of <pair.h>
970 * src/insets/insetgraphicsParams.C: add using directive.
971 (readResize): change return type to void.
974 * src/lyxfunc.C (getStatus): add missing break for build-program
975 function; add test for Literate for export functions.
977 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
978 entries in Options menu.
980 2000-07-31 Baruch Even <baruch.even@writeme.com>
982 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
983 protect against auto-allocation; release icon when needed.
985 2000-07-31 Matej Cepl <CeplM@seznam.cz>
987 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
990 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
991 earlier czech.kmap), useful only for programming.
993 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
995 * src/frontends/xforms/FormCitation.h: fix conditioning around
998 2000-07-31 Juergen Vigna <jug@sad.it>
1000 * src/frontends/xforms/FormTabular.C (local_update): changed
1001 radio_linebreaks to radio_useparbox and added radio_useminipage.
1003 * src/tabular.C: made support for using minipages/parboxes.
1005 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1007 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1009 (descent): so the cursor is in the middle.
1010 (width): bit smaller box.
1012 * src/insets/insetgraphics.h: added display() function.
1014 2000-07-31 Baruch Even <baruch.even@writeme.com>
1016 * src/frontends/Dialogs.h: Added showGraphics signals.
1018 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1019 xforms form definition of the graphics dialog.
1021 * src/frontends/xforms/FormGraphics.h:
1022 * src/frontends/xforms/FormGraphics.C: Added files, the
1023 GUIndependent code of InsetGraphics
1025 * src/insets/insetgraphics.h:
1026 * src/insets/insetgraphics.C: Major writing to make it work.
1028 * src/insets/insetgraphicsParams.h:
1029 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1030 struct between InsetGraphics and GUI.
1032 * src/LaTeXFeatures.h:
1033 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1034 support for graphicx package.
1036 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1037 for the graphics inset.
1039 * src/support/translator.h: Added file, used in
1040 InsetGraphicsParams. this is a template to translate between two
1043 * src/frontends/xforms/RadioButtonGroup.h:
1044 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1045 way to easily control a radio button group.
1047 2000-07-28 Juergen Vigna <jug@sad.it>
1049 * src/insets/insettabular.C (LocalDispatch):
1050 (TabularFeatures): added support for lyx-functions of tabular features.
1051 (cellstart): refixed this function after someone wrongly changed it.
1053 * src/commandtags.h:
1054 * src/LyXAction.C (init): added support for tabular-features
1056 2000-07-28 Allan Rae <rae@lyx.org>
1058 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1059 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1060 triggers the callback for input checking. As a result we sometimes get
1061 "LyX: This shouldn't happen..." printed to cerr.
1062 (input): Started using status variable since I only free() on
1063 destruction. Some input checking for paths and font sizes.
1065 * src/frontends/xforms/FormPreferences.h: Use status to control
1066 activation of Ok and Apply
1068 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1069 callback. Also resized to stop segfaults with 0.88. The problem is
1070 that xforms-0.88 requires the folder to be wide enough to fit all the
1071 tabs. If it isn't it causes all sorts of problems.
1073 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1075 * src/frontends/xforms/forms/README: Reflect reality.
1077 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1078 * src/frontends/xforms/forms/makefile: ditto.
1080 * src/commandtags.h: Get access to new Preferences dialog
1081 * src/LyXAction.C: ditto
1082 * src/lyxfunc.C: ditto
1083 * lib/ui/default.ui: ditto
1085 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1087 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1089 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1092 * src/frontends/xforms/form_url.[Ch]: added.
1094 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1096 * src/insets/insetbib.h: fixed bug in previous commit
1098 * src/frontends/xforms/FormUrl.h: ditto
1100 * src/frontends/xforms/FormPrint.h: ditto
1102 * src/frontends/xforms/FormPreferences.h: ditto
1104 * src/frontends/xforms/FormCopyright.h: ditto
1106 * src/frontends/xforms/FormCitation.C: ditto
1108 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1109 private copyconstructor and private default contructor
1111 * src/support/Makefile.am: add utility.hpp
1113 * src/support/utility.hpp: new file from boost
1115 * src/insets/insetbib.h: set owner in clone
1117 * src/frontends/xforms/FormCitation.C: added missing include
1120 * src/insets/form_url.[Ch]: removed
1122 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1124 * development/lyx.spec.in
1125 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1126 file/directory re-organization.
1128 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1130 * src/insets/insetcommand.[Ch]: moved the string data and
1131 associated manipulation methods into a new stand-alone class
1132 InsetCommandParams. This class has two additional methods
1133 getAsString() and setFromString() allowing the contents to be
1134 moved around as a single string.
1135 (addContents) method removed.
1136 (setContents) method no longer virtual.
1138 * src/buffer.C (readInset): made use of new InsetCitation,
1139 InsetUrl constructors based on InsetCommandParams.
1141 * src/commandtags.h: add LFUN_INSERT_URL
1143 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1144 independent InsetUrl and use InsetCommandParams to extract
1145 string info and create new Insets.
1147 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1149 * src/frontends/xforms/FormCitation.C (apply): uses
1152 * src/frontends/xforms/form_url.C
1153 * src/frontends/xforms/form_url.h
1154 * src/frontends/xforms/FormUrl.h
1155 * src/frontends/xforms/FormUrl.C
1156 * src/frontends/xforms/forms/form_url.fd: new files
1158 * src/insets/insetcite.[Ch]: removed unused constructors.
1160 * src/insets/insetinclude.[Ch]: no longer store filename
1162 * src/insets/inseturl.[Ch]: GUI-independent.
1164 2000-07-26 Juergen Vigna <jug@sad.it>
1165 * renamed frontend from gtk to gnome as it is that what is realized
1166 and did the necessary changes in the files.
1168 2000-07-26 Marko Vendelin <markov@ioc.ee>
1170 * configure.in: cleaning up gnome configuration scripts
1172 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1174 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1175 shortcuts syndrom by redrawing them explicitely (a better solution
1176 would be appreciated).
1178 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1180 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1183 * src/lyx_cb.C (MenuExport): change html export to do the right
1184 thing depending of the document type (instead of having
1185 html-linuxdoc and html-docbook).
1186 * src/lyxfunc.C (getStatus): update for html
1187 * lib/ui/default.ui: simplify due to the above change.
1188 * src/menus.C (ShowFileMenu): update too (in case we need it).
1190 * src/MenuBackend.C (read): if a menu is defined twice, add the
1191 new entries to the exiting one.
1193 2000-07-26 Juergen Vigna <jug@sad.it>
1195 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1197 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1198 and return a bool if it did actual save the file.
1199 (AutoSave): don't autosave a unnamed doc.
1201 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1202 check if this is an UNNAMED new file and react to it.
1203 (newFile): set buffer to unnamed and change to not mark a new
1204 buffer dirty if I didn't do anything with it.
1206 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1208 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1210 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1211 friend as per Angus's patch posted to lyx-devel.
1213 * src/ext_l10n.h: updated
1215 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1216 gettext on the style string right before inserting them into the
1219 * autogen.sh: add code to extract style strings form layout files,
1220 not good enough yet.
1222 * src/frontends/gtk/.cvsignore: add MAKEFILE
1224 * src/MenuBackend.C (read): run the label strings through gettext
1225 before storing them in the containers.
1227 * src/ext_l10n.h: new file
1229 * autogen.sh : generate the ext_l10n.h file here
1231 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1233 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1236 * lib/ui/default.ui: fix a couple of typos.
1238 * config/gnome/gtk.m4: added (and added to the list of files in
1241 * src/insets/insetinclude.C (unique_id): fix when we are using
1242 lyxstring instead of basic_string<>.
1243 * src/insets/insettext.C (LocalDispatch): ditto.
1244 * src/support/filetools.C: ditto.
1246 * lib/configure.m4: create the ui/ directory if necessary.
1248 * src/LyXView.[Ch] (updateToolbar): new method.
1250 * src/BufferView_pimpl.C (buffer): update the toolbar when
1251 opening/closing buffer.
1253 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1255 * src/LyXAction.C (getActionName): enhance to return also the name
1256 and options of pseudo-actions.
1257 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1259 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1260 as an example of what is possible). Used in File->Build too (more
1261 useful) and in the import/export menus (to mimick the complicated
1262 handling of linuxdoc and friends). Try to update all the entries.
1264 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1267 * src/MenuBackend.C (read): Parse the new OptItem tag.
1269 * src/MenuBackend.h: Add a new optional_ data member (used if the
1270 entry should be omitted when the lyxfunc is disabled).
1272 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1273 function, used as a shortcut.
1274 (create_submenu): align correctly the shortcuts on the widest
1277 * src/MenuBackend.h: MenuItem.label() only returns the label of
1278 the menu without shortcut; new method shortcut().
1280 2000-07-14 Marko Vendelin <markov@ioc.ee>
1282 * src/frontends/gtk/Dialogs.C:
1283 * src/frontends/gtk/FormCopyright.C:
1284 * src/frontends/gtk/FormCopyright.h:
1285 * src/frontends/gtk/Makefile.am: added these source-files for the
1286 Gtk/Gnome support of the Copyright-Dialog.
1288 * src/main.C: added Gnome::Main initialization if using
1289 Gtk/Gnome frontend-GUI.
1291 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1293 * config/gnome/aclocal-include.m4
1294 * config/gnome/compiler-flags.m4
1295 * config/gnome/curses.m4
1296 * config/gnome/gnome--.m4
1297 * config/gnome/gnome-bonobo-check.m4
1298 * config/gnome/gnome-common.m4
1299 * config/gnome/gnome-fileutils.m4
1300 * config/gnome/gnome-ghttp-check.m4
1301 * config/gnome/gnome-gnorba-check.m4
1302 * config/gnome/gnome-guile-checks.m4
1303 * config/gnome/gnome-libgtop-check.m4
1304 * config/gnome/gnome-objc-checks.m4
1305 * config/gnome/gnome-orbit-check.m4
1306 * config/gnome/gnome-print-check.m4
1307 * config/gnome/gnome-pthread-check.m4
1308 * config/gnome/gnome-support.m4
1309 * config/gnome/gnome-undelfs.m4
1310 * config/gnome/gnome-vfs.m4
1311 * config/gnome/gnome-x-checks.m4
1312 * config/gnome/gnome-xml-check.m4
1313 * config/gnome/gnome.m4
1314 * config/gnome/gperf-check.m4
1315 * config/gnome/gtk--.m4
1316 * config/gnome/linger.m4
1317 * config/gnome/need-declaration.m4: added configuration scripts
1318 for Gtk/Gnome frontend-GUI
1320 * configure.in: added support for the --with-frontend=gtk option
1322 * autogen.sh: added config/gnome/* to list of config-files
1324 * acconfig.h: added define for GTKGUI-support
1326 * config/lyxinclude.m4: added --with-frontend[=value] option value
1327 for Gtk/Gnome frontend-GUI support.
1329 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1331 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1335 * src/paragraph.C (GetChar): remove non-const version
1337 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1338 (search_kw): use it.
1340 * src/lyx_main.C (init): if "preferences" exist, read that instead
1342 (ReadRcFile): return bool if the file could be read ok.
1343 (ReadUIFile): add a check to see if lex file is set ok.
1345 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1346 bastring can be used instead of lyxstring (still uses the old code
1347 if std::string is good enough or if lyxstring is used.)
1349 * src/encoding.C: make the arrays static, move ininle functions
1351 * src/encoding.h: from here.
1353 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1354 (parseSingleLyXformat2Token): move inset parsing to separate method
1355 (readInset): new private method
1357 * src/Variables.h: remove virtual from get().
1359 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1360 access to NEW_INSETS and NEW_TABULAR
1362 * src/MenuBackend.h: remove superfluous forward declaration of
1363 MenuItem. Add documentations tags "///", remove empty MenuItem
1364 destructor, remove private default contructor.
1366 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1368 (read): more string mlabel and mname to where they are used
1369 (read): remove unused variables mlabel and mname
1370 (defaults): unconditional clear, make menusetup take advantage of
1371 add returning Menu &.
1373 * src/LyXView.h: define NEW_MENUBAR as default
1375 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1376 to NEW_INSETS and NEW_TABULAR.
1377 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1378 defined. Change some of the "xxxx-inset-insert" functions names to
1381 * several files: more enahncements to NEW_INSETS and the resulting
1384 * lib/lyxrc.example (\date_insert_format): move to misc section
1386 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1387 bastring and use AC_CACHE_CHECK.
1388 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1389 the system have the newest methods. uses AC_CACHE_CHECK
1390 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1391 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1392 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1394 * configure.in: add LYX_CXX_GOOD_STD_STRING
1396 * acinclude.m4: recreated
1398 2000-07-24 Amir Karger
1400 * README: add Hebrew, Arabic kmaps
1403 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1405 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1408 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1410 * Lot of files: add pragma interface/implementation.
1412 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1414 * lib/ui/default.ui: new file (ans new directory). Contains the
1415 default menu and toolbar.
1417 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1418 global space. Toolbars are now read (as menus) in ui files.
1420 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1422 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1423 is disabled because the document is read-only. We want to have the
1424 toggle state of the function anyway.
1425 (getStatus): add code for LFUN_VC* functions (mimicking what is
1426 done in old-style menus)
1428 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1429 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1431 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1432 * src/BufferView_pimpl.C: ditto.
1433 * src/lyxfunc.C: ditto.
1435 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1436 default). This replaces old-style menus by new ones.
1438 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1439 MenuItem. Contain the data structure of a menu.
1441 * src/insets/insettext.C: use LyXView::setLayout instead of
1442 accessing directly the toolbar combox.
1443 * src/lyxfunc.C (Dispatch): ditto.
1445 * src/LyXView.C (setLayout): new method, which just calls
1446 Toolbar::setLayout().
1447 (updateLayoutChoice): move part of this method in Toolbar.
1449 * src/toolbar.[Ch]: removed.
1451 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1452 implementation the toolbar.
1454 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1455 the toolbar. It might make sense to merge it with ToolbarDefaults
1457 (setLayout): new function.
1458 (updateLayoutList): ditto.
1459 (openLayoutList): ditto.
1461 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1462 xforms implementation of the toolbar.
1463 (get_toolbar_func): comment out, since I do not
1464 know what it is good for.
1466 * src/ToolbarDefaults.h: Add the ItemType enum.
1468 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1469 for a list of allocated C strings. Used in Menubar xforms
1470 implementation to avoid memory leaks.
1472 * src/support/lstrings.[Ch] (uppercase): new version taking and
1476 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1477 * lib/bind/emacs.bind: ditto.
1479 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1481 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1482 forward decl of LyXView.
1484 * src/toolbar.C (toolbarItem): moved from toolbar.h
1485 (toolbarItem::clean): ditto
1486 (toolbarItem::~toolbarItem): ditto
1487 (toolbarItem::operator): ditto
1489 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1491 * src/paragraph.h: control the NEW_TABULAR define from here
1493 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1494 USE_TABULAR_INSETS to NEW_TABULAR
1496 * src/ToolbarDefaults.C: add include "lyxlex.h"
1498 * files using the old table/tabular: use NEW_TABULAR to control
1499 compilation of old tabular stuff.
1501 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1504 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1505 planemet in reading of old style floats, fix the \end_deeper
1506 problem when reading old style floats.
1508 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1510 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1512 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1514 * lib/bind/sciword.bind: updated.
1516 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1518 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1519 layout write problem
1521 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1523 * src/Makefile.am (INCLUDES): remove image directory from include
1526 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1527 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1529 * src/LyXView.C (create_form_form_main): read the application icon
1532 * lib/images/*.xpm: change the icons to use transparent color for
1535 * src/toolbar.C (update): change the color of the button when it
1538 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1540 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1541 setting explicitely the minibuffer.
1542 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1544 * src/LyXView.C (showState): new function. Shows font information
1545 in minibuffer and update toolbar state.
1546 (LyXView): call Toolbar::update after creating the
1549 * src/toolbar.C: change toollist to be a vector instead of a
1551 (BubbleTimerCB): get help string directly from the callback
1552 argument of the corresponding icon (which is the action)
1553 (set): remove unnecessary ugliness.
1554 (update): new function. update the icons (depressed, disabled)
1555 depending of the status of the corresponding action.
1557 * src/toolbar.h: remove help in toolbarItem
1559 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1561 * src/Painter.C (text): Added code for using symbol glyphs from
1562 iso10646 fonts. Currently diabled.
1564 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1567 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1568 magyar,turkish and usorbian.
1570 * src/paragraph.C (isMultiLingual): Made more efficient.
1572 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1575 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1576 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1577 Also changed the prototype to "bool math_insert_greek(char)".
1579 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1581 * lots of files: apply the NEW_INSETS on all code that will not be
1582 needed when we move to use the new insets. Enable the define in
1583 lyxparagrah.h to try it.
1585 * src/insets/insettabular.C (cellstart): change to be a static
1587 (InsetTabular): initialize buffer in the initializer list.
1589 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1591 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1592 form_print.h out of the header file. Replaced with forward
1593 declarations of the relevant struct.
1595 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1598 * src/commandtags.h: do not include "debug.h" which does not
1599 belong there. #include it in some other places because of this
1602 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1604 * src/insets/insetcaption.C: add a couple "using" directives.
1606 * src/toolbar.C (add): get the help text directly from lyxaction.
1608 (setPixmap): new function. Loads from disk and sets a pixmap on a
1609 botton; the name of the pixmap file is derived from the command
1612 * src/toolbar.h: remove members isBitmap and pixmap from
1615 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1616 * lib/images/: move many files from images/banner.xpm.
1618 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1620 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1621 * src/toolbar.C: ditto.
1622 * configure.in: ditto.
1623 * INSTALL: document.
1625 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1626 the spellchecker popup is closed from the WM.
1628 2000-07-19 Juergen Vigna <jug@sad.it>
1630 * src/insets/insetfloat.C (Write): small fix because we use the
1631 insetname for the type now!
1633 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1635 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1638 * src/frontends/Dialogs.h: removed hideCitation signal
1640 * src/insets/insetcite.h: added hide signal
1642 * src/insets/insetcite.C (~InsetCitation): emits new signal
1643 (getScreenLabel): "intelligent" label should now fit on the screen!
1645 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1647 * src/frontends/xforms/FormCitation.C (showInset): connects
1648 hide() to the inset's hide signal
1649 (show): modified to use fl_set_object_position rather than
1650 fl_set_object_geometry wherever possible
1652 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1654 * src/insets/lyxinset.h: add caption code
1656 * src/insets/insetfloat.C (type): new method
1658 * src/insets/insetcaption.C (Write): new method
1660 (LyxCode): new method
1662 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1663 to get it right together with using the FloatList.
1665 * src/commandtags.h: add LFUN_INSET_CAPTION
1666 * src/lyxfunc.C (Dispatch): handle it
1668 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1671 * src/Variables.[Ch]: make expand take a const reference, remove
1672 the destructor, some whitespace changes.
1674 * src/LyXAction.C (init): add caption-inset-insert
1676 * src/FloatList.C (FloatList): update the default floats a bit.
1678 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1680 * src/Variables.[Ch]: new files. Intended to be used for language
1681 specific strings (like \chaptername) and filename substitution in
1684 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1686 * lib/kbd/american.kmap: update
1688 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1690 * src/bufferparams.[Ch]: remove member allowAccents.
1692 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1694 * src/LaTeXLog.C: use the log_form.h header.
1695 * src/lyx_gui.C: ditto.
1696 * src/lyx_gui_misc.C: ditto.
1697 * src/lyxvc.h: ditto.
1699 * forms/log_form.fd: new file, created from latexoptions.fd. I
1700 kept the log popup and nuked the options form.
1702 * src/{la,}texoptions.[Ch]: removed.
1703 * src/lyx_cb.C (LaTeXOptions): ditto
1705 * src/lyx_gui.C (create_forms): do not handle the
1706 fd_latex_options form.
1708 2000-07-18 Juergen Vigna <jug@sad.it>
1710 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1711 name of the inset so that it can be requested outside (text2.C).
1713 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1716 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1718 * src/mathed/formula.h (ConvertFont): constify
1720 * src/mathed/formula.C (Read): add warning if \end_inset is not
1721 found on expected place.
1723 * src/insets/lyxinset.h (ConvertFont): consify
1725 * src/insets/insetquotes.C (ConvertFont): constify
1726 * src/insets/insetquotes.h: ditto
1728 * src/insets/insetinfo.h: add labelfont
1730 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1731 (ascent): use labelfont
1735 (Write): make .lyx file a bit nicer
1737 * src/insets/insetfloat.C (Write): simplify somewhat...
1738 (Read): add warning if arg is not found
1740 * src/insets/insetcollapsable.C: add using std::max
1741 (Read): move string token and add warning in arg is not found
1742 (draw): use std::max to get the right ty
1743 (getMaxWidth): simplify by using std::max
1745 * src/insets/insetsection.h: new file
1746 * src/insets/insetsection.C: new file
1747 * src/insets/insetcaption.h: new file
1748 * src/insets/insetcaption.C: new file
1750 * src/insets/inset.C (ConvertFont): constify signature
1752 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1753 insetcaption.[Ch] and insetsection.[Ch]
1755 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1756 uses to use LABEL_COUNTER_CHAPTER instead.
1757 * src/text2.C (SetCounter): here
1759 * src/counters.h: new file
1760 * src/counters.C: new file
1761 * src/Sectioning.h: new file
1762 * src/Sectioning.C: new file
1764 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1766 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1768 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1771 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1774 2000-07-17 Juergen Vigna <jug@sad.it>
1776 * src/tabular.C (Validate): check if array-package is needed.
1777 (SetVAlignment): added support for vertical alignment.
1778 (SetLTFoot): better support for longtable header/footers
1779 (Latex): modified to support added features.
1781 * src/LaTeXFeatures.[Ch]: added array-package.
1783 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
1785 * src/lyx_gui.C (LyXGUI): make sure that the height is large
1788 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
1790 * configure.in: do not forget to put a space after -isystem.
1792 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
1794 * lib/kbd/arabic.kmap: a few fixes.
1796 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1798 * some whitespace chagnes to a number of files.
1800 * src/support/DebugStream.h: change to make it easier for
1801 doc++ to parse correctly.
1802 * src/support/lyxstring.h: ditto
1804 * src/mathed/math_utils.C (compara): change to have only one
1806 (MathedLookupBOP): change because of the above.
1808 * src/mathed/math_delim.C (math_deco_compare): change to have only
1810 (search_deco): change becasue of the above.
1812 * src/insets/insettabular.C (DrawCellSelection): use std::swap
1813 instead of manually coded one.
1815 * src/insets/insetquotes.C (Read): read the \end_inset too
1817 * src/insets/insetlatex.h: remove file
1818 * src/insets/insetlatex.C: remove file
1820 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
1822 (InsetPrintIndex): remove destructor
1824 * src/insets/insetinclude.h: remove default constructor
1826 * src/insets/insetfloat.C: work to make it work better
1828 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
1830 * src/insets/insetcite.h (InsetCitation): remove default constructor
1832 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
1834 * src/text.C (GetColumnNearX): comment out some currently unused code.
1836 * src/paragraph.C (writeFile): move some initializations closer to
1838 (CutIntoMinibuffer): small change to use new matchIT operator
1842 (InsertInset): ditto
1845 (InsetIterator): ditto
1846 (Erase): small change to use new matchFT operator
1848 (GetFontSettings): ditto
1849 (HighestFontInRange): ditto
1852 * src/lyxparagraph.h: some chars changed to value_type
1853 (matchIT): because of some stronger checking (perhaps too strong)
1854 in SGI STL, the two operator() unified to one.
1857 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
1859 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
1860 the last inset read added
1861 (parseSingleLyXformat2Token): some more (future) compability code added
1862 (parseSingleLyXformat2Token): warning about solitary \end_inset added
1863 (parseSingleLyXformat2Token): set last_inset_read
1864 (parseSingleLyXformat2Token): more code to read new "Float" correctly
1865 (parseSingleLyXformat2Token): don't double intializw string next_token
1867 * src/TextCache.C (text_fits::operator()): add const's to the signature
1868 (has_buffer::operator()): ditto
1870 * src/Floating.h: add some comments on the class
1872 * src/FloatList.[Ch] (typeExist): new method
1875 * src/BackStack.h: added default constructor, wanted by Gcc.
1877 2000-07-14 Juergen Vigna <jug@sad.it>
1879 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
1881 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
1883 * src/insets/insettabular.C (resizeLyXText): need this to be able to
1884 do a redraw when the window is resized!
1885 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
1887 * src/insets/insettext.C (resizeLyXText): added function to correctly
1888 being able to resize the LyXWindow.
1890 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
1892 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
1894 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
1895 crashes when closing dialog to a deleted inset.
1897 * src/insets/insetcite.[Ch] (Edit) : the return of this former
1898 method! Now similar to other insets.
1900 2000-07-13 Juergen Vigna <jug@sad.it>
1902 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
1904 * lib/examples/Literate.lyx: small patch!
1906 * src/insets/insetbib.C (Read): added this function because of wrong
1907 Write (without [begin|end]_inset).
1909 2000-07-11 Juergen Vigna <jug@sad.it>
1911 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
1912 as the insertInset could not be good!
1914 * src/screen.C (ToggleSelection): fixed toggle selection bug as
1915 the bool param should not be last.
1917 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1919 * sigc++/configure.in: fix bug in threading-related code (Yes, I
1920 did submit that to Karl).
1922 * configure.in: use -isystem instead of -I for X headers. This
1923 fixes a problem on solaris with a recent gcc;
1924 put the front-end code after the X detection code;
1925 configure in sigc++ before lib/
1927 * src/lyx_main.C (commandLineHelp): remove -display from command
1930 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
1932 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
1933 Also put in Makefile rules for building the ``listerrors''
1934 program for parsing errors from literate programs written in LyX.
1936 * lib/build-listerrors: Added small shell script as part of compile
1937 process. This builds a working ``listerrors'' binary if noweb is
1938 installed and either 1) the VNC X server is installed on the machine,
1939 or 2) the user is compiling from within a GUI. The existence of a GUI
1940 is necessary to use the ``lyx --export'' feature for now. This
1941 hack can be removed once ``lyx --export'' no longer requires a GUI to
1944 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
1946 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
1947 now passed back correctly from gcc and placed "under" error
1948 buttons in a Literate LyX source.
1950 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1952 * src/text.C (GetColumnNearX): Better behavior when a RTL
1953 paragraph is ended by LTR text.
1955 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
1958 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1960 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
1961 true when clipboard is empty.
1963 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
1965 * text.C (Backspace): Prevent rebreaking of a row if it is the last
1966 row of the paragraph.
1967 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
1968 to prevent calculation of bidi tables
1970 2000-07-07 Juergen Vigna <jug@sad.it>
1972 * src/screen.C (ToggleSelection): added y_offset and x_offset
1975 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
1978 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
1980 * src/insets/insettext.C: fixed Layout-Display!
1982 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1984 * configure.in: add check for strings.h header.
1986 * src/spellchecker.C: include <strings.h> in order to have a
1987 definition for bzero().
1989 2000-07-07 Juergen Vigna <jug@sad.it>
1991 * src/insets/insettext.C (draw): set the status of the bv->text to
1992 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
1994 * src/screen.C (DrawOneRow):
1995 (DrawFromTo): redraw the actual row if something has changed in it
1998 * src/text.C (draw): call an update of the toplevel-inset if something
1999 has changed inside while drawing.
2001 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2003 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2005 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2006 processing inside class.
2008 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2009 processing inside class.
2011 * src/insets/insetindex.h new struct Holder, consistent with other
2014 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2015 citation dialog from main code and placed it in src/frontends/xforms.
2016 Dialog launched through signals instead of callbacks
2018 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2020 * lyx.man: update the options description.
2022 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2024 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2025 handle neg values, set min width to 590, add doc about -display
2027 2000-07-05 Juergen Vigna <jug@sad.it>
2029 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2030 calls to BufferView *.
2032 * src/insets/insettext.C (checkAndActivateInset): small fix non
2033 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2035 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2036 their \end_inset token!
2038 2000-07-04 edscott <edscott@imp.mx>
2040 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2041 lib/lyxrc.example: added option \wheel_jump
2043 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2045 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2046 remove support for -width,-height,-xpos and -ypos.
2048 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2050 * src/encoding.[Ch]: New files.
2052 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2053 (text): Call to the underline() method only when needed.
2055 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2057 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2058 encoding(s) for the document.
2060 * src/bufferparams.C (BufferParams): Changed default value of
2063 * src/language.C (newLang): Removed.
2064 (items[]): Added encoding information for all defined languages.
2066 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2067 encoding choice button.
2069 * src/lyxrc.h (font_norm_type): New member variable.
2070 (set_font_norm_type): New method.
2072 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2073 paragraphs with different encodings.
2075 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2076 (TransformChar): Changed to work correctly with Arabic points.
2077 (draw): Added support for drawing Arabic points.
2078 (draw): Removed code for drawing underbars (this is done by
2081 * src/support/textutils.h (IsPrintableNonspace): New function.
2083 * src/BufferView_pimpl.h: Added "using SigC::Object".
2084 * src/LyXView.h: ditto.
2086 * src/insets/insetinclude.h (include_label): Changed to mutable.
2088 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2090 * src/mathed/math_iter.h: remove empty destructor
2092 * src/mathed/math_cursor.h: remove empty destructor
2094 * src/insets/lyxinset.h: add THEOREM_CODE
2096 * src/insets/insettheorem.[Ch]: new files
2098 * src/insets/insetminipage.C: (InsertInset): remove
2100 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2102 (InsertInset): remove
2104 * src/insets/insetlist.C: (InsertList): remove
2106 * src/insets/insetfootlike.[Ch]: new files
2108 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2111 (InsertInset): ditto
2113 * src/insets/insetert.C: remove include Painter.h, reindent
2114 (InsertInset): move to header
2116 * src/insets/insetcollapsable.h: remove explicit from default
2117 contructor, remove empty destructor, add InsertInset
2119 * src/insets/insetcollapsable.C (InsertInset): new func
2121 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2123 * src/vspace.h: add explicit to constructor
2125 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2126 \textcompwordmark, please test this.
2128 * src/lyxrc.C: set ascii_linelen to 65 by default
2130 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2132 * src/commandtags.h: add LFUN_INSET_THEOREM
2134 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2135 (makeLinuxDocFile): remove _some_ of the nice logic
2136 (makeDocBookFile): ditto
2138 * src/Painter.[Ch]: (~Painter): removed
2140 * src/LyXAction.C (init): entry for insettheorem added
2142 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2144 (deplog): code to detect files generated by LaTeX, needs testing
2147 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2149 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2151 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2153 * src/LaTeX.C (deplog): Add a check for files that are going to be
2154 created by the first latex run, part of the project to remove the
2157 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2158 contents to the extension list.
2160 2000-07-04 Juergen Vigna <jug@sad.it>
2162 * src/text.C (NextBreakPoint): added support for needFullRow()
2164 * src/insets/lyxinset.h: added needFullRow()
2166 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2169 * src/insets/insettext.C: lots of changes for update!
2171 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2173 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2175 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2177 * src/insets/insetinclude.C (InsetInclude): fixed
2178 initialization of include_label.
2179 (unique_id): now returns a string.
2181 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2183 * src/LaTeXFeatures.h: new member IncludedFiles, for
2184 a map of key, included file name.
2186 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2187 with the included files for inclusion in SGML preamble,
2188 i. e., linuxdoc and docbook.
2191 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2192 nice (is the generated linuxdoc code to be exported?), that
2193 allows to remove column, and only_body that will be true for
2194 slave documents. Insets are allowed inside SGML font type.
2195 New handling of the SGML preamble for included files.
2196 (makeDocBookFile): the same for docbook.
2198 * src/insets/insetinclude.h:
2199 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2201 (DocBook): new export methods.
2203 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2204 and makeDocBookFile.
2206 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2207 formats to export with command line argument -x.
2209 2000-06-29 Juergen Vigna <jug@sad.it>
2211 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2212 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2214 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2215 region could already been cleared by an inset!
2217 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2219 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2222 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2224 (cursorToggle): remove special handling of lyx focus.
2226 2000-06-28 Juergen Vigna <jug@sad.it>
2228 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2231 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2233 * src/insets/insetindex.C (Edit): add a callback when popup is
2236 * src/insets/insettext.C (LocalDispatch):
2237 * src/insets/insetmarginal.h:
2238 * src/insets/insetlist.h:
2239 * src/insets/insetfoot.h:
2240 * src/insets/insetfloat.h:
2241 * src/insets/insetert.h: add a missing std:: qualifier.
2243 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2245 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2248 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2250 * src/insets/insettext.C (Read): remove tmptok unused variable
2251 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2252 (InsertInset): change for new InsetInset code
2254 * src/insets/insettext.h: add TEXT inline method
2256 * src/insets/insettext.C: remove TEXT macro
2258 * src/insets/insetmarginal.C (Write): new method
2259 (Latex): change output slightly
2261 * src/insets/insetfoot.C (Write): new method
2262 (Latex): change output slightly (don't use endl when no need)
2264 * src/insets/insetert.C (Write): new method
2266 * src/insets/insetcollapsable.h: make button_length, button_top_y
2267 and button_bottm_y protected.
2269 * src/insets/insetcollapsable.C (Write): simplify code by using
2270 tostr. Also do not output the float name, the children class
2271 should to that to get control over own arguments
2273 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2274 src/insets/insetminipage.[Ch]:
2277 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2279 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2281 * src/Makefile.am (lyx_SOURCES): add the new files
2283 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2284 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2285 * src/commandtags.h: ditto
2287 * src/LaTeXFeatures.h: add a std::set of used floattypes
2289 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2291 * src/FloatList.[Ch] src/Floating.h: new files
2293 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2295 * src/lyx_cb.C (TableApplyCB): ditto
2297 * src/text2.C: ditto
2298 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2299 (parseSingleLyXformat2Token): ditto + add code for
2300 backwards compability for old float styles + add code for new insets
2302 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2304 (InsertInset(size_type, Inset *, LyXFont)): new method
2305 (InsetChar(size_type, char)): changed to use the other InsetChar
2306 with a LyXFont(ALL_INHERIT).
2307 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2308 insert the META_INSET.
2310 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2312 * sigc++/thread.h (Threads): from here
2314 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2315 definition out of line
2316 * sigc++/scope.h: from here
2318 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2320 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2321 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2323 * Makefile.am (bindist): new target.
2325 * INSTALL: add instructions for doing a binary distribution.
2327 * development/tools/README.bin.example: update a bit.
2329 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2332 * lib/lyxrc.example: new lyxrc tag \set_color.
2334 * src/lyxfunc.C (Dispatch):
2335 * src/commandtags.h:
2336 * src/LyXAction.C: new lyxfunc "set-color".
2338 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2339 and an x11name given as strings.
2341 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2342 cache when a color is changed.
2344 2000-06-26 Juergen Vigna <jug@sad.it>
2346 * src/lyxrow.C (width): added this functions and variable.
2348 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2351 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2353 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2355 * images/undo_bw.xpm: new icon.
2356 * images/redo_bw.xpm: ditto.
2358 * configure.in (INSTALL_SCRIPT): change value to
2359 ${INSTALL} to avoid failures of install-script target.
2360 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2362 * src/BufferView.h: add a magic "friend" declaration to please
2365 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2367 * forms/cite.fd: modified to allow resizing without messing
2370 * src/insetcite.C: Uses code from cite.fd almost without
2372 User can now resize dialog in the x-direction.
2373 Resizing the dialog in the y-direction is prevented, as the
2374 code does this intelligently already.
2376 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2378 * INSTALL: remove obsolete entry in "problems" section.
2380 * lib/examples/sl_*.lyx: update of the slovenian examples.
2382 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2384 2000-06-23 Juergen Vigna <jug@sad.it>
2386 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2388 * src/buffer.C (resize): delete the LyXText of textinsets.
2390 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2392 * src/insets/lyxinset.h: added another parameter 'cleared' to
2393 the draw() function.
2395 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2396 unlocking inset in inset.
2398 2000-06-22 Juergen Vigna <jug@sad.it>
2400 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2401 of insets and moved first to LyXText.
2403 * src/mathed/formulamacro.[Ch]:
2404 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2406 2000-06-21 Juergen Vigna <jug@sad.it>
2408 * src/text.C (GetVisibleRow): look if I should clear the area or not
2409 using Inset::doClearArea() function.
2411 * src/insets/lyxinset.h: added doClearArea() function and
2412 modified draw(Painter &, ...) to draw(BufferView *, ...)
2414 * src/text2.C (UpdateInset): return bool insted of int
2416 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2418 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2419 combox in the character popup
2421 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2422 BufferParams const & params
2424 2000-06-20 Juergen Vigna <jug@sad.it>
2426 * src/insets/insettext.C (SetParagraphData): set insetowner on
2429 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2431 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2432 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2434 (form_main_): remove
2436 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2437 (create_form_form_main): remove FD_form_main stuff, connect to
2438 autosave_timeout signal
2440 * src/LyXView.[Ch] (getMainForm): remove
2441 (UpdateTimerCB): remove
2442 * src/BufferView_pimpl.h: inherit from SigC::Object
2444 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2445 signal instead of callback
2447 * src/BufferView.[Ch] (cursorToggleCB): remove
2449 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2451 * src/BufferView_pimpl.C: changes because of the one below
2453 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2454 instead of storing a pointer to a LyXText.
2456 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2458 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2460 * src/lyxparagraph.h
2462 * src/paragraph.C: Changed fontlist to a sorted vector.
2464 2000-06-19 Juergen Vigna <jug@sad.it>
2466 * src/BufferView.h: added screen() function.
2468 * src/insets/insettext.C (LocalDispatch): some selection code
2471 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2473 * src/insets/insettext.C (SetParagraphData):
2475 (InsetText): fixes for multiple paragraphs.
2477 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2479 * development/lyx.spec.in: Call configure with ``--without-warnings''
2480 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2481 This should be fine, however, since we generally don't want to be
2482 verbose when making an RPM.
2484 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2486 * lib/scripts/fig2pstex.py: New file
2488 2000-06-16 Juergen Vigna <jug@sad.it>
2490 * src/insets/insettabular.C (UpdateLocal):
2491 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2492 (LocalDispatch): Changed all functions to use LyXText.
2494 2000-06-15 Juergen Vigna <jug@sad.it>
2496 * src/text.C (SetHeightOfRow): call inset::update before requesting
2499 * src/insets/insettext.C (update):
2500 * src/insets/insettabular.C (update): added implementation
2502 * src/insets/lyxinset.h: added update function
2504 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2506 * src/text.C (SelectNextWord): protect against null pointers with
2507 old-style string streams. (fix from Paul Theo Gonciari
2510 * src/cite.[Ch]: remove erroneous files.
2512 * lib/configure.m4: update the list of created directories.
2514 * src/lyxrow.C: include <config.h>
2515 * src/lyxcursor.C: ditto.
2517 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2519 * lib/examples/decimal.lyx: new example file from Mike.
2521 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2522 to find template definitions (from Dekel)
2524 * src/frontends/.cvsignore: add a few things.
2526 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2528 * src/Timeout.C (TimeOut): remove default argument.
2530 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2533 * src/insets/ExternalTemplate.C: add a "using" directive.
2535 * src/lyx_main.h: remove the act_ struct, which seems unused
2538 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2540 * LyX Developers Meeting: All files changed, due to random C++ (by
2541 coincidence) code generator script.
2543 - external inset (cool!)
2544 - initial online editing of preferences
2545 - insettabular breaks insettext(s contents)
2547 - some DocBook fixes
2548 - example files update
2549 - other cool stuff, create a diff and look for yourself.
2551 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2553 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2554 -1 this is a non-line-breaking textinset.
2556 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2557 if there is no width set.
2559 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2561 * Lots of files: Merged the dialogbase branch.
2563 2000-06-09 Allan Rae <rae@lyx.org>
2565 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2566 and the Dispatch methods that used it.
2568 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2569 access to functions formerly kept in Dispatch.
2571 2000-05-19 Allan Rae <rae@lyx.org>
2573 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2574 made to_page and count_copies integers again. from_page remains a
2575 string however because I want to allow entry of a print range like
2576 "1,4,22-25" using this field.
2578 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2579 and printer-params-get. These aren't useful from the minibuffer but
2580 could be used by a script/LyXServer app provided it passes a suitable
2581 auto_mem_buffer. I guess I should take a look at how the LyXServer
2582 works and make it support xtl buffers.
2584 * sigc++/: updated to libsigc++-1.0.1
2586 * src/xtl/: updated to xtl-1.3.pl.11
2588 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2589 those changes done to the files in src/ are actually recreated when
2590 they get regenerated. Please don't ever accept a patch that changes a
2591 dialog unless that patch includes the changes to the corresponding *.fd
2594 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2595 stringOnlyContains, renamed it and generalised it.
2597 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2598 branch. Removed the remaining old form_print code.
2600 2000-04-26 Allan Rae <rae@lyx.org>
2602 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2603 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2605 2000-04-25 Allan Rae <rae@lyx.org>
2607 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2608 against a base of xtl-1.3.pl.4
2610 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2611 filter the Id: entries so they still show the xtl version number
2614 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2615 into the src/xtl code. Patch still pending with José (XTL)
2617 2000-04-24 Allan Rae <rae@lyx.org>
2619 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2620 both more generic and much safer. Use the new template functions.
2621 * src/buffer.[Ch] (Dispatch): ditto.
2623 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2624 and mem buffer more intelligently. Also a little general cleanup.
2627 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2628 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2629 * src/xtl/Makefile.am: ditto.
2630 * src/xtl/.cvsignore: ditto.
2631 * src/Makefile.am: ditto.
2633 * src/PrinterParams.h: Removed the macros member functions. Added a
2634 testInvariant member function. A bit of tidying up and commenting.
2635 Included Angus's idea for fixing operation with egcs-1.1.2.
2637 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2638 cool expansion of XTL's mem_buffer to support automatic memory
2639 management within the buffer itself. Removed the various macros and
2640 replaced them with template functions that use either auto_mem_buffer
2641 or mem_buffer depending on a #define. The mem_buffer support will
2642 disappear as soon as the auto_mem_buffer is confirmed to be good on
2643 other platforms/compilers. That is, it's there so you've got something
2646 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2647 effectively forked XTL. However I expect José will include my code
2648 into the next major release. Also fixed a memory leak.
2649 * src/xtl/text.h: ditto.
2650 * src/xtl/xdr.h: ditto.
2651 * src/xtl/giop.h: ditto.
2653 2000-04-16 Allan Rae <rae@lyx.org>
2655 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2656 by autogen.sh and removed by maintainer-clean anyway.
2657 * .cvsignore, sigc++/.cvsignore: Support the above.
2659 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2661 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2663 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2664 macros, renamed static callback-target member functions to suit new
2665 scheme and made them public.
2666 * src/frontends/xforms/forms/form_print.fd: ditto.
2667 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2669 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2672 * src/xtl/: New directory containing a minimal distribution of XTL.
2673 This is XTL-1.3.pl.4.
2675 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2677 2000-04-15 Allan Rae <rae@lyx.org>
2679 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2681 * sigc++/: Updated to libsigc++-1.0.0
2683 2000-04-14 Allan Rae <rae@lyx.org>
2685 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2686 use the generic ones in future. I'll modify my conversion script.
2688 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2690 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2691 (CloseAllBufferRelatedDialogs): Renamed.
2692 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2694 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2695 of the generic ones. These are the same ones my conversion script
2698 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2699 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2700 * src/buffer.C (Dispatch): ditto
2702 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2703 functions for updating and hiding buffer dependent dialogs.
2704 * src/BufferView.C (buffer): ditto
2705 * src/buffer.C (setReadonly): ditto
2706 * src/lyxfunc.C (CloseBuffer): ditto
2708 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2709 Dialogs.h, and hence all the SigC stuff, into every file that includes
2710 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2712 * src/BufferView2.C: reduce the number of headers included by buffer.h
2714 2000-04-11 Allan Rae <rae@lyx.org>
2716 * src/frontends/xforms/xform_macros.h: A small collection of macros
2717 for building C callbacks.
2719 * src/frontends/xforms/Makefile.am: Added above file.
2721 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2722 scheme again. This time it should work for JMarc. If this is
2723 successful I'll revise my conversion script to automate some of this.
2724 The static member functions in the class also have to be public for
2725 this scheme will work. If the scheme works (it's almost identical to
2726 the way BufferView::cursorToggleCB is handled so it should work) then
2727 FormCopyright and FormPrint will be ready for inclusion into the main
2728 trunk immediately after 1.1.5 is released -- provided we're prepared
2729 for complaints about lame compilers not handling XTL.
2731 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2733 2000-04-07 Allan Rae <rae@lyx.org>
2735 * config/lyxinclude.m4: A bit more tidying up (Angus)
2737 * src/LString.h: JMarc's <string> header fix
2739 * src/PrinterParams.h: Used string for most data to remove some
2740 ugly code in the Print dialog and avoid even uglier code when
2741 appending the ints to a string for output.
2743 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2744 and moved "default:" back to the end of switch statement. Cleaned
2745 up the printing so it uses the right function calls and so the
2746 "print to file" option actually puts the file in the right directory.
2748 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2750 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2751 and Ok+Apply button control into a separate method: input (Angus).
2752 (input) Cleaned it up and improved it to be very thorough now.
2753 (All CB) static_cast used instead of C style cast (Angus). This will
2754 probably change again once we've worked out how to keep gcc-2.8.1 happy
2755 with real C callbacks.
2756 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2757 ignore some of the bool settings and has random numbers instead. Needs
2758 some more investigation. Added other input length checks and checking
2759 of file and printer names.
2761 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2762 would link (Angus). Seems the old code doesn't compile with the pragma
2763 statement either. Separated callback entries from internal methods.
2765 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2767 2000-03-17 Allan Rae <rae@lyx.org>
2769 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2770 need it? Maybe it could go in Dialogs instead? I could make it a
2771 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2772 values to get the bool return value.
2773 (Dispatch): New overloaded method for xtl support.
2775 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2776 extern "C" callback instead of static member functions. Hopefully,
2777 JMarc will be able to compile this. I haven't changed
2778 forms/form_copyright.fd yet. Breaking one of my own rules already.
2780 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
2781 because they aren't useful from the minibuffer. Maybe a LyXServer
2782 might want a help message though?
2784 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
2786 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
2787 xtl which needs both rtti and exceptions.
2789 * src/support/Makefile.am:
2790 * src/support/lxtl.h: New file. Some helper macros for using XTL.
2792 * src/frontends/xforms/input_validators.[ch]: input filters and
2793 validators. These conrol what keys are valid in input boxes.
2794 Use them and write some more. Much better idea than waiting till
2795 after the user has pressed Ok to say that the input fields don't make
2798 * src/frontends/xforms/Makefile.am:
2799 * src/frontends/xforms/forms/form_print.fd:
2800 * src/frontends/xforms/forms/makefile:
2801 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
2802 new scheme. Still have to make sure I haven't missed anything from
2803 the current implementation.
2805 * src/Makefile.am, src/PrinterParams.h: New data store.
2807 * other files: Added a couple of copyright notices.
2809 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2811 * src/insets/insetbib.h: move Holder struct in public space.
2813 * src/frontends/include/DialogBase.h: use SigC:: only when
2814 SIGC_CXX_NAMESPACES is defined.
2815 * src/frontends/include/Dialogs.h: ditto.
2817 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
2819 * src/frontends/xforms/FormCopyright.[Ch]: do not
2820 mention SigC:: explicitely.
2822 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2824 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
2825 deals with testing KDE in main configure.in
2826 * configure.in: ditto.
2828 2000-02-22 Allan Rae <rae@lyx.org>
2830 * Lots of files: Merged from HEAD
2832 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
2833 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
2835 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
2837 * sigc++/: new minidist.
2839 2000-02-14 Allan Rae <rae@lyx.org>
2841 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
2843 2000-02-08 Juergen Vigna <jug@sad.it>
2845 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
2846 file for the buildin GUI builder of KDevelop of the copyright-dialog.
2848 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
2849 for this port and so it is much easier for other people to port
2850 dialogs in a common development environment.
2852 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
2853 the QT/KDE implementation.
2855 * src/frontends/kde/Dialogs.C:
2856 * src/frontends/kde/FormCopyright.C:
2857 * src/frontends/kde/FormCopyright.h:
2858 * src/frontends/kde/Makefile.am:
2859 * src/frontends/kde/formcopyrightdialog.C:
2860 * src/frontends/kde/formcopyrightdialog.h:
2861 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
2862 for the kde support of the Copyright-Dialog.
2864 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
2865 subdir-substitution instead of hardcoded 'xforms' as we now have also
2868 * src/frontends/include/DialogBase.h (Object): just commented the
2869 label after #endif (nasty warning and I don't like warnings ;)
2871 * src/main.C (main): added KApplication initialization if using
2874 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
2875 For now only the KDE event-loop is added if frontend==kde.
2877 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
2879 * configure.in: added support for the --with-frontend[=value] option
2881 * autogen.sh: added kde.m4 file to list of config-files
2883 * acconfig.h: added define for KDEGUI-support
2885 * config/kde.m4: added configuration functions for KDE-port
2887 * config/lyxinclude.m4: added --with-frontend[=value] option with
2888 support for xforms and KDE.
2890 2000-02-08 Allan Rae <rae@lyx.org>
2892 * all Makefile.am: Fixed up so the make targets dist, distclean,
2893 install and uninstall all work even if builddir != srcdir. Still
2894 have a new sigc++ minidist update to come.
2896 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
2898 2000-02-01 Allan Rae <rae@lyx.org>
2900 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
2901 Many mods to get builddir != srcdir working.
2903 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
2904 for building on NT and so we can do the builddir != srcdir stuff.
2906 2000-01-30 Allan Rae <rae@lyx.org>
2908 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
2909 This will stay in "rae" branch. We probably don't really need it in
2910 the main trunk as anyone who wants to help programming it should get
2911 a full library installed also. So they can check both included and
2912 system supplied library compilation.
2914 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
2915 Added a 'mini' distribution of libsigc++. If you feel the urge to
2916 change something in these directories - Resist it. If you can't
2917 resist the urge then you should modify the following script and rebuild
2918 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
2919 all happen. Still uses a hacked version of libsigc++'s configure.in.
2920 I'm quite happy with the results. I'm not sure the extra work to turn
2921 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
2922 worth the trouble and would probably lead to extra maintenance
2924 I haven't tested the following important make targets: install, dist.
2925 Not ready for prime time but very close. Maybe 1.1.5.
2927 * development/tools/makeLyXsigc.sh: A shell script to automatically
2928 generate our mini-dist of libsigc++. It can only be used with a CVS
2929 checkout of libsigc++ not a tarball distribution. It's well commented.
2930 This will end up as part of the libsigc++ distribution so other apps
2931 can easily have an included mini-dist. If someone makes mods to the
2932 sigc++ subpackage without modifying this script to generate those
2933 changes I'll be very upset!
2935 * src/frontends/: Started the gui/system indep structure.
2937 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
2938 to access the gui-indep dialogs are in this class. Much improved
2939 design compared to previous revision. Lars, please refrain from
2940 moving this header into src/ like you did with Popups.h last time.
2942 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
2944 * src/frontends/xforms/: Started the gui-indep system with a single
2945 dialog: FormCopyright. Initial testing of use of libsigc++ was very
2948 * src/frontends/xforms/forms: Repository for the xforms .fd files.
2949 Here you'll find a very useful makefile and automated fdfix.sh that
2950 makes updating dailogs a no-brainer -- provided you follow the rules
2951 set out in the README. I'm thinking about adding another script to
2952 automatically generate skeleton code for a new dialog given just the
2955 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
2956 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
2957 Made FormCopyright gui-indep and added a lyxfunc to get to it.
2959 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
2961 * src/support/LSubstring.C (operator): simplify
2963 * src/lyxtext.h: removed bparams, use buffer_->params instead
2965 * src/lyxrow.h: make Row a real class, move all variables to
2966 private and use accessors.
2968 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
2970 (isRightToLeftPar): ditto
2971 (ChangeLanguage): ditto
2972 (isMultiLingual): ditto
2975 (SimpleTeXOnePar): ditto
2976 (TeXEnvironment): ditto
2977 (GetEndLabel): ditto
2979 (SetOnlyLayout): ditto
2980 (BreakParagraph): ditto
2981 (BreakParagraphConservative): ditto
2982 (GetFontSettings): ditto
2984 (CopyIntoMinibuffer): ditto
2985 (CutIntoMinibuffer): ditto
2986 (PasteParagraph): ditto
2987 (SetPExtraType): ditto
2988 (UnsetPExtraType): ditto
2989 (DocBookContTableRows): ditto
2990 (SimpleDocBookOneTablePar): ditto
2992 (TeXFootnote): ditto
2993 (SimpleTeXOneTablePar): ditto
2994 (TeXContTableRows): ditto
2995 (SimpleTeXSpecialChars): ditto
2998 * src/lyxcursor.h: make LyXCursor a real class, move all variables
2999 to private and use accessors.
3001 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3002 this, we did not use it anymore and has not been for ages. Just a
3003 waste of cpu cycles.
3005 * src/language.h: make Language a real class, move all variables
3006 to private and use accessors.
3008 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3009 (create_view): remove
3010 (update): some changes for new timer
3011 (cursorToggle): use new timer
3012 (beforeChange): change for new timer
3014 * src/BufferView.h (cursorToggleCB): removed last paramter because
3017 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3018 (cursorToggleCB): change because of new timer code
3020 * lib/CREDITS: updated own mailaddress
3022 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3024 * src/support/filetools.C (PutEnv): fix the code in case neither
3025 putenv() nor setenv() have been found.
3027 * INSTALL: mention the install-strip Makefile target.
3029 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3030 read-only documents.
3032 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3034 * lib/reLyX/configure.in (VERSION): avoid using a previously
3035 generated reLyX wrapper to find out $prefix.
3037 * lib/examples/eu_adibide_lyx-atua.lyx:
3038 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3039 translation of the Tutorial (Dooteo)
3041 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3043 * forms/cite.fd: new citation dialog
3045 * src/insetcite.[Ch]: the new citation dialog is moved into
3048 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3051 * src/insets/insetcommand.h: data members made private.
3053 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3055 * LyX 1.1.5 released
3057 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3059 * src/version.h (LYX_RELEASE): to 1.1.5
3061 * src/spellchecker.C (RunSpellChecker): return false if the
3062 spellchecker dies upon creation.
3064 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3066 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3067 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3071 * lib/CREDITS: update entry for Martin Vermeer.
3073 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3075 * src/text.C (draw): Draw foreign language bars at the bottom of
3076 the row instead of at the baseline.
3078 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3080 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3082 * lib/bind/de_menus.bind: updated
3084 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3086 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3088 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3090 * src/menus.C (Limit_string_length): New function
3091 (ShowTocMenu): Limit the number of items/length of items in the
3094 * src/paragraph.C (String): Correct result for a paragraph inside
3097 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3099 * src/bufferlist.C (close): test of buf->getuser() == NULL
3101 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3103 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3104 Do not call to SetCursor when the paragraph is a closed footnote!
3106 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3108 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3111 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3113 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3116 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3117 reference popup, that activates the reference-back action
3119 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3121 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3122 the menus. Also fixed a bug.
3124 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3125 the math panels when switching buffers (unless new buffer is readonly).
3127 * src/BufferView.C (NoSavedPositions)
3128 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3130 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3132 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3133 less of dvi dirty or not.
3135 * src/trans_mgr.[Ch] (insert): change first parameter to string
3138 * src/chset.[Ch] (encodeString): add const to first parameter
3140 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3142 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3146 * src/LaTeX.C (deplog): better searching for dependency files in
3147 the latex log. Uses now regexps.
3149 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3150 instead of the box hack or \hfill.
3152 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3154 * src/lyxfunc.C (doImportHelper): do not create the file before
3155 doing the actual import.
3156 (doImportASCIIasLines): create a new file before doing the insert.
3157 (doImportASCIIasParagraphs): ditto.
3159 * lib/lyxrc.example: remove mention of non-existing commands
3161 * lyx.man: remove mention of color-related switches.
3163 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3165 * src/lyx_gui.C: remove all the color-related ressources, which
3166 are not used anymore.
3168 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3171 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3173 * src/lyxrc.C (read): Add a missing break in the switch
3175 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3177 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3179 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3182 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3184 * src/text.C (draw): draw bars under foreign language words.
3186 * src/LColor.[Ch]: add LColor::language
3188 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3190 * src/lyxcursor.h (boundary): New member variable
3192 * src/text.C (IsBoundary): New methods
3194 * src/text.C: Use the above for currect cursor movement when there
3195 is both RTL & LTR text.
3197 * src/text2.C: ditto
3199 * src/bufferview_funcs.C (ToggleAndShow): ditto
3201 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3203 * src/text.C (DeleteLineForward): set selection to true to avoid
3204 that DeleteEmptyParagraphMechanism does some magic. This is how it
3205 is done in all other functions, and seems reasonable.
3206 (DeleteWordForward): do not jump over non-word stuff, since
3207 CursorRightOneWord() already does it.
3209 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3210 DeleteWordBackward, since they seem safe to me (since selection is
3211 set to "true") DeleteEmptyParagraphMechanism does nothing.
3213 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3215 * src/lyx_main.C (easyParse): simplify the code by factoring the
3216 part that removes parameters from the command line.
3217 (LyX): check wether wrong command line options have been given.
3219 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3221 * src/lyx_main.C : add support for specifying user LyX
3222 directory via command line option -userdir.
3224 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3226 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3227 the number of items per popup.
3228 (Add_to_refs_menu): Ditto.
3230 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3232 * src/lyxparagraph.h: renamed ClearParagraph() to
3233 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3234 textclass as parameter, and do nothing if free_spacing is
3235 true. This fixes part of the line-delete-forward problems.
3237 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3238 (pasteSelection): ditto.
3239 (SwitchLayoutsBetweenClasses): more translatable strings.
3241 * src/text2.C (CutSelection): use StripLeadingSpaces.
3242 (PasteSelection): ditto.
3243 (DeleteEmptyParagraphMechanism): ditto.
3245 2000-05-26 Juergen Vigna <jug@sad.it>
3247 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3248 is not needed in tabular insets.
3250 * src/insets/insettabular.C (TabularFeatures): added missing features.
3252 * src/tabular.C (DeleteColumn):
3254 (AppendRow): implemented this functions
3255 (cellsturct::operator=): clone the inset too;
3257 2000-05-23 Juergen Vigna <jug@sad.it>
3259 * src/insets/insettabular.C (LocalDispatch): better selection support
3260 when having multicolumn-cells.
3262 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3264 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3266 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3268 * src/ColorHandler.C (getGCForeground): put more test into _()
3270 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3273 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3276 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3278 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3279 there are no labels, or when buffer is readonly.
3281 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3282 there are no labels, buffer is SGML, or when buffer is readonly.
3284 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3286 * src/LColor.C (LColor): change a couple of grey40 to grey60
3287 (LColor): rewore initalization to make compiles go some magnitude
3289 (getGUIName): don't use gettext until we need the string.
3291 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3293 * src/Bullet.[Ch]: Fixed a small bug.
3295 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3297 * src/paragraph.C (String): Several fixes/improvements
3299 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3301 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3303 * src/paragraph.C (String): give more correct output.
3305 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3307 * src/lyxfont.C (stateText) Do not output the language if it is
3308 eqaul to the language of the document.
3310 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3311 between two paragraphs with the same language.
3313 * src/paragraph.C (getParLanguage) Return a correct answer for an
3314 empty dummy paragraph.
3316 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3319 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3322 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3323 the menus/popup, if requested fonts are unavailable.
3325 2000-05-22 Juergen Vigna <jug@sad.it>
3327 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3328 movement support (Up/Down/Tab/Shift-Tab).
3329 (LocalDispatch): added also preliminari cursor-selection.
3331 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3333 * src/paragraph.C (PasteParagraph): Hopefully now right!
3335 2000-05-22 Garst R. Reese <reese@isn.net>
3337 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3338 of list, change all references to Environment to Command
3339 * tex/hollywood.cls : rewrite environments as commands, add
3340 \uppercase to interiorshot and exteriorshot to force uppecase.
3341 * tex/broadway.cls : rewrite environments as commands. Tweak
3344 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3346 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3347 size of items: use a constant intead of the hardcoded 40, and more
3348 importantly do not remove the %m and %x tags added at the end.
3349 (Add_to_refs_menu): use vector::size_type instead of
3350 unsigned int as basic types for the variables. _Please_ do not
3351 assume that size_t is equal to unsigned int. On an alpha, this is
3352 unsigned long, which is _not_ the same.
3354 * src/language.C (initL): remove language "hungarian", since it
3355 seems that "magyar" is better.
3357 2000-05-22 Juergen Vigna <jug@sad.it>
3359 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3361 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3364 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3365 next was deleted but not set to 0.
3367 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3369 * src/language.C (initL): change the initialization of languages
3370 so that compiles goes _fast_.
3372 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3375 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3377 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3381 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3383 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3385 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3389 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3392 * src/insets/insetlo*.[Ch]: Made editable
3394 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3396 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3397 the current selection.
3399 * src/BufferView_pimpl.C (stuffClipboard): new method
3401 * src/BufferView.C (stuffClipboard): new method
3403 * src/paragraph.C (String): new method
3405 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3406 LColor::ignore when lyxname is not found.
3408 * src/BufferView.C (pasteSelection): new method
3410 * src/BufferView_pimpl.C (pasteSelection): new method
3412 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3414 * src/WorkArea.C (request_clipboard_cb): new static function
3415 (getClipboard): new method
3416 (putClipboard): new method
3418 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3420 * LyX 1.1.5pre2 released
3422 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3424 * src/vspace.C (operator=): removed
3425 (operator=): removed
3427 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3429 * src/layout.C (NumberOfClass): manually set the type in make_pair
3430 (NumberOfLayout): ditto
3432 * src/language.C: use the Language constructor for ignore_lang
3434 * src/language.h: add constructors to struct Language
3436 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3438 * src/text2.C (SetCursorIntern): comment out #warning
3440 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3442 * src/mathed/math_iter.h: initialize sx and sw to 0
3444 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3446 * forms/lyx.fd: Redesign of form_ref
3448 * src/LaTeXFeatures.[Ch]
3452 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3455 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3456 and Buffer::inset_iterator.
3458 * src/menus.C: Added new menus: TOC and Refs.
3460 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3462 * src/buffer.C (getTocList): New method.
3464 * src/BufferView2.C (ChangeRefs): New method.
3466 * src/buffer.C (getLabelList): New method. It replaces the old
3467 getReferenceList. The return type is vector<string> instead of
3470 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3471 the old getLabel() and GetNumberOfLabels() methods.
3472 * src/insets/insetlabel.C (getLabelList): ditto
3473 * src/mathed/formula.C (getLabelList): ditto
3475 * src/paragraph.C (String): New method.
3477 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3478 Uses the new getTocList() method.
3479 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3480 which automatically updates the contents of the browser.
3481 (RefUpdateCB): Use the new getLabelList method.
3483 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3485 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3487 * src/spellchecker.C: Added using std::reverse;
3489 2000-05-19 Juergen Vigna <jug@sad.it>
3491 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3493 * src/insets/insettext.C (computeTextRows): small fix for display of
3494 1 character after a newline.
3496 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3499 2000-05-18 Juergen Vigna <jug@sad.it>
3501 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3502 when changing width of column.
3504 * src/tabular.C (set_row_column_number_info): setting of
3505 autobreak rows if necessary.
3507 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3509 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3511 * src/vc-backend.*: renamed stat() to status() and vcstat to
3512 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3513 compilation broke. The new name seems more relevant, anyway.
3515 2000-05-17 Juergen Vigna <jug@sad.it>
3517 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3518 which was wrong if the removing caused removing of rows!
3520 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3521 (pushToken): new function.
3523 * src/text2.C (CutSelection): fix problem discovered with purify
3525 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3527 * src/debug.C (showTags): enlarge the first column, now that we
3528 have 6-digits debug codes.
3530 * lib/layouts/hollywood.layout:
3531 * lib/tex/hollywood.cls:
3532 * lib/tex/brodway.cls:
3533 * lib/layouts/brodway.layout: more commands and fewer
3534 environments. Preambles moved in the .cls files. Broadway now has
3535 more options on scene numbering and less whitespace (from Garst)
3537 * src/insets/insetbib.C (getKeys): make sure that we are in the
3538 document directory, in case the bib file is there.
3540 * src/insets/insetbib.C (Latex): revert bogus change.
3542 2000-05-16 Juergen Vigna <jug@sad.it>
3544 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3545 the TabularLayout on cursor move.
3547 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3549 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3552 (draw): fixed cursor position and drawing so that the cursor is
3553 visible when before the tabular-inset.
3555 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3556 when creating from old insettext.
3558 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3560 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3562 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3563 * lib/tex/brodway.cls: ditto
3565 * lib/layouts/brodway.layout: change alignment of parenthical
3568 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3570 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3571 versions 0.88 and 0.89 are supported.
3573 2000-05-15 Juergen Vigna <jug@sad.it>
3575 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3578 * src/insets/insettext.C (computeTextRows): redone completely this
3579 function in a much cleaner way, because of problems when having a
3581 (draw): added a frame border when the inset is locked.
3582 (SetDrawLockedFrame): this sets if we draw the border or not.
3583 (SetFrameColor): this sets the frame color (default=insetframe).
3585 * src/insets/lyxinset.h: added x() and y() functions which return
3586 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3587 function which is needed to see if we have a locking inset of some
3588 type in this inset (needed for now in insettabular).
3590 * src/vspace.C (inPixels): the same function also without a BufferView
3591 parameter as so it is easier to use it in some ocasions.
3593 * src/lyxfunc.C: changed all places where insertInset was used so
3594 that now if it couldn't be inserted it is deleted!
3596 * src/TabularLayout.C:
3597 * src/TableLayout.C: added support for new tabular-inset!
3599 * src/BufferView2.C (insertInset): this now returns a bool if the
3600 inset was really inserted!!!
3602 * src/tabular.C (GetLastCellInRow):
3603 (GetFirstCellInRow): new helper functions.
3604 (Latex): implemented for new tabular class.
3608 (TeXTopHLine): new Latex() helper functions.
3610 2000-05-12 Juergen Vigna <jug@sad.it>
3612 * src/mathed/formulamacro.C (Read):
3613 * src/mathed/formula.C (Read): read also the \end_inset here!
3615 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3617 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3618 crush when saving formulae with unbalanced parenthesis.
3620 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3622 * src/layout.C: Add new keyword "endlabelstring" to layout file
3624 * src/text.C (GetVisibleRow): Draw endlabel string.
3626 * lib/layouts/broadway.layout
3627 * lib/layouts/hollywood.layout: Added endlabel for the
3628 Parenthetical layout.
3630 * lib/layouts/heb-article.layout: Do not use slanted font shape
3631 for Theorem like environments.
3633 * src/buffer.C (makeLaTeXFile): Always add "american" to
3634 the UsedLanguages list if document language is RTL.
3636 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3638 * add addendum to README.OS2 and small patch (from SMiyata)
3640 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3642 * many files: correct the calls to ChangeExtension().
3644 * src/support/filetools.C (ChangeExtension): remove the no_path
3645 argument, which does not belong there. Use OnlyFileName() instead.
3647 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3648 files when LaTeXing a non-nice latex file.
3650 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3651 a chain of "if". Return false when deadkeys are not handled.
3653 * src/lyx_main.C (LyX): adapted the code for default bindings.
3655 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3656 bindings for basic functionality (except deadkeys).
3657 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3659 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3660 several methods: handle override_x_deadkeys.
3662 * src/lyxrc.h: remove the "bindings" map, which did not make much
3663 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3665 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3667 * src/lyxfont.C (stateText): use a saner method to determine
3668 whether the font is "default". Seems to fix the crash with DEC
3671 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3673 2000-05-08 Juergen Vigna <jug@sad.it>
3675 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3676 TabularLayoutMenu with mouse-button-3
3677 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3679 * src/TabularLayout.C: added this file for having a Layout for
3682 2000-05-05 Juergen Vigna <jug@sad.it>
3684 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3685 recalculating inset-widths.
3686 (TabularFeatures): activated this function so that I can change
3687 tabular-features via menu.
3689 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3690 that I can test some functions with the Table menu.
3692 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3694 * src/lyxfont.C (stateText): guard against stupid c++libs.
3696 * src/tabular.C: add using std::vector
3697 some whitespace changes, + removed som autogenerated code.
3699 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3701 2000-05-05 Juergen Vigna <jug@sad.it>
3703 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3704 row, columns and cellstructures.
3706 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3708 * lib/lyxrc.example: remove obsolete entries.
3710 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3711 reading of protected_separator for free_spacing.
3713 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3715 * src/text.C (draw): do not display an exclamation mark in the
3716 margin for margin notes. This is confusing, ugly and
3719 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3720 AMS math' is checked.
3722 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3723 name to see whether including the amsmath package is needed.
3725 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3727 * src/paragraph.C (validate): Compute UsedLanguages correctly
3728 (don't insert the american language if it doesn't appear in the
3731 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3732 The argument of \thanks{} command is considered moving argument
3734 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3737 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3739 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3740 for appendix/minipage/depth. The lines can be now both in the footnote
3741 frame, and outside the frame.
3743 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3746 2000-05-05 Juergen Vigna <jug@sad.it>
3748 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3749 neede only in tabular.[Ch].
3751 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3753 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3755 (Write): write '~' for PROTECTED_SEPARATOR
3757 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3759 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3762 * src/mathed/formula.C (drawStr): rename size to siz.
3764 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3765 possibly fix a bug by not changing the pflags = flags to piflags =
3768 2000-05-05 Juergen Vigna <jug@sad.it>
3770 * src/insets/insetbib.C: moved using directive
3772 * src/ImportNoweb.C: small fix for being able to compile (missing
3775 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3777 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3778 to use clear, since we don't depend on this in the code. Add test
3781 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3783 * (various *.C files): add using std::foo directives to please dec
3786 * replace calls to string::clear() to string::erase() (Angus)
3788 * src/cheaders/cmath: modified to provide std::abs.
3790 2000-05-04 Juergen Vigna <jug@sad.it>
3792 * src/insets/insettext.C: Prepared all for inserting of multiple
3793 paragraphs. Still display stuff to do (alignment and other things),
3794 but I would like to use LyXText to do this when we cleaned out the
3795 table-support stuff.
3797 * src/insets/insettabular.C: Changed lot of stuff and added lots
3798 of functionality still a lot to do.
3800 * src/tabular.C: Various functions changed name and moved to be
3801 const functions. Added new Read and Write functions and changed
3802 lots of things so it works good with tabular-insets (also removed
3803 some stuff which is not needed anymore * hacks *).
3805 * src/lyxcursor.h: added operators == and != which just look if
3806 par and pos are (not) equal.
3808 * src/buffer.C (latexParagraphs): inserted this function to latex
3809 all paragraphs form par to endpar as then I can use this too for
3812 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
3813 so that I can call this to from text insets with their own cursor.
3815 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
3816 output off all paragraphs (because of the fix below)!
3818 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
3819 the very last paragraph (this could be also the last paragraph of an
3822 * src/texrow.h: added rows() call which returns the count-variable.
3824 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3826 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
3828 * lib/configure.m4: better autodetection of DocBook tools.
3830 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3832 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
3834 * src/lyx_cb.C: add using std::reverse;
3836 * src/LaTeX.C (run): on error always run deleteFilesOnError before
3839 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
3840 selected files. Should fix repeated errors from generated files.
3842 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
3844 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
3846 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
3847 the spellchecker popup.
3849 * lib/lyxrc.example: Removed the \number_inset section
3851 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3853 * src/insets/figinset.C (various): Use IsFileReadable() to make
3854 sure that the file actually exist. Relying on ghostscripts errors
3855 is a bad idea since they can lead to X server crashes.
3857 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
3859 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
3862 * lib/lyxrc.example: smallish typo in description of
3863 \view_dvi_paper_option
3865 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
3868 * src/lyxfunc.C: doImportHelper to factor out common code of the
3869 various import methods. New functions doImportASCIIasLines,
3870 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
3871 doImportLinuxDoc for the format specific parts.
3874 * buffer.C: Dispatch returns now a bool to indicate success
3877 * lyx_gui.C: Add getLyXView() for member access
3879 * lyx_main.C: Change logic for batch commands: First try
3880 Buffer::Dispatch (possibly without GUI), if that fails, use
3883 * lyx_main.C: Add support for --import command line switch.
3884 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
3885 Available Formats: Everything accepted by 'buffer-import <format>'
3887 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3889 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
3892 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
3893 documents will be reformatted upon reentry.
3895 2000-04-27 Juergen Vigna <jug@sad.it>
3897 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
3898 correctly only last pos this was a bug.
3900 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3902 * release of lyx-1.1.5pre1
3904 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3906 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
3908 * src/menus.C: revert the change of naming (Figure->Graphic...)
3909 from 2000-04-11. It was incomplete and bad.
3911 * src/LColor.[Ch]: add LColor::depthbar.
3912 * src/text.C (GetVisibleRow): use it.
3914 * README: update the languages list.
3916 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
3918 * src/text.C (GetVisibleRow): show the depth of paragraphs using
3921 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3923 * README: remove sections that were just wrong.
3925 * src/text2.C (GetRowNearY): remove currentrow code
3927 * src/text.C (GetRow): remove currentrow code
3929 * src/screen.C (Update): rewritten a bit.
3930 (SmallUpdate): removed func
3932 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
3934 (FullRebreak): return bool
3935 (currentrow): remove var
3936 (currentrow_y): ditto
3938 * src/lyxscreen.h (Draw): change arg to unsigned long
3939 (FitCursor): return bool
3940 (FitManualCursor): ditto
3941 (Smallpdate): remove func
3942 (first): change to unsigned long
3943 (DrawOneRow): change second arg to long (from long &)
3944 (screen_refresh_y): remove var
3945 (scree_refresh_row): ditto
3947 * src/lyxrow.h: change baseline to usigned int from unsigned
3948 short, this brings some implicit/unsigned issues out in the open.
3950 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
3952 (Dispatch): don't call updateScrollbar after fitCursor. Use update
3953 instead of smallUpdate.
3955 * src/lyxcursor.h: change y to unsigned long
3957 * src/buffer.h: don't call updateScrollbar after fitcursor
3959 * src/buffer.C (parseSingleLyXformat2Token): move variables to
3960 where they are used. Removed "\\direction", this was not present
3961 in 1.1.4 and is already obsolete. Commented out some code that I
3962 believe to never be called.
3963 (runLiterate): don't call updateScrollbar after fitCursor
3965 (buildProgram): ditto
3968 * src/WorkArea.h (workWidth): change return val to unsigned
3971 (redraw): remove the button redraws
3972 (setScrollbarValue): change for scrollbar
3973 (getScrollbarValue): change for scrollbar
3974 (getScrollbarBounds): change for scrollbar
3976 * src/WorkArea.C (C_WorkArea_up_cb): removed func
3977 (C_WorkArea_down_cb): removed func
3978 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
3979 (resize): change for scrollbar
3980 (setScrollbar): ditto
3981 (setScrollbarBounds): ditto
3982 (setScrollbarIncrements): ditto
3983 (up_cb): removed func
3984 (down_cb): removed func
3985 (scroll_cb): change for scrollbar
3986 (work_area_handler): ditto
3988 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
3989 when FitCursor did something.
3990 (updateScrollbar): some unsigned changes
3991 (downCB): removed func
3992 (scrollUpOnePage): removed func
3993 (scrollDownOnePage): remvoed func
3994 (workAreaMotionNotify): don't call screen->FitCursor but use
3995 fitCursor instead. and bool return val
3996 (workAreaButtonPress): ditto
3997 (workAreaButtonRelease): some unsigned changes
3998 (checkInsetHit): ditto
3999 (workAreaExpose): ditto
4000 (update): parts rewritten, comments about the signed char arg added
4001 (smallUpdate): removed func
4002 (cursorPrevious): call needed updateScrollbar
4005 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4008 * src/BufferView.[Ch] (upCB): removed func
4009 (downCB): removed func
4010 (smallUpdate): removed func
4012 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4014 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4015 currentrow, currentrow_y optimization. This did not help a lot and
4016 if we want to do this kind of optimization we should rather use
4017 cursor.row instead of the currentrow.
4019 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4020 buffer spacing and klyx spacing support.
4022 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4024 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4027 2000-04-26 Juergen Vigna <jug@sad.it>
4029 * src/insets/figinset.C: fixes to Lars sstream changes!
4031 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4033 * A lot of files: Added Ascii(ostream &) methods to all inset
4034 classes. Used when exporting to ASCII.
4036 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4037 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4040 * src/text2.C (ToggleFree): Disabled implicit word selection when
4041 there is a change in the language
4043 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4044 no output was generated for end-of-sentence inset.
4046 * src/insets/lyxinset.h
4049 * src/paragraph.C: Removed the insetnumber code
4051 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4053 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4055 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4056 no_babel and no_epsfig completely from the file.
4057 (parseSingleLyXformat2Token): add handling for per-paragraph
4058 spacing as written by klyx.
4060 * src/insets/figinset.C: applied patch by Andre. Made it work with
4063 2000-04-20 Juergen Vigna <jug@sad.it>
4065 * src/insets/insettext.C (cutSelection):
4066 (copySelection): Fixed with selection from right to left.
4067 (draw): now the rows are not recalculated at every draw.
4068 (computeTextRows): for now reset the inset-owner here (this is
4069 important for an undo or copy where the inset-owner is not set
4072 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4073 motion to the_locking_inset screen->first was forgotten, this was
4074 not important till we got multiline insets.
4076 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4078 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4079 code seems to be alright (it is code changed by Dekel, and the
4080 intent is indeed that all macros should be defined \protect'ed)
4082 * NEWS: a bit of reorganisation of the new user-visible features.
4084 2000-04-19 Juergen Vigna <jug@sad.it>
4086 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4087 position. Set the inset_owner of the used paragraph so that it knows
4088 that it is inside an inset. Fixed cursor handling with mouse and
4089 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4090 and cleanups to make TextInsets work better.
4092 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4093 Changed parameters of various functions and added LockInsetInInset().
4095 * src/insets/insettext.C:
4097 * src/insets/insetcollapsable.h:
4098 * src/insets/insetcollapsable.C:
4099 * src/insets/insetfoot.h:
4100 * src/insets/insetfoot.C:
4101 * src/insets/insetert.h:
4102 * src/insets/insetert.C: cleaned up the code so that it works now
4103 correctly with insettext.
4105 * src/insets/inset.C:
4106 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4107 that insets in insets are supported right.
4110 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4112 * src/paragraph.C: some small fixes
4114 * src/debug.h: inserted INSETS debug info
4116 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4117 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4119 * src/commandtags.h:
4120 * src/LyXAction.C: insert code for InsetTabular.
4122 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4123 not Button1MotionMask.
4124 (workAreaButtonRelease): send always a InsetButtonRelease event to
4126 (checkInsetHit): some setCursor fixes (always with insets).
4128 * src/BufferView2.C (lockInset): returns a bool now and extended for
4129 locking insets inside insets.
4130 (showLockedInsetCursor): it is important to have the cursor always
4131 before the locked inset.
4132 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4134 * src/BufferView.h: made lockInset return a bool.
4136 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4138 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4139 that is used also internally but can be called as public to have back
4140 a cursor pos which is not set internally.
4141 (SetCursorIntern): Changed to use above function.
4143 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4145 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4150 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4151 patches for things that should be in or should be changed.
4153 * src/* [insetfiles]: change "usigned char fragile" to bool
4154 fragile. There was only one point that could that be questioned
4155 and that is commented in formulamacro.C. Grep for "CHECK".
4157 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4158 (DeleteBuffer): take it out of CutAndPaste and make it static.
4160 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4162 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4163 output the spacing envir commands. Also the new commands used in
4164 the LaTeX output makes the result better.
4166 * src/Spacing.C (writeEnvirBegin): new method
4167 (writeEnvirEnd): new method
4169 2000-04-18 Juergen Vigna <jug@sad.it>
4171 * src/CutAndPaste.C: made textclass a static member of the class
4172 as otherwise it is not accesed right!!!
4174 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4176 * forms/layout_forms.fd
4177 * src/layout_forms.h
4178 * src/layout_forms.C (create_form_form_character)
4179 * src/lyx_cb.C (UserFreeFont)
4180 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4181 documents (in the layout->character popup).
4183 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4185 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4186 \spell_command was in fact not honored (from Kevin Atkinson).
4188 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4191 * src/lyx_gui.h: make lyxViews private (Angus)
4193 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4195 * src/mathed/math_write.C
4196 (MathMatrixInset::Write) Put \protect before \begin{array} and
4197 \end{array} if fragile
4198 (MathParInset::Write): Put \protect before \\ if fragile
4200 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4202 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4203 initialization if the LyXColorHandler must be done after the
4204 connections to the XServer has been established.
4206 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4207 get the background pixel from the lyxColorhandler so that the
4208 figures are rendered with the correct background color.
4209 (NextToken): removed functions.
4210 (GetPSSizes): use ifs >> string instead of NextToken.
4212 * src/Painter.[Ch]: the color cache moved out of this file.
4214 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4217 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4219 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4220 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4222 * src/BufferView.C (enterView): new func
4223 (leaveView): new func
4225 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4227 (leaveView): new func, undefines xterm cursor when approp.
4229 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4230 (AllowInput): delete the Workarea cursor handling from this func.
4232 * src/Painter.C (underline): draw a slimer underline in most cases.
4234 * src/lyx_main.C (error_handler): use extern "C"
4236 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4238 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4239 sent directly to me.
4241 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4242 to the list by Dekel.
4244 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4247 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4248 methods from lyx_cb.here.
4250 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4253 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4255 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4256 instead of using current_view directly.
4258 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4260 * src/LyXAction.C (init): add the paragraph-spacing command.
4262 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4264 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4266 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4267 different from the documents.
4269 * src/text.C (SetHeightOfRow): take paragraph spacing into
4270 account, paragraph spacing takes precedence over buffer spacing
4271 (GetVisibleRow): ditto
4273 * src/paragraph.C (writeFile): output the spacing parameter too.
4274 (validate): set the correct features if spacing is used in the
4276 (Clear): set spacing to default
4277 (MakeSameLayout): spacing too
4278 (HasSameLayout): spacing too
4279 (SetLayout): spacing too
4280 (TeXOnePar): output the spacing commands
4282 * src/lyxparagraph.h: added a spacing variable for use with
4283 per-paragraph spacing.
4285 * src/Spacing.h: add a Default spacing and a method to check if
4286 the current spacing is default. also added an operator==
4288 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4291 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4293 * src/lyxserver.C (callback): fix dispatch of functions
4295 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4296 printf() into lyxerr call.
4298 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4301 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4302 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4303 the "Float" from each of the subitems.
4304 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4306 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4307 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4308 documented the change so that the workaround can be nuked later.
4310 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4313 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4315 * src/buffer.C (getLatexName): ditto
4316 (setReadonly): ditto
4318 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4320 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4321 avoid some uses of current_view. Added also a bufferParams()
4322 method to get at this.
4324 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4326 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4328 * src/lyxparagraph.[Ch]: removed
4329 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4330 with operators used by lower_bound and
4331 upper_bound in InsetTable's
4332 Make struct InsetTable private again. Used matchpos.
4334 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4336 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4337 document, the language of existing text is changed (unless the
4338 document is multi-lingual)
4340 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4342 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4344 * A lot of files: A rewrite of the Right-to-Left support.
4346 2000-04-10 Juergen Vigna <jug@sad.it>
4348 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4349 misplaced cursor when inset in inset is locked.
4351 * src/insets/insettext.C (LocalDispatch): small fix so that a
4352 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4354 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4355 footnote font should be decreased in size twice when displaying.
4357 * src/insets/insettext.C (GetDrawFont): inserted this function as
4358 the drawing-font may differ from the real paragraph font.
4360 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4361 insets (inset in inset!).
4363 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4364 function here because we don't want footnotes inside footnotes.
4366 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4368 (init): now set the inset_owner in paragraph.C
4369 (LocalDispatch): added some resetPos() in the right position
4372 (pasteSelection): changed to use the new CutAndPaste-Class.
4374 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4375 which tells if it is allowed to insert another inset inside this one.
4377 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4378 SwitchLayoutsBetweenClasses.
4380 * src/text2.C (InsertInset): checking of the new paragraph-function
4382 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4383 is not needed anymore here!
4386 (PasteSelection): redone (also with #ifdef) so that now this uses
4387 the CutAndPaste-Class.
4388 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4391 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4392 from/to text/insets.
4394 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4395 so that the paragraph knows if it is inside an (text)-inset.
4396 (InsertFromMinibuffer): changed return-value to bool as now it
4397 may happen that an inset is not inserted in the paragraph.
4398 (InsertInsetAllowed): this checks if it is allowed to insert an
4399 inset in this paragraph.
4401 (BreakParagraphConservative):
4402 (BreakParagraph) : small change for the above change of the return
4403 value of InsertFromMinibuffer.
4405 * src/lyxparagraph.h: added inset_owner and the functions to handle
4406 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4408 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4410 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4411 functions from BufferView to BufferView::Pimpl to ease maintence.
4413 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4414 correctly. Also use SetCursorIntern instead of SetCursor.
4416 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4419 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4421 * src/WorkArea.C (belowMouse): manually implement below mouse.
4423 * src/*: Add "explicit" on several constructors, I added probably
4424 some unneeded ones. A couple of changes to code because of this.
4426 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4427 implementation and private parts from the users of BufferView. Not
4430 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4431 implementation and private parts from the users of LyXLex. Not
4434 * src/BufferView_pimpl.[Ch]: new files
4436 * src/lyxlex_pimpl.[Ch]: new files
4438 * src/LyXView.[Ch]: some inline functions move out-of-line
4440 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4442 * src/lyxparagraph.h: make struct InsetTable public.
4444 * src/support/lyxstring.h: change lyxstring::difference_type to be
4445 ptrdiff_t. Add std:: modifiers to streams.
4447 * src/font.C: include the <cctype> header, for islower() and
4450 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4452 * src/font.[Ch]: new files. Contains the metric functions for
4453 fonts, takes a LyXFont as parameter. Better separation of concepts.
4455 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4456 changes because of this.
4458 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4460 * src/*: compile with -Winline and move functions that don't
4463 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4466 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4468 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4469 (various files changed because of this)
4471 * src/Painter.C (text): fixed the drawing of smallcaps.
4473 * src/lyxfont.[Ch] (drawText): removed unused member func.
4476 * src/*.C: added needed "using" statements and "std::" qualifiers.
4478 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4480 * src/*.h: removed all use of "using" from header files use
4481 qualifier std:: instead.
4483 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4485 * src/text.C (Backspace): some additional cleanups (we already
4486 know whether cursor.pos is 0 or not).
4488 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4489 automake does not provide one).
4491 * src/bmtable.h: replace C++ comments with C comments.
4493 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4495 * src/screen.C (ShowCursor): Change the shape of the cursor if
4496 the current language is not equal to the language of the document.
4497 (If the cursor change its shape unexpectedly, then you've found a bug)
4499 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4502 * src/insets/insetnumber.[Ch]: New files.
4504 * src/LyXAction.C (init)
4505 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4508 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4510 * src/lyxparagraph.h
4511 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4512 (the vector is kept sorted).
4514 * src/text.C (GetVisibleRow): Draw selection correctly when there
4515 is both LTR and RTL text.
4517 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4518 which is much faster.
4520 * src/text.C (GetVisibleRow and other): Do not draw the last space
4521 in a row if the direction of the last letter is not equal to the
4522 direction of the paragraph.
4524 * src/lyxfont.C (latexWriteStartChanges):
4525 Check that font language is not equal to basefont language.
4526 (latexWriteEndChanges): ditto
4528 * src/lyx_cb.C (StyleReset): Don't change the language while using
4529 the font-default command.
4531 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4532 empty paragraph before a footnote.
4534 * src/insets/insetcommand.C (draw): Increase x correctly.
4536 * src/screen.C (ShowCursor): Change cursor shape if
4537 current language != document language.
4539 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4541 2000-03-31 Juergen Vigna <jug@sad.it>
4543 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4544 (Clone): changed mode how the paragraph-data is copied to the
4545 new clone-paragraph.
4547 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4548 GetInset(pos) with no inset anymore there (in inset UNDO)
4550 * src/insets/insetcommand.C (draw): small fix as here x is
4551 incremented not as much as width() returns (2 before, 2 behind = 4)
4553 2000-03-30 Juergen Vigna <jug@sad.it>
4555 * src/insets/insettext.C (InsetText): small fix in initialize
4556 widthOffset (should not be done in the init() function)
4558 2000-03-29 Amir Karger <karger@lyx.org>
4560 * lib/examples/it_ItemizeBullets.lyx: translation by
4563 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4565 2000-03-29 Juergen Vigna <jug@sad.it>
4567 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4569 * src/insets/insetfoot.C (Clone): small change as for the below
4570 new init function in the text-inset
4572 * src/insets/insettext.C (init): new function as I've seen that
4573 clone did not copy the Paragraph-Data!
4574 (LocalDispatch): Added code so that now we have some sort of Undo
4575 functionality (well actually we HAVE Undo ;)
4577 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4579 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4581 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4584 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4586 * src/main.C: added a runtime check that verifies that the xforms
4587 header used when building LyX and the library used when running
4588 LyX match. Exit with a message if they don't match. This is a
4589 version number check only.
4591 * src/buffer.C (save): Don't allocate memory on the heap for
4592 struct utimbuf times.
4594 * *: some using changes, use iosfwd instead of the real headers.
4596 * src/lyxfont.C use char const * instead of string for the static
4597 strings. Rewrite some functions to use sstream.
4599 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4601 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4604 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4606 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4607 of Geodesy (from Martin Vermeer)
4609 * lib/layouts/svjour.inc: include file for the Springer svjour
4610 class. It can be used to support journals other than JoG.
4612 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4613 Miskiewicz <misiek@pld.org.pl>)
4614 * lib/reLyX/Makefile.am: ditto.
4616 2000-03-27 Juergen Vigna <jug@sad.it>
4618 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4619 also some modifications with operations on selected text.
4621 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4622 problems with clicking on insets (last famous words ;)
4624 * src/insets/insetcommand.C (draw):
4625 (width): Changed to have a bit of space before and after the inset so
4626 that the blinking cursor can be seen (otherwise it was hidden)
4628 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4630 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4631 would not be added to the link list when an installed gettext (not
4632 part of libc) is found.
4634 2000-03-24 Juergen Vigna <jug@sad.it>
4636 * src/insets/insetcollapsable.C (Edit):
4637 * src/mathed/formula.C (InsetButtonRelease):
4638 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4641 * src/BufferView.C (workAreaButtonPress):
4642 (workAreaButtonRelease):
4643 (checkInsetHit): Finally fixed the clicking on insets be handled
4646 * src/insets/insetert.C (Edit): inserted this call so that ERT
4647 insets work always with LaTeX-font
4649 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4651 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4652 caused lyx to startup with no GUI in place, causing in a crash
4653 upon startup when called with arguments.
4655 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4657 * src/FontLoader.C: better initialization of dummyXFontStruct.
4659 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4661 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4662 for linuxdoc and docbook import and export format options.
4664 * lib/lyxrc.example Example of default values for the previous flags.
4666 * src/lyx_cb.C Use those flags instead of the hardwired values for
4667 linuxdoc and docbook export.
4669 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4672 * src/menus.C Added menus entries for the new import/exports formats.
4674 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4676 * src/lyxrc.*: Added support for running without Gui
4679 * src/FontLoader.C: sensible defaults if no fonts are needed
4681 * src/lyx_cb.C: New function ShowMessage (writes either to the
4682 minibuffer or cout in case of no gui
4683 New function AskOverwrite for common stuff
4684 Consequently various changes to call these functions
4686 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4687 wild guess at sensible screen resolution when having no gui
4689 * src/lyxfont.C: no gui, no fonts... set some defaults
4691 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4693 * src/LColor.C: made the command inset background a bit lighter.
4695 2000-03-20 Hartmut Goebel <goebel@noris.net>
4697 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4698 stdstruct.inc. Koma-Script added some title elements which
4699 otherwise have been listed below "bibliography". This split allows
4700 adding title elements to where they belong.
4702 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4703 define the additional tilte elements and then include
4706 * many other layout files: changed to include stdtitle.inc just
4707 before stdstruct.inc.
4709 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4711 * src/buffer.C: (save) Added the option to store all backup files
4712 in a single directory
4714 * src/lyxrc.[Ch]: Added variable \backupdir_path
4716 * lib/lyxrc.example: Added descriptions of recently added variables
4718 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4719 bibtex inset, not closing the bibtex popup when deleting the inset)
4721 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4723 * src/lyx_cb.C: add a couple using directives.
4725 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4726 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4727 import based on the filename.
4729 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4730 file would be imported at start, if the filename where of a sgml file.
4732 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4734 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4736 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4737 * src/lyxfont.h Replaced the member variable bits.direction by the
4738 member variable lang. Made many changes in other files.
4739 This allows having a multi-lingual document
4741 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4742 that change the current language to <l>.
4743 Removed the command "font-rtl"
4745 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4746 format for Hebrew documents)
4748 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4749 When auto_mathmode is "true", pressing a digit key in normal mode
4750 will cause entering into mathmode.
4751 If auto_mathmode is "rtl" then this behavior will be active only
4752 when writing right-to-left text.
4754 * src/text2.C (InsertStringA) The string is inserted using the
4757 * src/paragraph.C (GetEndLabel) Gives a correct result for
4758 footnote paragraphs.
4760 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4762 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4764 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4765 front of PasteParagraph. Never insert a ' '. This should at least
4766 fix some cause for the segfaults that we have been experiencing,
4767 it also fixes backspace behaviour slightly. (Phu!)
4769 * src/support/lstrings.C (compare_no_case): some change to make it
4770 compile with gcc 2.95.2 and stdlibc++-v3
4772 * src/text2.C (MeltFootnoteEnvironment): change type o
4773 first_footnote_par_is_not_empty to bool.
4775 * src/lyxparagraph.h: make text private. Changes in other files
4777 (fitToSize): new function
4778 (setContentsFromPar): new function
4779 (clearContents): new function
4780 (SetChar): new function
4782 * src/paragraph.C (readSimpleWholeFile): deleted.
4784 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
4785 the file, just use a simple string instead. Also read the file in
4786 a more maintainable manner.
4788 * src/text2.C (InsertStringA): deleted.
4789 (InsertStringB): deleted.
4791 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4793 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
4794 RedoParagraphs from the doublespace handling part, just set status
4795 to NEED_MORE_REFRESH. Also don't update cursor position (should be
4796 done, but perhaps not like this.)
4798 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4800 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
4801 character when inserting an inset.
4803 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4805 * src/bufferparams.C (readLanguage): now takes "default" into
4808 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
4809 also initialize the toplevel_keymap with the default bindings from
4812 * src/buffer.C (Buffer): remove lyxrc from the parameters.
4814 * all files using lyxrc: have lyxrc as a real variable and not a
4815 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
4818 * src/lyxrc.C: remove double call to defaultKeyBindings
4820 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
4821 toolbar defauls using lyxlex. Remove enums, structs, functions
4824 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
4825 toolbar defaults. Also store default keybindings in a map.
4827 * src/ToolbarDefaults.[Ch]: New file. This class is used for
4828 storing the toolbar defaults without any xforms dependencies.
4830 * src/insets/figinset.C: patch posted to list by Andre Poenitz
4831 applied. Changed to use iterators.
4833 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
4835 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
4836 systems that don't have LINGUAS set to begin with.
4838 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4840 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
4841 the list by Dekel Tsur.
4843 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4845 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
4846 * src/insets/form_graphics.C: ditto.
4848 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
4850 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4852 * src/bufferparams.C (readLanguage): use the new language map
4854 * src/intl.C (InitKeyMapper): use the new language map
4856 * src/lyx_gui.C (create_forms): use the new language map
4858 * src/language.[Ch]: New files. Used for holding the information
4859 about each language. Now! Use this new language map enhance it and
4860 make it really usable for our needs.
4862 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
4864 * screen.C (ShowCursor): Removed duplicate code.
4865 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
4866 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
4868 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
4871 * src/text.C Added TransformChar method. Used for rendering Arabic
4872 text correctly (change the glyphs of the letter according to the
4873 position in the word)
4878 * src/lyxrc.C Added lyxrc command {language_command_begin,
4879 language_command_end,language_command_ltr,language_command_rtl,
4880 language_package} which allows the use of either arabtex or Omega
4883 * src/lyx_gui.C (init)
4885 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
4886 to use encoding for menu fonts which is different than the encoding
4889 * src/buffer.C (makeLaTeXFile): If params.language = "default",
4890 do not load the babel package.
4891 To write an English document with Hebrew/Arabic, change the document
4892 language to "english".
4894 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
4895 (alphaCounter): changed to return char
4896 (loweralphaCounter, hebrewCounter, romanCounter): New functions
4898 * lib/lyxrc.example Added examples for Hebrew/Arabic
4901 * src/layout.C Added layout command endlabeltype
4903 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
4905 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
4907 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4909 * src/mathed/math_delim.C (search_deco): return a
4910 math_deco_struct* instead of index.
4912 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4914 * All files with a USE_OSTREAM_ONLY within: removed all code that
4915 was unused when USE_OSTREAM_ONLY is defined.
4917 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
4918 of any less. Removed header and using.
4920 * src/text.C (GetVisibleRow): draw the string "Page Break
4921 (top/bottom)" on screen when drawing a pagebreak line.
4923 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4925 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
4927 * src/mathed/math_macro.C (draw): do some cast magic.
4930 * src/mathed/math_defs.h: change byte* argument to byte const*.
4932 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
4934 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
4935 know it is right to return InsetFoot* too, but cxx does not like
4938 * src/insets/insetcollapsable.[Ch] (Clone): make const.
4940 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
4942 * src/mathed/math_delim.C: change == to proper assignment.
4944 2000-03-09 Juergen Vigna <jug@sad.it>
4946 * src/insets/insettext.C (setPos): fixed various cursor positioning
4947 problems (via mouse and cursor-keys)
4948 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
4949 inset (still a small display problem but it works ;)
4951 * src/insets/insetcollapsable.C (draw): added button_top_y and
4952 button_bottom_y to have correct values for clicking on the inset.
4954 * src/support/lyxalgo.h: commented out 'using std::less'
4956 2000-03-08 Juergen Vigna <jug@sad.it>
4958 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
4959 Button-Release event closes as it is alos the Release-Event
4962 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
4964 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4966 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
4967 can add multiple spaces in Scrap (literate programming) styles...
4968 which, by the way, is how I got hooked on LyX to begin with.
4970 * src/mathed/formula.C (Write): Added dummy variable to an
4971 inset::Latex() call.
4972 (Latex): Add free_spacing boolean to inset::Latex()
4974 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
4976 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
4977 virtual function to include the free_spacing boolean from
4978 the containing paragraph's style.
4980 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
4981 Added free_spacing boolean arg to match inset.h
4983 * src/insets/insettext.C, src/insets/insettext.h (Latex):
4984 Added free_spacing boolean arg to match inset.h
4986 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
4987 Added free_spacing boolean and made sure that if in a free_spacing
4988 paragraph, that we output normal space if there is a protected space.
4990 * src/insets/insetref.C, src/insets/insetref.h (Latex):
4991 Added free_spacing boolean arg to match inset.h
4993 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
4994 Added free_spacing boolean arg to match inset.h
4996 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
4997 Added free_spacing boolean arg to match inset.h
4999 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5000 Added free_spacing boolean arg to match inset.h
5002 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5003 Added free_spacing boolean arg to match inset.h
5005 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5006 free_spacing boolean arg to match inset.h
5008 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5009 Added free_spacing boolean arg to match inset.h
5011 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5012 Added free_spacing boolean arg to match inset.h
5014 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5015 Added free_spacing boolean arg to match inset.h
5017 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5018 Added free_spacing boolean arg to match inset.h
5020 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5021 Added free_spacing boolean arg to match inset.h
5023 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5024 free_spacing boolean arg to match inset.h
5026 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5027 free_spacing boolean arg to match inset.h
5029 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5030 ignore free_spacing paragraphs. The user's spaces are left
5033 * src/text.C (InsertChar): Fixed the free_spacing layout
5034 attribute behavior. Now, if free_spacing is set, you can
5035 add multiple spaces in a paragraph with impunity (and they
5036 get output verbatim).
5037 (SelectSelectedWord): Added dummy argument to inset::Latex()
5040 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5043 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5044 paragraph layouts now only input a simple space instead.
5045 Special character insets don't make any sense in free-spacing
5048 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5049 hard-spaces in the *input* file to simple spaces if the layout
5050 is free-spacing. This converts old files which had to have
5051 hard-spaces in free-spacing layouts where a simple space was
5053 (writeFileAscii): Added free_spacing check to pass to the newly
5054 reworked inset::Latex(...) methods. The inset::Latex() code
5055 ensures that hard-spaces in free-spacing paragraphs get output
5056 as spaces (rather than "~").
5058 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5060 * src/mathed/math_delim.C (draw): draw the empty placeholder
5061 delims with a onoffdash line.
5062 (struct math_deco_compare): struct that holds the "functors" used
5063 for the sort and the binary search in math_deco_table.
5064 (class init_deco_table): class used for initial sort of the
5066 (search_deco): use lower_bound to do a binary search in the
5069 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5071 * src/lyxrc.C: a small secret thingie...
5073 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5074 and to not flush the stream as often as it used to.
5076 * src/support/lyxalgo.h: new file
5077 (sorted): template function used for checking if a sequence is
5078 sorted or not. Two versions with and without user supplied
5079 compare. Uses same compare as std::sort.
5081 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5082 it and give warning on lyxerr.
5084 (struct compare_tags): struct with function operators used for
5085 checking if sorted, sorting and lower_bound.
5086 (search_kw): use lower_bound instead of manually implemented
5089 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5091 * src/insets/insetcollapsable.h: fix Clone() declaration.
5092 * src/insets/insetfoot.h: ditto.
5094 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5096 2000-03-08 Juergen Vigna <jug@sad.it>
5098 * src/insets/lyxinset.h: added owner call which tells us if
5099 this inset is inside another inset. Changed also the return-type
5100 of Editable to an enum so it tells clearer what the return-value is.
5102 * src/insets/insettext.C (computeTextRows): fixed computing of
5103 textinsets which split automatically on more rows.
5105 * src/insets/insetert.[Ch]: changed this to be of BaseType
5108 * src/insets/insetfoot.[Ch]: added footnote inset
5110 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5111 collapsable insets (like footnote, ert, ...)
5113 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5115 * src/lyxdraw.h: remvoe file
5117 * src/lyxdraw.C: remove file
5119 * src/insets/insettext.C: added <algorithm>.
5121 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5123 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5124 (matrix_cb): case MM_OK use string stream
5126 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5129 * src/mathed/math_macro.C (draw): use string stream
5130 (Metrics): use string stream
5132 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5133 directly to the ostream.
5135 * src/vspace.C (asString): use string stream.
5136 (asString): use string stream
5137 (asLatexString): use string stream
5139 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5140 setting Spacing::Other.
5142 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5143 sprintf when creating the stretch vale.
5145 * src/text2.C (alphaCounter): changed to return a string and to
5146 not use a static variable internally. Also fixed a one-off bug.
5147 (SetCounter): changed the drawing of the labels to use string
5148 streams instead of sprintf.
5150 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5151 manipulator to use a scheme that does not require library support.
5152 This is also the way it is done in the new GNU libstdc++. Should
5153 work with DEC cxx now.
5155 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5157 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5158 end. This fixes a bug.
5160 * src/mathed (all files concerned with file writing): apply the
5161 USE_OSTREAM_ONLY changes to mathed too.
5163 * src/support/DebugStream.h: make the constructor explicit.
5165 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5166 count and ostream squashed.
5168 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5170 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5172 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5173 ostringstream uses STL strings, and we might not.
5175 * src/insets/insetspecialchar.C: add using directive.
5176 * src/insets/insettext.C: ditto.
5178 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5180 * lib/layouts/seminar.layout: feeble attempt at a layout for
5181 seminar.cls, far from completet and could really use some looking
5182 at from people used to write layout files.
5184 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5185 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5186 a lot nicer and works nicely with ostreams.
5188 * src/mathed/formula.C (draw): a slightly different solution that
5189 the one posted to the list, but I think this one works too. (font
5190 size wrong in headers.)
5192 * src/insets/insettext.C (computeTextRows): some fiddling on
5193 Jürgens turf, added some comments that he should read.
5195 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5196 used and it gave compiler warnings.
5197 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5200 * src/lyx_gui.C (create_forms): do the right thing when
5201 show_banner is true/false.
5203 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5204 show_banner is false.
5206 * most file writing files: Now use iostreams to do almost all of
5207 the writing. Also instead of passing string &, we now use
5208 stringstreams. mathed output is still not adapted to iostreams.
5209 This change can be turned off by commenting out all the occurences
5210 of the "#define USE_OSTREAM_ONLY 1" lines.
5212 * src/WorkArea.C (createPixmap): don't output debug messages.
5213 (WorkArea): don't output debug messages.
5215 * lib/lyxrc.example: added a comment about the new variable
5218 * development/Code_rules/Rules: Added some more commente about how
5219 to build class interfaces and on how better encapsulation can be
5222 2000-03-03 Juergen Vigna <jug@sad.it>
5224 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5225 automatically with the width of the LyX-Window
5227 * src/insets/insettext.C (computeTextRows): fixed update bug in
5228 displaying text-insets (scrollvalues where not initialized!)
5230 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5232 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5233 id in the check of the result from lower_bound is not enough since
5234 lower_bound can return last too, and then res->id will not be a
5237 * all insets and some code that use them: I have conditionalized
5238 removed the Latex(string & out, ...) this means that only the
5239 Latex(ostream &, ...) will be used. This is a work in progress to
5240 move towards using streams for all output of files.
5242 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5245 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5247 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5248 routine (this fixes bug where greek letters were surrounded by too
5251 * src/support/filetools.C (findtexfile): change a bit the search
5252 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5253 no longer passed to kpsewhich, we may have to change that later.
5255 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5256 warning options to avoid problems with X header files (from Angus
5258 * acinclude.m4: regenerated.
5260 2000-03-02 Juergen Vigna <jug@sad.it>
5262 * src/insets/insettext.C (WriteParagraphData): Using the
5263 par->writeFile() function for writing paragraph-data.
5264 (Read): Using buffer->parseSingleLyXformat2Token()-function
5265 for parsing paragraph data!
5267 * src/buffer.C (readLyXformat2): removed all parse data and using
5268 the new parseSingleLyXformat2Token()-function.
5269 (parseSingleLyXformat2Token): added this function to parse (read)
5270 lyx-file-format (this is called also from text-insets now!)
5272 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5274 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5277 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5278 directly instead of going through a func. One very bad thing: a
5279 static LyXFindReplace, but I don't know where to place it.
5281 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5282 string instead of char[]. Also changed to static.
5283 (GetSelectionOrWordAtCursor): changed to static inline
5284 (SetSelectionOverLenChars): ditto.
5286 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5287 current_view and global variables. both classes has changed names
5288 and LyXFindReplace is not inherited from SearchForm.
5290 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5291 fl_form_search form.
5293 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5295 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5297 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5298 bound (from Kayvan).
5300 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5302 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5304 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5306 * some things that I should comment but the local pub says head to
5309 * comment out all code that belongs to the Roff code for Ascii
5310 export of tables. (this is unused)
5312 * src/LyXView.C: use correct type for global variable
5313 current_layout. (LyXTextClass::size_type)
5315 * some code to get the new insetgraphics closer to working I'd be
5316 grateful for any help.
5318 * src/BufferView2.C (insertInset): use the return type of
5319 NumberOfLayout properly. (also changes in other files)
5321 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5322 this as a test. I want to know what breaks because of this.
5324 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5326 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5328 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5329 to use a \makebox in the label, this allows proper justification
5330 with out using protected spaces or multiple hfills. Now it is
5331 "label" for left justified, "\hfill label\hfill" for center, and
5332 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5333 should be changed accordingly.
5335 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5337 * src/lyxtext.h: change SetLayout() to take a
5338 LyXTextClass::size_type instead of a char (when there is more than
5339 127 layouts in a class); also change type of copylayouttype.
5340 * src/text2.C (SetLayout): ditto.
5341 * src/LyXView.C (updateLayoutChoice): ditto.
5343 * src/LaTeX.C (scanLogFile): errors where the line number was not
5344 given just after the '!'-line were ignored (from Dekel Tsur).
5346 * lib/lyxrc.example: fix description of \date_insert_format
5348 * lib/layouts/llncs.layout: new layout, contributed by Martin
5351 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5353 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5354 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5355 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5356 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5357 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5358 paragraph.C, text.C, text2.C)
5360 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5362 * src/insets/insettext.C (LocalDispatch): remove extra break
5365 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5366 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5368 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5369 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5371 * src/insets/insetbib.h: move InsetBibkey::Holder and
5372 InsetCitation::Holder in public space.
5374 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5376 * src/insets/insettext.h: small change to get the new files from
5377 Juergen to compile (use "string", not "class string").
5379 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5380 const & as parameter to LocalDispatch, use LyXFont const & as
5381 paramter to some other func. This also had impacto on lyxinsets.h
5382 and the two mathed insets.
5384 2000-02-24 Juergen Vigna <jug@sad.it>
5387 * src/commandtags.h:
5389 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5393 * src/BufferView2.C: added/updated code for various inset-functions
5395 * src/insets/insetert.[Ch]: added implementation of InsetERT
5397 * src/insets/insettext.[Ch]: added implementation of InsetText
5399 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5400 (draw): added preliminary code for inset scrolling not finshed yet
5402 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5403 as it is in lyxfunc.C now
5405 * src/insets/lyxinset.h: Added functions for text-insets
5407 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5409 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5410 BufferView and reimplement the list as a queue put inside its own
5413 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5415 * several files: use the new interface to the "updateinsetlist"
5417 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5419 (work_area_handler): call BufferView::trippleClick on trippleclick.
5421 * src/BufferView.C (doubleClick): new function, selects word on
5423 (trippleClick): new function, selects line on trippleclick.
5425 2000-02-22 Allan Rae <rae@lyx.org>
5427 * lib/bind/xemacs.bind: buffer-previous not supported
5429 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5431 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5434 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5436 * src/bufferlist.C: get rid of current_view from this file
5438 * src/spellchecker.C: get rid of current_view from this file
5440 * src/vspace.C: get rid of current_view from this file
5441 (inPixels): added BufferView parameter for this func
5442 (asLatexCommand): added a BufferParams for this func
5444 * src/text.C src/text2.C: get rid of current_view from these
5447 * src/lyxfont.C (getFontDirection): move this function here from
5450 * src/bufferparams.C (getDocumentDirection): move this function
5453 * src/paragraph.C (getParDirection): move this function here from
5455 (getLetterDirection): ditto
5457 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5459 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5460 resize due to wrong pixmap beeing used. Also took the opurtunity
5461 to make the LyXScreen stateless on regard to WorkArea and some
5462 general cleanup in the same files.
5464 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5466 * src/Makefile.am: add missing direction.h
5468 * src/PainterBase.h: made the width functions const.
5470 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5473 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5475 * src/insets/insetlatexaccent.C (draw): make the accents draw
5476 better, at present this will only work well with iso8859-1.
5478 * several files: remove the old drawing code, now we use the new
5481 * several files: remove support for mono_video, reverse_video and
5484 2000-02-17 Juergen Vigna <jug@sad.it>
5486 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5487 int ** as we have to return the pointer, otherwise we have only
5488 NULL pointers in the returning function.
5490 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5492 * src/LaTeX.C (operator()): quote file name when running latex.
5494 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5496 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5497 (bubble tip), this removes our special handling of this.
5499 * Remove all code that is unused now that we have the new
5500 workarea. (Code that are not active when NEW_WA is defined.)
5502 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5504 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5506 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5507 nonexisting layout; correctly redirect obsoleted layouts.
5509 * lib/lyxrc.example: document \view_dvi_paper_option
5511 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5514 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5515 (PreviewDVI): handle the view_dvi_paper_option variable.
5516 [Both from Roland Krause]
5518 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5520 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5521 char const *, int, LyXFont)
5522 (text(int, int, string, LyXFont)): ditto
5524 * src/text.C (InsertCharInTable): attempt to fix the double-space
5525 feature in tables too.
5526 (BackspaceInTable): ditto.
5527 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5529 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5531 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5533 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5534 newly found text in textcache to this.
5535 (buffer): set the owner of the text put into the textcache to 0
5537 * src/insets/figinset.C (draw): fixed the drawing of figures with
5540 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5541 drawing of mathframe, hfills, protected space, table lines. I have
5542 now no outstanding drawing problems with the new Painter code.
5544 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5546 * src/PainterBase.C (ellipse, circle): do not specify the default
5549 * src/LColor.h: add using directive.
5551 * src/Painter.[Ch]: change return type of methods from Painter& to
5552 PainterBase&. Add a using directive.
5554 * src/WorkArea.C: wrap xforms callbacks in C functions
5557 * lib/layouts/foils.layout: font fix and simplifications from Carl
5560 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5562 * a lot of files: The Painter, LColor and WorkArea from the old
5563 devel branch has been ported to lyx-devel. Some new files and a
5564 lot of #ifdeffed code. The new workarea is enabled by default, but
5565 if you want to test the new Painter and LColor you have to compile
5566 with USE_PAINTER defined (do this in config.h f.ex.) There are
5567 still some rought edges, and I'd like some help to clear those
5568 out. It looks stable (loads and displays the Userguide very well).
5571 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5573 * src/buffer.C (pop_tag): revert to the previous implementation
5574 (use a global variable for both loops).
5576 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5578 * src/lyxrc.C (LyXRC): change slightly default date format.
5580 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5581 there is an English text with a footnote that starts with a Hebrew
5582 paragraph, or vice versa.
5583 (TeXFootnote): ditto.
5585 * src/text.C (LeftMargin): allow for negative values for
5586 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5589 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5590 for input encoding (cyrillic)
5592 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5594 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5597 * src/toolbar.C (set): ditto
5598 * src/insets/insetbib.C (create_form_citation_form): ditto
5600 * lib/CREDITS: added Dekel Tsur.
5602 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5603 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5604 hebrew supports files from Dekel Tsur.
5606 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5607 <tzafrir@technion.ac.il>
5609 * src/lyxrc.C: put \date_insert_format at the right place.
5611 * src/buffer.C (makeLaTeXFile): fix the handling of
5612 BufferParams::sides when writing out latex files.
5614 * src/BufferView2.C: add a "using" directive.
5616 * src/support/lyxsum.C (sum): when we use lyxstring,
5617 ostringstream::str needs an additional .c_str().
5619 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5621 * src/support/filetools.C (ChangeExtension): patch from Etienne
5624 * src/TextCache.C (show): remove const_cast and make second
5625 parameter non-const LyXText *.
5627 * src/TextCache.h: use non const LyXText in show.
5629 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5632 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5634 * src/support/lyxsum.C: rework to be more flexible.
5636 * several places: don't check if a pointer is 0 if you are going
5639 * src/text.C: remove some dead code.
5641 * src/insets/figinset.C: remove some dead code
5643 * src/buffer.C: move the BufferView funcs to BufferView2.C
5644 remove all support for insetlatexdel
5645 remove support for oldpapersize stuff
5646 made some member funcs const
5648 * src/kbmap.C: use a std::list to store the bindings in.
5650 * src/BufferView2.C: new file
5652 * src/kbsequence.[Ch]: new files
5654 * src/LyXAction.C + others: remove all trace of buffer-previous
5656 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5657 only have one copy in the binary of this table.
5659 * hebrew patch: moved some functions from LyXText to more
5660 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5662 * several files: remove support for XForms older than 0.88
5664 remove some #if 0 #endif code
5666 * src/TextCache.[Ch]: new file. Holds the textcache.
5668 * src/BufferView.C: changes to use the new TextCache interface.
5669 (waitForX): remove the now unused code.
5671 * src/BackStack.h: remove some commented code
5673 * lib/bind/emacs.bind: remove binding for buffer-previous
5675 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5677 * applied the hebrew patch.
5679 * src/lyxrow.h: make sure that all Row variables are initialized.
5681 * src/text2.C (TextHandleUndo): comment out a delete, this might
5682 introduce a memory leak, but should also help us to not try to
5683 read freed memory. We need to look at this one.
5685 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5686 (LyXParagraph): initalize footnotekind.
5688 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5689 forgot this when applying the patch. Please heed the warnings.
5691 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5692 (aka. reformat problem)
5694 * src/bufferlist.C (exists): made const, and use const_iterator
5695 (isLoaded): new func.
5696 (release): use std::find to find the correct buffer.
5698 * src/bufferlist.h: made getState a const func.
5699 made empty a const func.
5700 made exists a const func.
5703 2000-02-01 Juergen Vigna <jug@sad.it>
5705 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5707 * po/it.po: updated a bit the italian po file and also changed the
5708 'file nuovo' for newfile to 'filenuovo' without a space, this did
5711 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5712 for the new insert_date command.
5714 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5715 from jdblair, to insert a date into the current text conforming to
5716 a strftime format (for now only considering the locale-set and not
5717 the document-language).
5719 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5721 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5722 Bounds Read error seen by purify. The problem was that islower is
5723 a macros which takes an unsigned char and uses it as an index for
5724 in array of characters properties (and is thus subject to the
5728 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5729 correctly the paper sides radio buttons.
5730 (UpdateDocumentButtons): ditto.
5732 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5734 * src/kbmap.C (getsym + others): change to return unsigned int,
5735 returning a long can give problems on 64 bit systems. (I assume
5736 that int is 32bit on 64bit systems)
5738 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5740 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5741 LyXLookupString to be zero-terminated. Really fixes problems seen
5744 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5746 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5747 write a (char*)0 to the lyxerr stream.
5749 * src/lastfiles.C: move algorithm before the using statemets.
5751 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5753 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5754 complains otherwise).
5755 * src/table.C: ditto
5757 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5760 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5761 that I removed earlier... It is really needed.
5763 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5765 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5767 * INSTALL: update xforms home page URL.
5769 * lib/configure.m4: fix a bug with unreadable layout files.
5771 * src/table.C (calculate_width_of_column): add "using std::max"
5774 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5776 * several files: marked several lines with "DEL LINE", this is
5777 lines that can be deleted without changing anything.
5778 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5779 checks this anyway */
5782 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
5784 * src/DepTable.C (update): add a "+" at the end when the checksum
5785 is different. (debugging string only)
5787 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
5788 the next inset to not be displayed. This should also fix the list
5789 of labels in the "Insert Crossreference" dialog.
5791 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5793 * src/support/LSubstring.C (LSubstring): set pos to string::npos
5794 when regex was not found.
5796 * src/support/lstrings.C (lowercase): use handcoded transform always.
5799 * src/text.C (Delete): fixed the crash. cursor.par->prev and
5800 old_cursor.par->prev could be 0.
5802 * several files: changed post inc/dec to pre inc/dec
5804 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
5805 write the lastfiles to file.
5807 * src/BufferView.C (buffer): only show TextCache info when debugging
5809 (resizeCurrentBuffer): ditto
5810 (workAreaExpose): ditto
5812 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
5814 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
5816 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
5817 a bit better by removing the special case for \i and \j.
5819 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5821 * src/lyx_main.C (easyParse): remove test for bad comand line
5822 options, since this broke all xforms-related parsing.
5824 * src/kbmap.C (getsym): set return type to unsigned long, as
5825 declared in header. On an alpha, long is _not_ the same as int.
5827 * src/support/LOstream.h: add a "using std::flush;"
5829 * src/insets/figinset.C: ditto.
5831 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5833 * src/bufferlist.C (write): use blinding fast file copy instead of
5834 "a char at a time", now we are doing it the C++ way.
5836 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
5837 std::list<int> instead.
5838 (addpidwait): reflect move to std::list<int>
5839 (sigchldchecker): ditto
5841 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
5844 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
5845 that obviously was wrong...
5847 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
5848 c, this avoids warnings with purify and islower.
5850 * src/insets/figinset.C: rename struct queue to struct
5851 queue_element and rewrite to use a std::queue. gsqueue is now a
5852 std::queue<queue_element>
5853 (runqueue): reflect move to std::queue
5856 * src/support/lstrings.h (tostr): specialize for bool, otherwise
5857 we would get "1" "0" instead of "true" "false. Also make the tostr
5860 2000-01-21 Juergen Vigna <jug@sad.it>
5862 * src/buffer.C (writeFileAscii): Disabled code for special groff
5863 handling of tabulars till I fix this in table.C
5865 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5867 * src/support/mkdir.C (mkdir): change second argument of mkdir to
5869 * src/support/lyxlib.h: ditto.
5871 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5873 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
5874 and 'j' look better. This might fix the "macron" bug that has been
5877 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
5878 functions as one template function. Delete the old versions.
5880 * src/support/lyxsum.C: move using std::ifstream inside
5883 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
5886 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
5888 * src/mathed/formula.C: delete #include "bufferlist.h" never used
5890 * src/insets/figinset.C (InitFigures): use new instead of malloc
5891 to allocate memory for figures and bitmaps.
5892 (DoneFigures): use delete[] instead of free to deallocate memory
5893 for figures and bitmaps.
5894 (runqueue): use new to allocate
5895 (getfigdata): use new/delete[] instead of malloc/free
5896 (RegisterFigure): ditto
5898 * some files: moved some declarations closer to first use, small
5899 whitespace changes use preincrement instead of postincrement where
5900 it does not make a difference.
5902 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
5903 step on the way to use stl::containers for key maps.
5905 * src/bufferlist.h: add a typedef for const_iterator and const
5906 versions of begin and end.
5908 * src/bufferlist.[Ch]: change name of member variable _state to
5909 state_. (avoid reserved names)
5911 (getFileNames): returns the filenames of the buffers in a vector.
5913 * configure.in (ALL_LINGUAS): added ro
5915 * src/support/putenv.C: new file
5917 * src/support/mkdir.C: new file
5919 2000-01-20 Allan Rae <rae@lyx.org>
5921 * lib/layouts/IEEEtran.layout: Added several theorem environments
5923 * lib/templates/IEEEtran.lyx: Example theorem environments and a
5924 couple of minor additions.
5926 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
5927 (except for those in footnotes of course)
5929 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5931 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
5933 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
5934 std::sort and std::lower_bound instead of qsort and handwritten
5936 (struct compara): struct that holds the functors used by std::sort
5937 and std::lower_bound in MathedLookupBOP.
5939 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5941 * src/support/LAssert.h: do not do partial specialization. We do
5944 * src/support/lyxlib.h: note that lyx::getUserName() and
5945 lyx::date() are not in use right now. Should these be suppressed?
5947 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
5948 (makeLinuxDocFile): do not put date and user name in linuxdoc
5951 * src/support/lyxlib.h (kill): change first argument to long int,
5952 since that's what solaris uses.
5954 * src/support/kill.C (kill): fix declaration to match prototype.
5956 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
5957 actually check whether namespaces are supported. This is not what
5960 * src/support/lyxsum.C: add a using directive.
5962 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5964 * src/support/kill.C: if we have namespace support we don't have
5965 to include lyxlib.h.
5967 * src/support/lyxlib.h: use namespace lyx if supported.
5969 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5971 * src/support/date.C: new file
5973 * src/support/chdir.C: new file
5975 * src/support/getUserName.C: new file
5977 * src/support/getcwd.C: new file
5979 * src/support/abort.C: new file
5981 * src/support/kill.C: new file
5983 * src/support/lyxlib.h: moved all the functions in this file
5984 insede struct lyx. Added also kill and abort to this struct. This
5985 is a way to avoid the "kill is not defined in <csignal>", we make
5986 C++ wrappers for functions that are not ANSI C or ANSI C++.
5988 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
5989 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
5990 lyx it has been renamed to sum.
5992 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5994 * src/text.C: add using directives for std::min and std::max.
5996 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5998 * src/texrow.C (getIdFromRow): actually return something useful in
5999 id and pos. Hopefully fixes the bug with positionning of errorbox
6002 * src/lyx_main.C (easyParse): output an error and exit if an
6003 incorrect command line option has been given.
6005 * src/spellchecker.C (ispell_check_word): document a memory leak.
6007 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6008 where a "struct utimbuf" is allocated with "new" and deleted with
6011 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6013 * src/text2.C (CutSelection): don't delete double spaces.
6014 (PasteSelection): ditto
6015 (CopySelection): ditto
6017 * src/text.C (Backspace): don't delete double spaces.
6019 * src/lyxlex.C (next): fix a bug that were only present with
6020 conformant std::istream::get to read comment lines, use
6021 std::istream::getline instead. This seems to fix the problem.
6023 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6025 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6026 allowed to insert space before space" editing problem. Please read
6027 commends at the beginning of the function. Comments about usage
6030 * src/text.C (InsertChar): fix for the "not allowed to insert
6031 space before space" editing problem.
6033 * src/text2.C (DeleteEmptyParagraphMechanism): when
6034 IsEmptyTableRow can only return false this last "else if" will
6035 always be a no-op. Commented out.
6037 * src/text.C (RedoParagraph): As far as I can understand tmp
6038 cursor is not really needed.
6040 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6041 present it could only return false anyway.
6042 (several functions): Did something not so smart...added a const
6043 specifier on a lot of methods.
6045 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6046 and add a tmp->text.resize. The LyXParagraph constructor does the
6048 (BreakParagraphConservative): ditto
6050 * src/support/path.h (Path): add a define so that the wrong usage
6051 "Path("/tmp") will be flagged as a compilation error:
6052 "`unnamed_Path' undeclared (first use this function)"
6054 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6056 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6057 which was bogus for several reasons.
6059 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6063 * autogen.sh: do not use "type -path" (what's that anyway?).
6065 * src/support/filetools.C (findtexfile): remove extraneous space
6066 which caused a kpsewhich warning (at least with kpathsea version
6069 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6071 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6073 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6075 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6077 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6079 * src/paragraph.C (BreakParagraph): do not reserve space on text
6080 if we don't need to (otherwise, if pos_end < pos, we end up
6081 reserving huge amounts of memory due to bad unsigned karma).
6082 (BreakParagraphConservative): ditto, although I have not seen
6083 evidence the bug can happen here.
6085 * src/lyxparagraph.h: add a using std::list.
6087 2000-01-11 Juergen Vigna <jug@sad.it>
6089 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6092 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6094 * src/vc-backend.C (doVCCommand): change to be static and take one
6095 more parameter: the path to chdir too be fore executing the command.
6096 (retrive): new function equiv to "co -r"
6098 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6099 file_not_found_hook is true.
6101 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6103 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6104 if a file is readwrite,readonly...anything else.
6106 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6108 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6109 (CreatePostscript): name change from MenuRunDVIPS (or something)
6110 (PreviewPostscript): name change from MenuPreviewPS
6111 (PreviewDVI): name change from MenuPreviewDVI
6113 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6114 \view_pdf_command., \pdf_to_ps_command
6116 * lib/configure.m4: added search for PDF viewer, and search for
6117 PDF to PS converter.
6118 (lyxrc.defaults output): add \pdflatex_command,
6119 \view_pdf_command and \pdf_to_ps_command.
6121 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6123 * src/bufferlist.C (write): we don't use blocksize for anything so
6126 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6128 * src/support/block.h: disable operator T* (), since it causes
6129 problems with both compilers I tried. See comments in the file.
6131 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6134 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6135 variable LYX_DIR_10x to LYX_DIR_11x.
6137 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6139 * INSTALL: document --with-lyxname.
6142 * configure.in: new configure flag --with-lyxname which allows to
6143 choose the name under which lyx is installed. Default is "lyx", of
6144 course. It used to be possible to do this with --program-suffix,
6145 but the later has in fact a different meaning for autoconf.
6147 * src/support/lstrings.h (lstrchr): reformat a bit.
6149 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6150 * src/mathed/math_defs.h: ditto.
6152 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6154 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6155 true, decides if we create a backup file or not when saving. New
6156 tag and variable \pdf_mode, defaults to false. New tag and
6157 variable \pdflatex_command, defaults to pdflatex. New tag and
6158 variable \view_pdf_command, defaults to xpdf. New tag and variable
6159 \pdf_to_ps_command, defaults to pdf2ps.
6161 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6163 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6164 does not have a BufferView.
6165 (unlockInset): ditto + don't access the_locking_inset if the
6166 buffer does not have a BufferView.
6168 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6169 certain circumstances so that we don't continue a keyboard
6170 operation long after the key was released. Try f.ex. to load a
6171 large document, press PageDown for some seconds and then release
6172 it. Before this change the document would contine to scroll for
6173 some time, with this change it stops imidiatly.
6175 * src/support/block.h: don't allocate more space than needed. As
6176 long as we don't try to write to the arr[x] in a array_type arr[x]
6177 it is perfectly ok. (if you write to it you might segfault).
6178 added operator value_type*() so that is possible to pass the array
6179 to functions expecting a C-pointer.
6181 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6184 * intl/*: updated to gettext 0.10.35, tried to add our own
6185 required modifications. Please verify.
6187 * po/*: updated to gettext 0.10.35, tried to add our own required
6188 modifications. Please verify.
6190 * src/support/lstrings.C (tostr): go at fixing the problem with
6191 cxx and stringstream. When stringstream is used return
6192 oss.str().c_str() so that problems with lyxstring and basic_string
6193 are avoided. Note that the best solution would be for cxx to use
6194 basic_string all the way, but it is not conformant yet. (it seems)
6196 * src/lyx_cb.C + other files: moved several global functions to
6197 class BufferView, some have been moved to BufferView.[Ch] others
6198 are still located in lyx_cb.C. Code changes because of this. (part
6199 of "get rid of current_view project".)
6201 * src/buffer.C + other files: moved several Buffer functions to
6202 class BufferView, the functions are still present in buffer.C.
6203 Code changes because of this.
6205 * config/lcmessage.m4: updated to most recent. used when creating
6208 * config/progtest.m4: updated to most recent. used when creating
6211 * config/gettext.m4: updated to most recent. applied patch for
6214 * config/gettext.m4.patch: new file that shows what changes we
6215 have done to the local copy of gettext.m4.
6217 * config/libtool.m4: new file, used in creation of acinclude.m4
6219 * config/lyxinclude.m4: new file, this is the lyx created m4
6220 macros, used in making acinclude.m4.
6222 * autogen.sh: GNU m4 discovered as a separate task not as part of
6223 the lib/configure creation.
6224 Generate acinlucde from files in config. Actually cat
6225 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6226 easier to upgrade .m4 files that really are external.
6228 * src/Spacing.h: moved using std::istringstream to right after
6229 <sstream>. This should fix the problem seen with some compilers.
6231 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6233 * src/lyx_cb.C: began some work to remove the dependency a lot of
6234 functions have on BufferView::text, even if not really needed.
6235 (GetCurrentTextClass): removed this func, it only hid the
6238 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6239 forgot this in last commit.
6241 * src/Bullet.C (bulletEntry): use static char const *[] for the
6242 tables, becuase of this the return arg had to change to string.
6244 (~Bullet): removed unneeded destructor
6246 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6247 (insetSleep): moved from Buffer
6248 (insetWakeup): moved from Buffer
6249 (insetUnlock): moved from Buffer
6251 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6252 from Buffer to BufferView.
6254 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6256 * config/ltmain.sh: updated to version 1.3.4 of libtool
6258 * config/ltconfig: updated to version 1.3.4 of libtool
6260 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6263 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6264 Did I get that right?
6266 * src/lyxlex.h: add a "using" directive or two.
6267 * src/Spacing.h: ditto.
6268 * src/insets/figinset.C: ditto.
6269 * src/support/filetools.C: ditto.
6270 * src/support/lstrings.C: ditto.
6271 * src/BufferView.C: ditto.
6272 * src/bufferlist.C: ditto.
6273 * src/lyx_cb.C: ditto.
6274 * src/lyxlex.C: ditto.
6276 * NEWS: add some changes for 1.1.4.
6278 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6280 * src/BufferView.C: first go at a TextCache to speed up switching
6283 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6285 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6286 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6287 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6288 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6291 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6292 members of the struct are correctly initialized to 0 (detected by
6294 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6295 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6297 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6298 pidwait, since it was allocated with "new". This was potentially
6299 very bad. Thanks to Michael Schmitt for running purify for us.
6302 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6304 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6306 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6308 1999-12-30 Allan Rae <rae@lyx.org>
6310 * lib/templates/IEEEtran.lyx: minor change
6312 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6313 src/mathed/formula.C (LocalDispatch): askForText changes
6315 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6316 know when a user has cancelled input. Fixes annoying problems with
6317 inserting labels and version control.
6319 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6321 * src/support/lstrings.C (tostr): rewritten to use strstream and
6324 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6326 * src/support/filetools.C (IsFileWriteable): use fstream to check
6327 (IsDirWriteable): use fileinfo to check
6329 * src/support/filetools.h (FilePtr): whole class deleted
6331 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6333 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6335 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6337 * src/bufferlist.C (write): use ifstream and ofstream instead of
6340 * src/Spacing.h: use istrstream instead of sscanf
6342 * src/mathed/math_defs.h: change first arg to istream from FILE*
6344 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6346 * src/mathed/math_parser.C: have yyis to be an istream
6347 (LexGetArg): use istream (yyis)
6349 (mathed_parse): ditto
6350 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6352 * src/mathed/formula.C (Read): rewritten to use istream
6354 * src/mathed/formulamacro.C (Read): rewritten to use istream
6356 * src/lyxlex.h (~LyXLex): deleted desturctor
6357 (getStream): new function, returns an istream
6358 (getFile): deleted funtion
6359 (IsOK): return is.good();
6361 * src/lyxlex.C (LyXLex): delete file and owns_file
6362 (setFile): open an filebuf and assign that to a istream instead of
6364 (setStream): new function, takes an istream as arg.
6365 (setFile): deleted function
6366 (EatLine): rewritten us use istream instead of FILE*
6370 * src/table.C (LyXTable): use istream instead of FILE*
6371 (Read): rewritten to take an istream instead of FILE*
6373 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6375 * src/buffer.C (Dispatch): remove an extraneous break statement.
6377 * src/support/filetools.C (QuoteName): change to do simple
6378 'quoting'. More work is necessary. Also changed to do nothing
6379 under emx (needs fix too).
6380 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6382 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6383 config.h.in to the AC_DEFINE_UNQUOTED() call.
6384 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6385 needs char * as argument (because Solaris 7 declares it like
6388 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6389 remove definition of BZERO.
6391 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6393 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6394 defined, "lyxregex.h" if not.
6396 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6398 (REGEX): new variable that is set to regex.c lyxregex.h when
6399 AM_CONDITIONAL USE_REGEX is set.
6400 (libsupport_la_SOURCES): add $(REGEX)
6402 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6405 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6408 * configure.in: add call to LYX_REGEX
6410 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6411 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6413 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6415 * lib/bind/fi_menus.bind: new file, from
6416 pauli.virtanen@saunalahti.fi.
6418 * src/buffer.C (getBibkeyList): pass the parameter delim to
6419 InsetInclude::getKeys and InsetBibtex::getKeys.
6421 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6422 is passed to Buffer::getBibkeyList
6424 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6425 instead of the hardcoded comma.
6427 * src/insets/insetbib.C (getKeys): make sure that there are not
6428 leading blanks in bibtex keys. Normal latex does not care, but
6429 harvard.sty seems to dislike blanks at the beginning of citation
6430 keys. In particular, the retturn value of the function is
6432 * INSTALL: make it clear that libstdc++ is needed and that gcc
6433 2.7.x probably does not work.
6435 * src/support/filetools.C (findtexfile): make debug message go to
6437 * src/insets/insetbib.C (getKeys): ditto
6439 * src/debug.C (showTags): make sure that the output is correctly
6442 * configure.in: add a comment for TWO_COLOR_ICON define.
6444 * acconfig.h: remove all the entries that already defined in
6445 configure.in or acinclude.m4.
6447 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6448 to avoid user name, date and copyright.
6450 1999-12-21 Juergen Vigna <jug@sad.it>
6452 * src/table.C (Read): Now read bogus row format informations
6453 if the format is < 5 so that afterwards the table can
6454 be read by lyx but without any format-info. Fixed the
6455 crash we experienced when not doing this.
6457 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6459 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6460 (RedoDrawingOfParagraph): ditto
6461 (RedoParagraphs): ditto
6462 (RemoveTableRow): ditto
6464 * src/text.C (Fill): rename arg paperwidth -> paper_width
6466 * src/buffer.C (insertLyXFile): rename var filename -> fname
6467 (writeFile): rename arg filename -> fname
6468 (writeFileAscii): ditto
6469 (makeLaTeXFile): ditto
6470 (makeLinuxDocFile): ditto
6471 (makeDocBookFile): ditto
6473 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6476 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6478 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6481 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6482 compiled by a C compiler not C++.
6484 * src/layout.h (LyXTextClass): added typedef for const_iterator
6485 (LyXTextClassList): added typedef for const_iterator + member
6486 functions begin and end.
6488 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6489 iterators to fill the choice_class.
6490 (updateLayoutChoice): rewritten to use iterators to fill the
6491 layoutlist in the toolbar.
6493 * src/BufferView.h (BufferView::work_area_width): removed unused
6496 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6498 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6499 (sgmlCloseTag): ditto
6501 * src/support/lstrings.h: return type of countChar changed to
6504 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6505 what version of this func to use. Also made to return unsigned int.
6507 * configure.in: call LYX_STD_COUNT
6509 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6510 conforming std::count.
6512 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6514 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6515 and a subscript would give bad display (patch from Dekel Tsur
6516 <dekel@math.tau.ac.il>).
6518 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6520 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6523 * src/chset.h: add a few 'using' directives
6525 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6526 triggered when no buffer is active
6528 * src/layout.C: removed `break' after `return' in switch(), since
6531 * src/lyx_main.C (init): make sure LyX can be ran in place even
6532 when libtool has done its magic with shared libraries. Fix the
6533 test for the case when the system directory has not been found.
6535 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6536 name for the latex file.
6537 (MenuMakeHTML): ditto
6539 * src/buffer.h: add an optional boolean argument, which is passed
6542 1999-12-20 Allan Rae <rae@lyx.org>
6544 * lib/templates/IEEEtran.lyx: small correction and update.
6546 * configure.in: Attempted to use LYX_PATH_HEADER
6548 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6550 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6551 input from JMarc. Now use preprocessor to find the header.
6552 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6553 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6554 LYX_STL_STRING_FWD. See comments in file.
6556 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6558 * The global MiniBuffer * minibuffer variable is dead.
6560 * The global FD_form_main * fd_form_main variable is dead.
6562 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6564 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6566 * src/table.h: add the LOstream.h header
6567 * src/debug.h: ditto
6569 * src/LyXAction.h: change the explaination of the ReadOnly
6570 attribute: is indicates that the function _can_ be used.
6572 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6575 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6577 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6583 * src/paragraph.C (GetWord): assert on pos>=0
6586 * src/support/lyxstring.C: condition the use of an invariant on
6588 * src/support/lyxstring.h: ditto
6590 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6591 Use LAssert.h instead of plain assert().
6593 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6595 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6596 * src/support/filetools.C: ditto
6598 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6601 * INSTALL: document the new configure flags
6603 * configure.in: suppress --with-debug; add --enable-assertions
6605 * acinclude.m4: various changes in alignment of help strings.
6607 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6609 * src/kbmap.C: commented out the use of the hash map in kb_map,
6610 beginning of movement to a stl::container.
6612 * several files: removed code that was not in effect when
6613 MOVE_TEXT was defined.
6615 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6616 for escaping should not be used. We can discuss if the string
6617 should be enclosed in f.ex. [] instead of "".
6619 * src/trans_mgr.C (insert): use the new returned value from
6620 encodeString to get deadkeys and keymaps done correctly.
6622 * src/chset.C (encodeString): changed to return a pair, to tell
6623 what to use if we know the string.
6625 * src/lyxscreen.h (fillArc): new function.
6627 * src/FontInfo.C (resize): rewritten to use more std::string like
6628 structore, especially string::replace.
6630 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6633 * configure.in (chmod +x some scripts): remove config/gcc-hack
6635 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6637 * src/buffer.C (writeFile): change once again the top comment in a
6638 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6639 instead of an hardcoded version number.
6640 (makeDocBookFile): ditto
6642 * src/version.h: add new define LYX_DOCVERSION
6644 * po/de.po: update from Pit Sütterlin
6645 * lib/bind/de_menus.bind: ditto.
6647 * src/lyxfunc.C (Dispatch): call MenuExport()
6648 * src/buffer.C (Dispatch): ditto
6650 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6651 LyXFunc::Dispatch().
6652 (MenuExport): new function, moved from
6653 LyXFunc::Dispatch().
6655 * src/trans_mgr.C (insert): small cleanup
6656 * src/chset.C (loadFile): ditto
6658 * lib/kbd/iso8859-1.cdef: add missing backslashes
6660 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6662 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6663 help with placing the manually drawn accents better.
6665 (Draw): x2 and hg changed to float to minimize rounding errors and
6666 help place the accents better.
6668 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6669 unsigned short to char is just wrong...cast the char to unsigned
6670 char instead so that the two values can compare sanely. This
6671 should also make the display of insetlatexaccents better and
6672 perhaps also some other insets.
6674 (lbearing): new function
6677 1999-12-15 Allan Rae <rae@lyx.org>
6679 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6680 header that provides a wrapper around the very annoying SGI STL header
6683 * src/support/lyxstring.C, src/LString.h:
6684 removed old SGI-STL-compatability attempts.
6686 * configure.in: Use LYX_STL_STRING_FWD.
6688 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6689 stl_string_fwd.h is around and try to determine it's location.
6690 Major improvement over previous SGI STL 3.2 compatability.
6691 Three small problems remain with this function due to my zero
6692 knowledge of autoconf. JMarc and lgb see the comments in the code.
6694 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6696 * src/broken_const.h, config/hack-gcc, config/README: removed
6698 * configure.in: remove --with-gcc-hack option; do not call
6701 * INSTALL: remove documentation of --with-broken-const and
6704 * acconfig.h: remove all trace of BROKEN_CONST define
6706 * src/buffer.C (makeDocBookFile): update version number in output
6708 (SimpleDocBookOnePar): fix an assert when trying to a character
6709 access beyond string length
6712 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6714 * po/de.po: fix the Export menu
6716 * lyx.man: update the description of -dbg
6718 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6719 (commandLineHelp): updated
6720 (easyParse): show list of available debug levels if -dbg is passed
6723 * src/Makefile.am: add debug.C
6725 * src/debug.h: moved some code to debug.C
6727 * src/debug.C: new file. Contains code to set and show debug
6730 * src/layout.C: remove 'break' after 'continue' in switch
6731 statements, since these cannot be reached.
6733 1999-12-13 Allan Rae <rae@lyx.org>
6735 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6736 (in_word_set): hash() -> math_hash()
6738 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6740 * acconfig.h: Added a test for whether we are using exceptions in the
6741 current compilation run. If so USING_EXCEPTIONS is defined.
6743 * config.in: Check for existance of stl_string_fwd.h
6744 * src/LString.h: If compiling --with-included-string and SGI's
6745 STL version 3.2 is present (see above test) we need to block their
6746 forward declaration of string and supply a __get_c_string().
6747 However, it turns out this is only necessary if compiling with
6748 exceptions enabled so I've a bit more to add yet.
6750 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6751 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6752 src/support/LRegex.h, src/undo.h:
6753 Shuffle the order of the included files a little to ensure that
6754 LString.h gets included before anything that includes stl_string_fwd.h
6756 * src/support/lyxstring.C: We need to #include LString.h instead of
6757 lyxstring.h to get the necessary definition of __get_c_string.
6758 (__get_c_string): New function. This is defined static just like SGI's
6759 although why they need to do this I'm not sure. Perhaps it should be
6760 in lstrings.C instead.
6762 * lib/templates/IEEEtran.lyx: New template file.
6764 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6766 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6767 * intl/Makefile.in (MKINSTALLDIRS): ditto
6769 * src/LyXAction.C (init): changed to hold the LFUN data in a
6770 automatic array in stead of in callso to newFunc, this speeds up
6771 compilation a lot. Also all the memory used by the array is
6772 returned when the init is completed.
6774 * a lot of files: compiled with -Wold-style-cast, changed most of
6775 the reported offenders to C++ style casts. Did not change the
6776 offenders in C files.
6778 * src/trans.h (Match): change argument type to unsigned int.
6780 * src/support/DebugStream.C: fix some types on the streambufs so
6781 that it works on a conforming implementation.
6783 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6785 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
6787 * src/support/lyxstring.C: remove the inline added earlier since
6788 they cause a bunch of unsatisfied symbols when linking with dec
6789 cxx. Cxx likes to have the body of inlines at the place where they
6792 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
6793 accessing negative bounds in array. This fixes the crash when
6794 inserting accented characters.
6795 * src/trans.h (Match): ditto
6797 * src/buffer.C (Dispatch): since this is a void, it should not try
6798 to return anything...
6800 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6802 * src/buffer.h: removed the two friends from Buffer. Some changes
6803 because of this. Buffer::getFileName and Buffer::setFileName
6804 renamed to Buffer::fileName() and Buffer::fileName(...).
6806 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6808 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
6809 and Buffer::update(short) to BufferView. This move is currently
6810 controlled by a define MOVE_TEXT, this will be removed when all
6811 shows to be ok. This move paves the way for better separation
6812 between buffer contents and buffer view. One side effect is that
6813 the BufferView needs a rebreak when swiching buffers, if we want
6814 to avoid this we can add a cache that holds pointers to LyXText's
6815 that is not currently in use.
6817 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
6820 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6822 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
6824 * lyx_main.C: new command line option -x (or --execute) and
6825 -e (or --export). Now direct conversion from .lyx to .tex
6826 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
6827 Unfortunately, X is still needed and the GUI pops up during the
6830 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6832 * src/Spacing.C: add a using directive to bring stream stuff into
6834 * src/paragraph.C: ditto
6835 * src/buffer.C: ditto
6837 * NEWS: updated a bit the new features of 1.1.3 (took a few things
6838 from Lars' announcement).
6840 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
6841 example files from Tino Meinen.
6843 1999-12-06 Allan Rae <rae@lyx.org>
6845 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
6847 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6849 * src/support/lyxstring.C: added a lot of inline for no good
6852 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
6853 latexWriteEndChanges, they were not used.
6855 * src/layout.h (operator<<): output operator for PageSides
6857 * src/mathed/math_iter.C (my_memcpy): slightly changed.
6859 * some example files: loaded in LyX 1.0.4 and saved again to update
6860 certain constructs (table format)
6862 * a lot of files: did the change to use fstream/iostream for all
6863 writing of files. Done with a close look at Andre Poenitz's patch.
6865 * some files: whitespace changes.
6867 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6869 * src/mathed/math_iter.C (my_memcpy): new function. Since the
6870 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
6871 architecture, we provide our own. It is used unconditionnally, but
6872 I do not think this is a performance problem. Thanks to Angus
6873 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
6874 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
6876 (GetInset): use my_memcpy.
6880 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
6881 it is easier to understand, but it uses less TeX-only constructs now.
6883 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
6884 elements contain spaces
6886 * lib/configure: regenerated
6888 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
6889 elements contain spaces; display the list of programs that are
6892 * autogen.sh: make sure lib/configure is executable
6894 * lib/examples/*: rename the tutorial examples to begin with the
6895 two-letters language code.
6897 * src/lyxfunc.C (getStatus): do not query current font if no
6900 * src/lyx_cb.C (RunScript): use QuoteName
6901 (MenuRunDvips): ditto
6902 (PrintApplyCB): ditto
6904 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
6905 around argument, so that it works well with the current shell.
6906 Does not work properly with OS/2 shells currently.
6908 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
6909 * src/LyXSendto.C (SendtoApplyCB): ditto
6910 * src/lyxfunc.C (Dispatch): ditto
6911 * src/buffer.C (runLaTeX): ditto
6912 (runLiterate): ditto
6913 (buildProgram): ditto
6915 * src/lyx_cb.C (RunScript): ditto
6916 (MenuMakeLaTeX): ditto
6918 * src/buffer.h (getLatexName): new method
6920 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
6922 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6924 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
6925 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
6926 (create_math_panel): ditto
6928 * src/lyxfunc.C (getStatus): re-activate the code which gets
6929 current font and cursor; add test for export to html.
6931 * src/lyxrc.C (read): remove unreachable break statements; add a
6934 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
6936 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6938 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
6939 introduced by faulty regex.
6940 * src/buffer.C: ditto
6941 * src/lastfiles.C: ditto
6942 * src/paragraph.C: ditto
6943 * src/table.C: ditto
6944 * src/vspace.C: ditto
6945 * src/insets/figinset.C: ditto
6946 Note: most of these is absolutely harmless, except the one in
6947 src/mathed formula.C.
6949 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6951 * src/ImportNoweb.C (documentclass): fixed bounds for substr
6952 operation, yielding correct results for the reLyX command.
6954 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6956 * src/support/filetools.C (ExpandPath): removed an over eager
6958 (ReplaceEnvironmentPath): ditto
6960 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
6961 shows that we are doing something fishy in our code...
6965 * src/lyxrc.C (read): use a double switch trick to get more help
6966 from the compiler. (the same trick is used in layout.C)
6967 (write): new function. opens a ofstream and pass that to output
6968 (output): new function, takes a ostream and writes the lyxrc
6969 elemts to it. uses a dummy switch to make sure no elements are
6972 * src/lyxlex.h: added a struct pushpophelper for use in functions
6973 with more than one exit point.
6975 * src/lyxlex.[Ch] (GetInteger): made it const
6979 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
6981 * src/layout.[hC] : LayoutTags splitted into several enums, new
6982 methods created, better error handling cleaner use of lyxlex. Read
6985 * src/bmtable.[Ch]: change some member prototypes because of the
6986 image const changes.
6988 * commandtags.h, src/LyXAction.C (init): new function:
6989 "preferences-save", saves the lyxrc entries into .lyx/preferences.
6990 This file is not read automatically but you can add \input
6991 preferences to your lyxrc if you want to. We need to discuss how
6994 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
6995 in .aux, also remove .bib and .bst files from dependencies when
6998 * src/BufferView.C, src/LyXView.C: add const_cast several places
6999 because of changes to images.
7001 * lib/images/*: same change as for images/*
7003 * lib/lyxrc.example: Default for accept_compound is false not no.
7005 * images/*: changed to be const, however I have som misgivings
7006 about this change so it might be changed back.
7008 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7010 * lib/configure, po/POTFILES.in: regenerated
7012 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7014 * config/lib_configure.m4: removed
7016 * lib/configure.m4: new file (was config/lib_configure.m4)
7018 * configure.in: do not test for rtti, since we do not use it.
7020 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7022 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7023 doubling of allocated space scheme. This makes it faster for large
7024 strings end to use less memory for small strings. xtra rememoved.
7026 * src/insets/figinset.C (waitalarm): commented out.
7027 (GhostscriptMsg): use static_cast
7028 (GhostscriptMsg): use new instead of malloc to allocate memory for
7029 cmap. also delete the memory after use.
7031 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7033 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7034 for changes in bibtex database or style.
7035 (runBibTeX): remove all .bib and .bst files from dep before we
7037 (run): use scanAuc in when dep file already exist.
7039 * src/DepTable.C (remove_files_with_extension): new method
7042 * src/DepTable.[Ch]: made many of the methods const.
7044 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7046 * src/bufferparams.C: make sure that the default textclass is
7047 "article". It used to be the first one by description order, but
7048 now the first one is "docbook".
7050 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7051 string; call Debug::value.
7052 (easyParse): pass complete argument to setDebuggingLevel().
7054 * src/debug.h (value): fix the code that parses debug levels.
7056 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7059 * src/LyXAction.C: use Debug::ACTION as debug channel.
7061 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7063 * NEWS: updated for the future 1.1.3 release.
7065 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7066 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7067 it should. This is of course a controversial change (since many
7068 people will find that their lyx workscreen is suddenly full of
7069 red), but done for the sake of correctness.
7071 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7072 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7074 * src/insets/inseterror.h, src/insets/inseturl.h,
7075 src/insets/insetinfo.h, src/insets/figinset.h,
7076 src/mathed/formulamacro.h, src/mathed/math_macro.h
7077 (EditMessage): add a missing const and add _() to make sure that
7080 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7081 src/insets/insetbib.C, src/support/filetools.C: add `using'
7084 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7085 doing 'Insert index of last word' at the beginning of a paragraph.
7087 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7089 * several files: white-space changes.
7091 * src/mathed/formula.C: removed IsAlpha and IsDigit
7093 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7094 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7097 * src/insets/figinset.C (GetPSSizes): don't break when
7098 "EndComments" is seen. But break when a boundingbox is read.
7100 * all classes inherited from Inset: return value of Clone
7101 changed back to Inset *.
7103 * all classes inherited form MathInset: return value of Clone
7104 changed back to MathedInset *.
7106 * src/insets/figinset.C (runqueue): use a ofstream to output the
7107 gs/ps file. Might need some setpresicion or setw. However I can
7108 see no problem with the current code.
7109 (runqueue): use sleep instead of the alarm/signal code. I just
7110 can't see the difference.
7112 * src/paragraph.C (LyXParagraph): reserve space in the new
7113 paragraph and resize the inserted paragraph to just fit.
7115 * src/lyxfunc.h (operator|=): added operator for func_status.
7117 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7118 check for readable file.
7120 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7121 check for readable file.
7122 (MenuMakeLinuxDoc): ditto
7123 (MenuMakeDocBook): ditto
7124 (MenuMakeAscii): ditto
7125 (InsertAsciiFile): split the test for openable and readable
7127 * src/bmtable.C (draw_bitmaptable): use
7128 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7130 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7131 findtexfile from LaTeX to filetools.
7133 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7134 instead of FilePtr. Needs to be verified by a literate user.
7136 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7138 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7139 (EditMessage): likewise.
7141 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7142 respectively as \textasciitilde and \textasciicircum.
7144 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7146 * src/support/lyxstring.h: made the methods that take iterators
7149 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7150 (regexMatch): made is use the real regex class.
7152 * src/support/Makefile.am: changed to use libtool
7154 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7156 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7158 (MathIsInset ++): changed several macros to be inline functions
7161 * src/mathed/Makefile.am: changed to use libtool
7163 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7165 * src/insets/inset* : Clone changed to const and return type is
7166 the true insettype not just Inset*.
7168 * src/insets/Makefile.am: changed to use libtool
7170 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7172 * src/undo.[Ch] : added empty() and changed some of the method
7175 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7177 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7178 setID use block<> for the bullets array, added const several places.
7180 * src/lyxfunc.C (getStatus): new function
7182 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7183 LyXAction, added const to several funtions.
7185 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7186 a std::map, and to store the dir items in a vector.
7188 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7191 * src/LyXView.[Ch] + other files : changed currentView to view.
7193 * src/LyXAction.[Ch] : ported from the old devel branch.
7195 * src/.cvsignore: added .libs and a.out
7197 * configure.in : changes to use libtool.
7199 * acinclude.m4 : inserted libtool.m4
7201 * .cvsignore: added libtool
7203 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7205 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7206 file name in insets and mathed directories (otherwise the
7207 dependency is not taken in account under cygwin).
7209 * src/text2.C (InsertString[AB]): make sure that we do not try to
7210 read characters past the string length.
7212 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7214 * lib/doc/LaTeXConfig.lyx.in,
7215 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7217 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7218 file saying who created them and when this heppened; this is
7219 useless and annoys tools like cvs.
7221 * lib/layouts/g-brief-{en,de}.layout,
7222 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7223 from Thomas Hartkens <thomas@hartkens.de>.
7225 * src/{insets,mathed}/Makefile.am: do not declare an empty
7226 LDFLAGS, so that it can be set at configure time (useful on Irix
7229 * lib/reLyX/configure.in: make sure that the prefix is set
7230 correctly in LYX_DIR.
7232 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7234 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7235 be used by 'command-sequence' this allows to bind a key to a
7236 sequence of LyX-commands
7237 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7239 * src/LyXAction.C: add "command-sequence"
7241 * src/LyXFunction.C: handling of "command-sequence"
7243 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7244 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7246 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7248 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7250 * src/buffer.C (writeFile): Do not output a comment giving user
7251 and date at the beginning of a .lyx file. This is useless and
7252 annoys cvs anyway; update version number to 1.1.
7254 * src/Makefile.am (LYX_DIR): add this definition, so that a
7255 default path is hardcoded in LyX.
7257 * configure.in: Use LYX_GNU_GETTEXT.
7259 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7260 AM_GNU_GETTEXT with a bug fixed.
7262 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7264 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7266 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7267 which is used to point to LyX data is now LYX_DIR_11x.
7269 * lyx.man: convert to a unix text file; small updates.
7271 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7273 * src/support/LSubstring.[Ch]: made the second arg of most of the
7274 constructors be a const reference.
7276 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7279 * src/support/lyxstring.[Ch] (swap): added missing member function
7280 and specialization of swap(str, str);
7282 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7284 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7285 trace of the old one.
7287 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7288 put the member definitions in undo.C.
7290 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7291 NEW_TEXT and have now only code that was included when this was
7294 * src/intl.C (LCombo): use static_cast
7296 (DispatchCallback): ditto
7298 * src/definitions.h: removed whole file
7300 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7302 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7303 parsing and stores in a std:map. a regex defines the file format.
7304 removed unneeded members.
7306 * src/bufferparams.h: added several enums from definitions.h here.
7307 Removed unsused destructor. Changed some types to use proper enum
7308 types. use block to have the temp_bullets and user_defined_bullets
7309 and to make the whole class assignable.
7311 * src/bufferparams.C (Copy): removed this functions, use a default
7314 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7317 * src/buffer.C (readLyXformat2): commend out all that have with
7318 oldpapersize to do. also comment out all that hve to do with
7319 insetlatex and insetlatexdel.
7320 (setOldPaperStuff): commented out
7322 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7324 * src/LyXAction.C: remove use of inset-latex-insert
7326 * src/mathed/math_panel.C (button_cb): use static_cast
7328 * src/insets/Makefile.am (insets_o_SOURCES): removed
7331 * src/support/lyxstring.C (helper): use the unsigned long
7332 specifier, UL, instead of a static_cast.
7334 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7336 * src/support/block.h: new file. to be used as a c-style array in
7337 classes, so that the class can be assignable.
7339 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7341 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7342 NULL, make sure to return an empty string (it is not possible to
7343 set a string to NULL).
7345 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7347 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7349 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7351 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7352 link line, so that Irix users (for example) can set it explicitely to
7355 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7356 it can be overidden at make time (static or dynamic link, for
7359 * src/vc-backend.C, src/LaTeXFeatures.h,
7360 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7361 statements to bring templates to global namespace.
7363 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7365 * src/support/lyxstring.C (operator[] const): make it standard
7368 * src/minibuffer.C (Init): changed to reflect that more
7369 information is given from the lyxvc and need not be provided here.
7371 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7373 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7375 * src/LyXView.C (UpdateTimerCB): use static_cast
7376 (KeyPressMask_raw_callback): ditto
7378 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7379 buffer_, a lot of changes because of this. currentBuffer() ->
7380 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7381 also changes to other files because of this.
7383 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7385 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7386 have no support for RCS and partial support for CVS, will be
7389 * src/insets/ several files: changes because of function name
7390 changes in Bufferview and LyXView.
7392 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7394 * src/support/LSubstring.[Ch]: new files. These implement a
7395 Substring that can be very convenient to use. i.e. is this
7397 string a = "Mary had a little sheep";
7398 Substring(a, "sheep") = "lamb";
7399 a is now "Mary has a little lamb".
7401 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7402 out patterns and subpatterns of strings. It is used by LSubstring
7403 and also by vc-backend.C
7405 * src/support/lyxstring.C: went over all the assertions used and
7406 tried to correct the wrong ones and flag which of them is required
7407 by the standard. some bugs found because of this. Also removed a
7408 couple of assertions.
7410 * src/support/Makefile.am (libsupport_a_SOURCES): added
7411 LSubstring.[Ch] and LRegex.[Ch]
7413 * src/support/FileInfo.h: have struct stat buf as an object and
7414 not a pointer to one, some changes because of this.
7416 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7417 information in layout when adding the layouts preamble to the
7420 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7423 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7424 because of bug in OS/2.
7426 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7428 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7429 \verbatim@font instead of \ttfamily, so that it can be redefined.
7431 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7432 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7433 src/layout.h, src/text2.C: add 'using' directive to bring the
7434 STL templates we need from the std:: namespace to the global one.
7435 Needed by DEC cxx in strict ansi mode.
7437 * src/support/LIstream.h,src/support/LOstream.h,
7438 src/support/lyxstring.h,src/table.h,
7439 src/lyxlookup.h: do not include <config.h> in header
7440 files. This should be done in the .C files only.
7442 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7446 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7448 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7449 from Kayvan to fix the tth invokation.
7451 * development/lyx.spec.in: updates from Kayvan to reflect the
7452 changes of file names.
7454 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7456 * src/text2.C (InsertStringB): use std::copy
7457 (InsertStringA): use std::copy
7459 * src/bufferlist.C: use a vector to store the buffers in. This is
7460 an internal change and should not affect any other thing.
7462 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7465 * src/text.C (Fill): fix potential bug, one off bug.
7467 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7469 * src/Makefile.am (lyx_main.o): add more files it depends on.
7471 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7473 * src/support/lyxstring.C: use size_t for the reference count,
7474 size, reserved memory and xtra.
7475 (internal_compare): new private member function. Now the compare
7476 functions should work for std::strings that have embedded '\0'
7478 (compare): all compare functions rewritten to use
7481 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7483 * src/support/lyxstring.C (compare): pass c_str()
7484 (compare): pass c_str
7485 (compare): pass c_str
7487 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7489 * src/support/DebugStream.C: <config.h> was not included correctly.
7491 * lib/configure: forgot to re-generate it :( I'll make this file
7492 auto generated soon.
7494 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7496 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7499 * src/support/lyxstring.C: some changes from length() to rep->sz.
7500 avoids a function call.
7502 * src/support/filetools.C (SpaceLess): yet another version of the
7503 algorithm...now per Jean-Marc's suggestions.
7505 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7507 * src/layout.C (less_textclass_desc): functor for use in sorting
7509 (LyXTextClass::Read): sort the textclasses after reading.
7511 * src/support/filetools.C (SpaceLess): new version of the
7512 SpaceLess functions. What problems does this one give? Please
7515 * images/banner_bw.xbm: made the arrays unsigned char *
7517 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7519 * src/support/lyxstring.C (find): remove bogus assertion in the
7520 two versions of find where this has not been done yet.
7522 * src/support/lyxlib.h: add missing int return type to
7525 * src/menus.C (ShowFileMenu): disable exporting to html if no
7526 html export command is present.
7528 * config/lib_configure.m4: add a test for an HTML converter. The
7529 programs checked for are, in this order: tth, latex2html and
7532 * lib/configure: generated from config/lib_configure.m4.
7534 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7535 html converter. The parameters are now passed through $$FName and
7536 $$OutName, instead of standard input/output.
7538 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7540 * lib/lyxrc.example: update description of \html_command.
7541 add "quotes" around \screen_font_xxx font setting examples to help
7542 people who use fonts with spaces in their names.
7544 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7546 * Distribution files: updates for v1.1.2
7548 * src/support/lyxstring.C (find): remove bogus assert and return
7549 npos for the same condition.
7551 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7553 * added patch for OS/2 from SMiyata.
7555 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7557 * src/text2.C (CutSelection): make space_wrapped a bool
7558 (CutSelection): dont declare int i until we have to.
7559 (alphaCounter): return a char const *.
7561 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7563 * src/support/syscall.C (Systemcalls::kill):
7564 src/support/filetools.C (PutEnv, PutEnvPath):
7565 src/lyx_cb.C (addNewlineAndDepth):
7566 src/FontInfo.C (FontInfo::resize): condition some #warning
7567 directives with WITH_WARNINGS.
7570 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7572 * src/layout.[Ch] + several files: access to class variables
7573 limited and made accessor functions instead a lot of code changed
7574 becuase of this. Also instead of returning pointers often a const
7575 reference is returned instead.
7577 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7579 * src/Makefile.am (dist-hook): added used to remove the CVS from
7580 cheaders upon creating a dist
7581 (EXTRA_DIST): added cheaders
7583 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7584 a character not as a small integer.
7586 * src/support/lyxstring.C (find): removed Assert and added i >=
7587 rep->sz to the first if.
7589 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7591 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7592 src/LyXView.C src/buffer.C src/bufferparams.C
7593 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7594 src/text2.C src/insets/insetinclude.C:
7595 lyxlayout renamed to textclasslist.
7597 * src/layout.C: some lyxerr changes.
7599 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7600 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7601 (LyXLayoutList): removed all traces of this class.
7602 (LyXTextClass::Read): rewrote LT_STYLE
7603 (LyXTextClass::hasLayout): new function
7604 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7605 both const and nonconst version.
7606 (LyXTextClass::delete_layout): new function.
7607 (LyXTextClassList::Style): bug fix. do the right thing if layout
7609 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7610 (LyXTextClassList::NameOfLayout): ditto
7611 (LyXTextClassList::Load): ditto
7613 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7615 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7617 * src/LyXAction.C (LookupFunc): added a workaround for sun
7618 compiler, on the other hand...we don't know if the current code
7619 compiles on sun at all...
7621 * src/support/filetools.C (CleanupPath): subst fix
7623 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7626 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7627 complained about this one?
7629 * src/insets/insetinclude.C (Latex): subst fix
7631 * src/insets/insetbib.C (getKeys): subst fix
7633 * src/LyXSendto.C (SendtoApplyCB): subst fix
7635 * src/lyx_main.C (init): subst fix
7637 * src/layout.C (Read): subst fix
7639 * src/lyx_sendfax_main.C (button_send): subst fix
7641 * src/buffer.C (RoffAsciiTable): subst fix
7643 * src/lyx_cb.C (MenuFax): subst fix
7644 (PrintApplyCB): subst fix
7646 1999-10-26 Juergen Vigna <jug@sad.it>
7648 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7650 (Read): Cleaned up this code so now we read only format vestion >= 5
7652 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7654 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7655 come nobody has complained about this one?
7657 * src/insets/insetinclude.C (Latex): subst fix
7659 * src/insets/insetbib.C (getKeys): subst fix
7661 * src/lyx_main.C (init): subst fix
7663 * src/layout.C (Read): subst fix
7665 * src/buffer.C (RoffAsciiTable): subst fix
7667 * src/lyx_cb.C (MenuFax): subst fix.
7669 * src/layout.[hC] + some other files: rewrote to use
7670 std::container to store textclasses and layouts in.
7671 Simplified, removed a lot of code. Make all classes
7672 assignable. Further simplifications and review of type
7673 use still to be one.
7675 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7676 lastfiles to create the lastfiles partr of the menu.
7678 * src/lastfiles.[Ch]: rewritten to use deque to store the
7679 lastfiles in. Uses fstream for reading and writing. Simplifies
7682 * src/support/syscall.C: remove explicit cast.
7684 * src/BufferView.C (CursorToggleCB): removed code snippets that
7686 use explicat C++ style casts instead of C style casts. also use
7687 u_vdata instea of passing pointers in longs.
7689 * src/PaperLayout.C: removed code snippets that were commented out.
7691 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7693 * src/lyx_main.C: removed code snippets that wer commented out.
7695 * src/paragraph.C: removed code snippets that were commented out.
7697 * src/lyxvc.C (logClose): use static_cast
7699 (viewLog): remove explicit cast to void*
7700 (showLog): removed old commented code
7702 * src/menus.C: use static_cast instead of C style casts. use
7703 u_vdata instead of u_ldata. remove explicit cast to (long) for
7704 pointers. Removed old code that was commented out.
7706 * src/insets/inset.C: removed old commented func
7708 * src/insets/insetref.C (InsetRef): removed old code that had been
7709 commented out for a long time.
7711 (escape): removed C style cast
7713 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7715 * src/insets/insetlatex.C (Draw): removed old commented code
7716 (Read): rewritten to use string
7718 * src/insets/insetlabel.C (escape): removed C style cast
7720 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7722 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7725 * src/insets/insetinclude.h: removed a couple of stupid bools
7727 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7728 (Clone): remove C style cast
7729 (getKeys): changed list to lst because of std::list
7731 * src/insets/inseterror.C (Draw): removed som old commented code.
7733 * src/insets/insetcommand.C (Draw): removed some old commented code.
7735 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7736 commented out forever.
7737 (bibitem_cb): use static_cast instead of C style cast
7738 use of vdata changed to u_vdata.
7740 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7742 (CloseUrlCB): use static_cast instead of C style cast.
7743 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7745 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7746 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7747 (CloseInfoCB): static_cast from ob->u_vdata instead.
7748 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7751 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7752 (C_InsetError_CloseErrorCB): forward the ob parameter
7753 (CloseErrorCB): static_cast from ob->u_vdata instead.
7755 * src/vspace.h: include LString.h since we use string in this class.
7757 * src/vspace.C (lyx_advance): changed name from advance because of
7758 nameclash with stl. And since we cannot use namespaces yet...I
7759 used a lyx_ prefix instead. Expect this to change when we begin
7762 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7764 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7765 and removed now defunct constructor and deconstructor.
7767 * src/BufferView.h: have backstack as a object not as a pointer.
7768 removed initialization from constructor. added include for BackStack
7770 * development/lyx.spec.in (%build): add CFLAGS also.
7772 * src/screen.C (drawFrame): removed another warning.
7774 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7776 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7777 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7778 README and ANNOUNCE a bit for the next release. More work is
7781 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
7782 unbreakable if we are in freespacing mode (LyX-Code), but not in
7785 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7787 * src/BackStack.h: fixed initialization order in constructor
7789 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
7791 * acinclude.m4 (VERSION): new rules for when a version is
7792 development, added also a variable for prerelease.
7793 (warnings): we set with_warnings=yes for prereleases
7794 (lyx_opt): prereleases compile with same optimization as development
7795 (CXXFLAGS): only use pedantic if we are a development version
7797 * src/BufferView.C (restorePosition): don't do anything if the
7800 * src/BackStack.h: added member empty, use this to test if there
7801 is anything to pop...
7803 1999-10-25 Juergen Vigna <jug@sad.it>
7806 * forms/layout_forms.fd +
7807 * forms/latexoptions.fd +
7808 * lyx.fd: changed for various form resize issues
7810 * src/mathed/math_panel.C +
7811 * src/insets/inseterror.C +
7812 * src/insets/insetinfo.C +
7813 * src/insets/inseturl.C +
7814 * src/insets/inseturl.h +
7817 * src/PaperLayout.C +
7818 * src/ParagraphExtra.C +
7819 * src/TableLayout.C +
7821 * src/layout_forms.C +
7828 * src/menus.C: fixed various resize issues. So now forms can be
7829 resized savely or not be resized at all.
7831 * forms/form_url.fd +
7832 * src/insets/form_url.[Ch]: added because it's cleaner and easier
7835 * src/insets/Makefile.am: added files form_url.[Ch]
7837 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7839 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
7840 (and presumably 6.2).
7842 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
7843 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
7844 remaining static member callbacks.
7846 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
7849 * src/support/lyxstring.h: declare struct Srep as friend of
7850 lyxstring, since DEC cxx complains otherwise.
7852 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7854 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7856 * src/LaTeX.C (run): made run_bibtex also depend on files with
7858 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
7859 are put into the dependency file.
7861 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
7862 the code has shown itself to work
7863 (create_ispell_pipe): removed another warning, added a comment
7866 * src/minibuffer.C (ExecutingCB): removed code that has been
7867 commented out a long time
7869 * src/lyxfunc.C (processKeyEvent): removed some very old commented
7870 out code + a warning.
7872 * src/support/lyxstring.h: comment out the three private
7873 operators, when compiling with string ansi conforming compilers
7876 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
7878 (pixmapFromBitmapData): change type of bdata to be unsigned char *
7879 (pixmapFromBitmapData): add a reinterpret_cast in the call to
7882 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
7885 * src/mathed/math_panel.C (create_math_panel): remove explicit
7888 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
7891 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
7892 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
7893 to XCreatePixmapFromBitmapData
7894 (fl_set_bmtable_data): change the last argument to be unsigned
7896 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
7897 and bh to be unsigned int, remove explicit casts in call to
7898 XReadBitmapFileData.
7900 * images/arrows.xbm: made the arrays unsigned char *
7901 * images/varsz.xbm: ditto
7902 * images/misc.xbm: ditto
7903 * images/greek.xbm: ditto
7904 * images/dots.xbm: ditto
7905 * images/brel.xbm: ditto
7906 * images/bop.xbm: ditto
7908 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
7910 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
7911 (LYX_PROG_CXX): added -pedantic to g++ compile options when
7912 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
7914 (LYX_CXX_CHEADERS): added <clocale> to the test.
7916 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
7918 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
7920 * src/support/lyxstring.C (append): fixed something that must be a
7921 bug, rep->assign was used instead of rep->append.
7923 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
7926 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
7927 lyx insert double chars. Fix spotted by Kayvan.
7929 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
7931 * Fixed the tth support. I messed up with the Emacs patch apply feature
7932 and omitted the changes in lyxrc.C.
7934 1999-10-22 Juergen Vigna <jug@sad.it>
7936 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
7938 * src/lyx_cb.C (MenuInsertRef) +
7939 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
7940 the form cannot be resized under it limits (fixes a segfault)
7942 * src/lyx.C (create_form_form_ref) +
7943 * forms/lyx.fd: Changed Gravity on name input field so that it is
7946 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7948 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
7949 <ostream> and <istream>.
7951 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
7952 whether <fstream> provides the latest standard features, or if we
7953 have an oldstyle library (like in egcs).
7954 (LYX_CXX_STL_STRING): fix the test.
7956 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
7957 code on MODERN_STL_STREAM.
7959 * src/support/lyxstring.h: use L{I,O}stream.h.
7961 * src/support/L{I,O}stream.h: new files, designed to setup
7962 correctly streams for our use
7963 - includes the right header depending on STL capabilities
7964 - puts std::ostream and std::endl (for LOStream.h) or
7965 std::istream (LIStream.h) in toplevel namespace.
7967 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7969 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
7970 was a bib file that had been changed we ensure that bibtex is run.
7971 (runBibTeX): enhanced to extract the names of the bib files and
7972 getting their absolute path and enter them into the dep file.
7973 (findtexfile): static func that is used to look for tex-files,
7974 checks for absolute patchs and tries also with kpsewhich.
7975 Alternative ways of finding the correct files are wanted. Will
7977 (do_popen): function that runs a command using popen and returns
7978 the whole output of that command in a string. Should be moved to
7981 * src/DepTable.[Ch] (extchanged): new function that returns true if a
7982 file with extension ext has changed.
7984 * src/insets/figinset.C: added ifdef guards around the fl_free
7985 code that jug commented out. Now it is commented out when
7986 compiling with XForms == 0.89.
7988 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
7989 to lyxstring.C, and only keep a forward declaration in
7990 lyxstring.h. Simplifies the header file a bit and should help a
7991 bit on compile time too. Also changes to Srep will not mandate a
7992 recompile of code just using string.
7993 (~lyxstring): definition moved here since it uses srep.
7994 (size): definition moved here since it uses srep.
7996 * src/support/lyxstring.h: removed a couple of "inline" that should
7999 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8001 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8004 1999-10-21 Juergen Vigna <jug@sad.it>
8006 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8007 set to left if I just remove the width entry (or it is empty).
8009 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8010 paragraph when having dummy paragraphs.
8012 1999-10-20 Juergen Vigna <jug@sad.it>
8014 * src/insets/figinset.C: just commented some fl_free_form calls
8015 and added warnings so that this calls should be activated later
8016 again. This avoids for now a segfault, but we have a memory leak!
8018 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8019 'const char * argument' to 'string argument', this should
8020 fix some Asserts() in lyxstring.C.
8022 * src/lyxfunc.h: Removed the function argAsString(const char *)
8023 as it is not used anymore.
8025 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8027 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8030 * src/Literate.h: some funcs moved from public to private to make
8031 interface clearer. Unneeded args removed.
8033 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8035 (scanBuildLogFile): ditto
8037 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8038 normal TeX Error. Still room for improvement.
8040 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8042 * src/buffer.C (insertErrors): changes to make the error
8043 desctription show properly.
8045 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8048 * src/support/lyxstring.C (helper): changed to use
8049 sizeof(object->rep->ref).
8050 (operator>>): changed to use a pointer instead.
8052 * src/support/lyxstring.h: changed const reference & to value_type
8053 const & lets see if that helps.
8055 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8057 * Makefile.am (rpmdist): fixed to have non static package and
8060 * src/support/lyxstring.C: removed the compilation guards
8062 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8065 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8066 conditional compile of lyxstring.Ch
8068 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8069 stupid check, but it is a lot better than the bastring hack.
8070 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8072 * several files: changed string::erase into string::clear. Not
8075 * src/chset.C (encodeString): use a char temporary instead
8077 * src/table.C (TexEndOfCell): added tostr around
8078 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8079 (TexEndOfCell): ditto
8080 (TexEndOfCell): ditto
8081 (TexEndOfCell): ditto
8082 (DocBookEndOfCell): ditto
8083 (DocBookEndOfCell): ditto
8084 (DocBookEndOfCell): ditto
8085 (DocBookEndOfCell): ditto
8087 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8089 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8091 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8092 (MenuBuildProg): added tostr around ret
8093 (MenuRunChktex): added tostr around ret
8094 (DocumentApplyCB): added tostr around ret
8096 * src/chset.C (encodeString): added tostr around t->ic
8098 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8099 (makeLaTeXFile): added tostr around tocdepth
8100 (makeLaTeXFile): added tostr around ftcound - 1
8102 * src/insets/insetbib.C (setCounter): added tostr around counter.
8104 * src/support/lyxstring.h: added an operator+=(int) to catch more
8107 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8108 (lyxstring): We DON'T allow NULL pointers.
8110 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8112 * src/mathed/math_macro.C (MathMacroArgument::Write,
8113 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8114 when writing them out.
8116 * src/LString.C: remove, since it is not used anymore.
8118 * src/support/lyxstring.C: condition the content to
8119 USE_INCLUDED_STRING macro.
8121 * src/mathed/math_symbols.C, src/support/lstrings.C,
8122 src/support/lyxstring.C: add `using' directive to specify what
8123 we need in <algorithm>. I do not think that we need to
8124 conditionalize this, but any thought is appreciated.
8126 * many files: change all callback functions to "C" linkage
8127 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8128 strict_ansi. Those who were static are now global.
8129 The case of callbacks which are static class members is
8130 trickier, since we have to make C wrappers around them (see
8131 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8132 did not finish this yet, since it defeats the purpose of
8133 encapsulation, and I am not sure what the best route is.
8135 1999-10-19 Juergen Vigna <jug@sad.it>
8137 * src/support/lyxstring.C (lyxstring): we permit to have a null
8138 pointer as assignment value and just don't assign it.
8140 * src/vspace.C (nextToken): corrected this function substituting
8141 find_first(_not)_of with find_last_of.
8143 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8144 (TableOptCloseCB) (TableSpeCloseCB):
8145 inserted fl_set_focus call for problem with fl_hide_form() in
8148 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8150 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8153 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8155 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8156 LyXLex::next() and not eatline() to get its argument.
8158 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8160 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8161 instead, use fstreams for io of the depfile, removed unneeded
8162 functions and variables.
8164 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8165 vector instead, removed all functions and variables that is not in
8168 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8170 * src/buffer.C (insertErrors): use new interface to TeXError
8172 * Makefile.am (rpmdist): added a rpmdist target
8174 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8175 per Kayvan's instructions.
8177 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8179 * src/Makefile.am: add a definition for localedir, so that locales
8180 are found after installation (Kayvan)
8182 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8184 * development/.cvsignore: new file.
8186 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8188 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8189 C++ compiler provides wrappers for C headers and use our alternate
8192 * configure.in: use LYX_CXX_CHEADERS.
8194 * src/cheader/: new directory, populated with cname headers from
8195 libstdc++-2.8.1. They are a bit old, but probably good enough for
8196 what we want (support compilers who lack them).
8198 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8199 from includes. It turns out is was stupid.
8201 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8203 * lib/Makefile.am (install-data-local): forgot a ';'
8204 (install-data-local): forgot a '\'
8205 (libinstalldirs): needed after all. reintroduced.
8207 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8209 * configure.in (AC_OUTPUT): added lyx.spec
8211 * development/lyx.spec: removed file
8213 * development/lyx.spec.in: new file
8215 * po/*.po: merged with lyx.pot becuase of make distcheck
8217 * lib/Makefile.am (dist-hook): added dist-hook so that
8218 documentation files will be included when doing a make
8219 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8220 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8222 more: tried to make install do the right thing, exclude CVS dirs
8225 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8226 Path would fit in more nicely.
8228 * all files that used to use pathstack: uses now Path instead.
8229 This change was a lot easier than expected.
8231 * src/support/path.h: new file
8233 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8235 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8237 * src/support/lyxstring.C (getline): Default arg was given for
8240 * Configure.cmd: removed file
8242 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8244 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8245 streams classes and types, add the proper 'using' statements when
8246 MODERN_STL is defined.
8248 * src/debug.h: move the << operator definition after the inclusion
8251 * src/support/filetools.C: include "LAssert.h", which is needed
8254 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8257 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8258 include "debug.h" to define a proper ostream.
8260 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8262 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8263 method to the SystemCall class which can kill a process, but it's
8264 not fully implemented yet.
8266 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8268 * src/support/FileInfo.h: Better documentation
8270 * src/lyxfunc.C: Added support for buffer-export html
8272 * src/menus.C: Added Export->As HTML...
8274 * lib/bind/*.bind: Added short-cut for buffer-export html
8276 * src/lyxrc.*: Added support for new \tth_command
8278 * lib/lyxrc.example: Added stuff for new \tth_command
8280 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8282 * lib/Makefile.am (IMAGES): removed images/README
8283 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8284 installes in correct place. Check permisions is installed
8287 * src/LaTeX.C: some no-op changes moved declaration of some
8290 * src/LaTeX.h (LATEX_H): changed include guard name
8292 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8294 * lib/reLyX/Makefile.am: install noweb2lyx.
8296 * lib/Makefile.am: install configure.
8298 * lib/reLyX/configure.in: declare a config aux dir; set package
8299 name to lyx (not sure what the best solution is); generate noweb2lyx.
8301 * lib/layouts/egs.layout: fix the bibliography layout.
8303 1999-10-08 Jürgen Vigna <jug@sad.it>
8305 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8306 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8307 it returned without continuing to search the path.
8309 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8311 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8312 also fixes a bug. It is not allowed to do tricks with std::strings
8313 like: string a("hei"); &a[e]; this will not give what you
8314 think... Any reason for the complexity in this func?
8316 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8318 * Updated README and INSTALL a bit, mostly to check that my
8319 CVS rights are correctly set up.
8321 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8323 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8324 does not allow '\0' chars but lyxstring and std::string does.
8326 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8328 * autogen.sh (AUTOCONF): let the autogen script create the
8329 POTFILES.in file too. POTFILES.in should perhaps now not be
8330 included in the cvs module.
8332 * some more files changed to use C++ includes instead of C ones.
8334 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8336 (Reread): added tostr to nlink. buggy output otherwise.
8337 (Reread): added a string() around szMode when assigning to Buffer,
8338 without this I got a log of garbled info strings.
8340 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8343 * I have added several ostream & operator<<(ostream &, some_type)
8344 functions. This has been done to avoid casting and warnings when
8345 outputting enums to lyxerr. This as thus eliminated a lot of
8346 explicit casts and has made the code clearer. Among the enums
8347 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8348 mathed enums, some font enum the Debug::type enum.
8350 * src/support/lyxstring.h (clear): missing method. equivalent of
8353 * all files that contained "stderr": rewrote constructs that used
8354 stderr to use lyxerr instead. (except bmtable)
8356 * src/support/DebugStream.h (level): and the passed t with
8357 Debug::ANY to avoid spurious bits set.
8359 * src/debug.h (Debug::type value): made it accept strings of the
8362 * configure.in (Check for programs): Added a check for kpsewhich,
8363 the latex generation will use this later to better the dicovery of
8366 * src/BufferView.C (create_view): we don't need to cast this to
8367 (void*) that is done automatically.
8368 (WorkAreaButtonPress): removed some dead code.
8370 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8372 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8373 is not overwritten when translated (David Sua'rez de Lis).
8375 * lib/CREDITS: Added David Sua'rez de Lis
8377 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8379 * src/bufferparams.C (BufferParams): default input encoding is now
8382 * acinclude.m4 (cross_compiling): comment out macro
8383 LYX_GXX_STRENGTH_REDUCE.
8385 * acconfig.h: make sure that const is not defined (to empty) when
8386 we are compiling C++. Remove commented out code using SIZEOF_xx
8389 * configure.in : move the test for const and inline as late as
8390 possible so that these C tests do not interefere with C++ ones.
8391 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8392 has not been proven.
8394 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8396 * src/table.C (getDocBookAlign): remove bad default value for
8399 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8401 (ShowFileMenu2): ditto.
8403 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8406 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8408 * Most files: finished the change from the old error code to use
8409 DebugStream for all lyxerr debugging. Only minor changes remain
8410 (e.g. the setting of debug levels using strings instead of number)
8412 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8414 * src/layout.C (Add): Changed to use compare_no_case instead of
8417 * src/FontInfo.C: changed loop variable type too string::size_type.
8419 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8421 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8422 set ETAGS_ARGS to --c++
8424 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8426 * src/table.C (DocBookEndOfCell): commented out two unused variables
8428 * src/paragraph.C: commented out four unused variables.
8430 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8431 insed a if clause with type string::size_type.
8433 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8436 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8438 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8439 variable, also changed loop to go from 0 to lenght + 1, instead of
8440 -1 to length. This should be correct.
8442 * src/LaTeX.C (scanError): use string::size_type as loop variable
8445 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8446 (l.896) since y_tmp and row was not used anyway.
8448 * src/insets/insetref.C (escape): use string::size_type as loop
8451 * src/insets/insetquotes.C (Width): use string::size_type as loop
8453 (Draw): use string::size_type as loop variable type.
8455 * src/insets/insetlatexaccent.C (checkContents): use
8456 string::size_type as loop variable type.
8458 * src/insets/insetlabel.C (escape): use string::size_type as loop
8461 * src/insets/insetinfo.C: added an extern for current_view.
8463 * src/insets/insetcommand.C (scanCommand): use string::size_type
8464 as loop variable type.
8466 * most files: removed the RCS tags. With them we had to recompile
8467 a lot of files after a simple cvs commit. Also we have never used
8468 them for anything meaningful.
8470 * most files: tags-query-replace NULL 0. As adviced several plases
8471 we now use "0" instead of "NULL" in our code.
8473 * src/support/filetools.C (SpaceLess): use string::size_type as
8476 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8478 * src/paragraph.C: fixed up some more string stuff.
8480 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8482 * src/support/filetools.h: make modestr a std::string.
8484 * src/filetools.C (GetEnv): made ch really const.
8486 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8487 made code that used these use max/min from <algorithm> instead.
8489 * changed several c library include files to their equivalent c++
8490 library include files. All is not changed yet.
8492 * created a support subdir in src, put lyxstring and lstrings
8493 there + the extra files atexit, fileblock, strerror. Created
8494 Makefile.am. edited configure.in and src/Makefile.am to use this
8495 new subdir. More files moved to support.
8497 * imported som of the functions from repository lyx, filetools
8499 * ran tags-query-replace on LString -> string, corrected the bogus
8500 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8501 is still some errors in there. This is errors where too much or
8502 too litle get deleted from strings (string::erase, string::substr,
8503 string::replace), there can also be some off by one errors, or
8504 just plain wrong use of functions from lstrings. Viewing of quotes
8507 * LyX is now running fairly well with string, but there are
8508 certainly some bugs yet (see above) also string is quite different
8509 from LString among others in that it does not allow null pointers
8510 passed in and will abort if it gets any.
8512 * Added the revtex4 files I forgot when setting up the repository.
8514 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8516 * All over: Tried to clean everything up so that only the files
8517 that we really need are included in the cvs repository.
8518 * Switched to use automake.
8519 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8520 * Install has not been checked.
8522 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8524 * po/pt.po: Three errors:
8525 l.533 and l.538 format specification error
8526 l. 402 duplicate entry, I just deleted it.