1 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3 * src/frontends/kde/Makefile.am: fix rule for
4 formindexdialogdata_moc.C
6 * src/.cvsignore: add ext_l10n.h to ignore
8 * acconfig.h: stop messing with __STRICT_ANSI__
9 * config/gnome.m4: remove option to set -ansi
10 * config/kde.m4: remove option to set -ansi
11 * config/lyxinclude.m4: don't set -ansi
13 2000-09-27 Juergen Vigna <jug@sad.it>
15 * various files: remove "default" language check.
17 * src/insets/insetquotes.C: removed use of current_view.
19 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
20 the one should have red ears by now!
22 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
23 in more then one paragraph. Fixed cursor-movement/selection.
25 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
26 paragraphs inside a text inset.
28 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
29 text-inset if this owner is an inset.
31 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
33 * src/Bullet.h: changed type of font, character and size to int
35 * src/buffer.C (asciiParagraph): remove actcell and fname1.
37 * src/insets/inseturl.[Ch]:
38 * src/insets/insetref.[Ch]:
39 * src/insets/insetlabel.[Ch]: add linelen to Ascii
41 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
43 * src/buffer.C (readFile): block-if statement rearranged to minimise
44 bloat. Patch does not reverse Jean-Marc's change ;-)
46 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
47 Class rewritten to store pointers to hide/update signals directly,
48 rather than Dialogs *. Also defined an enum to ease use. All xforms
49 forms can now be derived from this class.
51 * src/frontends/xforms/FormCommand.[Ch]
52 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
54 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
57 * src/frontends/xforms/forms/form_citation.fd
58 * src/frontends/xforms/forms/form_copyright.fd
59 * src/frontends/xforms/forms/form_error.fd
60 * src/frontends/xforms/forms/form_index.fd
61 * src/frontends/xforms/forms/form_ref.fd
62 * src/frontends/xforms/forms/form_toc.fd
63 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
65 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
67 * src/insets/insetfoot.C: removed redundent using directive.
69 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
71 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
72 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
74 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
75 created in the constructors in different groups. Then set() just
76 have to show the groups as needed. This fixes the redraw problems
77 (and is how the old menu code worked).
79 * src/support/lyxlib.h: declare the methods as static when we do
82 2000-09-26 Juergen Vigna <jug@sad.it>
84 * src/buffer.C (asciiParagraph): new function.
85 (writeFileAscii): new function with parameter ostream.
86 (writeFileAscii): use now asciiParagraph.
88 * various inset files: added the linelen parameter to the Ascii-func.
90 * src/tabular.C (Write): fixed error in writing file introduced by
91 the last changes from Lars.
93 * lib/bind/menus.bind: removed not supported functions.
95 * src/insets/insettext.C (Ascii): implemented this function.
97 * src/insets/lyxinset.h (Ascii): added linelen parameter.
99 * src/tabular.C (write_attribute[int,string,bool]): new functions.
100 (Write): use of the write_attribute functions.
102 * src/bufferlist.C (close): fixed reasking question!
104 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
106 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
107 new files use the everwhere possible.
110 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
111 src/log_form.C src/lyx.C:
114 * src/buffer.C (runLaTeX): remove func
116 * src/PaperLayout.C: removed file
117 * src/ParagraphExtra.C: likewise
118 * src/bullet_forms.C: likewise
119 * src/bullet_forms.h: likewise
120 * src/bullet_forms_cb.C: likewise
122 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
123 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
126 * several files: remove all traces of the old fd_form_paragraph,
127 and functions belonging to that.
129 * several files: remove all traces of the old fd_form_document,
130 and functions belonging to that.
132 * several files: constify local variables were possible.
134 * several files: remove all code that was dead when NEW_EXPORT was
137 * several files: removed string::c_str in as many places as
140 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
141 (e): be a bit more outspoken when patching
142 (updatesrc): only move files if changed.
144 * forms/layout_forms.h.patch: regenerated
146 * forms/layout_forms.fd: remove form_document and form_paragraph
147 and form_quotes and form_paper and form_table_options and
150 * forms/form1.fd: remove form_table
152 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
153 the fdui->... rewrite. Update some comments to xforms 0.88
155 * forms/bullet_forms.C.patch: removed file
156 * forms/bullet_forms.fd: likewise
157 * forms/bullet_forms.h.patch: likewise
159 * development/Code_rules/Rules: added a section on switch
160 statements. Updated some comment to xforms 0.88.
162 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
164 * src/buffer.C (readFile): make sure that the whole version number
165 is read after \lyxformat (even when it contains a comma)
167 * lib/ui/default.ui: change shortcut of math menu to M-a.
169 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
171 * src/vspace.C (nextToken): use isStrDbl() to check for proper
174 * src/LyXView.C (updateWindowTitle): show the full files name in
175 window title, limited to 30 characters.
177 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
178 When a number of characters has been given, we should not assume
179 that the string is 0-terminated.
181 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
182 calls (fixes some memory leaks)
184 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
185 trans member on exit.
187 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
189 * src/converter.C (GetReachable): fix typo.
191 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
192 understand ',' instead of '.'.
193 (GetInteger): rewrite to use strToInt().
195 2000-09-26 Juergen Vigna <jug@sad.it>
197 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
198 better visibility and error-message on wrong VSpace input.
200 * src/language.C (initL): added english again.
202 2000-09-25 Juergen Vigna <jug@sad.it>
204 * src/frontends/kde/Dialogs.C (Dialogs):
205 * src/frontends/gnome/Dialogs.C (Dialogs):
206 * src/frontends/kde/Makefile.am:
207 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
209 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
211 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
213 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
215 * src/frontends/xforms/FormParagraph.C:
216 * src/frontends/xforms/FormParagraph.h:
217 * src/frontends/xforms/form_paragraph.C:
218 * src/frontends/xforms/form_paragraph.h:
219 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
222 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
224 * src/tabular.C (OldFormatRead): forgot to delete the temporary
225 Paragraph-Data after use.
227 * src/insets/insettext.C (LocalDispatch): don't set the layout on
228 non breakable paragraphs.
230 2000-09-25 Garst R. Reese <reese@isn.net>
232 * src/language.C (initL): added missing language_country codes.
234 2000-09-25 Juergen Vigna <jug@sad.it>
236 * src/insets/insettext.C (InsetText):
237 (deleteLyXText): remove the not released LyXText structure!
239 2000-09-24 Marko Vendelin <markov@ioc.ee>
241 * src/frontends/gnome/mainapp.C
242 * src/frontends/gnome/mainapp.h: added support for keyboard
245 * src/frontends/gnome/FormCitation.C
246 * src/frontends/gnome/FormCitation.h
247 * src/frontends/gnome/Makefile.am
248 * src/frontends/gnome/pixbutton.h: completed the rewrite of
249 FormCitation to use "action area" in mainapp window
251 * src/frontends/gnome/Menubar_pimpl.C
252 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
255 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
257 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
258 width/descent/ascent values if name is empty.
259 (mathed_string_height): Use std::max.
261 2000-09-25 Allan Rae <rae@lyx.org>
263 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
264 segfault. This will be completely redesigned soon.
266 * sigc++: updated libsigc++. Fixes struct timespec bug.
268 * development/tools/makeLyXsigc.sh: .cvsignore addition
270 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
272 * several files: removed almost all traces of the old table
275 * src/TableLayout.C: removed file
277 2000-09-22 Juergen Vigna <jug@sad.it>
279 * src/frontends/kde/Dialogs.C: added credits forms.
281 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
283 * src/frontends/gnome/Dialogs.C: added some forms.
285 * src/spellchecker.C (init_spell_checker): set language in pspell code
286 (RunSpellChecker): some modifications for setting language string.
288 * src/language.[Ch]: added language_country code.
290 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
292 * src/frontends/Dialogs.h: added new signal showError.
293 Rearranged existing signals in some sort of alphabetical order.
295 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
296 FormError.[Ch], form_error.[Ch]
297 * src/frontends/xforms/forms/makefile: added new file form_error.fd
298 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
300 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
301 dialogs. I think that this can be used as the base to all these
304 * src/frontends/xforms/FormError.[Ch]
305 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
306 implementation of InsetError dialog.
308 * src/insets/inseterror.[Ch]: rendered GUI-independent.
310 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
311 * src/frontends/kde/Makefile.am: ditto
313 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
315 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
316 macrobf. This fixes a bug of invisible text.
318 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
320 * lib/doc/LaTeXConfig.lyx.in: updated.
322 * src/language.C (initL): remove language "francais" and change a
323 bit the names of the two other french variations.
325 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
326 string that may not be 0-terminated.
328 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
330 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
332 2000-09-20 Marko Vendelin <markov@ioc.ee>
334 * src/frontends/gnome/FormCitation.C
335 * src/frontends/gnome/FormIndex.C
336 * src/frontends/gnome/FormToc.C
337 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
338 the variable initialization to shut up the warnings
340 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
342 * src/table.[Ch]: deleted files
344 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
347 2000-09-18 Juergen Vigna <jug@sad.it>
349 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
350 problems with selection. Inserted new LFUN_PASTESELECTION.
351 (InsetButtonPress): inserted handling of middle mouse-button paste.
353 * src/spellchecker.C: changed word to word.c_str().
355 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
357 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
358 included in the ``make dist'' tarball.
360 2000-09-15 Juergen Vigna <jug@sad.it>
362 * src/CutAndPaste.C (cutSelection): small fix return the right
363 end position after cut inside one paragraph only.
365 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
366 we are locked as otherwise we don't have a valid cursor position!
368 * src/insets/figinset.C (draw): small bugfix but why is this needed???
370 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
372 * src/frontends/kde/FormRef.C: added using directive.
373 * src/frontends/kde/FormToc.C: ditto
375 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
377 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
379 2000-09-19 Marko Vendelin <markov@ioc.ee>
381 * src/frontends/gnome/Menubar_pimpl.C
382 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
383 Toc, ViewFormats, UpdateFormats, and ExportFormats.
385 * src/frontends/gnome/mainapp.C
386 * src/frontends/gnome/mainapp.h: support for menu update used
389 * src/frontends/gnome/mainapp.C
390 * src/frontends/gnome/mainapp.h: support for "action" area in the
391 main window. This area is used by small simple dialogs, such as
394 * src/frontends/gnome/FormIndex.C
395 * src/frontends/gnome/FormIndex.h
396 * src/frontends/gnome/FormUrl.C
397 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
400 * src/frontends/gnome/FormCitation.C
401 * src/frontends/gnome/FormCitation.h: rewrite to use main window
402 action area. Only "Insert new citation" is implemented.
404 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
406 * src/buffer.C (Dispatch): fix call to Dispatch
407 * src/insets/insetref.C (Edit): likewise
408 * src/insets/insetparent.C (Edit): likewise
409 * src/insets/insetinclude.C (include_cb): likewise
410 * src/frontends/xforms/FormUrl.C (apply): likewise
411 * src/frontends/xforms/FormToc.C (apply): likewise
412 * src/frontends/xforms/FormRef.C (apply): likewise
413 * src/frontends/xforms/FormIndex.C (apply): likewise
414 * src/frontends/xforms/FormCitation.C (apply): likewise
415 * src/lyxserver.C (callback): likewise
416 * src/lyxfunc.C (processKeySym): likewise
419 * src/lyx_cb.C (LayoutsCB): likewise
421 * Makefile.am (sourcedoc): small change
423 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
425 * src/main.C (main): Don't make an empty GUIRunTime object. all
426 methods are static. constify a bit remove unneded using + headers.
428 * src/tabular.C: some more const to local vars move some loop vars
430 * src/spellchecker.C: added some c_str after some word for pspell
432 * src/frontends/GUIRunTime.h: add new static method setDefaults
433 * src/frontends/xforms/GUIRunTime.C (setDefaults):
434 * src/frontends/kde/GUIRunTime.C (setDefaults):
435 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
437 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
438 with strnew in arg, use correct emptystring when calling SetName.
440 * several files: remove all commented code with relation to
441 HAVE_SSTREAM beeing false. We now only support stringstream and
444 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
446 * src/lyxfunc.C: construct correctly the automatic new file
449 * src/text2.C (IsStringInText): change type of variable i to shut
452 * src/support/sstream.h: do not use namespaces if the compiler
453 does not support them.
455 2000-09-15 Marko Vendelin <markov@ioc.ee>
456 * src/frontends/gnome/FormCitation.C
457 * src/frontends/gnome/FormCitation.h
458 * src/frontends/gnome/diainsertcitation_interface.c
459 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
460 regexp support to FormCitation [Gnome].
462 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
465 * configure.in: remove unused KDE/GTKGUI define
467 * src/frontends/kde/FormRef.C
468 * src/frontends/kde/FormRef.h
469 * src/frontends/kde/formrefdialog.C
470 * src/frontends/kde/formrefdialog.h: double click will
471 go to reference, now it is possible to change a cross-ref
474 * src/frontends/kde/FormToc.C
475 * src/frontends/kde/FormToc.h
476 * src/frontends/kde/formtocdialog.C
477 * src/frontends/kde/formtocdialog.h: add a depth
480 * src/frontends/kde/Makefile.am: add QtLyXView.h
483 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
485 * src/frontends/kde/FormCitation.h: added some using directives.
487 * src/frontends/kde/FormToc.h: corrected definition of doTree.
489 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
492 * src/mathed/math_defs.h: redefine SetAlign to use string rather
495 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
497 * src/buffer.C (pop_tag): revert for the second time a change by
498 Lars, who seems to really hate having non-local loop variables :)
500 * src/Lsstream.h: add "using" statements.
502 * src/support/copy.C (copy): add a bunch of std:: qualifiers
503 * src/buffer.C (writeFile): ditto
505 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
507 * src/buffer.C (writeFile): try to fix the locale modified format
508 number to always be as we want it.
510 * src/WorkArea.C (work_area_handler): try to workaround the bugs
511 in XForms 0.89. C-space is now working again.
513 * src/Lsstream.h src/support/sstream.h: new files.
515 * also commented out all cases where strstream were used.
517 * src/Bullet.h (c_str): remove method.
519 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
521 * a lot of files: get rid of "char const *" and "char *" is as
522 many places as possible. We only want to use them in interaction
523 with system of other libraries, not inside lyx.
525 * a lot of files: return const object is not of pod type. This
526 helps ensure that temporary objects is not modified. And fits well
527 with "programming by contract".
529 * configure.in: check for the locale header too
531 * Makefile.am (sourcedoc): new tag for generation of doc++
534 2000-09-14 Juergen Vigna <jug@sad.it>
536 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
537 callback to check which combo called it and do the right action.
539 * src/combox.C (combo_cb): added combo * to the callbacks.
540 (Hide): moved call of callback after Ungrab of the pointer.
542 * src/intl.h: removed LCombo2 function.
544 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
545 function as this can now be handled in one function.
547 * src/combox.h: added Combox * to callback prototype.
549 * src/frontends/xforms/Toolbar_pimpl.C:
550 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
552 2000-09-14 Garst Reese <reese@isn.net>
554 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
555 moved usepackage{xxx}'s to beginning of file. Changed left margin
556 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
557 underlining from title. Thanks to John Culleton for useful suggestions.
559 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
561 * src/lyxlex_pimpl.C (setFile): change error message to debug
564 2000-09-13 Juergen Vigna <jug@sad.it>
566 * src/frontends/xforms/FormDocument.C: implemented choice_class
567 as combox and give callback to combo_language so OK/Apply is activated
570 * src/bufferlist.C (newFile): small fix so already named files
571 (via an open call) are not requested to be named again on the
574 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
576 * src/frontends/kde/Makefile.am
577 * src/frontends/kde/FormRef.C
578 * src/frontends/kde/FormRef.h
579 * src/frontends/kde/formrefdialog.C
580 * src/frontends/kde/formrefdialog.h: implement
583 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
585 * src/frontends/kde/formtocdialog.C
586 * src/frontends/kde/formtocdialog.h
587 * src/frontends/kde/FormToc.C
588 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
590 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
592 * src/frontends/kde/FormCitation.C: fix thinko
593 where we didn't always display the reference text
596 * src/frontends/kde/formurldialog.C
597 * src/frontends/kde/formurldialog.h
598 * src/frontends/kde/FormUrl.C
599 * src/frontends/kde/FormUrl.h: minor cleanups
601 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
603 * src/frontends/kde/Makefile.am
604 * src/frontends/kde/FormToc.C
605 * src/frontends/kde/FormToc.h
606 * src/frontends/kde/FormCitation.C
607 * src/frontends/kde/FormCitation.h
608 * src/frontends/kde/FormIndex.C
609 * src/frontends/kde/FormIndex.h
610 * src/frontends/kde/formtocdialog.C
611 * src/frontends/kde/formtocdialog.h
612 * src/frontends/kde/formcitationdialog.C
613 * src/frontends/kde/formcitationdialog.h
614 * src/frontends/kde/formindexdialog.C
615 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
617 2000-09-12 Juergen Vigna <jug@sad.it>
619 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
622 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
624 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
627 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
629 * src/converter.C (Add, Convert): Added support for converter flags:
630 needaux, resultdir, resultfile.
631 (Convert): Added new parameter view_file.
632 (dvips_options): Fixed letter paper option.
634 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
635 (Export, GetExportableFormats, GetViewableFormats): Added support
638 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
640 (easyParse): Fixed to work with new export code.
642 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
645 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
647 * lib/bind/*.bind: Replaced
648 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
649 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
651 2000-09-11 Juergen Vigna <jug@sad.it>
653 * src/lyx_gui.C (runTime): uses global guiruntime variable.
655 * src/main.C (main): now GUII defines global guiruntime!
657 * src/frontends/gnome/GUIRunTime.C (initApplication):
658 * src/frontends/kde/GUIRunTime.C (initApplication):
659 * src/frontends/xforms/GUIRunTime.C (initApplication):
660 * src/frontends/GUIRunTime.h: added new function initApplication.
662 * src/spellchecker.C (sc_accept_word): change to add_to_session.
664 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
666 2000-09-08 Juergen Vigna <jug@sad.it>
668 * src/lyx_gui.C (create_forms): don't display the "default" entry as
669 we have already "Reset".
671 * src/language.C (initL): inserted "default" language and made this
672 THE default language (and not american!)
674 * src/paragraph.C: inserted handling of "default" language!
676 * src/lyxfont.C: ditto
680 * src/paragraph.C: output the \\par only if we have a following
681 paragraph otherwise it's not needed.
683 2000-09-05 Juergen Vigna <jug@sad.it>
685 * config/pspell.m4: added entry to lyx-flags
687 * src/spellchecker.C: modified version from Kevin for using pspell
689 2000-09-01 Marko Vendelin <markov@ioc.ee>
690 * src/frontends/gnome/Makefile.am
691 * src/frontends/gnome/FormCitation.C
692 * src/frontends/gnome/FormCitation.h
693 * src/frontends/gnome/diainsertcitation_callbacks.c
694 * src/frontends/gnome/diainsertcitation_callbacks.h
695 * src/frontends/gnome/diainsertcitation_interface.c
696 * src/frontends/gnome/diainsertcitation_interface.h
697 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
698 dialog for Gnome frontend
700 * src/main.C: Gnome libraries require keeping application name
701 and its version as strings
703 * src/frontends/gnome/mainapp.C: Change the name of the main window
704 from GnomeLyX to PACKAGE
706 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
708 * src/frontends/Liason.C: add "using: declaration.
710 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
712 * src/mathed/math_macro.C (Metrics): Set the size of the template
714 * src/mathed/formulamacro.C (Latex): Fixed the returned value
716 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
718 * src/converter.C (add_options): New function.
719 (SetViewer): Change $$FName into '$$FName'.
720 (View): Add options when running xdvi
721 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
722 (Convert): The 3rd parameter is now the desired filename. Converts
723 calls to lyx::rename if necessary.
724 Add options when running dvips.
725 (dvi_papersize,dvips_options): New methods.
727 * src/exporter.C (Export): Use getLatexName() instead of fileName().
729 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
730 using a call to Converter::dvips_options.
731 Fixed to work with nex export code.
734 * src/support/rename.C: New files
736 * src/support/syscall.h
737 * src/support/syscall.C: Added Starttype SystemDontWait.
739 * lib/ui/default.ui: Changed to work with new export code
741 * lib/configure.m4: Changed to work with new export code
743 * src/encoding.C: Changed latex name for iso8859_7 encoding.
745 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
747 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
748 so that code compiles with DEC cxx.
750 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
751 to work correctly! Also now supports the additional elements
754 2000-09-01 Allan Rae <rae@lyx.org>
756 * src/frontends/ButtonPolicies.C: renamed all the references to
757 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
759 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
760 since it's a const not a type.
762 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
764 2000-08-31 Juergen Vigna <jug@sad.it>
766 * src/insets/figinset.C: Various changes to look if the filename has
767 an extension and if not add it for inline previewing.
769 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
771 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
772 make buttonStatus and isReadOnly be const methods. (also reflect
773 this in derived classes.)
775 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
776 (nextState): change to be static inline, pass the StateMachine as
778 (PreferencesPolicy): remove casts
779 (OkCancelPolicy): remvoe casts
780 (OkCancelReadOnlyPolicy): remove casts
781 (NoRepeatedApplyReadOnlyPolicy): remove casts
782 (OkApplyCancelReadOnlyPolicy): remove casts
783 (OkApplyCancelPolicy): remove casts
784 (NoRepeatedApplyPolicy): remove casts
786 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
788 * src/converter.C: added some using directives
790 * src/frontends/ButtonPolicies.C: changes to overcome
791 "need lvalue" error with DEC c++
793 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
794 to WMHideCB for DEC c++
796 * src/frontends/xforms/Menubar_pimpl.C: added using directive
798 * src/frontends/xforms/forms/form_document.C.patch: use C callback
799 to BulletBMTableCB for DEC c++
801 2000-08-31 Allan Rae <rae@lyx.org>
803 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
804 character dialog separately from old document dialogs combo_language.
807 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
809 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
810 Removed LFUN_REF_CREATE.
812 * src/MenuBackend.C: Added new tags: toc and references
814 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
815 (add_lastfiles, add_documents, add_formats): Removed the unused smn
817 (add_toc, add_references): New methods.
818 (create_submenu): Handle correctly the case when there is a
819 seperator after optional menu items.
821 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
822 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
823 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
825 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
827 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
829 * src/converter.[Ch]: New file for converting between different
832 * src/export.[Ch]: New file for exporting a LyX file to different
835 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
836 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
837 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
838 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
839 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
840 RunDocBook, MenuExport.
842 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
843 Exporter::Preview methods if NEW_EXPORT is defined.
845 * src/buffer.C (Dispatch): Use Exporter::Export.
847 * src/lyxrc.C: Added new tags: \converter and \viewer.
850 * src/LyXAction.C: Define new lyx-function: buffer-update.
851 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
852 when NEW_EXPORT is defined.
854 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
856 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
858 * lib/ui/default.ui: Added submenus "view" and "update" to the
861 * src/filetools.C (GetExtension): New function.
863 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
865 2000-08-29 Allan Rae <rae@lyx.org>
867 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
869 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
870 (EnableDocumentLayout): removed
871 (DisableDocumentLayout): removed
872 (build): make use of ButtonController's read-only handling to
873 de/activate various objects. Replaces both of the above functions.
875 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
876 (readOnly): was read_only
877 (refresh): fixed dumb mistakes with read_only_ handling
879 * src/frontends/xforms/forms/form_document.fd:
880 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
881 tabbed dialogs so the tabs look more like tabs and so its easier to
882 work out which is the current tab.
884 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
885 segfault with form_table
887 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
889 2000-08-28 Juergen Vigna <jug@sad.it>
891 * acconfig.h: added USE_PSPELL.
893 * src/config.h.in: added USE_PSPELL.
895 * autogen.sh: added pspell.m4
897 * config/pspell.m4: new file.
899 * src/spellchecker.C: implemented support for pspell libary.
901 2000-08-25 Juergen Vigna <jug@sad.it>
903 * src/LyXAction.C (init): renamed LFUN_TABLE to
904 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
906 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
908 * src/lyxscreen.h: add force_clear variable and fuction to force
909 a clear area when redrawing in LyXText.
911 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
913 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
915 * some whitespace and comment changes.
917 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
919 * src/buffer.C: up te LYX_FORMAT to 2.17
921 2000-08-23 Juergen Vigna <jug@sad.it>
923 * src/BufferView_pimpl.C (tripleClick): disable this when in a
926 * src/insets/insettabular.C (pasteSelection): delete the insets
927 LyXText as it is not valid anymore.
928 (copySelection): new function.
929 (pasteSelection): new function.
930 (cutSelection): new function.
931 (LocalDispatch): implemented cut/copy/paste of cell selections.
933 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
934 don't have a LyXText.
936 * src/LyXAction.C (init): a NEW_TABULAR define too much.
938 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
941 2000-08-22 Juergen Vigna <jug@sad.it>
943 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
944 ifdef form_table out if NEW_TABULAR.
946 2000-08-21 Juergen Vigna <jug@sad.it>
948 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
949 (draw): fixed draw position so that the cursor is positioned in the
951 (InsetMotionNotify): hide/show cursor so the position is updated.
952 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
953 using cellstart() function where it should be used.
955 * src/insets/insettext.C (draw): ditto.
957 * src/tabular.C: fixed initialization of some missing variables and
958 made BoxType into an enum.
960 2000-08-22 Marko Vendelin <markov@ioc.ee>
961 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
962 stock menu item using action numerical value, not its string
966 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
968 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
969 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
971 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
973 * src/frontends/xforms/GUIRunTime.C: new file
975 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
976 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
978 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
980 * src/frontends/kde/GUIRunTime.C: new file
982 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
983 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
985 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
987 * src/frontends/gnome/GUIRunTime.C: new file
989 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
992 * src/frontends/GUIRunTime.h: removed constructor and destructor,
993 small change to documetentation.
995 * src/frontends/GUIRunTime.C: removed file
997 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
999 * src/lyxparagraph.h: enable NEW_TABULAR as default
1001 * src/lyxfunc.C (processKeySym): remove some commented code
1003 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
1004 NEW_TABULAR around the fd_form_table_options.
1006 * src/lyx_gui.C (runTime): call the static member function as
1007 GUIRunTime::runTime().
1009 2000-08-21 Allan Rae <rae@lyx.org>
1011 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
1014 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
1016 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
1018 2000-08-21 Allan Rae <rae@lyx.org>
1020 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
1021 keep Garst happy ;-)
1022 * src/frontends/xforms/FormPreferences.C (build): use setOK
1023 * src/frontends/xforms/FormDocument.C (build): use setOK
1024 (FormDocument): use the appropriate policy.
1026 2000-08-21 Allan Rae <rae@lyx.org>
1028 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
1029 automatic [de]activation of arbitrary objects when in a read-only state.
1031 * src/frontends/ButtonPolicies.h: More documentation
1032 (isReadOnly): added to support the above.
1034 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
1036 2000-08-18 Juergen Vigna <jug@sad.it>
1038 * src/insets/insettabular.C (getStatus): changed to return func_status.
1040 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
1041 display toggle menu entries if they are.
1043 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
1044 new document layout now.
1046 * src/lyxfunc.C: ditto
1048 * src/lyx_gui_misc.C: ditto
1050 * src/lyx_gui.C: ditto
1052 * lib/ui/default.ui: removed paper and quotes layout as they are now
1053 all in the document layout tabbed folder.
1055 * src/frontends/xforms/forms/form_document.fd: added Restore
1056 button and callbacks for all inputs for Allan's ButtonPolicy.
1058 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
1059 (CheckChoiceClass): added missing params setting on class change.
1060 (UpdateLayoutDocument): added for updating the layout on params.
1061 (build): forgot to RETURN_ALWAYS input_doc_spacing.
1062 (FormDocument): Implemented Allan's ButtonPolicy with the
1065 2000-08-17 Allan Rae <rae@lyx.org>
1067 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1068 so we can at least see the credits again.
1070 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1071 controller calls for the appropriate callbacks. Note that since Ok
1072 calls apply followed by cancel, and apply isn't a valid input for the
1073 APPLIED state, the bc_ calls have to be made in the static callback not
1074 within each of the real callbacks.
1076 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1077 (setOk): renamed from setOkay()
1079 2000-08-17 Juergen Vigna <jug@sad.it>
1081 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1082 in the implementation part.
1083 (composeUIInfo): don't show optional menu-items.
1085 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1087 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1089 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1090 text-state when in a text-inset.
1092 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1094 2000-08-17 Marko Vendelin <markov@ioc.ee>
1095 * src/frontends/gnome/FormIndex.C
1096 * src/frontends/gnome/FormIndex.h
1097 * src/frontends/gnome/FormToc.C
1098 * src/frontends/gnome/FormToc.h
1099 * src/frontends/gnome/dialogs
1100 * src/frontends/gnome/diatoc_callbacks.c
1101 * src/frontends/gnome/diatoc_callbacks.h
1102 * src/frontends/gnome/diainsertindex_callbacks.h
1103 * src/frontends/gnome/diainsertindex_callbacks.c
1104 * src/frontends/gnome/diainsertindex_interface.c
1105 * src/frontends/gnome/diainsertindex_interface.h
1106 * src/frontends/gnome/diatoc_interface.h
1107 * src/frontends/gnome/diatoc_interface.c
1108 * src/frontends/gnome/Makefile.am: Table of Contents and
1109 Insert Index dialogs implementation for Gnome frontend
1111 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1113 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1115 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1118 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1120 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1121 destructor. Don't definde if you don't need it
1122 (processEvents): made static, non-blocking events processing for
1124 (runTime): static method. event loop for xforms
1125 * similar as above for kde and gnome.
1127 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1128 new Pimpl is correct
1129 (runTime): new method calss the real frontends runtime func.
1131 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1133 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1135 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1137 2000-08-16 Juergen Vigna <jug@sad.it>
1139 * src/lyx_gui.C (runTime): added GUII RunTime support.
1141 * src/frontends/Makefile.am:
1142 * src/frontends/GUIRunTime.[Ch]:
1143 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1144 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1145 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1147 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1149 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1150 as this is already set in ${FRONTEND_INCLUDE} if needed.
1152 * configure.in (CPPFLAGS): setting the include dir for the frontend
1153 directory and don't set FRONTEND=xforms for now as this is executed
1156 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1158 * src/frontends/kde/Makefile.am:
1159 * src/frontends/kde/FormUrl.C:
1160 * src/frontends/kde/FormUrl.h:
1161 * src/frontends/kde/formurldialog.h:
1162 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1164 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1166 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1168 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1170 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1173 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1175 * src/WorkArea.C (work_area_handler): more work to get te
1176 FL_KEYBOARD to work with xforms 0.88 too, please test.
1178 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1180 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1182 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1185 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1187 * src/Timeout.h: remove Qt::emit hack.
1189 * several files: changes to allo doc++ compilation
1191 * src/lyxfunc.C (processKeySym): new method
1192 (processKeyEvent): comment out if FL_REVISION < 89
1194 * src/WorkArea.C: change some debugging levels.
1195 (WorkArea): set wantkey to FL_KEY_ALL
1196 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1197 clearer code and the use of compose with XForms 0.89. Change to
1198 use signals instead of calling methods in bufferview directly.
1200 * src/Painter.C: change some debugging levels.
1202 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1205 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1206 (workAreaKeyPress): new method
1208 2000-08-14 Juergen Vigna <jug@sad.it>
1210 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1212 * config/kde.m4: addes some features
1214 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1215 include missing xforms dialogs.
1217 * src/Timeout.h: a hack to be able to compile with qt/kde.
1219 * sigc++/.cvsignore: added acinclude.m4
1221 * lib/.cvsignore: added listerros
1223 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1224 xforms tree as objects are needed for other frontends.
1226 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1227 linking with not yet implemented xforms objects.
1229 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1231 2000-08-14 Baruch Even <baruch.even@writeme.com>
1233 * src/frontends/xforms/FormGraphics.h:
1234 * src/frontends/xforms/FormGraphics.C:
1235 * src/frontends/xforms/RadioButtonGroup.h:
1236 * src/frontends/xforms/RadioButtonGroup.C:
1237 * src/insets/insetgraphics.h:
1238 * src/insets/insetgraphics.C:
1239 * src/insets/insetgraphicsParams.h:
1240 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1241 instead of spaces, and various other indentation issues to make the
1242 sources more consistent.
1244 2000-08-14 Marko Vendelin <markov@ioc.ee>
1246 * src/frontends/gnome/dialogs/diaprint.glade
1247 * src/frontends/gnome/FormPrint.C
1248 * src/frontends/gnome/FormPrint.h
1249 * src/frontends/gnome/diaprint_callbacks.c
1250 * src/frontends/gnome/diaprint_callbacks.h
1251 * src/frontends/gnome/diaprint_interface.c
1252 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1255 * src/frontends/gnome/dialogs/diainserturl.glade
1256 * src/frontends/gnome/FormUrl.C
1257 * src/frontends/gnome/FormUrl.h
1258 * src/frontends/gnome/diainserturl_callbacks.c
1259 * src/frontends/gnome/diainserturl_callbacks.h
1260 * src/frontends/gnome/diainserturl_interface.c
1261 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1262 Gnome implementation
1264 * src/frontends/gnome/Dialogs.C
1265 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1266 all other dialogs. Copy all unimplemented dialogs from Xforms
1269 * src/frontends/gnome/support.c
1270 * src/frontends/gnome/support.h: support files generated by Glade
1274 * config/gnome.m4: Gnome configuration scripts
1276 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1277 configure --help message
1279 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1280 only if there are no events pendling in Gnome/Gtk. This enhances
1281 the performance of menus.
1284 2000-08-14 Allan Rae <rae@lyx.org>
1286 * lib/Makefile.am: listerrors cleaning
1288 * lib/listerrors: removed -- generated file
1289 * acinclude.m4: ditto
1290 * sigc++/acinclude.m4: ditto
1292 * src/frontends/xforms/forms/form_citation.fd:
1293 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1296 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1297 `updatesrc` and now we have a `test` target that does what `updatesrc`
1298 used to do. I didn't like having an install target that wasn't related
1301 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1302 on all except FormGraphics. This may yet happen. Followed by a major
1303 cleanup including using FL_TRANSIENT for most of the dialogs. More
1304 changes to come when the ButtonController below is introduced.
1306 * src/frontends/xforms/ButtonController.h: New file for managing up to
1307 four buttons on a dialog according to an externally defined policy.
1308 * src/frontends/xforms/Makefile.am: added above
1310 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1311 Apply and Cancel/Close buttons and everything in between and beyond.
1312 * src/frontends/Makefile.am: added above.
1314 * src/frontends/xforms/forms/form_preferences.fd:
1315 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1316 and removed variable 'status' as a result. Fixed the set_minsize thing.
1317 Use the new screen-font-update after checking screen fonts were changed
1318 Added a "Restore" button to restore the original lyxrc values while
1319 editing. This restores everything not just the last input changed.
1320 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1322 * src/LyXAction.C: screen-font-update added for updating buffers after
1323 screen font settings have been changed.
1324 * src/commandtags.h: ditto
1325 * src/lyxfunc.C: ditto
1327 * forms/lyx.fd: removed screen fonts dialog.
1328 * src/lyx_gui.C: ditto
1329 * src/menus.[Ch]: ditto
1330 * src/lyx.[Ch]: ditto
1331 * src/lyx_cb.C: ditto + code from here moved to make
1332 screen-font-update. And people wonder why progress on GUII is
1333 slow. Look at how scattered this stuff was! It takes forever
1336 * forms/fdfix.sh: Fixup the spacing after commas.
1337 * forms/makefile: Remove date from generated files. Fewer clashes now.
1338 * forms/bullet_forms.C.patch: included someones handwritten changes
1340 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1341 once I've discovered why LyXRC was made noncopyable.
1342 * src/lyx_main.C: ditto
1344 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1346 * src/frontends/xforms/forms/fdfix.sh:
1347 * src/frontends/xforms/forms/fdfixh.sed:
1348 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1349 * src/frontends/xforms/Form*.[hC]:
1350 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1351 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1352 provide a destructor for the struct FD_form_xxxx. Another version of
1353 the set_[max|min]size workaround and a few other cleanups. Actually,
1354 Angus' patch from 20000809.
1356 2000-08-13 Baruch Even <baruch.even@writeme.com>
1358 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1361 2000-08-11 Juergen Vigna <jug@sad.it>
1363 * src/insets/insetgraphics.C (InsetGraphics): changing init
1364 order because of warnings.
1366 * src/frontends/xforms/forms/makefile: adding patching .C with
1369 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1370 from .C.patch to .c.patch
1372 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1373 order because of warning.
1375 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1377 * src/frontends/Liason.C (setMinibuffer): new helper function
1379 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1381 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1383 * lib/ui/default.ui: commented out PaperLayout entry
1385 * src/frontends/xforms/form_document.[Ch]: new added files
1387 * src/frontends/xforms/FormDocument.[Ch]: ditto
1389 * src/frontends/xforms/forms/form_document.fd: ditto
1391 * src/frontends/xforms/forms/form_document.C.patch: ditto
1393 2000-08-10 Juergen Vigna <jug@sad.it>
1395 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1396 (InsetGraphics): initialized cacheHandle to 0.
1397 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1399 2000-08-10 Baruch Even <baruch.even@writeme.com>
1401 * src/graphics/GraphicsCache.h:
1402 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1403 correctly as a cache.
1405 * src/graphics/GraphicsCacheItem.h:
1406 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1409 * src/graphics/GraphicsCacheItem_pimpl.h:
1410 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1413 * src/insets/insetgraphics.h:
1414 * src/insets/insetgraphics.C: Changed from using a signal notification
1415 to polling when image is not loaded.
1417 2000-08-10 Allan Rae <rae@lyx.org>
1419 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1420 that there are two functions that have to been taken out of line by
1421 hand and aren't taken care of in the script. (Just a reminder note)
1423 * sigc++/macros/*.h.m4: Updated as above.
1425 2000-08-09 Juergen Vigna <jug@sad.it>
1427 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1429 * src/insets/insettabular.C: make drawing of single cell smarter.
1431 2000-08-09 Marko Vendelin <markov@ioc.ee>
1432 * src/frontends/gnome/Menubar_pimpl.C
1433 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1434 implementation: new files
1436 * src/frontends/gnome/mainapp.C
1437 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1440 * src/main.C: create Gnome main window
1442 * src/frontends/xforms/Menubar_pimpl.h
1443 * src/frontends/Menubar.C
1444 * src/frontends/Menubar.h: added method Menubar::update that calls
1445 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1447 * src/LyXView.C: calls Menubar::update to update the state
1450 * src/frontends/gnome/Makefile.am: added new files
1452 * src/frontends/Makefile.am: added frontend compiler options
1454 2000-08-08 Juergen Vigna <jug@sad.it>
1456 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1458 * src/bufferlist.C (close):
1459 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1460 documents if exiting without saving.
1462 * src/buffer.C (save): use removeAutosaveFile()
1464 * src/support/filetools.C (removeAutosaveFile): new function.
1466 * src/lyx_cb.C (MenuWrite): returns a bool now.
1467 (MenuWriteAs): check if file could really be saved and revert to the
1469 (MenuWriteAs): removing old autosavefile if existant.
1471 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1472 before Goto toggle declaration, because of compiler warning.
1474 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1476 * src/lyxfunc.C (MenuNew): small fix.
1478 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1480 * src/bufferlist.C (newFile):
1481 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1483 * src/lyxrc.C: added new_ask_filename tag
1485 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1487 * src/lyx.fd: removed code pertaining to form_ref
1488 * src/lyx.[Ch]: ditto
1489 * src/lyx_cb.C: ditto
1490 * src/lyx_gui.C: ditto
1491 * src/lyx_gui_misc.C: ditto
1493 * src/BufferView_pimpl.C (restorePosition): update buffer only
1496 * src/commandtags.h (LFUN_REFTOGGLE): removed
1497 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1498 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1499 (LFUN_REFBACK): renamed LFUN_REF_BACK
1501 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1502 * src/menus.C: ditto
1503 * src/lyxfunc.C (Dispatch): ditto.
1504 InsertRef dialog is now GUI-independent.
1506 * src/texrow.C: added using std::endl;
1508 * src/insets/insetref.[Ch]: strip out large amounts of code.
1509 The inset is now a container and this functionality is now
1510 managed by a new FormRef dialog
1512 * src/frontends/Dialogs.h (showRef, createRef): new signals
1514 * src/frontends/xforms/FormIndex.[Ch],
1515 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1516 when setting dialog's min/max size
1517 * src/frontends/xforms/FormIndex.[Ch]: ditto
1519 * src/frontends/xforms/FormRef.[Ch],
1520 src/frontends/xforms/forms/form_ref.fd: new xforms
1521 implementation of an InsetRef dialog
1523 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1526 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1527 ios::nocreate is not part of the standard. Removed.
1529 2000-08-07 Baruch Even <baruch.even@writeme.com>
1531 * src/graphics/Renderer.h:
1532 * src/graphics/Renderer.C: Added base class for rendering of different
1533 image formats into Pixmaps.
1535 * src/graphics/XPM_Renderer.h:
1536 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1537 in a different class.
1539 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1540 easily add support for other formats.
1542 * src/insets/figinset.C: plugged a leak of an X resource.
1544 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1546 * src/CutAndPaste.[Ch]: make all metods static.
1548 * development/Code_rules/Rules: more work, added section on
1549 Exceptions, and a References section.
1551 * a lot of header files: work to make doc++ able to generate the
1552 source documentation, some workarounds of doc++ problems. Doc++ is
1553 now able to generate the documentation.
1555 2000-08-07 Juergen Vigna <jug@sad.it>
1557 * src/insets/insettabular.C (recomputeTextInsets): removed function
1559 * src/tabular.C (SetWidthOfMulticolCell):
1561 (calculate_width_of_column_NMC): fixed return value so that it really
1562 only returns true if the column-width has changed (there where
1563 problems with muliticolumn-cells in this column).
1565 2000-08-04 Juergen Vigna <jug@sad.it>
1567 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1568 also on the scrollstatus of the inset.
1569 (workAreaMotionNotify): ditto.
1571 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1573 2000-08-01 Juergen Vigna <jug@sad.it>
1575 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1577 * src/commandtags.h:
1578 * src/LyXAction.C (init):
1579 * src/insets/inset.C (LocalDispatch): added support for
1582 * src/insets/inset.C (scroll): new functions.
1584 * src/insets/insettext.C (removeNewlines): new function.
1585 (SetAutoBreakRows): removes forced newlines in the text of the
1586 paragraph if autoBreakRows is set to false.
1588 * src/tabular.C (Latex): generates a parbox around the cell contents
1591 * src/frontends/xforms/FormTabular.C (local_update): removed
1592 the radio_useparbox button.
1594 * src/tabular.C (UseParbox): new function
1596 2000-08-06 Baruch Even <baruch.even@writeme.com>
1598 * src/graphics/GraphicsCache.h:
1599 * src/graphics/GraphicsCache.C:
1600 * src/graphics/GraphicsCacheItem.h:
1601 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1604 * src/insets/insetgraphics.h:
1605 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1606 drawing of the inline image.
1608 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1609 into the wrong position.
1611 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1614 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1616 * src/support/translator.h: move all typedefs to public section
1618 * src/support/filetools.C (MakeLatexName): return string const
1620 (TmpFileName): ditto
1621 (FileOpenSearch): ditto
1623 (LibFileSearch): ditto
1624 (i18nLibFileSearch): ditto
1627 (CreateTmpDir): ditto
1628 (CreateBufferTmpDir): ditto
1629 (CreateLyXTmpDir): ditto
1632 (MakeAbsPath): ditto
1634 (OnlyFilename): ditto
1636 (NormalizePath): ditto
1637 (CleanupPath): ditto
1638 (GetFileContents): ditto
1639 (ReplaceEnvironmentPath): ditto
1640 (MakeRelPath): ditto
1642 (ChangeExtension): ditto
1643 (MakeDisplayPath): ditto
1644 (do_popen): return cmdret const
1645 (findtexfile): return string const
1647 * src/support/DebugStream.h: add some /// to please doc++
1649 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1651 * src/texrow.C (same_rownumber): functor to use with find_if
1652 (getIdFromRow): rewritten to use find_if and to not update the
1653 positions. return true if row is found
1654 (increasePos): new method, use to update positions
1656 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1658 * src/lyxlex_pimpl.C (verifyTable): new method
1661 (GetString): return string const
1662 (pushTable): rewrite to use std::stack
1664 (setFile): better check
1667 * src/lyxlex.h: make LyXLex noncopyable
1669 * src/lyxlex.C (text): return char const * const
1670 (GetString): return string const
1671 (getLongString): return string const
1673 * src/lyx_gui_misc.C (askForText): return pair<...> const
1675 * src/lastfiles.[Ch] (operator): return string const
1677 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1678 istringstream not char const *.
1679 move token.end() out of loop.
1680 (readFile): move initializaton of token
1682 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1683 getIdFromRow is successful.
1685 * lib/bind/emacs.bind: don't include menus bind
1687 * development/Code_rules/Rules: the beginnings of making this
1688 better and covering more of the unwritten rules that we have.
1690 * development/Code_rules/Recommendations: a couple of wording
1693 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1695 * src/support/strerror.c: remove C++ comment.
1697 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1699 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1700 LFUN_INDEX_INSERT_LAST
1702 * src/texrow.C (getIdFromRow): changed from const_iterator to
1703 iterator, allowing code to compile with DEC cxx
1705 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1706 stores part of the class, as suggested by Allan. Will allow
1708 (apply): test to apply uses InsetCommandParams operator!=
1710 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1711 (apply): test to apply uses InsetCommandParams operator!=
1713 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1714 stores part of the class.
1715 (update): removed limits on min/max size.
1717 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1718 (apply): test to apply uses InsetCommandParams operator!=
1720 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1721 (Read, Write, scanCommand, getCommand): moved functionality
1722 into InsetCommandParams.
1724 (getScreenLabel): made pure virtual
1725 new InsetCommandParams operators== and !=
1727 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1728 c-tors based on InsetCommandParams. Removed others.
1729 * src/insets/insetinclude.[Ch]: ditto
1730 * src/insets/insetlabel.[Ch]: ditto
1731 * src/insets/insetparent.[Ch]: ditto
1732 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1734 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1735 insets derived from InsetCommand created using similar c-tors
1736 based on InsetCommandParams
1737 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1738 * src/menus.C (ShowRefsMenu): ditto
1739 * src/paragraph.C (Clone): ditto
1740 * src/text2.C (SetCounter): ditto
1741 * src/lyxfunc.C (Dispatch) ditto
1742 Also recreated old InsetIndex behaviour exactly. Can now
1743 index-insert at the start of a paragraph and index-insert-last
1744 without launching the pop-up.
1746 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1748 * lib/lyxrc.example: mark te pdf options as non functional.
1750 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1751 (isStrDbl): move tmpstr.end() out of loop.
1752 (strToDbl): move intialization of tmpstr
1753 (lowercase): return string const and move tmp.end() out of loop.
1754 (uppercase): return string const and move tmp.edn() out of loop.
1755 (prefixIs): add assertion
1760 (containsOnly): ditto
1761 (containsOnly): ditto
1762 (containsOnly): ditto
1763 (countChar): make last arg char not char const
1764 (token): return string const
1765 (subst): return string const, move tmp.end() out of loop.
1766 (subst): return string const, add assertion
1767 (strip): return string const
1768 (frontStrip): return string const, add assertion
1769 (frontStrip): return string const
1774 * src/support/lstrings.C: add inclde "LAssert.h"
1775 (isStrInt): move tmpstr.end() out of loop.
1777 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1778 toollist.end() out of loop.
1779 (deactivate): move toollist.end() out of loop.
1780 (update): move toollist.end() out of loop.
1781 (updateLayoutList): move tc.end() out of loop.
1782 (add): move toollist.end() out of loop.
1784 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1785 md.end() out of loop.
1787 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1789 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1792 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1793 (Erase): move insetlist.end() out of loop.
1795 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1796 ref to const string as first arg. Move initialization of some
1797 variables, whitespace changes.
1799 * src/kbmap.C (defkey): move table.end() out of loop.
1800 (kb_keymap): move table.end() out of loop.
1801 (findbinding): move table.end() out of loop.
1803 * src/MenuBackend.C (hasMenu): move end() out of loop.
1804 (getMenu): move end() out of loop.
1805 (getMenu): move menulist_.end() out of loop.
1807 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1809 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1812 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1813 (getFromLyXName): move infotab.end() out of loop.
1815 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1816 -fvtable-thunks -ffunction-sections -fdata-sections
1818 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1820 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1823 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1825 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1827 * src/frontends/xforms/FormCitation.[Ch],
1828 src/frontends/xforms/FormIndex.[Ch],
1829 src/frontends/xforms/FormToc.[Ch],
1830 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1832 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1834 * src/commandtags.h: renamed, created some flags for citation
1837 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1839 * src/lyxfunc.C (dispatch): use signals to insert index entry
1841 * src/frontends/Dialogs.h: new signal createIndex
1843 * src/frontends/xforms/FormCommand.[Ch],
1844 src/frontends/xforms/FormCitation.[Ch],
1845 src/frontends/xforms/FormToc.[Ch],
1846 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1848 * src/insets/insetindex.[Ch]: GUI-independent
1850 * src/frontends/xforms/FormIndex.[Ch],
1851 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1854 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1856 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1857 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1859 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1861 * src/insets/insetref.C (Latex): rewrite so that there is now
1862 question that a initialization is requested.
1864 * src/insets/insetcommand.h: reenable the hide signal
1866 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1868 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1869 fix handling of shortcuts (many bugs :)
1870 (add_lastfiles): ditto.
1872 * lib/ui/default.ui: fix a few shortcuts.
1874 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1876 * Makefile.am: Fix ``rpmdist'' target to return the exit
1877 status of the ``rpm'' command, instead of the last command in
1878 the chain (the ``rm lyx.xpm'' command, which always returns
1881 2000-08-02 Allan Rae <rae@lyx.org>
1883 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1884 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1885 * src/frontends/xforms/FormToc.C (FormToc): ditto
1887 * src/frontends/xforms/Makefile.am: A few forgotten files
1889 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1890 Signals-not-copyable-problem Lars' started commenting out.
1892 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1894 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1896 * src/insets/insetcommand.h: Signals is not copyable so anoter
1897 scheme for automatic hiding of forms must be used.
1899 * src/frontends/xforms/FormCitation.h: don't inerit from
1900 noncopyable, FormCommand already does that.
1901 * src/frontends/xforms/FormToc.h: ditto
1902 * src/frontends/xforms/FormUrl.h: ditto
1904 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1906 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1908 * src/insets/insetcommand.h (hide): new SigC::Signal0
1909 (d-tor) new virtual destructor emits hide signal
1911 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1912 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1914 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1915 LOF and LOT. Inset is now GUI-independent
1917 * src/insets/insetloa.[Ch]: redundant
1918 * src/insets/insetlof.[Ch]: ditto
1919 * src/insets/insetlot.[Ch]: ditto
1921 * src/frontends/xforms/forms/form_url.fd: tweaked!
1922 * src/frontends/xforms/forms/form_citation.fd: ditto
1924 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1925 dialogs dealing with InsetCommand insets
1927 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1928 FormCommand base class
1929 * src/frontends/xforms/FormUrl.[Ch]: ditto
1931 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1933 * src/frontends/xforms/FormToc.[Ch]: ditto
1935 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1936 passed a generic InsetCommand pointer
1937 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1939 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1940 and modified InsetTOC class
1941 * src/buffer.C: ditto
1943 * forms/lyx.fd: strip out old FD_form_toc code
1944 * src/lyx_gui_misc.C: ditto
1945 * src/lyx_gui.C: ditto
1946 * src/lyx_cb.C: ditto
1947 * src/lyx.[Ch]: ditto
1949 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1951 * src/support/utility.hpp: tr -d '\r'
1953 2000-08-01 Juergen Vigna <jug@sad.it>
1955 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1957 * src/commandtags.h:
1958 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1959 LFUN_TABULAR_FEATURES.
1961 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1962 LFUN_LAYOUT_TABULAR.
1964 * src/insets/insettabular.C (getStatus): implemented helper function.
1966 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1968 2000-07-31 Juergen Vigna <jug@sad.it>
1970 * src/text.C (draw): fixed screen update problem for text-insets.
1972 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1973 something changed probably this has to be added in various other
1976 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1978 2000-07-31 Baruch Even <baruch.even@writeme.com>
1980 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1981 templates to satisfy compaq cxx.
1984 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1986 * src/support/translator.h (equal_1st_in_pair::operator()): take
1987 const ref pair_type as arg.
1988 (equal_2nd_in_pair::operator()): ditto
1989 (Translator::~Translator): remove empty d-tor.
1991 * src/graphics/GraphicsCache.C: move include config.h to top, also
1992 put initialization of GraphicsCache::singleton here.
1993 (~GraphicsCache): move here
1994 (addFile): take const ref as arg
1997 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1999 * src/BufferView2.C (insertLyXFile): change te with/without header
2002 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2004 * src/frontends/xforms/FormGraphics.C (apply): add some
2005 static_cast. Not very nice, but required by compaq cxx.
2007 * src/frontends/xforms/RadioButtonGroup.h: include header
2008 <utility> instead of <pair.h>
2010 * src/insets/insetgraphicsParams.C: add using directive.
2011 (readResize): change return type to void.
2012 (readOrigin): ditto.
2014 * src/lyxfunc.C (getStatus): add missing break for build-program
2015 function; add test for Literate for export functions.
2017 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
2018 entries in Options menu.
2020 2000-07-31 Baruch Even <baruch.even@writeme.com>
2022 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
2023 protect against auto-allocation; release icon when needed.
2025 2000-07-31 Matej Cepl <CeplM@seznam.cz>
2027 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
2028 on usual typewriter.
2030 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
2031 earlier czech.kmap), useful only for programming.
2033 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2035 * src/frontends/xforms/FormCitation.h: fix conditioning around
2038 2000-07-31 Juergen Vigna <jug@sad.it>
2040 * src/frontends/xforms/FormTabular.C (local_update): changed
2041 radio_linebreaks to radio_useparbox and added radio_useminipage.
2043 * src/tabular.C: made support for using minipages/parboxes.
2045 * src/bufferlist.C (QwriteAll): small fix for asking for save.
2047 * src/insets/insetgraphics.C (draw): just draw the inset so that the
2049 (descent): so the cursor is in the middle.
2050 (width): bit smaller box.
2052 * src/insets/insetgraphics.h: added display() function.
2054 2000-07-31 Baruch Even <baruch.even@writeme.com>
2056 * src/frontends/Dialogs.h: Added showGraphics signals.
2058 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
2059 xforms form definition of the graphics dialog.
2061 * src/frontends/xforms/FormGraphics.h:
2062 * src/frontends/xforms/FormGraphics.C: Added files, the
2063 GUIndependent code of InsetGraphics
2065 * src/insets/insetgraphics.h:
2066 * src/insets/insetgraphics.C: Major writing to make it work.
2068 * src/insets/insetgraphicsParams.h:
2069 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2070 struct between InsetGraphics and GUI.
2072 * src/LaTeXFeatures.h:
2073 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2074 support for graphicx package.
2076 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2077 for the graphics inset.
2079 * src/support/translator.h: Added file, used in
2080 InsetGraphicsParams. this is a template to translate between two
2083 * src/frontends/xforms/RadioButtonGroup.h:
2084 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2085 way to easily control a radio button group.
2087 2000-07-28 Juergen Vigna <jug@sad.it>
2089 * src/insets/insettabular.C (LocalDispatch):
2090 (TabularFeatures): added support for lyx-functions of tabular features.
2091 (cellstart): refixed this function after someone wrongly changed it.
2093 * src/commandtags.h:
2094 * src/LyXAction.C (init): added support for tabular-features
2096 2000-07-28 Allan Rae <rae@lyx.org>
2098 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2099 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2100 triggers the callback for input checking. As a result we sometimes get
2101 "LyX: This shouldn't happen..." printed to cerr.
2102 (input): Started using status variable since I only free() on
2103 destruction. Some input checking for paths and font sizes.
2105 * src/frontends/xforms/FormPreferences.h: Use status to control
2106 activation of Ok and Apply
2108 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2109 callback. Also resized to stop segfaults with 0.88. The problem is
2110 that xforms-0.88 requires the folder to be wide enough to fit all the
2111 tabs. If it isn't it causes all sorts of problems.
2113 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2115 * src/frontends/xforms/forms/README: Reflect reality.
2117 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2118 * src/frontends/xforms/forms/makefile: ditto.
2120 * src/commandtags.h: Get access to new Preferences dialog
2121 * src/LyXAction.C: ditto
2122 * src/lyxfunc.C: ditto
2123 * lib/ui/default.ui: ditto
2125 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2127 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2129 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2132 * src/frontends/xforms/form_url.[Ch]: added.
2134 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2136 * src/insets/insetbib.h: fixed bug in previous commit
2138 * src/frontends/xforms/FormUrl.h: ditto
2140 * src/frontends/xforms/FormPrint.h: ditto
2142 * src/frontends/xforms/FormPreferences.h: ditto
2144 * src/frontends/xforms/FormCopyright.h: ditto
2146 * src/frontends/xforms/FormCitation.C: ditto
2148 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2149 private copyconstructor and private default contructor
2151 * src/support/Makefile.am: add utility.hpp
2153 * src/support/utility.hpp: new file from boost
2155 * src/insets/insetbib.h: set owner in clone
2157 * src/frontends/xforms/FormCitation.C: added missing include
2160 * src/insets/form_url.[Ch]: removed
2162 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2164 * development/lyx.spec.in
2165 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2166 file/directory re-organization.
2168 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2170 * src/insets/insetcommand.[Ch]: moved the string data and
2171 associated manipulation methods into a new stand-alone class
2172 InsetCommandParams. This class has two additional methods
2173 getAsString() and setFromString() allowing the contents to be
2174 moved around as a single string.
2175 (addContents) method removed.
2176 (setContents) method no longer virtual.
2178 * src/buffer.C (readInset): made use of new InsetCitation,
2179 InsetUrl constructors based on InsetCommandParams.
2181 * src/commandtags.h: add LFUN_INSERT_URL
2183 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2184 independent InsetUrl and use InsetCommandParams to extract
2185 string info and create new Insets.
2187 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2189 * src/frontends/xforms/FormCitation.C (apply): uses
2192 * src/frontends/xforms/form_url.C
2193 * src/frontends/xforms/form_url.h
2194 * src/frontends/xforms/FormUrl.h
2195 * src/frontends/xforms/FormUrl.C
2196 * src/frontends/xforms/forms/form_url.fd: new files
2198 * src/insets/insetcite.[Ch]: removed unused constructors.
2200 * src/insets/insetinclude.[Ch]: no longer store filename
2202 * src/insets/inseturl.[Ch]: GUI-independent.
2204 2000-07-26 Juergen Vigna <jug@sad.it>
2205 * renamed frontend from gtk to gnome as it is that what is realized
2206 and did the necessary changes in the files.
2208 2000-07-26 Marko Vendelin <markov@ioc.ee>
2210 * configure.in: cleaning up gnome configuration scripts
2212 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2214 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2215 shortcuts syndrom by redrawing them explicitely (a better solution
2216 would be appreciated).
2218 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2220 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2223 * src/lyx_cb.C (MenuExport): change html export to do the right
2224 thing depending of the document type (instead of having
2225 html-linuxdoc and html-docbook).
2226 * src/lyxfunc.C (getStatus): update for html
2227 * lib/ui/default.ui: simplify due to the above change.
2228 * src/menus.C (ShowFileMenu): update too (in case we need it).
2230 * src/MenuBackend.C (read): if a menu is defined twice, add the
2231 new entries to the exiting one.
2233 2000-07-26 Juergen Vigna <jug@sad.it>
2235 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2237 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2238 and return a bool if it did actual save the file.
2239 (AutoSave): don't autosave a unnamed doc.
2241 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2242 check if this is an UNNAMED new file and react to it.
2243 (newFile): set buffer to unnamed and change to not mark a new
2244 buffer dirty if I didn't do anything with it.
2246 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2248 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2250 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2251 friend as per Angus's patch posted to lyx-devel.
2253 * src/ext_l10n.h: updated
2255 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2256 gettext on the style string right before inserting them into the
2259 * autogen.sh: add code to extract style strings form layout files,
2260 not good enough yet.
2262 * src/frontends/gtk/.cvsignore: add MAKEFILE
2264 * src/MenuBackend.C (read): run the label strings through gettext
2265 before storing them in the containers.
2267 * src/ext_l10n.h: new file
2269 * autogen.sh : generate the ext_l10n.h file here
2271 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2273 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2276 * lib/ui/default.ui: fix a couple of typos.
2278 * config/gnome/gtk.m4: added (and added to the list of files in
2281 * src/insets/insetinclude.C (unique_id): fix when we are using
2282 lyxstring instead of basic_string<>.
2283 * src/insets/insettext.C (LocalDispatch): ditto.
2284 * src/support/filetools.C: ditto.
2286 * lib/configure.m4: create the ui/ directory if necessary.
2288 * src/LyXView.[Ch] (updateToolbar): new method.
2290 * src/BufferView_pimpl.C (buffer): update the toolbar when
2291 opening/closing buffer.
2293 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2295 * src/LyXAction.C (getActionName): enhance to return also the name
2296 and options of pseudo-actions.
2297 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2299 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2300 as an example of what is possible). Used in File->Build too (more
2301 useful) and in the import/export menus (to mimick the complicated
2302 handling of linuxdoc and friends). Try to update all the entries.
2304 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2307 * src/MenuBackend.C (read): Parse the new OptItem tag.
2309 * src/MenuBackend.h: Add a new optional_ data member (used if the
2310 entry should be omitted when the lyxfunc is disabled).
2312 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2313 function, used as a shortcut.
2314 (create_submenu): align correctly the shortcuts on the widest
2317 * src/MenuBackend.h: MenuItem.label() only returns the label of
2318 the menu without shortcut; new method shortcut().
2320 2000-07-14 Marko Vendelin <markov@ioc.ee>
2322 * src/frontends/gtk/Dialogs.C:
2323 * src/frontends/gtk/FormCopyright.C:
2324 * src/frontends/gtk/FormCopyright.h:
2325 * src/frontends/gtk/Makefile.am: added these source-files for the
2326 Gtk/Gnome support of the Copyright-Dialog.
2328 * src/main.C: added Gnome::Main initialization if using
2329 Gtk/Gnome frontend-GUI.
2331 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2333 * config/gnome/aclocal-include.m4
2334 * config/gnome/compiler-flags.m4
2335 * config/gnome/curses.m4
2336 * config/gnome/gnome--.m4
2337 * config/gnome/gnome-bonobo-check.m4
2338 * config/gnome/gnome-common.m4
2339 * config/gnome/gnome-fileutils.m4
2340 * config/gnome/gnome-ghttp-check.m4
2341 * config/gnome/gnome-gnorba-check.m4
2342 * config/gnome/gnome-guile-checks.m4
2343 * config/gnome/gnome-libgtop-check.m4
2344 * config/gnome/gnome-objc-checks.m4
2345 * config/gnome/gnome-orbit-check.m4
2346 * config/gnome/gnome-print-check.m4
2347 * config/gnome/gnome-pthread-check.m4
2348 * config/gnome/gnome-support.m4
2349 * config/gnome/gnome-undelfs.m4
2350 * config/gnome/gnome-vfs.m4
2351 * config/gnome/gnome-x-checks.m4
2352 * config/gnome/gnome-xml-check.m4
2353 * config/gnome/gnome.m4
2354 * config/gnome/gperf-check.m4
2355 * config/gnome/gtk--.m4
2356 * config/gnome/linger.m4
2357 * config/gnome/need-declaration.m4: added configuration scripts
2358 for Gtk/Gnome frontend-GUI
2360 * configure.in: added support for the --with-frontend=gtk option
2362 * autogen.sh: added config/gnome/* to list of config-files
2364 * acconfig.h: added define for GTKGUI-support
2366 * config/lyxinclude.m4: added --with-frontend[=value] option value
2367 for Gtk/Gnome frontend-GUI support.
2369 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2371 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2375 * src/paragraph.C (GetChar): remove non-const version
2377 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2378 (search_kw): use it.
2380 * src/lyx_main.C (init): if "preferences" exist, read that instead
2382 (ReadRcFile): return bool if the file could be read ok.
2383 (ReadUIFile): add a check to see if lex file is set ok.
2385 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2386 bastring can be used instead of lyxstring (still uses the old code
2387 if std::string is good enough or if lyxstring is used.)
2389 * src/encoding.C: make the arrays static, move ininle functions
2391 * src/encoding.h: from here.
2393 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2394 (parseSingleLyXformat2Token): move inset parsing to separate method
2395 (readInset): new private method
2397 * src/Variables.h: remove virtual from get().
2399 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2400 access to NEW_INSETS and NEW_TABULAR
2402 * src/MenuBackend.h: remove superfluous forward declaration of
2403 MenuItem. Add documentations tags "///", remove empty MenuItem
2404 destructor, remove private default contructor.
2406 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2408 (read): more string mlabel and mname to where they are used
2409 (read): remove unused variables mlabel and mname
2410 (defaults): unconditional clear, make menusetup take advantage of
2411 add returning Menu &.
2413 * src/LyXView.h: define NEW_MENUBAR as default
2415 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2416 to NEW_INSETS and NEW_TABULAR.
2417 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2418 defined. Change some of the "xxxx-inset-insert" functions names to
2421 * several files: more enahncements to NEW_INSETS and the resulting
2424 * lib/lyxrc.example (\date_insert_format): move to misc section
2426 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2427 bastring and use AC_CACHE_CHECK.
2428 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2429 the system have the newest methods. uses AC_CACHE_CHECK
2430 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2431 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2432 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2434 * configure.in: add LYX_CXX_GOOD_STD_STRING
2436 * acinclude.m4: recreated
2438 2000-07-24 Amir Karger
2440 * README: add Hebrew, Arabic kmaps
2443 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2445 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2448 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2450 * Lot of files: add pragma interface/implementation.
2452 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2454 * lib/ui/default.ui: new file (ans new directory). Contains the
2455 default menu and toolbar.
2457 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2458 global space. Toolbars are now read (as menus) in ui files.
2460 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2462 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2463 is disabled because the document is read-only. We want to have the
2464 toggle state of the function anyway.
2465 (getStatus): add code for LFUN_VC* functions (mimicking what is
2466 done in old-style menus)
2468 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2469 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2471 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2472 * src/BufferView_pimpl.C: ditto.
2473 * src/lyxfunc.C: ditto.
2475 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2476 default). This replaces old-style menus by new ones.
2478 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2479 MenuItem. Contain the data structure of a menu.
2481 * src/insets/insettext.C: use LyXView::setLayout instead of
2482 accessing directly the toolbar combox.
2483 * src/lyxfunc.C (Dispatch): ditto.
2485 * src/LyXView.C (setLayout): new method, which just calls
2486 Toolbar::setLayout().
2487 (updateLayoutChoice): move part of this method in Toolbar.
2489 * src/toolbar.[Ch]: removed.
2491 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2492 implementation the toolbar.
2494 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2495 the toolbar. It might make sense to merge it with ToolbarDefaults
2497 (setLayout): new function.
2498 (updateLayoutList): ditto.
2499 (openLayoutList): ditto.
2501 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2502 xforms implementation of the toolbar.
2503 (get_toolbar_func): comment out, since I do not
2504 know what it is good for.
2506 * src/ToolbarDefaults.h: Add the ItemType enum.
2508 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2509 for a list of allocated C strings. Used in Menubar xforms
2510 implementation to avoid memory leaks.
2512 * src/support/lstrings.[Ch] (uppercase): new version taking and
2516 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2517 * lib/bind/emacs.bind: ditto.
2519 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2521 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2522 forward decl of LyXView.
2524 * src/toolbar.C (toolbarItem): moved from toolbar.h
2525 (toolbarItem::clean): ditto
2526 (toolbarItem::~toolbarItem): ditto
2527 (toolbarItem::operator): ditto
2529 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2531 * src/paragraph.h: control the NEW_TABULAR define from here
2533 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2534 USE_TABULAR_INSETS to NEW_TABULAR
2536 * src/ToolbarDefaults.C: add include "lyxlex.h"
2538 * files using the old table/tabular: use NEW_TABULAR to control
2539 compilation of old tabular stuff.
2541 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2544 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2545 planemet in reading of old style floats, fix the \end_deeper
2546 problem when reading old style floats.
2548 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2550 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2552 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2554 * lib/bind/sciword.bind: updated.
2556 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2558 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2559 layout write problem
2561 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2563 * src/Makefile.am (INCLUDES): remove image directory from include
2566 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2567 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2569 * src/LyXView.C (create_form_form_main): read the application icon
2572 * lib/images/*.xpm: change the icons to use transparent color for
2575 * src/toolbar.C (update): change the color of the button when it
2578 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2580 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2581 setting explicitely the minibuffer.
2582 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2584 * src/LyXView.C (showState): new function. Shows font information
2585 in minibuffer and update toolbar state.
2586 (LyXView): call Toolbar::update after creating the
2589 * src/toolbar.C: change toollist to be a vector instead of a
2591 (BubbleTimerCB): get help string directly from the callback
2592 argument of the corresponding icon (which is the action)
2593 (set): remove unnecessary ugliness.
2594 (update): new function. update the icons (depressed, disabled)
2595 depending of the status of the corresponding action.
2597 * src/toolbar.h: remove help in toolbarItem
2599 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2601 * src/Painter.C (text): Added code for using symbol glyphs from
2602 iso10646 fonts. Currently diabled.
2604 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2607 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2608 magyar,turkish and usorbian.
2610 * src/paragraph.C (isMultiLingual): Made more efficient.
2612 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2615 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2616 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2617 Also changed the prototype to "bool math_insert_greek(char)".
2619 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2621 * lots of files: apply the NEW_INSETS on all code that will not be
2622 needed when we move to use the new insets. Enable the define in
2623 lyxparagrah.h to try it.
2625 * src/insets/insettabular.C (cellstart): change to be a static
2627 (InsetTabular): initialize buffer in the initializer list.
2629 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2631 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2632 form_print.h out of the header file. Replaced with forward
2633 declarations of the relevant struct.
2635 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2638 * src/commandtags.h: do not include "debug.h" which does not
2639 belong there. #include it in some other places because of this
2642 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2644 * src/insets/insetcaption.C: add a couple "using" directives.
2646 * src/toolbar.C (add): get the help text directly from lyxaction.
2648 (setPixmap): new function. Loads from disk and sets a pixmap on a
2649 botton; the name of the pixmap file is derived from the command
2652 * src/toolbar.h: remove members isBitmap and pixmap from
2655 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2656 * lib/images/: move many files from images/banner.xpm.
2658 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2660 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2661 * src/toolbar.C: ditto.
2662 * configure.in: ditto.
2663 * INSTALL: document.
2665 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2666 the spellchecker popup is closed from the WM.
2668 2000-07-19 Juergen Vigna <jug@sad.it>
2670 * src/insets/insetfloat.C (Write): small fix because we use the
2671 insetname for the type now!
2673 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2675 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2678 * src/frontends/Dialogs.h: removed hideCitation signal
2680 * src/insets/insetcite.h: added hide signal
2682 * src/insets/insetcite.C (~InsetCitation): emits new signal
2683 (getScreenLabel): "intelligent" label should now fit on the screen!
2685 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2687 * src/frontends/xforms/FormCitation.C (showInset): connects
2688 hide() to the inset's hide signal
2689 (show): modified to use fl_set_object_position rather than
2690 fl_set_object_geometry wherever possible
2692 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2694 * src/insets/lyxinset.h: add caption code
2696 * src/insets/insetfloat.C (type): new method
2698 * src/insets/insetcaption.C (Write): new method
2700 (LyxCode): new method
2702 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2703 to get it right together with using the FloatList.
2705 * src/commandtags.h: add LFUN_INSET_CAPTION
2706 * src/lyxfunc.C (Dispatch): handle it
2708 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2711 * src/Variables.[Ch]: make expand take a const reference, remove
2712 the destructor, some whitespace changes.
2714 * src/LyXAction.C (init): add caption-inset-insert
2716 * src/FloatList.C (FloatList): update the default floats a bit.
2718 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2720 * src/Variables.[Ch]: new files. Intended to be used for language
2721 specific strings (like \chaptername) and filename substitution in
2724 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2726 * lib/kbd/american.kmap: update
2728 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2730 * src/bufferparams.[Ch]: remove member allowAccents.
2732 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2734 * src/LaTeXLog.C: use the log_form.h header.
2735 * src/lyx_gui.C: ditto.
2736 * src/lyx_gui_misc.C: ditto.
2737 * src/lyxvc.h: ditto.
2739 * forms/log_form.fd: new file, created from latexoptions.fd. I
2740 kept the log popup and nuked the options form.
2742 * src/{la,}texoptions.[Ch]: removed.
2743 * src/lyx_cb.C (LaTeXOptions): ditto
2745 * src/lyx_gui.C (create_forms): do not handle the
2746 fd_latex_options form.
2748 2000-07-18 Juergen Vigna <jug@sad.it>
2750 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2751 name of the inset so that it can be requested outside (text2.C).
2753 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2756 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2758 * src/mathed/formula.h (ConvertFont): constify
2760 * src/mathed/formula.C (Read): add warning if \end_inset is not
2761 found on expected place.
2763 * src/insets/lyxinset.h (ConvertFont): consify
2765 * src/insets/insetquotes.C (ConvertFont): constify
2766 * src/insets/insetquotes.h: ditto
2768 * src/insets/insetinfo.h: add labelfont
2770 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2771 (ascent): use labelfont
2775 (Write): make .lyx file a bit nicer
2777 * src/insets/insetfloat.C (Write): simplify somewhat...
2778 (Read): add warning if arg is not found
2780 * src/insets/insetcollapsable.C: add using std::max
2781 (Read): move string token and add warning in arg is not found
2782 (draw): use std::max to get the right ty
2783 (getMaxWidth): simplify by using std::max
2785 * src/insets/insetsection.h: new file
2786 * src/insets/insetsection.C: new file
2787 * src/insets/insetcaption.h: new file
2788 * src/insets/insetcaption.C: new file
2790 * src/insets/inset.C (ConvertFont): constify signature
2792 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2793 insetcaption.[Ch] and insetsection.[Ch]
2795 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2796 uses to use LABEL_COUNTER_CHAPTER instead.
2797 * src/text2.C (SetCounter): here
2799 * src/counters.h: new file
2800 * src/counters.C: new file
2801 * src/Sectioning.h: new file
2802 * src/Sectioning.C: new file
2804 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2806 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2808 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2811 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2814 2000-07-17 Juergen Vigna <jug@sad.it>
2816 * src/tabular.C (Validate): check if array-package is needed.
2817 (SetVAlignment): added support for vertical alignment.
2818 (SetLTFoot): better support for longtable header/footers
2819 (Latex): modified to support added features.
2821 * src/LaTeXFeatures.[Ch]: added array-package.
2823 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2825 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2828 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2830 * configure.in: do not forget to put a space after -isystem.
2832 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2834 * lib/kbd/arabic.kmap: a few fixes.
2836 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2838 * some whitespace chagnes to a number of files.
2840 * src/support/DebugStream.h: change to make it easier for
2841 doc++ to parse correctly.
2842 * src/support/lyxstring.h: ditto
2844 * src/mathed/math_utils.C (compara): change to have only one
2846 (MathedLookupBOP): change because of the above.
2848 * src/mathed/math_delim.C (math_deco_compare): change to have only
2850 (search_deco): change becasue of the above.
2852 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2853 instead of manually coded one.
2855 * src/insets/insetquotes.C (Read): read the \end_inset too
2857 * src/insets/insetlatex.h: remove file
2858 * src/insets/insetlatex.C: remove file
2860 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2862 (InsetPrintIndex): remove destructor
2864 * src/insets/insetinclude.h: remove default constructor
2866 * src/insets/insetfloat.C: work to make it work better
2868 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2870 * src/insets/insetcite.h (InsetCitation): remove default constructor
2872 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2874 * src/text.C (GetColumnNearX): comment out some currently unused code.
2876 * src/paragraph.C (writeFile): move some initializations closer to
2878 (CutIntoMinibuffer): small change to use new matchIT operator
2882 (InsertInset): ditto
2885 (InsetIterator): ditto
2886 (Erase): small change to use new matchFT operator
2888 (GetFontSettings): ditto
2889 (HighestFontInRange): ditto
2892 * src/lyxparagraph.h: some chars changed to value_type
2893 (matchIT): because of some stronger checking (perhaps too strong)
2894 in SGI STL, the two operator() unified to one.
2897 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2899 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2900 the last inset read added
2901 (parseSingleLyXformat2Token): some more (future) compability code added
2902 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2903 (parseSingleLyXformat2Token): set last_inset_read
2904 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2905 (parseSingleLyXformat2Token): don't double intializw string next_token
2907 * src/TextCache.C (text_fits::operator()): add const's to the signature
2908 (has_buffer::operator()): ditto
2910 * src/Floating.h: add some comments on the class
2912 * src/FloatList.[Ch] (typeExist): new method
2915 * src/BackStack.h: added default constructor, wanted by Gcc.
2917 2000-07-14 Juergen Vigna <jug@sad.it>
2919 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2921 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2923 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2924 do a redraw when the window is resized!
2925 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2927 * src/insets/insettext.C (resizeLyXText): added function to correctly
2928 being able to resize the LyXWindow.
2930 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2932 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2934 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2935 crashes when closing dialog to a deleted inset.
2937 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2938 method! Now similar to other insets.
2940 2000-07-13 Juergen Vigna <jug@sad.it>
2942 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2944 * lib/examples/Literate.lyx: small patch!
2946 * src/insets/insetbib.C (Read): added this function because of wrong
2947 Write (without [begin|end]_inset).
2949 2000-07-11 Juergen Vigna <jug@sad.it>
2951 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2952 as the insertInset could not be good!
2954 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2955 the bool param should not be last.
2957 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2959 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2960 did submit that to Karl).
2962 * configure.in: use -isystem instead of -I for X headers. This
2963 fixes a problem on solaris with a recent gcc;
2964 put the front-end code after the X detection code;
2965 configure in sigc++ before lib/
2967 * src/lyx_main.C (commandLineHelp): remove -display from command
2970 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2972 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2973 Also put in Makefile rules for building the ``listerrors''
2974 program for parsing errors from literate programs written in LyX.
2976 * lib/build-listerrors: Added small shell script as part of compile
2977 process. This builds a working ``listerrors'' binary if noweb is
2978 installed and either 1) the VNC X server is installed on the machine,
2979 or 2) the user is compiling from within a GUI. The existence of a GUI
2980 is necessary to use the ``lyx --export'' feature for now. This
2981 hack can be removed once ``lyx --export'' no longer requires a GUI to
2984 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2986 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2987 now passed back correctly from gcc and placed "under" error
2988 buttons in a Literate LyX source.
2990 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2992 * src/text.C (GetColumnNearX): Better behavior when a RTL
2993 paragraph is ended by LTR text.
2995 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2998 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3000 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
3001 true when clipboard is empty.
3003 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
3005 * text.C (Backspace): Prevent rebreaking of a row if it is the last
3006 row of the paragraph.
3007 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
3008 to prevent calculation of bidi tables
3010 2000-07-07 Juergen Vigna <jug@sad.it>
3012 * src/screen.C (ToggleSelection): added y_offset and x_offset
3015 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
3018 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
3020 * src/insets/insettext.C: fixed Layout-Display!
3022 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3024 * configure.in: add check for strings.h header.
3026 * src/spellchecker.C: include <strings.h> in order to have a
3027 definition for bzero().
3029 2000-07-07 Juergen Vigna <jug@sad.it>
3031 * src/insets/insettext.C (draw): set the status of the bv->text to
3032 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
3034 * src/screen.C (DrawOneRow):
3035 (DrawFromTo): redraw the actual row if something has changed in it
3038 * src/text.C (draw): call an update of the toplevel-inset if something
3039 has changed inside while drawing.
3041 * src/lyxtext.h: added CHANGED_IN_DRAW status.
3043 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
3045 * src/insets/insetbib.[Ch] (callback) new method, moving callback
3046 processing inside class.
3048 * src/insets/insetindex.[Ch] (callback) new method, moving callback
3049 processing inside class.
3051 * src/insets/insetindex.h new struct Holder, consistent with other
3054 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
3055 citation dialog from main code and placed it in src/frontends/xforms.
3056 Dialog launched through signals instead of callbacks
3058 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
3060 * lyx.man: update the options description.
3062 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
3064 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3065 handle neg values, set min width to 590, add doc about -display
3067 2000-07-05 Juergen Vigna <jug@sad.it>
3069 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3070 calls to BufferView *.
3072 * src/insets/insettext.C (checkAndActivateInset): small fix non
3073 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3075 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3076 their \end_inset token!
3078 2000-07-04 edscott <edscott@imp.mx>
3080 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3081 lib/lyxrc.example: added option \wheel_jump
3083 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3085 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3086 remove support for -width,-height,-xpos and -ypos.
3088 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3090 * src/encoding.[Ch]: New files.
3092 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3093 (text): Call to the underline() method only when needed.
3095 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3097 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3098 encoding(s) for the document.
3100 * src/bufferparams.C (BufferParams): Changed default value of
3103 * src/language.C (newLang): Removed.
3104 (items[]): Added encoding information for all defined languages.
3106 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3107 encoding choice button.
3109 * src/lyxrc.h (font_norm_type): New member variable.
3110 (set_font_norm_type): New method.
3112 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3113 paragraphs with different encodings.
3115 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3116 (TransformChar): Changed to work correctly with Arabic points.
3117 (draw): Added support for drawing Arabic points.
3118 (draw): Removed code for drawing underbars (this is done by
3121 * src/support/textutils.h (IsPrintableNonspace): New function.
3123 * src/BufferView_pimpl.h: Added "using SigC::Object".
3124 * src/LyXView.h: ditto.
3126 * src/insets/insetinclude.h (include_label): Changed to mutable.
3128 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3130 * src/mathed/math_iter.h: remove empty destructor
3132 * src/mathed/math_cursor.h: remove empty destructor
3134 * src/insets/lyxinset.h: add THEOREM_CODE
3136 * src/insets/insettheorem.[Ch]: new files
3138 * src/insets/insetminipage.C: (InsertInset): remove
3140 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3142 (InsertInset): remove
3144 * src/insets/insetlist.C: (InsertList): remove
3146 * src/insets/insetfootlike.[Ch]: new files
3148 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3151 (InsertInset): ditto
3153 * src/insets/insetert.C: remove include Painter.h, reindent
3154 (InsertInset): move to header
3156 * src/insets/insetcollapsable.h: remove explicit from default
3157 contructor, remove empty destructor, add InsertInset
3159 * src/insets/insetcollapsable.C (InsertInset): new func
3161 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3163 * src/vspace.h: add explicit to constructor
3165 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3166 \textcompwordmark, please test this.
3168 * src/lyxrc.C: set ascii_linelen to 65 by default
3170 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3172 * src/commandtags.h: add LFUN_INSET_THEOREM
3174 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3175 (makeLinuxDocFile): remove _some_ of the nice logic
3176 (makeDocBookFile): ditto
3178 * src/Painter.[Ch]: (~Painter): removed
3180 * src/LyXAction.C (init): entry for insettheorem added
3182 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3184 (deplog): code to detect files generated by LaTeX, needs testing
3187 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3189 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3191 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3193 * src/LaTeX.C (deplog): Add a check for files that are going to be
3194 created by the first latex run, part of the project to remove the
3197 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3198 contents to the extension list.
3200 2000-07-04 Juergen Vigna <jug@sad.it>
3202 * src/text.C (NextBreakPoint): added support for needFullRow()
3204 * src/insets/lyxinset.h: added needFullRow()
3206 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3209 * src/insets/insettext.C: lots of changes for update!
3211 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3213 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3215 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3217 * src/insets/insetinclude.C (InsetInclude): fixed
3218 initialization of include_label.
3219 (unique_id): now returns a string.
3221 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3223 * src/LaTeXFeatures.h: new member IncludedFiles, for
3224 a map of key, included file name.
3226 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3227 with the included files for inclusion in SGML preamble,
3228 i. e., linuxdoc and docbook.
3231 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3232 nice (is the generated linuxdoc code to be exported?), that
3233 allows to remove column, and only_body that will be true for
3234 slave documents. Insets are allowed inside SGML font type.
3235 New handling of the SGML preamble for included files.
3236 (makeDocBookFile): the same for docbook.
3238 * src/insets/insetinclude.h:
3239 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3241 (DocBook): new export methods.
3243 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3244 and makeDocBookFile.
3246 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3247 formats to export with command line argument -x.
3249 2000-06-29 Juergen Vigna <jug@sad.it>
3251 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3252 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3254 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3255 region could already been cleared by an inset!
3257 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3259 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3262 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3264 (cursorToggle): remove special handling of lyx focus.
3266 2000-06-28 Juergen Vigna <jug@sad.it>
3268 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3271 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3273 * src/insets/insetindex.C (Edit): add a callback when popup is
3276 * src/insets/insettext.C (LocalDispatch):
3277 * src/insets/insetmarginal.h:
3278 * src/insets/insetlist.h:
3279 * src/insets/insetfoot.h:
3280 * src/insets/insetfloat.h:
3281 * src/insets/insetert.h: add a missing std:: qualifier.
3283 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3285 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3288 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3290 * src/insets/insettext.C (Read): remove tmptok unused variable
3291 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3292 (InsertInset): change for new InsetInset code
3294 * src/insets/insettext.h: add TEXT inline method
3296 * src/insets/insettext.C: remove TEXT macro
3298 * src/insets/insetmarginal.C (Write): new method
3299 (Latex): change output slightly
3301 * src/insets/insetfoot.C (Write): new method
3302 (Latex): change output slightly (don't use endl when no need)
3304 * src/insets/insetert.C (Write): new method
3306 * src/insets/insetcollapsable.h: make button_length, button_top_y
3307 and button_bottm_y protected.
3309 * src/insets/insetcollapsable.C (Write): simplify code by using
3310 tostr. Also do not output the float name, the children class
3311 should to that to get control over own arguments
3313 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3314 src/insets/insetminipage.[Ch]:
3317 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3319 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3321 * src/Makefile.am (lyx_SOURCES): add the new files
3323 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3324 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3325 * src/commandtags.h: ditto
3327 * src/LaTeXFeatures.h: add a std::set of used floattypes
3329 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3331 * src/FloatList.[Ch] src/Floating.h: new files
3333 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3335 * src/lyx_cb.C (TableApplyCB): ditto
3337 * src/text2.C: ditto
3338 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3339 (parseSingleLyXformat2Token): ditto + add code for
3340 backwards compability for old float styles + add code for new insets
3342 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3344 (InsertInset(size_type, Inset *, LyXFont)): new method
3345 (InsetChar(size_type, char)): changed to use the other InsetChar
3346 with a LyXFont(ALL_INHERIT).
3347 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3348 insert the META_INSET.
3350 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3352 * sigc++/thread.h (Threads): from here
3354 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3355 definition out of line
3356 * sigc++/scope.h: from here
3358 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3360 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3361 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3363 * Makefile.am (bindist): new target.
3365 * INSTALL: add instructions for doing a binary distribution.
3367 * development/tools/README.bin.example: update a bit.
3369 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3372 * lib/lyxrc.example: new lyxrc tag \set_color.
3374 * src/lyxfunc.C (Dispatch):
3375 * src/commandtags.h:
3376 * src/LyXAction.C: new lyxfunc "set-color".
3378 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3379 and an x11name given as strings.
3381 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3382 cache when a color is changed.
3384 2000-06-26 Juergen Vigna <jug@sad.it>
3386 * src/lyxrow.C (width): added this functions and variable.
3388 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3391 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3393 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3395 * images/undo_bw.xpm: new icon.
3396 * images/redo_bw.xpm: ditto.
3398 * configure.in (INSTALL_SCRIPT): change value to
3399 ${INSTALL} to avoid failures of install-script target.
3400 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3402 * src/BufferView.h: add a magic "friend" declaration to please
3405 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3407 * forms/cite.fd: modified to allow resizing without messing
3410 * src/insetcite.C: Uses code from cite.fd almost without
3412 User can now resize dialog in the x-direction.
3413 Resizing the dialog in the y-direction is prevented, as the
3414 code does this intelligently already.
3416 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3418 * INSTALL: remove obsolete entry in "problems" section.
3420 * lib/examples/sl_*.lyx: update of the slovenian examples.
3422 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3424 2000-06-23 Juergen Vigna <jug@sad.it>
3426 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3428 * src/buffer.C (resize): delete the LyXText of textinsets.
3430 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3432 * src/insets/lyxinset.h: added another parameter 'cleared' to
3433 the draw() function.
3435 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3436 unlocking inset in inset.
3438 2000-06-22 Juergen Vigna <jug@sad.it>
3440 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3441 of insets and moved first to LyXText.
3443 * src/mathed/formulamacro.[Ch]:
3444 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3446 2000-06-21 Juergen Vigna <jug@sad.it>
3448 * src/text.C (GetVisibleRow): look if I should clear the area or not
3449 using Inset::doClearArea() function.
3451 * src/insets/lyxinset.h: added doClearArea() function and
3452 modified draw(Painter &, ...) to draw(BufferView *, ...)
3454 * src/text2.C (UpdateInset): return bool insted of int
3456 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3458 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3459 combox in the character popup
3461 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3462 BufferParams const & params
3464 2000-06-20 Juergen Vigna <jug@sad.it>
3466 * src/insets/insettext.C (SetParagraphData): set insetowner on
3469 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3471 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3472 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3474 (form_main_): remove
3476 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3477 (create_form_form_main): remove FD_form_main stuff, connect to
3478 autosave_timeout signal
3480 * src/LyXView.[Ch] (getMainForm): remove
3481 (UpdateTimerCB): remove
3482 * src/BufferView_pimpl.h: inherit from SigC::Object
3484 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3485 signal instead of callback
3487 * src/BufferView.[Ch] (cursorToggleCB): remove
3489 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3491 * src/BufferView_pimpl.C: changes because of the one below
3493 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3494 instead of storing a pointer to a LyXText.
3496 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3498 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3500 * src/lyxparagraph.h
3502 * src/paragraph.C: Changed fontlist to a sorted vector.
3504 2000-06-19 Juergen Vigna <jug@sad.it>
3506 * src/BufferView.h: added screen() function.
3508 * src/insets/insettext.C (LocalDispatch): some selection code
3511 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3513 * src/insets/insettext.C (SetParagraphData):
3515 (InsetText): fixes for multiple paragraphs.
3517 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3519 * development/lyx.spec.in: Call configure with ``--without-warnings''
3520 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3521 This should be fine, however, since we generally don't want to be
3522 verbose when making an RPM.
3524 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3526 * lib/scripts/fig2pstex.py: New file
3528 2000-06-16 Juergen Vigna <jug@sad.it>
3530 * src/insets/insettabular.C (UpdateLocal):
3531 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3532 (LocalDispatch): Changed all functions to use LyXText.
3534 2000-06-15 Juergen Vigna <jug@sad.it>
3536 * src/text.C (SetHeightOfRow): call inset::update before requesting
3539 * src/insets/insettext.C (update):
3540 * src/insets/insettabular.C (update): added implementation
3542 * src/insets/lyxinset.h: added update function
3544 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3546 * src/text.C (SelectNextWord): protect against null pointers with
3547 old-style string streams. (fix from Paul Theo Gonciari
3550 * src/cite.[Ch]: remove erroneous files.
3552 * lib/configure.m4: update the list of created directories.
3554 * src/lyxrow.C: include <config.h>
3555 * src/lyxcursor.C: ditto.
3557 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3559 * lib/examples/decimal.lyx: new example file from Mike.
3561 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3562 to find template definitions (from Dekel)
3564 * src/frontends/.cvsignore: add a few things.
3566 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3568 * src/Timeout.C (TimeOut): remove default argument.
3570 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3573 * src/insets/ExternalTemplate.C: add a "using" directive.
3575 * src/lyx_main.h: remove the act_ struct, which seems unused
3578 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3580 * LyX Developers Meeting: All files changed, due to random C++ (by
3581 coincidence) code generator script.
3583 - external inset (cool!)
3584 - initial online editing of preferences
3585 - insettabular breaks insettext(s contents)
3587 - some DocBook fixes
3588 - example files update
3589 - other cool stuff, create a diff and look for yourself.
3591 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3593 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3594 -1 this is a non-line-breaking textinset.
3596 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3597 if there is no width set.
3599 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3601 * Lots of files: Merged the dialogbase branch.
3603 2000-06-09 Allan Rae <rae@lyx.org>
3605 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3606 and the Dispatch methods that used it.
3608 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3609 access to functions formerly kept in Dispatch.
3611 2000-05-19 Allan Rae <rae@lyx.org>
3613 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3614 made to_page and count_copies integers again. from_page remains a
3615 string however because I want to allow entry of a print range like
3616 "1,4,22-25" using this field.
3618 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3619 and printer-params-get. These aren't useful from the minibuffer but
3620 could be used by a script/LyXServer app provided it passes a suitable
3621 auto_mem_buffer. I guess I should take a look at how the LyXServer
3622 works and make it support xtl buffers.
3624 * sigc++/: updated to libsigc++-1.0.1
3626 * src/xtl/: updated to xtl-1.3.pl.11
3628 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3629 those changes done to the files in src/ are actually recreated when
3630 they get regenerated. Please don't ever accept a patch that changes a
3631 dialog unless that patch includes the changes to the corresponding *.fd
3634 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3635 stringOnlyContains, renamed it and generalised it.
3637 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3638 branch. Removed the remaining old form_print code.
3640 2000-04-26 Allan Rae <rae@lyx.org>
3642 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3643 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3645 2000-04-25 Allan Rae <rae@lyx.org>
3647 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3648 against a base of xtl-1.3.pl.4
3650 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3651 filter the Id: entries so they still show the xtl version number
3654 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3655 into the src/xtl code. Patch still pending with José (XTL)
3657 2000-04-24 Allan Rae <rae@lyx.org>
3659 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3660 both more generic and much safer. Use the new template functions.
3661 * src/buffer.[Ch] (Dispatch): ditto.
3663 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3664 and mem buffer more intelligently. Also a little general cleanup.
3667 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3668 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3669 * src/xtl/Makefile.am: ditto.
3670 * src/xtl/.cvsignore: ditto.
3671 * src/Makefile.am: ditto.
3673 * src/PrinterParams.h: Removed the macros member functions. Added a
3674 testInvariant member function. A bit of tidying up and commenting.
3675 Included Angus's idea for fixing operation with egcs-1.1.2.
3677 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3678 cool expansion of XTL's mem_buffer to support automatic memory
3679 management within the buffer itself. Removed the various macros and
3680 replaced them with template functions that use either auto_mem_buffer
3681 or mem_buffer depending on a #define. The mem_buffer support will
3682 disappear as soon as the auto_mem_buffer is confirmed to be good on
3683 other platforms/compilers. That is, it's there so you've got something
3686 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3687 effectively forked XTL. However I expect José will include my code
3688 into the next major release. Also fixed a memory leak.
3689 * src/xtl/text.h: ditto.
3690 * src/xtl/xdr.h: ditto.
3691 * src/xtl/giop.h: ditto.
3693 2000-04-16 Allan Rae <rae@lyx.org>
3695 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3696 by autogen.sh and removed by maintainer-clean anyway.
3697 * .cvsignore, sigc++/.cvsignore: Support the above.
3699 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3701 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3703 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3704 macros, renamed static callback-target member functions to suit new
3705 scheme and made them public.
3706 * src/frontends/xforms/forms/form_print.fd: ditto.
3707 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3709 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3712 * src/xtl/: New directory containing a minimal distribution of XTL.
3713 This is XTL-1.3.pl.4.
3715 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3717 2000-04-15 Allan Rae <rae@lyx.org>
3719 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3721 * sigc++/: Updated to libsigc++-1.0.0
3723 2000-04-14 Allan Rae <rae@lyx.org>
3725 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3726 use the generic ones in future. I'll modify my conversion script.
3728 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3730 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3731 (CloseAllBufferRelatedDialogs): Renamed.
3732 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3734 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3735 of the generic ones. These are the same ones my conversion script
3738 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3739 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3740 * src/buffer.C (Dispatch): ditto
3742 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3743 functions for updating and hiding buffer dependent dialogs.
3744 * src/BufferView.C (buffer): ditto
3745 * src/buffer.C (setReadonly): ditto
3746 * src/lyxfunc.C (CloseBuffer): ditto
3748 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3749 Dialogs.h, and hence all the SigC stuff, into every file that includes
3750 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3752 * src/BufferView2.C: reduce the number of headers included by buffer.h
3754 2000-04-11 Allan Rae <rae@lyx.org>
3756 * src/frontends/xforms/xform_macros.h: A small collection of macros
3757 for building C callbacks.
3759 * src/frontends/xforms/Makefile.am: Added above file.
3761 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3762 scheme again. This time it should work for JMarc. If this is
3763 successful I'll revise my conversion script to automate some of this.
3764 The static member functions in the class also have to be public for
3765 this scheme will work. If the scheme works (it's almost identical to
3766 the way BufferView::cursorToggleCB is handled so it should work) then
3767 FormCopyright and FormPrint will be ready for inclusion into the main
3768 trunk immediately after 1.1.5 is released -- provided we're prepared
3769 for complaints about lame compilers not handling XTL.
3771 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3773 2000-04-07 Allan Rae <rae@lyx.org>
3775 * config/lyxinclude.m4: A bit more tidying up (Angus)
3777 * src/LString.h: JMarc's <string> header fix
3779 * src/PrinterParams.h: Used string for most data to remove some
3780 ugly code in the Print dialog and avoid even uglier code when
3781 appending the ints to a string for output.
3783 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3784 and moved "default:" back to the end of switch statement. Cleaned
3785 up the printing so it uses the right function calls and so the
3786 "print to file" option actually puts the file in the right directory.
3788 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3790 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3791 and Ok+Apply button control into a separate method: input (Angus).
3792 (input) Cleaned it up and improved it to be very thorough now.
3793 (All CB) static_cast used instead of C style cast (Angus). This will
3794 probably change again once we've worked out how to keep gcc-2.8.1 happy
3795 with real C callbacks.
3796 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3797 ignore some of the bool settings and has random numbers instead. Needs
3798 some more investigation. Added other input length checks and checking
3799 of file and printer names.
3801 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3802 would link (Angus). Seems the old code doesn't compile with the pragma
3803 statement either. Separated callback entries from internal methods.
3805 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3807 2000-03-17 Allan Rae <rae@lyx.org>
3809 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3810 need it? Maybe it could go in Dialogs instead? I could make it a
3811 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3812 values to get the bool return value.
3813 (Dispatch): New overloaded method for xtl support.
3815 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3816 extern "C" callback instead of static member functions. Hopefully,
3817 JMarc will be able to compile this. I haven't changed
3818 forms/form_copyright.fd yet. Breaking one of my own rules already.
3820 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3821 because they aren't useful from the minibuffer. Maybe a LyXServer
3822 might want a help message though?
3824 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3826 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3827 xtl which needs both rtti and exceptions.
3829 * src/support/Makefile.am:
3830 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3832 * src/frontends/xforms/input_validators.[ch]: input filters and
3833 validators. These conrol what keys are valid in input boxes.
3834 Use them and write some more. Much better idea than waiting till
3835 after the user has pressed Ok to say that the input fields don't make
3838 * src/frontends/xforms/Makefile.am:
3839 * src/frontends/xforms/forms/form_print.fd:
3840 * src/frontends/xforms/forms/makefile:
3841 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3842 new scheme. Still have to make sure I haven't missed anything from
3843 the current implementation.
3845 * src/Makefile.am, src/PrinterParams.h: New data store.
3847 * other files: Added a couple of copyright notices.
3849 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3851 * src/insets/insetbib.h: move Holder struct in public space.
3853 * src/frontends/include/DialogBase.h: use SigC:: only when
3854 SIGC_CXX_NAMESPACES is defined.
3855 * src/frontends/include/Dialogs.h: ditto.
3857 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3859 * src/frontends/xforms/FormCopyright.[Ch]: do not
3860 mention SigC:: explicitely.
3862 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3864 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3865 deals with testing KDE in main configure.in
3866 * configure.in: ditto.
3868 2000-02-22 Allan Rae <rae@lyx.org>
3870 * Lots of files: Merged from HEAD
3872 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3873 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3875 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3877 * sigc++/: new minidist.
3879 2000-02-14 Allan Rae <rae@lyx.org>
3881 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3883 2000-02-08 Juergen Vigna <jug@sad.it>
3885 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3886 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3888 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3889 for this port and so it is much easier for other people to port
3890 dialogs in a common development environment.
3892 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3893 the QT/KDE implementation.
3895 * src/frontends/kde/Dialogs.C:
3896 * src/frontends/kde/FormCopyright.C:
3897 * src/frontends/kde/FormCopyright.h:
3898 * src/frontends/kde/Makefile.am:
3899 * src/frontends/kde/formcopyrightdialog.C:
3900 * src/frontends/kde/formcopyrightdialog.h:
3901 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3902 for the kde support of the Copyright-Dialog.
3904 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3905 subdir-substitution instead of hardcoded 'xforms' as we now have also
3908 * src/frontends/include/DialogBase.h (Object): just commented the
3909 label after #endif (nasty warning and I don't like warnings ;)
3911 * src/main.C (main): added KApplication initialization if using
3914 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3915 For now only the KDE event-loop is added if frontend==kde.
3917 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3919 * configure.in: added support for the --with-frontend[=value] option
3921 * autogen.sh: added kde.m4 file to list of config-files
3923 * acconfig.h: added define for KDEGUI-support
3925 * config/kde.m4: added configuration functions for KDE-port
3927 * config/lyxinclude.m4: added --with-frontend[=value] option with
3928 support for xforms and KDE.
3930 2000-02-08 Allan Rae <rae@lyx.org>
3932 * all Makefile.am: Fixed up so the make targets dist, distclean,
3933 install and uninstall all work even if builddir != srcdir. Still
3934 have a new sigc++ minidist update to come.
3936 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3938 2000-02-01 Allan Rae <rae@lyx.org>
3940 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3941 Many mods to get builddir != srcdir working.
3943 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3944 for building on NT and so we can do the builddir != srcdir stuff.
3946 2000-01-30 Allan Rae <rae@lyx.org>
3948 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3949 This will stay in "rae" branch. We probably don't really need it in
3950 the main trunk as anyone who wants to help programming it should get
3951 a full library installed also. So they can check both included and
3952 system supplied library compilation.
3954 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3955 Added a 'mini' distribution of libsigc++. If you feel the urge to
3956 change something in these directories - Resist it. If you can't
3957 resist the urge then you should modify the following script and rebuild
3958 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3959 all happen. Still uses a hacked version of libsigc++'s configure.in.
3960 I'm quite happy with the results. I'm not sure the extra work to turn
3961 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3962 worth the trouble and would probably lead to extra maintenance
3964 I haven't tested the following important make targets: install, dist.
3965 Not ready for prime time but very close. Maybe 1.1.5.
3967 * development/tools/makeLyXsigc.sh: A shell script to automatically
3968 generate our mini-dist of libsigc++. It can only be used with a CVS
3969 checkout of libsigc++ not a tarball distribution. It's well commented.
3970 This will end up as part of the libsigc++ distribution so other apps
3971 can easily have an included mini-dist. If someone makes mods to the
3972 sigc++ subpackage without modifying this script to generate those
3973 changes I'll be very upset!
3975 * src/frontends/: Started the gui/system indep structure.
3977 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3978 to access the gui-indep dialogs are in this class. Much improved
3979 design compared to previous revision. Lars, please refrain from
3980 moving this header into src/ like you did with Popups.h last time.
3982 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3984 * src/frontends/xforms/: Started the gui-indep system with a single
3985 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3988 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3989 Here you'll find a very useful makefile and automated fdfix.sh that
3990 makes updating dailogs a no-brainer -- provided you follow the rules
3991 set out in the README. I'm thinking about adding another script to
3992 automatically generate skeleton code for a new dialog given just the
3995 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3996 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3997 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3999 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
4001 * src/support/LSubstring.C (operator): simplify
4003 * src/lyxtext.h: removed bparams, use buffer_->params instead
4005 * src/lyxrow.h: make Row a real class, move all variables to
4006 private and use accessors.
4008 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
4010 (isRightToLeftPar): ditto
4011 (ChangeLanguage): ditto
4012 (isMultiLingual): ditto
4015 (SimpleTeXOnePar): ditto
4016 (TeXEnvironment): ditto
4017 (GetEndLabel): ditto
4019 (SetOnlyLayout): ditto
4020 (BreakParagraph): ditto
4021 (BreakParagraphConservative): ditto
4022 (GetFontSettings): ditto
4024 (CopyIntoMinibuffer): ditto
4025 (CutIntoMinibuffer): ditto
4026 (PasteParagraph): ditto
4027 (SetPExtraType): ditto
4028 (UnsetPExtraType): ditto
4029 (DocBookContTableRows): ditto
4030 (SimpleDocBookOneTablePar): ditto
4032 (TeXFootnote): ditto
4033 (SimpleTeXOneTablePar): ditto
4034 (TeXContTableRows): ditto
4035 (SimpleTeXSpecialChars): ditto
4038 * src/lyxcursor.h: make LyXCursor a real class, move all variables
4039 to private and use accessors.
4041 * src/lyx_cb.C: remove char updatetimer, and all code that uses
4042 this, we did not use it anymore and has not been for ages. Just a
4043 waste of cpu cycles.
4045 * src/language.h: make Language a real class, move all variables
4046 to private and use accessors.
4048 * src/BufferView_pimpl.C (Pimpl): use new timer code.
4049 (create_view): remove
4050 (update): some changes for new timer
4051 (cursorToggle): use new timer
4052 (beforeChange): change for new timer
4054 * src/BufferView.h (cursorToggleCB): removed last paramter because
4057 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
4058 (cursorToggleCB): change because of new timer code
4060 * lib/CREDITS: updated own mailaddress
4062 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4064 * src/support/filetools.C (PutEnv): fix the code in case neither
4065 putenv() nor setenv() have been found.
4067 * INSTALL: mention the install-strip Makefile target.
4069 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4070 read-only documents.
4072 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4074 * lib/reLyX/configure.in (VERSION): avoid using a previously
4075 generated reLyX wrapper to find out $prefix.
4077 * lib/examples/eu_adibide_lyx-atua.lyx:
4078 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4079 translation of the Tutorial (Dooteo)
4081 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4083 * forms/cite.fd: new citation dialog
4085 * src/insetcite.[Ch]: the new citation dialog is moved into
4088 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4091 * src/insets/insetcommand.h: data members made private.
4093 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4095 * LyX 1.1.5 released
4097 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4099 * src/version.h (LYX_RELEASE): to 1.1.5
4101 * src/spellchecker.C (RunSpellChecker): return false if the
4102 spellchecker dies upon creation.
4104 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4106 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4107 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4111 * lib/CREDITS: update entry for Martin Vermeer.
4113 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4115 * src/text.C (draw): Draw foreign language bars at the bottom of
4116 the row instead of at the baseline.
4118 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4120 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4122 * lib/bind/de_menus.bind: updated
4124 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4126 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4128 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4130 * src/menus.C (Limit_string_length): New function
4131 (ShowTocMenu): Limit the number of items/length of items in the
4134 * src/paragraph.C (String): Correct result for a paragraph inside
4137 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4139 * src/bufferlist.C (close): test of buf->getuser() == NULL
4141 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4143 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4144 Do not call to SetCursor when the paragraph is a closed footnote!
4146 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4148 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4151 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4153 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4156 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4157 reference popup, that activates the reference-back action
4159 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4161 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4162 the menus. Also fixed a bug.
4164 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4165 the math panels when switching buffers (unless new buffer is readonly).
4167 * src/BufferView.C (NoSavedPositions)
4168 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4170 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4172 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4173 less of dvi dirty or not.
4175 * src/trans_mgr.[Ch] (insert): change first parameter to string
4178 * src/chset.[Ch] (encodeString): add const to first parameter
4180 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4182 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4186 * src/LaTeX.C (deplog): better searching for dependency files in
4187 the latex log. Uses now regexps.
4189 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4190 instead of the box hack or \hfill.
4192 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4194 * src/lyxfunc.C (doImportHelper): do not create the file before
4195 doing the actual import.
4196 (doImportASCIIasLines): create a new file before doing the insert.
4197 (doImportASCIIasParagraphs): ditto.
4199 * lib/lyxrc.example: remove mention of non-existing commands
4201 * lyx.man: remove mention of color-related switches.
4203 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4205 * src/lyx_gui.C: remove all the color-related ressources, which
4206 are not used anymore.
4208 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4211 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4213 * src/lyxrc.C (read): Add a missing break in the switch
4215 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4217 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4219 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4222 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4224 * src/text.C (draw): draw bars under foreign language words.
4226 * src/LColor.[Ch]: add LColor::language
4228 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4230 * src/lyxcursor.h (boundary): New member variable
4232 * src/text.C (IsBoundary): New methods
4234 * src/text.C: Use the above for currect cursor movement when there
4235 is both RTL & LTR text.
4237 * src/text2.C: ditto
4239 * src/bufferview_funcs.C (ToggleAndShow): ditto
4241 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4243 * src/text.C (DeleteLineForward): set selection to true to avoid
4244 that DeleteEmptyParagraphMechanism does some magic. This is how it
4245 is done in all other functions, and seems reasonable.
4246 (DeleteWordForward): do not jump over non-word stuff, since
4247 CursorRightOneWord() already does it.
4249 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4250 DeleteWordBackward, since they seem safe to me (since selection is
4251 set to "true") DeleteEmptyParagraphMechanism does nothing.
4253 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4255 * src/lyx_main.C (easyParse): simplify the code by factoring the
4256 part that removes parameters from the command line.
4257 (LyX): check wether wrong command line options have been given.
4259 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4261 * src/lyx_main.C : add support for specifying user LyX
4262 directory via command line option -userdir.
4264 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4266 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4267 the number of items per popup.
4268 (Add_to_refs_menu): Ditto.
4270 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4272 * src/lyxparagraph.h: renamed ClearParagraph() to
4273 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4274 textclass as parameter, and do nothing if free_spacing is
4275 true. This fixes part of the line-delete-forward problems.
4277 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4278 (pasteSelection): ditto.
4279 (SwitchLayoutsBetweenClasses): more translatable strings.
4281 * src/text2.C (CutSelection): use StripLeadingSpaces.
4282 (PasteSelection): ditto.
4283 (DeleteEmptyParagraphMechanism): ditto.
4285 2000-05-26 Juergen Vigna <jug@sad.it>
4287 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4288 is not needed in tabular insets.
4290 * src/insets/insettabular.C (TabularFeatures): added missing features.
4292 * src/tabular.C (DeleteColumn):
4294 (AppendRow): implemented this functions
4295 (cellsturct::operator=): clone the inset too;
4297 2000-05-23 Juergen Vigna <jug@sad.it>
4299 * src/insets/insettabular.C (LocalDispatch): better selection support
4300 when having multicolumn-cells.
4302 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4304 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4306 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4308 * src/ColorHandler.C (getGCForeground): put more test into _()
4310 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4313 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4316 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4318 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4319 there are no labels, or when buffer is readonly.
4321 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4322 there are no labels, buffer is SGML, or when buffer is readonly.
4324 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4326 * src/LColor.C (LColor): change a couple of grey40 to grey60
4327 (LColor): rewore initalization to make compiles go some magnitude
4329 (getGUIName): don't use gettext until we need the string.
4331 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4333 * src/Bullet.[Ch]: Fixed a small bug.
4335 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4337 * src/paragraph.C (String): Several fixes/improvements
4339 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4341 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4343 * src/paragraph.C (String): give more correct output.
4345 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4347 * src/lyxfont.C (stateText) Do not output the language if it is
4348 eqaul to the language of the document.
4350 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4351 between two paragraphs with the same language.
4353 * src/paragraph.C (getParLanguage) Return a correct answer for an
4354 empty dummy paragraph.
4356 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4359 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4362 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4363 the menus/popup, if requested fonts are unavailable.
4365 2000-05-22 Juergen Vigna <jug@sad.it>
4367 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4368 movement support (Up/Down/Tab/Shift-Tab).
4369 (LocalDispatch): added also preliminari cursor-selection.
4371 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4373 * src/paragraph.C (PasteParagraph): Hopefully now right!
4375 2000-05-22 Garst R. Reese <reese@isn.net>
4377 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4378 of list, change all references to Environment to Command
4379 * tex/hollywood.cls : rewrite environments as commands, add
4380 \uppercase to interiorshot and exteriorshot to force uppecase.
4381 * tex/broadway.cls : rewrite environments as commands. Tweak
4384 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4386 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4387 size of items: use a constant intead of the hardcoded 40, and more
4388 importantly do not remove the %m and %x tags added at the end.
4389 (Add_to_refs_menu): use vector::size_type instead of
4390 unsigned int as basic types for the variables. _Please_ do not
4391 assume that size_t is equal to unsigned int. On an alpha, this is
4392 unsigned long, which is _not_ the same.
4394 * src/language.C (initL): remove language "hungarian", since it
4395 seems that "magyar" is better.
4397 2000-05-22 Juergen Vigna <jug@sad.it>
4399 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4401 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4404 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4405 next was deleted but not set to 0.
4407 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4409 * src/language.C (initL): change the initialization of languages
4410 so that compiles goes _fast_.
4412 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4415 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4417 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4421 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4423 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4425 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4429 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4432 * src/insets/insetlo*.[Ch]: Made editable
4434 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4436 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4437 the current selection.
4439 * src/BufferView_pimpl.C (stuffClipboard): new method
4441 * src/BufferView.C (stuffClipboard): new method
4443 * src/paragraph.C (String): new method
4445 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4446 LColor::ignore when lyxname is not found.
4448 * src/BufferView.C (pasteSelection): new method
4450 * src/BufferView_pimpl.C (pasteSelection): new method
4452 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4454 * src/WorkArea.C (request_clipboard_cb): new static function
4455 (getClipboard): new method
4456 (putClipboard): new method
4458 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4460 * LyX 1.1.5pre2 released
4462 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4464 * src/vspace.C (operator=): removed
4465 (operator=): removed
4467 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4469 * src/layout.C (NumberOfClass): manually set the type in make_pair
4470 (NumberOfLayout): ditto
4472 * src/language.C: use the Language constructor for ignore_lang
4474 * src/language.h: add constructors to struct Language
4476 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4478 * src/text2.C (SetCursorIntern): comment out #warning
4480 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4482 * src/mathed/math_iter.h: initialize sx and sw to 0
4484 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4486 * forms/lyx.fd: Redesign of form_ref
4488 * src/LaTeXFeatures.[Ch]
4492 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4495 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4496 and Buffer::inset_iterator.
4498 * src/menus.C: Added new menus: TOC and Refs.
4500 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4502 * src/buffer.C (getTocList): New method.
4504 * src/BufferView2.C (ChangeRefs): New method.
4506 * src/buffer.C (getLabelList): New method. It replaces the old
4507 getReferenceList. The return type is vector<string> instead of
4510 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4511 the old getLabel() and GetNumberOfLabels() methods.
4512 * src/insets/insetlabel.C (getLabelList): ditto
4513 * src/mathed/formula.C (getLabelList): ditto
4515 * src/paragraph.C (String): New method.
4517 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4518 Uses the new getTocList() method.
4519 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4520 which automatically updates the contents of the browser.
4521 (RefUpdateCB): Use the new getLabelList method.
4523 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4525 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4527 * src/spellchecker.C: Added using std::reverse;
4529 2000-05-19 Juergen Vigna <jug@sad.it>
4531 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4533 * src/insets/insettext.C (computeTextRows): small fix for display of
4534 1 character after a newline.
4536 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4539 2000-05-18 Juergen Vigna <jug@sad.it>
4541 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4542 when changing width of column.
4544 * src/tabular.C (set_row_column_number_info): setting of
4545 autobreak rows if necessary.
4547 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4549 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4551 * src/vc-backend.*: renamed stat() to status() and vcstat to
4552 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4553 compilation broke. The new name seems more relevant, anyway.
4555 2000-05-17 Juergen Vigna <jug@sad.it>
4557 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4558 which was wrong if the removing caused removing of rows!
4560 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4561 (pushToken): new function.
4563 * src/text2.C (CutSelection): fix problem discovered with purify
4565 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4567 * src/debug.C (showTags): enlarge the first column, now that we
4568 have 6-digits debug codes.
4570 * lib/layouts/hollywood.layout:
4571 * lib/tex/hollywood.cls:
4572 * lib/tex/brodway.cls:
4573 * lib/layouts/brodway.layout: more commands and fewer
4574 environments. Preambles moved in the .cls files. Broadway now has
4575 more options on scene numbering and less whitespace (from Garst)
4577 * src/insets/insetbib.C (getKeys): make sure that we are in the
4578 document directory, in case the bib file is there.
4580 * src/insets/insetbib.C (Latex): revert bogus change.
4582 2000-05-16 Juergen Vigna <jug@sad.it>
4584 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4585 the TabularLayout on cursor move.
4587 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4589 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4592 (draw): fixed cursor position and drawing so that the cursor is
4593 visible when before the tabular-inset.
4595 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4596 when creating from old insettext.
4598 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4600 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4602 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4603 * lib/tex/brodway.cls: ditto
4605 * lib/layouts/brodway.layout: change alignment of parenthical
4608 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4610 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4611 versions 0.88 and 0.89 are supported.
4613 2000-05-15 Juergen Vigna <jug@sad.it>
4615 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4618 * src/insets/insettext.C (computeTextRows): redone completely this
4619 function in a much cleaner way, because of problems when having a
4621 (draw): added a frame border when the inset is locked.
4622 (SetDrawLockedFrame): this sets if we draw the border or not.
4623 (SetFrameColor): this sets the frame color (default=insetframe).
4625 * src/insets/lyxinset.h: added x() and y() functions which return
4626 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4627 function which is needed to see if we have a locking inset of some
4628 type in this inset (needed for now in insettabular).
4630 * src/vspace.C (inPixels): the same function also without a BufferView
4631 parameter as so it is easier to use it in some ocasions.
4633 * src/lyxfunc.C: changed all places where insertInset was used so
4634 that now if it couldn't be inserted it is deleted!
4636 * src/TabularLayout.C:
4637 * src/TableLayout.C: added support for new tabular-inset!
4639 * src/BufferView2.C (insertInset): this now returns a bool if the
4640 inset was really inserted!!!
4642 * src/tabular.C (GetLastCellInRow):
4643 (GetFirstCellInRow): new helper functions.
4644 (Latex): implemented for new tabular class.
4648 (TeXTopHLine): new Latex() helper functions.
4650 2000-05-12 Juergen Vigna <jug@sad.it>
4652 * src/mathed/formulamacro.C (Read):
4653 * src/mathed/formula.C (Read): read also the \end_inset here!
4655 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4657 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4658 crush when saving formulae with unbalanced parenthesis.
4660 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4662 * src/layout.C: Add new keyword "endlabelstring" to layout file
4664 * src/text.C (GetVisibleRow): Draw endlabel string.
4666 * lib/layouts/broadway.layout
4667 * lib/layouts/hollywood.layout: Added endlabel for the
4668 Parenthetical layout.
4670 * lib/layouts/heb-article.layout: Do not use slanted font shape
4671 for Theorem like environments.
4673 * src/buffer.C (makeLaTeXFile): Always add "american" to
4674 the UsedLanguages list if document language is RTL.
4676 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4678 * add addendum to README.OS2 and small patch (from SMiyata)
4680 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4682 * many files: correct the calls to ChangeExtension().
4684 * src/support/filetools.C (ChangeExtension): remove the no_path
4685 argument, which does not belong there. Use OnlyFileName() instead.
4687 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4688 files when LaTeXing a non-nice latex file.
4690 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4691 a chain of "if". Return false when deadkeys are not handled.
4693 * src/lyx_main.C (LyX): adapted the code for default bindings.
4695 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4696 bindings for basic functionality (except deadkeys).
4697 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4699 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4700 several methods: handle override_x_deadkeys.
4702 * src/lyxrc.h: remove the "bindings" map, which did not make much
4703 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4705 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4707 * src/lyxfont.C (stateText): use a saner method to determine
4708 whether the font is "default". Seems to fix the crash with DEC
4711 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4713 2000-05-08 Juergen Vigna <jug@sad.it>
4715 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4716 TabularLayoutMenu with mouse-button-3
4717 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4719 * src/TabularLayout.C: added this file for having a Layout for
4722 2000-05-05 Juergen Vigna <jug@sad.it>
4724 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4725 recalculating inset-widths.
4726 (TabularFeatures): activated this function so that I can change
4727 tabular-features via menu.
4729 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4730 that I can test some functions with the Table menu.
4732 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4734 * src/lyxfont.C (stateText): guard against stupid c++libs.
4736 * src/tabular.C: add using std::vector
4737 some whitespace changes, + removed som autogenerated code.
4739 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4741 2000-05-05 Juergen Vigna <jug@sad.it>
4743 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4744 row, columns and cellstructures.
4746 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4748 * lib/lyxrc.example: remove obsolete entries.
4750 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4751 reading of protected_separator for free_spacing.
4753 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4755 * src/text.C (draw): do not display an exclamation mark in the
4756 margin for margin notes. This is confusing, ugly and
4759 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4760 AMS math' is checked.
4762 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4763 name to see whether including the amsmath package is needed.
4765 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4767 * src/paragraph.C (validate): Compute UsedLanguages correctly
4768 (don't insert the american language if it doesn't appear in the
4771 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4772 The argument of \thanks{} command is considered moving argument
4774 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4777 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4779 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4780 for appendix/minipage/depth. The lines can be now both in the footnote
4781 frame, and outside the frame.
4783 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4786 2000-05-05 Juergen Vigna <jug@sad.it>
4788 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4789 neede only in tabular.[Ch].
4791 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4793 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4795 (Write): write '~' for PROTECTED_SEPARATOR
4797 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4799 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4802 * src/mathed/formula.C (drawStr): rename size to siz.
4804 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4805 possibly fix a bug by not changing the pflags = flags to piflags =
4808 2000-05-05 Juergen Vigna <jug@sad.it>
4810 * src/insets/insetbib.C: moved using directive
4812 * src/ImportNoweb.C: small fix for being able to compile (missing
4815 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4817 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4818 to use clear, since we don't depend on this in the code. Add test
4821 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4823 * (various *.C files): add using std::foo directives to please dec
4826 * replace calls to string::clear() to string::erase() (Angus)
4828 * src/cheaders/cmath: modified to provide std::abs.
4830 2000-05-04 Juergen Vigna <jug@sad.it>
4832 * src/insets/insettext.C: Prepared all for inserting of multiple
4833 paragraphs. Still display stuff to do (alignment and other things),
4834 but I would like to use LyXText to do this when we cleaned out the
4835 table-support stuff.
4837 * src/insets/insettabular.C: Changed lot of stuff and added lots
4838 of functionality still a lot to do.
4840 * src/tabular.C: Various functions changed name and moved to be
4841 const functions. Added new Read and Write functions and changed
4842 lots of things so it works good with tabular-insets (also removed
4843 some stuff which is not needed anymore * hacks *).
4845 * src/lyxcursor.h: added operators == and != which just look if
4846 par and pos are (not) equal.
4848 * src/buffer.C (latexParagraphs): inserted this function to latex
4849 all paragraphs form par to endpar as then I can use this too for
4852 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4853 so that I can call this to from text insets with their own cursor.
4855 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4856 output off all paragraphs (because of the fix below)!
4858 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4859 the very last paragraph (this could be also the last paragraph of an
4862 * src/texrow.h: added rows() call which returns the count-variable.
4864 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4866 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4868 * lib/configure.m4: better autodetection of DocBook tools.
4870 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4872 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4874 * src/lyx_cb.C: add using std::reverse;
4876 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4879 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4880 selected files. Should fix repeated errors from generated files.
4882 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4884 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4886 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4887 the spellchecker popup.
4889 * lib/lyxrc.example: Removed the \number_inset section
4891 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4893 * src/insets/figinset.C (various): Use IsFileReadable() to make
4894 sure that the file actually exist. Relying on ghostscripts errors
4895 is a bad idea since they can lead to X server crashes.
4897 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4899 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4902 * lib/lyxrc.example: smallish typo in description of
4903 \view_dvi_paper_option
4905 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4908 * src/lyxfunc.C: doImportHelper to factor out common code of the
4909 various import methods. New functions doImportASCIIasLines,
4910 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4911 doImportLinuxDoc for the format specific parts.
4914 * buffer.C: Dispatch returns now a bool to indicate success
4917 * lyx_gui.C: Add getLyXView() for member access
4919 * lyx_main.C: Change logic for batch commands: First try
4920 Buffer::Dispatch (possibly without GUI), if that fails, use
4923 * lyx_main.C: Add support for --import command line switch.
4924 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4925 Available Formats: Everything accepted by 'buffer-import <format>'
4927 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4929 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4932 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4933 documents will be reformatted upon reentry.
4935 2000-04-27 Juergen Vigna <jug@sad.it>
4937 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4938 correctly only last pos this was a bug.
4940 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4942 * release of lyx-1.1.5pre1
4944 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4946 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4948 * src/menus.C: revert the change of naming (Figure->Graphic...)
4949 from 2000-04-11. It was incomplete and bad.
4951 * src/LColor.[Ch]: add LColor::depthbar.
4952 * src/text.C (GetVisibleRow): use it.
4954 * README: update the languages list.
4956 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4958 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4961 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4963 * README: remove sections that were just wrong.
4965 * src/text2.C (GetRowNearY): remove currentrow code
4967 * src/text.C (GetRow): remove currentrow code
4969 * src/screen.C (Update): rewritten a bit.
4970 (SmallUpdate): removed func
4972 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4974 (FullRebreak): return bool
4975 (currentrow): remove var
4976 (currentrow_y): ditto
4978 * src/lyxscreen.h (Draw): change arg to unsigned long
4979 (FitCursor): return bool
4980 (FitManualCursor): ditto
4981 (Smallpdate): remove func
4982 (first): change to unsigned long
4983 (DrawOneRow): change second arg to long (from long &)
4984 (screen_refresh_y): remove var
4985 (scree_refresh_row): ditto
4987 * src/lyxrow.h: change baseline to usigned int from unsigned
4988 short, this brings some implicit/unsigned issues out in the open.
4990 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4992 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4993 instead of smallUpdate.
4995 * src/lyxcursor.h: change y to unsigned long
4997 * src/buffer.h: don't call updateScrollbar after fitcursor
4999 * src/buffer.C (parseSingleLyXformat2Token): move variables to
5000 where they are used. Removed "\\direction", this was not present
5001 in 1.1.4 and is already obsolete. Commented out some code that I
5002 believe to never be called.
5003 (runLiterate): don't call updateScrollbar after fitCursor
5005 (buildProgram): ditto
5008 * src/WorkArea.h (workWidth): change return val to unsigned
5011 (redraw): remove the button redraws
5012 (setScrollbarValue): change for scrollbar
5013 (getScrollbarValue): change for scrollbar
5014 (getScrollbarBounds): change for scrollbar
5016 * src/WorkArea.C (C_WorkArea_up_cb): removed func
5017 (C_WorkArea_down_cb): removed func
5018 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
5019 (resize): change for scrollbar
5020 (setScrollbar): ditto
5021 (setScrollbarBounds): ditto
5022 (setScrollbarIncrements): ditto
5023 (up_cb): removed func
5024 (down_cb): removed func
5025 (scroll_cb): change for scrollbar
5026 (work_area_handler): ditto
5028 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
5029 when FitCursor did something.
5030 (updateScrollbar): some unsigned changes
5031 (downCB): removed func
5032 (scrollUpOnePage): removed func
5033 (scrollDownOnePage): remvoed func
5034 (workAreaMotionNotify): don't call screen->FitCursor but use
5035 fitCursor instead. and bool return val
5036 (workAreaButtonPress): ditto
5037 (workAreaButtonRelease): some unsigned changes
5038 (checkInsetHit): ditto
5039 (workAreaExpose): ditto
5040 (update): parts rewritten, comments about the signed char arg added
5041 (smallUpdate): removed func
5042 (cursorPrevious): call needed updateScrollbar
5045 * src/BufferView2.C (allFloats): don't call updateScrollbar after
5048 * src/BufferView.[Ch] (upCB): removed func
5049 (downCB): removed func
5050 (smallUpdate): removed func
5052 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5054 * src/lyxtext.h src/text.C src/text2.C: removed support for the
5055 currentrow, currentrow_y optimization. This did not help a lot and
5056 if we want to do this kind of optimization we should rather use
5057 cursor.row instead of the currentrow.
5059 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
5060 buffer spacing and klyx spacing support.
5062 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
5064 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5067 2000-04-26 Juergen Vigna <jug@sad.it>
5069 * src/insets/figinset.C: fixes to Lars sstream changes!
5071 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5073 * A lot of files: Added Ascii(ostream &) methods to all inset
5074 classes. Used when exporting to ASCII.
5076 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5077 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5080 * src/text2.C (ToggleFree): Disabled implicit word selection when
5081 there is a change in the language
5083 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5084 no output was generated for end-of-sentence inset.
5086 * src/insets/lyxinset.h
5089 * src/paragraph.C: Removed the insetnumber code
5091 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5093 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5095 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5096 no_babel and no_epsfig completely from the file.
5097 (parseSingleLyXformat2Token): add handling for per-paragraph
5098 spacing as written by klyx.
5100 * src/insets/figinset.C: applied patch by Andre. Made it work with
5103 2000-04-20 Juergen Vigna <jug@sad.it>
5105 * src/insets/insettext.C (cutSelection):
5106 (copySelection): Fixed with selection from right to left.
5107 (draw): now the rows are not recalculated at every draw.
5108 (computeTextRows): for now reset the inset-owner here (this is
5109 important for an undo or copy where the inset-owner is not set
5112 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5113 motion to the_locking_inset screen->first was forgotten, this was
5114 not important till we got multiline insets.
5116 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5118 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5119 code seems to be alright (it is code changed by Dekel, and the
5120 intent is indeed that all macros should be defined \protect'ed)
5122 * NEWS: a bit of reorganisation of the new user-visible features.
5124 2000-04-19 Juergen Vigna <jug@sad.it>
5126 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5127 position. Set the inset_owner of the used paragraph so that it knows
5128 that it is inside an inset. Fixed cursor handling with mouse and
5129 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5130 and cleanups to make TextInsets work better.
5132 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5133 Changed parameters of various functions and added LockInsetInInset().
5135 * src/insets/insettext.C:
5137 * src/insets/insetcollapsable.h:
5138 * src/insets/insetcollapsable.C:
5139 * src/insets/insetfoot.h:
5140 * src/insets/insetfoot.C:
5141 * src/insets/insetert.h:
5142 * src/insets/insetert.C: cleaned up the code so that it works now
5143 correctly with insettext.
5145 * src/insets/inset.C:
5146 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5147 that insets in insets are supported right.
5150 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5152 * src/paragraph.C: some small fixes
5154 * src/debug.h: inserted INSETS debug info
5156 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5157 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5159 * src/commandtags.h:
5160 * src/LyXAction.C: insert code for InsetTabular.
5162 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5163 not Button1MotionMask.
5164 (workAreaButtonRelease): send always a InsetButtonRelease event to
5166 (checkInsetHit): some setCursor fixes (always with insets).
5168 * src/BufferView2.C (lockInset): returns a bool now and extended for
5169 locking insets inside insets.
5170 (showLockedInsetCursor): it is important to have the cursor always
5171 before the locked inset.
5172 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5174 * src/BufferView.h: made lockInset return a bool.
5176 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5178 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5179 that is used also internally but can be called as public to have back
5180 a cursor pos which is not set internally.
5181 (SetCursorIntern): Changed to use above function.
5183 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5185 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5190 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5191 patches for things that should be in or should be changed.
5193 * src/* [insetfiles]: change "usigned char fragile" to bool
5194 fragile. There was only one point that could that be questioned
5195 and that is commented in formulamacro.C. Grep for "CHECK".
5197 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5198 (DeleteBuffer): take it out of CutAndPaste and make it static.
5200 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5202 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5203 output the spacing envir commands. Also the new commands used in
5204 the LaTeX output makes the result better.
5206 * src/Spacing.C (writeEnvirBegin): new method
5207 (writeEnvirEnd): new method
5209 2000-04-18 Juergen Vigna <jug@sad.it>
5211 * src/CutAndPaste.C: made textclass a static member of the class
5212 as otherwise it is not accesed right!!!
5214 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5216 * forms/layout_forms.fd
5217 * src/layout_forms.h
5218 * src/layout_forms.C (create_form_form_character)
5219 * src/lyx_cb.C (UserFreeFont)
5220 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5221 documents (in the layout->character popup).
5223 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5225 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5226 \spell_command was in fact not honored (from Kevin Atkinson).
5228 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5231 * src/lyx_gui.h: make lyxViews private (Angus)
5233 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5235 * src/mathed/math_write.C
5236 (MathMatrixInset::Write) Put \protect before \begin{array} and
5237 \end{array} if fragile
5238 (MathParInset::Write): Put \protect before \\ if fragile
5240 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5242 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5243 initialization if the LyXColorHandler must be done after the
5244 connections to the XServer has been established.
5246 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5247 get the background pixel from the lyxColorhandler so that the
5248 figures are rendered with the correct background color.
5249 (NextToken): removed functions.
5250 (GetPSSizes): use ifs >> string instead of NextToken.
5252 * src/Painter.[Ch]: the color cache moved out of this file.
5254 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5257 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5259 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5260 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5262 * src/BufferView.C (enterView): new func
5263 (leaveView): new func
5265 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5267 (leaveView): new func, undefines xterm cursor when approp.
5269 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5270 (AllowInput): delete the Workarea cursor handling from this func.
5272 * src/Painter.C (underline): draw a slimer underline in most cases.
5274 * src/lyx_main.C (error_handler): use extern "C"
5276 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5278 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5279 sent directly to me.
5281 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5282 to the list by Dekel.
5284 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5287 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5288 methods from lyx_cb.here.
5290 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5293 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5295 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5296 instead of using current_view directly.
5298 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5300 * src/LyXAction.C (init): add the paragraph-spacing command.
5302 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5304 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5306 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5307 different from the documents.
5309 * src/text.C (SetHeightOfRow): take paragraph spacing into
5310 account, paragraph spacing takes precedence over buffer spacing
5311 (GetVisibleRow): ditto
5313 * src/paragraph.C (writeFile): output the spacing parameter too.
5314 (validate): set the correct features if spacing is used in the
5316 (Clear): set spacing to default
5317 (MakeSameLayout): spacing too
5318 (HasSameLayout): spacing too
5319 (SetLayout): spacing too
5320 (TeXOnePar): output the spacing commands
5322 * src/lyxparagraph.h: added a spacing variable for use with
5323 per-paragraph spacing.
5325 * src/Spacing.h: add a Default spacing and a method to check if
5326 the current spacing is default. also added an operator==
5328 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5331 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5333 * src/lyxserver.C (callback): fix dispatch of functions
5335 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5336 printf() into lyxerr call.
5338 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5341 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5342 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5343 the "Float" from each of the subitems.
5344 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5346 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5347 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5348 documented the change so that the workaround can be nuked later.
5350 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5353 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5355 * src/buffer.C (getLatexName): ditto
5356 (setReadonly): ditto
5358 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5360 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5361 avoid some uses of current_view. Added also a bufferParams()
5362 method to get at this.
5364 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5366 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5368 * src/lyxparagraph.[Ch]: removed
5369 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5370 with operators used by lower_bound and
5371 upper_bound in InsetTable's
5372 Make struct InsetTable private again. Used matchpos.
5374 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5376 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5377 document, the language of existing text is changed (unless the
5378 document is multi-lingual)
5380 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5382 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5384 * A lot of files: A rewrite of the Right-to-Left support.
5386 2000-04-10 Juergen Vigna <jug@sad.it>
5388 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5389 misplaced cursor when inset in inset is locked.
5391 * src/insets/insettext.C (LocalDispatch): small fix so that a
5392 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5394 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5395 footnote font should be decreased in size twice when displaying.
5397 * src/insets/insettext.C (GetDrawFont): inserted this function as
5398 the drawing-font may differ from the real paragraph font.
5400 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5401 insets (inset in inset!).
5403 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5404 function here because we don't want footnotes inside footnotes.
5406 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5408 (init): now set the inset_owner in paragraph.C
5409 (LocalDispatch): added some resetPos() in the right position
5412 (pasteSelection): changed to use the new CutAndPaste-Class.
5414 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5415 which tells if it is allowed to insert another inset inside this one.
5417 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5418 SwitchLayoutsBetweenClasses.
5420 * src/text2.C (InsertInset): checking of the new paragraph-function
5422 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5423 is not needed anymore here!
5426 (PasteSelection): redone (also with #ifdef) so that now this uses
5427 the CutAndPaste-Class.
5428 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5431 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5432 from/to text/insets.
5434 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5435 so that the paragraph knows if it is inside an (text)-inset.
5436 (InsertFromMinibuffer): changed return-value to bool as now it
5437 may happen that an inset is not inserted in the paragraph.
5438 (InsertInsetAllowed): this checks if it is allowed to insert an
5439 inset in this paragraph.
5441 (BreakParagraphConservative):
5442 (BreakParagraph) : small change for the above change of the return
5443 value of InsertFromMinibuffer.
5445 * src/lyxparagraph.h: added inset_owner and the functions to handle
5446 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5448 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5450 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5451 functions from BufferView to BufferView::Pimpl to ease maintence.
5453 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5454 correctly. Also use SetCursorIntern instead of SetCursor.
5456 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5459 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5461 * src/WorkArea.C (belowMouse): manually implement below mouse.
5463 * src/*: Add "explicit" on several constructors, I added probably
5464 some unneeded ones. A couple of changes to code because of this.
5466 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5467 implementation and private parts from the users of BufferView. Not
5470 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5471 implementation and private parts from the users of LyXLex. Not
5474 * src/BufferView_pimpl.[Ch]: new files
5476 * src/lyxlex_pimpl.[Ch]: new files
5478 * src/LyXView.[Ch]: some inline functions move out-of-line
5480 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5482 * src/lyxparagraph.h: make struct InsetTable public.
5484 * src/support/lyxstring.h: change lyxstring::difference_type to be
5485 ptrdiff_t. Add std:: modifiers to streams.
5487 * src/font.C: include the <cctype> header, for islower() and
5490 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5492 * src/font.[Ch]: new files. Contains the metric functions for
5493 fonts, takes a LyXFont as parameter. Better separation of concepts.
5495 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5496 changes because of this.
5498 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5500 * src/*: compile with -Winline and move functions that don't
5503 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5506 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5508 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5509 (various files changed because of this)
5511 * src/Painter.C (text): fixed the drawing of smallcaps.
5513 * src/lyxfont.[Ch] (drawText): removed unused member func.
5516 * src/*.C: added needed "using" statements and "std::" qualifiers.
5518 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5520 * src/*.h: removed all use of "using" from header files use
5521 qualifier std:: instead.
5523 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5525 * src/text.C (Backspace): some additional cleanups (we already
5526 know whether cursor.pos is 0 or not).
5528 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5529 automake does not provide one).
5531 * src/bmtable.h: replace C++ comments with C comments.
5533 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5535 * src/screen.C (ShowCursor): Change the shape of the cursor if
5536 the current language is not equal to the language of the document.
5537 (If the cursor change its shape unexpectedly, then you've found a bug)
5539 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5542 * src/insets/insetnumber.[Ch]: New files.
5544 * src/LyXAction.C (init)
5545 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5548 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5550 * src/lyxparagraph.h
5551 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5552 (the vector is kept sorted).
5554 * src/text.C (GetVisibleRow): Draw selection correctly when there
5555 is both LTR and RTL text.
5557 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5558 which is much faster.
5560 * src/text.C (GetVisibleRow and other): Do not draw the last space
5561 in a row if the direction of the last letter is not equal to the
5562 direction of the paragraph.
5564 * src/lyxfont.C (latexWriteStartChanges):
5565 Check that font language is not equal to basefont language.
5566 (latexWriteEndChanges): ditto
5568 * src/lyx_cb.C (StyleReset): Don't change the language while using
5569 the font-default command.
5571 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5572 empty paragraph before a footnote.
5574 * src/insets/insetcommand.C (draw): Increase x correctly.
5576 * src/screen.C (ShowCursor): Change cursor shape if
5577 current language != document language.
5579 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5581 2000-03-31 Juergen Vigna <jug@sad.it>
5583 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5584 (Clone): changed mode how the paragraph-data is copied to the
5585 new clone-paragraph.
5587 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5588 GetInset(pos) with no inset anymore there (in inset UNDO)
5590 * src/insets/insetcommand.C (draw): small fix as here x is
5591 incremented not as much as width() returns (2 before, 2 behind = 4)
5593 2000-03-30 Juergen Vigna <jug@sad.it>
5595 * src/insets/insettext.C (InsetText): small fix in initialize
5596 widthOffset (should not be done in the init() function)
5598 2000-03-29 Amir Karger <karger@lyx.org>
5600 * lib/examples/it_ItemizeBullets.lyx: translation by
5603 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5605 2000-03-29 Juergen Vigna <jug@sad.it>
5607 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5609 * src/insets/insetfoot.C (Clone): small change as for the below
5610 new init function in the text-inset
5612 * src/insets/insettext.C (init): new function as I've seen that
5613 clone did not copy the Paragraph-Data!
5614 (LocalDispatch): Added code so that now we have some sort of Undo
5615 functionality (well actually we HAVE Undo ;)
5617 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5619 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5621 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5624 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5626 * src/main.C: added a runtime check that verifies that the xforms
5627 header used when building LyX and the library used when running
5628 LyX match. Exit with a message if they don't match. This is a
5629 version number check only.
5631 * src/buffer.C (save): Don't allocate memory on the heap for
5632 struct utimbuf times.
5634 * *: some using changes, use iosfwd instead of the real headers.
5636 * src/lyxfont.C use char const * instead of string for the static
5637 strings. Rewrite some functions to use sstream.
5639 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5641 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5644 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5646 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5647 of Geodesy (from Martin Vermeer)
5649 * lib/layouts/svjour.inc: include file for the Springer svjour
5650 class. It can be used to support journals other than JoG.
5652 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5653 Miskiewicz <misiek@pld.org.pl>)
5654 * lib/reLyX/Makefile.am: ditto.
5656 2000-03-27 Juergen Vigna <jug@sad.it>
5658 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5659 also some modifications with operations on selected text.
5661 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5662 problems with clicking on insets (last famous words ;)
5664 * src/insets/insetcommand.C (draw):
5665 (width): Changed to have a bit of space before and after the inset so
5666 that the blinking cursor can be seen (otherwise it was hidden)
5668 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5670 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5671 would not be added to the link list when an installed gettext (not
5672 part of libc) is found.
5674 2000-03-24 Juergen Vigna <jug@sad.it>
5676 * src/insets/insetcollapsable.C (Edit):
5677 * src/mathed/formula.C (InsetButtonRelease):
5678 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5681 * src/BufferView.C (workAreaButtonPress):
5682 (workAreaButtonRelease):
5683 (checkInsetHit): Finally fixed the clicking on insets be handled
5686 * src/insets/insetert.C (Edit): inserted this call so that ERT
5687 insets work always with LaTeX-font
5689 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5691 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5692 caused lyx to startup with no GUI in place, causing in a crash
5693 upon startup when called with arguments.
5695 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5697 * src/FontLoader.C: better initialization of dummyXFontStruct.
5699 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5701 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5702 for linuxdoc and docbook import and export format options.
5704 * lib/lyxrc.example Example of default values for the previous flags.
5706 * src/lyx_cb.C Use those flags instead of the hardwired values for
5707 linuxdoc and docbook export.
5709 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5712 * src/menus.C Added menus entries for the new import/exports formats.
5714 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5716 * src/lyxrc.*: Added support for running without Gui
5719 * src/FontLoader.C: sensible defaults if no fonts are needed
5721 * src/lyx_cb.C: New function ShowMessage (writes either to the
5722 minibuffer or cout in case of no gui
5723 New function AskOverwrite for common stuff
5724 Consequently various changes to call these functions
5726 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5727 wild guess at sensible screen resolution when having no gui
5729 * src/lyxfont.C: no gui, no fonts... set some defaults
5731 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5733 * src/LColor.C: made the command inset background a bit lighter.
5735 2000-03-20 Hartmut Goebel <goebel@noris.net>
5737 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5738 stdstruct.inc. Koma-Script added some title elements which
5739 otherwise have been listed below "bibliography". This split allows
5740 adding title elements to where they belong.
5742 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5743 define the additional tilte elements and then include
5746 * many other layout files: changed to include stdtitle.inc just
5747 before stdstruct.inc.
5749 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5751 * src/buffer.C: (save) Added the option to store all backup files
5752 in a single directory
5754 * src/lyxrc.[Ch]: Added variable \backupdir_path
5756 * lib/lyxrc.example: Added descriptions of recently added variables
5758 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5759 bibtex inset, not closing the bibtex popup when deleting the inset)
5761 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5763 * src/lyx_cb.C: add a couple using directives.
5765 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5766 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5767 import based on the filename.
5769 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5770 file would be imported at start, if the filename where of a sgml file.
5772 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5774 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5776 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5777 * src/lyxfont.h Replaced the member variable bits.direction by the
5778 member variable lang. Made many changes in other files.
5779 This allows having a multi-lingual document
5781 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5782 that change the current language to <l>.
5783 Removed the command "font-rtl"
5785 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5786 format for Hebrew documents)
5788 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5789 When auto_mathmode is "true", pressing a digit key in normal mode
5790 will cause entering into mathmode.
5791 If auto_mathmode is "rtl" then this behavior will be active only
5792 when writing right-to-left text.
5794 * src/text2.C (InsertStringA) The string is inserted using the
5797 * src/paragraph.C (GetEndLabel) Gives a correct result for
5798 footnote paragraphs.
5800 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5802 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5804 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5805 front of PasteParagraph. Never insert a ' '. This should at least
5806 fix some cause for the segfaults that we have been experiencing,
5807 it also fixes backspace behaviour slightly. (Phu!)
5809 * src/support/lstrings.C (compare_no_case): some change to make it
5810 compile with gcc 2.95.2 and stdlibc++-v3
5812 * src/text2.C (MeltFootnoteEnvironment): change type o
5813 first_footnote_par_is_not_empty to bool.
5815 * src/lyxparagraph.h: make text private. Changes in other files
5817 (fitToSize): new function
5818 (setContentsFromPar): new function
5819 (clearContents): new function
5820 (SetChar): new function
5822 * src/paragraph.C (readSimpleWholeFile): deleted.
5824 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5825 the file, just use a simple string instead. Also read the file in
5826 a more maintainable manner.
5828 * src/text2.C (InsertStringA): deleted.
5829 (InsertStringB): deleted.
5831 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5833 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5834 RedoParagraphs from the doublespace handling part, just set status
5835 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5836 done, but perhaps not like this.)
5838 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5840 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5841 character when inserting an inset.
5843 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5845 * src/bufferparams.C (readLanguage): now takes "default" into
5848 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5849 also initialize the toplevel_keymap with the default bindings from
5852 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5854 * all files using lyxrc: have lyxrc as a real variable and not a
5855 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5858 * src/lyxrc.C: remove double call to defaultKeyBindings
5860 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5861 toolbar defauls using lyxlex. Remove enums, structs, functions
5864 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5865 toolbar defaults. Also store default keybindings in a map.
5867 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5868 storing the toolbar defaults without any xforms dependencies.
5870 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5871 applied. Changed to use iterators.
5873 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5875 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5876 systems that don't have LINGUAS set to begin with.
5878 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5880 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5881 the list by Dekel Tsur.
5883 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5885 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5886 * src/insets/form_graphics.C: ditto.
5888 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5890 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5892 * src/bufferparams.C (readLanguage): use the new language map
5894 * src/intl.C (InitKeyMapper): use the new language map
5896 * src/lyx_gui.C (create_forms): use the new language map
5898 * src/language.[Ch]: New files. Used for holding the information
5899 about each language. Now! Use this new language map enhance it and
5900 make it really usable for our needs.
5902 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5904 * screen.C (ShowCursor): Removed duplicate code.
5905 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5906 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5908 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5911 * src/text.C Added TransformChar method. Used for rendering Arabic
5912 text correctly (change the glyphs of the letter according to the
5913 position in the word)
5918 * src/lyxrc.C Added lyxrc command {language_command_begin,
5919 language_command_end,language_command_ltr,language_command_rtl,
5920 language_package} which allows the use of either arabtex or Omega
5923 * src/lyx_gui.C (init)
5925 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5926 to use encoding for menu fonts which is different than the encoding
5929 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5930 do not load the babel package.
5931 To write an English document with Hebrew/Arabic, change the document
5932 language to "english".
5934 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5935 (alphaCounter): changed to return char
5936 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5938 * lib/lyxrc.example Added examples for Hebrew/Arabic
5941 * src/layout.C Added layout command endlabeltype
5943 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5945 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5947 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5949 * src/mathed/math_delim.C (search_deco): return a
5950 math_deco_struct* instead of index.
5952 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5954 * All files with a USE_OSTREAM_ONLY within: removed all code that
5955 was unused when USE_OSTREAM_ONLY is defined.
5957 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5958 of any less. Removed header and using.
5960 * src/text.C (GetVisibleRow): draw the string "Page Break
5961 (top/bottom)" on screen when drawing a pagebreak line.
5963 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5965 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5967 * src/mathed/math_macro.C (draw): do some cast magic.
5970 * src/mathed/math_defs.h: change byte* argument to byte const*.
5972 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5974 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5975 know it is right to return InsetFoot* too, but cxx does not like
5978 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5980 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5982 * src/mathed/math_delim.C: change == to proper assignment.
5984 2000-03-09 Juergen Vigna <jug@sad.it>
5986 * src/insets/insettext.C (setPos): fixed various cursor positioning
5987 problems (via mouse and cursor-keys)
5988 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5989 inset (still a small display problem but it works ;)
5991 * src/insets/insetcollapsable.C (draw): added button_top_y and
5992 button_bottom_y to have correct values for clicking on the inset.
5994 * src/support/lyxalgo.h: commented out 'using std::less'
5996 2000-03-08 Juergen Vigna <jug@sad.it>
5998 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5999 Button-Release event closes as it is alos the Release-Event
6002 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
6004 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6006 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
6007 can add multiple spaces in Scrap (literate programming) styles...
6008 which, by the way, is how I got hooked on LyX to begin with.
6010 * src/mathed/formula.C (Write): Added dummy variable to an
6011 inset::Latex() call.
6012 (Latex): Add free_spacing boolean to inset::Latex()
6014 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
6016 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
6017 virtual function to include the free_spacing boolean from
6018 the containing paragraph's style.
6020 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
6021 Added free_spacing boolean arg to match inset.h
6023 * src/insets/insettext.C, src/insets/insettext.h (Latex):
6024 Added free_spacing boolean arg to match inset.h
6026 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
6027 Added free_spacing boolean and made sure that if in a free_spacing
6028 paragraph, that we output normal space if there is a protected space.
6030 * src/insets/insetref.C, src/insets/insetref.h (Latex):
6031 Added free_spacing boolean arg to match inset.h
6033 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
6034 Added free_spacing boolean arg to match inset.h
6036 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
6037 Added free_spacing boolean arg to match inset.h
6039 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
6040 Added free_spacing boolean arg to match inset.h
6042 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
6043 Added free_spacing boolean arg to match inset.h
6045 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
6046 free_spacing boolean arg to match inset.h
6048 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
6049 Added free_spacing boolean arg to match inset.h
6051 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
6052 Added free_spacing boolean arg to match inset.h
6054 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
6055 Added free_spacing boolean arg to match inset.h
6057 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
6058 Added free_spacing boolean arg to match inset.h
6060 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
6061 Added free_spacing boolean arg to match inset.h
6063 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
6064 free_spacing boolean arg to match inset.h
6066 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6067 free_spacing boolean arg to match inset.h
6069 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6070 ignore free_spacing paragraphs. The user's spaces are left
6073 * src/text.C (InsertChar): Fixed the free_spacing layout
6074 attribute behavior. Now, if free_spacing is set, you can
6075 add multiple spaces in a paragraph with impunity (and they
6076 get output verbatim).
6077 (SelectSelectedWord): Added dummy argument to inset::Latex()
6080 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6083 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6084 paragraph layouts now only input a simple space instead.
6085 Special character insets don't make any sense in free-spacing
6088 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6089 hard-spaces in the *input* file to simple spaces if the layout
6090 is free-spacing. This converts old files which had to have
6091 hard-spaces in free-spacing layouts where a simple space was
6093 (writeFileAscii): Added free_spacing check to pass to the newly
6094 reworked inset::Latex(...) methods. The inset::Latex() code
6095 ensures that hard-spaces in free-spacing paragraphs get output
6096 as spaces (rather than "~").
6098 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6100 * src/mathed/math_delim.C (draw): draw the empty placeholder
6101 delims with a onoffdash line.
6102 (struct math_deco_compare): struct that holds the "functors" used
6103 for the sort and the binary search in math_deco_table.
6104 (class init_deco_table): class used for initial sort of the
6106 (search_deco): use lower_bound to do a binary search in the
6109 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6111 * src/lyxrc.C: a small secret thingie...
6113 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6114 and to not flush the stream as often as it used to.
6116 * src/support/lyxalgo.h: new file
6117 (sorted): template function used for checking if a sequence is
6118 sorted or not. Two versions with and without user supplied
6119 compare. Uses same compare as std::sort.
6121 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6122 it and give warning on lyxerr.
6124 (struct compare_tags): struct with function operators used for
6125 checking if sorted, sorting and lower_bound.
6126 (search_kw): use lower_bound instead of manually implemented
6129 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6131 * src/insets/insetcollapsable.h: fix Clone() declaration.
6132 * src/insets/insetfoot.h: ditto.
6134 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6136 2000-03-08 Juergen Vigna <jug@sad.it>
6138 * src/insets/lyxinset.h: added owner call which tells us if
6139 this inset is inside another inset. Changed also the return-type
6140 of Editable to an enum so it tells clearer what the return-value is.
6142 * src/insets/insettext.C (computeTextRows): fixed computing of
6143 textinsets which split automatically on more rows.
6145 * src/insets/insetert.[Ch]: changed this to be of BaseType
6148 * src/insets/insetfoot.[Ch]: added footnote inset
6150 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6151 collapsable insets (like footnote, ert, ...)
6153 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6155 * src/lyxdraw.h: remvoe file
6157 * src/lyxdraw.C: remove file
6159 * src/insets/insettext.C: added <algorithm>.
6161 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6163 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6164 (matrix_cb): case MM_OK use string stream
6166 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6169 * src/mathed/math_macro.C (draw): use string stream
6170 (Metrics): use string stream
6172 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6173 directly to the ostream.
6175 * src/vspace.C (asString): use string stream.
6176 (asString): use string stream
6177 (asLatexString): use string stream
6179 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6180 setting Spacing::Other.
6182 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6183 sprintf when creating the stretch vale.
6185 * src/text2.C (alphaCounter): changed to return a string and to
6186 not use a static variable internally. Also fixed a one-off bug.
6187 (SetCounter): changed the drawing of the labels to use string
6188 streams instead of sprintf.
6190 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6191 manipulator to use a scheme that does not require library support.
6192 This is also the way it is done in the new GNU libstdc++. Should
6193 work with DEC cxx now.
6195 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6197 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6198 end. This fixes a bug.
6200 * src/mathed (all files concerned with file writing): apply the
6201 USE_OSTREAM_ONLY changes to mathed too.
6203 * src/support/DebugStream.h: make the constructor explicit.
6205 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6206 count and ostream squashed.
6208 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6210 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6212 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6213 ostringstream uses STL strings, and we might not.
6215 * src/insets/insetspecialchar.C: add using directive.
6216 * src/insets/insettext.C: ditto.
6218 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6220 * lib/layouts/seminar.layout: feeble attempt at a layout for
6221 seminar.cls, far from completet and could really use some looking
6222 at from people used to write layout files.
6224 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6225 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6226 a lot nicer and works nicely with ostreams.
6228 * src/mathed/formula.C (draw): a slightly different solution that
6229 the one posted to the list, but I think this one works too. (font
6230 size wrong in headers.)
6232 * src/insets/insettext.C (computeTextRows): some fiddling on
6233 Jürgens turf, added some comments that he should read.
6235 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6236 used and it gave compiler warnings.
6237 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6240 * src/lyx_gui.C (create_forms): do the right thing when
6241 show_banner is true/false.
6243 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6244 show_banner is false.
6246 * most file writing files: Now use iostreams to do almost all of
6247 the writing. Also instead of passing string &, we now use
6248 stringstreams. mathed output is still not adapted to iostreams.
6249 This change can be turned off by commenting out all the occurences
6250 of the "#define USE_OSTREAM_ONLY 1" lines.
6252 * src/WorkArea.C (createPixmap): don't output debug messages.
6253 (WorkArea): don't output debug messages.
6255 * lib/lyxrc.example: added a comment about the new variable
6258 * development/Code_rules/Rules: Added some more commente about how
6259 to build class interfaces and on how better encapsulation can be
6262 2000-03-03 Juergen Vigna <jug@sad.it>
6264 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6265 automatically with the width of the LyX-Window
6267 * src/insets/insettext.C (computeTextRows): fixed update bug in
6268 displaying text-insets (scrollvalues where not initialized!)
6270 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6272 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6273 id in the check of the result from lower_bound is not enough since
6274 lower_bound can return last too, and then res->id will not be a
6277 * all insets and some code that use them: I have conditionalized
6278 removed the Latex(string & out, ...) this means that only the
6279 Latex(ostream &, ...) will be used. This is a work in progress to
6280 move towards using streams for all output of files.
6282 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6285 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6287 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6288 routine (this fixes bug where greek letters were surrounded by too
6291 * src/support/filetools.C (findtexfile): change a bit the search
6292 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6293 no longer passed to kpsewhich, we may have to change that later.
6295 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6296 warning options to avoid problems with X header files (from Angus
6298 * acinclude.m4: regenerated.
6300 2000-03-02 Juergen Vigna <jug@sad.it>
6302 * src/insets/insettext.C (WriteParagraphData): Using the
6303 par->writeFile() function for writing paragraph-data.
6304 (Read): Using buffer->parseSingleLyXformat2Token()-function
6305 for parsing paragraph data!
6307 * src/buffer.C (readLyXformat2): removed all parse data and using
6308 the new parseSingleLyXformat2Token()-function.
6309 (parseSingleLyXformat2Token): added this function to parse (read)
6310 lyx-file-format (this is called also from text-insets now!)
6312 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6314 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6317 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6318 directly instead of going through a func. One very bad thing: a
6319 static LyXFindReplace, but I don't know where to place it.
6321 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6322 string instead of char[]. Also changed to static.
6323 (GetSelectionOrWordAtCursor): changed to static inline
6324 (SetSelectionOverLenChars): ditto.
6326 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6327 current_view and global variables. both classes has changed names
6328 and LyXFindReplace is not inherited from SearchForm.
6330 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6331 fl_form_search form.
6333 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6335 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6337 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6338 bound (from Kayvan).
6340 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6342 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6344 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6346 * some things that I should comment but the local pub says head to
6349 * comment out all code that belongs to the Roff code for Ascii
6350 export of tables. (this is unused)
6352 * src/LyXView.C: use correct type for global variable
6353 current_layout. (LyXTextClass::size_type)
6355 * some code to get the new insetgraphics closer to working I'd be
6356 grateful for any help.
6358 * src/BufferView2.C (insertInset): use the return type of
6359 NumberOfLayout properly. (also changes in other files)
6361 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6362 this as a test. I want to know what breaks because of this.
6364 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6366 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6368 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6369 to use a \makebox in the label, this allows proper justification
6370 with out using protected spaces or multiple hfills. Now it is
6371 "label" for left justified, "\hfill label\hfill" for center, and
6372 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6373 should be changed accordingly.
6375 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6377 * src/lyxtext.h: change SetLayout() to take a
6378 LyXTextClass::size_type instead of a char (when there is more than
6379 127 layouts in a class); also change type of copylayouttype.
6380 * src/text2.C (SetLayout): ditto.
6381 * src/LyXView.C (updateLayoutChoice): ditto.
6383 * src/LaTeX.C (scanLogFile): errors where the line number was not
6384 given just after the '!'-line were ignored (from Dekel Tsur).
6386 * lib/lyxrc.example: fix description of \date_insert_format
6388 * lib/layouts/llncs.layout: new layout, contributed by Martin
6391 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6393 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6394 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6395 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6396 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6397 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6398 paragraph.C, text.C, text2.C)
6400 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6402 * src/insets/insettext.C (LocalDispatch): remove extra break
6405 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6406 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6408 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6409 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6411 * src/insets/insetbib.h: move InsetBibkey::Holder and
6412 InsetCitation::Holder in public space.
6414 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6416 * src/insets/insettext.h: small change to get the new files from
6417 Juergen to compile (use "string", not "class string").
6419 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6420 const & as parameter to LocalDispatch, use LyXFont const & as
6421 paramter to some other func. This also had impacto on lyxinsets.h
6422 and the two mathed insets.
6424 2000-02-24 Juergen Vigna <jug@sad.it>
6427 * src/commandtags.h:
6429 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6433 * src/BufferView2.C: added/updated code for various inset-functions
6435 * src/insets/insetert.[Ch]: added implementation of InsetERT
6437 * src/insets/insettext.[Ch]: added implementation of InsetText
6439 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6440 (draw): added preliminary code for inset scrolling not finshed yet
6442 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6443 as it is in lyxfunc.C now
6445 * src/insets/lyxinset.h: Added functions for text-insets
6447 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6449 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6450 BufferView and reimplement the list as a queue put inside its own
6453 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6455 * several files: use the new interface to the "updateinsetlist"
6457 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6459 (work_area_handler): call BufferView::trippleClick on trippleclick.
6461 * src/BufferView.C (doubleClick): new function, selects word on
6463 (trippleClick): new function, selects line on trippleclick.
6465 2000-02-22 Allan Rae <rae@lyx.org>
6467 * lib/bind/xemacs.bind: buffer-previous not supported
6469 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6471 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6474 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6476 * src/bufferlist.C: get rid of current_view from this file
6478 * src/spellchecker.C: get rid of current_view from this file
6480 * src/vspace.C: get rid of current_view from this file
6481 (inPixels): added BufferView parameter for this func
6482 (asLatexCommand): added a BufferParams for this func
6484 * src/text.C src/text2.C: get rid of current_view from these
6487 * src/lyxfont.C (getFontDirection): move this function here from
6490 * src/bufferparams.C (getDocumentDirection): move this function
6493 * src/paragraph.C (getParDirection): move this function here from
6495 (getLetterDirection): ditto
6497 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6499 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6500 resize due to wrong pixmap beeing used. Also took the opurtunity
6501 to make the LyXScreen stateless on regard to WorkArea and some
6502 general cleanup in the same files.
6504 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6506 * src/Makefile.am: add missing direction.h
6508 * src/PainterBase.h: made the width functions const.
6510 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6513 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6515 * src/insets/insetlatexaccent.C (draw): make the accents draw
6516 better, at present this will only work well with iso8859-1.
6518 * several files: remove the old drawing code, now we use the new
6521 * several files: remove support for mono_video, reverse_video and
6524 2000-02-17 Juergen Vigna <jug@sad.it>
6526 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6527 int ** as we have to return the pointer, otherwise we have only
6528 NULL pointers in the returning function.
6530 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6532 * src/LaTeX.C (operator()): quote file name when running latex.
6534 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6536 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6537 (bubble tip), this removes our special handling of this.
6539 * Remove all code that is unused now that we have the new
6540 workarea. (Code that are not active when NEW_WA is defined.)
6542 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6544 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6546 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6547 nonexisting layout; correctly redirect obsoleted layouts.
6549 * lib/lyxrc.example: document \view_dvi_paper_option
6551 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6554 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6555 (PreviewDVI): handle the view_dvi_paper_option variable.
6556 [Both from Roland Krause]
6558 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6560 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6561 char const *, int, LyXFont)
6562 (text(int, int, string, LyXFont)): ditto
6564 * src/text.C (InsertCharInTable): attempt to fix the double-space
6565 feature in tables too.
6566 (BackspaceInTable): ditto.
6567 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6569 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6571 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6573 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6574 newly found text in textcache to this.
6575 (buffer): set the owner of the text put into the textcache to 0
6577 * src/insets/figinset.C (draw): fixed the drawing of figures with
6580 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6581 drawing of mathframe, hfills, protected space, table lines. I have
6582 now no outstanding drawing problems with the new Painter code.
6584 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6586 * src/PainterBase.C (ellipse, circle): do not specify the default
6589 * src/LColor.h: add using directive.
6591 * src/Painter.[Ch]: change return type of methods from Painter& to
6592 PainterBase&. Add a using directive.
6594 * src/WorkArea.C: wrap xforms callbacks in C functions
6597 * lib/layouts/foils.layout: font fix and simplifications from Carl
6600 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6602 * a lot of files: The Painter, LColor and WorkArea from the old
6603 devel branch has been ported to lyx-devel. Some new files and a
6604 lot of #ifdeffed code. The new workarea is enabled by default, but
6605 if you want to test the new Painter and LColor you have to compile
6606 with USE_PAINTER defined (do this in config.h f.ex.) There are
6607 still some rought edges, and I'd like some help to clear those
6608 out. It looks stable (loads and displays the Userguide very well).
6611 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6613 * src/buffer.C (pop_tag): revert to the previous implementation
6614 (use a global variable for both loops).
6616 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6618 * src/lyxrc.C (LyXRC): change slightly default date format.
6620 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6621 there is an English text with a footnote that starts with a Hebrew
6622 paragraph, or vice versa.
6623 (TeXFootnote): ditto.
6625 * src/text.C (LeftMargin): allow for negative values for
6626 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6629 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6630 for input encoding (cyrillic)
6632 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6634 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6637 * src/toolbar.C (set): ditto
6638 * src/insets/insetbib.C (create_form_citation_form): ditto
6640 * lib/CREDITS: added Dekel Tsur.
6642 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6643 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6644 hebrew supports files from Dekel Tsur.
6646 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6647 <tzafrir@technion.ac.il>
6649 * src/lyxrc.C: put \date_insert_format at the right place.
6651 * src/buffer.C (makeLaTeXFile): fix the handling of
6652 BufferParams::sides when writing out latex files.
6654 * src/BufferView2.C: add a "using" directive.
6656 * src/support/lyxsum.C (sum): when we use lyxstring,
6657 ostringstream::str needs an additional .c_str().
6659 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6661 * src/support/filetools.C (ChangeExtension): patch from Etienne
6664 * src/TextCache.C (show): remove const_cast and make second
6665 parameter non-const LyXText *.
6667 * src/TextCache.h: use non const LyXText in show.
6669 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6672 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6674 * src/support/lyxsum.C: rework to be more flexible.
6676 * several places: don't check if a pointer is 0 if you are going
6679 * src/text.C: remove some dead code.
6681 * src/insets/figinset.C: remove some dead code
6683 * src/buffer.C: move the BufferView funcs to BufferView2.C
6684 remove all support for insetlatexdel
6685 remove support for oldpapersize stuff
6686 made some member funcs const
6688 * src/kbmap.C: use a std::list to store the bindings in.
6690 * src/BufferView2.C: new file
6692 * src/kbsequence.[Ch]: new files
6694 * src/LyXAction.C + others: remove all trace of buffer-previous
6696 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6697 only have one copy in the binary of this table.
6699 * hebrew patch: moved some functions from LyXText to more
6700 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6702 * several files: remove support for XForms older than 0.88
6704 remove some #if 0 #endif code
6706 * src/TextCache.[Ch]: new file. Holds the textcache.
6708 * src/BufferView.C: changes to use the new TextCache interface.
6709 (waitForX): remove the now unused code.
6711 * src/BackStack.h: remove some commented code
6713 * lib/bind/emacs.bind: remove binding for buffer-previous
6715 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6717 * applied the hebrew patch.
6719 * src/lyxrow.h: make sure that all Row variables are initialized.
6721 * src/text2.C (TextHandleUndo): comment out a delete, this might
6722 introduce a memory leak, but should also help us to not try to
6723 read freed memory. We need to look at this one.
6725 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6726 (LyXParagraph): initalize footnotekind.
6728 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6729 forgot this when applying the patch. Please heed the warnings.
6731 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6732 (aka. reformat problem)
6734 * src/bufferlist.C (exists): made const, and use const_iterator
6735 (isLoaded): new func.
6736 (release): use std::find to find the correct buffer.
6738 * src/bufferlist.h: made getState a const func.
6739 made empty a const func.
6740 made exists a const func.
6743 2000-02-01 Juergen Vigna <jug@sad.it>
6745 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6747 * po/it.po: updated a bit the italian po file and also changed the
6748 'file nuovo' for newfile to 'filenuovo' without a space, this did
6751 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6752 for the new insert_date command.
6754 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6755 from jdblair, to insert a date into the current text conforming to
6756 a strftime format (for now only considering the locale-set and not
6757 the document-language).
6759 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6761 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6762 Bounds Read error seen by purify. The problem was that islower is
6763 a macros which takes an unsigned char and uses it as an index for
6764 in array of characters properties (and is thus subject to the
6768 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6769 correctly the paper sides radio buttons.
6770 (UpdateDocumentButtons): ditto.
6772 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6774 * src/kbmap.C (getsym + others): change to return unsigned int,
6775 returning a long can give problems on 64 bit systems. (I assume
6776 that int is 32bit on 64bit systems)
6778 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6780 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6781 LyXLookupString to be zero-terminated. Really fixes problems seen
6784 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6786 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6787 write a (char*)0 to the lyxerr stream.
6789 * src/lastfiles.C: move algorithm before the using statemets.
6791 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6793 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6794 complains otherwise).
6795 * src/table.C: ditto
6797 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6800 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6801 that I removed earlier... It is really needed.
6803 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6805 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6807 * INSTALL: update xforms home page URL.
6809 * lib/configure.m4: fix a bug with unreadable layout files.
6811 * src/table.C (calculate_width_of_column): add "using std::max"
6814 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6816 * several files: marked several lines with "DEL LINE", this is
6817 lines that can be deleted without changing anything.
6818 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6819 checks this anyway */
6822 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6824 * src/DepTable.C (update): add a "+" at the end when the checksum
6825 is different. (debugging string only)
6827 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6828 the next inset to not be displayed. This should also fix the list
6829 of labels in the "Insert Crossreference" dialog.
6831 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6833 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6834 when regex was not found.
6836 * src/support/lstrings.C (lowercase): use handcoded transform always.
6839 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6840 old_cursor.par->prev could be 0.
6842 * several files: changed post inc/dec to pre inc/dec
6844 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6845 write the lastfiles to file.
6847 * src/BufferView.C (buffer): only show TextCache info when debugging
6849 (resizeCurrentBuffer): ditto
6850 (workAreaExpose): ditto
6852 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6854 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6856 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6857 a bit better by removing the special case for \i and \j.
6859 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6861 * src/lyx_main.C (easyParse): remove test for bad comand line
6862 options, since this broke all xforms-related parsing.
6864 * src/kbmap.C (getsym): set return type to unsigned long, as
6865 declared in header. On an alpha, long is _not_ the same as int.
6867 * src/support/LOstream.h: add a "using std::flush;"
6869 * src/insets/figinset.C: ditto.
6871 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6873 * src/bufferlist.C (write): use blinding fast file copy instead of
6874 "a char at a time", now we are doing it the C++ way.
6876 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6877 std::list<int> instead.
6878 (addpidwait): reflect move to std::list<int>
6879 (sigchldchecker): ditto
6881 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6884 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6885 that obviously was wrong...
6887 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6888 c, this avoids warnings with purify and islower.
6890 * src/insets/figinset.C: rename struct queue to struct
6891 queue_element and rewrite to use a std::queue. gsqueue is now a
6892 std::queue<queue_element>
6893 (runqueue): reflect move to std::queue
6896 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6897 we would get "1" "0" instead of "true" "false. Also make the tostr
6900 2000-01-21 Juergen Vigna <jug@sad.it>
6902 * src/buffer.C (writeFileAscii): Disabled code for special groff
6903 handling of tabulars till I fix this in table.C
6905 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6907 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6909 * src/support/lyxlib.h: ditto.
6911 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6913 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6914 and 'j' look better. This might fix the "macron" bug that has been
6917 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6918 functions as one template function. Delete the old versions.
6920 * src/support/lyxsum.C: move using std::ifstream inside
6923 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6926 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6928 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6930 * src/insets/figinset.C (InitFigures): use new instead of malloc
6931 to allocate memory for figures and bitmaps.
6932 (DoneFigures): use delete[] instead of free to deallocate memory
6933 for figures and bitmaps.
6934 (runqueue): use new to allocate
6935 (getfigdata): use new/delete[] instead of malloc/free
6936 (RegisterFigure): ditto
6938 * some files: moved some declarations closer to first use, small
6939 whitespace changes use preincrement instead of postincrement where
6940 it does not make a difference.
6942 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6943 step on the way to use stl::containers for key maps.
6945 * src/bufferlist.h: add a typedef for const_iterator and const
6946 versions of begin and end.
6948 * src/bufferlist.[Ch]: change name of member variable _state to
6949 state_. (avoid reserved names)
6951 (getFileNames): returns the filenames of the buffers in a vector.
6953 * configure.in (ALL_LINGUAS): added ro
6955 * src/support/putenv.C: new file
6957 * src/support/mkdir.C: new file
6959 2000-01-20 Allan Rae <rae@lyx.org>
6961 * lib/layouts/IEEEtran.layout: Added several theorem environments
6963 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6964 couple of minor additions.
6966 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6967 (except for those in footnotes of course)
6969 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6971 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6973 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6974 std::sort and std::lower_bound instead of qsort and handwritten
6976 (struct compara): struct that holds the functors used by std::sort
6977 and std::lower_bound in MathedLookupBOP.
6979 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6981 * src/support/LAssert.h: do not do partial specialization. We do
6984 * src/support/lyxlib.h: note that lyx::getUserName() and
6985 lyx::date() are not in use right now. Should these be suppressed?
6987 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6988 (makeLinuxDocFile): do not put date and user name in linuxdoc
6991 * src/support/lyxlib.h (kill): change first argument to long int,
6992 since that's what solaris uses.
6994 * src/support/kill.C (kill): fix declaration to match prototype.
6996 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6997 actually check whether namespaces are supported. This is not what
7000 * src/support/lyxsum.C: add a using directive.
7002 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7004 * src/support/kill.C: if we have namespace support we don't have
7005 to include lyxlib.h.
7007 * src/support/lyxlib.h: use namespace lyx if supported.
7009 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7011 * src/support/date.C: new file
7013 * src/support/chdir.C: new file
7015 * src/support/getUserName.C: new file
7017 * src/support/getcwd.C: new file
7019 * src/support/abort.C: new file
7021 * src/support/kill.C: new file
7023 * src/support/lyxlib.h: moved all the functions in this file
7024 insede struct lyx. Added also kill and abort to this struct. This
7025 is a way to avoid the "kill is not defined in <csignal>", we make
7026 C++ wrappers for functions that are not ANSI C or ANSI C++.
7028 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
7029 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
7030 lyx it has been renamed to sum.
7032 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7034 * src/text.C: add using directives for std::min and std::max.
7036 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7038 * src/texrow.C (getIdFromRow): actually return something useful in
7039 id and pos. Hopefully fixes the bug with positionning of errorbox
7042 * src/lyx_main.C (easyParse): output an error and exit if an
7043 incorrect command line option has been given.
7045 * src/spellchecker.C (ispell_check_word): document a memory leak.
7047 * src/bufferlist.C (write): fix mismatched allocation/deletion,
7048 where a "struct utimbuf" is allocated with "new" and deleted with
7051 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
7053 * src/text2.C (CutSelection): don't delete double spaces.
7054 (PasteSelection): ditto
7055 (CopySelection): ditto
7057 * src/text.C (Backspace): don't delete double spaces.
7059 * src/lyxlex.C (next): fix a bug that were only present with
7060 conformant std::istream::get to read comment lines, use
7061 std::istream::getline instead. This seems to fix the problem.
7063 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7065 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7066 allowed to insert space before space" editing problem. Please read
7067 commends at the beginning of the function. Comments about usage
7070 * src/text.C (InsertChar): fix for the "not allowed to insert
7071 space before space" editing problem.
7073 * src/text2.C (DeleteEmptyParagraphMechanism): when
7074 IsEmptyTableRow can only return false this last "else if" will
7075 always be a no-op. Commented out.
7077 * src/text.C (RedoParagraph): As far as I can understand tmp
7078 cursor is not really needed.
7080 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7081 present it could only return false anyway.
7082 (several functions): Did something not so smart...added a const
7083 specifier on a lot of methods.
7085 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7086 and add a tmp->text.resize. The LyXParagraph constructor does the
7088 (BreakParagraphConservative): ditto
7090 * src/support/path.h (Path): add a define so that the wrong usage
7091 "Path("/tmp") will be flagged as a compilation error:
7092 "`unnamed_Path' undeclared (first use this function)"
7094 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7096 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7097 which was bogus for several reasons.
7099 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7103 * autogen.sh: do not use "type -path" (what's that anyway?).
7105 * src/support/filetools.C (findtexfile): remove extraneous space
7106 which caused a kpsewhich warning (at least with kpathsea version
7109 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7111 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7113 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7115 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7117 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7119 * src/paragraph.C (BreakParagraph): do not reserve space on text
7120 if we don't need to (otherwise, if pos_end < pos, we end up
7121 reserving huge amounts of memory due to bad unsigned karma).
7122 (BreakParagraphConservative): ditto, although I have not seen
7123 evidence the bug can happen here.
7125 * src/lyxparagraph.h: add a using std::list.
7127 2000-01-11 Juergen Vigna <jug@sad.it>
7129 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7132 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7134 * src/vc-backend.C (doVCCommand): change to be static and take one
7135 more parameter: the path to chdir too be fore executing the command.
7136 (retrive): new function equiv to "co -r"
7138 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7139 file_not_found_hook is true.
7141 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7143 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7144 if a file is readwrite,readonly...anything else.
7146 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7148 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7149 (CreatePostscript): name change from MenuRunDVIPS (or something)
7150 (PreviewPostscript): name change from MenuPreviewPS
7151 (PreviewDVI): name change from MenuPreviewDVI
7153 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7154 \view_pdf_command., \pdf_to_ps_command
7156 * lib/configure.m4: added search for PDF viewer, and search for
7157 PDF to PS converter.
7158 (lyxrc.defaults output): add \pdflatex_command,
7159 \view_pdf_command and \pdf_to_ps_command.
7161 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7163 * src/bufferlist.C (write): we don't use blocksize for anything so
7166 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7168 * src/support/block.h: disable operator T* (), since it causes
7169 problems with both compilers I tried. See comments in the file.
7171 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7174 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7175 variable LYX_DIR_10x to LYX_DIR_11x.
7177 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7179 * INSTALL: document --with-lyxname.
7182 * configure.in: new configure flag --with-lyxname which allows to
7183 choose the name under which lyx is installed. Default is "lyx", of
7184 course. It used to be possible to do this with --program-suffix,
7185 but the later has in fact a different meaning for autoconf.
7187 * src/support/lstrings.h (lstrchr): reformat a bit.
7189 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7190 * src/mathed/math_defs.h: ditto.
7192 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7194 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7195 true, decides if we create a backup file or not when saving. New
7196 tag and variable \pdf_mode, defaults to false. New tag and
7197 variable \pdflatex_command, defaults to pdflatex. New tag and
7198 variable \view_pdf_command, defaults to xpdf. New tag and variable
7199 \pdf_to_ps_command, defaults to pdf2ps.
7201 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7203 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7204 does not have a BufferView.
7205 (unlockInset): ditto + don't access the_locking_inset if the
7206 buffer does not have a BufferView.
7208 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7209 certain circumstances so that we don't continue a keyboard
7210 operation long after the key was released. Try f.ex. to load a
7211 large document, press PageDown for some seconds and then release
7212 it. Before this change the document would contine to scroll for
7213 some time, with this change it stops imidiatly.
7215 * src/support/block.h: don't allocate more space than needed. As
7216 long as we don't try to write to the arr[x] in a array_type arr[x]
7217 it is perfectly ok. (if you write to it you might segfault).
7218 added operator value_type*() so that is possible to pass the array
7219 to functions expecting a C-pointer.
7221 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7224 * intl/*: updated to gettext 0.10.35, tried to add our own
7225 required modifications. Please verify.
7227 * po/*: updated to gettext 0.10.35, tried to add our own required
7228 modifications. Please verify.
7230 * src/support/lstrings.C (tostr): go at fixing the problem with
7231 cxx and stringstream. When stringstream is used return
7232 oss.str().c_str() so that problems with lyxstring and basic_string
7233 are avoided. Note that the best solution would be for cxx to use
7234 basic_string all the way, but it is not conformant yet. (it seems)
7236 * src/lyx_cb.C + other files: moved several global functions to
7237 class BufferView, some have been moved to BufferView.[Ch] others
7238 are still located in lyx_cb.C. Code changes because of this. (part
7239 of "get rid of current_view project".)
7241 * src/buffer.C + other files: moved several Buffer functions to
7242 class BufferView, the functions are still present in buffer.C.
7243 Code changes because of this.
7245 * config/lcmessage.m4: updated to most recent. used when creating
7248 * config/progtest.m4: updated to most recent. used when creating
7251 * config/gettext.m4: updated to most recent. applied patch for
7254 * config/gettext.m4.patch: new file that shows what changes we
7255 have done to the local copy of gettext.m4.
7257 * config/libtool.m4: new file, used in creation of acinclude.m4
7259 * config/lyxinclude.m4: new file, this is the lyx created m4
7260 macros, used in making acinclude.m4.
7262 * autogen.sh: GNU m4 discovered as a separate task not as part of
7263 the lib/configure creation.
7264 Generate acinlucde from files in config. Actually cat
7265 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7266 easier to upgrade .m4 files that really are external.
7268 * src/Spacing.h: moved using std::istringstream to right after
7269 <sstream>. This should fix the problem seen with some compilers.
7271 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7273 * src/lyx_cb.C: began some work to remove the dependency a lot of
7274 functions have on BufferView::text, even if not really needed.
7275 (GetCurrentTextClass): removed this func, it only hid the
7278 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7279 forgot this in last commit.
7281 * src/Bullet.C (bulletEntry): use static char const *[] for the
7282 tables, becuase of this the return arg had to change to string.
7284 (~Bullet): removed unneeded destructor
7286 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7287 (insetSleep): moved from Buffer
7288 (insetWakeup): moved from Buffer
7289 (insetUnlock): moved from Buffer
7291 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7292 from Buffer to BufferView.
7294 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7296 * config/ltmain.sh: updated to version 1.3.4 of libtool
7298 * config/ltconfig: updated to version 1.3.4 of libtool
7300 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7303 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7304 Did I get that right?
7306 * src/lyxlex.h: add a "using" directive or two.
7307 * src/Spacing.h: ditto.
7308 * src/insets/figinset.C: ditto.
7309 * src/support/filetools.C: ditto.
7310 * src/support/lstrings.C: ditto.
7311 * src/BufferView.C: ditto.
7312 * src/bufferlist.C: ditto.
7313 * src/lyx_cb.C: ditto.
7314 * src/lyxlex.C: ditto.
7316 * NEWS: add some changes for 1.1.4.
7318 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7320 * src/BufferView.C: first go at a TextCache to speed up switching
7323 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7325 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7326 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7327 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7328 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7331 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7332 members of the struct are correctly initialized to 0 (detected by
7334 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7335 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7337 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7338 pidwait, since it was allocated with "new". This was potentially
7339 very bad. Thanks to Michael Schmitt for running purify for us.
7342 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7344 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7346 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7348 1999-12-30 Allan Rae <rae@lyx.org>
7350 * lib/templates/IEEEtran.lyx: minor change
7352 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7353 src/mathed/formula.C (LocalDispatch): askForText changes
7355 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7356 know when a user has cancelled input. Fixes annoying problems with
7357 inserting labels and version control.
7359 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7361 * src/support/lstrings.C (tostr): rewritten to use strstream and
7364 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7366 * src/support/filetools.C (IsFileWriteable): use fstream to check
7367 (IsDirWriteable): use fileinfo to check
7369 * src/support/filetools.h (FilePtr): whole class deleted
7371 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7373 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7375 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7377 * src/bufferlist.C (write): use ifstream and ofstream instead of
7380 * src/Spacing.h: use istrstream instead of sscanf
7382 * src/mathed/math_defs.h: change first arg to istream from FILE*
7384 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7386 * src/mathed/math_parser.C: have yyis to be an istream
7387 (LexGetArg): use istream (yyis)
7389 (mathed_parse): ditto
7390 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7392 * src/mathed/formula.C (Read): rewritten to use istream
7394 * src/mathed/formulamacro.C (Read): rewritten to use istream
7396 * src/lyxlex.h (~LyXLex): deleted desturctor
7397 (getStream): new function, returns an istream
7398 (getFile): deleted funtion
7399 (IsOK): return is.good();
7401 * src/lyxlex.C (LyXLex): delete file and owns_file
7402 (setFile): open an filebuf and assign that to a istream instead of
7404 (setStream): new function, takes an istream as arg.
7405 (setFile): deleted function
7406 (EatLine): rewritten us use istream instead of FILE*
7410 * src/table.C (LyXTable): use istream instead of FILE*
7411 (Read): rewritten to take an istream instead of FILE*
7413 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7415 * src/buffer.C (Dispatch): remove an extraneous break statement.
7417 * src/support/filetools.C (QuoteName): change to do simple
7418 'quoting'. More work is necessary. Also changed to do nothing
7419 under emx (needs fix too).
7420 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7422 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7423 config.h.in to the AC_DEFINE_UNQUOTED() call.
7424 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7425 needs char * as argument (because Solaris 7 declares it like
7428 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7429 remove definition of BZERO.
7431 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7433 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7434 defined, "lyxregex.h" if not.
7436 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7438 (REGEX): new variable that is set to regex.c lyxregex.h when
7439 AM_CONDITIONAL USE_REGEX is set.
7440 (libsupport_la_SOURCES): add $(REGEX)
7442 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7445 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7448 * configure.in: add call to LYX_REGEX
7450 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7451 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7453 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7455 * lib/bind/fi_menus.bind: new file, from
7456 pauli.virtanen@saunalahti.fi.
7458 * src/buffer.C (getBibkeyList): pass the parameter delim to
7459 InsetInclude::getKeys and InsetBibtex::getKeys.
7461 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7462 is passed to Buffer::getBibkeyList
7464 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7465 instead of the hardcoded comma.
7467 * src/insets/insetbib.C (getKeys): make sure that there are not
7468 leading blanks in bibtex keys. Normal latex does not care, but
7469 harvard.sty seems to dislike blanks at the beginning of citation
7470 keys. In particular, the retturn value of the function is
7472 * INSTALL: make it clear that libstdc++ is needed and that gcc
7473 2.7.x probably does not work.
7475 * src/support/filetools.C (findtexfile): make debug message go to
7477 * src/insets/insetbib.C (getKeys): ditto
7479 * src/debug.C (showTags): make sure that the output is correctly
7482 * configure.in: add a comment for TWO_COLOR_ICON define.
7484 * acconfig.h: remove all the entries that already defined in
7485 configure.in or acinclude.m4.
7487 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7488 to avoid user name, date and copyright.
7490 1999-12-21 Juergen Vigna <jug@sad.it>
7492 * src/table.C (Read): Now read bogus row format informations
7493 if the format is < 5 so that afterwards the table can
7494 be read by lyx but without any format-info. Fixed the
7495 crash we experienced when not doing this.
7497 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7499 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7500 (RedoDrawingOfParagraph): ditto
7501 (RedoParagraphs): ditto
7502 (RemoveTableRow): ditto
7504 * src/text.C (Fill): rename arg paperwidth -> paper_width
7506 * src/buffer.C (insertLyXFile): rename var filename -> fname
7507 (writeFile): rename arg filename -> fname
7508 (writeFileAscii): ditto
7509 (makeLaTeXFile): ditto
7510 (makeLinuxDocFile): ditto
7511 (makeDocBookFile): ditto
7513 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7516 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7518 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7521 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7522 compiled by a C compiler not C++.
7524 * src/layout.h (LyXTextClass): added typedef for const_iterator
7525 (LyXTextClassList): added typedef for const_iterator + member
7526 functions begin and end.
7528 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7529 iterators to fill the choice_class.
7530 (updateLayoutChoice): rewritten to use iterators to fill the
7531 layoutlist in the toolbar.
7533 * src/BufferView.h (BufferView::work_area_width): removed unused
7536 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7538 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7539 (sgmlCloseTag): ditto
7541 * src/support/lstrings.h: return type of countChar changed to
7544 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7545 what version of this func to use. Also made to return unsigned int.
7547 * configure.in: call LYX_STD_COUNT
7549 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7550 conforming std::count.
7552 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7554 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7555 and a subscript would give bad display (patch from Dekel Tsur
7556 <dekel@math.tau.ac.il>).
7558 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7560 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7563 * src/chset.h: add a few 'using' directives
7565 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7566 triggered when no buffer is active
7568 * src/layout.C: removed `break' after `return' in switch(), since
7571 * src/lyx_main.C (init): make sure LyX can be ran in place even
7572 when libtool has done its magic with shared libraries. Fix the
7573 test for the case when the system directory has not been found.
7575 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7576 name for the latex file.
7577 (MenuMakeHTML): ditto
7579 * src/buffer.h: add an optional boolean argument, which is passed
7582 1999-12-20 Allan Rae <rae@lyx.org>
7584 * lib/templates/IEEEtran.lyx: small correction and update.
7586 * configure.in: Attempted to use LYX_PATH_HEADER
7588 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7590 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7591 input from JMarc. Now use preprocessor to find the header.
7592 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7593 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7594 LYX_STL_STRING_FWD. See comments in file.
7596 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7598 * The global MiniBuffer * minibuffer variable is dead.
7600 * The global FD_form_main * fd_form_main variable is dead.
7602 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7604 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7606 * src/table.h: add the LOstream.h header
7607 * src/debug.h: ditto
7609 * src/LyXAction.h: change the explaination of the ReadOnly
7610 attribute: is indicates that the function _can_ be used.
7612 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7615 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7617 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7623 * src/paragraph.C (GetWord): assert on pos>=0
7626 * src/support/lyxstring.C: condition the use of an invariant on
7628 * src/support/lyxstring.h: ditto
7630 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7631 Use LAssert.h instead of plain assert().
7633 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7635 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7636 * src/support/filetools.C: ditto
7638 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7641 * INSTALL: document the new configure flags
7643 * configure.in: suppress --with-debug; add --enable-assertions
7645 * acinclude.m4: various changes in alignment of help strings.
7647 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7649 * src/kbmap.C: commented out the use of the hash map in kb_map,
7650 beginning of movement to a stl::container.
7652 * several files: removed code that was not in effect when
7653 MOVE_TEXT was defined.
7655 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7656 for escaping should not be used. We can discuss if the string
7657 should be enclosed in f.ex. [] instead of "".
7659 * src/trans_mgr.C (insert): use the new returned value from
7660 encodeString to get deadkeys and keymaps done correctly.
7662 * src/chset.C (encodeString): changed to return a pair, to tell
7663 what to use if we know the string.
7665 * src/lyxscreen.h (fillArc): new function.
7667 * src/FontInfo.C (resize): rewritten to use more std::string like
7668 structore, especially string::replace.
7670 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7673 * configure.in (chmod +x some scripts): remove config/gcc-hack
7675 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7677 * src/buffer.C (writeFile): change once again the top comment in a
7678 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7679 instead of an hardcoded version number.
7680 (makeDocBookFile): ditto
7682 * src/version.h: add new define LYX_DOCVERSION
7684 * po/de.po: update from Pit Sütterlin
7685 * lib/bind/de_menus.bind: ditto.
7687 * src/lyxfunc.C (Dispatch): call MenuExport()
7688 * src/buffer.C (Dispatch): ditto
7690 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7691 LyXFunc::Dispatch().
7692 (MenuExport): new function, moved from
7693 LyXFunc::Dispatch().
7695 * src/trans_mgr.C (insert): small cleanup
7696 * src/chset.C (loadFile): ditto
7698 * lib/kbd/iso8859-1.cdef: add missing backslashes
7700 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7702 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7703 help with placing the manually drawn accents better.
7705 (Draw): x2 and hg changed to float to minimize rounding errors and
7706 help place the accents better.
7708 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7709 unsigned short to char is just wrong...cast the char to unsigned
7710 char instead so that the two values can compare sanely. This
7711 should also make the display of insetlatexaccents better and
7712 perhaps also some other insets.
7714 (lbearing): new function
7717 1999-12-15 Allan Rae <rae@lyx.org>
7719 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7720 header that provides a wrapper around the very annoying SGI STL header
7723 * src/support/lyxstring.C, src/LString.h:
7724 removed old SGI-STL-compatability attempts.
7726 * configure.in: Use LYX_STL_STRING_FWD.
7728 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7729 stl_string_fwd.h is around and try to determine it's location.
7730 Major improvement over previous SGI STL 3.2 compatability.
7731 Three small problems remain with this function due to my zero
7732 knowledge of autoconf. JMarc and lgb see the comments in the code.
7734 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7736 * src/broken_const.h, config/hack-gcc, config/README: removed
7738 * configure.in: remove --with-gcc-hack option; do not call
7741 * INSTALL: remove documentation of --with-broken-const and
7744 * acconfig.h: remove all trace of BROKEN_CONST define
7746 * src/buffer.C (makeDocBookFile): update version number in output
7748 (SimpleDocBookOnePar): fix an assert when trying to a character
7749 access beyond string length
7752 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7754 * po/de.po: fix the Export menu
7756 * lyx.man: update the description of -dbg
7758 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7759 (commandLineHelp): updated
7760 (easyParse): show list of available debug levels if -dbg is passed
7763 * src/Makefile.am: add debug.C
7765 * src/debug.h: moved some code to debug.C
7767 * src/debug.C: new file. Contains code to set and show debug
7770 * src/layout.C: remove 'break' after 'continue' in switch
7771 statements, since these cannot be reached.
7773 1999-12-13 Allan Rae <rae@lyx.org>
7775 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7776 (in_word_set): hash() -> math_hash()
7778 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7780 * acconfig.h: Added a test for whether we are using exceptions in the
7781 current compilation run. If so USING_EXCEPTIONS is defined.
7783 * config.in: Check for existance of stl_string_fwd.h
7784 * src/LString.h: If compiling --with-included-string and SGI's
7785 STL version 3.2 is present (see above test) we need to block their
7786 forward declaration of string and supply a __get_c_string().
7787 However, it turns out this is only necessary if compiling with
7788 exceptions enabled so I've a bit more to add yet.
7790 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7791 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7792 src/support/LRegex.h, src/undo.h:
7793 Shuffle the order of the included files a little to ensure that
7794 LString.h gets included before anything that includes stl_string_fwd.h
7796 * src/support/lyxstring.C: We need to #include LString.h instead of
7797 lyxstring.h to get the necessary definition of __get_c_string.
7798 (__get_c_string): New function. This is defined static just like SGI's
7799 although why they need to do this I'm not sure. Perhaps it should be
7800 in lstrings.C instead.
7802 * lib/templates/IEEEtran.lyx: New template file.
7804 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7806 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7807 * intl/Makefile.in (MKINSTALLDIRS): ditto
7809 * src/LyXAction.C (init): changed to hold the LFUN data in a
7810 automatic array in stead of in callso to newFunc, this speeds up
7811 compilation a lot. Also all the memory used by the array is
7812 returned when the init is completed.
7814 * a lot of files: compiled with -Wold-style-cast, changed most of
7815 the reported offenders to C++ style casts. Did not change the
7816 offenders in C files.
7818 * src/trans.h (Match): change argument type to unsigned int.
7820 * src/support/DebugStream.C: fix some types on the streambufs so
7821 that it works on a conforming implementation.
7823 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7825 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7827 * src/support/lyxstring.C: remove the inline added earlier since
7828 they cause a bunch of unsatisfied symbols when linking with dec
7829 cxx. Cxx likes to have the body of inlines at the place where they
7832 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7833 accessing negative bounds in array. This fixes the crash when
7834 inserting accented characters.
7835 * src/trans.h (Match): ditto
7837 * src/buffer.C (Dispatch): since this is a void, it should not try
7838 to return anything...
7840 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7842 * src/buffer.h: removed the two friends from Buffer. Some changes
7843 because of this. Buffer::getFileName and Buffer::setFileName
7844 renamed to Buffer::fileName() and Buffer::fileName(...).
7846 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7848 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7849 and Buffer::update(short) to BufferView. This move is currently
7850 controlled by a define MOVE_TEXT, this will be removed when all
7851 shows to be ok. This move paves the way for better separation
7852 between buffer contents and buffer view. One side effect is that
7853 the BufferView needs a rebreak when swiching buffers, if we want
7854 to avoid this we can add a cache that holds pointers to LyXText's
7855 that is not currently in use.
7857 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7860 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7862 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7864 * lyx_main.C: new command line option -x (or --execute) and
7865 -e (or --export). Now direct conversion from .lyx to .tex
7866 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7867 Unfortunately, X is still needed and the GUI pops up during the
7870 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7872 * src/Spacing.C: add a using directive to bring stream stuff into
7874 * src/paragraph.C: ditto
7875 * src/buffer.C: ditto
7877 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7878 from Lars' announcement).
7880 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7881 example files from Tino Meinen.
7883 1999-12-06 Allan Rae <rae@lyx.org>
7885 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7887 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7889 * src/support/lyxstring.C: added a lot of inline for no good
7892 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7893 latexWriteEndChanges, they were not used.
7895 * src/layout.h (operator<<): output operator for PageSides
7897 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7899 * some example files: loaded in LyX 1.0.4 and saved again to update
7900 certain constructs (table format)
7902 * a lot of files: did the change to use fstream/iostream for all
7903 writing of files. Done with a close look at Andre Poenitz's patch.
7905 * some files: whitespace changes.
7907 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7909 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7910 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7911 architecture, we provide our own. It is used unconditionnally, but
7912 I do not think this is a performance problem. Thanks to Angus
7913 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7914 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7916 (GetInset): use my_memcpy.
7920 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7921 it is easier to understand, but it uses less TeX-only constructs now.
7923 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7924 elements contain spaces
7926 * lib/configure: regenerated
7928 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7929 elements contain spaces; display the list of programs that are
7932 * autogen.sh: make sure lib/configure is executable
7934 * lib/examples/*: rename the tutorial examples to begin with the
7935 two-letters language code.
7937 * src/lyxfunc.C (getStatus): do not query current font if no
7940 * src/lyx_cb.C (RunScript): use QuoteName
7941 (MenuRunDvips): ditto
7942 (PrintApplyCB): ditto
7944 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7945 around argument, so that it works well with the current shell.
7946 Does not work properly with OS/2 shells currently.
7948 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7949 * src/LyXSendto.C (SendtoApplyCB): ditto
7950 * src/lyxfunc.C (Dispatch): ditto
7951 * src/buffer.C (runLaTeX): ditto
7952 (runLiterate): ditto
7953 (buildProgram): ditto
7955 * src/lyx_cb.C (RunScript): ditto
7956 (MenuMakeLaTeX): ditto
7958 * src/buffer.h (getLatexName): new method
7960 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7962 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7964 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7965 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7966 (create_math_panel): ditto
7968 * src/lyxfunc.C (getStatus): re-activate the code which gets
7969 current font and cursor; add test for export to html.
7971 * src/lyxrc.C (read): remove unreachable break statements; add a
7974 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7976 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7978 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7979 introduced by faulty regex.
7980 * src/buffer.C: ditto
7981 * src/lastfiles.C: ditto
7982 * src/paragraph.C: ditto
7983 * src/table.C: ditto
7984 * src/vspace.C: ditto
7985 * src/insets/figinset.C: ditto
7986 Note: most of these is absolutely harmless, except the one in
7987 src/mathed formula.C.
7989 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7991 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7992 operation, yielding correct results for the reLyX command.
7994 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7996 * src/support/filetools.C (ExpandPath): removed an over eager
7998 (ReplaceEnvironmentPath): ditto
8000 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
8001 shows that we are doing something fishy in our code...
8005 * src/lyxrc.C (read): use a double switch trick to get more help
8006 from the compiler. (the same trick is used in layout.C)
8007 (write): new function. opens a ofstream and pass that to output
8008 (output): new function, takes a ostream and writes the lyxrc
8009 elemts to it. uses a dummy switch to make sure no elements are
8012 * src/lyxlex.h: added a struct pushpophelper for use in functions
8013 with more than one exit point.
8015 * src/lyxlex.[Ch] (GetInteger): made it const
8019 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
8021 * src/layout.[hC] : LayoutTags splitted into several enums, new
8022 methods created, better error handling cleaner use of lyxlex. Read
8025 * src/bmtable.[Ch]: change some member prototypes because of the
8026 image const changes.
8028 * commandtags.h, src/LyXAction.C (init): new function:
8029 "preferences-save", saves the lyxrc entries into .lyx/preferences.
8030 This file is not read automatically but you can add \input
8031 preferences to your lyxrc if you want to. We need to discuss how
8034 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
8035 in .aux, also remove .bib and .bst files from dependencies when
8038 * src/BufferView.C, src/LyXView.C: add const_cast several places
8039 because of changes to images.
8041 * lib/images/*: same change as for images/*
8043 * lib/lyxrc.example: Default for accept_compound is false not no.
8045 * images/*: changed to be const, however I have som misgivings
8046 about this change so it might be changed back.
8048 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8050 * lib/configure, po/POTFILES.in: regenerated
8052 * autogen.sh: autogenerate lib/configure from lib/configure.m4
8054 * config/lib_configure.m4: removed
8056 * lib/configure.m4: new file (was config/lib_configure.m4)
8058 * configure.in: do not test for rtti, since we do not use it.
8060 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8062 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
8063 doubling of allocated space scheme. This makes it faster for large
8064 strings end to use less memory for small strings. xtra rememoved.
8066 * src/insets/figinset.C (waitalarm): commented out.
8067 (GhostscriptMsg): use static_cast
8068 (GhostscriptMsg): use new instead of malloc to allocate memory for
8069 cmap. also delete the memory after use.
8071 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8073 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8074 for changes in bibtex database or style.
8075 (runBibTeX): remove all .bib and .bst files from dep before we
8077 (run): use scanAuc in when dep file already exist.
8079 * src/DepTable.C (remove_files_with_extension): new method
8082 * src/DepTable.[Ch]: made many of the methods const.
8084 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8086 * src/bufferparams.C: make sure that the default textclass is
8087 "article". It used to be the first one by description order, but
8088 now the first one is "docbook".
8090 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8091 string; call Debug::value.
8092 (easyParse): pass complete argument to setDebuggingLevel().
8094 * src/debug.h (value): fix the code that parses debug levels.
8096 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8099 * src/LyXAction.C: use Debug::ACTION as debug channel.
8101 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8103 * NEWS: updated for the future 1.1.3 release.
8105 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8106 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8107 it should. This is of course a controversial change (since many
8108 people will find that their lyx workscreen is suddenly full of
8109 red), but done for the sake of correctness.
8111 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8112 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8114 * src/insets/inseterror.h, src/insets/inseturl.h,
8115 src/insets/insetinfo.h, src/insets/figinset.h,
8116 src/mathed/formulamacro.h, src/mathed/math_macro.h
8117 (EditMessage): add a missing const and add _() to make sure that
8120 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8121 src/insets/insetbib.C, src/support/filetools.C: add `using'
8124 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8125 doing 'Insert index of last word' at the beginning of a paragraph.
8127 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8129 * several files: white-space changes.
8131 * src/mathed/formula.C: removed IsAlpha and IsDigit
8133 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8134 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8137 * src/insets/figinset.C (GetPSSizes): don't break when
8138 "EndComments" is seen. But break when a boundingbox is read.
8140 * all classes inherited from Inset: return value of Clone
8141 changed back to Inset *.
8143 * all classes inherited form MathInset: return value of Clone
8144 changed back to MathedInset *.
8146 * src/insets/figinset.C (runqueue): use a ofstream to output the
8147 gs/ps file. Might need some setpresicion or setw. However I can
8148 see no problem with the current code.
8149 (runqueue): use sleep instead of the alarm/signal code. I just
8150 can't see the difference.
8152 * src/paragraph.C (LyXParagraph): reserve space in the new
8153 paragraph and resize the inserted paragraph to just fit.
8155 * src/lyxfunc.h (operator|=): added operator for func_status.
8157 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8158 check for readable file.
8160 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8161 check for readable file.
8162 (MenuMakeLinuxDoc): ditto
8163 (MenuMakeDocBook): ditto
8164 (MenuMakeAscii): ditto
8165 (InsertAsciiFile): split the test for openable and readable
8167 * src/bmtable.C (draw_bitmaptable): use
8168 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8170 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8171 findtexfile from LaTeX to filetools.
8173 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8174 instead of FilePtr. Needs to be verified by a literate user.
8176 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8178 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8179 (EditMessage): likewise.
8181 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8182 respectively as \textasciitilde and \textasciicircum.
8184 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8186 * src/support/lyxstring.h: made the methods that take iterators
8189 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8190 (regexMatch): made is use the real regex class.
8192 * src/support/Makefile.am: changed to use libtool
8194 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8196 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8198 (MathIsInset ++): changed several macros to be inline functions
8201 * src/mathed/Makefile.am: changed to use libtool
8203 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8205 * src/insets/inset* : Clone changed to const and return type is
8206 the true insettype not just Inset*.
8208 * src/insets/Makefile.am: changed to use libtool
8210 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8212 * src/undo.[Ch] : added empty() and changed some of the method
8215 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8217 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8218 setID use block<> for the bullets array, added const several places.
8220 * src/lyxfunc.C (getStatus): new function
8222 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8223 LyXAction, added const to several funtions.
8225 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8226 a std::map, and to store the dir items in a vector.
8228 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8231 * src/LyXView.[Ch] + other files : changed currentView to view.
8233 * src/LyXAction.[Ch] : ported from the old devel branch.
8235 * src/.cvsignore: added .libs and a.out
8237 * configure.in : changes to use libtool.
8239 * acinclude.m4 : inserted libtool.m4
8241 * .cvsignore: added libtool
8243 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8245 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8246 file name in insets and mathed directories (otherwise the
8247 dependency is not taken in account under cygwin).
8249 * src/text2.C (InsertString[AB]): make sure that we do not try to
8250 read characters past the string length.
8252 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8254 * lib/doc/LaTeXConfig.lyx.in,
8255 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8257 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8258 file saying who created them and when this heppened; this is
8259 useless and annoys tools like cvs.
8261 * lib/layouts/g-brief-{en,de}.layout,
8262 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8263 from Thomas Hartkens <thomas@hartkens.de>.
8265 * src/{insets,mathed}/Makefile.am: do not declare an empty
8266 LDFLAGS, so that it can be set at configure time (useful on Irix
8269 * lib/reLyX/configure.in: make sure that the prefix is set
8270 correctly in LYX_DIR.
8272 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8274 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8275 be used by 'command-sequence' this allows to bind a key to a
8276 sequence of LyX-commands
8277 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8279 * src/LyXAction.C: add "command-sequence"
8281 * src/LyXFunction.C: handling of "command-sequence"
8283 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8284 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8286 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8288 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8290 * src/buffer.C (writeFile): Do not output a comment giving user
8291 and date at the beginning of a .lyx file. This is useless and
8292 annoys cvs anyway; update version number to 1.1.
8294 * src/Makefile.am (LYX_DIR): add this definition, so that a
8295 default path is hardcoded in LyX.
8297 * configure.in: Use LYX_GNU_GETTEXT.
8299 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8300 AM_GNU_GETTEXT with a bug fixed.
8302 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8304 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8306 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8307 which is used to point to LyX data is now LYX_DIR_11x.
8309 * lyx.man: convert to a unix text file; small updates.
8311 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8313 * src/support/LSubstring.[Ch]: made the second arg of most of the
8314 constructors be a const reference.
8316 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8319 * src/support/lyxstring.[Ch] (swap): added missing member function
8320 and specialization of swap(str, str);
8322 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8324 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8325 trace of the old one.
8327 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8328 put the member definitions in undo.C.
8330 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8331 NEW_TEXT and have now only code that was included when this was
8334 * src/intl.C (LCombo): use static_cast
8336 (DispatchCallback): ditto
8338 * src/definitions.h: removed whole file
8340 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8342 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8343 parsing and stores in a std:map. a regex defines the file format.
8344 removed unneeded members.
8346 * src/bufferparams.h: added several enums from definitions.h here.
8347 Removed unsused destructor. Changed some types to use proper enum
8348 types. use block to have the temp_bullets and user_defined_bullets
8349 and to make the whole class assignable.
8351 * src/bufferparams.C (Copy): removed this functions, use a default
8354 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8357 * src/buffer.C (readLyXformat2): commend out all that have with
8358 oldpapersize to do. also comment out all that hve to do with
8359 insetlatex and insetlatexdel.
8360 (setOldPaperStuff): commented out
8362 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8364 * src/LyXAction.C: remove use of inset-latex-insert
8366 * src/mathed/math_panel.C (button_cb): use static_cast
8368 * src/insets/Makefile.am (insets_o_SOURCES): removed
8371 * src/support/lyxstring.C (helper): use the unsigned long
8372 specifier, UL, instead of a static_cast.
8374 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8376 * src/support/block.h: new file. to be used as a c-style array in
8377 classes, so that the class can be assignable.
8379 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8381 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8382 NULL, make sure to return an empty string (it is not possible to
8383 set a string to NULL).
8385 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8387 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8389 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8391 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8392 link line, so that Irix users (for example) can set it explicitely to
8395 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8396 it can be overidden at make time (static or dynamic link, for
8399 * src/vc-backend.C, src/LaTeXFeatures.h,
8400 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8401 statements to bring templates to global namespace.
8403 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8405 * src/support/lyxstring.C (operator[] const): make it standard
8408 * src/minibuffer.C (Init): changed to reflect that more
8409 information is given from the lyxvc and need not be provided here.
8411 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8413 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8415 * src/LyXView.C (UpdateTimerCB): use static_cast
8416 (KeyPressMask_raw_callback): ditto
8418 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8419 buffer_, a lot of changes because of this. currentBuffer() ->
8420 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8421 also changes to other files because of this.
8423 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8425 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8426 have no support for RCS and partial support for CVS, will be
8429 * src/insets/ several files: changes because of function name
8430 changes in Bufferview and LyXView.
8432 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8434 * src/support/LSubstring.[Ch]: new files. These implement a
8435 Substring that can be very convenient to use. i.e. is this
8437 string a = "Mary had a little sheep";
8438 Substring(a, "sheep") = "lamb";
8439 a is now "Mary has a little lamb".
8441 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8442 out patterns and subpatterns of strings. It is used by LSubstring
8443 and also by vc-backend.C
8445 * src/support/lyxstring.C: went over all the assertions used and
8446 tried to correct the wrong ones and flag which of them is required
8447 by the standard. some bugs found because of this. Also removed a
8448 couple of assertions.
8450 * src/support/Makefile.am (libsupport_a_SOURCES): added
8451 LSubstring.[Ch] and LRegex.[Ch]
8453 * src/support/FileInfo.h: have struct stat buf as an object and
8454 not a pointer to one, some changes because of this.
8456 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8457 information in layout when adding the layouts preamble to the
8460 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8463 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8464 because of bug in OS/2.
8466 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8468 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8469 \verbatim@font instead of \ttfamily, so that it can be redefined.
8471 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8472 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8473 src/layout.h, src/text2.C: add 'using' directive to bring the
8474 STL templates we need from the std:: namespace to the global one.
8475 Needed by DEC cxx in strict ansi mode.
8477 * src/support/LIstream.h,src/support/LOstream.h,
8478 src/support/lyxstring.h,src/table.h,
8479 src/lyxlookup.h: do not include <config.h> in header
8480 files. This should be done in the .C files only.
8482 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8486 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8488 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8489 from Kayvan to fix the tth invokation.
8491 * development/lyx.spec.in: updates from Kayvan to reflect the
8492 changes of file names.
8494 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8496 * src/text2.C (InsertStringB): use std::copy
8497 (InsertStringA): use std::copy
8499 * src/bufferlist.C: use a vector to store the buffers in. This is
8500 an internal change and should not affect any other thing.
8502 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8505 * src/text.C (Fill): fix potential bug, one off bug.
8507 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8509 * src/Makefile.am (lyx_main.o): add more files it depends on.
8511 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8513 * src/support/lyxstring.C: use size_t for the reference count,
8514 size, reserved memory and xtra.
8515 (internal_compare): new private member function. Now the compare
8516 functions should work for std::strings that have embedded '\0'
8518 (compare): all compare functions rewritten to use
8521 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8523 * src/support/lyxstring.C (compare): pass c_str()
8524 (compare): pass c_str
8525 (compare): pass c_str
8527 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8529 * src/support/DebugStream.C: <config.h> was not included correctly.
8531 * lib/configure: forgot to re-generate it :( I'll make this file
8532 auto generated soon.
8534 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8536 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8539 * src/support/lyxstring.C: some changes from length() to rep->sz.
8540 avoids a function call.
8542 * src/support/filetools.C (SpaceLess): yet another version of the
8543 algorithm...now per Jean-Marc's suggestions.
8545 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8547 * src/layout.C (less_textclass_desc): functor for use in sorting
8549 (LyXTextClass::Read): sort the textclasses after reading.
8551 * src/support/filetools.C (SpaceLess): new version of the
8552 SpaceLess functions. What problems does this one give? Please
8555 * images/banner_bw.xbm: made the arrays unsigned char *
8557 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8559 * src/support/lyxstring.C (find): remove bogus assertion in the
8560 two versions of find where this has not been done yet.
8562 * src/support/lyxlib.h: add missing int return type to
8565 * src/menus.C (ShowFileMenu): disable exporting to html if no
8566 html export command is present.
8568 * config/lib_configure.m4: add a test for an HTML converter. The
8569 programs checked for are, in this order: tth, latex2html and
8572 * lib/configure: generated from config/lib_configure.m4.
8574 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8575 html converter. The parameters are now passed through $$FName and
8576 $$OutName, instead of standard input/output.
8578 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8580 * lib/lyxrc.example: update description of \html_command.
8581 add "quotes" around \screen_font_xxx font setting examples to help
8582 people who use fonts with spaces in their names.
8584 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8586 * Distribution files: updates for v1.1.2
8588 * src/support/lyxstring.C (find): remove bogus assert and return
8589 npos for the same condition.
8591 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8593 * added patch for OS/2 from SMiyata.
8595 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8597 * src/text2.C (CutSelection): make space_wrapped a bool
8598 (CutSelection): dont declare int i until we have to.
8599 (alphaCounter): return a char const *.
8601 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8603 * src/support/syscall.C (Systemcalls::kill):
8604 src/support/filetools.C (PutEnv, PutEnvPath):
8605 src/lyx_cb.C (addNewlineAndDepth):
8606 src/FontInfo.C (FontInfo::resize): condition some #warning
8607 directives with WITH_WARNINGS.
8610 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8612 * src/layout.[Ch] + several files: access to class variables
8613 limited and made accessor functions instead a lot of code changed
8614 becuase of this. Also instead of returning pointers often a const
8615 reference is returned instead.
8617 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8619 * src/Makefile.am (dist-hook): added used to remove the CVS from
8620 cheaders upon creating a dist
8621 (EXTRA_DIST): added cheaders
8623 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8624 a character not as a small integer.
8626 * src/support/lyxstring.C (find): removed Assert and added i >=
8627 rep->sz to the first if.
8629 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8631 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8632 src/LyXView.C src/buffer.C src/bufferparams.C
8633 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8634 src/text2.C src/insets/insetinclude.C:
8635 lyxlayout renamed to textclasslist.
8637 * src/layout.C: some lyxerr changes.
8639 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8640 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8641 (LyXLayoutList): removed all traces of this class.
8642 (LyXTextClass::Read): rewrote LT_STYLE
8643 (LyXTextClass::hasLayout): new function
8644 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8645 both const and nonconst version.
8646 (LyXTextClass::delete_layout): new function.
8647 (LyXTextClassList::Style): bug fix. do the right thing if layout
8649 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8650 (LyXTextClassList::NameOfLayout): ditto
8651 (LyXTextClassList::Load): ditto
8653 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8655 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8657 * src/LyXAction.C (LookupFunc): added a workaround for sun
8658 compiler, on the other hand...we don't know if the current code
8659 compiles on sun at all...
8661 * src/support/filetools.C (CleanupPath): subst fix
8663 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8666 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8667 complained about this one?
8669 * src/insets/insetinclude.C (Latex): subst fix
8671 * src/insets/insetbib.C (getKeys): subst fix
8673 * src/LyXSendto.C (SendtoApplyCB): subst fix
8675 * src/lyx_main.C (init): subst fix
8677 * src/layout.C (Read): subst fix
8679 * src/lyx_sendfax_main.C (button_send): subst fix
8681 * src/buffer.C (RoffAsciiTable): subst fix
8683 * src/lyx_cb.C (MenuFax): subst fix
8684 (PrintApplyCB): subst fix
8686 1999-10-26 Juergen Vigna <jug@sad.it>
8688 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8690 (Read): Cleaned up this code so now we read only format vestion >= 5
8692 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8694 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8695 come nobody has complained about this one?
8697 * src/insets/insetinclude.C (Latex): subst fix
8699 * src/insets/insetbib.C (getKeys): subst fix
8701 * src/lyx_main.C (init): subst fix
8703 * src/layout.C (Read): subst fix
8705 * src/buffer.C (RoffAsciiTable): subst fix
8707 * src/lyx_cb.C (MenuFax): subst fix.
8709 * src/layout.[hC] + some other files: rewrote to use
8710 std::container to store textclasses and layouts in.
8711 Simplified, removed a lot of code. Make all classes
8712 assignable. Further simplifications and review of type
8713 use still to be one.
8715 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8716 lastfiles to create the lastfiles partr of the menu.
8718 * src/lastfiles.[Ch]: rewritten to use deque to store the
8719 lastfiles in. Uses fstream for reading and writing. Simplifies
8722 * src/support/syscall.C: remove explicit cast.
8724 * src/BufferView.C (CursorToggleCB): removed code snippets that
8726 use explicat C++ style casts instead of C style casts. also use
8727 u_vdata instea of passing pointers in longs.
8729 * src/PaperLayout.C: removed code snippets that were commented out.
8731 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8733 * src/lyx_main.C: removed code snippets that wer commented out.
8735 * src/paragraph.C: removed code snippets that were commented out.
8737 * src/lyxvc.C (logClose): use static_cast
8739 (viewLog): remove explicit cast to void*
8740 (showLog): removed old commented code
8742 * src/menus.C: use static_cast instead of C style casts. use
8743 u_vdata instead of u_ldata. remove explicit cast to (long) for
8744 pointers. Removed old code that was commented out.
8746 * src/insets/inset.C: removed old commented func
8748 * src/insets/insetref.C (InsetRef): removed old code that had been
8749 commented out for a long time.
8751 (escape): removed C style cast
8753 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8755 * src/insets/insetlatex.C (Draw): removed old commented code
8756 (Read): rewritten to use string
8758 * src/insets/insetlabel.C (escape): removed C style cast
8760 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8762 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8765 * src/insets/insetinclude.h: removed a couple of stupid bools
8767 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8768 (Clone): remove C style cast
8769 (getKeys): changed list to lst because of std::list
8771 * src/insets/inseterror.C (Draw): removed som old commented code.
8773 * src/insets/insetcommand.C (Draw): removed some old commented code.
8775 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8776 commented out forever.
8777 (bibitem_cb): use static_cast instead of C style cast
8778 use of vdata changed to u_vdata.
8780 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8782 (CloseUrlCB): use static_cast instead of C style cast.
8783 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8785 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8786 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8787 (CloseInfoCB): static_cast from ob->u_vdata instead.
8788 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8791 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8792 (C_InsetError_CloseErrorCB): forward the ob parameter
8793 (CloseErrorCB): static_cast from ob->u_vdata instead.
8795 * src/vspace.h: include LString.h since we use string in this class.
8797 * src/vspace.C (lyx_advance): changed name from advance because of
8798 nameclash with stl. And since we cannot use namespaces yet...I
8799 used a lyx_ prefix instead. Expect this to change when we begin
8802 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8804 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8805 and removed now defunct constructor and deconstructor.
8807 * src/BufferView.h: have backstack as a object not as a pointer.
8808 removed initialization from constructor. added include for BackStack
8810 * development/lyx.spec.in (%build): add CFLAGS also.
8812 * src/screen.C (drawFrame): removed another warning.
8814 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8816 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8817 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8818 README and ANNOUNCE a bit for the next release. More work is
8821 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8822 unbreakable if we are in freespacing mode (LyX-Code), but not in
8825 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8827 * src/BackStack.h: fixed initialization order in constructor
8829 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8831 * acinclude.m4 (VERSION): new rules for when a version is
8832 development, added also a variable for prerelease.
8833 (warnings): we set with_warnings=yes for prereleases
8834 (lyx_opt): prereleases compile with same optimization as development
8835 (CXXFLAGS): only use pedantic if we are a development version
8837 * src/BufferView.C (restorePosition): don't do anything if the
8840 * src/BackStack.h: added member empty, use this to test if there
8841 is anything to pop...
8843 1999-10-25 Juergen Vigna <jug@sad.it>
8846 * forms/layout_forms.fd +
8847 * forms/latexoptions.fd +
8848 * lyx.fd: changed for various form resize issues
8850 * src/mathed/math_panel.C +
8851 * src/insets/inseterror.C +
8852 * src/insets/insetinfo.C +
8853 * src/insets/inseturl.C +
8854 * src/insets/inseturl.h +
8857 * src/PaperLayout.C +
8858 * src/ParagraphExtra.C +
8859 * src/TableLayout.C +
8861 * src/layout_forms.C +
8868 * src/menus.C: fixed various resize issues. So now forms can be
8869 resized savely or not be resized at all.
8871 * forms/form_url.fd +
8872 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8875 * src/insets/Makefile.am: added files form_url.[Ch]
8877 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8879 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8880 (and presumably 6.2).
8882 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8883 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8884 remaining static member callbacks.
8886 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8889 * src/support/lyxstring.h: declare struct Srep as friend of
8890 lyxstring, since DEC cxx complains otherwise.
8892 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8894 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8896 * src/LaTeX.C (run): made run_bibtex also depend on files with
8898 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8899 are put into the dependency file.
8901 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8902 the code has shown itself to work
8903 (create_ispell_pipe): removed another warning, added a comment
8906 * src/minibuffer.C (ExecutingCB): removed code that has been
8907 commented out a long time
8909 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8910 out code + a warning.
8912 * src/support/lyxstring.h: comment out the three private
8913 operators, when compiling with string ansi conforming compilers
8916 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8918 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8919 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8922 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8925 * src/mathed/math_panel.C (create_math_panel): remove explicit
8928 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8931 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8932 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8933 to XCreatePixmapFromBitmapData
8934 (fl_set_bmtable_data): change the last argument to be unsigned
8936 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8937 and bh to be unsigned int, remove explicit casts in call to
8938 XReadBitmapFileData.
8940 * images/arrows.xbm: made the arrays unsigned char *
8941 * images/varsz.xbm: ditto
8942 * images/misc.xbm: ditto
8943 * images/greek.xbm: ditto
8944 * images/dots.xbm: ditto
8945 * images/brel.xbm: ditto
8946 * images/bop.xbm: ditto
8948 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8950 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8951 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8952 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8954 (LYX_CXX_CHEADERS): added <clocale> to the test.
8956 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8958 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8960 * src/support/lyxstring.C (append): fixed something that must be a
8961 bug, rep->assign was used instead of rep->append.
8963 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8966 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8967 lyx insert double chars. Fix spotted by Kayvan.
8969 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8971 * Fixed the tth support. I messed up with the Emacs patch apply feature
8972 and omitted the changes in lyxrc.C.
8974 1999-10-22 Juergen Vigna <jug@sad.it>
8976 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8978 * src/lyx_cb.C (MenuInsertRef) +
8979 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8980 the form cannot be resized under it limits (fixes a segfault)
8982 * src/lyx.C (create_form_form_ref) +
8983 * forms/lyx.fd: Changed Gravity on name input field so that it is
8986 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8988 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8989 <ostream> and <istream>.
8991 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8992 whether <fstream> provides the latest standard features, or if we
8993 have an oldstyle library (like in egcs).
8994 (LYX_CXX_STL_STRING): fix the test.
8996 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8997 code on MODERN_STL_STREAM.
8999 * src/support/lyxstring.h: use L{I,O}stream.h.
9001 * src/support/L{I,O}stream.h: new files, designed to setup
9002 correctly streams for our use
9003 - includes the right header depending on STL capabilities
9004 - puts std::ostream and std::endl (for LOStream.h) or
9005 std::istream (LIStream.h) in toplevel namespace.
9007 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9009 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
9010 was a bib file that had been changed we ensure that bibtex is run.
9011 (runBibTeX): enhanced to extract the names of the bib files and
9012 getting their absolute path and enter them into the dep file.
9013 (findtexfile): static func that is used to look for tex-files,
9014 checks for absolute patchs and tries also with kpsewhich.
9015 Alternative ways of finding the correct files are wanted. Will
9017 (do_popen): function that runs a command using popen and returns
9018 the whole output of that command in a string. Should be moved to
9021 * src/DepTable.[Ch] (extchanged): new function that returns true if a
9022 file with extension ext has changed.
9024 * src/insets/figinset.C: added ifdef guards around the fl_free
9025 code that jug commented out. Now it is commented out when
9026 compiling with XForms == 0.89.
9028 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
9029 to lyxstring.C, and only keep a forward declaration in
9030 lyxstring.h. Simplifies the header file a bit and should help a
9031 bit on compile time too. Also changes to Srep will not mandate a
9032 recompile of code just using string.
9033 (~lyxstring): definition moved here since it uses srep.
9034 (size): definition moved here since it uses srep.
9036 * src/support/lyxstring.h: removed a couple of "inline" that should
9039 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9041 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
9044 1999-10-21 Juergen Vigna <jug@sad.it>
9046 * src/table.C (SetPWidth): Just a small fix so the alignment is not
9047 set to left if I just remove the width entry (or it is empty).
9049 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
9050 paragraph when having dummy paragraphs.
9052 1999-10-20 Juergen Vigna <jug@sad.it>
9054 * src/insets/figinset.C: just commented some fl_free_form calls
9055 and added warnings so that this calls should be activated later
9056 again. This avoids for now a segfault, but we have a memory leak!
9058 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
9059 'const char * argument' to 'string argument', this should
9060 fix some Asserts() in lyxstring.C.
9062 * src/lyxfunc.h: Removed the function argAsString(const char *)
9063 as it is not used anymore.
9065 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9067 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9070 * src/Literate.h: some funcs moved from public to private to make
9071 interface clearer. Unneeded args removed.
9073 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9075 (scanBuildLogFile): ditto
9077 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9078 normal TeX Error. Still room for improvement.
9080 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9082 * src/buffer.C (insertErrors): changes to make the error
9083 desctription show properly.
9085 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9088 * src/support/lyxstring.C (helper): changed to use
9089 sizeof(object->rep->ref).
9090 (operator>>): changed to use a pointer instead.
9092 * src/support/lyxstring.h: changed const reference & to value_type
9093 const & lets see if that helps.
9095 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9097 * Makefile.am (rpmdist): fixed to have non static package and
9100 * src/support/lyxstring.C: removed the compilation guards
9102 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9105 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9106 conditional compile of lyxstring.Ch
9108 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9109 stupid check, but it is a lot better than the bastring hack.
9110 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9112 * several files: changed string::erase into string::clear. Not
9115 * src/chset.C (encodeString): use a char temporary instead
9117 * src/table.C (TexEndOfCell): added tostr around
9118 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9119 (TexEndOfCell): ditto
9120 (TexEndOfCell): ditto
9121 (TexEndOfCell): ditto
9122 (DocBookEndOfCell): ditto
9123 (DocBookEndOfCell): ditto
9124 (DocBookEndOfCell): ditto
9125 (DocBookEndOfCell): ditto
9127 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9129 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9131 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9132 (MenuBuildProg): added tostr around ret
9133 (MenuRunChktex): added tostr around ret
9134 (DocumentApplyCB): added tostr around ret
9136 * src/chset.C (encodeString): added tostr around t->ic
9138 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9139 (makeLaTeXFile): added tostr around tocdepth
9140 (makeLaTeXFile): added tostr around ftcound - 1
9142 * src/insets/insetbib.C (setCounter): added tostr around counter.
9144 * src/support/lyxstring.h: added an operator+=(int) to catch more
9147 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9148 (lyxstring): We DON'T allow NULL pointers.
9150 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9152 * src/mathed/math_macro.C (MathMacroArgument::Write,
9153 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9154 when writing them out.
9156 * src/LString.C: remove, since it is not used anymore.
9158 * src/support/lyxstring.C: condition the content to
9159 USE_INCLUDED_STRING macro.
9161 * src/mathed/math_symbols.C, src/support/lstrings.C,
9162 src/support/lyxstring.C: add `using' directive to specify what
9163 we need in <algorithm>. I do not think that we need to
9164 conditionalize this, but any thought is appreciated.
9166 * many files: change all callback functions to "C" linkage
9167 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9168 strict_ansi. Those who were static are now global.
9169 The case of callbacks which are static class members is
9170 trickier, since we have to make C wrappers around them (see
9171 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9172 did not finish this yet, since it defeats the purpose of
9173 encapsulation, and I am not sure what the best route is.
9175 1999-10-19 Juergen Vigna <jug@sad.it>
9177 * src/support/lyxstring.C (lyxstring): we permit to have a null
9178 pointer as assignment value and just don't assign it.
9180 * src/vspace.C (nextToken): corrected this function substituting
9181 find_first(_not)_of with find_last_of.
9183 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9184 (TableOptCloseCB) (TableSpeCloseCB):
9185 inserted fl_set_focus call for problem with fl_hide_form() in
9188 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9190 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9193 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9195 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9196 LyXLex::next() and not eatline() to get its argument.
9198 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9200 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9201 instead, use fstreams for io of the depfile, removed unneeded
9202 functions and variables.
9204 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9205 vector instead, removed all functions and variables that is not in
9208 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9210 * src/buffer.C (insertErrors): use new interface to TeXError
9212 * Makefile.am (rpmdist): added a rpmdist target
9214 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9215 per Kayvan's instructions.
9217 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9219 * src/Makefile.am: add a definition for localedir, so that locales
9220 are found after installation (Kayvan)
9222 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9224 * development/.cvsignore: new file.
9226 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9228 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9229 C++ compiler provides wrappers for C headers and use our alternate
9232 * configure.in: use LYX_CXX_CHEADERS.
9234 * src/cheader/: new directory, populated with cname headers from
9235 libstdc++-2.8.1. They are a bit old, but probably good enough for
9236 what we want (support compilers who lack them).
9238 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9239 from includes. It turns out is was stupid.
9241 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9243 * lib/Makefile.am (install-data-local): forgot a ';'
9244 (install-data-local): forgot a '\'
9245 (libinstalldirs): needed after all. reintroduced.
9247 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9249 * configure.in (AC_OUTPUT): added lyx.spec
9251 * development/lyx.spec: removed file
9253 * development/lyx.spec.in: new file
9255 * po/*.po: merged with lyx.pot becuase of make distcheck
9257 * lib/Makefile.am (dist-hook): added dist-hook so that
9258 documentation files will be included when doing a make
9259 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9260 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9262 more: tried to make install do the right thing, exclude CVS dirs
9265 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9266 Path would fit in more nicely.
9268 * all files that used to use pathstack: uses now Path instead.
9269 This change was a lot easier than expected.
9271 * src/support/path.h: new file
9273 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9275 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9277 * src/support/lyxstring.C (getline): Default arg was given for
9280 * Configure.cmd: removed file
9282 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9284 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9285 streams classes and types, add the proper 'using' statements when
9286 MODERN_STL is defined.
9288 * src/debug.h: move the << operator definition after the inclusion
9291 * src/support/filetools.C: include "LAssert.h", which is needed
9294 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9297 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9298 include "debug.h" to define a proper ostream.
9300 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9302 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9303 method to the SystemCall class which can kill a process, but it's
9304 not fully implemented yet.
9306 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9308 * src/support/FileInfo.h: Better documentation
9310 * src/lyxfunc.C: Added support for buffer-export html
9312 * src/menus.C: Added Export->As HTML...
9314 * lib/bind/*.bind: Added short-cut for buffer-export html
9316 * src/lyxrc.*: Added support for new \tth_command
9318 * lib/lyxrc.example: Added stuff for new \tth_command
9320 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9322 * lib/Makefile.am (IMAGES): removed images/README
9323 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9324 installes in correct place. Check permisions is installed
9327 * src/LaTeX.C: some no-op changes moved declaration of some
9330 * src/LaTeX.h (LATEX_H): changed include guard name
9332 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9334 * lib/reLyX/Makefile.am: install noweb2lyx.
9336 * lib/Makefile.am: install configure.
9338 * lib/reLyX/configure.in: declare a config aux dir; set package
9339 name to lyx (not sure what the best solution is); generate noweb2lyx.
9341 * lib/layouts/egs.layout: fix the bibliography layout.
9343 1999-10-08 Jürgen Vigna <jug@sad.it>
9345 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9346 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9347 it returned without continuing to search the path.
9349 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9351 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9352 also fixes a bug. It is not allowed to do tricks with std::strings
9353 like: string a("hei"); &a[e]; this will not give what you
9354 think... Any reason for the complexity in this func?
9356 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9358 * Updated README and INSTALL a bit, mostly to check that my
9359 CVS rights are correctly set up.
9361 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9363 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9364 does not allow '\0' chars but lyxstring and std::string does.
9366 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9368 * autogen.sh (AUTOCONF): let the autogen script create the
9369 POTFILES.in file too. POTFILES.in should perhaps now not be
9370 included in the cvs module.
9372 * some more files changed to use C++ includes instead of C ones.
9374 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9376 (Reread): added tostr to nlink. buggy output otherwise.
9377 (Reread): added a string() around szMode when assigning to Buffer,
9378 without this I got a log of garbled info strings.
9380 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9383 * I have added several ostream & operator<<(ostream &, some_type)
9384 functions. This has been done to avoid casting and warnings when
9385 outputting enums to lyxerr. This as thus eliminated a lot of
9386 explicit casts and has made the code clearer. Among the enums
9387 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9388 mathed enums, some font enum the Debug::type enum.
9390 * src/support/lyxstring.h (clear): missing method. equivalent of
9393 * all files that contained "stderr": rewrote constructs that used
9394 stderr to use lyxerr instead. (except bmtable)
9396 * src/support/DebugStream.h (level): and the passed t with
9397 Debug::ANY to avoid spurious bits set.
9399 * src/debug.h (Debug::type value): made it accept strings of the
9402 * configure.in (Check for programs): Added a check for kpsewhich,
9403 the latex generation will use this later to better the dicovery of
9406 * src/BufferView.C (create_view): we don't need to cast this to
9407 (void*) that is done automatically.
9408 (WorkAreaButtonPress): removed some dead code.
9410 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9412 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9413 is not overwritten when translated (David Sua'rez de Lis).
9415 * lib/CREDITS: Added David Sua'rez de Lis
9417 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9419 * src/bufferparams.C (BufferParams): default input encoding is now
9422 * acinclude.m4 (cross_compiling): comment out macro
9423 LYX_GXX_STRENGTH_REDUCE.
9425 * acconfig.h: make sure that const is not defined (to empty) when
9426 we are compiling C++. Remove commented out code using SIZEOF_xx
9429 * configure.in : move the test for const and inline as late as
9430 possible so that these C tests do not interefere with C++ ones.
9431 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9432 has not been proven.
9434 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9436 * src/table.C (getDocBookAlign): remove bad default value for
9439 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9441 (ShowFileMenu2): ditto.
9443 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9446 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9448 * Most files: finished the change from the old error code to use
9449 DebugStream for all lyxerr debugging. Only minor changes remain
9450 (e.g. the setting of debug levels using strings instead of number)
9452 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9454 * src/layout.C (Add): Changed to use compare_no_case instead of
9457 * src/FontInfo.C: changed loop variable type too string::size_type.
9459 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9461 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9462 set ETAGS_ARGS to --c++
9464 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9466 * src/table.C (DocBookEndOfCell): commented out two unused variables
9468 * src/paragraph.C: commented out four unused variables.
9470 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9471 insed a if clause with type string::size_type.
9473 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9476 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9478 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9479 variable, also changed loop to go from 0 to lenght + 1, instead of
9480 -1 to length. This should be correct.
9482 * src/LaTeX.C (scanError): use string::size_type as loop variable
9485 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9486 (l.896) since y_tmp and row was not used anyway.
9488 * src/insets/insetref.C (escape): use string::size_type as loop
9491 * src/insets/insetquotes.C (Width): use string::size_type as loop
9493 (Draw): use string::size_type as loop variable type.
9495 * src/insets/insetlatexaccent.C (checkContents): use
9496 string::size_type as loop variable type.
9498 * src/insets/insetlabel.C (escape): use string::size_type as loop
9501 * src/insets/insetinfo.C: added an extern for current_view.
9503 * src/insets/insetcommand.C (scanCommand): use string::size_type
9504 as loop variable type.
9506 * most files: removed the RCS tags. With them we had to recompile
9507 a lot of files after a simple cvs commit. Also we have never used
9508 them for anything meaningful.
9510 * most files: tags-query-replace NULL 0. As adviced several plases
9511 we now use "0" instead of "NULL" in our code.
9513 * src/support/filetools.C (SpaceLess): use string::size_type as
9516 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9518 * src/paragraph.C: fixed up some more string stuff.
9520 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9522 * src/support/filetools.h: make modestr a std::string.
9524 * src/filetools.C (GetEnv): made ch really const.
9526 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9527 made code that used these use max/min from <algorithm> instead.
9529 * changed several c library include files to their equivalent c++
9530 library include files. All is not changed yet.
9532 * created a support subdir in src, put lyxstring and lstrings
9533 there + the extra files atexit, fileblock, strerror. Created
9534 Makefile.am. edited configure.in and src/Makefile.am to use this
9535 new subdir. More files moved to support.
9537 * imported som of the functions from repository lyx, filetools
9539 * ran tags-query-replace on LString -> string, corrected the bogus
9540 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9541 is still some errors in there. This is errors where too much or
9542 too litle get deleted from strings (string::erase, string::substr,
9543 string::replace), there can also be some off by one errors, or
9544 just plain wrong use of functions from lstrings. Viewing of quotes
9547 * LyX is now running fairly well with string, but there are
9548 certainly some bugs yet (see above) also string is quite different
9549 from LString among others in that it does not allow null pointers
9550 passed in and will abort if it gets any.
9552 * Added the revtex4 files I forgot when setting up the repository.
9554 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9556 * All over: Tried to clean everything up so that only the files
9557 that we really need are included in the cvs repository.
9558 * Switched to use automake.
9559 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9560 * Install has not been checked.
9562 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9564 * po/pt.po: Three errors:
9565 l.533 and l.538 format specification error
9566 l. 402 duplicate entry, I just deleted it.