1 2000-09-25 Juergen Vigna <jug@sad.it>
3 * src/frontends/kde/Dialogs.C (Dialogs):
4 * src/frontends/gnome/Dialogs.C (Dialogs):
5 * src/frontends/kde/Makefile.am:
6 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
8 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
10 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
12 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
14 * src/frontends/xforms/FormParagraph.C:
15 * src/frontends/xforms/FormParagraph.h:
16 * src/frontends/xforms/form_paragraph.C:
17 * src/frontends/xforms/form_paragraph.h:
18 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
21 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
23 * src/tabular.C (OldFormatRead): forgot to delete the temporary
24 Paragraph-Data after use.
26 * src/insets/insettext.C (LocalDispatch): don't set the layout on
27 non breakable paragraphs.
29 2000-09-25 Garst R. Reese <reese@isn.net>
31 * src/language.C (initL): added missing language_country codes.
33 2000-09-25 Juergen Vigna <jug@sad.it>
35 * src/insets/insettext.C (InsetText):
36 (deleteLyXText): remove the not released LyXText structure!
38 2000-09-24 Marko Vendelin <markov@ioc.ee>
40 * src/frontends/gnome/mainapp.C
41 * src/frontends/gnome/mainapp.h: added support for keyboard
44 * src/frontends/gnome/FormCitation.C
45 * src/frontends/gnome/FormCitation.h
46 * src/frontends/gnome/Makefile.am
47 * src/frontends/gnome/pixbutton.h: completed the rewrite of
48 FormCitation to use "action area" in mainapp window
50 * src/frontends/gnome/Menubar_pimpl.C
51 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
54 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
56 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
57 width/descent/ascent values if name is empty.
58 (mathed_string_height): Use std::max.
60 2000-09-25 Allan Rae <rae@lyx.org>
62 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
63 segfault. This will be completely redesigned soon.
65 * sigc++: updated libsigc++. Fixes struct timespec bug.
67 * development/tools/makeLyXsigc.sh: .cvsignore addition
69 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
71 * several files: removed almost all traces of the old table
74 * src/TableLayout.C: removed file
76 2000-09-22 Juergen Vigna <jug@sad.it>
78 * src/frontends/kde/Dialogs.C: added credits forms.
80 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
82 * src/frontends/gnome/Dialogs.C: added some forms.
84 * src/spellchecker.C (init_spell_checker): set language in pspell code
85 (RunSpellChecker): some modifications for setting language string.
87 * src/language.[Ch]: added language_country code.
89 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
91 * src/frontends/Dialogs.h: added new signal showError.
92 Rearranged existing signals in some sort of alphabetical order.
94 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
95 FormError.[Ch], form_error.[Ch]
96 * src/frontends/xforms/forms/makefile: added new file form_error.fd
97 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
99 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
100 dialogs. I think that this can be used as the base to all these
103 * src/frontends/xforms/FormError.[Ch]
104 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
105 implementation of InsetError dialog.
107 * src/insets/inseterror.[Ch]: rendered GUI-independent.
109 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
110 * src/frontends/kde/Makefile.am: ditto
112 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
114 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
115 macrobf. This fixes a bug of invisible text.
117 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
119 * lib/doc/LaTeXConfig.lyx.in: updated.
121 * src/language.C (initL): remove language "francais" and change a
122 bit the names of the two other french variations.
124 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
125 string that may not be 0-terminated.
127 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
129 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
131 2000-09-20 Marko Vendelin <markov@ioc.ee>
133 * src/frontends/gnome/FormCitation.C
134 * src/frontends/gnome/FormIndex.C
135 * src/frontends/gnome/FormToc.C
136 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
137 the variable initialization to shut up the warnings
139 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
141 * src/table.[Ch]: deleted files
143 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
146 2000-09-18 Juergen Vigna <jug@sad.it>
148 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
149 problems with selection. Inserted new LFUN_PASTESELECTION.
150 (InsetButtonPress): inserted handling of middle mouse-button paste.
152 * src/spellchecker.C: changed word to word.c_str().
154 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
156 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
157 included in the ``make dist'' tarball.
159 2000-09-15 Juergen Vigna <jug@sad.it>
161 * src/CutAndPaste.C (cutSelection): small fix return the right
162 end position after cut inside one paragraph only.
164 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
165 we are locked as otherwise we don't have a valid cursor position!
167 * src/insets/figinset.C (draw): small bugfix but why is this needed???
169 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
171 * src/frontends/kde/FormRef.C: added using directive.
172 * src/frontends/kde/FormToc.C: ditto
174 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
176 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
179 2000-09-19 Marko Vendelin <markov@ioc.ee>
181 * src/frontends/gnome/Menubar_pimpl.C
182 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
183 Toc, ViewFormats, UpdateFormats, and ExportFormats.
185 * src/frontends/gnome/mainapp.C
186 * src/frontends/gnome/mainapp.h: support for menu update used
189 * src/frontends/gnome/mainapp.C
190 * src/frontends/gnome/mainapp.h: support for "action" area in the
191 main window. This area is used by small simple dialogs, such as
194 * src/frontends/gnome/FormIndex.C
195 * src/frontends/gnome/FormIndex.h
196 * src/frontends/gnome/FormUrl.C
197 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
200 * src/frontends/gnome/FormCitation.C
201 * src/frontends/gnome/FormCitation.h: rewrite to use main window
202 action area. Only "Insert new citation" is implemented.
206 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
208 * src/buffer.C (Dispatch): fix call to Dispatch
209 * src/insets/insetref.C (Edit): likewise
210 * src/insets/insetparent.C (Edit): likewise
211 * src/insets/insetinclude.C (include_cb): likewise
212 * src/frontends/xforms/FormUrl.C (apply): likewise
213 * src/frontends/xforms/FormToc.C (apply): likewise
214 * src/frontends/xforms/FormRef.C (apply): likewise
215 * src/frontends/xforms/FormIndex.C (apply): likewise
216 * src/frontends/xforms/FormCitation.C (apply): likewise
217 * src/lyxserver.C (callback): likewise
218 * src/lyxfunc.C (processKeySym): likewise
221 * src/lyx_cb.C (LayoutsCB): likewise
223 * Makefile.am (sourcedoc): small change
225 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
227 * src/main.C (main): Don't make an empty GUIRunTime object. all
228 methods are static. constify a bit remove unneded using + headers.
230 * src/tabular.C: some more const to local vars move some loop vars
232 * src/spellchecker.C: added some c_str after some word for pspell
234 * src/frontends/GUIRunTime.h: add new static method setDefaults
235 * src/frontends/xforms/GUIRunTime.C (setDefaults):
236 * src/frontends/kde/GUIRunTime.C (setDefaults):
237 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
239 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
240 with strnew in arg, use correct emptystring when calling SetName.
242 * several files: remove all commented code with relation to
243 HAVE_SSTREAM beeing false. We now only support stringstream and
246 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
248 * src/lyxfunc.C: construct correctly the automatic new file
251 * src/text2.C (IsStringInText): change type of variable i to shut
254 * src/support/sstream.h: do not use namespaces if the compiler
255 does not support them.
257 2000-09-15 Marko Vendelin <markov@ioc.ee>
258 * src/frontends/gnome/FormCitation.C
259 * src/frontends/gnome/FormCitation.h
260 * src/frontends/gnome/diainsertcitation_interface.c
261 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
262 regexp support to FormCitation [Gnome].
264 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
267 * configure.in: remove unused KDE/GTKGUI define
269 * src/frontends/kde/FormRef.C
270 * src/frontends/kde/FormRef.h
271 * src/frontends/kde/formrefdialog.C
272 * src/frontends/kde/formrefdialog.h: double click will
273 go to reference, now it is possible to change a cross-ref
276 * src/frontends/kde/FormToc.C
277 * src/frontends/kde/FormToc.h
278 * src/frontends/kde/formtocdialog.C
279 * src/frontends/kde/formtocdialog.h: add a depth
282 * src/frontends/kde/Makefile.am: add QtLyXView.h
285 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
287 * src/frontends/kde/FormCitation.h: added some using directives.
289 * src/frontends/kde/FormToc.h: corrected definition of doTree.
291 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
294 * src/mathed/math_defs.h: redefine SetAlign to use string rather
297 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
299 * src/buffer.C (pop_tag): revert for the second time a change by
300 Lars, who seems to really hate having non-local loop variables :)
302 * src/Lsstream.h: add "using" statements.
304 * src/support/copy.C (copy): add a bunch of std:: qualifiers
305 * src/buffer.C (writeFile): ditto
307 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
309 * src/buffer.C (writeFile): try to fix the locale modified format
310 number to always be as we want it.
312 * src/WorkArea.C (work_area_handler): try to workaround the bugs
313 in XForms 0.89. C-space is now working again.
315 * src/Lsstream.h src/support/sstream.h: new files.
317 * also commented out all cases where strstream were used.
319 * src/Bullet.h (c_str): remove method.
321 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
323 * a lot of files: get rid of "char const *" and "char *" is as
324 many places as possible. We only want to use them in interaction
325 with system of other libraries, not inside lyx.
327 * a lot of files: return const object is not of pod type. This
328 helps ensure that temporary objects is not modified. And fits well
329 with "programming by contract".
331 * configure.in: check for the locale header too
333 * Makefile.am (sourcedoc): new tag for generation of doc++
336 2000-09-14 Juergen Vigna <jug@sad.it>
338 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
339 callback to check which combo called it and do the right action.
341 * src/combox.C (combo_cb): added combo * to the callbacks.
342 (Hide): moved call of callback after Ungrab of the pointer.
344 * src/intl.h: removed LCombo2 function.
346 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
347 function as this can now be handled in one function.
349 * src/combox.h: added Combox * to callback prototype.
351 * src/frontends/xforms/Toolbar_pimpl.C:
352 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
354 2000-09-14 Garst Reese <reese@isn.net>
356 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
357 moved usepackage{xxx}'s to beginning of file. Changed left margin
358 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
359 underlining from title. Thanks to John Culleton for useful suggestions.
361 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
363 * src/lyxlex_pimpl.C (setFile): change error message to debug
366 2000-09-13 Juergen Vigna <jug@sad.it>
368 * src/frontends/xforms/FormDocument.C: implemented choice_class
369 as combox and give callback to combo_language so OK/Apply is activated
372 * src/bufferlist.C (newFile): small fix so already named files
373 (via an open call) are not requested to be named again on the
376 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
378 * src/frontends/kde/Makefile.am
379 * src/frontends/kde/FormRef.C
380 * src/frontends/kde/FormRef.h
381 * src/frontends/kde/formrefdialog.C
382 * src/frontends/kde/formrefdialog.h: implement
385 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
387 * src/frontends/kde/formtocdialog.C
388 * src/frontends/kde/formtocdialog.h
389 * src/frontends/kde/FormToc.C
390 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
392 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
394 * src/frontends/kde/FormCitation.C: fix thinko
395 where we didn't always display the reference text
398 * src/frontends/kde/formurldialog.C
399 * src/frontends/kde/formurldialog.h
400 * src/frontends/kde/FormUrl.C
401 * src/frontends/kde/FormUrl.h: minor cleanups
403 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
405 * src/frontends/kde/Makefile.am
406 * src/frontends/kde/FormToc.C
407 * src/frontends/kde/FormToc.h
408 * src/frontends/kde/FormCitation.C
409 * src/frontends/kde/FormCitation.h
410 * src/frontends/kde/FormIndex.C
411 * src/frontends/kde/FormIndex.h
412 * src/frontends/kde/formtocdialog.C
413 * src/frontends/kde/formtocdialog.h
414 * src/frontends/kde/formcitationdialog.C
415 * src/frontends/kde/formcitationdialog.h
416 * src/frontends/kde/formindexdialog.C
417 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
419 2000-09-12 Juergen Vigna <jug@sad.it>
421 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
424 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
426 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
429 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
431 * src/converter.C (Add, Convert): Added support for converter flags:
432 needaux, resultdir, resultfile.
433 (Convert): Added new parameter view_file.
434 (dvips_options): Fixed letter paper option.
436 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
437 (Export, GetExportableFormats, GetViewableFormats): Added support
440 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
442 (easyParse): Fixed to work with new export code.
444 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
447 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
449 * lib/bind/*.bind: Replaced
450 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
451 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
453 2000-09-11 Juergen Vigna <jug@sad.it>
455 * src/lyx_gui.C (runTime): uses global guiruntime variable.
457 * src/main.C (main): now GUII defines global guiruntime!
459 * src/frontends/gnome/GUIRunTime.C (initApplication):
460 * src/frontends/kde/GUIRunTime.C (initApplication):
461 * src/frontends/xforms/GUIRunTime.C (initApplication):
462 * src/frontends/GUIRunTime.h: added new function initApplication.
464 * src/spellchecker.C (sc_accept_word): change to add_to_session.
466 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
468 2000-09-08 Juergen Vigna <jug@sad.it>
470 * src/lyx_gui.C (create_forms): don't display the "default" entry as
471 we have already "Reset".
473 * src/language.C (initL): inserted "default" language and made this
474 THE default language (and not american!)
476 * src/paragraph.C: inserted handling of "default" language!
478 * src/lyxfont.C: ditto
482 * src/paragraph.C: output the \\par only if we have a following
483 paragraph otherwise it's not needed.
485 2000-09-05 Juergen Vigna <jug@sad.it>
487 * config/pspell.m4: added entry to lyx-flags
489 * src/spellchecker.C: modified version from Kevin for using pspell
491 2000-09-01 Marko Vendelin <markov@ioc.ee>
492 * src/frontends/gnome/Makefile.am
493 * src/frontends/gnome/FormCitation.C
494 * src/frontends/gnome/FormCitation.h
495 * src/frontends/gnome/diainsertcitation_callbacks.c
496 * src/frontends/gnome/diainsertcitation_callbacks.h
497 * src/frontends/gnome/diainsertcitation_interface.c
498 * src/frontends/gnome/diainsertcitation_interface.h
499 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
500 dialog for Gnome frontend
502 * src/main.C: Gnome libraries require keeping application name
503 and its version as strings
505 * src/frontends/gnome/mainapp.C: Change the name of the main window
506 from GnomeLyX to PACKAGE
508 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
510 * src/frontends/Liason.C: add "using: declaration.
512 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
514 * src/mathed/math_macro.C (Metrics): Set the size of the template
516 * src/mathed/formulamacro.C (Latex): Fixed the returned value
518 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
520 * src/converter.C (add_options): New function.
521 (SetViewer): Change $$FName into '$$FName'.
522 (View): Add options when running xdvi
523 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
524 (Convert): The 3rd parameter is now the desired filename. Converts
525 calls to lyx::rename if necessary.
526 Add options when running dvips.
527 (dvi_papersize,dvips_options): New methods.
529 * src/exporter.C (Export): Use getLatexName() instead of fileName().
531 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
532 using a call to Converter::dvips_options.
533 Fixed to work with nex export code.
536 * src/support/rename.C: New files
538 * src/support/syscall.h
539 * src/support/syscall.C: Added Starttype SystemDontWait.
541 * lib/ui/default.ui: Changed to work with new export code
543 * lib/configure.m4: Changed to work with new export code
545 * src/encoding.C: Changed latex name for iso8859_7 encoding.
547 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
549 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
550 so that code compiles with DEC cxx.
552 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
553 to work correctly! Also now supports the additional elements
556 2000-09-01 Allan Rae <rae@lyx.org>
558 * src/frontends/ButtonPolicies.C: renamed all the references to
559 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
561 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
562 since it's a const not a type.
564 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
566 2000-08-31 Juergen Vigna <jug@sad.it>
568 * src/insets/figinset.C: Various changes to look if the filename has
569 an extension and if not add it for inline previewing.
571 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
573 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
574 make buttonStatus and isReadOnly be const methods. (also reflect
575 this in derived classes.)
577 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
578 (nextState): change to be static inline, pass the StateMachine as
580 (PreferencesPolicy): remove casts
581 (OkCancelPolicy): remvoe casts
582 (OkCancelReadOnlyPolicy): remove casts
583 (NoRepeatedApplyReadOnlyPolicy): remove casts
584 (OkApplyCancelReadOnlyPolicy): remove casts
585 (OkApplyCancelPolicy): remove casts
586 (NoRepeatedApplyPolicy): remove casts
588 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
590 * src/converter.C: added some using directives
592 * src/frontends/ButtonPolicies.C: changes to overcome
593 "need lvalue" error with DEC c++
595 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
596 to WMHideCB for DEC c++
598 * src/frontends/xforms/Menubar_pimpl.C: added using directive
600 * src/frontends/xforms/forms/form_document.C.patch: use C callback
601 to BulletBMTableCB for DEC c++
603 2000-08-31 Allan Rae <rae@lyx.org>
605 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
606 character dialog separately from old document dialogs combo_language.
609 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
611 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
612 Removed LFUN_REF_CREATE.
614 * src/MenuBackend.C: Added new tags: toc and references
616 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
617 (add_lastfiles, add_documents, add_formats): Removed the unused smn
619 (add_toc, add_references): New methods.
620 (create_submenu): Handle correctly the case when there is a
621 seperator after optional menu items.
623 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
624 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
625 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
627 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
629 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
631 * src/converter.[Ch]: New file for converting between different
634 * src/export.[Ch]: New file for exporting a LyX file to different
637 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
638 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
639 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
640 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
641 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
642 RunDocBook, MenuExport.
644 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
645 Exporter::Preview methods if NEW_EXPORT is defined.
647 * src/buffer.C (Dispatch): Use Exporter::Export.
649 * src/lyxrc.C: Added new tags: \converter and \viewer.
652 * src/LyXAction.C: Define new lyx-function: buffer-update.
653 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
654 when NEW_EXPORT is defined.
656 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
658 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
660 * lib/ui/default.ui: Added submenus "view" and "update" to the
663 * src/filetools.C (GetExtension): New function.
665 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
667 2000-08-29 Allan Rae <rae@lyx.org>
669 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
671 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
672 (EnableDocumentLayout): removed
673 (DisableDocumentLayout): removed
674 (build): make use of ButtonController's read-only handling to
675 de/activate various objects. Replaces both of the above functions.
677 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
678 (readOnly): was read_only
679 (refresh): fixed dumb mistakes with read_only_ handling
681 * src/frontends/xforms/forms/form_document.fd:
682 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
683 tabbed dialogs so the tabs look more like tabs and so its easier to
684 work out which is the current tab.
686 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
687 segfault with form_table
689 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
691 2000-08-28 Juergen Vigna <jug@sad.it>
693 * acconfig.h: added USE_PSPELL.
695 * src/config.h.in: added USE_PSPELL.
697 * autogen.sh: added pspell.m4
699 * config/pspell.m4: new file.
701 * src/spellchecker.C: implemented support for pspell libary.
703 2000-08-25 Juergen Vigna <jug@sad.it>
705 * src/LyXAction.C (init): renamed LFUN_TABLE to
706 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
708 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
710 * src/lyxscreen.h: add force_clear variable and fuction to force
711 a clear area when redrawing in LyXText.
713 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
715 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
717 * some whitespace and comment changes.
719 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
721 * src/buffer.C: up te LYX_FORMAT to 2.17
723 2000-08-23 Juergen Vigna <jug@sad.it>
725 * src/BufferView_pimpl.C (tripleClick): disable this when in a
728 * src/insets/insettabular.C (pasteSelection): delete the insets
729 LyXText as it is not valid anymore.
730 (copySelection): new function.
731 (pasteSelection): new function.
732 (cutSelection): new function.
733 (LocalDispatch): implemented cut/copy/paste of cell selections.
735 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
736 don't have a LyXText.
738 * src/LyXAction.C (init): a NEW_TABULAR define too much.
740 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
743 2000-08-22 Juergen Vigna <jug@sad.it>
745 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
746 ifdef form_table out if NEW_TABULAR.
748 2000-08-21 Juergen Vigna <jug@sad.it>
750 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
751 (draw): fixed draw position so that the cursor is positioned in the
753 (InsetMotionNotify): hide/show cursor so the position is updated.
754 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
755 using cellstart() function where it should be used.
757 * src/insets/insettext.C (draw): ditto.
759 * src/tabular.C: fixed initialization of some missing variables and
760 made BoxType into an enum.
762 2000-08-22 Marko Vendelin <markov@ioc.ee>
763 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
764 stock menu item using action numerical value, not its string
768 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
770 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
771 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
773 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
775 * src/frontends/xforms/GUIRunTime.C: new file
777 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
778 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
780 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
782 * src/frontends/kde/GUIRunTime.C: new file
784 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
785 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
787 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
789 * src/frontends/gnome/GUIRunTime.C: new file
791 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
794 * src/frontends/GUIRunTime.h: removed constructor and destructor,
795 small change to documetentation.
797 * src/frontends/GUIRunTime.C: removed file
799 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
801 * src/lyxparagraph.h: enable NEW_TABULAR as default
803 * src/lyxfunc.C (processKeySym): remove some commented code
805 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
806 NEW_TABULAR around the fd_form_table_options.
808 * src/lyx_gui.C (runTime): call the static member function as
809 GUIRunTime::runTime().
811 2000-08-21 Allan Rae <rae@lyx.org>
813 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
816 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
818 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
820 2000-08-21 Allan Rae <rae@lyx.org>
822 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
824 * src/frontends/xforms/FormPreferences.C (build): use setOK
825 * src/frontends/xforms/FormDocument.C (build): use setOK
826 (FormDocument): use the appropriate policy.
828 2000-08-21 Allan Rae <rae@lyx.org>
830 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
831 automatic [de]activation of arbitrary objects when in a read-only state.
833 * src/frontends/ButtonPolicies.h: More documentation
834 (isReadOnly): added to support the above.
836 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
838 2000-08-18 Juergen Vigna <jug@sad.it>
840 * src/insets/insettabular.C (getStatus): changed to return func_status.
842 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
843 display toggle menu entries if they are.
845 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
846 new document layout now.
848 * src/lyxfunc.C: ditto
850 * src/lyx_gui_misc.C: ditto
852 * src/lyx_gui.C: ditto
854 * lib/ui/default.ui: removed paper and quotes layout as they are now
855 all in the document layout tabbed folder.
857 * src/frontends/xforms/forms/form_document.fd: added Restore
858 button and callbacks for all inputs for Allan's ButtonPolicy.
860 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
861 (CheckChoiceClass): added missing params setting on class change.
862 (UpdateLayoutDocument): added for updating the layout on params.
863 (build): forgot to RETURN_ALWAYS input_doc_spacing.
864 (FormDocument): Implemented Allan's ButtonPolicy with the
867 2000-08-17 Allan Rae <rae@lyx.org>
869 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
870 so we can at least see the credits again.
872 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
873 controller calls for the appropriate callbacks. Note that since Ok
874 calls apply followed by cancel, and apply isn't a valid input for the
875 APPLIED state, the bc_ calls have to be made in the static callback not
876 within each of the real callbacks.
878 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
879 (setOk): renamed from setOkay()
881 2000-08-17 Juergen Vigna <jug@sad.it>
883 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
884 in the implementation part.
885 (composeUIInfo): don't show optional menu-items.
887 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
889 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
891 * src/bufferview_funcs.C (CurrentState): fixed to show also the
892 text-state when in a text-inset.
894 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
896 2000-08-17 Marko Vendelin <markov@ioc.ee>
897 * src/frontends/gnome/FormIndex.C
898 * src/frontends/gnome/FormIndex.h
899 * src/frontends/gnome/FormToc.C
900 * src/frontends/gnome/FormToc.h
901 * src/frontends/gnome/dialogs
902 * src/frontends/gnome/diatoc_callbacks.c
903 * src/frontends/gnome/diatoc_callbacks.h
904 * src/frontends/gnome/diainsertindex_callbacks.h
905 * src/frontends/gnome/diainsertindex_callbacks.c
906 * src/frontends/gnome/diainsertindex_interface.c
907 * src/frontends/gnome/diainsertindex_interface.h
908 * src/frontends/gnome/diatoc_interface.h
909 * src/frontends/gnome/diatoc_interface.c
910 * src/frontends/gnome/Makefile.am: Table of Contents and
911 Insert Index dialogs implementation for Gnome frontend
913 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
915 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
917 * src/frontends/gnome/diainserturl_interface.c: make the dialog
920 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
922 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
923 destructor. Don't definde if you don't need it
924 (processEvents): made static, non-blocking events processing for
926 (runTime): static method. event loop for xforms
927 * similar as above for kde and gnome.
929 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
931 (runTime): new method calss the real frontends runtime func.
933 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
935 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
937 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
939 2000-08-16 Juergen Vigna <jug@sad.it>
941 * src/lyx_gui.C (runTime): added GUII RunTime support.
943 * src/frontends/Makefile.am:
944 * src/frontends/GUIRunTime.[Ch]:
945 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
946 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
947 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
949 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
951 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
952 as this is already set in ${FRONTEND_INCLUDE} if needed.
954 * configure.in (CPPFLAGS): setting the include dir for the frontend
955 directory and don't set FRONTEND=xforms for now as this is executed
958 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
960 * src/frontends/kde/Makefile.am:
961 * src/frontends/kde/FormUrl.C:
962 * src/frontends/kde/FormUrl.h:
963 * src/frontends/kde/formurldialog.h:
964 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
966 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
968 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
970 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
972 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
975 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
977 * src/WorkArea.C (work_area_handler): more work to get te
978 FL_KEYBOARD to work with xforms 0.88 too, please test.
980 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
982 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
984 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
987 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
989 * src/Timeout.h: remove Qt::emit hack.
991 * several files: changes to allo doc++ compilation
993 * src/lyxfunc.C (processKeySym): new method
994 (processKeyEvent): comment out if FL_REVISION < 89
996 * src/WorkArea.C: change some debugging levels.
997 (WorkArea): set wantkey to FL_KEY_ALL
998 (work_area_handler): enable the FL_KEYBOARD clause, this enables
999 clearer code and the use of compose with XForms 0.89. Change to
1000 use signals instead of calling methods in bufferview directly.
1002 * src/Painter.C: change some debugging levels.
1004 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1007 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1008 (workAreaKeyPress): new method
1010 2000-08-14 Juergen Vigna <jug@sad.it>
1012 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1014 * config/kde.m4: addes some features
1016 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1017 include missing xforms dialogs.
1019 * src/Timeout.h: a hack to be able to compile with qt/kde.
1021 * sigc++/.cvsignore: added acinclude.m4
1023 * lib/.cvsignore: added listerros
1025 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1026 xforms tree as objects are needed for other frontends.
1028 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1029 linking with not yet implemented xforms objects.
1031 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1033 2000-08-14 Baruch Even <baruch.even@writeme.com>
1035 * src/frontends/xforms/FormGraphics.h:
1036 * src/frontends/xforms/FormGraphics.C:
1037 * src/frontends/xforms/RadioButtonGroup.h:
1038 * src/frontends/xforms/RadioButtonGroup.C:
1039 * src/insets/insetgraphics.h:
1040 * src/insets/insetgraphics.C:
1041 * src/insets/insetgraphicsParams.h:
1042 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1043 instead of spaces, and various other indentation issues to make the
1044 sources more consistent.
1046 2000-08-14 Marko Vendelin <markov@ioc.ee>
1048 * src/frontends/gnome/dialogs/diaprint.glade
1049 * src/frontends/gnome/FormPrint.C
1050 * src/frontends/gnome/FormPrint.h
1051 * src/frontends/gnome/diaprint_callbacks.c
1052 * src/frontends/gnome/diaprint_callbacks.h
1053 * src/frontends/gnome/diaprint_interface.c
1054 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1057 * src/frontends/gnome/dialogs/diainserturl.glade
1058 * src/frontends/gnome/FormUrl.C
1059 * src/frontends/gnome/FormUrl.h
1060 * src/frontends/gnome/diainserturl_callbacks.c
1061 * src/frontends/gnome/diainserturl_callbacks.h
1062 * src/frontends/gnome/diainserturl_interface.c
1063 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1064 Gnome implementation
1066 * src/frontends/gnome/Dialogs.C
1067 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1068 all other dialogs. Copy all unimplemented dialogs from Xforms
1071 * src/frontends/gnome/support.c
1072 * src/frontends/gnome/support.h: support files generated by Glade
1076 * config/gnome.m4: Gnome configuration scripts
1078 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1079 configure --help message
1081 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1082 only if there are no events pendling in Gnome/Gtk. This enhances
1083 the performance of menus.
1086 2000-08-14 Allan Rae <rae@lyx.org>
1088 * lib/Makefile.am: listerrors cleaning
1090 * lib/listerrors: removed -- generated file
1091 * acinclude.m4: ditto
1092 * sigc++/acinclude.m4: ditto
1094 * src/frontends/xforms/forms/form_citation.fd:
1095 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1098 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1099 `updatesrc` and now we have a `test` target that does what `updatesrc`
1100 used to do. I didn't like having an install target that wasn't related
1103 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1104 on all except FormGraphics. This may yet happen. Followed by a major
1105 cleanup including using FL_TRANSIENT for most of the dialogs. More
1106 changes to come when the ButtonController below is introduced.
1108 * src/frontends/xforms/ButtonController.h: New file for managing up to
1109 four buttons on a dialog according to an externally defined policy.
1110 * src/frontends/xforms/Makefile.am: added above
1112 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1113 Apply and Cancel/Close buttons and everything in between and beyond.
1114 * src/frontends/Makefile.am: added above.
1116 * src/frontends/xforms/forms/form_preferences.fd:
1117 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1118 and removed variable 'status' as a result. Fixed the set_minsize thing.
1119 Use the new screen-font-update after checking screen fonts were changed
1120 Added a "Restore" button to restore the original lyxrc values while
1121 editing. This restores everything not just the last input changed.
1122 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1124 * src/LyXAction.C: screen-font-update added for updating buffers after
1125 screen font settings have been changed.
1126 * src/commandtags.h: ditto
1127 * src/lyxfunc.C: ditto
1129 * forms/lyx.fd: removed screen fonts dialog.
1130 * src/lyx_gui.C: ditto
1131 * src/menus.[Ch]: ditto
1132 * src/lyx.[Ch]: ditto
1133 * src/lyx_cb.C: ditto + code from here moved to make
1134 screen-font-update. And people wonder why progress on GUII is
1135 slow. Look at how scattered this stuff was! It takes forever
1138 * forms/fdfix.sh: Fixup the spacing after commas.
1139 * forms/makefile: Remove date from generated files. Fewer clashes now.
1140 * forms/bullet_forms.C.patch: included someones handwritten changes
1142 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1143 once I've discovered why LyXRC was made noncopyable.
1144 * src/lyx_main.C: ditto
1146 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1148 * src/frontends/xforms/forms/fdfix.sh:
1149 * src/frontends/xforms/forms/fdfixh.sed:
1150 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1151 * src/frontends/xforms/Form*.[hC]:
1152 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1153 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1154 provide a destructor for the struct FD_form_xxxx. Another version of
1155 the set_[max|min]size workaround and a few other cleanups. Actually,
1156 Angus' patch from 20000809.
1158 2000-08-13 Baruch Even <baruch.even@writeme.com>
1160 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1163 2000-08-11 Juergen Vigna <jug@sad.it>
1165 * src/insets/insetgraphics.C (InsetGraphics): changing init
1166 order because of warnings.
1168 * src/frontends/xforms/forms/makefile: adding patching .C with
1171 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1172 from .C.patch to .c.patch
1174 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1175 order because of warning.
1177 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1179 * src/frontends/Liason.C (setMinibuffer): new helper function
1181 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1183 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1185 * lib/ui/default.ui: commented out PaperLayout entry
1187 * src/frontends/xforms/form_document.[Ch]: new added files
1189 * src/frontends/xforms/FormDocument.[Ch]: ditto
1191 * src/frontends/xforms/forms/form_document.fd: ditto
1193 * src/frontends/xforms/forms/form_document.C.patch: ditto
1195 2000-08-10 Juergen Vigna <jug@sad.it>
1197 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1198 (InsetGraphics): initialized cacheHandle to 0.
1199 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1201 2000-08-10 Baruch Even <baruch.even@writeme.com>
1203 * src/graphics/GraphicsCache.h:
1204 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1205 correctly as a cache.
1207 * src/graphics/GraphicsCacheItem.h:
1208 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1211 * src/graphics/GraphicsCacheItem_pimpl.h:
1212 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1215 * src/insets/insetgraphics.h:
1216 * src/insets/insetgraphics.C: Changed from using a signal notification
1217 to polling when image is not loaded.
1219 2000-08-10 Allan Rae <rae@lyx.org>
1221 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1222 that there are two functions that have to been taken out of line by
1223 hand and aren't taken care of in the script. (Just a reminder note)
1225 * sigc++/macros/*.h.m4: Updated as above.
1227 2000-08-09 Juergen Vigna <jug@sad.it>
1229 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1231 * src/insets/insettabular.C: make drawing of single cell smarter.
1233 2000-08-09 Marko Vendelin <markov@ioc.ee>
1234 * src/frontends/gnome/Menubar_pimpl.C
1235 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1236 implementation: new files
1238 * src/frontends/gnome/mainapp.C
1239 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1242 * src/main.C: create Gnome main window
1244 * src/frontends/xforms/Menubar_pimpl.h
1245 * src/frontends/Menubar.C
1246 * src/frontends/Menubar.h: added method Menubar::update that calls
1247 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1249 * src/LyXView.C: calls Menubar::update to update the state
1252 * src/frontends/gnome/Makefile.am: added new files
1254 * src/frontends/Makefile.am: added frontend compiler options
1256 2000-08-08 Juergen Vigna <jug@sad.it>
1258 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1260 * src/bufferlist.C (close):
1261 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1262 documents if exiting without saving.
1264 * src/buffer.C (save): use removeAutosaveFile()
1266 * src/support/filetools.C (removeAutosaveFile): new function.
1268 * src/lyx_cb.C (MenuWrite): returns a bool now.
1269 (MenuWriteAs): check if file could really be saved and revert to the
1271 (MenuWriteAs): removing old autosavefile if existant.
1273 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1274 before Goto toggle declaration, because of compiler warning.
1276 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1278 * src/lyxfunc.C (MenuNew): small fix.
1280 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1282 * src/bufferlist.C (newFile):
1283 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1285 * src/lyxrc.C: added new_ask_filename tag
1287 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1289 * src/lyx.fd: removed code pertaining to form_ref
1290 * src/lyx.[Ch]: ditto
1291 * src/lyx_cb.C: ditto
1292 * src/lyx_gui.C: ditto
1293 * src/lyx_gui_misc.C: ditto
1295 * src/BufferView_pimpl.C (restorePosition): update buffer only
1298 * src/commandtags.h (LFUN_REFTOGGLE): removed
1299 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1300 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1301 (LFUN_REFBACK): renamed LFUN_REF_BACK
1303 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1304 * src/menus.C: ditto
1305 * src/lyxfunc.C (Dispatch): ditto.
1306 InsertRef dialog is now GUI-independent.
1308 * src/texrow.C: added using std::endl;
1310 * src/insets/insetref.[Ch]: strip out large amounts of code.
1311 The inset is now a container and this functionality is now
1312 managed by a new FormRef dialog
1314 * src/frontends/Dialogs.h (showRef, createRef): new signals
1316 * src/frontends/xforms/FormIndex.[Ch],
1317 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1318 when setting dialog's min/max size
1319 * src/frontends/xforms/FormIndex.[Ch]: ditto
1321 * src/frontends/xforms/FormRef.[Ch],
1322 src/frontends/xforms/forms/form_ref.fd: new xforms
1323 implementation of an InsetRef dialog
1325 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1328 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1329 ios::nocreate is not part of the standard. Removed.
1331 2000-08-07 Baruch Even <baruch.even@writeme.com>
1333 * src/graphics/Renderer.h:
1334 * src/graphics/Renderer.C: Added base class for rendering of different
1335 image formats into Pixmaps.
1337 * src/graphics/XPM_Renderer.h:
1338 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1339 in a different class.
1341 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1342 easily add support for other formats.
1344 * src/insets/figinset.C: plugged a leak of an X resource.
1346 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1348 * src/CutAndPaste.[Ch]: make all metods static.
1350 * development/Code_rules/Rules: more work, added section on
1351 Exceptions, and a References section.
1353 * a lot of header files: work to make doc++ able to generate the
1354 source documentation, some workarounds of doc++ problems. Doc++ is
1355 now able to generate the documentation.
1357 2000-08-07 Juergen Vigna <jug@sad.it>
1359 * src/insets/insettabular.C (recomputeTextInsets): removed function
1361 * src/tabular.C (SetWidthOfMulticolCell):
1363 (calculate_width_of_column_NMC): fixed return value so that it really
1364 only returns true if the column-width has changed (there where
1365 problems with muliticolumn-cells in this column).
1367 2000-08-04 Juergen Vigna <jug@sad.it>
1369 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1370 also on the scrollstatus of the inset.
1371 (workAreaMotionNotify): ditto.
1373 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1375 2000-08-01 Juergen Vigna <jug@sad.it>
1377 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1379 * src/commandtags.h:
1380 * src/LyXAction.C (init):
1381 * src/insets/inset.C (LocalDispatch): added support for
1384 * src/insets/inset.C (scroll): new functions.
1386 * src/insets/insettext.C (removeNewlines): new function.
1387 (SetAutoBreakRows): removes forced newlines in the text of the
1388 paragraph if autoBreakRows is set to false.
1390 * src/tabular.C (Latex): generates a parbox around the cell contents
1393 * src/frontends/xforms/FormTabular.C (local_update): removed
1394 the radio_useparbox button.
1396 * src/tabular.C (UseParbox): new function
1398 2000-08-06 Baruch Even <baruch.even@writeme.com>
1400 * src/graphics/GraphicsCache.h:
1401 * src/graphics/GraphicsCache.C:
1402 * src/graphics/GraphicsCacheItem.h:
1403 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1406 * src/insets/insetgraphics.h:
1407 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1408 drawing of the inline image.
1410 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1411 into the wrong position.
1413 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1416 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1418 * src/support/translator.h: move all typedefs to public section
1420 * src/support/filetools.C (MakeLatexName): return string const
1422 (TmpFileName): ditto
1423 (FileOpenSearch): ditto
1425 (LibFileSearch): ditto
1426 (i18nLibFileSearch): ditto
1429 (CreateTmpDir): ditto
1430 (CreateBufferTmpDir): ditto
1431 (CreateLyXTmpDir): ditto
1434 (MakeAbsPath): ditto
1436 (OnlyFilename): ditto
1438 (NormalizePath): ditto
1439 (CleanupPath): ditto
1440 (GetFileContents): ditto
1441 (ReplaceEnvironmentPath): ditto
1442 (MakeRelPath): ditto
1444 (ChangeExtension): ditto
1445 (MakeDisplayPath): ditto
1446 (do_popen): return cmdret const
1447 (findtexfile): return string const
1449 * src/support/DebugStream.h: add some /// to please doc++
1451 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1453 * src/texrow.C (same_rownumber): functor to use with find_if
1454 (getIdFromRow): rewritten to use find_if and to not update the
1455 positions. return true if row is found
1456 (increasePos): new method, use to update positions
1458 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1460 * src/lyxlex_pimpl.C (verifyTable): new method
1463 (GetString): return string const
1464 (pushTable): rewrite to use std::stack
1466 (setFile): better check
1469 * src/lyxlex.h: make LyXLex noncopyable
1471 * src/lyxlex.C (text): return char const * const
1472 (GetString): return string const
1473 (getLongString): return string const
1475 * src/lyx_gui_misc.C (askForText): return pair<...> const
1477 * src/lastfiles.[Ch] (operator): return string const
1479 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1480 istringstream not char const *.
1481 move token.end() out of loop.
1482 (readFile): move initializaton of token
1484 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1485 getIdFromRow is successful.
1487 * lib/bind/emacs.bind: don't include menus bind
1489 * development/Code_rules/Rules: the beginnings of making this
1490 better and covering more of the unwritten rules that we have.
1492 * development/Code_rules/Recommendations: a couple of wording
1495 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1497 * src/support/strerror.c: remove C++ comment.
1499 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1501 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1502 LFUN_INDEX_INSERT_LAST
1504 * src/texrow.C (getIdFromRow): changed from const_iterator to
1505 iterator, allowing code to compile with DEC cxx
1507 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1508 stores part of the class, as suggested by Allan. Will allow
1510 (apply): test to apply uses InsetCommandParams operator!=
1512 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1513 (apply): test to apply uses InsetCommandParams operator!=
1515 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1516 stores part of the class.
1517 (update): removed limits on min/max size.
1519 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1520 (apply): test to apply uses InsetCommandParams operator!=
1522 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1523 (Read, Write, scanCommand, getCommand): moved functionality
1524 into InsetCommandParams.
1526 (getScreenLabel): made pure virtual
1527 new InsetCommandParams operators== and !=
1529 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1530 c-tors based on InsetCommandParams. Removed others.
1531 * src/insets/insetinclude.[Ch]: ditto
1532 * src/insets/insetlabel.[Ch]: ditto
1533 * src/insets/insetparent.[Ch]: ditto
1534 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1536 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1537 insets derived from InsetCommand created using similar c-tors
1538 based on InsetCommandParams
1539 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1540 * src/menus.C (ShowRefsMenu): ditto
1541 * src/paragraph.C (Clone): ditto
1542 * src/text2.C (SetCounter): ditto
1543 * src/lyxfunc.C (Dispatch) ditto
1544 Also recreated old InsetIndex behaviour exactly. Can now
1545 index-insert at the start of a paragraph and index-insert-last
1546 without launching the pop-up.
1548 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1550 * lib/lyxrc.example: mark te pdf options as non functional.
1552 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1553 (isStrDbl): move tmpstr.end() out of loop.
1554 (strToDbl): move intialization of tmpstr
1555 (lowercase): return string const and move tmp.end() out of loop.
1556 (uppercase): return string const and move tmp.edn() out of loop.
1557 (prefixIs): add assertion
1562 (containsOnly): ditto
1563 (containsOnly): ditto
1564 (containsOnly): ditto
1565 (countChar): make last arg char not char const
1566 (token): return string const
1567 (subst): return string const, move tmp.end() out of loop.
1568 (subst): return string const, add assertion
1569 (strip): return string const
1570 (frontStrip): return string const, add assertion
1571 (frontStrip): return string const
1576 * src/support/lstrings.C: add inclde "LAssert.h"
1577 (isStrInt): move tmpstr.end() out of loop.
1579 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1580 toollist.end() out of loop.
1581 (deactivate): move toollist.end() out of loop.
1582 (update): move toollist.end() out of loop.
1583 (updateLayoutList): move tc.end() out of loop.
1584 (add): move toollist.end() out of loop.
1586 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1587 md.end() out of loop.
1589 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1591 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1594 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1595 (Erase): move insetlist.end() out of loop.
1597 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1598 ref to const string as first arg. Move initialization of some
1599 variables, whitespace changes.
1601 * src/kbmap.C (defkey): move table.end() out of loop.
1602 (kb_keymap): move table.end() out of loop.
1603 (findbinding): move table.end() out of loop.
1605 * src/MenuBackend.C (hasMenu): move end() out of loop.
1606 (getMenu): move end() out of loop.
1607 (getMenu): move menulist_.end() out of loop.
1609 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1611 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1614 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1615 (getFromLyXName): move infotab.end() out of loop.
1617 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1618 -fvtable-thunks -ffunction-sections -fdata-sections
1620 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1622 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1625 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1627 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1629 * src/frontends/xforms/FormCitation.[Ch],
1630 src/frontends/xforms/FormIndex.[Ch],
1631 src/frontends/xforms/FormToc.[Ch],
1632 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1634 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1636 * src/commandtags.h: renamed, created some flags for citation
1639 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1641 * src/lyxfunc.C (dispatch): use signals to insert index entry
1643 * src/frontends/Dialogs.h: new signal createIndex
1645 * src/frontends/xforms/FormCommand.[Ch],
1646 src/frontends/xforms/FormCitation.[Ch],
1647 src/frontends/xforms/FormToc.[Ch],
1648 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1650 * src/insets/insetindex.[Ch]: GUI-independent
1652 * src/frontends/xforms/FormIndex.[Ch],
1653 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1656 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1658 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1659 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1661 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1663 * src/insets/insetref.C (Latex): rewrite so that there is now
1664 question that a initialization is requested.
1666 * src/insets/insetcommand.h: reenable the hide signal
1668 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1670 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1671 fix handling of shortcuts (many bugs :)
1672 (add_lastfiles): ditto.
1674 * lib/ui/default.ui: fix a few shortcuts.
1676 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1678 * Makefile.am: Fix ``rpmdist'' target to return the exit
1679 status of the ``rpm'' command, instead of the last command in
1680 the chain (the ``rm lyx.xpm'' command, which always returns
1683 2000-08-02 Allan Rae <rae@lyx.org>
1685 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1686 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1687 * src/frontends/xforms/FormToc.C (FormToc): ditto
1689 * src/frontends/xforms/Makefile.am: A few forgotten files
1691 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1692 Signals-not-copyable-problem Lars' started commenting out.
1694 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1696 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1698 * src/insets/insetcommand.h: Signals is not copyable so anoter
1699 scheme for automatic hiding of forms must be used.
1701 * src/frontends/xforms/FormCitation.h: don't inerit from
1702 noncopyable, FormCommand already does that.
1703 * src/frontends/xforms/FormToc.h: ditto
1704 * src/frontends/xforms/FormUrl.h: ditto
1706 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1708 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1710 * src/insets/insetcommand.h (hide): new SigC::Signal0
1711 (d-tor) new virtual destructor emits hide signal
1713 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1714 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1716 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1717 LOF and LOT. Inset is now GUI-independent
1719 * src/insets/insetloa.[Ch]: redundant
1720 * src/insets/insetlof.[Ch]: ditto
1721 * src/insets/insetlot.[Ch]: ditto
1723 * src/frontends/xforms/forms/form_url.fd: tweaked!
1724 * src/frontends/xforms/forms/form_citation.fd: ditto
1726 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1727 dialogs dealing with InsetCommand insets
1729 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1730 FormCommand base class
1731 * src/frontends/xforms/FormUrl.[Ch]: ditto
1733 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1735 * src/frontends/xforms/FormToc.[Ch]: ditto
1737 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1738 passed a generic InsetCommand pointer
1739 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1741 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1742 and modified InsetTOC class
1743 * src/buffer.C: ditto
1745 * forms/lyx.fd: strip out old FD_form_toc code
1746 * src/lyx_gui_misc.C: ditto
1747 * src/lyx_gui.C: ditto
1748 * src/lyx_cb.C: ditto
1749 * src/lyx.[Ch]: ditto
1751 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1753 * src/support/utility.hpp: tr -d '\r'
1755 2000-08-01 Juergen Vigna <jug@sad.it>
1757 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1759 * src/commandtags.h:
1760 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1761 LFUN_TABULAR_FEATURES.
1763 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1764 LFUN_LAYOUT_TABULAR.
1766 * src/insets/insettabular.C (getStatus): implemented helper function.
1768 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1770 2000-07-31 Juergen Vigna <jug@sad.it>
1772 * src/text.C (draw): fixed screen update problem for text-insets.
1774 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1775 something changed probably this has to be added in various other
1778 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1780 2000-07-31 Baruch Even <baruch.even@writeme.com>
1782 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1783 templates to satisfy compaq cxx.
1786 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1788 * src/support/translator.h (equal_1st_in_pair::operator()): take
1789 const ref pair_type as arg.
1790 (equal_2nd_in_pair::operator()): ditto
1791 (Translator::~Translator): remove empty d-tor.
1793 * src/graphics/GraphicsCache.C: move include config.h to top, also
1794 put initialization of GraphicsCache::singleton here.
1795 (~GraphicsCache): move here
1796 (addFile): take const ref as arg
1799 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1801 * src/BufferView2.C (insertLyXFile): change te with/without header
1804 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1806 * src/frontends/xforms/FormGraphics.C (apply): add some
1807 static_cast. Not very nice, but required by compaq cxx.
1809 * src/frontends/xforms/RadioButtonGroup.h: include header
1810 <utility> instead of <pair.h>
1812 * src/insets/insetgraphicsParams.C: add using directive.
1813 (readResize): change return type to void.
1814 (readOrigin): ditto.
1816 * src/lyxfunc.C (getStatus): add missing break for build-program
1817 function; add test for Literate for export functions.
1819 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1820 entries in Options menu.
1822 2000-07-31 Baruch Even <baruch.even@writeme.com>
1824 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1825 protect against auto-allocation; release icon when needed.
1827 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1829 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1830 on usual typewriter.
1832 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1833 earlier czech.kmap), useful only for programming.
1835 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1837 * src/frontends/xforms/FormCitation.h: fix conditioning around
1840 2000-07-31 Juergen Vigna <jug@sad.it>
1842 * src/frontends/xforms/FormTabular.C (local_update): changed
1843 radio_linebreaks to radio_useparbox and added radio_useminipage.
1845 * src/tabular.C: made support for using minipages/parboxes.
1847 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1849 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1851 (descent): so the cursor is in the middle.
1852 (width): bit smaller box.
1854 * src/insets/insetgraphics.h: added display() function.
1856 2000-07-31 Baruch Even <baruch.even@writeme.com>
1858 * src/frontends/Dialogs.h: Added showGraphics signals.
1860 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1861 xforms form definition of the graphics dialog.
1863 * src/frontends/xforms/FormGraphics.h:
1864 * src/frontends/xforms/FormGraphics.C: Added files, the
1865 GUIndependent code of InsetGraphics
1867 * src/insets/insetgraphics.h:
1868 * src/insets/insetgraphics.C: Major writing to make it work.
1870 * src/insets/insetgraphicsParams.h:
1871 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1872 struct between InsetGraphics and GUI.
1874 * src/LaTeXFeatures.h:
1875 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1876 support for graphicx package.
1878 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1879 for the graphics inset.
1881 * src/support/translator.h: Added file, used in
1882 InsetGraphicsParams. this is a template to translate between two
1885 * src/frontends/xforms/RadioButtonGroup.h:
1886 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1887 way to easily control a radio button group.
1889 2000-07-28 Juergen Vigna <jug@sad.it>
1891 * src/insets/insettabular.C (LocalDispatch):
1892 (TabularFeatures): added support for lyx-functions of tabular features.
1893 (cellstart): refixed this function after someone wrongly changed it.
1895 * src/commandtags.h:
1896 * src/LyXAction.C (init): added support for tabular-features
1898 2000-07-28 Allan Rae <rae@lyx.org>
1900 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1901 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1902 triggers the callback for input checking. As a result we sometimes get
1903 "LyX: This shouldn't happen..." printed to cerr.
1904 (input): Started using status variable since I only free() on
1905 destruction. Some input checking for paths and font sizes.
1907 * src/frontends/xforms/FormPreferences.h: Use status to control
1908 activation of Ok and Apply
1910 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1911 callback. Also resized to stop segfaults with 0.88. The problem is
1912 that xforms-0.88 requires the folder to be wide enough to fit all the
1913 tabs. If it isn't it causes all sorts of problems.
1915 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1917 * src/frontends/xforms/forms/README: Reflect reality.
1919 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1920 * src/frontends/xforms/forms/makefile: ditto.
1922 * src/commandtags.h: Get access to new Preferences dialog
1923 * src/LyXAction.C: ditto
1924 * src/lyxfunc.C: ditto
1925 * lib/ui/default.ui: ditto
1927 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1929 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1931 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1934 * src/frontends/xforms/form_url.[Ch]: added.
1936 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1938 * src/insets/insetbib.h: fixed bug in previous commit
1940 * src/frontends/xforms/FormUrl.h: ditto
1942 * src/frontends/xforms/FormPrint.h: ditto
1944 * src/frontends/xforms/FormPreferences.h: ditto
1946 * src/frontends/xforms/FormCopyright.h: ditto
1948 * src/frontends/xforms/FormCitation.C: ditto
1950 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1951 private copyconstructor and private default contructor
1953 * src/support/Makefile.am: add utility.hpp
1955 * src/support/utility.hpp: new file from boost
1957 * src/insets/insetbib.h: set owner in clone
1959 * src/frontends/xforms/FormCitation.C: added missing include
1962 * src/insets/form_url.[Ch]: removed
1964 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1966 * development/lyx.spec.in
1967 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1968 file/directory re-organization.
1970 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1972 * src/insets/insetcommand.[Ch]: moved the string data and
1973 associated manipulation methods into a new stand-alone class
1974 InsetCommandParams. This class has two additional methods
1975 getAsString() and setFromString() allowing the contents to be
1976 moved around as a single string.
1977 (addContents) method removed.
1978 (setContents) method no longer virtual.
1980 * src/buffer.C (readInset): made use of new InsetCitation,
1981 InsetUrl constructors based on InsetCommandParams.
1983 * src/commandtags.h: add LFUN_INSERT_URL
1985 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1986 independent InsetUrl and use InsetCommandParams to extract
1987 string info and create new Insets.
1989 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1991 * src/frontends/xforms/FormCitation.C (apply): uses
1994 * src/frontends/xforms/form_url.C
1995 * src/frontends/xforms/form_url.h
1996 * src/frontends/xforms/FormUrl.h
1997 * src/frontends/xforms/FormUrl.C
1998 * src/frontends/xforms/forms/form_url.fd: new files
2000 * src/insets/insetcite.[Ch]: removed unused constructors.
2002 * src/insets/insetinclude.[Ch]: no longer store filename
2004 * src/insets/inseturl.[Ch]: GUI-independent.
2006 2000-07-26 Juergen Vigna <jug@sad.it>
2007 * renamed frontend from gtk to gnome as it is that what is realized
2008 and did the necessary changes in the files.
2010 2000-07-26 Marko Vendelin <markov@ioc.ee>
2012 * configure.in: cleaning up gnome configuration scripts
2014 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2016 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2017 shortcuts syndrom by redrawing them explicitely (a better solution
2018 would be appreciated).
2020 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2022 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2025 * src/lyx_cb.C (MenuExport): change html export to do the right
2026 thing depending of the document type (instead of having
2027 html-linuxdoc and html-docbook).
2028 * src/lyxfunc.C (getStatus): update for html
2029 * lib/ui/default.ui: simplify due to the above change.
2030 * src/menus.C (ShowFileMenu): update too (in case we need it).
2032 * src/MenuBackend.C (read): if a menu is defined twice, add the
2033 new entries to the exiting one.
2035 2000-07-26 Juergen Vigna <jug@sad.it>
2037 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2039 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2040 and return a bool if it did actual save the file.
2041 (AutoSave): don't autosave a unnamed doc.
2043 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2044 check if this is an UNNAMED new file and react to it.
2045 (newFile): set buffer to unnamed and change to not mark a new
2046 buffer dirty if I didn't do anything with it.
2048 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2050 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2052 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2053 friend as per Angus's patch posted to lyx-devel.
2055 * src/ext_l10n.h: updated
2057 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2058 gettext on the style string right before inserting them into the
2061 * autogen.sh: add code to extract style strings form layout files,
2062 not good enough yet.
2064 * src/frontends/gtk/.cvsignore: add MAKEFILE
2066 * src/MenuBackend.C (read): run the label strings through gettext
2067 before storing them in the containers.
2069 * src/ext_l10n.h: new file
2071 * autogen.sh : generate the ext_l10n.h file here
2073 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2075 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2078 * lib/ui/default.ui: fix a couple of typos.
2080 * config/gnome/gtk.m4: added (and added to the list of files in
2083 * src/insets/insetinclude.C (unique_id): fix when we are using
2084 lyxstring instead of basic_string<>.
2085 * src/insets/insettext.C (LocalDispatch): ditto.
2086 * src/support/filetools.C: ditto.
2088 * lib/configure.m4: create the ui/ directory if necessary.
2090 * src/LyXView.[Ch] (updateToolbar): new method.
2092 * src/BufferView_pimpl.C (buffer): update the toolbar when
2093 opening/closing buffer.
2095 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2097 * src/LyXAction.C (getActionName): enhance to return also the name
2098 and options of pseudo-actions.
2099 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2101 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2102 as an example of what is possible). Used in File->Build too (more
2103 useful) and in the import/export menus (to mimick the complicated
2104 handling of linuxdoc and friends). Try to update all the entries.
2106 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2109 * src/MenuBackend.C (read): Parse the new OptItem tag.
2111 * src/MenuBackend.h: Add a new optional_ data member (used if the
2112 entry should be omitted when the lyxfunc is disabled).
2114 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2115 function, used as a shortcut.
2116 (create_submenu): align correctly the shortcuts on the widest
2119 * src/MenuBackend.h: MenuItem.label() only returns the label of
2120 the menu without shortcut; new method shortcut().
2122 2000-07-14 Marko Vendelin <markov@ioc.ee>
2124 * src/frontends/gtk/Dialogs.C:
2125 * src/frontends/gtk/FormCopyright.C:
2126 * src/frontends/gtk/FormCopyright.h:
2127 * src/frontends/gtk/Makefile.am: added these source-files for the
2128 Gtk/Gnome support of the Copyright-Dialog.
2130 * src/main.C: added Gnome::Main initialization if using
2131 Gtk/Gnome frontend-GUI.
2133 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2135 * config/gnome/aclocal-include.m4
2136 * config/gnome/compiler-flags.m4
2137 * config/gnome/curses.m4
2138 * config/gnome/gnome--.m4
2139 * config/gnome/gnome-bonobo-check.m4
2140 * config/gnome/gnome-common.m4
2141 * config/gnome/gnome-fileutils.m4
2142 * config/gnome/gnome-ghttp-check.m4
2143 * config/gnome/gnome-gnorba-check.m4
2144 * config/gnome/gnome-guile-checks.m4
2145 * config/gnome/gnome-libgtop-check.m4
2146 * config/gnome/gnome-objc-checks.m4
2147 * config/gnome/gnome-orbit-check.m4
2148 * config/gnome/gnome-print-check.m4
2149 * config/gnome/gnome-pthread-check.m4
2150 * config/gnome/gnome-support.m4
2151 * config/gnome/gnome-undelfs.m4
2152 * config/gnome/gnome-vfs.m4
2153 * config/gnome/gnome-x-checks.m4
2154 * config/gnome/gnome-xml-check.m4
2155 * config/gnome/gnome.m4
2156 * config/gnome/gperf-check.m4
2157 * config/gnome/gtk--.m4
2158 * config/gnome/linger.m4
2159 * config/gnome/need-declaration.m4: added configuration scripts
2160 for Gtk/Gnome frontend-GUI
2162 * configure.in: added support for the --with-frontend=gtk option
2164 * autogen.sh: added config/gnome/* to list of config-files
2166 * acconfig.h: added define for GTKGUI-support
2168 * config/lyxinclude.m4: added --with-frontend[=value] option value
2169 for Gtk/Gnome frontend-GUI support.
2171 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2173 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2177 * src/paragraph.C (GetChar): remove non-const version
2179 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2180 (search_kw): use it.
2182 * src/lyx_main.C (init): if "preferences" exist, read that instead
2184 (ReadRcFile): return bool if the file could be read ok.
2185 (ReadUIFile): add a check to see if lex file is set ok.
2187 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2188 bastring can be used instead of lyxstring (still uses the old code
2189 if std::string is good enough or if lyxstring is used.)
2191 * src/encoding.C: make the arrays static, move ininle functions
2193 * src/encoding.h: from here.
2195 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2196 (parseSingleLyXformat2Token): move inset parsing to separate method
2197 (readInset): new private method
2199 * src/Variables.h: remove virtual from get().
2201 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2202 access to NEW_INSETS and NEW_TABULAR
2204 * src/MenuBackend.h: remove superfluous forward declaration of
2205 MenuItem. Add documentations tags "///", remove empty MenuItem
2206 destructor, remove private default contructor.
2208 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2210 (read): more string mlabel and mname to where they are used
2211 (read): remove unused variables mlabel and mname
2212 (defaults): unconditional clear, make menusetup take advantage of
2213 add returning Menu &.
2215 * src/LyXView.h: define NEW_MENUBAR as default
2217 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2218 to NEW_INSETS and NEW_TABULAR.
2219 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2220 defined. Change some of the "xxxx-inset-insert" functions names to
2223 * several files: more enahncements to NEW_INSETS and the resulting
2226 * lib/lyxrc.example (\date_insert_format): move to misc section
2228 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2229 bastring and use AC_CACHE_CHECK.
2230 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2231 the system have the newest methods. uses AC_CACHE_CHECK
2232 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2233 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2234 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2236 * configure.in: add LYX_CXX_GOOD_STD_STRING
2238 * acinclude.m4: recreated
2240 2000-07-24 Amir Karger
2242 * README: add Hebrew, Arabic kmaps
2245 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2247 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2250 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2252 * Lot of files: add pragma interface/implementation.
2254 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2256 * lib/ui/default.ui: new file (ans new directory). Contains the
2257 default menu and toolbar.
2259 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2260 global space. Toolbars are now read (as menus) in ui files.
2262 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2264 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2265 is disabled because the document is read-only. We want to have the
2266 toggle state of the function anyway.
2267 (getStatus): add code for LFUN_VC* functions (mimicking what is
2268 done in old-style menus)
2270 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2271 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2273 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2274 * src/BufferView_pimpl.C: ditto.
2275 * src/lyxfunc.C: ditto.
2277 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2278 default). This replaces old-style menus by new ones.
2280 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2281 MenuItem. Contain the data structure of a menu.
2283 * src/insets/insettext.C: use LyXView::setLayout instead of
2284 accessing directly the toolbar combox.
2285 * src/lyxfunc.C (Dispatch): ditto.
2287 * src/LyXView.C (setLayout): new method, which just calls
2288 Toolbar::setLayout().
2289 (updateLayoutChoice): move part of this method in Toolbar.
2291 * src/toolbar.[Ch]: removed.
2293 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2294 implementation the toolbar.
2296 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2297 the toolbar. It might make sense to merge it with ToolbarDefaults
2299 (setLayout): new function.
2300 (updateLayoutList): ditto.
2301 (openLayoutList): ditto.
2303 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2304 xforms implementation of the toolbar.
2305 (get_toolbar_func): comment out, since I do not
2306 know what it is good for.
2308 * src/ToolbarDefaults.h: Add the ItemType enum.
2310 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2311 for a list of allocated C strings. Used in Menubar xforms
2312 implementation to avoid memory leaks.
2314 * src/support/lstrings.[Ch] (uppercase): new version taking and
2318 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2319 * lib/bind/emacs.bind: ditto.
2321 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2323 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2324 forward decl of LyXView.
2326 * src/toolbar.C (toolbarItem): moved from toolbar.h
2327 (toolbarItem::clean): ditto
2328 (toolbarItem::~toolbarItem): ditto
2329 (toolbarItem::operator): ditto
2331 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2333 * src/paragraph.h: control the NEW_TABULAR define from here
2335 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2336 USE_TABULAR_INSETS to NEW_TABULAR
2338 * src/ToolbarDefaults.C: add include "lyxlex.h"
2340 * files using the old table/tabular: use NEW_TABULAR to control
2341 compilation of old tabular stuff.
2343 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2346 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2347 planemet in reading of old style floats, fix the \end_deeper
2348 problem when reading old style floats.
2350 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2352 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2354 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2356 * lib/bind/sciword.bind: updated.
2358 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2360 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2361 layout write problem
2363 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2365 * src/Makefile.am (INCLUDES): remove image directory from include
2368 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2369 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2371 * src/LyXView.C (create_form_form_main): read the application icon
2374 * lib/images/*.xpm: change the icons to use transparent color for
2377 * src/toolbar.C (update): change the color of the button when it
2380 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2382 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2383 setting explicitely the minibuffer.
2384 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2386 * src/LyXView.C (showState): new function. Shows font information
2387 in minibuffer and update toolbar state.
2388 (LyXView): call Toolbar::update after creating the
2391 * src/toolbar.C: change toollist to be a vector instead of a
2393 (BubbleTimerCB): get help string directly from the callback
2394 argument of the corresponding icon (which is the action)
2395 (set): remove unnecessary ugliness.
2396 (update): new function. update the icons (depressed, disabled)
2397 depending of the status of the corresponding action.
2399 * src/toolbar.h: remove help in toolbarItem
2401 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2403 * src/Painter.C (text): Added code for using symbol glyphs from
2404 iso10646 fonts. Currently diabled.
2406 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2409 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2410 magyar,turkish and usorbian.
2412 * src/paragraph.C (isMultiLingual): Made more efficient.
2414 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2417 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2418 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2419 Also changed the prototype to "bool math_insert_greek(char)".
2421 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2423 * lots of files: apply the NEW_INSETS on all code that will not be
2424 needed when we move to use the new insets. Enable the define in
2425 lyxparagrah.h to try it.
2427 * src/insets/insettabular.C (cellstart): change to be a static
2429 (InsetTabular): initialize buffer in the initializer list.
2431 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2433 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2434 form_print.h out of the header file. Replaced with forward
2435 declarations of the relevant struct.
2437 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2440 * src/commandtags.h: do not include "debug.h" which does not
2441 belong there. #include it in some other places because of this
2444 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2446 * src/insets/insetcaption.C: add a couple "using" directives.
2448 * src/toolbar.C (add): get the help text directly from lyxaction.
2450 (setPixmap): new function. Loads from disk and sets a pixmap on a
2451 botton; the name of the pixmap file is derived from the command
2454 * src/toolbar.h: remove members isBitmap and pixmap from
2457 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2458 * lib/images/: move many files from images/banner.xpm.
2460 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2462 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2463 * src/toolbar.C: ditto.
2464 * configure.in: ditto.
2465 * INSTALL: document.
2467 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2468 the spellchecker popup is closed from the WM.
2470 2000-07-19 Juergen Vigna <jug@sad.it>
2472 * src/insets/insetfloat.C (Write): small fix because we use the
2473 insetname for the type now!
2475 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2477 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2480 * src/frontends/Dialogs.h: removed hideCitation signal
2482 * src/insets/insetcite.h: added hide signal
2484 * src/insets/insetcite.C (~InsetCitation): emits new signal
2485 (getScreenLabel): "intelligent" label should now fit on the screen!
2487 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2489 * src/frontends/xforms/FormCitation.C (showInset): connects
2490 hide() to the inset's hide signal
2491 (show): modified to use fl_set_object_position rather than
2492 fl_set_object_geometry wherever possible
2494 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2496 * src/insets/lyxinset.h: add caption code
2498 * src/insets/insetfloat.C (type): new method
2500 * src/insets/insetcaption.C (Write): new method
2502 (LyxCode): new method
2504 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2505 to get it right together with using the FloatList.
2507 * src/commandtags.h: add LFUN_INSET_CAPTION
2508 * src/lyxfunc.C (Dispatch): handle it
2510 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2513 * src/Variables.[Ch]: make expand take a const reference, remove
2514 the destructor, some whitespace changes.
2516 * src/LyXAction.C (init): add caption-inset-insert
2518 * src/FloatList.C (FloatList): update the default floats a bit.
2520 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2522 * src/Variables.[Ch]: new files. Intended to be used for language
2523 specific strings (like \chaptername) and filename substitution in
2526 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2528 * lib/kbd/american.kmap: update
2530 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2532 * src/bufferparams.[Ch]: remove member allowAccents.
2534 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2536 * src/LaTeXLog.C: use the log_form.h header.
2537 * src/lyx_gui.C: ditto.
2538 * src/lyx_gui_misc.C: ditto.
2539 * src/lyxvc.h: ditto.
2541 * forms/log_form.fd: new file, created from latexoptions.fd. I
2542 kept the log popup and nuked the options form.
2544 * src/{la,}texoptions.[Ch]: removed.
2545 * src/lyx_cb.C (LaTeXOptions): ditto
2547 * src/lyx_gui.C (create_forms): do not handle the
2548 fd_latex_options form.
2550 2000-07-18 Juergen Vigna <jug@sad.it>
2552 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2553 name of the inset so that it can be requested outside (text2.C).
2555 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2558 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2560 * src/mathed/formula.h (ConvertFont): constify
2562 * src/mathed/formula.C (Read): add warning if \end_inset is not
2563 found on expected place.
2565 * src/insets/lyxinset.h (ConvertFont): consify
2567 * src/insets/insetquotes.C (ConvertFont): constify
2568 * src/insets/insetquotes.h: ditto
2570 * src/insets/insetinfo.h: add labelfont
2572 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2573 (ascent): use labelfont
2577 (Write): make .lyx file a bit nicer
2579 * src/insets/insetfloat.C (Write): simplify somewhat...
2580 (Read): add warning if arg is not found
2582 * src/insets/insetcollapsable.C: add using std::max
2583 (Read): move string token and add warning in arg is not found
2584 (draw): use std::max to get the right ty
2585 (getMaxWidth): simplify by using std::max
2587 * src/insets/insetsection.h: new file
2588 * src/insets/insetsection.C: new file
2589 * src/insets/insetcaption.h: new file
2590 * src/insets/insetcaption.C: new file
2592 * src/insets/inset.C (ConvertFont): constify signature
2594 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2595 insetcaption.[Ch] and insetsection.[Ch]
2597 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2598 uses to use LABEL_COUNTER_CHAPTER instead.
2599 * src/text2.C (SetCounter): here
2601 * src/counters.h: new file
2602 * src/counters.C: new file
2603 * src/Sectioning.h: new file
2604 * src/Sectioning.C: new file
2606 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2608 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2610 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2613 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2616 2000-07-17 Juergen Vigna <jug@sad.it>
2618 * src/tabular.C (Validate): check if array-package is needed.
2619 (SetVAlignment): added support for vertical alignment.
2620 (SetLTFoot): better support for longtable header/footers
2621 (Latex): modified to support added features.
2623 * src/LaTeXFeatures.[Ch]: added array-package.
2625 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2627 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2630 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2632 * configure.in: do not forget to put a space after -isystem.
2634 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2636 * lib/kbd/arabic.kmap: a few fixes.
2638 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2640 * some whitespace chagnes to a number of files.
2642 * src/support/DebugStream.h: change to make it easier for
2643 doc++ to parse correctly.
2644 * src/support/lyxstring.h: ditto
2646 * src/mathed/math_utils.C (compara): change to have only one
2648 (MathedLookupBOP): change because of the above.
2650 * src/mathed/math_delim.C (math_deco_compare): change to have only
2652 (search_deco): change becasue of the above.
2654 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2655 instead of manually coded one.
2657 * src/insets/insetquotes.C (Read): read the \end_inset too
2659 * src/insets/insetlatex.h: remove file
2660 * src/insets/insetlatex.C: remove file
2662 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2664 (InsetPrintIndex): remove destructor
2666 * src/insets/insetinclude.h: remove default constructor
2668 * src/insets/insetfloat.C: work to make it work better
2670 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2672 * src/insets/insetcite.h (InsetCitation): remove default constructor
2674 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2676 * src/text.C (GetColumnNearX): comment out some currently unused code.
2678 * src/paragraph.C (writeFile): move some initializations closer to
2680 (CutIntoMinibuffer): small change to use new matchIT operator
2684 (InsertInset): ditto
2687 (InsetIterator): ditto
2688 (Erase): small change to use new matchFT operator
2690 (GetFontSettings): ditto
2691 (HighestFontInRange): ditto
2694 * src/lyxparagraph.h: some chars changed to value_type
2695 (matchIT): because of some stronger checking (perhaps too strong)
2696 in SGI STL, the two operator() unified to one.
2699 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2701 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2702 the last inset read added
2703 (parseSingleLyXformat2Token): some more (future) compability code added
2704 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2705 (parseSingleLyXformat2Token): set last_inset_read
2706 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2707 (parseSingleLyXformat2Token): don't double intializw string next_token
2709 * src/TextCache.C (text_fits::operator()): add const's to the signature
2710 (has_buffer::operator()): ditto
2712 * src/Floating.h: add some comments on the class
2714 * src/FloatList.[Ch] (typeExist): new method
2717 * src/BackStack.h: added default constructor, wanted by Gcc.
2719 2000-07-14 Juergen Vigna <jug@sad.it>
2721 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2723 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2725 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2726 do a redraw when the window is resized!
2727 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2729 * src/insets/insettext.C (resizeLyXText): added function to correctly
2730 being able to resize the LyXWindow.
2732 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2734 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2736 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2737 crashes when closing dialog to a deleted inset.
2739 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2740 method! Now similar to other insets.
2742 2000-07-13 Juergen Vigna <jug@sad.it>
2744 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2746 * lib/examples/Literate.lyx: small patch!
2748 * src/insets/insetbib.C (Read): added this function because of wrong
2749 Write (without [begin|end]_inset).
2751 2000-07-11 Juergen Vigna <jug@sad.it>
2753 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2754 as the insertInset could not be good!
2756 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2757 the bool param should not be last.
2759 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2761 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2762 did submit that to Karl).
2764 * configure.in: use -isystem instead of -I for X headers. This
2765 fixes a problem on solaris with a recent gcc;
2766 put the front-end code after the X detection code;
2767 configure in sigc++ before lib/
2769 * src/lyx_main.C (commandLineHelp): remove -display from command
2772 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2774 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2775 Also put in Makefile rules for building the ``listerrors''
2776 program for parsing errors from literate programs written in LyX.
2778 * lib/build-listerrors: Added small shell script as part of compile
2779 process. This builds a working ``listerrors'' binary if noweb is
2780 installed and either 1) the VNC X server is installed on the machine,
2781 or 2) the user is compiling from within a GUI. The existence of a GUI
2782 is necessary to use the ``lyx --export'' feature for now. This
2783 hack can be removed once ``lyx --export'' no longer requires a GUI to
2786 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2788 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2789 now passed back correctly from gcc and placed "under" error
2790 buttons in a Literate LyX source.
2792 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2794 * src/text.C (GetColumnNearX): Better behavior when a RTL
2795 paragraph is ended by LTR text.
2797 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2800 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2802 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2803 true when clipboard is empty.
2805 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2807 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2808 row of the paragraph.
2809 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2810 to prevent calculation of bidi tables
2812 2000-07-07 Juergen Vigna <jug@sad.it>
2814 * src/screen.C (ToggleSelection): added y_offset and x_offset
2817 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2820 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2822 * src/insets/insettext.C: fixed Layout-Display!
2824 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2826 * configure.in: add check for strings.h header.
2828 * src/spellchecker.C: include <strings.h> in order to have a
2829 definition for bzero().
2831 2000-07-07 Juergen Vigna <jug@sad.it>
2833 * src/insets/insettext.C (draw): set the status of the bv->text to
2834 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2836 * src/screen.C (DrawOneRow):
2837 (DrawFromTo): redraw the actual row if something has changed in it
2840 * src/text.C (draw): call an update of the toplevel-inset if something
2841 has changed inside while drawing.
2843 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2845 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2847 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2848 processing inside class.
2850 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2851 processing inside class.
2853 * src/insets/insetindex.h new struct Holder, consistent with other
2856 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2857 citation dialog from main code and placed it in src/frontends/xforms.
2858 Dialog launched through signals instead of callbacks
2860 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2862 * lyx.man: update the options description.
2864 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2866 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2867 handle neg values, set min width to 590, add doc about -display
2869 2000-07-05 Juergen Vigna <jug@sad.it>
2871 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2872 calls to BufferView *.
2874 * src/insets/insettext.C (checkAndActivateInset): small fix non
2875 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2877 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2878 their \end_inset token!
2880 2000-07-04 edscott <edscott@imp.mx>
2882 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2883 lib/lyxrc.example: added option \wheel_jump
2885 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2887 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2888 remove support for -width,-height,-xpos and -ypos.
2890 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2892 * src/encoding.[Ch]: New files.
2894 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2895 (text): Call to the underline() method only when needed.
2897 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2899 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2900 encoding(s) for the document.
2902 * src/bufferparams.C (BufferParams): Changed default value of
2905 * src/language.C (newLang): Removed.
2906 (items[]): Added encoding information for all defined languages.
2908 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2909 encoding choice button.
2911 * src/lyxrc.h (font_norm_type): New member variable.
2912 (set_font_norm_type): New method.
2914 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2915 paragraphs with different encodings.
2917 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2918 (TransformChar): Changed to work correctly with Arabic points.
2919 (draw): Added support for drawing Arabic points.
2920 (draw): Removed code for drawing underbars (this is done by
2923 * src/support/textutils.h (IsPrintableNonspace): New function.
2925 * src/BufferView_pimpl.h: Added "using SigC::Object".
2926 * src/LyXView.h: ditto.
2928 * src/insets/insetinclude.h (include_label): Changed to mutable.
2930 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2932 * src/mathed/math_iter.h: remove empty destructor
2934 * src/mathed/math_cursor.h: remove empty destructor
2936 * src/insets/lyxinset.h: add THEOREM_CODE
2938 * src/insets/insettheorem.[Ch]: new files
2940 * src/insets/insetminipage.C: (InsertInset): remove
2942 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2944 (InsertInset): remove
2946 * src/insets/insetlist.C: (InsertList): remove
2948 * src/insets/insetfootlike.[Ch]: new files
2950 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2953 (InsertInset): ditto
2955 * src/insets/insetert.C: remove include Painter.h, reindent
2956 (InsertInset): move to header
2958 * src/insets/insetcollapsable.h: remove explicit from default
2959 contructor, remove empty destructor, add InsertInset
2961 * src/insets/insetcollapsable.C (InsertInset): new func
2963 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2965 * src/vspace.h: add explicit to constructor
2967 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2968 \textcompwordmark, please test this.
2970 * src/lyxrc.C: set ascii_linelen to 65 by default
2972 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2974 * src/commandtags.h: add LFUN_INSET_THEOREM
2976 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2977 (makeLinuxDocFile): remove _some_ of the nice logic
2978 (makeDocBookFile): ditto
2980 * src/Painter.[Ch]: (~Painter): removed
2982 * src/LyXAction.C (init): entry for insettheorem added
2984 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2986 (deplog): code to detect files generated by LaTeX, needs testing
2989 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2991 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2993 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2995 * src/LaTeX.C (deplog): Add a check for files that are going to be
2996 created by the first latex run, part of the project to remove the
2999 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3000 contents to the extension list.
3002 2000-07-04 Juergen Vigna <jug@sad.it>
3004 * src/text.C (NextBreakPoint): added support for needFullRow()
3006 * src/insets/lyxinset.h: added needFullRow()
3008 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3011 * src/insets/insettext.C: lots of changes for update!
3013 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3015 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3017 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3019 * src/insets/insetinclude.C (InsetInclude): fixed
3020 initialization of include_label.
3021 (unique_id): now returns a string.
3023 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3025 * src/LaTeXFeatures.h: new member IncludedFiles, for
3026 a map of key, included file name.
3028 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3029 with the included files for inclusion in SGML preamble,
3030 i. e., linuxdoc and docbook.
3033 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3034 nice (is the generated linuxdoc code to be exported?), that
3035 allows to remove column, and only_body that will be true for
3036 slave documents. Insets are allowed inside SGML font type.
3037 New handling of the SGML preamble for included files.
3038 (makeDocBookFile): the same for docbook.
3040 * src/insets/insetinclude.h:
3041 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3043 (DocBook): new export methods.
3045 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3046 and makeDocBookFile.
3048 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3049 formats to export with command line argument -x.
3051 2000-06-29 Juergen Vigna <jug@sad.it>
3053 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3054 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3056 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3057 region could already been cleared by an inset!
3059 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3061 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3064 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3066 (cursorToggle): remove special handling of lyx focus.
3068 2000-06-28 Juergen Vigna <jug@sad.it>
3070 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3073 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3075 * src/insets/insetindex.C (Edit): add a callback when popup is
3078 * src/insets/insettext.C (LocalDispatch):
3079 * src/insets/insetmarginal.h:
3080 * src/insets/insetlist.h:
3081 * src/insets/insetfoot.h:
3082 * src/insets/insetfloat.h:
3083 * src/insets/insetert.h: add a missing std:: qualifier.
3085 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3087 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3090 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3092 * src/insets/insettext.C (Read): remove tmptok unused variable
3093 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3094 (InsertInset): change for new InsetInset code
3096 * src/insets/insettext.h: add TEXT inline method
3098 * src/insets/insettext.C: remove TEXT macro
3100 * src/insets/insetmarginal.C (Write): new method
3101 (Latex): change output slightly
3103 * src/insets/insetfoot.C (Write): new method
3104 (Latex): change output slightly (don't use endl when no need)
3106 * src/insets/insetert.C (Write): new method
3108 * src/insets/insetcollapsable.h: make button_length, button_top_y
3109 and button_bottm_y protected.
3111 * src/insets/insetcollapsable.C (Write): simplify code by using
3112 tostr. Also do not output the float name, the children class
3113 should to that to get control over own arguments
3115 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3116 src/insets/insetminipage.[Ch]:
3119 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3121 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3123 * src/Makefile.am (lyx_SOURCES): add the new files
3125 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3126 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3127 * src/commandtags.h: ditto
3129 * src/LaTeXFeatures.h: add a std::set of used floattypes
3131 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3133 * src/FloatList.[Ch] src/Floating.h: new files
3135 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3137 * src/lyx_cb.C (TableApplyCB): ditto
3139 * src/text2.C: ditto
3140 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3141 (parseSingleLyXformat2Token): ditto + add code for
3142 backwards compability for old float styles + add code for new insets
3144 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3146 (InsertInset(size_type, Inset *, LyXFont)): new method
3147 (InsetChar(size_type, char)): changed to use the other InsetChar
3148 with a LyXFont(ALL_INHERIT).
3149 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3150 insert the META_INSET.
3152 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3154 * sigc++/thread.h (Threads): from here
3156 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3157 definition out of line
3158 * sigc++/scope.h: from here
3160 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3162 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3163 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3165 * Makefile.am (bindist): new target.
3167 * INSTALL: add instructions for doing a binary distribution.
3169 * development/tools/README.bin.example: update a bit.
3171 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3174 * lib/lyxrc.example: new lyxrc tag \set_color.
3176 * src/lyxfunc.C (Dispatch):
3177 * src/commandtags.h:
3178 * src/LyXAction.C: new lyxfunc "set-color".
3180 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3181 and an x11name given as strings.
3183 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3184 cache when a color is changed.
3186 2000-06-26 Juergen Vigna <jug@sad.it>
3188 * src/lyxrow.C (width): added this functions and variable.
3190 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3193 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3195 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3197 * images/undo_bw.xpm: new icon.
3198 * images/redo_bw.xpm: ditto.
3200 * configure.in (INSTALL_SCRIPT): change value to
3201 ${INSTALL} to avoid failures of install-script target.
3202 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3204 * src/BufferView.h: add a magic "friend" declaration to please
3207 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3209 * forms/cite.fd: modified to allow resizing without messing
3212 * src/insetcite.C: Uses code from cite.fd almost without
3214 User can now resize dialog in the x-direction.
3215 Resizing the dialog in the y-direction is prevented, as the
3216 code does this intelligently already.
3218 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3220 * INSTALL: remove obsolete entry in "problems" section.
3222 * lib/examples/sl_*.lyx: update of the slovenian examples.
3224 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3226 2000-06-23 Juergen Vigna <jug@sad.it>
3228 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3230 * src/buffer.C (resize): delete the LyXText of textinsets.
3232 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3234 * src/insets/lyxinset.h: added another parameter 'cleared' to
3235 the draw() function.
3237 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3238 unlocking inset in inset.
3240 2000-06-22 Juergen Vigna <jug@sad.it>
3242 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3243 of insets and moved first to LyXText.
3245 * src/mathed/formulamacro.[Ch]:
3246 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3248 2000-06-21 Juergen Vigna <jug@sad.it>
3250 * src/text.C (GetVisibleRow): look if I should clear the area or not
3251 using Inset::doClearArea() function.
3253 * src/insets/lyxinset.h: added doClearArea() function and
3254 modified draw(Painter &, ...) to draw(BufferView *, ...)
3256 * src/text2.C (UpdateInset): return bool insted of int
3258 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3260 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3261 combox in the character popup
3263 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3264 BufferParams const & params
3266 2000-06-20 Juergen Vigna <jug@sad.it>
3268 * src/insets/insettext.C (SetParagraphData): set insetowner on
3271 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3273 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3274 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3276 (form_main_): remove
3278 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3279 (create_form_form_main): remove FD_form_main stuff, connect to
3280 autosave_timeout signal
3282 * src/LyXView.[Ch] (getMainForm): remove
3283 (UpdateTimerCB): remove
3284 * src/BufferView_pimpl.h: inherit from SigC::Object
3286 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3287 signal instead of callback
3289 * src/BufferView.[Ch] (cursorToggleCB): remove
3291 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3293 * src/BufferView_pimpl.C: changes because of the one below
3295 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3296 instead of storing a pointer to a LyXText.
3298 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3300 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3302 * src/lyxparagraph.h
3304 * src/paragraph.C: Changed fontlist to a sorted vector.
3306 2000-06-19 Juergen Vigna <jug@sad.it>
3308 * src/BufferView.h: added screen() function.
3310 * src/insets/insettext.C (LocalDispatch): some selection code
3313 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3315 * src/insets/insettext.C (SetParagraphData):
3317 (InsetText): fixes for multiple paragraphs.
3319 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3321 * development/lyx.spec.in: Call configure with ``--without-warnings''
3322 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3323 This should be fine, however, since we generally don't want to be
3324 verbose when making an RPM.
3326 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3328 * lib/scripts/fig2pstex.py: New file
3330 2000-06-16 Juergen Vigna <jug@sad.it>
3332 * src/insets/insettabular.C (UpdateLocal):
3333 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3334 (LocalDispatch): Changed all functions to use LyXText.
3336 2000-06-15 Juergen Vigna <jug@sad.it>
3338 * src/text.C (SetHeightOfRow): call inset::update before requesting
3341 * src/insets/insettext.C (update):
3342 * src/insets/insettabular.C (update): added implementation
3344 * src/insets/lyxinset.h: added update function
3346 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3348 * src/text.C (SelectNextWord): protect against null pointers with
3349 old-style string streams. (fix from Paul Theo Gonciari
3352 * src/cite.[Ch]: remove erroneous files.
3354 * lib/configure.m4: update the list of created directories.
3356 * src/lyxrow.C: include <config.h>
3357 * src/lyxcursor.C: ditto.
3359 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3361 * lib/examples/decimal.lyx: new example file from Mike.
3363 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3364 to find template definitions (from Dekel)
3366 * src/frontends/.cvsignore: add a few things.
3368 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3370 * src/Timeout.C (TimeOut): remove default argument.
3372 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3375 * src/insets/ExternalTemplate.C: add a "using" directive.
3377 * src/lyx_main.h: remove the act_ struct, which seems unused
3380 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3382 * LyX Developers Meeting: All files changed, due to random C++ (by
3383 coincidence) code generator script.
3385 - external inset (cool!)
3386 - initial online editing of preferences
3387 - insettabular breaks insettext(s contents)
3389 - some DocBook fixes
3390 - example files update
3391 - other cool stuff, create a diff and look for yourself.
3393 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3395 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3396 -1 this is a non-line-breaking textinset.
3398 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3399 if there is no width set.
3401 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3403 * Lots of files: Merged the dialogbase branch.
3405 2000-06-09 Allan Rae <rae@lyx.org>
3407 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3408 and the Dispatch methods that used it.
3410 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3411 access to functions formerly kept in Dispatch.
3413 2000-05-19 Allan Rae <rae@lyx.org>
3415 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3416 made to_page and count_copies integers again. from_page remains a
3417 string however because I want to allow entry of a print range like
3418 "1,4,22-25" using this field.
3420 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3421 and printer-params-get. These aren't useful from the minibuffer but
3422 could be used by a script/LyXServer app provided it passes a suitable
3423 auto_mem_buffer. I guess I should take a look at how the LyXServer
3424 works and make it support xtl buffers.
3426 * sigc++/: updated to libsigc++-1.0.1
3428 * src/xtl/: updated to xtl-1.3.pl.11
3430 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3431 those changes done to the files in src/ are actually recreated when
3432 they get regenerated. Please don't ever accept a patch that changes a
3433 dialog unless that patch includes the changes to the corresponding *.fd
3436 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3437 stringOnlyContains, renamed it and generalised it.
3439 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3440 branch. Removed the remaining old form_print code.
3442 2000-04-26 Allan Rae <rae@lyx.org>
3444 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3445 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3447 2000-04-25 Allan Rae <rae@lyx.org>
3449 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3450 against a base of xtl-1.3.pl.4
3452 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3453 filter the Id: entries so they still show the xtl version number
3456 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3457 into the src/xtl code. Patch still pending with José (XTL)
3459 2000-04-24 Allan Rae <rae@lyx.org>
3461 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3462 both more generic and much safer. Use the new template functions.
3463 * src/buffer.[Ch] (Dispatch): ditto.
3465 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3466 and mem buffer more intelligently. Also a little general cleanup.
3469 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3470 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3471 * src/xtl/Makefile.am: ditto.
3472 * src/xtl/.cvsignore: ditto.
3473 * src/Makefile.am: ditto.
3475 * src/PrinterParams.h: Removed the macros member functions. Added a
3476 testInvariant member function. A bit of tidying up and commenting.
3477 Included Angus's idea for fixing operation with egcs-1.1.2.
3479 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3480 cool expansion of XTL's mem_buffer to support automatic memory
3481 management within the buffer itself. Removed the various macros and
3482 replaced them with template functions that use either auto_mem_buffer
3483 or mem_buffer depending on a #define. The mem_buffer support will
3484 disappear as soon as the auto_mem_buffer is confirmed to be good on
3485 other platforms/compilers. That is, it's there so you've got something
3488 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3489 effectively forked XTL. However I expect José will include my code
3490 into the next major release. Also fixed a memory leak.
3491 * src/xtl/text.h: ditto.
3492 * src/xtl/xdr.h: ditto.
3493 * src/xtl/giop.h: ditto.
3495 2000-04-16 Allan Rae <rae@lyx.org>
3497 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3498 by autogen.sh and removed by maintainer-clean anyway.
3499 * .cvsignore, sigc++/.cvsignore: Support the above.
3501 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3503 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3505 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3506 macros, renamed static callback-target member functions to suit new
3507 scheme and made them public.
3508 * src/frontends/xforms/forms/form_print.fd: ditto.
3509 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3511 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3514 * src/xtl/: New directory containing a minimal distribution of XTL.
3515 This is XTL-1.3.pl.4.
3517 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3519 2000-04-15 Allan Rae <rae@lyx.org>
3521 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3523 * sigc++/: Updated to libsigc++-1.0.0
3525 2000-04-14 Allan Rae <rae@lyx.org>
3527 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3528 use the generic ones in future. I'll modify my conversion script.
3530 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3532 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3533 (CloseAllBufferRelatedDialogs): Renamed.
3534 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3536 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3537 of the generic ones. These are the same ones my conversion script
3540 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3541 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3542 * src/buffer.C (Dispatch): ditto
3544 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3545 functions for updating and hiding buffer dependent dialogs.
3546 * src/BufferView.C (buffer): ditto
3547 * src/buffer.C (setReadonly): ditto
3548 * src/lyxfunc.C (CloseBuffer): ditto
3550 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3551 Dialogs.h, and hence all the SigC stuff, into every file that includes
3552 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3554 * src/BufferView2.C: reduce the number of headers included by buffer.h
3556 2000-04-11 Allan Rae <rae@lyx.org>
3558 * src/frontends/xforms/xform_macros.h: A small collection of macros
3559 for building C callbacks.
3561 * src/frontends/xforms/Makefile.am: Added above file.
3563 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3564 scheme again. This time it should work for JMarc. If this is
3565 successful I'll revise my conversion script to automate some of this.
3566 The static member functions in the class also have to be public for
3567 this scheme will work. If the scheme works (it's almost identical to
3568 the way BufferView::cursorToggleCB is handled so it should work) then
3569 FormCopyright and FormPrint will be ready for inclusion into the main
3570 trunk immediately after 1.1.5 is released -- provided we're prepared
3571 for complaints about lame compilers not handling XTL.
3573 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3575 2000-04-07 Allan Rae <rae@lyx.org>
3577 * config/lyxinclude.m4: A bit more tidying up (Angus)
3579 * src/LString.h: JMarc's <string> header fix
3581 * src/PrinterParams.h: Used string for most data to remove some
3582 ugly code in the Print dialog and avoid even uglier code when
3583 appending the ints to a string for output.
3585 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3586 and moved "default:" back to the end of switch statement. Cleaned
3587 up the printing so it uses the right function calls and so the
3588 "print to file" option actually puts the file in the right directory.
3590 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3592 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3593 and Ok+Apply button control into a separate method: input (Angus).
3594 (input) Cleaned it up and improved it to be very thorough now.
3595 (All CB) static_cast used instead of C style cast (Angus). This will
3596 probably change again once we've worked out how to keep gcc-2.8.1 happy
3597 with real C callbacks.
3598 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3599 ignore some of the bool settings and has random numbers instead. Needs
3600 some more investigation. Added other input length checks and checking
3601 of file and printer names.
3603 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3604 would link (Angus). Seems the old code doesn't compile with the pragma
3605 statement either. Separated callback entries from internal methods.
3607 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3609 2000-03-17 Allan Rae <rae@lyx.org>
3611 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3612 need it? Maybe it could go in Dialogs instead? I could make it a
3613 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3614 values to get the bool return value.
3615 (Dispatch): New overloaded method for xtl support.
3617 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3618 extern "C" callback instead of static member functions. Hopefully,
3619 JMarc will be able to compile this. I haven't changed
3620 forms/form_copyright.fd yet. Breaking one of my own rules already.
3622 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3623 because they aren't useful from the minibuffer. Maybe a LyXServer
3624 might want a help message though?
3626 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3628 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3629 xtl which needs both rtti and exceptions.
3631 * src/support/Makefile.am:
3632 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3634 * src/frontends/xforms/input_validators.[ch]: input filters and
3635 validators. These conrol what keys are valid in input boxes.
3636 Use them and write some more. Much better idea than waiting till
3637 after the user has pressed Ok to say that the input fields don't make
3640 * src/frontends/xforms/Makefile.am:
3641 * src/frontends/xforms/forms/form_print.fd:
3642 * src/frontends/xforms/forms/makefile:
3643 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3644 new scheme. Still have to make sure I haven't missed anything from
3645 the current implementation.
3647 * src/Makefile.am, src/PrinterParams.h: New data store.
3649 * other files: Added a couple of copyright notices.
3651 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3653 * src/insets/insetbib.h: move Holder struct in public space.
3655 * src/frontends/include/DialogBase.h: use SigC:: only when
3656 SIGC_CXX_NAMESPACES is defined.
3657 * src/frontends/include/Dialogs.h: ditto.
3659 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3661 * src/frontends/xforms/FormCopyright.[Ch]: do not
3662 mention SigC:: explicitely.
3664 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3666 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3667 deals with testing KDE in main configure.in
3668 * configure.in: ditto.
3670 2000-02-22 Allan Rae <rae@lyx.org>
3672 * Lots of files: Merged from HEAD
3674 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3675 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3677 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3679 * sigc++/: new minidist.
3681 2000-02-14 Allan Rae <rae@lyx.org>
3683 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3685 2000-02-08 Juergen Vigna <jug@sad.it>
3687 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3688 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3690 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3691 for this port and so it is much easier for other people to port
3692 dialogs in a common development environment.
3694 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3695 the QT/KDE implementation.
3697 * src/frontends/kde/Dialogs.C:
3698 * src/frontends/kde/FormCopyright.C:
3699 * src/frontends/kde/FormCopyright.h:
3700 * src/frontends/kde/Makefile.am:
3701 * src/frontends/kde/formcopyrightdialog.C:
3702 * src/frontends/kde/formcopyrightdialog.h:
3703 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3704 for the kde support of the Copyright-Dialog.
3706 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3707 subdir-substitution instead of hardcoded 'xforms' as we now have also
3710 * src/frontends/include/DialogBase.h (Object): just commented the
3711 label after #endif (nasty warning and I don't like warnings ;)
3713 * src/main.C (main): added KApplication initialization if using
3716 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3717 For now only the KDE event-loop is added if frontend==kde.
3719 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3721 * configure.in: added support for the --with-frontend[=value] option
3723 * autogen.sh: added kde.m4 file to list of config-files
3725 * acconfig.h: added define for KDEGUI-support
3727 * config/kde.m4: added configuration functions for KDE-port
3729 * config/lyxinclude.m4: added --with-frontend[=value] option with
3730 support for xforms and KDE.
3732 2000-02-08 Allan Rae <rae@lyx.org>
3734 * all Makefile.am: Fixed up so the make targets dist, distclean,
3735 install and uninstall all work even if builddir != srcdir. Still
3736 have a new sigc++ minidist update to come.
3738 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3740 2000-02-01 Allan Rae <rae@lyx.org>
3742 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3743 Many mods to get builddir != srcdir working.
3745 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3746 for building on NT and so we can do the builddir != srcdir stuff.
3748 2000-01-30 Allan Rae <rae@lyx.org>
3750 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3751 This will stay in "rae" branch. We probably don't really need it in
3752 the main trunk as anyone who wants to help programming it should get
3753 a full library installed also. So they can check both included and
3754 system supplied library compilation.
3756 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3757 Added a 'mini' distribution of libsigc++. If you feel the urge to
3758 change something in these directories - Resist it. If you can't
3759 resist the urge then you should modify the following script and rebuild
3760 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3761 all happen. Still uses a hacked version of libsigc++'s configure.in.
3762 I'm quite happy with the results. I'm not sure the extra work to turn
3763 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3764 worth the trouble and would probably lead to extra maintenance
3766 I haven't tested the following important make targets: install, dist.
3767 Not ready for prime time but very close. Maybe 1.1.5.
3769 * development/tools/makeLyXsigc.sh: A shell script to automatically
3770 generate our mini-dist of libsigc++. It can only be used with a CVS
3771 checkout of libsigc++ not a tarball distribution. It's well commented.
3772 This will end up as part of the libsigc++ distribution so other apps
3773 can easily have an included mini-dist. If someone makes mods to the
3774 sigc++ subpackage without modifying this script to generate those
3775 changes I'll be very upset!
3777 * src/frontends/: Started the gui/system indep structure.
3779 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3780 to access the gui-indep dialogs are in this class. Much improved
3781 design compared to previous revision. Lars, please refrain from
3782 moving this header into src/ like you did with Popups.h last time.
3784 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3786 * src/frontends/xforms/: Started the gui-indep system with a single
3787 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3790 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3791 Here you'll find a very useful makefile and automated fdfix.sh that
3792 makes updating dailogs a no-brainer -- provided you follow the rules
3793 set out in the README. I'm thinking about adding another script to
3794 automatically generate skeleton code for a new dialog given just the
3797 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3798 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3799 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3801 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3803 * src/support/LSubstring.C (operator): simplify
3805 * src/lyxtext.h: removed bparams, use buffer_->params instead
3807 * src/lyxrow.h: make Row a real class, move all variables to
3808 private and use accessors.
3810 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3812 (isRightToLeftPar): ditto
3813 (ChangeLanguage): ditto
3814 (isMultiLingual): ditto
3817 (SimpleTeXOnePar): ditto
3818 (TeXEnvironment): ditto
3819 (GetEndLabel): ditto
3821 (SetOnlyLayout): ditto
3822 (BreakParagraph): ditto
3823 (BreakParagraphConservative): ditto
3824 (GetFontSettings): ditto
3826 (CopyIntoMinibuffer): ditto
3827 (CutIntoMinibuffer): ditto
3828 (PasteParagraph): ditto
3829 (SetPExtraType): ditto
3830 (UnsetPExtraType): ditto
3831 (DocBookContTableRows): ditto
3832 (SimpleDocBookOneTablePar): ditto
3834 (TeXFootnote): ditto
3835 (SimpleTeXOneTablePar): ditto
3836 (TeXContTableRows): ditto
3837 (SimpleTeXSpecialChars): ditto
3840 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3841 to private and use accessors.
3843 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3844 this, we did not use it anymore and has not been for ages. Just a
3845 waste of cpu cycles.
3847 * src/language.h: make Language a real class, move all variables
3848 to private and use accessors.
3850 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3851 (create_view): remove
3852 (update): some changes for new timer
3853 (cursorToggle): use new timer
3854 (beforeChange): change for new timer
3856 * src/BufferView.h (cursorToggleCB): removed last paramter because
3859 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3860 (cursorToggleCB): change because of new timer code
3862 * lib/CREDITS: updated own mailaddress
3864 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3866 * src/support/filetools.C (PutEnv): fix the code in case neither
3867 putenv() nor setenv() have been found.
3869 * INSTALL: mention the install-strip Makefile target.
3871 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3872 read-only documents.
3874 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3876 * lib/reLyX/configure.in (VERSION): avoid using a previously
3877 generated reLyX wrapper to find out $prefix.
3879 * lib/examples/eu_adibide_lyx-atua.lyx:
3880 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3881 translation of the Tutorial (Dooteo)
3883 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3885 * forms/cite.fd: new citation dialog
3887 * src/insetcite.[Ch]: the new citation dialog is moved into
3890 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3893 * src/insets/insetcommand.h: data members made private.
3895 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3897 * LyX 1.1.5 released
3899 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3901 * src/version.h (LYX_RELEASE): to 1.1.5
3903 * src/spellchecker.C (RunSpellChecker): return false if the
3904 spellchecker dies upon creation.
3906 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3908 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3909 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3913 * lib/CREDITS: update entry for Martin Vermeer.
3915 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3917 * src/text.C (draw): Draw foreign language bars at the bottom of
3918 the row instead of at the baseline.
3920 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3922 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3924 * lib/bind/de_menus.bind: updated
3926 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3928 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3930 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3932 * src/menus.C (Limit_string_length): New function
3933 (ShowTocMenu): Limit the number of items/length of items in the
3936 * src/paragraph.C (String): Correct result for a paragraph inside
3939 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3941 * src/bufferlist.C (close): test of buf->getuser() == NULL
3943 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3945 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3946 Do not call to SetCursor when the paragraph is a closed footnote!
3948 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3950 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3953 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3955 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3958 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3959 reference popup, that activates the reference-back action
3961 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3963 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3964 the menus. Also fixed a bug.
3966 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3967 the math panels when switching buffers (unless new buffer is readonly).
3969 * src/BufferView.C (NoSavedPositions)
3970 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3972 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3974 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3975 less of dvi dirty or not.
3977 * src/trans_mgr.[Ch] (insert): change first parameter to string
3980 * src/chset.[Ch] (encodeString): add const to first parameter
3982 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3984 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3988 * src/LaTeX.C (deplog): better searching for dependency files in
3989 the latex log. Uses now regexps.
3991 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3992 instead of the box hack or \hfill.
3994 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3996 * src/lyxfunc.C (doImportHelper): do not create the file before
3997 doing the actual import.
3998 (doImportASCIIasLines): create a new file before doing the insert.
3999 (doImportASCIIasParagraphs): ditto.
4001 * lib/lyxrc.example: remove mention of non-existing commands
4003 * lyx.man: remove mention of color-related switches.
4005 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4007 * src/lyx_gui.C: remove all the color-related ressources, which
4008 are not used anymore.
4010 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4013 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4015 * src/lyxrc.C (read): Add a missing break in the switch
4017 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4019 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4021 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4024 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4026 * src/text.C (draw): draw bars under foreign language words.
4028 * src/LColor.[Ch]: add LColor::language
4030 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4032 * src/lyxcursor.h (boundary): New member variable
4034 * src/text.C (IsBoundary): New methods
4036 * src/text.C: Use the above for currect cursor movement when there
4037 is both RTL & LTR text.
4039 * src/text2.C: ditto
4041 * src/bufferview_funcs.C (ToggleAndShow): ditto
4043 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4045 * src/text.C (DeleteLineForward): set selection to true to avoid
4046 that DeleteEmptyParagraphMechanism does some magic. This is how it
4047 is done in all other functions, and seems reasonable.
4048 (DeleteWordForward): do not jump over non-word stuff, since
4049 CursorRightOneWord() already does it.
4051 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4052 DeleteWordBackward, since they seem safe to me (since selection is
4053 set to "true") DeleteEmptyParagraphMechanism does nothing.
4055 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4057 * src/lyx_main.C (easyParse): simplify the code by factoring the
4058 part that removes parameters from the command line.
4059 (LyX): check wether wrong command line options have been given.
4061 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4063 * src/lyx_main.C : add support for specifying user LyX
4064 directory via command line option -userdir.
4066 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4068 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4069 the number of items per popup.
4070 (Add_to_refs_menu): Ditto.
4072 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4074 * src/lyxparagraph.h: renamed ClearParagraph() to
4075 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4076 textclass as parameter, and do nothing if free_spacing is
4077 true. This fixes part of the line-delete-forward problems.
4079 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4080 (pasteSelection): ditto.
4081 (SwitchLayoutsBetweenClasses): more translatable strings.
4083 * src/text2.C (CutSelection): use StripLeadingSpaces.
4084 (PasteSelection): ditto.
4085 (DeleteEmptyParagraphMechanism): ditto.
4087 2000-05-26 Juergen Vigna <jug@sad.it>
4089 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4090 is not needed in tabular insets.
4092 * src/insets/insettabular.C (TabularFeatures): added missing features.
4094 * src/tabular.C (DeleteColumn):
4096 (AppendRow): implemented this functions
4097 (cellsturct::operator=): clone the inset too;
4099 2000-05-23 Juergen Vigna <jug@sad.it>
4101 * src/insets/insettabular.C (LocalDispatch): better selection support
4102 when having multicolumn-cells.
4104 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4106 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4108 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4110 * src/ColorHandler.C (getGCForeground): put more test into _()
4112 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4115 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4118 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4120 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4121 there are no labels, or when buffer is readonly.
4123 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4124 there are no labels, buffer is SGML, or when buffer is readonly.
4126 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4128 * src/LColor.C (LColor): change a couple of grey40 to grey60
4129 (LColor): rewore initalization to make compiles go some magnitude
4131 (getGUIName): don't use gettext until we need the string.
4133 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4135 * src/Bullet.[Ch]: Fixed a small bug.
4137 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4139 * src/paragraph.C (String): Several fixes/improvements
4141 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4143 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4145 * src/paragraph.C (String): give more correct output.
4147 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4149 * src/lyxfont.C (stateText) Do not output the language if it is
4150 eqaul to the language of the document.
4152 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4153 between two paragraphs with the same language.
4155 * src/paragraph.C (getParLanguage) Return a correct answer for an
4156 empty dummy paragraph.
4158 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4161 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4164 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4165 the menus/popup, if requested fonts are unavailable.
4167 2000-05-22 Juergen Vigna <jug@sad.it>
4169 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4170 movement support (Up/Down/Tab/Shift-Tab).
4171 (LocalDispatch): added also preliminari cursor-selection.
4173 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4175 * src/paragraph.C (PasteParagraph): Hopefully now right!
4177 2000-05-22 Garst R. Reese <reese@isn.net>
4179 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4180 of list, change all references to Environment to Command
4181 * tex/hollywood.cls : rewrite environments as commands, add
4182 \uppercase to interiorshot and exteriorshot to force uppecase.
4183 * tex/broadway.cls : rewrite environments as commands. Tweak
4186 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4188 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4189 size of items: use a constant intead of the hardcoded 40, and more
4190 importantly do not remove the %m and %x tags added at the end.
4191 (Add_to_refs_menu): use vector::size_type instead of
4192 unsigned int as basic types for the variables. _Please_ do not
4193 assume that size_t is equal to unsigned int. On an alpha, this is
4194 unsigned long, which is _not_ the same.
4196 * src/language.C (initL): remove language "hungarian", since it
4197 seems that "magyar" is better.
4199 2000-05-22 Juergen Vigna <jug@sad.it>
4201 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4203 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4206 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4207 next was deleted but not set to 0.
4209 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4211 * src/language.C (initL): change the initialization of languages
4212 so that compiles goes _fast_.
4214 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4217 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4219 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4223 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4225 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4227 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4231 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4234 * src/insets/insetlo*.[Ch]: Made editable
4236 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4238 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4239 the current selection.
4241 * src/BufferView_pimpl.C (stuffClipboard): new method
4243 * src/BufferView.C (stuffClipboard): new method
4245 * src/paragraph.C (String): new method
4247 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4248 LColor::ignore when lyxname is not found.
4250 * src/BufferView.C (pasteSelection): new method
4252 * src/BufferView_pimpl.C (pasteSelection): new method
4254 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4256 * src/WorkArea.C (request_clipboard_cb): new static function
4257 (getClipboard): new method
4258 (putClipboard): new method
4260 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4262 * LyX 1.1.5pre2 released
4264 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4266 * src/vspace.C (operator=): removed
4267 (operator=): removed
4269 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4271 * src/layout.C (NumberOfClass): manually set the type in make_pair
4272 (NumberOfLayout): ditto
4274 * src/language.C: use the Language constructor for ignore_lang
4276 * src/language.h: add constructors to struct Language
4278 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4280 * src/text2.C (SetCursorIntern): comment out #warning
4282 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4284 * src/mathed/math_iter.h: initialize sx and sw to 0
4286 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4288 * forms/lyx.fd: Redesign of form_ref
4290 * src/LaTeXFeatures.[Ch]
4294 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4297 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4298 and Buffer::inset_iterator.
4300 * src/menus.C: Added new menus: TOC and Refs.
4302 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4304 * src/buffer.C (getTocList): New method.
4306 * src/BufferView2.C (ChangeRefs): New method.
4308 * src/buffer.C (getLabelList): New method. It replaces the old
4309 getReferenceList. The return type is vector<string> instead of
4312 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4313 the old getLabel() and GetNumberOfLabels() methods.
4314 * src/insets/insetlabel.C (getLabelList): ditto
4315 * src/mathed/formula.C (getLabelList): ditto
4317 * src/paragraph.C (String): New method.
4319 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4320 Uses the new getTocList() method.
4321 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4322 which automatically updates the contents of the browser.
4323 (RefUpdateCB): Use the new getLabelList method.
4325 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4327 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4329 * src/spellchecker.C: Added using std::reverse;
4331 2000-05-19 Juergen Vigna <jug@sad.it>
4333 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4335 * src/insets/insettext.C (computeTextRows): small fix for display of
4336 1 character after a newline.
4338 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4341 2000-05-18 Juergen Vigna <jug@sad.it>
4343 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4344 when changing width of column.
4346 * src/tabular.C (set_row_column_number_info): setting of
4347 autobreak rows if necessary.
4349 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4351 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4353 * src/vc-backend.*: renamed stat() to status() and vcstat to
4354 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4355 compilation broke. The new name seems more relevant, anyway.
4357 2000-05-17 Juergen Vigna <jug@sad.it>
4359 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4360 which was wrong if the removing caused removing of rows!
4362 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4363 (pushToken): new function.
4365 * src/text2.C (CutSelection): fix problem discovered with purify
4367 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4369 * src/debug.C (showTags): enlarge the first column, now that we
4370 have 6-digits debug codes.
4372 * lib/layouts/hollywood.layout:
4373 * lib/tex/hollywood.cls:
4374 * lib/tex/brodway.cls:
4375 * lib/layouts/brodway.layout: more commands and fewer
4376 environments. Preambles moved in the .cls files. Broadway now has
4377 more options on scene numbering and less whitespace (from Garst)
4379 * src/insets/insetbib.C (getKeys): make sure that we are in the
4380 document directory, in case the bib file is there.
4382 * src/insets/insetbib.C (Latex): revert bogus change.
4384 2000-05-16 Juergen Vigna <jug@sad.it>
4386 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4387 the TabularLayout on cursor move.
4389 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4391 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4394 (draw): fixed cursor position and drawing so that the cursor is
4395 visible when before the tabular-inset.
4397 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4398 when creating from old insettext.
4400 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4402 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4404 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4405 * lib/tex/brodway.cls: ditto
4407 * lib/layouts/brodway.layout: change alignment of parenthical
4410 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4412 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4413 versions 0.88 and 0.89 are supported.
4415 2000-05-15 Juergen Vigna <jug@sad.it>
4417 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4420 * src/insets/insettext.C (computeTextRows): redone completely this
4421 function in a much cleaner way, because of problems when having a
4423 (draw): added a frame border when the inset is locked.
4424 (SetDrawLockedFrame): this sets if we draw the border or not.
4425 (SetFrameColor): this sets the frame color (default=insetframe).
4427 * src/insets/lyxinset.h: added x() and y() functions which return
4428 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4429 function which is needed to see if we have a locking inset of some
4430 type in this inset (needed for now in insettabular).
4432 * src/vspace.C (inPixels): the same function also without a BufferView
4433 parameter as so it is easier to use it in some ocasions.
4435 * src/lyxfunc.C: changed all places where insertInset was used so
4436 that now if it couldn't be inserted it is deleted!
4438 * src/TabularLayout.C:
4439 * src/TableLayout.C: added support for new tabular-inset!
4441 * src/BufferView2.C (insertInset): this now returns a bool if the
4442 inset was really inserted!!!
4444 * src/tabular.C (GetLastCellInRow):
4445 (GetFirstCellInRow): new helper functions.
4446 (Latex): implemented for new tabular class.
4450 (TeXTopHLine): new Latex() helper functions.
4452 2000-05-12 Juergen Vigna <jug@sad.it>
4454 * src/mathed/formulamacro.C (Read):
4455 * src/mathed/formula.C (Read): read also the \end_inset here!
4457 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4459 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4460 crush when saving formulae with unbalanced parenthesis.
4462 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4464 * src/layout.C: Add new keyword "endlabelstring" to layout file
4466 * src/text.C (GetVisibleRow): Draw endlabel string.
4468 * lib/layouts/broadway.layout
4469 * lib/layouts/hollywood.layout: Added endlabel for the
4470 Parenthetical layout.
4472 * lib/layouts/heb-article.layout: Do not use slanted font shape
4473 for Theorem like environments.
4475 * src/buffer.C (makeLaTeXFile): Always add "american" to
4476 the UsedLanguages list if document language is RTL.
4478 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4480 * add addendum to README.OS2 and small patch (from SMiyata)
4482 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4484 * many files: correct the calls to ChangeExtension().
4486 * src/support/filetools.C (ChangeExtension): remove the no_path
4487 argument, which does not belong there. Use OnlyFileName() instead.
4489 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4490 files when LaTeXing a non-nice latex file.
4492 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4493 a chain of "if". Return false when deadkeys are not handled.
4495 * src/lyx_main.C (LyX): adapted the code for default bindings.
4497 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4498 bindings for basic functionality (except deadkeys).
4499 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4501 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4502 several methods: handle override_x_deadkeys.
4504 * src/lyxrc.h: remove the "bindings" map, which did not make much
4505 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4507 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4509 * src/lyxfont.C (stateText): use a saner method to determine
4510 whether the font is "default". Seems to fix the crash with DEC
4513 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4515 2000-05-08 Juergen Vigna <jug@sad.it>
4517 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4518 TabularLayoutMenu with mouse-button-3
4519 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4521 * src/TabularLayout.C: added this file for having a Layout for
4524 2000-05-05 Juergen Vigna <jug@sad.it>
4526 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4527 recalculating inset-widths.
4528 (TabularFeatures): activated this function so that I can change
4529 tabular-features via menu.
4531 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4532 that I can test some functions with the Table menu.
4534 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4536 * src/lyxfont.C (stateText): guard against stupid c++libs.
4538 * src/tabular.C: add using std::vector
4539 some whitespace changes, + removed som autogenerated code.
4541 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4543 2000-05-05 Juergen Vigna <jug@sad.it>
4545 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4546 row, columns and cellstructures.
4548 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4550 * lib/lyxrc.example: remove obsolete entries.
4552 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4553 reading of protected_separator for free_spacing.
4555 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4557 * src/text.C (draw): do not display an exclamation mark in the
4558 margin for margin notes. This is confusing, ugly and
4561 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4562 AMS math' is checked.
4564 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4565 name to see whether including the amsmath package is needed.
4567 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4569 * src/paragraph.C (validate): Compute UsedLanguages correctly
4570 (don't insert the american language if it doesn't appear in the
4573 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4574 The argument of \thanks{} command is considered moving argument
4576 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4579 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4581 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4582 for appendix/minipage/depth. The lines can be now both in the footnote
4583 frame, and outside the frame.
4585 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4588 2000-05-05 Juergen Vigna <jug@sad.it>
4590 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4591 neede only in tabular.[Ch].
4593 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4595 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4597 (Write): write '~' for PROTECTED_SEPARATOR
4599 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4601 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4604 * src/mathed/formula.C (drawStr): rename size to siz.
4606 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4607 possibly fix a bug by not changing the pflags = flags to piflags =
4610 2000-05-05 Juergen Vigna <jug@sad.it>
4612 * src/insets/insetbib.C: moved using directive
4614 * src/ImportNoweb.C: small fix for being able to compile (missing
4617 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4619 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4620 to use clear, since we don't depend on this in the code. Add test
4623 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4625 * (various *.C files): add using std::foo directives to please dec
4628 * replace calls to string::clear() to string::erase() (Angus)
4630 * src/cheaders/cmath: modified to provide std::abs.
4632 2000-05-04 Juergen Vigna <jug@sad.it>
4634 * src/insets/insettext.C: Prepared all for inserting of multiple
4635 paragraphs. Still display stuff to do (alignment and other things),
4636 but I would like to use LyXText to do this when we cleaned out the
4637 table-support stuff.
4639 * src/insets/insettabular.C: Changed lot of stuff and added lots
4640 of functionality still a lot to do.
4642 * src/tabular.C: Various functions changed name and moved to be
4643 const functions. Added new Read and Write functions and changed
4644 lots of things so it works good with tabular-insets (also removed
4645 some stuff which is not needed anymore * hacks *).
4647 * src/lyxcursor.h: added operators == and != which just look if
4648 par and pos are (not) equal.
4650 * src/buffer.C (latexParagraphs): inserted this function to latex
4651 all paragraphs form par to endpar as then I can use this too for
4654 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4655 so that I can call this to from text insets with their own cursor.
4657 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4658 output off all paragraphs (because of the fix below)!
4660 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4661 the very last paragraph (this could be also the last paragraph of an
4664 * src/texrow.h: added rows() call which returns the count-variable.
4666 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4668 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4670 * lib/configure.m4: better autodetection of DocBook tools.
4672 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4674 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4676 * src/lyx_cb.C: add using std::reverse;
4678 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4681 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4682 selected files. Should fix repeated errors from generated files.
4684 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4686 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4688 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4689 the spellchecker popup.
4691 * lib/lyxrc.example: Removed the \number_inset section
4693 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4695 * src/insets/figinset.C (various): Use IsFileReadable() to make
4696 sure that the file actually exist. Relying on ghostscripts errors
4697 is a bad idea since they can lead to X server crashes.
4699 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4701 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4704 * lib/lyxrc.example: smallish typo in description of
4705 \view_dvi_paper_option
4707 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4710 * src/lyxfunc.C: doImportHelper to factor out common code of the
4711 various import methods. New functions doImportASCIIasLines,
4712 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4713 doImportLinuxDoc for the format specific parts.
4716 * buffer.C: Dispatch returns now a bool to indicate success
4719 * lyx_gui.C: Add getLyXView() for member access
4721 * lyx_main.C: Change logic for batch commands: First try
4722 Buffer::Dispatch (possibly without GUI), if that fails, use
4725 * lyx_main.C: Add support for --import command line switch.
4726 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4727 Available Formats: Everything accepted by 'buffer-import <format>'
4729 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4731 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4734 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4735 documents will be reformatted upon reentry.
4737 2000-04-27 Juergen Vigna <jug@sad.it>
4739 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4740 correctly only last pos this was a bug.
4742 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4744 * release of lyx-1.1.5pre1
4746 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4748 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4750 * src/menus.C: revert the change of naming (Figure->Graphic...)
4751 from 2000-04-11. It was incomplete and bad.
4753 * src/LColor.[Ch]: add LColor::depthbar.
4754 * src/text.C (GetVisibleRow): use it.
4756 * README: update the languages list.
4758 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4760 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4763 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4765 * README: remove sections that were just wrong.
4767 * src/text2.C (GetRowNearY): remove currentrow code
4769 * src/text.C (GetRow): remove currentrow code
4771 * src/screen.C (Update): rewritten a bit.
4772 (SmallUpdate): removed func
4774 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4776 (FullRebreak): return bool
4777 (currentrow): remove var
4778 (currentrow_y): ditto
4780 * src/lyxscreen.h (Draw): change arg to unsigned long
4781 (FitCursor): return bool
4782 (FitManualCursor): ditto
4783 (Smallpdate): remove func
4784 (first): change to unsigned long
4785 (DrawOneRow): change second arg to long (from long &)
4786 (screen_refresh_y): remove var
4787 (scree_refresh_row): ditto
4789 * src/lyxrow.h: change baseline to usigned int from unsigned
4790 short, this brings some implicit/unsigned issues out in the open.
4792 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4794 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4795 instead of smallUpdate.
4797 * src/lyxcursor.h: change y to unsigned long
4799 * src/buffer.h: don't call updateScrollbar after fitcursor
4801 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4802 where they are used. Removed "\\direction", this was not present
4803 in 1.1.4 and is already obsolete. Commented out some code that I
4804 believe to never be called.
4805 (runLiterate): don't call updateScrollbar after fitCursor
4807 (buildProgram): ditto
4810 * src/WorkArea.h (workWidth): change return val to unsigned
4813 (redraw): remove the button redraws
4814 (setScrollbarValue): change for scrollbar
4815 (getScrollbarValue): change for scrollbar
4816 (getScrollbarBounds): change for scrollbar
4818 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4819 (C_WorkArea_down_cb): removed func
4820 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4821 (resize): change for scrollbar
4822 (setScrollbar): ditto
4823 (setScrollbarBounds): ditto
4824 (setScrollbarIncrements): ditto
4825 (up_cb): removed func
4826 (down_cb): removed func
4827 (scroll_cb): change for scrollbar
4828 (work_area_handler): ditto
4830 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4831 when FitCursor did something.
4832 (updateScrollbar): some unsigned changes
4833 (downCB): removed func
4834 (scrollUpOnePage): removed func
4835 (scrollDownOnePage): remvoed func
4836 (workAreaMotionNotify): don't call screen->FitCursor but use
4837 fitCursor instead. and bool return val
4838 (workAreaButtonPress): ditto
4839 (workAreaButtonRelease): some unsigned changes
4840 (checkInsetHit): ditto
4841 (workAreaExpose): ditto
4842 (update): parts rewritten, comments about the signed char arg added
4843 (smallUpdate): removed func
4844 (cursorPrevious): call needed updateScrollbar
4847 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4850 * src/BufferView.[Ch] (upCB): removed func
4851 (downCB): removed func
4852 (smallUpdate): removed func
4854 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4856 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4857 currentrow, currentrow_y optimization. This did not help a lot and
4858 if we want to do this kind of optimization we should rather use
4859 cursor.row instead of the currentrow.
4861 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4862 buffer spacing and klyx spacing support.
4864 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4866 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4869 2000-04-26 Juergen Vigna <jug@sad.it>
4871 * src/insets/figinset.C: fixes to Lars sstream changes!
4873 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4875 * A lot of files: Added Ascii(ostream &) methods to all inset
4876 classes. Used when exporting to ASCII.
4878 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4879 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4882 * src/text2.C (ToggleFree): Disabled implicit word selection when
4883 there is a change in the language
4885 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4886 no output was generated for end-of-sentence inset.
4888 * src/insets/lyxinset.h
4891 * src/paragraph.C: Removed the insetnumber code
4893 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4895 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4897 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4898 no_babel and no_epsfig completely from the file.
4899 (parseSingleLyXformat2Token): add handling for per-paragraph
4900 spacing as written by klyx.
4902 * src/insets/figinset.C: applied patch by Andre. Made it work with
4905 2000-04-20 Juergen Vigna <jug@sad.it>
4907 * src/insets/insettext.C (cutSelection):
4908 (copySelection): Fixed with selection from right to left.
4909 (draw): now the rows are not recalculated at every draw.
4910 (computeTextRows): for now reset the inset-owner here (this is
4911 important for an undo or copy where the inset-owner is not set
4914 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4915 motion to the_locking_inset screen->first was forgotten, this was
4916 not important till we got multiline insets.
4918 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4920 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4921 code seems to be alright (it is code changed by Dekel, and the
4922 intent is indeed that all macros should be defined \protect'ed)
4924 * NEWS: a bit of reorganisation of the new user-visible features.
4926 2000-04-19 Juergen Vigna <jug@sad.it>
4928 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4929 position. Set the inset_owner of the used paragraph so that it knows
4930 that it is inside an inset. Fixed cursor handling with mouse and
4931 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4932 and cleanups to make TextInsets work better.
4934 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4935 Changed parameters of various functions and added LockInsetInInset().
4937 * src/insets/insettext.C:
4939 * src/insets/insetcollapsable.h:
4940 * src/insets/insetcollapsable.C:
4941 * src/insets/insetfoot.h:
4942 * src/insets/insetfoot.C:
4943 * src/insets/insetert.h:
4944 * src/insets/insetert.C: cleaned up the code so that it works now
4945 correctly with insettext.
4947 * src/insets/inset.C:
4948 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4949 that insets in insets are supported right.
4952 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4954 * src/paragraph.C: some small fixes
4956 * src/debug.h: inserted INSETS debug info
4958 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4959 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4961 * src/commandtags.h:
4962 * src/LyXAction.C: insert code for InsetTabular.
4964 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4965 not Button1MotionMask.
4966 (workAreaButtonRelease): send always a InsetButtonRelease event to
4968 (checkInsetHit): some setCursor fixes (always with insets).
4970 * src/BufferView2.C (lockInset): returns a bool now and extended for
4971 locking insets inside insets.
4972 (showLockedInsetCursor): it is important to have the cursor always
4973 before the locked inset.
4974 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4976 * src/BufferView.h: made lockInset return a bool.
4978 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4980 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4981 that is used also internally but can be called as public to have back
4982 a cursor pos which is not set internally.
4983 (SetCursorIntern): Changed to use above function.
4985 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4987 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4992 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4993 patches for things that should be in or should be changed.
4995 * src/* [insetfiles]: change "usigned char fragile" to bool
4996 fragile. There was only one point that could that be questioned
4997 and that is commented in formulamacro.C. Grep for "CHECK".
4999 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5000 (DeleteBuffer): take it out of CutAndPaste and make it static.
5002 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5004 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5005 output the spacing envir commands. Also the new commands used in
5006 the LaTeX output makes the result better.
5008 * src/Spacing.C (writeEnvirBegin): new method
5009 (writeEnvirEnd): new method
5011 2000-04-18 Juergen Vigna <jug@sad.it>
5013 * src/CutAndPaste.C: made textclass a static member of the class
5014 as otherwise it is not accesed right!!!
5016 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5018 * forms/layout_forms.fd
5019 * src/layout_forms.h
5020 * src/layout_forms.C (create_form_form_character)
5021 * src/lyx_cb.C (UserFreeFont)
5022 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5023 documents (in the layout->character popup).
5025 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5027 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5028 \spell_command was in fact not honored (from Kevin Atkinson).
5030 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5033 * src/lyx_gui.h: make lyxViews private (Angus)
5035 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5037 * src/mathed/math_write.C
5038 (MathMatrixInset::Write) Put \protect before \begin{array} and
5039 \end{array} if fragile
5040 (MathParInset::Write): Put \protect before \\ if fragile
5042 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5044 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5045 initialization if the LyXColorHandler must be done after the
5046 connections to the XServer has been established.
5048 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5049 get the background pixel from the lyxColorhandler so that the
5050 figures are rendered with the correct background color.
5051 (NextToken): removed functions.
5052 (GetPSSizes): use ifs >> string instead of NextToken.
5054 * src/Painter.[Ch]: the color cache moved out of this file.
5056 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5059 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5061 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5062 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5064 * src/BufferView.C (enterView): new func
5065 (leaveView): new func
5067 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5069 (leaveView): new func, undefines xterm cursor when approp.
5071 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5072 (AllowInput): delete the Workarea cursor handling from this func.
5074 * src/Painter.C (underline): draw a slimer underline in most cases.
5076 * src/lyx_main.C (error_handler): use extern "C"
5078 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5080 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5081 sent directly to me.
5083 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5084 to the list by Dekel.
5086 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5089 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5090 methods from lyx_cb.here.
5092 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5095 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5097 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5098 instead of using current_view directly.
5100 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5102 * src/LyXAction.C (init): add the paragraph-spacing command.
5104 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5106 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5108 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5109 different from the documents.
5111 * src/text.C (SetHeightOfRow): take paragraph spacing into
5112 account, paragraph spacing takes precedence over buffer spacing
5113 (GetVisibleRow): ditto
5115 * src/paragraph.C (writeFile): output the spacing parameter too.
5116 (validate): set the correct features if spacing is used in the
5118 (Clear): set spacing to default
5119 (MakeSameLayout): spacing too
5120 (HasSameLayout): spacing too
5121 (SetLayout): spacing too
5122 (TeXOnePar): output the spacing commands
5124 * src/lyxparagraph.h: added a spacing variable for use with
5125 per-paragraph spacing.
5127 * src/Spacing.h: add a Default spacing and a method to check if
5128 the current spacing is default. also added an operator==
5130 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5133 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5135 * src/lyxserver.C (callback): fix dispatch of functions
5137 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5138 printf() into lyxerr call.
5140 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5143 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5144 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5145 the "Float" from each of the subitems.
5146 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5148 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5149 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5150 documented the change so that the workaround can be nuked later.
5152 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5155 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5157 * src/buffer.C (getLatexName): ditto
5158 (setReadonly): ditto
5160 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5162 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5163 avoid some uses of current_view. Added also a bufferParams()
5164 method to get at this.
5166 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5168 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5170 * src/lyxparagraph.[Ch]: removed
5171 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5172 with operators used by lower_bound and
5173 upper_bound in InsetTable's
5174 Make struct InsetTable private again. Used matchpos.
5176 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5178 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5179 document, the language of existing text is changed (unless the
5180 document is multi-lingual)
5182 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5184 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5186 * A lot of files: A rewrite of the Right-to-Left support.
5188 2000-04-10 Juergen Vigna <jug@sad.it>
5190 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5191 misplaced cursor when inset in inset is locked.
5193 * src/insets/insettext.C (LocalDispatch): small fix so that a
5194 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5196 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5197 footnote font should be decreased in size twice when displaying.
5199 * src/insets/insettext.C (GetDrawFont): inserted this function as
5200 the drawing-font may differ from the real paragraph font.
5202 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5203 insets (inset in inset!).
5205 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5206 function here because we don't want footnotes inside footnotes.
5208 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5210 (init): now set the inset_owner in paragraph.C
5211 (LocalDispatch): added some resetPos() in the right position
5214 (pasteSelection): changed to use the new CutAndPaste-Class.
5216 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5217 which tells if it is allowed to insert another inset inside this one.
5219 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5220 SwitchLayoutsBetweenClasses.
5222 * src/text2.C (InsertInset): checking of the new paragraph-function
5224 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5225 is not needed anymore here!
5228 (PasteSelection): redone (also with #ifdef) so that now this uses
5229 the CutAndPaste-Class.
5230 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5233 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5234 from/to text/insets.
5236 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5237 so that the paragraph knows if it is inside an (text)-inset.
5238 (InsertFromMinibuffer): changed return-value to bool as now it
5239 may happen that an inset is not inserted in the paragraph.
5240 (InsertInsetAllowed): this checks if it is allowed to insert an
5241 inset in this paragraph.
5243 (BreakParagraphConservative):
5244 (BreakParagraph) : small change for the above change of the return
5245 value of InsertFromMinibuffer.
5247 * src/lyxparagraph.h: added inset_owner and the functions to handle
5248 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5250 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5252 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5253 functions from BufferView to BufferView::Pimpl to ease maintence.
5255 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5256 correctly. Also use SetCursorIntern instead of SetCursor.
5258 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5261 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5263 * src/WorkArea.C (belowMouse): manually implement below mouse.
5265 * src/*: Add "explicit" on several constructors, I added probably
5266 some unneeded ones. A couple of changes to code because of this.
5268 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5269 implementation and private parts from the users of BufferView. Not
5272 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5273 implementation and private parts from the users of LyXLex. Not
5276 * src/BufferView_pimpl.[Ch]: new files
5278 * src/lyxlex_pimpl.[Ch]: new files
5280 * src/LyXView.[Ch]: some inline functions move out-of-line
5282 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5284 * src/lyxparagraph.h: make struct InsetTable public.
5286 * src/support/lyxstring.h: change lyxstring::difference_type to be
5287 ptrdiff_t. Add std:: modifiers to streams.
5289 * src/font.C: include the <cctype> header, for islower() and
5292 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5294 * src/font.[Ch]: new files. Contains the metric functions for
5295 fonts, takes a LyXFont as parameter. Better separation of concepts.
5297 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5298 changes because of this.
5300 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5302 * src/*: compile with -Winline and move functions that don't
5305 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5308 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5310 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5311 (various files changed because of this)
5313 * src/Painter.C (text): fixed the drawing of smallcaps.
5315 * src/lyxfont.[Ch] (drawText): removed unused member func.
5318 * src/*.C: added needed "using" statements and "std::" qualifiers.
5320 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5322 * src/*.h: removed all use of "using" from header files use
5323 qualifier std:: instead.
5325 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5327 * src/text.C (Backspace): some additional cleanups (we already
5328 know whether cursor.pos is 0 or not).
5330 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5331 automake does not provide one).
5333 * src/bmtable.h: replace C++ comments with C comments.
5335 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5337 * src/screen.C (ShowCursor): Change the shape of the cursor if
5338 the current language is not equal to the language of the document.
5339 (If the cursor change its shape unexpectedly, then you've found a bug)
5341 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5344 * src/insets/insetnumber.[Ch]: New files.
5346 * src/LyXAction.C (init)
5347 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5350 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5352 * src/lyxparagraph.h
5353 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5354 (the vector is kept sorted).
5356 * src/text.C (GetVisibleRow): Draw selection correctly when there
5357 is both LTR and RTL text.
5359 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5360 which is much faster.
5362 * src/text.C (GetVisibleRow and other): Do not draw the last space
5363 in a row if the direction of the last letter is not equal to the
5364 direction of the paragraph.
5366 * src/lyxfont.C (latexWriteStartChanges):
5367 Check that font language is not equal to basefont language.
5368 (latexWriteEndChanges): ditto
5370 * src/lyx_cb.C (StyleReset): Don't change the language while using
5371 the font-default command.
5373 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5374 empty paragraph before a footnote.
5376 * src/insets/insetcommand.C (draw): Increase x correctly.
5378 * src/screen.C (ShowCursor): Change cursor shape if
5379 current language != document language.
5381 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5383 2000-03-31 Juergen Vigna <jug@sad.it>
5385 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5386 (Clone): changed mode how the paragraph-data is copied to the
5387 new clone-paragraph.
5389 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5390 GetInset(pos) with no inset anymore there (in inset UNDO)
5392 * src/insets/insetcommand.C (draw): small fix as here x is
5393 incremented not as much as width() returns (2 before, 2 behind = 4)
5395 2000-03-30 Juergen Vigna <jug@sad.it>
5397 * src/insets/insettext.C (InsetText): small fix in initialize
5398 widthOffset (should not be done in the init() function)
5400 2000-03-29 Amir Karger <karger@lyx.org>
5402 * lib/examples/it_ItemizeBullets.lyx: translation by
5405 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5407 2000-03-29 Juergen Vigna <jug@sad.it>
5409 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5411 * src/insets/insetfoot.C (Clone): small change as for the below
5412 new init function in the text-inset
5414 * src/insets/insettext.C (init): new function as I've seen that
5415 clone did not copy the Paragraph-Data!
5416 (LocalDispatch): Added code so that now we have some sort of Undo
5417 functionality (well actually we HAVE Undo ;)
5419 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5421 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5423 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5426 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5428 * src/main.C: added a runtime check that verifies that the xforms
5429 header used when building LyX and the library used when running
5430 LyX match. Exit with a message if they don't match. This is a
5431 version number check only.
5433 * src/buffer.C (save): Don't allocate memory on the heap for
5434 struct utimbuf times.
5436 * *: some using changes, use iosfwd instead of the real headers.
5438 * src/lyxfont.C use char const * instead of string for the static
5439 strings. Rewrite some functions to use sstream.
5441 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5443 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5446 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5448 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5449 of Geodesy (from Martin Vermeer)
5451 * lib/layouts/svjour.inc: include file for the Springer svjour
5452 class. It can be used to support journals other than JoG.
5454 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5455 Miskiewicz <misiek@pld.org.pl>)
5456 * lib/reLyX/Makefile.am: ditto.
5458 2000-03-27 Juergen Vigna <jug@sad.it>
5460 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5461 also some modifications with operations on selected text.
5463 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5464 problems with clicking on insets (last famous words ;)
5466 * src/insets/insetcommand.C (draw):
5467 (width): Changed to have a bit of space before and after the inset so
5468 that the blinking cursor can be seen (otherwise it was hidden)
5470 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5472 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5473 would not be added to the link list when an installed gettext (not
5474 part of libc) is found.
5476 2000-03-24 Juergen Vigna <jug@sad.it>
5478 * src/insets/insetcollapsable.C (Edit):
5479 * src/mathed/formula.C (InsetButtonRelease):
5480 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5483 * src/BufferView.C (workAreaButtonPress):
5484 (workAreaButtonRelease):
5485 (checkInsetHit): Finally fixed the clicking on insets be handled
5488 * src/insets/insetert.C (Edit): inserted this call so that ERT
5489 insets work always with LaTeX-font
5491 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5493 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5494 caused lyx to startup with no GUI in place, causing in a crash
5495 upon startup when called with arguments.
5497 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5499 * src/FontLoader.C: better initialization of dummyXFontStruct.
5501 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5503 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5504 for linuxdoc and docbook import and export format options.
5506 * lib/lyxrc.example Example of default values for the previous flags.
5508 * src/lyx_cb.C Use those flags instead of the hardwired values for
5509 linuxdoc and docbook export.
5511 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5514 * src/menus.C Added menus entries for the new import/exports formats.
5516 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5518 * src/lyxrc.*: Added support for running without Gui
5521 * src/FontLoader.C: sensible defaults if no fonts are needed
5523 * src/lyx_cb.C: New function ShowMessage (writes either to the
5524 minibuffer or cout in case of no gui
5525 New function AskOverwrite for common stuff
5526 Consequently various changes to call these functions
5528 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5529 wild guess at sensible screen resolution when having no gui
5531 * src/lyxfont.C: no gui, no fonts... set some defaults
5533 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5535 * src/LColor.C: made the command inset background a bit lighter.
5537 2000-03-20 Hartmut Goebel <goebel@noris.net>
5539 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5540 stdstruct.inc. Koma-Script added some title elements which
5541 otherwise have been listed below "bibliography". This split allows
5542 adding title elements to where they belong.
5544 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5545 define the additional tilte elements and then include
5548 * many other layout files: changed to include stdtitle.inc just
5549 before stdstruct.inc.
5551 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5553 * src/buffer.C: (save) Added the option to store all backup files
5554 in a single directory
5556 * src/lyxrc.[Ch]: Added variable \backupdir_path
5558 * lib/lyxrc.example: Added descriptions of recently added variables
5560 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5561 bibtex inset, not closing the bibtex popup when deleting the inset)
5563 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5565 * src/lyx_cb.C: add a couple using directives.
5567 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5568 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5569 import based on the filename.
5571 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5572 file would be imported at start, if the filename where of a sgml file.
5574 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5576 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5578 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5579 * src/lyxfont.h Replaced the member variable bits.direction by the
5580 member variable lang. Made many changes in other files.
5581 This allows having a multi-lingual document
5583 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5584 that change the current language to <l>.
5585 Removed the command "font-rtl"
5587 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5588 format for Hebrew documents)
5590 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5591 When auto_mathmode is "true", pressing a digit key in normal mode
5592 will cause entering into mathmode.
5593 If auto_mathmode is "rtl" then this behavior will be active only
5594 when writing right-to-left text.
5596 * src/text2.C (InsertStringA) The string is inserted using the
5599 * src/paragraph.C (GetEndLabel) Gives a correct result for
5600 footnote paragraphs.
5602 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5604 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5606 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5607 front of PasteParagraph. Never insert a ' '. This should at least
5608 fix some cause for the segfaults that we have been experiencing,
5609 it also fixes backspace behaviour slightly. (Phu!)
5611 * src/support/lstrings.C (compare_no_case): some change to make it
5612 compile with gcc 2.95.2 and stdlibc++-v3
5614 * src/text2.C (MeltFootnoteEnvironment): change type o
5615 first_footnote_par_is_not_empty to bool.
5617 * src/lyxparagraph.h: make text private. Changes in other files
5619 (fitToSize): new function
5620 (setContentsFromPar): new function
5621 (clearContents): new function
5622 (SetChar): new function
5624 * src/paragraph.C (readSimpleWholeFile): deleted.
5626 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5627 the file, just use a simple string instead. Also read the file in
5628 a more maintainable manner.
5630 * src/text2.C (InsertStringA): deleted.
5631 (InsertStringB): deleted.
5633 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5635 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5636 RedoParagraphs from the doublespace handling part, just set status
5637 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5638 done, but perhaps not like this.)
5640 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5642 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5643 character when inserting an inset.
5645 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5647 * src/bufferparams.C (readLanguage): now takes "default" into
5650 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5651 also initialize the toplevel_keymap with the default bindings from
5654 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5656 * all files using lyxrc: have lyxrc as a real variable and not a
5657 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5660 * src/lyxrc.C: remove double call to defaultKeyBindings
5662 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5663 toolbar defauls using lyxlex. Remove enums, structs, functions
5666 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5667 toolbar defaults. Also store default keybindings in a map.
5669 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5670 storing the toolbar defaults without any xforms dependencies.
5672 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5673 applied. Changed to use iterators.
5675 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5677 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5678 systems that don't have LINGUAS set to begin with.
5680 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5682 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5683 the list by Dekel Tsur.
5685 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5687 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5688 * src/insets/form_graphics.C: ditto.
5690 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5692 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5694 * src/bufferparams.C (readLanguage): use the new language map
5696 * src/intl.C (InitKeyMapper): use the new language map
5698 * src/lyx_gui.C (create_forms): use the new language map
5700 * src/language.[Ch]: New files. Used for holding the information
5701 about each language. Now! Use this new language map enhance it and
5702 make it really usable for our needs.
5704 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5706 * screen.C (ShowCursor): Removed duplicate code.
5707 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5708 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5710 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5713 * src/text.C Added TransformChar method. Used for rendering Arabic
5714 text correctly (change the glyphs of the letter according to the
5715 position in the word)
5720 * src/lyxrc.C Added lyxrc command {language_command_begin,
5721 language_command_end,language_command_ltr,language_command_rtl,
5722 language_package} which allows the use of either arabtex or Omega
5725 * src/lyx_gui.C (init)
5727 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5728 to use encoding for menu fonts which is different than the encoding
5731 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5732 do not load the babel package.
5733 To write an English document with Hebrew/Arabic, change the document
5734 language to "english".
5736 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5737 (alphaCounter): changed to return char
5738 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5740 * lib/lyxrc.example Added examples for Hebrew/Arabic
5743 * src/layout.C Added layout command endlabeltype
5745 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5747 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5749 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5751 * src/mathed/math_delim.C (search_deco): return a
5752 math_deco_struct* instead of index.
5754 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5756 * All files with a USE_OSTREAM_ONLY within: removed all code that
5757 was unused when USE_OSTREAM_ONLY is defined.
5759 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5760 of any less. Removed header and using.
5762 * src/text.C (GetVisibleRow): draw the string "Page Break
5763 (top/bottom)" on screen when drawing a pagebreak line.
5765 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5767 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5769 * src/mathed/math_macro.C (draw): do some cast magic.
5772 * src/mathed/math_defs.h: change byte* argument to byte const*.
5774 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5776 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5777 know it is right to return InsetFoot* too, but cxx does not like
5780 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5782 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5784 * src/mathed/math_delim.C: change == to proper assignment.
5786 2000-03-09 Juergen Vigna <jug@sad.it>
5788 * src/insets/insettext.C (setPos): fixed various cursor positioning
5789 problems (via mouse and cursor-keys)
5790 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5791 inset (still a small display problem but it works ;)
5793 * src/insets/insetcollapsable.C (draw): added button_top_y and
5794 button_bottom_y to have correct values for clicking on the inset.
5796 * src/support/lyxalgo.h: commented out 'using std::less'
5798 2000-03-08 Juergen Vigna <jug@sad.it>
5800 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5801 Button-Release event closes as it is alos the Release-Event
5804 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5806 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5808 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5809 can add multiple spaces in Scrap (literate programming) styles...
5810 which, by the way, is how I got hooked on LyX to begin with.
5812 * src/mathed/formula.C (Write): Added dummy variable to an
5813 inset::Latex() call.
5814 (Latex): Add free_spacing boolean to inset::Latex()
5816 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5818 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5819 virtual function to include the free_spacing boolean from
5820 the containing paragraph's style.
5822 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5823 Added free_spacing boolean arg to match inset.h
5825 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5826 Added free_spacing boolean arg to match inset.h
5828 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5829 Added free_spacing boolean and made sure that if in a free_spacing
5830 paragraph, that we output normal space if there is a protected space.
5832 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5833 Added free_spacing boolean arg to match inset.h
5835 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5836 Added free_spacing boolean arg to match inset.h
5838 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5839 Added free_spacing boolean arg to match inset.h
5841 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5842 Added free_spacing boolean arg to match inset.h
5844 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5845 Added free_spacing boolean arg to match inset.h
5847 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5848 free_spacing boolean arg to match inset.h
5850 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5851 Added free_spacing boolean arg to match inset.h
5853 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5854 Added free_spacing boolean arg to match inset.h
5856 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5857 Added free_spacing boolean arg to match inset.h
5859 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5860 Added free_spacing boolean arg to match inset.h
5862 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5863 Added free_spacing boolean arg to match inset.h
5865 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5866 free_spacing boolean arg to match inset.h
5868 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5869 free_spacing boolean arg to match inset.h
5871 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5872 ignore free_spacing paragraphs. The user's spaces are left
5875 * src/text.C (InsertChar): Fixed the free_spacing layout
5876 attribute behavior. Now, if free_spacing is set, you can
5877 add multiple spaces in a paragraph with impunity (and they
5878 get output verbatim).
5879 (SelectSelectedWord): Added dummy argument to inset::Latex()
5882 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5885 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5886 paragraph layouts now only input a simple space instead.
5887 Special character insets don't make any sense in free-spacing
5890 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5891 hard-spaces in the *input* file to simple spaces if the layout
5892 is free-spacing. This converts old files which had to have
5893 hard-spaces in free-spacing layouts where a simple space was
5895 (writeFileAscii): Added free_spacing check to pass to the newly
5896 reworked inset::Latex(...) methods. The inset::Latex() code
5897 ensures that hard-spaces in free-spacing paragraphs get output
5898 as spaces (rather than "~").
5900 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5902 * src/mathed/math_delim.C (draw): draw the empty placeholder
5903 delims with a onoffdash line.
5904 (struct math_deco_compare): struct that holds the "functors" used
5905 for the sort and the binary search in math_deco_table.
5906 (class init_deco_table): class used for initial sort of the
5908 (search_deco): use lower_bound to do a binary search in the
5911 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5913 * src/lyxrc.C: a small secret thingie...
5915 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5916 and to not flush the stream as often as it used to.
5918 * src/support/lyxalgo.h: new file
5919 (sorted): template function used for checking if a sequence is
5920 sorted or not. Two versions with and without user supplied
5921 compare. Uses same compare as std::sort.
5923 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5924 it and give warning on lyxerr.
5926 (struct compare_tags): struct with function operators used for
5927 checking if sorted, sorting and lower_bound.
5928 (search_kw): use lower_bound instead of manually implemented
5931 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5933 * src/insets/insetcollapsable.h: fix Clone() declaration.
5934 * src/insets/insetfoot.h: ditto.
5936 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5938 2000-03-08 Juergen Vigna <jug@sad.it>
5940 * src/insets/lyxinset.h: added owner call which tells us if
5941 this inset is inside another inset. Changed also the return-type
5942 of Editable to an enum so it tells clearer what the return-value is.
5944 * src/insets/insettext.C (computeTextRows): fixed computing of
5945 textinsets which split automatically on more rows.
5947 * src/insets/insetert.[Ch]: changed this to be of BaseType
5950 * src/insets/insetfoot.[Ch]: added footnote inset
5952 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5953 collapsable insets (like footnote, ert, ...)
5955 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5957 * src/lyxdraw.h: remvoe file
5959 * src/lyxdraw.C: remove file
5961 * src/insets/insettext.C: added <algorithm>.
5963 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5965 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5966 (matrix_cb): case MM_OK use string stream
5968 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5971 * src/mathed/math_macro.C (draw): use string stream
5972 (Metrics): use string stream
5974 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5975 directly to the ostream.
5977 * src/vspace.C (asString): use string stream.
5978 (asString): use string stream
5979 (asLatexString): use string stream
5981 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5982 setting Spacing::Other.
5984 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5985 sprintf when creating the stretch vale.
5987 * src/text2.C (alphaCounter): changed to return a string and to
5988 not use a static variable internally. Also fixed a one-off bug.
5989 (SetCounter): changed the drawing of the labels to use string
5990 streams instead of sprintf.
5992 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5993 manipulator to use a scheme that does not require library support.
5994 This is also the way it is done in the new GNU libstdc++. Should
5995 work with DEC cxx now.
5997 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5999 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6000 end. This fixes a bug.
6002 * src/mathed (all files concerned with file writing): apply the
6003 USE_OSTREAM_ONLY changes to mathed too.
6005 * src/support/DebugStream.h: make the constructor explicit.
6007 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6008 count and ostream squashed.
6010 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6012 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6014 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6015 ostringstream uses STL strings, and we might not.
6017 * src/insets/insetspecialchar.C: add using directive.
6018 * src/insets/insettext.C: ditto.
6020 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6022 * lib/layouts/seminar.layout: feeble attempt at a layout for
6023 seminar.cls, far from completet and could really use some looking
6024 at from people used to write layout files.
6026 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6027 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6028 a lot nicer and works nicely with ostreams.
6030 * src/mathed/formula.C (draw): a slightly different solution that
6031 the one posted to the list, but I think this one works too. (font
6032 size wrong in headers.)
6034 * src/insets/insettext.C (computeTextRows): some fiddling on
6035 Jürgens turf, added some comments that he should read.
6037 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6038 used and it gave compiler warnings.
6039 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6042 * src/lyx_gui.C (create_forms): do the right thing when
6043 show_banner is true/false.
6045 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6046 show_banner is false.
6048 * most file writing files: Now use iostreams to do almost all of
6049 the writing. Also instead of passing string &, we now use
6050 stringstreams. mathed output is still not adapted to iostreams.
6051 This change can be turned off by commenting out all the occurences
6052 of the "#define USE_OSTREAM_ONLY 1" lines.
6054 * src/WorkArea.C (createPixmap): don't output debug messages.
6055 (WorkArea): don't output debug messages.
6057 * lib/lyxrc.example: added a comment about the new variable
6060 * development/Code_rules/Rules: Added some more commente about how
6061 to build class interfaces and on how better encapsulation can be
6064 2000-03-03 Juergen Vigna <jug@sad.it>
6066 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6067 automatically with the width of the LyX-Window
6069 * src/insets/insettext.C (computeTextRows): fixed update bug in
6070 displaying text-insets (scrollvalues where not initialized!)
6072 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6074 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6075 id in the check of the result from lower_bound is not enough since
6076 lower_bound can return last too, and then res->id will not be a
6079 * all insets and some code that use them: I have conditionalized
6080 removed the Latex(string & out, ...) this means that only the
6081 Latex(ostream &, ...) will be used. This is a work in progress to
6082 move towards using streams for all output of files.
6084 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6087 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6089 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6090 routine (this fixes bug where greek letters were surrounded by too
6093 * src/support/filetools.C (findtexfile): change a bit the search
6094 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6095 no longer passed to kpsewhich, we may have to change that later.
6097 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6098 warning options to avoid problems with X header files (from Angus
6100 * acinclude.m4: regenerated.
6102 2000-03-02 Juergen Vigna <jug@sad.it>
6104 * src/insets/insettext.C (WriteParagraphData): Using the
6105 par->writeFile() function for writing paragraph-data.
6106 (Read): Using buffer->parseSingleLyXformat2Token()-function
6107 for parsing paragraph data!
6109 * src/buffer.C (readLyXformat2): removed all parse data and using
6110 the new parseSingleLyXformat2Token()-function.
6111 (parseSingleLyXformat2Token): added this function to parse (read)
6112 lyx-file-format (this is called also from text-insets now!)
6114 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6116 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6119 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6120 directly instead of going through a func. One very bad thing: a
6121 static LyXFindReplace, but I don't know where to place it.
6123 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6124 string instead of char[]. Also changed to static.
6125 (GetSelectionOrWordAtCursor): changed to static inline
6126 (SetSelectionOverLenChars): ditto.
6128 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6129 current_view and global variables. both classes has changed names
6130 and LyXFindReplace is not inherited from SearchForm.
6132 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6133 fl_form_search form.
6135 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6137 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6139 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6140 bound (from Kayvan).
6142 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6144 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6146 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6148 * some things that I should comment but the local pub says head to
6151 * comment out all code that belongs to the Roff code for Ascii
6152 export of tables. (this is unused)
6154 * src/LyXView.C: use correct type for global variable
6155 current_layout. (LyXTextClass::size_type)
6157 * some code to get the new insetgraphics closer to working I'd be
6158 grateful for any help.
6160 * src/BufferView2.C (insertInset): use the return type of
6161 NumberOfLayout properly. (also changes in other files)
6163 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6164 this as a test. I want to know what breaks because of this.
6166 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6168 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6170 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6171 to use a \makebox in the label, this allows proper justification
6172 with out using protected spaces or multiple hfills. Now it is
6173 "label" for left justified, "\hfill label\hfill" for center, and
6174 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6175 should be changed accordingly.
6177 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6179 * src/lyxtext.h: change SetLayout() to take a
6180 LyXTextClass::size_type instead of a char (when there is more than
6181 127 layouts in a class); also change type of copylayouttype.
6182 * src/text2.C (SetLayout): ditto.
6183 * src/LyXView.C (updateLayoutChoice): ditto.
6185 * src/LaTeX.C (scanLogFile): errors where the line number was not
6186 given just after the '!'-line were ignored (from Dekel Tsur).
6188 * lib/lyxrc.example: fix description of \date_insert_format
6190 * lib/layouts/llncs.layout: new layout, contributed by Martin
6193 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6195 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6196 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6197 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6198 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6199 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6200 paragraph.C, text.C, text2.C)
6202 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6204 * src/insets/insettext.C (LocalDispatch): remove extra break
6207 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6208 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6210 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6211 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6213 * src/insets/insetbib.h: move InsetBibkey::Holder and
6214 InsetCitation::Holder in public space.
6216 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6218 * src/insets/insettext.h: small change to get the new files from
6219 Juergen to compile (use "string", not "class string").
6221 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6222 const & as parameter to LocalDispatch, use LyXFont const & as
6223 paramter to some other func. This also had impacto on lyxinsets.h
6224 and the two mathed insets.
6226 2000-02-24 Juergen Vigna <jug@sad.it>
6229 * src/commandtags.h:
6231 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6235 * src/BufferView2.C: added/updated code for various inset-functions
6237 * src/insets/insetert.[Ch]: added implementation of InsetERT
6239 * src/insets/insettext.[Ch]: added implementation of InsetText
6241 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6242 (draw): added preliminary code for inset scrolling not finshed yet
6244 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6245 as it is in lyxfunc.C now
6247 * src/insets/lyxinset.h: Added functions for text-insets
6249 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6251 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6252 BufferView and reimplement the list as a queue put inside its own
6255 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6257 * several files: use the new interface to the "updateinsetlist"
6259 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6261 (work_area_handler): call BufferView::trippleClick on trippleclick.
6263 * src/BufferView.C (doubleClick): new function, selects word on
6265 (trippleClick): new function, selects line on trippleclick.
6267 2000-02-22 Allan Rae <rae@lyx.org>
6269 * lib/bind/xemacs.bind: buffer-previous not supported
6271 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6273 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6276 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6278 * src/bufferlist.C: get rid of current_view from this file
6280 * src/spellchecker.C: get rid of current_view from this file
6282 * src/vspace.C: get rid of current_view from this file
6283 (inPixels): added BufferView parameter for this func
6284 (asLatexCommand): added a BufferParams for this func
6286 * src/text.C src/text2.C: get rid of current_view from these
6289 * src/lyxfont.C (getFontDirection): move this function here from
6292 * src/bufferparams.C (getDocumentDirection): move this function
6295 * src/paragraph.C (getParDirection): move this function here from
6297 (getLetterDirection): ditto
6299 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6301 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6302 resize due to wrong pixmap beeing used. Also took the opurtunity
6303 to make the LyXScreen stateless on regard to WorkArea and some
6304 general cleanup in the same files.
6306 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6308 * src/Makefile.am: add missing direction.h
6310 * src/PainterBase.h: made the width functions const.
6312 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6315 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6317 * src/insets/insetlatexaccent.C (draw): make the accents draw
6318 better, at present this will only work well with iso8859-1.
6320 * several files: remove the old drawing code, now we use the new
6323 * several files: remove support for mono_video, reverse_video and
6326 2000-02-17 Juergen Vigna <jug@sad.it>
6328 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6329 int ** as we have to return the pointer, otherwise we have only
6330 NULL pointers in the returning function.
6332 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6334 * src/LaTeX.C (operator()): quote file name when running latex.
6336 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6338 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6339 (bubble tip), this removes our special handling of this.
6341 * Remove all code that is unused now that we have the new
6342 workarea. (Code that are not active when NEW_WA is defined.)
6344 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6346 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6348 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6349 nonexisting layout; correctly redirect obsoleted layouts.
6351 * lib/lyxrc.example: document \view_dvi_paper_option
6353 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6356 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6357 (PreviewDVI): handle the view_dvi_paper_option variable.
6358 [Both from Roland Krause]
6360 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6362 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6363 char const *, int, LyXFont)
6364 (text(int, int, string, LyXFont)): ditto
6366 * src/text.C (InsertCharInTable): attempt to fix the double-space
6367 feature in tables too.
6368 (BackspaceInTable): ditto.
6369 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6371 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6373 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6375 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6376 newly found text in textcache to this.
6377 (buffer): set the owner of the text put into the textcache to 0
6379 * src/insets/figinset.C (draw): fixed the drawing of figures with
6382 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6383 drawing of mathframe, hfills, protected space, table lines. I have
6384 now no outstanding drawing problems with the new Painter code.
6386 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6388 * src/PainterBase.C (ellipse, circle): do not specify the default
6391 * src/LColor.h: add using directive.
6393 * src/Painter.[Ch]: change return type of methods from Painter& to
6394 PainterBase&. Add a using directive.
6396 * src/WorkArea.C: wrap xforms callbacks in C functions
6399 * lib/layouts/foils.layout: font fix and simplifications from Carl
6402 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6404 * a lot of files: The Painter, LColor and WorkArea from the old
6405 devel branch has been ported to lyx-devel. Some new files and a
6406 lot of #ifdeffed code. The new workarea is enabled by default, but
6407 if you want to test the new Painter and LColor you have to compile
6408 with USE_PAINTER defined (do this in config.h f.ex.) There are
6409 still some rought edges, and I'd like some help to clear those
6410 out. It looks stable (loads and displays the Userguide very well).
6413 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6415 * src/buffer.C (pop_tag): revert to the previous implementation
6416 (use a global variable for both loops).
6418 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6420 * src/lyxrc.C (LyXRC): change slightly default date format.
6422 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6423 there is an English text with a footnote that starts with a Hebrew
6424 paragraph, or vice versa.
6425 (TeXFootnote): ditto.
6427 * src/text.C (LeftMargin): allow for negative values for
6428 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6431 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6432 for input encoding (cyrillic)
6434 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6436 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6439 * src/toolbar.C (set): ditto
6440 * src/insets/insetbib.C (create_form_citation_form): ditto
6442 * lib/CREDITS: added Dekel Tsur.
6444 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6445 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6446 hebrew supports files from Dekel Tsur.
6448 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6449 <tzafrir@technion.ac.il>
6451 * src/lyxrc.C: put \date_insert_format at the right place.
6453 * src/buffer.C (makeLaTeXFile): fix the handling of
6454 BufferParams::sides when writing out latex files.
6456 * src/BufferView2.C: add a "using" directive.
6458 * src/support/lyxsum.C (sum): when we use lyxstring,
6459 ostringstream::str needs an additional .c_str().
6461 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6463 * src/support/filetools.C (ChangeExtension): patch from Etienne
6466 * src/TextCache.C (show): remove const_cast and make second
6467 parameter non-const LyXText *.
6469 * src/TextCache.h: use non const LyXText in show.
6471 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6474 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6476 * src/support/lyxsum.C: rework to be more flexible.
6478 * several places: don't check if a pointer is 0 if you are going
6481 * src/text.C: remove some dead code.
6483 * src/insets/figinset.C: remove some dead code
6485 * src/buffer.C: move the BufferView funcs to BufferView2.C
6486 remove all support for insetlatexdel
6487 remove support for oldpapersize stuff
6488 made some member funcs const
6490 * src/kbmap.C: use a std::list to store the bindings in.
6492 * src/BufferView2.C: new file
6494 * src/kbsequence.[Ch]: new files
6496 * src/LyXAction.C + others: remove all trace of buffer-previous
6498 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6499 only have one copy in the binary of this table.
6501 * hebrew patch: moved some functions from LyXText to more
6502 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6504 * several files: remove support for XForms older than 0.88
6506 remove some #if 0 #endif code
6508 * src/TextCache.[Ch]: new file. Holds the textcache.
6510 * src/BufferView.C: changes to use the new TextCache interface.
6511 (waitForX): remove the now unused code.
6513 * src/BackStack.h: remove some commented code
6515 * lib/bind/emacs.bind: remove binding for buffer-previous
6517 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6519 * applied the hebrew patch.
6521 * src/lyxrow.h: make sure that all Row variables are initialized.
6523 * src/text2.C (TextHandleUndo): comment out a delete, this might
6524 introduce a memory leak, but should also help us to not try to
6525 read freed memory. We need to look at this one.
6527 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6528 (LyXParagraph): initalize footnotekind.
6530 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6531 forgot this when applying the patch. Please heed the warnings.
6533 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6534 (aka. reformat problem)
6536 * src/bufferlist.C (exists): made const, and use const_iterator
6537 (isLoaded): new func.
6538 (release): use std::find to find the correct buffer.
6540 * src/bufferlist.h: made getState a const func.
6541 made empty a const func.
6542 made exists a const func.
6545 2000-02-01 Juergen Vigna <jug@sad.it>
6547 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6549 * po/it.po: updated a bit the italian po file and also changed the
6550 'file nuovo' for newfile to 'filenuovo' without a space, this did
6553 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6554 for the new insert_date command.
6556 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6557 from jdblair, to insert a date into the current text conforming to
6558 a strftime format (for now only considering the locale-set and not
6559 the document-language).
6561 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6563 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6564 Bounds Read error seen by purify. The problem was that islower is
6565 a macros which takes an unsigned char and uses it as an index for
6566 in array of characters properties (and is thus subject to the
6570 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6571 correctly the paper sides radio buttons.
6572 (UpdateDocumentButtons): ditto.
6574 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6576 * src/kbmap.C (getsym + others): change to return unsigned int,
6577 returning a long can give problems on 64 bit systems. (I assume
6578 that int is 32bit on 64bit systems)
6580 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6582 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6583 LyXLookupString to be zero-terminated. Really fixes problems seen
6586 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6588 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6589 write a (char*)0 to the lyxerr stream.
6591 * src/lastfiles.C: move algorithm before the using statemets.
6593 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6595 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6596 complains otherwise).
6597 * src/table.C: ditto
6599 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6602 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6603 that I removed earlier... It is really needed.
6605 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6607 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6609 * INSTALL: update xforms home page URL.
6611 * lib/configure.m4: fix a bug with unreadable layout files.
6613 * src/table.C (calculate_width_of_column): add "using std::max"
6616 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6618 * several files: marked several lines with "DEL LINE", this is
6619 lines that can be deleted without changing anything.
6620 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6621 checks this anyway */
6624 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6626 * src/DepTable.C (update): add a "+" at the end when the checksum
6627 is different. (debugging string only)
6629 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6630 the next inset to not be displayed. This should also fix the list
6631 of labels in the "Insert Crossreference" dialog.
6633 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6635 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6636 when regex was not found.
6638 * src/support/lstrings.C (lowercase): use handcoded transform always.
6641 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6642 old_cursor.par->prev could be 0.
6644 * several files: changed post inc/dec to pre inc/dec
6646 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6647 write the lastfiles to file.
6649 * src/BufferView.C (buffer): only show TextCache info when debugging
6651 (resizeCurrentBuffer): ditto
6652 (workAreaExpose): ditto
6654 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6656 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6658 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6659 a bit better by removing the special case for \i and \j.
6661 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6663 * src/lyx_main.C (easyParse): remove test for bad comand line
6664 options, since this broke all xforms-related parsing.
6666 * src/kbmap.C (getsym): set return type to unsigned long, as
6667 declared in header. On an alpha, long is _not_ the same as int.
6669 * src/support/LOstream.h: add a "using std::flush;"
6671 * src/insets/figinset.C: ditto.
6673 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6675 * src/bufferlist.C (write): use blinding fast file copy instead of
6676 "a char at a time", now we are doing it the C++ way.
6678 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6679 std::list<int> instead.
6680 (addpidwait): reflect move to std::list<int>
6681 (sigchldchecker): ditto
6683 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6686 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6687 that obviously was wrong...
6689 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6690 c, this avoids warnings with purify and islower.
6692 * src/insets/figinset.C: rename struct queue to struct
6693 queue_element and rewrite to use a std::queue. gsqueue is now a
6694 std::queue<queue_element>
6695 (runqueue): reflect move to std::queue
6698 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6699 we would get "1" "0" instead of "true" "false. Also make the tostr
6702 2000-01-21 Juergen Vigna <jug@sad.it>
6704 * src/buffer.C (writeFileAscii): Disabled code for special groff
6705 handling of tabulars till I fix this in table.C
6707 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6709 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6711 * src/support/lyxlib.h: ditto.
6713 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6715 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6716 and 'j' look better. This might fix the "macron" bug that has been
6719 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6720 functions as one template function. Delete the old versions.
6722 * src/support/lyxsum.C: move using std::ifstream inside
6725 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6728 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6730 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6732 * src/insets/figinset.C (InitFigures): use new instead of malloc
6733 to allocate memory for figures and bitmaps.
6734 (DoneFigures): use delete[] instead of free to deallocate memory
6735 for figures and bitmaps.
6736 (runqueue): use new to allocate
6737 (getfigdata): use new/delete[] instead of malloc/free
6738 (RegisterFigure): ditto
6740 * some files: moved some declarations closer to first use, small
6741 whitespace changes use preincrement instead of postincrement where
6742 it does not make a difference.
6744 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6745 step on the way to use stl::containers for key maps.
6747 * src/bufferlist.h: add a typedef for const_iterator and const
6748 versions of begin and end.
6750 * src/bufferlist.[Ch]: change name of member variable _state to
6751 state_. (avoid reserved names)
6753 (getFileNames): returns the filenames of the buffers in a vector.
6755 * configure.in (ALL_LINGUAS): added ro
6757 * src/support/putenv.C: new file
6759 * src/support/mkdir.C: new file
6761 2000-01-20 Allan Rae <rae@lyx.org>
6763 * lib/layouts/IEEEtran.layout: Added several theorem environments
6765 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6766 couple of minor additions.
6768 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6769 (except for those in footnotes of course)
6771 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6773 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6775 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6776 std::sort and std::lower_bound instead of qsort and handwritten
6778 (struct compara): struct that holds the functors used by std::sort
6779 and std::lower_bound in MathedLookupBOP.
6781 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6783 * src/support/LAssert.h: do not do partial specialization. We do
6786 * src/support/lyxlib.h: note that lyx::getUserName() and
6787 lyx::date() are not in use right now. Should these be suppressed?
6789 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6790 (makeLinuxDocFile): do not put date and user name in linuxdoc
6793 * src/support/lyxlib.h (kill): change first argument to long int,
6794 since that's what solaris uses.
6796 * src/support/kill.C (kill): fix declaration to match prototype.
6798 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6799 actually check whether namespaces are supported. This is not what
6802 * src/support/lyxsum.C: add a using directive.
6804 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6806 * src/support/kill.C: if we have namespace support we don't have
6807 to include lyxlib.h.
6809 * src/support/lyxlib.h: use namespace lyx if supported.
6811 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6813 * src/support/date.C: new file
6815 * src/support/chdir.C: new file
6817 * src/support/getUserName.C: new file
6819 * src/support/getcwd.C: new file
6821 * src/support/abort.C: new file
6823 * src/support/kill.C: new file
6825 * src/support/lyxlib.h: moved all the functions in this file
6826 insede struct lyx. Added also kill and abort to this struct. This
6827 is a way to avoid the "kill is not defined in <csignal>", we make
6828 C++ wrappers for functions that are not ANSI C or ANSI C++.
6830 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6831 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6832 lyx it has been renamed to sum.
6834 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6836 * src/text.C: add using directives for std::min and std::max.
6838 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6840 * src/texrow.C (getIdFromRow): actually return something useful in
6841 id and pos. Hopefully fixes the bug with positionning of errorbox
6844 * src/lyx_main.C (easyParse): output an error and exit if an
6845 incorrect command line option has been given.
6847 * src/spellchecker.C (ispell_check_word): document a memory leak.
6849 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6850 where a "struct utimbuf" is allocated with "new" and deleted with
6853 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6855 * src/text2.C (CutSelection): don't delete double spaces.
6856 (PasteSelection): ditto
6857 (CopySelection): ditto
6859 * src/text.C (Backspace): don't delete double spaces.
6861 * src/lyxlex.C (next): fix a bug that were only present with
6862 conformant std::istream::get to read comment lines, use
6863 std::istream::getline instead. This seems to fix the problem.
6865 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6867 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6868 allowed to insert space before space" editing problem. Please read
6869 commends at the beginning of the function. Comments about usage
6872 * src/text.C (InsertChar): fix for the "not allowed to insert
6873 space before space" editing problem.
6875 * src/text2.C (DeleteEmptyParagraphMechanism): when
6876 IsEmptyTableRow can only return false this last "else if" will
6877 always be a no-op. Commented out.
6879 * src/text.C (RedoParagraph): As far as I can understand tmp
6880 cursor is not really needed.
6882 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6883 present it could only return false anyway.
6884 (several functions): Did something not so smart...added a const
6885 specifier on a lot of methods.
6887 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6888 and add a tmp->text.resize. The LyXParagraph constructor does the
6890 (BreakParagraphConservative): ditto
6892 * src/support/path.h (Path): add a define so that the wrong usage
6893 "Path("/tmp") will be flagged as a compilation error:
6894 "`unnamed_Path' undeclared (first use this function)"
6896 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6898 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6899 which was bogus for several reasons.
6901 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6905 * autogen.sh: do not use "type -path" (what's that anyway?).
6907 * src/support/filetools.C (findtexfile): remove extraneous space
6908 which caused a kpsewhich warning (at least with kpathsea version
6911 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6913 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6915 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6917 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6919 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6921 * src/paragraph.C (BreakParagraph): do not reserve space on text
6922 if we don't need to (otherwise, if pos_end < pos, we end up
6923 reserving huge amounts of memory due to bad unsigned karma).
6924 (BreakParagraphConservative): ditto, although I have not seen
6925 evidence the bug can happen here.
6927 * src/lyxparagraph.h: add a using std::list.
6929 2000-01-11 Juergen Vigna <jug@sad.it>
6931 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6934 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6936 * src/vc-backend.C (doVCCommand): change to be static and take one
6937 more parameter: the path to chdir too be fore executing the command.
6938 (retrive): new function equiv to "co -r"
6940 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6941 file_not_found_hook is true.
6943 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6945 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6946 if a file is readwrite,readonly...anything else.
6948 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6950 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6951 (CreatePostscript): name change from MenuRunDVIPS (or something)
6952 (PreviewPostscript): name change from MenuPreviewPS
6953 (PreviewDVI): name change from MenuPreviewDVI
6955 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6956 \view_pdf_command., \pdf_to_ps_command
6958 * lib/configure.m4: added search for PDF viewer, and search for
6959 PDF to PS converter.
6960 (lyxrc.defaults output): add \pdflatex_command,
6961 \view_pdf_command and \pdf_to_ps_command.
6963 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6965 * src/bufferlist.C (write): we don't use blocksize for anything so
6968 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6970 * src/support/block.h: disable operator T* (), since it causes
6971 problems with both compilers I tried. See comments in the file.
6973 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6976 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6977 variable LYX_DIR_10x to LYX_DIR_11x.
6979 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6981 * INSTALL: document --with-lyxname.
6984 * configure.in: new configure flag --with-lyxname which allows to
6985 choose the name under which lyx is installed. Default is "lyx", of
6986 course. It used to be possible to do this with --program-suffix,
6987 but the later has in fact a different meaning for autoconf.
6989 * src/support/lstrings.h (lstrchr): reformat a bit.
6991 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6992 * src/mathed/math_defs.h: ditto.
6994 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6996 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6997 true, decides if we create a backup file or not when saving. New
6998 tag and variable \pdf_mode, defaults to false. New tag and
6999 variable \pdflatex_command, defaults to pdflatex. New tag and
7000 variable \view_pdf_command, defaults to xpdf. New tag and variable
7001 \pdf_to_ps_command, defaults to pdf2ps.
7003 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7005 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7006 does not have a BufferView.
7007 (unlockInset): ditto + don't access the_locking_inset if the
7008 buffer does not have a BufferView.
7010 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7011 certain circumstances so that we don't continue a keyboard
7012 operation long after the key was released. Try f.ex. to load a
7013 large document, press PageDown for some seconds and then release
7014 it. Before this change the document would contine to scroll for
7015 some time, with this change it stops imidiatly.
7017 * src/support/block.h: don't allocate more space than needed. As
7018 long as we don't try to write to the arr[x] in a array_type arr[x]
7019 it is perfectly ok. (if you write to it you might segfault).
7020 added operator value_type*() so that is possible to pass the array
7021 to functions expecting a C-pointer.
7023 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7026 * intl/*: updated to gettext 0.10.35, tried to add our own
7027 required modifications. Please verify.
7029 * po/*: updated to gettext 0.10.35, tried to add our own required
7030 modifications. Please verify.
7032 * src/support/lstrings.C (tostr): go at fixing the problem with
7033 cxx and stringstream. When stringstream is used return
7034 oss.str().c_str() so that problems with lyxstring and basic_string
7035 are avoided. Note that the best solution would be for cxx to use
7036 basic_string all the way, but it is not conformant yet. (it seems)
7038 * src/lyx_cb.C + other files: moved several global functions to
7039 class BufferView, some have been moved to BufferView.[Ch] others
7040 are still located in lyx_cb.C. Code changes because of this. (part
7041 of "get rid of current_view project".)
7043 * src/buffer.C + other files: moved several Buffer functions to
7044 class BufferView, the functions are still present in buffer.C.
7045 Code changes because of this.
7047 * config/lcmessage.m4: updated to most recent. used when creating
7050 * config/progtest.m4: updated to most recent. used when creating
7053 * config/gettext.m4: updated to most recent. applied patch for
7056 * config/gettext.m4.patch: new file that shows what changes we
7057 have done to the local copy of gettext.m4.
7059 * config/libtool.m4: new file, used in creation of acinclude.m4
7061 * config/lyxinclude.m4: new file, this is the lyx created m4
7062 macros, used in making acinclude.m4.
7064 * autogen.sh: GNU m4 discovered as a separate task not as part of
7065 the lib/configure creation.
7066 Generate acinlucde from files in config. Actually cat
7067 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7068 easier to upgrade .m4 files that really are external.
7070 * src/Spacing.h: moved using std::istringstream to right after
7071 <sstream>. This should fix the problem seen with some compilers.
7073 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7075 * src/lyx_cb.C: began some work to remove the dependency a lot of
7076 functions have on BufferView::text, even if not really needed.
7077 (GetCurrentTextClass): removed this func, it only hid the
7080 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7081 forgot this in last commit.
7083 * src/Bullet.C (bulletEntry): use static char const *[] for the
7084 tables, becuase of this the return arg had to change to string.
7086 (~Bullet): removed unneeded destructor
7088 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7089 (insetSleep): moved from Buffer
7090 (insetWakeup): moved from Buffer
7091 (insetUnlock): moved from Buffer
7093 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7094 from Buffer to BufferView.
7096 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7098 * config/ltmain.sh: updated to version 1.3.4 of libtool
7100 * config/ltconfig: updated to version 1.3.4 of libtool
7102 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7105 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7106 Did I get that right?
7108 * src/lyxlex.h: add a "using" directive or two.
7109 * src/Spacing.h: ditto.
7110 * src/insets/figinset.C: ditto.
7111 * src/support/filetools.C: ditto.
7112 * src/support/lstrings.C: ditto.
7113 * src/BufferView.C: ditto.
7114 * src/bufferlist.C: ditto.
7115 * src/lyx_cb.C: ditto.
7116 * src/lyxlex.C: ditto.
7118 * NEWS: add some changes for 1.1.4.
7120 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7122 * src/BufferView.C: first go at a TextCache to speed up switching
7125 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7127 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7128 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7129 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7130 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7133 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7134 members of the struct are correctly initialized to 0 (detected by
7136 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7137 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7139 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7140 pidwait, since it was allocated with "new". This was potentially
7141 very bad. Thanks to Michael Schmitt for running purify for us.
7144 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7146 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7148 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7150 1999-12-30 Allan Rae <rae@lyx.org>
7152 * lib/templates/IEEEtran.lyx: minor change
7154 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7155 src/mathed/formula.C (LocalDispatch): askForText changes
7157 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7158 know when a user has cancelled input. Fixes annoying problems with
7159 inserting labels and version control.
7161 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7163 * src/support/lstrings.C (tostr): rewritten to use strstream and
7166 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7168 * src/support/filetools.C (IsFileWriteable): use fstream to check
7169 (IsDirWriteable): use fileinfo to check
7171 * src/support/filetools.h (FilePtr): whole class deleted
7173 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7175 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7177 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7179 * src/bufferlist.C (write): use ifstream and ofstream instead of
7182 * src/Spacing.h: use istrstream instead of sscanf
7184 * src/mathed/math_defs.h: change first arg to istream from FILE*
7186 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7188 * src/mathed/math_parser.C: have yyis to be an istream
7189 (LexGetArg): use istream (yyis)
7191 (mathed_parse): ditto
7192 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7194 * src/mathed/formula.C (Read): rewritten to use istream
7196 * src/mathed/formulamacro.C (Read): rewritten to use istream
7198 * src/lyxlex.h (~LyXLex): deleted desturctor
7199 (getStream): new function, returns an istream
7200 (getFile): deleted funtion
7201 (IsOK): return is.good();
7203 * src/lyxlex.C (LyXLex): delete file and owns_file
7204 (setFile): open an filebuf and assign that to a istream instead of
7206 (setStream): new function, takes an istream as arg.
7207 (setFile): deleted function
7208 (EatLine): rewritten us use istream instead of FILE*
7212 * src/table.C (LyXTable): use istream instead of FILE*
7213 (Read): rewritten to take an istream instead of FILE*
7215 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7217 * src/buffer.C (Dispatch): remove an extraneous break statement.
7219 * src/support/filetools.C (QuoteName): change to do simple
7220 'quoting'. More work is necessary. Also changed to do nothing
7221 under emx (needs fix too).
7222 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7224 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7225 config.h.in to the AC_DEFINE_UNQUOTED() call.
7226 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7227 needs char * as argument (because Solaris 7 declares it like
7230 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7231 remove definition of BZERO.
7233 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7235 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7236 defined, "lyxregex.h" if not.
7238 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7240 (REGEX): new variable that is set to regex.c lyxregex.h when
7241 AM_CONDITIONAL USE_REGEX is set.
7242 (libsupport_la_SOURCES): add $(REGEX)
7244 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7247 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7250 * configure.in: add call to LYX_REGEX
7252 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7253 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7255 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7257 * lib/bind/fi_menus.bind: new file, from
7258 pauli.virtanen@saunalahti.fi.
7260 * src/buffer.C (getBibkeyList): pass the parameter delim to
7261 InsetInclude::getKeys and InsetBibtex::getKeys.
7263 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7264 is passed to Buffer::getBibkeyList
7266 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7267 instead of the hardcoded comma.
7269 * src/insets/insetbib.C (getKeys): make sure that there are not
7270 leading blanks in bibtex keys. Normal latex does not care, but
7271 harvard.sty seems to dislike blanks at the beginning of citation
7272 keys. In particular, the retturn value of the function is
7274 * INSTALL: make it clear that libstdc++ is needed and that gcc
7275 2.7.x probably does not work.
7277 * src/support/filetools.C (findtexfile): make debug message go to
7279 * src/insets/insetbib.C (getKeys): ditto
7281 * src/debug.C (showTags): make sure that the output is correctly
7284 * configure.in: add a comment for TWO_COLOR_ICON define.
7286 * acconfig.h: remove all the entries that already defined in
7287 configure.in or acinclude.m4.
7289 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7290 to avoid user name, date and copyright.
7292 1999-12-21 Juergen Vigna <jug@sad.it>
7294 * src/table.C (Read): Now read bogus row format informations
7295 if the format is < 5 so that afterwards the table can
7296 be read by lyx but without any format-info. Fixed the
7297 crash we experienced when not doing this.
7299 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7301 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7302 (RedoDrawingOfParagraph): ditto
7303 (RedoParagraphs): ditto
7304 (RemoveTableRow): ditto
7306 * src/text.C (Fill): rename arg paperwidth -> paper_width
7308 * src/buffer.C (insertLyXFile): rename var filename -> fname
7309 (writeFile): rename arg filename -> fname
7310 (writeFileAscii): ditto
7311 (makeLaTeXFile): ditto
7312 (makeLinuxDocFile): ditto
7313 (makeDocBookFile): ditto
7315 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7318 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7320 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7323 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7324 compiled by a C compiler not C++.
7326 * src/layout.h (LyXTextClass): added typedef for const_iterator
7327 (LyXTextClassList): added typedef for const_iterator + member
7328 functions begin and end.
7330 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7331 iterators to fill the choice_class.
7332 (updateLayoutChoice): rewritten to use iterators to fill the
7333 layoutlist in the toolbar.
7335 * src/BufferView.h (BufferView::work_area_width): removed unused
7338 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7340 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7341 (sgmlCloseTag): ditto
7343 * src/support/lstrings.h: return type of countChar changed to
7346 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7347 what version of this func to use. Also made to return unsigned int.
7349 * configure.in: call LYX_STD_COUNT
7351 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7352 conforming std::count.
7354 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7356 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7357 and a subscript would give bad display (patch from Dekel Tsur
7358 <dekel@math.tau.ac.il>).
7360 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7362 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7365 * src/chset.h: add a few 'using' directives
7367 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7368 triggered when no buffer is active
7370 * src/layout.C: removed `break' after `return' in switch(), since
7373 * src/lyx_main.C (init): make sure LyX can be ran in place even
7374 when libtool has done its magic with shared libraries. Fix the
7375 test for the case when the system directory has not been found.
7377 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7378 name for the latex file.
7379 (MenuMakeHTML): ditto
7381 * src/buffer.h: add an optional boolean argument, which is passed
7384 1999-12-20 Allan Rae <rae@lyx.org>
7386 * lib/templates/IEEEtran.lyx: small correction and update.
7388 * configure.in: Attempted to use LYX_PATH_HEADER
7390 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7392 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7393 input from JMarc. Now use preprocessor to find the header.
7394 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7395 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7396 LYX_STL_STRING_FWD. See comments in file.
7398 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7400 * The global MiniBuffer * minibuffer variable is dead.
7402 * The global FD_form_main * fd_form_main variable is dead.
7404 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7406 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7408 * src/table.h: add the LOstream.h header
7409 * src/debug.h: ditto
7411 * src/LyXAction.h: change the explaination of the ReadOnly
7412 attribute: is indicates that the function _can_ be used.
7414 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7417 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7419 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7425 * src/paragraph.C (GetWord): assert on pos>=0
7428 * src/support/lyxstring.C: condition the use of an invariant on
7430 * src/support/lyxstring.h: ditto
7432 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7433 Use LAssert.h instead of plain assert().
7435 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7437 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7438 * src/support/filetools.C: ditto
7440 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7443 * INSTALL: document the new configure flags
7445 * configure.in: suppress --with-debug; add --enable-assertions
7447 * acinclude.m4: various changes in alignment of help strings.
7449 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7451 * src/kbmap.C: commented out the use of the hash map in kb_map,
7452 beginning of movement to a stl::container.
7454 * several files: removed code that was not in effect when
7455 MOVE_TEXT was defined.
7457 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7458 for escaping should not be used. We can discuss if the string
7459 should be enclosed in f.ex. [] instead of "".
7461 * src/trans_mgr.C (insert): use the new returned value from
7462 encodeString to get deadkeys and keymaps done correctly.
7464 * src/chset.C (encodeString): changed to return a pair, to tell
7465 what to use if we know the string.
7467 * src/lyxscreen.h (fillArc): new function.
7469 * src/FontInfo.C (resize): rewritten to use more std::string like
7470 structore, especially string::replace.
7472 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7475 * configure.in (chmod +x some scripts): remove config/gcc-hack
7477 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7479 * src/buffer.C (writeFile): change once again the top comment in a
7480 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7481 instead of an hardcoded version number.
7482 (makeDocBookFile): ditto
7484 * src/version.h: add new define LYX_DOCVERSION
7486 * po/de.po: update from Pit Sütterlin
7487 * lib/bind/de_menus.bind: ditto.
7489 * src/lyxfunc.C (Dispatch): call MenuExport()
7490 * src/buffer.C (Dispatch): ditto
7492 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7493 LyXFunc::Dispatch().
7494 (MenuExport): new function, moved from
7495 LyXFunc::Dispatch().
7497 * src/trans_mgr.C (insert): small cleanup
7498 * src/chset.C (loadFile): ditto
7500 * lib/kbd/iso8859-1.cdef: add missing backslashes
7502 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7504 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7505 help with placing the manually drawn accents better.
7507 (Draw): x2 and hg changed to float to minimize rounding errors and
7508 help place the accents better.
7510 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7511 unsigned short to char is just wrong...cast the char to unsigned
7512 char instead so that the two values can compare sanely. This
7513 should also make the display of insetlatexaccents better and
7514 perhaps also some other insets.
7516 (lbearing): new function
7519 1999-12-15 Allan Rae <rae@lyx.org>
7521 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7522 header that provides a wrapper around the very annoying SGI STL header
7525 * src/support/lyxstring.C, src/LString.h:
7526 removed old SGI-STL-compatability attempts.
7528 * configure.in: Use LYX_STL_STRING_FWD.
7530 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7531 stl_string_fwd.h is around and try to determine it's location.
7532 Major improvement over previous SGI STL 3.2 compatability.
7533 Three small problems remain with this function due to my zero
7534 knowledge of autoconf. JMarc and lgb see the comments in the code.
7536 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7538 * src/broken_const.h, config/hack-gcc, config/README: removed
7540 * configure.in: remove --with-gcc-hack option; do not call
7543 * INSTALL: remove documentation of --with-broken-const and
7546 * acconfig.h: remove all trace of BROKEN_CONST define
7548 * src/buffer.C (makeDocBookFile): update version number in output
7550 (SimpleDocBookOnePar): fix an assert when trying to a character
7551 access beyond string length
7554 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7556 * po/de.po: fix the Export menu
7558 * lyx.man: update the description of -dbg
7560 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7561 (commandLineHelp): updated
7562 (easyParse): show list of available debug levels if -dbg is passed
7565 * src/Makefile.am: add debug.C
7567 * src/debug.h: moved some code to debug.C
7569 * src/debug.C: new file. Contains code to set and show debug
7572 * src/layout.C: remove 'break' after 'continue' in switch
7573 statements, since these cannot be reached.
7575 1999-12-13 Allan Rae <rae@lyx.org>
7577 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7578 (in_word_set): hash() -> math_hash()
7580 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7582 * acconfig.h: Added a test for whether we are using exceptions in the
7583 current compilation run. If so USING_EXCEPTIONS is defined.
7585 * config.in: Check for existance of stl_string_fwd.h
7586 * src/LString.h: If compiling --with-included-string and SGI's
7587 STL version 3.2 is present (see above test) we need to block their
7588 forward declaration of string and supply a __get_c_string().
7589 However, it turns out this is only necessary if compiling with
7590 exceptions enabled so I've a bit more to add yet.
7592 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7593 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7594 src/support/LRegex.h, src/undo.h:
7595 Shuffle the order of the included files a little to ensure that
7596 LString.h gets included before anything that includes stl_string_fwd.h
7598 * src/support/lyxstring.C: We need to #include LString.h instead of
7599 lyxstring.h to get the necessary definition of __get_c_string.
7600 (__get_c_string): New function. This is defined static just like SGI's
7601 although why they need to do this I'm not sure. Perhaps it should be
7602 in lstrings.C instead.
7604 * lib/templates/IEEEtran.lyx: New template file.
7606 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7608 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7609 * intl/Makefile.in (MKINSTALLDIRS): ditto
7611 * src/LyXAction.C (init): changed to hold the LFUN data in a
7612 automatic array in stead of in callso to newFunc, this speeds up
7613 compilation a lot. Also all the memory used by the array is
7614 returned when the init is completed.
7616 * a lot of files: compiled with -Wold-style-cast, changed most of
7617 the reported offenders to C++ style casts. Did not change the
7618 offenders in C files.
7620 * src/trans.h (Match): change argument type to unsigned int.
7622 * src/support/DebugStream.C: fix some types on the streambufs so
7623 that it works on a conforming implementation.
7625 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7627 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7629 * src/support/lyxstring.C: remove the inline added earlier since
7630 they cause a bunch of unsatisfied symbols when linking with dec
7631 cxx. Cxx likes to have the body of inlines at the place where they
7634 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7635 accessing negative bounds in array. This fixes the crash when
7636 inserting accented characters.
7637 * src/trans.h (Match): ditto
7639 * src/buffer.C (Dispatch): since this is a void, it should not try
7640 to return anything...
7642 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7644 * src/buffer.h: removed the two friends from Buffer. Some changes
7645 because of this. Buffer::getFileName and Buffer::setFileName
7646 renamed to Buffer::fileName() and Buffer::fileName(...).
7648 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7650 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7651 and Buffer::update(short) to BufferView. This move is currently
7652 controlled by a define MOVE_TEXT, this will be removed when all
7653 shows to be ok. This move paves the way for better separation
7654 between buffer contents and buffer view. One side effect is that
7655 the BufferView needs a rebreak when swiching buffers, if we want
7656 to avoid this we can add a cache that holds pointers to LyXText's
7657 that is not currently in use.
7659 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7662 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7664 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7666 * lyx_main.C: new command line option -x (or --execute) and
7667 -e (or --export). Now direct conversion from .lyx to .tex
7668 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7669 Unfortunately, X is still needed and the GUI pops up during the
7672 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7674 * src/Spacing.C: add a using directive to bring stream stuff into
7676 * src/paragraph.C: ditto
7677 * src/buffer.C: ditto
7679 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7680 from Lars' announcement).
7682 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7683 example files from Tino Meinen.
7685 1999-12-06 Allan Rae <rae@lyx.org>
7687 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7689 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7691 * src/support/lyxstring.C: added a lot of inline for no good
7694 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7695 latexWriteEndChanges, they were not used.
7697 * src/layout.h (operator<<): output operator for PageSides
7699 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7701 * some example files: loaded in LyX 1.0.4 and saved again to update
7702 certain constructs (table format)
7704 * a lot of files: did the change to use fstream/iostream for all
7705 writing of files. Done with a close look at Andre Poenitz's patch.
7707 * some files: whitespace changes.
7709 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7711 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7712 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7713 architecture, we provide our own. It is used unconditionnally, but
7714 I do not think this is a performance problem. Thanks to Angus
7715 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7716 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7718 (GetInset): use my_memcpy.
7722 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7723 it is easier to understand, but it uses less TeX-only constructs now.
7725 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7726 elements contain spaces
7728 * lib/configure: regenerated
7730 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7731 elements contain spaces; display the list of programs that are
7734 * autogen.sh: make sure lib/configure is executable
7736 * lib/examples/*: rename the tutorial examples to begin with the
7737 two-letters language code.
7739 * src/lyxfunc.C (getStatus): do not query current font if no
7742 * src/lyx_cb.C (RunScript): use QuoteName
7743 (MenuRunDvips): ditto
7744 (PrintApplyCB): ditto
7746 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7747 around argument, so that it works well with the current shell.
7748 Does not work properly with OS/2 shells currently.
7750 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7751 * src/LyXSendto.C (SendtoApplyCB): ditto
7752 * src/lyxfunc.C (Dispatch): ditto
7753 * src/buffer.C (runLaTeX): ditto
7754 (runLiterate): ditto
7755 (buildProgram): ditto
7757 * src/lyx_cb.C (RunScript): ditto
7758 (MenuMakeLaTeX): ditto
7760 * src/buffer.h (getLatexName): new method
7762 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7764 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7766 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7767 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7768 (create_math_panel): ditto
7770 * src/lyxfunc.C (getStatus): re-activate the code which gets
7771 current font and cursor; add test for export to html.
7773 * src/lyxrc.C (read): remove unreachable break statements; add a
7776 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7778 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7780 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7781 introduced by faulty regex.
7782 * src/buffer.C: ditto
7783 * src/lastfiles.C: ditto
7784 * src/paragraph.C: ditto
7785 * src/table.C: ditto
7786 * src/vspace.C: ditto
7787 * src/insets/figinset.C: ditto
7788 Note: most of these is absolutely harmless, except the one in
7789 src/mathed formula.C.
7791 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7793 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7794 operation, yielding correct results for the reLyX command.
7796 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7798 * src/support/filetools.C (ExpandPath): removed an over eager
7800 (ReplaceEnvironmentPath): ditto
7802 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7803 shows that we are doing something fishy in our code...
7807 * src/lyxrc.C (read): use a double switch trick to get more help
7808 from the compiler. (the same trick is used in layout.C)
7809 (write): new function. opens a ofstream and pass that to output
7810 (output): new function, takes a ostream and writes the lyxrc
7811 elemts to it. uses a dummy switch to make sure no elements are
7814 * src/lyxlex.h: added a struct pushpophelper for use in functions
7815 with more than one exit point.
7817 * src/lyxlex.[Ch] (GetInteger): made it const
7821 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7823 * src/layout.[hC] : LayoutTags splitted into several enums, new
7824 methods created, better error handling cleaner use of lyxlex. Read
7827 * src/bmtable.[Ch]: change some member prototypes because of the
7828 image const changes.
7830 * commandtags.h, src/LyXAction.C (init): new function:
7831 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7832 This file is not read automatically but you can add \input
7833 preferences to your lyxrc if you want to. We need to discuss how
7836 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7837 in .aux, also remove .bib and .bst files from dependencies when
7840 * src/BufferView.C, src/LyXView.C: add const_cast several places
7841 because of changes to images.
7843 * lib/images/*: same change as for images/*
7845 * lib/lyxrc.example: Default for accept_compound is false not no.
7847 * images/*: changed to be const, however I have som misgivings
7848 about this change so it might be changed back.
7850 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7852 * lib/configure, po/POTFILES.in: regenerated
7854 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7856 * config/lib_configure.m4: removed
7858 * lib/configure.m4: new file (was config/lib_configure.m4)
7860 * configure.in: do not test for rtti, since we do not use it.
7862 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7864 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7865 doubling of allocated space scheme. This makes it faster for large
7866 strings end to use less memory for small strings. xtra rememoved.
7868 * src/insets/figinset.C (waitalarm): commented out.
7869 (GhostscriptMsg): use static_cast
7870 (GhostscriptMsg): use new instead of malloc to allocate memory for
7871 cmap. also delete the memory after use.
7873 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7875 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7876 for changes in bibtex database or style.
7877 (runBibTeX): remove all .bib and .bst files from dep before we
7879 (run): use scanAuc in when dep file already exist.
7881 * src/DepTable.C (remove_files_with_extension): new method
7884 * src/DepTable.[Ch]: made many of the methods const.
7886 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7888 * src/bufferparams.C: make sure that the default textclass is
7889 "article". It used to be the first one by description order, but
7890 now the first one is "docbook".
7892 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7893 string; call Debug::value.
7894 (easyParse): pass complete argument to setDebuggingLevel().
7896 * src/debug.h (value): fix the code that parses debug levels.
7898 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7901 * src/LyXAction.C: use Debug::ACTION as debug channel.
7903 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7905 * NEWS: updated for the future 1.1.3 release.
7907 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7908 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7909 it should. This is of course a controversial change (since many
7910 people will find that their lyx workscreen is suddenly full of
7911 red), but done for the sake of correctness.
7913 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7914 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7916 * src/insets/inseterror.h, src/insets/inseturl.h,
7917 src/insets/insetinfo.h, src/insets/figinset.h,
7918 src/mathed/formulamacro.h, src/mathed/math_macro.h
7919 (EditMessage): add a missing const and add _() to make sure that
7922 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7923 src/insets/insetbib.C, src/support/filetools.C: add `using'
7926 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7927 doing 'Insert index of last word' at the beginning of a paragraph.
7929 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7931 * several files: white-space changes.
7933 * src/mathed/formula.C: removed IsAlpha and IsDigit
7935 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7936 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7939 * src/insets/figinset.C (GetPSSizes): don't break when
7940 "EndComments" is seen. But break when a boundingbox is read.
7942 * all classes inherited from Inset: return value of Clone
7943 changed back to Inset *.
7945 * all classes inherited form MathInset: return value of Clone
7946 changed back to MathedInset *.
7948 * src/insets/figinset.C (runqueue): use a ofstream to output the
7949 gs/ps file. Might need some setpresicion or setw. However I can
7950 see no problem with the current code.
7951 (runqueue): use sleep instead of the alarm/signal code. I just
7952 can't see the difference.
7954 * src/paragraph.C (LyXParagraph): reserve space in the new
7955 paragraph and resize the inserted paragraph to just fit.
7957 * src/lyxfunc.h (operator|=): added operator for func_status.
7959 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7960 check for readable file.
7962 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7963 check for readable file.
7964 (MenuMakeLinuxDoc): ditto
7965 (MenuMakeDocBook): ditto
7966 (MenuMakeAscii): ditto
7967 (InsertAsciiFile): split the test for openable and readable
7969 * src/bmtable.C (draw_bitmaptable): use
7970 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7972 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7973 findtexfile from LaTeX to filetools.
7975 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7976 instead of FilePtr. Needs to be verified by a literate user.
7978 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7980 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7981 (EditMessage): likewise.
7983 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7984 respectively as \textasciitilde and \textasciicircum.
7986 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7988 * src/support/lyxstring.h: made the methods that take iterators
7991 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7992 (regexMatch): made is use the real regex class.
7994 * src/support/Makefile.am: changed to use libtool
7996 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7998 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8000 (MathIsInset ++): changed several macros to be inline functions
8003 * src/mathed/Makefile.am: changed to use libtool
8005 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8007 * src/insets/inset* : Clone changed to const and return type is
8008 the true insettype not just Inset*.
8010 * src/insets/Makefile.am: changed to use libtool
8012 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8014 * src/undo.[Ch] : added empty() and changed some of the method
8017 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8019 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8020 setID use block<> for the bullets array, added const several places.
8022 * src/lyxfunc.C (getStatus): new function
8024 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8025 LyXAction, added const to several funtions.
8027 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8028 a std::map, and to store the dir items in a vector.
8030 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8033 * src/LyXView.[Ch] + other files : changed currentView to view.
8035 * src/LyXAction.[Ch] : ported from the old devel branch.
8037 * src/.cvsignore: added .libs and a.out
8039 * configure.in : changes to use libtool.
8041 * acinclude.m4 : inserted libtool.m4
8043 * .cvsignore: added libtool
8045 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8047 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8048 file name in insets and mathed directories (otherwise the
8049 dependency is not taken in account under cygwin).
8051 * src/text2.C (InsertString[AB]): make sure that we do not try to
8052 read characters past the string length.
8054 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8056 * lib/doc/LaTeXConfig.lyx.in,
8057 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8059 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8060 file saying who created them and when this heppened; this is
8061 useless and annoys tools like cvs.
8063 * lib/layouts/g-brief-{en,de}.layout,
8064 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8065 from Thomas Hartkens <thomas@hartkens.de>.
8067 * src/{insets,mathed}/Makefile.am: do not declare an empty
8068 LDFLAGS, so that it can be set at configure time (useful on Irix
8071 * lib/reLyX/configure.in: make sure that the prefix is set
8072 correctly in LYX_DIR.
8074 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8076 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8077 be used by 'command-sequence' this allows to bind a key to a
8078 sequence of LyX-commands
8079 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8081 * src/LyXAction.C: add "command-sequence"
8083 * src/LyXFunction.C: handling of "command-sequence"
8085 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8086 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8088 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8090 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8092 * src/buffer.C (writeFile): Do not output a comment giving user
8093 and date at the beginning of a .lyx file. This is useless and
8094 annoys cvs anyway; update version number to 1.1.
8096 * src/Makefile.am (LYX_DIR): add this definition, so that a
8097 default path is hardcoded in LyX.
8099 * configure.in: Use LYX_GNU_GETTEXT.
8101 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8102 AM_GNU_GETTEXT with a bug fixed.
8104 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8106 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8108 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8109 which is used to point to LyX data is now LYX_DIR_11x.
8111 * lyx.man: convert to a unix text file; small updates.
8113 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8115 * src/support/LSubstring.[Ch]: made the second arg of most of the
8116 constructors be a const reference.
8118 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8121 * src/support/lyxstring.[Ch] (swap): added missing member function
8122 and specialization of swap(str, str);
8124 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8126 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8127 trace of the old one.
8129 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8130 put the member definitions in undo.C.
8132 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8133 NEW_TEXT and have now only code that was included when this was
8136 * src/intl.C (LCombo): use static_cast
8138 (DispatchCallback): ditto
8140 * src/definitions.h: removed whole file
8142 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8144 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8145 parsing and stores in a std:map. a regex defines the file format.
8146 removed unneeded members.
8148 * src/bufferparams.h: added several enums from definitions.h here.
8149 Removed unsused destructor. Changed some types to use proper enum
8150 types. use block to have the temp_bullets and user_defined_bullets
8151 and to make the whole class assignable.
8153 * src/bufferparams.C (Copy): removed this functions, use a default
8156 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8159 * src/buffer.C (readLyXformat2): commend out all that have with
8160 oldpapersize to do. also comment out all that hve to do with
8161 insetlatex and insetlatexdel.
8162 (setOldPaperStuff): commented out
8164 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8166 * src/LyXAction.C: remove use of inset-latex-insert
8168 * src/mathed/math_panel.C (button_cb): use static_cast
8170 * src/insets/Makefile.am (insets_o_SOURCES): removed
8173 * src/support/lyxstring.C (helper): use the unsigned long
8174 specifier, UL, instead of a static_cast.
8176 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8178 * src/support/block.h: new file. to be used as a c-style array in
8179 classes, so that the class can be assignable.
8181 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8183 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8184 NULL, make sure to return an empty string (it is not possible to
8185 set a string to NULL).
8187 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8189 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8191 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8193 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8194 link line, so that Irix users (for example) can set it explicitely to
8197 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8198 it can be overidden at make time (static or dynamic link, for
8201 * src/vc-backend.C, src/LaTeXFeatures.h,
8202 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8203 statements to bring templates to global namespace.
8205 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8207 * src/support/lyxstring.C (operator[] const): make it standard
8210 * src/minibuffer.C (Init): changed to reflect that more
8211 information is given from the lyxvc and need not be provided here.
8213 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8215 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8217 * src/LyXView.C (UpdateTimerCB): use static_cast
8218 (KeyPressMask_raw_callback): ditto
8220 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8221 buffer_, a lot of changes because of this. currentBuffer() ->
8222 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8223 also changes to other files because of this.
8225 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8227 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8228 have no support for RCS and partial support for CVS, will be
8231 * src/insets/ several files: changes because of function name
8232 changes in Bufferview and LyXView.
8234 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8236 * src/support/LSubstring.[Ch]: new files. These implement a
8237 Substring that can be very convenient to use. i.e. is this
8239 string a = "Mary had a little sheep";
8240 Substring(a, "sheep") = "lamb";
8241 a is now "Mary has a little lamb".
8243 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8244 out patterns and subpatterns of strings. It is used by LSubstring
8245 and also by vc-backend.C
8247 * src/support/lyxstring.C: went over all the assertions used and
8248 tried to correct the wrong ones and flag which of them is required
8249 by the standard. some bugs found because of this. Also removed a
8250 couple of assertions.
8252 * src/support/Makefile.am (libsupport_a_SOURCES): added
8253 LSubstring.[Ch] and LRegex.[Ch]
8255 * src/support/FileInfo.h: have struct stat buf as an object and
8256 not a pointer to one, some changes because of this.
8258 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8259 information in layout when adding the layouts preamble to the
8262 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8265 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8266 because of bug in OS/2.
8268 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8270 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8271 \verbatim@font instead of \ttfamily, so that it can be redefined.
8273 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8274 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8275 src/layout.h, src/text2.C: add 'using' directive to bring the
8276 STL templates we need from the std:: namespace to the global one.
8277 Needed by DEC cxx in strict ansi mode.
8279 * src/support/LIstream.h,src/support/LOstream.h,
8280 src/support/lyxstring.h,src/table.h,
8281 src/lyxlookup.h: do not include <config.h> in header
8282 files. This should be done in the .C files only.
8284 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8288 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8290 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8291 from Kayvan to fix the tth invokation.
8293 * development/lyx.spec.in: updates from Kayvan to reflect the
8294 changes of file names.
8296 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8298 * src/text2.C (InsertStringB): use std::copy
8299 (InsertStringA): use std::copy
8301 * src/bufferlist.C: use a vector to store the buffers in. This is
8302 an internal change and should not affect any other thing.
8304 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8307 * src/text.C (Fill): fix potential bug, one off bug.
8309 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8311 * src/Makefile.am (lyx_main.o): add more files it depends on.
8313 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8315 * src/support/lyxstring.C: use size_t for the reference count,
8316 size, reserved memory and xtra.
8317 (internal_compare): new private member function. Now the compare
8318 functions should work for std::strings that have embedded '\0'
8320 (compare): all compare functions rewritten to use
8323 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8325 * src/support/lyxstring.C (compare): pass c_str()
8326 (compare): pass c_str
8327 (compare): pass c_str
8329 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8331 * src/support/DebugStream.C: <config.h> was not included correctly.
8333 * lib/configure: forgot to re-generate it :( I'll make this file
8334 auto generated soon.
8336 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8338 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8341 * src/support/lyxstring.C: some changes from length() to rep->sz.
8342 avoids a function call.
8344 * src/support/filetools.C (SpaceLess): yet another version of the
8345 algorithm...now per Jean-Marc's suggestions.
8347 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8349 * src/layout.C (less_textclass_desc): functor for use in sorting
8351 (LyXTextClass::Read): sort the textclasses after reading.
8353 * src/support/filetools.C (SpaceLess): new version of the
8354 SpaceLess functions. What problems does this one give? Please
8357 * images/banner_bw.xbm: made the arrays unsigned char *
8359 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8361 * src/support/lyxstring.C (find): remove bogus assertion in the
8362 two versions of find where this has not been done yet.
8364 * src/support/lyxlib.h: add missing int return type to
8367 * src/menus.C (ShowFileMenu): disable exporting to html if no
8368 html export command is present.
8370 * config/lib_configure.m4: add a test for an HTML converter. The
8371 programs checked for are, in this order: tth, latex2html and
8374 * lib/configure: generated from config/lib_configure.m4.
8376 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8377 html converter. The parameters are now passed through $$FName and
8378 $$OutName, instead of standard input/output.
8380 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8382 * lib/lyxrc.example: update description of \html_command.
8383 add "quotes" around \screen_font_xxx font setting examples to help
8384 people who use fonts with spaces in their names.
8386 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8388 * Distribution files: updates for v1.1.2
8390 * src/support/lyxstring.C (find): remove bogus assert and return
8391 npos for the same condition.
8393 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8395 * added patch for OS/2 from SMiyata.
8397 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8399 * src/text2.C (CutSelection): make space_wrapped a bool
8400 (CutSelection): dont declare int i until we have to.
8401 (alphaCounter): return a char const *.
8403 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8405 * src/support/syscall.C (Systemcalls::kill):
8406 src/support/filetools.C (PutEnv, PutEnvPath):
8407 src/lyx_cb.C (addNewlineAndDepth):
8408 src/FontInfo.C (FontInfo::resize): condition some #warning
8409 directives with WITH_WARNINGS.
8412 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8414 * src/layout.[Ch] + several files: access to class variables
8415 limited and made accessor functions instead a lot of code changed
8416 becuase of this. Also instead of returning pointers often a const
8417 reference is returned instead.
8419 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8421 * src/Makefile.am (dist-hook): added used to remove the CVS from
8422 cheaders upon creating a dist
8423 (EXTRA_DIST): added cheaders
8425 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8426 a character not as a small integer.
8428 * src/support/lyxstring.C (find): removed Assert and added i >=
8429 rep->sz to the first if.
8431 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8433 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8434 src/LyXView.C src/buffer.C src/bufferparams.C
8435 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8436 src/text2.C src/insets/insetinclude.C:
8437 lyxlayout renamed to textclasslist.
8439 * src/layout.C: some lyxerr changes.
8441 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8442 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8443 (LyXLayoutList): removed all traces of this class.
8444 (LyXTextClass::Read): rewrote LT_STYLE
8445 (LyXTextClass::hasLayout): new function
8446 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8447 both const and nonconst version.
8448 (LyXTextClass::delete_layout): new function.
8449 (LyXTextClassList::Style): bug fix. do the right thing if layout
8451 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8452 (LyXTextClassList::NameOfLayout): ditto
8453 (LyXTextClassList::Load): ditto
8455 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8457 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8459 * src/LyXAction.C (LookupFunc): added a workaround for sun
8460 compiler, on the other hand...we don't know if the current code
8461 compiles on sun at all...
8463 * src/support/filetools.C (CleanupPath): subst fix
8465 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8468 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8469 complained about this one?
8471 * src/insets/insetinclude.C (Latex): subst fix
8473 * src/insets/insetbib.C (getKeys): subst fix
8475 * src/LyXSendto.C (SendtoApplyCB): subst fix
8477 * src/lyx_main.C (init): subst fix
8479 * src/layout.C (Read): subst fix
8481 * src/lyx_sendfax_main.C (button_send): subst fix
8483 * src/buffer.C (RoffAsciiTable): subst fix
8485 * src/lyx_cb.C (MenuFax): subst fix
8486 (PrintApplyCB): subst fix
8488 1999-10-26 Juergen Vigna <jug@sad.it>
8490 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8492 (Read): Cleaned up this code so now we read only format vestion >= 5
8494 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8496 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8497 come nobody has complained about this one?
8499 * src/insets/insetinclude.C (Latex): subst fix
8501 * src/insets/insetbib.C (getKeys): subst fix
8503 * src/lyx_main.C (init): subst fix
8505 * src/layout.C (Read): subst fix
8507 * src/buffer.C (RoffAsciiTable): subst fix
8509 * src/lyx_cb.C (MenuFax): subst fix.
8511 * src/layout.[hC] + some other files: rewrote to use
8512 std::container to store textclasses and layouts in.
8513 Simplified, removed a lot of code. Make all classes
8514 assignable. Further simplifications and review of type
8515 use still to be one.
8517 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8518 lastfiles to create the lastfiles partr of the menu.
8520 * src/lastfiles.[Ch]: rewritten to use deque to store the
8521 lastfiles in. Uses fstream for reading and writing. Simplifies
8524 * src/support/syscall.C: remove explicit cast.
8526 * src/BufferView.C (CursorToggleCB): removed code snippets that
8528 use explicat C++ style casts instead of C style casts. also use
8529 u_vdata instea of passing pointers in longs.
8531 * src/PaperLayout.C: removed code snippets that were commented out.
8533 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8535 * src/lyx_main.C: removed code snippets that wer commented out.
8537 * src/paragraph.C: removed code snippets that were commented out.
8539 * src/lyxvc.C (logClose): use static_cast
8541 (viewLog): remove explicit cast to void*
8542 (showLog): removed old commented code
8544 * src/menus.C: use static_cast instead of C style casts. use
8545 u_vdata instead of u_ldata. remove explicit cast to (long) for
8546 pointers. Removed old code that was commented out.
8548 * src/insets/inset.C: removed old commented func
8550 * src/insets/insetref.C (InsetRef): removed old code that had been
8551 commented out for a long time.
8553 (escape): removed C style cast
8555 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8557 * src/insets/insetlatex.C (Draw): removed old commented code
8558 (Read): rewritten to use string
8560 * src/insets/insetlabel.C (escape): removed C style cast
8562 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8564 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8567 * src/insets/insetinclude.h: removed a couple of stupid bools
8569 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8570 (Clone): remove C style cast
8571 (getKeys): changed list to lst because of std::list
8573 * src/insets/inseterror.C (Draw): removed som old commented code.
8575 * src/insets/insetcommand.C (Draw): removed some old commented code.
8577 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8578 commented out forever.
8579 (bibitem_cb): use static_cast instead of C style cast
8580 use of vdata changed to u_vdata.
8582 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8584 (CloseUrlCB): use static_cast instead of C style cast.
8585 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8587 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8588 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8589 (CloseInfoCB): static_cast from ob->u_vdata instead.
8590 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8593 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8594 (C_InsetError_CloseErrorCB): forward the ob parameter
8595 (CloseErrorCB): static_cast from ob->u_vdata instead.
8597 * src/vspace.h: include LString.h since we use string in this class.
8599 * src/vspace.C (lyx_advance): changed name from advance because of
8600 nameclash with stl. And since we cannot use namespaces yet...I
8601 used a lyx_ prefix instead. Expect this to change when we begin
8604 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8606 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8607 and removed now defunct constructor and deconstructor.
8609 * src/BufferView.h: have backstack as a object not as a pointer.
8610 removed initialization from constructor. added include for BackStack
8612 * development/lyx.spec.in (%build): add CFLAGS also.
8614 * src/screen.C (drawFrame): removed another warning.
8616 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8618 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8619 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8620 README and ANNOUNCE a bit for the next release. More work is
8623 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8624 unbreakable if we are in freespacing mode (LyX-Code), but not in
8627 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8629 * src/BackStack.h: fixed initialization order in constructor
8631 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8633 * acinclude.m4 (VERSION): new rules for when a version is
8634 development, added also a variable for prerelease.
8635 (warnings): we set with_warnings=yes for prereleases
8636 (lyx_opt): prereleases compile with same optimization as development
8637 (CXXFLAGS): only use pedantic if we are a development version
8639 * src/BufferView.C (restorePosition): don't do anything if the
8642 * src/BackStack.h: added member empty, use this to test if there
8643 is anything to pop...
8645 1999-10-25 Juergen Vigna <jug@sad.it>
8648 * forms/layout_forms.fd +
8649 * forms/latexoptions.fd +
8650 * lyx.fd: changed for various form resize issues
8652 * src/mathed/math_panel.C +
8653 * src/insets/inseterror.C +
8654 * src/insets/insetinfo.C +
8655 * src/insets/inseturl.C +
8656 * src/insets/inseturl.h +
8659 * src/PaperLayout.C +
8660 * src/ParagraphExtra.C +
8661 * src/TableLayout.C +
8663 * src/layout_forms.C +
8670 * src/menus.C: fixed various resize issues. So now forms can be
8671 resized savely or not be resized at all.
8673 * forms/form_url.fd +
8674 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8677 * src/insets/Makefile.am: added files form_url.[Ch]
8679 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8681 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8682 (and presumably 6.2).
8684 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8685 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8686 remaining static member callbacks.
8688 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8691 * src/support/lyxstring.h: declare struct Srep as friend of
8692 lyxstring, since DEC cxx complains otherwise.
8694 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8696 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8698 * src/LaTeX.C (run): made run_bibtex also depend on files with
8700 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8701 are put into the dependency file.
8703 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8704 the code has shown itself to work
8705 (create_ispell_pipe): removed another warning, added a comment
8708 * src/minibuffer.C (ExecutingCB): removed code that has been
8709 commented out a long time
8711 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8712 out code + a warning.
8714 * src/support/lyxstring.h: comment out the three private
8715 operators, when compiling with string ansi conforming compilers
8718 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8720 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8721 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8724 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8727 * src/mathed/math_panel.C (create_math_panel): remove explicit
8730 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8733 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8734 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8735 to XCreatePixmapFromBitmapData
8736 (fl_set_bmtable_data): change the last argument to be unsigned
8738 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8739 and bh to be unsigned int, remove explicit casts in call to
8740 XReadBitmapFileData.
8742 * images/arrows.xbm: made the arrays unsigned char *
8743 * images/varsz.xbm: ditto
8744 * images/misc.xbm: ditto
8745 * images/greek.xbm: ditto
8746 * images/dots.xbm: ditto
8747 * images/brel.xbm: ditto
8748 * images/bop.xbm: ditto
8750 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8752 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8753 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8754 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8756 (LYX_CXX_CHEADERS): added <clocale> to the test.
8758 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8760 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8762 * src/support/lyxstring.C (append): fixed something that must be a
8763 bug, rep->assign was used instead of rep->append.
8765 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8768 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8769 lyx insert double chars. Fix spotted by Kayvan.
8771 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8773 * Fixed the tth support. I messed up with the Emacs patch apply feature
8774 and omitted the changes in lyxrc.C.
8776 1999-10-22 Juergen Vigna <jug@sad.it>
8778 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8780 * src/lyx_cb.C (MenuInsertRef) +
8781 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8782 the form cannot be resized under it limits (fixes a segfault)
8784 * src/lyx.C (create_form_form_ref) +
8785 * forms/lyx.fd: Changed Gravity on name input field so that it is
8788 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8790 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8791 <ostream> and <istream>.
8793 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8794 whether <fstream> provides the latest standard features, or if we
8795 have an oldstyle library (like in egcs).
8796 (LYX_CXX_STL_STRING): fix the test.
8798 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8799 code on MODERN_STL_STREAM.
8801 * src/support/lyxstring.h: use L{I,O}stream.h.
8803 * src/support/L{I,O}stream.h: new files, designed to setup
8804 correctly streams for our use
8805 - includes the right header depending on STL capabilities
8806 - puts std::ostream and std::endl (for LOStream.h) or
8807 std::istream (LIStream.h) in toplevel namespace.
8809 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8811 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8812 was a bib file that had been changed we ensure that bibtex is run.
8813 (runBibTeX): enhanced to extract the names of the bib files and
8814 getting their absolute path and enter them into the dep file.
8815 (findtexfile): static func that is used to look for tex-files,
8816 checks for absolute patchs and tries also with kpsewhich.
8817 Alternative ways of finding the correct files are wanted. Will
8819 (do_popen): function that runs a command using popen and returns
8820 the whole output of that command in a string. Should be moved to
8823 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8824 file with extension ext has changed.
8826 * src/insets/figinset.C: added ifdef guards around the fl_free
8827 code that jug commented out. Now it is commented out when
8828 compiling with XForms == 0.89.
8830 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8831 to lyxstring.C, and only keep a forward declaration in
8832 lyxstring.h. Simplifies the header file a bit and should help a
8833 bit on compile time too. Also changes to Srep will not mandate a
8834 recompile of code just using string.
8835 (~lyxstring): definition moved here since it uses srep.
8836 (size): definition moved here since it uses srep.
8838 * src/support/lyxstring.h: removed a couple of "inline" that should
8841 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8843 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8846 1999-10-21 Juergen Vigna <jug@sad.it>
8848 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8849 set to left if I just remove the width entry (or it is empty).
8851 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8852 paragraph when having dummy paragraphs.
8854 1999-10-20 Juergen Vigna <jug@sad.it>
8856 * src/insets/figinset.C: just commented some fl_free_form calls
8857 and added warnings so that this calls should be activated later
8858 again. This avoids for now a segfault, but we have a memory leak!
8860 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8861 'const char * argument' to 'string argument', this should
8862 fix some Asserts() in lyxstring.C.
8864 * src/lyxfunc.h: Removed the function argAsString(const char *)
8865 as it is not used anymore.
8867 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8869 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8872 * src/Literate.h: some funcs moved from public to private to make
8873 interface clearer. Unneeded args removed.
8875 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8877 (scanBuildLogFile): ditto
8879 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8880 normal TeX Error. Still room for improvement.
8882 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8884 * src/buffer.C (insertErrors): changes to make the error
8885 desctription show properly.
8887 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8890 * src/support/lyxstring.C (helper): changed to use
8891 sizeof(object->rep->ref).
8892 (operator>>): changed to use a pointer instead.
8894 * src/support/lyxstring.h: changed const reference & to value_type
8895 const & lets see if that helps.
8897 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8899 * Makefile.am (rpmdist): fixed to have non static package and
8902 * src/support/lyxstring.C: removed the compilation guards
8904 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8907 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8908 conditional compile of lyxstring.Ch
8910 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8911 stupid check, but it is a lot better than the bastring hack.
8912 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8914 * several files: changed string::erase into string::clear. Not
8917 * src/chset.C (encodeString): use a char temporary instead
8919 * src/table.C (TexEndOfCell): added tostr around
8920 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8921 (TexEndOfCell): ditto
8922 (TexEndOfCell): ditto
8923 (TexEndOfCell): ditto
8924 (DocBookEndOfCell): ditto
8925 (DocBookEndOfCell): ditto
8926 (DocBookEndOfCell): ditto
8927 (DocBookEndOfCell): ditto
8929 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8931 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8933 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8934 (MenuBuildProg): added tostr around ret
8935 (MenuRunChktex): added tostr around ret
8936 (DocumentApplyCB): added tostr around ret
8938 * src/chset.C (encodeString): added tostr around t->ic
8940 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8941 (makeLaTeXFile): added tostr around tocdepth
8942 (makeLaTeXFile): added tostr around ftcound - 1
8944 * src/insets/insetbib.C (setCounter): added tostr around counter.
8946 * src/support/lyxstring.h: added an operator+=(int) to catch more
8949 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8950 (lyxstring): We DON'T allow NULL pointers.
8952 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8954 * src/mathed/math_macro.C (MathMacroArgument::Write,
8955 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8956 when writing them out.
8958 * src/LString.C: remove, since it is not used anymore.
8960 * src/support/lyxstring.C: condition the content to
8961 USE_INCLUDED_STRING macro.
8963 * src/mathed/math_symbols.C, src/support/lstrings.C,
8964 src/support/lyxstring.C: add `using' directive to specify what
8965 we need in <algorithm>. I do not think that we need to
8966 conditionalize this, but any thought is appreciated.
8968 * many files: change all callback functions to "C" linkage
8969 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8970 strict_ansi. Those who were static are now global.
8971 The case of callbacks which are static class members is
8972 trickier, since we have to make C wrappers around them (see
8973 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8974 did not finish this yet, since it defeats the purpose of
8975 encapsulation, and I am not sure what the best route is.
8977 1999-10-19 Juergen Vigna <jug@sad.it>
8979 * src/support/lyxstring.C (lyxstring): we permit to have a null
8980 pointer as assignment value and just don't assign it.
8982 * src/vspace.C (nextToken): corrected this function substituting
8983 find_first(_not)_of with find_last_of.
8985 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8986 (TableOptCloseCB) (TableSpeCloseCB):
8987 inserted fl_set_focus call for problem with fl_hide_form() in
8990 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8992 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8995 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8997 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8998 LyXLex::next() and not eatline() to get its argument.
9000 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9002 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9003 instead, use fstreams for io of the depfile, removed unneeded
9004 functions and variables.
9006 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9007 vector instead, removed all functions and variables that is not in
9010 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9012 * src/buffer.C (insertErrors): use new interface to TeXError
9014 * Makefile.am (rpmdist): added a rpmdist target
9016 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9017 per Kayvan's instructions.
9019 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9021 * src/Makefile.am: add a definition for localedir, so that locales
9022 are found after installation (Kayvan)
9024 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9026 * development/.cvsignore: new file.
9028 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9030 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9031 C++ compiler provides wrappers for C headers and use our alternate
9034 * configure.in: use LYX_CXX_CHEADERS.
9036 * src/cheader/: new directory, populated with cname headers from
9037 libstdc++-2.8.1. They are a bit old, but probably good enough for
9038 what we want (support compilers who lack them).
9040 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9041 from includes. It turns out is was stupid.
9043 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9045 * lib/Makefile.am (install-data-local): forgot a ';'
9046 (install-data-local): forgot a '\'
9047 (libinstalldirs): needed after all. reintroduced.
9049 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9051 * configure.in (AC_OUTPUT): added lyx.spec
9053 * development/lyx.spec: removed file
9055 * development/lyx.spec.in: new file
9057 * po/*.po: merged with lyx.pot becuase of make distcheck
9059 * lib/Makefile.am (dist-hook): added dist-hook so that
9060 documentation files will be included when doing a make
9061 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9062 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9064 more: tried to make install do the right thing, exclude CVS dirs
9067 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9068 Path would fit in more nicely.
9070 * all files that used to use pathstack: uses now Path instead.
9071 This change was a lot easier than expected.
9073 * src/support/path.h: new file
9075 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9077 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9079 * src/support/lyxstring.C (getline): Default arg was given for
9082 * Configure.cmd: removed file
9084 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9086 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9087 streams classes and types, add the proper 'using' statements when
9088 MODERN_STL is defined.
9090 * src/debug.h: move the << operator definition after the inclusion
9093 * src/support/filetools.C: include "LAssert.h", which is needed
9096 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9099 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9100 include "debug.h" to define a proper ostream.
9102 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9104 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9105 method to the SystemCall class which can kill a process, but it's
9106 not fully implemented yet.
9108 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9110 * src/support/FileInfo.h: Better documentation
9112 * src/lyxfunc.C: Added support for buffer-export html
9114 * src/menus.C: Added Export->As HTML...
9116 * lib/bind/*.bind: Added short-cut for buffer-export html
9118 * src/lyxrc.*: Added support for new \tth_command
9120 * lib/lyxrc.example: Added stuff for new \tth_command
9122 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9124 * lib/Makefile.am (IMAGES): removed images/README
9125 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9126 installes in correct place. Check permisions is installed
9129 * src/LaTeX.C: some no-op changes moved declaration of some
9132 * src/LaTeX.h (LATEX_H): changed include guard name
9134 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9136 * lib/reLyX/Makefile.am: install noweb2lyx.
9138 * lib/Makefile.am: install configure.
9140 * lib/reLyX/configure.in: declare a config aux dir; set package
9141 name to lyx (not sure what the best solution is); generate noweb2lyx.
9143 * lib/layouts/egs.layout: fix the bibliography layout.
9145 1999-10-08 Jürgen Vigna <jug@sad.it>
9147 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9148 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9149 it returned without continuing to search the path.
9151 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9153 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9154 also fixes a bug. It is not allowed to do tricks with std::strings
9155 like: string a("hei"); &a[e]; this will not give what you
9156 think... Any reason for the complexity in this func?
9158 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9160 * Updated README and INSTALL a bit, mostly to check that my
9161 CVS rights are correctly set up.
9163 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9165 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9166 does not allow '\0' chars but lyxstring and std::string does.
9168 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9170 * autogen.sh (AUTOCONF): let the autogen script create the
9171 POTFILES.in file too. POTFILES.in should perhaps now not be
9172 included in the cvs module.
9174 * some more files changed to use C++ includes instead of C ones.
9176 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9178 (Reread): added tostr to nlink. buggy output otherwise.
9179 (Reread): added a string() around szMode when assigning to Buffer,
9180 without this I got a log of garbled info strings.
9182 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9185 * I have added several ostream & operator<<(ostream &, some_type)
9186 functions. This has been done to avoid casting and warnings when
9187 outputting enums to lyxerr. This as thus eliminated a lot of
9188 explicit casts and has made the code clearer. Among the enums
9189 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9190 mathed enums, some font enum the Debug::type enum.
9192 * src/support/lyxstring.h (clear): missing method. equivalent of
9195 * all files that contained "stderr": rewrote constructs that used
9196 stderr to use lyxerr instead. (except bmtable)
9198 * src/support/DebugStream.h (level): and the passed t with
9199 Debug::ANY to avoid spurious bits set.
9201 * src/debug.h (Debug::type value): made it accept strings of the
9204 * configure.in (Check for programs): Added a check for kpsewhich,
9205 the latex generation will use this later to better the dicovery of
9208 * src/BufferView.C (create_view): we don't need to cast this to
9209 (void*) that is done automatically.
9210 (WorkAreaButtonPress): removed some dead code.
9212 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9214 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9215 is not overwritten when translated (David Sua'rez de Lis).
9217 * lib/CREDITS: Added David Sua'rez de Lis
9219 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9221 * src/bufferparams.C (BufferParams): default input encoding is now
9224 * acinclude.m4 (cross_compiling): comment out macro
9225 LYX_GXX_STRENGTH_REDUCE.
9227 * acconfig.h: make sure that const is not defined (to empty) when
9228 we are compiling C++. Remove commented out code using SIZEOF_xx
9231 * configure.in : move the test for const and inline as late as
9232 possible so that these C tests do not interefere with C++ ones.
9233 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9234 has not been proven.
9236 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9238 * src/table.C (getDocBookAlign): remove bad default value for
9241 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9243 (ShowFileMenu2): ditto.
9245 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9248 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9250 * Most files: finished the change from the old error code to use
9251 DebugStream for all lyxerr debugging. Only minor changes remain
9252 (e.g. the setting of debug levels using strings instead of number)
9254 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9256 * src/layout.C (Add): Changed to use compare_no_case instead of
9259 * src/FontInfo.C: changed loop variable type too string::size_type.
9261 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9263 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9264 set ETAGS_ARGS to --c++
9266 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9268 * src/table.C (DocBookEndOfCell): commented out two unused variables
9270 * src/paragraph.C: commented out four unused variables.
9272 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9273 insed a if clause with type string::size_type.
9275 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9278 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9280 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9281 variable, also changed loop to go from 0 to lenght + 1, instead of
9282 -1 to length. This should be correct.
9284 * src/LaTeX.C (scanError): use string::size_type as loop variable
9287 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9288 (l.896) since y_tmp and row was not used anyway.
9290 * src/insets/insetref.C (escape): use string::size_type as loop
9293 * src/insets/insetquotes.C (Width): use string::size_type as loop
9295 (Draw): use string::size_type as loop variable type.
9297 * src/insets/insetlatexaccent.C (checkContents): use
9298 string::size_type as loop variable type.
9300 * src/insets/insetlabel.C (escape): use string::size_type as loop
9303 * src/insets/insetinfo.C: added an extern for current_view.
9305 * src/insets/insetcommand.C (scanCommand): use string::size_type
9306 as loop variable type.
9308 * most files: removed the RCS tags. With them we had to recompile
9309 a lot of files after a simple cvs commit. Also we have never used
9310 them for anything meaningful.
9312 * most files: tags-query-replace NULL 0. As adviced several plases
9313 we now use "0" instead of "NULL" in our code.
9315 * src/support/filetools.C (SpaceLess): use string::size_type as
9318 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9320 * src/paragraph.C: fixed up some more string stuff.
9322 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9324 * src/support/filetools.h: make modestr a std::string.
9326 * src/filetools.C (GetEnv): made ch really const.
9328 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9329 made code that used these use max/min from <algorithm> instead.
9331 * changed several c library include files to their equivalent c++
9332 library include files. All is not changed yet.
9334 * created a support subdir in src, put lyxstring and lstrings
9335 there + the extra files atexit, fileblock, strerror. Created
9336 Makefile.am. edited configure.in and src/Makefile.am to use this
9337 new subdir. More files moved to support.
9339 * imported som of the functions from repository lyx, filetools
9341 * ran tags-query-replace on LString -> string, corrected the bogus
9342 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9343 is still some errors in there. This is errors where too much or
9344 too litle get deleted from strings (string::erase, string::substr,
9345 string::replace), there can also be some off by one errors, or
9346 just plain wrong use of functions from lstrings. Viewing of quotes
9349 * LyX is now running fairly well with string, but there are
9350 certainly some bugs yet (see above) also string is quite different
9351 from LString among others in that it does not allow null pointers
9352 passed in and will abort if it gets any.
9354 * Added the revtex4 files I forgot when setting up the repository.
9356 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9358 * All over: Tried to clean everything up so that only the files
9359 that we really need are included in the cvs repository.
9360 * Switched to use automake.
9361 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9362 * Install has not been checked.
9364 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9366 * po/pt.po: Three errors:
9367 l.533 and l.538 format specification error
9368 l. 402 duplicate entry, I just deleted it.