1 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3 * src/converter.C: added some using directives
5 * src/frontends/ButtonPolicies.C: changes to overcome
6 "need lvalue" error with DEC c++
8 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
9 to WMHideCB for DEC c++
11 * src/frontends/xforms/Menubar_pimpl.C: added using directive
13 * src/frontends/xforms/forms/form_document.C.patch: use C callback
14 to BulletBMTableCB for DEC c++
16 2000-08-31 Allan Rae <rae@lyx.org>
18 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
19 character dialog separately from old document dialogs combo_language.
22 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
24 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
25 Removed LFUN_REF_CREATE.
27 * src/MenuBackend.C: Added new tags: toc and references
29 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
30 (add_lastfiles, add_documents, add_formats): Removed the unused smn
32 (add_toc, add_references): New methods.
33 (create_submenu): Handle correctly the case when there is a
34 seperator after optional menu items.
36 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
37 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
38 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
40 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
42 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
44 * src/converter.[Ch]: New file for converting between different
47 * src/export.[Ch]: New file for exporting a LyX file to different
50 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
51 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
52 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
53 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
54 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
55 RunDocBook, MenuExport.
57 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
58 Exporter::Preview methods if NEW_EXPORT is defined.
60 * src/buffer.C (Dispatch): Use Exporter::Export.
62 * src/lyxrc.C: Added new tags: \converter and \viewer.
65 * src/LyXAction.C: Define new lyx-function: buffer-update.
66 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
67 when NEW_EXPORT is defined.
69 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
71 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
73 * lib/ui/default.ui: Added submenus "view" and "update" to the
76 * src/filetools.C (GetExtension): New function.
78 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
80 2000-08-29 Allan Rae <rae@lyx.org>
82 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
84 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
85 (EnableDocumentLayout): removed
86 (DisableDocumentLayout): removed
87 (build): make use of ButtonController's read-only handling to
88 de/activate various objects. Replaces both of the above functions.
90 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
91 (readOnly): was read_only
92 (refresh): fixed dumb mistakes with read_only_ handling
94 * src/frontends/xforms/forms/form_document.fd:
95 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
96 tabbed dialogs so the tabs look more like tabs and so its easier to
97 work out which is the current tab.
99 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
100 segfault with form_table
102 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
104 2000-08-28 Juergen Vigna <jug@sad.it>
106 * acconfig.h: added USE_PSPELL.
108 * src/config.h.in: added USE_PSPELL.
110 * autogen.sh: added pspell.m4
112 * config/pspell.m4: new file.
114 * src/spellchecker.C: implemented support for pspell libary.
116 2000-08-25 Juergen Vigna <jug@sad.it>
118 * src/LyXAction.C (init): renamed LFUN_TABLE to
119 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
121 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
123 * src/lyxscreen.h: add force_clear variable and fuction to force
124 a clear area when redrawing in LyXText.
126 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
128 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
130 * some whitespace and comment changes.
132 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
134 * src/buffer.C: up te LYX_FORMAT to 2.17
136 2000-08-23 Juergen Vigna <jug@sad.it>
138 * src/BufferView_pimpl.C (tripleClick): disable this when in a
141 * src/insets/insettabular.C (pasteSelection): delete the insets
142 LyXText as it is not valid anymore.
143 (copySelection): new function.
144 (pasteSelection): new function.
145 (cutSelection): new function.
146 (LocalDispatch): implemented cut/copy/paste of cell selections.
148 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
149 don't have a LyXText.
151 * src/LyXAction.C (init): a NEW_TABULAR define too much.
153 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
156 2000-08-22 Juergen Vigna <jug@sad.it>
158 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
159 ifdef form_table out if NEW_TABULAR.
161 2000-08-21 Juergen Vigna <jug@sad.it>
163 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
164 (draw): fixed draw position so that the cursor is positioned in the
166 (InsetMotionNotify): hide/show cursor so the position is updated.
167 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
168 using cellstart() function where it should be used.
170 * src/insets/insettext.C (draw): ditto.
172 * src/tabular.C: fixed initialization of some missing variables and
173 made BoxType into an enum.
175 2000-08-22 Marko Vendelin <markov@ioc.ee>
176 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
177 stock menu item using action numerical value, not its string
181 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
183 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
184 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
186 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
188 * src/frontends/xforms/GUIRunTime.C: new file
190 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
191 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
193 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
195 * src/frontends/kde/GUIRunTime.C: new file
197 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
198 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
200 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
202 * src/frontends/gnome/GUIRunTime.C: new file
204 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
207 * src/frontends/GUIRunTime.h: removed constructor and destructor,
208 small change to documetentation.
210 * src/frontends/GUIRunTime.C: removed file
212 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
214 * src/lyxparagraph.h: enable NEW_TABULAR as default
216 * src/lyxfunc.C (processKeySym): remove some commented code
218 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
219 NEW_TABULAR around the fd_form_table_options.
221 * src/lyx_gui.C (runTime): call the static member function as
222 GUIRunTime::runTime().
224 2000-08-21 Allan Rae <rae@lyx.org>
226 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
229 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
231 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
233 2000-08-21 Allan Rae <rae@lyx.org>
235 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
237 * src/frontends/xforms/FormPreferences.C (build): use setOK
238 * src/frontends/xforms/FormDocument.C (build): use setOK
239 (FormDocument): use the appropriate policy.
241 2000-08-21 Allan Rae <rae@lyx.org>
243 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
244 automatic [de]activation of arbitrary objects when in a read-only state.
246 * src/frontends/ButtonPolicies.h: More documentation
247 (isReadOnly): added to support the above.
249 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
251 2000-08-18 Juergen Vigna <jug@sad.it>
253 * src/insets/insettabular.C (getStatus): changed to return func_status.
255 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
256 display toggle menu entries if they are.
258 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
259 new document layout now.
261 * src/lyxfunc.C: ditto
263 * src/lyx_gui_misc.C: ditto
265 * src/lyx_gui.C: ditto
267 * lib/ui/default.ui: removed paper and quotes layout as they are now
268 all in the document layout tabbed folder.
270 * src/frontends/xforms/forms/form_document.fd: added Restore
271 button and callbacks for all inputs for Allan's ButtonPolicy.
273 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
274 (CheckChoiceClass): added missing params setting on class change.
275 (UpdateLayoutDocument): added for updating the layout on params.
276 (build): forgot to RETURN_ALWAYS input_doc_spacing.
277 (FormDocument): Implemented Allan's ButtonPolicy with the
280 2000-08-17 Allan Rae <rae@lyx.org>
282 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
283 so we can at least see the credits again.
285 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
286 controller calls for the appropriate callbacks. Note that since Ok
287 calls apply followed by cancel, and apply isn't a valid input for the
288 APPLIED state, the bc_ calls have to be made in the static callback not
289 within each of the real callbacks.
291 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
292 (setOk): renamed from setOkay()
294 2000-08-17 Juergen Vigna <jug@sad.it>
296 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
297 in the implementation part.
298 (composeUIInfo): don't show optional menu-items.
300 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
302 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
304 * src/bufferview_funcs.C (CurrentState): fixed to show also the
305 text-state when in a text-inset.
307 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
309 2000-08-17 Marko Vendelin <markov@ioc.ee>
310 * src/frontends/gnome/FormIndex.C
311 * src/frontends/gnome/FormIndex.h
312 * src/frontends/gnome/FormToc.C
313 * src/frontends/gnome/FormToc.h
314 * src/frontends/gnome/dialogs
315 * src/frontends/gnome/diatoc_callbacks.c
316 * src/frontends/gnome/diatoc_callbacks.h
317 * src/frontends/gnome/diainsertindex_callbacks.h
318 * src/frontends/gnome/diainsertindex_callbacks.c
319 * src/frontends/gnome/diainsertindex_interface.c
320 * src/frontends/gnome/diainsertindex_interface.h
321 * src/frontends/gnome/diatoc_interface.h
322 * src/frontends/gnome/diatoc_interface.c
323 * src/frontends/gnome/Makefile.am: Table of Contents and
324 Insert Index dialogs implementation for Gnome frontend
326 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
328 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
330 * src/frontends/gnome/diainserturl_interface.c: make the dialog
333 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
335 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
336 destructor. Don't definde if you don't need it
337 (processEvents): made static, non-blocking events processing for
339 (runTime): static method. event loop for xforms
340 * similar as above for kde and gnome.
342 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
344 (runTime): new method calss the real frontends runtime func.
346 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
348 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
350 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
352 2000-08-16 Juergen Vigna <jug@sad.it>
354 * src/lyx_gui.C (runTime): added GUII RunTime support.
356 * src/frontends/Makefile.am:
357 * src/frontends/GUIRunTime.[Ch]:
358 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
359 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
360 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
362 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
364 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
365 as this is already set in ${FRONTEND_INCLUDE} if needed.
367 * configure.in (CPPFLAGS): setting the include dir for the frontend
368 directory and don't set FRONTEND=xforms for now as this is executed
371 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
373 * src/frontends/kde/Makefile.am:
374 * src/frontends/kde/FormUrl.C:
375 * src/frontends/kde/FormUrl.h:
376 * src/frontends/kde/formurldialog.h:
377 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
379 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
381 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
383 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
385 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
388 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
390 * src/WorkArea.C (work_area_handler): more work to get te
391 FL_KEYBOARD to work with xforms 0.88 too, please test.
393 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
395 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
397 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
400 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
402 * src/Timeout.h: remove Qt::emit hack.
404 * several files: changes to allo doc++ compilation
406 * src/lyxfunc.C (processKeySym): new method
407 (processKeyEvent): comment out if FL_REVISION < 89
409 * src/WorkArea.C: change some debugging levels.
410 (WorkArea): set wantkey to FL_KEY_ALL
411 (work_area_handler): enable the FL_KEYBOARD clause, this enables
412 clearer code and the use of compose with XForms 0.89. Change to
413 use signals instead of calling methods in bufferview directly.
415 * src/Painter.C: change some debugging levels.
417 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
420 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
421 (workAreaKeyPress): new method
423 2000-08-14 Juergen Vigna <jug@sad.it>
425 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
427 * config/kde.m4: addes some features
429 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
430 include missing xforms dialogs.
432 * src/Timeout.h: a hack to be able to compile with qt/kde.
434 * sigc++/.cvsignore: added acinclude.m4
436 * lib/.cvsignore: added listerros
438 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
439 xforms tree as objects are needed for other frontends.
441 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
442 linking with not yet implemented xforms objects.
444 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
446 2000-08-14 Baruch Even <baruch.even@writeme.com>
448 * src/frontends/xforms/FormGraphics.h:
449 * src/frontends/xforms/FormGraphics.C:
450 * src/frontends/xforms/RadioButtonGroup.h:
451 * src/frontends/xforms/RadioButtonGroup.C:
452 * src/insets/insetgraphics.h:
453 * src/insets/insetgraphics.C:
454 * src/insets/insetgraphicsParams.h:
455 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
456 instead of spaces, and various other indentation issues to make the
457 sources more consistent.
459 2000-08-14 Marko Vendelin <markov@ioc.ee>
461 * src/frontends/gnome/dialogs/diaprint.glade
462 * src/frontends/gnome/FormPrint.C
463 * src/frontends/gnome/FormPrint.h
464 * src/frontends/gnome/diaprint_callbacks.c
465 * src/frontends/gnome/diaprint_callbacks.h
466 * src/frontends/gnome/diaprint_interface.c
467 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
470 * src/frontends/gnome/dialogs/diainserturl.glade
471 * src/frontends/gnome/FormUrl.C
472 * src/frontends/gnome/FormUrl.h
473 * src/frontends/gnome/diainserturl_callbacks.c
474 * src/frontends/gnome/diainserturl_callbacks.h
475 * src/frontends/gnome/diainserturl_interface.c
476 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
479 * src/frontends/gnome/Dialogs.C
480 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
481 all other dialogs. Copy all unimplemented dialogs from Xforms
484 * src/frontends/gnome/support.c
485 * src/frontends/gnome/support.h: support files generated by Glade
489 * config/gnome.m4: Gnome configuration scripts
491 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
492 configure --help message
494 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
495 only if there are no events pendling in Gnome/Gtk. This enhances
496 the performance of menus.
499 2000-08-14 Allan Rae <rae@lyx.org>
501 * lib/Makefile.am: listerrors cleaning
503 * lib/listerrors: removed -- generated file
504 * acinclude.m4: ditto
505 * sigc++/acinclude.m4: ditto
507 * src/frontends/xforms/forms/form_citation.fd:
508 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
511 * src/frontends/xforms/forms/makefile: I renamed the `install` target
512 `updatesrc` and now we have a `test` target that does what `updatesrc`
513 used to do. I didn't like having an install target that wasn't related
516 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
517 on all except FormGraphics. This may yet happen. Followed by a major
518 cleanup including using FL_TRANSIENT for most of the dialogs. More
519 changes to come when the ButtonController below is introduced.
521 * src/frontends/xforms/ButtonController.h: New file for managing up to
522 four buttons on a dialog according to an externally defined policy.
523 * src/frontends/xforms/Makefile.am: added above
525 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
526 Apply and Cancel/Close buttons and everything in between and beyond.
527 * src/frontends/Makefile.am: added above.
529 * src/frontends/xforms/forms/form_preferences.fd:
530 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
531 and removed variable 'status' as a result. Fixed the set_minsize thing.
532 Use the new screen-font-update after checking screen fonts were changed
533 Added a "Restore" button to restore the original lyxrc values while
534 editing. This restores everything not just the last input changed.
535 That's still a tricky one. As is the "LyX: this shouldn't happen..."
537 * src/LyXAction.C: screen-font-update added for updating buffers after
538 screen font settings have been changed.
539 * src/commandtags.h: ditto
540 * src/lyxfunc.C: ditto
542 * forms/lyx.fd: removed screen fonts dialog.
543 * src/lyx_gui.C: ditto
544 * src/menus.[Ch]: ditto
545 * src/lyx.[Ch]: ditto
546 * src/lyx_cb.C: ditto + code from here moved to make
547 screen-font-update. And people wonder why progress on GUII is
548 slow. Look at how scattered this stuff was! It takes forever
551 * forms/fdfix.sh: Fixup the spacing after commas.
552 * forms/makefile: Remove date from generated files. Fewer clashes now.
553 * forms/bullet_forms.C.patch: included someones handwritten changes
555 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
556 once I've discovered why LyXRC was made noncopyable.
557 * src/lyx_main.C: ditto
559 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
561 * src/frontends/xforms/forms/fdfix.sh:
562 * src/frontends/xforms/forms/fdfixh.sed:
563 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
564 * src/frontends/xforms/Form*.[hC]:
565 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
566 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
567 provide a destructor for the struct FD_form_xxxx. Another version of
568 the set_[max|min]size workaround and a few other cleanups. Actually,
569 Angus' patch from 20000809.
571 2000-08-13 Baruch Even <baruch.even@writeme.com>
573 * src/insets/insetgraphics.C (Clone): Added several fields that needed
576 2000-08-11 Juergen Vigna <jug@sad.it>
578 * src/insets/insetgraphics.C (InsetGraphics): changing init
579 order because of warnings.
581 * src/frontends/xforms/forms/makefile: adding patching .C with
584 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
585 from .C.patch to .c.patch
587 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
588 order because of warning.
590 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
592 * src/frontends/Liason.C (setMinibuffer): new helper function
594 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
596 * src/lyxfunc.C (Dispatch): calling new Document-Layout
598 * lib/ui/default.ui: commented out PaperLayout entry
600 * src/frontends/xforms/form_document.[Ch]: new added files
602 * src/frontends/xforms/FormDocument.[Ch]: ditto
604 * src/frontends/xforms/forms/form_document.fd: ditto
606 * src/frontends/xforms/forms/form_document.C.patch: ditto
608 2000-08-10 Juergen Vigna <jug@sad.it>
610 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
611 (InsetGraphics): initialized cacheHandle to 0.
612 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
614 2000-08-10 Baruch Even <baruch.even@writeme.com>
616 * src/graphics/GraphicsCache.h:
617 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
618 correctly as a cache.
620 * src/graphics/GraphicsCacheItem.h:
621 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
624 * src/graphics/GraphicsCacheItem_pimpl.h:
625 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
628 * src/insets/insetgraphics.h:
629 * src/insets/insetgraphics.C: Changed from using a signal notification
630 to polling when image is not loaded.
632 2000-08-10 Allan Rae <rae@lyx.org>
634 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
635 that there are two functions that have to been taken out of line by
636 hand and aren't taken care of in the script. (Just a reminder note)
638 * sigc++/macros/*.h.m4: Updated as above.
640 2000-08-09 Juergen Vigna <jug@sad.it>
642 * src/insets/insettext.C (draw): small fix for clearing rectangle.
644 * src/insets/insettabular.C: make drawing of single cell smarter.
646 2000-08-09 Marko Vendelin <markov@ioc.ee>
647 * src/frontends/gnome/Menubar_pimpl.C
648 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
649 implementation: new files
651 * src/frontends/gnome/mainapp.C
652 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
655 * src/main.C: create Gnome main window
657 * src/frontends/xforms/Menubar_pimpl.h
658 * src/frontends/Menubar.C
659 * src/frontends/Menubar.h: added method Menubar::update that calls
660 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
662 * src/LyXView.C: calls Menubar::update to update the state
665 * src/frontends/gnome/Makefile.am: added new files
667 * src/frontends/Makefile.am: added frontend compiler options
669 2000-08-08 Juergen Vigna <jug@sad.it>
671 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
673 * src/bufferlist.C (close):
674 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
675 documents if exiting without saving.
677 * src/buffer.C (save): use removeAutosaveFile()
679 * src/support/filetools.C (removeAutosaveFile): new function.
681 * src/lyx_cb.C (MenuWrite): returns a bool now.
682 (MenuWriteAs): check if file could really be saved and revert to the
684 (MenuWriteAs): removing old autosavefile if existant.
686 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
687 before Goto toggle declaration, because of compiler warning.
689 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
691 * src/lyxfunc.C (MenuNew): small fix.
693 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
695 * src/bufferlist.C (newFile):
696 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
698 * src/lyxrc.C: added new_ask_filename tag
700 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
702 * src/lyx.fd: removed code pertaining to form_ref
703 * src/lyx.[Ch]: ditto
704 * src/lyx_cb.C: ditto
705 * src/lyx_gui.C: ditto
706 * src/lyx_gui_misc.C: ditto
708 * src/BufferView_pimpl.C (restorePosition): update buffer only
711 * src/commandtags.h (LFUN_REFTOGGLE): removed
712 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
713 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
714 (LFUN_REFBACK): renamed LFUN_REF_BACK
716 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
718 * src/lyxfunc.C (Dispatch): ditto.
719 InsertRef dialog is now GUI-independent.
721 * src/texrow.C: added using std::endl;
723 * src/insets/insetref.[Ch]: strip out large amounts of code.
724 The inset is now a container and this functionality is now
725 managed by a new FormRef dialog
727 * src/frontends/Dialogs.h (showRef, createRef): new signals
729 * src/frontends/xforms/FormIndex.[Ch],
730 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
731 when setting dialog's min/max size
732 * src/frontends/xforms/FormIndex.[Ch]: ditto
734 * src/frontends/xforms/FormRef.[Ch],
735 src/frontends/xforms/forms/form_ref.fd: new xforms
736 implementation of an InsetRef dialog
738 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
741 * src/graphics/XPM_Renderer.C (isImageFormatOK):
742 ios::nocreate is not part of the standard. Removed.
744 2000-08-07 Baruch Even <baruch.even@writeme.com>
746 * src/graphics/Renderer.h:
747 * src/graphics/Renderer.C: Added base class for rendering of different
748 image formats into Pixmaps.
750 * src/graphics/XPM_Renderer.h:
751 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
752 in a different class.
754 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
755 easily add support for other formats.
757 * src/insets/figinset.C: plugged a leak of an X resource.
759 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
761 * src/CutAndPaste.[Ch]: make all metods static.
763 * development/Code_rules/Rules: more work, added section on
764 Exceptions, and a References section.
766 * a lot of header files: work to make doc++ able to generate the
767 source documentation, some workarounds of doc++ problems. Doc++ is
768 now able to generate the documentation.
770 2000-08-07 Juergen Vigna <jug@sad.it>
772 * src/insets/insettabular.C (recomputeTextInsets): removed function
774 * src/tabular.C (SetWidthOfMulticolCell):
776 (calculate_width_of_column_NMC): fixed return value so that it really
777 only returns true if the column-width has changed (there where
778 problems with muliticolumn-cells in this column).
780 2000-08-04 Juergen Vigna <jug@sad.it>
782 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
783 also on the scrollstatus of the inset.
784 (workAreaMotionNotify): ditto.
786 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
788 2000-08-01 Juergen Vigna <jug@sad.it>
790 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
793 * src/LyXAction.C (init):
794 * src/insets/inset.C (LocalDispatch): added support for
797 * src/insets/inset.C (scroll): new functions.
799 * src/insets/insettext.C (removeNewlines): new function.
800 (SetAutoBreakRows): removes forced newlines in the text of the
801 paragraph if autoBreakRows is set to false.
803 * src/tabular.C (Latex): generates a parbox around the cell contents
806 * src/frontends/xforms/FormTabular.C (local_update): removed
807 the radio_useparbox button.
809 * src/tabular.C (UseParbox): new function
811 2000-08-06 Baruch Even <baruch.even@writeme.com>
813 * src/graphics/GraphicsCache.h:
814 * src/graphics/GraphicsCache.C:
815 * src/graphics/GraphicsCacheItem.h:
816 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
819 * src/insets/insetgraphics.h:
820 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
821 drawing of the inline image.
823 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
824 into the wrong position.
826 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
829 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
831 * src/support/translator.h: move all typedefs to public section
833 * src/support/filetools.C (MakeLatexName): return string const
836 (FileOpenSearch): ditto
838 (LibFileSearch): ditto
839 (i18nLibFileSearch): ditto
842 (CreateTmpDir): ditto
843 (CreateBufferTmpDir): ditto
844 (CreateLyXTmpDir): ditto
849 (OnlyFilename): ditto
851 (NormalizePath): ditto
853 (GetFileContents): ditto
854 (ReplaceEnvironmentPath): ditto
857 (ChangeExtension): ditto
858 (MakeDisplayPath): ditto
859 (do_popen): return cmdret const
860 (findtexfile): return string const
862 * src/support/DebugStream.h: add some /// to please doc++
864 * src/frontends/DialogBase.h (endif): add some /// to please doc++
866 * src/texrow.C (same_rownumber): functor to use with find_if
867 (getIdFromRow): rewritten to use find_if and to not update the
868 positions. return true if row is found
869 (increasePos): new method, use to update positions
871 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
873 * src/lyxlex_pimpl.C (verifyTable): new method
876 (GetString): return string const
877 (pushTable): rewrite to use std::stack
879 (setFile): better check
882 * src/lyxlex.h: make LyXLex noncopyable
884 * src/lyxlex.C (text): return char const * const
885 (GetString): return string const
886 (getLongString): return string const
888 * src/lyx_gui_misc.C (askForText): return pair<...> const
890 * src/lastfiles.[Ch] (operator): return string const
892 * src/buffer.C (parseSingleLyXformat2Token): pass string to
893 istringstream not char const *.
894 move token.end() out of loop.
895 (readFile): move initializaton of token
897 * src/BufferView2.C (insertErrors): run texrow.increasePos if
898 getIdFromRow is successful.
900 * lib/bind/emacs.bind: don't include menus bind
902 * development/Code_rules/Rules: the beginnings of making this
903 better and covering more of the unwritten rules that we have.
905 * development/Code_rules/Recommendations: a couple of wording
908 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
910 * src/support/strerror.c: remove C++ comment.
912 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
914 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
915 LFUN_INDEX_INSERT_LAST
917 * src/texrow.C (getIdFromRow): changed from const_iterator to
918 iterator, allowing code to compile with DEC cxx
920 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
921 stores part of the class, as suggested by Allan. Will allow
923 (apply): test to apply uses InsetCommandParams operator!=
925 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
926 (apply): test to apply uses InsetCommandParams operator!=
928 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
929 stores part of the class.
930 (update): removed limits on min/max size.
932 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
933 (apply): test to apply uses InsetCommandParams operator!=
935 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
936 (Read, Write, scanCommand, getCommand): moved functionality
937 into InsetCommandParams.
939 (getScreenLabel): made pure virtual
940 new InsetCommandParams operators== and !=
942 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
943 c-tors based on InsetCommandParams. Removed others.
944 * src/insets/insetinclude.[Ch]: ditto
945 * src/insets/insetlabel.[Ch]: ditto
946 * src/insets/insetparent.[Ch]: ditto
947 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
949 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
950 insets derived from InsetCommand created using similar c-tors
951 based on InsetCommandParams
952 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
953 * src/menus.C (ShowRefsMenu): ditto
954 * src/paragraph.C (Clone): ditto
955 * src/text2.C (SetCounter): ditto
956 * src/lyxfunc.C (Dispatch) ditto
957 Also recreated old InsetIndex behaviour exactly. Can now
958 index-insert at the start of a paragraph and index-insert-last
959 without launching the pop-up.
961 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
963 * lib/lyxrc.example: mark te pdf options as non functional.
965 * src/support/lstrings.C (strToInt): move initalization of tmpstr
966 (isStrDbl): move tmpstr.end() out of loop.
967 (strToDbl): move intialization of tmpstr
968 (lowercase): return string const and move tmp.end() out of loop.
969 (uppercase): return string const and move tmp.edn() out of loop.
970 (prefixIs): add assertion
975 (containsOnly): ditto
976 (containsOnly): ditto
977 (containsOnly): ditto
978 (countChar): make last arg char not char const
979 (token): return string const
980 (subst): return string const, move tmp.end() out of loop.
981 (subst): return string const, add assertion
982 (strip): return string const
983 (frontStrip): return string const, add assertion
984 (frontStrip): return string const
989 * src/support/lstrings.C: add inclde "LAssert.h"
990 (isStrInt): move tmpstr.end() out of loop.
992 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
993 toollist.end() out of loop.
994 (deactivate): move toollist.end() out of loop.
995 (update): move toollist.end() out of loop.
996 (updateLayoutList): move tc.end() out of loop.
997 (add): move toollist.end() out of loop.
999 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1000 md.end() out of loop.
1002 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1004 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1007 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1008 (Erase): move insetlist.end() out of loop.
1010 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1011 ref to const string as first arg. Move initialization of some
1012 variables, whitespace changes.
1014 * src/kbmap.C (defkey): move table.end() out of loop.
1015 (kb_keymap): move table.end() out of loop.
1016 (findbinding): move table.end() out of loop.
1018 * src/MenuBackend.C (hasMenu): move end() out of loop.
1019 (getMenu): move end() out of loop.
1020 (getMenu): move menulist_.end() out of loop.
1022 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1024 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1027 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1028 (getFromLyXName): move infotab.end() out of loop.
1030 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1031 -fvtable-thunks -ffunction-sections -fdata-sections
1033 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1035 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1038 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1040 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1042 * src/frontends/xforms/FormCitation.[Ch],
1043 src/frontends/xforms/FormIndex.[Ch],
1044 src/frontends/xforms/FormToc.[Ch],
1045 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1047 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1049 * src/commandtags.h: renamed, created some flags for citation
1052 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1054 * src/lyxfunc.C (dispatch): use signals to insert index entry
1056 * src/frontends/Dialogs.h: new signal createIndex
1058 * src/frontends/xforms/FormCommand.[Ch],
1059 src/frontends/xforms/FormCitation.[Ch],
1060 src/frontends/xforms/FormToc.[Ch],
1061 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1063 * src/insets/insetindex.[Ch]: GUI-independent
1065 * src/frontends/xforms/FormIndex.[Ch],
1066 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1069 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1071 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1072 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1074 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1076 * src/insets/insetref.C (Latex): rewrite so that there is now
1077 question that a initialization is requested.
1079 * src/insets/insetcommand.h: reenable the hide signal
1081 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1083 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1084 fix handling of shortcuts (many bugs :)
1085 (add_lastfiles): ditto.
1087 * lib/ui/default.ui: fix a few shortcuts.
1089 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1091 * Makefile.am: Fix ``rpmdist'' target to return the exit
1092 status of the ``rpm'' command, instead of the last command in
1093 the chain (the ``rm lyx.xpm'' command, which always returns
1096 2000-08-02 Allan Rae <rae@lyx.org>
1098 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1099 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1100 * src/frontends/xforms/FormToc.C (FormToc): ditto
1102 * src/frontends/xforms/Makefile.am: A few forgotten files
1104 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1105 Signals-not-copyable-problem Lars' started commenting out.
1107 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1109 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1111 * src/insets/insetcommand.h: Signals is not copyable so anoter
1112 scheme for automatic hiding of forms must be used.
1114 * src/frontends/xforms/FormCitation.h: don't inerit from
1115 noncopyable, FormCommand already does that.
1116 * src/frontends/xforms/FormToc.h: ditto
1117 * src/frontends/xforms/FormUrl.h: ditto
1119 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1121 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1123 * src/insets/insetcommand.h (hide): new SigC::Signal0
1124 (d-tor) new virtual destructor emits hide signal
1126 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1127 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1129 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1130 LOF and LOT. Inset is now GUI-independent
1132 * src/insets/insetloa.[Ch]: redundant
1133 * src/insets/insetlof.[Ch]: ditto
1134 * src/insets/insetlot.[Ch]: ditto
1136 * src/frontends/xforms/forms/form_url.fd: tweaked!
1137 * src/frontends/xforms/forms/form_citation.fd: ditto
1139 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1140 dialogs dealing with InsetCommand insets
1142 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1143 FormCommand base class
1144 * src/frontends/xforms/FormUrl.[Ch]: ditto
1146 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1148 * src/frontends/xforms/FormToc.[Ch]: ditto
1150 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1151 passed a generic InsetCommand pointer
1152 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1154 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1155 and modified InsetTOC class
1156 * src/buffer.C: ditto
1158 * forms/lyx.fd: strip out old FD_form_toc code
1159 * src/lyx_gui_misc.C: ditto
1160 * src/lyx_gui.C: ditto
1161 * src/lyx_cb.C: ditto
1162 * src/lyx.[Ch]: ditto
1164 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1166 * src/support/utility.hpp: tr -d '\r'
1168 2000-08-01 Juergen Vigna <jug@sad.it>
1170 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1172 * src/commandtags.h:
1173 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1174 LFUN_TABULAR_FEATURES.
1176 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1177 LFUN_LAYOUT_TABULAR.
1179 * src/insets/insettabular.C (getStatus): implemented helper function.
1181 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1183 2000-07-31 Juergen Vigna <jug@sad.it>
1185 * src/text.C (draw): fixed screen update problem for text-insets.
1187 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1188 something changed probably this has to be added in various other
1191 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1193 2000-07-31 Baruch Even <baruch.even@writeme.com>
1195 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1196 templates to satisfy compaq cxx.
1199 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1201 * src/support/translator.h (equal_1st_in_pair::operator()): take
1202 const ref pair_type as arg.
1203 (equal_2nd_in_pair::operator()): ditto
1204 (Translator::~Translator): remove empty d-tor.
1206 * src/graphics/GraphicsCache.C: move include config.h to top, also
1207 put initialization of GraphicsCache::singleton here.
1208 (~GraphicsCache): move here
1209 (addFile): take const ref as arg
1212 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1214 * src/BufferView2.C (insertLyXFile): change te with/without header
1217 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1219 * src/frontends/xforms/FormGraphics.C (apply): add some
1220 static_cast. Not very nice, but required by compaq cxx.
1222 * src/frontends/xforms/RadioButtonGroup.h: include header
1223 <utility> instead of <pair.h>
1225 * src/insets/insetgraphicsParams.C: add using directive.
1226 (readResize): change return type to void.
1227 (readOrigin): ditto.
1229 * src/lyxfunc.C (getStatus): add missing break for build-program
1230 function; add test for Literate for export functions.
1232 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1233 entries in Options menu.
1235 2000-07-31 Baruch Even <baruch.even@writeme.com>
1237 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1238 protect against auto-allocation; release icon when needed.
1240 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1242 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1243 on usual typewriter.
1245 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1246 earlier czech.kmap), useful only for programming.
1248 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1250 * src/frontends/xforms/FormCitation.h: fix conditioning around
1253 2000-07-31 Juergen Vigna <jug@sad.it>
1255 * src/frontends/xforms/FormTabular.C (local_update): changed
1256 radio_linebreaks to radio_useparbox and added radio_useminipage.
1258 * src/tabular.C: made support for using minipages/parboxes.
1260 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1262 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1264 (descent): so the cursor is in the middle.
1265 (width): bit smaller box.
1267 * src/insets/insetgraphics.h: added display() function.
1269 2000-07-31 Baruch Even <baruch.even@writeme.com>
1271 * src/frontends/Dialogs.h: Added showGraphics signals.
1273 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1274 xforms form definition of the graphics dialog.
1276 * src/frontends/xforms/FormGraphics.h:
1277 * src/frontends/xforms/FormGraphics.C: Added files, the
1278 GUIndependent code of InsetGraphics
1280 * src/insets/insetgraphics.h:
1281 * src/insets/insetgraphics.C: Major writing to make it work.
1283 * src/insets/insetgraphicsParams.h:
1284 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1285 struct between InsetGraphics and GUI.
1287 * src/LaTeXFeatures.h:
1288 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1289 support for graphicx package.
1291 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1292 for the graphics inset.
1294 * src/support/translator.h: Added file, used in
1295 InsetGraphicsParams. this is a template to translate between two
1298 * src/frontends/xforms/RadioButtonGroup.h:
1299 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1300 way to easily control a radio button group.
1302 2000-07-28 Juergen Vigna <jug@sad.it>
1304 * src/insets/insettabular.C (LocalDispatch):
1305 (TabularFeatures): added support for lyx-functions of tabular features.
1306 (cellstart): refixed this function after someone wrongly changed it.
1308 * src/commandtags.h:
1309 * src/LyXAction.C (init): added support for tabular-features
1311 2000-07-28 Allan Rae <rae@lyx.org>
1313 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1314 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1315 triggers the callback for input checking. As a result we sometimes get
1316 "LyX: This shouldn't happen..." printed to cerr.
1317 (input): Started using status variable since I only free() on
1318 destruction. Some input checking for paths and font sizes.
1320 * src/frontends/xforms/FormPreferences.h: Use status to control
1321 activation of Ok and Apply
1323 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1324 callback. Also resized to stop segfaults with 0.88. The problem is
1325 that xforms-0.88 requires the folder to be wide enough to fit all the
1326 tabs. If it isn't it causes all sorts of problems.
1328 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1330 * src/frontends/xforms/forms/README: Reflect reality.
1332 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1333 * src/frontends/xforms/forms/makefile: ditto.
1335 * src/commandtags.h: Get access to new Preferences dialog
1336 * src/LyXAction.C: ditto
1337 * src/lyxfunc.C: ditto
1338 * lib/ui/default.ui: ditto
1340 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1342 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1344 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1347 * src/frontends/xforms/form_url.[Ch]: added.
1349 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1351 * src/insets/insetbib.h: fixed bug in previous commit
1353 * src/frontends/xforms/FormUrl.h: ditto
1355 * src/frontends/xforms/FormPrint.h: ditto
1357 * src/frontends/xforms/FormPreferences.h: ditto
1359 * src/frontends/xforms/FormCopyright.h: ditto
1361 * src/frontends/xforms/FormCitation.C: ditto
1363 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1364 private copyconstructor and private default contructor
1366 * src/support/Makefile.am: add utility.hpp
1368 * src/support/utility.hpp: new file from boost
1370 * src/insets/insetbib.h: set owner in clone
1372 * src/frontends/xforms/FormCitation.C: added missing include
1375 * src/insets/form_url.[Ch]: removed
1377 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1379 * development/lyx.spec.in
1380 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1381 file/directory re-organization.
1383 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1385 * src/insets/insetcommand.[Ch]: moved the string data and
1386 associated manipulation methods into a new stand-alone class
1387 InsetCommandParams. This class has two additional methods
1388 getAsString() and setFromString() allowing the contents to be
1389 moved around as a single string.
1390 (addContents) method removed.
1391 (setContents) method no longer virtual.
1393 * src/buffer.C (readInset): made use of new InsetCitation,
1394 InsetUrl constructors based on InsetCommandParams.
1396 * src/commandtags.h: add LFUN_INSERT_URL
1398 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1399 independent InsetUrl and use InsetCommandParams to extract
1400 string info and create new Insets.
1402 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1404 * src/frontends/xforms/FormCitation.C (apply): uses
1407 * src/frontends/xforms/form_url.C
1408 * src/frontends/xforms/form_url.h
1409 * src/frontends/xforms/FormUrl.h
1410 * src/frontends/xforms/FormUrl.C
1411 * src/frontends/xforms/forms/form_url.fd: new files
1413 * src/insets/insetcite.[Ch]: removed unused constructors.
1415 * src/insets/insetinclude.[Ch]: no longer store filename
1417 * src/insets/inseturl.[Ch]: GUI-independent.
1419 2000-07-26 Juergen Vigna <jug@sad.it>
1420 * renamed frontend from gtk to gnome as it is that what is realized
1421 and did the necessary changes in the files.
1423 2000-07-26 Marko Vendelin <markov@ioc.ee>
1425 * configure.in: cleaning up gnome configuration scripts
1427 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1429 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1430 shortcuts syndrom by redrawing them explicitely (a better solution
1431 would be appreciated).
1433 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1435 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1438 * src/lyx_cb.C (MenuExport): change html export to do the right
1439 thing depending of the document type (instead of having
1440 html-linuxdoc and html-docbook).
1441 * src/lyxfunc.C (getStatus): update for html
1442 * lib/ui/default.ui: simplify due to the above change.
1443 * src/menus.C (ShowFileMenu): update too (in case we need it).
1445 * src/MenuBackend.C (read): if a menu is defined twice, add the
1446 new entries to the exiting one.
1448 2000-07-26 Juergen Vigna <jug@sad.it>
1450 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1452 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1453 and return a bool if it did actual save the file.
1454 (AutoSave): don't autosave a unnamed doc.
1456 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1457 check if this is an UNNAMED new file and react to it.
1458 (newFile): set buffer to unnamed and change to not mark a new
1459 buffer dirty if I didn't do anything with it.
1461 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1463 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1465 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1466 friend as per Angus's patch posted to lyx-devel.
1468 * src/ext_l10n.h: updated
1470 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1471 gettext on the style string right before inserting them into the
1474 * autogen.sh: add code to extract style strings form layout files,
1475 not good enough yet.
1477 * src/frontends/gtk/.cvsignore: add MAKEFILE
1479 * src/MenuBackend.C (read): run the label strings through gettext
1480 before storing them in the containers.
1482 * src/ext_l10n.h: new file
1484 * autogen.sh : generate the ext_l10n.h file here
1486 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1488 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1491 * lib/ui/default.ui: fix a couple of typos.
1493 * config/gnome/gtk.m4: added (and added to the list of files in
1496 * src/insets/insetinclude.C (unique_id): fix when we are using
1497 lyxstring instead of basic_string<>.
1498 * src/insets/insettext.C (LocalDispatch): ditto.
1499 * src/support/filetools.C: ditto.
1501 * lib/configure.m4: create the ui/ directory if necessary.
1503 * src/LyXView.[Ch] (updateToolbar): new method.
1505 * src/BufferView_pimpl.C (buffer): update the toolbar when
1506 opening/closing buffer.
1508 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1510 * src/LyXAction.C (getActionName): enhance to return also the name
1511 and options of pseudo-actions.
1512 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1514 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1515 as an example of what is possible). Used in File->Build too (more
1516 useful) and in the import/export menus (to mimick the complicated
1517 handling of linuxdoc and friends). Try to update all the entries.
1519 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1522 * src/MenuBackend.C (read): Parse the new OptItem tag.
1524 * src/MenuBackend.h: Add a new optional_ data member (used if the
1525 entry should be omitted when the lyxfunc is disabled).
1527 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1528 function, used as a shortcut.
1529 (create_submenu): align correctly the shortcuts on the widest
1532 * src/MenuBackend.h: MenuItem.label() only returns the label of
1533 the menu without shortcut; new method shortcut().
1535 2000-07-14 Marko Vendelin <markov@ioc.ee>
1537 * src/frontends/gtk/Dialogs.C:
1538 * src/frontends/gtk/FormCopyright.C:
1539 * src/frontends/gtk/FormCopyright.h:
1540 * src/frontends/gtk/Makefile.am: added these source-files for the
1541 Gtk/Gnome support of the Copyright-Dialog.
1543 * src/main.C: added Gnome::Main initialization if using
1544 Gtk/Gnome frontend-GUI.
1546 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1548 * config/gnome/aclocal-include.m4
1549 * config/gnome/compiler-flags.m4
1550 * config/gnome/curses.m4
1551 * config/gnome/gnome--.m4
1552 * config/gnome/gnome-bonobo-check.m4
1553 * config/gnome/gnome-common.m4
1554 * config/gnome/gnome-fileutils.m4
1555 * config/gnome/gnome-ghttp-check.m4
1556 * config/gnome/gnome-gnorba-check.m4
1557 * config/gnome/gnome-guile-checks.m4
1558 * config/gnome/gnome-libgtop-check.m4
1559 * config/gnome/gnome-objc-checks.m4
1560 * config/gnome/gnome-orbit-check.m4
1561 * config/gnome/gnome-print-check.m4
1562 * config/gnome/gnome-pthread-check.m4
1563 * config/gnome/gnome-support.m4
1564 * config/gnome/gnome-undelfs.m4
1565 * config/gnome/gnome-vfs.m4
1566 * config/gnome/gnome-x-checks.m4
1567 * config/gnome/gnome-xml-check.m4
1568 * config/gnome/gnome.m4
1569 * config/gnome/gperf-check.m4
1570 * config/gnome/gtk--.m4
1571 * config/gnome/linger.m4
1572 * config/gnome/need-declaration.m4: added configuration scripts
1573 for Gtk/Gnome frontend-GUI
1575 * configure.in: added support for the --with-frontend=gtk option
1577 * autogen.sh: added config/gnome/* to list of config-files
1579 * acconfig.h: added define for GTKGUI-support
1581 * config/lyxinclude.m4: added --with-frontend[=value] option value
1582 for Gtk/Gnome frontend-GUI support.
1584 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1586 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1590 * src/paragraph.C (GetChar): remove non-const version
1592 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1593 (search_kw): use it.
1595 * src/lyx_main.C (init): if "preferences" exist, read that instead
1597 (ReadRcFile): return bool if the file could be read ok.
1598 (ReadUIFile): add a check to see if lex file is set ok.
1600 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1601 bastring can be used instead of lyxstring (still uses the old code
1602 if std::string is good enough or if lyxstring is used.)
1604 * src/encoding.C: make the arrays static, move ininle functions
1606 * src/encoding.h: from here.
1608 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1609 (parseSingleLyXformat2Token): move inset parsing to separate method
1610 (readInset): new private method
1612 * src/Variables.h: remove virtual from get().
1614 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1615 access to NEW_INSETS and NEW_TABULAR
1617 * src/MenuBackend.h: remove superfluous forward declaration of
1618 MenuItem. Add documentations tags "///", remove empty MenuItem
1619 destructor, remove private default contructor.
1621 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1623 (read): more string mlabel and mname to where they are used
1624 (read): remove unused variables mlabel and mname
1625 (defaults): unconditional clear, make menusetup take advantage of
1626 add returning Menu &.
1628 * src/LyXView.h: define NEW_MENUBAR as default
1630 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1631 to NEW_INSETS and NEW_TABULAR.
1632 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1633 defined. Change some of the "xxxx-inset-insert" functions names to
1636 * several files: more enahncements to NEW_INSETS and the resulting
1639 * lib/lyxrc.example (\date_insert_format): move to misc section
1641 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1642 bastring and use AC_CACHE_CHECK.
1643 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1644 the system have the newest methods. uses AC_CACHE_CHECK
1645 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1646 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1647 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1649 * configure.in: add LYX_CXX_GOOD_STD_STRING
1651 * acinclude.m4: recreated
1653 2000-07-24 Amir Karger
1655 * README: add Hebrew, Arabic kmaps
1658 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1660 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1663 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1665 * Lot of files: add pragma interface/implementation.
1667 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1669 * lib/ui/default.ui: new file (ans new directory). Contains the
1670 default menu and toolbar.
1672 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1673 global space. Toolbars are now read (as menus) in ui files.
1675 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1677 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1678 is disabled because the document is read-only. We want to have the
1679 toggle state of the function anyway.
1680 (getStatus): add code for LFUN_VC* functions (mimicking what is
1681 done in old-style menus)
1683 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1684 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1686 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1687 * src/BufferView_pimpl.C: ditto.
1688 * src/lyxfunc.C: ditto.
1690 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1691 default). This replaces old-style menus by new ones.
1693 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1694 MenuItem. Contain the data structure of a menu.
1696 * src/insets/insettext.C: use LyXView::setLayout instead of
1697 accessing directly the toolbar combox.
1698 * src/lyxfunc.C (Dispatch): ditto.
1700 * src/LyXView.C (setLayout): new method, which just calls
1701 Toolbar::setLayout().
1702 (updateLayoutChoice): move part of this method in Toolbar.
1704 * src/toolbar.[Ch]: removed.
1706 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1707 implementation the toolbar.
1709 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1710 the toolbar. It might make sense to merge it with ToolbarDefaults
1712 (setLayout): new function.
1713 (updateLayoutList): ditto.
1714 (openLayoutList): ditto.
1716 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1717 xforms implementation of the toolbar.
1718 (get_toolbar_func): comment out, since I do not
1719 know what it is good for.
1721 * src/ToolbarDefaults.h: Add the ItemType enum.
1723 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1724 for a list of allocated C strings. Used in Menubar xforms
1725 implementation to avoid memory leaks.
1727 * src/support/lstrings.[Ch] (uppercase): new version taking and
1731 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1732 * lib/bind/emacs.bind: ditto.
1734 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1736 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1737 forward decl of LyXView.
1739 * src/toolbar.C (toolbarItem): moved from toolbar.h
1740 (toolbarItem::clean): ditto
1741 (toolbarItem::~toolbarItem): ditto
1742 (toolbarItem::operator): ditto
1744 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1746 * src/paragraph.h: control the NEW_TABULAR define from here
1748 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1749 USE_TABULAR_INSETS to NEW_TABULAR
1751 * src/ToolbarDefaults.C: add include "lyxlex.h"
1753 * files using the old table/tabular: use NEW_TABULAR to control
1754 compilation of old tabular stuff.
1756 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1759 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1760 planemet in reading of old style floats, fix the \end_deeper
1761 problem when reading old style floats.
1763 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1765 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1767 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1769 * lib/bind/sciword.bind: updated.
1771 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1773 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1774 layout write problem
1776 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1778 * src/Makefile.am (INCLUDES): remove image directory from include
1781 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1782 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1784 * src/LyXView.C (create_form_form_main): read the application icon
1787 * lib/images/*.xpm: change the icons to use transparent color for
1790 * src/toolbar.C (update): change the color of the button when it
1793 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1795 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1796 setting explicitely the minibuffer.
1797 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1799 * src/LyXView.C (showState): new function. Shows font information
1800 in minibuffer and update toolbar state.
1801 (LyXView): call Toolbar::update after creating the
1804 * src/toolbar.C: change toollist to be a vector instead of a
1806 (BubbleTimerCB): get help string directly from the callback
1807 argument of the corresponding icon (which is the action)
1808 (set): remove unnecessary ugliness.
1809 (update): new function. update the icons (depressed, disabled)
1810 depending of the status of the corresponding action.
1812 * src/toolbar.h: remove help in toolbarItem
1814 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1816 * src/Painter.C (text): Added code for using symbol glyphs from
1817 iso10646 fonts. Currently diabled.
1819 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1822 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1823 magyar,turkish and usorbian.
1825 * src/paragraph.C (isMultiLingual): Made more efficient.
1827 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1830 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1831 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1832 Also changed the prototype to "bool math_insert_greek(char)".
1834 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1836 * lots of files: apply the NEW_INSETS on all code that will not be
1837 needed when we move to use the new insets. Enable the define in
1838 lyxparagrah.h to try it.
1840 * src/insets/insettabular.C (cellstart): change to be a static
1842 (InsetTabular): initialize buffer in the initializer list.
1844 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1846 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1847 form_print.h out of the header file. Replaced with forward
1848 declarations of the relevant struct.
1850 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1853 * src/commandtags.h: do not include "debug.h" which does not
1854 belong there. #include it in some other places because of this
1857 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1859 * src/insets/insetcaption.C: add a couple "using" directives.
1861 * src/toolbar.C (add): get the help text directly from lyxaction.
1863 (setPixmap): new function. Loads from disk and sets a pixmap on a
1864 botton; the name of the pixmap file is derived from the command
1867 * src/toolbar.h: remove members isBitmap and pixmap from
1870 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1871 * lib/images/: move many files from images/banner.xpm.
1873 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1875 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1876 * src/toolbar.C: ditto.
1877 * configure.in: ditto.
1878 * INSTALL: document.
1880 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1881 the spellchecker popup is closed from the WM.
1883 2000-07-19 Juergen Vigna <jug@sad.it>
1885 * src/insets/insetfloat.C (Write): small fix because we use the
1886 insetname for the type now!
1888 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1890 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1893 * src/frontends/Dialogs.h: removed hideCitation signal
1895 * src/insets/insetcite.h: added hide signal
1897 * src/insets/insetcite.C (~InsetCitation): emits new signal
1898 (getScreenLabel): "intelligent" label should now fit on the screen!
1900 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1902 * src/frontends/xforms/FormCitation.C (showInset): connects
1903 hide() to the inset's hide signal
1904 (show): modified to use fl_set_object_position rather than
1905 fl_set_object_geometry wherever possible
1907 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1909 * src/insets/lyxinset.h: add caption code
1911 * src/insets/insetfloat.C (type): new method
1913 * src/insets/insetcaption.C (Write): new method
1915 (LyxCode): new method
1917 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1918 to get it right together with using the FloatList.
1920 * src/commandtags.h: add LFUN_INSET_CAPTION
1921 * src/lyxfunc.C (Dispatch): handle it
1923 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1926 * src/Variables.[Ch]: make expand take a const reference, remove
1927 the destructor, some whitespace changes.
1929 * src/LyXAction.C (init): add caption-inset-insert
1931 * src/FloatList.C (FloatList): update the default floats a bit.
1933 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1935 * src/Variables.[Ch]: new files. Intended to be used for language
1936 specific strings (like \chaptername) and filename substitution in
1939 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1941 * lib/kbd/american.kmap: update
1943 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1945 * src/bufferparams.[Ch]: remove member allowAccents.
1947 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1949 * src/LaTeXLog.C: use the log_form.h header.
1950 * src/lyx_gui.C: ditto.
1951 * src/lyx_gui_misc.C: ditto.
1952 * src/lyxvc.h: ditto.
1954 * forms/log_form.fd: new file, created from latexoptions.fd. I
1955 kept the log popup and nuked the options form.
1957 * src/{la,}texoptions.[Ch]: removed.
1958 * src/lyx_cb.C (LaTeXOptions): ditto
1960 * src/lyx_gui.C (create_forms): do not handle the
1961 fd_latex_options form.
1963 2000-07-18 Juergen Vigna <jug@sad.it>
1965 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1966 name of the inset so that it can be requested outside (text2.C).
1968 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1971 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1973 * src/mathed/formula.h (ConvertFont): constify
1975 * src/mathed/formula.C (Read): add warning if \end_inset is not
1976 found on expected place.
1978 * src/insets/lyxinset.h (ConvertFont): consify
1980 * src/insets/insetquotes.C (ConvertFont): constify
1981 * src/insets/insetquotes.h: ditto
1983 * src/insets/insetinfo.h: add labelfont
1985 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1986 (ascent): use labelfont
1990 (Write): make .lyx file a bit nicer
1992 * src/insets/insetfloat.C (Write): simplify somewhat...
1993 (Read): add warning if arg is not found
1995 * src/insets/insetcollapsable.C: add using std::max
1996 (Read): move string token and add warning in arg is not found
1997 (draw): use std::max to get the right ty
1998 (getMaxWidth): simplify by using std::max
2000 * src/insets/insetsection.h: new file
2001 * src/insets/insetsection.C: new file
2002 * src/insets/insetcaption.h: new file
2003 * src/insets/insetcaption.C: new file
2005 * src/insets/inset.C (ConvertFont): constify signature
2007 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2008 insetcaption.[Ch] and insetsection.[Ch]
2010 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2011 uses to use LABEL_COUNTER_CHAPTER instead.
2012 * src/text2.C (SetCounter): here
2014 * src/counters.h: new file
2015 * src/counters.C: new file
2016 * src/Sectioning.h: new file
2017 * src/Sectioning.C: new file
2019 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2021 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2023 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2026 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2029 2000-07-17 Juergen Vigna <jug@sad.it>
2031 * src/tabular.C (Validate): check if array-package is needed.
2032 (SetVAlignment): added support for vertical alignment.
2033 (SetLTFoot): better support for longtable header/footers
2034 (Latex): modified to support added features.
2036 * src/LaTeXFeatures.[Ch]: added array-package.
2038 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2040 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2043 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2045 * configure.in: do not forget to put a space after -isystem.
2047 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2049 * lib/kbd/arabic.kmap: a few fixes.
2051 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2053 * some whitespace chagnes to a number of files.
2055 * src/support/DebugStream.h: change to make it easier for
2056 doc++ to parse correctly.
2057 * src/support/lyxstring.h: ditto
2059 * src/mathed/math_utils.C (compara): change to have only one
2061 (MathedLookupBOP): change because of the above.
2063 * src/mathed/math_delim.C (math_deco_compare): change to have only
2065 (search_deco): change becasue of the above.
2067 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2068 instead of manually coded one.
2070 * src/insets/insetquotes.C (Read): read the \end_inset too
2072 * src/insets/insetlatex.h: remove file
2073 * src/insets/insetlatex.C: remove file
2075 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2077 (InsetPrintIndex): remove destructor
2079 * src/insets/insetinclude.h: remove default constructor
2081 * src/insets/insetfloat.C: work to make it work better
2083 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2085 * src/insets/insetcite.h (InsetCitation): remove default constructor
2087 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2089 * src/text.C (GetColumnNearX): comment out some currently unused code.
2091 * src/paragraph.C (writeFile): move some initializations closer to
2093 (CutIntoMinibuffer): small change to use new matchIT operator
2097 (InsertInset): ditto
2100 (InsetIterator): ditto
2101 (Erase): small change to use new matchFT operator
2103 (GetFontSettings): ditto
2104 (HighestFontInRange): ditto
2107 * src/lyxparagraph.h: some chars changed to value_type
2108 (matchIT): because of some stronger checking (perhaps too strong)
2109 in SGI STL, the two operator() unified to one.
2112 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2114 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2115 the last inset read added
2116 (parseSingleLyXformat2Token): some more (future) compability code added
2117 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2118 (parseSingleLyXformat2Token): set last_inset_read
2119 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2120 (parseSingleLyXformat2Token): don't double intializw string next_token
2122 * src/TextCache.C (text_fits::operator()): add const's to the signature
2123 (has_buffer::operator()): ditto
2125 * src/Floating.h: add some comments on the class
2127 * src/FloatList.[Ch] (typeExist): new method
2130 * src/BackStack.h: added default constructor, wanted by Gcc.
2132 2000-07-14 Juergen Vigna <jug@sad.it>
2134 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2136 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2138 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2139 do a redraw when the window is resized!
2140 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2142 * src/insets/insettext.C (resizeLyXText): added function to correctly
2143 being able to resize the LyXWindow.
2145 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2147 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2149 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2150 crashes when closing dialog to a deleted inset.
2152 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2153 method! Now similar to other insets.
2155 2000-07-13 Juergen Vigna <jug@sad.it>
2157 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2159 * lib/examples/Literate.lyx: small patch!
2161 * src/insets/insetbib.C (Read): added this function because of wrong
2162 Write (without [begin|end]_inset).
2164 2000-07-11 Juergen Vigna <jug@sad.it>
2166 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2167 as the insertInset could not be good!
2169 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2170 the bool param should not be last.
2172 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2174 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2175 did submit that to Karl).
2177 * configure.in: use -isystem instead of -I for X headers. This
2178 fixes a problem on solaris with a recent gcc;
2179 put the front-end code after the X detection code;
2180 configure in sigc++ before lib/
2182 * src/lyx_main.C (commandLineHelp): remove -display from command
2185 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2187 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2188 Also put in Makefile rules for building the ``listerrors''
2189 program for parsing errors from literate programs written in LyX.
2191 * lib/build-listerrors: Added small shell script as part of compile
2192 process. This builds a working ``listerrors'' binary if noweb is
2193 installed and either 1) the VNC X server is installed on the machine,
2194 or 2) the user is compiling from within a GUI. The existence of a GUI
2195 is necessary to use the ``lyx --export'' feature for now. This
2196 hack can be removed once ``lyx --export'' no longer requires a GUI to
2199 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2201 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2202 now passed back correctly from gcc and placed "under" error
2203 buttons in a Literate LyX source.
2205 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2207 * src/text.C (GetColumnNearX): Better behavior when a RTL
2208 paragraph is ended by LTR text.
2210 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2213 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2215 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2216 true when clipboard is empty.
2218 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2220 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2221 row of the paragraph.
2222 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2223 to prevent calculation of bidi tables
2225 2000-07-07 Juergen Vigna <jug@sad.it>
2227 * src/screen.C (ToggleSelection): added y_offset and x_offset
2230 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2233 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2235 * src/insets/insettext.C: fixed Layout-Display!
2237 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2239 * configure.in: add check for strings.h header.
2241 * src/spellchecker.C: include <strings.h> in order to have a
2242 definition for bzero().
2244 2000-07-07 Juergen Vigna <jug@sad.it>
2246 * src/insets/insettext.C (draw): set the status of the bv->text to
2247 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2249 * src/screen.C (DrawOneRow):
2250 (DrawFromTo): redraw the actual row if something has changed in it
2253 * src/text.C (draw): call an update of the toplevel-inset if something
2254 has changed inside while drawing.
2256 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2258 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2260 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2261 processing inside class.
2263 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2264 processing inside class.
2266 * src/insets/insetindex.h new struct Holder, consistent with other
2269 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2270 citation dialog from main code and placed it in src/frontends/xforms.
2271 Dialog launched through signals instead of callbacks
2273 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2275 * lyx.man: update the options description.
2277 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2279 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2280 handle neg values, set min width to 590, add doc about -display
2282 2000-07-05 Juergen Vigna <jug@sad.it>
2284 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2285 calls to BufferView *.
2287 * src/insets/insettext.C (checkAndActivateInset): small fix non
2288 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2290 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2291 their \end_inset token!
2293 2000-07-04 edscott <edscott@imp.mx>
2295 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2296 lib/lyxrc.example: added option \wheel_jump
2298 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2300 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2301 remove support for -width,-height,-xpos and -ypos.
2303 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2305 * src/encoding.[Ch]: New files.
2307 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2308 (text): Call to the underline() method only when needed.
2310 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2312 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2313 encoding(s) for the document.
2315 * src/bufferparams.C (BufferParams): Changed default value of
2318 * src/language.C (newLang): Removed.
2319 (items[]): Added encoding information for all defined languages.
2321 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2322 encoding choice button.
2324 * src/lyxrc.h (font_norm_type): New member variable.
2325 (set_font_norm_type): New method.
2327 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2328 paragraphs with different encodings.
2330 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2331 (TransformChar): Changed to work correctly with Arabic points.
2332 (draw): Added support for drawing Arabic points.
2333 (draw): Removed code for drawing underbars (this is done by
2336 * src/support/textutils.h (IsPrintableNonspace): New function.
2338 * src/BufferView_pimpl.h: Added "using SigC::Object".
2339 * src/LyXView.h: ditto.
2341 * src/insets/insetinclude.h (include_label): Changed to mutable.
2343 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2345 * src/mathed/math_iter.h: remove empty destructor
2347 * src/mathed/math_cursor.h: remove empty destructor
2349 * src/insets/lyxinset.h: add THEOREM_CODE
2351 * src/insets/insettheorem.[Ch]: new files
2353 * src/insets/insetminipage.C: (InsertInset): remove
2355 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2357 (InsertInset): remove
2359 * src/insets/insetlist.C: (InsertList): remove
2361 * src/insets/insetfootlike.[Ch]: new files
2363 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2366 (InsertInset): ditto
2368 * src/insets/insetert.C: remove include Painter.h, reindent
2369 (InsertInset): move to header
2371 * src/insets/insetcollapsable.h: remove explicit from default
2372 contructor, remove empty destructor, add InsertInset
2374 * src/insets/insetcollapsable.C (InsertInset): new func
2376 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2378 * src/vspace.h: add explicit to constructor
2380 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2381 \textcompwordmark, please test this.
2383 * src/lyxrc.C: set ascii_linelen to 65 by default
2385 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2387 * src/commandtags.h: add LFUN_INSET_THEOREM
2389 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2390 (makeLinuxDocFile): remove _some_ of the nice logic
2391 (makeDocBookFile): ditto
2393 * src/Painter.[Ch]: (~Painter): removed
2395 * src/LyXAction.C (init): entry for insettheorem added
2397 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2399 (deplog): code to detect files generated by LaTeX, needs testing
2402 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2404 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2406 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2408 * src/LaTeX.C (deplog): Add a check for files that are going to be
2409 created by the first latex run, part of the project to remove the
2412 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2413 contents to the extension list.
2415 2000-07-04 Juergen Vigna <jug@sad.it>
2417 * src/text.C (NextBreakPoint): added support for needFullRow()
2419 * src/insets/lyxinset.h: added needFullRow()
2421 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2424 * src/insets/insettext.C: lots of changes for update!
2426 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2428 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2430 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2432 * src/insets/insetinclude.C (InsetInclude): fixed
2433 initialization of include_label.
2434 (unique_id): now returns a string.
2436 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2438 * src/LaTeXFeatures.h: new member IncludedFiles, for
2439 a map of key, included file name.
2441 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2442 with the included files for inclusion in SGML preamble,
2443 i. e., linuxdoc and docbook.
2446 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2447 nice (is the generated linuxdoc code to be exported?), that
2448 allows to remove column, and only_body that will be true for
2449 slave documents. Insets are allowed inside SGML font type.
2450 New handling of the SGML preamble for included files.
2451 (makeDocBookFile): the same for docbook.
2453 * src/insets/insetinclude.h:
2454 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2456 (DocBook): new export methods.
2458 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2459 and makeDocBookFile.
2461 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2462 formats to export with command line argument -x.
2464 2000-06-29 Juergen Vigna <jug@sad.it>
2466 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2467 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2469 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2470 region could already been cleared by an inset!
2472 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2474 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2477 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2479 (cursorToggle): remove special handling of lyx focus.
2481 2000-06-28 Juergen Vigna <jug@sad.it>
2483 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2486 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2488 * src/insets/insetindex.C (Edit): add a callback when popup is
2491 * src/insets/insettext.C (LocalDispatch):
2492 * src/insets/insetmarginal.h:
2493 * src/insets/insetlist.h:
2494 * src/insets/insetfoot.h:
2495 * src/insets/insetfloat.h:
2496 * src/insets/insetert.h: add a missing std:: qualifier.
2498 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2500 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2503 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2505 * src/insets/insettext.C (Read): remove tmptok unused variable
2506 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2507 (InsertInset): change for new InsetInset code
2509 * src/insets/insettext.h: add TEXT inline method
2511 * src/insets/insettext.C: remove TEXT macro
2513 * src/insets/insetmarginal.C (Write): new method
2514 (Latex): change output slightly
2516 * src/insets/insetfoot.C (Write): new method
2517 (Latex): change output slightly (don't use endl when no need)
2519 * src/insets/insetert.C (Write): new method
2521 * src/insets/insetcollapsable.h: make button_length, button_top_y
2522 and button_bottm_y protected.
2524 * src/insets/insetcollapsable.C (Write): simplify code by using
2525 tostr. Also do not output the float name, the children class
2526 should to that to get control over own arguments
2528 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2529 src/insets/insetminipage.[Ch]:
2532 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2534 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2536 * src/Makefile.am (lyx_SOURCES): add the new files
2538 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2539 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2540 * src/commandtags.h: ditto
2542 * src/LaTeXFeatures.h: add a std::set of used floattypes
2544 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2546 * src/FloatList.[Ch] src/Floating.h: new files
2548 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2550 * src/lyx_cb.C (TableApplyCB): ditto
2552 * src/text2.C: ditto
2553 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2554 (parseSingleLyXformat2Token): ditto + add code for
2555 backwards compability for old float styles + add code for new insets
2557 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2559 (InsertInset(size_type, Inset *, LyXFont)): new method
2560 (InsetChar(size_type, char)): changed to use the other InsetChar
2561 with a LyXFont(ALL_INHERIT).
2562 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2563 insert the META_INSET.
2565 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2567 * sigc++/thread.h (Threads): from here
2569 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2570 definition out of line
2571 * sigc++/scope.h: from here
2573 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2575 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2576 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2578 * Makefile.am (bindist): new target.
2580 * INSTALL: add instructions for doing a binary distribution.
2582 * development/tools/README.bin.example: update a bit.
2584 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2587 * lib/lyxrc.example: new lyxrc tag \set_color.
2589 * src/lyxfunc.C (Dispatch):
2590 * src/commandtags.h:
2591 * src/LyXAction.C: new lyxfunc "set-color".
2593 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2594 and an x11name given as strings.
2596 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2597 cache when a color is changed.
2599 2000-06-26 Juergen Vigna <jug@sad.it>
2601 * src/lyxrow.C (width): added this functions and variable.
2603 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2606 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2608 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2610 * images/undo_bw.xpm: new icon.
2611 * images/redo_bw.xpm: ditto.
2613 * configure.in (INSTALL_SCRIPT): change value to
2614 ${INSTALL} to avoid failures of install-script target.
2615 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2617 * src/BufferView.h: add a magic "friend" declaration to please
2620 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2622 * forms/cite.fd: modified to allow resizing without messing
2625 * src/insetcite.C: Uses code from cite.fd almost without
2627 User can now resize dialog in the x-direction.
2628 Resizing the dialog in the y-direction is prevented, as the
2629 code does this intelligently already.
2631 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2633 * INSTALL: remove obsolete entry in "problems" section.
2635 * lib/examples/sl_*.lyx: update of the slovenian examples.
2637 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2639 2000-06-23 Juergen Vigna <jug@sad.it>
2641 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2643 * src/buffer.C (resize): delete the LyXText of textinsets.
2645 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2647 * src/insets/lyxinset.h: added another parameter 'cleared' to
2648 the draw() function.
2650 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2651 unlocking inset in inset.
2653 2000-06-22 Juergen Vigna <jug@sad.it>
2655 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2656 of insets and moved first to LyXText.
2658 * src/mathed/formulamacro.[Ch]:
2659 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2661 2000-06-21 Juergen Vigna <jug@sad.it>
2663 * src/text.C (GetVisibleRow): look if I should clear the area or not
2664 using Inset::doClearArea() function.
2666 * src/insets/lyxinset.h: added doClearArea() function and
2667 modified draw(Painter &, ...) to draw(BufferView *, ...)
2669 * src/text2.C (UpdateInset): return bool insted of int
2671 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2673 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2674 combox in the character popup
2676 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2677 BufferParams const & params
2679 2000-06-20 Juergen Vigna <jug@sad.it>
2681 * src/insets/insettext.C (SetParagraphData): set insetowner on
2684 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2686 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2687 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2689 (form_main_): remove
2691 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2692 (create_form_form_main): remove FD_form_main stuff, connect to
2693 autosave_timeout signal
2695 * src/LyXView.[Ch] (getMainForm): remove
2696 (UpdateTimerCB): remove
2697 * src/BufferView_pimpl.h: inherit from SigC::Object
2699 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2700 signal instead of callback
2702 * src/BufferView.[Ch] (cursorToggleCB): remove
2704 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2706 * src/BufferView_pimpl.C: changes because of the one below
2708 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2709 instead of storing a pointer to a LyXText.
2711 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2713 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2715 * src/lyxparagraph.h
2717 * src/paragraph.C: Changed fontlist to a sorted vector.
2719 2000-06-19 Juergen Vigna <jug@sad.it>
2721 * src/BufferView.h: added screen() function.
2723 * src/insets/insettext.C (LocalDispatch): some selection code
2726 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2728 * src/insets/insettext.C (SetParagraphData):
2730 (InsetText): fixes for multiple paragraphs.
2732 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2734 * development/lyx.spec.in: Call configure with ``--without-warnings''
2735 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2736 This should be fine, however, since we generally don't want to be
2737 verbose when making an RPM.
2739 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2741 * lib/scripts/fig2pstex.py: New file
2743 2000-06-16 Juergen Vigna <jug@sad.it>
2745 * src/insets/insettabular.C (UpdateLocal):
2746 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2747 (LocalDispatch): Changed all functions to use LyXText.
2749 2000-06-15 Juergen Vigna <jug@sad.it>
2751 * src/text.C (SetHeightOfRow): call inset::update before requesting
2754 * src/insets/insettext.C (update):
2755 * src/insets/insettabular.C (update): added implementation
2757 * src/insets/lyxinset.h: added update function
2759 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2761 * src/text.C (SelectNextWord): protect against null pointers with
2762 old-style string streams. (fix from Paul Theo Gonciari
2765 * src/cite.[Ch]: remove erroneous files.
2767 * lib/configure.m4: update the list of created directories.
2769 * src/lyxrow.C: include <config.h>
2770 * src/lyxcursor.C: ditto.
2772 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2774 * lib/examples/decimal.lyx: new example file from Mike.
2776 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2777 to find template definitions (from Dekel)
2779 * src/frontends/.cvsignore: add a few things.
2781 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2783 * src/Timeout.C (TimeOut): remove default argument.
2785 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2788 * src/insets/ExternalTemplate.C: add a "using" directive.
2790 * src/lyx_main.h: remove the act_ struct, which seems unused
2793 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2795 * LyX Developers Meeting: All files changed, due to random C++ (by
2796 coincidence) code generator script.
2798 - external inset (cool!)
2799 - initial online editing of preferences
2800 - insettabular breaks insettext(s contents)
2802 - some DocBook fixes
2803 - example files update
2804 - other cool stuff, create a diff and look for yourself.
2806 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2808 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2809 -1 this is a non-line-breaking textinset.
2811 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2812 if there is no width set.
2814 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2816 * Lots of files: Merged the dialogbase branch.
2818 2000-06-09 Allan Rae <rae@lyx.org>
2820 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2821 and the Dispatch methods that used it.
2823 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2824 access to functions formerly kept in Dispatch.
2826 2000-05-19 Allan Rae <rae@lyx.org>
2828 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2829 made to_page and count_copies integers again. from_page remains a
2830 string however because I want to allow entry of a print range like
2831 "1,4,22-25" using this field.
2833 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2834 and printer-params-get. These aren't useful from the minibuffer but
2835 could be used by a script/LyXServer app provided it passes a suitable
2836 auto_mem_buffer. I guess I should take a look at how the LyXServer
2837 works and make it support xtl buffers.
2839 * sigc++/: updated to libsigc++-1.0.1
2841 * src/xtl/: updated to xtl-1.3.pl.11
2843 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2844 those changes done to the files in src/ are actually recreated when
2845 they get regenerated. Please don't ever accept a patch that changes a
2846 dialog unless that patch includes the changes to the corresponding *.fd
2849 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2850 stringOnlyContains, renamed it and generalised it.
2852 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2853 branch. Removed the remaining old form_print code.
2855 2000-04-26 Allan Rae <rae@lyx.org>
2857 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2858 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2860 2000-04-25 Allan Rae <rae@lyx.org>
2862 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2863 against a base of xtl-1.3.pl.4
2865 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2866 filter the Id: entries so they still show the xtl version number
2869 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2870 into the src/xtl code. Patch still pending with José (XTL)
2872 2000-04-24 Allan Rae <rae@lyx.org>
2874 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2875 both more generic and much safer. Use the new template functions.
2876 * src/buffer.[Ch] (Dispatch): ditto.
2878 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2879 and mem buffer more intelligently. Also a little general cleanup.
2882 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2883 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2884 * src/xtl/Makefile.am: ditto.
2885 * src/xtl/.cvsignore: ditto.
2886 * src/Makefile.am: ditto.
2888 * src/PrinterParams.h: Removed the macros member functions. Added a
2889 testInvariant member function. A bit of tidying up and commenting.
2890 Included Angus's idea for fixing operation with egcs-1.1.2.
2892 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2893 cool expansion of XTL's mem_buffer to support automatic memory
2894 management within the buffer itself. Removed the various macros and
2895 replaced them with template functions that use either auto_mem_buffer
2896 or mem_buffer depending on a #define. The mem_buffer support will
2897 disappear as soon as the auto_mem_buffer is confirmed to be good on
2898 other platforms/compilers. That is, it's there so you've got something
2901 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2902 effectively forked XTL. However I expect José will include my code
2903 into the next major release. Also fixed a memory leak.
2904 * src/xtl/text.h: ditto.
2905 * src/xtl/xdr.h: ditto.
2906 * src/xtl/giop.h: ditto.
2908 2000-04-16 Allan Rae <rae@lyx.org>
2910 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2911 by autogen.sh and removed by maintainer-clean anyway.
2912 * .cvsignore, sigc++/.cvsignore: Support the above.
2914 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2916 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2918 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2919 macros, renamed static callback-target member functions to suit new
2920 scheme and made them public.
2921 * src/frontends/xforms/forms/form_print.fd: ditto.
2922 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2924 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2927 * src/xtl/: New directory containing a minimal distribution of XTL.
2928 This is XTL-1.3.pl.4.
2930 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2932 2000-04-15 Allan Rae <rae@lyx.org>
2934 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2936 * sigc++/: Updated to libsigc++-1.0.0
2938 2000-04-14 Allan Rae <rae@lyx.org>
2940 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2941 use the generic ones in future. I'll modify my conversion script.
2943 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2945 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2946 (CloseAllBufferRelatedDialogs): Renamed.
2947 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2949 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2950 of the generic ones. These are the same ones my conversion script
2953 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2954 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2955 * src/buffer.C (Dispatch): ditto
2957 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2958 functions for updating and hiding buffer dependent dialogs.
2959 * src/BufferView.C (buffer): ditto
2960 * src/buffer.C (setReadonly): ditto
2961 * src/lyxfunc.C (CloseBuffer): ditto
2963 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2964 Dialogs.h, and hence all the SigC stuff, into every file that includes
2965 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2967 * src/BufferView2.C: reduce the number of headers included by buffer.h
2969 2000-04-11 Allan Rae <rae@lyx.org>
2971 * src/frontends/xforms/xform_macros.h: A small collection of macros
2972 for building C callbacks.
2974 * src/frontends/xforms/Makefile.am: Added above file.
2976 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2977 scheme again. This time it should work for JMarc. If this is
2978 successful I'll revise my conversion script to automate some of this.
2979 The static member functions in the class also have to be public for
2980 this scheme will work. If the scheme works (it's almost identical to
2981 the way BufferView::cursorToggleCB is handled so it should work) then
2982 FormCopyright and FormPrint will be ready for inclusion into the main
2983 trunk immediately after 1.1.5 is released -- provided we're prepared
2984 for complaints about lame compilers not handling XTL.
2986 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2988 2000-04-07 Allan Rae <rae@lyx.org>
2990 * config/lyxinclude.m4: A bit more tidying up (Angus)
2992 * src/LString.h: JMarc's <string> header fix
2994 * src/PrinterParams.h: Used string for most data to remove some
2995 ugly code in the Print dialog and avoid even uglier code when
2996 appending the ints to a string for output.
2998 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2999 and moved "default:" back to the end of switch statement. Cleaned
3000 up the printing so it uses the right function calls and so the
3001 "print to file" option actually puts the file in the right directory.
3003 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3005 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3006 and Ok+Apply button control into a separate method: input (Angus).
3007 (input) Cleaned it up and improved it to be very thorough now.
3008 (All CB) static_cast used instead of C style cast (Angus). This will
3009 probably change again once we've worked out how to keep gcc-2.8.1 happy
3010 with real C callbacks.
3011 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3012 ignore some of the bool settings and has random numbers instead. Needs
3013 some more investigation. Added other input length checks and checking
3014 of file and printer names.
3016 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3017 would link (Angus). Seems the old code doesn't compile with the pragma
3018 statement either. Separated callback entries from internal methods.
3020 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3022 2000-03-17 Allan Rae <rae@lyx.org>
3024 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3025 need it? Maybe it could go in Dialogs instead? I could make it a
3026 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3027 values to get the bool return value.
3028 (Dispatch): New overloaded method for xtl support.
3030 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3031 extern "C" callback instead of static member functions. Hopefully,
3032 JMarc will be able to compile this. I haven't changed
3033 forms/form_copyright.fd yet. Breaking one of my own rules already.
3035 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3036 because they aren't useful from the minibuffer. Maybe a LyXServer
3037 might want a help message though?
3039 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3041 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3042 xtl which needs both rtti and exceptions.
3044 * src/support/Makefile.am:
3045 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3047 * src/frontends/xforms/input_validators.[ch]: input filters and
3048 validators. These conrol what keys are valid in input boxes.
3049 Use them and write some more. Much better idea than waiting till
3050 after the user has pressed Ok to say that the input fields don't make
3053 * src/frontends/xforms/Makefile.am:
3054 * src/frontends/xforms/forms/form_print.fd:
3055 * src/frontends/xforms/forms/makefile:
3056 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3057 new scheme. Still have to make sure I haven't missed anything from
3058 the current implementation.
3060 * src/Makefile.am, src/PrinterParams.h: New data store.
3062 * other files: Added a couple of copyright notices.
3064 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3066 * src/insets/insetbib.h: move Holder struct in public space.
3068 * src/frontends/include/DialogBase.h: use SigC:: only when
3069 SIGC_CXX_NAMESPACES is defined.
3070 * src/frontends/include/Dialogs.h: ditto.
3072 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3074 * src/frontends/xforms/FormCopyright.[Ch]: do not
3075 mention SigC:: explicitely.
3077 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3079 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3080 deals with testing KDE in main configure.in
3081 * configure.in: ditto.
3083 2000-02-22 Allan Rae <rae@lyx.org>
3085 * Lots of files: Merged from HEAD
3087 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3088 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3090 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3092 * sigc++/: new minidist.
3094 2000-02-14 Allan Rae <rae@lyx.org>
3096 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3098 2000-02-08 Juergen Vigna <jug@sad.it>
3100 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3101 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3103 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3104 for this port and so it is much easier for other people to port
3105 dialogs in a common development environment.
3107 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3108 the QT/KDE implementation.
3110 * src/frontends/kde/Dialogs.C:
3111 * src/frontends/kde/FormCopyright.C:
3112 * src/frontends/kde/FormCopyright.h:
3113 * src/frontends/kde/Makefile.am:
3114 * src/frontends/kde/formcopyrightdialog.C:
3115 * src/frontends/kde/formcopyrightdialog.h:
3116 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3117 for the kde support of the Copyright-Dialog.
3119 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3120 subdir-substitution instead of hardcoded 'xforms' as we now have also
3123 * src/frontends/include/DialogBase.h (Object): just commented the
3124 label after #endif (nasty warning and I don't like warnings ;)
3126 * src/main.C (main): added KApplication initialization if using
3129 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3130 For now only the KDE event-loop is added if frontend==kde.
3132 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3134 * configure.in: added support for the --with-frontend[=value] option
3136 * autogen.sh: added kde.m4 file to list of config-files
3138 * acconfig.h: added define for KDEGUI-support
3140 * config/kde.m4: added configuration functions for KDE-port
3142 * config/lyxinclude.m4: added --with-frontend[=value] option with
3143 support for xforms and KDE.
3145 2000-02-08 Allan Rae <rae@lyx.org>
3147 * all Makefile.am: Fixed up so the make targets dist, distclean,
3148 install and uninstall all work even if builddir != srcdir. Still
3149 have a new sigc++ minidist update to come.
3151 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3153 2000-02-01 Allan Rae <rae@lyx.org>
3155 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3156 Many mods to get builddir != srcdir working.
3158 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3159 for building on NT and so we can do the builddir != srcdir stuff.
3161 2000-01-30 Allan Rae <rae@lyx.org>
3163 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3164 This will stay in "rae" branch. We probably don't really need it in
3165 the main trunk as anyone who wants to help programming it should get
3166 a full library installed also. So they can check both included and
3167 system supplied library compilation.
3169 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3170 Added a 'mini' distribution of libsigc++. If you feel the urge to
3171 change something in these directories - Resist it. If you can't
3172 resist the urge then you should modify the following script and rebuild
3173 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3174 all happen. Still uses a hacked version of libsigc++'s configure.in.
3175 I'm quite happy with the results. I'm not sure the extra work to turn
3176 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3177 worth the trouble and would probably lead to extra maintenance
3179 I haven't tested the following important make targets: install, dist.
3180 Not ready for prime time but very close. Maybe 1.1.5.
3182 * development/tools/makeLyXsigc.sh: A shell script to automatically
3183 generate our mini-dist of libsigc++. It can only be used with a CVS
3184 checkout of libsigc++ not a tarball distribution. It's well commented.
3185 This will end up as part of the libsigc++ distribution so other apps
3186 can easily have an included mini-dist. If someone makes mods to the
3187 sigc++ subpackage without modifying this script to generate those
3188 changes I'll be very upset!
3190 * src/frontends/: Started the gui/system indep structure.
3192 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3193 to access the gui-indep dialogs are in this class. Much improved
3194 design compared to previous revision. Lars, please refrain from
3195 moving this header into src/ like you did with Popups.h last time.
3197 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3199 * src/frontends/xforms/: Started the gui-indep system with a single
3200 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3203 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3204 Here you'll find a very useful makefile and automated fdfix.sh that
3205 makes updating dailogs a no-brainer -- provided you follow the rules
3206 set out in the README. I'm thinking about adding another script to
3207 automatically generate skeleton code for a new dialog given just the
3210 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3211 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3212 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3214 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3216 * src/support/LSubstring.C (operator): simplify
3218 * src/lyxtext.h: removed bparams, use buffer_->params instead
3220 * src/lyxrow.h: make Row a real class, move all variables to
3221 private and use accessors.
3223 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3225 (isRightToLeftPar): ditto
3226 (ChangeLanguage): ditto
3227 (isMultiLingual): ditto
3230 (SimpleTeXOnePar): ditto
3231 (TeXEnvironment): ditto
3232 (GetEndLabel): ditto
3234 (SetOnlyLayout): ditto
3235 (BreakParagraph): ditto
3236 (BreakParagraphConservative): ditto
3237 (GetFontSettings): ditto
3239 (CopyIntoMinibuffer): ditto
3240 (CutIntoMinibuffer): ditto
3241 (PasteParagraph): ditto
3242 (SetPExtraType): ditto
3243 (UnsetPExtraType): ditto
3244 (DocBookContTableRows): ditto
3245 (SimpleDocBookOneTablePar): ditto
3247 (TeXFootnote): ditto
3248 (SimpleTeXOneTablePar): ditto
3249 (TeXContTableRows): ditto
3250 (SimpleTeXSpecialChars): ditto
3253 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3254 to private and use accessors.
3256 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3257 this, we did not use it anymore and has not been for ages. Just a
3258 waste of cpu cycles.
3260 * src/language.h: make Language a real class, move all variables
3261 to private and use accessors.
3263 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3264 (create_view): remove
3265 (update): some changes for new timer
3266 (cursorToggle): use new timer
3267 (beforeChange): change for new timer
3269 * src/BufferView.h (cursorToggleCB): removed last paramter because
3272 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3273 (cursorToggleCB): change because of new timer code
3275 * lib/CREDITS: updated own mailaddress
3277 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3279 * src/support/filetools.C (PutEnv): fix the code in case neither
3280 putenv() nor setenv() have been found.
3282 * INSTALL: mention the install-strip Makefile target.
3284 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3285 read-only documents.
3287 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3289 * lib/reLyX/configure.in (VERSION): avoid using a previously
3290 generated reLyX wrapper to find out $prefix.
3292 * lib/examples/eu_adibide_lyx-atua.lyx:
3293 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3294 translation of the Tutorial (Dooteo)
3296 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3298 * forms/cite.fd: new citation dialog
3300 * src/insetcite.[Ch]: the new citation dialog is moved into
3303 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3306 * src/insets/insetcommand.h: data members made private.
3308 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3310 * LyX 1.1.5 released
3312 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3314 * src/version.h (LYX_RELEASE): to 1.1.5
3316 * src/spellchecker.C (RunSpellChecker): return false if the
3317 spellchecker dies upon creation.
3319 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3321 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3322 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3326 * lib/CREDITS: update entry for Martin Vermeer.
3328 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3330 * src/text.C (draw): Draw foreign language bars at the bottom of
3331 the row instead of at the baseline.
3333 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3335 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3337 * lib/bind/de_menus.bind: updated
3339 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3341 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3343 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3345 * src/menus.C (Limit_string_length): New function
3346 (ShowTocMenu): Limit the number of items/length of items in the
3349 * src/paragraph.C (String): Correct result for a paragraph inside
3352 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3354 * src/bufferlist.C (close): test of buf->getuser() == NULL
3356 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3358 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3359 Do not call to SetCursor when the paragraph is a closed footnote!
3361 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3363 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3366 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3368 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3371 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3372 reference popup, that activates the reference-back action
3374 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3376 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3377 the menus. Also fixed a bug.
3379 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3380 the math panels when switching buffers (unless new buffer is readonly).
3382 * src/BufferView.C (NoSavedPositions)
3383 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3385 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3387 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3388 less of dvi dirty or not.
3390 * src/trans_mgr.[Ch] (insert): change first parameter to string
3393 * src/chset.[Ch] (encodeString): add const to first parameter
3395 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3397 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3401 * src/LaTeX.C (deplog): better searching for dependency files in
3402 the latex log. Uses now regexps.
3404 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3405 instead of the box hack or \hfill.
3407 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3409 * src/lyxfunc.C (doImportHelper): do not create the file before
3410 doing the actual import.
3411 (doImportASCIIasLines): create a new file before doing the insert.
3412 (doImportASCIIasParagraphs): ditto.
3414 * lib/lyxrc.example: remove mention of non-existing commands
3416 * lyx.man: remove mention of color-related switches.
3418 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3420 * src/lyx_gui.C: remove all the color-related ressources, which
3421 are not used anymore.
3423 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3426 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3428 * src/lyxrc.C (read): Add a missing break in the switch
3430 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3432 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3434 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3437 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3439 * src/text.C (draw): draw bars under foreign language words.
3441 * src/LColor.[Ch]: add LColor::language
3443 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3445 * src/lyxcursor.h (boundary): New member variable
3447 * src/text.C (IsBoundary): New methods
3449 * src/text.C: Use the above for currect cursor movement when there
3450 is both RTL & LTR text.
3452 * src/text2.C: ditto
3454 * src/bufferview_funcs.C (ToggleAndShow): ditto
3456 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3458 * src/text.C (DeleteLineForward): set selection to true to avoid
3459 that DeleteEmptyParagraphMechanism does some magic. This is how it
3460 is done in all other functions, and seems reasonable.
3461 (DeleteWordForward): do not jump over non-word stuff, since
3462 CursorRightOneWord() already does it.
3464 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3465 DeleteWordBackward, since they seem safe to me (since selection is
3466 set to "true") DeleteEmptyParagraphMechanism does nothing.
3468 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3470 * src/lyx_main.C (easyParse): simplify the code by factoring the
3471 part that removes parameters from the command line.
3472 (LyX): check wether wrong command line options have been given.
3474 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3476 * src/lyx_main.C : add support for specifying user LyX
3477 directory via command line option -userdir.
3479 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3481 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3482 the number of items per popup.
3483 (Add_to_refs_menu): Ditto.
3485 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3487 * src/lyxparagraph.h: renamed ClearParagraph() to
3488 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3489 textclass as parameter, and do nothing if free_spacing is
3490 true. This fixes part of the line-delete-forward problems.
3492 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3493 (pasteSelection): ditto.
3494 (SwitchLayoutsBetweenClasses): more translatable strings.
3496 * src/text2.C (CutSelection): use StripLeadingSpaces.
3497 (PasteSelection): ditto.
3498 (DeleteEmptyParagraphMechanism): ditto.
3500 2000-05-26 Juergen Vigna <jug@sad.it>
3502 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3503 is not needed in tabular insets.
3505 * src/insets/insettabular.C (TabularFeatures): added missing features.
3507 * src/tabular.C (DeleteColumn):
3509 (AppendRow): implemented this functions
3510 (cellsturct::operator=): clone the inset too;
3512 2000-05-23 Juergen Vigna <jug@sad.it>
3514 * src/insets/insettabular.C (LocalDispatch): better selection support
3515 when having multicolumn-cells.
3517 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3519 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3521 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3523 * src/ColorHandler.C (getGCForeground): put more test into _()
3525 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3528 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3531 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3533 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3534 there are no labels, or when buffer is readonly.
3536 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3537 there are no labels, buffer is SGML, or when buffer is readonly.
3539 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3541 * src/LColor.C (LColor): change a couple of grey40 to grey60
3542 (LColor): rewore initalization to make compiles go some magnitude
3544 (getGUIName): don't use gettext until we need the string.
3546 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3548 * src/Bullet.[Ch]: Fixed a small bug.
3550 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3552 * src/paragraph.C (String): Several fixes/improvements
3554 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3556 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3558 * src/paragraph.C (String): give more correct output.
3560 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3562 * src/lyxfont.C (stateText) Do not output the language if it is
3563 eqaul to the language of the document.
3565 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3566 between two paragraphs with the same language.
3568 * src/paragraph.C (getParLanguage) Return a correct answer for an
3569 empty dummy paragraph.
3571 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3574 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3577 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3578 the menus/popup, if requested fonts are unavailable.
3580 2000-05-22 Juergen Vigna <jug@sad.it>
3582 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3583 movement support (Up/Down/Tab/Shift-Tab).
3584 (LocalDispatch): added also preliminari cursor-selection.
3586 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3588 * src/paragraph.C (PasteParagraph): Hopefully now right!
3590 2000-05-22 Garst R. Reese <reese@isn.net>
3592 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3593 of list, change all references to Environment to Command
3594 * tex/hollywood.cls : rewrite environments as commands, add
3595 \uppercase to interiorshot and exteriorshot to force uppecase.
3596 * tex/broadway.cls : rewrite environments as commands. Tweak
3599 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3601 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3602 size of items: use a constant intead of the hardcoded 40, and more
3603 importantly do not remove the %m and %x tags added at the end.
3604 (Add_to_refs_menu): use vector::size_type instead of
3605 unsigned int as basic types for the variables. _Please_ do not
3606 assume that size_t is equal to unsigned int. On an alpha, this is
3607 unsigned long, which is _not_ the same.
3609 * src/language.C (initL): remove language "hungarian", since it
3610 seems that "magyar" is better.
3612 2000-05-22 Juergen Vigna <jug@sad.it>
3614 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3616 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3619 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3620 next was deleted but not set to 0.
3622 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3624 * src/language.C (initL): change the initialization of languages
3625 so that compiles goes _fast_.
3627 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3630 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3632 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3636 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3638 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3640 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3644 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3647 * src/insets/insetlo*.[Ch]: Made editable
3649 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3651 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3652 the current selection.
3654 * src/BufferView_pimpl.C (stuffClipboard): new method
3656 * src/BufferView.C (stuffClipboard): new method
3658 * src/paragraph.C (String): new method
3660 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3661 LColor::ignore when lyxname is not found.
3663 * src/BufferView.C (pasteSelection): new method
3665 * src/BufferView_pimpl.C (pasteSelection): new method
3667 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3669 * src/WorkArea.C (request_clipboard_cb): new static function
3670 (getClipboard): new method
3671 (putClipboard): new method
3673 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3675 * LyX 1.1.5pre2 released
3677 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3679 * src/vspace.C (operator=): removed
3680 (operator=): removed
3682 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3684 * src/layout.C (NumberOfClass): manually set the type in make_pair
3685 (NumberOfLayout): ditto
3687 * src/language.C: use the Language constructor for ignore_lang
3689 * src/language.h: add constructors to struct Language
3691 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3693 * src/text2.C (SetCursorIntern): comment out #warning
3695 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3697 * src/mathed/math_iter.h: initialize sx and sw to 0
3699 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3701 * forms/lyx.fd: Redesign of form_ref
3703 * src/LaTeXFeatures.[Ch]
3707 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3710 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3711 and Buffer::inset_iterator.
3713 * src/menus.C: Added new menus: TOC and Refs.
3715 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3717 * src/buffer.C (getTocList): New method.
3719 * src/BufferView2.C (ChangeRefs): New method.
3721 * src/buffer.C (getLabelList): New method. It replaces the old
3722 getReferenceList. The return type is vector<string> instead of
3725 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3726 the old getLabel() and GetNumberOfLabels() methods.
3727 * src/insets/insetlabel.C (getLabelList): ditto
3728 * src/mathed/formula.C (getLabelList): ditto
3730 * src/paragraph.C (String): New method.
3732 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3733 Uses the new getTocList() method.
3734 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3735 which automatically updates the contents of the browser.
3736 (RefUpdateCB): Use the new getLabelList method.
3738 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3740 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3742 * src/spellchecker.C: Added using std::reverse;
3744 2000-05-19 Juergen Vigna <jug@sad.it>
3746 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3748 * src/insets/insettext.C (computeTextRows): small fix for display of
3749 1 character after a newline.
3751 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3754 2000-05-18 Juergen Vigna <jug@sad.it>
3756 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3757 when changing width of column.
3759 * src/tabular.C (set_row_column_number_info): setting of
3760 autobreak rows if necessary.
3762 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3764 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3766 * src/vc-backend.*: renamed stat() to status() and vcstat to
3767 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3768 compilation broke. The new name seems more relevant, anyway.
3770 2000-05-17 Juergen Vigna <jug@sad.it>
3772 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3773 which was wrong if the removing caused removing of rows!
3775 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3776 (pushToken): new function.
3778 * src/text2.C (CutSelection): fix problem discovered with purify
3780 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3782 * src/debug.C (showTags): enlarge the first column, now that we
3783 have 6-digits debug codes.
3785 * lib/layouts/hollywood.layout:
3786 * lib/tex/hollywood.cls:
3787 * lib/tex/brodway.cls:
3788 * lib/layouts/brodway.layout: more commands and fewer
3789 environments. Preambles moved in the .cls files. Broadway now has
3790 more options on scene numbering and less whitespace (from Garst)
3792 * src/insets/insetbib.C (getKeys): make sure that we are in the
3793 document directory, in case the bib file is there.
3795 * src/insets/insetbib.C (Latex): revert bogus change.
3797 2000-05-16 Juergen Vigna <jug@sad.it>
3799 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3800 the TabularLayout on cursor move.
3802 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3804 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3807 (draw): fixed cursor position and drawing so that the cursor is
3808 visible when before the tabular-inset.
3810 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3811 when creating from old insettext.
3813 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3815 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3817 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3818 * lib/tex/brodway.cls: ditto
3820 * lib/layouts/brodway.layout: change alignment of parenthical
3823 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3825 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3826 versions 0.88 and 0.89 are supported.
3828 2000-05-15 Juergen Vigna <jug@sad.it>
3830 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3833 * src/insets/insettext.C (computeTextRows): redone completely this
3834 function in a much cleaner way, because of problems when having a
3836 (draw): added a frame border when the inset is locked.
3837 (SetDrawLockedFrame): this sets if we draw the border or not.
3838 (SetFrameColor): this sets the frame color (default=insetframe).
3840 * src/insets/lyxinset.h: added x() and y() functions which return
3841 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3842 function which is needed to see if we have a locking inset of some
3843 type in this inset (needed for now in insettabular).
3845 * src/vspace.C (inPixels): the same function also without a BufferView
3846 parameter as so it is easier to use it in some ocasions.
3848 * src/lyxfunc.C: changed all places where insertInset was used so
3849 that now if it couldn't be inserted it is deleted!
3851 * src/TabularLayout.C:
3852 * src/TableLayout.C: added support for new tabular-inset!
3854 * src/BufferView2.C (insertInset): this now returns a bool if the
3855 inset was really inserted!!!
3857 * src/tabular.C (GetLastCellInRow):
3858 (GetFirstCellInRow): new helper functions.
3859 (Latex): implemented for new tabular class.
3863 (TeXTopHLine): new Latex() helper functions.
3865 2000-05-12 Juergen Vigna <jug@sad.it>
3867 * src/mathed/formulamacro.C (Read):
3868 * src/mathed/formula.C (Read): read also the \end_inset here!
3870 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3872 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3873 crush when saving formulae with unbalanced parenthesis.
3875 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3877 * src/layout.C: Add new keyword "endlabelstring" to layout file
3879 * src/text.C (GetVisibleRow): Draw endlabel string.
3881 * lib/layouts/broadway.layout
3882 * lib/layouts/hollywood.layout: Added endlabel for the
3883 Parenthetical layout.
3885 * lib/layouts/heb-article.layout: Do not use slanted font shape
3886 for Theorem like environments.
3888 * src/buffer.C (makeLaTeXFile): Always add "american" to
3889 the UsedLanguages list if document language is RTL.
3891 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3893 * add addendum to README.OS2 and small patch (from SMiyata)
3895 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3897 * many files: correct the calls to ChangeExtension().
3899 * src/support/filetools.C (ChangeExtension): remove the no_path
3900 argument, which does not belong there. Use OnlyFileName() instead.
3902 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3903 files when LaTeXing a non-nice latex file.
3905 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3906 a chain of "if". Return false when deadkeys are not handled.
3908 * src/lyx_main.C (LyX): adapted the code for default bindings.
3910 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3911 bindings for basic functionality (except deadkeys).
3912 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3914 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3915 several methods: handle override_x_deadkeys.
3917 * src/lyxrc.h: remove the "bindings" map, which did not make much
3918 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3920 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3922 * src/lyxfont.C (stateText): use a saner method to determine
3923 whether the font is "default". Seems to fix the crash with DEC
3926 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3928 2000-05-08 Juergen Vigna <jug@sad.it>
3930 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3931 TabularLayoutMenu with mouse-button-3
3932 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3934 * src/TabularLayout.C: added this file for having a Layout for
3937 2000-05-05 Juergen Vigna <jug@sad.it>
3939 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3940 recalculating inset-widths.
3941 (TabularFeatures): activated this function so that I can change
3942 tabular-features via menu.
3944 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3945 that I can test some functions with the Table menu.
3947 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3949 * src/lyxfont.C (stateText): guard against stupid c++libs.
3951 * src/tabular.C: add using std::vector
3952 some whitespace changes, + removed som autogenerated code.
3954 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3956 2000-05-05 Juergen Vigna <jug@sad.it>
3958 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3959 row, columns and cellstructures.
3961 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3963 * lib/lyxrc.example: remove obsolete entries.
3965 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3966 reading of protected_separator for free_spacing.
3968 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3970 * src/text.C (draw): do not display an exclamation mark in the
3971 margin for margin notes. This is confusing, ugly and
3974 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3975 AMS math' is checked.
3977 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3978 name to see whether including the amsmath package is needed.
3980 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3982 * src/paragraph.C (validate): Compute UsedLanguages correctly
3983 (don't insert the american language if it doesn't appear in the
3986 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3987 The argument of \thanks{} command is considered moving argument
3989 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3992 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3994 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3995 for appendix/minipage/depth. The lines can be now both in the footnote
3996 frame, and outside the frame.
3998 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4001 2000-05-05 Juergen Vigna <jug@sad.it>
4003 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4004 neede only in tabular.[Ch].
4006 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4008 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4010 (Write): write '~' for PROTECTED_SEPARATOR
4012 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4014 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4017 * src/mathed/formula.C (drawStr): rename size to siz.
4019 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4020 possibly fix a bug by not changing the pflags = flags to piflags =
4023 2000-05-05 Juergen Vigna <jug@sad.it>
4025 * src/insets/insetbib.C: moved using directive
4027 * src/ImportNoweb.C: small fix for being able to compile (missing
4030 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4032 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4033 to use clear, since we don't depend on this in the code. Add test
4036 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4038 * (various *.C files): add using std::foo directives to please dec
4041 * replace calls to string::clear() to string::erase() (Angus)
4043 * src/cheaders/cmath: modified to provide std::abs.
4045 2000-05-04 Juergen Vigna <jug@sad.it>
4047 * src/insets/insettext.C: Prepared all for inserting of multiple
4048 paragraphs. Still display stuff to do (alignment and other things),
4049 but I would like to use LyXText to do this when we cleaned out the
4050 table-support stuff.
4052 * src/insets/insettabular.C: Changed lot of stuff and added lots
4053 of functionality still a lot to do.
4055 * src/tabular.C: Various functions changed name and moved to be
4056 const functions. Added new Read and Write functions and changed
4057 lots of things so it works good with tabular-insets (also removed
4058 some stuff which is not needed anymore * hacks *).
4060 * src/lyxcursor.h: added operators == and != which just look if
4061 par and pos are (not) equal.
4063 * src/buffer.C (latexParagraphs): inserted this function to latex
4064 all paragraphs form par to endpar as then I can use this too for
4067 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4068 so that I can call this to from text insets with their own cursor.
4070 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4071 output off all paragraphs (because of the fix below)!
4073 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4074 the very last paragraph (this could be also the last paragraph of an
4077 * src/texrow.h: added rows() call which returns the count-variable.
4079 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4081 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4083 * lib/configure.m4: better autodetection of DocBook tools.
4085 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4087 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4089 * src/lyx_cb.C: add using std::reverse;
4091 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4094 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4095 selected files. Should fix repeated errors from generated files.
4097 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4099 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4101 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4102 the spellchecker popup.
4104 * lib/lyxrc.example: Removed the \number_inset section
4106 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4108 * src/insets/figinset.C (various): Use IsFileReadable() to make
4109 sure that the file actually exist. Relying on ghostscripts errors
4110 is a bad idea since they can lead to X server crashes.
4112 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4114 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4117 * lib/lyxrc.example: smallish typo in description of
4118 \view_dvi_paper_option
4120 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4123 * src/lyxfunc.C: doImportHelper to factor out common code of the
4124 various import methods. New functions doImportASCIIasLines,
4125 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4126 doImportLinuxDoc for the format specific parts.
4129 * buffer.C: Dispatch returns now a bool to indicate success
4132 * lyx_gui.C: Add getLyXView() for member access
4134 * lyx_main.C: Change logic for batch commands: First try
4135 Buffer::Dispatch (possibly without GUI), if that fails, use
4138 * lyx_main.C: Add support for --import command line switch.
4139 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4140 Available Formats: Everything accepted by 'buffer-import <format>'
4142 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4144 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4147 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4148 documents will be reformatted upon reentry.
4150 2000-04-27 Juergen Vigna <jug@sad.it>
4152 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4153 correctly only last pos this was a bug.
4155 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4157 * release of lyx-1.1.5pre1
4159 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4161 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4163 * src/menus.C: revert the change of naming (Figure->Graphic...)
4164 from 2000-04-11. It was incomplete and bad.
4166 * src/LColor.[Ch]: add LColor::depthbar.
4167 * src/text.C (GetVisibleRow): use it.
4169 * README: update the languages list.
4171 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4173 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4176 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4178 * README: remove sections that were just wrong.
4180 * src/text2.C (GetRowNearY): remove currentrow code
4182 * src/text.C (GetRow): remove currentrow code
4184 * src/screen.C (Update): rewritten a bit.
4185 (SmallUpdate): removed func
4187 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4189 (FullRebreak): return bool
4190 (currentrow): remove var
4191 (currentrow_y): ditto
4193 * src/lyxscreen.h (Draw): change arg to unsigned long
4194 (FitCursor): return bool
4195 (FitManualCursor): ditto
4196 (Smallpdate): remove func
4197 (first): change to unsigned long
4198 (DrawOneRow): change second arg to long (from long &)
4199 (screen_refresh_y): remove var
4200 (scree_refresh_row): ditto
4202 * src/lyxrow.h: change baseline to usigned int from unsigned
4203 short, this brings some implicit/unsigned issues out in the open.
4205 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4207 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4208 instead of smallUpdate.
4210 * src/lyxcursor.h: change y to unsigned long
4212 * src/buffer.h: don't call updateScrollbar after fitcursor
4214 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4215 where they are used. Removed "\\direction", this was not present
4216 in 1.1.4 and is already obsolete. Commented out some code that I
4217 believe to never be called.
4218 (runLiterate): don't call updateScrollbar after fitCursor
4220 (buildProgram): ditto
4223 * src/WorkArea.h (workWidth): change return val to unsigned
4226 (redraw): remove the button redraws
4227 (setScrollbarValue): change for scrollbar
4228 (getScrollbarValue): change for scrollbar
4229 (getScrollbarBounds): change for scrollbar
4231 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4232 (C_WorkArea_down_cb): removed func
4233 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4234 (resize): change for scrollbar
4235 (setScrollbar): ditto
4236 (setScrollbarBounds): ditto
4237 (setScrollbarIncrements): ditto
4238 (up_cb): removed func
4239 (down_cb): removed func
4240 (scroll_cb): change for scrollbar
4241 (work_area_handler): ditto
4243 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4244 when FitCursor did something.
4245 (updateScrollbar): some unsigned changes
4246 (downCB): removed func
4247 (scrollUpOnePage): removed func
4248 (scrollDownOnePage): remvoed func
4249 (workAreaMotionNotify): don't call screen->FitCursor but use
4250 fitCursor instead. and bool return val
4251 (workAreaButtonPress): ditto
4252 (workAreaButtonRelease): some unsigned changes
4253 (checkInsetHit): ditto
4254 (workAreaExpose): ditto
4255 (update): parts rewritten, comments about the signed char arg added
4256 (smallUpdate): removed func
4257 (cursorPrevious): call needed updateScrollbar
4260 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4263 * src/BufferView.[Ch] (upCB): removed func
4264 (downCB): removed func
4265 (smallUpdate): removed func
4267 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4269 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4270 currentrow, currentrow_y optimization. This did not help a lot and
4271 if we want to do this kind of optimization we should rather use
4272 cursor.row instead of the currentrow.
4274 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4275 buffer spacing and klyx spacing support.
4277 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4279 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4282 2000-04-26 Juergen Vigna <jug@sad.it>
4284 * src/insets/figinset.C: fixes to Lars sstream changes!
4286 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4288 * A lot of files: Added Ascii(ostream &) methods to all inset
4289 classes. Used when exporting to ASCII.
4291 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4292 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4295 * src/text2.C (ToggleFree): Disabled implicit word selection when
4296 there is a change in the language
4298 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4299 no output was generated for end-of-sentence inset.
4301 * src/insets/lyxinset.h
4304 * src/paragraph.C: Removed the insetnumber code
4306 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4308 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4310 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4311 no_babel and no_epsfig completely from the file.
4312 (parseSingleLyXformat2Token): add handling for per-paragraph
4313 spacing as written by klyx.
4315 * src/insets/figinset.C: applied patch by Andre. Made it work with
4318 2000-04-20 Juergen Vigna <jug@sad.it>
4320 * src/insets/insettext.C (cutSelection):
4321 (copySelection): Fixed with selection from right to left.
4322 (draw): now the rows are not recalculated at every draw.
4323 (computeTextRows): for now reset the inset-owner here (this is
4324 important for an undo or copy where the inset-owner is not set
4327 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4328 motion to the_locking_inset screen->first was forgotten, this was
4329 not important till we got multiline insets.
4331 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4333 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4334 code seems to be alright (it is code changed by Dekel, and the
4335 intent is indeed that all macros should be defined \protect'ed)
4337 * NEWS: a bit of reorganisation of the new user-visible features.
4339 2000-04-19 Juergen Vigna <jug@sad.it>
4341 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4342 position. Set the inset_owner of the used paragraph so that it knows
4343 that it is inside an inset. Fixed cursor handling with mouse and
4344 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4345 and cleanups to make TextInsets work better.
4347 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4348 Changed parameters of various functions and added LockInsetInInset().
4350 * src/insets/insettext.C:
4352 * src/insets/insetcollapsable.h:
4353 * src/insets/insetcollapsable.C:
4354 * src/insets/insetfoot.h:
4355 * src/insets/insetfoot.C:
4356 * src/insets/insetert.h:
4357 * src/insets/insetert.C: cleaned up the code so that it works now
4358 correctly with insettext.
4360 * src/insets/inset.C:
4361 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4362 that insets in insets are supported right.
4365 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4367 * src/paragraph.C: some small fixes
4369 * src/debug.h: inserted INSETS debug info
4371 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4372 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4374 * src/commandtags.h:
4375 * src/LyXAction.C: insert code for InsetTabular.
4377 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4378 not Button1MotionMask.
4379 (workAreaButtonRelease): send always a InsetButtonRelease event to
4381 (checkInsetHit): some setCursor fixes (always with insets).
4383 * src/BufferView2.C (lockInset): returns a bool now and extended for
4384 locking insets inside insets.
4385 (showLockedInsetCursor): it is important to have the cursor always
4386 before the locked inset.
4387 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4389 * src/BufferView.h: made lockInset return a bool.
4391 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4393 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4394 that is used also internally but can be called as public to have back
4395 a cursor pos which is not set internally.
4396 (SetCursorIntern): Changed to use above function.
4398 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4400 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4405 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4406 patches for things that should be in or should be changed.
4408 * src/* [insetfiles]: change "usigned char fragile" to bool
4409 fragile. There was only one point that could that be questioned
4410 and that is commented in formulamacro.C. Grep for "CHECK".
4412 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4413 (DeleteBuffer): take it out of CutAndPaste and make it static.
4415 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4417 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4418 output the spacing envir commands. Also the new commands used in
4419 the LaTeX output makes the result better.
4421 * src/Spacing.C (writeEnvirBegin): new method
4422 (writeEnvirEnd): new method
4424 2000-04-18 Juergen Vigna <jug@sad.it>
4426 * src/CutAndPaste.C: made textclass a static member of the class
4427 as otherwise it is not accesed right!!!
4429 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4431 * forms/layout_forms.fd
4432 * src/layout_forms.h
4433 * src/layout_forms.C (create_form_form_character)
4434 * src/lyx_cb.C (UserFreeFont)
4435 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4436 documents (in the layout->character popup).
4438 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4440 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4441 \spell_command was in fact not honored (from Kevin Atkinson).
4443 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4446 * src/lyx_gui.h: make lyxViews private (Angus)
4448 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4450 * src/mathed/math_write.C
4451 (MathMatrixInset::Write) Put \protect before \begin{array} and
4452 \end{array} if fragile
4453 (MathParInset::Write): Put \protect before \\ if fragile
4455 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4457 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4458 initialization if the LyXColorHandler must be done after the
4459 connections to the XServer has been established.
4461 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4462 get the background pixel from the lyxColorhandler so that the
4463 figures are rendered with the correct background color.
4464 (NextToken): removed functions.
4465 (GetPSSizes): use ifs >> string instead of NextToken.
4467 * src/Painter.[Ch]: the color cache moved out of this file.
4469 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4472 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4474 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4475 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4477 * src/BufferView.C (enterView): new func
4478 (leaveView): new func
4480 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4482 (leaveView): new func, undefines xterm cursor when approp.
4484 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4485 (AllowInput): delete the Workarea cursor handling from this func.
4487 * src/Painter.C (underline): draw a slimer underline in most cases.
4489 * src/lyx_main.C (error_handler): use extern "C"
4491 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4493 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4494 sent directly to me.
4496 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4497 to the list by Dekel.
4499 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4502 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4503 methods from lyx_cb.here.
4505 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4508 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4510 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4511 instead of using current_view directly.
4513 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4515 * src/LyXAction.C (init): add the paragraph-spacing command.
4517 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4519 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4521 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4522 different from the documents.
4524 * src/text.C (SetHeightOfRow): take paragraph spacing into
4525 account, paragraph spacing takes precedence over buffer spacing
4526 (GetVisibleRow): ditto
4528 * src/paragraph.C (writeFile): output the spacing parameter too.
4529 (validate): set the correct features if spacing is used in the
4531 (Clear): set spacing to default
4532 (MakeSameLayout): spacing too
4533 (HasSameLayout): spacing too
4534 (SetLayout): spacing too
4535 (TeXOnePar): output the spacing commands
4537 * src/lyxparagraph.h: added a spacing variable for use with
4538 per-paragraph spacing.
4540 * src/Spacing.h: add a Default spacing and a method to check if
4541 the current spacing is default. also added an operator==
4543 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4546 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4548 * src/lyxserver.C (callback): fix dispatch of functions
4550 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4551 printf() into lyxerr call.
4553 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4556 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4557 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4558 the "Float" from each of the subitems.
4559 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4561 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4562 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4563 documented the change so that the workaround can be nuked later.
4565 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4568 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4570 * src/buffer.C (getLatexName): ditto
4571 (setReadonly): ditto
4573 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4575 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4576 avoid some uses of current_view. Added also a bufferParams()
4577 method to get at this.
4579 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4581 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4583 * src/lyxparagraph.[Ch]: removed
4584 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4585 with operators used by lower_bound and
4586 upper_bound in InsetTable's
4587 Make struct InsetTable private again. Used matchpos.
4589 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4591 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4592 document, the language of existing text is changed (unless the
4593 document is multi-lingual)
4595 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4597 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4599 * A lot of files: A rewrite of the Right-to-Left support.
4601 2000-04-10 Juergen Vigna <jug@sad.it>
4603 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4604 misplaced cursor when inset in inset is locked.
4606 * src/insets/insettext.C (LocalDispatch): small fix so that a
4607 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4609 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4610 footnote font should be decreased in size twice when displaying.
4612 * src/insets/insettext.C (GetDrawFont): inserted this function as
4613 the drawing-font may differ from the real paragraph font.
4615 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4616 insets (inset in inset!).
4618 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4619 function here because we don't want footnotes inside footnotes.
4621 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4623 (init): now set the inset_owner in paragraph.C
4624 (LocalDispatch): added some resetPos() in the right position
4627 (pasteSelection): changed to use the new CutAndPaste-Class.
4629 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4630 which tells if it is allowed to insert another inset inside this one.
4632 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4633 SwitchLayoutsBetweenClasses.
4635 * src/text2.C (InsertInset): checking of the new paragraph-function
4637 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4638 is not needed anymore here!
4641 (PasteSelection): redone (also with #ifdef) so that now this uses
4642 the CutAndPaste-Class.
4643 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4646 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4647 from/to text/insets.
4649 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4650 so that the paragraph knows if it is inside an (text)-inset.
4651 (InsertFromMinibuffer): changed return-value to bool as now it
4652 may happen that an inset is not inserted in the paragraph.
4653 (InsertInsetAllowed): this checks if it is allowed to insert an
4654 inset in this paragraph.
4656 (BreakParagraphConservative):
4657 (BreakParagraph) : small change for the above change of the return
4658 value of InsertFromMinibuffer.
4660 * src/lyxparagraph.h: added inset_owner and the functions to handle
4661 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4663 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4665 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4666 functions from BufferView to BufferView::Pimpl to ease maintence.
4668 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4669 correctly. Also use SetCursorIntern instead of SetCursor.
4671 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4674 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4676 * src/WorkArea.C (belowMouse): manually implement below mouse.
4678 * src/*: Add "explicit" on several constructors, I added probably
4679 some unneeded ones. A couple of changes to code because of this.
4681 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4682 implementation and private parts from the users of BufferView. Not
4685 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4686 implementation and private parts from the users of LyXLex. Not
4689 * src/BufferView_pimpl.[Ch]: new files
4691 * src/lyxlex_pimpl.[Ch]: new files
4693 * src/LyXView.[Ch]: some inline functions move out-of-line
4695 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4697 * src/lyxparagraph.h: make struct InsetTable public.
4699 * src/support/lyxstring.h: change lyxstring::difference_type to be
4700 ptrdiff_t. Add std:: modifiers to streams.
4702 * src/font.C: include the <cctype> header, for islower() and
4705 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4707 * src/font.[Ch]: new files. Contains the metric functions for
4708 fonts, takes a LyXFont as parameter. Better separation of concepts.
4710 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4711 changes because of this.
4713 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4715 * src/*: compile with -Winline and move functions that don't
4718 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4721 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4723 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4724 (various files changed because of this)
4726 * src/Painter.C (text): fixed the drawing of smallcaps.
4728 * src/lyxfont.[Ch] (drawText): removed unused member func.
4731 * src/*.C: added needed "using" statements and "std::" qualifiers.
4733 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4735 * src/*.h: removed all use of "using" from header files use
4736 qualifier std:: instead.
4738 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4740 * src/text.C (Backspace): some additional cleanups (we already
4741 know whether cursor.pos is 0 or not).
4743 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4744 automake does not provide one).
4746 * src/bmtable.h: replace C++ comments with C comments.
4748 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4750 * src/screen.C (ShowCursor): Change the shape of the cursor if
4751 the current language is not equal to the language of the document.
4752 (If the cursor change its shape unexpectedly, then you've found a bug)
4754 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4757 * src/insets/insetnumber.[Ch]: New files.
4759 * src/LyXAction.C (init)
4760 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4763 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4765 * src/lyxparagraph.h
4766 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4767 (the vector is kept sorted).
4769 * src/text.C (GetVisibleRow): Draw selection correctly when there
4770 is both LTR and RTL text.
4772 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4773 which is much faster.
4775 * src/text.C (GetVisibleRow and other): Do not draw the last space
4776 in a row if the direction of the last letter is not equal to the
4777 direction of the paragraph.
4779 * src/lyxfont.C (latexWriteStartChanges):
4780 Check that font language is not equal to basefont language.
4781 (latexWriteEndChanges): ditto
4783 * src/lyx_cb.C (StyleReset): Don't change the language while using
4784 the font-default command.
4786 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4787 empty paragraph before a footnote.
4789 * src/insets/insetcommand.C (draw): Increase x correctly.
4791 * src/screen.C (ShowCursor): Change cursor shape if
4792 current language != document language.
4794 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4796 2000-03-31 Juergen Vigna <jug@sad.it>
4798 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4799 (Clone): changed mode how the paragraph-data is copied to the
4800 new clone-paragraph.
4802 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4803 GetInset(pos) with no inset anymore there (in inset UNDO)
4805 * src/insets/insetcommand.C (draw): small fix as here x is
4806 incremented not as much as width() returns (2 before, 2 behind = 4)
4808 2000-03-30 Juergen Vigna <jug@sad.it>
4810 * src/insets/insettext.C (InsetText): small fix in initialize
4811 widthOffset (should not be done in the init() function)
4813 2000-03-29 Amir Karger <karger@lyx.org>
4815 * lib/examples/it_ItemizeBullets.lyx: translation by
4818 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4820 2000-03-29 Juergen Vigna <jug@sad.it>
4822 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4824 * src/insets/insetfoot.C (Clone): small change as for the below
4825 new init function in the text-inset
4827 * src/insets/insettext.C (init): new function as I've seen that
4828 clone did not copy the Paragraph-Data!
4829 (LocalDispatch): Added code so that now we have some sort of Undo
4830 functionality (well actually we HAVE Undo ;)
4832 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4834 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4836 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4839 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4841 * src/main.C: added a runtime check that verifies that the xforms
4842 header used when building LyX and the library used when running
4843 LyX match. Exit with a message if they don't match. This is a
4844 version number check only.
4846 * src/buffer.C (save): Don't allocate memory on the heap for
4847 struct utimbuf times.
4849 * *: some using changes, use iosfwd instead of the real headers.
4851 * src/lyxfont.C use char const * instead of string for the static
4852 strings. Rewrite some functions to use sstream.
4854 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4856 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4859 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4861 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4862 of Geodesy (from Martin Vermeer)
4864 * lib/layouts/svjour.inc: include file for the Springer svjour
4865 class. It can be used to support journals other than JoG.
4867 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4868 Miskiewicz <misiek@pld.org.pl>)
4869 * lib/reLyX/Makefile.am: ditto.
4871 2000-03-27 Juergen Vigna <jug@sad.it>
4873 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4874 also some modifications with operations on selected text.
4876 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4877 problems with clicking on insets (last famous words ;)
4879 * src/insets/insetcommand.C (draw):
4880 (width): Changed to have a bit of space before and after the inset so
4881 that the blinking cursor can be seen (otherwise it was hidden)
4883 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4885 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4886 would not be added to the link list when an installed gettext (not
4887 part of libc) is found.
4889 2000-03-24 Juergen Vigna <jug@sad.it>
4891 * src/insets/insetcollapsable.C (Edit):
4892 * src/mathed/formula.C (InsetButtonRelease):
4893 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4896 * src/BufferView.C (workAreaButtonPress):
4897 (workAreaButtonRelease):
4898 (checkInsetHit): Finally fixed the clicking on insets be handled
4901 * src/insets/insetert.C (Edit): inserted this call so that ERT
4902 insets work always with LaTeX-font
4904 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4906 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4907 caused lyx to startup with no GUI in place, causing in a crash
4908 upon startup when called with arguments.
4910 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4912 * src/FontLoader.C: better initialization of dummyXFontStruct.
4914 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4916 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4917 for linuxdoc and docbook import and export format options.
4919 * lib/lyxrc.example Example of default values for the previous flags.
4921 * src/lyx_cb.C Use those flags instead of the hardwired values for
4922 linuxdoc and docbook export.
4924 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4927 * src/menus.C Added menus entries for the new import/exports formats.
4929 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4931 * src/lyxrc.*: Added support for running without Gui
4934 * src/FontLoader.C: sensible defaults if no fonts are needed
4936 * src/lyx_cb.C: New function ShowMessage (writes either to the
4937 minibuffer or cout in case of no gui
4938 New function AskOverwrite for common stuff
4939 Consequently various changes to call these functions
4941 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4942 wild guess at sensible screen resolution when having no gui
4944 * src/lyxfont.C: no gui, no fonts... set some defaults
4946 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4948 * src/LColor.C: made the command inset background a bit lighter.
4950 2000-03-20 Hartmut Goebel <goebel@noris.net>
4952 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4953 stdstruct.inc. Koma-Script added some title elements which
4954 otherwise have been listed below "bibliography". This split allows
4955 adding title elements to where they belong.
4957 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4958 define the additional tilte elements and then include
4961 * many other layout files: changed to include stdtitle.inc just
4962 before stdstruct.inc.
4964 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4966 * src/buffer.C: (save) Added the option to store all backup files
4967 in a single directory
4969 * src/lyxrc.[Ch]: Added variable \backupdir_path
4971 * lib/lyxrc.example: Added descriptions of recently added variables
4973 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4974 bibtex inset, not closing the bibtex popup when deleting the inset)
4976 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4978 * src/lyx_cb.C: add a couple using directives.
4980 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4981 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4982 import based on the filename.
4984 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4985 file would be imported at start, if the filename where of a sgml file.
4987 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4989 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4991 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4992 * src/lyxfont.h Replaced the member variable bits.direction by the
4993 member variable lang. Made many changes in other files.
4994 This allows having a multi-lingual document
4996 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4997 that change the current language to <l>.
4998 Removed the command "font-rtl"
5000 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5001 format for Hebrew documents)
5003 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5004 When auto_mathmode is "true", pressing a digit key in normal mode
5005 will cause entering into mathmode.
5006 If auto_mathmode is "rtl" then this behavior will be active only
5007 when writing right-to-left text.
5009 * src/text2.C (InsertStringA) The string is inserted using the
5012 * src/paragraph.C (GetEndLabel) Gives a correct result for
5013 footnote paragraphs.
5015 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5017 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5019 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5020 front of PasteParagraph. Never insert a ' '. This should at least
5021 fix some cause for the segfaults that we have been experiencing,
5022 it also fixes backspace behaviour slightly. (Phu!)
5024 * src/support/lstrings.C (compare_no_case): some change to make it
5025 compile with gcc 2.95.2 and stdlibc++-v3
5027 * src/text2.C (MeltFootnoteEnvironment): change type o
5028 first_footnote_par_is_not_empty to bool.
5030 * src/lyxparagraph.h: make text private. Changes in other files
5032 (fitToSize): new function
5033 (setContentsFromPar): new function
5034 (clearContents): new function
5035 (SetChar): new function
5037 * src/paragraph.C (readSimpleWholeFile): deleted.
5039 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5040 the file, just use a simple string instead. Also read the file in
5041 a more maintainable manner.
5043 * src/text2.C (InsertStringA): deleted.
5044 (InsertStringB): deleted.
5046 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5048 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5049 RedoParagraphs from the doublespace handling part, just set status
5050 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5051 done, but perhaps not like this.)
5053 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5055 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5056 character when inserting an inset.
5058 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5060 * src/bufferparams.C (readLanguage): now takes "default" into
5063 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5064 also initialize the toplevel_keymap with the default bindings from
5067 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5069 * all files using lyxrc: have lyxrc as a real variable and not a
5070 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5073 * src/lyxrc.C: remove double call to defaultKeyBindings
5075 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5076 toolbar defauls using lyxlex. Remove enums, structs, functions
5079 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5080 toolbar defaults. Also store default keybindings in a map.
5082 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5083 storing the toolbar defaults without any xforms dependencies.
5085 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5086 applied. Changed to use iterators.
5088 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5090 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5091 systems that don't have LINGUAS set to begin with.
5093 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5095 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5096 the list by Dekel Tsur.
5098 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5100 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5101 * src/insets/form_graphics.C: ditto.
5103 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5105 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5107 * src/bufferparams.C (readLanguage): use the new language map
5109 * src/intl.C (InitKeyMapper): use the new language map
5111 * src/lyx_gui.C (create_forms): use the new language map
5113 * src/language.[Ch]: New files. Used for holding the information
5114 about each language. Now! Use this new language map enhance it and
5115 make it really usable for our needs.
5117 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5119 * screen.C (ShowCursor): Removed duplicate code.
5120 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5121 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5123 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5126 * src/text.C Added TransformChar method. Used for rendering Arabic
5127 text correctly (change the glyphs of the letter according to the
5128 position in the word)
5133 * src/lyxrc.C Added lyxrc command {language_command_begin,
5134 language_command_end,language_command_ltr,language_command_rtl,
5135 language_package} which allows the use of either arabtex or Omega
5138 * src/lyx_gui.C (init)
5140 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5141 to use encoding for menu fonts which is different than the encoding
5144 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5145 do not load the babel package.
5146 To write an English document with Hebrew/Arabic, change the document
5147 language to "english".
5149 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5150 (alphaCounter): changed to return char
5151 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5153 * lib/lyxrc.example Added examples for Hebrew/Arabic
5156 * src/layout.C Added layout command endlabeltype
5158 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5160 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5162 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5164 * src/mathed/math_delim.C (search_deco): return a
5165 math_deco_struct* instead of index.
5167 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5169 * All files with a USE_OSTREAM_ONLY within: removed all code that
5170 was unused when USE_OSTREAM_ONLY is defined.
5172 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5173 of any less. Removed header and using.
5175 * src/text.C (GetVisibleRow): draw the string "Page Break
5176 (top/bottom)" on screen when drawing a pagebreak line.
5178 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5180 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5182 * src/mathed/math_macro.C (draw): do some cast magic.
5185 * src/mathed/math_defs.h: change byte* argument to byte const*.
5187 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5189 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5190 know it is right to return InsetFoot* too, but cxx does not like
5193 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5195 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5197 * src/mathed/math_delim.C: change == to proper assignment.
5199 2000-03-09 Juergen Vigna <jug@sad.it>
5201 * src/insets/insettext.C (setPos): fixed various cursor positioning
5202 problems (via mouse and cursor-keys)
5203 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5204 inset (still a small display problem but it works ;)
5206 * src/insets/insetcollapsable.C (draw): added button_top_y and
5207 button_bottom_y to have correct values for clicking on the inset.
5209 * src/support/lyxalgo.h: commented out 'using std::less'
5211 2000-03-08 Juergen Vigna <jug@sad.it>
5213 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5214 Button-Release event closes as it is alos the Release-Event
5217 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5219 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5221 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5222 can add multiple spaces in Scrap (literate programming) styles...
5223 which, by the way, is how I got hooked on LyX to begin with.
5225 * src/mathed/formula.C (Write): Added dummy variable to an
5226 inset::Latex() call.
5227 (Latex): Add free_spacing boolean to inset::Latex()
5229 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5231 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5232 virtual function to include the free_spacing boolean from
5233 the containing paragraph's style.
5235 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5236 Added free_spacing boolean arg to match inset.h
5238 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5239 Added free_spacing boolean arg to match inset.h
5241 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5242 Added free_spacing boolean and made sure that if in a free_spacing
5243 paragraph, that we output normal space if there is a protected space.
5245 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5246 Added free_spacing boolean arg to match inset.h
5248 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5249 Added free_spacing boolean arg to match inset.h
5251 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5252 Added free_spacing boolean arg to match inset.h
5254 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5255 Added free_spacing boolean arg to match inset.h
5257 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5258 Added free_spacing boolean arg to match inset.h
5260 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5261 free_spacing boolean arg to match inset.h
5263 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5264 Added free_spacing boolean arg to match inset.h
5266 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5267 Added free_spacing boolean arg to match inset.h
5269 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5270 Added free_spacing boolean arg to match inset.h
5272 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5273 Added free_spacing boolean arg to match inset.h
5275 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5276 Added free_spacing boolean arg to match inset.h
5278 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5279 free_spacing boolean arg to match inset.h
5281 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5282 free_spacing boolean arg to match inset.h
5284 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5285 ignore free_spacing paragraphs. The user's spaces are left
5288 * src/text.C (InsertChar): Fixed the free_spacing layout
5289 attribute behavior. Now, if free_spacing is set, you can
5290 add multiple spaces in a paragraph with impunity (and they
5291 get output verbatim).
5292 (SelectSelectedWord): Added dummy argument to inset::Latex()
5295 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5298 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5299 paragraph layouts now only input a simple space instead.
5300 Special character insets don't make any sense in free-spacing
5303 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5304 hard-spaces in the *input* file to simple spaces if the layout
5305 is free-spacing. This converts old files which had to have
5306 hard-spaces in free-spacing layouts where a simple space was
5308 (writeFileAscii): Added free_spacing check to pass to the newly
5309 reworked inset::Latex(...) methods. The inset::Latex() code
5310 ensures that hard-spaces in free-spacing paragraphs get output
5311 as spaces (rather than "~").
5313 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5315 * src/mathed/math_delim.C (draw): draw the empty placeholder
5316 delims with a onoffdash line.
5317 (struct math_deco_compare): struct that holds the "functors" used
5318 for the sort and the binary search in math_deco_table.
5319 (class init_deco_table): class used for initial sort of the
5321 (search_deco): use lower_bound to do a binary search in the
5324 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5326 * src/lyxrc.C: a small secret thingie...
5328 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5329 and to not flush the stream as often as it used to.
5331 * src/support/lyxalgo.h: new file
5332 (sorted): template function used for checking if a sequence is
5333 sorted or not. Two versions with and without user supplied
5334 compare. Uses same compare as std::sort.
5336 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5337 it and give warning on lyxerr.
5339 (struct compare_tags): struct with function operators used for
5340 checking if sorted, sorting and lower_bound.
5341 (search_kw): use lower_bound instead of manually implemented
5344 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5346 * src/insets/insetcollapsable.h: fix Clone() declaration.
5347 * src/insets/insetfoot.h: ditto.
5349 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5351 2000-03-08 Juergen Vigna <jug@sad.it>
5353 * src/insets/lyxinset.h: added owner call which tells us if
5354 this inset is inside another inset. Changed also the return-type
5355 of Editable to an enum so it tells clearer what the return-value is.
5357 * src/insets/insettext.C (computeTextRows): fixed computing of
5358 textinsets which split automatically on more rows.
5360 * src/insets/insetert.[Ch]: changed this to be of BaseType
5363 * src/insets/insetfoot.[Ch]: added footnote inset
5365 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5366 collapsable insets (like footnote, ert, ...)
5368 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5370 * src/lyxdraw.h: remvoe file
5372 * src/lyxdraw.C: remove file
5374 * src/insets/insettext.C: added <algorithm>.
5376 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5378 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5379 (matrix_cb): case MM_OK use string stream
5381 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5384 * src/mathed/math_macro.C (draw): use string stream
5385 (Metrics): use string stream
5387 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5388 directly to the ostream.
5390 * src/vspace.C (asString): use string stream.
5391 (asString): use string stream
5392 (asLatexString): use string stream
5394 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5395 setting Spacing::Other.
5397 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5398 sprintf when creating the stretch vale.
5400 * src/text2.C (alphaCounter): changed to return a string and to
5401 not use a static variable internally. Also fixed a one-off bug.
5402 (SetCounter): changed the drawing of the labels to use string
5403 streams instead of sprintf.
5405 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5406 manipulator to use a scheme that does not require library support.
5407 This is also the way it is done in the new GNU libstdc++. Should
5408 work with DEC cxx now.
5410 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5412 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5413 end. This fixes a bug.
5415 * src/mathed (all files concerned with file writing): apply the
5416 USE_OSTREAM_ONLY changes to mathed too.
5418 * src/support/DebugStream.h: make the constructor explicit.
5420 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5421 count and ostream squashed.
5423 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5425 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5427 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5428 ostringstream uses STL strings, and we might not.
5430 * src/insets/insetspecialchar.C: add using directive.
5431 * src/insets/insettext.C: ditto.
5433 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5435 * lib/layouts/seminar.layout: feeble attempt at a layout for
5436 seminar.cls, far from completet and could really use some looking
5437 at from people used to write layout files.
5439 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5440 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5441 a lot nicer and works nicely with ostreams.
5443 * src/mathed/formula.C (draw): a slightly different solution that
5444 the one posted to the list, but I think this one works too. (font
5445 size wrong in headers.)
5447 * src/insets/insettext.C (computeTextRows): some fiddling on
5448 Jürgens turf, added some comments that he should read.
5450 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5451 used and it gave compiler warnings.
5452 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5455 * src/lyx_gui.C (create_forms): do the right thing when
5456 show_banner is true/false.
5458 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5459 show_banner is false.
5461 * most file writing files: Now use iostreams to do almost all of
5462 the writing. Also instead of passing string &, we now use
5463 stringstreams. mathed output is still not adapted to iostreams.
5464 This change can be turned off by commenting out all the occurences
5465 of the "#define USE_OSTREAM_ONLY 1" lines.
5467 * src/WorkArea.C (createPixmap): don't output debug messages.
5468 (WorkArea): don't output debug messages.
5470 * lib/lyxrc.example: added a comment about the new variable
5473 * development/Code_rules/Rules: Added some more commente about how
5474 to build class interfaces and on how better encapsulation can be
5477 2000-03-03 Juergen Vigna <jug@sad.it>
5479 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5480 automatically with the width of the LyX-Window
5482 * src/insets/insettext.C (computeTextRows): fixed update bug in
5483 displaying text-insets (scrollvalues where not initialized!)
5485 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5487 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5488 id in the check of the result from lower_bound is not enough since
5489 lower_bound can return last too, and then res->id will not be a
5492 * all insets and some code that use them: I have conditionalized
5493 removed the Latex(string & out, ...) this means that only the
5494 Latex(ostream &, ...) will be used. This is a work in progress to
5495 move towards using streams for all output of files.
5497 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5500 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5502 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5503 routine (this fixes bug where greek letters were surrounded by too
5506 * src/support/filetools.C (findtexfile): change a bit the search
5507 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5508 no longer passed to kpsewhich, we may have to change that later.
5510 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5511 warning options to avoid problems with X header files (from Angus
5513 * acinclude.m4: regenerated.
5515 2000-03-02 Juergen Vigna <jug@sad.it>
5517 * src/insets/insettext.C (WriteParagraphData): Using the
5518 par->writeFile() function for writing paragraph-data.
5519 (Read): Using buffer->parseSingleLyXformat2Token()-function
5520 for parsing paragraph data!
5522 * src/buffer.C (readLyXformat2): removed all parse data and using
5523 the new parseSingleLyXformat2Token()-function.
5524 (parseSingleLyXformat2Token): added this function to parse (read)
5525 lyx-file-format (this is called also from text-insets now!)
5527 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5529 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5532 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5533 directly instead of going through a func. One very bad thing: a
5534 static LyXFindReplace, but I don't know where to place it.
5536 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5537 string instead of char[]. Also changed to static.
5538 (GetSelectionOrWordAtCursor): changed to static inline
5539 (SetSelectionOverLenChars): ditto.
5541 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5542 current_view and global variables. both classes has changed names
5543 and LyXFindReplace is not inherited from SearchForm.
5545 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5546 fl_form_search form.
5548 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5550 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5552 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5553 bound (from Kayvan).
5555 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5557 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5559 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5561 * some things that I should comment but the local pub says head to
5564 * comment out all code that belongs to the Roff code for Ascii
5565 export of tables. (this is unused)
5567 * src/LyXView.C: use correct type for global variable
5568 current_layout. (LyXTextClass::size_type)
5570 * some code to get the new insetgraphics closer to working I'd be
5571 grateful for any help.
5573 * src/BufferView2.C (insertInset): use the return type of
5574 NumberOfLayout properly. (also changes in other files)
5576 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5577 this as a test. I want to know what breaks because of this.
5579 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5581 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5583 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5584 to use a \makebox in the label, this allows proper justification
5585 with out using protected spaces or multiple hfills. Now it is
5586 "label" for left justified, "\hfill label\hfill" for center, and
5587 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5588 should be changed accordingly.
5590 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5592 * src/lyxtext.h: change SetLayout() to take a
5593 LyXTextClass::size_type instead of a char (when there is more than
5594 127 layouts in a class); also change type of copylayouttype.
5595 * src/text2.C (SetLayout): ditto.
5596 * src/LyXView.C (updateLayoutChoice): ditto.
5598 * src/LaTeX.C (scanLogFile): errors where the line number was not
5599 given just after the '!'-line were ignored (from Dekel Tsur).
5601 * lib/lyxrc.example: fix description of \date_insert_format
5603 * lib/layouts/llncs.layout: new layout, contributed by Martin
5606 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5608 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5609 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5610 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5611 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5612 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5613 paragraph.C, text.C, text2.C)
5615 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5617 * src/insets/insettext.C (LocalDispatch): remove extra break
5620 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5621 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5623 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5624 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5626 * src/insets/insetbib.h: move InsetBibkey::Holder and
5627 InsetCitation::Holder in public space.
5629 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5631 * src/insets/insettext.h: small change to get the new files from
5632 Juergen to compile (use "string", not "class string").
5634 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5635 const & as parameter to LocalDispatch, use LyXFont const & as
5636 paramter to some other func. This also had impacto on lyxinsets.h
5637 and the two mathed insets.
5639 2000-02-24 Juergen Vigna <jug@sad.it>
5642 * src/commandtags.h:
5644 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5648 * src/BufferView2.C: added/updated code for various inset-functions
5650 * src/insets/insetert.[Ch]: added implementation of InsetERT
5652 * src/insets/insettext.[Ch]: added implementation of InsetText
5654 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5655 (draw): added preliminary code for inset scrolling not finshed yet
5657 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5658 as it is in lyxfunc.C now
5660 * src/insets/lyxinset.h: Added functions for text-insets
5662 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5664 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5665 BufferView and reimplement the list as a queue put inside its own
5668 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5670 * several files: use the new interface to the "updateinsetlist"
5672 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5674 (work_area_handler): call BufferView::trippleClick on trippleclick.
5676 * src/BufferView.C (doubleClick): new function, selects word on
5678 (trippleClick): new function, selects line on trippleclick.
5680 2000-02-22 Allan Rae <rae@lyx.org>
5682 * lib/bind/xemacs.bind: buffer-previous not supported
5684 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5686 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5689 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5691 * src/bufferlist.C: get rid of current_view from this file
5693 * src/spellchecker.C: get rid of current_view from this file
5695 * src/vspace.C: get rid of current_view from this file
5696 (inPixels): added BufferView parameter for this func
5697 (asLatexCommand): added a BufferParams for this func
5699 * src/text.C src/text2.C: get rid of current_view from these
5702 * src/lyxfont.C (getFontDirection): move this function here from
5705 * src/bufferparams.C (getDocumentDirection): move this function
5708 * src/paragraph.C (getParDirection): move this function here from
5710 (getLetterDirection): ditto
5712 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5714 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5715 resize due to wrong pixmap beeing used. Also took the opurtunity
5716 to make the LyXScreen stateless on regard to WorkArea and some
5717 general cleanup in the same files.
5719 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5721 * src/Makefile.am: add missing direction.h
5723 * src/PainterBase.h: made the width functions const.
5725 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5728 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5730 * src/insets/insetlatexaccent.C (draw): make the accents draw
5731 better, at present this will only work well with iso8859-1.
5733 * several files: remove the old drawing code, now we use the new
5736 * several files: remove support for mono_video, reverse_video and
5739 2000-02-17 Juergen Vigna <jug@sad.it>
5741 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5742 int ** as we have to return the pointer, otherwise we have only
5743 NULL pointers in the returning function.
5745 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5747 * src/LaTeX.C (operator()): quote file name when running latex.
5749 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5751 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5752 (bubble tip), this removes our special handling of this.
5754 * Remove all code that is unused now that we have the new
5755 workarea. (Code that are not active when NEW_WA is defined.)
5757 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5759 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5761 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5762 nonexisting layout; correctly redirect obsoleted layouts.
5764 * lib/lyxrc.example: document \view_dvi_paper_option
5766 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5769 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5770 (PreviewDVI): handle the view_dvi_paper_option variable.
5771 [Both from Roland Krause]
5773 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5775 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5776 char const *, int, LyXFont)
5777 (text(int, int, string, LyXFont)): ditto
5779 * src/text.C (InsertCharInTable): attempt to fix the double-space
5780 feature in tables too.
5781 (BackspaceInTable): ditto.
5782 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5784 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5786 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5788 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5789 newly found text in textcache to this.
5790 (buffer): set the owner of the text put into the textcache to 0
5792 * src/insets/figinset.C (draw): fixed the drawing of figures with
5795 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5796 drawing of mathframe, hfills, protected space, table lines. I have
5797 now no outstanding drawing problems with the new Painter code.
5799 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5801 * src/PainterBase.C (ellipse, circle): do not specify the default
5804 * src/LColor.h: add using directive.
5806 * src/Painter.[Ch]: change return type of methods from Painter& to
5807 PainterBase&. Add a using directive.
5809 * src/WorkArea.C: wrap xforms callbacks in C functions
5812 * lib/layouts/foils.layout: font fix and simplifications from Carl
5815 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5817 * a lot of files: The Painter, LColor and WorkArea from the old
5818 devel branch has been ported to lyx-devel. Some new files and a
5819 lot of #ifdeffed code. The new workarea is enabled by default, but
5820 if you want to test the new Painter and LColor you have to compile
5821 with USE_PAINTER defined (do this in config.h f.ex.) There are
5822 still some rought edges, and I'd like some help to clear those
5823 out. It looks stable (loads and displays the Userguide very well).
5826 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5828 * src/buffer.C (pop_tag): revert to the previous implementation
5829 (use a global variable for both loops).
5831 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5833 * src/lyxrc.C (LyXRC): change slightly default date format.
5835 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5836 there is an English text with a footnote that starts with a Hebrew
5837 paragraph, or vice versa.
5838 (TeXFootnote): ditto.
5840 * src/text.C (LeftMargin): allow for negative values for
5841 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5844 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5845 for input encoding (cyrillic)
5847 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5849 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5852 * src/toolbar.C (set): ditto
5853 * src/insets/insetbib.C (create_form_citation_form): ditto
5855 * lib/CREDITS: added Dekel Tsur.
5857 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5858 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5859 hebrew supports files from Dekel Tsur.
5861 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5862 <tzafrir@technion.ac.il>
5864 * src/lyxrc.C: put \date_insert_format at the right place.
5866 * src/buffer.C (makeLaTeXFile): fix the handling of
5867 BufferParams::sides when writing out latex files.
5869 * src/BufferView2.C: add a "using" directive.
5871 * src/support/lyxsum.C (sum): when we use lyxstring,
5872 ostringstream::str needs an additional .c_str().
5874 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5876 * src/support/filetools.C (ChangeExtension): patch from Etienne
5879 * src/TextCache.C (show): remove const_cast and make second
5880 parameter non-const LyXText *.
5882 * src/TextCache.h: use non const LyXText in show.
5884 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5887 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5889 * src/support/lyxsum.C: rework to be more flexible.
5891 * several places: don't check if a pointer is 0 if you are going
5894 * src/text.C: remove some dead code.
5896 * src/insets/figinset.C: remove some dead code
5898 * src/buffer.C: move the BufferView funcs to BufferView2.C
5899 remove all support for insetlatexdel
5900 remove support for oldpapersize stuff
5901 made some member funcs const
5903 * src/kbmap.C: use a std::list to store the bindings in.
5905 * src/BufferView2.C: new file
5907 * src/kbsequence.[Ch]: new files
5909 * src/LyXAction.C + others: remove all trace of buffer-previous
5911 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5912 only have one copy in the binary of this table.
5914 * hebrew patch: moved some functions from LyXText to more
5915 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5917 * several files: remove support for XForms older than 0.88
5919 remove some #if 0 #endif code
5921 * src/TextCache.[Ch]: new file. Holds the textcache.
5923 * src/BufferView.C: changes to use the new TextCache interface.
5924 (waitForX): remove the now unused code.
5926 * src/BackStack.h: remove some commented code
5928 * lib/bind/emacs.bind: remove binding for buffer-previous
5930 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5932 * applied the hebrew patch.
5934 * src/lyxrow.h: make sure that all Row variables are initialized.
5936 * src/text2.C (TextHandleUndo): comment out a delete, this might
5937 introduce a memory leak, but should also help us to not try to
5938 read freed memory. We need to look at this one.
5940 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5941 (LyXParagraph): initalize footnotekind.
5943 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5944 forgot this when applying the patch. Please heed the warnings.
5946 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5947 (aka. reformat problem)
5949 * src/bufferlist.C (exists): made const, and use const_iterator
5950 (isLoaded): new func.
5951 (release): use std::find to find the correct buffer.
5953 * src/bufferlist.h: made getState a const func.
5954 made empty a const func.
5955 made exists a const func.
5958 2000-02-01 Juergen Vigna <jug@sad.it>
5960 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5962 * po/it.po: updated a bit the italian po file and also changed the
5963 'file nuovo' for newfile to 'filenuovo' without a space, this did
5966 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5967 for the new insert_date command.
5969 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5970 from jdblair, to insert a date into the current text conforming to
5971 a strftime format (for now only considering the locale-set and not
5972 the document-language).
5974 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5976 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5977 Bounds Read error seen by purify. The problem was that islower is
5978 a macros which takes an unsigned char and uses it as an index for
5979 in array of characters properties (and is thus subject to the
5983 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5984 correctly the paper sides radio buttons.
5985 (UpdateDocumentButtons): ditto.
5987 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5989 * src/kbmap.C (getsym + others): change to return unsigned int,
5990 returning a long can give problems on 64 bit systems. (I assume
5991 that int is 32bit on 64bit systems)
5993 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5995 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5996 LyXLookupString to be zero-terminated. Really fixes problems seen
5999 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6001 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6002 write a (char*)0 to the lyxerr stream.
6004 * src/lastfiles.C: move algorithm before the using statemets.
6006 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6008 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6009 complains otherwise).
6010 * src/table.C: ditto
6012 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6015 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6016 that I removed earlier... It is really needed.
6018 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6020 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6022 * INSTALL: update xforms home page URL.
6024 * lib/configure.m4: fix a bug with unreadable layout files.
6026 * src/table.C (calculate_width_of_column): add "using std::max"
6029 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6031 * several files: marked several lines with "DEL LINE", this is
6032 lines that can be deleted without changing anything.
6033 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6034 checks this anyway */
6037 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6039 * src/DepTable.C (update): add a "+" at the end when the checksum
6040 is different. (debugging string only)
6042 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6043 the next inset to not be displayed. This should also fix the list
6044 of labels in the "Insert Crossreference" dialog.
6046 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6048 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6049 when regex was not found.
6051 * src/support/lstrings.C (lowercase): use handcoded transform always.
6054 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6055 old_cursor.par->prev could be 0.
6057 * several files: changed post inc/dec to pre inc/dec
6059 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6060 write the lastfiles to file.
6062 * src/BufferView.C (buffer): only show TextCache info when debugging
6064 (resizeCurrentBuffer): ditto
6065 (workAreaExpose): ditto
6067 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6069 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6071 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6072 a bit better by removing the special case for \i and \j.
6074 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6076 * src/lyx_main.C (easyParse): remove test for bad comand line
6077 options, since this broke all xforms-related parsing.
6079 * src/kbmap.C (getsym): set return type to unsigned long, as
6080 declared in header. On an alpha, long is _not_ the same as int.
6082 * src/support/LOstream.h: add a "using std::flush;"
6084 * src/insets/figinset.C: ditto.
6086 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6088 * src/bufferlist.C (write): use blinding fast file copy instead of
6089 "a char at a time", now we are doing it the C++ way.
6091 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6092 std::list<int> instead.
6093 (addpidwait): reflect move to std::list<int>
6094 (sigchldchecker): ditto
6096 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6099 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6100 that obviously was wrong...
6102 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6103 c, this avoids warnings with purify and islower.
6105 * src/insets/figinset.C: rename struct queue to struct
6106 queue_element and rewrite to use a std::queue. gsqueue is now a
6107 std::queue<queue_element>
6108 (runqueue): reflect move to std::queue
6111 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6112 we would get "1" "0" instead of "true" "false. Also make the tostr
6115 2000-01-21 Juergen Vigna <jug@sad.it>
6117 * src/buffer.C (writeFileAscii): Disabled code for special groff
6118 handling of tabulars till I fix this in table.C
6120 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6122 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6124 * src/support/lyxlib.h: ditto.
6126 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6128 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6129 and 'j' look better. This might fix the "macron" bug that has been
6132 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6133 functions as one template function. Delete the old versions.
6135 * src/support/lyxsum.C: move using std::ifstream inside
6138 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6141 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6143 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6145 * src/insets/figinset.C (InitFigures): use new instead of malloc
6146 to allocate memory for figures and bitmaps.
6147 (DoneFigures): use delete[] instead of free to deallocate memory
6148 for figures and bitmaps.
6149 (runqueue): use new to allocate
6150 (getfigdata): use new/delete[] instead of malloc/free
6151 (RegisterFigure): ditto
6153 * some files: moved some declarations closer to first use, small
6154 whitespace changes use preincrement instead of postincrement where
6155 it does not make a difference.
6157 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6158 step on the way to use stl::containers for key maps.
6160 * src/bufferlist.h: add a typedef for const_iterator and const
6161 versions of begin and end.
6163 * src/bufferlist.[Ch]: change name of member variable _state to
6164 state_. (avoid reserved names)
6166 (getFileNames): returns the filenames of the buffers in a vector.
6168 * configure.in (ALL_LINGUAS): added ro
6170 * src/support/putenv.C: new file
6172 * src/support/mkdir.C: new file
6174 2000-01-20 Allan Rae <rae@lyx.org>
6176 * lib/layouts/IEEEtran.layout: Added several theorem environments
6178 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6179 couple of minor additions.
6181 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6182 (except for those in footnotes of course)
6184 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6186 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6188 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6189 std::sort and std::lower_bound instead of qsort and handwritten
6191 (struct compara): struct that holds the functors used by std::sort
6192 and std::lower_bound in MathedLookupBOP.
6194 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6196 * src/support/LAssert.h: do not do partial specialization. We do
6199 * src/support/lyxlib.h: note that lyx::getUserName() and
6200 lyx::date() are not in use right now. Should these be suppressed?
6202 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6203 (makeLinuxDocFile): do not put date and user name in linuxdoc
6206 * src/support/lyxlib.h (kill): change first argument to long int,
6207 since that's what solaris uses.
6209 * src/support/kill.C (kill): fix declaration to match prototype.
6211 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6212 actually check whether namespaces are supported. This is not what
6215 * src/support/lyxsum.C: add a using directive.
6217 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6219 * src/support/kill.C: if we have namespace support we don't have
6220 to include lyxlib.h.
6222 * src/support/lyxlib.h: use namespace lyx if supported.
6224 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6226 * src/support/date.C: new file
6228 * src/support/chdir.C: new file
6230 * src/support/getUserName.C: new file
6232 * src/support/getcwd.C: new file
6234 * src/support/abort.C: new file
6236 * src/support/kill.C: new file
6238 * src/support/lyxlib.h: moved all the functions in this file
6239 insede struct lyx. Added also kill and abort to this struct. This
6240 is a way to avoid the "kill is not defined in <csignal>", we make
6241 C++ wrappers for functions that are not ANSI C or ANSI C++.
6243 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6244 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6245 lyx it has been renamed to sum.
6247 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6249 * src/text.C: add using directives for std::min and std::max.
6251 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6253 * src/texrow.C (getIdFromRow): actually return something useful in
6254 id and pos. Hopefully fixes the bug with positionning of errorbox
6257 * src/lyx_main.C (easyParse): output an error and exit if an
6258 incorrect command line option has been given.
6260 * src/spellchecker.C (ispell_check_word): document a memory leak.
6262 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6263 where a "struct utimbuf" is allocated with "new" and deleted with
6266 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6268 * src/text2.C (CutSelection): don't delete double spaces.
6269 (PasteSelection): ditto
6270 (CopySelection): ditto
6272 * src/text.C (Backspace): don't delete double spaces.
6274 * src/lyxlex.C (next): fix a bug that were only present with
6275 conformant std::istream::get to read comment lines, use
6276 std::istream::getline instead. This seems to fix the problem.
6278 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6280 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6281 allowed to insert space before space" editing problem. Please read
6282 commends at the beginning of the function. Comments about usage
6285 * src/text.C (InsertChar): fix for the "not allowed to insert
6286 space before space" editing problem.
6288 * src/text2.C (DeleteEmptyParagraphMechanism): when
6289 IsEmptyTableRow can only return false this last "else if" will
6290 always be a no-op. Commented out.
6292 * src/text.C (RedoParagraph): As far as I can understand tmp
6293 cursor is not really needed.
6295 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6296 present it could only return false anyway.
6297 (several functions): Did something not so smart...added a const
6298 specifier on a lot of methods.
6300 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6301 and add a tmp->text.resize. The LyXParagraph constructor does the
6303 (BreakParagraphConservative): ditto
6305 * src/support/path.h (Path): add a define so that the wrong usage
6306 "Path("/tmp") will be flagged as a compilation error:
6307 "`unnamed_Path' undeclared (first use this function)"
6309 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6311 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6312 which was bogus for several reasons.
6314 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6318 * autogen.sh: do not use "type -path" (what's that anyway?).
6320 * src/support/filetools.C (findtexfile): remove extraneous space
6321 which caused a kpsewhich warning (at least with kpathsea version
6324 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6326 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6328 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6330 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6332 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6334 * src/paragraph.C (BreakParagraph): do not reserve space on text
6335 if we don't need to (otherwise, if pos_end < pos, we end up
6336 reserving huge amounts of memory due to bad unsigned karma).
6337 (BreakParagraphConservative): ditto, although I have not seen
6338 evidence the bug can happen here.
6340 * src/lyxparagraph.h: add a using std::list.
6342 2000-01-11 Juergen Vigna <jug@sad.it>
6344 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6347 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6349 * src/vc-backend.C (doVCCommand): change to be static and take one
6350 more parameter: the path to chdir too be fore executing the command.
6351 (retrive): new function equiv to "co -r"
6353 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6354 file_not_found_hook is true.
6356 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6358 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6359 if a file is readwrite,readonly...anything else.
6361 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6363 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6364 (CreatePostscript): name change from MenuRunDVIPS (or something)
6365 (PreviewPostscript): name change from MenuPreviewPS
6366 (PreviewDVI): name change from MenuPreviewDVI
6368 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6369 \view_pdf_command., \pdf_to_ps_command
6371 * lib/configure.m4: added search for PDF viewer, and search for
6372 PDF to PS converter.
6373 (lyxrc.defaults output): add \pdflatex_command,
6374 \view_pdf_command and \pdf_to_ps_command.
6376 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6378 * src/bufferlist.C (write): we don't use blocksize for anything so
6381 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6383 * src/support/block.h: disable operator T* (), since it causes
6384 problems with both compilers I tried. See comments in the file.
6386 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6389 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6390 variable LYX_DIR_10x to LYX_DIR_11x.
6392 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6394 * INSTALL: document --with-lyxname.
6397 * configure.in: new configure flag --with-lyxname which allows to
6398 choose the name under which lyx is installed. Default is "lyx", of
6399 course. It used to be possible to do this with --program-suffix,
6400 but the later has in fact a different meaning for autoconf.
6402 * src/support/lstrings.h (lstrchr): reformat a bit.
6404 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6405 * src/mathed/math_defs.h: ditto.
6407 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6409 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6410 true, decides if we create a backup file or not when saving. New
6411 tag and variable \pdf_mode, defaults to false. New tag and
6412 variable \pdflatex_command, defaults to pdflatex. New tag and
6413 variable \view_pdf_command, defaults to xpdf. New tag and variable
6414 \pdf_to_ps_command, defaults to pdf2ps.
6416 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6418 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6419 does not have a BufferView.
6420 (unlockInset): ditto + don't access the_locking_inset if the
6421 buffer does not have a BufferView.
6423 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6424 certain circumstances so that we don't continue a keyboard
6425 operation long after the key was released. Try f.ex. to load a
6426 large document, press PageDown for some seconds and then release
6427 it. Before this change the document would contine to scroll for
6428 some time, with this change it stops imidiatly.
6430 * src/support/block.h: don't allocate more space than needed. As
6431 long as we don't try to write to the arr[x] in a array_type arr[x]
6432 it is perfectly ok. (if you write to it you might segfault).
6433 added operator value_type*() so that is possible to pass the array
6434 to functions expecting a C-pointer.
6436 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6439 * intl/*: updated to gettext 0.10.35, tried to add our own
6440 required modifications. Please verify.
6442 * po/*: updated to gettext 0.10.35, tried to add our own required
6443 modifications. Please verify.
6445 * src/support/lstrings.C (tostr): go at fixing the problem with
6446 cxx and stringstream. When stringstream is used return
6447 oss.str().c_str() so that problems with lyxstring and basic_string
6448 are avoided. Note that the best solution would be for cxx to use
6449 basic_string all the way, but it is not conformant yet. (it seems)
6451 * src/lyx_cb.C + other files: moved several global functions to
6452 class BufferView, some have been moved to BufferView.[Ch] others
6453 are still located in lyx_cb.C. Code changes because of this. (part
6454 of "get rid of current_view project".)
6456 * src/buffer.C + other files: moved several Buffer functions to
6457 class BufferView, the functions are still present in buffer.C.
6458 Code changes because of this.
6460 * config/lcmessage.m4: updated to most recent. used when creating
6463 * config/progtest.m4: updated to most recent. used when creating
6466 * config/gettext.m4: updated to most recent. applied patch for
6469 * config/gettext.m4.patch: new file that shows what changes we
6470 have done to the local copy of gettext.m4.
6472 * config/libtool.m4: new file, used in creation of acinclude.m4
6474 * config/lyxinclude.m4: new file, this is the lyx created m4
6475 macros, used in making acinclude.m4.
6477 * autogen.sh: GNU m4 discovered as a separate task not as part of
6478 the lib/configure creation.
6479 Generate acinlucde from files in config. Actually cat
6480 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6481 easier to upgrade .m4 files that really are external.
6483 * src/Spacing.h: moved using std::istringstream to right after
6484 <sstream>. This should fix the problem seen with some compilers.
6486 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6488 * src/lyx_cb.C: began some work to remove the dependency a lot of
6489 functions have on BufferView::text, even if not really needed.
6490 (GetCurrentTextClass): removed this func, it only hid the
6493 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6494 forgot this in last commit.
6496 * src/Bullet.C (bulletEntry): use static char const *[] for the
6497 tables, becuase of this the return arg had to change to string.
6499 (~Bullet): removed unneeded destructor
6501 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6502 (insetSleep): moved from Buffer
6503 (insetWakeup): moved from Buffer
6504 (insetUnlock): moved from Buffer
6506 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6507 from Buffer to BufferView.
6509 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6511 * config/ltmain.sh: updated to version 1.3.4 of libtool
6513 * config/ltconfig: updated to version 1.3.4 of libtool
6515 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6518 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6519 Did I get that right?
6521 * src/lyxlex.h: add a "using" directive or two.
6522 * src/Spacing.h: ditto.
6523 * src/insets/figinset.C: ditto.
6524 * src/support/filetools.C: ditto.
6525 * src/support/lstrings.C: ditto.
6526 * src/BufferView.C: ditto.
6527 * src/bufferlist.C: ditto.
6528 * src/lyx_cb.C: ditto.
6529 * src/lyxlex.C: ditto.
6531 * NEWS: add some changes for 1.1.4.
6533 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6535 * src/BufferView.C: first go at a TextCache to speed up switching
6538 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6540 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6541 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6542 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6543 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6546 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6547 members of the struct are correctly initialized to 0 (detected by
6549 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6550 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6552 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6553 pidwait, since it was allocated with "new". This was potentially
6554 very bad. Thanks to Michael Schmitt for running purify for us.
6557 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6559 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6561 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6563 1999-12-30 Allan Rae <rae@lyx.org>
6565 * lib/templates/IEEEtran.lyx: minor change
6567 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6568 src/mathed/formula.C (LocalDispatch): askForText changes
6570 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6571 know when a user has cancelled input. Fixes annoying problems with
6572 inserting labels and version control.
6574 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6576 * src/support/lstrings.C (tostr): rewritten to use strstream and
6579 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6581 * src/support/filetools.C (IsFileWriteable): use fstream to check
6582 (IsDirWriteable): use fileinfo to check
6584 * src/support/filetools.h (FilePtr): whole class deleted
6586 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6588 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6590 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6592 * src/bufferlist.C (write): use ifstream and ofstream instead of
6595 * src/Spacing.h: use istrstream instead of sscanf
6597 * src/mathed/math_defs.h: change first arg to istream from FILE*
6599 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6601 * src/mathed/math_parser.C: have yyis to be an istream
6602 (LexGetArg): use istream (yyis)
6604 (mathed_parse): ditto
6605 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6607 * src/mathed/formula.C (Read): rewritten to use istream
6609 * src/mathed/formulamacro.C (Read): rewritten to use istream
6611 * src/lyxlex.h (~LyXLex): deleted desturctor
6612 (getStream): new function, returns an istream
6613 (getFile): deleted funtion
6614 (IsOK): return is.good();
6616 * src/lyxlex.C (LyXLex): delete file and owns_file
6617 (setFile): open an filebuf and assign that to a istream instead of
6619 (setStream): new function, takes an istream as arg.
6620 (setFile): deleted function
6621 (EatLine): rewritten us use istream instead of FILE*
6625 * src/table.C (LyXTable): use istream instead of FILE*
6626 (Read): rewritten to take an istream instead of FILE*
6628 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6630 * src/buffer.C (Dispatch): remove an extraneous break statement.
6632 * src/support/filetools.C (QuoteName): change to do simple
6633 'quoting'. More work is necessary. Also changed to do nothing
6634 under emx (needs fix too).
6635 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6637 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6638 config.h.in to the AC_DEFINE_UNQUOTED() call.
6639 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6640 needs char * as argument (because Solaris 7 declares it like
6643 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6644 remove definition of BZERO.
6646 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6648 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6649 defined, "lyxregex.h" if not.
6651 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6653 (REGEX): new variable that is set to regex.c lyxregex.h when
6654 AM_CONDITIONAL USE_REGEX is set.
6655 (libsupport_la_SOURCES): add $(REGEX)
6657 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6660 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6663 * configure.in: add call to LYX_REGEX
6665 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6666 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6668 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6670 * lib/bind/fi_menus.bind: new file, from
6671 pauli.virtanen@saunalahti.fi.
6673 * src/buffer.C (getBibkeyList): pass the parameter delim to
6674 InsetInclude::getKeys and InsetBibtex::getKeys.
6676 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6677 is passed to Buffer::getBibkeyList
6679 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6680 instead of the hardcoded comma.
6682 * src/insets/insetbib.C (getKeys): make sure that there are not
6683 leading blanks in bibtex keys. Normal latex does not care, but
6684 harvard.sty seems to dislike blanks at the beginning of citation
6685 keys. In particular, the retturn value of the function is
6687 * INSTALL: make it clear that libstdc++ is needed and that gcc
6688 2.7.x probably does not work.
6690 * src/support/filetools.C (findtexfile): make debug message go to
6692 * src/insets/insetbib.C (getKeys): ditto
6694 * src/debug.C (showTags): make sure that the output is correctly
6697 * configure.in: add a comment for TWO_COLOR_ICON define.
6699 * acconfig.h: remove all the entries that already defined in
6700 configure.in or acinclude.m4.
6702 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6703 to avoid user name, date and copyright.
6705 1999-12-21 Juergen Vigna <jug@sad.it>
6707 * src/table.C (Read): Now read bogus row format informations
6708 if the format is < 5 so that afterwards the table can
6709 be read by lyx but without any format-info. Fixed the
6710 crash we experienced when not doing this.
6712 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6714 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6715 (RedoDrawingOfParagraph): ditto
6716 (RedoParagraphs): ditto
6717 (RemoveTableRow): ditto
6719 * src/text.C (Fill): rename arg paperwidth -> paper_width
6721 * src/buffer.C (insertLyXFile): rename var filename -> fname
6722 (writeFile): rename arg filename -> fname
6723 (writeFileAscii): ditto
6724 (makeLaTeXFile): ditto
6725 (makeLinuxDocFile): ditto
6726 (makeDocBookFile): ditto
6728 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6731 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6733 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6736 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6737 compiled by a C compiler not C++.
6739 * src/layout.h (LyXTextClass): added typedef for const_iterator
6740 (LyXTextClassList): added typedef for const_iterator + member
6741 functions begin and end.
6743 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6744 iterators to fill the choice_class.
6745 (updateLayoutChoice): rewritten to use iterators to fill the
6746 layoutlist in the toolbar.
6748 * src/BufferView.h (BufferView::work_area_width): removed unused
6751 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6753 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6754 (sgmlCloseTag): ditto
6756 * src/support/lstrings.h: return type of countChar changed to
6759 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6760 what version of this func to use. Also made to return unsigned int.
6762 * configure.in: call LYX_STD_COUNT
6764 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6765 conforming std::count.
6767 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6769 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6770 and a subscript would give bad display (patch from Dekel Tsur
6771 <dekel@math.tau.ac.il>).
6773 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6775 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6778 * src/chset.h: add a few 'using' directives
6780 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6781 triggered when no buffer is active
6783 * src/layout.C: removed `break' after `return' in switch(), since
6786 * src/lyx_main.C (init): make sure LyX can be ran in place even
6787 when libtool has done its magic with shared libraries. Fix the
6788 test for the case when the system directory has not been found.
6790 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6791 name for the latex file.
6792 (MenuMakeHTML): ditto
6794 * src/buffer.h: add an optional boolean argument, which is passed
6797 1999-12-20 Allan Rae <rae@lyx.org>
6799 * lib/templates/IEEEtran.lyx: small correction and update.
6801 * configure.in: Attempted to use LYX_PATH_HEADER
6803 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6805 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6806 input from JMarc. Now use preprocessor to find the header.
6807 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6808 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6809 LYX_STL_STRING_FWD. See comments in file.
6811 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6813 * The global MiniBuffer * minibuffer variable is dead.
6815 * The global FD_form_main * fd_form_main variable is dead.
6817 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6819 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6821 * src/table.h: add the LOstream.h header
6822 * src/debug.h: ditto
6824 * src/LyXAction.h: change the explaination of the ReadOnly
6825 attribute: is indicates that the function _can_ be used.
6827 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6830 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6832 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6838 * src/paragraph.C (GetWord): assert on pos>=0
6841 * src/support/lyxstring.C: condition the use of an invariant on
6843 * src/support/lyxstring.h: ditto
6845 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6846 Use LAssert.h instead of plain assert().
6848 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6850 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6851 * src/support/filetools.C: ditto
6853 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6856 * INSTALL: document the new configure flags
6858 * configure.in: suppress --with-debug; add --enable-assertions
6860 * acinclude.m4: various changes in alignment of help strings.
6862 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6864 * src/kbmap.C: commented out the use of the hash map in kb_map,
6865 beginning of movement to a stl::container.
6867 * several files: removed code that was not in effect when
6868 MOVE_TEXT was defined.
6870 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6871 for escaping should not be used. We can discuss if the string
6872 should be enclosed in f.ex. [] instead of "".
6874 * src/trans_mgr.C (insert): use the new returned value from
6875 encodeString to get deadkeys and keymaps done correctly.
6877 * src/chset.C (encodeString): changed to return a pair, to tell
6878 what to use if we know the string.
6880 * src/lyxscreen.h (fillArc): new function.
6882 * src/FontInfo.C (resize): rewritten to use more std::string like
6883 structore, especially string::replace.
6885 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6888 * configure.in (chmod +x some scripts): remove config/gcc-hack
6890 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6892 * src/buffer.C (writeFile): change once again the top comment in a
6893 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6894 instead of an hardcoded version number.
6895 (makeDocBookFile): ditto
6897 * src/version.h: add new define LYX_DOCVERSION
6899 * po/de.po: update from Pit Sütterlin
6900 * lib/bind/de_menus.bind: ditto.
6902 * src/lyxfunc.C (Dispatch): call MenuExport()
6903 * src/buffer.C (Dispatch): ditto
6905 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6906 LyXFunc::Dispatch().
6907 (MenuExport): new function, moved from
6908 LyXFunc::Dispatch().
6910 * src/trans_mgr.C (insert): small cleanup
6911 * src/chset.C (loadFile): ditto
6913 * lib/kbd/iso8859-1.cdef: add missing backslashes
6915 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6917 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6918 help with placing the manually drawn accents better.
6920 (Draw): x2 and hg changed to float to minimize rounding errors and
6921 help place the accents better.
6923 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6924 unsigned short to char is just wrong...cast the char to unsigned
6925 char instead so that the two values can compare sanely. This
6926 should also make the display of insetlatexaccents better and
6927 perhaps also some other insets.
6929 (lbearing): new function
6932 1999-12-15 Allan Rae <rae@lyx.org>
6934 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6935 header that provides a wrapper around the very annoying SGI STL header
6938 * src/support/lyxstring.C, src/LString.h:
6939 removed old SGI-STL-compatability attempts.
6941 * configure.in: Use LYX_STL_STRING_FWD.
6943 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6944 stl_string_fwd.h is around and try to determine it's location.
6945 Major improvement over previous SGI STL 3.2 compatability.
6946 Three small problems remain with this function due to my zero
6947 knowledge of autoconf. JMarc and lgb see the comments in the code.
6949 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6951 * src/broken_const.h, config/hack-gcc, config/README: removed
6953 * configure.in: remove --with-gcc-hack option; do not call
6956 * INSTALL: remove documentation of --with-broken-const and
6959 * acconfig.h: remove all trace of BROKEN_CONST define
6961 * src/buffer.C (makeDocBookFile): update version number in output
6963 (SimpleDocBookOnePar): fix an assert when trying to a character
6964 access beyond string length
6967 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6969 * po/de.po: fix the Export menu
6971 * lyx.man: update the description of -dbg
6973 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6974 (commandLineHelp): updated
6975 (easyParse): show list of available debug levels if -dbg is passed
6978 * src/Makefile.am: add debug.C
6980 * src/debug.h: moved some code to debug.C
6982 * src/debug.C: new file. Contains code to set and show debug
6985 * src/layout.C: remove 'break' after 'continue' in switch
6986 statements, since these cannot be reached.
6988 1999-12-13 Allan Rae <rae@lyx.org>
6990 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6991 (in_word_set): hash() -> math_hash()
6993 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6995 * acconfig.h: Added a test for whether we are using exceptions in the
6996 current compilation run. If so USING_EXCEPTIONS is defined.
6998 * config.in: Check for existance of stl_string_fwd.h
6999 * src/LString.h: If compiling --with-included-string and SGI's
7000 STL version 3.2 is present (see above test) we need to block their
7001 forward declaration of string and supply a __get_c_string().
7002 However, it turns out this is only necessary if compiling with
7003 exceptions enabled so I've a bit more to add yet.
7005 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7006 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7007 src/support/LRegex.h, src/undo.h:
7008 Shuffle the order of the included files a little to ensure that
7009 LString.h gets included before anything that includes stl_string_fwd.h
7011 * src/support/lyxstring.C: We need to #include LString.h instead of
7012 lyxstring.h to get the necessary definition of __get_c_string.
7013 (__get_c_string): New function. This is defined static just like SGI's
7014 although why they need to do this I'm not sure. Perhaps it should be
7015 in lstrings.C instead.
7017 * lib/templates/IEEEtran.lyx: New template file.
7019 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7021 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7022 * intl/Makefile.in (MKINSTALLDIRS): ditto
7024 * src/LyXAction.C (init): changed to hold the LFUN data in a
7025 automatic array in stead of in callso to newFunc, this speeds up
7026 compilation a lot. Also all the memory used by the array is
7027 returned when the init is completed.
7029 * a lot of files: compiled with -Wold-style-cast, changed most of
7030 the reported offenders to C++ style casts. Did not change the
7031 offenders in C files.
7033 * src/trans.h (Match): change argument type to unsigned int.
7035 * src/support/DebugStream.C: fix some types on the streambufs so
7036 that it works on a conforming implementation.
7038 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7040 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7042 * src/support/lyxstring.C: remove the inline added earlier since
7043 they cause a bunch of unsatisfied symbols when linking with dec
7044 cxx. Cxx likes to have the body of inlines at the place where they
7047 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7048 accessing negative bounds in array. This fixes the crash when
7049 inserting accented characters.
7050 * src/trans.h (Match): ditto
7052 * src/buffer.C (Dispatch): since this is a void, it should not try
7053 to return anything...
7055 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7057 * src/buffer.h: removed the two friends from Buffer. Some changes
7058 because of this. Buffer::getFileName and Buffer::setFileName
7059 renamed to Buffer::fileName() and Buffer::fileName(...).
7061 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7063 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7064 and Buffer::update(short) to BufferView. This move is currently
7065 controlled by a define MOVE_TEXT, this will be removed when all
7066 shows to be ok. This move paves the way for better separation
7067 between buffer contents and buffer view. One side effect is that
7068 the BufferView needs a rebreak when swiching buffers, if we want
7069 to avoid this we can add a cache that holds pointers to LyXText's
7070 that is not currently in use.
7072 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7075 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7077 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7079 * lyx_main.C: new command line option -x (or --execute) and
7080 -e (or --export). Now direct conversion from .lyx to .tex
7081 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7082 Unfortunately, X is still needed and the GUI pops up during the
7085 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7087 * src/Spacing.C: add a using directive to bring stream stuff into
7089 * src/paragraph.C: ditto
7090 * src/buffer.C: ditto
7092 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7093 from Lars' announcement).
7095 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7096 example files from Tino Meinen.
7098 1999-12-06 Allan Rae <rae@lyx.org>
7100 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7102 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7104 * src/support/lyxstring.C: added a lot of inline for no good
7107 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7108 latexWriteEndChanges, they were not used.
7110 * src/layout.h (operator<<): output operator for PageSides
7112 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7114 * some example files: loaded in LyX 1.0.4 and saved again to update
7115 certain constructs (table format)
7117 * a lot of files: did the change to use fstream/iostream for all
7118 writing of files. Done with a close look at Andre Poenitz's patch.
7120 * some files: whitespace changes.
7122 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7124 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7125 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7126 architecture, we provide our own. It is used unconditionnally, but
7127 I do not think this is a performance problem. Thanks to Angus
7128 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7129 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7131 (GetInset): use my_memcpy.
7135 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7136 it is easier to understand, but it uses less TeX-only constructs now.
7138 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7139 elements contain spaces
7141 * lib/configure: regenerated
7143 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7144 elements contain spaces; display the list of programs that are
7147 * autogen.sh: make sure lib/configure is executable
7149 * lib/examples/*: rename the tutorial examples to begin with the
7150 two-letters language code.
7152 * src/lyxfunc.C (getStatus): do not query current font if no
7155 * src/lyx_cb.C (RunScript): use QuoteName
7156 (MenuRunDvips): ditto
7157 (PrintApplyCB): ditto
7159 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7160 around argument, so that it works well with the current shell.
7161 Does not work properly with OS/2 shells currently.
7163 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7164 * src/LyXSendto.C (SendtoApplyCB): ditto
7165 * src/lyxfunc.C (Dispatch): ditto
7166 * src/buffer.C (runLaTeX): ditto
7167 (runLiterate): ditto
7168 (buildProgram): ditto
7170 * src/lyx_cb.C (RunScript): ditto
7171 (MenuMakeLaTeX): ditto
7173 * src/buffer.h (getLatexName): new method
7175 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7177 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7179 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7180 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7181 (create_math_panel): ditto
7183 * src/lyxfunc.C (getStatus): re-activate the code which gets
7184 current font and cursor; add test for export to html.
7186 * src/lyxrc.C (read): remove unreachable break statements; add a
7189 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7191 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7193 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7194 introduced by faulty regex.
7195 * src/buffer.C: ditto
7196 * src/lastfiles.C: ditto
7197 * src/paragraph.C: ditto
7198 * src/table.C: ditto
7199 * src/vspace.C: ditto
7200 * src/insets/figinset.C: ditto
7201 Note: most of these is absolutely harmless, except the one in
7202 src/mathed formula.C.
7204 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7206 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7207 operation, yielding correct results for the reLyX command.
7209 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7211 * src/support/filetools.C (ExpandPath): removed an over eager
7213 (ReplaceEnvironmentPath): ditto
7215 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7216 shows that we are doing something fishy in our code...
7220 * src/lyxrc.C (read): use a double switch trick to get more help
7221 from the compiler. (the same trick is used in layout.C)
7222 (write): new function. opens a ofstream and pass that to output
7223 (output): new function, takes a ostream and writes the lyxrc
7224 elemts to it. uses a dummy switch to make sure no elements are
7227 * src/lyxlex.h: added a struct pushpophelper for use in functions
7228 with more than one exit point.
7230 * src/lyxlex.[Ch] (GetInteger): made it const
7234 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7236 * src/layout.[hC] : LayoutTags splitted into several enums, new
7237 methods created, better error handling cleaner use of lyxlex. Read
7240 * src/bmtable.[Ch]: change some member prototypes because of the
7241 image const changes.
7243 * commandtags.h, src/LyXAction.C (init): new function:
7244 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7245 This file is not read automatically but you can add \input
7246 preferences to your lyxrc if you want to. We need to discuss how
7249 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7250 in .aux, also remove .bib and .bst files from dependencies when
7253 * src/BufferView.C, src/LyXView.C: add const_cast several places
7254 because of changes to images.
7256 * lib/images/*: same change as for images/*
7258 * lib/lyxrc.example: Default for accept_compound is false not no.
7260 * images/*: changed to be const, however I have som misgivings
7261 about this change so it might be changed back.
7263 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7265 * lib/configure, po/POTFILES.in: regenerated
7267 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7269 * config/lib_configure.m4: removed
7271 * lib/configure.m4: new file (was config/lib_configure.m4)
7273 * configure.in: do not test for rtti, since we do not use it.
7275 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7277 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7278 doubling of allocated space scheme. This makes it faster for large
7279 strings end to use less memory for small strings. xtra rememoved.
7281 * src/insets/figinset.C (waitalarm): commented out.
7282 (GhostscriptMsg): use static_cast
7283 (GhostscriptMsg): use new instead of malloc to allocate memory for
7284 cmap. also delete the memory after use.
7286 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7288 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7289 for changes in bibtex database or style.
7290 (runBibTeX): remove all .bib and .bst files from dep before we
7292 (run): use scanAuc in when dep file already exist.
7294 * src/DepTable.C (remove_files_with_extension): new method
7297 * src/DepTable.[Ch]: made many of the methods const.
7299 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7301 * src/bufferparams.C: make sure that the default textclass is
7302 "article". It used to be the first one by description order, but
7303 now the first one is "docbook".
7305 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7306 string; call Debug::value.
7307 (easyParse): pass complete argument to setDebuggingLevel().
7309 * src/debug.h (value): fix the code that parses debug levels.
7311 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7314 * src/LyXAction.C: use Debug::ACTION as debug channel.
7316 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7318 * NEWS: updated for the future 1.1.3 release.
7320 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7321 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7322 it should. This is of course a controversial change (since many
7323 people will find that their lyx workscreen is suddenly full of
7324 red), but done for the sake of correctness.
7326 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7327 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7329 * src/insets/inseterror.h, src/insets/inseturl.h,
7330 src/insets/insetinfo.h, src/insets/figinset.h,
7331 src/mathed/formulamacro.h, src/mathed/math_macro.h
7332 (EditMessage): add a missing const and add _() to make sure that
7335 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7336 src/insets/insetbib.C, src/support/filetools.C: add `using'
7339 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7340 doing 'Insert index of last word' at the beginning of a paragraph.
7342 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7344 * several files: white-space changes.
7346 * src/mathed/formula.C: removed IsAlpha and IsDigit
7348 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7349 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7352 * src/insets/figinset.C (GetPSSizes): don't break when
7353 "EndComments" is seen. But break when a boundingbox is read.
7355 * all classes inherited from Inset: return value of Clone
7356 changed back to Inset *.
7358 * all classes inherited form MathInset: return value of Clone
7359 changed back to MathedInset *.
7361 * src/insets/figinset.C (runqueue): use a ofstream to output the
7362 gs/ps file. Might need some setpresicion or setw. However I can
7363 see no problem with the current code.
7364 (runqueue): use sleep instead of the alarm/signal code. I just
7365 can't see the difference.
7367 * src/paragraph.C (LyXParagraph): reserve space in the new
7368 paragraph and resize the inserted paragraph to just fit.
7370 * src/lyxfunc.h (operator|=): added operator for func_status.
7372 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7373 check for readable file.
7375 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7376 check for readable file.
7377 (MenuMakeLinuxDoc): ditto
7378 (MenuMakeDocBook): ditto
7379 (MenuMakeAscii): ditto
7380 (InsertAsciiFile): split the test for openable and readable
7382 * src/bmtable.C (draw_bitmaptable): use
7383 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7385 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7386 findtexfile from LaTeX to filetools.
7388 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7389 instead of FilePtr. Needs to be verified by a literate user.
7391 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7393 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7394 (EditMessage): likewise.
7396 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7397 respectively as \textasciitilde and \textasciicircum.
7399 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7401 * src/support/lyxstring.h: made the methods that take iterators
7404 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7405 (regexMatch): made is use the real regex class.
7407 * src/support/Makefile.am: changed to use libtool
7409 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7411 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7413 (MathIsInset ++): changed several macros to be inline functions
7416 * src/mathed/Makefile.am: changed to use libtool
7418 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7420 * src/insets/inset* : Clone changed to const and return type is
7421 the true insettype not just Inset*.
7423 * src/insets/Makefile.am: changed to use libtool
7425 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7427 * src/undo.[Ch] : added empty() and changed some of the method
7430 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7432 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7433 setID use block<> for the bullets array, added const several places.
7435 * src/lyxfunc.C (getStatus): new function
7437 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7438 LyXAction, added const to several funtions.
7440 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7441 a std::map, and to store the dir items in a vector.
7443 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7446 * src/LyXView.[Ch] + other files : changed currentView to view.
7448 * src/LyXAction.[Ch] : ported from the old devel branch.
7450 * src/.cvsignore: added .libs and a.out
7452 * configure.in : changes to use libtool.
7454 * acinclude.m4 : inserted libtool.m4
7456 * .cvsignore: added libtool
7458 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7460 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7461 file name in insets and mathed directories (otherwise the
7462 dependency is not taken in account under cygwin).
7464 * src/text2.C (InsertString[AB]): make sure that we do not try to
7465 read characters past the string length.
7467 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7469 * lib/doc/LaTeXConfig.lyx.in,
7470 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7472 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7473 file saying who created them and when this heppened; this is
7474 useless and annoys tools like cvs.
7476 * lib/layouts/g-brief-{en,de}.layout,
7477 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7478 from Thomas Hartkens <thomas@hartkens.de>.
7480 * src/{insets,mathed}/Makefile.am: do not declare an empty
7481 LDFLAGS, so that it can be set at configure time (useful on Irix
7484 * lib/reLyX/configure.in: make sure that the prefix is set
7485 correctly in LYX_DIR.
7487 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7489 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7490 be used by 'command-sequence' this allows to bind a key to a
7491 sequence of LyX-commands
7492 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7494 * src/LyXAction.C: add "command-sequence"
7496 * src/LyXFunction.C: handling of "command-sequence"
7498 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7499 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7501 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7503 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7505 * src/buffer.C (writeFile): Do not output a comment giving user
7506 and date at the beginning of a .lyx file. This is useless and
7507 annoys cvs anyway; update version number to 1.1.
7509 * src/Makefile.am (LYX_DIR): add this definition, so that a
7510 default path is hardcoded in LyX.
7512 * configure.in: Use LYX_GNU_GETTEXT.
7514 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7515 AM_GNU_GETTEXT with a bug fixed.
7517 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7519 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7521 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7522 which is used to point to LyX data is now LYX_DIR_11x.
7524 * lyx.man: convert to a unix text file; small updates.
7526 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7528 * src/support/LSubstring.[Ch]: made the second arg of most of the
7529 constructors be a const reference.
7531 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7534 * src/support/lyxstring.[Ch] (swap): added missing member function
7535 and specialization of swap(str, str);
7537 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7539 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7540 trace of the old one.
7542 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7543 put the member definitions in undo.C.
7545 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7546 NEW_TEXT and have now only code that was included when this was
7549 * src/intl.C (LCombo): use static_cast
7551 (DispatchCallback): ditto
7553 * src/definitions.h: removed whole file
7555 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7557 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7558 parsing and stores in a std:map. a regex defines the file format.
7559 removed unneeded members.
7561 * src/bufferparams.h: added several enums from definitions.h here.
7562 Removed unsused destructor. Changed some types to use proper enum
7563 types. use block to have the temp_bullets and user_defined_bullets
7564 and to make the whole class assignable.
7566 * src/bufferparams.C (Copy): removed this functions, use a default
7569 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7572 * src/buffer.C (readLyXformat2): commend out all that have with
7573 oldpapersize to do. also comment out all that hve to do with
7574 insetlatex and insetlatexdel.
7575 (setOldPaperStuff): commented out
7577 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7579 * src/LyXAction.C: remove use of inset-latex-insert
7581 * src/mathed/math_panel.C (button_cb): use static_cast
7583 * src/insets/Makefile.am (insets_o_SOURCES): removed
7586 * src/support/lyxstring.C (helper): use the unsigned long
7587 specifier, UL, instead of a static_cast.
7589 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7591 * src/support/block.h: new file. to be used as a c-style array in
7592 classes, so that the class can be assignable.
7594 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7596 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7597 NULL, make sure to return an empty string (it is not possible to
7598 set a string to NULL).
7600 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7602 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7604 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7606 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7607 link line, so that Irix users (for example) can set it explicitely to
7610 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7611 it can be overidden at make time (static or dynamic link, for
7614 * src/vc-backend.C, src/LaTeXFeatures.h,
7615 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7616 statements to bring templates to global namespace.
7618 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7620 * src/support/lyxstring.C (operator[] const): make it standard
7623 * src/minibuffer.C (Init): changed to reflect that more
7624 information is given from the lyxvc and need not be provided here.
7626 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7628 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7630 * src/LyXView.C (UpdateTimerCB): use static_cast
7631 (KeyPressMask_raw_callback): ditto
7633 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7634 buffer_, a lot of changes because of this. currentBuffer() ->
7635 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7636 also changes to other files because of this.
7638 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7640 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7641 have no support for RCS and partial support for CVS, will be
7644 * src/insets/ several files: changes because of function name
7645 changes in Bufferview and LyXView.
7647 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7649 * src/support/LSubstring.[Ch]: new files. These implement a
7650 Substring that can be very convenient to use. i.e. is this
7652 string a = "Mary had a little sheep";
7653 Substring(a, "sheep") = "lamb";
7654 a is now "Mary has a little lamb".
7656 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7657 out patterns and subpatterns of strings. It is used by LSubstring
7658 and also by vc-backend.C
7660 * src/support/lyxstring.C: went over all the assertions used and
7661 tried to correct the wrong ones and flag which of them is required
7662 by the standard. some bugs found because of this. Also removed a
7663 couple of assertions.
7665 * src/support/Makefile.am (libsupport_a_SOURCES): added
7666 LSubstring.[Ch] and LRegex.[Ch]
7668 * src/support/FileInfo.h: have struct stat buf as an object and
7669 not a pointer to one, some changes because of this.
7671 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7672 information in layout when adding the layouts preamble to the
7675 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7678 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7679 because of bug in OS/2.
7681 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7683 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7684 \verbatim@font instead of \ttfamily, so that it can be redefined.
7686 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7687 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7688 src/layout.h, src/text2.C: add 'using' directive to bring the
7689 STL templates we need from the std:: namespace to the global one.
7690 Needed by DEC cxx in strict ansi mode.
7692 * src/support/LIstream.h,src/support/LOstream.h,
7693 src/support/lyxstring.h,src/table.h,
7694 src/lyxlookup.h: do not include <config.h> in header
7695 files. This should be done in the .C files only.
7697 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7701 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7703 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7704 from Kayvan to fix the tth invokation.
7706 * development/lyx.spec.in: updates from Kayvan to reflect the
7707 changes of file names.
7709 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7711 * src/text2.C (InsertStringB): use std::copy
7712 (InsertStringA): use std::copy
7714 * src/bufferlist.C: use a vector to store the buffers in. This is
7715 an internal change and should not affect any other thing.
7717 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7720 * src/text.C (Fill): fix potential bug, one off bug.
7722 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7724 * src/Makefile.am (lyx_main.o): add more files it depends on.
7726 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7728 * src/support/lyxstring.C: use size_t for the reference count,
7729 size, reserved memory and xtra.
7730 (internal_compare): new private member function. Now the compare
7731 functions should work for std::strings that have embedded '\0'
7733 (compare): all compare functions rewritten to use
7736 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7738 * src/support/lyxstring.C (compare): pass c_str()
7739 (compare): pass c_str
7740 (compare): pass c_str
7742 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7744 * src/support/DebugStream.C: <config.h> was not included correctly.
7746 * lib/configure: forgot to re-generate it :( I'll make this file
7747 auto generated soon.
7749 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7751 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7754 * src/support/lyxstring.C: some changes from length() to rep->sz.
7755 avoids a function call.
7757 * src/support/filetools.C (SpaceLess): yet another version of the
7758 algorithm...now per Jean-Marc's suggestions.
7760 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7762 * src/layout.C (less_textclass_desc): functor for use in sorting
7764 (LyXTextClass::Read): sort the textclasses after reading.
7766 * src/support/filetools.C (SpaceLess): new version of the
7767 SpaceLess functions. What problems does this one give? Please
7770 * images/banner_bw.xbm: made the arrays unsigned char *
7772 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7774 * src/support/lyxstring.C (find): remove bogus assertion in the
7775 two versions of find where this has not been done yet.
7777 * src/support/lyxlib.h: add missing int return type to
7780 * src/menus.C (ShowFileMenu): disable exporting to html if no
7781 html export command is present.
7783 * config/lib_configure.m4: add a test for an HTML converter. The
7784 programs checked for are, in this order: tth, latex2html and
7787 * lib/configure: generated from config/lib_configure.m4.
7789 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7790 html converter. The parameters are now passed through $$FName and
7791 $$OutName, instead of standard input/output.
7793 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7795 * lib/lyxrc.example: update description of \html_command.
7796 add "quotes" around \screen_font_xxx font setting examples to help
7797 people who use fonts with spaces in their names.
7799 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7801 * Distribution files: updates for v1.1.2
7803 * src/support/lyxstring.C (find): remove bogus assert and return
7804 npos for the same condition.
7806 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7808 * added patch for OS/2 from SMiyata.
7810 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7812 * src/text2.C (CutSelection): make space_wrapped a bool
7813 (CutSelection): dont declare int i until we have to.
7814 (alphaCounter): return a char const *.
7816 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7818 * src/support/syscall.C (Systemcalls::kill):
7819 src/support/filetools.C (PutEnv, PutEnvPath):
7820 src/lyx_cb.C (addNewlineAndDepth):
7821 src/FontInfo.C (FontInfo::resize): condition some #warning
7822 directives with WITH_WARNINGS.
7825 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7827 * src/layout.[Ch] + several files: access to class variables
7828 limited and made accessor functions instead a lot of code changed
7829 becuase of this. Also instead of returning pointers often a const
7830 reference is returned instead.
7832 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7834 * src/Makefile.am (dist-hook): added used to remove the CVS from
7835 cheaders upon creating a dist
7836 (EXTRA_DIST): added cheaders
7838 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7839 a character not as a small integer.
7841 * src/support/lyxstring.C (find): removed Assert and added i >=
7842 rep->sz to the first if.
7844 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7846 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7847 src/LyXView.C src/buffer.C src/bufferparams.C
7848 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7849 src/text2.C src/insets/insetinclude.C:
7850 lyxlayout renamed to textclasslist.
7852 * src/layout.C: some lyxerr changes.
7854 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7855 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7856 (LyXLayoutList): removed all traces of this class.
7857 (LyXTextClass::Read): rewrote LT_STYLE
7858 (LyXTextClass::hasLayout): new function
7859 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7860 both const and nonconst version.
7861 (LyXTextClass::delete_layout): new function.
7862 (LyXTextClassList::Style): bug fix. do the right thing if layout
7864 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7865 (LyXTextClassList::NameOfLayout): ditto
7866 (LyXTextClassList::Load): ditto
7868 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7870 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7872 * src/LyXAction.C (LookupFunc): added a workaround for sun
7873 compiler, on the other hand...we don't know if the current code
7874 compiles on sun at all...
7876 * src/support/filetools.C (CleanupPath): subst fix
7878 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7881 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7882 complained about this one?
7884 * src/insets/insetinclude.C (Latex): subst fix
7886 * src/insets/insetbib.C (getKeys): subst fix
7888 * src/LyXSendto.C (SendtoApplyCB): subst fix
7890 * src/lyx_main.C (init): subst fix
7892 * src/layout.C (Read): subst fix
7894 * src/lyx_sendfax_main.C (button_send): subst fix
7896 * src/buffer.C (RoffAsciiTable): subst fix
7898 * src/lyx_cb.C (MenuFax): subst fix
7899 (PrintApplyCB): subst fix
7901 1999-10-26 Juergen Vigna <jug@sad.it>
7903 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7905 (Read): Cleaned up this code so now we read only format vestion >= 5
7907 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7909 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7910 come nobody has complained about this one?
7912 * src/insets/insetinclude.C (Latex): subst fix
7914 * src/insets/insetbib.C (getKeys): subst fix
7916 * src/lyx_main.C (init): subst fix
7918 * src/layout.C (Read): subst fix
7920 * src/buffer.C (RoffAsciiTable): subst fix
7922 * src/lyx_cb.C (MenuFax): subst fix.
7924 * src/layout.[hC] + some other files: rewrote to use
7925 std::container to store textclasses and layouts in.
7926 Simplified, removed a lot of code. Make all classes
7927 assignable. Further simplifications and review of type
7928 use still to be one.
7930 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7931 lastfiles to create the lastfiles partr of the menu.
7933 * src/lastfiles.[Ch]: rewritten to use deque to store the
7934 lastfiles in. Uses fstream for reading and writing. Simplifies
7937 * src/support/syscall.C: remove explicit cast.
7939 * src/BufferView.C (CursorToggleCB): removed code snippets that
7941 use explicat C++ style casts instead of C style casts. also use
7942 u_vdata instea of passing pointers in longs.
7944 * src/PaperLayout.C: removed code snippets that were commented out.
7946 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7948 * src/lyx_main.C: removed code snippets that wer commented out.
7950 * src/paragraph.C: removed code snippets that were commented out.
7952 * src/lyxvc.C (logClose): use static_cast
7954 (viewLog): remove explicit cast to void*
7955 (showLog): removed old commented code
7957 * src/menus.C: use static_cast instead of C style casts. use
7958 u_vdata instead of u_ldata. remove explicit cast to (long) for
7959 pointers. Removed old code that was commented out.
7961 * src/insets/inset.C: removed old commented func
7963 * src/insets/insetref.C (InsetRef): removed old code that had been
7964 commented out for a long time.
7966 (escape): removed C style cast
7968 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7970 * src/insets/insetlatex.C (Draw): removed old commented code
7971 (Read): rewritten to use string
7973 * src/insets/insetlabel.C (escape): removed C style cast
7975 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7977 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7980 * src/insets/insetinclude.h: removed a couple of stupid bools
7982 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7983 (Clone): remove C style cast
7984 (getKeys): changed list to lst because of std::list
7986 * src/insets/inseterror.C (Draw): removed som old commented code.
7988 * src/insets/insetcommand.C (Draw): removed some old commented code.
7990 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7991 commented out forever.
7992 (bibitem_cb): use static_cast instead of C style cast
7993 use of vdata changed to u_vdata.
7995 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7997 (CloseUrlCB): use static_cast instead of C style cast.
7998 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8000 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8001 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8002 (CloseInfoCB): static_cast from ob->u_vdata instead.
8003 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8006 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8007 (C_InsetError_CloseErrorCB): forward the ob parameter
8008 (CloseErrorCB): static_cast from ob->u_vdata instead.
8010 * src/vspace.h: include LString.h since we use string in this class.
8012 * src/vspace.C (lyx_advance): changed name from advance because of
8013 nameclash with stl. And since we cannot use namespaces yet...I
8014 used a lyx_ prefix instead. Expect this to change when we begin
8017 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8019 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8020 and removed now defunct constructor and deconstructor.
8022 * src/BufferView.h: have backstack as a object not as a pointer.
8023 removed initialization from constructor. added include for BackStack
8025 * development/lyx.spec.in (%build): add CFLAGS also.
8027 * src/screen.C (drawFrame): removed another warning.
8029 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8031 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8032 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8033 README and ANNOUNCE a bit for the next release. More work is
8036 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8037 unbreakable if we are in freespacing mode (LyX-Code), but not in
8040 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8042 * src/BackStack.h: fixed initialization order in constructor
8044 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8046 * acinclude.m4 (VERSION): new rules for when a version is
8047 development, added also a variable for prerelease.
8048 (warnings): we set with_warnings=yes for prereleases
8049 (lyx_opt): prereleases compile with same optimization as development
8050 (CXXFLAGS): only use pedantic if we are a development version
8052 * src/BufferView.C (restorePosition): don't do anything if the
8055 * src/BackStack.h: added member empty, use this to test if there
8056 is anything to pop...
8058 1999-10-25 Juergen Vigna <jug@sad.it>
8061 * forms/layout_forms.fd +
8062 * forms/latexoptions.fd +
8063 * lyx.fd: changed for various form resize issues
8065 * src/mathed/math_panel.C +
8066 * src/insets/inseterror.C +
8067 * src/insets/insetinfo.C +
8068 * src/insets/inseturl.C +
8069 * src/insets/inseturl.h +
8072 * src/PaperLayout.C +
8073 * src/ParagraphExtra.C +
8074 * src/TableLayout.C +
8076 * src/layout_forms.C +
8083 * src/menus.C: fixed various resize issues. So now forms can be
8084 resized savely or not be resized at all.
8086 * forms/form_url.fd +
8087 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8090 * src/insets/Makefile.am: added files form_url.[Ch]
8092 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8094 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8095 (and presumably 6.2).
8097 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8098 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8099 remaining static member callbacks.
8101 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8104 * src/support/lyxstring.h: declare struct Srep as friend of
8105 lyxstring, since DEC cxx complains otherwise.
8107 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8109 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8111 * src/LaTeX.C (run): made run_bibtex also depend on files with
8113 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8114 are put into the dependency file.
8116 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8117 the code has shown itself to work
8118 (create_ispell_pipe): removed another warning, added a comment
8121 * src/minibuffer.C (ExecutingCB): removed code that has been
8122 commented out a long time
8124 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8125 out code + a warning.
8127 * src/support/lyxstring.h: comment out the three private
8128 operators, when compiling with string ansi conforming compilers
8131 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8133 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8134 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8137 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8140 * src/mathed/math_panel.C (create_math_panel): remove explicit
8143 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8146 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8147 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8148 to XCreatePixmapFromBitmapData
8149 (fl_set_bmtable_data): change the last argument to be unsigned
8151 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8152 and bh to be unsigned int, remove explicit casts in call to
8153 XReadBitmapFileData.
8155 * images/arrows.xbm: made the arrays unsigned char *
8156 * images/varsz.xbm: ditto
8157 * images/misc.xbm: ditto
8158 * images/greek.xbm: ditto
8159 * images/dots.xbm: ditto
8160 * images/brel.xbm: ditto
8161 * images/bop.xbm: ditto
8163 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8165 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8166 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8167 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8169 (LYX_CXX_CHEADERS): added <clocale> to the test.
8171 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8173 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8175 * src/support/lyxstring.C (append): fixed something that must be a
8176 bug, rep->assign was used instead of rep->append.
8178 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8181 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8182 lyx insert double chars. Fix spotted by Kayvan.
8184 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8186 * Fixed the tth support. I messed up with the Emacs patch apply feature
8187 and omitted the changes in lyxrc.C.
8189 1999-10-22 Juergen Vigna <jug@sad.it>
8191 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8193 * src/lyx_cb.C (MenuInsertRef) +
8194 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8195 the form cannot be resized under it limits (fixes a segfault)
8197 * src/lyx.C (create_form_form_ref) +
8198 * forms/lyx.fd: Changed Gravity on name input field so that it is
8201 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8203 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8204 <ostream> and <istream>.
8206 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8207 whether <fstream> provides the latest standard features, or if we
8208 have an oldstyle library (like in egcs).
8209 (LYX_CXX_STL_STRING): fix the test.
8211 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8212 code on MODERN_STL_STREAM.
8214 * src/support/lyxstring.h: use L{I,O}stream.h.
8216 * src/support/L{I,O}stream.h: new files, designed to setup
8217 correctly streams for our use
8218 - includes the right header depending on STL capabilities
8219 - puts std::ostream and std::endl (for LOStream.h) or
8220 std::istream (LIStream.h) in toplevel namespace.
8222 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8224 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8225 was a bib file that had been changed we ensure that bibtex is run.
8226 (runBibTeX): enhanced to extract the names of the bib files and
8227 getting their absolute path and enter them into the dep file.
8228 (findtexfile): static func that is used to look for tex-files,
8229 checks for absolute patchs and tries also with kpsewhich.
8230 Alternative ways of finding the correct files are wanted. Will
8232 (do_popen): function that runs a command using popen and returns
8233 the whole output of that command in a string. Should be moved to
8236 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8237 file with extension ext has changed.
8239 * src/insets/figinset.C: added ifdef guards around the fl_free
8240 code that jug commented out. Now it is commented out when
8241 compiling with XForms == 0.89.
8243 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8244 to lyxstring.C, and only keep a forward declaration in
8245 lyxstring.h. Simplifies the header file a bit and should help a
8246 bit on compile time too. Also changes to Srep will not mandate a
8247 recompile of code just using string.
8248 (~lyxstring): definition moved here since it uses srep.
8249 (size): definition moved here since it uses srep.
8251 * src/support/lyxstring.h: removed a couple of "inline" that should
8254 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8256 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8259 1999-10-21 Juergen Vigna <jug@sad.it>
8261 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8262 set to left if I just remove the width entry (or it is empty).
8264 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8265 paragraph when having dummy paragraphs.
8267 1999-10-20 Juergen Vigna <jug@sad.it>
8269 * src/insets/figinset.C: just commented some fl_free_form calls
8270 and added warnings so that this calls should be activated later
8271 again. This avoids for now a segfault, but we have a memory leak!
8273 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8274 'const char * argument' to 'string argument', this should
8275 fix some Asserts() in lyxstring.C.
8277 * src/lyxfunc.h: Removed the function argAsString(const char *)
8278 as it is not used anymore.
8280 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8282 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8285 * src/Literate.h: some funcs moved from public to private to make
8286 interface clearer. Unneeded args removed.
8288 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8290 (scanBuildLogFile): ditto
8292 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8293 normal TeX Error. Still room for improvement.
8295 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8297 * src/buffer.C (insertErrors): changes to make the error
8298 desctription show properly.
8300 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8303 * src/support/lyxstring.C (helper): changed to use
8304 sizeof(object->rep->ref).
8305 (operator>>): changed to use a pointer instead.
8307 * src/support/lyxstring.h: changed const reference & to value_type
8308 const & lets see if that helps.
8310 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8312 * Makefile.am (rpmdist): fixed to have non static package and
8315 * src/support/lyxstring.C: removed the compilation guards
8317 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8320 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8321 conditional compile of lyxstring.Ch
8323 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8324 stupid check, but it is a lot better than the bastring hack.
8325 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8327 * several files: changed string::erase into string::clear. Not
8330 * src/chset.C (encodeString): use a char temporary instead
8332 * src/table.C (TexEndOfCell): added tostr around
8333 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8334 (TexEndOfCell): ditto
8335 (TexEndOfCell): ditto
8336 (TexEndOfCell): ditto
8337 (DocBookEndOfCell): ditto
8338 (DocBookEndOfCell): ditto
8339 (DocBookEndOfCell): ditto
8340 (DocBookEndOfCell): ditto
8342 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8344 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8346 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8347 (MenuBuildProg): added tostr around ret
8348 (MenuRunChktex): added tostr around ret
8349 (DocumentApplyCB): added tostr around ret
8351 * src/chset.C (encodeString): added tostr around t->ic
8353 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8354 (makeLaTeXFile): added tostr around tocdepth
8355 (makeLaTeXFile): added tostr around ftcound - 1
8357 * src/insets/insetbib.C (setCounter): added tostr around counter.
8359 * src/support/lyxstring.h: added an operator+=(int) to catch more
8362 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8363 (lyxstring): We DON'T allow NULL pointers.
8365 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8367 * src/mathed/math_macro.C (MathMacroArgument::Write,
8368 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8369 when writing them out.
8371 * src/LString.C: remove, since it is not used anymore.
8373 * src/support/lyxstring.C: condition the content to
8374 USE_INCLUDED_STRING macro.
8376 * src/mathed/math_symbols.C, src/support/lstrings.C,
8377 src/support/lyxstring.C: add `using' directive to specify what
8378 we need in <algorithm>. I do not think that we need to
8379 conditionalize this, but any thought is appreciated.
8381 * many files: change all callback functions to "C" linkage
8382 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8383 strict_ansi. Those who were static are now global.
8384 The case of callbacks which are static class members is
8385 trickier, since we have to make C wrappers around them (see
8386 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8387 did not finish this yet, since it defeats the purpose of
8388 encapsulation, and I am not sure what the best route is.
8390 1999-10-19 Juergen Vigna <jug@sad.it>
8392 * src/support/lyxstring.C (lyxstring): we permit to have a null
8393 pointer as assignment value and just don't assign it.
8395 * src/vspace.C (nextToken): corrected this function substituting
8396 find_first(_not)_of with find_last_of.
8398 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8399 (TableOptCloseCB) (TableSpeCloseCB):
8400 inserted fl_set_focus call for problem with fl_hide_form() in
8403 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8405 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8408 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8410 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8411 LyXLex::next() and not eatline() to get its argument.
8413 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8415 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8416 instead, use fstreams for io of the depfile, removed unneeded
8417 functions and variables.
8419 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8420 vector instead, removed all functions and variables that is not in
8423 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8425 * src/buffer.C (insertErrors): use new interface to TeXError
8427 * Makefile.am (rpmdist): added a rpmdist target
8429 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8430 per Kayvan's instructions.
8432 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8434 * src/Makefile.am: add a definition for localedir, so that locales
8435 are found after installation (Kayvan)
8437 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8439 * development/.cvsignore: new file.
8441 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8443 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8444 C++ compiler provides wrappers for C headers and use our alternate
8447 * configure.in: use LYX_CXX_CHEADERS.
8449 * src/cheader/: new directory, populated with cname headers from
8450 libstdc++-2.8.1. They are a bit old, but probably good enough for
8451 what we want (support compilers who lack them).
8453 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8454 from includes. It turns out is was stupid.
8456 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8458 * lib/Makefile.am (install-data-local): forgot a ';'
8459 (install-data-local): forgot a '\'
8460 (libinstalldirs): needed after all. reintroduced.
8462 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8464 * configure.in (AC_OUTPUT): added lyx.spec
8466 * development/lyx.spec: removed file
8468 * development/lyx.spec.in: new file
8470 * po/*.po: merged with lyx.pot becuase of make distcheck
8472 * lib/Makefile.am (dist-hook): added dist-hook so that
8473 documentation files will be included when doing a make
8474 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8475 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8477 more: tried to make install do the right thing, exclude CVS dirs
8480 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8481 Path would fit in more nicely.
8483 * all files that used to use pathstack: uses now Path instead.
8484 This change was a lot easier than expected.
8486 * src/support/path.h: new file
8488 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8490 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8492 * src/support/lyxstring.C (getline): Default arg was given for
8495 * Configure.cmd: removed file
8497 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8499 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8500 streams classes and types, add the proper 'using' statements when
8501 MODERN_STL is defined.
8503 * src/debug.h: move the << operator definition after the inclusion
8506 * src/support/filetools.C: include "LAssert.h", which is needed
8509 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8512 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8513 include "debug.h" to define a proper ostream.
8515 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8517 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8518 method to the SystemCall class which can kill a process, but it's
8519 not fully implemented yet.
8521 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8523 * src/support/FileInfo.h: Better documentation
8525 * src/lyxfunc.C: Added support for buffer-export html
8527 * src/menus.C: Added Export->As HTML...
8529 * lib/bind/*.bind: Added short-cut for buffer-export html
8531 * src/lyxrc.*: Added support for new \tth_command
8533 * lib/lyxrc.example: Added stuff for new \tth_command
8535 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8537 * lib/Makefile.am (IMAGES): removed images/README
8538 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8539 installes in correct place. Check permisions is installed
8542 * src/LaTeX.C: some no-op changes moved declaration of some
8545 * src/LaTeX.h (LATEX_H): changed include guard name
8547 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8549 * lib/reLyX/Makefile.am: install noweb2lyx.
8551 * lib/Makefile.am: install configure.
8553 * lib/reLyX/configure.in: declare a config aux dir; set package
8554 name to lyx (not sure what the best solution is); generate noweb2lyx.
8556 * lib/layouts/egs.layout: fix the bibliography layout.
8558 1999-10-08 Jürgen Vigna <jug@sad.it>
8560 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8561 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8562 it returned without continuing to search the path.
8564 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8566 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8567 also fixes a bug. It is not allowed to do tricks with std::strings
8568 like: string a("hei"); &a[e]; this will not give what you
8569 think... Any reason for the complexity in this func?
8571 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8573 * Updated README and INSTALL a bit, mostly to check that my
8574 CVS rights are correctly set up.
8576 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8578 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8579 does not allow '\0' chars but lyxstring and std::string does.
8581 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8583 * autogen.sh (AUTOCONF): let the autogen script create the
8584 POTFILES.in file too. POTFILES.in should perhaps now not be
8585 included in the cvs module.
8587 * some more files changed to use C++ includes instead of C ones.
8589 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8591 (Reread): added tostr to nlink. buggy output otherwise.
8592 (Reread): added a string() around szMode when assigning to Buffer,
8593 without this I got a log of garbled info strings.
8595 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8598 * I have added several ostream & operator<<(ostream &, some_type)
8599 functions. This has been done to avoid casting and warnings when
8600 outputting enums to lyxerr. This as thus eliminated a lot of
8601 explicit casts and has made the code clearer. Among the enums
8602 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8603 mathed enums, some font enum the Debug::type enum.
8605 * src/support/lyxstring.h (clear): missing method. equivalent of
8608 * all files that contained "stderr": rewrote constructs that used
8609 stderr to use lyxerr instead. (except bmtable)
8611 * src/support/DebugStream.h (level): and the passed t with
8612 Debug::ANY to avoid spurious bits set.
8614 * src/debug.h (Debug::type value): made it accept strings of the
8617 * configure.in (Check for programs): Added a check for kpsewhich,
8618 the latex generation will use this later to better the dicovery of
8621 * src/BufferView.C (create_view): we don't need to cast this to
8622 (void*) that is done automatically.
8623 (WorkAreaButtonPress): removed some dead code.
8625 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8627 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8628 is not overwritten when translated (David Sua'rez de Lis).
8630 * lib/CREDITS: Added David Sua'rez de Lis
8632 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8634 * src/bufferparams.C (BufferParams): default input encoding is now
8637 * acinclude.m4 (cross_compiling): comment out macro
8638 LYX_GXX_STRENGTH_REDUCE.
8640 * acconfig.h: make sure that const is not defined (to empty) when
8641 we are compiling C++. Remove commented out code using SIZEOF_xx
8644 * configure.in : move the test for const and inline as late as
8645 possible so that these C tests do not interefere with C++ ones.
8646 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8647 has not been proven.
8649 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8651 * src/table.C (getDocBookAlign): remove bad default value for
8654 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8656 (ShowFileMenu2): ditto.
8658 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8661 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8663 * Most files: finished the change from the old error code to use
8664 DebugStream for all lyxerr debugging. Only minor changes remain
8665 (e.g. the setting of debug levels using strings instead of number)
8667 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8669 * src/layout.C (Add): Changed to use compare_no_case instead of
8672 * src/FontInfo.C: changed loop variable type too string::size_type.
8674 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8676 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8677 set ETAGS_ARGS to --c++
8679 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8681 * src/table.C (DocBookEndOfCell): commented out two unused variables
8683 * src/paragraph.C: commented out four unused variables.
8685 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8686 insed a if clause with type string::size_type.
8688 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8691 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8693 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8694 variable, also changed loop to go from 0 to lenght + 1, instead of
8695 -1 to length. This should be correct.
8697 * src/LaTeX.C (scanError): use string::size_type as loop variable
8700 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8701 (l.896) since y_tmp and row was not used anyway.
8703 * src/insets/insetref.C (escape): use string::size_type as loop
8706 * src/insets/insetquotes.C (Width): use string::size_type as loop
8708 (Draw): use string::size_type as loop variable type.
8710 * src/insets/insetlatexaccent.C (checkContents): use
8711 string::size_type as loop variable type.
8713 * src/insets/insetlabel.C (escape): use string::size_type as loop
8716 * src/insets/insetinfo.C: added an extern for current_view.
8718 * src/insets/insetcommand.C (scanCommand): use string::size_type
8719 as loop variable type.
8721 * most files: removed the RCS tags. With them we had to recompile
8722 a lot of files after a simple cvs commit. Also we have never used
8723 them for anything meaningful.
8725 * most files: tags-query-replace NULL 0. As adviced several plases
8726 we now use "0" instead of "NULL" in our code.
8728 * src/support/filetools.C (SpaceLess): use string::size_type as
8731 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8733 * src/paragraph.C: fixed up some more string stuff.
8735 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8737 * src/support/filetools.h: make modestr a std::string.
8739 * src/filetools.C (GetEnv): made ch really const.
8741 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8742 made code that used these use max/min from <algorithm> instead.
8744 * changed several c library include files to their equivalent c++
8745 library include files. All is not changed yet.
8747 * created a support subdir in src, put lyxstring and lstrings
8748 there + the extra files atexit, fileblock, strerror. Created
8749 Makefile.am. edited configure.in and src/Makefile.am to use this
8750 new subdir. More files moved to support.
8752 * imported som of the functions from repository lyx, filetools
8754 * ran tags-query-replace on LString -> string, corrected the bogus
8755 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8756 is still some errors in there. This is errors where too much or
8757 too litle get deleted from strings (string::erase, string::substr,
8758 string::replace), there can also be some off by one errors, or
8759 just plain wrong use of functions from lstrings. Viewing of quotes
8762 * LyX is now running fairly well with string, but there are
8763 certainly some bugs yet (see above) also string is quite different
8764 from LString among others in that it does not allow null pointers
8765 passed in and will abort if it gets any.
8767 * Added the revtex4 files I forgot when setting up the repository.
8769 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8771 * All over: Tried to clean everything up so that only the files
8772 that we really need are included in the cvs repository.
8773 * Switched to use automake.
8774 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8775 * Install has not been checked.
8777 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8779 * po/pt.po: Three errors:
8780 l.533 and l.538 format specification error
8781 l. 402 duplicate entry, I just deleted it.