1 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/minibuffer.C: fix for older compilers
5 2000-10-30 Juergen Vigna <jug@sad.it>
7 * src/insets/insettext.C (InsertInset): fixed this as the cursor
8 has to be Left of the inset otherwise LyXText won't find it!
10 * src/BufferView2.C (open_new_inset): delete the inset if it can
13 2000-10-30 Rob Lahaye <lahaye@postech.edu>
17 2000-10-29 Marko Vendelin <markov@ioc.ee>
18 * src/frontends/gnome/FormCitation.C
19 * src/frontends/gnome/FormCitation.h
20 * src/frontends/gnome/FormCopyright.C
21 * src/frontends/gnome/FormCopyright.h
22 * src/frontends/gnome/FormError.C
23 * src/frontends/gnome/FormError.h
24 * src/frontends/gnome/FormIndex.C
25 * src/frontends/gnome/FormIndex.h
26 * src/frontends/gnome/FormPrint.C
27 * src/frontends/gnome/FormPrint.h
28 * src/frontends/gnome/FormRef.C
29 * src/frontends/gnome/FormRef.h
30 * src/frontends/gnome/FormToc.C
31 * src/frontends/gnome/FormToc.h
32 * src/frontends/gnome/FormUrl.C
33 * src/frontends/gnome/FormUrl.h
34 * src/frontends/gnome/Menubar_pimpl.C
35 * src/frontends/gnome/mainapp.C
36 * src/frontends/gnome/mainapp.h
37 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
38 changing update() to updateSlot() where appropriate
40 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
42 * src/frontends/xforms/FormPreferences.[Ch]:
43 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
46 2000-10-28 Juergen Vigna <jug@sad.it>
48 * src/insets/insettabular.C (draw): fixed drawing bug.
50 * src/insets/insettext.C (clear):
52 (SetParagraphData): clearing the TEXT buffers when deleting the
53 paragraphs used by it.
55 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
57 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
59 2000-10-27 Juergen Vigna <jug@sad.it>
61 * src/tabular.C (~LyXTabular): removed not needed anymore.
63 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
66 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
68 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
71 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
74 * src/frontends/xforms/FormPreferences.[Ch]:
75 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
76 Reorganised as modules based on tabs. Much easier to follow the
77 flow and to add new tabs. Added warning and feedback messages.
80 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
82 * src/tabular.h (DocBook): add std:: qualifier.
84 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
86 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
87 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
90 * insettabular.C (DocBook): uses the tabular methods to export
93 * src/insets/insettext.h
94 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
96 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
98 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
101 * src/lyxfunc.C (MenuNew): lessen the scope of fname
102 moved misplaced AllowInput two lines up.
104 * src/buffer.C (readFile): compare float with float, not with int
106 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
108 * src/minibuffer.C: add "using SigC::slot" statement.
110 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
112 * src/frontends/xforms/forms/README: updated section about make.
114 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
115 Tidied some forms up, made two of form_tabular's tabs more
116 self-consistent, fixed Jean-Marc's size problem in form_preferences,
117 fixed translation problem with "Column".
119 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
121 * src/minibuffer.h: use Timeout instead of the xforms timer
123 (setTimer) rewrite for the Timeout, change to unsigned arg
124 (set): change to unsigned timer arg
127 * src/minibuffer.C (TimerCB): removed func
128 (C_MiniBuffer_TimerCB): removed func
129 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
130 (peek_event): use a switch statement
131 (add): don't use fl_add_timer.
132 (Set): rewrite to use the Timeout
135 * src/Timeout.[Ch] (setType): return a Timeout &
136 (setTimeout): ditto, change to unsigned arg for timeout
138 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
140 * src/mathed/formula.C (mathed_string_width): Use string instead
141 of a constant size char array.
143 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
145 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
146 the two recently added operator<< for SMInput and State.
148 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
150 (OkCancelPolicy): ditto
151 (OkCancelReadOnlyPolicy): ditto
152 (NoRepeatedApplyReadOnlyPolicy): ditto
153 (OkApplyCancelReadOnlyPolicy): ditto
154 (OkApplyCancelPolicy): ditto
155 (NoRepeatedApplyPolicy): ditto
157 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
159 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
160 add the usual std:: qualifiers.
162 2000-10-25 Juergen Vigna <jug@sad.it>
164 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
166 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
168 * src/support/filetools.C (MakeRelPath): change some types to
171 * src/frontends/ButtonPolicies.h (operator<<): new operator for
172 ButtonPolicy::SMInput and ButtonPolicy::State.
174 * src/FontLoader.C (reset): small cleanup
175 (unload): small cleanup
177 * src/FontInfo.C (getFontname): initialize error to 10000.0
179 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
181 * src/frontends/xforms/FormPreferences.[Ch]:
182 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
183 TeX encoding and default paper size sections.
185 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
187 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
190 * src/frontends/xforms/FormError.C (disconnect): use erase() to
191 make the message_ empty.
192 (FormError): don't initialize message_ in initializer list.
194 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
196 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
198 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
200 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
202 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
204 * src/frontends/kde/*data.[Ch]: _("") is not
207 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
209 * src/buffer.C: removed redundant using directive.
211 * src/frontends/DialogBase.h: revert to original definition of
214 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
215 stuff into two classes, one for each dialog, requires a new
216 element in the dialogs vector, FormTabularCreate.
218 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
221 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
222 method. Continues Allan's idea, but means that derived classes
223 don't need to worry about "update or hide?".
225 * src/frontends/xforms/FormError.C (showInset): add connection
228 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
229 one for each dialog. FormTabular now contains main tabular dialog
232 * src/frontends/xforms/FormTabularCreate.[Ch]:
233 * src/frontends/xforms/forms/form_tabular_create.fd: the create
236 * src/frontends/xforms/FormGraphics.[Ch]:
237 * src/frontends/xforms/forms/form_graphics.fd
238 * src/frontends/xforms/FormTabular.[Ch]:
239 * src/frontends/xforms/forms/form_tabular.fd: made daughter
240 classes of FormInset.
242 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
243 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
245 * src/frontends/xforms/Makefile.am:
246 * src/frontends/xforms/forms/makefile: added new files.
248 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
249 variable. added Signal0 hide signal, in keeping with other GUI-I
252 * src/support/lstrings.h: removed redundant std:: qualifier as
253 it's already declared in Lsstream.h.
255 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
257 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
261 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
263 * src/tabular.C (Ascii): minimize scope of cell.
265 * src/BufferView2.C (nextWord): return string() instead of 0;
267 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
269 * src/converter.h: add a std:: qualifier
271 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
273 * src/importer.[Ch]: New files. Used for importing files into LyX.
275 * src/lyxfunc.C (doImport): Use the new Importer class.
277 * src/converter.h: Add shortcut member to the Format class.
278 Used for holding the menu shortcut.
280 * src/converter.C and other files: Made a distinction between
281 format name and format extension. New formats can be defined using
282 the \format lyxrc tag.
283 Added two new converter flags: latex and disable.
285 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
287 * src/support/lyxlib.h: unify namespace/struct implementation.
288 Remove extra declarations.
290 * src/support/chdir.C (chdir): remove version taking char const *
292 * src/support/rename.C: ditto.
293 * src/support/lyxsum.C: ditto.
295 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
297 * src/frontends/xforms/FormBase.[Ch]:
298 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
299 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
300 work only for the next call to fl_show_form(). The correct place to set
301 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
302 done. FormBase also stores minw_, minh_ itself. All dialogs derived
303 from FormBase have the minimum size set; no more stupid crashes with
306 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
308 * lib/ui/default.ui: fix shortcut for Insert->Include File.
310 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
312 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
314 * src/support/lyxlib.h: changed second argument of mkdir to
315 unsigned long int (unsigned int would probably have been enough,
316 but...). Removed <sys/types.h> header.
317 * src/support/mkdir.C (mkdir): ditto.
321 2000-10-19 Juergen Vigna <jug@sad.it>
323 * src/lyxfunc.C (MenuNew): small fix (form John)
325 * src/screen.C (Update): removed unneeded code.
327 * src/tabular.C (Ascii): refixed int != uint bug!
329 * src/support/lyxlib.h: added sys/types.h include for now permits
330 compiling, but I don't like this!
332 2000-10-18 Juergen Vigna <jug@sad.it>
334 * src/text2.C (ClearSelection): if we clear the selection we need
335 more refresh so set the status apropriately
337 * src/insets/insettext.C (draw): hopefully finally fixed draw
340 2000-10-12 Juergen Vigna <jug@sad.it>
342 * src/insets/insettext.C (draw): another small fix and make a block
343 so that variables are localized.
345 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
347 * src/support/lstrings.C (lowercase, uppercase):
348 use explicit casts to remove compiler warnings.
350 * src/support/LRegex.C (Impl):
351 * src/support/StrPool.C (add):
352 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
353 (AddPath, MakeDisplayPath):
354 * src/support/lstrings.C (prefixIs, subst):
355 use correct type to remove compiler warnings.
357 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
359 * src/support/lyxlib.h:
360 * src/support/mkdir.C (mkdir): change parameter to mode_t for
361 portability and to remove compiler warning with DEC cxx.
363 * src/support/FileInfo.[Ch] (flagRWX): ditto.
365 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
367 * src/minibuffer.C (peek_event): retun 1 when there has been a
368 mouseclick in the minibuffer.
372 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
374 * src/frontends/xforms/FormParagraph.C: more space above/below
377 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
379 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
380 a char only if real_current_font was changed.
382 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
384 * NEWS: update somewhat for 1.1.6
386 * lib/ui/default.ui: clean up.
388 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
390 * lib/CREDITS: clean up
392 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
394 * src/combox.[Ch] (select): changed argument back to int
395 * src/combox.C (peek_event): removed num_bytes as it is declared but
398 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
399 modified calls to Combox::select() to remove warnings about type
402 * src/insets/insetbutton.C (width): explicit cast to remove warning
403 about type conversion.
405 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
408 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
409 sel_pos_end, refering to cursor position are changed to
410 LyXParagraph::size_type.
412 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
413 consistent with LyXCursor::pos().
414 (inset_pos): changed to LyXParagraph::size_type for same reason.
416 * src/insets/insettext.C (resizeLyXText): changed some temporary
417 variables refing to cursor position to LyXParagraph::size_type.
419 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
421 * src/frontends/kde/<various>: The Great Renaming,
424 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
426 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
428 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
430 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
431 0 when there are no arguments.
433 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
435 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
436 to segfaults when pressing Ok in InsetBibtex dialog.
438 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
440 * forms/layout_forms.fd:
441 * src/layout_forms.C (create_form_form_character): small change to use
442 labelframe rather than engraved frame + text
444 * src/lyx_gui.C (create_forms): initialise choice_language with some
445 arbitrary value to prevent segfault when dialog is shown.
447 2000-10-16 Baruch Even <baruch.even@writeme.com>
449 * src/converter.C (runLaTeX, scanLog): Added a warning when there
450 is no resulting file. This pertains only to LaTeX output.
452 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
454 * src/text.C (Backspace): Make sure that the row of the cursor is
457 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
460 * src/lyx_gui.C (init): Prevent a crash when only one font from
461 menu/popup fonts is not found.
463 * lib/lyxrc.example: Add an example for binding a key for language
466 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
468 * src/converter.C (GetReachable): Changed the returned type to
470 (IsReachable): New method
472 * src/MenuBackend.C (expand): Handle formats that appear more
475 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
477 * src/frontends/support/Makefile.am
478 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
481 * lib/CREDITS: add Garst Reese.
483 * src/support/snprintf.h: add extern "C" {} around the definitions.
485 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
487 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
490 * src/frontends/xforms/FormDocument.C:
491 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
492 compile without "conversion to integral type of smaller size"
495 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
497 * src/text.C (GetColumnNearX): Fixed disabled code.
499 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
501 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
504 * src/support/snprintf.[ch]: new files
506 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
508 * src/frontends/kde/formprintdialog.C: add
509 file browser for selecting postscript output
511 * src/frontends/kde/formprintdialogdata.C:
512 * src/frontends/kde/formprintdialogdata.h: re-generate
515 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
517 * src/frontends/gnome/Makefile.am:
518 * src/frontends/kde/Makefile.am: FormCommand.C
519 disappeared from xforms
521 * src/frontends/kde/FormCitation.C:
522 * src/frontends/kde/FormIndex.C: read-only
525 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
527 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
530 * src/bufferlist.C: add using directive.
532 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
534 * src/support/lyxfunctional.h: version of class_fun for void
535 returns added, const versions of back_inseter_fun and compare_fun
538 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
540 * src/frontends/xforms/FormInset.C (showInset): fix typo.
542 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
544 * ChangeLog: cleanup.
546 * lib/CREDITS: update to add all the contributors we've forgotten.
547 I have obviously missed some, so tell me whether there were
550 2000-10-13 Marko Vendelin <markov@ioc.ee>
552 * src/frontends/gnome/FormCitation.C
553 * src/frontends/gnome/FormCitation.h
554 * src/frontends/gnome/FormError.C
555 * src/frontends/gnome/FormIndex.C
556 * src/frontends/gnome/FormRef.C
557 * src/frontends/gnome/FormRef.h
558 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
560 * src/frontends/gnome/FormCitation.C
561 * src/frontends/gnome/FormCopyright.C
562 * src/frontends/gnome/FormError.C
563 * src/frontends/gnome/FormIndex.C
564 * src/frontends/gnome/FormRef.C
565 * src/frontends/gnome/FormToc.C
566 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
569 * src/frontends/gnome/Menubar_pimpl.C
570 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
573 2000-10-11 Baruch Even <baruch.even@writeme.com>
576 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
577 to convey its real action.
579 * src/minibuffer.C (peek_event): Added action when mouse clicks to
580 clear the minibuffer and prepare to enter a command.
582 * src/mathed/formula.C (LocalDispatch): Changed to conform with
583 the rename from ExecCommand to PrepareForCommand.
584 * src/lyxfunc.C (Dispatch): ditto.
586 2000-10-11 Baruch Even <baruch.even@writeme.com>
588 * src/buffer.C (writeFile): Added test for errors on writing, this
589 catches all errors and not only file system full errors as intended.
591 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
593 * src/lyx_gui.C (create_forms): better fix for crash with
594 translated interface.
596 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
598 * src/frontends/kde/Makefile.am:
599 * src/frontends/kde/FormCopyright.C:
600 * src/frontends/kde/formcopyrightdialog.C:
601 * src/frontends/kde/formcopyrightdialog.h:
602 * src/frontends/kde/formcopyrightdialogdata.C:
603 * src/frontends/kde/formcopyrightdialogdata.h:
604 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
605 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
606 copyright to use qtarch
608 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
610 * src/encoding.C (read): Fixed bug that caused an error message at
613 * po/Makefile.in.in: Fixed rule for ext_l10n.h
615 * lib/lyxrc.example: Fixed hebrew example.
617 2000-10-13 Allan Rae <rae@lyx.org>
619 * src/frontends/xforms/FormPreferences.C (input): reworking the
621 (build, update, apply): New inputs in various tabfolders
623 * src/frontends/xforms/FormToc.C: use new button policy.
624 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
625 dialogs that either can't use any existing policy or where it just
628 * src/frontends/xforms/FormTabular.h: removed copyright notice that
631 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
632 added a bool parameter which is ignored.
634 * src/buffer.C (setReadonly):
635 * src/BufferView_pimpl.C (buffer):
636 * src/frontends/kde/FormCopyright.h (update):
637 * src/frontends/kde/FormCitation.[Ch] (update):
638 * src/frontends/kde/FormIndex.[Ch] (update):
639 * src/frontends/kde/FormPrint.[Ch] (update):
640 * src/frontends/kde/FormRef.[Ch] (update):
641 * src/frontends/kde/FormToc.[Ch] (update):
642 * src/frontends/kde/FormUrl.[Ch] (update):
643 * src/frontends/gnome/FormCopyright.h (update):
644 * src/frontends/gnome/FormCitation.[Ch] (update):
645 * src/frontends/gnome/FormError.[Ch] (update):
646 * src/frontends/gnome/FormIndex.[Ch] (update):
647 * src/frontends/gnome/FormPrint.[Ch] (update):
648 * src/frontends/gnome/FormRef.h (update):
649 * src/frontends/gnome/FormToc.[Ch] (update):
650 * src/frontends/gnome/FormUrl.[Ch] (update):
651 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
652 to updateBufferDependent and DialogBase
654 * src/frontends/xforms/FormCitation.[hC]:
655 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
656 * src/frontends/xforms/FormError.[Ch]:
657 * src/frontends/xforms/FormGraphics.[Ch]:
658 * src/frontends/xforms/FormIndex.[Ch]:
659 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
660 and fixed readOnly handling.
661 * src/frontends/xforms/FormPrint.[Ch]:
662 * src/frontends/xforms/FormRef.[Ch]:
663 * src/frontends/xforms/FormTabular.[Ch]:
664 * src/frontends/xforms/FormToc.[Ch]:
665 * src/frontends/xforms/FormUrl.[Ch]:
666 * src/frontends/xforms/FormInset.[Ch]:
667 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
668 form of updateBufferDependent.
670 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
671 if form()->visible just in case someone does stuff to the form in a
674 * src/frontends/DialogBase.h (enum): removed enum since we can now use
675 the buttoncontroller for everything the enum used to be used for.
676 (update) It would seem we need to force all dialogs to use a bool
677 parameter or have two update functions. I chose to go with one.
678 I did try removing update() from here and FormBase and defining the
679 appropriate update signatures in FormBaseB[DI] but then ran into the
680 problem of the update() call in FormBase::show(). Whatever I did
681 to get around that would require another function and that just
682 got more confusing. Hence the decision to make everyone have an
683 update(bool). An alternative might have been to override show() in
684 FormBaseB[DI] and that would allow the different and appropriate
687 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
688 true == buffer change occurred. I decided against using a default
689 template parameter since not all compilers support that at present.
691 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
693 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
694 army knife" by removing functionality.
695 (clearStore): removed. All such housekeeping on hide()ing the dialog
696 is to be carried out by overloaded disconnect() methods.
697 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
698 superceded by Baruch's neat test (FormGraphics) to update an existing
699 dialog if a new signal is recieved rather than block all new signals
701 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
702 only to Inset dialogs.
703 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
704 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
706 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
708 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
709 as a base class to all inset dialogs. Used solely to connect/disconnect
710 the Inset::hide signal and to define what action to take on receipt of
711 a UpdateBufferDependent signal.
712 (FormCommand): now derived from FormInset.
714 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
717 * src/frontends/xforms/FormCopyright.[Ch]:
718 * src/frontends/xforms/FormPreferences.[Ch]:
719 now derived from FormBaseBI.
721 * src/frontends/xforms/FormDocument.[Ch]:
722 * src/frontends/xforms/FormParagraph.[Ch]:
723 * src/frontends/xforms/FormPrint.[Ch]:
724 now derived from FormBaseBD.
726 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
728 * src/frontends/xforms/FormCitation.[Ch]:
729 * src/frontends/xforms/FormError.[Ch]:
730 * src/frontends/xforms/FormRef.[Ch]:
731 * src/frontends/xforms/FormToc.[Ch]:
732 (clearStore): reworked as disconnect().
734 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
737 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
739 * src/converter.C (runLaTeX): constify buffer argument
742 * src/frontends/support/Makefile.am (INCLUDES): fix.
744 * src/buffer.h: add std:: qualifier
745 * src/insets/figinset.C (addpidwait): ditto
746 * src/MenuBackend.C: ditto
747 * src/buffer.C: ditto
748 * src/bufferlist.C: ditto
749 * src/layout.C: ditto
750 * src/lyxfunc.C: ditto
752 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
754 * src/lyxtext.h (bidi_level): change return type to
755 LyXParagraph::size_type.
757 * src/lyxparagraph.h: change size_type to
758 TextContainer::difference_type. This should really be
759 TextContainer::size_type, but we need currently to support signed
762 2000-10-11 Marko Vendelin <markov@ioc.ee>
763 * src/frontends/gnome/FormError.h
764 * src/frontends/gnome/FormRef.C
765 * src/frontends/gnome/FormRef.h
766 * src/frontends/gnome/FormError.C
767 * src/frontends/gnome/Makefile.am
768 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
769 to Gnome frontend. Both dialogs use "action" area.
771 2000-10-12 Baruch Even <baruch.even@writeme.com>
773 * src/graphics/GraphicsCacheItem_pimpl.C:
774 * src/graphics/Renderer.C:
775 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
778 2000-10-12 Juergen Vigna <jug@sad.it>
780 * src/insets/insettext.C (draw): fixed drawing bug (specifically
781 visible when selecting).
783 * development/Code_rules/Rules: fixed some typos.
785 2000-10-09 Baruch Even <baruch.even@writeme.com>
787 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
788 compiling on egcs 1.1.2 possible.
790 * src/filedlg.C (comp_direntry::operator() ): ditto.
792 2000-08-31 Baruch Even <baruch.even@writeme.com>
794 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
797 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
798 transient it now only gets freed when the object is destructed.
800 2000-08-24 Baruch Even <baruch.even@writeme.com>
802 * src/frontends/FormGraphics.h:
803 * src/frontends/FormGraphics.C: Changed to use ButtonController and
806 2000-08-20 Baruch Even <baruch.even@writeme.com>
808 * src/insets/insetgraphics.C:
809 (draw): Added messages to the drawn rectangle to report status.
810 (updateInset): Disabled the use of the inline graphics,
813 2000-08-17 Baruch Even <baruch.even@writeme.com>
815 * src/frontends/support: Directory added for the support of GUII LyX.
817 * src/frontends/support/LyXImage.h:
818 * src/frontends/support/LyXImage.C: Base class for GUII holding of
821 * src/frontends/support/LyXImage_X.h:
822 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
823 version of LyXImage, this uses the Xlib Pixmap.
828 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
829 replacement to Pixmap.
831 * src/insets/insetgraphics.h:
832 * src/insets/insetgraphics.C:
833 * src/graphics/GraphicsCacheItem.h:
834 * src/graphics/GraphicsCacheItem.C:
835 * src/graphics/GraphicsCacheItem_pimpl.h:
836 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
839 * src/graphics/GraphicsCacheItem.h:
840 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
841 another copy of the object.
843 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
844 of cacheHandle, this fixed a bug that sent LyX crashing.
846 * src/graphics/XPM_Renderer.h:
847 * src/graphics/XPM_Renderer.C:
848 * src/graphics/EPS_Renderer.h:
849 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
851 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
853 * src/lyxfunc.C (processKeySym): only handle the
854 lockinginset/inset stuff if we have a buffer and text loaded...
856 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
858 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
860 * src/support/lyxfunctional.h: add operator= that takes a reference
862 * src/lyxserver.C (mkfifo): make first arg const
864 * src/layout.h: renamed name(...) to setName(...) to work around
867 * src/buffer.C (setFileName): had to change name of function to
868 work around bugs in egcs. (renamed from fileName)
870 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
872 * src/support/translator.h: move helper template classes to
873 lyxfunctional.h, include "support/lyxfunctional.h"
875 * src/support/lyxmanip.h: add delaration of fmt
877 * src/support/lyxfunctional.h: new file
878 (class_fun_t): new template class
879 (class_fun): helper template function
880 (back_insert_fun_iterator): new template class
881 (back_inserter_fun): helper template function
882 (compare_memfun_t): new template class
883 (compare_memfun): helper template function
884 (equal_1st_in_pair): moved here from translator
885 (equal_2nd_in_pair): moved here from translator
887 * src/support/fmt.C: new file
888 (fmt): new func, can be used for a printf substitute when still
889 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
891 * src/support/StrPool.C: add some comments
893 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
896 * src/insets/figinset.C (addpidwait): use std::copy with
897 ostream_iterator to fill the pidwaitlist
899 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
901 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
904 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
907 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
909 * src/frontends/xforms/FormDocument.C (build): remove c_str()
910 (class_update): ditto
912 (CheckChoiceClass): move initialization of tc and tct
914 * src/tabular.C: remove current_view
915 (OldFormatRead): similar to right below [istream::ignore]
917 * src/lyxlex_pimpl.C (next): add code for faster skipping of
918 chars, unfortunately this is buggy on gcc 2.95.2, so currently
919 unused [istream::ignore]
921 * src/lyxfunc.C: include "support/lyxfunctional.h"
922 (getInsetByCode): use std::find_if and compare_memfun
924 * src/lyxfont.C (stateText): remove c_str()
926 * src/lyx_main.C (setDebuggingLevel): make static
927 (commandLineHelp): make static
929 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
930 Screen* together with fl_get_display() and fl_screen
932 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
933 togheter with fl_get_display() and fl_screen
934 (create_forms): remove c_str()
936 * src/layout.C: include "support/lyxfunctional.h"
937 (hasLayout): use std::find_if and compare_memfun
938 (GetLayout): use std::find_if and comapre_memfun
939 (delete_layout): use std::remove_if and compare_memfun
940 (NumberOfClass): use std:.find_if and compare_memfun
942 * src/gettext.h: change for the new functions
944 * src/gettext.C: new file, make _(char const * str) and _(string
945 const & str) real functions.
947 * src/font.C (width): rewrite slightly to avoid one extra variable
949 * src/debug.C: initialize Debug::ANY here
951 * src/commandtags.h: update number comments
953 * src/combox.h (get): make const func
955 (getline): make const
957 * src/combox.C (input_cb): handle case where fl_get_input can
960 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
961 "support/lyxfunctional.h", remove current_view variable.
962 (resize): use std::for_each with std::mem_fun
963 (getFileNames): use std::copy with back_inserter_fun
964 (getBuffer): change arg type to unsigned int
965 (emergencyWriteAll): call emergencyWrite with std::for_each and
967 (emergencyWrite): new method, the for loop in emergencyWriteAll
969 (exists): use std::find_if with compare_memfun
970 (getBuffer): use std::find_if and compare_memfun
972 * src/buffer.h: add typedefs for iterator_category, value_type
973 difference_type, pointer and reference for inset_iterator
974 add postfix ++ for inset_iterator
975 make inset_iterator::getPos() const
977 * src/buffer.C: added support/lyxmanip.h
978 (readFile): use lyxerr << fmt instead of printf
979 (makeLaTeXFile): use std::copy to write out encodings
981 * src/Painter.C (text): rewrite slightly to avoid extra font variable
983 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
984 free and the char * temp.
985 (hasMenu): use std::find_if and compare_memfun
988 * src/Makefile.am (lyx_SOURCES): added gettext.C
990 * src/LyXAction.C (retrieveActionArg): clear the arg, use
991 string::insert small change to avoid temporary
993 * src/LColor.C (getGUIName): remove c_str()
995 * several files: change all occurrences of fl_display to
998 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
999 that -pedantic is not used for gcc 2.97 (cvs gcc)
1001 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1003 2000-10-11 Allan Rae <rae@lyx.org>
1005 * src/frontends/xforms/FormPreferences.C (input): template path must be
1006 a readable directory. It doesn't need to be writeable.
1007 (build, delete, update, apply): New inputs in the various tabfolders
1009 * src/frontends/xforms/forms/form_preferences.fd:
1010 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1011 several new entries to existing folders. Shuffled some existing stuff
1014 * src/frontends/xforms/forms/form_print.fd:
1015 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1016 Should probably rework PrinterParams as well. Note that the switch to
1017 collated is effectively the same as !unsorted so changing PrinterParams
1018 will require a lot of fiddly changes to reverse the existing logic.
1020 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1022 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1024 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1026 2000-10-10 Allan Rae <rae@lyx.org>
1029 * src/lyxfunc.C (Dispatch):
1031 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1034 * src/lyxrc.C (output): Only write the differences between system lyxrc
1035 and the users settings.
1038 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1040 I'll rewrite this later, after 1.1.6 probably, to keep a single
1041 LyXRC but two instances of a LyXRCStruct.
1043 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1045 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1047 * src/tabular.h: add a few std:: qualifiers.
1049 * src/encoding.C: add using directive.
1050 * src/language.C: ditto.
1052 * src/insets/insetquotes.C (Validate): use languages->lang()
1053 instead of only language.
1055 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1057 * lib/languages: New file.
1059 * lib/encodings: New file.
1061 * src/language.C (Languages): New class.
1062 (read): New method. Reads the languages from the 'languages' file.
1064 * src/encoding.C (Encodings): New class.
1065 (read): New method. Reads the encodings from the 'encodings' file.
1067 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1070 * src/bufferparams.h and a lot of files: Deleted the member language,
1071 and renamed language_info to language
1073 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1074 * src/lyxfont.C (latexWriteStartChanges): ditto.
1075 * src/paragraph.C (validate,TeXOnePar): ditto.
1077 * src/lyxfont.C (update): Restored deleted code.
1079 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1081 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1083 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1085 * src/insets/figinset.[Ch]:
1086 * src/insets/insetinclude.[Ch]:
1087 * src/insets/insetinclude.[Ch]:
1088 * src/insets/insetparent.[Ch]:
1089 * src/insets/insetref.[Ch]:
1090 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1092 * src/insets/*.[Ch]:
1093 * src/mathed/formula.[Ch]:
1094 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1096 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1097 * src/lyx_cb.C (FigureApplyCB):
1098 * src/lyxfunc.C (getStatus, Dispatch):
1099 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1102 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1104 * src/converter.[Ch] (Formats::View):
1105 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1107 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1108 *current_view->buffer(). This will change later, but this patch is way
1111 2000-10-09 Juergen Vigna <jug@sad.it>
1113 * src/text.C (GetRow): small fix.
1115 * src/BufferView_pimpl.C (cursorPrevious):
1116 (cursorNext): added LyXText parameter to function.
1118 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1119 keypress depending on cursor position.
1121 2000-10-06 Juergen Vigna <jug@sad.it>
1123 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1124 (copySelection): redone this function and also copy ascii representa-
1127 * src/tabular.C (Ascii):
1131 (print_n_chars): new functions to realize the ascii export of tabulars.
1133 2000-10-05 Juergen Vigna <jug@sad.it>
1135 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1136 if we don't have a buffer.
1138 2000-10-10 Allan Rae <rae@lyx.org>
1140 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1141 with closing dialog. It seems that nested tabfolders require hiding
1142 of inner tabfolders before hiding the dialog itself. Actually all I
1143 did was hide the active outer folder.
1145 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1146 unless there really is a buffer. hideBufferDependent is called
1149 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1150 POTFILES.in stays in $(srcdir).
1152 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1154 * lib/lyxrc.example: Few changes.
1156 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1158 * src/BufferView_pimpl.C (buffer): only need one the
1159 updateBufferDependent signal to be emitted once! Moved to the end of
1160 the method to allow bv_->text to be updated first.
1162 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1163 and hSignal_ with Dialogs * and BufferDependency variables.
1164 New Buffer * parent_, initialised when the dialog is launched. Used to
1165 check whether to update() or hide() dialog in the new, private
1166 updateOrHide() method that is connected to the updateBufferDependent
1167 signal. Daughter classes dictate what to do using the
1168 ChangedBufferAction enum, passed to the c-tor.
1170 * src/frontends/xforms/FormCitation.C:
1171 * src/frontends/xforms/FormCommand.C:
1172 * src/frontends/xforms/FormCopyright.C:
1173 * src/frontends/xforms/FormDocument.C:
1174 * src/frontends/xforms/FormError.C:
1175 * src/frontends/xforms/FormIndex.C:
1176 * src/frontends/xforms/FormPreferences.C:
1177 * src/frontends/xforms/FormPrint.C:
1178 * src/frontends/xforms/FormRef.C:
1179 * src/frontends/xforms/FormToc.C:
1180 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1183 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1184 ChangedBufferAction enum.
1186 * src/frontends/xforms/FormParagraph.[Ch]
1187 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1190 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1192 * lib/bind/cua.bind: fix a bit.
1193 * lib/bind/emacs.bind: ditto.
1195 * lib/bind/menus.bind: remove real menu entries from there.
1197 * src/spellchecker.C: make sure we only include strings.h when
1200 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1202 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1203 function. It enlarges the maximum number of pup when needed.
1204 (add_toc2): Open a new menu if maximum number of items per menu has
1207 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1209 * src/frontends/kde/FormPrint.C: fix error reporting
1211 * src/frontends/xforms/FormDocument.C: fix compiler
1214 * lib/.cvsignore: add Literate.nw
1216 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1219 * bufferview_funcs.[Ch]
1222 * text2.C: Add support for numbers in RTL text.
1224 2000-10-06 Allan Rae <rae@lyx.org>
1226 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1227 to be gettext.m4 friendly again. ext_l10n.h is now
1228 generated into $top_srcdir instead of $top_builddir
1229 so that lyx.pot will be built correctly -- without
1230 duplicate parsing of ext_l10n.h.
1232 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1234 * src/frontends/kde/FormCitation.C: make the dialog
1235 behave more sensibly
1237 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1239 * config/kde.m4: fix consecutive ./configure runs,
1240 look for qtarch, fix library order
1242 * src/frontends/kde/Makefile.am: tidy up,
1243 add Print dialog, add .dlg dependencies
1245 * src/frontends/kde/FormPrint.C:
1246 * src/frontends/kde/FormPrint.h:
1247 * src/frontends/kde/formprintdialog.C:
1248 * src/frontends/kde/formprintdialog.h:
1249 * src/frontends/kde/formprintdialogdata.C:
1250 * src/frontends/kde/formprintdialogdata.h:
1251 * src/frontends/kde/dlg/formprintdialog.dlg: add
1254 * src/frontends/kde/dlg/README: Added explanatory readme
1256 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1257 script to double-check qtarch's output
1259 * src/frontends/kde/formindexdialog.C:
1260 * src/frontends/kde/formindexdialogdata.C:
1261 * src/frontends/kde/formindexdialogdata.h:
1262 * src/frontends/kde/dlg/formindexdialog.dlg: update
1263 for qtarch, minor fixes
1265 2000-10-05 Allan Rae <rae@lyx.org>
1267 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1268 dialogs when switching buffers update them instead. It's up to each
1269 dialog to decide if it should still be visible or not.
1270 update() should return a bool to control visiblity within show().
1271 Or perhaps better to set a member variable and use that to control
1274 * lib/build-listerrors: create an empty "listerrors" file just to stop
1275 make trying to regenerate it all the time if you don't have noweb
1278 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1280 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1281 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1282 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1283 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1284 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1286 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1288 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1290 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1291 deleting buffer. Closes all buffer-dependent dialogs.
1293 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1295 * src/frontends/xforms/FormCitation.[Ch]:
1296 * src/frontends/xforms/FormPreferences.[Ch]:
1297 * src/frontends/xforms/FormPrint.[Ch]:
1298 * src/frontends/xforms/FormRef.[Ch]:
1299 * src/frontends/xforms/FormUrl.[Ch]: ditto
1301 * src/frontends/xforms/FormDocument.[Ch]:
1302 * src/frontends/xforms/forms/form_document.C.patch:
1303 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1304 pass through a single input() function.
1306 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1308 * lib/build-listerrors: return status as OK
1310 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1312 * lib/lyxrc.example: Updated to new export code
1314 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1316 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1319 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1322 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1323 LyX-Code is defined.
1324 * lib/layouts/amsbook.layout: ditto.
1326 * boost/Makefile.am: fix typo.
1328 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1330 (add_lastfiles): removed.
1331 (add_documents): removed.
1332 (add_formats): removed.
1334 * src/frontends/Menubar.C: remove useless "using" directive.
1336 * src/MenuBackend.h: add a new MenuItem constructor.
1338 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1341 2000-10-04 Allan Rae <rae@lyx.org>
1343 * lib/Makefile.am (listerrors):
1344 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1345 I haven't got notangle installed so Kayvan please test. The output
1346 should end up in $builddir. This also allows people who don't have
1347 noweb installed to complete the make process without error.
1349 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1350 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1351 by JMarc's picky compiler.
1353 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1356 * src/insets/insettabular.C (setPos): change for loop to not use
1357 sequencing operator. Please check this Jürgen.
1359 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1361 * src/insets/insetcite.C (getScreenLabel): ditto
1362 * src/support/filetools.C (QuoteName): ditto
1363 (ChangeExtension): ditto
1365 * src/BufferView_pimpl.C (scrollCB): make heigt int
1367 * src/BufferView2.C (insertInset): comment out unused arg
1369 * boost/Makefile.am (EXTRADIST): new variable
1371 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1373 * src/exporter.C (IsExportable): Fixed
1375 * lib/configure.m4: Small fix
1377 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1379 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1380 * src/insets/insetbib.C (bibitemWidest): ditto.
1381 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1383 2000-10-03 Juergen Vigna <jug@sad.it>
1385 * src/BufferView2.C (theLockingInset): removed const because of
1386 Agnus's compile problems.
1388 * src/insets/insettext.C (LocalDispatch): set the language of the
1389 surronding paragraph on inserting the first character.
1391 * various files: changed use of BufferView::the_locking_inset.
1393 * src/BufferView2.C (theLockingInset):
1394 (theLockingInset): new functions.
1396 * src/BufferView.h: removed the_locking_inset.
1398 * src/lyxtext.h: added the_locking_inset
1400 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1402 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1404 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1406 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1407 * src/mathed/math_cursor.C (IsAlpha): ditto.
1408 * src/mathed/math_inset.C (strnew): ditto.
1409 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1410 (IMetrics): cxp set but never used; removed.
1411 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1412 that the variable in question has been removed also!
1415 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1416 using the Buffer * passed to Latex(), using the BufferView * passed to
1417 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1419 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1420 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1422 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1423 * src/buffer.C (readInset): used new InsetBibtex c-tor
1424 * (getBibkeyList): used new InsetBibtex::getKeys
1426 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1429 * lib/build-listerrors
1431 * src/exporter.C: Add literate programming support to the export code
1434 * src/lyx_cb.C: Remove old literate code.
1436 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1439 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1440 * src/converter.C (View, Convert): Use QuoteName.
1442 * src/insets/figinset.C (Preview): Use Formats::View.
1444 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1446 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1448 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1449 the top of the function, because compaq cxx complains that the
1450 "goto exit_with_message" when the function is disabled bypasses
1452 (MenuNew): try a better fix for the generation of new file names.
1453 This time, I used AddName() instead of AddPath(), hoping Juergen
1456 2000-10-03 Allan Rae <rae@lyx.org>
1458 * src/frontends/xforms/forms/form_preferences.fd:
1459 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1460 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1461 "Look and Feel"->"General" but will need to be split up further into
1462 general output and general input tabs. Current plan is for four outer
1463 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1464 stuff; "Inputs" for input and import configuration; "Outputs" for
1465 output and export configuration; and one more whatever is left over
1466 called "General". The leftovers at present look like being which
1467 viewers to use, spellchecker, language support and might be better
1468 named "Support". I've put "Paths" in "Inputs" for the moment as this
1469 seems reasonable for now at least.
1470 One problem remains: X error kills LyX when you close Preferences.
1472 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1474 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1475 qualifier from form()
1476 * src/frontends/xforms/FormCitation.[Ch]:
1477 * src/frontends/xforms/FormCopyright.[Ch]:
1478 * src/frontends/xforms/FormDocument.[Ch]:
1479 * src/frontends/xforms/FormError.[Ch]:
1480 * src/frontends/xforms/FormIndex.[Ch]:
1481 * src/frontends/xforms/FormPreferences.[Ch]:
1482 * src/frontends/xforms/FormPrint.[Ch]:
1483 * src/frontends/xforms/FormRef.[Ch]:
1484 * src/frontends/xforms/FormToc.[Ch]:
1485 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1487 * src/frontends/xforms/FormCitation.[Ch]:
1488 * src/frontends/xforms/FormIndex.[Ch]:
1489 * src/frontends/xforms/FormRef.[Ch]:
1490 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1491 with Allan's naming policy
1493 * src/frontends/xforms/FormCitation.C: some static casts to remove
1496 2000-10-02 Juergen Vigna <jug@sad.it>
1498 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1499 now you can type or do stuff inside the table-cell also when in dummy
1500 position, fixed visible cursor.
1502 * src/insets/insettext.C (Edit): fixing cursor-view position.
1504 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1505 be used for equal functions in lyxfunc and insettext.
1507 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1509 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1511 * src/frontends/gnome/FormCitation.h:
1512 * src/frontends/gnome/FormCopyright.h:
1513 * src/frontends/gnome/FormIndex.h:
1514 * src/frontends/gnome/FormPrint.h:
1515 * src/frontends/gnome/FormToc.h:
1516 * src/frontends/gnome/FormUrl.h:
1517 * src/frontends/kde/FormCitation.h:
1518 * src/frontends/kde/FormCopyright.h:
1519 * src/frontends/kde/FormIndex.h:
1520 * src/frontends/kde/FormRef.h:
1521 * src/frontends/kde/FormToc.h:
1522 * src/frontends/kde/FormUrl.h: fix remaining users of
1525 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1527 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1528 from depth argument.
1529 (DocBookHandleCaption): ditto.
1530 (DocBookHandleFootnote): ditto.
1531 (SimpleDocBookOnePar): ditto.
1533 * src/frontends/xforms/FormDocument.h (form): remove extra
1534 FormDocument:: qualifier.
1536 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1538 * sigc++/handle.h: ditto.
1540 * src/lyx_gui_misc.C: add "using" directive.
1542 * src/cheaders/cstddef: new file, needed by the boost library (for
1545 2000-10-02 Juergen Vigna <jug@sad.it>
1547 * src/insets/insettext.C (SetFont): better support.
1549 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1551 * src/screen.C (DrawOneRow): some uint refixes!
1553 2000-10-02 Allan Rae <rae@lyx.org>
1555 * boost/.cvsignore: ignore Makefile as well
1557 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1558 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1560 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1561 Left this one out by accident.
1563 * src/frontends/xforms/FormBase.h (restore): default to calling
1564 update() since that will restore the original/currently-applied values.
1565 Any input() triggered error messages will require the derived classes
1566 to redefine restore().
1568 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1569 avoid a segfault. combo_doc_class is the main concern.
1571 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1573 * Simplify build-listerrors in view of GUI-less export ability!
1575 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1577 * src/lyx_main.C (easyParse): Disable gui when exporting
1579 * src/insets/figinset.C:
1582 * src/lyx_gui_misc.C
1583 * src/tabular.C: Changes to allow no-gui.
1585 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1587 * src/support/utility.hpp: removed file
1588 * src/support/block.h: removed file
1590 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1593 * src/mathed/formula.C: add support/lyxlib.h
1594 * src/mathed/formulamacro.C: ditto
1596 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1597 * src/lyxparagraph.h: ditto
1599 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1600 * src/frontends/Makefile.am (INCLUDES): ditto
1601 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1602 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1603 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1604 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1605 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1606 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1608 * src/BufferView.h: use boost/utility.hpp
1609 * src/LColor.h: ditto
1610 * src/LaTeX.h: ditto
1611 * src/LyXAction.h: ditto
1612 * src/LyXView.h: ditto
1613 * src/bufferlist.h: ditto
1614 * src/lastfiles.h: ditto
1615 * src/layout.h: ditto
1616 * src/lyx_gui.h: ditto
1617 * src/lyx_main.h: ditto
1618 * src/lyxlex.h: ditto
1619 * src/lyxrc.h: ditto
1620 * src/frontends/ButtonPolicies.h: ditto
1621 * src/frontends/Dialogs.h: ditto
1622 * src/frontends/xforms/FormBase.h: ditto
1623 * src/frontends/xforms/FormGraphics.h: ditto
1624 * src/frontends/xforms/FormParagraph.h: ditto
1625 * src/frontends/xforms/FormTabular.h: ditto
1626 * src/graphics/GraphicsCache.h: ditto
1627 * src/graphics/Renderer.h: ditto
1628 * src/insets/ExternalTemplate.h: ditto
1629 * src/insets/insetcommand.h: ditto
1630 * src/support/path.h: ditto
1632 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1633 and introduce clause for 2.97.
1635 * boost/libs/README: new file
1637 * boost/boost/utility.hpp: new file
1639 * boost/boost/config.hpp: new file
1641 * boost/boost/array.hpp: new file
1643 * boost/Makefile.am: new file
1645 * boost/.cvsignore: new file
1647 * configure.in (AC_OUTPUT): add boost/Makefile
1649 * Makefile.am (SUBDIRS): add boost
1651 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1653 * src/support/lstrings.C (suffixIs): Fixed.
1655 2000-10-01 Allan Rae <rae@lyx.org>
1657 * src/PrinterParams.h: moved things around to avoid the "can't
1658 inline call" warning.
1660 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1661 into doc++ documentation.
1663 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1665 * src/frontends/xforms/FormRef.C: make use of button controller
1666 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1667 cleaned up button controller usage.
1668 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1669 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1670 use the button controller
1672 * src/frontends/xforms/forms/*.fd: and associated generated files
1673 updated to reflect changes to FormBase. Some other FormXxxx files
1674 also got minor updates to reflect changes to FormBase.
1676 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1677 (hide): made virtual.
1678 (input): return a bool. true == valid input
1679 (RestoreCB, restore): new
1680 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1681 Changes to allow derived dialogs to use a ButtonController and
1682 make sense when doing so: OK button calls ok() and so on.
1684 * src/frontends/xforms/ButtonController.h (class ButtonController):
1685 Switch from template implementation to taking Policy parameter.
1686 Allows FormBase to provide a ButtonController for any dialog.
1688 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1689 Probably should rename connect and disconnect.
1690 (apply): use the radio button groups
1691 (form): needed by FormBase
1692 (build): setup the radio button groups
1694 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1696 * several files: type changes to reduce the number of warnings and
1697 to unify type hangling a bit. Still much to do.
1699 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1701 * lib/images/*: rename a bunch of icons to match Dekel converter
1704 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1707 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1709 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1711 * sigc++/handle.h: ditto for class Handle.
1713 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1715 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1717 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1719 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1720 removal of the "default" language.
1722 * src/combox.h (getline): Check that sel > 0
1724 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1726 * lib/examples/docbook_example.lyx
1727 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1729 * lib/layouts/docbook-book.layout: new docbook book layout.
1731 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1733 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1735 * src/insets/figinset.C (DocBook):fixed small typo.
1737 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1739 * src/insets/insetinclude.h: string include_label doesn't need to be
1742 2000-09-29 Allan Rae <rae@lyx.org>
1744 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1745 Allow derived type to control connection and disconnection from signals
1746 of its choice if desired.
1748 2000-09-28 Juergen Vigna <jug@sad.it>
1750 * src/insets/insettabular.C (update): fixed cursor setting when
1751 the_locking_inset changed.
1752 (draw): made this a bit cleaner.
1753 (InsetButtonPress): fixed!
1755 * various files: added LyXText Parameter to fitCursor call.
1757 * src/BufferView.C (fitCursor): added LyXText parameter.
1759 * src/insets/insettabular.C (draw): small draw fix.
1761 * src/tabular.C: right setting of left/right celllines.
1763 * src/tabular.[Ch]: fixed various types in funcions and structures.
1764 * src/insets/insettabular.C: ditto
1765 * src/frontends/xforms/FormTabular.C: ditto
1767 2000-09-28 Allan Rae <rae@lyx.org>
1769 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1770 that the #ifdef's had been applied to part of what should have been
1771 a complete condition. It's possible there are other tests that
1772 were specific to tables that are also wrong now that InsetTabular is
1773 being used. Now we need to fix the output of '\n' after a table in a
1774 float for the same reason as the original condition:
1775 "don't insert this if we would be adding it before or after a table
1776 in a float. This little trick is needed in order to allow use of
1777 tables in \subfigures or \subtables."
1778 Juergen can you check this?
1780 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1782 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1783 output to the ostream.
1785 * several files: fixed types based on warnings from cxx
1787 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1789 * src/frontends/kde/Makefile.am: fix rule for
1790 formindexdialogdata_moc.C
1792 * src/.cvsignore: add ext_l10n.h to ignore
1794 * acconfig.h: stop messing with __STRICT_ANSI__
1795 * config/gnome.m4: remove option to set -ansi
1796 * config/kde.m4: remove option to set -ansi
1797 * config/lyxinclude.m4: don't set -ansi
1799 2000-09-27 Juergen Vigna <jug@sad.it>
1801 * various files: remove "default" language check.
1803 * src/insets/insetquotes.C: removed use of current_view.
1805 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1806 the one should have red ears by now!
1808 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1809 in more then one paragraph. Fixed cursor-movement/selection.
1811 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1812 paragraphs inside a text inset.
1814 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1815 text-inset if this owner is an inset.
1817 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1819 * src/Bullet.h: changed type of font, character and size to int
1821 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1823 * src/insets/inseturl.[Ch]:
1824 * src/insets/insetref.[Ch]:
1825 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1827 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1829 * src/buffer.C (readFile): block-if statement rearranged to minimise
1830 bloat. Patch does not reverse Jean-Marc's change ;-)
1832 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1833 Class rewritten to store pointers to hide/update signals directly,
1834 rather than Dialogs *. Also defined an enum to ease use. All xforms
1835 forms can now be derived from this class.
1837 * src/frontends/xforms/FormCommand.[Ch]
1838 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1840 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1843 * src/frontends/xforms/forms/form_citation.fd
1844 * src/frontends/xforms/forms/form_copyright.fd
1845 * src/frontends/xforms/forms/form_error.fd
1846 * src/frontends/xforms/forms/form_index.fd
1847 * src/frontends/xforms/forms/form_ref.fd
1848 * src/frontends/xforms/forms/form_toc.fd
1849 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1851 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1853 * src/insets/insetfoot.C: removed redundent using directive.
1855 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1857 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1858 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1860 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1861 created in the constructors in different groups. Then set() just
1862 have to show the groups as needed. This fixes the redraw problems
1863 (and is how the old menu code worked).
1865 * src/support/lyxlib.h: declare the methods as static when we do
1866 not have namespaces.
1868 2000-09-26 Juergen Vigna <jug@sad.it>
1870 * src/buffer.C (asciiParagraph): new function.
1871 (writeFileAscii): new function with parameter ostream.
1872 (writeFileAscii): use now asciiParagraph.
1874 * various inset files: added the linelen parameter to the Ascii-func.
1876 * src/tabular.C (Write): fixed error in writing file introduced by
1877 the last changes from Lars.
1879 * lib/bind/menus.bind: removed not supported functions.
1881 * src/insets/insettext.C (Ascii): implemented this function.
1883 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1885 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1886 (Write): use of the write_attribute functions.
1888 * src/bufferlist.C (close): fixed reasking question!
1890 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1892 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1893 new files use the everwhere possible.
1896 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1897 src/log_form.C src/lyx.C:
1900 * src/buffer.C (runLaTeX): remove func
1902 * src/PaperLayout.C: removed file
1903 * src/ParagraphExtra.C: likewise
1904 * src/bullet_forms.C: likewise
1905 * src/bullet_forms.h: likewise
1906 * src/bullet_forms_cb.C: likewise
1908 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1909 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1912 * several files: remove all traces of the old fd_form_paragraph,
1913 and functions belonging to that.
1915 * several files: remove all traces of the old fd_form_document,
1916 and functions belonging to that.
1918 * several files: constify local variables were possible.
1920 * several files: remove all code that was dead when NEW_EXPORT was
1923 * several files: removed string::c_str in as many places as
1926 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1927 (e): be a bit more outspoken when patching
1928 (updatesrc): only move files if changed.
1930 * forms/layout_forms.h.patch: regenerated
1932 * forms/layout_forms.fd: remove form_document and form_paragraph
1933 and form_quotes and form_paper and form_table_options and
1934 form_paragraph_extra
1936 * forms/form1.fd: remove form_table
1938 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1939 the fdui->... rewrite. Update some comments to xforms 0.88
1941 * forms/bullet_forms.C.patch: removed file
1942 * forms/bullet_forms.fd: likewise
1943 * forms/bullet_forms.h.patch: likewise
1945 * development/Code_rules/Rules: added a section on switch
1946 statements. Updated some comment to xforms 0.88.
1948 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1950 * src/buffer.C (readFile): make sure that the whole version number
1951 is read after \lyxformat (even when it contains a comma)
1953 * lib/ui/default.ui: change shortcut of math menu to M-a.
1955 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1957 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1960 * src/LyXView.C (updateWindowTitle): show the full files name in
1961 window title, limited to 30 characters.
1963 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1964 When a number of characters has been given, we should not assume
1965 that the string is 0-terminated.
1967 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1968 calls (fixes some memory leaks)
1970 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1971 trans member on exit.
1973 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1975 * src/converter.C (GetReachable): fix typo.
1977 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1978 understand ',' instead of '.'.
1979 (GetInteger): rewrite to use strToInt().
1981 2000-09-26 Juergen Vigna <jug@sad.it>
1983 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1984 better visibility and error-message on wrong VSpace input.
1986 * src/language.C (initL): added english again.
1988 2000-09-25 Juergen Vigna <jug@sad.it>
1990 * src/frontends/kde/Dialogs.C (Dialogs):
1991 * src/frontends/gnome/Dialogs.C (Dialogs):
1992 * src/frontends/kde/Makefile.am:
1993 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1995 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1997 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1999 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2001 * src/frontends/xforms/FormParagraph.C:
2002 * src/frontends/xforms/FormParagraph.h:
2003 * src/frontends/xforms/form_paragraph.C:
2004 * src/frontends/xforms/form_paragraph.h:
2005 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2008 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2010 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2011 Paragraph-Data after use.
2013 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2014 non breakable paragraphs.
2016 2000-09-25 Garst R. Reese <reese@isn.net>
2018 * src/language.C (initL): added missing language_country codes.
2020 2000-09-25 Juergen Vigna <jug@sad.it>
2022 * src/insets/insettext.C (InsetText):
2023 (deleteLyXText): remove the not released LyXText structure!
2025 2000-09-24 Marko Vendelin <markov@ioc.ee>
2027 * src/frontends/gnome/mainapp.C
2028 * src/frontends/gnome/mainapp.h: added support for keyboard
2031 * src/frontends/gnome/FormCitation.C
2032 * src/frontends/gnome/FormCitation.h
2033 * src/frontends/gnome/Makefile.am
2034 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2035 FormCitation to use "action area" in mainapp window
2037 * src/frontends/gnome/Menubar_pimpl.C
2038 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2041 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2043 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2044 width/descent/ascent values if name is empty.
2045 (mathed_string_height): Use std::max.
2047 2000-09-25 Allan Rae <rae@lyx.org>
2049 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2050 segfault. This will be completely redesigned soon.
2052 * sigc++: updated libsigc++. Fixes struct timespec bug.
2054 * development/tools/makeLyXsigc.sh: .cvsignore addition
2056 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2058 * several files: removed almost all traces of the old table
2061 * src/TableLayout.C: removed file
2063 2000-09-22 Juergen Vigna <jug@sad.it>
2065 * src/frontends/kde/Dialogs.C: added credits forms.
2067 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2069 * src/frontends/gnome/Dialogs.C: added some forms.
2071 * src/spellchecker.C (init_spell_checker): set language in pspell code
2072 (RunSpellChecker): some modifications for setting language string.
2074 * src/language.[Ch]: added language_country code.
2076 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2078 * src/frontends/Dialogs.h: added new signal showError.
2079 Rearranged existing signals in some sort of alphabetical order.
2081 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2082 FormError.[Ch], form_error.[Ch]
2083 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2084 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2086 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2087 dialogs. I think that this can be used as the base to all these
2090 * src/frontends/xforms/FormError.[Ch]
2091 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2092 implementation of InsetError dialog.
2094 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2096 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2097 * src/frontends/kde/Makefile.am: ditto
2099 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2101 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2102 macrobf. This fixes a bug of invisible text.
2104 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2106 * lib/doc/LaTeXConfig.lyx.in: updated.
2108 * src/language.C (initL): remove language "francais" and change a
2109 bit the names of the two other french variations.
2111 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2112 string that may not be 0-terminated.
2114 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2116 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2118 2000-09-20 Marko Vendelin <markov@ioc.ee>
2120 * src/frontends/gnome/FormCitation.C
2121 * src/frontends/gnome/FormIndex.C
2122 * src/frontends/gnome/FormToc.C
2123 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2124 the variable initialization to shut up the warnings
2126 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2128 * src/table.[Ch]: deleted files
2130 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2133 2000-09-18 Juergen Vigna <jug@sad.it>
2135 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2136 problems with selection. Inserted new LFUN_PASTESELECTION.
2137 (InsetButtonPress): inserted handling of middle mouse-button paste.
2139 * src/spellchecker.C: changed word to word.c_str().
2141 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2143 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2144 included in the ``make dist'' tarball.
2146 2000-09-15 Juergen Vigna <jug@sad.it>
2148 * src/CutAndPaste.C (cutSelection): small fix return the right
2149 end position after cut inside one paragraph only.
2151 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2152 we are locked as otherwise we don't have a valid cursor position!
2154 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2156 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2158 * src/frontends/kde/FormRef.C: added using directive.
2159 * src/frontends/kde/FormToc.C: ditto
2161 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2163 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2165 2000-09-19 Marko Vendelin <markov@ioc.ee>
2167 * src/frontends/gnome/Menubar_pimpl.C
2168 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2169 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2171 * src/frontends/gnome/mainapp.C
2172 * src/frontends/gnome/mainapp.h: support for menu update used
2175 * src/frontends/gnome/mainapp.C
2176 * src/frontends/gnome/mainapp.h: support for "action" area in the
2177 main window. This area is used by small simple dialogs, such as
2180 * src/frontends/gnome/FormIndex.C
2181 * src/frontends/gnome/FormIndex.h
2182 * src/frontends/gnome/FormUrl.C
2183 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2186 * src/frontends/gnome/FormCitation.C
2187 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2188 action area. Only "Insert new citation" is implemented.
2190 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2192 * src/buffer.C (Dispatch): fix call to Dispatch
2193 * src/insets/insetref.C (Edit): likewise
2194 * src/insets/insetparent.C (Edit): likewise
2195 * src/insets/insetinclude.C (include_cb): likewise
2196 * src/frontends/xforms/FormUrl.C (apply): likewise
2197 * src/frontends/xforms/FormToc.C (apply): likewise
2198 * src/frontends/xforms/FormRef.C (apply): likewise
2199 * src/frontends/xforms/FormIndex.C (apply): likewise
2200 * src/frontends/xforms/FormCitation.C (apply): likewise
2201 * src/lyxserver.C (callback): likewise
2202 * src/lyxfunc.C (processKeySym): likewise
2203 (Dispatch): likewise
2204 (Dispatch): likewise
2205 * src/lyx_cb.C (LayoutsCB): likewise
2207 * Makefile.am (sourcedoc): small change
2209 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2211 * src/main.C (main): Don't make an empty GUIRunTime object. all
2212 methods are static. constify a bit remove unneded using + headers.
2214 * src/tabular.C: some more const to local vars move some loop vars
2216 * src/spellchecker.C: added some c_str after some word for pspell
2218 * src/frontends/GUIRunTime.h: add new static method setDefaults
2219 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2220 * src/frontends/kde/GUIRunTime.C (setDefaults):
2221 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2223 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2224 with strnew in arg, use correct emptystring when calling SetName.
2226 * several files: remove all commented code with relation to
2227 HAVE_SSTREAM beeing false. We now only support stringstream and
2230 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2232 * src/lyxfunc.C: construct correctly the automatic new file
2235 * src/text2.C (IsStringInText): change type of variable i to shut
2238 * src/support/sstream.h: do not use namespaces if the compiler
2239 does not support them.
2241 2000-09-15 Marko Vendelin <markov@ioc.ee>
2242 * src/frontends/gnome/FormCitation.C
2243 * src/frontends/gnome/FormCitation.h
2244 * src/frontends/gnome/diainsertcitation_interface.c
2245 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2246 regexp support to FormCitation [Gnome].
2248 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2251 * configure.in: remove unused KDE/GTKGUI define
2253 * src/frontends/kde/FormRef.C
2254 * src/frontends/kde/FormRef.h
2255 * src/frontends/kde/formrefdialog.C
2256 * src/frontends/kde/formrefdialog.h: double click will
2257 go to reference, now it is possible to change a cross-ref
2260 * src/frontends/kde/FormToc.C
2261 * src/frontends/kde/FormToc.h
2262 * src/frontends/kde/formtocdialog.C
2263 * src/frontends/kde/formtocdialog.h: add a depth
2266 * src/frontends/kde/Makefile.am: add QtLyXView.h
2269 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2271 * src/frontends/kde/FormCitation.h: added some using directives.
2273 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2275 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2278 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2281 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2283 * src/buffer.C (pop_tag): revert for the second time a change by
2284 Lars, who seems to really hate having non-local loop variables :)
2286 * src/Lsstream.h: add "using" statements.
2288 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2289 * src/buffer.C (writeFile): ditto
2291 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2293 * src/buffer.C (writeFile): try to fix the locale modified format
2294 number to always be as we want it.
2296 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2297 in XForms 0.89. C-space is now working again.
2299 * src/Lsstream.h src/support/sstream.h: new files.
2301 * also commented out all cases where strstream were used.
2303 * src/Bullet.h (c_str): remove method.
2305 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2307 * a lot of files: get rid of "char const *" and "char *" is as
2308 many places as possible. We only want to use them in interaction
2309 with system of other libraries, not inside lyx.
2311 * a lot of files: return const object is not of pod type. This
2312 helps ensure that temporary objects is not modified. And fits well
2313 with "programming by contract".
2315 * configure.in: check for the locale header too
2317 * Makefile.am (sourcedoc): new tag for generation of doc++
2320 2000-09-14 Juergen Vigna <jug@sad.it>
2322 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2323 callback to check which combo called it and do the right action.
2325 * src/combox.C (combo_cb): added combo * to the callbacks.
2326 (Hide): moved call of callback after Ungrab of the pointer.
2328 * src/intl.h: removed LCombo2 function.
2330 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2331 function as this can now be handled in one function.
2333 * src/combox.h: added Combox * to callback prototype.
2335 * src/frontends/xforms/Toolbar_pimpl.C:
2336 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2338 2000-09-14 Garst Reese <reese@isn.net>
2340 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2341 moved usepackage{xxx}'s to beginning of file. Changed left margin
2342 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2343 underlining from title. Thanks to John Culleton for useful suggestions.
2345 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2347 * src/lyxlex_pimpl.C (setFile): change error message to debug
2350 2000-09-13 Juergen Vigna <jug@sad.it>
2352 * src/frontends/xforms/FormDocument.C: implemented choice_class
2353 as combox and give callback to combo_language so OK/Apply is activated
2356 * src/bufferlist.C (newFile): small fix so already named files
2357 (via an open call) are not requested to be named again on the
2360 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2362 * src/frontends/kde/Makefile.am
2363 * src/frontends/kde/FormRef.C
2364 * src/frontends/kde/FormRef.h
2365 * src/frontends/kde/formrefdialog.C
2366 * src/frontends/kde/formrefdialog.h: implement
2369 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2371 * src/frontends/kde/formtocdialog.C
2372 * src/frontends/kde/formtocdialog.h
2373 * src/frontends/kde/FormToc.C
2374 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2376 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2378 * src/frontends/kde/FormCitation.C: fix thinko
2379 where we didn't always display the reference text
2382 * src/frontends/kde/formurldialog.C
2383 * src/frontends/kde/formurldialog.h
2384 * src/frontends/kde/FormUrl.C
2385 * src/frontends/kde/FormUrl.h: minor cleanups
2387 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2389 * src/frontends/kde/Makefile.am
2390 * src/frontends/kde/FormToc.C
2391 * src/frontends/kde/FormToc.h
2392 * src/frontends/kde/FormCitation.C
2393 * src/frontends/kde/FormCitation.h
2394 * src/frontends/kde/FormIndex.C
2395 * src/frontends/kde/FormIndex.h
2396 * src/frontends/kde/formtocdialog.C
2397 * src/frontends/kde/formtocdialog.h
2398 * src/frontends/kde/formcitationdialog.C
2399 * src/frontends/kde/formcitationdialog.h
2400 * src/frontends/kde/formindexdialog.C
2401 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2403 2000-09-12 Juergen Vigna <jug@sad.it>
2405 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2408 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2410 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2413 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2415 * src/converter.C (Add, Convert): Added support for converter flags:
2416 needaux, resultdir, resultfile.
2417 (Convert): Added new parameter view_file.
2418 (dvips_options): Fixed letter paper option.
2420 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2421 (Export, GetExportableFormats, GetViewableFormats): Added support
2424 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2426 (easyParse): Fixed to work with new export code.
2428 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2431 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2433 * lib/bind/*.bind: Replaced
2434 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2435 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2437 2000-09-11 Juergen Vigna <jug@sad.it>
2439 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2441 * src/main.C (main): now GUII defines global guiruntime!
2443 * src/frontends/gnome/GUIRunTime.C (initApplication):
2444 * src/frontends/kde/GUIRunTime.C (initApplication):
2445 * src/frontends/xforms/GUIRunTime.C (initApplication):
2446 * src/frontends/GUIRunTime.h: added new function initApplication.
2448 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2450 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2452 2000-09-08 Juergen Vigna <jug@sad.it>
2454 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2455 we have already "Reset".
2457 * src/language.C (initL): inserted "default" language and made this
2458 THE default language (and not american!)
2460 * src/paragraph.C: inserted handling of "default" language!
2462 * src/lyxfont.C: ditto
2466 * src/paragraph.C: output the \\par only if we have a following
2467 paragraph otherwise it's not needed.
2469 2000-09-05 Juergen Vigna <jug@sad.it>
2471 * config/pspell.m4: added entry to lyx-flags
2473 * src/spellchecker.C: modified version from Kevin for using pspell
2475 2000-09-01 Marko Vendelin <markov@ioc.ee>
2476 * src/frontends/gnome/Makefile.am
2477 * src/frontends/gnome/FormCitation.C
2478 * src/frontends/gnome/FormCitation.h
2479 * src/frontends/gnome/diainsertcitation_callbacks.c
2480 * src/frontends/gnome/diainsertcitation_callbacks.h
2481 * src/frontends/gnome/diainsertcitation_interface.c
2482 * src/frontends/gnome/diainsertcitation_interface.h
2483 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2484 dialog for Gnome frontend
2486 * src/main.C: Gnome libraries require keeping application name
2487 and its version as strings
2489 * src/frontends/gnome/mainapp.C: Change the name of the main window
2490 from GnomeLyX to PACKAGE
2492 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2494 * src/frontends/Liason.C: add "using: declaration.
2496 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2498 * src/mathed/math_macro.C (Metrics): Set the size of the template
2500 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2502 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2504 * src/converter.C (add_options): New function.
2505 (SetViewer): Change $$FName into '$$FName'.
2506 (View): Add options when running xdvi
2507 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2508 (Convert): The 3rd parameter is now the desired filename. Converts
2509 calls to lyx::rename if necessary.
2510 Add options when running dvips.
2511 (dvi_papersize,dvips_options): New methods.
2513 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2515 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2516 using a call to Converter::dvips_options.
2517 Fixed to work with nex export code.
2519 * src/support/copy.C
2520 * src/support/rename.C: New files
2522 * src/support/syscall.h
2523 * src/support/syscall.C: Added Starttype SystemDontWait.
2525 * lib/ui/default.ui: Changed to work with new export code
2527 * lib/configure.m4: Changed to work with new export code
2529 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2531 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2533 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2534 so that code compiles with DEC cxx.
2536 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2537 to work correctly! Also now supports the additional elements
2540 2000-09-01 Allan Rae <rae@lyx.org>
2542 * src/frontends/ButtonPolicies.C: renamed all the references to
2543 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2545 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2546 since it's a const not a type.
2548 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2550 2000-08-31 Juergen Vigna <jug@sad.it>
2552 * src/insets/figinset.C: Various changes to look if the filename has
2553 an extension and if not add it for inline previewing.
2555 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2557 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2558 make buttonStatus and isReadOnly be const methods. (also reflect
2559 this in derived classes.)
2561 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2562 (nextState): change to be static inline, pass the StateMachine as
2564 (PreferencesPolicy): remove casts
2565 (OkCancelPolicy): remvoe casts
2566 (OkCancelReadOnlyPolicy): remove casts
2567 (NoRepeatedApplyReadOnlyPolicy): remove casts
2568 (OkApplyCancelReadOnlyPolicy): remove casts
2569 (OkApplyCancelPolicy): remove casts
2570 (NoRepeatedApplyPolicy): remove casts
2572 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2574 * src/converter.C: added some using directives
2576 * src/frontends/ButtonPolicies.C: changes to overcome
2577 "need lvalue" error with DEC c++
2579 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2580 to WMHideCB for DEC c++
2582 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2584 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2585 to BulletBMTableCB for DEC c++
2587 2000-08-31 Allan Rae <rae@lyx.org>
2589 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2590 character dialog separately from old document dialogs combo_language.
2593 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2595 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2596 Removed LFUN_REF_CREATE.
2598 * src/MenuBackend.C: Added new tags: toc and references
2600 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2601 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2603 (add_toc, add_references): New methods.
2604 (create_submenu): Handle correctly the case when there is a
2605 seperator after optional menu items.
2607 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2608 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2609 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2611 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2613 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2615 * src/converter.[Ch]: New file for converting between different
2618 * src/export.[Ch]: New file for exporting a LyX file to different
2621 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2622 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2623 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2624 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2625 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2626 RunDocBook, MenuExport.
2628 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2629 Exporter::Preview methods if NEW_EXPORT is defined.
2631 * src/buffer.C (Dispatch): Use Exporter::Export.
2633 * src/lyxrc.C: Added new tags: \converter and \viewer.
2636 * src/LyXAction.C: Define new lyx-function: buffer-update.
2637 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2638 when NEW_EXPORT is defined.
2640 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2642 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2644 * lib/ui/default.ui: Added submenus "view" and "update" to the
2647 * src/filetools.C (GetExtension): New function.
2649 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2651 2000-08-29 Allan Rae <rae@lyx.org>
2653 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2655 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2656 (EnableDocumentLayout): removed
2657 (DisableDocumentLayout): removed
2658 (build): make use of ButtonController's read-only handling to
2659 de/activate various objects. Replaces both of the above functions.
2661 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2662 (readOnly): was read_only
2663 (refresh): fixed dumb mistakes with read_only_ handling
2665 * src/frontends/xforms/forms/form_document.fd:
2666 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2667 tabbed dialogs so the tabs look more like tabs and so its easier to
2668 work out which is the current tab.
2670 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2671 segfault with form_table
2673 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2675 2000-08-28 Juergen Vigna <jug@sad.it>
2677 * acconfig.h: added USE_PSPELL.
2679 * src/config.h.in: added USE_PSPELL.
2681 * autogen.sh: added pspell.m4
2683 * config/pspell.m4: new file.
2685 * src/spellchecker.C: implemented support for pspell libary.
2687 2000-08-25 Juergen Vigna <jug@sad.it>
2689 * src/LyXAction.C (init): renamed LFUN_TABLE to
2690 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2692 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2694 * src/lyxscreen.h: add force_clear variable and fuction to force
2695 a clear area when redrawing in LyXText.
2697 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2699 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2701 * some whitespace and comment changes.
2703 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2705 * src/buffer.C: up te LYX_FORMAT to 2.17
2707 2000-08-23 Juergen Vigna <jug@sad.it>
2709 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2712 * src/insets/insettabular.C (pasteSelection): delete the insets
2713 LyXText as it is not valid anymore.
2714 (copySelection): new function.
2715 (pasteSelection): new function.
2716 (cutSelection): new function.
2717 (LocalDispatch): implemented cut/copy/paste of cell selections.
2719 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2720 don't have a LyXText.
2722 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2724 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2727 2000-08-22 Juergen Vigna <jug@sad.it>
2729 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2730 ifdef form_table out if NEW_TABULAR.
2732 2000-08-21 Juergen Vigna <jug@sad.it>
2734 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2735 (draw): fixed draw position so that the cursor is positioned in the
2737 (InsetMotionNotify): hide/show cursor so the position is updated.
2738 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2739 using cellstart() function where it should be used.
2741 * src/insets/insettext.C (draw): ditto.
2743 * src/tabular.C: fixed initialization of some missing variables and
2744 made BoxType into an enum.
2746 2000-08-22 Marko Vendelin <markov@ioc.ee>
2747 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2748 stock menu item using action numerical value, not its string
2752 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2754 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2755 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2757 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2759 * src/frontends/xforms/GUIRunTime.C: new file
2761 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2762 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2764 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2766 * src/frontends/kde/GUIRunTime.C: new file
2768 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2769 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2771 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2773 * src/frontends/gnome/GUIRunTime.C: new file
2775 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2778 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2779 small change to documetentation.
2781 * src/frontends/GUIRunTime.C: removed file
2783 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2785 * src/lyxparagraph.h: enable NEW_TABULAR as default
2787 * src/lyxfunc.C (processKeySym): remove some commented code
2789 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2790 NEW_TABULAR around the fd_form_table_options.
2792 * src/lyx_gui.C (runTime): call the static member function as
2793 GUIRunTime::runTime().
2795 2000-08-21 Allan Rae <rae@lyx.org>
2797 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2800 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2802 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2804 2000-08-21 Allan Rae <rae@lyx.org>
2806 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2807 keep Garst happy ;-)
2808 * src/frontends/xforms/FormPreferences.C (build): use setOK
2809 * src/frontends/xforms/FormDocument.C (build): use setOK
2810 (FormDocument): use the appropriate policy.
2812 2000-08-21 Allan Rae <rae@lyx.org>
2814 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2815 automatic [de]activation of arbitrary objects when in a read-only state.
2817 * src/frontends/ButtonPolicies.h: More documentation
2818 (isReadOnly): added to support the above.
2820 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2822 2000-08-18 Juergen Vigna <jug@sad.it>
2824 * src/insets/insettabular.C (getStatus): changed to return func_status.
2826 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2827 display toggle menu entries if they are.
2829 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2830 new document layout now.
2832 * src/lyxfunc.C: ditto
2834 * src/lyx_gui_misc.C: ditto
2836 * src/lyx_gui.C: ditto
2838 * lib/ui/default.ui: removed paper and quotes layout as they are now
2839 all in the document layout tabbed folder.
2841 * src/frontends/xforms/forms/form_document.fd: added Restore
2842 button and callbacks for all inputs for Allan's ButtonPolicy.
2844 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2845 (CheckChoiceClass): added missing params setting on class change.
2846 (UpdateLayoutDocument): added for updating the layout on params.
2847 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2848 (FormDocument): Implemented Allan's ButtonPolicy with the
2851 2000-08-17 Allan Rae <rae@lyx.org>
2853 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2854 so we can at least see the credits again.
2856 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2857 controller calls for the appropriate callbacks. Note that since Ok
2858 calls apply followed by cancel, and apply isn't a valid input for the
2859 APPLIED state, the bc_ calls have to be made in the static callback not
2860 within each of the real callbacks.
2862 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2863 (setOk): renamed from setOkay()
2865 2000-08-17 Juergen Vigna <jug@sad.it>
2867 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2868 in the implementation part.
2869 (composeUIInfo): don't show optional menu-items.
2871 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2873 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2875 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2876 text-state when in a text-inset.
2878 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2880 2000-08-17 Marko Vendelin <markov@ioc.ee>
2881 * src/frontends/gnome/FormIndex.C
2882 * src/frontends/gnome/FormIndex.h
2883 * src/frontends/gnome/FormToc.C
2884 * src/frontends/gnome/FormToc.h
2885 * src/frontends/gnome/dialogs
2886 * src/frontends/gnome/diatoc_callbacks.c
2887 * src/frontends/gnome/diatoc_callbacks.h
2888 * src/frontends/gnome/diainsertindex_callbacks.h
2889 * src/frontends/gnome/diainsertindex_callbacks.c
2890 * src/frontends/gnome/diainsertindex_interface.c
2891 * src/frontends/gnome/diainsertindex_interface.h
2892 * src/frontends/gnome/diatoc_interface.h
2893 * src/frontends/gnome/diatoc_interface.c
2894 * src/frontends/gnome/Makefile.am: Table of Contents and
2895 Insert Index dialogs implementation for Gnome frontend
2897 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2899 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2901 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2904 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2906 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2907 destructor. Don't definde if you don't need it
2908 (processEvents): made static, non-blocking events processing for
2910 (runTime): static method. event loop for xforms
2911 * similar as above for kde and gnome.
2913 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2914 new Pimpl is correct
2915 (runTime): new method calss the real frontends runtime func.
2917 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2919 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2921 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2923 2000-08-16 Juergen Vigna <jug@sad.it>
2925 * src/lyx_gui.C (runTime): added GUII RunTime support.
2927 * src/frontends/Makefile.am:
2928 * src/frontends/GUIRunTime.[Ch]:
2929 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2930 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2931 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2933 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2935 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2936 as this is already set in ${FRONTEND_INCLUDE} if needed.
2938 * configure.in (CPPFLAGS): setting the include dir for the frontend
2939 directory and don't set FRONTEND=xforms for now as this is executed
2942 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2944 * src/frontends/kde/Makefile.am:
2945 * src/frontends/kde/FormUrl.C:
2946 * src/frontends/kde/FormUrl.h:
2947 * src/frontends/kde/formurldialog.h:
2948 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2950 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2952 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2954 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2956 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2959 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2961 * src/WorkArea.C (work_area_handler): more work to get te
2962 FL_KEYBOARD to work with xforms 0.88 too, please test.
2964 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2966 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2968 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2971 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2973 * src/Timeout.h: remove Qt::emit hack.
2975 * several files: changes to allo doc++ compilation
2977 * src/lyxfunc.C (processKeySym): new method
2978 (processKeyEvent): comment out if FL_REVISION < 89
2980 * src/WorkArea.C: change some debugging levels.
2981 (WorkArea): set wantkey to FL_KEY_ALL
2982 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2983 clearer code and the use of compose with XForms 0.89. Change to
2984 use signals instead of calling methods in bufferview directly.
2986 * src/Painter.C: change some debugging levels.
2988 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2991 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2992 (workAreaKeyPress): new method
2994 2000-08-14 Juergen Vigna <jug@sad.it>
2996 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2998 * config/kde.m4: addes some features
3000 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3001 include missing xforms dialogs.
3003 * src/Timeout.h: a hack to be able to compile with qt/kde.
3005 * sigc++/.cvsignore: added acinclude.m4
3007 * lib/.cvsignore: added listerros
3009 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3010 xforms tree as objects are needed for other frontends.
3012 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3013 linking with not yet implemented xforms objects.
3015 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3017 2000-08-14 Baruch Even <baruch.even@writeme.com>
3019 * src/frontends/xforms/FormGraphics.h:
3020 * src/frontends/xforms/FormGraphics.C:
3021 * src/frontends/xforms/RadioButtonGroup.h:
3022 * src/frontends/xforms/RadioButtonGroup.C:
3023 * src/insets/insetgraphics.h:
3024 * src/insets/insetgraphics.C:
3025 * src/insets/insetgraphicsParams.h:
3026 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3027 instead of spaces, and various other indentation issues to make the
3028 sources more consistent.
3030 2000-08-14 Marko Vendelin <markov@ioc.ee>
3032 * src/frontends/gnome/dialogs/diaprint.glade
3033 * src/frontends/gnome/FormPrint.C
3034 * src/frontends/gnome/FormPrint.h
3035 * src/frontends/gnome/diaprint_callbacks.c
3036 * src/frontends/gnome/diaprint_callbacks.h
3037 * src/frontends/gnome/diaprint_interface.c
3038 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3041 * src/frontends/gnome/dialogs/diainserturl.glade
3042 * src/frontends/gnome/FormUrl.C
3043 * src/frontends/gnome/FormUrl.h
3044 * src/frontends/gnome/diainserturl_callbacks.c
3045 * src/frontends/gnome/diainserturl_callbacks.h
3046 * src/frontends/gnome/diainserturl_interface.c
3047 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3048 Gnome implementation
3050 * src/frontends/gnome/Dialogs.C
3051 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3052 all other dialogs. Copy all unimplemented dialogs from Xforms
3055 * src/frontends/gnome/support.c
3056 * src/frontends/gnome/support.h: support files generated by Glade
3060 * config/gnome.m4: Gnome configuration scripts
3062 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3063 configure --help message
3065 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3066 only if there are no events pendling in Gnome/Gtk. This enhances
3067 the performance of menus.
3070 2000-08-14 Allan Rae <rae@lyx.org>
3072 * lib/Makefile.am: listerrors cleaning
3074 * lib/listerrors: removed -- generated file
3075 * acinclude.m4: ditto
3076 * sigc++/acinclude.m4: ditto
3078 * src/frontends/xforms/forms/form_citation.fd:
3079 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3082 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3083 `updatesrc` and now we have a `test` target that does what `updatesrc`
3084 used to do. I didn't like having an install target that wasn't related
3087 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3088 on all except FormGraphics. This may yet happen. Followed by a major
3089 cleanup including using FL_TRANSIENT for most of the dialogs. More
3090 changes to come when the ButtonController below is introduced.
3092 * src/frontends/xforms/ButtonController.h: New file for managing up to
3093 four buttons on a dialog according to an externally defined policy.
3094 * src/frontends/xforms/Makefile.am: added above
3096 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3097 Apply and Cancel/Close buttons and everything in between and beyond.
3098 * src/frontends/Makefile.am: added above.
3100 * src/frontends/xforms/forms/form_preferences.fd:
3101 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3102 and removed variable 'status' as a result. Fixed the set_minsize thing.
3103 Use the new screen-font-update after checking screen fonts were changed
3104 Added a "Restore" button to restore the original lyxrc values while
3105 editing. This restores everything not just the last input changed.
3106 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3108 * src/LyXAction.C: screen-font-update added for updating buffers after
3109 screen font settings have been changed.
3110 * src/commandtags.h: ditto
3111 * src/lyxfunc.C: ditto
3113 * forms/lyx.fd: removed screen fonts dialog.
3114 * src/lyx_gui.C: ditto
3115 * src/menus.[Ch]: ditto
3116 * src/lyx.[Ch]: ditto
3117 * src/lyx_cb.C: ditto + code from here moved to make
3118 screen-font-update. And people wonder why progress on GUII is
3119 slow. Look at how scattered this stuff was! It takes forever
3122 * forms/fdfix.sh: Fixup the spacing after commas.
3123 * forms/makefile: Remove date from generated files. Fewer clashes now.
3124 * forms/bullet_forms.C.patch: included someones handwritten changes
3126 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3127 once I've discovered why LyXRC was made noncopyable.
3128 * src/lyx_main.C: ditto
3130 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3132 * src/frontends/xforms/forms/fdfix.sh:
3133 * src/frontends/xforms/forms/fdfixh.sed:
3134 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3135 * src/frontends/xforms/Form*.[hC]:
3136 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3137 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3138 provide a destructor for the struct FD_form_xxxx. Another version of
3139 the set_[max|min]size workaround and a few other cleanups. Actually,
3140 Angus' patch from 20000809.
3142 2000-08-13 Baruch Even <baruch.even@writeme.com>
3144 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3147 2000-08-11 Juergen Vigna <jug@sad.it>
3149 * src/insets/insetgraphics.C (InsetGraphics): changing init
3150 order because of warnings.
3152 * src/frontends/xforms/forms/makefile: adding patching .C with
3155 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3156 from .C.patch to .c.patch
3158 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3159 order because of warning.
3161 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3163 * src/frontends/Liason.C (setMinibuffer): new helper function
3165 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3167 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3169 * lib/ui/default.ui: commented out PaperLayout entry
3171 * src/frontends/xforms/form_document.[Ch]: new added files
3173 * src/frontends/xforms/FormDocument.[Ch]: ditto
3175 * src/frontends/xforms/forms/form_document.fd: ditto
3177 * src/frontends/xforms/forms/form_document.C.patch: ditto
3179 2000-08-10 Juergen Vigna <jug@sad.it>
3181 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3182 (InsetGraphics): initialized cacheHandle to 0.
3183 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3185 2000-08-10 Baruch Even <baruch.even@writeme.com>
3187 * src/graphics/GraphicsCache.h:
3188 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3189 correctly as a cache.
3191 * src/graphics/GraphicsCacheItem.h:
3192 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3195 * src/graphics/GraphicsCacheItem_pimpl.h:
3196 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3199 * src/insets/insetgraphics.h:
3200 * src/insets/insetgraphics.C: Changed from using a signal notification
3201 to polling when image is not loaded.
3203 2000-08-10 Allan Rae <rae@lyx.org>
3205 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3206 that there are two functions that have to been taken out of line by
3207 hand and aren't taken care of in the script. (Just a reminder note)
3209 * sigc++/macros/*.h.m4: Updated as above.
3211 2000-08-09 Juergen Vigna <jug@sad.it>
3213 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3215 * src/insets/insettabular.C: make drawing of single cell smarter.
3217 2000-08-09 Marko Vendelin <markov@ioc.ee>
3218 * src/frontends/gnome/Menubar_pimpl.C
3219 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3220 implementation: new files
3222 * src/frontends/gnome/mainapp.C
3223 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3226 * src/main.C: create Gnome main window
3228 * src/frontends/xforms/Menubar_pimpl.h
3229 * src/frontends/Menubar.C
3230 * src/frontends/Menubar.h: added method Menubar::update that calls
3231 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3233 * src/LyXView.C: calls Menubar::update to update the state
3236 * src/frontends/gnome/Makefile.am: added new files
3238 * src/frontends/Makefile.am: added frontend compiler options
3240 2000-08-08 Juergen Vigna <jug@sad.it>
3242 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3244 * src/bufferlist.C (close):
3245 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3246 documents if exiting without saving.
3248 * src/buffer.C (save): use removeAutosaveFile()
3250 * src/support/filetools.C (removeAutosaveFile): new function.
3252 * src/lyx_cb.C (MenuWrite): returns a bool now.
3253 (MenuWriteAs): check if file could really be saved and revert to the
3255 (MenuWriteAs): removing old autosavefile if existant.
3257 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3258 before Goto toggle declaration, because of compiler warning.
3260 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3262 * src/lyxfunc.C (MenuNew): small fix.
3264 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3266 * src/bufferlist.C (newFile):
3267 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3269 * src/lyxrc.C: added new_ask_filename tag
3271 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3273 * src/lyx.fd: removed code pertaining to form_ref
3274 * src/lyx.[Ch]: ditto
3275 * src/lyx_cb.C: ditto
3276 * src/lyx_gui.C: ditto
3277 * src/lyx_gui_misc.C: ditto
3279 * src/BufferView_pimpl.C (restorePosition): update buffer only
3282 * src/commandtags.h (LFUN_REFTOGGLE): removed
3283 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3284 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3285 (LFUN_REFBACK): renamed LFUN_REF_BACK
3287 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3288 * src/menus.C: ditto
3289 * src/lyxfunc.C (Dispatch): ditto.
3290 InsertRef dialog is now GUI-independent.
3292 * src/texrow.C: added using std::endl;
3294 * src/insets/insetref.[Ch]: strip out large amounts of code.
3295 The inset is now a container and this functionality is now
3296 managed by a new FormRef dialog
3298 * src/frontends/Dialogs.h (showRef, createRef): new signals
3300 * src/frontends/xforms/FormIndex.[Ch],
3301 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3302 when setting dialog's min/max size
3303 * src/frontends/xforms/FormIndex.[Ch]: ditto
3305 * src/frontends/xforms/FormRef.[Ch],
3306 src/frontends/xforms/forms/form_ref.fd: new xforms
3307 implementation of an InsetRef dialog
3309 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3312 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3313 ios::nocreate is not part of the standard. Removed.
3315 2000-08-07 Baruch Even <baruch.even@writeme.com>
3317 * src/graphics/Renderer.h:
3318 * src/graphics/Renderer.C: Added base class for rendering of different
3319 image formats into Pixmaps.
3321 * src/graphics/XPM_Renderer.h:
3322 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3323 in a different class.
3325 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3326 easily add support for other formats.
3328 * src/insets/figinset.C: plugged a leak of an X resource.
3330 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3332 * src/CutAndPaste.[Ch]: make all metods static.
3334 * development/Code_rules/Rules: more work, added section on
3335 Exceptions, and a References section.
3337 * a lot of header files: work to make doc++ able to generate the
3338 source documentation, some workarounds of doc++ problems. Doc++ is
3339 now able to generate the documentation.
3341 2000-08-07 Juergen Vigna <jug@sad.it>
3343 * src/insets/insettabular.C (recomputeTextInsets): removed function
3345 * src/tabular.C (SetWidthOfMulticolCell):
3347 (calculate_width_of_column_NMC): fixed return value so that it really
3348 only returns true if the column-width has changed (there where
3349 problems with muliticolumn-cells in this column).
3351 2000-08-04 Juergen Vigna <jug@sad.it>
3353 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3354 also on the scrollstatus of the inset.
3355 (workAreaMotionNotify): ditto.
3357 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3359 2000-08-01 Juergen Vigna <jug@sad.it>
3361 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3363 * src/commandtags.h:
3364 * src/LyXAction.C (init):
3365 * src/insets/inset.C (LocalDispatch): added support for
3368 * src/insets/inset.C (scroll): new functions.
3370 * src/insets/insettext.C (removeNewlines): new function.
3371 (SetAutoBreakRows): removes forced newlines in the text of the
3372 paragraph if autoBreakRows is set to false.
3374 * src/tabular.C (Latex): generates a parbox around the cell contents
3377 * src/frontends/xforms/FormTabular.C (local_update): removed
3378 the radio_useparbox button.
3380 * src/tabular.C (UseParbox): new function
3382 2000-08-06 Baruch Even <baruch.even@writeme.com>
3384 * src/graphics/GraphicsCache.h:
3385 * src/graphics/GraphicsCache.C:
3386 * src/graphics/GraphicsCacheItem.h:
3387 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3390 * src/insets/insetgraphics.h:
3391 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3392 and the drawing of the inline image.
3394 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3395 loaded into the wrong position.
3397 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3400 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3402 * src/support/translator.h: move all typedefs to public section
3404 * src/support/filetools.C (MakeLatexName): return string const
3406 (TmpFileName): ditto
3407 (FileOpenSearch): ditto
3409 (LibFileSearch): ditto
3410 (i18nLibFileSearch): ditto
3413 (CreateTmpDir): ditto
3414 (CreateBufferTmpDir): ditto
3415 (CreateLyXTmpDir): ditto
3418 (MakeAbsPath): ditto
3420 (OnlyFilename): ditto
3422 (NormalizePath): ditto
3423 (CleanupPath): ditto
3424 (GetFileContents): ditto
3425 (ReplaceEnvironmentPath): ditto
3426 (MakeRelPath): ditto
3428 (ChangeExtension): ditto
3429 (MakeDisplayPath): ditto
3430 (do_popen): return cmdret const
3431 (findtexfile): return string const
3433 * src/support/DebugStream.h: add some /// to please doc++
3435 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3437 * src/texrow.C (same_rownumber): functor to use with find_if
3438 (getIdFromRow): rewritten to use find_if and to not update the
3439 positions. return true if row is found
3440 (increasePos): new method, use to update positions
3442 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3444 * src/lyxlex_pimpl.C (verifyTable): new method
3447 (GetString): return string const
3448 (pushTable): rewrite to use std::stack
3450 (setFile): better check
3453 * src/lyxlex.h: make LyXLex noncopyable
3455 * src/lyxlex.C (text): return char const * const
3456 (GetString): return string const
3457 (getLongString): return string const
3459 * src/lyx_gui_misc.C (askForText): return pair<...> const
3461 * src/lastfiles.[Ch] (operator): return string const
3463 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3464 istringstream not char const *.
3465 move token.end() out of loop.
3466 (readFile): move initializaton of token
3468 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3469 getIdFromRow is successful.
3471 * lib/bind/emacs.bind: don't include menus bind
3473 * development/Code_rules/Rules: the beginnings of making this
3474 better and covering more of the unwritten rules that we have.
3476 * development/Code_rules/Recommendations: a couple of wording
3479 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3481 * src/support/strerror.c: remove C++ comment.
3483 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3485 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3486 LFUN_INDEX_INSERT_LAST
3488 * src/texrow.C (getIdFromRow): changed from const_iterator to
3489 iterator, allowing code to compile with DEC cxx
3491 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3492 stores part of the class, as suggested by Allan. Will allow
3494 (apply): test to apply uses InsetCommandParams operator!=
3496 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3497 (apply): test to apply uses InsetCommandParams operator!=
3499 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3500 stores part of the class.
3501 (update): removed limits on min/max size.
3503 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3504 (apply): test to apply uses InsetCommandParams operator!=
3506 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3507 (Read, Write, scanCommand, getCommand): moved functionality
3508 into InsetCommandParams.
3510 (getScreenLabel): made pure virtual
3511 new InsetCommandParams operators== and !=
3513 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3514 c-tors based on InsetCommandParams. Removed others.
3515 * src/insets/insetinclude.[Ch]: ditto
3516 * src/insets/insetlabel.[Ch]: ditto
3517 * src/insets/insetparent.[Ch]: ditto
3518 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3520 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3521 insets derived from InsetCommand created using similar c-tors
3522 based on InsetCommandParams
3523 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3524 * src/menus.C (ShowRefsMenu): ditto
3525 * src/paragraph.C (Clone): ditto
3526 * src/text2.C (SetCounter): ditto
3527 * src/lyxfunc.C (Dispatch) ditto
3528 Also recreated old InsetIndex behaviour exactly. Can now
3529 index-insert at the start of a paragraph and index-insert-last
3530 without launching the pop-up.
3532 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3534 * lib/lyxrc.example: mark te pdf options as non functional.
3536 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3537 (isStrDbl): move tmpstr.end() out of loop.
3538 (strToDbl): move intialization of tmpstr
3539 (lowercase): return string const and move tmp.end() out of loop.
3540 (uppercase): return string const and move tmp.edn() out of loop.
3541 (prefixIs): add assertion
3546 (containsOnly): ditto
3547 (containsOnly): ditto
3548 (containsOnly): ditto
3549 (countChar): make last arg char not char const
3550 (token): return string const
3551 (subst): return string const, move tmp.end() out of loop.
3552 (subst): return string const, add assertion
3553 (strip): return string const
3554 (frontStrip): return string const, add assertion
3555 (frontStrip): return string const
3560 * src/support/lstrings.C: add inclde "LAssert.h"
3561 (isStrInt): move tmpstr.end() out of loop.
3563 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3564 toollist.end() out of loop.
3565 (deactivate): move toollist.end() out of loop.
3566 (update): move toollist.end() out of loop.
3567 (updateLayoutList): move tc.end() out of loop.
3568 (add): move toollist.end() out of loop.
3570 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3571 md.end() out of loop.
3573 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3575 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3578 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3579 (Erase): move insetlist.end() out of loop.
3581 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3582 ref to const string as first arg. Move initialization of some
3583 variables, whitespace changes.
3585 * src/kbmap.C (defkey): move table.end() out of loop.
3586 (kb_keymap): move table.end() out of loop.
3587 (findbinding): move table.end() out of loop.
3589 * src/MenuBackend.C (hasMenu): move end() out of loop.
3590 (getMenu): move end() out of loop.
3591 (getMenu): move menulist_.end() out of loop.
3593 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3595 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3598 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3599 (getFromLyXName): move infotab.end() out of loop.
3601 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3602 -fvtable-thunks -ffunction-sections -fdata-sections
3604 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3606 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3609 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3611 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3613 * src/frontends/xforms/FormCitation.[Ch],
3614 src/frontends/xforms/FormIndex.[Ch],
3615 src/frontends/xforms/FormToc.[Ch],
3616 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3618 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3620 * src/commandtags.h: renamed, created some flags for citation
3623 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3625 * src/lyxfunc.C (dispatch): use signals to insert index entry
3627 * src/frontends/Dialogs.h: new signal createIndex
3629 * src/frontends/xforms/FormCommand.[Ch],
3630 src/frontends/xforms/FormCitation.[Ch],
3631 src/frontends/xforms/FormToc.[Ch],
3632 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3634 * src/insets/insetindex.[Ch]: GUI-independent
3636 * src/frontends/xforms/FormIndex.[Ch],
3637 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3640 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3642 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3643 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3645 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3647 * src/insets/insetref.C (Latex): rewrite so that there is now
3648 question that a initialization is requested.
3650 * src/insets/insetcommand.h: reenable the hide signal
3652 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3654 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3655 fix handling of shortcuts (many bugs :)
3656 (add_lastfiles): ditto.
3658 * lib/ui/default.ui: fix a few shortcuts.
3660 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3662 * Makefile.am: Fix ``rpmdist'' target to return the exit
3663 status of the ``rpm'' command, instead of the last command in
3664 the chain (the ``rm lyx.xpm'' command, which always returns
3667 2000-08-02 Allan Rae <rae@lyx.org>
3669 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3670 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3671 * src/frontends/xforms/FormToc.C (FormToc): ditto
3673 * src/frontends/xforms/Makefile.am: A few forgotten files
3675 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3676 Signals-not-copyable-problem Lars' started commenting out.
3678 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3680 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3682 * src/insets/insetcommand.h: Signals is not copyable so anoter
3683 scheme for automatic hiding of forms must be used.
3685 * src/frontends/xforms/FormCitation.h: don't inerit from
3686 noncopyable, FormCommand already does that.
3687 * src/frontends/xforms/FormToc.h: ditto
3688 * src/frontends/xforms/FormUrl.h: ditto
3690 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3692 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3694 * src/insets/insetcommand.h (hide): new SigC::Signal0
3695 (d-tor) new virtual destructor emits hide signal
3697 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3698 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3700 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3701 LOF and LOT. Inset is now GUI-independent
3703 * src/insets/insetloa.[Ch]: redundant
3704 * src/insets/insetlof.[Ch]: ditto
3705 * src/insets/insetlot.[Ch]: ditto
3707 * src/frontends/xforms/forms/form_url.fd: tweaked!
3708 * src/frontends/xforms/forms/form_citation.fd: ditto
3710 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3711 dialogs dealing with InsetCommand insets
3713 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3714 FormCommand base class
3715 * src/frontends/xforms/FormUrl.[Ch]: ditto
3717 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3719 * src/frontends/xforms/FormToc.[Ch]: ditto
3721 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3722 passed a generic InsetCommand pointer
3723 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3725 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3726 and modified InsetTOC class
3727 * src/buffer.C: ditto
3729 * forms/lyx.fd: strip out old FD_form_toc code
3730 * src/lyx_gui_misc.C: ditto
3731 * src/lyx_gui.C: ditto
3732 * src/lyx_cb.C: ditto
3733 * src/lyx.[Ch]: ditto
3735 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3737 * src/support/utility.hpp: tr -d '\r'
3739 2000-08-01 Juergen Vigna <jug@sad.it>
3741 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3743 * src/commandtags.h:
3744 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3745 LFUN_TABULAR_FEATURES.
3747 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3748 LFUN_LAYOUT_TABULAR.
3750 * src/insets/insettabular.C (getStatus): implemented helper function.
3752 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3754 2000-07-31 Juergen Vigna <jug@sad.it>
3756 * src/text.C (draw): fixed screen update problem for text-insets.
3758 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3759 something changed probably this has to be added in various other
3762 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3764 2000-07-31 Baruch Even <baruch.even@writeme.com>
3766 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3767 templates to satisfy compaq cxx.
3770 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3772 * src/support/translator.h (equal_1st_in_pair::operator()): take
3773 const ref pair_type as arg.
3774 (equal_2nd_in_pair::operator()): ditto
3775 (Translator::~Translator): remove empty d-tor.
3777 * src/graphics/GraphicsCache.C: move include config.h to top, also
3778 put initialization of GraphicsCache::singleton here.
3779 (~GraphicsCache): move here
3780 (addFile): take const ref as arg
3783 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3785 * src/BufferView2.C (insertLyXFile): change te with/without header
3788 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3790 * src/frontends/xforms/FormGraphics.C (apply): add some
3791 static_cast. Not very nice, but required by compaq cxx.
3793 * src/frontends/xforms/RadioButtonGroup.h: include header
3794 <utility> instead of <pair.h>
3796 * src/insets/insetgraphicsParams.C: add using directive.
3797 (readResize): change return type to void.
3798 (readOrigin): ditto.
3800 * src/lyxfunc.C (getStatus): add missing break for build-program
3801 function; add test for Literate for export functions.
3803 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3804 entries in Options menu.
3806 2000-07-31 Baruch Even <baruch.even@writeme.com>
3808 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3809 protect against auto-allocation; release icon when needed.
3811 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3813 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3814 on usual typewriter.
3816 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3817 earlier czech.kmap), useful only for programming.
3819 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3821 * src/frontends/xforms/FormCitation.h: fix conditioning around
3824 2000-07-31 Juergen Vigna <jug@sad.it>
3826 * src/frontends/xforms/FormTabular.C (local_update): changed
3827 radio_linebreaks to radio_useparbox and added radio_useminipage.
3829 * src/tabular.C: made support for using minipages/parboxes.
3831 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3833 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3835 (descent): so the cursor is in the middle.
3836 (width): bit smaller box.
3838 * src/insets/insetgraphics.h: added display() function.
3840 2000-07-31 Baruch Even <baruch.even@writeme.com>
3842 * src/frontends/Dialogs.h: Added showGraphics signals.
3844 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3845 xforms form definition of the graphics dialog.
3847 * src/frontends/xforms/FormGraphics.h:
3848 * src/frontends/xforms/FormGraphics.C: Added files, the
3849 GUIndependent code of InsetGraphics
3851 * src/insets/insetgraphics.h:
3852 * src/insets/insetgraphics.C: Major writing to make it work.
3854 * src/insets/insetgraphicsParams.h:
3855 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3856 struct between InsetGraphics and GUI.
3858 * src/LaTeXFeatures.h:
3859 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3860 support for graphicx package.
3862 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3863 for the graphics inset.
3865 * src/support/translator.h: Added file, used in
3866 InsetGraphicsParams. this is a template to translate between two
3869 * src/frontends/xforms/RadioButtonGroup.h:
3870 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3871 way to easily control a radio button group.
3873 2000-07-28 Juergen Vigna <jug@sad.it>
3875 * src/insets/insettabular.C (LocalDispatch):
3876 (TabularFeatures): added support for lyx-functions of tabular features.
3877 (cellstart): refixed this function after someone wrongly changed it.
3879 * src/commandtags.h:
3880 * src/LyXAction.C (init): added support for tabular-features
3882 2000-07-28 Allan Rae <rae@lyx.org>
3884 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3885 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3886 triggers the callback for input checking. As a result we sometimes get
3887 "LyX: This shouldn't happen..." printed to cerr.
3888 (input): Started using status variable since I only free() on
3889 destruction. Some input checking for paths and font sizes.
3891 * src/frontends/xforms/FormPreferences.h: Use status to control
3892 activation of Ok and Apply
3894 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3895 callback. Also resized to stop segfaults with 0.88. The problem is
3896 that xforms-0.88 requires the folder to be wide enough to fit all the
3897 tabs. If it isn't it causes all sorts of problems.
3899 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3901 * src/frontends/xforms/forms/README: Reflect reality.
3903 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3904 * src/frontends/xforms/forms/makefile: ditto.
3906 * src/commandtags.h: Get access to new Preferences dialog
3907 * src/LyXAction.C: ditto
3908 * src/lyxfunc.C: ditto
3909 * lib/ui/default.ui: ditto
3911 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3913 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3915 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3918 * src/frontends/xforms/form_url.[Ch]: added.
3920 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3922 * src/insets/insetbib.h: fixed bug in previous commit
3924 * src/frontends/xforms/FormUrl.h: ditto
3926 * src/frontends/xforms/FormPrint.h: ditto
3928 * src/frontends/xforms/FormPreferences.h: ditto
3930 * src/frontends/xforms/FormCopyright.h: ditto
3932 * src/frontends/xforms/FormCitation.C: ditto
3934 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3935 private copyconstructor and private default contructor
3937 * src/support/Makefile.am: add utility.hpp
3939 * src/support/utility.hpp: new file from boost
3941 * src/insets/insetbib.h: set owner in clone
3943 * src/frontends/xforms/FormCitation.C: added missing include
3946 * src/insets/form_url.[Ch]: removed
3948 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3950 * development/lyx.spec.in
3951 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3952 file/directory re-organization.
3954 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3956 * src/insets/insetcommand.[Ch]: moved the string data and
3957 associated manipulation methods into a new stand-alone class
3958 InsetCommandParams. This class has two additional methods
3959 getAsString() and setFromString() allowing the contents to be
3960 moved around as a single string.
3961 (addContents) method removed.
3962 (setContents) method no longer virtual.
3964 * src/buffer.C (readInset): made use of new InsetCitation,
3965 InsetUrl constructors based on InsetCommandParams.
3967 * src/commandtags.h: add LFUN_INSERT_URL
3969 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3970 independent InsetUrl and use InsetCommandParams to extract
3971 string info and create new Insets.
3973 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3975 * src/frontends/xforms/FormCitation.C (apply): uses
3978 * src/frontends/xforms/form_url.C
3979 * src/frontends/xforms/form_url.h
3980 * src/frontends/xforms/FormUrl.h
3981 * src/frontends/xforms/FormUrl.C
3982 * src/frontends/xforms/forms/form_url.fd: new files
3984 * src/insets/insetcite.[Ch]: removed unused constructors.
3986 * src/insets/insetinclude.[Ch]: no longer store filename
3988 * src/insets/inseturl.[Ch]: GUI-independent.
3990 2000-07-26 Juergen Vigna <jug@sad.it>
3991 * renamed frontend from gtk to gnome as it is that what is realized
3992 and did the necessary changes in the files.
3994 2000-07-26 Marko Vendelin <markov@ioc.ee>
3996 * configure.in: cleaning up gnome configuration scripts
3998 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4000 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4001 shortcuts syndrom by redrawing them explicitely (a better solution
4002 would be appreciated).
4004 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4006 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4009 * src/lyx_cb.C (MenuExport): change html export to do the right
4010 thing depending of the document type (instead of having
4011 html-linuxdoc and html-docbook).
4012 * src/lyxfunc.C (getStatus): update for html
4013 * lib/ui/default.ui: simplify due to the above change.
4014 * src/menus.C (ShowFileMenu): update too (in case we need it).
4016 * src/MenuBackend.C (read): if a menu is defined twice, add the
4017 new entries to the exiting one.
4019 2000-07-26 Juergen Vigna <jug@sad.it>
4021 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4023 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4024 and return a bool if it did actual save the file.
4025 (AutoSave): don't autosave a unnamed doc.
4027 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4028 check if this is an UNNAMED new file and react to it.
4029 (newFile): set buffer to unnamed and change to not mark a new
4030 buffer dirty if I didn't do anything with it.
4032 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4034 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4036 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4037 friend as per Angus's patch posted to lyx-devel.
4039 * src/ext_l10n.h: updated
4041 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4042 gettext on the style string right before inserting them into the
4045 * autogen.sh: add code to extract style strings form layout files,
4046 not good enough yet.
4048 * src/frontends/gtk/.cvsignore: add MAKEFILE
4050 * src/MenuBackend.C (read): run the label strings through gettext
4051 before storing them in the containers.
4053 * src/ext_l10n.h: new file
4055 * autogen.sh : generate the ext_l10n.h file here
4057 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4059 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4062 * lib/ui/default.ui: fix a couple of typos.
4064 * config/gnome/gtk.m4: added (and added to the list of files in
4067 * src/insets/insetinclude.C (unique_id): fix when we are using
4068 lyxstring instead of basic_string<>.
4069 * src/insets/insettext.C (LocalDispatch): ditto.
4070 * src/support/filetools.C: ditto.
4072 * lib/configure.m4: create the ui/ directory if necessary.
4074 * src/LyXView.[Ch] (updateToolbar): new method.
4076 * src/BufferView_pimpl.C (buffer): update the toolbar when
4077 opening/closing buffer.
4079 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4081 * src/LyXAction.C (getActionName): enhance to return also the name
4082 and options of pseudo-actions.
4083 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4085 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4086 as an example of what is possible). Used in File->Build too (more
4087 useful) and in the import/export menus (to mimick the complicated
4088 handling of linuxdoc and friends). Try to update all the entries.
4090 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4093 * src/MenuBackend.C (read): Parse the new OptItem tag.
4095 * src/MenuBackend.h: Add a new optional_ data member (used if the
4096 entry should be omitted when the lyxfunc is disabled).
4098 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4099 function, used as a shortcut.
4100 (create_submenu): align correctly the shortcuts on the widest
4103 * src/MenuBackend.h: MenuItem.label() only returns the label of
4104 the menu without shortcut; new method shortcut().
4106 2000-07-14 Marko Vendelin <markov@ioc.ee>
4108 * src/frontends/gtk/Dialogs.C:
4109 * src/frontends/gtk/FormCopyright.C:
4110 * src/frontends/gtk/FormCopyright.h:
4111 * src/frontends/gtk/Makefile.am: added these source-files for the
4112 Gtk/Gnome support of the Copyright-Dialog.
4114 * src/main.C: added Gnome::Main initialization if using
4115 Gtk/Gnome frontend-GUI.
4117 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4119 * config/gnome/aclocal-include.m4
4120 * config/gnome/compiler-flags.m4
4121 * config/gnome/curses.m4
4122 * config/gnome/gnome--.m4
4123 * config/gnome/gnome-bonobo-check.m4
4124 * config/gnome/gnome-common.m4
4125 * config/gnome/gnome-fileutils.m4
4126 * config/gnome/gnome-ghttp-check.m4
4127 * config/gnome/gnome-gnorba-check.m4
4128 * config/gnome/gnome-guile-checks.m4
4129 * config/gnome/gnome-libgtop-check.m4
4130 * config/gnome/gnome-objc-checks.m4
4131 * config/gnome/gnome-orbit-check.m4
4132 * config/gnome/gnome-print-check.m4
4133 * config/gnome/gnome-pthread-check.m4
4134 * config/gnome/gnome-support.m4
4135 * config/gnome/gnome-undelfs.m4
4136 * config/gnome/gnome-vfs.m4
4137 * config/gnome/gnome-x-checks.m4
4138 * config/gnome/gnome-xml-check.m4
4139 * config/gnome/gnome.m4
4140 * config/gnome/gperf-check.m4
4141 * config/gnome/gtk--.m4
4142 * config/gnome/linger.m4
4143 * config/gnome/need-declaration.m4: added configuration scripts
4144 for Gtk/Gnome frontend-GUI
4146 * configure.in: added support for the --with-frontend=gtk option
4148 * autogen.sh: added config/gnome/* to list of config-files
4150 * acconfig.h: added define for GTKGUI-support
4152 * config/lyxinclude.m4: added --with-frontend[=value] option value
4153 for Gtk/Gnome frontend-GUI support.
4155 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4157 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4161 * src/paragraph.C (GetChar): remove non-const version
4163 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4164 (search_kw): use it.
4166 * src/lyx_main.C (init): if "preferences" exist, read that instead
4168 (ReadRcFile): return bool if the file could be read ok.
4169 (ReadUIFile): add a check to see if lex file is set ok.
4171 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4172 bastring can be used instead of lyxstring (still uses the old code
4173 if std::string is good enough or if lyxstring is used.)
4175 * src/encoding.C: make the arrays static, move ininle functions
4177 * src/encoding.h: from here.
4179 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4180 (parseSingleLyXformat2Token): move inset parsing to separate method
4181 (readInset): new private method
4183 * src/Variables.h: remove virtual from get().
4185 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4186 access to NEW_INSETS and NEW_TABULAR
4188 * src/MenuBackend.h: remove superfluous forward declaration of
4189 MenuItem. Add documentations tags "///", remove empty MenuItem
4190 destructor, remove private default contructor.
4192 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4194 (read): more string mlabel and mname to where they are used
4195 (read): remove unused variables mlabel and mname
4196 (defaults): unconditional clear, make menusetup take advantage of
4197 add returning Menu &.
4199 * src/LyXView.h: define NEW_MENUBAR as default
4201 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4202 to NEW_INSETS and NEW_TABULAR.
4203 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4204 defined. Change some of the "xxxx-inset-insert" functions names to
4207 * several files: more enahncements to NEW_INSETS and the resulting
4210 * lib/lyxrc.example (\date_insert_format): move to misc section
4212 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4213 bastring and use AC_CACHE_CHECK.
4214 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4215 the system have the newest methods. uses AC_CACHE_CHECK
4216 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4217 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4218 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4220 * configure.in: add LYX_CXX_GOOD_STD_STRING
4222 * acinclude.m4: recreated
4224 2000-07-24 Amir Karger <karger@lyx.org>
4226 * README: add Hebrew, Arabic kmaps
4229 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4231 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4234 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4236 * Lot of files: add pragma interface/implementation.
4238 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4240 * lib/ui/default.ui: new file (ans new directory). Contains the
4241 default menu and toolbar.
4243 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4244 global space. Toolbars are now read (as menus) in ui files.
4246 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4248 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4249 is disabled because the document is read-only. We want to have the
4250 toggle state of the function anyway.
4251 (getStatus): add code for LFUN_VC* functions (mimicking what is
4252 done in old-style menus)
4254 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4255 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4257 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4258 * src/BufferView_pimpl.C: ditto.
4259 * src/lyxfunc.C: ditto.
4261 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4262 default). This replaces old-style menus by new ones.
4264 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4265 MenuItem. Contain the data structure of a menu.
4267 * src/insets/insettext.C: use LyXView::setLayout instead of
4268 accessing directly the toolbar combox.
4269 * src/lyxfunc.C (Dispatch): ditto.
4271 * src/LyXView.C (setLayout): new method, which just calls
4272 Toolbar::setLayout().
4273 (updateLayoutChoice): move part of this method in Toolbar.
4275 * src/toolbar.[Ch]: removed.
4277 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4278 implementation the toolbar.
4280 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4281 the toolbar. It might make sense to merge it with ToolbarDefaults
4283 (setLayout): new function.
4284 (updateLayoutList): ditto.
4285 (openLayoutList): ditto.
4287 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4288 xforms implementation of the toolbar.
4289 (get_toolbar_func): comment out, since I do not
4290 know what it is good for.
4292 * src/ToolbarDefaults.h: Add the ItemType enum.
4294 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4295 for a list of allocated C strings. Used in Menubar xforms
4296 implementation to avoid memory leaks.
4298 * src/support/lstrings.[Ch] (uppercase): new version taking and
4302 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4303 * lib/bind/emacs.bind: ditto.
4305 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4307 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4308 forward decl of LyXView.
4310 * src/toolbar.C (toolbarItem): moved from toolbar.h
4311 (toolbarItem::clean): ditto
4312 (toolbarItem::~toolbarItem): ditto
4313 (toolbarItem::operator): ditto
4315 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4317 * src/paragraph.h: control the NEW_TABULAR define from here
4319 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4320 USE_TABULAR_INSETS to NEW_TABULAR
4322 * src/ToolbarDefaults.C: add include "lyxlex.h"
4324 * files using the old table/tabular: use NEW_TABULAR to control
4325 compilation of old tabular stuff.
4327 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4330 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4331 planemet in reading of old style floats, fix the \end_deeper
4332 problem when reading old style floats.
4334 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4336 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4338 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4340 * lib/bind/sciword.bind: updated.
4342 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4344 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4345 layout write problem
4347 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4349 * src/Makefile.am (INCLUDES): remove image directory from include
4352 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4353 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4355 * src/LyXView.C (create_form_form_main): read the application icon
4358 * lib/images/*.xpm: change the icons to use transparent color for
4361 * src/toolbar.C (update): change the color of the button when it
4364 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4366 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4367 setting explicitely the minibuffer.
4368 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4370 * src/LyXView.C (showState): new function. Shows font information
4371 in minibuffer and update toolbar state.
4372 (LyXView): call Toolbar::update after creating the
4375 * src/toolbar.C: change toollist to be a vector instead of a
4377 (BubbleTimerCB): get help string directly from the callback
4378 argument of the corresponding icon (which is the action)
4379 (set): remove unnecessary ugliness.
4380 (update): new function. update the icons (depressed, disabled)
4381 depending of the status of the corresponding action.
4383 * src/toolbar.h: remove help in toolbarItem
4385 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4387 * src/Painter.C (text): Added code for using symbol glyphs from
4388 iso10646 fonts. Currently diabled.
4390 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4393 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4394 magyar,turkish and usorbian.
4396 * src/paragraph.C (isMultiLingual): Made more efficient.
4398 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4401 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4402 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4403 Also changed the prototype to "bool math_insert_greek(char)".
4405 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4407 * lots of files: apply the NEW_INSETS on all code that will not be
4408 needed when we move to use the new insets. Enable the define in
4409 lyxparagrah.h to try it.
4411 * src/insets/insettabular.C (cellstart): change to be a static
4413 (InsetTabular): initialize buffer in the initializer list.
4415 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4417 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4418 form_print.h out of the header file. Replaced with forward
4419 declarations of the relevant struct.
4421 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4424 * src/commandtags.h: do not include "debug.h" which does not
4425 belong there. #include it in some other places because of this
4428 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4430 * src/insets/insetcaption.C: add a couple "using" directives.
4432 * src/toolbar.C (add): get the help text directly from lyxaction.
4434 (setPixmap): new function. Loads from disk and sets a pixmap on a
4435 botton; the name of the pixmap file is derived from the command
4438 * src/toolbar.h: remove members isBitmap and pixmap from
4441 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4442 * lib/images/: move many files from images/banner.xpm.
4444 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4446 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4447 * src/toolbar.C: ditto.
4448 * configure.in: ditto.
4449 * INSTALL: document.
4451 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4452 the spellchecker popup is closed from the WM.
4454 2000-07-19 Juergen Vigna <jug@sad.it>
4456 * src/insets/insetfloat.C (Write): small fix because we use the
4457 insetname for the type now!
4459 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4461 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4464 * src/frontends/Dialogs.h: removed hideCitation signal
4466 * src/insets/insetcite.h: added hide signal
4468 * src/insets/insetcite.C (~InsetCitation): emits new signal
4469 (getScreenLabel): "intelligent" label should now fit on the screen!
4471 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4473 * src/frontends/xforms/FormCitation.C (showInset): connects
4474 hide() to the inset's hide signal
4475 (show): modified to use fl_set_object_position rather than
4476 fl_set_object_geometry wherever possible
4478 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4480 * src/insets/lyxinset.h: add caption code
4482 * src/insets/insetfloat.C (type): new method
4484 * src/insets/insetcaption.C (Write): new method
4486 (LyxCode): new method
4488 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4489 to get it right together with using the FloatList.
4491 * src/commandtags.h: add LFUN_INSET_CAPTION
4492 * src/lyxfunc.C (Dispatch): handle it
4494 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4497 * src/Variables.[Ch]: make expand take a const reference, remove
4498 the destructor, some whitespace changes.
4500 * src/LyXAction.C (init): add caption-inset-insert
4502 * src/FloatList.C (FloatList): update the default floats a bit.
4504 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4506 * src/Variables.[Ch]: new files. Intended to be used for language
4507 specific strings (like \chaptername) and filename substitution in
4510 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4512 * lib/kbd/american.kmap: update
4514 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4516 * src/bufferparams.[Ch]: remove member allowAccents.
4518 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4520 * src/LaTeXLog.C: use the log_form.h header.
4521 * src/lyx_gui.C: ditto.
4522 * src/lyx_gui_misc.C: ditto.
4523 * src/lyxvc.h: ditto.
4525 * forms/log_form.fd: new file, created from latexoptions.fd. I
4526 kept the log popup and nuked the options form.
4528 * src/{la,}texoptions.[Ch]: removed.
4529 * src/lyx_cb.C (LaTeXOptions): ditto
4531 * src/lyx_gui.C (create_forms): do not handle the
4532 fd_latex_options form.
4534 2000-07-18 Juergen Vigna <jug@sad.it>
4536 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4537 name of the inset so that it can be requested outside (text2.C).
4539 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4542 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4544 * src/mathed/formula.h (ConvertFont): constify
4546 * src/mathed/formula.C (Read): add warning if \end_inset is not
4547 found on expected place.
4549 * src/insets/lyxinset.h (ConvertFont): consify
4551 * src/insets/insetquotes.C (ConvertFont): constify
4552 * src/insets/insetquotes.h: ditto
4554 * src/insets/insetinfo.h: add labelfont
4556 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4557 (ascent): use labelfont
4561 (Write): make .lyx file a bit nicer
4563 * src/insets/insetfloat.C (Write): simplify somewhat...
4564 (Read): add warning if arg is not found
4566 * src/insets/insetcollapsable.C: add using std::max
4567 (Read): move string token and add warning in arg is not found
4568 (draw): use std::max to get the right ty
4569 (getMaxWidth): simplify by using std::max
4571 * src/insets/insetsection.h: new file
4572 * src/insets/insetsection.C: new file
4573 * src/insets/insetcaption.h: new file
4574 * src/insets/insetcaption.C: new file
4576 * src/insets/inset.C (ConvertFont): constify signature
4578 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4579 insetcaption.[Ch] and insetsection.[Ch]
4581 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4582 uses to use LABEL_COUNTER_CHAPTER instead.
4583 * src/text2.C (SetCounter): here
4585 * src/counters.h: new file
4586 * src/counters.C: new file
4587 * src/Sectioning.h: new file
4588 * src/Sectioning.C: new file
4590 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4592 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4594 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4597 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4600 2000-07-17 Juergen Vigna <jug@sad.it>
4602 * src/tabular.C (Validate): check if array-package is needed.
4603 (SetVAlignment): added support for vertical alignment.
4604 (SetLTFoot): better support for longtable header/footers
4605 (Latex): modified to support added features.
4607 * src/LaTeXFeatures.[Ch]: added array-package.
4609 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4611 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4614 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4616 * configure.in: do not forget to put a space after -isystem.
4618 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4620 * lib/kbd/arabic.kmap: a few fixes.
4622 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4624 * some whitespace chagnes to a number of files.
4626 * src/support/DebugStream.h: change to make it easier for
4627 doc++ to parse correctly.
4628 * src/support/lyxstring.h: ditto
4630 * src/mathed/math_utils.C (compara): change to have only one
4632 (MathedLookupBOP): change because of the above.
4634 * src/mathed/math_delim.C (math_deco_compare): change to have only
4636 (search_deco): change becasue of the above.
4638 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4639 instead of manually coded one.
4641 * src/insets/insetquotes.C (Read): read the \end_inset too
4643 * src/insets/insetlatex.h: remove file
4644 * src/insets/insetlatex.C: remove file
4646 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4648 (InsetPrintIndex): remove destructor
4650 * src/insets/insetinclude.h: remove default constructor
4652 * src/insets/insetfloat.C: work to make it work better
4654 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4656 * src/insets/insetcite.h (InsetCitation): remove default constructor
4658 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4660 * src/text.C (GetColumnNearX): comment out some currently unused code.
4662 * src/paragraph.C (writeFile): move some initializations closer to
4664 (CutIntoMinibuffer): small change to use new matchIT operator
4668 (InsertInset): ditto
4671 (InsetIterator): ditto
4672 (Erase): small change to use new matchFT operator
4674 (GetFontSettings): ditto
4675 (HighestFontInRange): ditto
4678 * src/lyxparagraph.h: some chars changed to value_type
4679 (matchIT): because of some stronger checking (perhaps too strong)
4680 in SGI STL, the two operator() unified to one.
4683 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4685 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4686 the last inset read added
4687 (parseSingleLyXformat2Token): some more (future) compability code added
4688 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4689 (parseSingleLyXformat2Token): set last_inset_read
4690 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4691 (parseSingleLyXformat2Token): don't double intializw string next_token
4693 * src/TextCache.C (text_fits::operator()): add const's to the signature
4694 (has_buffer::operator()): ditto
4696 * src/Floating.h: add some comments on the class
4698 * src/FloatList.[Ch] (typeExist): new method
4701 * src/BackStack.h: added default constructor, wanted by Gcc.
4703 2000-07-14 Juergen Vigna <jug@sad.it>
4705 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4707 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4709 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4710 do a redraw when the window is resized!
4711 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4713 * src/insets/insettext.C (resizeLyXText): added function to correctly
4714 being able to resize the LyXWindow.
4716 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4718 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4720 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4721 crashes when closing dialog to a deleted inset.
4723 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4724 method! Now similar to other insets.
4726 2000-07-13 Juergen Vigna <jug@sad.it>
4728 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4730 * lib/examples/Literate.lyx: small patch!
4732 * src/insets/insetbib.C (Read): added this function because of wrong
4733 Write (without [begin|end]_inset).
4735 2000-07-11 Juergen Vigna <jug@sad.it>
4737 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4738 as the insertInset could not be good!
4740 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4741 the bool param should not be last.
4743 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4745 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4746 did submit that to Karl).
4748 * configure.in: use -isystem instead of -I for X headers. This
4749 fixes a problem on solaris with a recent gcc;
4750 put the front-end code after the X detection code;
4751 configure in sigc++ before lib/
4753 * src/lyx_main.C (commandLineHelp): remove -display from command
4756 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4758 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4759 Also put in Makefile rules for building the ``listerrors''
4760 program for parsing errors from literate programs written in LyX.
4762 * lib/build-listerrors: Added small shell script as part of compile
4763 process. This builds a working ``listerrors'' binary if noweb is
4764 installed and either 1) the VNC X server is installed on the machine,
4765 or 2) the user is compiling from within a GUI. The existence of a GUI
4766 is necessary to use the ``lyx --export'' feature for now. This
4767 hack can be removed once ``lyx --export'' no longer requires a GUI to
4770 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4772 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4773 now passed back correctly from gcc and placed "under" error
4774 buttons in a Literate LyX source.
4776 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4778 * src/text.C (GetColumnNearX): Better behavior when a RTL
4779 paragraph is ended by LTR text.
4781 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4784 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4786 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4787 true when clipboard is empty.
4789 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4791 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4792 row of the paragraph.
4793 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4794 to prevent calculation of bidi tables
4796 2000-07-07 Juergen Vigna <jug@sad.it>
4798 * src/screen.C (ToggleSelection): added y_offset and x_offset
4801 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4804 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4806 * src/insets/insettext.C: fixed Layout-Display!
4808 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4810 * configure.in: add check for strings.h header.
4812 * src/spellchecker.C: include <strings.h> in order to have a
4813 definition for bzero().
4815 2000-07-07 Juergen Vigna <jug@sad.it>
4817 * src/insets/insettext.C (draw): set the status of the bv->text to
4818 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4820 * src/screen.C (DrawOneRow):
4821 (DrawFromTo): redraw the actual row if something has changed in it
4824 * src/text.C (draw): call an update of the toplevel-inset if something
4825 has changed inside while drawing.
4827 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4829 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4831 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4832 processing inside class.
4834 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4835 processing inside class.
4837 * src/insets/insetindex.h new struct Holder, consistent with other
4840 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4841 citation dialog from main code and placed it in src/frontends/xforms.
4842 Dialog launched through signals instead of callbacks
4844 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4846 * lyx.man: update the options description.
4848 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4850 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4851 handle neg values, set min width to 590, add doc about -display
4853 2000-07-05 Juergen Vigna <jug@sad.it>
4855 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4856 calls to BufferView *.
4858 * src/insets/insettext.C (checkAndActivateInset): small fix non
4859 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4861 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4862 their \end_inset token!
4864 2000-07-04 edscott <edscott@imp.mx>
4866 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4867 lib/lyxrc.example: added option \wheel_jump
4869 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4871 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4872 remove support for -width,-height,-xpos and -ypos.
4874 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4876 * src/encoding.[Ch]: New files.
4878 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4879 (text): Call to the underline() method only when needed.
4881 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4883 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4884 encoding(s) for the document.
4886 * src/bufferparams.C (BufferParams): Changed default value of
4889 * src/language.C (newLang): Removed.
4890 (items[]): Added encoding information for all defined languages.
4892 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4893 encoding choice button.
4895 * src/lyxrc.h (font_norm_type): New member variable.
4896 (set_font_norm_type): New method.
4898 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4899 paragraphs with different encodings.
4901 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4902 (TransformChar): Changed to work correctly with Arabic points.
4903 (draw): Added support for drawing Arabic points.
4904 (draw): Removed code for drawing underbars (this is done by
4907 * src/support/textutils.h (IsPrintableNonspace): New function.
4909 * src/BufferView_pimpl.h: Added "using SigC::Object".
4910 * src/LyXView.h: ditto.
4912 * src/insets/insetinclude.h (include_label): Changed to mutable.
4914 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4916 * src/mathed/math_iter.h: remove empty destructor
4918 * src/mathed/math_cursor.h: remove empty destructor
4920 * src/insets/lyxinset.h: add THEOREM_CODE
4922 * src/insets/insettheorem.[Ch]: new files
4924 * src/insets/insetminipage.C: (InsertInset): remove
4926 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4928 (InsertInset): remove
4930 * src/insets/insetlist.C: (InsertList): remove
4932 * src/insets/insetfootlike.[Ch]: new files
4934 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4937 (InsertInset): ditto
4939 * src/insets/insetert.C: remove include Painter.h, reindent
4940 (InsertInset): move to header
4942 * src/insets/insetcollapsable.h: remove explicit from default
4943 contructor, remove empty destructor, add InsertInset
4945 * src/insets/insetcollapsable.C (InsertInset): new func
4947 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4949 * src/vspace.h: add explicit to constructor
4951 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4952 \textcompwordmark, please test this.
4954 * src/lyxrc.C: set ascii_linelen to 65 by default
4956 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4958 * src/commandtags.h: add LFUN_INSET_THEOREM
4960 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4961 (makeLinuxDocFile): remove _some_ of the nice logic
4962 (makeDocBookFile): ditto
4964 * src/Painter.[Ch]: (~Painter): removed
4966 * src/LyXAction.C (init): entry for insettheorem added
4968 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4970 (deplog): code to detect files generated by LaTeX, needs testing
4973 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4975 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4977 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4979 * src/LaTeX.C (deplog): Add a check for files that are going to be
4980 created by the first latex run, part of the project to remove the
4983 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4984 contents to the extension list.
4986 2000-07-04 Juergen Vigna <jug@sad.it>
4988 * src/text.C (NextBreakPoint): added support for needFullRow()
4990 * src/insets/lyxinset.h: added needFullRow()
4992 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4995 * src/insets/insettext.C: lots of changes for update!
4997 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4999 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5001 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5003 * src/insets/insetinclude.C (InsetInclude): fixed
5004 initialization of include_label.
5005 (unique_id): now returns a string.
5007 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5009 * src/LaTeXFeatures.h: new member IncludedFiles, for
5010 a map of key, included file name.
5012 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5013 with the included files for inclusion in SGML preamble,
5014 i. e., linuxdoc and docbook.
5017 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5018 nice (is the generated linuxdoc code to be exported?), that
5019 allows to remove column, and only_body that will be true for
5020 slave documents. Insets are allowed inside SGML font type.
5021 New handling of the SGML preamble for included files.
5022 (makeDocBookFile): the same for docbook.
5024 * src/insets/insetinclude.h:
5025 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5027 (DocBook): new export methods.
5029 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5030 and makeDocBookFile.
5032 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5033 formats to export with command line argument -x.
5035 2000-06-29 Juergen Vigna <jug@sad.it>
5037 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5038 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5040 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5041 region could already been cleared by an inset!
5043 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5045 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5048 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5050 (cursorToggle): remove special handling of lyx focus.
5052 2000-06-28 Juergen Vigna <jug@sad.it>
5054 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5057 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5059 * src/insets/insetindex.C (Edit): add a callback when popup is
5062 * src/insets/insettext.C (LocalDispatch):
5063 * src/insets/insetmarginal.h:
5064 * src/insets/insetlist.h:
5065 * src/insets/insetfoot.h:
5066 * src/insets/insetfloat.h:
5067 * src/insets/insetert.h: add a missing std:: qualifier.
5069 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5071 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5074 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5076 * src/insets/insettext.C (Read): remove tmptok unused variable
5077 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5078 (InsertInset): change for new InsetInset code
5080 * src/insets/insettext.h: add TEXT inline method
5082 * src/insets/insettext.C: remove TEXT macro
5084 * src/insets/insetmarginal.C (Write): new method
5085 (Latex): change output slightly
5087 * src/insets/insetfoot.C (Write): new method
5088 (Latex): change output slightly (don't use endl when no need)
5090 * src/insets/insetert.C (Write): new method
5092 * src/insets/insetcollapsable.h: make button_length, button_top_y
5093 and button_bottm_y protected.
5095 * src/insets/insetcollapsable.C (Write): simplify code by using
5096 tostr. Also do not output the float name, the children class
5097 should to that to get control over own arguments
5099 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5100 src/insets/insetminipage.[Ch]:
5103 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5105 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5107 * src/Makefile.am (lyx_SOURCES): add the new files
5109 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5110 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5111 * src/commandtags.h: ditto
5113 * src/LaTeXFeatures.h: add a std::set of used floattypes
5115 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5117 * src/FloatList.[Ch] src/Floating.h: new files
5119 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5121 * src/lyx_cb.C (TableApplyCB): ditto
5123 * src/text2.C: ditto
5124 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5125 (parseSingleLyXformat2Token): ditto + add code for
5126 backwards compability for old float styles + add code for new insets
5128 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5130 (InsertInset(size_type, Inset *, LyXFont)): new method
5131 (InsetChar(size_type, char)): changed to use the other InsetChar
5132 with a LyXFont(ALL_INHERIT).
5133 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5134 insert the META_INSET.
5136 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5138 * sigc++/thread.h (Threads): from here
5140 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5141 definition out of line
5142 * sigc++/scope.h: from here
5144 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5146 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5147 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5149 * Makefile.am (bindist): new target.
5151 * INSTALL: add instructions for doing a binary distribution.
5153 * development/tools/README.bin.example: update a bit.
5155 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5158 * lib/lyxrc.example: new lyxrc tag \set_color.
5160 * src/lyxfunc.C (Dispatch):
5161 * src/commandtags.h:
5162 * src/LyXAction.C: new lyxfunc "set-color".
5164 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5165 and an x11name given as strings.
5167 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5168 cache when a color is changed.
5170 2000-06-26 Juergen Vigna <jug@sad.it>
5172 * src/lyxrow.C (width): added this functions and variable.
5174 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5177 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5179 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5181 * images/undo_bw.xpm: new icon.
5182 * images/redo_bw.xpm: ditto.
5184 * configure.in (INSTALL_SCRIPT): change value to
5185 ${INSTALL} to avoid failures of install-script target.
5186 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5188 * src/BufferView.h: add a magic "friend" declaration to please
5191 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5193 * forms/cite.fd: modified to allow resizing without messing
5196 * src/insetcite.C: Uses code from cite.fd almost without
5198 User can now resize dialog in the x-direction.
5199 Resizing the dialog in the y-direction is prevented, as the
5200 code does this intelligently already.
5202 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5204 * INSTALL: remove obsolete entry in "problems" section.
5206 * lib/examples/sl_*.lyx: update of the slovenian examples.
5208 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5210 2000-06-23 Juergen Vigna <jug@sad.it>
5212 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5214 * src/buffer.C (resize): delete the LyXText of textinsets.
5216 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5218 * src/insets/lyxinset.h: added another parameter 'cleared' to
5219 the draw() function.
5221 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5222 unlocking inset in inset.
5224 2000-06-22 Juergen Vigna <jug@sad.it>
5226 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5227 of insets and moved first to LyXText.
5229 * src/mathed/formulamacro.[Ch]:
5230 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5232 2000-06-21 Juergen Vigna <jug@sad.it>
5234 * src/text.C (GetVisibleRow): look if I should clear the area or not
5235 using Inset::doClearArea() function.
5237 * src/insets/lyxinset.h: added doClearArea() function and
5238 modified draw(Painter &, ...) to draw(BufferView *, ...)
5240 * src/text2.C (UpdateInset): return bool insted of int
5242 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5244 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5245 combox in the character popup
5247 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5248 BufferParams const & params
5250 2000-06-20 Juergen Vigna <jug@sad.it>
5252 * src/insets/insettext.C (SetParagraphData): set insetowner on
5255 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5257 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5258 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5260 (form_main_): remove
5262 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5263 (create_form_form_main): remove FD_form_main stuff, connect to
5264 autosave_timeout signal
5266 * src/LyXView.[Ch] (getMainForm): remove
5267 (UpdateTimerCB): remove
5268 * src/BufferView_pimpl.h: inherit from SigC::Object
5270 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5271 signal instead of callback
5273 * src/BufferView.[Ch] (cursorToggleCB): remove
5275 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5277 * src/BufferView_pimpl.C: changes because of the one below
5279 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5280 instead of storing a pointer to a LyXText.
5282 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5284 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5286 * src/lyxparagraph.h
5288 * src/paragraph.C: Changed fontlist to a sorted vector.
5290 2000-06-19 Juergen Vigna <jug@sad.it>
5292 * src/BufferView.h: added screen() function.
5294 * src/insets/insettext.C (LocalDispatch): some selection code
5297 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5299 * src/insets/insettext.C (SetParagraphData):
5301 (InsetText): fixes for multiple paragraphs.
5303 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5305 * development/lyx.spec.in: Call configure with ``--without-warnings''
5306 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5307 This should be fine, however, since we generally don't want to be
5308 verbose when making an RPM.
5310 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5312 * lib/scripts/fig2pstex.py: New file
5314 2000-06-16 Juergen Vigna <jug@sad.it>
5316 * src/insets/insettabular.C (UpdateLocal):
5317 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5318 (LocalDispatch): Changed all functions to use LyXText.
5320 2000-06-15 Juergen Vigna <jug@sad.it>
5322 * src/text.C (SetHeightOfRow): call inset::update before requesting
5325 * src/insets/insettext.C (update):
5326 * src/insets/insettabular.C (update): added implementation
5328 * src/insets/lyxinset.h: added update function
5330 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5332 * src/text.C (SelectNextWord): protect against null pointers with
5333 old-style string streams. (fix from Paul Theo Gonciari
5336 * src/cite.[Ch]: remove erroneous files.
5338 * lib/configure.m4: update the list of created directories.
5340 * src/lyxrow.C: include <config.h>
5341 * src/lyxcursor.C: ditto.
5343 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5345 * lib/examples/decimal.lyx: new example file from Mike.
5347 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5348 to find template definitions (from Dekel)
5350 * src/frontends/.cvsignore: add a few things.
5352 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5354 * src/Timeout.C (TimeOut): remove default argument.
5356 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5359 * src/insets/ExternalTemplate.C: add a "using" directive.
5361 * src/lyx_main.h: remove the act_ struct, which seems unused
5364 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5366 * LyX Developers Meeting: All files changed, due to random C++ (by
5367 coincidence) code generator script.
5369 - external inset (cool!)
5370 - initial online editing of preferences
5371 - insettabular breaks insettext(s contents)
5373 - some DocBook fixes
5374 - example files update
5375 - other cool stuff, create a diff and look for yourself.
5377 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5379 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5380 -1 this is a non-line-breaking textinset.
5382 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5383 if there is no width set.
5385 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5387 * Lots of files: Merged the dialogbase branch.
5389 2000-06-09 Allan Rae <rae@lyx.org>
5391 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5392 and the Dispatch methods that used it.
5394 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5395 access to functions formerly kept in Dispatch.
5397 2000-05-19 Allan Rae <rae@lyx.org>
5399 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5400 made to_page and count_copies integers again. from_page remains a
5401 string however because I want to allow entry of a print range like
5402 "1,4,22-25" using this field.
5404 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5405 and printer-params-get. These aren't useful from the minibuffer but
5406 could be used by a script/LyXServer app provided it passes a suitable
5407 auto_mem_buffer. I guess I should take a look at how the LyXServer
5408 works and make it support xtl buffers.
5410 * sigc++/: updated to libsigc++-1.0.1
5412 * src/xtl/: updated to xtl-1.3.pl.11
5414 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5415 those changes done to the files in src/ are actually recreated when
5416 they get regenerated. Please don't ever accept a patch that changes a
5417 dialog unless that patch includes the changes to the corresponding *.fd
5420 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5421 stringOnlyContains, renamed it and generalised it.
5423 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5424 branch. Removed the remaining old form_print code.
5426 2000-04-26 Allan Rae <rae@lyx.org>
5428 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5429 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5431 2000-04-25 Allan Rae <rae@lyx.org>
5433 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5434 against a base of xtl-1.3.pl.4
5436 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5437 filter the Id: entries so they still show the xtl version number
5440 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5441 into the src/xtl code. Patch still pending with José (XTL)
5443 2000-04-24 Allan Rae <rae@lyx.org>
5445 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5446 both more generic and much safer. Use the new template functions.
5447 * src/buffer.[Ch] (Dispatch): ditto.
5449 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5450 and mem buffer more intelligently. Also a little general cleanup.
5453 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5454 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5455 * src/xtl/Makefile.am: ditto.
5456 * src/xtl/.cvsignore: ditto.
5457 * src/Makefile.am: ditto.
5459 * src/PrinterParams.h: Removed the macros member functions. Added a
5460 testInvariant member function. A bit of tidying up and commenting.
5461 Included Angus's idea for fixing operation with egcs-1.1.2.
5463 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5464 cool expansion of XTL's mem_buffer to support automatic memory
5465 management within the buffer itself. Removed the various macros and
5466 replaced them with template functions that use either auto_mem_buffer
5467 or mem_buffer depending on a #define. The mem_buffer support will
5468 disappear as soon as the auto_mem_buffer is confirmed to be good on
5469 other platforms/compilers. That is, it's there so you've got something
5472 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5473 effectively forked XTL. However I expect José will include my code
5474 into the next major release. Also fixed a memory leak.
5475 * src/xtl/text.h: ditto.
5476 * src/xtl/xdr.h: ditto.
5477 * src/xtl/giop.h: ditto.
5479 2000-04-16 Allan Rae <rae@lyx.org>
5481 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5482 by autogen.sh and removed by maintainer-clean anyway.
5483 * .cvsignore, sigc++/.cvsignore: Support the above.
5485 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5487 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5489 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5490 macros, renamed static callback-target member functions to suit new
5491 scheme and made them public.
5492 * src/frontends/xforms/forms/form_print.fd: ditto.
5493 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5495 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5498 * src/xtl/: New directory containing a minimal distribution of XTL.
5499 This is XTL-1.3.pl.4.
5501 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5503 2000-04-15 Allan Rae <rae@lyx.org>
5505 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5507 * sigc++/: Updated to libsigc++-1.0.0
5509 2000-04-14 Allan Rae <rae@lyx.org>
5511 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5512 use the generic ones in future. I'll modify my conversion script.
5514 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5516 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5517 (CloseAllBufferRelatedDialogs): Renamed.
5518 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5520 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5521 of the generic ones. These are the same ones my conversion script
5524 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5525 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5526 * src/buffer.C (Dispatch): ditto
5528 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5529 functions for updating and hiding buffer dependent dialogs.
5530 * src/BufferView.C (buffer): ditto
5531 * src/buffer.C (setReadonly): ditto
5532 * src/lyxfunc.C (CloseBuffer): ditto
5534 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5535 Dialogs.h, and hence all the SigC stuff, into every file that includes
5536 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5538 * src/BufferView2.C: reduce the number of headers included by buffer.h
5540 2000-04-11 Allan Rae <rae@lyx.org>
5542 * src/frontends/xforms/xform_macros.h: A small collection of macros
5543 for building C callbacks.
5545 * src/frontends/xforms/Makefile.am: Added above file.
5547 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5548 scheme again. This time it should work for JMarc. If this is
5549 successful I'll revise my conversion script to automate some of this.
5550 The static member functions in the class also have to be public for
5551 this scheme will work. If the scheme works (it's almost identical to
5552 the way BufferView::cursorToggleCB is handled so it should work) then
5553 FormCopyright and FormPrint will be ready for inclusion into the main
5554 trunk immediately after 1.1.5 is released -- provided we're prepared
5555 for complaints about lame compilers not handling XTL.
5557 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5559 2000-04-07 Allan Rae <rae@lyx.org>
5561 * config/lyxinclude.m4: A bit more tidying up (Angus)
5563 * src/LString.h: JMarc's <string> header fix
5565 * src/PrinterParams.h: Used string for most data to remove some
5566 ugly code in the Print dialog and avoid even uglier code when
5567 appending the ints to a string for output.
5569 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5570 and moved "default:" back to the end of switch statement. Cleaned
5571 up the printing so it uses the right function calls and so the
5572 "print to file" option actually puts the file in the right directory.
5574 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5576 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5577 and Ok+Apply button control into a separate method: input (Angus).
5578 (input) Cleaned it up and improved it to be very thorough now.
5579 (All CB) static_cast used instead of C style cast (Angus). This will
5580 probably change again once we've worked out how to keep gcc-2.8.1 happy
5581 with real C callbacks.
5582 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5583 ignore some of the bool settings and has random numbers instead. Needs
5584 some more investigation. Added other input length checks and checking
5585 of file and printer names.
5587 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5588 would link (Angus). Seems the old code doesn't compile with the pragma
5589 statement either. Separated callback entries from internal methods.
5591 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5593 2000-03-17 Allan Rae <rae@lyx.org>
5595 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5596 need it? Maybe it could go in Dialogs instead? I could make it a
5597 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5598 values to get the bool return value.
5599 (Dispatch): New overloaded method for xtl support.
5601 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5602 extern "C" callback instead of static member functions. Hopefully,
5603 JMarc will be able to compile this. I haven't changed
5604 forms/form_copyright.fd yet. Breaking one of my own rules already.
5606 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5607 because they aren't useful from the minibuffer. Maybe a LyXServer
5608 might want a help message though?
5610 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5612 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5613 xtl which needs both rtti and exceptions.
5615 * src/support/Makefile.am:
5616 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5618 * src/frontends/xforms/input_validators.[ch]: input filters and
5619 validators. These conrol what keys are valid in input boxes.
5620 Use them and write some more. Much better idea than waiting till
5621 after the user has pressed Ok to say that the input fields don't make
5624 * src/frontends/xforms/Makefile.am:
5625 * src/frontends/xforms/forms/form_print.fd:
5626 * src/frontends/xforms/forms/makefile:
5627 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5628 new scheme. Still have to make sure I haven't missed anything from
5629 the current implementation.
5631 * src/Makefile.am, src/PrinterParams.h: New data store.
5633 * other files: Added a couple of copyright notices.
5635 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5637 * src/insets/insetbib.h: move Holder struct in public space.
5639 * src/frontends/include/DialogBase.h: use SigC:: only when
5640 SIGC_CXX_NAMESPACES is defined.
5641 * src/frontends/include/Dialogs.h: ditto.
5643 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5645 * src/frontends/xforms/FormCopyright.[Ch]: do not
5646 mention SigC:: explicitely.
5648 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5650 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5651 deals with testing KDE in main configure.in
5652 * configure.in: ditto.
5654 2000-02-22 Allan Rae <rae@lyx.org>
5656 * Lots of files: Merged from HEAD
5658 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5659 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5661 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5663 * sigc++/: new minidist.
5665 2000-02-14 Allan Rae <rae@lyx.org>
5667 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5669 2000-02-08 Juergen Vigna <jug@sad.it>
5671 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5672 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5674 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5675 for this port and so it is much easier for other people to port
5676 dialogs in a common development environment.
5678 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5679 the QT/KDE implementation.
5681 * src/frontends/kde/Dialogs.C:
5682 * src/frontends/kde/FormCopyright.C:
5683 * src/frontends/kde/FormCopyright.h:
5684 * src/frontends/kde/Makefile.am:
5685 * src/frontends/kde/formcopyrightdialog.C:
5686 * src/frontends/kde/formcopyrightdialog.h:
5687 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5688 for the kde support of the Copyright-Dialog.
5690 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5691 subdir-substitution instead of hardcoded 'xforms' as we now have also
5694 * src/frontends/include/DialogBase.h (Object): just commented the
5695 label after #endif (nasty warning and I don't like warnings ;)
5697 * src/main.C (main): added KApplication initialization if using
5700 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5701 For now only the KDE event-loop is added if frontend==kde.
5703 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5705 * configure.in: added support for the --with-frontend[=value] option
5707 * autogen.sh: added kde.m4 file to list of config-files
5709 * acconfig.h: added define for KDEGUI-support
5711 * config/kde.m4: added configuration functions for KDE-port
5713 * config/lyxinclude.m4: added --with-frontend[=value] option with
5714 support for xforms and KDE.
5716 2000-02-08 Allan Rae <rae@lyx.org>
5718 * all Makefile.am: Fixed up so the make targets dist, distclean,
5719 install and uninstall all work even if builddir != srcdir. Still
5720 have a new sigc++ minidist update to come.
5722 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5724 2000-02-01 Allan Rae <rae@lyx.org>
5726 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5727 Many mods to get builddir != srcdir working.
5729 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5730 for building on NT and so we can do the builddir != srcdir stuff.
5732 2000-01-30 Allan Rae <rae@lyx.org>
5734 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5735 This will stay in "rae" branch. We probably don't really need it in
5736 the main trunk as anyone who wants to help programming it should get
5737 a full library installed also. So they can check both included and
5738 system supplied library compilation.
5740 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5741 Added a 'mini' distribution of libsigc++. If you feel the urge to
5742 change something in these directories - Resist it. If you can't
5743 resist the urge then you should modify the following script and rebuild
5744 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5745 all happen. Still uses a hacked version of libsigc++'s configure.in.
5746 I'm quite happy with the results. I'm not sure the extra work to turn
5747 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5748 worth the trouble and would probably lead to extra maintenance
5750 I haven't tested the following important make targets: install, dist.
5751 Not ready for prime time but very close. Maybe 1.1.5.
5753 * development/tools/makeLyXsigc.sh: A shell script to automatically
5754 generate our mini-dist of libsigc++. It can only be used with a CVS
5755 checkout of libsigc++ not a tarball distribution. It's well commented.
5756 This will end up as part of the libsigc++ distribution so other apps
5757 can easily have an included mini-dist. If someone makes mods to the
5758 sigc++ subpackage without modifying this script to generate those
5759 changes I'll be very upset!
5761 * src/frontends/: Started the gui/system indep structure.
5763 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5764 to access the gui-indep dialogs are in this class. Much improved
5765 design compared to previous revision. Lars, please refrain from
5766 moving this header into src/ like you did with Popups.h last time.
5768 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5770 * src/frontends/xforms/: Started the gui-indep system with a single
5771 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5774 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5775 Here you'll find a very useful makefile and automated fdfix.sh that
5776 makes updating dailogs a no-brainer -- provided you follow the rules
5777 set out in the README. I'm thinking about adding another script to
5778 automatically generate skeleton code for a new dialog given just the
5781 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5782 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5783 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5785 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5787 * src/support/LSubstring.C (operator): simplify
5789 * src/lyxtext.h: removed bparams, use buffer_->params instead
5791 * src/lyxrow.h: make Row a real class, move all variables to
5792 private and use accessors.
5794 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5796 (isRightToLeftPar): ditto
5797 (ChangeLanguage): ditto
5798 (isMultiLingual): ditto
5801 (SimpleTeXOnePar): ditto
5802 (TeXEnvironment): ditto
5803 (GetEndLabel): ditto
5805 (SetOnlyLayout): ditto
5806 (BreakParagraph): ditto
5807 (BreakParagraphConservative): ditto
5808 (GetFontSettings): ditto
5810 (CopyIntoMinibuffer): ditto
5811 (CutIntoMinibuffer): ditto
5812 (PasteParagraph): ditto
5813 (SetPExtraType): ditto
5814 (UnsetPExtraType): ditto
5815 (DocBookContTableRows): ditto
5816 (SimpleDocBookOneTablePar): ditto
5818 (TeXFootnote): ditto
5819 (SimpleTeXOneTablePar): ditto
5820 (TeXContTableRows): ditto
5821 (SimpleTeXSpecialChars): ditto
5824 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5825 to private and use accessors.
5827 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5828 this, we did not use it anymore and has not been for ages. Just a
5829 waste of cpu cycles.
5831 * src/language.h: make Language a real class, move all variables
5832 to private and use accessors.
5834 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5835 (create_view): remove
5836 (update): some changes for new timer
5837 (cursorToggle): use new timer
5838 (beforeChange): change for new timer
5840 * src/BufferView.h (cursorToggleCB): removed last paramter because
5843 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5844 (cursorToggleCB): change because of new timer code
5846 * lib/CREDITS: updated own mailaddress
5848 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5850 * src/support/filetools.C (PutEnv): fix the code in case neither
5851 putenv() nor setenv() have been found.
5853 * INSTALL: mention the install-strip Makefile target.
5855 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5856 read-only documents.
5858 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5860 * lib/reLyX/configure.in (VERSION): avoid using a previously
5861 generated reLyX wrapper to find out $prefix.
5863 * lib/examples/eu_adibide_lyx-atua.lyx:
5864 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5865 translation of the Tutorial (Dooteo)
5867 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5869 * forms/cite.fd: new citation dialog
5871 * src/insetcite.[Ch]: the new citation dialog is moved into
5874 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5877 * src/insets/insetcommand.h: data members made private.
5879 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5881 * LyX 1.1.5 released
5883 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5885 * src/version.h (LYX_RELEASE): to 1.1.5
5887 * src/spellchecker.C (RunSpellChecker): return false if the
5888 spellchecker dies upon creation.
5890 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5892 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5893 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5897 * lib/CREDITS: update entry for Martin Vermeer.
5899 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5901 * src/text.C (draw): Draw foreign language bars at the bottom of
5902 the row instead of at the baseline.
5904 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5906 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5908 * lib/bind/de_menus.bind: updated
5910 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5912 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5914 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5916 * src/menus.C (Limit_string_length): New function
5917 (ShowTocMenu): Limit the number of items/length of items in the
5920 * src/paragraph.C (String): Correct result for a paragraph inside
5923 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5925 * src/bufferlist.C (close): test of buf->getuser() == NULL
5927 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5929 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5930 Do not call to SetCursor when the paragraph is a closed footnote!
5932 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5934 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5937 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5939 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5942 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5943 reference popup, that activates the reference-back action
5945 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5947 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5948 the menus. Also fixed a bug.
5950 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5951 the math panels when switching buffers (unless new buffer is readonly).
5953 * src/BufferView.C (NoSavedPositions)
5954 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5956 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5958 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5959 less of dvi dirty or not.
5961 * src/trans_mgr.[Ch] (insert): change first parameter to string
5964 * src/chset.[Ch] (encodeString): add const to first parameter
5966 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5968 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5972 * src/LaTeX.C (deplog): better searching for dependency files in
5973 the latex log. Uses now regexps.
5975 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5976 instead of the box hack or \hfill.
5978 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5980 * src/lyxfunc.C (doImportHelper): do not create the file before
5981 doing the actual import.
5982 (doImportASCIIasLines): create a new file before doing the insert.
5983 (doImportASCIIasParagraphs): ditto.
5985 * lib/lyxrc.example: remove mention of non-existing commands
5987 * lyx.man: remove mention of color-related switches.
5989 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5991 * src/lyx_gui.C: remove all the color-related ressources, which
5992 are not used anymore.
5994 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5997 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5999 * src/lyxrc.C (read): Add a missing break in the switch
6001 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6003 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6005 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6008 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6010 * src/text.C (draw): draw bars under foreign language words.
6012 * src/LColor.[Ch]: add LColor::language
6014 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6016 * src/lyxcursor.h (boundary): New member variable
6018 * src/text.C (IsBoundary): New methods
6020 * src/text.C: Use the above for currect cursor movement when there
6021 is both RTL & LTR text.
6023 * src/text2.C: ditto
6025 * src/bufferview_funcs.C (ToggleAndShow): ditto
6027 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6029 * src/text.C (DeleteLineForward): set selection to true to avoid
6030 that DeleteEmptyParagraphMechanism does some magic. This is how it
6031 is done in all other functions, and seems reasonable.
6032 (DeleteWordForward): do not jump over non-word stuff, since
6033 CursorRightOneWord() already does it.
6035 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6036 DeleteWordBackward, since they seem safe to me (since selection is
6037 set to "true") DeleteEmptyParagraphMechanism does nothing.
6039 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6041 * src/lyx_main.C (easyParse): simplify the code by factoring the
6042 part that removes parameters from the command line.
6043 (LyX): check wether wrong command line options have been given.
6045 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6047 * src/lyx_main.C : add support for specifying user LyX
6048 directory via command line option -userdir.
6050 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6052 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6053 the number of items per popup.
6054 (Add_to_refs_menu): Ditto.
6056 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6058 * src/lyxparagraph.h: renamed ClearParagraph() to
6059 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6060 textclass as parameter, and do nothing if free_spacing is
6061 true. This fixes part of the line-delete-forward problems.
6063 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6064 (pasteSelection): ditto.
6065 (SwitchLayoutsBetweenClasses): more translatable strings.
6067 * src/text2.C (CutSelection): use StripLeadingSpaces.
6068 (PasteSelection): ditto.
6069 (DeleteEmptyParagraphMechanism): ditto.
6071 2000-05-26 Juergen Vigna <jug@sad.it>
6073 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6074 is not needed in tabular insets.
6076 * src/insets/insettabular.C (TabularFeatures): added missing features.
6078 * src/tabular.C (DeleteColumn):
6080 (AppendRow): implemented this functions
6081 (cellsturct::operator=): clone the inset too;
6083 2000-05-23 Juergen Vigna <jug@sad.it>
6085 * src/insets/insettabular.C (LocalDispatch): better selection support
6086 when having multicolumn-cells.
6088 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6090 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6092 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6094 * src/ColorHandler.C (getGCForeground): put more test into _()
6096 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6099 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6102 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6104 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6105 there are no labels, or when buffer is readonly.
6107 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6108 there are no labels, buffer is SGML, or when buffer is readonly.
6110 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6112 * src/LColor.C (LColor): change a couple of grey40 to grey60
6113 (LColor): rewore initalization to make compiles go some magnitude
6115 (getGUIName): don't use gettext until we need the string.
6117 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6119 * src/Bullet.[Ch]: Fixed a small bug.
6121 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6123 * src/paragraph.C (String): Several fixes/improvements
6125 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6127 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6129 * src/paragraph.C (String): give more correct output.
6131 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6133 * src/lyxfont.C (stateText) Do not output the language if it is
6134 eqaul to the language of the document.
6136 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6137 between two paragraphs with the same language.
6139 * src/paragraph.C (getParLanguage) Return a correct answer for an
6140 empty dummy paragraph.
6142 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6145 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6148 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6149 the menus/popup, if requested fonts are unavailable.
6151 2000-05-22 Juergen Vigna <jug@sad.it>
6153 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6154 movement support (Up/Down/Tab/Shift-Tab).
6155 (LocalDispatch): added also preliminari cursor-selection.
6157 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6159 * src/paragraph.C (PasteParagraph): Hopefully now right!
6161 2000-05-22 Garst R. Reese <reese@isn.net>
6163 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6164 of list, change all references to Environment to Command
6165 * tex/hollywood.cls : rewrite environments as commands, add
6166 \uppercase to interiorshot and exteriorshot to force uppecase.
6167 * tex/broadway.cls : rewrite environments as commands. Tweak
6170 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6172 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6173 size of items: use a constant intead of the hardcoded 40, and more
6174 importantly do not remove the %m and %x tags added at the end.
6175 (Add_to_refs_menu): use vector::size_type instead of
6176 unsigned int as basic types for the variables. _Please_ do not
6177 assume that size_t is equal to unsigned int. On an alpha, this is
6178 unsigned long, which is _not_ the same.
6180 * src/language.C (initL): remove language "hungarian", since it
6181 seems that "magyar" is better.
6183 2000-05-22 Juergen Vigna <jug@sad.it>
6185 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6187 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6190 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6191 next was deleted but not set to 0.
6193 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6195 * src/language.C (initL): change the initialization of languages
6196 so that compiles goes _fast_.
6198 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6201 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6203 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6207 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6209 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6211 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6215 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6218 * src/insets/insetlo*.[Ch]: Made editable
6220 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6222 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6223 the current selection.
6225 * src/BufferView_pimpl.C (stuffClipboard): new method
6227 * src/BufferView.C (stuffClipboard): new method
6229 * src/paragraph.C (String): new method
6231 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6232 LColor::ignore when lyxname is not found.
6234 * src/BufferView.C (pasteSelection): new method
6236 * src/BufferView_pimpl.C (pasteSelection): new method
6238 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6240 * src/WorkArea.C (request_clipboard_cb): new static function
6241 (getClipboard): new method
6242 (putClipboard): new method
6244 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6246 * LyX 1.1.5pre2 released
6248 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6250 * src/vspace.C (operator=): removed
6251 (operator=): removed
6253 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6255 * src/layout.C (NumberOfClass): manually set the type in make_pair
6256 (NumberOfLayout): ditto
6258 * src/language.C: use the Language constructor for ignore_lang
6260 * src/language.h: add constructors to struct Language
6262 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6264 * src/text2.C (SetCursorIntern): comment out #warning
6266 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6268 * src/mathed/math_iter.h: initialize sx and sw to 0
6270 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6272 * forms/lyx.fd: Redesign of form_ref
6274 * src/LaTeXFeatures.[Ch]
6278 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6281 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6282 and Buffer::inset_iterator.
6284 * src/menus.C: Added new menus: TOC and Refs.
6286 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6288 * src/buffer.C (getTocList): New method.
6290 * src/BufferView2.C (ChangeRefs): New method.
6292 * src/buffer.C (getLabelList): New method. It replaces the old
6293 getReferenceList. The return type is vector<string> instead of
6296 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6297 the old getLabel() and GetNumberOfLabels() methods.
6298 * src/insets/insetlabel.C (getLabelList): ditto
6299 * src/mathed/formula.C (getLabelList): ditto
6301 * src/paragraph.C (String): New method.
6303 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6304 Uses the new getTocList() method.
6305 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6306 which automatically updates the contents of the browser.
6307 (RefUpdateCB): Use the new getLabelList method.
6309 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6311 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6313 * src/spellchecker.C: Added using std::reverse;
6315 2000-05-19 Juergen Vigna <jug@sad.it>
6317 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6319 * src/insets/insettext.C (computeTextRows): small fix for display of
6320 1 character after a newline.
6322 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6325 2000-05-18 Juergen Vigna <jug@sad.it>
6327 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6328 when changing width of column.
6330 * src/tabular.C (set_row_column_number_info): setting of
6331 autobreak rows if necessary.
6333 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6335 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6337 * src/vc-backend.*: renamed stat() to status() and vcstat to
6338 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6339 compilation broke. The new name seems more relevant, anyway.
6341 2000-05-17 Juergen Vigna <jug@sad.it>
6343 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6344 which was wrong if the removing caused removing of rows!
6346 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6347 (pushToken): new function.
6349 * src/text2.C (CutSelection): fix problem discovered with purify
6351 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6353 * src/debug.C (showTags): enlarge the first column, now that we
6354 have 6-digits debug codes.
6356 * lib/layouts/hollywood.layout:
6357 * lib/tex/hollywood.cls:
6358 * lib/tex/brodway.cls:
6359 * lib/layouts/brodway.layout: more commands and fewer
6360 environments. Preambles moved in the .cls files. Broadway now has
6361 more options on scene numbering and less whitespace (from Garst)
6363 * src/insets/insetbib.C (getKeys): make sure that we are in the
6364 document directory, in case the bib file is there.
6366 * src/insets/insetbib.C (Latex): revert bogus change.
6368 2000-05-16 Juergen Vigna <jug@sad.it>
6370 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6371 the TabularLayout on cursor move.
6373 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6375 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6378 (draw): fixed cursor position and drawing so that the cursor is
6379 visible when before the tabular-inset.
6381 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6382 when creating from old insettext.
6384 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6386 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6388 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6389 * lib/tex/brodway.cls: ditto
6391 * lib/layouts/brodway.layout: change alignment of parenthical
6394 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6396 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6397 versions 0.88 and 0.89 are supported.
6399 2000-05-15 Juergen Vigna <jug@sad.it>
6401 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6404 * src/insets/insettext.C (computeTextRows): redone completely this
6405 function in a much cleaner way, because of problems when having a
6407 (draw): added a frame border when the inset is locked.
6408 (SetDrawLockedFrame): this sets if we draw the border or not.
6409 (SetFrameColor): this sets the frame color (default=insetframe).
6411 * src/insets/lyxinset.h: added x() and y() functions which return
6412 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6413 function which is needed to see if we have a locking inset of some
6414 type in this inset (needed for now in insettabular).
6416 * src/vspace.C (inPixels): the same function also without a BufferView
6417 parameter as so it is easier to use it in some ocasions.
6419 * src/lyxfunc.C: changed all places where insertInset was used so
6420 that now if it couldn't be inserted it is deleted!
6422 * src/TabularLayout.C:
6423 * src/TableLayout.C: added support for new tabular-inset!
6425 * src/BufferView2.C (insertInset): this now returns a bool if the
6426 inset was really inserted!!!
6428 * src/tabular.C (GetLastCellInRow):
6429 (GetFirstCellInRow): new helper functions.
6430 (Latex): implemented for new tabular class.
6434 (TeXTopHLine): new Latex() helper functions.
6436 2000-05-12 Juergen Vigna <jug@sad.it>
6438 * src/mathed/formulamacro.C (Read):
6439 * src/mathed/formula.C (Read): read also the \end_inset here!
6441 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6443 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6444 crush when saving formulae with unbalanced parenthesis.
6446 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6448 * src/layout.C: Add new keyword "endlabelstring" to layout file
6450 * src/text.C (GetVisibleRow): Draw endlabel string.
6452 * lib/layouts/broadway.layout
6453 * lib/layouts/hollywood.layout: Added endlabel for the
6454 Parenthetical layout.
6456 * lib/layouts/heb-article.layout: Do not use slanted font shape
6457 for Theorem like environments.
6459 * src/buffer.C (makeLaTeXFile): Always add "american" to
6460 the UsedLanguages list if document language is RTL.
6462 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6464 * add addendum to README.OS2 and small patch (from SMiyata)
6466 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6468 * many files: correct the calls to ChangeExtension().
6470 * src/support/filetools.C (ChangeExtension): remove the no_path
6471 argument, which does not belong there. Use OnlyFileName() instead.
6473 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6474 files when LaTeXing a non-nice latex file.
6476 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6477 a chain of "if". Return false when deadkeys are not handled.
6479 * src/lyx_main.C (LyX): adapted the code for default bindings.
6481 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6482 bindings for basic functionality (except deadkeys).
6483 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6485 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6486 several methods: handle override_x_deadkeys.
6488 * src/lyxrc.h: remove the "bindings" map, which did not make much
6489 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6491 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6493 * src/lyxfont.C (stateText): use a saner method to determine
6494 whether the font is "default". Seems to fix the crash with DEC
6497 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6499 2000-05-08 Juergen Vigna <jug@sad.it>
6501 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6502 TabularLayoutMenu with mouse-button-3
6503 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6505 * src/TabularLayout.C: added this file for having a Layout for
6508 2000-05-05 Juergen Vigna <jug@sad.it>
6510 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6511 recalculating inset-widths.
6512 (TabularFeatures): activated this function so that I can change
6513 tabular-features via menu.
6515 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6516 that I can test some functions with the Table menu.
6518 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6520 * src/lyxfont.C (stateText): guard against stupid c++libs.
6522 * src/tabular.C: add using std::vector
6523 some whitespace changes, + removed som autogenerated code.
6525 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6527 2000-05-05 Juergen Vigna <jug@sad.it>
6529 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6530 row, columns and cellstructures.
6532 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6534 * lib/lyxrc.example: remove obsolete entries.
6536 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6537 reading of protected_separator for free_spacing.
6539 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6541 * src/text.C (draw): do not display an exclamation mark in the
6542 margin for margin notes. This is confusing, ugly and
6545 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6546 AMS math' is checked.
6548 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6549 name to see whether including the amsmath package is needed.
6551 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6553 * src/paragraph.C (validate): Compute UsedLanguages correctly
6554 (don't insert the american language if it doesn't appear in the
6557 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6558 The argument of \thanks{} command is considered moving argument
6560 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6563 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6565 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6566 for appendix/minipage/depth. The lines can be now both in the footnote
6567 frame, and outside the frame.
6569 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6572 2000-05-05 Juergen Vigna <jug@sad.it>
6574 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6575 neede only in tabular.[Ch].
6577 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6579 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6581 (Write): write '~' for PROTECTED_SEPARATOR
6583 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6585 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6588 * src/mathed/formula.C (drawStr): rename size to siz.
6590 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6591 possibly fix a bug by not changing the pflags = flags to piflags =
6594 2000-05-05 Juergen Vigna <jug@sad.it>
6596 * src/insets/insetbib.C: moved using directive
6598 * src/ImportNoweb.C: small fix for being able to compile (missing
6601 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6603 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6604 to use clear, since we don't depend on this in the code. Add test
6607 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6609 * (various *.C files): add using std::foo directives to please dec
6612 * replace calls to string::clear() to string::erase() (Angus)
6614 * src/cheaders/cmath: modified to provide std::abs.
6616 2000-05-04 Juergen Vigna <jug@sad.it>
6618 * src/insets/insettext.C: Prepared all for inserting of multiple
6619 paragraphs. Still display stuff to do (alignment and other things),
6620 but I would like to use LyXText to do this when we cleaned out the
6621 table-support stuff.
6623 * src/insets/insettabular.C: Changed lot of stuff and added lots
6624 of functionality still a lot to do.
6626 * src/tabular.C: Various functions changed name and moved to be
6627 const functions. Added new Read and Write functions and changed
6628 lots of things so it works good with tabular-insets (also removed
6629 some stuff which is not needed anymore * hacks *).
6631 * src/lyxcursor.h: added operators == and != which just look if
6632 par and pos are (not) equal.
6634 * src/buffer.C (latexParagraphs): inserted this function to latex
6635 all paragraphs form par to endpar as then I can use this too for
6638 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6639 so that I can call this to from text insets with their own cursor.
6641 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6642 output off all paragraphs (because of the fix below)!
6644 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6645 the very last paragraph (this could be also the last paragraph of an
6648 * src/texrow.h: added rows() call which returns the count-variable.
6650 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6652 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6654 * lib/configure.m4: better autodetection of DocBook tools.
6656 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6658 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6660 * src/lyx_cb.C: add using std::reverse;
6662 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6665 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6666 selected files. Should fix repeated errors from generated files.
6668 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6670 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6672 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6673 the spellchecker popup.
6675 * lib/lyxrc.example: Removed the \number_inset section
6677 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6679 * src/insets/figinset.C (various): Use IsFileReadable() to make
6680 sure that the file actually exist. Relying on ghostscripts errors
6681 is a bad idea since they can lead to X server crashes.
6683 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6685 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6688 * lib/lyxrc.example: smallish typo in description of
6689 \view_dvi_paper_option
6691 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6694 * src/lyxfunc.C: doImportHelper to factor out common code of the
6695 various import methods. New functions doImportASCIIasLines,
6696 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6697 doImportLinuxDoc for the format specific parts.
6700 * buffer.C: Dispatch returns now a bool to indicate success
6703 * lyx_gui.C: Add getLyXView() for member access
6705 * lyx_main.C: Change logic for batch commands: First try
6706 Buffer::Dispatch (possibly without GUI), if that fails, use
6709 * lyx_main.C: Add support for --import command line switch.
6710 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6711 Available Formats: Everything accepted by 'buffer-import <format>'
6713 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6715 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6718 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6719 documents will be reformatted upon reentry.
6721 2000-04-27 Juergen Vigna <jug@sad.it>
6723 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6724 correctly only last pos this was a bug.
6726 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6728 * release of lyx-1.1.5pre1
6730 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6732 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6734 * src/menus.C: revert the change of naming (Figure->Graphic...)
6735 from 2000-04-11. It was incomplete and bad.
6737 * src/LColor.[Ch]: add LColor::depthbar.
6738 * src/text.C (GetVisibleRow): use it.
6740 * README: update the languages list.
6742 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6744 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6747 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6749 * README: remove sections that were just wrong.
6751 * src/text2.C (GetRowNearY): remove currentrow code
6753 * src/text.C (GetRow): remove currentrow code
6755 * src/screen.C (Update): rewritten a bit.
6756 (SmallUpdate): removed func
6758 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6760 (FullRebreak): return bool
6761 (currentrow): remove var
6762 (currentrow_y): ditto
6764 * src/lyxscreen.h (Draw): change arg to unsigned long
6765 (FitCursor): return bool
6766 (FitManualCursor): ditto
6767 (Smallpdate): remove func
6768 (first): change to unsigned long
6769 (DrawOneRow): change second arg to long (from long &)
6770 (screen_refresh_y): remove var
6771 (scree_refresh_row): ditto
6773 * src/lyxrow.h: change baseline to usigned int from unsigned
6774 short, this brings some implicit/unsigned issues out in the open.
6776 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6778 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6779 instead of smallUpdate.
6781 * src/lyxcursor.h: change y to unsigned long
6783 * src/buffer.h: don't call updateScrollbar after fitcursor
6785 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6786 where they are used. Removed "\\direction", this was not present
6787 in 1.1.4 and is already obsolete. Commented out some code that I
6788 believe to never be called.
6789 (runLiterate): don't call updateScrollbar after fitCursor
6791 (buildProgram): ditto
6794 * src/WorkArea.h (workWidth): change return val to unsigned
6797 (redraw): remove the button redraws
6798 (setScrollbarValue): change for scrollbar
6799 (getScrollbarValue): change for scrollbar
6800 (getScrollbarBounds): change for scrollbar
6802 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6803 (C_WorkArea_down_cb): removed func
6804 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6805 (resize): change for scrollbar
6806 (setScrollbar): ditto
6807 (setScrollbarBounds): ditto
6808 (setScrollbarIncrements): ditto
6809 (up_cb): removed func
6810 (down_cb): removed func
6811 (scroll_cb): change for scrollbar
6812 (work_area_handler): ditto
6814 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6815 when FitCursor did something.
6816 (updateScrollbar): some unsigned changes
6817 (downCB): removed func
6818 (scrollUpOnePage): removed func
6819 (scrollDownOnePage): remvoed func
6820 (workAreaMotionNotify): don't call screen->FitCursor but use
6821 fitCursor instead. and bool return val
6822 (workAreaButtonPress): ditto
6823 (workAreaButtonRelease): some unsigned changes
6824 (checkInsetHit): ditto
6825 (workAreaExpose): ditto
6826 (update): parts rewritten, comments about the signed char arg added
6827 (smallUpdate): removed func
6828 (cursorPrevious): call needed updateScrollbar
6831 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6834 * src/BufferView.[Ch] (upCB): removed func
6835 (downCB): removed func
6836 (smallUpdate): removed func
6838 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6840 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6841 currentrow, currentrow_y optimization. This did not help a lot and
6842 if we want to do this kind of optimization we should rather use
6843 cursor.row instead of the currentrow.
6845 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6846 buffer spacing and klyx spacing support.
6848 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6850 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6853 2000-04-26 Juergen Vigna <jug@sad.it>
6855 * src/insets/figinset.C: fixes to Lars sstream changes!
6857 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6859 * A lot of files: Added Ascii(ostream &) methods to all inset
6860 classes. Used when exporting to ASCII.
6862 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6863 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6866 * src/text2.C (ToggleFree): Disabled implicit word selection when
6867 there is a change in the language
6869 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6870 no output was generated for end-of-sentence inset.
6872 * src/insets/lyxinset.h
6875 * src/paragraph.C: Removed the insetnumber code
6877 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6879 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6881 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6882 no_babel and no_epsfig completely from the file.
6883 (parseSingleLyXformat2Token): add handling for per-paragraph
6884 spacing as written by klyx.
6886 * src/insets/figinset.C: applied patch by Andre. Made it work with
6889 2000-04-20 Juergen Vigna <jug@sad.it>
6891 * src/insets/insettext.C (cutSelection):
6892 (copySelection): Fixed with selection from right to left.
6893 (draw): now the rows are not recalculated at every draw.
6894 (computeTextRows): for now reset the inset-owner here (this is
6895 important for an undo or copy where the inset-owner is not set
6898 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6899 motion to the_locking_inset screen->first was forgotten, this was
6900 not important till we got multiline insets.
6902 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6904 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6905 code seems to be alright (it is code changed by Dekel, and the
6906 intent is indeed that all macros should be defined \protect'ed)
6908 * NEWS: a bit of reorganisation of the new user-visible features.
6910 2000-04-19 Juergen Vigna <jug@sad.it>
6912 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6913 position. Set the inset_owner of the used paragraph so that it knows
6914 that it is inside an inset. Fixed cursor handling with mouse and
6915 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6916 and cleanups to make TextInsets work better.
6918 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6919 Changed parameters of various functions and added LockInsetInInset().
6921 * src/insets/insettext.C:
6923 * src/insets/insetcollapsable.h:
6924 * src/insets/insetcollapsable.C:
6925 * src/insets/insetfoot.h:
6926 * src/insets/insetfoot.C:
6927 * src/insets/insetert.h:
6928 * src/insets/insetert.C: cleaned up the code so that it works now
6929 correctly with insettext.
6931 * src/insets/inset.C:
6932 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6933 that insets in insets are supported right.
6936 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6938 * src/paragraph.C: some small fixes
6940 * src/debug.h: inserted INSETS debug info
6942 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6943 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6945 * src/commandtags.h:
6946 * src/LyXAction.C: insert code for InsetTabular.
6948 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6949 not Button1MotionMask.
6950 (workAreaButtonRelease): send always a InsetButtonRelease event to
6952 (checkInsetHit): some setCursor fixes (always with insets).
6954 * src/BufferView2.C (lockInset): returns a bool now and extended for
6955 locking insets inside insets.
6956 (showLockedInsetCursor): it is important to have the cursor always
6957 before the locked inset.
6958 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6960 * src/BufferView.h: made lockInset return a bool.
6962 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6964 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6965 that is used also internally but can be called as public to have back
6966 a cursor pos which is not set internally.
6967 (SetCursorIntern): Changed to use above function.
6969 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6971 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6976 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6977 patches for things that should be in or should be changed.
6979 * src/* [insetfiles]: change "usigned char fragile" to bool
6980 fragile. There was only one point that could that be questioned
6981 and that is commented in formulamacro.C. Grep for "CHECK".
6983 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6984 (DeleteBuffer): take it out of CutAndPaste and make it static.
6986 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6988 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6989 output the spacing envir commands. Also the new commands used in
6990 the LaTeX output makes the result better.
6992 * src/Spacing.C (writeEnvirBegin): new method
6993 (writeEnvirEnd): new method
6995 2000-04-18 Juergen Vigna <jug@sad.it>
6997 * src/CutAndPaste.C: made textclass a static member of the class
6998 as otherwise it is not accesed right!!!
7000 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7002 * forms/layout_forms.fd
7003 * src/layout_forms.h
7004 * src/layout_forms.C (create_form_form_character)
7005 * src/lyx_cb.C (UserFreeFont)
7006 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7007 documents (in the layout->character popup).
7009 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7011 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7012 \spell_command was in fact not honored (from Kevin Atkinson).
7014 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7017 * src/lyx_gui.h: make lyxViews private (Angus)
7019 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7021 * src/mathed/math_write.C
7022 (MathMatrixInset::Write) Put \protect before \begin{array} and
7023 \end{array} if fragile
7024 (MathParInset::Write): Put \protect before \\ if fragile
7026 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7028 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7029 initialization if the LyXColorHandler must be done after the
7030 connections to the XServer has been established.
7032 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7033 get the background pixel from the lyxColorhandler so that the
7034 figures are rendered with the correct background color.
7035 (NextToken): removed functions.
7036 (GetPSSizes): use ifs >> string instead of NextToken.
7038 * src/Painter.[Ch]: the color cache moved out of this file.
7040 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7043 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7045 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7046 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7048 * src/BufferView.C (enterView): new func
7049 (leaveView): new func
7051 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7053 (leaveView): new func, undefines xterm cursor when approp.
7055 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7056 (AllowInput): delete the Workarea cursor handling from this func.
7058 * src/Painter.C (underline): draw a slimer underline in most cases.
7060 * src/lyx_main.C (error_handler): use extern "C"
7062 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7064 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7065 sent directly to me.
7067 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7068 to the list by Dekel.
7070 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7073 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7074 methods from lyx_cb.here.
7076 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7079 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7081 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7082 instead of using current_view directly.
7084 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7086 * src/LyXAction.C (init): add the paragraph-spacing command.
7088 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7090 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7092 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7093 different from the documents.
7095 * src/text.C (SetHeightOfRow): take paragraph spacing into
7096 account, paragraph spacing takes precedence over buffer spacing
7097 (GetVisibleRow): ditto
7099 * src/paragraph.C (writeFile): output the spacing parameter too.
7100 (validate): set the correct features if spacing is used in the
7102 (Clear): set spacing to default
7103 (MakeSameLayout): spacing too
7104 (HasSameLayout): spacing too
7105 (SetLayout): spacing too
7106 (TeXOnePar): output the spacing commands
7108 * src/lyxparagraph.h: added a spacing variable for use with
7109 per-paragraph spacing.
7111 * src/Spacing.h: add a Default spacing and a method to check if
7112 the current spacing is default. also added an operator==
7114 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7117 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7119 * src/lyxserver.C (callback): fix dispatch of functions
7121 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7122 printf() into lyxerr call.
7124 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7127 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7128 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7129 the "Float" from each of the subitems.
7130 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7132 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7133 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7134 documented the change so that the workaround can be nuked later.
7136 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7139 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7141 * src/buffer.C (getLatexName): ditto
7142 (setReadonly): ditto
7144 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7146 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7147 avoid some uses of current_view. Added also a bufferParams()
7148 method to get at this.
7150 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7152 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7154 * src/lyxparagraph.[Ch]: removed
7155 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7156 with operators used by lower_bound and
7157 upper_bound in InsetTable's
7158 Make struct InsetTable private again. Used matchpos.
7160 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7162 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7163 document, the language of existing text is changed (unless the
7164 document is multi-lingual)
7166 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7168 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7170 * A lot of files: A rewrite of the Right-to-Left support.
7172 2000-04-10 Juergen Vigna <jug@sad.it>
7174 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7175 misplaced cursor when inset in inset is locked.
7177 * src/insets/insettext.C (LocalDispatch): small fix so that a
7178 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7180 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7181 footnote font should be decreased in size twice when displaying.
7183 * src/insets/insettext.C (GetDrawFont): inserted this function as
7184 the drawing-font may differ from the real paragraph font.
7186 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7187 insets (inset in inset!).
7189 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7190 function here because we don't want footnotes inside footnotes.
7192 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7194 (init): now set the inset_owner in paragraph.C
7195 (LocalDispatch): added some resetPos() in the right position
7198 (pasteSelection): changed to use the new CutAndPaste-Class.
7200 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7201 which tells if it is allowed to insert another inset inside this one.
7203 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7204 SwitchLayoutsBetweenClasses.
7206 * src/text2.C (InsertInset): checking of the new paragraph-function
7208 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7209 is not needed anymore here!
7212 (PasteSelection): redone (also with #ifdef) so that now this uses
7213 the CutAndPaste-Class.
7214 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7217 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7218 from/to text/insets.
7220 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7221 so that the paragraph knows if it is inside an (text)-inset.
7222 (InsertFromMinibuffer): changed return-value to bool as now it
7223 may happen that an inset is not inserted in the paragraph.
7224 (InsertInsetAllowed): this checks if it is allowed to insert an
7225 inset in this paragraph.
7227 (BreakParagraphConservative):
7228 (BreakParagraph) : small change for the above change of the return
7229 value of InsertFromMinibuffer.
7231 * src/lyxparagraph.h: added inset_owner and the functions to handle
7232 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7234 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7236 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7237 functions from BufferView to BufferView::Pimpl to ease maintence.
7239 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7240 correctly. Also use SetCursorIntern instead of SetCursor.
7242 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7245 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7247 * src/WorkArea.C (belowMouse): manually implement below mouse.
7249 * src/*: Add "explicit" on several constructors, I added probably
7250 some unneeded ones. A couple of changes to code because of this.
7252 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7253 implementation and private parts from the users of BufferView. Not
7256 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7257 implementation and private parts from the users of LyXLex. Not
7260 * src/BufferView_pimpl.[Ch]: new files
7262 * src/lyxlex_pimpl.[Ch]: new files
7264 * src/LyXView.[Ch]: some inline functions move out-of-line
7266 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7268 * src/lyxparagraph.h: make struct InsetTable public.
7270 * src/support/lyxstring.h: change lyxstring::difference_type to be
7271 ptrdiff_t. Add std:: modifiers to streams.
7273 * src/font.C: include the <cctype> header, for islower() and
7276 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7278 * src/font.[Ch]: new files. Contains the metric functions for
7279 fonts, takes a LyXFont as parameter. Better separation of concepts.
7281 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7282 changes because of this.
7284 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7286 * src/*: compile with -Winline and move functions that don't
7289 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7292 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7294 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7295 (various files changed because of this)
7297 * src/Painter.C (text): fixed the drawing of smallcaps.
7299 * src/lyxfont.[Ch] (drawText): removed unused member func.
7302 * src/*.C: added needed "using" statements and "std::" qualifiers.
7304 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7306 * src/*.h: removed all use of "using" from header files use
7307 qualifier std:: instead.
7309 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7311 * src/text.C (Backspace): some additional cleanups (we already
7312 know whether cursor.pos is 0 or not).
7314 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7315 automake does not provide one).
7317 * src/bmtable.h: replace C++ comments with C comments.
7319 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7321 * src/screen.C (ShowCursor): Change the shape of the cursor if
7322 the current language is not equal to the language of the document.
7323 (If the cursor change its shape unexpectedly, then you've found a bug)
7325 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7328 * src/insets/insetnumber.[Ch]: New files.
7330 * src/LyXAction.C (init)
7331 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7334 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7336 * src/lyxparagraph.h
7337 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7338 (the vector is kept sorted).
7340 * src/text.C (GetVisibleRow): Draw selection correctly when there
7341 is both LTR and RTL text.
7343 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7344 which is much faster.
7346 * src/text.C (GetVisibleRow and other): Do not draw the last space
7347 in a row if the direction of the last letter is not equal to the
7348 direction of the paragraph.
7350 * src/lyxfont.C (latexWriteStartChanges):
7351 Check that font language is not equal to basefont language.
7352 (latexWriteEndChanges): ditto
7354 * src/lyx_cb.C (StyleReset): Don't change the language while using
7355 the font-default command.
7357 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7358 empty paragraph before a footnote.
7360 * src/insets/insetcommand.C (draw): Increase x correctly.
7362 * src/screen.C (ShowCursor): Change cursor shape if
7363 current language != document language.
7365 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7367 2000-03-31 Juergen Vigna <jug@sad.it>
7369 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7370 (Clone): changed mode how the paragraph-data is copied to the
7371 new clone-paragraph.
7373 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7374 GetInset(pos) with no inset anymore there (in inset UNDO)
7376 * src/insets/insetcommand.C (draw): small fix as here x is
7377 incremented not as much as width() returns (2 before, 2 behind = 4)
7379 2000-03-30 Juergen Vigna <jug@sad.it>
7381 * src/insets/insettext.C (InsetText): small fix in initialize
7382 widthOffset (should not be done in the init() function)
7384 2000-03-29 Amir Karger <karger@lyx.org>
7386 * lib/examples/it_ItemizeBullets.lyx: translation by
7389 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7391 2000-03-29 Juergen Vigna <jug@sad.it>
7393 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7395 * src/insets/insetfoot.C (Clone): small change as for the below
7396 new init function in the text-inset
7398 * src/insets/insettext.C (init): new function as I've seen that
7399 clone did not copy the Paragraph-Data!
7400 (LocalDispatch): Added code so that now we have some sort of Undo
7401 functionality (well actually we HAVE Undo ;)
7403 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7405 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7407 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7410 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7412 * src/main.C: added a runtime check that verifies that the xforms
7413 header used when building LyX and the library used when running
7414 LyX match. Exit with a message if they don't match. This is a
7415 version number check only.
7417 * src/buffer.C (save): Don't allocate memory on the heap for
7418 struct utimbuf times.
7420 * *: some using changes, use iosfwd instead of the real headers.
7422 * src/lyxfont.C use char const * instead of string for the static
7423 strings. Rewrite some functions to use sstream.
7425 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7427 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7430 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7432 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7433 of Geodesy (from Martin Vermeer)
7435 * lib/layouts/svjour.inc: include file for the Springer svjour
7436 class. It can be used to support journals other than JoG.
7438 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7439 Miskiewicz <misiek@pld.org.pl>)
7440 * lib/reLyX/Makefile.am: ditto.
7442 2000-03-27 Juergen Vigna <jug@sad.it>
7444 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7445 also some modifications with operations on selected text.
7447 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7448 problems with clicking on insets (last famous words ;)
7450 * src/insets/insetcommand.C (draw):
7451 (width): Changed to have a bit of space before and after the inset so
7452 that the blinking cursor can be seen (otherwise it was hidden)
7454 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7456 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7457 would not be added to the link list when an installed gettext (not
7458 part of libc) is found.
7460 2000-03-24 Juergen Vigna <jug@sad.it>
7462 * src/insets/insetcollapsable.C (Edit):
7463 * src/mathed/formula.C (InsetButtonRelease):
7464 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7467 * src/BufferView.C (workAreaButtonPress):
7468 (workAreaButtonRelease):
7469 (checkInsetHit): Finally fixed the clicking on insets be handled
7472 * src/insets/insetert.C (Edit): inserted this call so that ERT
7473 insets work always with LaTeX-font
7475 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7477 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7478 caused lyx to startup with no GUI in place, causing in a crash
7479 upon startup when called with arguments.
7481 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7483 * src/FontLoader.C: better initialization of dummyXFontStruct.
7485 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7487 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7488 for linuxdoc and docbook import and export format options.
7490 * lib/lyxrc.example Example of default values for the previous flags.
7492 * src/lyx_cb.C Use those flags instead of the hardwired values for
7493 linuxdoc and docbook export.
7495 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7498 * src/menus.C Added menus entries for the new import/exports formats.
7500 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7502 * src/lyxrc.*: Added support for running without Gui
7505 * src/FontLoader.C: sensible defaults if no fonts are needed
7507 * src/lyx_cb.C: New function ShowMessage (writes either to the
7508 minibuffer or cout in case of no gui
7509 New function AskOverwrite for common stuff
7510 Consequently various changes to call these functions
7512 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7513 wild guess at sensible screen resolution when having no gui
7515 * src/lyxfont.C: no gui, no fonts... set some defaults
7517 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7519 * src/LColor.C: made the command inset background a bit lighter.
7521 2000-03-20 Hartmut Goebel <goebel@noris.net>
7523 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7524 stdstruct.inc. Koma-Script added some title elements which
7525 otherwise have been listed below "bibliography". This split allows
7526 adding title elements to where they belong.
7528 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7529 define the additional title elements and then include
7532 * many other layout files: changed to include stdtitle.inc just
7533 before stdstruct.inc.
7535 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7537 * src/buffer.C: (save) Added the option to store all backup files
7538 in a single directory
7540 * src/lyxrc.[Ch]: Added variable \backupdir_path
7542 * lib/lyxrc.example: Added descriptions of recently added variables
7544 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7545 bibtex inset, not closing the bibtex popup when deleting the inset)
7547 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7549 * src/lyx_cb.C: add a couple using directives.
7551 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7552 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7553 import based on the filename.
7555 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7556 file would be imported at start, if the filename where of a sgml file.
7558 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7560 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7562 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7563 * src/lyxfont.h Replaced the member variable bits.direction by the
7564 member variable lang. Made many changes in other files.
7565 This allows having a multi-lingual document
7567 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7568 that change the current language to <l>.
7569 Removed the command "font-rtl"
7571 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7572 format for Hebrew documents)
7574 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7575 When auto_mathmode is "true", pressing a digit key in normal mode
7576 will cause entering into mathmode.
7577 If auto_mathmode is "rtl" then this behavior will be active only
7578 when writing right-to-left text.
7580 * src/text2.C (InsertStringA) The string is inserted using the
7583 * src/paragraph.C (GetEndLabel) Gives a correct result for
7584 footnote paragraphs.
7586 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7588 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7590 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7591 front of PasteParagraph. Never insert a ' '. This should at least
7592 fix some cause for the segfaults that we have been experiencing,
7593 it also fixes backspace behaviour slightly. (Phu!)
7595 * src/support/lstrings.C (compare_no_case): some change to make it
7596 compile with gcc 2.95.2 and stdlibc++-v3
7598 * src/text2.C (MeltFootnoteEnvironment): change type o
7599 first_footnote_par_is_not_empty to bool.
7601 * src/lyxparagraph.h: make text private. Changes in other files
7603 (fitToSize): new function
7604 (setContentsFromPar): new function
7605 (clearContents): new function
7606 (SetChar): new function
7608 * src/paragraph.C (readSimpleWholeFile): deleted.
7610 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7611 the file, just use a simple string instead. Also read the file in
7612 a more maintainable manner.
7614 * src/text2.C (InsertStringA): deleted.
7615 (InsertStringB): deleted.
7617 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7619 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7620 RedoParagraphs from the doublespace handling part, just set status
7621 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7622 done, but perhaps not like this.)
7624 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7626 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7627 character when inserting an inset.
7629 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7631 * src/bufferparams.C (readLanguage): now takes "default" into
7634 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7635 also initialize the toplevel_keymap with the default bindings from
7638 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7640 * all files using lyxrc: have lyxrc as a real variable and not a
7641 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7644 * src/lyxrc.C: remove double call to defaultKeyBindings
7646 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7647 toolbar defauls using lyxlex. Remove enums, structs, functions
7650 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7651 toolbar defaults. Also store default keybindings in a map.
7653 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7654 storing the toolbar defaults without any xforms dependencies.
7656 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7657 applied. Changed to use iterators.
7659 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7661 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7662 systems that don't have LINGUAS set to begin with.
7664 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7666 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7667 the list by Dekel Tsur.
7669 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7671 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7672 * src/insets/form_graphics.C: ditto.
7674 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7676 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7678 * src/bufferparams.C (readLanguage): use the new language map
7680 * src/intl.C (InitKeyMapper): use the new language map
7682 * src/lyx_gui.C (create_forms): use the new language map
7684 * src/language.[Ch]: New files. Used for holding the information
7685 about each language. Now! Use this new language map enhance it and
7686 make it really usable for our needs.
7688 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7690 * screen.C (ShowCursor): Removed duplicate code.
7691 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7692 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7694 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7697 * src/text.C Added TransformChar method. Used for rendering Arabic
7698 text correctly (change the glyphs of the letter according to the
7699 position in the word)
7704 * src/lyxrc.C Added lyxrc command {language_command_begin,
7705 language_command_end,language_command_ltr,language_command_rtl,
7706 language_package} which allows the use of either arabtex or Omega
7709 * src/lyx_gui.C (init)
7711 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7712 to use encoding for menu fonts which is different than the encoding
7715 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7716 do not load the babel package.
7717 To write an English document with Hebrew/Arabic, change the document
7718 language to "english".
7720 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7721 (alphaCounter): changed to return char
7722 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7724 * lib/lyxrc.example Added examples for Hebrew/Arabic
7727 * src/layout.C Added layout command endlabeltype
7729 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7731 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7733 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7735 * src/mathed/math_delim.C (search_deco): return a
7736 math_deco_struct* instead of index.
7738 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7740 * All files with a USE_OSTREAM_ONLY within: removed all code that
7741 was unused when USE_OSTREAM_ONLY is defined.
7743 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7744 of any less. Removed header and using.
7746 * src/text.C (GetVisibleRow): draw the string "Page Break
7747 (top/bottom)" on screen when drawing a pagebreak line.
7749 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7751 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7753 * src/mathed/math_macro.C (draw): do some cast magic.
7756 * src/mathed/math_defs.h: change byte* argument to byte const*.
7758 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7760 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7761 know it is right to return InsetFoot* too, but cxx does not like
7764 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7766 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7768 * src/mathed/math_delim.C: change == to proper assignment.
7770 2000-03-09 Juergen Vigna <jug@sad.it>
7772 * src/insets/insettext.C (setPos): fixed various cursor positioning
7773 problems (via mouse and cursor-keys)
7774 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7775 inset (still a small display problem but it works ;)
7777 * src/insets/insetcollapsable.C (draw): added button_top_y and
7778 button_bottom_y to have correct values for clicking on the inset.
7780 * src/support/lyxalgo.h: commented out 'using std::less'
7782 2000-03-08 Juergen Vigna <jug@sad.it>
7784 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7785 Button-Release event closes as it is alos the Release-Event
7788 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7790 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7792 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7793 can add multiple spaces in Scrap (literate programming) styles...
7794 which, by the way, is how I got hooked on LyX to begin with.
7796 * src/mathed/formula.C (Write): Added dummy variable to an
7797 inset::Latex() call.
7798 (Latex): Add free_spacing boolean to inset::Latex()
7800 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7802 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7803 virtual function to include the free_spacing boolean from
7804 the containing paragraph's style.
7806 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7807 Added free_spacing boolean arg to match inset.h
7809 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7810 Added free_spacing boolean arg to match inset.h
7812 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7813 Added free_spacing boolean and made sure that if in a free_spacing
7814 paragraph, that we output normal space if there is a protected space.
7816 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7817 Added free_spacing boolean arg to match inset.h
7819 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7820 Added free_spacing boolean arg to match inset.h
7822 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7823 Added free_spacing boolean arg to match inset.h
7825 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7826 Added free_spacing boolean arg to match inset.h
7828 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7829 Added free_spacing boolean arg to match inset.h
7831 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7832 free_spacing boolean arg to match inset.h
7834 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7835 Added free_spacing boolean arg to match inset.h
7837 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7838 Added free_spacing boolean arg to match inset.h
7840 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7841 Added free_spacing boolean arg to match inset.h
7843 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7844 Added free_spacing boolean arg to match inset.h
7846 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7847 Added free_spacing boolean arg to match inset.h
7849 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7850 free_spacing boolean arg to match inset.h
7852 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7853 free_spacing boolean arg to match inset.h
7855 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7856 ignore free_spacing paragraphs. The user's spaces are left
7859 * src/text.C (InsertChar): Fixed the free_spacing layout
7860 attribute behavior. Now, if free_spacing is set, you can
7861 add multiple spaces in a paragraph with impunity (and they
7862 get output verbatim).
7863 (SelectSelectedWord): Added dummy argument to inset::Latex()
7866 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7869 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7870 paragraph layouts now only input a simple space instead.
7871 Special character insets don't make any sense in free-spacing
7874 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7875 hard-spaces in the *input* file to simple spaces if the layout
7876 is free-spacing. This converts old files which had to have
7877 hard-spaces in free-spacing layouts where a simple space was
7879 (writeFileAscii): Added free_spacing check to pass to the newly
7880 reworked inset::Latex(...) methods. The inset::Latex() code
7881 ensures that hard-spaces in free-spacing paragraphs get output
7882 as spaces (rather than "~").
7884 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7886 * src/mathed/math_delim.C (draw): draw the empty placeholder
7887 delims with a onoffdash line.
7888 (struct math_deco_compare): struct that holds the "functors" used
7889 for the sort and the binary search in math_deco_table.
7890 (class init_deco_table): class used for initial sort of the
7892 (search_deco): use lower_bound to do a binary search in the
7895 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7897 * src/lyxrc.C: a small secret thingie...
7899 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7900 and to not flush the stream as often as it used to.
7902 * src/support/lyxalgo.h: new file
7903 (sorted): template function used for checking if a sequence is
7904 sorted or not. Two versions with and without user supplied
7905 compare. Uses same compare as std::sort.
7907 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7908 it and give warning on lyxerr.
7910 (struct compare_tags): struct with function operators used for
7911 checking if sorted, sorting and lower_bound.
7912 (search_kw): use lower_bound instead of manually implemented
7915 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7917 * src/insets/insetcollapsable.h: fix Clone() declaration.
7918 * src/insets/insetfoot.h: ditto.
7920 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7922 2000-03-08 Juergen Vigna <jug@sad.it>
7924 * src/insets/lyxinset.h: added owner call which tells us if
7925 this inset is inside another inset. Changed also the return-type
7926 of Editable to an enum so it tells clearer what the return-value is.
7928 * src/insets/insettext.C (computeTextRows): fixed computing of
7929 textinsets which split automatically on more rows.
7931 * src/insets/insetert.[Ch]: changed this to be of BaseType
7934 * src/insets/insetfoot.[Ch]: added footnote inset
7936 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7937 collapsable insets (like footnote, ert, ...)
7939 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7941 * src/lyxdraw.h: remvoe file
7943 * src/lyxdraw.C: remove file
7945 * src/insets/insettext.C: added <algorithm>.
7947 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7949 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7950 (matrix_cb): case MM_OK use string stream
7952 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7955 * src/mathed/math_macro.C (draw): use string stream
7956 (Metrics): use string stream
7958 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7959 directly to the ostream.
7961 * src/vspace.C (asString): use string stream.
7962 (asString): use string stream
7963 (asLatexString): use string stream
7965 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7966 setting Spacing::Other.
7968 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7969 sprintf when creating the stretch vale.
7971 * src/text2.C (alphaCounter): changed to return a string and to
7972 not use a static variable internally. Also fixed a one-off bug.
7973 (SetCounter): changed the drawing of the labels to use string
7974 streams instead of sprintf.
7976 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7977 manipulator to use a scheme that does not require library support.
7978 This is also the way it is done in the new GNU libstdc++. Should
7979 work with DEC cxx now.
7981 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7983 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7984 end. This fixes a bug.
7986 * src/mathed (all files concerned with file writing): apply the
7987 USE_OSTREAM_ONLY changes to mathed too.
7989 * src/support/DebugStream.h: make the constructor explicit.
7991 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7992 count and ostream squashed.
7994 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7996 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7998 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7999 ostringstream uses STL strings, and we might not.
8001 * src/insets/insetspecialchar.C: add using directive.
8002 * src/insets/insettext.C: ditto.
8004 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8006 * lib/layouts/seminar.layout: feeble attempt at a layout for
8007 seminar.cls, far from completet and could really use some looking
8008 at from people used to write layout files.
8010 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8011 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8012 a lot nicer and works nicely with ostreams.
8014 * src/mathed/formula.C (draw): a slightly different solution that
8015 the one posted to the list, but I think this one works too. (font
8016 size wrong in headers.)
8018 * src/insets/insettext.C (computeTextRows): some fiddling on
8019 Jürgens turf, added some comments that he should read.
8021 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8022 used and it gave compiler warnings.
8023 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8026 * src/lyx_gui.C (create_forms): do the right thing when
8027 show_banner is true/false.
8029 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8030 show_banner is false.
8032 * most file writing files: Now use iostreams to do almost all of
8033 the writing. Also instead of passing string &, we now use
8034 stringstreams. mathed output is still not adapted to iostreams.
8035 This change can be turned off by commenting out all the occurences
8036 of the "#define USE_OSTREAM_ONLY 1" lines.
8038 * src/WorkArea.C (createPixmap): don't output debug messages.
8039 (WorkArea): don't output debug messages.
8041 * lib/lyxrc.example: added a comment about the new variable
8044 * development/Code_rules/Rules: Added some more commente about how
8045 to build class interfaces and on how better encapsulation can be
8048 2000-03-03 Juergen Vigna <jug@sad.it>
8050 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8051 automatically with the width of the LyX-Window
8053 * src/insets/insettext.C (computeTextRows): fixed update bug in
8054 displaying text-insets (scrollvalues where not initialized!)
8056 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8058 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8059 id in the check of the result from lower_bound is not enough since
8060 lower_bound can return last too, and then res->id will not be a
8063 * all insets and some code that use them: I have conditionalized
8064 removed the Latex(string & out, ...) this means that only the
8065 Latex(ostream &, ...) will be used. This is a work in progress to
8066 move towards using streams for all output of files.
8068 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8071 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8073 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8074 routine (this fixes bug where greek letters were surrounded by too
8077 * src/support/filetools.C (findtexfile): change a bit the search
8078 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8079 no longer passed to kpsewhich, we may have to change that later.
8081 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8082 warning options to avoid problems with X header files (from Angus
8084 * acinclude.m4: regenerated.
8086 2000-03-02 Juergen Vigna <jug@sad.it>
8088 * src/insets/insettext.C (WriteParagraphData): Using the
8089 par->writeFile() function for writing paragraph-data.
8090 (Read): Using buffer->parseSingleLyXformat2Token()-function
8091 for parsing paragraph data!
8093 * src/buffer.C (readLyXformat2): removed all parse data and using
8094 the new parseSingleLyXformat2Token()-function.
8095 (parseSingleLyXformat2Token): added this function to parse (read)
8096 lyx-file-format (this is called also from text-insets now!)
8098 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8100 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8103 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8104 directly instead of going through a func. One very bad thing: a
8105 static LyXFindReplace, but I don't know where to place it.
8107 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8108 string instead of char[]. Also changed to static.
8109 (GetSelectionOrWordAtCursor): changed to static inline
8110 (SetSelectionOverLenChars): ditto.
8112 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8113 current_view and global variables. both classes has changed names
8114 and LyXFindReplace is not inherited from SearchForm.
8116 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8117 fl_form_search form.
8119 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8121 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8123 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8124 bound (from Kayvan).
8126 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8128 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8130 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8132 * some things that I should comment but the local pub says head to
8135 * comment out all code that belongs to the Roff code for Ascii
8136 export of tables. (this is unused)
8138 * src/LyXView.C: use correct type for global variable
8139 current_layout. (LyXTextClass::size_type)
8141 * some code to get the new insetgraphics closer to working I'd be
8142 grateful for any help.
8144 * src/BufferView2.C (insertInset): use the return type of
8145 NumberOfLayout properly. (also changes in other files)
8147 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8148 this as a test. I want to know what breaks because of this.
8150 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8152 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8154 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8155 to use a \makebox in the label, this allows proper justification
8156 with out using protected spaces or multiple hfills. Now it is
8157 "label" for left justified, "\hfill label\hfill" for center, and
8158 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8159 should be changed accordingly.
8161 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8163 * src/lyxtext.h: change SetLayout() to take a
8164 LyXTextClass::size_type instead of a char (when there is more than
8165 127 layouts in a class); also change type of copylayouttype.
8166 * src/text2.C (SetLayout): ditto.
8167 * src/LyXView.C (updateLayoutChoice): ditto.
8169 * src/LaTeX.C (scanLogFile): errors where the line number was not
8170 given just after the '!'-line were ignored (from Dekel Tsur).
8172 * lib/lyxrc.example: fix description of \date_insert_format
8174 * lib/layouts/llncs.layout: new layout, contributed by Martin
8177 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8179 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8180 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8181 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8182 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8183 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8184 paragraph.C, text.C, text2.C)
8186 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8188 * src/insets/insettext.C (LocalDispatch): remove extra break
8191 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8192 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8194 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8195 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8197 * src/insets/insetbib.h: move InsetBibkey::Holder and
8198 InsetCitation::Holder in public space.
8200 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8202 * src/insets/insettext.h: small change to get the new files from
8203 Juergen to compile (use "string", not "class string").
8205 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8206 const & as parameter to LocalDispatch, use LyXFont const & as
8207 paramter to some other func. This also had impacto on lyxinsets.h
8208 and the two mathed insets.
8210 2000-02-24 Juergen Vigna <jug@sad.it>
8213 * src/commandtags.h:
8215 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8219 * src/BufferView2.C: added/updated code for various inset-functions
8221 * src/insets/insetert.[Ch]: added implementation of InsetERT
8223 * src/insets/insettext.[Ch]: added implementation of InsetText
8225 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8226 (draw): added preliminary code for inset scrolling not finshed yet
8228 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8229 as it is in lyxfunc.C now
8231 * src/insets/lyxinset.h: Added functions for text-insets
8233 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8235 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8236 BufferView and reimplement the list as a queue put inside its own
8239 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8241 * several files: use the new interface to the "updateinsetlist"
8243 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8245 (work_area_handler): call BufferView::trippleClick on trippleclick.
8247 * src/BufferView.C (doubleClick): new function, selects word on
8249 (trippleClick): new function, selects line on trippleclick.
8251 2000-02-22 Allan Rae <rae@lyx.org>
8253 * lib/bind/xemacs.bind: buffer-previous not supported
8255 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8257 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8260 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8262 * src/bufferlist.C: get rid of current_view from this file
8264 * src/spellchecker.C: get rid of current_view from this file
8266 * src/vspace.C: get rid of current_view from this file
8267 (inPixels): added BufferView parameter for this func
8268 (asLatexCommand): added a BufferParams for this func
8270 * src/text.C src/text2.C: get rid of current_view from these
8273 * src/lyxfont.C (getFontDirection): move this function here from
8276 * src/bufferparams.C (getDocumentDirection): move this function
8279 * src/paragraph.C (getParDirection): move this function here from
8281 (getLetterDirection): ditto
8283 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8285 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8286 resize due to wrong pixmap beeing used. Also took the opurtunity
8287 to make the LyXScreen stateless on regard to WorkArea and some
8288 general cleanup in the same files.
8290 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8292 * src/Makefile.am: add missing direction.h
8294 * src/PainterBase.h: made the width functions const.
8296 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8299 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8301 * src/insets/insetlatexaccent.C (draw): make the accents draw
8302 better, at present this will only work well with iso8859-1.
8304 * several files: remove the old drawing code, now we use the new
8307 * several files: remove support for mono_video, reverse_video and
8310 2000-02-17 Juergen Vigna <jug@sad.it>
8312 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8313 int ** as we have to return the pointer, otherwise we have only
8314 NULL pointers in the returning function.
8316 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8318 * src/LaTeX.C (operator()): quote file name when running latex.
8320 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8322 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8323 (bubble tip), this removes our special handling of this.
8325 * Remove all code that is unused now that we have the new
8326 workarea. (Code that are not active when NEW_WA is defined.)
8328 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8330 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8332 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8333 nonexisting layout; correctly redirect obsoleted layouts.
8335 * lib/lyxrc.example: document \view_dvi_paper_option
8337 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8340 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8341 (PreviewDVI): handle the view_dvi_paper_option variable.
8342 [Both from Roland Krause]
8344 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8346 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8347 char const *, int, LyXFont)
8348 (text(int, int, string, LyXFont)): ditto
8350 * src/text.C (InsertCharInTable): attempt to fix the double-space
8351 feature in tables too.
8352 (BackspaceInTable): ditto.
8353 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8355 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8357 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8359 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8360 newly found text in textcache to this.
8361 (buffer): set the owner of the text put into the textcache to 0
8363 * src/insets/figinset.C (draw): fixed the drawing of figures with
8366 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8367 drawing of mathframe, hfills, protected space, table lines. I have
8368 now no outstanding drawing problems with the new Painter code.
8370 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8372 * src/PainterBase.C (ellipse, circle): do not specify the default
8375 * src/LColor.h: add using directive.
8377 * src/Painter.[Ch]: change return type of methods from Painter& to
8378 PainterBase&. Add a using directive.
8380 * src/WorkArea.C: wrap xforms callbacks in C functions
8383 * lib/layouts/foils.layout: font fix and simplifications from Carl
8386 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8388 * a lot of files: The Painter, LColor and WorkArea from the old
8389 devel branch has been ported to lyx-devel. Some new files and a
8390 lot of #ifdeffed code. The new workarea is enabled by default, but
8391 if you want to test the new Painter and LColor you have to compile
8392 with USE_PAINTER defined (do this in config.h f.ex.) There are
8393 still some rought edges, and I'd like some help to clear those
8394 out. It looks stable (loads and displays the Userguide very well).
8397 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8399 * src/buffer.C (pop_tag): revert to the previous implementation
8400 (use a global variable for both loops).
8402 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8404 * src/lyxrc.C (LyXRC): change slightly default date format.
8406 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8407 there is an English text with a footnote that starts with a Hebrew
8408 paragraph, or vice versa.
8409 (TeXFootnote): ditto.
8411 * src/text.C (LeftMargin): allow for negative values for
8412 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8415 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8416 for input encoding (cyrillic)
8418 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8420 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8423 * src/toolbar.C (set): ditto
8424 * src/insets/insetbib.C (create_form_citation_form): ditto
8426 * lib/CREDITS: added Dekel Tsur.
8428 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8429 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8430 hebrew supports files from Dekel Tsur.
8432 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8433 <tzafrir@technion.ac.il>
8435 * src/lyxrc.C: put \date_insert_format at the right place.
8437 * src/buffer.C (makeLaTeXFile): fix the handling of
8438 BufferParams::sides when writing out latex files.
8440 * src/BufferView2.C: add a "using" directive.
8442 * src/support/lyxsum.C (sum): when we use lyxstring,
8443 ostringstream::str needs an additional .c_str().
8445 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8447 * src/support/filetools.C (ChangeExtension): patch from Etienne
8450 * src/TextCache.C (show): remove const_cast and make second
8451 parameter non-const LyXText *.
8453 * src/TextCache.h: use non const LyXText in show.
8455 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8458 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8460 * src/support/lyxsum.C: rework to be more flexible.
8462 * several places: don't check if a pointer is 0 if you are going
8465 * src/text.C: remove some dead code.
8467 * src/insets/figinset.C: remove some dead code
8469 * src/buffer.C: move the BufferView funcs to BufferView2.C
8470 remove all support for insetlatexdel
8471 remove support for oldpapersize stuff
8472 made some member funcs const
8474 * src/kbmap.C: use a std::list to store the bindings in.
8476 * src/BufferView2.C: new file
8478 * src/kbsequence.[Ch]: new files
8480 * src/LyXAction.C + others: remove all trace of buffer-previous
8482 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8483 only have one copy in the binary of this table.
8485 * hebrew patch: moved some functions from LyXText to more
8486 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8488 * several files: remove support for XForms older than 0.88
8490 remove some #if 0 #endif code
8492 * src/TextCache.[Ch]: new file. Holds the textcache.
8494 * src/BufferView.C: changes to use the new TextCache interface.
8495 (waitForX): remove the now unused code.
8497 * src/BackStack.h: remove some commented code
8499 * lib/bind/emacs.bind: remove binding for buffer-previous
8501 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8503 * applied the hebrew patch.
8505 * src/lyxrow.h: make sure that all Row variables are initialized.
8507 * src/text2.C (TextHandleUndo): comment out a delete, this might
8508 introduce a memory leak, but should also help us to not try to
8509 read freed memory. We need to look at this one.
8511 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8512 (LyXParagraph): initalize footnotekind.
8514 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8515 forgot this when applying the patch. Please heed the warnings.
8517 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8518 (aka. reformat problem)
8520 * src/bufferlist.C (exists): made const, and use const_iterator
8521 (isLoaded): new func.
8522 (release): use std::find to find the correct buffer.
8524 * src/bufferlist.h: made getState a const func.
8525 made empty a const func.
8526 made exists a const func.
8529 2000-02-01 Juergen Vigna <jug@sad.it>
8531 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8533 * po/it.po: updated a bit the italian po file and also changed the
8534 'file nuovo' for newfile to 'filenuovo' without a space, this did
8537 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8538 for the new insert_date command.
8540 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8541 from jdblair, to insert a date into the current text conforming to
8542 a strftime format (for now only considering the locale-set and not
8543 the document-language).
8545 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8547 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8548 Bounds Read error seen by purify. The problem was that islower is
8549 a macros which takes an unsigned char and uses it as an index for
8550 in array of characters properties (and is thus subject to the
8554 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8555 correctly the paper sides radio buttons.
8556 (UpdateDocumentButtons): ditto.
8558 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8560 * src/kbmap.C (getsym + others): change to return unsigned int,
8561 returning a long can give problems on 64 bit systems. (I assume
8562 that int is 32bit on 64bit systems)
8564 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8566 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8567 LyXLookupString to be zero-terminated. Really fixes problems seen
8570 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8572 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8573 write a (char*)0 to the lyxerr stream.
8575 * src/lastfiles.C: move algorithm before the using statemets.
8577 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8579 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8580 complains otherwise).
8581 * src/table.C: ditto
8583 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8586 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8587 that I removed earlier... It is really needed.
8589 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8591 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8593 * INSTALL: update xforms home page URL.
8595 * lib/configure.m4: fix a bug with unreadable layout files.
8597 * src/table.C (calculate_width_of_column): add "using std::max"
8600 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8602 * several files: marked several lines with "DEL LINE", this is
8603 lines that can be deleted without changing anything.
8604 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8605 checks this anyway */
8608 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8610 * src/DepTable.C (update): add a "+" at the end when the checksum
8611 is different. (debugging string only)
8613 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8614 the next inset to not be displayed. This should also fix the list
8615 of labels in the "Insert Crossreference" dialog.
8617 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8619 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8620 when regex was not found.
8622 * src/support/lstrings.C (lowercase): use handcoded transform always.
8625 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8626 old_cursor.par->prev could be 0.
8628 * several files: changed post inc/dec to pre inc/dec
8630 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8631 write the lastfiles to file.
8633 * src/BufferView.C (buffer): only show TextCache info when debugging
8635 (resizeCurrentBuffer): ditto
8636 (workAreaExpose): ditto
8638 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8640 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8642 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8643 a bit better by removing the special case for \i and \j.
8645 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8647 * src/lyx_main.C (easyParse): remove test for bad comand line
8648 options, since this broke all xforms-related parsing.
8650 * src/kbmap.C (getsym): set return type to unsigned long, as
8651 declared in header. On an alpha, long is _not_ the same as int.
8653 * src/support/LOstream.h: add a "using std::flush;"
8655 * src/insets/figinset.C: ditto.
8657 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8659 * src/bufferlist.C (write): use blinding fast file copy instead of
8660 "a char at a time", now we are doing it the C++ way.
8662 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8663 std::list<int> instead.
8664 (addpidwait): reflect move to std::list<int>
8665 (sigchldchecker): ditto
8667 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8670 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8671 that obviously was wrong...
8673 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8674 c, this avoids warnings with purify and islower.
8676 * src/insets/figinset.C: rename struct queue to struct
8677 queue_element and rewrite to use a std::queue. gsqueue is now a
8678 std::queue<queue_element>
8679 (runqueue): reflect move to std::queue
8682 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8683 we would get "1" "0" instead of "true" "false. Also make the tostr
8686 2000-01-21 Juergen Vigna <jug@sad.it>
8688 * src/buffer.C (writeFileAscii): Disabled code for special groff
8689 handling of tabulars till I fix this in table.C
8691 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8693 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8695 * src/support/lyxlib.h: ditto.
8697 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8699 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8700 and 'j' look better. This might fix the "macron" bug that has been
8703 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8704 functions as one template function. Delete the old versions.
8706 * src/support/lyxsum.C: move using std::ifstream inside
8709 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8712 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8714 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8716 * src/insets/figinset.C (InitFigures): use new instead of malloc
8717 to allocate memory for figures and bitmaps.
8718 (DoneFigures): use delete[] instead of free to deallocate memory
8719 for figures and bitmaps.
8720 (runqueue): use new to allocate
8721 (getfigdata): use new/delete[] instead of malloc/free
8722 (RegisterFigure): ditto
8724 * some files: moved some declarations closer to first use, small
8725 whitespace changes use preincrement instead of postincrement where
8726 it does not make a difference.
8728 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8729 step on the way to use stl::containers for key maps.
8731 * src/bufferlist.h: add a typedef for const_iterator and const
8732 versions of begin and end.
8734 * src/bufferlist.[Ch]: change name of member variable _state to
8735 state_. (avoid reserved names)
8737 (getFileNames): returns the filenames of the buffers in a vector.
8739 * configure.in (ALL_LINGUAS): added ro
8741 * src/support/putenv.C: new file
8743 * src/support/mkdir.C: new file
8745 2000-01-20 Allan Rae <rae@lyx.org>
8747 * lib/layouts/IEEEtran.layout: Added several theorem environments
8749 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8750 couple of minor additions.
8752 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8753 (except for those in footnotes of course)
8755 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8757 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8759 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8760 std::sort and std::lower_bound instead of qsort and handwritten
8762 (struct compara): struct that holds the functors used by std::sort
8763 and std::lower_bound in MathedLookupBOP.
8765 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8767 * src/support/LAssert.h: do not do partial specialization. We do
8770 * src/support/lyxlib.h: note that lyx::getUserName() and
8771 lyx::date() are not in use right now. Should these be suppressed?
8773 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8774 (makeLinuxDocFile): do not put date and user name in linuxdoc
8777 * src/support/lyxlib.h (kill): change first argument to long int,
8778 since that's what solaris uses.
8780 * src/support/kill.C (kill): fix declaration to match prototype.
8782 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8783 actually check whether namespaces are supported. This is not what
8786 * src/support/lyxsum.C: add a using directive.
8788 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8790 * src/support/kill.C: if we have namespace support we don't have
8791 to include lyxlib.h.
8793 * src/support/lyxlib.h: use namespace lyx if supported.
8795 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8797 * src/support/date.C: new file
8799 * src/support/chdir.C: new file
8801 * src/support/getUserName.C: new file
8803 * src/support/getcwd.C: new file
8805 * src/support/abort.C: new file
8807 * src/support/kill.C: new file
8809 * src/support/lyxlib.h: moved all the functions in this file
8810 insede struct lyx. Added also kill and abort to this struct. This
8811 is a way to avoid the "kill is not defined in <csignal>", we make
8812 C++ wrappers for functions that are not ANSI C or ANSI C++.
8814 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8815 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8816 lyx it has been renamed to sum.
8818 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8820 * src/text.C: add using directives for std::min and std::max.
8822 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8824 * src/texrow.C (getIdFromRow): actually return something useful in
8825 id and pos. Hopefully fixes the bug with positionning of errorbox
8828 * src/lyx_main.C (easyParse): output an error and exit if an
8829 incorrect command line option has been given.
8831 * src/spellchecker.C (ispell_check_word): document a memory leak.
8833 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8834 where a "struct utimbuf" is allocated with "new" and deleted with
8837 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8839 * src/text2.C (CutSelection): don't delete double spaces.
8840 (PasteSelection): ditto
8841 (CopySelection): ditto
8843 * src/text.C (Backspace): don't delete double spaces.
8845 * src/lyxlex.C (next): fix a bug that were only present with
8846 conformant std::istream::get to read comment lines, use
8847 std::istream::getline instead. This seems to fix the problem.
8849 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8851 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8852 allowed to insert space before space" editing problem. Please read
8853 commends at the beginning of the function. Comments about usage
8856 * src/text.C (InsertChar): fix for the "not allowed to insert
8857 space before space" editing problem.
8859 * src/text2.C (DeleteEmptyParagraphMechanism): when
8860 IsEmptyTableRow can only return false this last "else if" will
8861 always be a no-op. Commented out.
8863 * src/text.C (RedoParagraph): As far as I can understand tmp
8864 cursor is not really needed.
8866 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8867 present it could only return false anyway.
8868 (several functions): Did something not so smart...added a const
8869 specifier on a lot of methods.
8871 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8872 and add a tmp->text.resize. The LyXParagraph constructor does the
8874 (BreakParagraphConservative): ditto
8876 * src/support/path.h (Path): add a define so that the wrong usage
8877 "Path("/tmp") will be flagged as a compilation error:
8878 "`unnamed_Path' undeclared (first use this function)"
8880 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8882 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8883 which was bogus for several reasons.
8885 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8889 * autogen.sh: do not use "type -path" (what's that anyway?).
8891 * src/support/filetools.C (findtexfile): remove extraneous space
8892 which caused a kpsewhich warning (at least with kpathsea version
8895 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8897 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8899 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8901 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8903 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8905 * src/paragraph.C (BreakParagraph): do not reserve space on text
8906 if we don't need to (otherwise, if pos_end < pos, we end up
8907 reserving huge amounts of memory due to bad unsigned karma).
8908 (BreakParagraphConservative): ditto, although I have not seen
8909 evidence the bug can happen here.
8911 * src/lyxparagraph.h: add a using std::list.
8913 2000-01-11 Juergen Vigna <jug@sad.it>
8915 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8918 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8920 * src/vc-backend.C (doVCCommand): change to be static and take one
8921 more parameter: the path to chdir too be fore executing the command.
8922 (retrive): new function equiv to "co -r"
8924 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8925 file_not_found_hook is true.
8927 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8929 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8930 if a file is readwrite,readonly...anything else.
8932 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8934 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8935 (CreatePostscript): name change from MenuRunDVIPS (or something)
8936 (PreviewPostscript): name change from MenuPreviewPS
8937 (PreviewDVI): name change from MenuPreviewDVI
8939 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8940 \view_pdf_command., \pdf_to_ps_command
8942 * lib/configure.m4: added search for PDF viewer, and search for
8943 PDF to PS converter.
8944 (lyxrc.defaults output): add \pdflatex_command,
8945 \view_pdf_command and \pdf_to_ps_command.
8947 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8949 * src/bufferlist.C (write): we don't use blocksize for anything so
8952 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8954 * src/support/block.h: disable operator T* (), since it causes
8955 problems with both compilers I tried. See comments in the file.
8957 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8960 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8961 variable LYX_DIR_10x to LYX_DIR_11x.
8963 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8965 * INSTALL: document --with-lyxname.
8968 * configure.in: new configure flag --with-lyxname which allows to
8969 choose the name under which lyx is installed. Default is "lyx", of
8970 course. It used to be possible to do this with --program-suffix,
8971 but the later has in fact a different meaning for autoconf.
8973 * src/support/lstrings.h (lstrchr): reformat a bit.
8975 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8976 * src/mathed/math_defs.h: ditto.
8978 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8980 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8981 true, decides if we create a backup file or not when saving. New
8982 tag and variable \pdf_mode, defaults to false. New tag and
8983 variable \pdflatex_command, defaults to pdflatex. New tag and
8984 variable \view_pdf_command, defaults to xpdf. New tag and variable
8985 \pdf_to_ps_command, defaults to pdf2ps.
8987 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8989 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8990 does not have a BufferView.
8991 (unlockInset): ditto + don't access the_locking_inset if the
8992 buffer does not have a BufferView.
8994 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8995 certain circumstances so that we don't continue a keyboard
8996 operation long after the key was released. Try f.ex. to load a
8997 large document, press PageDown for some seconds and then release
8998 it. Before this change the document would contine to scroll for
8999 some time, with this change it stops imidiatly.
9001 * src/support/block.h: don't allocate more space than needed. As
9002 long as we don't try to write to the arr[x] in a array_type arr[x]
9003 it is perfectly ok. (if you write to it you might segfault).
9004 added operator value_type*() so that is possible to pass the array
9005 to functions expecting a C-pointer.
9007 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9010 * intl/*: updated to gettext 0.10.35, tried to add our own
9011 required modifications. Please verify.
9013 * po/*: updated to gettext 0.10.35, tried to add our own required
9014 modifications. Please verify.
9016 * src/support/lstrings.C (tostr): go at fixing the problem with
9017 cxx and stringstream. When stringstream is used return
9018 oss.str().c_str() so that problems with lyxstring and basic_string
9019 are avoided. Note that the best solution would be for cxx to use
9020 basic_string all the way, but it is not conformant yet. (it seems)
9022 * src/lyx_cb.C + other files: moved several global functions to
9023 class BufferView, some have been moved to BufferView.[Ch] others
9024 are still located in lyx_cb.C. Code changes because of this. (part
9025 of "get rid of current_view project".)
9027 * src/buffer.C + other files: moved several Buffer functions to
9028 class BufferView, the functions are still present in buffer.C.
9029 Code changes because of this.
9031 * config/lcmessage.m4: updated to most recent. used when creating
9034 * config/progtest.m4: updated to most recent. used when creating
9037 * config/gettext.m4: updated to most recent. applied patch for
9040 * config/gettext.m4.patch: new file that shows what changes we
9041 have done to the local copy of gettext.m4.
9043 * config/libtool.m4: new file, used in creation of acinclude.m4
9045 * config/lyxinclude.m4: new file, this is the lyx created m4
9046 macros, used in making acinclude.m4.
9048 * autogen.sh: GNU m4 discovered as a separate task not as part of
9049 the lib/configure creation.
9050 Generate acinlucde from files in config. Actually cat
9051 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9052 easier to upgrade .m4 files that really are external.
9054 * src/Spacing.h: moved using std::istringstream to right after
9055 <sstream>. This should fix the problem seen with some compilers.
9057 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9059 * src/lyx_cb.C: began some work to remove the dependency a lot of
9060 functions have on BufferView::text, even if not really needed.
9061 (GetCurrentTextClass): removed this func, it only hid the
9064 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9065 forgot this in last commit.
9067 * src/Bullet.C (bulletEntry): use static char const *[] for the
9068 tables, becuase of this the return arg had to change to string.
9070 (~Bullet): removed unneeded destructor
9072 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9073 (insetSleep): moved from Buffer
9074 (insetWakeup): moved from Buffer
9075 (insetUnlock): moved from Buffer
9077 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9078 from Buffer to BufferView.
9080 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9082 * config/ltmain.sh: updated to version 1.3.4 of libtool
9084 * config/ltconfig: updated to version 1.3.4 of libtool
9086 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9089 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9090 Did I get that right?
9092 * src/lyxlex.h: add a "using" directive or two.
9093 * src/Spacing.h: ditto.
9094 * src/insets/figinset.C: ditto.
9095 * src/support/filetools.C: ditto.
9096 * src/support/lstrings.C: ditto.
9097 * src/BufferView.C: ditto.
9098 * src/bufferlist.C: ditto.
9099 * src/lyx_cb.C: ditto.
9100 * src/lyxlex.C: ditto.
9102 * NEWS: add some changes for 1.1.4.
9104 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9106 * src/BufferView.C: first go at a TextCache to speed up switching
9109 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9111 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9112 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9113 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9114 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9117 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9118 members of the struct are correctly initialized to 0 (detected by
9120 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9121 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9123 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9124 pidwait, since it was allocated with "new". This was potentially
9125 very bad. Thanks to Michael Schmitt for running purify for us.
9128 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9130 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9132 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9134 1999-12-30 Allan Rae <rae@lyx.org>
9136 * lib/templates/IEEEtran.lyx: minor change
9138 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9139 src/mathed/formula.C (LocalDispatch): askForText changes
9141 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9142 know when a user has cancelled input. Fixes annoying problems with
9143 inserting labels and version control.
9145 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9147 * src/support/lstrings.C (tostr): rewritten to use strstream and
9150 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9152 * src/support/filetools.C (IsFileWriteable): use fstream to check
9153 (IsDirWriteable): use fileinfo to check
9155 * src/support/filetools.h (FilePtr): whole class deleted
9157 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9159 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9161 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9163 * src/bufferlist.C (write): use ifstream and ofstream instead of
9166 * src/Spacing.h: use istrstream instead of sscanf
9168 * src/mathed/math_defs.h: change first arg to istream from FILE*
9170 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9172 * src/mathed/math_parser.C: have yyis to be an istream
9173 (LexGetArg): use istream (yyis)
9175 (mathed_parse): ditto
9176 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9178 * src/mathed/formula.C (Read): rewritten to use istream
9180 * src/mathed/formulamacro.C (Read): rewritten to use istream
9182 * src/lyxlex.h (~LyXLex): deleted desturctor
9183 (getStream): new function, returns an istream
9184 (getFile): deleted funtion
9185 (IsOK): return is.good();
9187 * src/lyxlex.C (LyXLex): delete file and owns_file
9188 (setFile): open an filebuf and assign that to a istream instead of
9190 (setStream): new function, takes an istream as arg.
9191 (setFile): deleted function
9192 (EatLine): rewritten us use istream instead of FILE*
9196 * src/table.C (LyXTable): use istream instead of FILE*
9197 (Read): rewritten to take an istream instead of FILE*
9199 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9201 * src/buffer.C (Dispatch): remove an extraneous break statement.
9203 * src/support/filetools.C (QuoteName): change to do simple
9204 'quoting'. More work is necessary. Also changed to do nothing
9205 under emx (needs fix too).
9206 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9208 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9209 config.h.in to the AC_DEFINE_UNQUOTED() call.
9210 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9211 needs char * as argument (because Solaris 7 declares it like
9214 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9215 remove definition of BZERO.
9217 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9219 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9220 defined, "lyxregex.h" if not.
9222 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9224 (REGEX): new variable that is set to regex.c lyxregex.h when
9225 AM_CONDITIONAL USE_REGEX is set.
9226 (libsupport_la_SOURCES): add $(REGEX)
9228 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9231 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9234 * configure.in: add call to LYX_REGEX
9236 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9237 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9239 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9241 * lib/bind/fi_menus.bind: new file, from
9242 pauli.virtanen@saunalahti.fi.
9244 * src/buffer.C (getBibkeyList): pass the parameter delim to
9245 InsetInclude::getKeys and InsetBibtex::getKeys.
9247 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9248 is passed to Buffer::getBibkeyList
9250 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9251 instead of the hardcoded comma.
9253 * src/insets/insetbib.C (getKeys): make sure that there are not
9254 leading blanks in bibtex keys. Normal latex does not care, but
9255 harvard.sty seems to dislike blanks at the beginning of citation
9256 keys. In particular, the retturn value of the function is
9258 * INSTALL: make it clear that libstdc++ is needed and that gcc
9259 2.7.x probably does not work.
9261 * src/support/filetools.C (findtexfile): make debug message go to
9263 * src/insets/insetbib.C (getKeys): ditto
9265 * src/debug.C (showTags): make sure that the output is correctly
9268 * configure.in: add a comment for TWO_COLOR_ICON define.
9270 * acconfig.h: remove all the entries that already defined in
9271 configure.in or acinclude.m4.
9273 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9274 to avoid user name, date and copyright.
9276 1999-12-21 Juergen Vigna <jug@sad.it>
9278 * src/table.C (Read): Now read bogus row format informations
9279 if the format is < 5 so that afterwards the table can
9280 be read by lyx but without any format-info. Fixed the
9281 crash we experienced when not doing this.
9283 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9285 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9286 (RedoDrawingOfParagraph): ditto
9287 (RedoParagraphs): ditto
9288 (RemoveTableRow): ditto
9290 * src/text.C (Fill): rename arg paperwidth -> paper_width
9292 * src/buffer.C (insertLyXFile): rename var filename -> fname
9293 (writeFile): rename arg filename -> fname
9294 (writeFileAscii): ditto
9295 (makeLaTeXFile): ditto
9296 (makeLinuxDocFile): ditto
9297 (makeDocBookFile): ditto
9299 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9302 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9304 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9307 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9308 compiled by a C compiler not C++.
9310 * src/layout.h (LyXTextClass): added typedef for const_iterator
9311 (LyXTextClassList): added typedef for const_iterator + member
9312 functions begin and end.
9314 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9315 iterators to fill the choice_class.
9316 (updateLayoutChoice): rewritten to use iterators to fill the
9317 layoutlist in the toolbar.
9319 * src/BufferView.h (BufferView::work_area_width): removed unused
9322 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9324 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9325 (sgmlCloseTag): ditto
9327 * src/support/lstrings.h: return type of countChar changed to
9330 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9331 what version of this func to use. Also made to return unsigned int.
9333 * configure.in: call LYX_STD_COUNT
9335 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9336 conforming std::count.
9338 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9340 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9341 and a subscript would give bad display (patch from Dekel Tsur
9342 <dekel@math.tau.ac.il>).
9344 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9346 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9349 * src/chset.h: add a few 'using' directives
9351 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9352 triggered when no buffer is active
9354 * src/layout.C: removed `break' after `return' in switch(), since
9357 * src/lyx_main.C (init): make sure LyX can be ran in place even
9358 when libtool has done its magic with shared libraries. Fix the
9359 test for the case when the system directory has not been found.
9361 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9362 name for the latex file.
9363 (MenuMakeHTML): ditto
9365 * src/buffer.h: add an optional boolean argument, which is passed
9368 1999-12-20 Allan Rae <rae@lyx.org>
9370 * lib/templates/IEEEtran.lyx: small correction and update.
9372 * configure.in: Attempted to use LYX_PATH_HEADER
9374 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9376 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9377 input from JMarc. Now use preprocessor to find the header.
9378 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9379 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9380 LYX_STL_STRING_FWD. See comments in file.
9382 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9384 * The global MiniBuffer * minibuffer variable is dead.
9386 * The global FD_form_main * fd_form_main variable is dead.
9388 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9390 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9392 * src/table.h: add the LOstream.h header
9393 * src/debug.h: ditto
9395 * src/LyXAction.h: change the explaination of the ReadOnly
9396 attribute: is indicates that the function _can_ be used.
9398 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9401 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9403 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9409 * src/paragraph.C (GetWord): assert on pos>=0
9412 * src/support/lyxstring.C: condition the use of an invariant on
9414 * src/support/lyxstring.h: ditto
9416 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9417 Use LAssert.h instead of plain assert().
9419 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9421 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9422 * src/support/filetools.C: ditto
9424 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9427 * INSTALL: document the new configure flags
9429 * configure.in: suppress --with-debug; add --enable-assertions
9431 * acinclude.m4: various changes in alignment of help strings.
9433 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9435 * src/kbmap.C: commented out the use of the hash map in kb_map,
9436 beginning of movement to a stl::container.
9438 * several files: removed code that was not in effect when
9439 MOVE_TEXT was defined.
9441 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9442 for escaping should not be used. We can discuss if the string
9443 should be enclosed in f.ex. [] instead of "".
9445 * src/trans_mgr.C (insert): use the new returned value from
9446 encodeString to get deadkeys and keymaps done correctly.
9448 * src/chset.C (encodeString): changed to return a pair, to tell
9449 what to use if we know the string.
9451 * src/lyxscreen.h (fillArc): new function.
9453 * src/FontInfo.C (resize): rewritten to use more std::string like
9454 structore, especially string::replace.
9456 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9459 * configure.in (chmod +x some scripts): remove config/gcc-hack
9461 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9463 * src/buffer.C (writeFile): change once again the top comment in a
9464 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9465 instead of an hardcoded version number.
9466 (makeDocBookFile): ditto
9468 * src/version.h: add new define LYX_DOCVERSION
9470 * po/de.po: update from Pit Sütterlin
9471 * lib/bind/de_menus.bind: ditto.
9473 * src/lyxfunc.C (Dispatch): call MenuExport()
9474 * src/buffer.C (Dispatch): ditto
9476 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9477 LyXFunc::Dispatch().
9478 (MenuExport): new function, moved from
9479 LyXFunc::Dispatch().
9481 * src/trans_mgr.C (insert): small cleanup
9482 * src/chset.C (loadFile): ditto
9484 * lib/kbd/iso8859-1.cdef: add missing backslashes
9486 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9488 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9489 help with placing the manually drawn accents better.
9491 (Draw): x2 and hg changed to float to minimize rounding errors and
9492 help place the accents better.
9494 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9495 unsigned short to char is just wrong...cast the char to unsigned
9496 char instead so that the two values can compare sanely. This
9497 should also make the display of insetlatexaccents better and
9498 perhaps also some other insets.
9500 (lbearing): new function
9503 1999-12-15 Allan Rae <rae@lyx.org>
9505 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9506 header that provides a wrapper around the very annoying SGI STL header
9509 * src/support/lyxstring.C, src/LString.h:
9510 removed old SGI-STL-compatability attempts.
9512 * configure.in: Use LYX_STL_STRING_FWD.
9514 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9515 stl_string_fwd.h is around and try to determine it's location.
9516 Major improvement over previous SGI STL 3.2 compatability.
9517 Three small problems remain with this function due to my zero
9518 knowledge of autoconf. JMarc and lgb see the comments in the code.
9520 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9522 * src/broken_const.h, config/hack-gcc, config/README: removed
9524 * configure.in: remove --with-gcc-hack option; do not call
9527 * INSTALL: remove documentation of --with-broken-const and
9530 * acconfig.h: remove all trace of BROKEN_CONST define
9532 * src/buffer.C (makeDocBookFile): update version number in output
9534 (SimpleDocBookOnePar): fix an assert when trying to a character
9535 access beyond string length
9538 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9540 * po/de.po: fix the Export menu
9542 * lyx.man: update the description of -dbg
9544 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9545 (commandLineHelp): updated
9546 (easyParse): show list of available debug levels if -dbg is passed
9549 * src/Makefile.am: add debug.C
9551 * src/debug.h: moved some code to debug.C
9553 * src/debug.C: new file. Contains code to set and show debug
9556 * src/layout.C: remove 'break' after 'continue' in switch
9557 statements, since these cannot be reached.
9559 1999-12-13 Allan Rae <rae@lyx.org>
9561 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9562 (in_word_set): hash() -> math_hash()
9564 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9566 * acconfig.h: Added a test for whether we are using exceptions in the
9567 current compilation run. If so USING_EXCEPTIONS is defined.
9569 * config.in: Check for existance of stl_string_fwd.h
9570 * src/LString.h: If compiling --with-included-string and SGI's
9571 STL version 3.2 is present (see above test) we need to block their
9572 forward declaration of string and supply a __get_c_string().
9573 However, it turns out this is only necessary if compiling with
9574 exceptions enabled so I've a bit more to add yet.
9576 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9577 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9578 src/support/LRegex.h, src/undo.h:
9579 Shuffle the order of the included files a little to ensure that
9580 LString.h gets included before anything that includes stl_string_fwd.h
9582 * src/support/lyxstring.C: We need to #include LString.h instead of
9583 lyxstring.h to get the necessary definition of __get_c_string.
9584 (__get_c_string): New function. This is defined static just like SGI's
9585 although why they need to do this I'm not sure. Perhaps it should be
9586 in lstrings.C instead.
9588 * lib/templates/IEEEtran.lyx: New template file.
9590 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9592 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9593 * intl/Makefile.in (MKINSTALLDIRS): ditto
9595 * src/LyXAction.C (init): changed to hold the LFUN data in a
9596 automatic array in stead of in callso to newFunc, this speeds up
9597 compilation a lot. Also all the memory used by the array is
9598 returned when the init is completed.
9600 * a lot of files: compiled with -Wold-style-cast, changed most of
9601 the reported offenders to C++ style casts. Did not change the
9602 offenders in C files.
9604 * src/trans.h (Match): change argument type to unsigned int.
9606 * src/support/DebugStream.C: fix some types on the streambufs so
9607 that it works on a conforming implementation.
9609 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9611 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9613 * src/support/lyxstring.C: remove the inline added earlier since
9614 they cause a bunch of unsatisfied symbols when linking with dec
9615 cxx. Cxx likes to have the body of inlines at the place where they
9618 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9619 accessing negative bounds in array. This fixes the crash when
9620 inserting accented characters.
9621 * src/trans.h (Match): ditto
9623 * src/buffer.C (Dispatch): since this is a void, it should not try
9624 to return anything...
9626 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9628 * src/buffer.h: removed the two friends from Buffer. Some changes
9629 because of this. Buffer::getFileName and Buffer::setFileName
9630 renamed to Buffer::fileName() and Buffer::fileName(...).
9632 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9634 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9635 and Buffer::update(short) to BufferView. This move is currently
9636 controlled by a define MOVE_TEXT, this will be removed when all
9637 shows to be ok. This move paves the way for better separation
9638 between buffer contents and buffer view. One side effect is that
9639 the BufferView needs a rebreak when swiching buffers, if we want
9640 to avoid this we can add a cache that holds pointers to LyXText's
9641 that is not currently in use.
9643 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9646 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9648 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9650 * lyx_main.C: new command line option -x (or --execute) and
9651 -e (or --export). Now direct conversion from .lyx to .tex
9652 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9653 Unfortunately, X is still needed and the GUI pops up during the
9656 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9658 * src/Spacing.C: add a using directive to bring stream stuff into
9660 * src/paragraph.C: ditto
9661 * src/buffer.C: ditto
9663 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9664 from Lars' announcement).
9666 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9667 example files from Tino Meinen.
9669 1999-12-06 Allan Rae <rae@lyx.org>
9671 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9673 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9675 * src/support/lyxstring.C: added a lot of inline for no good
9678 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9679 latexWriteEndChanges, they were not used.
9681 * src/layout.h (operator<<): output operator for PageSides
9683 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9685 * some example files: loaded in LyX 1.0.4 and saved again to update
9686 certain constructs (table format)
9688 * a lot of files: did the change to use fstream/iostream for all
9689 writing of files. Done with a close look at Andre Poenitz's patch.
9691 * some files: whitespace changes.
9693 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9695 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9696 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9697 architecture, we provide our own. It is used unconditionnally, but
9698 I do not think this is a performance problem. Thanks to Angus
9699 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9700 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9702 (GetInset): use my_memcpy.
9706 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9707 it is easier to understand, but it uses less TeX-only constructs now.
9709 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9710 elements contain spaces
9712 * lib/configure: regenerated
9714 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9715 elements contain spaces; display the list of programs that are
9718 * autogen.sh: make sure lib/configure is executable
9720 * lib/examples/*: rename the tutorial examples to begin with the
9721 two-letters language code.
9723 * src/lyxfunc.C (getStatus): do not query current font if no
9726 * src/lyx_cb.C (RunScript): use QuoteName
9727 (MenuRunDvips): ditto
9728 (PrintApplyCB): ditto
9730 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9731 around argument, so that it works well with the current shell.
9732 Does not work properly with OS/2 shells currently.
9734 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9735 * src/LyXSendto.C (SendtoApplyCB): ditto
9736 * src/lyxfunc.C (Dispatch): ditto
9737 * src/buffer.C (runLaTeX): ditto
9738 (runLiterate): ditto
9739 (buildProgram): ditto
9741 * src/lyx_cb.C (RunScript): ditto
9742 (MenuMakeLaTeX): ditto
9744 * src/buffer.h (getLatexName): new method
9746 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9748 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9750 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9751 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9752 (create_math_panel): ditto
9754 * src/lyxfunc.C (getStatus): re-activate the code which gets
9755 current font and cursor; add test for export to html.
9757 * src/lyxrc.C (read): remove unreachable break statements; add a
9760 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9762 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9764 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9765 introduced by faulty regex.
9766 * src/buffer.C: ditto
9767 * src/lastfiles.C: ditto
9768 * src/paragraph.C: ditto
9769 * src/table.C: ditto
9770 * src/vspace.C: ditto
9771 * src/insets/figinset.C: ditto
9772 Note: most of these is absolutely harmless, except the one in
9773 src/mathed formula.C.
9775 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9777 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9778 operation, yielding correct results for the reLyX command.
9780 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9782 * src/support/filetools.C (ExpandPath): removed an over eager
9784 (ReplaceEnvironmentPath): ditto
9786 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9787 shows that we are doing something fishy in our code...
9791 * src/lyxrc.C (read): use a double switch trick to get more help
9792 from the compiler. (the same trick is used in layout.C)
9793 (write): new function. opens a ofstream and pass that to output
9794 (output): new function, takes a ostream and writes the lyxrc
9795 elemts to it. uses a dummy switch to make sure no elements are
9798 * src/lyxlex.h: added a struct pushpophelper for use in functions
9799 with more than one exit point.
9801 * src/lyxlex.[Ch] (GetInteger): made it const
9805 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9807 * src/layout.[hC] : LayoutTags splitted into several enums, new
9808 methods created, better error handling cleaner use of lyxlex. Read
9811 * src/bmtable.[Ch]: change some member prototypes because of the
9812 image const changes.
9814 * commandtags.h, src/LyXAction.C (init): new function:
9815 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9816 This file is not read automatically but you can add \input
9817 preferences to your lyxrc if you want to. We need to discuss how
9820 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9821 in .aux, also remove .bib and .bst files from dependencies when
9824 * src/BufferView.C, src/LyXView.C: add const_cast several places
9825 because of changes to images.
9827 * lib/images/*: same change as for images/*
9829 * lib/lyxrc.example: Default for accept_compound is false not no.
9831 * images/*: changed to be const, however I have som misgivings
9832 about this change so it might be changed back.
9834 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9836 * lib/configure, po/POTFILES.in: regenerated
9838 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9840 * config/lib_configure.m4: removed
9842 * lib/configure.m4: new file (was config/lib_configure.m4)
9844 * configure.in: do not test for rtti, since we do not use it.
9846 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9848 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9849 doubling of allocated space scheme. This makes it faster for large
9850 strings end to use less memory for small strings. xtra rememoved.
9852 * src/insets/figinset.C (waitalarm): commented out.
9853 (GhostscriptMsg): use static_cast
9854 (GhostscriptMsg): use new instead of malloc to allocate memory for
9855 cmap. also delete the memory after use.
9857 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9859 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9860 for changes in bibtex database or style.
9861 (runBibTeX): remove all .bib and .bst files from dep before we
9863 (run): use scanAuc in when dep file already exist.
9865 * src/DepTable.C (remove_files_with_extension): new method
9868 * src/DepTable.[Ch]: made many of the methods const.
9870 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9872 * src/bufferparams.C: make sure that the default textclass is
9873 "article". It used to be the first one by description order, but
9874 now the first one is "docbook".
9876 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9877 string; call Debug::value.
9878 (easyParse): pass complete argument to setDebuggingLevel().
9880 * src/debug.h (value): fix the code that parses debug levels.
9882 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9885 * src/LyXAction.C: use Debug::ACTION as debug channel.
9887 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9889 * NEWS: updated for the future 1.1.3 release.
9891 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9892 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9893 it should. This is of course a controversial change (since many
9894 people will find that their lyx workscreen is suddenly full of
9895 red), but done for the sake of correctness.
9897 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9898 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9900 * src/insets/inseterror.h, src/insets/inseturl.h,
9901 src/insets/insetinfo.h, src/insets/figinset.h,
9902 src/mathed/formulamacro.h, src/mathed/math_macro.h
9903 (EditMessage): add a missing const and add _() to make sure that
9906 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9907 src/insets/insetbib.C, src/support/filetools.C: add `using'
9910 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9911 doing 'Insert index of last word' at the beginning of a paragraph.
9913 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9915 * several files: white-space changes.
9917 * src/mathed/formula.C: removed IsAlpha and IsDigit
9919 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9920 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9923 * src/insets/figinset.C (GetPSSizes): don't break when
9924 "EndComments" is seen. But break when a boundingbox is read.
9926 * all classes inherited from Inset: return value of Clone
9927 changed back to Inset *.
9929 * all classes inherited form MathInset: return value of Clone
9930 changed back to MathedInset *.
9932 * src/insets/figinset.C (runqueue): use a ofstream to output the
9933 gs/ps file. Might need some setpresicion or setw. However I can
9934 see no problem with the current code.
9935 (runqueue): use sleep instead of the alarm/signal code. I just
9936 can't see the difference.
9938 * src/paragraph.C (LyXParagraph): reserve space in the new
9939 paragraph and resize the inserted paragraph to just fit.
9941 * src/lyxfunc.h (operator|=): added operator for func_status.
9943 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9944 check for readable file.
9946 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9947 check for readable file.
9948 (MenuMakeLinuxDoc): ditto
9949 (MenuMakeDocBook): ditto
9950 (MenuMakeAscii): ditto
9951 (InsertAsciiFile): split the test for openable and readable
9953 * src/bmtable.C (draw_bitmaptable): use
9954 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9956 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9957 findtexfile from LaTeX to filetools.
9959 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9960 instead of FilePtr. Needs to be verified by a literate user.
9962 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9964 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9965 (EditMessage): likewise.
9967 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9968 respectively as \textasciitilde and \textasciicircum.
9970 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9972 * src/support/lyxstring.h: made the methods that take iterators
9975 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9976 (regexMatch): made is use the real regex class.
9978 * src/support/Makefile.am: changed to use libtool
9980 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9982 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9984 (MathIsInset ++): changed several macros to be inline functions
9987 * src/mathed/Makefile.am: changed to use libtool
9989 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9991 * src/insets/inset* : Clone changed to const and return type is
9992 the true insettype not just Inset*.
9994 * src/insets/Makefile.am: changed to use libtool
9996 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9998 * src/undo.[Ch] : added empty() and changed some of the method
10001 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10003 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10004 setID use block<> for the bullets array, added const several places.
10006 * src/lyxfunc.C (getStatus): new function
10008 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10009 LyXAction, added const to several funtions.
10011 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10012 a std::map, and to store the dir items in a vector.
10014 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10017 * src/LyXView.[Ch] + other files : changed currentView to view.
10019 * src/LyXAction.[Ch] : ported from the old devel branch.
10021 * src/.cvsignore: added .libs and a.out
10023 * configure.in : changes to use libtool.
10025 * acinclude.m4 : inserted libtool.m4
10027 * .cvsignore: added libtool
10029 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10031 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10032 file name in insets and mathed directories (otherwise the
10033 dependency is not taken in account under cygwin).
10035 * src/text2.C (InsertString[AB]): make sure that we do not try to
10036 read characters past the string length.
10038 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10040 * lib/doc/LaTeXConfig.lyx.in,
10041 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10043 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10044 file saying who created them and when this heppened; this is
10045 useless and annoys tools like cvs.
10047 * lib/layouts/g-brief-{en,de}.layout,
10048 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10049 from Thomas Hartkens <thomas@hartkens.de>.
10051 * src/{insets,mathed}/Makefile.am: do not declare an empty
10052 LDFLAGS, so that it can be set at configure time (useful on Irix
10055 * lib/reLyX/configure.in: make sure that the prefix is set
10056 correctly in LYX_DIR.
10058 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10060 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10061 be used by 'command-sequence' this allows to bind a key to a
10062 sequence of LyX-commands
10063 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10065 * src/LyXAction.C: add "command-sequence"
10067 * src/LyXFunction.C: handling of "command-sequence"
10069 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10070 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10072 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10074 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10076 * src/buffer.C (writeFile): Do not output a comment giving user
10077 and date at the beginning of a .lyx file. This is useless and
10078 annoys cvs anyway; update version number to 1.1.
10080 * src/Makefile.am (LYX_DIR): add this definition, so that a
10081 default path is hardcoded in LyX.
10083 * configure.in: Use LYX_GNU_GETTEXT.
10085 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10086 AM_GNU_GETTEXT with a bug fixed.
10088 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10090 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10092 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10093 which is used to point to LyX data is now LYX_DIR_11x.
10095 * lyx.man: convert to a unix text file; small updates.
10097 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10099 * src/support/LSubstring.[Ch]: made the second arg of most of the
10100 constructors be a const reference.
10102 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10105 * src/support/lyxstring.[Ch] (swap): added missing member function
10106 and specialization of swap(str, str);
10108 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10110 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10111 trace of the old one.
10113 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10114 put the member definitions in undo.C.
10116 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10117 NEW_TEXT and have now only code that was included when this was
10120 * src/intl.C (LCombo): use static_cast
10122 (DispatchCallback): ditto
10124 * src/definitions.h: removed whole file
10126 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10128 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10129 parsing and stores in a std:map. a regex defines the file format.
10130 removed unneeded members.
10132 * src/bufferparams.h: added several enums from definitions.h here.
10133 Removed unsused destructor. Changed some types to use proper enum
10134 types. use block to have the temp_bullets and user_defined_bullets
10135 and to make the whole class assignable.
10137 * src/bufferparams.C (Copy): removed this functions, use a default
10138 assignment instead.
10140 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10143 * src/buffer.C (readLyXformat2): commend out all that have with
10144 oldpapersize to do. also comment out all that hve to do with
10145 insetlatex and insetlatexdel.
10146 (setOldPaperStuff): commented out
10148 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10150 * src/LyXAction.C: remove use of inset-latex-insert
10152 * src/mathed/math_panel.C (button_cb): use static_cast
10154 * src/insets/Makefile.am (insets_o_SOURCES): removed
10157 * src/support/lyxstring.C (helper): use the unsigned long
10158 specifier, UL, instead of a static_cast.
10160 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10162 * src/support/block.h: new file. to be used as a c-style array in
10163 classes, so that the class can be assignable.
10165 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10167 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10168 NULL, make sure to return an empty string (it is not possible to
10169 set a string to NULL).
10171 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10173 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10175 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10177 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10178 link line, so that Irix users (for example) can set it explicitely to
10181 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10182 it can be overidden at make time (static or dynamic link, for
10185 * src/vc-backend.C, src/LaTeXFeatures.h,
10186 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10187 statements to bring templates to global namespace.
10189 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10191 * src/support/lyxstring.C (operator[] const): make it standard
10194 * src/minibuffer.C (Init): changed to reflect that more
10195 information is given from the lyxvc and need not be provided here.
10197 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10199 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10201 * src/LyXView.C (UpdateTimerCB): use static_cast
10202 (KeyPressMask_raw_callback): ditto
10204 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10205 buffer_, a lot of changes because of this. currentBuffer() ->
10206 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10207 also changes to other files because of this.
10209 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10211 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10212 have no support for RCS and partial support for CVS, will be
10215 * src/insets/ several files: changes because of function name
10216 changes in Bufferview and LyXView.
10218 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10220 * src/support/LSubstring.[Ch]: new files. These implement a
10221 Substring that can be very convenient to use. i.e. is this
10223 string a = "Mary had a little sheep";
10224 Substring(a, "sheep") = "lamb";
10225 a is now "Mary has a little lamb".
10227 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10228 out patterns and subpatterns of strings. It is used by LSubstring
10229 and also by vc-backend.C
10231 * src/support/lyxstring.C: went over all the assertions used and
10232 tried to correct the wrong ones and flag which of them is required
10233 by the standard. some bugs found because of this. Also removed a
10234 couple of assertions.
10236 * src/support/Makefile.am (libsupport_a_SOURCES): added
10237 LSubstring.[Ch] and LRegex.[Ch]
10239 * src/support/FileInfo.h: have struct stat buf as an object and
10240 not a pointer to one, some changes because of this.
10242 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10243 information in layout when adding the layouts preamble to the
10244 textclass preamble.
10246 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10249 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10250 because of bug in OS/2.
10252 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10254 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10255 \verbatim@font instead of \ttfamily, so that it can be redefined.
10257 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10258 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10259 src/layout.h, src/text2.C: add 'using' directive to bring the
10260 STL templates we need from the std:: namespace to the global one.
10261 Needed by DEC cxx in strict ansi mode.
10263 * src/support/LIstream.h,src/support/LOstream.h,
10264 src/support/lyxstring.h,src/table.h,
10265 src/lyxlookup.h: do not include <config.h> in header
10266 files. This should be done in the .C files only.
10268 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10272 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10274 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10275 from Kayvan to fix the tth invokation.
10277 * development/lyx.spec.in: updates from Kayvan to reflect the
10278 changes of file names.
10280 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10282 * src/text2.C (InsertStringB): use std::copy
10283 (InsertStringA): use std::copy
10285 * src/bufferlist.C: use a vector to store the buffers in. This is
10286 an internal change and should not affect any other thing.
10288 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10291 * src/text.C (Fill): fix potential bug, one off bug.
10293 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10295 * src/Makefile.am (lyx_main.o): add more files it depends on.
10297 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10299 * src/support/lyxstring.C: use size_t for the reference count,
10300 size, reserved memory and xtra.
10301 (internal_compare): new private member function. Now the compare
10302 functions should work for std::strings that have embedded '\0'
10304 (compare): all compare functions rewritten to use
10307 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10309 * src/support/lyxstring.C (compare): pass c_str()
10310 (compare): pass c_str
10311 (compare): pass c_str
10313 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10315 * src/support/DebugStream.C: <config.h> was not included correctly.
10317 * lib/configure: forgot to re-generate it :( I'll make this file
10318 auto generated soon.
10320 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10322 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10325 * src/support/lyxstring.C: some changes from length() to rep->sz.
10326 avoids a function call.
10328 * src/support/filetools.C (SpaceLess): yet another version of the
10329 algorithm...now per Jean-Marc's suggestions.
10331 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10333 * src/layout.C (less_textclass_desc): functor for use in sorting
10335 (LyXTextClass::Read): sort the textclasses after reading.
10337 * src/support/filetools.C (SpaceLess): new version of the
10338 SpaceLess functions. What problems does this one give? Please
10341 * images/banner_bw.xbm: made the arrays unsigned char *
10343 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10345 * src/support/lyxstring.C (find): remove bogus assertion in the
10346 two versions of find where this has not been done yet.
10348 * src/support/lyxlib.h: add missing int return type to
10351 * src/menus.C (ShowFileMenu): disable exporting to html if no
10352 html export command is present.
10354 * config/lib_configure.m4: add a test for an HTML converter. The
10355 programs checked for are, in this order: tth, latex2html and
10358 * lib/configure: generated from config/lib_configure.m4.
10360 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10361 html converter. The parameters are now passed through $$FName and
10362 $$OutName, instead of standard input/output.
10364 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10366 * lib/lyxrc.example: update description of \html_command.
10367 add "quotes" around \screen_font_xxx font setting examples to help
10368 people who use fonts with spaces in their names.
10370 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10372 * Distribution files: updates for v1.1.2
10374 * src/support/lyxstring.C (find): remove bogus assert and return
10375 npos for the same condition.
10377 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10379 * added patch for OS/2 from SMiyata.
10381 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10383 * src/text2.C (CutSelection): make space_wrapped a bool
10384 (CutSelection): dont declare int i until we have to.
10385 (alphaCounter): return a char const *.
10387 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10389 * src/support/syscall.C (Systemcalls::kill):
10390 src/support/filetools.C (PutEnv, PutEnvPath):
10391 src/lyx_cb.C (addNewlineAndDepth):
10392 src/FontInfo.C (FontInfo::resize): condition some #warning
10393 directives with WITH_WARNINGS.
10396 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10398 * src/layout.[Ch] + several files: access to class variables
10399 limited and made accessor functions instead a lot of code changed
10400 becuase of this. Also instead of returning pointers often a const
10401 reference is returned instead.
10403 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10405 * src/Makefile.am (dist-hook): added used to remove the CVS from
10406 cheaders upon creating a dist
10407 (EXTRA_DIST): added cheaders
10409 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10410 a character not as a small integer.
10412 * src/support/lyxstring.C (find): removed Assert and added i >=
10413 rep->sz to the first if.
10415 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10417 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10418 src/LyXView.C src/buffer.C src/bufferparams.C
10419 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10420 src/text2.C src/insets/insetinclude.C:
10421 lyxlayout renamed to textclasslist.
10423 * src/layout.C: some lyxerr changes.
10425 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10426 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10427 (LyXLayoutList): removed all traces of this class.
10428 (LyXTextClass::Read): rewrote LT_STYLE
10429 (LyXTextClass::hasLayout): new function
10430 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10431 both const and nonconst version.
10432 (LyXTextClass::delete_layout): new function.
10433 (LyXTextClassList::Style): bug fix. do the right thing if layout
10435 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10436 (LyXTextClassList::NameOfLayout): ditto
10437 (LyXTextClassList::Load): ditto
10439 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10441 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10443 * src/LyXAction.C (LookupFunc): added a workaround for sun
10444 compiler, on the other hand...we don't know if the current code
10445 compiles on sun at all...
10447 * src/support/filetools.C (CleanupPath): subst fix
10449 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10452 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10453 complained about this one?
10455 * src/insets/insetinclude.C (Latex): subst fix
10457 * src/insets/insetbib.C (getKeys): subst fix
10459 * src/LyXSendto.C (SendtoApplyCB): subst fix
10461 * src/lyx_main.C (init): subst fix
10463 * src/layout.C (Read): subst fix
10465 * src/lyx_sendfax_main.C (button_send): subst fix
10467 * src/buffer.C (RoffAsciiTable): subst fix
10469 * src/lyx_cb.C (MenuFax): subst fix
10470 (PrintApplyCB): subst fix
10472 1999-10-26 Juergen Vigna <jug@sad.it>
10474 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10476 (Read): Cleaned up this code so now we read only format vestion >= 5
10478 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10480 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10481 come nobody has complained about this one?
10483 * src/insets/insetinclude.C (Latex): subst fix
10485 * src/insets/insetbib.C (getKeys): subst fix
10487 * src/lyx_main.C (init): subst fix
10489 * src/layout.C (Read): subst fix
10491 * src/buffer.C (RoffAsciiTable): subst fix
10493 * src/lyx_cb.C (MenuFax): subst fix.
10495 * src/layout.[hC] + some other files: rewrote to use
10496 std::container to store textclasses and layouts in.
10497 Simplified, removed a lot of code. Make all classes
10498 assignable. Further simplifications and review of type
10499 use still to be one.
10501 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10502 lastfiles to create the lastfiles partr of the menu.
10504 * src/lastfiles.[Ch]: rewritten to use deque to store the
10505 lastfiles in. Uses fstream for reading and writing. Simplifies
10508 * src/support/syscall.C: remove explicit cast.
10510 * src/BufferView.C (CursorToggleCB): removed code snippets that
10511 were commented out.
10512 use explicat C++ style casts instead of C style casts. also use
10513 u_vdata instea of passing pointers in longs.
10515 * src/PaperLayout.C: removed code snippets that were commented out.
10517 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10519 * src/lyx_main.C: removed code snippets that wer commented out.
10521 * src/paragraph.C: removed code snippets that were commented out.
10523 * src/lyxvc.C (logClose): use static_cast
10525 (viewLog): remove explicit cast to void*
10526 (showLog): removed old commented code
10528 * src/menus.C: use static_cast instead of C style casts. use
10529 u_vdata instead of u_ldata. remove explicit cast to (long) for
10530 pointers. Removed old code that was commented out.
10532 * src/insets/inset.C: removed old commented func
10534 * src/insets/insetref.C (InsetRef): removed old code that had been
10535 commented out for a long time.
10537 (escape): removed C style cast
10539 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10541 * src/insets/insetlatex.C (Draw): removed old commented code
10542 (Read): rewritten to use string
10544 * src/insets/insetlabel.C (escape): removed C style cast
10546 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10548 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10549 old commented code.
10551 * src/insets/insetinclude.h: removed a couple of stupid bools
10553 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10554 (Clone): remove C style cast
10555 (getKeys): changed list to lst because of std::list
10557 * src/insets/inseterror.C (Draw): removed som old commented code.
10559 * src/insets/insetcommand.C (Draw): removed some old commented code.
10561 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10562 commented out forever.
10563 (bibitem_cb): use static_cast instead of C style cast
10564 use of vdata changed to u_vdata.
10566 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10568 (CloseUrlCB): use static_cast instead of C style cast.
10569 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10571 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10572 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10573 (CloseInfoCB): static_cast from ob->u_vdata instead.
10574 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10577 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10578 (C_InsetError_CloseErrorCB): forward the ob parameter
10579 (CloseErrorCB): static_cast from ob->u_vdata instead.
10581 * src/vspace.h: include LString.h since we use string in this class.
10583 * src/vspace.C (lyx_advance): changed name from advance because of
10584 nameclash with stl. And since we cannot use namespaces yet...I
10585 used a lyx_ prefix instead. Expect this to change when we begin
10588 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10590 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10591 and removed now defunct constructor and deconstructor.
10593 * src/BufferView.h: have backstack as a object not as a pointer.
10594 removed initialization from constructor. added include for BackStack
10596 * development/lyx.spec.in (%build): add CFLAGS also.
10598 * src/screen.C (drawFrame): removed another warning.
10600 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10602 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10603 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10604 README and ANNOUNCE a bit for the next release. More work is
10607 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10608 unbreakable if we are in freespacing mode (LyX-Code), but not in
10611 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10613 * src/BackStack.h: fixed initialization order in constructor
10615 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10617 * acinclude.m4 (VERSION): new rules for when a version is
10618 development, added also a variable for prerelease.
10619 (warnings): we set with_warnings=yes for prereleases
10620 (lyx_opt): prereleases compile with same optimization as development
10621 (CXXFLAGS): only use pedantic if we are a development version
10623 * src/BufferView.C (restorePosition): don't do anything if the
10624 backstack is empty.
10626 * src/BackStack.h: added member empty, use this to test if there
10627 is anything to pop...
10629 1999-10-25 Juergen Vigna <jug@sad.it>
10632 * forms/layout_forms.fd +
10633 * forms/latexoptions.fd +
10634 * lyx.fd: changed for various form resize issues
10636 * src/mathed/math_panel.C +
10637 * src/insets/inseterror.C +
10638 * src/insets/insetinfo.C +
10639 * src/insets/inseturl.C +
10640 * src/insets/inseturl.h +
10642 * src/LyXSendto.C +
10643 * src/PaperLayout.C +
10644 * src/ParagraphExtra.C +
10645 * src/TableLayout.C +
10647 * src/layout_forms.C +
10654 * src/menus.C: fixed various resize issues. So now forms can be
10655 resized savely or not be resized at all.
10657 * forms/form_url.fd +
10658 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10661 * src/insets/Makefile.am: added files form_url.[Ch]
10663 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10665 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10666 (and presumably 6.2).
10668 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10669 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10670 remaining static member callbacks.
10672 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10675 * src/support/lyxstring.h: declare struct Srep as friend of
10676 lyxstring, since DEC cxx complains otherwise.
10678 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10680 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10682 * src/LaTeX.C (run): made run_bibtex also depend on files with
10684 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10685 are put into the dependency file.
10687 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10688 the code has shown itself to work
10689 (create_ispell_pipe): removed another warning, added a comment
10692 * src/minibuffer.C (ExecutingCB): removed code that has been
10693 commented out a long time
10695 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10696 out code + a warning.
10698 * src/support/lyxstring.h: comment out the three private
10699 operators, when compiling with string ansi conforming compilers
10700 they make problems.
10702 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10704 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10705 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10708 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10711 * src/mathed/math_panel.C (create_math_panel): remove explicit
10714 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10717 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10718 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10719 to XCreatePixmapFromBitmapData
10720 (fl_set_bmtable_data): change the last argument to be unsigned
10722 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10723 and bh to be unsigned int, remove explicit casts in call to
10724 XReadBitmapFileData.
10726 * images/arrows.xbm: made the arrays unsigned char *
10727 * images/varsz.xbm: ditto
10728 * images/misc.xbm: ditto
10729 * images/greek.xbm: ditto
10730 * images/dots.xbm: ditto
10731 * images/brel.xbm: ditto
10732 * images/bop.xbm: ditto
10734 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10736 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10737 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10738 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10740 (LYX_CXX_CHEADERS): added <clocale> to the test.
10742 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10744 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10746 * src/support/lyxstring.C (append): fixed something that must be a
10747 bug, rep->assign was used instead of rep->append.
10749 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10752 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10753 lyx insert double chars. Fix spotted by Kayvan.
10755 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10757 * Fixed the tth support. I messed up with the Emacs patch apply feature
10758 and omitted the changes in lyxrc.C.
10760 1999-10-22 Juergen Vigna <jug@sad.it>
10762 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10764 * src/lyx_cb.C (MenuInsertRef) +
10765 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10766 the form cannot be resized under it limits (fixes a segfault)
10768 * src/lyx.C (create_form_form_ref) +
10769 * forms/lyx.fd: Changed Gravity on name input field so that it is
10772 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10774 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10775 <ostream> and <istream>.
10777 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10778 whether <fstream> provides the latest standard features, or if we
10779 have an oldstyle library (like in egcs).
10780 (LYX_CXX_STL_STRING): fix the test.
10782 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10783 code on MODERN_STL_STREAM.
10785 * src/support/lyxstring.h: use L{I,O}stream.h.
10787 * src/support/L{I,O}stream.h: new files, designed to setup
10788 correctly streams for our use
10789 - includes the right header depending on STL capabilities
10790 - puts std::ostream and std::endl (for LOStream.h) or
10791 std::istream (LIStream.h) in toplevel namespace.
10793 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10795 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10796 was a bib file that had been changed we ensure that bibtex is run.
10797 (runBibTeX): enhanced to extract the names of the bib files and
10798 getting their absolute path and enter them into the dep file.
10799 (findtexfile): static func that is used to look for tex-files,
10800 checks for absolute patchs and tries also with kpsewhich.
10801 Alternative ways of finding the correct files are wanted. Will
10803 (do_popen): function that runs a command using popen and returns
10804 the whole output of that command in a string. Should be moved to
10807 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10808 file with extension ext has changed.
10810 * src/insets/figinset.C: added ifdef guards around the fl_free
10811 code that jug commented out. Now it is commented out when
10812 compiling with XForms == 0.89.
10814 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10815 to lyxstring.C, and only keep a forward declaration in
10816 lyxstring.h. Simplifies the header file a bit and should help a
10817 bit on compile time too. Also changes to Srep will not mandate a
10818 recompile of code just using string.
10819 (~lyxstring): definition moved here since it uses srep.
10820 (size): definition moved here since it uses srep.
10822 * src/support/lyxstring.h: removed a couple of "inline" that should
10825 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10827 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10830 1999-10-21 Juergen Vigna <jug@sad.it>
10832 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10833 set to left if I just remove the width entry (or it is empty).
10835 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10836 paragraph when having dummy paragraphs.
10838 1999-10-20 Juergen Vigna <jug@sad.it>
10840 * src/insets/figinset.C: just commented some fl_free_form calls
10841 and added warnings so that this calls should be activated later
10842 again. This avoids for now a segfault, but we have a memory leak!
10844 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10845 'const char * argument' to 'string argument', this should
10846 fix some Asserts() in lyxstring.C.
10848 * src/lyxfunc.h: Removed the function argAsString(const char *)
10849 as it is not used anymore.
10851 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10853 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10856 * src/Literate.h: some funcs moved from public to private to make
10857 interface clearer. Unneeded args removed.
10859 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10861 (scanBuildLogFile): ditto
10863 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10864 normal TeX Error. Still room for improvement.
10866 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10868 * src/buffer.C (insertErrors): changes to make the error
10869 desctription show properly.
10871 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10874 * src/support/lyxstring.C (helper): changed to use
10875 sizeof(object->rep->ref).
10876 (operator>>): changed to use a pointer instead.
10878 * src/support/lyxstring.h: changed const reference & to value_type
10879 const & lets see if that helps.
10881 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10883 * Makefile.am (rpmdist): fixed to have non static package and
10886 * src/support/lyxstring.C: removed the compilation guards
10888 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10891 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10892 conditional compile of lyxstring.Ch
10894 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10895 stupid check, but it is a lot better than the bastring hack.
10896 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10898 * several files: changed string::erase into string::clear. Not
10901 * src/chset.C (encodeString): use a char temporary instead
10903 * src/table.C (TexEndOfCell): added tostr around
10904 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10905 (TexEndOfCell): ditto
10906 (TexEndOfCell): ditto
10907 (TexEndOfCell): ditto
10908 (DocBookEndOfCell): ditto
10909 (DocBookEndOfCell): ditto
10910 (DocBookEndOfCell): ditto
10911 (DocBookEndOfCell): ditto
10913 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10915 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10917 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10918 (MenuBuildProg): added tostr around ret
10919 (MenuRunChktex): added tostr around ret
10920 (DocumentApplyCB): added tostr around ret
10922 * src/chset.C (encodeString): added tostr around t->ic
10924 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10925 (makeLaTeXFile): added tostr around tocdepth
10926 (makeLaTeXFile): added tostr around ftcound - 1
10928 * src/insets/insetbib.C (setCounter): added tostr around counter.
10930 * src/support/lyxstring.h: added an operator+=(int) to catch more
10933 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10934 (lyxstring): We DON'T allow NULL pointers.
10936 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10938 * src/mathed/math_macro.C (MathMacroArgument::Write,
10939 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10940 when writing them out.
10942 * src/LString.C: remove, since it is not used anymore.
10944 * src/support/lyxstring.C: condition the content to
10945 USE_INCLUDED_STRING macro.
10947 * src/mathed/math_symbols.C, src/support/lstrings.C,
10948 src/support/lyxstring.C: add `using' directive to specify what
10949 we need in <algorithm>. I do not think that we need to
10950 conditionalize this, but any thought is appreciated.
10952 * many files: change all callback functions to "C" linkage
10953 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10954 strict_ansi. Those who were static are now global.
10955 The case of callbacks which are static class members is
10956 trickier, since we have to make C wrappers around them (see
10957 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10958 did not finish this yet, since it defeats the purpose of
10959 encapsulation, and I am not sure what the best route is.
10961 1999-10-19 Juergen Vigna <jug@sad.it>
10963 * src/support/lyxstring.C (lyxstring): we permit to have a null
10964 pointer as assignment value and just don't assign it.
10966 * src/vspace.C (nextToken): corrected this function substituting
10967 find_first(_not)_of with find_last_of.
10969 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10970 (TableOptCloseCB) (TableSpeCloseCB):
10971 inserted fl_set_focus call for problem with fl_hide_form() in
10974 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10976 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10979 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10981 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10982 LyXLex::next() and not eatline() to get its argument.
10984 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10986 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10987 instead, use fstreams for io of the depfile, removed unneeded
10988 functions and variables.
10990 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10991 vector instead, removed all functions and variables that is not in
10994 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10996 * src/buffer.C (insertErrors): use new interface to TeXError
10998 * Makefile.am (rpmdist): added a rpmdist target
11000 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11001 per Kayvan's instructions.
11003 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11005 * src/Makefile.am: add a definition for localedir, so that locales
11006 are found after installation (Kayvan)
11008 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11010 * development/.cvsignore: new file.
11012 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11014 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11015 C++ compiler provides wrappers for C headers and use our alternate
11018 * configure.in: use LYX_CXX_CHEADERS.
11020 * src/cheader/: new directory, populated with cname headers from
11021 libstdc++-2.8.1. They are a bit old, but probably good enough for
11022 what we want (support compilers who lack them).
11024 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11025 from includes. It turns out is was stupid.
11027 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11029 * lib/Makefile.am (install-data-local): forgot a ';'
11030 (install-data-local): forgot a '\'
11031 (libinstalldirs): needed after all. reintroduced.
11033 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11035 * configure.in (AC_OUTPUT): added lyx.spec
11037 * development/lyx.spec: removed file
11039 * development/lyx.spec.in: new file
11041 * po/*.po: merged with lyx.pot becuase of make distcheck
11043 * lib/Makefile.am (dist-hook): added dist-hook so that
11044 documentation files will be included when doing a make
11045 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11046 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11048 more: tried to make install do the right thing, exclude CVS dirs
11051 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11052 Path would fit in more nicely.
11054 * all files that used to use pathstack: uses now Path instead.
11055 This change was a lot easier than expected.
11057 * src/support/path.h: new file
11059 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11061 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11063 * src/support/lyxstring.C (getline): Default arg was given for
11066 * Configure.cmd: removed file
11068 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11070 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11071 streams classes and types, add the proper 'using' statements when
11072 MODERN_STL is defined.
11074 * src/debug.h: move the << operator definition after the inclusion
11077 * src/support/filetools.C: include "LAssert.h", which is needed
11080 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11083 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11084 include "debug.h" to define a proper ostream.
11086 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11088 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11089 method to the SystemCall class which can kill a process, but it's
11090 not fully implemented yet.
11092 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11094 * src/support/FileInfo.h: Better documentation
11096 * src/lyxfunc.C: Added support for buffer-export html
11098 * src/menus.C: Added Export->As HTML...
11100 * lib/bind/*.bind: Added short-cut for buffer-export html
11102 * src/lyxrc.*: Added support for new \tth_command
11104 * lib/lyxrc.example: Added stuff for new \tth_command
11106 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11108 * lib/Makefile.am (IMAGES): removed images/README
11109 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11110 installes in correct place. Check permisions is installed
11113 * src/LaTeX.C: some no-op changes moved declaration of some
11116 * src/LaTeX.h (LATEX_H): changed include guard name
11118 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11120 * lib/reLyX/Makefile.am: install noweb2lyx.
11122 * lib/Makefile.am: install configure.
11124 * lib/reLyX/configure.in: declare a config aux dir; set package
11125 name to lyx (not sure what the best solution is); generate noweb2lyx.
11127 * lib/layouts/egs.layout: fix the bibliography layout.
11129 1999-10-08 Jürgen Vigna <jug@sad.it>
11131 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11132 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11133 it returned without continuing to search the path.
11135 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11137 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11138 also fixes a bug. It is not allowed to do tricks with std::strings
11139 like: string a("hei"); &a[e]; this will not give what you
11140 think... Any reason for the complexity in this func?
11142 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11144 * Updated README and INSTALL a bit, mostly to check that my
11145 CVS rights are correctly set up.
11147 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11149 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11150 does not allow '\0' chars but lyxstring and std::string does.
11152 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11154 * autogen.sh (AUTOCONF): let the autogen script create the
11155 POTFILES.in file too. POTFILES.in should perhaps now not be
11156 included in the cvs module.
11158 * some more files changed to use C++ includes instead of C ones.
11160 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11162 (Reread): added tostr to nlink. buggy output otherwise.
11163 (Reread): added a string() around szMode when assigning to Buffer,
11164 without this I got a log of garbled info strings.
11166 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11169 * I have added several ostream & operator<<(ostream &, some_type)
11170 functions. This has been done to avoid casting and warnings when
11171 outputting enums to lyxerr. This as thus eliminated a lot of
11172 explicit casts and has made the code clearer. Among the enums
11173 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11174 mathed enums, some font enum the Debug::type enum.
11176 * src/support/lyxstring.h (clear): missing method. equivalent of
11179 * all files that contained "stderr": rewrote constructs that used
11180 stderr to use lyxerr instead. (except bmtable)
11182 * src/support/DebugStream.h (level): and the passed t with
11183 Debug::ANY to avoid spurious bits set.
11185 * src/debug.h (Debug::type value): made it accept strings of the
11186 type INFO,INIT,KEY.
11188 * configure.in (Check for programs): Added a check for kpsewhich,
11189 the latex generation will use this later to better the dicovery of
11192 * src/BufferView.C (create_view): we don't need to cast this to
11193 (void*) that is done automatically.
11194 (WorkAreaButtonPress): removed some dead code.
11196 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11198 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11199 is not overwritten when translated (David Sua'rez de Lis).
11201 * lib/CREDITS: Added David Sua'rez de Lis
11203 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11205 * src/bufferparams.C (BufferParams): default input encoding is now
11208 * acinclude.m4 (cross_compiling): comment out macro
11209 LYX_GXX_STRENGTH_REDUCE.
11211 * acconfig.h: make sure that const is not defined (to empty) when
11212 we are compiling C++. Remove commented out code using SIZEOF_xx
11215 * configure.in : move the test for const and inline as late as
11216 possible so that these C tests do not interefere with C++ ones.
11217 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11218 has not been proven.
11220 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11222 * src/table.C (getDocBookAlign): remove bad default value for
11223 isColumn parameter.
11225 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11227 (ShowFileMenu2): ditto.
11229 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11230 of files to ignore.
11232 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11234 * Most files: finished the change from the old error code to use
11235 DebugStream for all lyxerr debugging. Only minor changes remain
11236 (e.g. the setting of debug levels using strings instead of number)
11238 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11240 * src/layout.C (Add): Changed to use compare_no_case instead of
11243 * src/FontInfo.C: changed loop variable type too string::size_type.
11245 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11247 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11248 set ETAGS_ARGS to --c++
11250 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11252 * src/table.C (DocBookEndOfCell): commented out two unused variables
11254 * src/paragraph.C: commented out four unused variables.
11256 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11257 insed a if clause with type string::size_type.
11259 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11262 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11264 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11265 variable, also changed loop to go from 0 to lenght + 1, instead of
11266 -1 to length. This should be correct.
11268 * src/LaTeX.C (scanError): use string::size_type as loop variable
11271 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11272 (l.896) since y_tmp and row was not used anyway.
11274 * src/insets/insetref.C (escape): use string::size_type as loop
11277 * src/insets/insetquotes.C (Width): use string::size_type as loop
11279 (Draw): use string::size_type as loop variable type.
11281 * src/insets/insetlatexaccent.C (checkContents): use
11282 string::size_type as loop variable type.
11284 * src/insets/insetlabel.C (escape): use string::size_type as loop
11287 * src/insets/insetinfo.C: added an extern for current_view.
11289 * src/insets/insetcommand.C (scanCommand): use string::size_type
11290 as loop variable type.
11292 * most files: removed the RCS tags. With them we had to recompile
11293 a lot of files after a simple cvs commit. Also we have never used
11294 them for anything meaningful.
11296 * most files: tags-query-replace NULL 0. As adviced several plases
11297 we now use "0" instead of "NULL" in our code.
11299 * src/support/filetools.C (SpaceLess): use string::size_type as
11300 loop variable type.
11302 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11304 * src/paragraph.C: fixed up some more string stuff.
11306 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11308 * src/support/filetools.h: make modestr a std::string.
11310 * src/filetools.C (GetEnv): made ch really const.
11312 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11313 made code that used these use max/min from <algorithm> instead.
11315 * changed several c library include files to their equivalent c++
11316 library include files. All is not changed yet.
11318 * created a support subdir in src, put lyxstring and lstrings
11319 there + the extra files atexit, fileblock, strerror. Created
11320 Makefile.am. edited configure.in and src/Makefile.am to use this
11321 new subdir. More files moved to support.
11323 * imported som of the functions from repository lyx, filetools
11325 * ran tags-query-replace on LString -> string, corrected the bogus
11326 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11327 is still some errors in there. This is errors where too much or
11328 too litle get deleted from strings (string::erase, string::substr,
11329 string::replace), there can also be some off by one errors, or
11330 just plain wrong use of functions from lstrings. Viewing of quotes
11333 * LyX is now running fairly well with string, but there are
11334 certainly some bugs yet (see above) also string is quite different
11335 from LString among others in that it does not allow null pointers
11336 passed in and will abort if it gets any.
11338 * Added the revtex4 files I forgot when setting up the repository.
11340 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11342 * All over: Tried to clean everything up so that only the files
11343 that we really need are included in the cvs repository.
11344 * Switched to use automake.
11345 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11346 * Install has not been checked.
11348 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11350 * po/pt.po: Three errors:
11351 l.533 and l.538 format specification error
11352 l. 402 duplicate entry, I just deleted it.