1 2000-08-25 Juergen Vigna <jug@sad.it>
3 * src/lyxscreen.h: add force_clear variable and fuction to force
4 a clear area when redrawing in LyXText.
6 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
8 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10 * some whitespace and comment changes.
12 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
14 * src/buffer.C: up te LYX_FORMAT to 2.17
16 2000-08-23 Juergen Vigna <jug@sad.it>
18 * src/BufferView_pimpl.C (tripleClick): disable this when in a
21 * src/insets/insettabular.C (pasteSelection): delete the insets
22 LyXText as it is not valid anymore.
23 (copySelection): new function.
24 (pasteSelection): new function.
25 (cutSelection): new function.
26 (LocalDispatch): implemented cut/copy/paste of cell selections.
28 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
31 * src/LyXAction.C (init): a NEW_TABULAR define too much.
33 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
36 2000-08-22 Juergen Vigna <jug@sad.it>
38 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
39 ifdef form_table out if NEW_TABULAR.
41 2000-08-21 Juergen Vigna <jug@sad.it>
43 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
44 (draw): fixed draw position so that the cursor is positioned in the
46 (InsetMotionNotify): hide/show cursor so the position is updated.
47 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
48 using cellstart() function where it should be used.
50 * src/insets/insettext.C (draw): ditto.
52 * src/tabular.C: fixed initialization of some missing variables and
53 made BoxType into an enum.
55 2000-08-22 Marko Vendelin <markov@ioc.ee>
56 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
57 stock menu item using action numerical value, not its string
61 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
63 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
64 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
66 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
68 * src/frontends/xforms/GUIRunTime.C: new file
70 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
71 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
73 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
75 * src/frontends/kde/GUIRunTime.C: new file
77 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
78 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
80 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
82 * src/frontends/gnome/GUIRunTime.C: new file
84 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
87 * src/frontends/GUIRunTime.h: removed constructor and destructor,
88 small change to documetentation.
90 * src/frontends/GUIRunTime.C: removed file
92 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
94 * src/lyxparagraph.h: enable NEW_TABULAR as default
96 * src/lyxfunc.C (processKeySym): remove some commented code
98 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
99 NEW_TABULAR around the fd_form_table_options.
101 * src/lyx_gui.C (runTime): call the static member function as
102 GUIRunTime::runTime().
104 2000-08-21 Allan Rae <rae@lyx.org>
106 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
109 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
111 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
113 2000-08-21 Allan Rae <rae@lyx.org>
115 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
117 * src/frontends/xforms/FormPreferences.C (build): use setOK
118 * src/frontends/xforms/FormDocument.C (build): use setOK
119 (FormDocument): use the appropriate policy.
121 2000-08-21 Allan Rae <rae@lyx.org>
123 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
124 automatic [de]activation of arbitrary objects when in a read-only state.
126 * src/frontends/ButtonPolicies.h: More documentation
127 (isReadOnly): added to support the above.
129 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
131 2000-08-18 Juergen Vigna <jug@sad.it>
133 * src/insets/insettabular.C (getStatus): changed to return func_status.
135 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
136 display toggle menu entries if they are.
138 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
139 new document layout now.
141 * src/lyxfunc.C: ditto
143 * src/lyx_gui_misc.C: ditto
145 * src/lyx_gui.C: ditto
147 * lib/ui/default.ui: removed paper and quotes layout as they are now
148 all in the document layout tabbed folder.
150 * src/frontends/xforms/forms/form_document.fd: added Restore
151 button and callbacks for all inputs for Allan's ButtonPolicy.
153 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
154 (CheckChoiceClass): added missing params setting on class change.
155 (UpdateLayoutDocument): added for updating the layout on params.
156 (build): forgot to RETURN_ALWAYS input_doc_spacing.
157 (FormDocument): Implemented Allan's ButtonPolicy with the
160 2000-08-17 Allan Rae <rae@lyx.org>
162 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
163 so we can at least see the credits again.
165 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
166 controller calls for the appropriate callbacks. Note that since Ok
167 calls apply followed by cancel, and apply isn't a valid input for the
168 APPLIED state, the bc_ calls have to be made in the static callback not
169 within each of the real callbacks.
171 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
172 (setOk): renamed from setOkay()
174 2000-08-17 Juergen Vigna <jug@sad.it>
176 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
177 in the implementation part.
178 (composeUIInfo): don't show optional menu-items.
180 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
182 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
184 * src/bufferview_funcs.C (CurrentState): fixed to show also the
185 text-state when in a text-inset.
187 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
189 2000-08-17 Marko Vendelin <markov@ioc.ee>
190 * src/frontends/gnome/FormIndex.C
191 * src/frontends/gnome/FormIndex.h
192 * src/frontends/gnome/FormToc.C
193 * src/frontends/gnome/FormToc.h
194 * src/frontends/gnome/dialogs
195 * src/frontends/gnome/diatoc_callbacks.c
196 * src/frontends/gnome/diatoc_callbacks.h
197 * src/frontends/gnome/diainsertindex_callbacks.h
198 * src/frontends/gnome/diainsertindex_callbacks.c
199 * src/frontends/gnome/diainsertindex_interface.c
200 * src/frontends/gnome/diainsertindex_interface.h
201 * src/frontends/gnome/diatoc_interface.h
202 * src/frontends/gnome/diatoc_interface.c
203 * src/frontends/gnome/Makefile.am: Table of Contents and
204 Insert Index dialogs implementation for Gnome frontend
206 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
208 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
210 * src/frontends/gnome/diainserturl_interface.c: make the dialog
213 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
215 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
216 destructor. Don't definde if you don't need it
217 (processEvents): made static, non-blocking events processing for
219 (runTime): static method. event loop for xforms
220 * similar as above for kde and gnome.
222 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
224 (runTime): new method calss the real frontends runtime func.
226 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
228 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
230 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
232 2000-08-16 Juergen Vigna <jug@sad.it>
234 * src/lyx_gui.C (runTime): added GUII RunTime support.
236 * src/frontends/Makefile.am:
237 * src/frontends/GUIRunTime.[Ch]:
238 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
239 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
240 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
242 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
244 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
245 as this is already set in ${FRONTEND_INCLUDE} if needed.
247 * configure.in (CPPFLAGS): setting the include dir for the frontend
248 directory and don't set FRONTEND=xforms for now as this is executed
251 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
253 * src/frontends/kde/Makefile.am:
254 * src/frontends/kde/FormUrl.C:
255 * src/frontends/kde/FormUrl.h:
256 * src/frontends/kde/formurldialog.h:
257 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
259 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
261 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
263 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
265 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
268 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
270 * src/WorkArea.C (work_area_handler): more work to get te
271 FL_KEYBOARD to work with xforms 0.88 too, please test.
273 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
275 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
277 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
280 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
282 * src/Timeout.h: remove Qt::emit hack.
284 * several files: changes to allo doc++ compilation
286 * src/lyxfunc.C (processKeySym): new method
287 (processKeyEvent): comment out if FL_REVISION < 89
289 * src/WorkArea.C: change some debugging levels.
290 (WorkArea): set wantkey to FL_KEY_ALL
291 (work_area_handler): enable the FL_KEYBOARD clause, this enables
292 clearer code and the use of compose with XForms 0.89. Change to
293 use signals instead of calling methods in bufferview directly.
295 * src/Painter.C: change some debugging levels.
297 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
300 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
301 (workAreaKeyPress): new method
303 2000-08-14 Juergen Vigna <jug@sad.it>
305 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
307 * config/kde.m4: addes some features
309 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
310 include missing xforms dialogs.
312 * src/Timeout.h: a hack to be able to compile with qt/kde.
314 * sigc++/.cvsignore: added acinclude.m4
316 * lib/.cvsignore: added listerros
318 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
319 xforms tree as objects are needed for other frontends.
321 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
322 linking with not yet implemented xforms objects.
324 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
326 2000-08-14 Baruch Even <baruch.even@writeme.com>
328 * src/frontends/xforms/FormGraphics.h:
329 * src/frontends/xforms/FormGraphics.C:
330 * src/frontends/xforms/RadioButtonGroup.h:
331 * src/frontends/xforms/RadioButtonGroup.C:
332 * src/insets/insetgraphics.h:
333 * src/insets/insetgraphics.C:
334 * src/insets/insetgraphicsParams.h:
335 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
336 instead of spaces, and various other indentation issues to make the
337 sources more consistent.
339 2000-08-14 Marko Vendelin <markov@ioc.ee>
341 * src/frontends/gnome/dialogs/diaprint.glade
342 * src/frontends/gnome/FormPrint.C
343 * src/frontends/gnome/FormPrint.h
344 * src/frontends/gnome/diaprint_callbacks.c
345 * src/frontends/gnome/diaprint_callbacks.h
346 * src/frontends/gnome/diaprint_interface.c
347 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
350 * src/frontends/gnome/dialogs/diainserturl.glade
351 * src/frontends/gnome/FormUrl.C
352 * src/frontends/gnome/FormUrl.h
353 * src/frontends/gnome/diainserturl_callbacks.c
354 * src/frontends/gnome/diainserturl_callbacks.h
355 * src/frontends/gnome/diainserturl_interface.c
356 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
359 * src/frontends/gnome/Dialogs.C
360 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
361 all other dialogs. Copy all unimplemented dialogs from Xforms
364 * src/frontends/gnome/support.c
365 * src/frontends/gnome/support.h: support files generated by Glade
369 * config/gnome.m4: Gnome configuration scripts
371 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
372 configure --help message
374 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
375 only if there are no events pendling in Gnome/Gtk. This enhances
376 the performance of menus.
379 2000-08-14 Allan Rae <rae@lyx.org>
381 * lib/Makefile.am: listerrors cleaning
383 * lib/listerrors: removed -- generated file
384 * acinclude.m4: ditto
385 * sigc++/acinclude.m4: ditto
387 * src/frontends/xforms/forms/form_citation.fd:
388 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
391 * src/frontends/xforms/forms/makefile: I renamed the `install` target
392 `updatesrc` and now we have a `test` target that does what `updatesrc`
393 used to do. I didn't like having an install target that wasn't related
396 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
397 on all except FormGraphics. This may yet happen. Followed by a major
398 cleanup including using FL_TRANSIENT for most of the dialogs. More
399 changes to come when the ButtonController below is introduced.
401 * src/frontends/xforms/ButtonController.h: New file for managing up to
402 four buttons on a dialog according to an externally defined policy.
403 * src/frontends/xforms/Makefile.am: added above
405 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
406 Apply and Cancel/Close buttons and everything in between and beyond.
407 * src/frontends/Makefile.am: added above.
409 * src/frontends/xforms/forms/form_preferences.fd:
410 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
411 and removed variable 'status' as a result. Fixed the set_minsize thing.
412 Use the new screen-font-update after checking screen fonts were changed
413 Added a "Restore" button to restore the original lyxrc values while
414 editing. This restores everything not just the last input changed.
415 That's still a tricky one. As is the "LyX: this shouldn't happen..."
417 * src/LyXAction.C: screen-font-update added for updating buffers after
418 screen font settings have been changed.
419 * src/commandtags.h: ditto
420 * src/lyxfunc.C: ditto
422 * forms/lyx.fd: removed screen fonts dialog.
423 * src/lyx_gui.C: ditto
424 * src/menus.[Ch]: ditto
425 * src/lyx.[Ch]: ditto
426 * src/lyx_cb.C: ditto + code from here moved to make
427 screen-font-update. And people wonder why progress on GUII is
428 slow. Look at how scattered this stuff was! It takes forever
431 * forms/fdfix.sh: Fixup the spacing after commas.
432 * forms/makefile: Remove date from generated files. Fewer clashes now.
433 * forms/bullet_forms.C.patch: included someones handwritten changes
435 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
436 once I've discovered why LyXRC was made noncopyable.
437 * src/lyx_main.C: ditto
439 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
441 * src/frontends/xforms/forms/fdfix.sh:
442 * src/frontends/xforms/forms/fdfixh.sed:
443 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
444 * src/frontends/xforms/Form*.[hC]:
445 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
446 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
447 provide a destructor for the struct FD_form_xxxx. Another version of
448 the set_[max|min]size workaround and a few other cleanups. Actually,
449 Angus' patch from 20000809.
451 2000-08-13 Baruch Even <baruch.even@writeme.com>
453 * src/insets/insetgraphics.C (Clone): Added several fields that needed
456 2000-08-11 Juergen Vigna <jug@sad.it>
458 * src/insets/insetgraphics.C (InsetGraphics): changing init
459 order because of warnings.
461 * src/frontends/xforms/forms/makefile: adding patching .C with
464 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
465 from .C.patch to .c.patch
467 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
468 order because of warning.
470 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
472 * src/frontends/Liason.C (setMinibuffer): new helper function
474 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
476 * src/lyxfunc.C (Dispatch): calling new Document-Layout
478 * lib/ui/default.ui: commented out PaperLayout entry
480 * src/frontends/xforms/form_document.[Ch]: new added files
482 * src/frontends/xforms/FormDocument.[Ch]: ditto
484 * src/frontends/xforms/forms/form_document.fd: ditto
486 * src/frontends/xforms/forms/form_document.C.patch: ditto
488 2000-08-10 Juergen Vigna <jug@sad.it>
490 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
491 (InsetGraphics): initialized cacheHandle to 0.
492 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
494 2000-08-10 Baruch Even <baruch.even@writeme.com>
496 * src/graphics/GraphicsCache.h:
497 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
498 correctly as a cache.
500 * src/graphics/GraphicsCacheItem.h:
501 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
504 * src/graphics/GraphicsCacheItem_pimpl.h:
505 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
508 * src/insets/insetgraphics.h:
509 * src/insets/insetgraphics.C: Changed from using a signal notification
510 to polling when image is not loaded.
512 2000-08-10 Allan Rae <rae@lyx.org>
514 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
515 that there are two functions that have to been taken out of line by
516 hand and aren't taken care of in the script. (Just a reminder note)
518 * sigc++/macros/*.h.m4: Updated as above.
520 2000-08-09 Juergen Vigna <jug@sad.it>
522 * src/insets/insettext.C (draw): small fix for clearing rectangle.
524 * src/insets/insettabular.C: make drawing of single cell smarter.
526 2000-08-09 Marko Vendelin <markov@ioc.ee>
527 * src/frontends/gnome/Menubar_pimpl.C
528 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
529 implementation: new files
531 * src/frontends/gnome/mainapp.C
532 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
535 * src/main.C: create Gnome main window
537 * src/frontends/xforms/Menubar_pimpl.h
538 * src/frontends/Menubar.C
539 * src/frontends/Menubar.h: added method Menubar::update that calls
540 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
542 * src/LyXView.C: calls Menubar::update to update the state
545 * src/frontends/gnome/Makefile.am: added new files
547 * src/frontends/Makefile.am: added frontend compiler options
549 2000-08-08 Juergen Vigna <jug@sad.it>
551 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
553 * src/bufferlist.C (close):
554 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
555 documents if exiting without saving.
557 * src/buffer.C (save): use removeAutosaveFile()
559 * src/support/filetools.C (removeAutosaveFile): new function.
561 * src/lyx_cb.C (MenuWrite): returns a bool now.
562 (MenuWriteAs): check if file could really be saved and revert to the
564 (MenuWriteAs): removing old autosavefile if existant.
566 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
567 before Goto toggle declaration, because of compiler warning.
569 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
571 * src/lyxfunc.C (MenuNew): small fix.
573 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
575 * src/bufferlist.C (newFile):
576 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
578 * src/lyxrc.C: added new_ask_filename tag
580 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
582 * src/lyx.fd: removed code pertaining to form_ref
583 * src/lyx.[Ch]: ditto
584 * src/lyx_cb.C: ditto
585 * src/lyx_gui.C: ditto
586 * src/lyx_gui_misc.C: ditto
588 * src/BufferView_pimpl.C (restorePosition): update buffer only
591 * src/commandtags.h (LFUN_REFTOGGLE): removed
592 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
593 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
594 (LFUN_REFBACK): renamed LFUN_REF_BACK
596 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
598 * src/lyxfunc.C (Dispatch): ditto.
599 InsertRef dialog is now GUI-independent.
601 * src/texrow.C: added using std::endl;
603 * src/insets/insetref.[Ch]: strip out large amounts of code.
604 The inset is now a container and this functionality is now
605 managed by a new FormRef dialog
607 * src/frontends/Dialogs.h (showRef, createRef): new signals
609 * src/frontends/xforms/FormIndex.[Ch],
610 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
611 when setting dialog's min/max size
612 * src/frontends/xforms/FormIndex.[Ch]: ditto
614 * src/frontends/xforms/FormRef.[Ch],
615 src/frontends/xforms/forms/form_ref.fd: new xforms
616 implementation of an InsetRef dialog
618 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
621 * src/graphics/XPM_Renderer.C (isImageFormatOK):
622 ios::nocreate is not part of the standard. Removed.
624 2000-08-07 Baruch Even <baruch.even@writeme.com>
626 * src/graphics/Renderer.h:
627 * src/graphics/Renderer.C: Added base class for rendering of different
628 image formats into Pixmaps.
630 * src/graphics/XPM_Renderer.h:
631 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
632 in a different class.
634 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
635 easily add support for other formats.
637 * src/insets/figinset.C: plugged a leak of an X resource.
639 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
641 * src/CutAndPaste.[Ch]: make all metods static.
643 * development/Code_rules/Rules: more work, added section on
644 Exceptions, and a References section.
646 * a lot of header files: work to make doc++ able to generate the
647 source documentation, some workarounds of doc++ problems. Doc++ is
648 now able to generate the documentation.
650 2000-08-07 Juergen Vigna <jug@sad.it>
652 * src/insets/insettabular.C (recomputeTextInsets): removed function
654 * src/tabular.C (SetWidthOfMulticolCell):
656 (calculate_width_of_column_NMC): fixed return value so that it really
657 only returns true if the column-width has changed (there where
658 problems with muliticolumn-cells in this column).
660 2000-08-04 Juergen Vigna <jug@sad.it>
662 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
663 also on the scrollstatus of the inset.
664 (workAreaMotionNotify): ditto.
666 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
668 2000-08-01 Juergen Vigna <jug@sad.it>
670 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
673 * src/LyXAction.C (init):
674 * src/insets/inset.C (LocalDispatch): added support for
677 * src/insets/inset.C (scroll): new functions.
679 * src/insets/insettext.C (removeNewlines): new function.
680 (SetAutoBreakRows): removes forced newlines in the text of the
681 paragraph if autoBreakRows is set to false.
683 * src/tabular.C (Latex): generates a parbox around the cell contents
686 * src/frontends/xforms/FormTabular.C (local_update): removed
687 the radio_useparbox button.
689 * src/tabular.C (UseParbox): new function
691 2000-08-06 Baruch Even <baruch.even@writeme.com>
693 * src/graphics/GraphicsCache.h:
694 * src/graphics/GraphicsCache.C:
695 * src/graphics/GraphicsCacheItem.h:
696 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
699 * src/insets/insetgraphics.h:
700 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
701 drawing of the inline image.
703 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
704 into the wrong position.
706 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
709 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
711 * src/support/translator.h: move all typedefs to public section
713 * src/support/filetools.C (MakeLatexName): return string const
716 (FileOpenSearch): ditto
718 (LibFileSearch): ditto
719 (i18nLibFileSearch): ditto
722 (CreateTmpDir): ditto
723 (CreateBufferTmpDir): ditto
724 (CreateLyXTmpDir): ditto
729 (OnlyFilename): ditto
731 (NormalizePath): ditto
733 (GetFileContents): ditto
734 (ReplaceEnvironmentPath): ditto
737 (ChangeExtension): ditto
738 (MakeDisplayPath): ditto
739 (do_popen): return cmdret const
740 (findtexfile): return string const
742 * src/support/DebugStream.h: add some /// to please doc++
744 * src/frontends/DialogBase.h (endif): add some /// to please doc++
746 * src/texrow.C (same_rownumber): functor to use with find_if
747 (getIdFromRow): rewritten to use find_if and to not update the
748 positions. return true if row is found
749 (increasePos): new method, use to update positions
751 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
753 * src/lyxlex_pimpl.C (verifyTable): new method
756 (GetString): return string const
757 (pushTable): rewrite to use std::stack
759 (setFile): better check
762 * src/lyxlex.h: make LyXLex noncopyable
764 * src/lyxlex.C (text): return char const * const
765 (GetString): return string const
766 (getLongString): return string const
768 * src/lyx_gui_misc.C (askForText): return pair<...> const
770 * src/lastfiles.[Ch] (operator): return string const
772 * src/buffer.C (parseSingleLyXformat2Token): pass string to
773 istringstream not char const *.
774 move token.end() out of loop.
775 (readFile): move initializaton of token
777 * src/BufferView2.C (insertErrors): run texrow.increasePos if
778 getIdFromRow is successful.
780 * lib/bind/emacs.bind: don't include menus bind
782 * development/Code_rules/Rules: the beginnings of making this
783 better and covering more of the unwritten rules that we have.
785 * development/Code_rules/Recommendations: a couple of wording
788 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
790 * src/support/strerror.c: remove C++ comment.
792 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
794 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
795 LFUN_INDEX_INSERT_LAST
797 * src/texrow.C (getIdFromRow): changed from const_iterator to
798 iterator, allowing code to compile with DEC cxx
800 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
801 stores part of the class, as suggested by Allan. Will allow
803 (apply): test to apply uses InsetCommandParams operator!=
805 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
806 (apply): test to apply uses InsetCommandParams operator!=
808 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
809 stores part of the class.
810 (update): removed limits on min/max size.
812 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
813 (apply): test to apply uses InsetCommandParams operator!=
815 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
816 (Read, Write, scanCommand, getCommand): moved functionality
817 into InsetCommandParams.
819 (getScreenLabel): made pure virtual
820 new InsetCommandParams operators== and !=
822 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
823 c-tors based on InsetCommandParams. Removed others.
824 * src/insets/insetinclude.[Ch]: ditto
825 * src/insets/insetlabel.[Ch]: ditto
826 * src/insets/insetparent.[Ch]: ditto
827 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
829 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
830 insets derived from InsetCommand created using similar c-tors
831 based on InsetCommandParams
832 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
833 * src/menus.C (ShowRefsMenu): ditto
834 * src/paragraph.C (Clone): ditto
835 * src/text2.C (SetCounter): ditto
836 * src/lyxfunc.C (Dispatch) ditto
837 Also recreated old InsetIndex behaviour exactly. Can now
838 index-insert at the start of a paragraph and index-insert-last
839 without launching the pop-up.
841 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
843 * lib/lyxrc.example: mark te pdf options as non functional.
845 * src/support/lstrings.C (strToInt): move initalization of tmpstr
846 (isStrDbl): move tmpstr.end() out of loop.
847 (strToDbl): move intialization of tmpstr
848 (lowercase): return string const and move tmp.end() out of loop.
849 (uppercase): return string const and move tmp.edn() out of loop.
850 (prefixIs): add assertion
855 (containsOnly): ditto
856 (containsOnly): ditto
857 (containsOnly): ditto
858 (countChar): make last arg char not char const
859 (token): return string const
860 (subst): return string const, move tmp.end() out of loop.
861 (subst): return string const, add assertion
862 (strip): return string const
863 (frontStrip): return string const, add assertion
864 (frontStrip): return string const
869 * src/support/lstrings.C: add inclde "LAssert.h"
870 (isStrInt): move tmpstr.end() out of loop.
872 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
873 toollist.end() out of loop.
874 (deactivate): move toollist.end() out of loop.
875 (update): move toollist.end() out of loop.
876 (updateLayoutList): move tc.end() out of loop.
877 (add): move toollist.end() out of loop.
879 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
880 md.end() out of loop.
882 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
884 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
887 * src/paragraph.C (Erase): move fontlist.end() out of loop.
888 (Erase): move insetlist.end() out of loop.
890 * src/lyx_sendfax_main.C: make show_logfile static and to take a
891 ref to const string as first arg. Move initialization of some
892 variables, whitespace changes.
894 * src/kbmap.C (defkey): move table.end() out of loop.
895 (kb_keymap): move table.end() out of loop.
896 (findbinding): move table.end() out of loop.
898 * src/MenuBackend.C (hasMenu): move end() out of loop.
899 (getMenu): move end() out of loop.
900 (getMenu): move menulist_.end() out of loop.
902 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
904 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
907 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
908 (getFromLyXName): move infotab.end() out of loop.
910 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
911 -fvtable-thunks -ffunction-sections -fdata-sections
913 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
915 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
918 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
920 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
922 * src/frontends/xforms/FormCitation.[Ch],
923 src/frontends/xforms/FormIndex.[Ch],
924 src/frontends/xforms/FormToc.[Ch],
925 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
927 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
929 * src/commandtags.h: renamed, created some flags for citation
932 * src/lyx_gui_misc.C: stripped out old FD_index_form code
934 * src/lyxfunc.C (dispatch): use signals to insert index entry
936 * src/frontends/Dialogs.h: new signal createIndex
938 * src/frontends/xforms/FormCommand.[Ch],
939 src/frontends/xforms/FormCitation.[Ch],
940 src/frontends/xforms/FormToc.[Ch],
941 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
943 * src/insets/insetindex.[Ch]: GUI-independent
945 * src/frontends/xforms/FormIndex.[Ch],
946 * src/frontends/xforms/forms/form_index.fd: xforms implementation
949 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
951 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
952 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
954 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
956 * src/insets/insetref.C (Latex): rewrite so that there is now
957 question that a initialization is requested.
959 * src/insets/insetcommand.h: reenable the hide signal
961 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
963 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
964 fix handling of shortcuts (many bugs :)
965 (add_lastfiles): ditto.
967 * lib/ui/default.ui: fix a few shortcuts.
969 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
971 * Makefile.am: Fix ``rpmdist'' target to return the exit
972 status of the ``rpm'' command, instead of the last command in
973 the chain (the ``rm lyx.xpm'' command, which always returns
976 2000-08-02 Allan Rae <rae@lyx.org>
978 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
979 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
980 * src/frontends/xforms/FormToc.C (FormToc): ditto
982 * src/frontends/xforms/Makefile.am: A few forgotten files
984 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
985 Signals-not-copyable-problem Lars' started commenting out.
987 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
989 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
991 * src/insets/insetcommand.h: Signals is not copyable so anoter
992 scheme for automatic hiding of forms must be used.
994 * src/frontends/xforms/FormCitation.h: don't inerit from
995 noncopyable, FormCommand already does that.
996 * src/frontends/xforms/FormToc.h: ditto
997 * src/frontends/xforms/FormUrl.h: ditto
999 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1001 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1003 * src/insets/insetcommand.h (hide): new SigC::Signal0
1004 (d-tor) new virtual destructor emits hide signal
1006 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1007 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1009 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1010 LOF and LOT. Inset is now GUI-independent
1012 * src/insets/insetloa.[Ch]: redundant
1013 * src/insets/insetlof.[Ch]: ditto
1014 * src/insets/insetlot.[Ch]: ditto
1016 * src/frontends/xforms/forms/form_url.fd: tweaked!
1017 * src/frontends/xforms/forms/form_citation.fd: ditto
1019 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1020 dialogs dealing with InsetCommand insets
1022 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1023 FormCommand base class
1024 * src/frontends/xforms/FormUrl.[Ch]: ditto
1026 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1028 * src/frontends/xforms/FormToc.[Ch]: ditto
1030 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1031 passed a generic InsetCommand pointer
1032 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1034 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1035 and modified InsetTOC class
1036 * src/buffer.C: ditto
1038 * forms/lyx.fd: strip out old FD_form_toc code
1039 * src/lyx_gui_misc.C: ditto
1040 * src/lyx_gui.C: ditto
1041 * src/lyx_cb.C: ditto
1042 * src/lyx.[Ch]: ditto
1044 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1046 * src/support/utility.hpp: tr -d '\r'
1048 2000-08-01 Juergen Vigna <jug@sad.it>
1050 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1052 * src/commandtags.h:
1053 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1054 LFUN_TABULAR_FEATURES.
1056 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1057 LFUN_LAYOUT_TABULAR.
1059 * src/insets/insettabular.C (getStatus): implemented helper function.
1061 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1063 2000-07-31 Juergen Vigna <jug@sad.it>
1065 * src/text.C (draw): fixed screen update problem for text-insets.
1067 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1068 something changed probably this has to be added in various other
1071 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1073 2000-07-31 Baruch Even <baruch.even@writeme.com>
1075 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1076 templates to satisfy compaq cxx.
1079 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1081 * src/support/translator.h (equal_1st_in_pair::operator()): take
1082 const ref pair_type as arg.
1083 (equal_2nd_in_pair::operator()): ditto
1084 (Translator::~Translator): remove empty d-tor.
1086 * src/graphics/GraphicsCache.C: move include config.h to top, also
1087 put initialization of GraphicsCache::singleton here.
1088 (~GraphicsCache): move here
1089 (addFile): take const ref as arg
1092 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1094 * src/BufferView2.C (insertLyXFile): change te with/without header
1097 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1099 * src/frontends/xforms/FormGraphics.C (apply): add some
1100 static_cast. Not very nice, but required by compaq cxx.
1102 * src/frontends/xforms/RadioButtonGroup.h: include header
1103 <utility> instead of <pair.h>
1105 * src/insets/insetgraphicsParams.C: add using directive.
1106 (readResize): change return type to void.
1107 (readOrigin): ditto.
1109 * src/lyxfunc.C (getStatus): add missing break for build-program
1110 function; add test for Literate for export functions.
1112 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1113 entries in Options menu.
1115 2000-07-31 Baruch Even <baruch.even@writeme.com>
1117 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1118 protect against auto-allocation; release icon when needed.
1120 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1122 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1123 on usual typewriter.
1125 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1126 earlier czech.kmap), useful only for programming.
1128 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1130 * src/frontends/xforms/FormCitation.h: fix conditioning around
1133 2000-07-31 Juergen Vigna <jug@sad.it>
1135 * src/frontends/xforms/FormTabular.C (local_update): changed
1136 radio_linebreaks to radio_useparbox and added radio_useminipage.
1138 * src/tabular.C: made support for using minipages/parboxes.
1140 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1142 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1144 (descent): so the cursor is in the middle.
1145 (width): bit smaller box.
1147 * src/insets/insetgraphics.h: added display() function.
1149 2000-07-31 Baruch Even <baruch.even@writeme.com>
1151 * src/frontends/Dialogs.h: Added showGraphics signals.
1153 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1154 xforms form definition of the graphics dialog.
1156 * src/frontends/xforms/FormGraphics.h:
1157 * src/frontends/xforms/FormGraphics.C: Added files, the
1158 GUIndependent code of InsetGraphics
1160 * src/insets/insetgraphics.h:
1161 * src/insets/insetgraphics.C: Major writing to make it work.
1163 * src/insets/insetgraphicsParams.h:
1164 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1165 struct between InsetGraphics and GUI.
1167 * src/LaTeXFeatures.h:
1168 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1169 support for graphicx package.
1171 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1172 for the graphics inset.
1174 * src/support/translator.h: Added file, used in
1175 InsetGraphicsParams. this is a template to translate between two
1178 * src/frontends/xforms/RadioButtonGroup.h:
1179 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1180 way to easily control a radio button group.
1182 2000-07-28 Juergen Vigna <jug@sad.it>
1184 * src/insets/insettabular.C (LocalDispatch):
1185 (TabularFeatures): added support for lyx-functions of tabular features.
1186 (cellstart): refixed this function after someone wrongly changed it.
1188 * src/commandtags.h:
1189 * src/LyXAction.C (init): added support for tabular-features
1191 2000-07-28 Allan Rae <rae@lyx.org>
1193 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1194 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1195 triggers the callback for input checking. As a result we sometimes get
1196 "LyX: This shouldn't happen..." printed to cerr.
1197 (input): Started using status variable since I only free() on
1198 destruction. Some input checking for paths and font sizes.
1200 * src/frontends/xforms/FormPreferences.h: Use status to control
1201 activation of Ok and Apply
1203 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1204 callback. Also resized to stop segfaults with 0.88. The problem is
1205 that xforms-0.88 requires the folder to be wide enough to fit all the
1206 tabs. If it isn't it causes all sorts of problems.
1208 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1210 * src/frontends/xforms/forms/README: Reflect reality.
1212 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1213 * src/frontends/xforms/forms/makefile: ditto.
1215 * src/commandtags.h: Get access to new Preferences dialog
1216 * src/LyXAction.C: ditto
1217 * src/lyxfunc.C: ditto
1218 * lib/ui/default.ui: ditto
1220 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1222 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1224 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1227 * src/frontends/xforms/form_url.[Ch]: added.
1229 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1231 * src/insets/insetbib.h: fixed bug in previous commit
1233 * src/frontends/xforms/FormUrl.h: ditto
1235 * src/frontends/xforms/FormPrint.h: ditto
1237 * src/frontends/xforms/FormPreferences.h: ditto
1239 * src/frontends/xforms/FormCopyright.h: ditto
1241 * src/frontends/xforms/FormCitation.C: ditto
1243 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1244 private copyconstructor and private default contructor
1246 * src/support/Makefile.am: add utility.hpp
1248 * src/support/utility.hpp: new file from boost
1250 * src/insets/insetbib.h: set owner in clone
1252 * src/frontends/xforms/FormCitation.C: added missing include
1255 * src/insets/form_url.[Ch]: removed
1257 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1259 * development/lyx.spec.in
1260 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1261 file/directory re-organization.
1263 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1265 * src/insets/insetcommand.[Ch]: moved the string data and
1266 associated manipulation methods into a new stand-alone class
1267 InsetCommandParams. This class has two additional methods
1268 getAsString() and setFromString() allowing the contents to be
1269 moved around as a single string.
1270 (addContents) method removed.
1271 (setContents) method no longer virtual.
1273 * src/buffer.C (readInset): made use of new InsetCitation,
1274 InsetUrl constructors based on InsetCommandParams.
1276 * src/commandtags.h: add LFUN_INSERT_URL
1278 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1279 independent InsetUrl and use InsetCommandParams to extract
1280 string info and create new Insets.
1282 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1284 * src/frontends/xforms/FormCitation.C (apply): uses
1287 * src/frontends/xforms/form_url.C
1288 * src/frontends/xforms/form_url.h
1289 * src/frontends/xforms/FormUrl.h
1290 * src/frontends/xforms/FormUrl.C
1291 * src/frontends/xforms/forms/form_url.fd: new files
1293 * src/insets/insetcite.[Ch]: removed unused constructors.
1295 * src/insets/insetinclude.[Ch]: no longer store filename
1297 * src/insets/inseturl.[Ch]: GUI-independent.
1299 2000-07-26 Juergen Vigna <jug@sad.it>
1300 * renamed frontend from gtk to gnome as it is that what is realized
1301 and did the necessary changes in the files.
1303 2000-07-26 Marko Vendelin <markov@ioc.ee>
1305 * configure.in: cleaning up gnome configuration scripts
1307 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1309 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1310 shortcuts syndrom by redrawing them explicitely (a better solution
1311 would be appreciated).
1313 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1315 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1318 * src/lyx_cb.C (MenuExport): change html export to do the right
1319 thing depending of the document type (instead of having
1320 html-linuxdoc and html-docbook).
1321 * src/lyxfunc.C (getStatus): update for html
1322 * lib/ui/default.ui: simplify due to the above change.
1323 * src/menus.C (ShowFileMenu): update too (in case we need it).
1325 * src/MenuBackend.C (read): if a menu is defined twice, add the
1326 new entries to the exiting one.
1328 2000-07-26 Juergen Vigna <jug@sad.it>
1330 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1332 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1333 and return a bool if it did actual save the file.
1334 (AutoSave): don't autosave a unnamed doc.
1336 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1337 check if this is an UNNAMED new file and react to it.
1338 (newFile): set buffer to unnamed and change to not mark a new
1339 buffer dirty if I didn't do anything with it.
1341 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1343 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1345 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1346 friend as per Angus's patch posted to lyx-devel.
1348 * src/ext_l10n.h: updated
1350 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1351 gettext on the style string right before inserting them into the
1354 * autogen.sh: add code to extract style strings form layout files,
1355 not good enough yet.
1357 * src/frontends/gtk/.cvsignore: add MAKEFILE
1359 * src/MenuBackend.C (read): run the label strings through gettext
1360 before storing them in the containers.
1362 * src/ext_l10n.h: new file
1364 * autogen.sh : generate the ext_l10n.h file here
1366 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1368 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1371 * lib/ui/default.ui: fix a couple of typos.
1373 * config/gnome/gtk.m4: added (and added to the list of files in
1376 * src/insets/insetinclude.C (unique_id): fix when we are using
1377 lyxstring instead of basic_string<>.
1378 * src/insets/insettext.C (LocalDispatch): ditto.
1379 * src/support/filetools.C: ditto.
1381 * lib/configure.m4: create the ui/ directory if necessary.
1383 * src/LyXView.[Ch] (updateToolbar): new method.
1385 * src/BufferView_pimpl.C (buffer): update the toolbar when
1386 opening/closing buffer.
1388 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1390 * src/LyXAction.C (getActionName): enhance to return also the name
1391 and options of pseudo-actions.
1392 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1394 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1395 as an example of what is possible). Used in File->Build too (more
1396 useful) and in the import/export menus (to mimick the complicated
1397 handling of linuxdoc and friends). Try to update all the entries.
1399 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1402 * src/MenuBackend.C (read): Parse the new OptItem tag.
1404 * src/MenuBackend.h: Add a new optional_ data member (used if the
1405 entry should be omitted when the lyxfunc is disabled).
1407 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1408 function, used as a shortcut.
1409 (create_submenu): align correctly the shortcuts on the widest
1412 * src/MenuBackend.h: MenuItem.label() only returns the label of
1413 the menu without shortcut; new method shortcut().
1415 2000-07-14 Marko Vendelin <markov@ioc.ee>
1417 * src/frontends/gtk/Dialogs.C:
1418 * src/frontends/gtk/FormCopyright.C:
1419 * src/frontends/gtk/FormCopyright.h:
1420 * src/frontends/gtk/Makefile.am: added these source-files for the
1421 Gtk/Gnome support of the Copyright-Dialog.
1423 * src/main.C: added Gnome::Main initialization if using
1424 Gtk/Gnome frontend-GUI.
1426 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1428 * config/gnome/aclocal-include.m4
1429 * config/gnome/compiler-flags.m4
1430 * config/gnome/curses.m4
1431 * config/gnome/gnome--.m4
1432 * config/gnome/gnome-bonobo-check.m4
1433 * config/gnome/gnome-common.m4
1434 * config/gnome/gnome-fileutils.m4
1435 * config/gnome/gnome-ghttp-check.m4
1436 * config/gnome/gnome-gnorba-check.m4
1437 * config/gnome/gnome-guile-checks.m4
1438 * config/gnome/gnome-libgtop-check.m4
1439 * config/gnome/gnome-objc-checks.m4
1440 * config/gnome/gnome-orbit-check.m4
1441 * config/gnome/gnome-print-check.m4
1442 * config/gnome/gnome-pthread-check.m4
1443 * config/gnome/gnome-support.m4
1444 * config/gnome/gnome-undelfs.m4
1445 * config/gnome/gnome-vfs.m4
1446 * config/gnome/gnome-x-checks.m4
1447 * config/gnome/gnome-xml-check.m4
1448 * config/gnome/gnome.m4
1449 * config/gnome/gperf-check.m4
1450 * config/gnome/gtk--.m4
1451 * config/gnome/linger.m4
1452 * config/gnome/need-declaration.m4: added configuration scripts
1453 for Gtk/Gnome frontend-GUI
1455 * configure.in: added support for the --with-frontend=gtk option
1457 * autogen.sh: added config/gnome/* to list of config-files
1459 * acconfig.h: added define for GTKGUI-support
1461 * config/lyxinclude.m4: added --with-frontend[=value] option value
1462 for Gtk/Gnome frontend-GUI support.
1464 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1466 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1470 * src/paragraph.C (GetChar): remove non-const version
1472 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1473 (search_kw): use it.
1475 * src/lyx_main.C (init): if "preferences" exist, read that instead
1477 (ReadRcFile): return bool if the file could be read ok.
1478 (ReadUIFile): add a check to see if lex file is set ok.
1480 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1481 bastring can be used instead of lyxstring (still uses the old code
1482 if std::string is good enough or if lyxstring is used.)
1484 * src/encoding.C: make the arrays static, move ininle functions
1486 * src/encoding.h: from here.
1488 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1489 (parseSingleLyXformat2Token): move inset parsing to separate method
1490 (readInset): new private method
1492 * src/Variables.h: remove virtual from get().
1494 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1495 access to NEW_INSETS and NEW_TABULAR
1497 * src/MenuBackend.h: remove superfluous forward declaration of
1498 MenuItem. Add documentations tags "///", remove empty MenuItem
1499 destructor, remove private default contructor.
1501 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1503 (read): more string mlabel and mname to where they are used
1504 (read): remove unused variables mlabel and mname
1505 (defaults): unconditional clear, make menusetup take advantage of
1506 add returning Menu &.
1508 * src/LyXView.h: define NEW_MENUBAR as default
1510 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1511 to NEW_INSETS and NEW_TABULAR.
1512 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1513 defined. Change some of the "xxxx-inset-insert" functions names to
1516 * several files: more enahncements to NEW_INSETS and the resulting
1519 * lib/lyxrc.example (\date_insert_format): move to misc section
1521 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1522 bastring and use AC_CACHE_CHECK.
1523 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1524 the system have the newest methods. uses AC_CACHE_CHECK
1525 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1526 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1527 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1529 * configure.in: add LYX_CXX_GOOD_STD_STRING
1531 * acinclude.m4: recreated
1533 2000-07-24 Amir Karger
1535 * README: add Hebrew, Arabic kmaps
1538 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1540 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1543 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1545 * Lot of files: add pragma interface/implementation.
1547 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1549 * lib/ui/default.ui: new file (ans new directory). Contains the
1550 default menu and toolbar.
1552 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1553 global space. Toolbars are now read (as menus) in ui files.
1555 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1557 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1558 is disabled because the document is read-only. We want to have the
1559 toggle state of the function anyway.
1560 (getStatus): add code for LFUN_VC* functions (mimicking what is
1561 done in old-style menus)
1563 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1564 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1566 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1567 * src/BufferView_pimpl.C: ditto.
1568 * src/lyxfunc.C: ditto.
1570 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1571 default). This replaces old-style menus by new ones.
1573 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1574 MenuItem. Contain the data structure of a menu.
1576 * src/insets/insettext.C: use LyXView::setLayout instead of
1577 accessing directly the toolbar combox.
1578 * src/lyxfunc.C (Dispatch): ditto.
1580 * src/LyXView.C (setLayout): new method, which just calls
1581 Toolbar::setLayout().
1582 (updateLayoutChoice): move part of this method in Toolbar.
1584 * src/toolbar.[Ch]: removed.
1586 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1587 implementation the toolbar.
1589 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1590 the toolbar. It might make sense to merge it with ToolbarDefaults
1592 (setLayout): new function.
1593 (updateLayoutList): ditto.
1594 (openLayoutList): ditto.
1596 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1597 xforms implementation of the toolbar.
1598 (get_toolbar_func): comment out, since I do not
1599 know what it is good for.
1601 * src/ToolbarDefaults.h: Add the ItemType enum.
1603 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1604 for a list of allocated C strings. Used in Menubar xforms
1605 implementation to avoid memory leaks.
1607 * src/support/lstrings.[Ch] (uppercase): new version taking and
1611 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1612 * lib/bind/emacs.bind: ditto.
1614 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1616 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1617 forward decl of LyXView.
1619 * src/toolbar.C (toolbarItem): moved from toolbar.h
1620 (toolbarItem::clean): ditto
1621 (toolbarItem::~toolbarItem): ditto
1622 (toolbarItem::operator): ditto
1624 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1626 * src/paragraph.h: control the NEW_TABULAR define from here
1628 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1629 USE_TABULAR_INSETS to NEW_TABULAR
1631 * src/ToolbarDefaults.C: add include "lyxlex.h"
1633 * files using the old table/tabular: use NEW_TABULAR to control
1634 compilation of old tabular stuff.
1636 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1639 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1640 planemet in reading of old style floats, fix the \end_deeper
1641 problem when reading old style floats.
1643 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1645 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1647 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1649 * lib/bind/sciword.bind: updated.
1651 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1653 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1654 layout write problem
1656 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1658 * src/Makefile.am (INCLUDES): remove image directory from include
1661 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1662 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1664 * src/LyXView.C (create_form_form_main): read the application icon
1667 * lib/images/*.xpm: change the icons to use transparent color for
1670 * src/toolbar.C (update): change the color of the button when it
1673 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1675 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1676 setting explicitely the minibuffer.
1677 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1679 * src/LyXView.C (showState): new function. Shows font information
1680 in minibuffer and update toolbar state.
1681 (LyXView): call Toolbar::update after creating the
1684 * src/toolbar.C: change toollist to be a vector instead of a
1686 (BubbleTimerCB): get help string directly from the callback
1687 argument of the corresponding icon (which is the action)
1688 (set): remove unnecessary ugliness.
1689 (update): new function. update the icons (depressed, disabled)
1690 depending of the status of the corresponding action.
1692 * src/toolbar.h: remove help in toolbarItem
1694 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1696 * src/Painter.C (text): Added code for using symbol glyphs from
1697 iso10646 fonts. Currently diabled.
1699 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1702 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1703 magyar,turkish and usorbian.
1705 * src/paragraph.C (isMultiLingual): Made more efficient.
1707 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1710 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1711 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1712 Also changed the prototype to "bool math_insert_greek(char)".
1714 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1716 * lots of files: apply the NEW_INSETS on all code that will not be
1717 needed when we move to use the new insets. Enable the define in
1718 lyxparagrah.h to try it.
1720 * src/insets/insettabular.C (cellstart): change to be a static
1722 (InsetTabular): initialize buffer in the initializer list.
1724 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1726 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1727 form_print.h out of the header file. Replaced with forward
1728 declarations of the relevant struct.
1730 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1733 * src/commandtags.h: do not include "debug.h" which does not
1734 belong there. #include it in some other places because of this
1737 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1739 * src/insets/insetcaption.C: add a couple "using" directives.
1741 * src/toolbar.C (add): get the help text directly from lyxaction.
1743 (setPixmap): new function. Loads from disk and sets a pixmap on a
1744 botton; the name of the pixmap file is derived from the command
1747 * src/toolbar.h: remove members isBitmap and pixmap from
1750 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1751 * lib/images/: move many files from images/banner.xpm.
1753 * src/lyx_gui.C (create_forms): read banner pixmap from file.
1755 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
1756 * src/toolbar.C: ditto.
1757 * configure.in: ditto.
1758 * INSTALL: document.
1760 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
1761 the spellchecker popup is closed from the WM.
1763 2000-07-19 Juergen Vigna <jug@sad.it>
1765 * src/insets/insetfloat.C (Write): small fix because we use the
1766 insetname for the type now!
1768 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
1770 * src/frontends/xforms/forms/form_citation.fd: object sizes are
1773 * src/frontends/Dialogs.h: removed hideCitation signal
1775 * src/insets/insetcite.h: added hide signal
1777 * src/insets/insetcite.C (~InsetCitation): emits new signal
1778 (getScreenLabel): "intelligent" label should now fit on the screen!
1780 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
1782 * src/frontends/xforms/FormCitation.C (showInset): connects
1783 hide() to the inset's hide signal
1784 (show): modified to use fl_set_object_position rather than
1785 fl_set_object_geometry wherever possible
1787 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1789 * src/insets/lyxinset.h: add caption code
1791 * src/insets/insetfloat.C (type): new method
1793 * src/insets/insetcaption.C (Write): new method
1795 (LyxCode): new method
1797 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
1798 to get it right together with using the FloatList.
1800 * src/commandtags.h: add LFUN_INSET_CAPTION
1801 * src/lyxfunc.C (Dispatch): handle it
1803 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
1806 * src/Variables.[Ch]: make expand take a const reference, remove
1807 the destructor, some whitespace changes.
1809 * src/LyXAction.C (init): add caption-inset-insert
1811 * src/FloatList.C (FloatList): update the default floats a bit.
1813 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1815 * src/Variables.[Ch]: new files. Intended to be used for language
1816 specific strings (like \chaptername) and filename substitution in
1819 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
1821 * lib/kbd/american.kmap: update
1823 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
1825 * src/bufferparams.[Ch]: remove member allowAccents.
1827 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
1829 * src/LaTeXLog.C: use the log_form.h header.
1830 * src/lyx_gui.C: ditto.
1831 * src/lyx_gui_misc.C: ditto.
1832 * src/lyxvc.h: ditto.
1834 * forms/log_form.fd: new file, created from latexoptions.fd. I
1835 kept the log popup and nuked the options form.
1837 * src/{la,}texoptions.[Ch]: removed.
1838 * src/lyx_cb.C (LaTeXOptions): ditto
1840 * src/lyx_gui.C (create_forms): do not handle the
1841 fd_latex_options form.
1843 2000-07-18 Juergen Vigna <jug@sad.it>
1845 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
1846 name of the inset so that it can be requested outside (text2.C).
1848 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
1851 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1853 * src/mathed/formula.h (ConvertFont): constify
1855 * src/mathed/formula.C (Read): add warning if \end_inset is not
1856 found on expected place.
1858 * src/insets/lyxinset.h (ConvertFont): consify
1860 * src/insets/insetquotes.C (ConvertFont): constify
1861 * src/insets/insetquotes.h: ditto
1863 * src/insets/insetinfo.h: add labelfont
1865 * src/insets/insetinfo.C (InsetInfo): set the labelfont
1866 (ascent): use labelfont
1870 (Write): make .lyx file a bit nicer
1872 * src/insets/insetfloat.C (Write): simplify somewhat...
1873 (Read): add warning if arg is not found
1875 * src/insets/insetcollapsable.C: add using std::max
1876 (Read): move string token and add warning in arg is not found
1877 (draw): use std::max to get the right ty
1878 (getMaxWidth): simplify by using std::max
1880 * src/insets/insetsection.h: new file
1881 * src/insets/insetsection.C: new file
1882 * src/insets/insetcaption.h: new file
1883 * src/insets/insetcaption.C: new file
1885 * src/insets/inset.C (ConvertFont): constify signature
1887 * src/insets/Makefile.am (libinsets_la_SOURCES): add
1888 insetcaption.[Ch] and insetsection.[Ch]
1890 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
1891 uses to use LABEL_COUNTER_CHAPTER instead.
1892 * src/text2.C (SetCounter): here
1894 * src/counters.h: new file
1895 * src/counters.C: new file
1896 * src/Sectioning.h: new file
1897 * src/Sectioning.C: new file
1899 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
1901 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1903 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
1906 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
1909 2000-07-17 Juergen Vigna <jug@sad.it>
1911 * src/tabular.C (Validate): check if array-package is needed.
1912 (SetVAlignment): added support for vertical alignment.
1913 (SetLTFoot): better support for longtable header/footers
1914 (Latex): modified to support added features.
1916 * src/LaTeXFeatures.[Ch]: added array-package.
1918 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
1920 * src/lyx_gui.C (LyXGUI): make sure that the height is large
1923 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
1925 * configure.in: do not forget to put a space after -isystem.
1927 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
1929 * lib/kbd/arabic.kmap: a few fixes.
1931 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1933 * some whitespace chagnes to a number of files.
1935 * src/support/DebugStream.h: change to make it easier for
1936 doc++ to parse correctly.
1937 * src/support/lyxstring.h: ditto
1939 * src/mathed/math_utils.C (compara): change to have only one
1941 (MathedLookupBOP): change because of the above.
1943 * src/mathed/math_delim.C (math_deco_compare): change to have only
1945 (search_deco): change becasue of the above.
1947 * src/insets/insettabular.C (DrawCellSelection): use std::swap
1948 instead of manually coded one.
1950 * src/insets/insetquotes.C (Read): read the \end_inset too
1952 * src/insets/insetlatex.h: remove file
1953 * src/insets/insetlatex.C: remove file
1955 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
1957 (InsetPrintIndex): remove destructor
1959 * src/insets/insetinclude.h: remove default constructor
1961 * src/insets/insetfloat.C: work to make it work better
1963 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
1965 * src/insets/insetcite.h (InsetCitation): remove default constructor
1967 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
1969 * src/text.C (GetColumnNearX): comment out some currently unused code.
1971 * src/paragraph.C (writeFile): move some initializations closer to
1973 (CutIntoMinibuffer): small change to use new matchIT operator
1977 (InsertInset): ditto
1980 (InsetIterator): ditto
1981 (Erase): small change to use new matchFT operator
1983 (GetFontSettings): ditto
1984 (HighestFontInRange): ditto
1987 * src/lyxparagraph.h: some chars changed to value_type
1988 (matchIT): because of some stronger checking (perhaps too strong)
1989 in SGI STL, the two operator() unified to one.
1992 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
1994 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
1995 the last inset read added
1996 (parseSingleLyXformat2Token): some more (future) compability code added
1997 (parseSingleLyXformat2Token): warning about solitary \end_inset added
1998 (parseSingleLyXformat2Token): set last_inset_read
1999 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2000 (parseSingleLyXformat2Token): don't double intializw string next_token
2002 * src/TextCache.C (text_fits::operator()): add const's to the signature
2003 (has_buffer::operator()): ditto
2005 * src/Floating.h: add some comments on the class
2007 * src/FloatList.[Ch] (typeExist): new method
2010 * src/BackStack.h: added default constructor, wanted by Gcc.
2012 2000-07-14 Juergen Vigna <jug@sad.it>
2014 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2016 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2018 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2019 do a redraw when the window is resized!
2020 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2022 * src/insets/insettext.C (resizeLyXText): added function to correctly
2023 being able to resize the LyXWindow.
2025 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2027 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2029 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2030 crashes when closing dialog to a deleted inset.
2032 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2033 method! Now similar to other insets.
2035 2000-07-13 Juergen Vigna <jug@sad.it>
2037 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2039 * lib/examples/Literate.lyx: small patch!
2041 * src/insets/insetbib.C (Read): added this function because of wrong
2042 Write (without [begin|end]_inset).
2044 2000-07-11 Juergen Vigna <jug@sad.it>
2046 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2047 as the insertInset could not be good!
2049 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2050 the bool param should not be last.
2052 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2054 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2055 did submit that to Karl).
2057 * configure.in: use -isystem instead of -I for X headers. This
2058 fixes a problem on solaris with a recent gcc;
2059 put the front-end code after the X detection code;
2060 configure in sigc++ before lib/
2062 * src/lyx_main.C (commandLineHelp): remove -display from command
2065 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2067 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2068 Also put in Makefile rules for building the ``listerrors''
2069 program for parsing errors from literate programs written in LyX.
2071 * lib/build-listerrors: Added small shell script as part of compile
2072 process. This builds a working ``listerrors'' binary if noweb is
2073 installed and either 1) the VNC X server is installed on the machine,
2074 or 2) the user is compiling from within a GUI. The existence of a GUI
2075 is necessary to use the ``lyx --export'' feature for now. This
2076 hack can be removed once ``lyx --export'' no longer requires a GUI to
2079 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2081 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2082 now passed back correctly from gcc and placed "under" error
2083 buttons in a Literate LyX source.
2085 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2087 * src/text.C (GetColumnNearX): Better behavior when a RTL
2088 paragraph is ended by LTR text.
2090 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2093 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2095 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2096 true when clipboard is empty.
2098 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2100 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2101 row of the paragraph.
2102 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2103 to prevent calculation of bidi tables
2105 2000-07-07 Juergen Vigna <jug@sad.it>
2107 * src/screen.C (ToggleSelection): added y_offset and x_offset
2110 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2113 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2115 * src/insets/insettext.C: fixed Layout-Display!
2117 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2119 * configure.in: add check for strings.h header.
2121 * src/spellchecker.C: include <strings.h> in order to have a
2122 definition for bzero().
2124 2000-07-07 Juergen Vigna <jug@sad.it>
2126 * src/insets/insettext.C (draw): set the status of the bv->text to
2127 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2129 * src/screen.C (DrawOneRow):
2130 (DrawFromTo): redraw the actual row if something has changed in it
2133 * src/text.C (draw): call an update of the toplevel-inset if something
2134 has changed inside while drawing.
2136 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2138 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2140 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2141 processing inside class.
2143 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2144 processing inside class.
2146 * src/insets/insetindex.h new struct Holder, consistent with other
2149 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2150 citation dialog from main code and placed it in src/frontends/xforms.
2151 Dialog launched through signals instead of callbacks
2153 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2155 * lyx.man: update the options description.
2157 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2159 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2160 handle neg values, set min width to 590, add doc about -display
2162 2000-07-05 Juergen Vigna <jug@sad.it>
2164 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2165 calls to BufferView *.
2167 * src/insets/insettext.C (checkAndActivateInset): small fix non
2168 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2170 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2171 their \end_inset token!
2173 2000-07-04 edscott <edscott@imp.mx>
2175 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2176 lib/lyxrc.example: added option \wheel_jump
2178 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2180 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2181 remove support for -width,-height,-xpos and -ypos.
2183 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2185 * src/encoding.[Ch]: New files.
2187 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2188 (text): Call to the underline() method only when needed.
2190 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2192 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2193 encoding(s) for the document.
2195 * src/bufferparams.C (BufferParams): Changed default value of
2198 * src/language.C (newLang): Removed.
2199 (items[]): Added encoding information for all defined languages.
2201 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2202 encoding choice button.
2204 * src/lyxrc.h (font_norm_type): New member variable.
2205 (set_font_norm_type): New method.
2207 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2208 paragraphs with different encodings.
2210 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2211 (TransformChar): Changed to work correctly with Arabic points.
2212 (draw): Added support for drawing Arabic points.
2213 (draw): Removed code for drawing underbars (this is done by
2216 * src/support/textutils.h (IsPrintableNonspace): New function.
2218 * src/BufferView_pimpl.h: Added "using SigC::Object".
2219 * src/LyXView.h: ditto.
2221 * src/insets/insetinclude.h (include_label): Changed to mutable.
2223 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2225 * src/mathed/math_iter.h: remove empty destructor
2227 * src/mathed/math_cursor.h: remove empty destructor
2229 * src/insets/lyxinset.h: add THEOREM_CODE
2231 * src/insets/insettheorem.[Ch]: new files
2233 * src/insets/insetminipage.C: (InsertInset): remove
2235 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2237 (InsertInset): remove
2239 * src/insets/insetlist.C: (InsertList): remove
2241 * src/insets/insetfootlike.[Ch]: new files
2243 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2246 (InsertInset): ditto
2248 * src/insets/insetert.C: remove include Painter.h, reindent
2249 (InsertInset): move to header
2251 * src/insets/insetcollapsable.h: remove explicit from default
2252 contructor, remove empty destructor, add InsertInset
2254 * src/insets/insetcollapsable.C (InsertInset): new func
2256 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2258 * src/vspace.h: add explicit to constructor
2260 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2261 \textcompwordmark, please test this.
2263 * src/lyxrc.C: set ascii_linelen to 65 by default
2265 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2267 * src/commandtags.h: add LFUN_INSET_THEOREM
2269 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2270 (makeLinuxDocFile): remove _some_ of the nice logic
2271 (makeDocBookFile): ditto
2273 * src/Painter.[Ch]: (~Painter): removed
2275 * src/LyXAction.C (init): entry for insettheorem added
2277 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2279 (deplog): code to detect files generated by LaTeX, needs testing
2282 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2284 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2286 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2288 * src/LaTeX.C (deplog): Add a check for files that are going to be
2289 created by the first latex run, part of the project to remove the
2292 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2293 contents to the extension list.
2295 2000-07-04 Juergen Vigna <jug@sad.it>
2297 * src/text.C (NextBreakPoint): added support for needFullRow()
2299 * src/insets/lyxinset.h: added needFullRow()
2301 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2304 * src/insets/insettext.C: lots of changes for update!
2306 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2308 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2310 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2312 * src/insets/insetinclude.C (InsetInclude): fixed
2313 initialization of include_label.
2314 (unique_id): now returns a string.
2316 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2318 * src/LaTeXFeatures.h: new member IncludedFiles, for
2319 a map of key, included file name.
2321 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2322 with the included files for inclusion in SGML preamble,
2323 i. e., linuxdoc and docbook.
2326 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2327 nice (is the generated linuxdoc code to be exported?), that
2328 allows to remove column, and only_body that will be true for
2329 slave documents. Insets are allowed inside SGML font type.
2330 New handling of the SGML preamble for included files.
2331 (makeDocBookFile): the same for docbook.
2333 * src/insets/insetinclude.h:
2334 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2336 (DocBook): new export methods.
2338 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2339 and makeDocBookFile.
2341 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2342 formats to export with command line argument -x.
2344 2000-06-29 Juergen Vigna <jug@sad.it>
2346 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2347 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2349 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2350 region could already been cleared by an inset!
2352 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2354 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2357 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2359 (cursorToggle): remove special handling of lyx focus.
2361 2000-06-28 Juergen Vigna <jug@sad.it>
2363 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2366 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2368 * src/insets/insetindex.C (Edit): add a callback when popup is
2371 * src/insets/insettext.C (LocalDispatch):
2372 * src/insets/insetmarginal.h:
2373 * src/insets/insetlist.h:
2374 * src/insets/insetfoot.h:
2375 * src/insets/insetfloat.h:
2376 * src/insets/insetert.h: add a missing std:: qualifier.
2378 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2380 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2383 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2385 * src/insets/insettext.C (Read): remove tmptok unused variable
2386 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2387 (InsertInset): change for new InsetInset code
2389 * src/insets/insettext.h: add TEXT inline method
2391 * src/insets/insettext.C: remove TEXT macro
2393 * src/insets/insetmarginal.C (Write): new method
2394 (Latex): change output slightly
2396 * src/insets/insetfoot.C (Write): new method
2397 (Latex): change output slightly (don't use endl when no need)
2399 * src/insets/insetert.C (Write): new method
2401 * src/insets/insetcollapsable.h: make button_length, button_top_y
2402 and button_bottm_y protected.
2404 * src/insets/insetcollapsable.C (Write): simplify code by using
2405 tostr. Also do not output the float name, the children class
2406 should to that to get control over own arguments
2408 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2409 src/insets/insetminipage.[Ch]:
2412 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2414 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2416 * src/Makefile.am (lyx_SOURCES): add the new files
2418 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2419 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2420 * src/commandtags.h: ditto
2422 * src/LaTeXFeatures.h: add a std::set of used floattypes
2424 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2426 * src/FloatList.[Ch] src/Floating.h: new files
2428 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2430 * src/lyx_cb.C (TableApplyCB): ditto
2432 * src/text2.C: ditto
2433 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2434 (parseSingleLyXformat2Token): ditto + add code for
2435 backwards compability for old float styles + add code for new insets
2437 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2439 (InsertInset(size_type, Inset *, LyXFont)): new method
2440 (InsetChar(size_type, char)): changed to use the other InsetChar
2441 with a LyXFont(ALL_INHERIT).
2442 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2443 insert the META_INSET.
2445 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2447 * sigc++/thread.h (Threads): from here
2449 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2450 definition out of line
2451 * sigc++/scope.h: from here
2453 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2455 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2456 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2458 * Makefile.am (bindist): new target.
2460 * INSTALL: add instructions for doing a binary distribution.
2462 * development/tools/README.bin.example: update a bit.
2464 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2467 * lib/lyxrc.example: new lyxrc tag \set_color.
2469 * src/lyxfunc.C (Dispatch):
2470 * src/commandtags.h:
2471 * src/LyXAction.C: new lyxfunc "set-color".
2473 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2474 and an x11name given as strings.
2476 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2477 cache when a color is changed.
2479 2000-06-26 Juergen Vigna <jug@sad.it>
2481 * src/lyxrow.C (width): added this functions and variable.
2483 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2486 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2488 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2490 * images/undo_bw.xpm: new icon.
2491 * images/redo_bw.xpm: ditto.
2493 * configure.in (INSTALL_SCRIPT): change value to
2494 ${INSTALL} to avoid failures of install-script target.
2495 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2497 * src/BufferView.h: add a magic "friend" declaration to please
2500 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2502 * forms/cite.fd: modified to allow resizing without messing
2505 * src/insetcite.C: Uses code from cite.fd almost without
2507 User can now resize dialog in the x-direction.
2508 Resizing the dialog in the y-direction is prevented, as the
2509 code does this intelligently already.
2511 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2513 * INSTALL: remove obsolete entry in "problems" section.
2515 * lib/examples/sl_*.lyx: update of the slovenian examples.
2517 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2519 2000-06-23 Juergen Vigna <jug@sad.it>
2521 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2523 * src/buffer.C (resize): delete the LyXText of textinsets.
2525 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2527 * src/insets/lyxinset.h: added another parameter 'cleared' to
2528 the draw() function.
2530 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2531 unlocking inset in inset.
2533 2000-06-22 Juergen Vigna <jug@sad.it>
2535 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2536 of insets and moved first to LyXText.
2538 * src/mathed/formulamacro.[Ch]:
2539 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2541 2000-06-21 Juergen Vigna <jug@sad.it>
2543 * src/text.C (GetVisibleRow): look if I should clear the area or not
2544 using Inset::doClearArea() function.
2546 * src/insets/lyxinset.h: added doClearArea() function and
2547 modified draw(Painter &, ...) to draw(BufferView *, ...)
2549 * src/text2.C (UpdateInset): return bool insted of int
2551 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2553 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2554 combox in the character popup
2556 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2557 BufferParams const & params
2559 2000-06-20 Juergen Vigna <jug@sad.it>
2561 * src/insets/insettext.C (SetParagraphData): set insetowner on
2564 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2566 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2567 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2569 (form_main_): remove
2571 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2572 (create_form_form_main): remove FD_form_main stuff, connect to
2573 autosave_timeout signal
2575 * src/LyXView.[Ch] (getMainForm): remove
2576 (UpdateTimerCB): remove
2577 * src/BufferView_pimpl.h: inherit from SigC::Object
2579 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2580 signal instead of callback
2582 * src/BufferView.[Ch] (cursorToggleCB): remove
2584 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2586 * src/BufferView_pimpl.C: changes because of the one below
2588 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2589 instead of storing a pointer to a LyXText.
2591 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2593 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2595 * src/lyxparagraph.h
2597 * src/paragraph.C: Changed fontlist to a sorted vector.
2599 2000-06-19 Juergen Vigna <jug@sad.it>
2601 * src/BufferView.h: added screen() function.
2603 * src/insets/insettext.C (LocalDispatch): some selection code
2606 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2608 * src/insets/insettext.C (SetParagraphData):
2610 (InsetText): fixes for multiple paragraphs.
2612 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2614 * development/lyx.spec.in: Call configure with ``--without-warnings''
2615 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2616 This should be fine, however, since we generally don't want to be
2617 verbose when making an RPM.
2619 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2621 * lib/scripts/fig2pstex.py: New file
2623 2000-06-16 Juergen Vigna <jug@sad.it>
2625 * src/insets/insettabular.C (UpdateLocal):
2626 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2627 (LocalDispatch): Changed all functions to use LyXText.
2629 2000-06-15 Juergen Vigna <jug@sad.it>
2631 * src/text.C (SetHeightOfRow): call inset::update before requesting
2634 * src/insets/insettext.C (update):
2635 * src/insets/insettabular.C (update): added implementation
2637 * src/insets/lyxinset.h: added update function
2639 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2641 * src/text.C (SelectNextWord): protect against null pointers with
2642 old-style string streams. (fix from Paul Theo Gonciari
2645 * src/cite.[Ch]: remove erroneous files.
2647 * lib/configure.m4: update the list of created directories.
2649 * src/lyxrow.C: include <config.h>
2650 * src/lyxcursor.C: ditto.
2652 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2654 * lib/examples/decimal.lyx: new example file from Mike.
2656 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2657 to find template definitions (from Dekel)
2659 * src/frontends/.cvsignore: add a few things.
2661 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2663 * src/Timeout.C (TimeOut): remove default argument.
2665 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2668 * src/insets/ExternalTemplate.C: add a "using" directive.
2670 * src/lyx_main.h: remove the act_ struct, which seems unused
2673 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2675 * LyX Developers Meeting: All files changed, due to random C++ (by
2676 coincidence) code generator script.
2678 - external inset (cool!)
2679 - initial online editing of preferences
2680 - insettabular breaks insettext(s contents)
2682 - some DocBook fixes
2683 - example files update
2684 - other cool stuff, create a diff and look for yourself.
2686 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2688 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2689 -1 this is a non-line-breaking textinset.
2691 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2692 if there is no width set.
2694 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2696 * Lots of files: Merged the dialogbase branch.
2698 2000-06-09 Allan Rae <rae@lyx.org>
2700 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2701 and the Dispatch methods that used it.
2703 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2704 access to functions formerly kept in Dispatch.
2706 2000-05-19 Allan Rae <rae@lyx.org>
2708 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2709 made to_page and count_copies integers again. from_page remains a
2710 string however because I want to allow entry of a print range like
2711 "1,4,22-25" using this field.
2713 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2714 and printer-params-get. These aren't useful from the minibuffer but
2715 could be used by a script/LyXServer app provided it passes a suitable
2716 auto_mem_buffer. I guess I should take a look at how the LyXServer
2717 works and make it support xtl buffers.
2719 * sigc++/: updated to libsigc++-1.0.1
2721 * src/xtl/: updated to xtl-1.3.pl.11
2723 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2724 those changes done to the files in src/ are actually recreated when
2725 they get regenerated. Please don't ever accept a patch that changes a
2726 dialog unless that patch includes the changes to the corresponding *.fd
2729 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2730 stringOnlyContains, renamed it and generalised it.
2732 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2733 branch. Removed the remaining old form_print code.
2735 2000-04-26 Allan Rae <rae@lyx.org>
2737 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2738 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2740 2000-04-25 Allan Rae <rae@lyx.org>
2742 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2743 against a base of xtl-1.3.pl.4
2745 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2746 filter the Id: entries so they still show the xtl version number
2749 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2750 into the src/xtl code. Patch still pending with José (XTL)
2752 2000-04-24 Allan Rae <rae@lyx.org>
2754 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
2755 both more generic and much safer. Use the new template functions.
2756 * src/buffer.[Ch] (Dispatch): ditto.
2758 * src/frontends/xforms/FormPrint.C (update): Use new template functions
2759 and mem buffer more intelligently. Also a little general cleanup.
2762 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
2763 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
2764 * src/xtl/Makefile.am: ditto.
2765 * src/xtl/.cvsignore: ditto.
2766 * src/Makefile.am: ditto.
2768 * src/PrinterParams.h: Removed the macros member functions. Added a
2769 testInvariant member function. A bit of tidying up and commenting.
2770 Included Angus's idea for fixing operation with egcs-1.1.2.
2772 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
2773 cool expansion of XTL's mem_buffer to support automatic memory
2774 management within the buffer itself. Removed the various macros and
2775 replaced them with template functions that use either auto_mem_buffer
2776 or mem_buffer depending on a #define. The mem_buffer support will
2777 disappear as soon as the auto_mem_buffer is confirmed to be good on
2778 other platforms/compilers. That is, it's there so you've got something
2781 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
2782 effectively forked XTL. However I expect José will include my code
2783 into the next major release. Also fixed a memory leak.
2784 * src/xtl/text.h: ditto.
2785 * src/xtl/xdr.h: ditto.
2786 * src/xtl/giop.h: ditto.
2788 2000-04-16 Allan Rae <rae@lyx.org>
2790 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
2791 by autogen.sh and removed by maintainer-clean anyway.
2792 * .cvsignore, sigc++/.cvsignore: Support the above.
2794 * sigc++/.cvsignore: Forgot that retbind.h was generated.
2796 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
2798 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
2799 macros, renamed static callback-target member functions to suit new
2800 scheme and made them public.
2801 * src/frontends/xforms/forms/form_print.fd: ditto.
2802 * src/frontends/xforms/forms/form_copyright.fd: ditto.
2804 * src/support/lxtl.h: small cleanup to use typedef instead of #define
2807 * src/xtl/: New directory containing a minimal distribution of XTL.
2808 This is XTL-1.3.pl.4.
2810 * development/tools/lxtl.sh: A script to generate the above mini-dist.
2812 2000-04-15 Allan Rae <rae@lyx.org>
2814 * development/tools/makeLyXsigc.sh: Remove the library version numbers
2816 * sigc++/: Updated to libsigc++-1.0.0
2818 2000-04-14 Allan Rae <rae@lyx.org>
2820 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
2821 use the generic ones in future. I'll modify my conversion script.
2823 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
2825 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
2826 (CloseAllBufferRelatedDialogs): Renamed.
2827 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
2829 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
2830 of the generic ones. These are the same ones my conversion script
2833 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
2834 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
2835 * src/buffer.C (Dispatch): ditto
2837 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
2838 functions for updating and hiding buffer dependent dialogs.
2839 * src/BufferView.C (buffer): ditto
2840 * src/buffer.C (setReadonly): ditto
2841 * src/lyxfunc.C (CloseBuffer): ditto
2843 * src/buffer.h: Take setReadonly() out of line so I don't have to include
2844 Dialogs.h, and hence all the SigC stuff, into every file that includes
2845 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
2847 * src/BufferView2.C: reduce the number of headers included by buffer.h
2849 2000-04-11 Allan Rae <rae@lyx.org>
2851 * src/frontends/xforms/xform_macros.h: A small collection of macros
2852 for building C callbacks.
2854 * src/frontends/xforms/Makefile.am: Added above file.
2856 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
2857 scheme again. This time it should work for JMarc. If this is
2858 successful I'll revise my conversion script to automate some of this.
2859 The static member functions in the class also have to be public for
2860 this scheme will work. If the scheme works (it's almost identical to
2861 the way BufferView::cursorToggleCB is handled so it should work) then
2862 FormCopyright and FormPrint will be ready for inclusion into the main
2863 trunk immediately after 1.1.5 is released -- provided we're prepared
2864 for complaints about lame compilers not handling XTL.
2866 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
2868 2000-04-07 Allan Rae <rae@lyx.org>
2870 * config/lyxinclude.m4: A bit more tidying up (Angus)
2872 * src/LString.h: JMarc's <string> header fix
2874 * src/PrinterParams.h: Used string for most data to remove some
2875 ugly code in the Print dialog and avoid even uglier code when
2876 appending the ints to a string for output.
2878 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
2879 and moved "default:" back to the end of switch statement. Cleaned
2880 up the printing so it uses the right function calls and so the
2881 "print to file" option actually puts the file in the right directory.
2883 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
2885 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
2886 and Ok+Apply button control into a separate method: input (Angus).
2887 (input) Cleaned it up and improved it to be very thorough now.
2888 (All CB) static_cast used instead of C style cast (Angus). This will
2889 probably change again once we've worked out how to keep gcc-2.8.1 happy
2890 with real C callbacks.
2891 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
2892 ignore some of the bool settings and has random numbers instead. Needs
2893 some more investigation. Added other input length checks and checking
2894 of file and printer names.
2896 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
2897 would link (Angus). Seems the old code doesn't compile with the pragma
2898 statement either. Separated callback entries from internal methods.
2900 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
2902 2000-03-17 Allan Rae <rae@lyx.org>
2904 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
2905 need it? Maybe it could go in Dialogs instead? I could make it a
2906 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
2907 values to get the bool return value.
2908 (Dispatch): New overloaded method for xtl support.
2910 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
2911 extern "C" callback instead of static member functions. Hopefully,
2912 JMarc will be able to compile this. I haven't changed
2913 forms/form_copyright.fd yet. Breaking one of my own rules already.
2915 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
2916 because they aren't useful from the minibuffer. Maybe a LyXServer
2917 might want a help message though?
2919 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
2921 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
2922 xtl which needs both rtti and exceptions.
2924 * src/support/Makefile.am:
2925 * src/support/lxtl.h: New file. Some helper macros for using XTL.
2927 * src/frontends/xforms/input_validators.[ch]: input filters and
2928 validators. These conrol what keys are valid in input boxes.
2929 Use them and write some more. Much better idea than waiting till
2930 after the user has pressed Ok to say that the input fields don't make
2933 * src/frontends/xforms/Makefile.am:
2934 * src/frontends/xforms/forms/form_print.fd:
2935 * src/frontends/xforms/forms/makefile:
2936 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
2937 new scheme. Still have to make sure I haven't missed anything from
2938 the current implementation.
2940 * src/Makefile.am, src/PrinterParams.h: New data store.
2942 * other files: Added a couple of copyright notices.
2944 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2946 * src/insets/insetbib.h: move Holder struct in public space.
2948 * src/frontends/include/DialogBase.h: use SigC:: only when
2949 SIGC_CXX_NAMESPACES is defined.
2950 * src/frontends/include/Dialogs.h: ditto.
2952 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
2954 * src/frontends/xforms/FormCopyright.[Ch]: do not
2955 mention SigC:: explicitely.
2957 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2959 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
2960 deals with testing KDE in main configure.in
2961 * configure.in: ditto.
2963 2000-02-22 Allan Rae <rae@lyx.org>
2965 * Lots of files: Merged from HEAD
2967 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
2968 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
2970 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
2972 * sigc++/: new minidist.
2974 2000-02-14 Allan Rae <rae@lyx.org>
2976 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
2978 2000-02-08 Juergen Vigna <jug@sad.it>
2980 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
2981 file for the buildin GUI builder of KDevelop of the copyright-dialog.
2983 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
2984 for this port and so it is much easier for other people to port
2985 dialogs in a common development environment.
2987 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
2988 the QT/KDE implementation.
2990 * src/frontends/kde/Dialogs.C:
2991 * src/frontends/kde/FormCopyright.C:
2992 * src/frontends/kde/FormCopyright.h:
2993 * src/frontends/kde/Makefile.am:
2994 * src/frontends/kde/formcopyrightdialog.C:
2995 * src/frontends/kde/formcopyrightdialog.h:
2996 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
2997 for the kde support of the Copyright-Dialog.
2999 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3000 subdir-substitution instead of hardcoded 'xforms' as we now have also
3003 * src/frontends/include/DialogBase.h (Object): just commented the
3004 label after #endif (nasty warning and I don't like warnings ;)
3006 * src/main.C (main): added KApplication initialization if using
3009 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3010 For now only the KDE event-loop is added if frontend==kde.
3012 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3014 * configure.in: added support for the --with-frontend[=value] option
3016 * autogen.sh: added kde.m4 file to list of config-files
3018 * acconfig.h: added define for KDEGUI-support
3020 * config/kde.m4: added configuration functions for KDE-port
3022 * config/lyxinclude.m4: added --with-frontend[=value] option with
3023 support for xforms and KDE.
3025 2000-02-08 Allan Rae <rae@lyx.org>
3027 * all Makefile.am: Fixed up so the make targets dist, distclean,
3028 install and uninstall all work even if builddir != srcdir. Still
3029 have a new sigc++ minidist update to come.
3031 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3033 2000-02-01 Allan Rae <rae@lyx.org>
3035 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3036 Many mods to get builddir != srcdir working.
3038 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3039 for building on NT and so we can do the builddir != srcdir stuff.
3041 2000-01-30 Allan Rae <rae@lyx.org>
3043 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3044 This will stay in "rae" branch. We probably don't really need it in
3045 the main trunk as anyone who wants to help programming it should get
3046 a full library installed also. So they can check both included and
3047 system supplied library compilation.
3049 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3050 Added a 'mini' distribution of libsigc++. If you feel the urge to
3051 change something in these directories - Resist it. If you can't
3052 resist the urge then you should modify the following script and rebuild
3053 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3054 all happen. Still uses a hacked version of libsigc++'s configure.in.
3055 I'm quite happy with the results. I'm not sure the extra work to turn
3056 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3057 worth the trouble and would probably lead to extra maintenance
3059 I haven't tested the following important make targets: install, dist.
3060 Not ready for prime time but very close. Maybe 1.1.5.
3062 * development/tools/makeLyXsigc.sh: A shell script to automatically
3063 generate our mini-dist of libsigc++. It can only be used with a CVS
3064 checkout of libsigc++ not a tarball distribution. It's well commented.
3065 This will end up as part of the libsigc++ distribution so other apps
3066 can easily have an included mini-dist. If someone makes mods to the
3067 sigc++ subpackage without modifying this script to generate those
3068 changes I'll be very upset!
3070 * src/frontends/: Started the gui/system indep structure.
3072 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3073 to access the gui-indep dialogs are in this class. Much improved
3074 design compared to previous revision. Lars, please refrain from
3075 moving this header into src/ like you did with Popups.h last time.
3077 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3079 * src/frontends/xforms/: Started the gui-indep system with a single
3080 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3083 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3084 Here you'll find a very useful makefile and automated fdfix.sh that
3085 makes updating dailogs a no-brainer -- provided you follow the rules
3086 set out in the README. I'm thinking about adding another script to
3087 automatically generate skeleton code for a new dialog given just the
3090 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3091 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3092 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3094 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3096 * src/support/LSubstring.C (operator): simplify
3098 * src/lyxtext.h: removed bparams, use buffer_->params instead
3100 * src/lyxrow.h: make Row a real class, move all variables to
3101 private and use accessors.
3103 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3105 (isRightToLeftPar): ditto
3106 (ChangeLanguage): ditto
3107 (isMultiLingual): ditto
3110 (SimpleTeXOnePar): ditto
3111 (TeXEnvironment): ditto
3112 (GetEndLabel): ditto
3114 (SetOnlyLayout): ditto
3115 (BreakParagraph): ditto
3116 (BreakParagraphConservative): ditto
3117 (GetFontSettings): ditto
3119 (CopyIntoMinibuffer): ditto
3120 (CutIntoMinibuffer): ditto
3121 (PasteParagraph): ditto
3122 (SetPExtraType): ditto
3123 (UnsetPExtraType): ditto
3124 (DocBookContTableRows): ditto
3125 (SimpleDocBookOneTablePar): ditto
3127 (TeXFootnote): ditto
3128 (SimpleTeXOneTablePar): ditto
3129 (TeXContTableRows): ditto
3130 (SimpleTeXSpecialChars): ditto
3133 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3134 to private and use accessors.
3136 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3137 this, we did not use it anymore and has not been for ages. Just a
3138 waste of cpu cycles.
3140 * src/language.h: make Language a real class, move all variables
3141 to private and use accessors.
3143 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3144 (create_view): remove
3145 (update): some changes for new timer
3146 (cursorToggle): use new timer
3147 (beforeChange): change for new timer
3149 * src/BufferView.h (cursorToggleCB): removed last paramter because
3152 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3153 (cursorToggleCB): change because of new timer code
3155 * lib/CREDITS: updated own mailaddress
3157 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3159 * src/support/filetools.C (PutEnv): fix the code in case neither
3160 putenv() nor setenv() have been found.
3162 * INSTALL: mention the install-strip Makefile target.
3164 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3165 read-only documents.
3167 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3169 * lib/reLyX/configure.in (VERSION): avoid using a previously
3170 generated reLyX wrapper to find out $prefix.
3172 * lib/examples/eu_adibide_lyx-atua.lyx:
3173 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3174 translation of the Tutorial (Dooteo)
3176 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3178 * forms/cite.fd: new citation dialog
3180 * src/insetcite.[Ch]: the new citation dialog is moved into
3183 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3186 * src/insets/insetcommand.h: data members made private.
3188 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3190 * LyX 1.1.5 released
3192 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3194 * src/version.h (LYX_RELEASE): to 1.1.5
3196 * src/spellchecker.C (RunSpellChecker): return false if the
3197 spellchecker dies upon creation.
3199 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3201 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3202 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3206 * lib/CREDITS: update entry for Martin Vermeer.
3208 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3210 * src/text.C (draw): Draw foreign language bars at the bottom of
3211 the row instead of at the baseline.
3213 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3215 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3217 * lib/bind/de_menus.bind: updated
3219 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3221 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3223 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3225 * src/menus.C (Limit_string_length): New function
3226 (ShowTocMenu): Limit the number of items/length of items in the
3229 * src/paragraph.C (String): Correct result for a paragraph inside
3232 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3234 * src/bufferlist.C (close): test of buf->getuser() == NULL
3236 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3238 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3239 Do not call to SetCursor when the paragraph is a closed footnote!
3241 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3243 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3246 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3248 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3251 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3252 reference popup, that activates the reference-back action
3254 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3256 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3257 the menus. Also fixed a bug.
3259 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3260 the math panels when switching buffers (unless new buffer is readonly).
3262 * src/BufferView.C (NoSavedPositions)
3263 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3265 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3267 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3268 less of dvi dirty or not.
3270 * src/trans_mgr.[Ch] (insert): change first parameter to string
3273 * src/chset.[Ch] (encodeString): add const to first parameter
3275 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3277 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3281 * src/LaTeX.C (deplog): better searching for dependency files in
3282 the latex log. Uses now regexps.
3284 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3285 instead of the box hack or \hfill.
3287 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3289 * src/lyxfunc.C (doImportHelper): do not create the file before
3290 doing the actual import.
3291 (doImportASCIIasLines): create a new file before doing the insert.
3292 (doImportASCIIasParagraphs): ditto.
3294 * lib/lyxrc.example: remove mention of non-existing commands
3296 * lyx.man: remove mention of color-related switches.
3298 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3300 * src/lyx_gui.C: remove all the color-related ressources, which
3301 are not used anymore.
3303 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3306 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3308 * src/lyxrc.C (read): Add a missing break in the switch
3310 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3312 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3314 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3317 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3319 * src/text.C (draw): draw bars under foreign language words.
3321 * src/LColor.[Ch]: add LColor::language
3323 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3325 * src/lyxcursor.h (boundary): New member variable
3327 * src/text.C (IsBoundary): New methods
3329 * src/text.C: Use the above for currect cursor movement when there
3330 is both RTL & LTR text.
3332 * src/text2.C: ditto
3334 * src/bufferview_funcs.C (ToggleAndShow): ditto
3336 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3338 * src/text.C (DeleteLineForward): set selection to true to avoid
3339 that DeleteEmptyParagraphMechanism does some magic. This is how it
3340 is done in all other functions, and seems reasonable.
3341 (DeleteWordForward): do not jump over non-word stuff, since
3342 CursorRightOneWord() already does it.
3344 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3345 DeleteWordBackward, since they seem safe to me (since selection is
3346 set to "true") DeleteEmptyParagraphMechanism does nothing.
3348 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3350 * src/lyx_main.C (easyParse): simplify the code by factoring the
3351 part that removes parameters from the command line.
3352 (LyX): check wether wrong command line options have been given.
3354 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3356 * src/lyx_main.C : add support for specifying user LyX
3357 directory via command line option -userdir.
3359 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3361 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3362 the number of items per popup.
3363 (Add_to_refs_menu): Ditto.
3365 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3367 * src/lyxparagraph.h: renamed ClearParagraph() to
3368 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3369 textclass as parameter, and do nothing if free_spacing is
3370 true. This fixes part of the line-delete-forward problems.
3372 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3373 (pasteSelection): ditto.
3374 (SwitchLayoutsBetweenClasses): more translatable strings.
3376 * src/text2.C (CutSelection): use StripLeadingSpaces.
3377 (PasteSelection): ditto.
3378 (DeleteEmptyParagraphMechanism): ditto.
3380 2000-05-26 Juergen Vigna <jug@sad.it>
3382 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3383 is not needed in tabular insets.
3385 * src/insets/insettabular.C (TabularFeatures): added missing features.
3387 * src/tabular.C (DeleteColumn):
3389 (AppendRow): implemented this functions
3390 (cellsturct::operator=): clone the inset too;
3392 2000-05-23 Juergen Vigna <jug@sad.it>
3394 * src/insets/insettabular.C (LocalDispatch): better selection support
3395 when having multicolumn-cells.
3397 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3399 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3401 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3403 * src/ColorHandler.C (getGCForeground): put more test into _()
3405 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3408 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3411 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3413 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3414 there are no labels, or when buffer is readonly.
3416 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3417 there are no labels, buffer is SGML, or when buffer is readonly.
3419 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3421 * src/LColor.C (LColor): change a couple of grey40 to grey60
3422 (LColor): rewore initalization to make compiles go some magnitude
3424 (getGUIName): don't use gettext until we need the string.
3426 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3428 * src/Bullet.[Ch]: Fixed a small bug.
3430 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3432 * src/paragraph.C (String): Several fixes/improvements
3434 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3436 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3438 * src/paragraph.C (String): give more correct output.
3440 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3442 * src/lyxfont.C (stateText) Do not output the language if it is
3443 eqaul to the language of the document.
3445 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3446 between two paragraphs with the same language.
3448 * src/paragraph.C (getParLanguage) Return a correct answer for an
3449 empty dummy paragraph.
3451 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3454 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3457 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3458 the menus/popup, if requested fonts are unavailable.
3460 2000-05-22 Juergen Vigna <jug@sad.it>
3462 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3463 movement support (Up/Down/Tab/Shift-Tab).
3464 (LocalDispatch): added also preliminari cursor-selection.
3466 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3468 * src/paragraph.C (PasteParagraph): Hopefully now right!
3470 2000-05-22 Garst R. Reese <reese@isn.net>
3472 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3473 of list, change all references to Environment to Command
3474 * tex/hollywood.cls : rewrite environments as commands, add
3475 \uppercase to interiorshot and exteriorshot to force uppecase.
3476 * tex/broadway.cls : rewrite environments as commands. Tweak
3479 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3481 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3482 size of items: use a constant intead of the hardcoded 40, and more
3483 importantly do not remove the %m and %x tags added at the end.
3484 (Add_to_refs_menu): use vector::size_type instead of
3485 unsigned int as basic types for the variables. _Please_ do not
3486 assume that size_t is equal to unsigned int. On an alpha, this is
3487 unsigned long, which is _not_ the same.
3489 * src/language.C (initL): remove language "hungarian", since it
3490 seems that "magyar" is better.
3492 2000-05-22 Juergen Vigna <jug@sad.it>
3494 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3496 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3499 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3500 next was deleted but not set to 0.
3502 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3504 * src/language.C (initL): change the initialization of languages
3505 so that compiles goes _fast_.
3507 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3510 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3512 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3516 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3518 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3520 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3524 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3527 * src/insets/insetlo*.[Ch]: Made editable
3529 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3531 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3532 the current selection.
3534 * src/BufferView_pimpl.C (stuffClipboard): new method
3536 * src/BufferView.C (stuffClipboard): new method
3538 * src/paragraph.C (String): new method
3540 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3541 LColor::ignore when lyxname is not found.
3543 * src/BufferView.C (pasteSelection): new method
3545 * src/BufferView_pimpl.C (pasteSelection): new method
3547 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3549 * src/WorkArea.C (request_clipboard_cb): new static function
3550 (getClipboard): new method
3551 (putClipboard): new method
3553 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3555 * LyX 1.1.5pre2 released
3557 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3559 * src/vspace.C (operator=): removed
3560 (operator=): removed
3562 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3564 * src/layout.C (NumberOfClass): manually set the type in make_pair
3565 (NumberOfLayout): ditto
3567 * src/language.C: use the Language constructor for ignore_lang
3569 * src/language.h: add constructors to struct Language
3571 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3573 * src/text2.C (SetCursorIntern): comment out #warning
3575 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3577 * src/mathed/math_iter.h: initialize sx and sw to 0
3579 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3581 * forms/lyx.fd: Redesign of form_ref
3583 * src/LaTeXFeatures.[Ch]
3587 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3590 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3591 and Buffer::inset_iterator.
3593 * src/menus.C: Added new menus: TOC and Refs.
3595 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3597 * src/buffer.C (getTocList): New method.
3599 * src/BufferView2.C (ChangeRefs): New method.
3601 * src/buffer.C (getLabelList): New method. It replaces the old
3602 getReferenceList. The return type is vector<string> instead of
3605 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3606 the old getLabel() and GetNumberOfLabels() methods.
3607 * src/insets/insetlabel.C (getLabelList): ditto
3608 * src/mathed/formula.C (getLabelList): ditto
3610 * src/paragraph.C (String): New method.
3612 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3613 Uses the new getTocList() method.
3614 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3615 which automatically updates the contents of the browser.
3616 (RefUpdateCB): Use the new getLabelList method.
3618 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3620 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3622 * src/spellchecker.C: Added using std::reverse;
3624 2000-05-19 Juergen Vigna <jug@sad.it>
3626 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3628 * src/insets/insettext.C (computeTextRows): small fix for display of
3629 1 character after a newline.
3631 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3634 2000-05-18 Juergen Vigna <jug@sad.it>
3636 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3637 when changing width of column.
3639 * src/tabular.C (set_row_column_number_info): setting of
3640 autobreak rows if necessary.
3642 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3644 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3646 * src/vc-backend.*: renamed stat() to status() and vcstat to
3647 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3648 compilation broke. The new name seems more relevant, anyway.
3650 2000-05-17 Juergen Vigna <jug@sad.it>
3652 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3653 which was wrong if the removing caused removing of rows!
3655 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3656 (pushToken): new function.
3658 * src/text2.C (CutSelection): fix problem discovered with purify
3660 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3662 * src/debug.C (showTags): enlarge the first column, now that we
3663 have 6-digits debug codes.
3665 * lib/layouts/hollywood.layout:
3666 * lib/tex/hollywood.cls:
3667 * lib/tex/brodway.cls:
3668 * lib/layouts/brodway.layout: more commands and fewer
3669 environments. Preambles moved in the .cls files. Broadway now has
3670 more options on scene numbering and less whitespace (from Garst)
3672 * src/insets/insetbib.C (getKeys): make sure that we are in the
3673 document directory, in case the bib file is there.
3675 * src/insets/insetbib.C (Latex): revert bogus change.
3677 2000-05-16 Juergen Vigna <jug@sad.it>
3679 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3680 the TabularLayout on cursor move.
3682 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3684 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3687 (draw): fixed cursor position and drawing so that the cursor is
3688 visible when before the tabular-inset.
3690 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3691 when creating from old insettext.
3693 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3695 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3697 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3698 * lib/tex/brodway.cls: ditto
3700 * lib/layouts/brodway.layout: change alignment of parenthical
3703 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3705 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3706 versions 0.88 and 0.89 are supported.
3708 2000-05-15 Juergen Vigna <jug@sad.it>
3710 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3713 * src/insets/insettext.C (computeTextRows): redone completely this
3714 function in a much cleaner way, because of problems when having a
3716 (draw): added a frame border when the inset is locked.
3717 (SetDrawLockedFrame): this sets if we draw the border or not.
3718 (SetFrameColor): this sets the frame color (default=insetframe).
3720 * src/insets/lyxinset.h: added x() and y() functions which return
3721 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3722 function which is needed to see if we have a locking inset of some
3723 type in this inset (needed for now in insettabular).
3725 * src/vspace.C (inPixels): the same function also without a BufferView
3726 parameter as so it is easier to use it in some ocasions.
3728 * src/lyxfunc.C: changed all places where insertInset was used so
3729 that now if it couldn't be inserted it is deleted!
3731 * src/TabularLayout.C:
3732 * src/TableLayout.C: added support for new tabular-inset!
3734 * src/BufferView2.C (insertInset): this now returns a bool if the
3735 inset was really inserted!!!
3737 * src/tabular.C (GetLastCellInRow):
3738 (GetFirstCellInRow): new helper functions.
3739 (Latex): implemented for new tabular class.
3743 (TeXTopHLine): new Latex() helper functions.
3745 2000-05-12 Juergen Vigna <jug@sad.it>
3747 * src/mathed/formulamacro.C (Read):
3748 * src/mathed/formula.C (Read): read also the \end_inset here!
3750 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3752 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3753 crush when saving formulae with unbalanced parenthesis.
3755 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
3757 * src/layout.C: Add new keyword "endlabelstring" to layout file
3759 * src/text.C (GetVisibleRow): Draw endlabel string.
3761 * lib/layouts/broadway.layout
3762 * lib/layouts/hollywood.layout: Added endlabel for the
3763 Parenthetical layout.
3765 * lib/layouts/heb-article.layout: Do not use slanted font shape
3766 for Theorem like environments.
3768 * src/buffer.C (makeLaTeXFile): Always add "american" to
3769 the UsedLanguages list if document language is RTL.
3771 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3773 * add addendum to README.OS2 and small patch (from SMiyata)
3775 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3777 * many files: correct the calls to ChangeExtension().
3779 * src/support/filetools.C (ChangeExtension): remove the no_path
3780 argument, which does not belong there. Use OnlyFileName() instead.
3782 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
3783 files when LaTeXing a non-nice latex file.
3785 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
3786 a chain of "if". Return false when deadkeys are not handled.
3788 * src/lyx_main.C (LyX): adapted the code for default bindings.
3790 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
3791 bindings for basic functionality (except deadkeys).
3792 (deadKeyBindings): new method. Performs the bindings of deadkeys.
3794 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
3795 several methods: handle override_x_deadkeys.
3797 * src/lyxrc.h: remove the "bindings" map, which did not make much
3798 sense anyway. New variable override_x_deadkeys, defaulting to "true".
3800 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3802 * src/lyxfont.C (stateText): use a saner method to determine
3803 whether the font is "default". Seems to fix the crash with DEC
3806 * src/Bullet.[Ch] (Bullet): remove const on parameters.
3808 2000-05-08 Juergen Vigna <jug@sad.it>
3810 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
3811 TabularLayoutMenu with mouse-button-3
3812 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
3814 * src/TabularLayout.C: added this file for having a Layout for
3817 2000-05-05 Juergen Vigna <jug@sad.it>
3819 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
3820 recalculating inset-widths.
3821 (TabularFeatures): activated this function so that I can change
3822 tabular-features via menu.
3824 * src/menus.C (ShowEditMenu): inserted support for insettabular so
3825 that I can test some functions with the Table menu.
3827 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3829 * src/lyxfont.C (stateText): guard against stupid c++libs.
3831 * src/tabular.C: add using std::vector
3832 some whitespace changes, + removed som autogenerated code.
3834 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
3836 2000-05-05 Juergen Vigna <jug@sad.it>
3838 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
3839 row, columns and cellstructures.
3841 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3843 * lib/lyxrc.example: remove obsolete entries.
3845 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
3846 reading of protected_separator for free_spacing.
3848 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3850 * src/text.C (draw): do not display an exclamation mark in the
3851 margin for margin notes. This is confusing, ugly and
3854 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
3855 AMS math' is checked.
3857 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
3858 name to see whether including the amsmath package is needed.
3860 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
3862 * src/paragraph.C (validate): Compute UsedLanguages correctly
3863 (don't insert the american language if it doesn't appear in the
3866 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
3867 The argument of \thanks{} command is considered moving argument
3869 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
3872 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
3874 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
3875 for appendix/minipage/depth. The lines can be now both in the footnote
3876 frame, and outside the frame.
3878 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
3881 2000-05-05 Juergen Vigna <jug@sad.it>
3883 * src/table.[Ch]: removed the inset and buffer stuff as this is now
3884 neede only in tabular.[Ch].
3886 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3888 * src/insets/insetspecialchar.C (Read): allow command == '~' for
3890 (Write): write '~' for PROTECTED_SEPARATOR
3892 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3894 * src/lyxparagraph.h: add a friend struct matchIT after the struct
3897 * src/mathed/formula.C (drawStr): rename size to siz.
3899 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
3900 possibly fix a bug by not changing the pflags = flags to piflags =
3903 2000-05-05 Juergen Vigna <jug@sad.it>
3905 * src/insets/insetbib.C: moved using directive
3907 * src/ImportNoweb.C: small fix for being able to compile (missing
3910 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3912 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
3913 to use clear, since we don't depend on this in the code. Add test
3916 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3918 * (various *.C files): add using std::foo directives to please dec
3921 * replace calls to string::clear() to string::erase() (Angus)
3923 * src/cheaders/cmath: modified to provide std::abs.
3925 2000-05-04 Juergen Vigna <jug@sad.it>
3927 * src/insets/insettext.C: Prepared all for inserting of multiple
3928 paragraphs. Still display stuff to do (alignment and other things),
3929 but I would like to use LyXText to do this when we cleaned out the
3930 table-support stuff.
3932 * src/insets/insettabular.C: Changed lot of stuff and added lots
3933 of functionality still a lot to do.
3935 * src/tabular.C: Various functions changed name and moved to be
3936 const functions. Added new Read and Write functions and changed
3937 lots of things so it works good with tabular-insets (also removed
3938 some stuff which is not needed anymore * hacks *).
3940 * src/lyxcursor.h: added operators == and != which just look if
3941 par and pos are (not) equal.
3943 * src/buffer.C (latexParagraphs): inserted this function to latex
3944 all paragraphs form par to endpar as then I can use this too for
3947 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
3948 so that I can call this to from text insets with their own cursor.
3950 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
3951 output off all paragraphs (because of the fix below)!
3953 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
3954 the very last paragraph (this could be also the last paragraph of an
3957 * src/texrow.h: added rows() call which returns the count-variable.
3959 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3961 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
3963 * lib/configure.m4: better autodetection of DocBook tools.
3965 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3967 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
3969 * src/lyx_cb.C: add using std::reverse;
3971 * src/LaTeX.C (run): on error always run deleteFilesOnError before
3974 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
3975 selected files. Should fix repeated errors from generated files.
3977 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
3979 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
3981 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
3982 the spellchecker popup.
3984 * lib/lyxrc.example: Removed the \number_inset section
3986 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3988 * src/insets/figinset.C (various): Use IsFileReadable() to make
3989 sure that the file actually exist. Relying on ghostscripts errors
3990 is a bad idea since they can lead to X server crashes.
3992 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
3994 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
3997 * lib/lyxrc.example: smallish typo in description of
3998 \view_dvi_paper_option
4000 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4003 * src/lyxfunc.C: doImportHelper to factor out common code of the
4004 various import methods. New functions doImportASCIIasLines,
4005 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4006 doImportLinuxDoc for the format specific parts.
4009 * buffer.C: Dispatch returns now a bool to indicate success
4012 * lyx_gui.C: Add getLyXView() for member access
4014 * lyx_main.C: Change logic for batch commands: First try
4015 Buffer::Dispatch (possibly without GUI), if that fails, use
4018 * lyx_main.C: Add support for --import command line switch.
4019 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4020 Available Formats: Everything accepted by 'buffer-import <format>'
4022 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4024 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4027 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4028 documents will be reformatted upon reentry.
4030 2000-04-27 Juergen Vigna <jug@sad.it>
4032 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4033 correctly only last pos this was a bug.
4035 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4037 * release of lyx-1.1.5pre1
4039 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4041 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4043 * src/menus.C: revert the change of naming (Figure->Graphic...)
4044 from 2000-04-11. It was incomplete and bad.
4046 * src/LColor.[Ch]: add LColor::depthbar.
4047 * src/text.C (GetVisibleRow): use it.
4049 * README: update the languages list.
4051 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4053 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4056 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4058 * README: remove sections that were just wrong.
4060 * src/text2.C (GetRowNearY): remove currentrow code
4062 * src/text.C (GetRow): remove currentrow code
4064 * src/screen.C (Update): rewritten a bit.
4065 (SmallUpdate): removed func
4067 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4069 (FullRebreak): return bool
4070 (currentrow): remove var
4071 (currentrow_y): ditto
4073 * src/lyxscreen.h (Draw): change arg to unsigned long
4074 (FitCursor): return bool
4075 (FitManualCursor): ditto
4076 (Smallpdate): remove func
4077 (first): change to unsigned long
4078 (DrawOneRow): change second arg to long (from long &)
4079 (screen_refresh_y): remove var
4080 (scree_refresh_row): ditto
4082 * src/lyxrow.h: change baseline to usigned int from unsigned
4083 short, this brings some implicit/unsigned issues out in the open.
4085 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4087 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4088 instead of smallUpdate.
4090 * src/lyxcursor.h: change y to unsigned long
4092 * src/buffer.h: don't call updateScrollbar after fitcursor
4094 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4095 where they are used. Removed "\\direction", this was not present
4096 in 1.1.4 and is already obsolete. Commented out some code that I
4097 believe to never be called.
4098 (runLiterate): don't call updateScrollbar after fitCursor
4100 (buildProgram): ditto
4103 * src/WorkArea.h (workWidth): change return val to unsigned
4106 (redraw): remove the button redraws
4107 (setScrollbarValue): change for scrollbar
4108 (getScrollbarValue): change for scrollbar
4109 (getScrollbarBounds): change for scrollbar
4111 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4112 (C_WorkArea_down_cb): removed func
4113 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4114 (resize): change for scrollbar
4115 (setScrollbar): ditto
4116 (setScrollbarBounds): ditto
4117 (setScrollbarIncrements): ditto
4118 (up_cb): removed func
4119 (down_cb): removed func
4120 (scroll_cb): change for scrollbar
4121 (work_area_handler): ditto
4123 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4124 when FitCursor did something.
4125 (updateScrollbar): some unsigned changes
4126 (downCB): removed func
4127 (scrollUpOnePage): removed func
4128 (scrollDownOnePage): remvoed func
4129 (workAreaMotionNotify): don't call screen->FitCursor but use
4130 fitCursor instead. and bool return val
4131 (workAreaButtonPress): ditto
4132 (workAreaButtonRelease): some unsigned changes
4133 (checkInsetHit): ditto
4134 (workAreaExpose): ditto
4135 (update): parts rewritten, comments about the signed char arg added
4136 (smallUpdate): removed func
4137 (cursorPrevious): call needed updateScrollbar
4140 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4143 * src/BufferView.[Ch] (upCB): removed func
4144 (downCB): removed func
4145 (smallUpdate): removed func
4147 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4149 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4150 currentrow, currentrow_y optimization. This did not help a lot and
4151 if we want to do this kind of optimization we should rather use
4152 cursor.row instead of the currentrow.
4154 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4155 buffer spacing and klyx spacing support.
4157 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4159 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4162 2000-04-26 Juergen Vigna <jug@sad.it>
4164 * src/insets/figinset.C: fixes to Lars sstream changes!
4166 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4168 * A lot of files: Added Ascii(ostream &) methods to all inset
4169 classes. Used when exporting to ASCII.
4171 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4172 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4175 * src/text2.C (ToggleFree): Disabled implicit word selection when
4176 there is a change in the language
4178 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4179 no output was generated for end-of-sentence inset.
4181 * src/insets/lyxinset.h
4184 * src/paragraph.C: Removed the insetnumber code
4186 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4188 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4190 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4191 no_babel and no_epsfig completely from the file.
4192 (parseSingleLyXformat2Token): add handling for per-paragraph
4193 spacing as written by klyx.
4195 * src/insets/figinset.C: applied patch by Andre. Made it work with
4198 2000-04-20 Juergen Vigna <jug@sad.it>
4200 * src/insets/insettext.C (cutSelection):
4201 (copySelection): Fixed with selection from right to left.
4202 (draw): now the rows are not recalculated at every draw.
4203 (computeTextRows): for now reset the inset-owner here (this is
4204 important for an undo or copy where the inset-owner is not set
4207 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4208 motion to the_locking_inset screen->first was forgotten, this was
4209 not important till we got multiline insets.
4211 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4213 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4214 code seems to be alright (it is code changed by Dekel, and the
4215 intent is indeed that all macros should be defined \protect'ed)
4217 * NEWS: a bit of reorganisation of the new user-visible features.
4219 2000-04-19 Juergen Vigna <jug@sad.it>
4221 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4222 position. Set the inset_owner of the used paragraph so that it knows
4223 that it is inside an inset. Fixed cursor handling with mouse and
4224 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4225 and cleanups to make TextInsets work better.
4227 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4228 Changed parameters of various functions and added LockInsetInInset().
4230 * src/insets/insettext.C:
4232 * src/insets/insetcollapsable.h:
4233 * src/insets/insetcollapsable.C:
4234 * src/insets/insetfoot.h:
4235 * src/insets/insetfoot.C:
4236 * src/insets/insetert.h:
4237 * src/insets/insetert.C: cleaned up the code so that it works now
4238 correctly with insettext.
4240 * src/insets/inset.C:
4241 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4242 that insets in insets are supported right.
4245 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4247 * src/paragraph.C: some small fixes
4249 * src/debug.h: inserted INSETS debug info
4251 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4252 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4254 * src/commandtags.h:
4255 * src/LyXAction.C: insert code for InsetTabular.
4257 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4258 not Button1MotionMask.
4259 (workAreaButtonRelease): send always a InsetButtonRelease event to
4261 (checkInsetHit): some setCursor fixes (always with insets).
4263 * src/BufferView2.C (lockInset): returns a bool now and extended for
4264 locking insets inside insets.
4265 (showLockedInsetCursor): it is important to have the cursor always
4266 before the locked inset.
4267 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4269 * src/BufferView.h: made lockInset return a bool.
4271 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4273 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4274 that is used also internally but can be called as public to have back
4275 a cursor pos which is not set internally.
4276 (SetCursorIntern): Changed to use above function.
4278 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4280 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4285 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4286 patches for things that should be in or should be changed.
4288 * src/* [insetfiles]: change "usigned char fragile" to bool
4289 fragile. There was only one point that could that be questioned
4290 and that is commented in formulamacro.C. Grep for "CHECK".
4292 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4293 (DeleteBuffer): take it out of CutAndPaste and make it static.
4295 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4297 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4298 output the spacing envir commands. Also the new commands used in
4299 the LaTeX output makes the result better.
4301 * src/Spacing.C (writeEnvirBegin): new method
4302 (writeEnvirEnd): new method
4304 2000-04-18 Juergen Vigna <jug@sad.it>
4306 * src/CutAndPaste.C: made textclass a static member of the class
4307 as otherwise it is not accesed right!!!
4309 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4311 * forms/layout_forms.fd
4312 * src/layout_forms.h
4313 * src/layout_forms.C (create_form_form_character)
4314 * src/lyx_cb.C (UserFreeFont)
4315 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4316 documents (in the layout->character popup).
4318 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4320 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4321 \spell_command was in fact not honored (from Kevin Atkinson).
4323 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4326 * src/lyx_gui.h: make lyxViews private (Angus)
4328 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4330 * src/mathed/math_write.C
4331 (MathMatrixInset::Write) Put \protect before \begin{array} and
4332 \end{array} if fragile
4333 (MathParInset::Write): Put \protect before \\ if fragile
4335 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4337 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4338 initialization if the LyXColorHandler must be done after the
4339 connections to the XServer has been established.
4341 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4342 get the background pixel from the lyxColorhandler so that the
4343 figures are rendered with the correct background color.
4344 (NextToken): removed functions.
4345 (GetPSSizes): use ifs >> string instead of NextToken.
4347 * src/Painter.[Ch]: the color cache moved out of this file.
4349 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4352 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4354 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4355 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4357 * src/BufferView.C (enterView): new func
4358 (leaveView): new func
4360 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4362 (leaveView): new func, undefines xterm cursor when approp.
4364 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4365 (AllowInput): delete the Workarea cursor handling from this func.
4367 * src/Painter.C (underline): draw a slimer underline in most cases.
4369 * src/lyx_main.C (error_handler): use extern "C"
4371 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4373 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4374 sent directly to me.
4376 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4377 to the list by Dekel.
4379 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4382 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4383 methods from lyx_cb.here.
4385 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4388 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4390 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4391 instead of using current_view directly.
4393 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4395 * src/LyXAction.C (init): add the paragraph-spacing command.
4397 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4399 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4401 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4402 different from the documents.
4404 * src/text.C (SetHeightOfRow): take paragraph spacing into
4405 account, paragraph spacing takes precedence over buffer spacing
4406 (GetVisibleRow): ditto
4408 * src/paragraph.C (writeFile): output the spacing parameter too.
4409 (validate): set the correct features if spacing is used in the
4411 (Clear): set spacing to default
4412 (MakeSameLayout): spacing too
4413 (HasSameLayout): spacing too
4414 (SetLayout): spacing too
4415 (TeXOnePar): output the spacing commands
4417 * src/lyxparagraph.h: added a spacing variable for use with
4418 per-paragraph spacing.
4420 * src/Spacing.h: add a Default spacing and a method to check if
4421 the current spacing is default. also added an operator==
4423 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4426 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4428 * src/lyxserver.C (callback): fix dispatch of functions
4430 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4431 printf() into lyxerr call.
4433 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4436 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4437 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4438 the "Float" from each of the subitems.
4439 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4441 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4442 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4443 documented the change so that the workaround can be nuked later.
4445 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4448 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4450 * src/buffer.C (getLatexName): ditto
4451 (setReadonly): ditto
4453 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4455 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4456 avoid some uses of current_view. Added also a bufferParams()
4457 method to get at this.
4459 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4461 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4463 * src/lyxparagraph.[Ch]: removed
4464 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4465 with operators used by lower_bound and
4466 upper_bound in InsetTable's
4467 Make struct InsetTable private again. Used matchpos.
4469 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4471 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4472 document, the language of existing text is changed (unless the
4473 document is multi-lingual)
4475 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4477 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4479 * A lot of files: A rewrite of the Right-to-Left support.
4481 2000-04-10 Juergen Vigna <jug@sad.it>
4483 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4484 misplaced cursor when inset in inset is locked.
4486 * src/insets/insettext.C (LocalDispatch): small fix so that a
4487 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4489 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4490 footnote font should be decreased in size twice when displaying.
4492 * src/insets/insettext.C (GetDrawFont): inserted this function as
4493 the drawing-font may differ from the real paragraph font.
4495 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4496 insets (inset in inset!).
4498 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4499 function here because we don't want footnotes inside footnotes.
4501 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4503 (init): now set the inset_owner in paragraph.C
4504 (LocalDispatch): added some resetPos() in the right position
4507 (pasteSelection): changed to use the new CutAndPaste-Class.
4509 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4510 which tells if it is allowed to insert another inset inside this one.
4512 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4513 SwitchLayoutsBetweenClasses.
4515 * src/text2.C (InsertInset): checking of the new paragraph-function
4517 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4518 is not needed anymore here!
4521 (PasteSelection): redone (also with #ifdef) so that now this uses
4522 the CutAndPaste-Class.
4523 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4526 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4527 from/to text/insets.
4529 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4530 so that the paragraph knows if it is inside an (text)-inset.
4531 (InsertFromMinibuffer): changed return-value to bool as now it
4532 may happen that an inset is not inserted in the paragraph.
4533 (InsertInsetAllowed): this checks if it is allowed to insert an
4534 inset in this paragraph.
4536 (BreakParagraphConservative):
4537 (BreakParagraph) : small change for the above change of the return
4538 value of InsertFromMinibuffer.
4540 * src/lyxparagraph.h: added inset_owner and the functions to handle
4541 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4543 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4545 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4546 functions from BufferView to BufferView::Pimpl to ease maintence.
4548 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4549 correctly. Also use SetCursorIntern instead of SetCursor.
4551 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4554 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4556 * src/WorkArea.C (belowMouse): manually implement below mouse.
4558 * src/*: Add "explicit" on several constructors, I added probably
4559 some unneeded ones. A couple of changes to code because of this.
4561 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4562 implementation and private parts from the users of BufferView. Not
4565 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4566 implementation and private parts from the users of LyXLex. Not
4569 * src/BufferView_pimpl.[Ch]: new files
4571 * src/lyxlex_pimpl.[Ch]: new files
4573 * src/LyXView.[Ch]: some inline functions move out-of-line
4575 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4577 * src/lyxparagraph.h: make struct InsetTable public.
4579 * src/support/lyxstring.h: change lyxstring::difference_type to be
4580 ptrdiff_t. Add std:: modifiers to streams.
4582 * src/font.C: include the <cctype> header, for islower() and
4585 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4587 * src/font.[Ch]: new files. Contains the metric functions for
4588 fonts, takes a LyXFont as parameter. Better separation of concepts.
4590 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4591 changes because of this.
4593 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4595 * src/*: compile with -Winline and move functions that don't
4598 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4601 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4603 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4604 (various files changed because of this)
4606 * src/Painter.C (text): fixed the drawing of smallcaps.
4608 * src/lyxfont.[Ch] (drawText): removed unused member func.
4611 * src/*.C: added needed "using" statements and "std::" qualifiers.
4613 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4615 * src/*.h: removed all use of "using" from header files use
4616 qualifier std:: instead.
4618 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4620 * src/text.C (Backspace): some additional cleanups (we already
4621 know whether cursor.pos is 0 or not).
4623 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4624 automake does not provide one).
4626 * src/bmtable.h: replace C++ comments with C comments.
4628 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4630 * src/screen.C (ShowCursor): Change the shape of the cursor if
4631 the current language is not equal to the language of the document.
4632 (If the cursor change its shape unexpectedly, then you've found a bug)
4634 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4637 * src/insets/insetnumber.[Ch]: New files.
4639 * src/LyXAction.C (init)
4640 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4643 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4645 * src/lyxparagraph.h
4646 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4647 (the vector is kept sorted).
4649 * src/text.C (GetVisibleRow): Draw selection correctly when there
4650 is both LTR and RTL text.
4652 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4653 which is much faster.
4655 * src/text.C (GetVisibleRow and other): Do not draw the last space
4656 in a row if the direction of the last letter is not equal to the
4657 direction of the paragraph.
4659 * src/lyxfont.C (latexWriteStartChanges):
4660 Check that font language is not equal to basefont language.
4661 (latexWriteEndChanges): ditto
4663 * src/lyx_cb.C (StyleReset): Don't change the language while using
4664 the font-default command.
4666 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4667 empty paragraph before a footnote.
4669 * src/insets/insetcommand.C (draw): Increase x correctly.
4671 * src/screen.C (ShowCursor): Change cursor shape if
4672 current language != document language.
4674 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4676 2000-03-31 Juergen Vigna <jug@sad.it>
4678 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4679 (Clone): changed mode how the paragraph-data is copied to the
4680 new clone-paragraph.
4682 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4683 GetInset(pos) with no inset anymore there (in inset UNDO)
4685 * src/insets/insetcommand.C (draw): small fix as here x is
4686 incremented not as much as width() returns (2 before, 2 behind = 4)
4688 2000-03-30 Juergen Vigna <jug@sad.it>
4690 * src/insets/insettext.C (InsetText): small fix in initialize
4691 widthOffset (should not be done in the init() function)
4693 2000-03-29 Amir Karger <karger@lyx.org>
4695 * lib/examples/it_ItemizeBullets.lyx: translation by
4698 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4700 2000-03-29 Juergen Vigna <jug@sad.it>
4702 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4704 * src/insets/insetfoot.C (Clone): small change as for the below
4705 new init function in the text-inset
4707 * src/insets/insettext.C (init): new function as I've seen that
4708 clone did not copy the Paragraph-Data!
4709 (LocalDispatch): Added code so that now we have some sort of Undo
4710 functionality (well actually we HAVE Undo ;)
4712 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4714 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4716 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4719 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4721 * src/main.C: added a runtime check that verifies that the xforms
4722 header used when building LyX and the library used when running
4723 LyX match. Exit with a message if they don't match. This is a
4724 version number check only.
4726 * src/buffer.C (save): Don't allocate memory on the heap for
4727 struct utimbuf times.
4729 * *: some using changes, use iosfwd instead of the real headers.
4731 * src/lyxfont.C use char const * instead of string for the static
4732 strings. Rewrite some functions to use sstream.
4734 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4736 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4739 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4741 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4742 of Geodesy (from Martin Vermeer)
4744 * lib/layouts/svjour.inc: include file for the Springer svjour
4745 class. It can be used to support journals other than JoG.
4747 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4748 Miskiewicz <misiek@pld.org.pl>)
4749 * lib/reLyX/Makefile.am: ditto.
4751 2000-03-27 Juergen Vigna <jug@sad.it>
4753 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
4754 also some modifications with operations on selected text.
4756 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
4757 problems with clicking on insets (last famous words ;)
4759 * src/insets/insetcommand.C (draw):
4760 (width): Changed to have a bit of space before and after the inset so
4761 that the blinking cursor can be seen (otherwise it was hidden)
4763 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4765 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
4766 would not be added to the link list when an installed gettext (not
4767 part of libc) is found.
4769 2000-03-24 Juergen Vigna <jug@sad.it>
4771 * src/insets/insetcollapsable.C (Edit):
4772 * src/mathed/formula.C (InsetButtonRelease):
4773 (InsetButtonPress): fixed for new handling of ButtonPress/Release
4776 * src/BufferView.C (workAreaButtonPress):
4777 (workAreaButtonRelease):
4778 (checkInsetHit): Finally fixed the clicking on insets be handled
4781 * src/insets/insetert.C (Edit): inserted this call so that ERT
4782 insets work always with LaTeX-font
4784 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
4786 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
4787 caused lyx to startup with no GUI in place, causing in a crash
4788 upon startup when called with arguments.
4790 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4792 * src/FontLoader.C: better initialization of dummyXFontStruct.
4794 2000-03-20 José Abílio Matos <jamatos@lyx.org>
4796 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
4797 for linuxdoc and docbook import and export format options.
4799 * lib/lyxrc.example Example of default values for the previous flags.
4801 * src/lyx_cb.C Use those flags instead of the hardwired values for
4802 linuxdoc and docbook export.
4804 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
4807 * src/menus.C Added menus entries for the new import/exports formats.
4809 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4811 * src/lyxrc.*: Added support for running without Gui
4814 * src/FontLoader.C: sensible defaults if no fonts are needed
4816 * src/lyx_cb.C: New function ShowMessage (writes either to the
4817 minibuffer or cout in case of no gui
4818 New function AskOverwrite for common stuff
4819 Consequently various changes to call these functions
4821 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
4822 wild guess at sensible screen resolution when having no gui
4824 * src/lyxfont.C: no gui, no fonts... set some defaults
4826 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4828 * src/LColor.C: made the command inset background a bit lighter.
4830 2000-03-20 Hartmut Goebel <goebel@noris.net>
4832 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
4833 stdstruct.inc. Koma-Script added some title elements which
4834 otherwise have been listed below "bibliography". This split allows
4835 adding title elements to where they belong.
4837 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
4838 define the additional tilte elements and then include
4841 * many other layout files: changed to include stdtitle.inc just
4842 before stdstruct.inc.
4844 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
4846 * src/buffer.C: (save) Added the option to store all backup files
4847 in a single directory
4849 * src/lyxrc.[Ch]: Added variable \backupdir_path
4851 * lib/lyxrc.example: Added descriptions of recently added variables
4853 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
4854 bibtex inset, not closing the bibtex popup when deleting the inset)
4856 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4858 * src/lyx_cb.C: add a couple using directives.
4860 2000-03-17 José Abílio Matos <jamatos@lyx.org>
4861 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
4862 import based on the filename.
4864 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
4865 file would be imported at start, if the filename where of a sgml file.
4867 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
4869 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
4871 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
4872 * src/lyxfont.h Replaced the member variable bits.direction by the
4873 member variable lang. Made many changes in other files.
4874 This allows having a multi-lingual document
4876 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
4877 that change the current language to <l>.
4878 Removed the command "font-rtl"
4880 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
4881 format for Hebrew documents)
4883 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
4884 When auto_mathmode is "true", pressing a digit key in normal mode
4885 will cause entering into mathmode.
4886 If auto_mathmode is "rtl" then this behavior will be active only
4887 when writing right-to-left text.
4889 * src/text2.C (InsertStringA) The string is inserted using the
4892 * src/paragraph.C (GetEndLabel) Gives a correct result for
4893 footnote paragraphs.
4895 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
4897 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4899 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
4900 front of PasteParagraph. Never insert a ' '. This should at least
4901 fix some cause for the segfaults that we have been experiencing,
4902 it also fixes backspace behaviour slightly. (Phu!)
4904 * src/support/lstrings.C (compare_no_case): some change to make it
4905 compile with gcc 2.95.2 and stdlibc++-v3
4907 * src/text2.C (MeltFootnoteEnvironment): change type o
4908 first_footnote_par_is_not_empty to bool.
4910 * src/lyxparagraph.h: make text private. Changes in other files
4912 (fitToSize): new function
4913 (setContentsFromPar): new function
4914 (clearContents): new function
4915 (SetChar): new function
4917 * src/paragraph.C (readSimpleWholeFile): deleted.
4919 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
4920 the file, just use a simple string instead. Also read the file in
4921 a more maintainable manner.
4923 * src/text2.C (InsertStringA): deleted.
4924 (InsertStringB): deleted.
4926 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4928 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
4929 RedoParagraphs from the doublespace handling part, just set status
4930 to NEED_MORE_REFRESH. Also don't update cursor position (should be
4931 done, but perhaps not like this.)
4933 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4935 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
4936 character when inserting an inset.
4938 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4940 * src/bufferparams.C (readLanguage): now takes "default" into
4943 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
4944 also initialize the toplevel_keymap with the default bindings from
4947 * src/buffer.C (Buffer): remove lyxrc from the parameters.
4949 * all files using lyxrc: have lyxrc as a real variable and not a
4950 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
4953 * src/lyxrc.C: remove double call to defaultKeyBindings
4955 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
4956 toolbar defauls using lyxlex. Remove enums, structs, functions
4959 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
4960 toolbar defaults. Also store default keybindings in a map.
4962 * src/ToolbarDefaults.[Ch]: New file. This class is used for
4963 storing the toolbar defaults without any xforms dependencies.
4965 * src/insets/figinset.C: patch posted to list by Andre Poenitz
4966 applied. Changed to use iterators.
4968 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
4970 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
4971 systems that don't have LINGUAS set to begin with.
4973 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4975 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
4976 the list by Dekel Tsur.
4978 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4980 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
4981 * src/insets/form_graphics.C: ditto.
4983 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
4985 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4987 * src/bufferparams.C (readLanguage): use the new language map
4989 * src/intl.C (InitKeyMapper): use the new language map
4991 * src/lyx_gui.C (create_forms): use the new language map
4993 * src/language.[Ch]: New files. Used for holding the information
4994 about each language. Now! Use this new language map enhance it and
4995 make it really usable for our needs.
4997 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
4999 * screen.C (ShowCursor): Removed duplicate code.
5000 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5001 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5003 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5006 * src/text.C Added TransformChar method. Used for rendering Arabic
5007 text correctly (change the glyphs of the letter according to the
5008 position in the word)
5013 * src/lyxrc.C Added lyxrc command {language_command_begin,
5014 language_command_end,language_command_ltr,language_command_rtl,
5015 language_package} which allows the use of either arabtex or Omega
5018 * src/lyx_gui.C (init)
5020 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5021 to use encoding for menu fonts which is different than the encoding
5024 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5025 do not load the babel package.
5026 To write an English document with Hebrew/Arabic, change the document
5027 language to "english".
5029 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5030 (alphaCounter): changed to return char
5031 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5033 * lib/lyxrc.example Added examples for Hebrew/Arabic
5036 * src/layout.C Added layout command endlabeltype
5038 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5040 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5042 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5044 * src/mathed/math_delim.C (search_deco): return a
5045 math_deco_struct* instead of index.
5047 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5049 * All files with a USE_OSTREAM_ONLY within: removed all code that
5050 was unused when USE_OSTREAM_ONLY is defined.
5052 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5053 of any less. Removed header and using.
5055 * src/text.C (GetVisibleRow): draw the string "Page Break
5056 (top/bottom)" on screen when drawing a pagebreak line.
5058 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5060 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5062 * src/mathed/math_macro.C (draw): do some cast magic.
5065 * src/mathed/math_defs.h: change byte* argument to byte const*.
5067 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5069 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5070 know it is right to return InsetFoot* too, but cxx does not like
5073 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5075 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5077 * src/mathed/math_delim.C: change == to proper assignment.
5079 2000-03-09 Juergen Vigna <jug@sad.it>
5081 * src/insets/insettext.C (setPos): fixed various cursor positioning
5082 problems (via mouse and cursor-keys)
5083 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5084 inset (still a small display problem but it works ;)
5086 * src/insets/insetcollapsable.C (draw): added button_top_y and
5087 button_bottom_y to have correct values for clicking on the inset.
5089 * src/support/lyxalgo.h: commented out 'using std::less'
5091 2000-03-08 Juergen Vigna <jug@sad.it>
5093 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5094 Button-Release event closes as it is alos the Release-Event
5097 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5099 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5101 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5102 can add multiple spaces in Scrap (literate programming) styles...
5103 which, by the way, is how I got hooked on LyX to begin with.
5105 * src/mathed/formula.C (Write): Added dummy variable to an
5106 inset::Latex() call.
5107 (Latex): Add free_spacing boolean to inset::Latex()
5109 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5111 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5112 virtual function to include the free_spacing boolean from
5113 the containing paragraph's style.
5115 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5116 Added free_spacing boolean arg to match inset.h
5118 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5119 Added free_spacing boolean arg to match inset.h
5121 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5122 Added free_spacing boolean and made sure that if in a free_spacing
5123 paragraph, that we output normal space if there is a protected space.
5125 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5126 Added free_spacing boolean arg to match inset.h
5128 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5129 Added free_spacing boolean arg to match inset.h
5131 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5132 Added free_spacing boolean arg to match inset.h
5134 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5135 Added free_spacing boolean arg to match inset.h
5137 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5138 Added free_spacing boolean arg to match inset.h
5140 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5141 free_spacing boolean arg to match inset.h
5143 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5144 Added free_spacing boolean arg to match inset.h
5146 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5147 Added free_spacing boolean arg to match inset.h
5149 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5150 Added free_spacing boolean arg to match inset.h
5152 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5153 Added free_spacing boolean arg to match inset.h
5155 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5156 Added free_spacing boolean arg to match inset.h
5158 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5159 free_spacing boolean arg to match inset.h
5161 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5162 free_spacing boolean arg to match inset.h
5164 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5165 ignore free_spacing paragraphs. The user's spaces are left
5168 * src/text.C (InsertChar): Fixed the free_spacing layout
5169 attribute behavior. Now, if free_spacing is set, you can
5170 add multiple spaces in a paragraph with impunity (and they
5171 get output verbatim).
5172 (SelectSelectedWord): Added dummy argument to inset::Latex()
5175 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5178 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5179 paragraph layouts now only input a simple space instead.
5180 Special character insets don't make any sense in free-spacing
5183 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5184 hard-spaces in the *input* file to simple spaces if the layout
5185 is free-spacing. This converts old files which had to have
5186 hard-spaces in free-spacing layouts where a simple space was
5188 (writeFileAscii): Added free_spacing check to pass to the newly
5189 reworked inset::Latex(...) methods. The inset::Latex() code
5190 ensures that hard-spaces in free-spacing paragraphs get output
5191 as spaces (rather than "~").
5193 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5195 * src/mathed/math_delim.C (draw): draw the empty placeholder
5196 delims with a onoffdash line.
5197 (struct math_deco_compare): struct that holds the "functors" used
5198 for the sort and the binary search in math_deco_table.
5199 (class init_deco_table): class used for initial sort of the
5201 (search_deco): use lower_bound to do a binary search in the
5204 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5206 * src/lyxrc.C: a small secret thingie...
5208 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5209 and to not flush the stream as often as it used to.
5211 * src/support/lyxalgo.h: new file
5212 (sorted): template function used for checking if a sequence is
5213 sorted or not. Two versions with and without user supplied
5214 compare. Uses same compare as std::sort.
5216 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5217 it and give warning on lyxerr.
5219 (struct compare_tags): struct with function operators used for
5220 checking if sorted, sorting and lower_bound.
5221 (search_kw): use lower_bound instead of manually implemented
5224 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5226 * src/insets/insetcollapsable.h: fix Clone() declaration.
5227 * src/insets/insetfoot.h: ditto.
5229 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5231 2000-03-08 Juergen Vigna <jug@sad.it>
5233 * src/insets/lyxinset.h: added owner call which tells us if
5234 this inset is inside another inset. Changed also the return-type
5235 of Editable to an enum so it tells clearer what the return-value is.
5237 * src/insets/insettext.C (computeTextRows): fixed computing of
5238 textinsets which split automatically on more rows.
5240 * src/insets/insetert.[Ch]: changed this to be of BaseType
5243 * src/insets/insetfoot.[Ch]: added footnote inset
5245 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5246 collapsable insets (like footnote, ert, ...)
5248 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5250 * src/lyxdraw.h: remvoe file
5252 * src/lyxdraw.C: remove file
5254 * src/insets/insettext.C: added <algorithm>.
5256 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5258 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5259 (matrix_cb): case MM_OK use string stream
5261 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5264 * src/mathed/math_macro.C (draw): use string stream
5265 (Metrics): use string stream
5267 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5268 directly to the ostream.
5270 * src/vspace.C (asString): use string stream.
5271 (asString): use string stream
5272 (asLatexString): use string stream
5274 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5275 setting Spacing::Other.
5277 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5278 sprintf when creating the stretch vale.
5280 * src/text2.C (alphaCounter): changed to return a string and to
5281 not use a static variable internally. Also fixed a one-off bug.
5282 (SetCounter): changed the drawing of the labels to use string
5283 streams instead of sprintf.
5285 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5286 manipulator to use a scheme that does not require library support.
5287 This is also the way it is done in the new GNU libstdc++. Should
5288 work with DEC cxx now.
5290 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5292 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5293 end. This fixes a bug.
5295 * src/mathed (all files concerned with file writing): apply the
5296 USE_OSTREAM_ONLY changes to mathed too.
5298 * src/support/DebugStream.h: make the constructor explicit.
5300 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5301 count and ostream squashed.
5303 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5305 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5307 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5308 ostringstream uses STL strings, and we might not.
5310 * src/insets/insetspecialchar.C: add using directive.
5311 * src/insets/insettext.C: ditto.
5313 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5315 * lib/layouts/seminar.layout: feeble attempt at a layout for
5316 seminar.cls, far from completet and could really use some looking
5317 at from people used to write layout files.
5319 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5320 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5321 a lot nicer and works nicely with ostreams.
5323 * src/mathed/formula.C (draw): a slightly different solution that
5324 the one posted to the list, but I think this one works too. (font
5325 size wrong in headers.)
5327 * src/insets/insettext.C (computeTextRows): some fiddling on
5328 Jürgens turf, added some comments that he should read.
5330 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5331 used and it gave compiler warnings.
5332 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5335 * src/lyx_gui.C (create_forms): do the right thing when
5336 show_banner is true/false.
5338 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5339 show_banner is false.
5341 * most file writing files: Now use iostreams to do almost all of
5342 the writing. Also instead of passing string &, we now use
5343 stringstreams. mathed output is still not adapted to iostreams.
5344 This change can be turned off by commenting out all the occurences
5345 of the "#define USE_OSTREAM_ONLY 1" lines.
5347 * src/WorkArea.C (createPixmap): don't output debug messages.
5348 (WorkArea): don't output debug messages.
5350 * lib/lyxrc.example: added a comment about the new variable
5353 * development/Code_rules/Rules: Added some more commente about how
5354 to build class interfaces and on how better encapsulation can be
5357 2000-03-03 Juergen Vigna <jug@sad.it>
5359 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5360 automatically with the width of the LyX-Window
5362 * src/insets/insettext.C (computeTextRows): fixed update bug in
5363 displaying text-insets (scrollvalues where not initialized!)
5365 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5367 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5368 id in the check of the result from lower_bound is not enough since
5369 lower_bound can return last too, and then res->id will not be a
5372 * all insets and some code that use them: I have conditionalized
5373 removed the Latex(string & out, ...) this means that only the
5374 Latex(ostream &, ...) will be used. This is a work in progress to
5375 move towards using streams for all output of files.
5377 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5380 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5382 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5383 routine (this fixes bug where greek letters were surrounded by too
5386 * src/support/filetools.C (findtexfile): change a bit the search
5387 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5388 no longer passed to kpsewhich, we may have to change that later.
5390 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5391 warning options to avoid problems with X header files (from Angus
5393 * acinclude.m4: regenerated.
5395 2000-03-02 Juergen Vigna <jug@sad.it>
5397 * src/insets/insettext.C (WriteParagraphData): Using the
5398 par->writeFile() function for writing paragraph-data.
5399 (Read): Using buffer->parseSingleLyXformat2Token()-function
5400 for parsing paragraph data!
5402 * src/buffer.C (readLyXformat2): removed all parse data and using
5403 the new parseSingleLyXformat2Token()-function.
5404 (parseSingleLyXformat2Token): added this function to parse (read)
5405 lyx-file-format (this is called also from text-insets now!)
5407 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5409 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5412 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5413 directly instead of going through a func. One very bad thing: a
5414 static LyXFindReplace, but I don't know where to place it.
5416 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5417 string instead of char[]. Also changed to static.
5418 (GetSelectionOrWordAtCursor): changed to static inline
5419 (SetSelectionOverLenChars): ditto.
5421 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5422 current_view and global variables. both classes has changed names
5423 and LyXFindReplace is not inherited from SearchForm.
5425 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5426 fl_form_search form.
5428 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5430 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5432 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5433 bound (from Kayvan).
5435 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5437 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5439 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5441 * some things that I should comment but the local pub says head to
5444 * comment out all code that belongs to the Roff code for Ascii
5445 export of tables. (this is unused)
5447 * src/LyXView.C: use correct type for global variable
5448 current_layout. (LyXTextClass::size_type)
5450 * some code to get the new insetgraphics closer to working I'd be
5451 grateful for any help.
5453 * src/BufferView2.C (insertInset): use the return type of
5454 NumberOfLayout properly. (also changes in other files)
5456 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5457 this as a test. I want to know what breaks because of this.
5459 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5461 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5463 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5464 to use a \makebox in the label, this allows proper justification
5465 with out using protected spaces or multiple hfills. Now it is
5466 "label" for left justified, "\hfill label\hfill" for center, and
5467 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5468 should be changed accordingly.
5470 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5472 * src/lyxtext.h: change SetLayout() to take a
5473 LyXTextClass::size_type instead of a char (when there is more than
5474 127 layouts in a class); also change type of copylayouttype.
5475 * src/text2.C (SetLayout): ditto.
5476 * src/LyXView.C (updateLayoutChoice): ditto.
5478 * src/LaTeX.C (scanLogFile): errors where the line number was not
5479 given just after the '!'-line were ignored (from Dekel Tsur).
5481 * lib/lyxrc.example: fix description of \date_insert_format
5483 * lib/layouts/llncs.layout: new layout, contributed by Martin
5486 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5488 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5489 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5490 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5491 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5492 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5493 paragraph.C, text.C, text2.C)
5495 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5497 * src/insets/insettext.C (LocalDispatch): remove extra break
5500 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5501 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5503 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5504 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5506 * src/insets/insetbib.h: move InsetBibkey::Holder and
5507 InsetCitation::Holder in public space.
5509 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5511 * src/insets/insettext.h: small change to get the new files from
5512 Juergen to compile (use "string", not "class string").
5514 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5515 const & as parameter to LocalDispatch, use LyXFont const & as
5516 paramter to some other func. This also had impacto on lyxinsets.h
5517 and the two mathed insets.
5519 2000-02-24 Juergen Vigna <jug@sad.it>
5522 * src/commandtags.h:
5524 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5528 * src/BufferView2.C: added/updated code for various inset-functions
5530 * src/insets/insetert.[Ch]: added implementation of InsetERT
5532 * src/insets/insettext.[Ch]: added implementation of InsetText
5534 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5535 (draw): added preliminary code for inset scrolling not finshed yet
5537 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5538 as it is in lyxfunc.C now
5540 * src/insets/lyxinset.h: Added functions for text-insets
5542 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5544 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5545 BufferView and reimplement the list as a queue put inside its own
5548 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5550 * several files: use the new interface to the "updateinsetlist"
5552 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5554 (work_area_handler): call BufferView::trippleClick on trippleclick.
5556 * src/BufferView.C (doubleClick): new function, selects word on
5558 (trippleClick): new function, selects line on trippleclick.
5560 2000-02-22 Allan Rae <rae@lyx.org>
5562 * lib/bind/xemacs.bind: buffer-previous not supported
5564 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5566 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5569 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5571 * src/bufferlist.C: get rid of current_view from this file
5573 * src/spellchecker.C: get rid of current_view from this file
5575 * src/vspace.C: get rid of current_view from this file
5576 (inPixels): added BufferView parameter for this func
5577 (asLatexCommand): added a BufferParams for this func
5579 * src/text.C src/text2.C: get rid of current_view from these
5582 * src/lyxfont.C (getFontDirection): move this function here from
5585 * src/bufferparams.C (getDocumentDirection): move this function
5588 * src/paragraph.C (getParDirection): move this function here from
5590 (getLetterDirection): ditto
5592 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5594 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5595 resize due to wrong pixmap beeing used. Also took the opurtunity
5596 to make the LyXScreen stateless on regard to WorkArea and some
5597 general cleanup in the same files.
5599 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5601 * src/Makefile.am: add missing direction.h
5603 * src/PainterBase.h: made the width functions const.
5605 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5608 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5610 * src/insets/insetlatexaccent.C (draw): make the accents draw
5611 better, at present this will only work well with iso8859-1.
5613 * several files: remove the old drawing code, now we use the new
5616 * several files: remove support for mono_video, reverse_video and
5619 2000-02-17 Juergen Vigna <jug@sad.it>
5621 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5622 int ** as we have to return the pointer, otherwise we have only
5623 NULL pointers in the returning function.
5625 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5627 * src/LaTeX.C (operator()): quote file name when running latex.
5629 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5631 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5632 (bubble tip), this removes our special handling of this.
5634 * Remove all code that is unused now that we have the new
5635 workarea. (Code that are not active when NEW_WA is defined.)
5637 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5639 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5641 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5642 nonexisting layout; correctly redirect obsoleted layouts.
5644 * lib/lyxrc.example: document \view_dvi_paper_option
5646 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5649 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5650 (PreviewDVI): handle the view_dvi_paper_option variable.
5651 [Both from Roland Krause]
5653 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5655 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5656 char const *, int, LyXFont)
5657 (text(int, int, string, LyXFont)): ditto
5659 * src/text.C (InsertCharInTable): attempt to fix the double-space
5660 feature in tables too.
5661 (BackspaceInTable): ditto.
5662 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5664 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5666 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5668 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5669 newly found text in textcache to this.
5670 (buffer): set the owner of the text put into the textcache to 0
5672 * src/insets/figinset.C (draw): fixed the drawing of figures with
5675 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5676 drawing of mathframe, hfills, protected space, table lines. I have
5677 now no outstanding drawing problems with the new Painter code.
5679 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5681 * src/PainterBase.C (ellipse, circle): do not specify the default
5684 * src/LColor.h: add using directive.
5686 * src/Painter.[Ch]: change return type of methods from Painter& to
5687 PainterBase&. Add a using directive.
5689 * src/WorkArea.C: wrap xforms callbacks in C functions
5692 * lib/layouts/foils.layout: font fix and simplifications from Carl
5695 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5697 * a lot of files: The Painter, LColor and WorkArea from the old
5698 devel branch has been ported to lyx-devel. Some new files and a
5699 lot of #ifdeffed code. The new workarea is enabled by default, but
5700 if you want to test the new Painter and LColor you have to compile
5701 with USE_PAINTER defined (do this in config.h f.ex.) There are
5702 still some rought edges, and I'd like some help to clear those
5703 out. It looks stable (loads and displays the Userguide very well).
5706 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5708 * src/buffer.C (pop_tag): revert to the previous implementation
5709 (use a global variable for both loops).
5711 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5713 * src/lyxrc.C (LyXRC): change slightly default date format.
5715 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5716 there is an English text with a footnote that starts with a Hebrew
5717 paragraph, or vice versa.
5718 (TeXFootnote): ditto.
5720 * src/text.C (LeftMargin): allow for negative values for
5721 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5724 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5725 for input encoding (cyrillic)
5727 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5729 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5732 * src/toolbar.C (set): ditto
5733 * src/insets/insetbib.C (create_form_citation_form): ditto
5735 * lib/CREDITS: added Dekel Tsur.
5737 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5738 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5739 hebrew supports files from Dekel Tsur.
5741 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5742 <tzafrir@technion.ac.il>
5744 * src/lyxrc.C: put \date_insert_format at the right place.
5746 * src/buffer.C (makeLaTeXFile): fix the handling of
5747 BufferParams::sides when writing out latex files.
5749 * src/BufferView2.C: add a "using" directive.
5751 * src/support/lyxsum.C (sum): when we use lyxstring,
5752 ostringstream::str needs an additional .c_str().
5754 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5756 * src/support/filetools.C (ChangeExtension): patch from Etienne
5759 * src/TextCache.C (show): remove const_cast and make second
5760 parameter non-const LyXText *.
5762 * src/TextCache.h: use non const LyXText in show.
5764 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
5767 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5769 * src/support/lyxsum.C: rework to be more flexible.
5771 * several places: don't check if a pointer is 0 if you are going
5774 * src/text.C: remove some dead code.
5776 * src/insets/figinset.C: remove some dead code
5778 * src/buffer.C: move the BufferView funcs to BufferView2.C
5779 remove all support for insetlatexdel
5780 remove support for oldpapersize stuff
5781 made some member funcs const
5783 * src/kbmap.C: use a std::list to store the bindings in.
5785 * src/BufferView2.C: new file
5787 * src/kbsequence.[Ch]: new files
5789 * src/LyXAction.C + others: remove all trace of buffer-previous
5791 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
5792 only have one copy in the binary of this table.
5794 * hebrew patch: moved some functions from LyXText to more
5795 appropriate places. (LyXParagraph, BufferParams, LyXFont)
5797 * several files: remove support for XForms older than 0.88
5799 remove some #if 0 #endif code
5801 * src/TextCache.[Ch]: new file. Holds the textcache.
5803 * src/BufferView.C: changes to use the new TextCache interface.
5804 (waitForX): remove the now unused code.
5806 * src/BackStack.h: remove some commented code
5808 * lib/bind/emacs.bind: remove binding for buffer-previous
5810 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5812 * applied the hebrew patch.
5814 * src/lyxrow.h: make sure that all Row variables are initialized.
5816 * src/text2.C (TextHandleUndo): comment out a delete, this might
5817 introduce a memory leak, but should also help us to not try to
5818 read freed memory. We need to look at this one.
5820 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
5821 (LyXParagraph): initalize footnotekind.
5823 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
5824 forgot this when applying the patch. Please heed the warnings.
5826 * src/BufferView.C (buffer): a fix for the buffer-reload problem
5827 (aka. reformat problem)
5829 * src/bufferlist.C (exists): made const, and use const_iterator
5830 (isLoaded): new func.
5831 (release): use std::find to find the correct buffer.
5833 * src/bufferlist.h: made getState a const func.
5834 made empty a const func.
5835 made exists a const func.
5838 2000-02-01 Juergen Vigna <jug@sad.it>
5840 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
5842 * po/it.po: updated a bit the italian po file and also changed the
5843 'file nuovo' for newfile to 'filenuovo' without a space, this did
5846 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
5847 for the new insert_date command.
5849 * src/lyxfunc.C (Dispatch): added support for a insert_date function
5850 from jdblair, to insert a date into the current text conforming to
5851 a strftime format (for now only considering the locale-set and not
5852 the document-language).
5854 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5856 * src/lyxfont.C (textWidth): hopefully better fix for the Array
5857 Bounds Read error seen by purify. The problem was that islower is
5858 a macros which takes an unsigned char and uses it as an index for
5859 in array of characters properties (and is thus subject to the
5863 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
5864 correctly the paper sides radio buttons.
5865 (UpdateDocumentButtons): ditto.
5867 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5869 * src/kbmap.C (getsym + others): change to return unsigned int,
5870 returning a long can give problems on 64 bit systems. (I assume
5871 that int is 32bit on 64bit systems)
5873 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5875 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
5876 LyXLookupString to be zero-terminated. Really fixes problems seen
5879 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5881 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
5882 write a (char*)0 to the lyxerr stream.
5884 * src/lastfiles.C: move algorithm before the using statemets.
5886 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5888 * src/lastfiles.C: move using directives in global scope (egcs 1.x
5889 complains otherwise).
5890 * src/table.C: ditto
5892 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
5895 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
5896 that I removed earlier... It is really needed.
5898 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
5900 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5902 * INSTALL: update xforms home page URL.
5904 * lib/configure.m4: fix a bug with unreadable layout files.
5906 * src/table.C (calculate_width_of_column): add "using std::max"
5909 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5911 * several files: marked several lines with "DEL LINE", this is
5912 lines that can be deleted without changing anything.
5913 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
5914 checks this anyway */
5917 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
5919 * src/DepTable.C (update): add a "+" at the end when the checksum
5920 is different. (debugging string only)
5922 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
5923 the next inset to not be displayed. This should also fix the list
5924 of labels in the "Insert Crossreference" dialog.
5926 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
5928 * src/support/LSubstring.C (LSubstring): set pos to string::npos
5929 when regex was not found.
5931 * src/support/lstrings.C (lowercase): use handcoded transform always.
5934 * src/text.C (Delete): fixed the crash. cursor.par->prev and
5935 old_cursor.par->prev could be 0.
5937 * several files: changed post inc/dec to pre inc/dec
5939 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
5940 write the lastfiles to file.
5942 * src/BufferView.C (buffer): only show TextCache info when debugging
5944 (resizeCurrentBuffer): ditto
5945 (workAreaExpose): ditto
5947 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
5949 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
5951 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
5952 a bit better by removing the special case for \i and \j.
5954 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5956 * src/lyx_main.C (easyParse): remove test for bad comand line
5957 options, since this broke all xforms-related parsing.
5959 * src/kbmap.C (getsym): set return type to unsigned long, as
5960 declared in header. On an alpha, long is _not_ the same as int.
5962 * src/support/LOstream.h: add a "using std::flush;"
5964 * src/insets/figinset.C: ditto.
5966 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5968 * src/bufferlist.C (write): use blinding fast file copy instead of
5969 "a char at a time", now we are doing it the C++ way.
5971 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
5972 std::list<int> instead.
5973 (addpidwait): reflect move to std::list<int>
5974 (sigchldchecker): ditto
5976 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
5979 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
5980 that obviously was wrong...
5982 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
5983 c, this avoids warnings with purify and islower.
5985 * src/insets/figinset.C: rename struct queue to struct
5986 queue_element and rewrite to use a std::queue. gsqueue is now a
5987 std::queue<queue_element>
5988 (runqueue): reflect move to std::queue
5991 * src/support/lstrings.h (tostr): specialize for bool, otherwise
5992 we would get "1" "0" instead of "true" "false. Also make the tostr
5995 2000-01-21 Juergen Vigna <jug@sad.it>
5997 * src/buffer.C (writeFileAscii): Disabled code for special groff
5998 handling of tabulars till I fix this in table.C
6000 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6002 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6004 * src/support/lyxlib.h: ditto.
6006 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6008 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6009 and 'j' look better. This might fix the "macron" bug that has been
6012 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6013 functions as one template function. Delete the old versions.
6015 * src/support/lyxsum.C: move using std::ifstream inside
6018 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6021 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6023 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6025 * src/insets/figinset.C (InitFigures): use new instead of malloc
6026 to allocate memory for figures and bitmaps.
6027 (DoneFigures): use delete[] instead of free to deallocate memory
6028 for figures and bitmaps.
6029 (runqueue): use new to allocate
6030 (getfigdata): use new/delete[] instead of malloc/free
6031 (RegisterFigure): ditto
6033 * some files: moved some declarations closer to first use, small
6034 whitespace changes use preincrement instead of postincrement where
6035 it does not make a difference.
6037 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6038 step on the way to use stl::containers for key maps.
6040 * src/bufferlist.h: add a typedef for const_iterator and const
6041 versions of begin and end.
6043 * src/bufferlist.[Ch]: change name of member variable _state to
6044 state_. (avoid reserved names)
6046 (getFileNames): returns the filenames of the buffers in a vector.
6048 * configure.in (ALL_LINGUAS): added ro
6050 * src/support/putenv.C: new file
6052 * src/support/mkdir.C: new file
6054 2000-01-20 Allan Rae <rae@lyx.org>
6056 * lib/layouts/IEEEtran.layout: Added several theorem environments
6058 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6059 couple of minor additions.
6061 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6062 (except for those in footnotes of course)
6064 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6066 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6068 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6069 std::sort and std::lower_bound instead of qsort and handwritten
6071 (struct compara): struct that holds the functors used by std::sort
6072 and std::lower_bound in MathedLookupBOP.
6074 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6076 * src/support/LAssert.h: do not do partial specialization. We do
6079 * src/support/lyxlib.h: note that lyx::getUserName() and
6080 lyx::date() are not in use right now. Should these be suppressed?
6082 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6083 (makeLinuxDocFile): do not put date and user name in linuxdoc
6086 * src/support/lyxlib.h (kill): change first argument to long int,
6087 since that's what solaris uses.
6089 * src/support/kill.C (kill): fix declaration to match prototype.
6091 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6092 actually check whether namespaces are supported. This is not what
6095 * src/support/lyxsum.C: add a using directive.
6097 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6099 * src/support/kill.C: if we have namespace support we don't have
6100 to include lyxlib.h.
6102 * src/support/lyxlib.h: use namespace lyx if supported.
6104 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6106 * src/support/date.C: new file
6108 * src/support/chdir.C: new file
6110 * src/support/getUserName.C: new file
6112 * src/support/getcwd.C: new file
6114 * src/support/abort.C: new file
6116 * src/support/kill.C: new file
6118 * src/support/lyxlib.h: moved all the functions in this file
6119 insede struct lyx. Added also kill and abort to this struct. This
6120 is a way to avoid the "kill is not defined in <csignal>", we make
6121 C++ wrappers for functions that are not ANSI C or ANSI C++.
6123 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6124 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6125 lyx it has been renamed to sum.
6127 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6129 * src/text.C: add using directives for std::min and std::max.
6131 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6133 * src/texrow.C (getIdFromRow): actually return something useful in
6134 id and pos. Hopefully fixes the bug with positionning of errorbox
6137 * src/lyx_main.C (easyParse): output an error and exit if an
6138 incorrect command line option has been given.
6140 * src/spellchecker.C (ispell_check_word): document a memory leak.
6142 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6143 where a "struct utimbuf" is allocated with "new" and deleted with
6146 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6148 * src/text2.C (CutSelection): don't delete double spaces.
6149 (PasteSelection): ditto
6150 (CopySelection): ditto
6152 * src/text.C (Backspace): don't delete double spaces.
6154 * src/lyxlex.C (next): fix a bug that were only present with
6155 conformant std::istream::get to read comment lines, use
6156 std::istream::getline instead. This seems to fix the problem.
6158 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6160 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6161 allowed to insert space before space" editing problem. Please read
6162 commends at the beginning of the function. Comments about usage
6165 * src/text.C (InsertChar): fix for the "not allowed to insert
6166 space before space" editing problem.
6168 * src/text2.C (DeleteEmptyParagraphMechanism): when
6169 IsEmptyTableRow can only return false this last "else if" will
6170 always be a no-op. Commented out.
6172 * src/text.C (RedoParagraph): As far as I can understand tmp
6173 cursor is not really needed.
6175 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6176 present it could only return false anyway.
6177 (several functions): Did something not so smart...added a const
6178 specifier on a lot of methods.
6180 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6181 and add a tmp->text.resize. The LyXParagraph constructor does the
6183 (BreakParagraphConservative): ditto
6185 * src/support/path.h (Path): add a define so that the wrong usage
6186 "Path("/tmp") will be flagged as a compilation error:
6187 "`unnamed_Path' undeclared (first use this function)"
6189 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6191 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6192 which was bogus for several reasons.
6194 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6198 * autogen.sh: do not use "type -path" (what's that anyway?).
6200 * src/support/filetools.C (findtexfile): remove extraneous space
6201 which caused a kpsewhich warning (at least with kpathsea version
6204 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6206 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6208 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6210 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6212 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6214 * src/paragraph.C (BreakParagraph): do not reserve space on text
6215 if we don't need to (otherwise, if pos_end < pos, we end up
6216 reserving huge amounts of memory due to bad unsigned karma).
6217 (BreakParagraphConservative): ditto, although I have not seen
6218 evidence the bug can happen here.
6220 * src/lyxparagraph.h: add a using std::list.
6222 2000-01-11 Juergen Vigna <jug@sad.it>
6224 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6227 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6229 * src/vc-backend.C (doVCCommand): change to be static and take one
6230 more parameter: the path to chdir too be fore executing the command.
6231 (retrive): new function equiv to "co -r"
6233 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6234 file_not_found_hook is true.
6236 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6238 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6239 if a file is readwrite,readonly...anything else.
6241 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6243 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6244 (CreatePostscript): name change from MenuRunDVIPS (or something)
6245 (PreviewPostscript): name change from MenuPreviewPS
6246 (PreviewDVI): name change from MenuPreviewDVI
6248 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6249 \view_pdf_command., \pdf_to_ps_command
6251 * lib/configure.m4: added search for PDF viewer, and search for
6252 PDF to PS converter.
6253 (lyxrc.defaults output): add \pdflatex_command,
6254 \view_pdf_command and \pdf_to_ps_command.
6256 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6258 * src/bufferlist.C (write): we don't use blocksize for anything so
6261 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6263 * src/support/block.h: disable operator T* (), since it causes
6264 problems with both compilers I tried. See comments in the file.
6266 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6269 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6270 variable LYX_DIR_10x to LYX_DIR_11x.
6272 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6274 * INSTALL: document --with-lyxname.
6277 * configure.in: new configure flag --with-lyxname which allows to
6278 choose the name under which lyx is installed. Default is "lyx", of
6279 course. It used to be possible to do this with --program-suffix,
6280 but the later has in fact a different meaning for autoconf.
6282 * src/support/lstrings.h (lstrchr): reformat a bit.
6284 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6285 * src/mathed/math_defs.h: ditto.
6287 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6289 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6290 true, decides if we create a backup file or not when saving. New
6291 tag and variable \pdf_mode, defaults to false. New tag and
6292 variable \pdflatex_command, defaults to pdflatex. New tag and
6293 variable \view_pdf_command, defaults to xpdf. New tag and variable
6294 \pdf_to_ps_command, defaults to pdf2ps.
6296 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6298 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6299 does not have a BufferView.
6300 (unlockInset): ditto + don't access the_locking_inset if the
6301 buffer does not have a BufferView.
6303 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6304 certain circumstances so that we don't continue a keyboard
6305 operation long after the key was released. Try f.ex. to load a
6306 large document, press PageDown for some seconds and then release
6307 it. Before this change the document would contine to scroll for
6308 some time, with this change it stops imidiatly.
6310 * src/support/block.h: don't allocate more space than needed. As
6311 long as we don't try to write to the arr[x] in a array_type arr[x]
6312 it is perfectly ok. (if you write to it you might segfault).
6313 added operator value_type*() so that is possible to pass the array
6314 to functions expecting a C-pointer.
6316 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6319 * intl/*: updated to gettext 0.10.35, tried to add our own
6320 required modifications. Please verify.
6322 * po/*: updated to gettext 0.10.35, tried to add our own required
6323 modifications. Please verify.
6325 * src/support/lstrings.C (tostr): go at fixing the problem with
6326 cxx and stringstream. When stringstream is used return
6327 oss.str().c_str() so that problems with lyxstring and basic_string
6328 are avoided. Note that the best solution would be for cxx to use
6329 basic_string all the way, but it is not conformant yet. (it seems)
6331 * src/lyx_cb.C + other files: moved several global functions to
6332 class BufferView, some have been moved to BufferView.[Ch] others
6333 are still located in lyx_cb.C. Code changes because of this. (part
6334 of "get rid of current_view project".)
6336 * src/buffer.C + other files: moved several Buffer functions to
6337 class BufferView, the functions are still present in buffer.C.
6338 Code changes because of this.
6340 * config/lcmessage.m4: updated to most recent. used when creating
6343 * config/progtest.m4: updated to most recent. used when creating
6346 * config/gettext.m4: updated to most recent. applied patch for
6349 * config/gettext.m4.patch: new file that shows what changes we
6350 have done to the local copy of gettext.m4.
6352 * config/libtool.m4: new file, used in creation of acinclude.m4
6354 * config/lyxinclude.m4: new file, this is the lyx created m4
6355 macros, used in making acinclude.m4.
6357 * autogen.sh: GNU m4 discovered as a separate task not as part of
6358 the lib/configure creation.
6359 Generate acinlucde from files in config. Actually cat
6360 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6361 easier to upgrade .m4 files that really are external.
6363 * src/Spacing.h: moved using std::istringstream to right after
6364 <sstream>. This should fix the problem seen with some compilers.
6366 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6368 * src/lyx_cb.C: began some work to remove the dependency a lot of
6369 functions have on BufferView::text, even if not really needed.
6370 (GetCurrentTextClass): removed this func, it only hid the
6373 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6374 forgot this in last commit.
6376 * src/Bullet.C (bulletEntry): use static char const *[] for the
6377 tables, becuase of this the return arg had to change to string.
6379 (~Bullet): removed unneeded destructor
6381 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6382 (insetSleep): moved from Buffer
6383 (insetWakeup): moved from Buffer
6384 (insetUnlock): moved from Buffer
6386 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6387 from Buffer to BufferView.
6389 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6391 * config/ltmain.sh: updated to version 1.3.4 of libtool
6393 * config/ltconfig: updated to version 1.3.4 of libtool
6395 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6398 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6399 Did I get that right?
6401 * src/lyxlex.h: add a "using" directive or two.
6402 * src/Spacing.h: ditto.
6403 * src/insets/figinset.C: ditto.
6404 * src/support/filetools.C: ditto.
6405 * src/support/lstrings.C: ditto.
6406 * src/BufferView.C: ditto.
6407 * src/bufferlist.C: ditto.
6408 * src/lyx_cb.C: ditto.
6409 * src/lyxlex.C: ditto.
6411 * NEWS: add some changes for 1.1.4.
6413 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6415 * src/BufferView.C: first go at a TextCache to speed up switching
6418 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6420 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6421 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6422 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6423 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6426 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6427 members of the struct are correctly initialized to 0 (detected by
6429 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6430 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6432 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6433 pidwait, since it was allocated with "new". This was potentially
6434 very bad. Thanks to Michael Schmitt for running purify for us.
6437 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6439 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6441 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6443 1999-12-30 Allan Rae <rae@lyx.org>
6445 * lib/templates/IEEEtran.lyx: minor change
6447 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6448 src/mathed/formula.C (LocalDispatch): askForText changes
6450 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6451 know when a user has cancelled input. Fixes annoying problems with
6452 inserting labels and version control.
6454 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6456 * src/support/lstrings.C (tostr): rewritten to use strstream and
6459 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6461 * src/support/filetools.C (IsFileWriteable): use fstream to check
6462 (IsDirWriteable): use fileinfo to check
6464 * src/support/filetools.h (FilePtr): whole class deleted
6466 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6468 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6470 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6472 * src/bufferlist.C (write): use ifstream and ofstream instead of
6475 * src/Spacing.h: use istrstream instead of sscanf
6477 * src/mathed/math_defs.h: change first arg to istream from FILE*
6479 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6481 * src/mathed/math_parser.C: have yyis to be an istream
6482 (LexGetArg): use istream (yyis)
6484 (mathed_parse): ditto
6485 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6487 * src/mathed/formula.C (Read): rewritten to use istream
6489 * src/mathed/formulamacro.C (Read): rewritten to use istream
6491 * src/lyxlex.h (~LyXLex): deleted desturctor
6492 (getStream): new function, returns an istream
6493 (getFile): deleted funtion
6494 (IsOK): return is.good();
6496 * src/lyxlex.C (LyXLex): delete file and owns_file
6497 (setFile): open an filebuf and assign that to a istream instead of
6499 (setStream): new function, takes an istream as arg.
6500 (setFile): deleted function
6501 (EatLine): rewritten us use istream instead of FILE*
6505 * src/table.C (LyXTable): use istream instead of FILE*
6506 (Read): rewritten to take an istream instead of FILE*
6508 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6510 * src/buffer.C (Dispatch): remove an extraneous break statement.
6512 * src/support/filetools.C (QuoteName): change to do simple
6513 'quoting'. More work is necessary. Also changed to do nothing
6514 under emx (needs fix too).
6515 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6517 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6518 config.h.in to the AC_DEFINE_UNQUOTED() call.
6519 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6520 needs char * as argument (because Solaris 7 declares it like
6523 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6524 remove definition of BZERO.
6526 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6528 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6529 defined, "lyxregex.h" if not.
6531 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6533 (REGEX): new variable that is set to regex.c lyxregex.h when
6534 AM_CONDITIONAL USE_REGEX is set.
6535 (libsupport_la_SOURCES): add $(REGEX)
6537 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6540 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6543 * configure.in: add call to LYX_REGEX
6545 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6546 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6548 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6550 * lib/bind/fi_menus.bind: new file, from
6551 pauli.virtanen@saunalahti.fi.
6553 * src/buffer.C (getBibkeyList): pass the parameter delim to
6554 InsetInclude::getKeys and InsetBibtex::getKeys.
6556 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6557 is passed to Buffer::getBibkeyList
6559 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6560 instead of the hardcoded comma.
6562 * src/insets/insetbib.C (getKeys): make sure that there are not
6563 leading blanks in bibtex keys. Normal latex does not care, but
6564 harvard.sty seems to dislike blanks at the beginning of citation
6565 keys. In particular, the retturn value of the function is
6567 * INSTALL: make it clear that libstdc++ is needed and that gcc
6568 2.7.x probably does not work.
6570 * src/support/filetools.C (findtexfile): make debug message go to
6572 * src/insets/insetbib.C (getKeys): ditto
6574 * src/debug.C (showTags): make sure that the output is correctly
6577 * configure.in: add a comment for TWO_COLOR_ICON define.
6579 * acconfig.h: remove all the entries that already defined in
6580 configure.in or acinclude.m4.
6582 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6583 to avoid user name, date and copyright.
6585 1999-12-21 Juergen Vigna <jug@sad.it>
6587 * src/table.C (Read): Now read bogus row format informations
6588 if the format is < 5 so that afterwards the table can
6589 be read by lyx but without any format-info. Fixed the
6590 crash we experienced when not doing this.
6592 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6594 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6595 (RedoDrawingOfParagraph): ditto
6596 (RedoParagraphs): ditto
6597 (RemoveTableRow): ditto
6599 * src/text.C (Fill): rename arg paperwidth -> paper_width
6601 * src/buffer.C (insertLyXFile): rename var filename -> fname
6602 (writeFile): rename arg filename -> fname
6603 (writeFileAscii): ditto
6604 (makeLaTeXFile): ditto
6605 (makeLinuxDocFile): ditto
6606 (makeDocBookFile): ditto
6608 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6611 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6613 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6616 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6617 compiled by a C compiler not C++.
6619 * src/layout.h (LyXTextClass): added typedef for const_iterator
6620 (LyXTextClassList): added typedef for const_iterator + member
6621 functions begin and end.
6623 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6624 iterators to fill the choice_class.
6625 (updateLayoutChoice): rewritten to use iterators to fill the
6626 layoutlist in the toolbar.
6628 * src/BufferView.h (BufferView::work_area_width): removed unused
6631 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6633 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6634 (sgmlCloseTag): ditto
6636 * src/support/lstrings.h: return type of countChar changed to
6639 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6640 what version of this func to use. Also made to return unsigned int.
6642 * configure.in: call LYX_STD_COUNT
6644 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6645 conforming std::count.
6647 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6649 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6650 and a subscript would give bad display (patch from Dekel Tsur
6651 <dekel@math.tau.ac.il>).
6653 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6655 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6658 * src/chset.h: add a few 'using' directives
6660 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6661 triggered when no buffer is active
6663 * src/layout.C: removed `break' after `return' in switch(), since
6666 * src/lyx_main.C (init): make sure LyX can be ran in place even
6667 when libtool has done its magic with shared libraries. Fix the
6668 test for the case when the system directory has not been found.
6670 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6671 name for the latex file.
6672 (MenuMakeHTML): ditto
6674 * src/buffer.h: add an optional boolean argument, which is passed
6677 1999-12-20 Allan Rae <rae@lyx.org>
6679 * lib/templates/IEEEtran.lyx: small correction and update.
6681 * configure.in: Attempted to use LYX_PATH_HEADER
6683 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6685 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6686 input from JMarc. Now use preprocessor to find the header.
6687 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6688 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6689 LYX_STL_STRING_FWD. See comments in file.
6691 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6693 * The global MiniBuffer * minibuffer variable is dead.
6695 * The global FD_form_main * fd_form_main variable is dead.
6697 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6699 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6701 * src/table.h: add the LOstream.h header
6702 * src/debug.h: ditto
6704 * src/LyXAction.h: change the explaination of the ReadOnly
6705 attribute: is indicates that the function _can_ be used.
6707 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6710 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6712 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6718 * src/paragraph.C (GetWord): assert on pos>=0
6721 * src/support/lyxstring.C: condition the use of an invariant on
6723 * src/support/lyxstring.h: ditto
6725 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6726 Use LAssert.h instead of plain assert().
6728 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6730 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6731 * src/support/filetools.C: ditto
6733 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6736 * INSTALL: document the new configure flags
6738 * configure.in: suppress --with-debug; add --enable-assertions
6740 * acinclude.m4: various changes in alignment of help strings.
6742 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6744 * src/kbmap.C: commented out the use of the hash map in kb_map,
6745 beginning of movement to a stl::container.
6747 * several files: removed code that was not in effect when
6748 MOVE_TEXT was defined.
6750 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6751 for escaping should not be used. We can discuss if the string
6752 should be enclosed in f.ex. [] instead of "".
6754 * src/trans_mgr.C (insert): use the new returned value from
6755 encodeString to get deadkeys and keymaps done correctly.
6757 * src/chset.C (encodeString): changed to return a pair, to tell
6758 what to use if we know the string.
6760 * src/lyxscreen.h (fillArc): new function.
6762 * src/FontInfo.C (resize): rewritten to use more std::string like
6763 structore, especially string::replace.
6765 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
6768 * configure.in (chmod +x some scripts): remove config/gcc-hack
6770 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6772 * src/buffer.C (writeFile): change once again the top comment in a
6773 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
6774 instead of an hardcoded version number.
6775 (makeDocBookFile): ditto
6777 * src/version.h: add new define LYX_DOCVERSION
6779 * po/de.po: update from Pit Sütterlin
6780 * lib/bind/de_menus.bind: ditto.
6782 * src/lyxfunc.C (Dispatch): call MenuExport()
6783 * src/buffer.C (Dispatch): ditto
6785 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
6786 LyXFunc::Dispatch().
6787 (MenuExport): new function, moved from
6788 LyXFunc::Dispatch().
6790 * src/trans_mgr.C (insert): small cleanup
6791 * src/chset.C (loadFile): ditto
6793 * lib/kbd/iso8859-1.cdef: add missing backslashes
6795 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6797 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
6798 help with placing the manually drawn accents better.
6800 (Draw): x2 and hg changed to float to minimize rounding errors and
6801 help place the accents better.
6803 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
6804 unsigned short to char is just wrong...cast the char to unsigned
6805 char instead so that the two values can compare sanely. This
6806 should also make the display of insetlatexaccents better and
6807 perhaps also some other insets.
6809 (lbearing): new function
6812 1999-12-15 Allan Rae <rae@lyx.org>
6814 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
6815 header that provides a wrapper around the very annoying SGI STL header
6818 * src/support/lyxstring.C, src/LString.h:
6819 removed old SGI-STL-compatability attempts.
6821 * configure.in: Use LYX_STL_STRING_FWD.
6823 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
6824 stl_string_fwd.h is around and try to determine it's location.
6825 Major improvement over previous SGI STL 3.2 compatability.
6826 Three small problems remain with this function due to my zero
6827 knowledge of autoconf. JMarc and lgb see the comments in the code.
6829 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6831 * src/broken_const.h, config/hack-gcc, config/README: removed
6833 * configure.in: remove --with-gcc-hack option; do not call
6836 * INSTALL: remove documentation of --with-broken-const and
6839 * acconfig.h: remove all trace of BROKEN_CONST define
6841 * src/buffer.C (makeDocBookFile): update version number in output
6843 (SimpleDocBookOnePar): fix an assert when trying to a character
6844 access beyond string length
6847 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6849 * po/de.po: fix the Export menu
6851 * lyx.man: update the description of -dbg
6853 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
6854 (commandLineHelp): updated
6855 (easyParse): show list of available debug levels if -dbg is passed
6858 * src/Makefile.am: add debug.C
6860 * src/debug.h: moved some code to debug.C
6862 * src/debug.C: new file. Contains code to set and show debug
6865 * src/layout.C: remove 'break' after 'continue' in switch
6866 statements, since these cannot be reached.
6868 1999-12-13 Allan Rae <rae@lyx.org>
6870 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
6871 (in_word_set): hash() -> math_hash()
6873 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
6875 * acconfig.h: Added a test for whether we are using exceptions in the
6876 current compilation run. If so USING_EXCEPTIONS is defined.
6878 * config.in: Check for existance of stl_string_fwd.h
6879 * src/LString.h: If compiling --with-included-string and SGI's
6880 STL version 3.2 is present (see above test) we need to block their
6881 forward declaration of string and supply a __get_c_string().
6882 However, it turns out this is only necessary if compiling with
6883 exceptions enabled so I've a bit more to add yet.
6885 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
6886 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
6887 src/support/LRegex.h, src/undo.h:
6888 Shuffle the order of the included files a little to ensure that
6889 LString.h gets included before anything that includes stl_string_fwd.h
6891 * src/support/lyxstring.C: We need to #include LString.h instead of
6892 lyxstring.h to get the necessary definition of __get_c_string.
6893 (__get_c_string): New function. This is defined static just like SGI's
6894 although why they need to do this I'm not sure. Perhaps it should be
6895 in lstrings.C instead.
6897 * lib/templates/IEEEtran.lyx: New template file.
6899 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6901 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
6902 * intl/Makefile.in (MKINSTALLDIRS): ditto
6904 * src/LyXAction.C (init): changed to hold the LFUN data in a
6905 automatic array in stead of in callso to newFunc, this speeds up
6906 compilation a lot. Also all the memory used by the array is
6907 returned when the init is completed.
6909 * a lot of files: compiled with -Wold-style-cast, changed most of
6910 the reported offenders to C++ style casts. Did not change the
6911 offenders in C files.
6913 * src/trans.h (Match): change argument type to unsigned int.
6915 * src/support/DebugStream.C: fix some types on the streambufs so
6916 that it works on a conforming implementation.
6918 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6920 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
6922 * src/support/lyxstring.C: remove the inline added earlier since
6923 they cause a bunch of unsatisfied symbols when linking with dec
6924 cxx. Cxx likes to have the body of inlines at the place where they
6927 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
6928 accessing negative bounds in array. This fixes the crash when
6929 inserting accented characters.
6930 * src/trans.h (Match): ditto
6932 * src/buffer.C (Dispatch): since this is a void, it should not try
6933 to return anything...
6935 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6937 * src/buffer.h: removed the two friends from Buffer. Some changes
6938 because of this. Buffer::getFileName and Buffer::setFileName
6939 renamed to Buffer::fileName() and Buffer::fileName(...).
6941 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6943 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
6944 and Buffer::update(short) to BufferView. This move is currently
6945 controlled by a define MOVE_TEXT, this will be removed when all
6946 shows to be ok. This move paves the way for better separation
6947 between buffer contents and buffer view. One side effect is that
6948 the BufferView needs a rebreak when swiching buffers, if we want
6949 to avoid this we can add a cache that holds pointers to LyXText's
6950 that is not currently in use.
6952 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
6955 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6957 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
6959 * lyx_main.C: new command line option -x (or --execute) and
6960 -e (or --export). Now direct conversion from .lyx to .tex
6961 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
6962 Unfortunately, X is still needed and the GUI pops up during the
6965 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6967 * src/Spacing.C: add a using directive to bring stream stuff into
6969 * src/paragraph.C: ditto
6970 * src/buffer.C: ditto
6972 * NEWS: updated a bit the new features of 1.1.3 (took a few things
6973 from Lars' announcement).
6975 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
6976 example files from Tino Meinen.
6978 1999-12-06 Allan Rae <rae@lyx.org>
6980 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
6982 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6984 * src/support/lyxstring.C: added a lot of inline for no good
6987 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
6988 latexWriteEndChanges, they were not used.
6990 * src/layout.h (operator<<): output operator for PageSides
6992 * src/mathed/math_iter.C (my_memcpy): slightly changed.
6994 * some example files: loaded in LyX 1.0.4 and saved again to update
6995 certain constructs (table format)
6997 * a lot of files: did the change to use fstream/iostream for all
6998 writing of files. Done with a close look at Andre Poenitz's patch.
7000 * some files: whitespace changes.
7002 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7004 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7005 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7006 architecture, we provide our own. It is used unconditionnally, but
7007 I do not think this is a performance problem. Thanks to Angus
7008 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7009 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7011 (GetInset): use my_memcpy.
7015 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7016 it is easier to understand, but it uses less TeX-only constructs now.
7018 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7019 elements contain spaces
7021 * lib/configure: regenerated
7023 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7024 elements contain spaces; display the list of programs that are
7027 * autogen.sh: make sure lib/configure is executable
7029 * lib/examples/*: rename the tutorial examples to begin with the
7030 two-letters language code.
7032 * src/lyxfunc.C (getStatus): do not query current font if no
7035 * src/lyx_cb.C (RunScript): use QuoteName
7036 (MenuRunDvips): ditto
7037 (PrintApplyCB): ditto
7039 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7040 around argument, so that it works well with the current shell.
7041 Does not work properly with OS/2 shells currently.
7043 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7044 * src/LyXSendto.C (SendtoApplyCB): ditto
7045 * src/lyxfunc.C (Dispatch): ditto
7046 * src/buffer.C (runLaTeX): ditto
7047 (runLiterate): ditto
7048 (buildProgram): ditto
7050 * src/lyx_cb.C (RunScript): ditto
7051 (MenuMakeLaTeX): ditto
7053 * src/buffer.h (getLatexName): new method
7055 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7057 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7059 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7060 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7061 (create_math_panel): ditto
7063 * src/lyxfunc.C (getStatus): re-activate the code which gets
7064 current font and cursor; add test for export to html.
7066 * src/lyxrc.C (read): remove unreachable break statements; add a
7069 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7071 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7073 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7074 introduced by faulty regex.
7075 * src/buffer.C: ditto
7076 * src/lastfiles.C: ditto
7077 * src/paragraph.C: ditto
7078 * src/table.C: ditto
7079 * src/vspace.C: ditto
7080 * src/insets/figinset.C: ditto
7081 Note: most of these is absolutely harmless, except the one in
7082 src/mathed formula.C.
7084 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7086 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7087 operation, yielding correct results for the reLyX command.
7089 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7091 * src/support/filetools.C (ExpandPath): removed an over eager
7093 (ReplaceEnvironmentPath): ditto
7095 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7096 shows that we are doing something fishy in our code...
7100 * src/lyxrc.C (read): use a double switch trick to get more help
7101 from the compiler. (the same trick is used in layout.C)
7102 (write): new function. opens a ofstream and pass that to output
7103 (output): new function, takes a ostream and writes the lyxrc
7104 elemts to it. uses a dummy switch to make sure no elements are
7107 * src/lyxlex.h: added a struct pushpophelper for use in functions
7108 with more than one exit point.
7110 * src/lyxlex.[Ch] (GetInteger): made it const
7114 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7116 * src/layout.[hC] : LayoutTags splitted into several enums, new
7117 methods created, better error handling cleaner use of lyxlex. Read
7120 * src/bmtable.[Ch]: change some member prototypes because of the
7121 image const changes.
7123 * commandtags.h, src/LyXAction.C (init): new function:
7124 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7125 This file is not read automatically but you can add \input
7126 preferences to your lyxrc if you want to. We need to discuss how
7129 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7130 in .aux, also remove .bib and .bst files from dependencies when
7133 * src/BufferView.C, src/LyXView.C: add const_cast several places
7134 because of changes to images.
7136 * lib/images/*: same change as for images/*
7138 * lib/lyxrc.example: Default for accept_compound is false not no.
7140 * images/*: changed to be const, however I have som misgivings
7141 about this change so it might be changed back.
7143 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7145 * lib/configure, po/POTFILES.in: regenerated
7147 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7149 * config/lib_configure.m4: removed
7151 * lib/configure.m4: new file (was config/lib_configure.m4)
7153 * configure.in: do not test for rtti, since we do not use it.
7155 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7157 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7158 doubling of allocated space scheme. This makes it faster for large
7159 strings end to use less memory for small strings. xtra rememoved.
7161 * src/insets/figinset.C (waitalarm): commented out.
7162 (GhostscriptMsg): use static_cast
7163 (GhostscriptMsg): use new instead of malloc to allocate memory for
7164 cmap. also delete the memory after use.
7166 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7168 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7169 for changes in bibtex database or style.
7170 (runBibTeX): remove all .bib and .bst files from dep before we
7172 (run): use scanAuc in when dep file already exist.
7174 * src/DepTable.C (remove_files_with_extension): new method
7177 * src/DepTable.[Ch]: made many of the methods const.
7179 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7181 * src/bufferparams.C: make sure that the default textclass is
7182 "article". It used to be the first one by description order, but
7183 now the first one is "docbook".
7185 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7186 string; call Debug::value.
7187 (easyParse): pass complete argument to setDebuggingLevel().
7189 * src/debug.h (value): fix the code that parses debug levels.
7191 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7194 * src/LyXAction.C: use Debug::ACTION as debug channel.
7196 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7198 * NEWS: updated for the future 1.1.3 release.
7200 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7201 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7202 it should. This is of course a controversial change (since many
7203 people will find that their lyx workscreen is suddenly full of
7204 red), but done for the sake of correctness.
7206 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7207 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7209 * src/insets/inseterror.h, src/insets/inseturl.h,
7210 src/insets/insetinfo.h, src/insets/figinset.h,
7211 src/mathed/formulamacro.h, src/mathed/math_macro.h
7212 (EditMessage): add a missing const and add _() to make sure that
7215 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7216 src/insets/insetbib.C, src/support/filetools.C: add `using'
7219 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7220 doing 'Insert index of last word' at the beginning of a paragraph.
7222 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7224 * several files: white-space changes.
7226 * src/mathed/formula.C: removed IsAlpha and IsDigit
7228 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7229 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7232 * src/insets/figinset.C (GetPSSizes): don't break when
7233 "EndComments" is seen. But break when a boundingbox is read.
7235 * all classes inherited from Inset: return value of Clone
7236 changed back to Inset *.
7238 * all classes inherited form MathInset: return value of Clone
7239 changed back to MathedInset *.
7241 * src/insets/figinset.C (runqueue): use a ofstream to output the
7242 gs/ps file. Might need some setpresicion or setw. However I can
7243 see no problem with the current code.
7244 (runqueue): use sleep instead of the alarm/signal code. I just
7245 can't see the difference.
7247 * src/paragraph.C (LyXParagraph): reserve space in the new
7248 paragraph and resize the inserted paragraph to just fit.
7250 * src/lyxfunc.h (operator|=): added operator for func_status.
7252 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7253 check for readable file.
7255 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7256 check for readable file.
7257 (MenuMakeLinuxDoc): ditto
7258 (MenuMakeDocBook): ditto
7259 (MenuMakeAscii): ditto
7260 (InsertAsciiFile): split the test for openable and readable
7262 * src/bmtable.C (draw_bitmaptable): use
7263 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7265 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7266 findtexfile from LaTeX to filetools.
7268 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7269 instead of FilePtr. Needs to be verified by a literate user.
7271 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7273 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7274 (EditMessage): likewise.
7276 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7277 respectively as \textasciitilde and \textasciicircum.
7279 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7281 * src/support/lyxstring.h: made the methods that take iterators
7284 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7285 (regexMatch): made is use the real regex class.
7287 * src/support/Makefile.am: changed to use libtool
7289 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7291 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7293 (MathIsInset ++): changed several macros to be inline functions
7296 * src/mathed/Makefile.am: changed to use libtool
7298 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7300 * src/insets/inset* : Clone changed to const and return type is
7301 the true insettype not just Inset*.
7303 * src/insets/Makefile.am: changed to use libtool
7305 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7307 * src/undo.[Ch] : added empty() and changed some of the method
7310 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7312 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7313 setID use block<> for the bullets array, added const several places.
7315 * src/lyxfunc.C (getStatus): new function
7317 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7318 LyXAction, added const to several funtions.
7320 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7321 a std::map, and to store the dir items in a vector.
7323 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7326 * src/LyXView.[Ch] + other files : changed currentView to view.
7328 * src/LyXAction.[Ch] : ported from the old devel branch.
7330 * src/.cvsignore: added .libs and a.out
7332 * configure.in : changes to use libtool.
7334 * acinclude.m4 : inserted libtool.m4
7336 * .cvsignore: added libtool
7338 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7340 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7341 file name in insets and mathed directories (otherwise the
7342 dependency is not taken in account under cygwin).
7344 * src/text2.C (InsertString[AB]): make sure that we do not try to
7345 read characters past the string length.
7347 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7349 * lib/doc/LaTeXConfig.lyx.in,
7350 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7352 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7353 file saying who created them and when this heppened; this is
7354 useless and annoys tools like cvs.
7356 * lib/layouts/g-brief-{en,de}.layout,
7357 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7358 from Thomas Hartkens <thomas@hartkens.de>.
7360 * src/{insets,mathed}/Makefile.am: do not declare an empty
7361 LDFLAGS, so that it can be set at configure time (useful on Irix
7364 * lib/reLyX/configure.in: make sure that the prefix is set
7365 correctly in LYX_DIR.
7367 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7369 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7370 be used by 'command-sequence' this allows to bind a key to a
7371 sequence of LyX-commands
7372 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7374 * src/LyXAction.C: add "command-sequence"
7376 * src/LyXFunction.C: handling of "command-sequence"
7378 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7379 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7381 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7383 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7385 * src/buffer.C (writeFile): Do not output a comment giving user
7386 and date at the beginning of a .lyx file. This is useless and
7387 annoys cvs anyway; update version number to 1.1.
7389 * src/Makefile.am (LYX_DIR): add this definition, so that a
7390 default path is hardcoded in LyX.
7392 * configure.in: Use LYX_GNU_GETTEXT.
7394 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7395 AM_GNU_GETTEXT with a bug fixed.
7397 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7399 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7401 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7402 which is used to point to LyX data is now LYX_DIR_11x.
7404 * lyx.man: convert to a unix text file; small updates.
7406 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7408 * src/support/LSubstring.[Ch]: made the second arg of most of the
7409 constructors be a const reference.
7411 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7414 * src/support/lyxstring.[Ch] (swap): added missing member function
7415 and specialization of swap(str, str);
7417 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7419 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7420 trace of the old one.
7422 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7423 put the member definitions in undo.C.
7425 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7426 NEW_TEXT and have now only code that was included when this was
7429 * src/intl.C (LCombo): use static_cast
7431 (DispatchCallback): ditto
7433 * src/definitions.h: removed whole file
7435 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7437 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7438 parsing and stores in a std:map. a regex defines the file format.
7439 removed unneeded members.
7441 * src/bufferparams.h: added several enums from definitions.h here.
7442 Removed unsused destructor. Changed some types to use proper enum
7443 types. use block to have the temp_bullets and user_defined_bullets
7444 and to make the whole class assignable.
7446 * src/bufferparams.C (Copy): removed this functions, use a default
7449 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7452 * src/buffer.C (readLyXformat2): commend out all that have with
7453 oldpapersize to do. also comment out all that hve to do with
7454 insetlatex and insetlatexdel.
7455 (setOldPaperStuff): commented out
7457 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7459 * src/LyXAction.C: remove use of inset-latex-insert
7461 * src/mathed/math_panel.C (button_cb): use static_cast
7463 * src/insets/Makefile.am (insets_o_SOURCES): removed
7466 * src/support/lyxstring.C (helper): use the unsigned long
7467 specifier, UL, instead of a static_cast.
7469 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7471 * src/support/block.h: new file. to be used as a c-style array in
7472 classes, so that the class can be assignable.
7474 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7476 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7477 NULL, make sure to return an empty string (it is not possible to
7478 set a string to NULL).
7480 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7482 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7484 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7486 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7487 link line, so that Irix users (for example) can set it explicitely to
7490 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7491 it can be overidden at make time (static or dynamic link, for
7494 * src/vc-backend.C, src/LaTeXFeatures.h,
7495 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7496 statements to bring templates to global namespace.
7498 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7500 * src/support/lyxstring.C (operator[] const): make it standard
7503 * src/minibuffer.C (Init): changed to reflect that more
7504 information is given from the lyxvc and need not be provided here.
7506 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7508 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7510 * src/LyXView.C (UpdateTimerCB): use static_cast
7511 (KeyPressMask_raw_callback): ditto
7513 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7514 buffer_, a lot of changes because of this. currentBuffer() ->
7515 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7516 also changes to other files because of this.
7518 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7520 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7521 have no support for RCS and partial support for CVS, will be
7524 * src/insets/ several files: changes because of function name
7525 changes in Bufferview and LyXView.
7527 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7529 * src/support/LSubstring.[Ch]: new files. These implement a
7530 Substring that can be very convenient to use. i.e. is this
7532 string a = "Mary had a little sheep";
7533 Substring(a, "sheep") = "lamb";
7534 a is now "Mary has a little lamb".
7536 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7537 out patterns and subpatterns of strings. It is used by LSubstring
7538 and also by vc-backend.C
7540 * src/support/lyxstring.C: went over all the assertions used and
7541 tried to correct the wrong ones and flag which of them is required
7542 by the standard. some bugs found because of this. Also removed a
7543 couple of assertions.
7545 * src/support/Makefile.am (libsupport_a_SOURCES): added
7546 LSubstring.[Ch] and LRegex.[Ch]
7548 * src/support/FileInfo.h: have struct stat buf as an object and
7549 not a pointer to one, some changes because of this.
7551 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7552 information in layout when adding the layouts preamble to the
7555 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7558 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7559 because of bug in OS/2.
7561 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7563 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7564 \verbatim@font instead of \ttfamily, so that it can be redefined.
7566 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7567 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7568 src/layout.h, src/text2.C: add 'using' directive to bring the
7569 STL templates we need from the std:: namespace to the global one.
7570 Needed by DEC cxx in strict ansi mode.
7572 * src/support/LIstream.h,src/support/LOstream.h,
7573 src/support/lyxstring.h,src/table.h,
7574 src/lyxlookup.h: do not include <config.h> in header
7575 files. This should be done in the .C files only.
7577 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7581 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7583 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7584 from Kayvan to fix the tth invokation.
7586 * development/lyx.spec.in: updates from Kayvan to reflect the
7587 changes of file names.
7589 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7591 * src/text2.C (InsertStringB): use std::copy
7592 (InsertStringA): use std::copy
7594 * src/bufferlist.C: use a vector to store the buffers in. This is
7595 an internal change and should not affect any other thing.
7597 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7600 * src/text.C (Fill): fix potential bug, one off bug.
7602 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7604 * src/Makefile.am (lyx_main.o): add more files it depends on.
7606 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7608 * src/support/lyxstring.C: use size_t for the reference count,
7609 size, reserved memory and xtra.
7610 (internal_compare): new private member function. Now the compare
7611 functions should work for std::strings that have embedded '\0'
7613 (compare): all compare functions rewritten to use
7616 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7618 * src/support/lyxstring.C (compare): pass c_str()
7619 (compare): pass c_str
7620 (compare): pass c_str
7622 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7624 * src/support/DebugStream.C: <config.h> was not included correctly.
7626 * lib/configure: forgot to re-generate it :( I'll make this file
7627 auto generated soon.
7629 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7631 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7634 * src/support/lyxstring.C: some changes from length() to rep->sz.
7635 avoids a function call.
7637 * src/support/filetools.C (SpaceLess): yet another version of the
7638 algorithm...now per Jean-Marc's suggestions.
7640 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7642 * src/layout.C (less_textclass_desc): functor for use in sorting
7644 (LyXTextClass::Read): sort the textclasses after reading.
7646 * src/support/filetools.C (SpaceLess): new version of the
7647 SpaceLess functions. What problems does this one give? Please
7650 * images/banner_bw.xbm: made the arrays unsigned char *
7652 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7654 * src/support/lyxstring.C (find): remove bogus assertion in the
7655 two versions of find where this has not been done yet.
7657 * src/support/lyxlib.h: add missing int return type to
7660 * src/menus.C (ShowFileMenu): disable exporting to html if no
7661 html export command is present.
7663 * config/lib_configure.m4: add a test for an HTML converter. The
7664 programs checked for are, in this order: tth, latex2html and
7667 * lib/configure: generated from config/lib_configure.m4.
7669 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7670 html converter. The parameters are now passed through $$FName and
7671 $$OutName, instead of standard input/output.
7673 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7675 * lib/lyxrc.example: update description of \html_command.
7676 add "quotes" around \screen_font_xxx font setting examples to help
7677 people who use fonts with spaces in their names.
7679 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7681 * Distribution files: updates for v1.1.2
7683 * src/support/lyxstring.C (find): remove bogus assert and return
7684 npos for the same condition.
7686 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7688 * added patch for OS/2 from SMiyata.
7690 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7692 * src/text2.C (CutSelection): make space_wrapped a bool
7693 (CutSelection): dont declare int i until we have to.
7694 (alphaCounter): return a char const *.
7696 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7698 * src/support/syscall.C (Systemcalls::kill):
7699 src/support/filetools.C (PutEnv, PutEnvPath):
7700 src/lyx_cb.C (addNewlineAndDepth):
7701 src/FontInfo.C (FontInfo::resize): condition some #warning
7702 directives with WITH_WARNINGS.
7705 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7707 * src/layout.[Ch] + several files: access to class variables
7708 limited and made accessor functions instead a lot of code changed
7709 becuase of this. Also instead of returning pointers often a const
7710 reference is returned instead.
7712 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7714 * src/Makefile.am (dist-hook): added used to remove the CVS from
7715 cheaders upon creating a dist
7716 (EXTRA_DIST): added cheaders
7718 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7719 a character not as a small integer.
7721 * src/support/lyxstring.C (find): removed Assert and added i >=
7722 rep->sz to the first if.
7724 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7726 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7727 src/LyXView.C src/buffer.C src/bufferparams.C
7728 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7729 src/text2.C src/insets/insetinclude.C:
7730 lyxlayout renamed to textclasslist.
7732 * src/layout.C: some lyxerr changes.
7734 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7735 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7736 (LyXLayoutList): removed all traces of this class.
7737 (LyXTextClass::Read): rewrote LT_STYLE
7738 (LyXTextClass::hasLayout): new function
7739 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7740 both const and nonconst version.
7741 (LyXTextClass::delete_layout): new function.
7742 (LyXTextClassList::Style): bug fix. do the right thing if layout
7744 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7745 (LyXTextClassList::NameOfLayout): ditto
7746 (LyXTextClassList::Load): ditto
7748 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7750 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7752 * src/LyXAction.C (LookupFunc): added a workaround for sun
7753 compiler, on the other hand...we don't know if the current code
7754 compiles on sun at all...
7756 * src/support/filetools.C (CleanupPath): subst fix
7758 * src/insets/insetbib.C (delDatabase): subst fix, this looks
7761 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
7762 complained about this one?
7764 * src/insets/insetinclude.C (Latex): subst fix
7766 * src/insets/insetbib.C (getKeys): subst fix
7768 * src/LyXSendto.C (SendtoApplyCB): subst fix
7770 * src/lyx_main.C (init): subst fix
7772 * src/layout.C (Read): subst fix
7774 * src/lyx_sendfax_main.C (button_send): subst fix
7776 * src/buffer.C (RoffAsciiTable): subst fix
7778 * src/lyx_cb.C (MenuFax): subst fix
7779 (PrintApplyCB): subst fix
7781 1999-10-26 Juergen Vigna <jug@sad.it>
7783 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
7785 (Read): Cleaned up this code so now we read only format vestion >= 5
7787 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7789 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
7790 come nobody has complained about this one?
7792 * src/insets/insetinclude.C (Latex): subst fix
7794 * src/insets/insetbib.C (getKeys): subst fix
7796 * src/lyx_main.C (init): subst fix
7798 * src/layout.C (Read): subst fix
7800 * src/buffer.C (RoffAsciiTable): subst fix
7802 * src/lyx_cb.C (MenuFax): subst fix.
7804 * src/layout.[hC] + some other files: rewrote to use
7805 std::container to store textclasses and layouts in.
7806 Simplified, removed a lot of code. Make all classes
7807 assignable. Further simplifications and review of type
7808 use still to be one.
7810 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
7811 lastfiles to create the lastfiles partr of the menu.
7813 * src/lastfiles.[Ch]: rewritten to use deque to store the
7814 lastfiles in. Uses fstream for reading and writing. Simplifies
7817 * src/support/syscall.C: remove explicit cast.
7819 * src/BufferView.C (CursorToggleCB): removed code snippets that
7821 use explicat C++ style casts instead of C style casts. also use
7822 u_vdata instea of passing pointers in longs.
7824 * src/PaperLayout.C: removed code snippets that were commented out.
7826 * src/lyx_gui_misc.C: removed code snippets that were commented out.
7828 * src/lyx_main.C: removed code snippets that wer commented out.
7830 * src/paragraph.C: removed code snippets that were commented out.
7832 * src/lyxvc.C (logClose): use static_cast
7834 (viewLog): remove explicit cast to void*
7835 (showLog): removed old commented code
7837 * src/menus.C: use static_cast instead of C style casts. use
7838 u_vdata instead of u_ldata. remove explicit cast to (long) for
7839 pointers. Removed old code that was commented out.
7841 * src/insets/inset.C: removed old commented func
7843 * src/insets/insetref.C (InsetRef): removed old code that had been
7844 commented out for a long time.
7846 (escape): removed C style cast
7848 * src/insets/insetlatexaccent.C (Draw): removed old commented code
7850 * src/insets/insetlatex.C (Draw): removed old commented code
7851 (Read): rewritten to use string
7853 * src/insets/insetlabel.C (escape): removed C style cast
7855 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
7857 * src/insets/insetindex.C: use static_cast and u_vdata, removed
7860 * src/insets/insetinclude.h: removed a couple of stupid bools
7862 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
7863 (Clone): remove C style cast
7864 (getKeys): changed list to lst because of std::list
7866 * src/insets/inseterror.C (Draw): removed som old commented code.
7868 * src/insets/insetcommand.C (Draw): removed some old commented code.
7870 * src/insets/insetbib.C (bibitem_cb): removed code that has been
7871 commented out forever.
7872 (bibitem_cb): use static_cast instead of C style cast
7873 use of vdata changed to u_vdata.
7875 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
7877 (CloseUrlCB): use static_cast instead of C style cast.
7878 (CloseUrlCB): added a fl_free form...it seemed to be missing.
7880 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
7881 (C_InsetInfo_CloseInfoCB): forward the ob parameter
7882 (CloseInfoCB): static_cast from ob->u_vdata instead.
7883 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
7886 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
7887 (C_InsetError_CloseErrorCB): forward the ob parameter
7888 (CloseErrorCB): static_cast from ob->u_vdata instead.
7890 * src/vspace.h: include LString.h since we use string in this class.
7892 * src/vspace.C (lyx_advance): changed name from advance because of
7893 nameclash with stl. And since we cannot use namespaces yet...I
7894 used a lyx_ prefix instead. Expect this to change when we begin
7897 * src/BufferView.[Ch] (BufferView::~BufferView): removed
7899 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
7900 and removed now defunct constructor and deconstructor.
7902 * src/BufferView.h: have backstack as a object not as a pointer.
7903 removed initialization from constructor. added include for BackStack
7905 * development/lyx.spec.in (%build): add CFLAGS also.
7907 * src/screen.C (drawFrame): removed another warning.
7909 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7911 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
7912 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
7913 README and ANNOUNCE a bit for the next release. More work is
7916 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
7917 unbreakable if we are in freespacing mode (LyX-Code), but not in
7920 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7922 * src/BackStack.h: fixed initialization order in constructor
7924 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
7926 * acinclude.m4 (VERSION): new rules for when a version is
7927 development, added also a variable for prerelease.
7928 (warnings): we set with_warnings=yes for prereleases
7929 (lyx_opt): prereleases compile with same optimization as development
7930 (CXXFLAGS): only use pedantic if we are a development version
7932 * src/BufferView.C (restorePosition): don't do anything if the
7935 * src/BackStack.h: added member empty, use this to test if there
7936 is anything to pop...
7938 1999-10-25 Juergen Vigna <jug@sad.it>
7941 * forms/layout_forms.fd +
7942 * forms/latexoptions.fd +
7943 * lyx.fd: changed for various form resize issues
7945 * src/mathed/math_panel.C +
7946 * src/insets/inseterror.C +
7947 * src/insets/insetinfo.C +
7948 * src/insets/inseturl.C +
7949 * src/insets/inseturl.h +
7952 * src/PaperLayout.C +
7953 * src/ParagraphExtra.C +
7954 * src/TableLayout.C +
7956 * src/layout_forms.C +
7963 * src/menus.C: fixed various resize issues. So now forms can be
7964 resized savely or not be resized at all.
7966 * forms/form_url.fd +
7967 * src/insets/form_url.[Ch]: added because it's cleaner and easier
7970 * src/insets/Makefile.am: added files form_url.[Ch]
7972 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7974 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
7975 (and presumably 6.2).
7977 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
7978 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
7979 remaining static member callbacks.
7981 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
7984 * src/support/lyxstring.h: declare struct Srep as friend of
7985 lyxstring, since DEC cxx complains otherwise.
7987 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7989 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7991 * src/LaTeX.C (run): made run_bibtex also depend on files with
7993 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
7994 are put into the dependency file.
7996 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
7997 the code has shown itself to work
7998 (create_ispell_pipe): removed another warning, added a comment
8001 * src/minibuffer.C (ExecutingCB): removed code that has been
8002 commented out a long time
8004 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8005 out code + a warning.
8007 * src/support/lyxstring.h: comment out the three private
8008 operators, when compiling with string ansi conforming compilers
8011 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8013 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8014 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8017 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8020 * src/mathed/math_panel.C (create_math_panel): remove explicit
8023 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8026 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8027 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8028 to XCreatePixmapFromBitmapData
8029 (fl_set_bmtable_data): change the last argument to be unsigned
8031 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8032 and bh to be unsigned int, remove explicit casts in call to
8033 XReadBitmapFileData.
8035 * images/arrows.xbm: made the arrays unsigned char *
8036 * images/varsz.xbm: ditto
8037 * images/misc.xbm: ditto
8038 * images/greek.xbm: ditto
8039 * images/dots.xbm: ditto
8040 * images/brel.xbm: ditto
8041 * images/bop.xbm: ditto
8043 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8045 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8046 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8047 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8049 (LYX_CXX_CHEADERS): added <clocale> to the test.
8051 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8053 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8055 * src/support/lyxstring.C (append): fixed something that must be a
8056 bug, rep->assign was used instead of rep->append.
8058 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8061 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8062 lyx insert double chars. Fix spotted by Kayvan.
8064 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8066 * Fixed the tth support. I messed up with the Emacs patch apply feature
8067 and omitted the changes in lyxrc.C.
8069 1999-10-22 Juergen Vigna <jug@sad.it>
8071 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8073 * src/lyx_cb.C (MenuInsertRef) +
8074 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8075 the form cannot be resized under it limits (fixes a segfault)
8077 * src/lyx.C (create_form_form_ref) +
8078 * forms/lyx.fd: Changed Gravity on name input field so that it is
8081 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8083 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8084 <ostream> and <istream>.
8086 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8087 whether <fstream> provides the latest standard features, or if we
8088 have an oldstyle library (like in egcs).
8089 (LYX_CXX_STL_STRING): fix the test.
8091 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8092 code on MODERN_STL_STREAM.
8094 * src/support/lyxstring.h: use L{I,O}stream.h.
8096 * src/support/L{I,O}stream.h: new files, designed to setup
8097 correctly streams for our use
8098 - includes the right header depending on STL capabilities
8099 - puts std::ostream and std::endl (for LOStream.h) or
8100 std::istream (LIStream.h) in toplevel namespace.
8102 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8104 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8105 was a bib file that had been changed we ensure that bibtex is run.
8106 (runBibTeX): enhanced to extract the names of the bib files and
8107 getting their absolute path and enter them into the dep file.
8108 (findtexfile): static func that is used to look for tex-files,
8109 checks for absolute patchs and tries also with kpsewhich.
8110 Alternative ways of finding the correct files are wanted. Will
8112 (do_popen): function that runs a command using popen and returns
8113 the whole output of that command in a string. Should be moved to
8116 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8117 file with extension ext has changed.
8119 * src/insets/figinset.C: added ifdef guards around the fl_free
8120 code that jug commented out. Now it is commented out when
8121 compiling with XForms == 0.89.
8123 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8124 to lyxstring.C, and only keep a forward declaration in
8125 lyxstring.h. Simplifies the header file a bit and should help a
8126 bit on compile time too. Also changes to Srep will not mandate a
8127 recompile of code just using string.
8128 (~lyxstring): definition moved here since it uses srep.
8129 (size): definition moved here since it uses srep.
8131 * src/support/lyxstring.h: removed a couple of "inline" that should
8134 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8136 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8139 1999-10-21 Juergen Vigna <jug@sad.it>
8141 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8142 set to left if I just remove the width entry (or it is empty).
8144 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8145 paragraph when having dummy paragraphs.
8147 1999-10-20 Juergen Vigna <jug@sad.it>
8149 * src/insets/figinset.C: just commented some fl_free_form calls
8150 and added warnings so that this calls should be activated later
8151 again. This avoids for now a segfault, but we have a memory leak!
8153 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8154 'const char * argument' to 'string argument', this should
8155 fix some Asserts() in lyxstring.C.
8157 * src/lyxfunc.h: Removed the function argAsString(const char *)
8158 as it is not used anymore.
8160 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8162 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8165 * src/Literate.h: some funcs moved from public to private to make
8166 interface clearer. Unneeded args removed.
8168 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8170 (scanBuildLogFile): ditto
8172 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8173 normal TeX Error. Still room for improvement.
8175 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8177 * src/buffer.C (insertErrors): changes to make the error
8178 desctription show properly.
8180 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8183 * src/support/lyxstring.C (helper): changed to use
8184 sizeof(object->rep->ref).
8185 (operator>>): changed to use a pointer instead.
8187 * src/support/lyxstring.h: changed const reference & to value_type
8188 const & lets see if that helps.
8190 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8192 * Makefile.am (rpmdist): fixed to have non static package and
8195 * src/support/lyxstring.C: removed the compilation guards
8197 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8200 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8201 conditional compile of lyxstring.Ch
8203 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8204 stupid check, but it is a lot better than the bastring hack.
8205 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8207 * several files: changed string::erase into string::clear. Not
8210 * src/chset.C (encodeString): use a char temporary instead
8212 * src/table.C (TexEndOfCell): added tostr around
8213 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8214 (TexEndOfCell): ditto
8215 (TexEndOfCell): ditto
8216 (TexEndOfCell): ditto
8217 (DocBookEndOfCell): ditto
8218 (DocBookEndOfCell): ditto
8219 (DocBookEndOfCell): ditto
8220 (DocBookEndOfCell): ditto
8222 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8224 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8226 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8227 (MenuBuildProg): added tostr around ret
8228 (MenuRunChktex): added tostr around ret
8229 (DocumentApplyCB): added tostr around ret
8231 * src/chset.C (encodeString): added tostr around t->ic
8233 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8234 (makeLaTeXFile): added tostr around tocdepth
8235 (makeLaTeXFile): added tostr around ftcound - 1
8237 * src/insets/insetbib.C (setCounter): added tostr around counter.
8239 * src/support/lyxstring.h: added an operator+=(int) to catch more
8242 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8243 (lyxstring): We DON'T allow NULL pointers.
8245 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8247 * src/mathed/math_macro.C (MathMacroArgument::Write,
8248 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8249 when writing them out.
8251 * src/LString.C: remove, since it is not used anymore.
8253 * src/support/lyxstring.C: condition the content to
8254 USE_INCLUDED_STRING macro.
8256 * src/mathed/math_symbols.C, src/support/lstrings.C,
8257 src/support/lyxstring.C: add `using' directive to specify what
8258 we need in <algorithm>. I do not think that we need to
8259 conditionalize this, but any thought is appreciated.
8261 * many files: change all callback functions to "C" linkage
8262 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8263 strict_ansi. Those who were static are now global.
8264 The case of callbacks which are static class members is
8265 trickier, since we have to make C wrappers around them (see
8266 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8267 did not finish this yet, since it defeats the purpose of
8268 encapsulation, and I am not sure what the best route is.
8270 1999-10-19 Juergen Vigna <jug@sad.it>
8272 * src/support/lyxstring.C (lyxstring): we permit to have a null
8273 pointer as assignment value and just don't assign it.
8275 * src/vspace.C (nextToken): corrected this function substituting
8276 find_first(_not)_of with find_last_of.
8278 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8279 (TableOptCloseCB) (TableSpeCloseCB):
8280 inserted fl_set_focus call for problem with fl_hide_form() in
8283 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8285 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8288 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8290 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8291 LyXLex::next() and not eatline() to get its argument.
8293 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8295 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8296 instead, use fstreams for io of the depfile, removed unneeded
8297 functions and variables.
8299 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8300 vector instead, removed all functions and variables that is not in
8303 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8305 * src/buffer.C (insertErrors): use new interface to TeXError
8307 * Makefile.am (rpmdist): added a rpmdist target
8309 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8310 per Kayvan's instructions.
8312 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8314 * src/Makefile.am: add a definition for localedir, so that locales
8315 are found after installation (Kayvan)
8317 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8319 * development/.cvsignore: new file.
8321 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8323 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8324 C++ compiler provides wrappers for C headers and use our alternate
8327 * configure.in: use LYX_CXX_CHEADERS.
8329 * src/cheader/: new directory, populated with cname headers from
8330 libstdc++-2.8.1. They are a bit old, but probably good enough for
8331 what we want (support compilers who lack them).
8333 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8334 from includes. It turns out is was stupid.
8336 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8338 * lib/Makefile.am (install-data-local): forgot a ';'
8339 (install-data-local): forgot a '\'
8340 (libinstalldirs): needed after all. reintroduced.
8342 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8344 * configure.in (AC_OUTPUT): added lyx.spec
8346 * development/lyx.spec: removed file
8348 * development/lyx.spec.in: new file
8350 * po/*.po: merged with lyx.pot becuase of make distcheck
8352 * lib/Makefile.am (dist-hook): added dist-hook so that
8353 documentation files will be included when doing a make
8354 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8355 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8357 more: tried to make install do the right thing, exclude CVS dirs
8360 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8361 Path would fit in more nicely.
8363 * all files that used to use pathstack: uses now Path instead.
8364 This change was a lot easier than expected.
8366 * src/support/path.h: new file
8368 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8370 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8372 * src/support/lyxstring.C (getline): Default arg was given for
8375 * Configure.cmd: removed file
8377 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8379 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8380 streams classes and types, add the proper 'using' statements when
8381 MODERN_STL is defined.
8383 * src/debug.h: move the << operator definition after the inclusion
8386 * src/support/filetools.C: include "LAssert.h", which is needed
8389 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8392 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8393 include "debug.h" to define a proper ostream.
8395 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8397 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8398 method to the SystemCall class which can kill a process, but it's
8399 not fully implemented yet.
8401 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8403 * src/support/FileInfo.h: Better documentation
8405 * src/lyxfunc.C: Added support for buffer-export html
8407 * src/menus.C: Added Export->As HTML...
8409 * lib/bind/*.bind: Added short-cut for buffer-export html
8411 * src/lyxrc.*: Added support for new \tth_command
8413 * lib/lyxrc.example: Added stuff for new \tth_command
8415 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8417 * lib/Makefile.am (IMAGES): removed images/README
8418 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8419 installes in correct place. Check permisions is installed
8422 * src/LaTeX.C: some no-op changes moved declaration of some
8425 * src/LaTeX.h (LATEX_H): changed include guard name
8427 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8429 * lib/reLyX/Makefile.am: install noweb2lyx.
8431 * lib/Makefile.am: install configure.
8433 * lib/reLyX/configure.in: declare a config aux dir; set package
8434 name to lyx (not sure what the best solution is); generate noweb2lyx.
8436 * lib/layouts/egs.layout: fix the bibliography layout.
8438 1999-10-08 Jürgen Vigna <jug@sad.it>
8440 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8441 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8442 it returned without continuing to search the path.
8444 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8446 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8447 also fixes a bug. It is not allowed to do tricks with std::strings
8448 like: string a("hei"); &a[e]; this will not give what you
8449 think... Any reason for the complexity in this func?
8451 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8453 * Updated README and INSTALL a bit, mostly to check that my
8454 CVS rights are correctly set up.
8456 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8458 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8459 does not allow '\0' chars but lyxstring and std::string does.
8461 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8463 * autogen.sh (AUTOCONF): let the autogen script create the
8464 POTFILES.in file too. POTFILES.in should perhaps now not be
8465 included in the cvs module.
8467 * some more files changed to use C++ includes instead of C ones.
8469 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8471 (Reread): added tostr to nlink. buggy output otherwise.
8472 (Reread): added a string() around szMode when assigning to Buffer,
8473 without this I got a log of garbled info strings.
8475 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8478 * I have added several ostream & operator<<(ostream &, some_type)
8479 functions. This has been done to avoid casting and warnings when
8480 outputting enums to lyxerr. This as thus eliminated a lot of
8481 explicit casts and has made the code clearer. Among the enums
8482 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8483 mathed enums, some font enum the Debug::type enum.
8485 * src/support/lyxstring.h (clear): missing method. equivalent of
8488 * all files that contained "stderr": rewrote constructs that used
8489 stderr to use lyxerr instead. (except bmtable)
8491 * src/support/DebugStream.h (level): and the passed t with
8492 Debug::ANY to avoid spurious bits set.
8494 * src/debug.h (Debug::type value): made it accept strings of the
8497 * configure.in (Check for programs): Added a check for kpsewhich,
8498 the latex generation will use this later to better the dicovery of
8501 * src/BufferView.C (create_view): we don't need to cast this to
8502 (void*) that is done automatically.
8503 (WorkAreaButtonPress): removed some dead code.
8505 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8507 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8508 is not overwritten when translated (David Sua'rez de Lis).
8510 * lib/CREDITS: Added David Sua'rez de Lis
8512 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8514 * src/bufferparams.C (BufferParams): default input encoding is now
8517 * acinclude.m4 (cross_compiling): comment out macro
8518 LYX_GXX_STRENGTH_REDUCE.
8520 * acconfig.h: make sure that const is not defined (to empty) when
8521 we are compiling C++. Remove commented out code using SIZEOF_xx
8524 * configure.in : move the test for const and inline as late as
8525 possible so that these C tests do not interefere with C++ ones.
8526 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8527 has not been proven.
8529 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8531 * src/table.C (getDocBookAlign): remove bad default value for
8534 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8536 (ShowFileMenu2): ditto.
8538 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8541 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8543 * Most files: finished the change from the old error code to use
8544 DebugStream for all lyxerr debugging. Only minor changes remain
8545 (e.g. the setting of debug levels using strings instead of number)
8547 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8549 * src/layout.C (Add): Changed to use compare_no_case instead of
8552 * src/FontInfo.C: changed loop variable type too string::size_type.
8554 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8556 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8557 set ETAGS_ARGS to --c++
8559 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8561 * src/table.C (DocBookEndOfCell): commented out two unused variables
8563 * src/paragraph.C: commented out four unused variables.
8565 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8566 insed a if clause with type string::size_type.
8568 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8571 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8573 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8574 variable, also changed loop to go from 0 to lenght + 1, instead of
8575 -1 to length. This should be correct.
8577 * src/LaTeX.C (scanError): use string::size_type as loop variable
8580 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8581 (l.896) since y_tmp and row was not used anyway.
8583 * src/insets/insetref.C (escape): use string::size_type as loop
8586 * src/insets/insetquotes.C (Width): use string::size_type as loop
8588 (Draw): use string::size_type as loop variable type.
8590 * src/insets/insetlatexaccent.C (checkContents): use
8591 string::size_type as loop variable type.
8593 * src/insets/insetlabel.C (escape): use string::size_type as loop
8596 * src/insets/insetinfo.C: added an extern for current_view.
8598 * src/insets/insetcommand.C (scanCommand): use string::size_type
8599 as loop variable type.
8601 * most files: removed the RCS tags. With them we had to recompile
8602 a lot of files after a simple cvs commit. Also we have never used
8603 them for anything meaningful.
8605 * most files: tags-query-replace NULL 0. As adviced several plases
8606 we now use "0" instead of "NULL" in our code.
8608 * src/support/filetools.C (SpaceLess): use string::size_type as
8611 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8613 * src/paragraph.C: fixed up some more string stuff.
8615 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8617 * src/support/filetools.h: make modestr a std::string.
8619 * src/filetools.C (GetEnv): made ch really const.
8621 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8622 made code that used these use max/min from <algorithm> instead.
8624 * changed several c library include files to their equivalent c++
8625 library include files. All is not changed yet.
8627 * created a support subdir in src, put lyxstring and lstrings
8628 there + the extra files atexit, fileblock, strerror. Created
8629 Makefile.am. edited configure.in and src/Makefile.am to use this
8630 new subdir. More files moved to support.
8632 * imported som of the functions from repository lyx, filetools
8634 * ran tags-query-replace on LString -> string, corrected the bogus
8635 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8636 is still some errors in there. This is errors where too much or
8637 too litle get deleted from strings (string::erase, string::substr,
8638 string::replace), there can also be some off by one errors, or
8639 just plain wrong use of functions from lstrings. Viewing of quotes
8642 * LyX is now running fairly well with string, but there are
8643 certainly some bugs yet (see above) also string is quite different
8644 from LString among others in that it does not allow null pointers
8645 passed in and will abort if it gets any.
8647 * Added the revtex4 files I forgot when setting up the repository.
8649 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8651 * All over: Tried to clean everything up so that only the files
8652 that we really need are included in the cvs repository.
8653 * Switched to use automake.
8654 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8655 * Install has not been checked.
8657 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8659 * po/pt.po: Three errors:
8660 l.533 and l.538 format specification error
8661 l. 402 duplicate entry, I just deleted it.