1 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
3 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
6 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
9 * src/frontends/xforms/FormPreferences.[Ch]:
10 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
11 Reorganised as modules based on tabs. Much easier to follow the
12 flow and to add new tabs. Added warning and feedback messages.
15 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
17 * src/tabular.h (DocBook): add std:: qualifier.
19 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
21 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
22 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
25 * insettabular.C (DocBook): uses the tabular methods to export
28 * src/insets/insettext.h
29 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
31 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
33 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
36 * src/lyxfunc.C (MenuNew): lessen the scope of fname
37 moved misplaced AllowInput two lines up.
39 * src/buffer.C (readFile): compare float with float, not with int
41 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
43 * src/minibuffer.C: add "using SigC::slot" statement.
45 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
47 * src/frontends/xforms/forms/README: updated section about make.
49 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
50 Tidied some forms up, made two of form_tabular's tabs more
51 self-consistent, fixed Jean-Marc's size problem in form_preferences,
52 fixed translation problem with "Column".
54 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
56 * src/minibuffer.h: use Timeout instead of the xforms timer
58 (setTimer) rewrite for the Timeout, change to unsigned arg
59 (set): change to unsigned timer arg
62 * src/minibuffer.C (TimerCB): removed func
63 (C_MiniBuffer_TimerCB): removed func
64 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
65 (peek_event): use a switch statement
66 (add): don't use fl_add_timer.
67 (Set): rewrite to use the Timeout
70 * src/Timeout.[Ch] (setType): return a Timeout &
71 (setTimeout): ditto, change to unsigned arg for timeout
73 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
75 * src/mathed/formula.C (mathed_string_width): Use string instead
76 of a constant size char array.
78 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
80 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
81 the two recently added operator<< for SMInput and State.
83 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
85 (OkCancelPolicy): ditto
86 (OkCancelReadOnlyPolicy): ditto
87 (NoRepeatedApplyReadOnlyPolicy): ditto
88 (OkApplyCancelReadOnlyPolicy): ditto
89 (OkApplyCancelPolicy): ditto
90 (NoRepeatedApplyPolicy): ditto
92 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
94 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
95 add the usual std:: qualifiers.
97 2000-10-25 Juergen Vigna <jug@sad.it>
99 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
101 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
103 * src/support/filetools.C (MakeRelPath): change some types to
106 * src/frontends/ButtonPolicies.h (operator<<): new operator for
107 ButtonPolicy::SMInput and ButtonPolicy::State.
109 * src/FontLoader.C (reset): small cleanup
110 (unload): small cleanup
112 * src/FontInfo.C (getFontname): initialize error to 10000.0
114 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
116 * src/frontends/xforms/FormPreferences.[Ch]:
117 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
118 TeX encoding and default paper size sections.
120 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
122 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
125 * src/frontends/xforms/FormError.C (disconnect): use erase() to
126 make the message_ empty.
127 (FormError): don't initialize message_ in initializer list.
129 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
131 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
133 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
135 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
137 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
139 * src/frontends/kde/*data.[Ch]: _("") is not
142 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
144 * src/buffer.C: removed redundant using directive.
146 * src/frontends/DialogBase.h: revert to original definition of
149 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
150 stuff into two classes, one for each dialog, requires a new
151 element in the dialogs vector, FormTabularCreate.
153 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
156 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
157 method. Continues Allan's idea, but means that derived classes
158 don't need to worry about "update or hide?".
160 * src/frontends/xforms/FormError.C (showInset): add connection
163 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
164 one for each dialog. FormTabular now contains main tabular dialog
167 * src/frontends/xforms/FormTabularCreate.[Ch]:
168 * src/frontends/xforms/forms/form_tabular_create.fd: the create
171 * src/frontends/xforms/FormGraphics.[Ch]:
172 * src/frontends/xforms/forms/form_graphics.fd
173 * src/frontends/xforms/FormTabular.[Ch]:
174 * src/frontends/xforms/forms/form_tabular.fd: made daughter
175 classes of FormInset.
177 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
178 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
180 * src/frontends/xforms/Makefile.am:
181 * src/frontends/xforms/forms/makefile: added new files.
183 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
184 variable. added Signal0 hide signal, in keeping with other GUI-I
187 * src/support/lstrings.h: removed redundant std:: qualifier as
188 it's already declared in Lsstream.h.
190 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
192 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
196 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
198 * src/tabular.C (Ascii): minimize scope of cell.
200 * src/BufferView2.C (nextWord): return string() instead of 0;
202 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
204 * src/converter.h: add a std:: qualifier
206 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
208 * src/importer.[Ch]: New files. Used for importing files into LyX.
210 * src/lyxfunc.C (doImport): Use the new Importer class.
212 * src/converter.h: Add shortcut member to the Format class.
213 Used for holding the menu shortcut.
215 * src/converter.C and other files: Made a distinction between
216 format name and format extension. New formats can be defined using
217 the \format lyxrc tag.
218 Added two new converter flags: latex and disable.
220 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
222 * src/support/lyxlib.h: unify namespace/struct implementation.
223 Remove extra declarations.
225 * src/support/chdir.C (chdir): remove version taking char const *
227 * src/support/rename.C: ditto.
228 * src/support/lyxsum.C: ditto.
230 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
232 * src/frontends/xforms/FormBase.[Ch]:
233 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
234 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
235 work only for the next call to fl_show_form(). The correct place to set
236 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
237 done. FormBase also stores minw_, minh_ itself. All dialogs derived
238 from FormBase have the minimum size set; no more stupid crashes with
241 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
243 * lib/ui/default.ui: fix shortcut for Insert->Include File.
245 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
247 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
249 * src/support/lyxlib.h: changed second argument of mkdir to
250 unsigned long int (unsigned int would probably have been enough,
251 but...). Removed <sys/types.h> header.
252 * src/support/mkdir.C (mkdir): ditto.
256 2000-10-19 Juergen Vigna <jug@sad.it>
258 * src/lyxfunc.C (MenuNew): small fix (form John)
260 * src/screen.C (Update): removed unneeded code.
262 * src/tabular.C (Ascii): refixed int != uint bug!
264 * src/support/lyxlib.h: added sys/types.h include for now permits
265 compiling, but I don't like this!
267 2000-10-18 Juergen Vigna <jug@sad.it>
269 * src/text2.C (ClearSelection): if we clear the selection we need
270 more refresh so set the status apropriately
272 * src/insets/insettext.C (draw): hopefully finally fixed draw
275 2000-10-12 Juergen Vigna <jug@sad.it>
277 * src/insets/insettext.C (draw): another small fix and make a block
278 so that variables are localized.
280 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
282 * src/support/lstrings.C (lowercase, uppercase):
283 use explicit casts to remove compiler warnings.
285 * src/support/LRegex.C (Impl):
286 * src/support/StrPool.C (add):
287 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
288 (AddPath, MakeDisplayPath):
289 * src/support/lstrings.C (prefixIs, subst):
290 use correct type to remove compiler warnings.
292 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
294 * src/support/lyxlib.h:
295 * src/support/mkdir.C (mkdir): change parameter to mode_t for
296 portability and to remove compiler warning with DEC cxx.
298 * src/support/FileInfo.[Ch] (flagRWX): ditto.
300 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
302 * src/minibuffer.C (peek_event): retun 1 when there has been a
303 mouseclick in the minibuffer.
307 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
309 * src/frontends/xforms/FormParagraph.C: more space above/below
312 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
314 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
315 a char only if real_current_font was changed.
317 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
319 * NEWS: update somewhat for 1.1.6
321 * lib/ui/default.ui: clean up.
323 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
325 * lib/CREDITS: clean up
327 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
329 * src/combox.[Ch] (select): changed argument back to int
330 * src/combox.C (peek_event): removed num_bytes as it is declared but
333 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
334 modified calls to Combox::select() to remove warnings about type
337 * src/insets/insetbutton.C (width): explicit cast to remove warning
338 about type conversion.
340 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
343 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
344 sel_pos_end, refering to cursor position are changed to
345 LyXParagraph::size_type.
347 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
348 consistent with LyXCursor::pos().
349 (inset_pos): changed to LyXParagraph::size_type for same reason.
351 * src/insets/insettext.C (resizeLyXText): changed some temporary
352 variables refing to cursor position to LyXParagraph::size_type.
354 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
356 * src/frontends/kde/<various>: The Great Renaming,
359 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
361 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
363 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
365 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
366 0 when there are no arguments.
368 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
370 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
371 to segfaults when pressing Ok in InsetBibtex dialog.
373 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
375 * forms/layout_forms.fd:
376 * src/layout_forms.C (create_form_form_character): small change to use
377 labelframe rather than engraved frame + text
379 * src/lyx_gui.C (create_forms): initialise choice_language with some
380 arbitrary value to prevent segfault when dialog is shown.
382 2000-10-16 Baruch Even <baruch.even@writeme.com>
384 * src/converter.C (runLaTeX, scanLog): Added a warning when there
385 is no resulting file. This pertains only to LaTeX output.
387 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
389 * src/text.C (Backspace): Make sure that the row of the cursor is
392 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
395 * src/lyx_gui.C (init): Prevent a crash when only one font from
396 menu/popup fonts is not found.
398 * lib/lyxrc.example: Add an example for binding a key for language
401 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
403 * src/converter.C (GetReachable): Changed the returned type to
405 (IsReachable): New method
407 * src/MenuBackend.C (expand): Handle formats that appear more
410 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
412 * src/frontends/support/Makefile.am
413 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
416 * lib/CREDITS: add Garst Reese.
418 * src/support/snprintf.h: add extern "C" {} around the definitions.
420 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
422 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
425 * src/frontends/xforms/FormDocument.C:
426 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
427 compile without "conversion to integral type of smaller size"
430 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
432 * src/text.C (GetColumnNearX): Fixed disabled code.
434 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
436 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
439 * src/support/snprintf.[ch]: new files
441 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
443 * src/frontends/kde/formprintdialog.C: add
444 file browser for selecting postscript output
446 * src/frontends/kde/formprintdialogdata.C:
447 * src/frontends/kde/formprintdialogdata.h: re-generate
450 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
452 * src/frontends/gnome/Makefile.am:
453 * src/frontends/kde/Makefile.am: FormCommand.C
454 disappeared from xforms
456 * src/frontends/kde/FormCitation.C:
457 * src/frontends/kde/FormIndex.C: read-only
460 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
462 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
465 * src/bufferlist.C: add using directive.
467 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
469 * src/support/lyxfunctional.h: version of class_fun for void
470 returns added, const versions of back_inseter_fun and compare_fun
473 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
475 * src/frontends/xforms/FormInset.C (showInset): fix typo.
477 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
479 * ChangeLog: cleanup.
481 * lib/CREDITS: update to add all the contributors we've forgotten.
482 I have obviously missed some, so tell me whether there were
485 2000-10-13 Marko Vendelin <markov@ioc.ee>
487 * src/frontends/gnome/FormCitation.C
488 * src/frontends/gnome/FormCitation.h
489 * src/frontends/gnome/FormError.C
490 * src/frontends/gnome/FormIndex.C
491 * src/frontends/gnome/FormRef.C
492 * src/frontends/gnome/FormRef.h
493 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
495 * src/frontends/gnome/FormCitation.C
496 * src/frontends/gnome/FormCopyright.C
497 * src/frontends/gnome/FormError.C
498 * src/frontends/gnome/FormIndex.C
499 * src/frontends/gnome/FormRef.C
500 * src/frontends/gnome/FormToc.C
501 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
504 * src/frontends/gnome/Menubar_pimpl.C
505 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
508 2000-10-11 Baruch Even <baruch.even@writeme.com>
511 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
512 to convey its real action.
514 * src/minibuffer.C (peek_event): Added action when mouse clicks to
515 clear the minibuffer and prepare to enter a command.
517 * src/mathed/formula.C (LocalDispatch): Changed to conform with
518 the rename from ExecCommand to PrepareForCommand.
519 * src/lyxfunc.C (Dispatch): ditto.
521 2000-10-11 Baruch Even <baruch.even@writeme.com>
523 * src/buffer.C (writeFile): Added test for errors on writing, this
524 catches all errors and not only file system full errors as intended.
526 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
528 * src/lyx_gui.C (create_forms): better fix for crash with
529 translated interface.
531 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
533 * src/frontends/kde/Makefile.am:
534 * src/frontends/kde/FormCopyright.C:
535 * src/frontends/kde/formcopyrightdialog.C:
536 * src/frontends/kde/formcopyrightdialog.h:
537 * src/frontends/kde/formcopyrightdialogdata.C:
538 * src/frontends/kde/formcopyrightdialogdata.h:
539 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
540 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
541 copyright to use qtarch
543 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
545 * src/encoding.C (read): Fixed bug that caused an error message at
548 * po/Makefile.in.in: Fixed rule for ext_l10n.h
550 * lib/lyxrc.example: Fixed hebrew example.
552 2000-10-13 Allan Rae <rae@lyx.org>
554 * src/frontends/xforms/FormPreferences.C (input): reworking the
556 (build, update, apply): New inputs in various tabfolders
558 * src/frontends/xforms/FormToc.C: use new button policy.
559 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
560 dialogs that either can't use any existing policy or where it just
563 * src/frontends/xforms/FormTabular.h: removed copyright notice that
566 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
567 added a bool parameter which is ignored.
569 * src/buffer.C (setReadonly):
570 * src/BufferView_pimpl.C (buffer):
571 * src/frontends/kde/FormCopyright.h (update):
572 * src/frontends/kde/FormCitation.[Ch] (update):
573 * src/frontends/kde/FormIndex.[Ch] (update):
574 * src/frontends/kde/FormPrint.[Ch] (update):
575 * src/frontends/kde/FormRef.[Ch] (update):
576 * src/frontends/kde/FormToc.[Ch] (update):
577 * src/frontends/kde/FormUrl.[Ch] (update):
578 * src/frontends/gnome/FormCopyright.h (update):
579 * src/frontends/gnome/FormCitation.[Ch] (update):
580 * src/frontends/gnome/FormError.[Ch] (update):
581 * src/frontends/gnome/FormIndex.[Ch] (update):
582 * src/frontends/gnome/FormPrint.[Ch] (update):
583 * src/frontends/gnome/FormRef.h (update):
584 * src/frontends/gnome/FormToc.[Ch] (update):
585 * src/frontends/gnome/FormUrl.[Ch] (update):
586 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
587 to updateBufferDependent and DialogBase
589 * src/frontends/xforms/FormCitation.[hC]:
590 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
591 * src/frontends/xforms/FormError.[Ch]:
592 * src/frontends/xforms/FormGraphics.[Ch]:
593 * src/frontends/xforms/FormIndex.[Ch]:
594 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
595 and fixed readOnly handling.
596 * src/frontends/xforms/FormPrint.[Ch]:
597 * src/frontends/xforms/FormRef.[Ch]:
598 * src/frontends/xforms/FormTabular.[Ch]:
599 * src/frontends/xforms/FormToc.[Ch]:
600 * src/frontends/xforms/FormUrl.[Ch]:
601 * src/frontends/xforms/FormInset.[Ch]:
602 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
603 form of updateBufferDependent.
605 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
606 if form()->visible just in case someone does stuff to the form in a
609 * src/frontends/DialogBase.h (enum): removed enum since we can now use
610 the buttoncontroller for everything the enum used to be used for.
611 (update) It would seem we need to force all dialogs to use a bool
612 parameter or have two update functions. I chose to go with one.
613 I did try removing update() from here and FormBase and defining the
614 appropriate update signatures in FormBaseB[DI] but then ran into the
615 problem of the update() call in FormBase::show(). Whatever I did
616 to get around that would require another function and that just
617 got more confusing. Hence the decision to make everyone have an
618 update(bool). An alternative might have been to override show() in
619 FormBaseB[DI] and that would allow the different and appropriate
622 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
623 true == buffer change occurred. I decided against using a default
624 template parameter since not all compilers support that at present.
626 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
628 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
629 army knife" by removing functionality.
630 (clearStore): removed. All such housekeeping on hide()ing the dialog
631 is to be carried out by overloaded disconnect() methods.
632 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
633 superceded by Baruch's neat test (FormGraphics) to update an existing
634 dialog if a new signal is recieved rather than block all new signals
636 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
637 only to Inset dialogs.
638 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
639 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
641 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
643 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
644 as a base class to all inset dialogs. Used solely to connect/disconnect
645 the Inset::hide signal and to define what action to take on receipt of
646 a UpdateBufferDependent signal.
647 (FormCommand): now derived from FormInset.
649 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
652 * src/frontends/xforms/FormCopyright.[Ch]:
653 * src/frontends/xforms/FormPreferences.[Ch]:
654 now derived from FormBaseBI.
656 * src/frontends/xforms/FormDocument.[Ch]:
657 * src/frontends/xforms/FormParagraph.[Ch]:
658 * src/frontends/xforms/FormPrint.[Ch]:
659 now derived from FormBaseBD.
661 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
663 * src/frontends/xforms/FormCitation.[Ch]:
664 * src/frontends/xforms/FormError.[Ch]:
665 * src/frontends/xforms/FormRef.[Ch]:
666 * src/frontends/xforms/FormToc.[Ch]:
667 (clearStore): reworked as disconnect().
669 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
672 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
674 * src/converter.C (runLaTeX): constify buffer argument
677 * src/frontends/support/Makefile.am (INCLUDES): fix.
679 * src/buffer.h: add std:: qualifier
680 * src/insets/figinset.C (addpidwait): ditto
681 * src/MenuBackend.C: ditto
682 * src/buffer.C: ditto
683 * src/bufferlist.C: ditto
684 * src/layout.C: ditto
685 * src/lyxfunc.C: ditto
687 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
689 * src/lyxtext.h (bidi_level): change return type to
690 LyXParagraph::size_type.
692 * src/lyxparagraph.h: change size_type to
693 TextContainer::difference_type. This should really be
694 TextContainer::size_type, but we need currently to support signed
697 2000-10-11 Marko Vendelin <markov@ioc.ee>
698 * src/frontends/gnome/FormError.h
699 * src/frontends/gnome/FormRef.C
700 * src/frontends/gnome/FormRef.h
701 * src/frontends/gnome/FormError.C
702 * src/frontends/gnome/Makefile.am
703 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
704 to Gnome frontend. Both dialogs use "action" area.
706 2000-10-12 Baruch Even <baruch.even@writeme.com>
708 * src/graphics/GraphicsCacheItem_pimpl.C:
709 * src/graphics/Renderer.C:
710 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
713 2000-10-12 Juergen Vigna <jug@sad.it>
715 * src/insets/insettext.C (draw): fixed drawing bug (specifically
716 visible when selecting).
718 * development/Code_rules/Rules: fixed some typos.
720 2000-10-09 Baruch Even <baruch.even@writeme.com>
722 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
723 compiling on egcs 1.1.2 possible.
725 * src/filedlg.C (comp_direntry::operator() ): ditto.
727 2000-08-31 Baruch Even <baruch.even@writeme.com>
729 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
732 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
733 transient it now only gets freed when the object is destructed.
735 2000-08-24 Baruch Even <baruch.even@writeme.com>
737 * src/frontends/FormGraphics.h:
738 * src/frontends/FormGraphics.C: Changed to use ButtonController and
741 2000-08-20 Baruch Even <baruch.even@writeme.com>
743 * src/insets/insetgraphics.C:
744 (draw): Added messages to the drawn rectangle to report status.
745 (updateInset): Disabled the use of the inline graphics,
748 2000-08-17 Baruch Even <baruch.even@writeme.com>
750 * src/frontends/support: Directory added for the support of GUII LyX.
752 * src/frontends/support/LyXImage.h:
753 * src/frontends/support/LyXImage.C: Base class for GUII holding of
756 * src/frontends/support/LyXImage_X.h:
757 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
758 version of LyXImage, this uses the Xlib Pixmap.
763 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
764 replacement to Pixmap.
766 * src/insets/insetgraphics.h:
767 * src/insets/insetgraphics.C:
768 * src/graphics/GraphicsCacheItem.h:
769 * src/graphics/GraphicsCacheItem.C:
770 * src/graphics/GraphicsCacheItem_pimpl.h:
771 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
774 * src/graphics/GraphicsCacheItem.h:
775 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
776 another copy of the object.
778 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
779 of cacheHandle, this fixed a bug that sent LyX crashing.
781 * src/graphics/XPM_Renderer.h:
782 * src/graphics/XPM_Renderer.C:
783 * src/graphics/EPS_Renderer.h:
784 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
786 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
788 * src/lyxfunc.C (processKeySym): only handle the
789 lockinginset/inset stuff if we have a buffer and text loaded...
791 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
793 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
795 * src/support/lyxfunctional.h: add operator= that takes a reference
797 * src/lyxserver.C (mkfifo): make first arg const
799 * src/layout.h: renamed name(...) to setName(...) to work around
802 * src/buffer.C (setFileName): had to change name of function to
803 work around bugs in egcs. (renamed from fileName)
805 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
807 * src/support/translator.h: move helper template classes to
808 lyxfunctional.h, include "support/lyxfunctional.h"
810 * src/support/lyxmanip.h: add delaration of fmt
812 * src/support/lyxfunctional.h: new file
813 (class_fun_t): new template class
814 (class_fun): helper template function
815 (back_insert_fun_iterator): new template class
816 (back_inserter_fun): helper template function
817 (compare_memfun_t): new template class
818 (compare_memfun): helper template function
819 (equal_1st_in_pair): moved here from translator
820 (equal_2nd_in_pair): moved here from translator
822 * src/support/fmt.C: new file
823 (fmt): new func, can be used for a printf substitute when still
824 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
826 * src/support/StrPool.C: add some comments
828 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
831 * src/insets/figinset.C (addpidwait): use std::copy with
832 ostream_iterator to fill the pidwaitlist
834 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
836 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
839 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
842 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
844 * src/frontends/xforms/FormDocument.C (build): remove c_str()
845 (class_update): ditto
847 (CheckChoiceClass): move initialization of tc and tct
849 * src/tabular.C: remove current_view
850 (OldFormatRead): similar to right below [istream::ignore]
852 * src/lyxlex_pimpl.C (next): add code for faster skipping of
853 chars, unfortunately this is buggy on gcc 2.95.2, so currently
854 unused [istream::ignore]
856 * src/lyxfunc.C: include "support/lyxfunctional.h"
857 (getInsetByCode): use std::find_if and compare_memfun
859 * src/lyxfont.C (stateText): remove c_str()
861 * src/lyx_main.C (setDebuggingLevel): make static
862 (commandLineHelp): make static
864 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
865 Screen* together with fl_get_display() and fl_screen
867 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
868 togheter with fl_get_display() and fl_screen
869 (create_forms): remove c_str()
871 * src/layout.C: include "support/lyxfunctional.h"
872 (hasLayout): use std::find_if and compare_memfun
873 (GetLayout): use std::find_if and comapre_memfun
874 (delete_layout): use std::remove_if and compare_memfun
875 (NumberOfClass): use std:.find_if and compare_memfun
877 * src/gettext.h: change for the new functions
879 * src/gettext.C: new file, make _(char const * str) and _(string
880 const & str) real functions.
882 * src/font.C (width): rewrite slightly to avoid one extra variable
884 * src/debug.C: initialize Debug::ANY here
886 * src/commandtags.h: update number comments
888 * src/combox.h (get): make const func
890 (getline): make const
892 * src/combox.C (input_cb): handle case where fl_get_input can
895 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
896 "support/lyxfunctional.h", remove current_view variable.
897 (resize): use std::for_each with std::mem_fun
898 (getFileNames): use std::copy with back_inserter_fun
899 (getBuffer): change arg type to unsigned int
900 (emergencyWriteAll): call emergencyWrite with std::for_each and
902 (emergencyWrite): new method, the for loop in emergencyWriteAll
904 (exists): use std::find_if with compare_memfun
905 (getBuffer): use std::find_if and compare_memfun
907 * src/buffer.h: add typedefs for iterator_category, value_type
908 difference_type, pointer and reference for inset_iterator
909 add postfix ++ for inset_iterator
910 make inset_iterator::getPos() const
912 * src/buffer.C: added support/lyxmanip.h
913 (readFile): use lyxerr << fmt instead of printf
914 (makeLaTeXFile): use std::copy to write out encodings
916 * src/Painter.C (text): rewrite slightly to avoid extra font variable
918 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
919 free and the char * temp.
920 (hasMenu): use std::find_if and compare_memfun
923 * src/Makefile.am (lyx_SOURCES): added gettext.C
925 * src/LyXAction.C (retrieveActionArg): clear the arg, use
926 string::insert small change to avoid temporary
928 * src/LColor.C (getGUIName): remove c_str()
930 * several files: change all occurrences of fl_display to
933 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
934 that -pedantic is not used for gcc 2.97 (cvs gcc)
936 * boost/Makefile.am: begin slowly to prepare for a real boost lib
938 2000-10-11 Allan Rae <rae@lyx.org>
940 * src/frontends/xforms/FormPreferences.C (input): template path must be
941 a readable directory. It doesn't need to be writeable.
942 (build, delete, update, apply): New inputs in the various tabfolders
944 * src/frontends/xforms/forms/form_preferences.fd:
945 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
946 several new entries to existing folders. Shuffled some existing stuff
949 * src/frontends/xforms/forms/form_print.fd:
950 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
951 Should probably rework PrinterParams as well. Note that the switch to
952 collated is effectively the same as !unsorted so changing PrinterParams
953 will require a lot of fiddly changes to reverse the existing logic.
955 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
957 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
959 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
961 2000-10-10 Allan Rae <rae@lyx.org>
964 * src/lyxfunc.C (Dispatch):
966 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
969 * src/lyxrc.C (output): Only write the differences between system lyxrc
970 and the users settings.
973 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
975 I'll rewrite this later, after 1.1.6 probably, to keep a single
976 LyXRC but two instances of a LyXRCStruct.
978 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
980 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
982 * src/tabular.h: add a few std:: qualifiers.
984 * src/encoding.C: add using directive.
985 * src/language.C: ditto.
987 * src/insets/insetquotes.C (Validate): use languages->lang()
988 instead of only language.
990 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
992 * lib/languages: New file.
994 * lib/encodings: New file.
996 * src/language.C (Languages): New class.
997 (read): New method. Reads the languages from the 'languages' file.
999 * src/encoding.C (Encodings): New class.
1000 (read): New method. Reads the encodings from the 'encodings' file.
1002 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1005 * src/bufferparams.h and a lot of files: Deleted the member language,
1006 and renamed language_info to language
1008 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1009 * src/lyxfont.C (latexWriteStartChanges): ditto.
1010 * src/paragraph.C (validate,TeXOnePar): ditto.
1012 * src/lyxfont.C (update): Restored deleted code.
1014 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1016 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1018 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1020 * src/insets/figinset.[Ch]:
1021 * src/insets/insetinclude.[Ch]:
1022 * src/insets/insetinclude.[Ch]:
1023 * src/insets/insetparent.[Ch]:
1024 * src/insets/insetref.[Ch]:
1025 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1027 * src/insets/*.[Ch]:
1028 * src/mathed/formula.[Ch]:
1029 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1031 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1032 * src/lyx_cb.C (FigureApplyCB):
1033 * src/lyxfunc.C (getStatus, Dispatch):
1034 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1037 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1039 * src/converter.[Ch] (Formats::View):
1040 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1042 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1043 *current_view->buffer(). This will change later, but this patch is way
1046 2000-10-09 Juergen Vigna <jug@sad.it>
1048 * src/text.C (GetRow): small fix.
1050 * src/BufferView_pimpl.C (cursorPrevious):
1051 (cursorNext): added LyXText parameter to function.
1053 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1054 keypress depending on cursor position.
1056 2000-10-06 Juergen Vigna <jug@sad.it>
1058 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1059 (copySelection): redone this function and also copy ascii representa-
1062 * src/tabular.C (Ascii):
1066 (print_n_chars): new functions to realize the ascii export of tabulars.
1068 2000-10-05 Juergen Vigna <jug@sad.it>
1070 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1071 if we don't have a buffer.
1073 2000-10-10 Allan Rae <rae@lyx.org>
1075 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1076 with closing dialog. It seems that nested tabfolders require hiding
1077 of inner tabfolders before hiding the dialog itself. Actually all I
1078 did was hide the active outer folder.
1080 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1081 unless there really is a buffer. hideBufferDependent is called
1084 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1085 POTFILES.in stays in $(srcdir).
1087 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1089 * lib/lyxrc.example: Few changes.
1091 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1093 * src/BufferView_pimpl.C (buffer): only need one the
1094 updateBufferDependent signal to be emitted once! Moved to the end of
1095 the method to allow bv_->text to be updated first.
1097 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1098 and hSignal_ with Dialogs * and BufferDependency variables.
1099 New Buffer * parent_, initialised when the dialog is launched. Used to
1100 check whether to update() or hide() dialog in the new, private
1101 updateOrHide() method that is connected to the updateBufferDependent
1102 signal. Daughter classes dictate what to do using the
1103 ChangedBufferAction enum, passed to the c-tor.
1105 * src/frontends/xforms/FormCitation.C:
1106 * src/frontends/xforms/FormCommand.C:
1107 * src/frontends/xforms/FormCopyright.C:
1108 * src/frontends/xforms/FormDocument.C:
1109 * src/frontends/xforms/FormError.C:
1110 * src/frontends/xforms/FormIndex.C:
1111 * src/frontends/xforms/FormPreferences.C:
1112 * src/frontends/xforms/FormPrint.C:
1113 * src/frontends/xforms/FormRef.C:
1114 * src/frontends/xforms/FormToc.C:
1115 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1118 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1119 ChangedBufferAction enum.
1121 * src/frontends/xforms/FormParagraph.[Ch]
1122 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1125 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1127 * lib/bind/cua.bind: fix a bit.
1128 * lib/bind/emacs.bind: ditto.
1130 * lib/bind/menus.bind: remove real menu entries from there.
1132 * src/spellchecker.C: make sure we only include strings.h when
1135 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1137 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1138 function. It enlarges the maximum number of pup when needed.
1139 (add_toc2): Open a new menu if maximum number of items per menu has
1142 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1144 * src/frontends/kde/FormPrint.C: fix error reporting
1146 * src/frontends/xforms/FormDocument.C: fix compiler
1149 * lib/.cvsignore: add Literate.nw
1151 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1154 * bufferview_funcs.[Ch]
1157 * text2.C: Add support for numbers in RTL text.
1159 2000-10-06 Allan Rae <rae@lyx.org>
1161 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1162 to be gettext.m4 friendly again. ext_l10n.h is now
1163 generated into $top_srcdir instead of $top_builddir
1164 so that lyx.pot will be built correctly -- without
1165 duplicate parsing of ext_l10n.h.
1167 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1169 * src/frontends/kde/FormCitation.C: make the dialog
1170 behave more sensibly
1172 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1174 * config/kde.m4: fix consecutive ./configure runs,
1175 look for qtarch, fix library order
1177 * src/frontends/kde/Makefile.am: tidy up,
1178 add Print dialog, add .dlg dependencies
1180 * src/frontends/kde/FormPrint.C:
1181 * src/frontends/kde/FormPrint.h:
1182 * src/frontends/kde/formprintdialog.C:
1183 * src/frontends/kde/formprintdialog.h:
1184 * src/frontends/kde/formprintdialogdata.C:
1185 * src/frontends/kde/formprintdialogdata.h:
1186 * src/frontends/kde/dlg/formprintdialog.dlg: add
1189 * src/frontends/kde/dlg/README: Added explanatory readme
1191 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1192 script to double-check qtarch's output
1194 * src/frontends/kde/formindexdialog.C:
1195 * src/frontends/kde/formindexdialogdata.C:
1196 * src/frontends/kde/formindexdialogdata.h:
1197 * src/frontends/kde/dlg/formindexdialog.dlg: update
1198 for qtarch, minor fixes
1200 2000-10-05 Allan Rae <rae@lyx.org>
1202 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1203 dialogs when switching buffers update them instead. It's up to each
1204 dialog to decide if it should still be visible or not.
1205 update() should return a bool to control visiblity within show().
1206 Or perhaps better to set a member variable and use that to control
1209 * lib/build-listerrors: create an empty "listerrors" file just to stop
1210 make trying to regenerate it all the time if you don't have noweb
1213 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1215 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1216 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1217 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1218 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1219 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1221 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1223 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1225 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1226 deleting buffer. Closes all buffer-dependent dialogs.
1228 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1230 * src/frontends/xforms/FormCitation.[Ch]:
1231 * src/frontends/xforms/FormPreferences.[Ch]:
1232 * src/frontends/xforms/FormPrint.[Ch]:
1233 * src/frontends/xforms/FormRef.[Ch]:
1234 * src/frontends/xforms/FormUrl.[Ch]: ditto
1236 * src/frontends/xforms/FormDocument.[Ch]:
1237 * src/frontends/xforms/forms/form_document.C.patch:
1238 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1239 pass through a single input() function.
1241 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1243 * lib/build-listerrors: return status as OK
1245 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1247 * lib/lyxrc.example: Updated to new export code
1249 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1251 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1254 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1257 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1258 LyX-Code is defined.
1259 * lib/layouts/amsbook.layout: ditto.
1261 * boost/Makefile.am: fix typo.
1263 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1265 (add_lastfiles): removed.
1266 (add_documents): removed.
1267 (add_formats): removed.
1269 * src/frontends/Menubar.C: remove useless "using" directive.
1271 * src/MenuBackend.h: add a new MenuItem constructor.
1273 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1276 2000-10-04 Allan Rae <rae@lyx.org>
1278 * lib/Makefile.am (listerrors):
1279 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1280 I haven't got notangle installed so Kayvan please test. The output
1281 should end up in $builddir. This also allows people who don't have
1282 noweb installed to complete the make process without error.
1284 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1285 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1286 by JMarc's picky compiler.
1288 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1291 * src/insets/insettabular.C (setPos): change for loop to not use
1292 sequencing operator. Please check this Jürgen.
1294 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1296 * src/insets/insetcite.C (getScreenLabel): ditto
1297 * src/support/filetools.C (QuoteName): ditto
1298 (ChangeExtension): ditto
1300 * src/BufferView_pimpl.C (scrollCB): make heigt int
1302 * src/BufferView2.C (insertInset): comment out unused arg
1304 * boost/Makefile.am (EXTRADIST): new variable
1306 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1308 * src/exporter.C (IsExportable): Fixed
1310 * lib/configure.m4: Small fix
1312 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1314 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1315 * src/insets/insetbib.C (bibitemWidest): ditto.
1316 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1318 2000-10-03 Juergen Vigna <jug@sad.it>
1320 * src/BufferView2.C (theLockingInset): removed const because of
1321 Agnus's compile problems.
1323 * src/insets/insettext.C (LocalDispatch): set the language of the
1324 surronding paragraph on inserting the first character.
1326 * various files: changed use of BufferView::the_locking_inset.
1328 * src/BufferView2.C (theLockingInset):
1329 (theLockingInset): new functions.
1331 * src/BufferView.h: removed the_locking_inset.
1333 * src/lyxtext.h: added the_locking_inset
1335 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1337 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1339 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1341 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1342 * src/mathed/math_cursor.C (IsAlpha): ditto.
1343 * src/mathed/math_inset.C (strnew): ditto.
1344 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1345 (IMetrics): cxp set but never used; removed.
1346 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1347 that the variable in question has been removed also!
1350 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1351 using the Buffer * passed to Latex(), using the BufferView * passed to
1352 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1354 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1355 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1357 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1358 * src/buffer.C (readInset): used new InsetBibtex c-tor
1359 * (getBibkeyList): used new InsetBibtex::getKeys
1361 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1364 * lib/build-listerrors
1366 * src/exporter.C: Add literate programming support to the export code
1369 * src/lyx_cb.C: Remove old literate code.
1371 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1374 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1375 * src/converter.C (View, Convert): Use QuoteName.
1377 * src/insets/figinset.C (Preview): Use Formats::View.
1379 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1381 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1383 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1384 the top of the function, because compaq cxx complains that the
1385 "goto exit_with_message" when the function is disabled bypasses
1387 (MenuNew): try a better fix for the generation of new file names.
1388 This time, I used AddName() instead of AddPath(), hoping Juergen
1391 2000-10-03 Allan Rae <rae@lyx.org>
1393 * src/frontends/xforms/forms/form_preferences.fd:
1394 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1395 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1396 "Look and Feel"->"General" but will need to be split up further into
1397 general output and general input tabs. Current plan is for four outer
1398 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1399 stuff; "Inputs" for input and import configuration; "Outputs" for
1400 output and export configuration; and one more whatever is left over
1401 called "General". The leftovers at present look like being which
1402 viewers to use, spellchecker, language support and might be better
1403 named "Support". I've put "Paths" in "Inputs" for the moment as this
1404 seems reasonable for now at least.
1405 One problem remains: X error kills LyX when you close Preferences.
1407 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1409 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1410 qualifier from form()
1411 * src/frontends/xforms/FormCitation.[Ch]:
1412 * src/frontends/xforms/FormCopyright.[Ch]:
1413 * src/frontends/xforms/FormDocument.[Ch]:
1414 * src/frontends/xforms/FormError.[Ch]:
1415 * src/frontends/xforms/FormIndex.[Ch]:
1416 * src/frontends/xforms/FormPreferences.[Ch]:
1417 * src/frontends/xforms/FormPrint.[Ch]:
1418 * src/frontends/xforms/FormRef.[Ch]:
1419 * src/frontends/xforms/FormToc.[Ch]:
1420 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1422 * src/frontends/xforms/FormCitation.[Ch]:
1423 * src/frontends/xforms/FormIndex.[Ch]:
1424 * src/frontends/xforms/FormRef.[Ch]:
1425 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1426 with Allan's naming policy
1428 * src/frontends/xforms/FormCitation.C: some static casts to remove
1431 2000-10-02 Juergen Vigna <jug@sad.it>
1433 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1434 now you can type or do stuff inside the table-cell also when in dummy
1435 position, fixed visible cursor.
1437 * src/insets/insettext.C (Edit): fixing cursor-view position.
1439 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1440 be used for equal functions in lyxfunc and insettext.
1442 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1444 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1446 * src/frontends/gnome/FormCitation.h:
1447 * src/frontends/gnome/FormCopyright.h:
1448 * src/frontends/gnome/FormIndex.h:
1449 * src/frontends/gnome/FormPrint.h:
1450 * src/frontends/gnome/FormToc.h:
1451 * src/frontends/gnome/FormUrl.h:
1452 * src/frontends/kde/FormCitation.h:
1453 * src/frontends/kde/FormCopyright.h:
1454 * src/frontends/kde/FormIndex.h:
1455 * src/frontends/kde/FormRef.h:
1456 * src/frontends/kde/FormToc.h:
1457 * src/frontends/kde/FormUrl.h: fix remaining users of
1460 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1462 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1463 from depth argument.
1464 (DocBookHandleCaption): ditto.
1465 (DocBookHandleFootnote): ditto.
1466 (SimpleDocBookOnePar): ditto.
1468 * src/frontends/xforms/FormDocument.h (form): remove extra
1469 FormDocument:: qualifier.
1471 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1473 * sigc++/handle.h: ditto.
1475 * src/lyx_gui_misc.C: add "using" directive.
1477 * src/cheaders/cstddef: new file, needed by the boost library (for
1480 2000-10-02 Juergen Vigna <jug@sad.it>
1482 * src/insets/insettext.C (SetFont): better support.
1484 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1486 * src/screen.C (DrawOneRow): some uint refixes!
1488 2000-10-02 Allan Rae <rae@lyx.org>
1490 * boost/.cvsignore: ignore Makefile as well
1492 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1493 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1495 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1496 Left this one out by accident.
1498 * src/frontends/xforms/FormBase.h (restore): default to calling
1499 update() since that will restore the original/currently-applied values.
1500 Any input() triggered error messages will require the derived classes
1501 to redefine restore().
1503 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1504 avoid a segfault. combo_doc_class is the main concern.
1506 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1508 * Simplify build-listerrors in view of GUI-less export ability!
1510 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1512 * src/lyx_main.C (easyParse): Disable gui when exporting
1514 * src/insets/figinset.C:
1517 * src/lyx_gui_misc.C
1518 * src/tabular.C: Changes to allow no-gui.
1520 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1522 * src/support/utility.hpp: removed file
1523 * src/support/block.h: removed file
1525 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1528 * src/mathed/formula.C: add support/lyxlib.h
1529 * src/mathed/formulamacro.C: ditto
1531 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1532 * src/lyxparagraph.h: ditto
1534 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1535 * src/frontends/Makefile.am (INCLUDES): ditto
1536 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1537 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1538 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1539 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1540 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1541 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1543 * src/BufferView.h: use boost/utility.hpp
1544 * src/LColor.h: ditto
1545 * src/LaTeX.h: ditto
1546 * src/LyXAction.h: ditto
1547 * src/LyXView.h: ditto
1548 * src/bufferlist.h: ditto
1549 * src/lastfiles.h: ditto
1550 * src/layout.h: ditto
1551 * src/lyx_gui.h: ditto
1552 * src/lyx_main.h: ditto
1553 * src/lyxlex.h: ditto
1554 * src/lyxrc.h: ditto
1555 * src/frontends/ButtonPolicies.h: ditto
1556 * src/frontends/Dialogs.h: ditto
1557 * src/frontends/xforms/FormBase.h: ditto
1558 * src/frontends/xforms/FormGraphics.h: ditto
1559 * src/frontends/xforms/FormParagraph.h: ditto
1560 * src/frontends/xforms/FormTabular.h: ditto
1561 * src/graphics/GraphicsCache.h: ditto
1562 * src/graphics/Renderer.h: ditto
1563 * src/insets/ExternalTemplate.h: ditto
1564 * src/insets/insetcommand.h: ditto
1565 * src/support/path.h: ditto
1567 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1568 and introduce clause for 2.97.
1570 * boost/libs/README: new file
1572 * boost/boost/utility.hpp: new file
1574 * boost/boost/config.hpp: new file
1576 * boost/boost/array.hpp: new file
1578 * boost/Makefile.am: new file
1580 * boost/.cvsignore: new file
1582 * configure.in (AC_OUTPUT): add boost/Makefile
1584 * Makefile.am (SUBDIRS): add boost
1586 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1588 * src/support/lstrings.C (suffixIs): Fixed.
1590 2000-10-01 Allan Rae <rae@lyx.org>
1592 * src/PrinterParams.h: moved things around to avoid the "can't
1593 inline call" warning.
1595 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1596 into doc++ documentation.
1598 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1600 * src/frontends/xforms/FormRef.C: make use of button controller
1601 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1602 cleaned up button controller usage.
1603 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1604 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1605 use the button controller
1607 * src/frontends/xforms/forms/*.fd: and associated generated files
1608 updated to reflect changes to FormBase. Some other FormXxxx files
1609 also got minor updates to reflect changes to FormBase.
1611 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1612 (hide): made virtual.
1613 (input): return a bool. true == valid input
1614 (RestoreCB, restore): new
1615 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1616 Changes to allow derived dialogs to use a ButtonController and
1617 make sense when doing so: OK button calls ok() and so on.
1619 * src/frontends/xforms/ButtonController.h (class ButtonController):
1620 Switch from template implementation to taking Policy parameter.
1621 Allows FormBase to provide a ButtonController for any dialog.
1623 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1624 Probably should rename connect and disconnect.
1625 (apply): use the radio button groups
1626 (form): needed by FormBase
1627 (build): setup the radio button groups
1629 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1631 * several files: type changes to reduce the number of warnings and
1632 to unify type hangling a bit. Still much to do.
1634 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1636 * lib/images/*: rename a bunch of icons to match Dekel converter
1639 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1642 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1644 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1646 * sigc++/handle.h: ditto for class Handle.
1648 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1650 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1652 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1654 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1655 removal of the "default" language.
1657 * src/combox.h (getline): Check that sel > 0
1659 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1661 * lib/examples/docbook_example.lyx
1662 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1664 * lib/layouts/docbook-book.layout: new docbook book layout.
1666 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1668 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1670 * src/insets/figinset.C (DocBook):fixed small typo.
1672 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1674 * src/insets/insetinclude.h: string include_label doesn't need to be
1677 2000-09-29 Allan Rae <rae@lyx.org>
1679 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1680 Allow derived type to control connection and disconnection from signals
1681 of its choice if desired.
1683 2000-09-28 Juergen Vigna <jug@sad.it>
1685 * src/insets/insettabular.C (update): fixed cursor setting when
1686 the_locking_inset changed.
1687 (draw): made this a bit cleaner.
1688 (InsetButtonPress): fixed!
1690 * various files: added LyXText Parameter to fitCursor call.
1692 * src/BufferView.C (fitCursor): added LyXText parameter.
1694 * src/insets/insettabular.C (draw): small draw fix.
1696 * src/tabular.C: right setting of left/right celllines.
1698 * src/tabular.[Ch]: fixed various types in funcions and structures.
1699 * src/insets/insettabular.C: ditto
1700 * src/frontends/xforms/FormTabular.C: ditto
1702 2000-09-28 Allan Rae <rae@lyx.org>
1704 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1705 that the #ifdef's had been applied to part of what should have been
1706 a complete condition. It's possible there are other tests that
1707 were specific to tables that are also wrong now that InsetTabular is
1708 being used. Now we need to fix the output of '\n' after a table in a
1709 float for the same reason as the original condition:
1710 "don't insert this if we would be adding it before or after a table
1711 in a float. This little trick is needed in order to allow use of
1712 tables in \subfigures or \subtables."
1713 Juergen can you check this?
1715 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1717 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1718 output to the ostream.
1720 * several files: fixed types based on warnings from cxx
1722 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1724 * src/frontends/kde/Makefile.am: fix rule for
1725 formindexdialogdata_moc.C
1727 * src/.cvsignore: add ext_l10n.h to ignore
1729 * acconfig.h: stop messing with __STRICT_ANSI__
1730 * config/gnome.m4: remove option to set -ansi
1731 * config/kde.m4: remove option to set -ansi
1732 * config/lyxinclude.m4: don't set -ansi
1734 2000-09-27 Juergen Vigna <jug@sad.it>
1736 * various files: remove "default" language check.
1738 * src/insets/insetquotes.C: removed use of current_view.
1740 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1741 the one should have red ears by now!
1743 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1744 in more then one paragraph. Fixed cursor-movement/selection.
1746 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1747 paragraphs inside a text inset.
1749 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1750 text-inset if this owner is an inset.
1752 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1754 * src/Bullet.h: changed type of font, character and size to int
1756 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1758 * src/insets/inseturl.[Ch]:
1759 * src/insets/insetref.[Ch]:
1760 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1762 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1764 * src/buffer.C (readFile): block-if statement rearranged to minimise
1765 bloat. Patch does not reverse Jean-Marc's change ;-)
1767 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1768 Class rewritten to store pointers to hide/update signals directly,
1769 rather than Dialogs *. Also defined an enum to ease use. All xforms
1770 forms can now be derived from this class.
1772 * src/frontends/xforms/FormCommand.[Ch]
1773 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1775 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1778 * src/frontends/xforms/forms/form_citation.fd
1779 * src/frontends/xforms/forms/form_copyright.fd
1780 * src/frontends/xforms/forms/form_error.fd
1781 * src/frontends/xforms/forms/form_index.fd
1782 * src/frontends/xforms/forms/form_ref.fd
1783 * src/frontends/xforms/forms/form_toc.fd
1784 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1786 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1788 * src/insets/insetfoot.C: removed redundent using directive.
1790 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1792 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1793 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1795 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1796 created in the constructors in different groups. Then set() just
1797 have to show the groups as needed. This fixes the redraw problems
1798 (and is how the old menu code worked).
1800 * src/support/lyxlib.h: declare the methods as static when we do
1801 not have namespaces.
1803 2000-09-26 Juergen Vigna <jug@sad.it>
1805 * src/buffer.C (asciiParagraph): new function.
1806 (writeFileAscii): new function with parameter ostream.
1807 (writeFileAscii): use now asciiParagraph.
1809 * various inset files: added the linelen parameter to the Ascii-func.
1811 * src/tabular.C (Write): fixed error in writing file introduced by
1812 the last changes from Lars.
1814 * lib/bind/menus.bind: removed not supported functions.
1816 * src/insets/insettext.C (Ascii): implemented this function.
1818 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1820 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1821 (Write): use of the write_attribute functions.
1823 * src/bufferlist.C (close): fixed reasking question!
1825 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1827 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1828 new files use the everwhere possible.
1831 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1832 src/log_form.C src/lyx.C:
1835 * src/buffer.C (runLaTeX): remove func
1837 * src/PaperLayout.C: removed file
1838 * src/ParagraphExtra.C: likewise
1839 * src/bullet_forms.C: likewise
1840 * src/bullet_forms.h: likewise
1841 * src/bullet_forms_cb.C: likewise
1843 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1844 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1847 * several files: remove all traces of the old fd_form_paragraph,
1848 and functions belonging to that.
1850 * several files: remove all traces of the old fd_form_document,
1851 and functions belonging to that.
1853 * several files: constify local variables were possible.
1855 * several files: remove all code that was dead when NEW_EXPORT was
1858 * several files: removed string::c_str in as many places as
1861 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1862 (e): be a bit more outspoken when patching
1863 (updatesrc): only move files if changed.
1865 * forms/layout_forms.h.patch: regenerated
1867 * forms/layout_forms.fd: remove form_document and form_paragraph
1868 and form_quotes and form_paper and form_table_options and
1869 form_paragraph_extra
1871 * forms/form1.fd: remove form_table
1873 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1874 the fdui->... rewrite. Update some comments to xforms 0.88
1876 * forms/bullet_forms.C.patch: removed file
1877 * forms/bullet_forms.fd: likewise
1878 * forms/bullet_forms.h.patch: likewise
1880 * development/Code_rules/Rules: added a section on switch
1881 statements. Updated some comment to xforms 0.88.
1883 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1885 * src/buffer.C (readFile): make sure that the whole version number
1886 is read after \lyxformat (even when it contains a comma)
1888 * lib/ui/default.ui: change shortcut of math menu to M-a.
1890 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1892 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1895 * src/LyXView.C (updateWindowTitle): show the full files name in
1896 window title, limited to 30 characters.
1898 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1899 When a number of characters has been given, we should not assume
1900 that the string is 0-terminated.
1902 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1903 calls (fixes some memory leaks)
1905 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1906 trans member on exit.
1908 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1910 * src/converter.C (GetReachable): fix typo.
1912 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1913 understand ',' instead of '.'.
1914 (GetInteger): rewrite to use strToInt().
1916 2000-09-26 Juergen Vigna <jug@sad.it>
1918 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1919 better visibility and error-message on wrong VSpace input.
1921 * src/language.C (initL): added english again.
1923 2000-09-25 Juergen Vigna <jug@sad.it>
1925 * src/frontends/kde/Dialogs.C (Dialogs):
1926 * src/frontends/gnome/Dialogs.C (Dialogs):
1927 * src/frontends/kde/Makefile.am:
1928 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1930 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1932 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1934 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1936 * src/frontends/xforms/FormParagraph.C:
1937 * src/frontends/xforms/FormParagraph.h:
1938 * src/frontends/xforms/form_paragraph.C:
1939 * src/frontends/xforms/form_paragraph.h:
1940 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1943 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1945 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1946 Paragraph-Data after use.
1948 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1949 non breakable paragraphs.
1951 2000-09-25 Garst R. Reese <reese@isn.net>
1953 * src/language.C (initL): added missing language_country codes.
1955 2000-09-25 Juergen Vigna <jug@sad.it>
1957 * src/insets/insettext.C (InsetText):
1958 (deleteLyXText): remove the not released LyXText structure!
1960 2000-09-24 Marko Vendelin <markov@ioc.ee>
1962 * src/frontends/gnome/mainapp.C
1963 * src/frontends/gnome/mainapp.h: added support for keyboard
1966 * src/frontends/gnome/FormCitation.C
1967 * src/frontends/gnome/FormCitation.h
1968 * src/frontends/gnome/Makefile.am
1969 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1970 FormCitation to use "action area" in mainapp window
1972 * src/frontends/gnome/Menubar_pimpl.C
1973 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1976 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1978 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1979 width/descent/ascent values if name is empty.
1980 (mathed_string_height): Use std::max.
1982 2000-09-25 Allan Rae <rae@lyx.org>
1984 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1985 segfault. This will be completely redesigned soon.
1987 * sigc++: updated libsigc++. Fixes struct timespec bug.
1989 * development/tools/makeLyXsigc.sh: .cvsignore addition
1991 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1993 * several files: removed almost all traces of the old table
1996 * src/TableLayout.C: removed file
1998 2000-09-22 Juergen Vigna <jug@sad.it>
2000 * src/frontends/kde/Dialogs.C: added credits forms.
2002 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2004 * src/frontends/gnome/Dialogs.C: added some forms.
2006 * src/spellchecker.C (init_spell_checker): set language in pspell code
2007 (RunSpellChecker): some modifications for setting language string.
2009 * src/language.[Ch]: added language_country code.
2011 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2013 * src/frontends/Dialogs.h: added new signal showError.
2014 Rearranged existing signals in some sort of alphabetical order.
2016 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2017 FormError.[Ch], form_error.[Ch]
2018 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2019 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2021 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2022 dialogs. I think that this can be used as the base to all these
2025 * src/frontends/xforms/FormError.[Ch]
2026 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2027 implementation of InsetError dialog.
2029 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2031 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2032 * src/frontends/kde/Makefile.am: ditto
2034 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2036 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2037 macrobf. This fixes a bug of invisible text.
2039 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2041 * lib/doc/LaTeXConfig.lyx.in: updated.
2043 * src/language.C (initL): remove language "francais" and change a
2044 bit the names of the two other french variations.
2046 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2047 string that may not be 0-terminated.
2049 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2051 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2053 2000-09-20 Marko Vendelin <markov@ioc.ee>
2055 * src/frontends/gnome/FormCitation.C
2056 * src/frontends/gnome/FormIndex.C
2057 * src/frontends/gnome/FormToc.C
2058 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2059 the variable initialization to shut up the warnings
2061 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2063 * src/table.[Ch]: deleted files
2065 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2068 2000-09-18 Juergen Vigna <jug@sad.it>
2070 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2071 problems with selection. Inserted new LFUN_PASTESELECTION.
2072 (InsetButtonPress): inserted handling of middle mouse-button paste.
2074 * src/spellchecker.C: changed word to word.c_str().
2076 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2078 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2079 included in the ``make dist'' tarball.
2081 2000-09-15 Juergen Vigna <jug@sad.it>
2083 * src/CutAndPaste.C (cutSelection): small fix return the right
2084 end position after cut inside one paragraph only.
2086 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2087 we are locked as otherwise we don't have a valid cursor position!
2089 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2091 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2093 * src/frontends/kde/FormRef.C: added using directive.
2094 * src/frontends/kde/FormToc.C: ditto
2096 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2098 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2100 2000-09-19 Marko Vendelin <markov@ioc.ee>
2102 * src/frontends/gnome/Menubar_pimpl.C
2103 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2104 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2106 * src/frontends/gnome/mainapp.C
2107 * src/frontends/gnome/mainapp.h: support for menu update used
2110 * src/frontends/gnome/mainapp.C
2111 * src/frontends/gnome/mainapp.h: support for "action" area in the
2112 main window. This area is used by small simple dialogs, such as
2115 * src/frontends/gnome/FormIndex.C
2116 * src/frontends/gnome/FormIndex.h
2117 * src/frontends/gnome/FormUrl.C
2118 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2121 * src/frontends/gnome/FormCitation.C
2122 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2123 action area. Only "Insert new citation" is implemented.
2125 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2127 * src/buffer.C (Dispatch): fix call to Dispatch
2128 * src/insets/insetref.C (Edit): likewise
2129 * src/insets/insetparent.C (Edit): likewise
2130 * src/insets/insetinclude.C (include_cb): likewise
2131 * src/frontends/xforms/FormUrl.C (apply): likewise
2132 * src/frontends/xforms/FormToc.C (apply): likewise
2133 * src/frontends/xforms/FormRef.C (apply): likewise
2134 * src/frontends/xforms/FormIndex.C (apply): likewise
2135 * src/frontends/xforms/FormCitation.C (apply): likewise
2136 * src/lyxserver.C (callback): likewise
2137 * src/lyxfunc.C (processKeySym): likewise
2138 (Dispatch): likewise
2139 (Dispatch): likewise
2140 * src/lyx_cb.C (LayoutsCB): likewise
2142 * Makefile.am (sourcedoc): small change
2144 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2146 * src/main.C (main): Don't make an empty GUIRunTime object. all
2147 methods are static. constify a bit remove unneded using + headers.
2149 * src/tabular.C: some more const to local vars move some loop vars
2151 * src/spellchecker.C: added some c_str after some word for pspell
2153 * src/frontends/GUIRunTime.h: add new static method setDefaults
2154 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2155 * src/frontends/kde/GUIRunTime.C (setDefaults):
2156 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2158 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2159 with strnew in arg, use correct emptystring when calling SetName.
2161 * several files: remove all commented code with relation to
2162 HAVE_SSTREAM beeing false. We now only support stringstream and
2165 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2167 * src/lyxfunc.C: construct correctly the automatic new file
2170 * src/text2.C (IsStringInText): change type of variable i to shut
2173 * src/support/sstream.h: do not use namespaces if the compiler
2174 does not support them.
2176 2000-09-15 Marko Vendelin <markov@ioc.ee>
2177 * src/frontends/gnome/FormCitation.C
2178 * src/frontends/gnome/FormCitation.h
2179 * src/frontends/gnome/diainsertcitation_interface.c
2180 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2181 regexp support to FormCitation [Gnome].
2183 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2186 * configure.in: remove unused KDE/GTKGUI define
2188 * src/frontends/kde/FormRef.C
2189 * src/frontends/kde/FormRef.h
2190 * src/frontends/kde/formrefdialog.C
2191 * src/frontends/kde/formrefdialog.h: double click will
2192 go to reference, now it is possible to change a cross-ref
2195 * src/frontends/kde/FormToc.C
2196 * src/frontends/kde/FormToc.h
2197 * src/frontends/kde/formtocdialog.C
2198 * src/frontends/kde/formtocdialog.h: add a depth
2201 * src/frontends/kde/Makefile.am: add QtLyXView.h
2204 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2206 * src/frontends/kde/FormCitation.h: added some using directives.
2208 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2210 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2213 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2216 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2218 * src/buffer.C (pop_tag): revert for the second time a change by
2219 Lars, who seems to really hate having non-local loop variables :)
2221 * src/Lsstream.h: add "using" statements.
2223 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2224 * src/buffer.C (writeFile): ditto
2226 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2228 * src/buffer.C (writeFile): try to fix the locale modified format
2229 number to always be as we want it.
2231 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2232 in XForms 0.89. C-space is now working again.
2234 * src/Lsstream.h src/support/sstream.h: new files.
2236 * also commented out all cases where strstream were used.
2238 * src/Bullet.h (c_str): remove method.
2240 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2242 * a lot of files: get rid of "char const *" and "char *" is as
2243 many places as possible. We only want to use them in interaction
2244 with system of other libraries, not inside lyx.
2246 * a lot of files: return const object is not of pod type. This
2247 helps ensure that temporary objects is not modified. And fits well
2248 with "programming by contract".
2250 * configure.in: check for the locale header too
2252 * Makefile.am (sourcedoc): new tag for generation of doc++
2255 2000-09-14 Juergen Vigna <jug@sad.it>
2257 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2258 callback to check which combo called it and do the right action.
2260 * src/combox.C (combo_cb): added combo * to the callbacks.
2261 (Hide): moved call of callback after Ungrab of the pointer.
2263 * src/intl.h: removed LCombo2 function.
2265 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2266 function as this can now be handled in one function.
2268 * src/combox.h: added Combox * to callback prototype.
2270 * src/frontends/xforms/Toolbar_pimpl.C:
2271 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2273 2000-09-14 Garst Reese <reese@isn.net>
2275 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2276 moved usepackage{xxx}'s to beginning of file. Changed left margin
2277 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2278 underlining from title. Thanks to John Culleton for useful suggestions.
2280 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2282 * src/lyxlex_pimpl.C (setFile): change error message to debug
2285 2000-09-13 Juergen Vigna <jug@sad.it>
2287 * src/frontends/xforms/FormDocument.C: implemented choice_class
2288 as combox and give callback to combo_language so OK/Apply is activated
2291 * src/bufferlist.C (newFile): small fix so already named files
2292 (via an open call) are not requested to be named again on the
2295 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2297 * src/frontends/kde/Makefile.am
2298 * src/frontends/kde/FormRef.C
2299 * src/frontends/kde/FormRef.h
2300 * src/frontends/kde/formrefdialog.C
2301 * src/frontends/kde/formrefdialog.h: implement
2304 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2306 * src/frontends/kde/formtocdialog.C
2307 * src/frontends/kde/formtocdialog.h
2308 * src/frontends/kde/FormToc.C
2309 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2311 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2313 * src/frontends/kde/FormCitation.C: fix thinko
2314 where we didn't always display the reference text
2317 * src/frontends/kde/formurldialog.C
2318 * src/frontends/kde/formurldialog.h
2319 * src/frontends/kde/FormUrl.C
2320 * src/frontends/kde/FormUrl.h: minor cleanups
2322 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2324 * src/frontends/kde/Makefile.am
2325 * src/frontends/kde/FormToc.C
2326 * src/frontends/kde/FormToc.h
2327 * src/frontends/kde/FormCitation.C
2328 * src/frontends/kde/FormCitation.h
2329 * src/frontends/kde/FormIndex.C
2330 * src/frontends/kde/FormIndex.h
2331 * src/frontends/kde/formtocdialog.C
2332 * src/frontends/kde/formtocdialog.h
2333 * src/frontends/kde/formcitationdialog.C
2334 * src/frontends/kde/formcitationdialog.h
2335 * src/frontends/kde/formindexdialog.C
2336 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2338 2000-09-12 Juergen Vigna <jug@sad.it>
2340 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2343 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2345 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2348 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2350 * src/converter.C (Add, Convert): Added support for converter flags:
2351 needaux, resultdir, resultfile.
2352 (Convert): Added new parameter view_file.
2353 (dvips_options): Fixed letter paper option.
2355 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2356 (Export, GetExportableFormats, GetViewableFormats): Added support
2359 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2361 (easyParse): Fixed to work with new export code.
2363 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2366 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2368 * lib/bind/*.bind: Replaced
2369 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2370 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2372 2000-09-11 Juergen Vigna <jug@sad.it>
2374 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2376 * src/main.C (main): now GUII defines global guiruntime!
2378 * src/frontends/gnome/GUIRunTime.C (initApplication):
2379 * src/frontends/kde/GUIRunTime.C (initApplication):
2380 * src/frontends/xforms/GUIRunTime.C (initApplication):
2381 * src/frontends/GUIRunTime.h: added new function initApplication.
2383 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2385 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2387 2000-09-08 Juergen Vigna <jug@sad.it>
2389 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2390 we have already "Reset".
2392 * src/language.C (initL): inserted "default" language and made this
2393 THE default language (and not american!)
2395 * src/paragraph.C: inserted handling of "default" language!
2397 * src/lyxfont.C: ditto
2401 * src/paragraph.C: output the \\par only if we have a following
2402 paragraph otherwise it's not needed.
2404 2000-09-05 Juergen Vigna <jug@sad.it>
2406 * config/pspell.m4: added entry to lyx-flags
2408 * src/spellchecker.C: modified version from Kevin for using pspell
2410 2000-09-01 Marko Vendelin <markov@ioc.ee>
2411 * src/frontends/gnome/Makefile.am
2412 * src/frontends/gnome/FormCitation.C
2413 * src/frontends/gnome/FormCitation.h
2414 * src/frontends/gnome/diainsertcitation_callbacks.c
2415 * src/frontends/gnome/diainsertcitation_callbacks.h
2416 * src/frontends/gnome/diainsertcitation_interface.c
2417 * src/frontends/gnome/diainsertcitation_interface.h
2418 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2419 dialog for Gnome frontend
2421 * src/main.C: Gnome libraries require keeping application name
2422 and its version as strings
2424 * src/frontends/gnome/mainapp.C: Change the name of the main window
2425 from GnomeLyX to PACKAGE
2427 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2429 * src/frontends/Liason.C: add "using: declaration.
2431 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2433 * src/mathed/math_macro.C (Metrics): Set the size of the template
2435 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2437 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2439 * src/converter.C (add_options): New function.
2440 (SetViewer): Change $$FName into '$$FName'.
2441 (View): Add options when running xdvi
2442 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2443 (Convert): The 3rd parameter is now the desired filename. Converts
2444 calls to lyx::rename if necessary.
2445 Add options when running dvips.
2446 (dvi_papersize,dvips_options): New methods.
2448 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2450 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2451 using a call to Converter::dvips_options.
2452 Fixed to work with nex export code.
2454 * src/support/copy.C
2455 * src/support/rename.C: New files
2457 * src/support/syscall.h
2458 * src/support/syscall.C: Added Starttype SystemDontWait.
2460 * lib/ui/default.ui: Changed to work with new export code
2462 * lib/configure.m4: Changed to work with new export code
2464 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2466 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2468 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2469 so that code compiles with DEC cxx.
2471 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2472 to work correctly! Also now supports the additional elements
2475 2000-09-01 Allan Rae <rae@lyx.org>
2477 * src/frontends/ButtonPolicies.C: renamed all the references to
2478 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2480 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2481 since it's a const not a type.
2483 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2485 2000-08-31 Juergen Vigna <jug@sad.it>
2487 * src/insets/figinset.C: Various changes to look if the filename has
2488 an extension and if not add it for inline previewing.
2490 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2492 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2493 make buttonStatus and isReadOnly be const methods. (also reflect
2494 this in derived classes.)
2496 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2497 (nextState): change to be static inline, pass the StateMachine as
2499 (PreferencesPolicy): remove casts
2500 (OkCancelPolicy): remvoe casts
2501 (OkCancelReadOnlyPolicy): remove casts
2502 (NoRepeatedApplyReadOnlyPolicy): remove casts
2503 (OkApplyCancelReadOnlyPolicy): remove casts
2504 (OkApplyCancelPolicy): remove casts
2505 (NoRepeatedApplyPolicy): remove casts
2507 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2509 * src/converter.C: added some using directives
2511 * src/frontends/ButtonPolicies.C: changes to overcome
2512 "need lvalue" error with DEC c++
2514 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2515 to WMHideCB for DEC c++
2517 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2519 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2520 to BulletBMTableCB for DEC c++
2522 2000-08-31 Allan Rae <rae@lyx.org>
2524 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2525 character dialog separately from old document dialogs combo_language.
2528 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2530 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2531 Removed LFUN_REF_CREATE.
2533 * src/MenuBackend.C: Added new tags: toc and references
2535 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2536 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2538 (add_toc, add_references): New methods.
2539 (create_submenu): Handle correctly the case when there is a
2540 seperator after optional menu items.
2542 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2543 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2544 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2546 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2548 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2550 * src/converter.[Ch]: New file for converting between different
2553 * src/export.[Ch]: New file for exporting a LyX file to different
2556 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2557 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2558 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2559 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2560 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2561 RunDocBook, MenuExport.
2563 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2564 Exporter::Preview methods if NEW_EXPORT is defined.
2566 * src/buffer.C (Dispatch): Use Exporter::Export.
2568 * src/lyxrc.C: Added new tags: \converter and \viewer.
2571 * src/LyXAction.C: Define new lyx-function: buffer-update.
2572 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2573 when NEW_EXPORT is defined.
2575 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2577 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2579 * lib/ui/default.ui: Added submenus "view" and "update" to the
2582 * src/filetools.C (GetExtension): New function.
2584 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2586 2000-08-29 Allan Rae <rae@lyx.org>
2588 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2590 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2591 (EnableDocumentLayout): removed
2592 (DisableDocumentLayout): removed
2593 (build): make use of ButtonController's read-only handling to
2594 de/activate various objects. Replaces both of the above functions.
2596 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2597 (readOnly): was read_only
2598 (refresh): fixed dumb mistakes with read_only_ handling
2600 * src/frontends/xforms/forms/form_document.fd:
2601 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2602 tabbed dialogs so the tabs look more like tabs and so its easier to
2603 work out which is the current tab.
2605 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2606 segfault with form_table
2608 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2610 2000-08-28 Juergen Vigna <jug@sad.it>
2612 * acconfig.h: added USE_PSPELL.
2614 * src/config.h.in: added USE_PSPELL.
2616 * autogen.sh: added pspell.m4
2618 * config/pspell.m4: new file.
2620 * src/spellchecker.C: implemented support for pspell libary.
2622 2000-08-25 Juergen Vigna <jug@sad.it>
2624 * src/LyXAction.C (init): renamed LFUN_TABLE to
2625 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2627 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2629 * src/lyxscreen.h: add force_clear variable and fuction to force
2630 a clear area when redrawing in LyXText.
2632 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2634 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2636 * some whitespace and comment changes.
2638 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2640 * src/buffer.C: up te LYX_FORMAT to 2.17
2642 2000-08-23 Juergen Vigna <jug@sad.it>
2644 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2647 * src/insets/insettabular.C (pasteSelection): delete the insets
2648 LyXText as it is not valid anymore.
2649 (copySelection): new function.
2650 (pasteSelection): new function.
2651 (cutSelection): new function.
2652 (LocalDispatch): implemented cut/copy/paste of cell selections.
2654 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2655 don't have a LyXText.
2657 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2659 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2662 2000-08-22 Juergen Vigna <jug@sad.it>
2664 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2665 ifdef form_table out if NEW_TABULAR.
2667 2000-08-21 Juergen Vigna <jug@sad.it>
2669 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2670 (draw): fixed draw position so that the cursor is positioned in the
2672 (InsetMotionNotify): hide/show cursor so the position is updated.
2673 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2674 using cellstart() function where it should be used.
2676 * src/insets/insettext.C (draw): ditto.
2678 * src/tabular.C: fixed initialization of some missing variables and
2679 made BoxType into an enum.
2681 2000-08-22 Marko Vendelin <markov@ioc.ee>
2682 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2683 stock menu item using action numerical value, not its string
2687 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2689 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2690 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2692 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2694 * src/frontends/xforms/GUIRunTime.C: new file
2696 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2697 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2699 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2701 * src/frontends/kde/GUIRunTime.C: new file
2703 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2704 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2706 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2708 * src/frontends/gnome/GUIRunTime.C: new file
2710 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2713 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2714 small change to documetentation.
2716 * src/frontends/GUIRunTime.C: removed file
2718 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2720 * src/lyxparagraph.h: enable NEW_TABULAR as default
2722 * src/lyxfunc.C (processKeySym): remove some commented code
2724 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2725 NEW_TABULAR around the fd_form_table_options.
2727 * src/lyx_gui.C (runTime): call the static member function as
2728 GUIRunTime::runTime().
2730 2000-08-21 Allan Rae <rae@lyx.org>
2732 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2735 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2737 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2739 2000-08-21 Allan Rae <rae@lyx.org>
2741 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2742 keep Garst happy ;-)
2743 * src/frontends/xforms/FormPreferences.C (build): use setOK
2744 * src/frontends/xforms/FormDocument.C (build): use setOK
2745 (FormDocument): use the appropriate policy.
2747 2000-08-21 Allan Rae <rae@lyx.org>
2749 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2750 automatic [de]activation of arbitrary objects when in a read-only state.
2752 * src/frontends/ButtonPolicies.h: More documentation
2753 (isReadOnly): added to support the above.
2755 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2757 2000-08-18 Juergen Vigna <jug@sad.it>
2759 * src/insets/insettabular.C (getStatus): changed to return func_status.
2761 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2762 display toggle menu entries if they are.
2764 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2765 new document layout now.
2767 * src/lyxfunc.C: ditto
2769 * src/lyx_gui_misc.C: ditto
2771 * src/lyx_gui.C: ditto
2773 * lib/ui/default.ui: removed paper and quotes layout as they are now
2774 all in the document layout tabbed folder.
2776 * src/frontends/xforms/forms/form_document.fd: added Restore
2777 button and callbacks for all inputs for Allan's ButtonPolicy.
2779 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2780 (CheckChoiceClass): added missing params setting on class change.
2781 (UpdateLayoutDocument): added for updating the layout on params.
2782 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2783 (FormDocument): Implemented Allan's ButtonPolicy with the
2786 2000-08-17 Allan Rae <rae@lyx.org>
2788 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2789 so we can at least see the credits again.
2791 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2792 controller calls for the appropriate callbacks. Note that since Ok
2793 calls apply followed by cancel, and apply isn't a valid input for the
2794 APPLIED state, the bc_ calls have to be made in the static callback not
2795 within each of the real callbacks.
2797 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2798 (setOk): renamed from setOkay()
2800 2000-08-17 Juergen Vigna <jug@sad.it>
2802 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2803 in the implementation part.
2804 (composeUIInfo): don't show optional menu-items.
2806 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2808 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2810 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2811 text-state when in a text-inset.
2813 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2815 2000-08-17 Marko Vendelin <markov@ioc.ee>
2816 * src/frontends/gnome/FormIndex.C
2817 * src/frontends/gnome/FormIndex.h
2818 * src/frontends/gnome/FormToc.C
2819 * src/frontends/gnome/FormToc.h
2820 * src/frontends/gnome/dialogs
2821 * src/frontends/gnome/diatoc_callbacks.c
2822 * src/frontends/gnome/diatoc_callbacks.h
2823 * src/frontends/gnome/diainsertindex_callbacks.h
2824 * src/frontends/gnome/diainsertindex_callbacks.c
2825 * src/frontends/gnome/diainsertindex_interface.c
2826 * src/frontends/gnome/diainsertindex_interface.h
2827 * src/frontends/gnome/diatoc_interface.h
2828 * src/frontends/gnome/diatoc_interface.c
2829 * src/frontends/gnome/Makefile.am: Table of Contents and
2830 Insert Index dialogs implementation for Gnome frontend
2832 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2834 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2836 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2839 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2841 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2842 destructor. Don't definde if you don't need it
2843 (processEvents): made static, non-blocking events processing for
2845 (runTime): static method. event loop for xforms
2846 * similar as above for kde and gnome.
2848 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2849 new Pimpl is correct
2850 (runTime): new method calss the real frontends runtime func.
2852 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2854 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2856 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2858 2000-08-16 Juergen Vigna <jug@sad.it>
2860 * src/lyx_gui.C (runTime): added GUII RunTime support.
2862 * src/frontends/Makefile.am:
2863 * src/frontends/GUIRunTime.[Ch]:
2864 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2865 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2866 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2868 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2870 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2871 as this is already set in ${FRONTEND_INCLUDE} if needed.
2873 * configure.in (CPPFLAGS): setting the include dir for the frontend
2874 directory and don't set FRONTEND=xforms for now as this is executed
2877 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2879 * src/frontends/kde/Makefile.am:
2880 * src/frontends/kde/FormUrl.C:
2881 * src/frontends/kde/FormUrl.h:
2882 * src/frontends/kde/formurldialog.h:
2883 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2885 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2887 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2889 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2891 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2894 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2896 * src/WorkArea.C (work_area_handler): more work to get te
2897 FL_KEYBOARD to work with xforms 0.88 too, please test.
2899 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2901 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2903 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2906 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2908 * src/Timeout.h: remove Qt::emit hack.
2910 * several files: changes to allo doc++ compilation
2912 * src/lyxfunc.C (processKeySym): new method
2913 (processKeyEvent): comment out if FL_REVISION < 89
2915 * src/WorkArea.C: change some debugging levels.
2916 (WorkArea): set wantkey to FL_KEY_ALL
2917 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2918 clearer code and the use of compose with XForms 0.89. Change to
2919 use signals instead of calling methods in bufferview directly.
2921 * src/Painter.C: change some debugging levels.
2923 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2926 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2927 (workAreaKeyPress): new method
2929 2000-08-14 Juergen Vigna <jug@sad.it>
2931 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2933 * config/kde.m4: addes some features
2935 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2936 include missing xforms dialogs.
2938 * src/Timeout.h: a hack to be able to compile with qt/kde.
2940 * sigc++/.cvsignore: added acinclude.m4
2942 * lib/.cvsignore: added listerros
2944 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2945 xforms tree as objects are needed for other frontends.
2947 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2948 linking with not yet implemented xforms objects.
2950 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2952 2000-08-14 Baruch Even <baruch.even@writeme.com>
2954 * src/frontends/xforms/FormGraphics.h:
2955 * src/frontends/xforms/FormGraphics.C:
2956 * src/frontends/xforms/RadioButtonGroup.h:
2957 * src/frontends/xforms/RadioButtonGroup.C:
2958 * src/insets/insetgraphics.h:
2959 * src/insets/insetgraphics.C:
2960 * src/insets/insetgraphicsParams.h:
2961 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2962 instead of spaces, and various other indentation issues to make the
2963 sources more consistent.
2965 2000-08-14 Marko Vendelin <markov@ioc.ee>
2967 * src/frontends/gnome/dialogs/diaprint.glade
2968 * src/frontends/gnome/FormPrint.C
2969 * src/frontends/gnome/FormPrint.h
2970 * src/frontends/gnome/diaprint_callbacks.c
2971 * src/frontends/gnome/diaprint_callbacks.h
2972 * src/frontends/gnome/diaprint_interface.c
2973 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2976 * src/frontends/gnome/dialogs/diainserturl.glade
2977 * src/frontends/gnome/FormUrl.C
2978 * src/frontends/gnome/FormUrl.h
2979 * src/frontends/gnome/diainserturl_callbacks.c
2980 * src/frontends/gnome/diainserturl_callbacks.h
2981 * src/frontends/gnome/diainserturl_interface.c
2982 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2983 Gnome implementation
2985 * src/frontends/gnome/Dialogs.C
2986 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2987 all other dialogs. Copy all unimplemented dialogs from Xforms
2990 * src/frontends/gnome/support.c
2991 * src/frontends/gnome/support.h: support files generated by Glade
2995 * config/gnome.m4: Gnome configuration scripts
2997 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2998 configure --help message
3000 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3001 only if there are no events pendling in Gnome/Gtk. This enhances
3002 the performance of menus.
3005 2000-08-14 Allan Rae <rae@lyx.org>
3007 * lib/Makefile.am: listerrors cleaning
3009 * lib/listerrors: removed -- generated file
3010 * acinclude.m4: ditto
3011 * sigc++/acinclude.m4: ditto
3013 * src/frontends/xforms/forms/form_citation.fd:
3014 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3017 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3018 `updatesrc` and now we have a `test` target that does what `updatesrc`
3019 used to do. I didn't like having an install target that wasn't related
3022 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3023 on all except FormGraphics. This may yet happen. Followed by a major
3024 cleanup including using FL_TRANSIENT for most of the dialogs. More
3025 changes to come when the ButtonController below is introduced.
3027 * src/frontends/xforms/ButtonController.h: New file for managing up to
3028 four buttons on a dialog according to an externally defined policy.
3029 * src/frontends/xforms/Makefile.am: added above
3031 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3032 Apply and Cancel/Close buttons and everything in between and beyond.
3033 * src/frontends/Makefile.am: added above.
3035 * src/frontends/xforms/forms/form_preferences.fd:
3036 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3037 and removed variable 'status' as a result. Fixed the set_minsize thing.
3038 Use the new screen-font-update after checking screen fonts were changed
3039 Added a "Restore" button to restore the original lyxrc values while
3040 editing. This restores everything not just the last input changed.
3041 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3043 * src/LyXAction.C: screen-font-update added for updating buffers after
3044 screen font settings have been changed.
3045 * src/commandtags.h: ditto
3046 * src/lyxfunc.C: ditto
3048 * forms/lyx.fd: removed screen fonts dialog.
3049 * src/lyx_gui.C: ditto
3050 * src/menus.[Ch]: ditto
3051 * src/lyx.[Ch]: ditto
3052 * src/lyx_cb.C: ditto + code from here moved to make
3053 screen-font-update. And people wonder why progress on GUII is
3054 slow. Look at how scattered this stuff was! It takes forever
3057 * forms/fdfix.sh: Fixup the spacing after commas.
3058 * forms/makefile: Remove date from generated files. Fewer clashes now.
3059 * forms/bullet_forms.C.patch: included someones handwritten changes
3061 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3062 once I've discovered why LyXRC was made noncopyable.
3063 * src/lyx_main.C: ditto
3065 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3067 * src/frontends/xforms/forms/fdfix.sh:
3068 * src/frontends/xforms/forms/fdfixh.sed:
3069 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3070 * src/frontends/xforms/Form*.[hC]:
3071 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3072 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3073 provide a destructor for the struct FD_form_xxxx. Another version of
3074 the set_[max|min]size workaround and a few other cleanups. Actually,
3075 Angus' patch from 20000809.
3077 2000-08-13 Baruch Even <baruch.even@writeme.com>
3079 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3082 2000-08-11 Juergen Vigna <jug@sad.it>
3084 * src/insets/insetgraphics.C (InsetGraphics): changing init
3085 order because of warnings.
3087 * src/frontends/xforms/forms/makefile: adding patching .C with
3090 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3091 from .C.patch to .c.patch
3093 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3094 order because of warning.
3096 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3098 * src/frontends/Liason.C (setMinibuffer): new helper function
3100 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3102 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3104 * lib/ui/default.ui: commented out PaperLayout entry
3106 * src/frontends/xforms/form_document.[Ch]: new added files
3108 * src/frontends/xforms/FormDocument.[Ch]: ditto
3110 * src/frontends/xforms/forms/form_document.fd: ditto
3112 * src/frontends/xforms/forms/form_document.C.patch: ditto
3114 2000-08-10 Juergen Vigna <jug@sad.it>
3116 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3117 (InsetGraphics): initialized cacheHandle to 0.
3118 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3120 2000-08-10 Baruch Even <baruch.even@writeme.com>
3122 * src/graphics/GraphicsCache.h:
3123 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3124 correctly as a cache.
3126 * src/graphics/GraphicsCacheItem.h:
3127 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3130 * src/graphics/GraphicsCacheItem_pimpl.h:
3131 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3134 * src/insets/insetgraphics.h:
3135 * src/insets/insetgraphics.C: Changed from using a signal notification
3136 to polling when image is not loaded.
3138 2000-08-10 Allan Rae <rae@lyx.org>
3140 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3141 that there are two functions that have to been taken out of line by
3142 hand and aren't taken care of in the script. (Just a reminder note)
3144 * sigc++/macros/*.h.m4: Updated as above.
3146 2000-08-09 Juergen Vigna <jug@sad.it>
3148 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3150 * src/insets/insettabular.C: make drawing of single cell smarter.
3152 2000-08-09 Marko Vendelin <markov@ioc.ee>
3153 * src/frontends/gnome/Menubar_pimpl.C
3154 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3155 implementation: new files
3157 * src/frontends/gnome/mainapp.C
3158 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3161 * src/main.C: create Gnome main window
3163 * src/frontends/xforms/Menubar_pimpl.h
3164 * src/frontends/Menubar.C
3165 * src/frontends/Menubar.h: added method Menubar::update that calls
3166 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3168 * src/LyXView.C: calls Menubar::update to update the state
3171 * src/frontends/gnome/Makefile.am: added new files
3173 * src/frontends/Makefile.am: added frontend compiler options
3175 2000-08-08 Juergen Vigna <jug@sad.it>
3177 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3179 * src/bufferlist.C (close):
3180 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3181 documents if exiting without saving.
3183 * src/buffer.C (save): use removeAutosaveFile()
3185 * src/support/filetools.C (removeAutosaveFile): new function.
3187 * src/lyx_cb.C (MenuWrite): returns a bool now.
3188 (MenuWriteAs): check if file could really be saved and revert to the
3190 (MenuWriteAs): removing old autosavefile if existant.
3192 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3193 before Goto toggle declaration, because of compiler warning.
3195 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3197 * src/lyxfunc.C (MenuNew): small fix.
3199 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3201 * src/bufferlist.C (newFile):
3202 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3204 * src/lyxrc.C: added new_ask_filename tag
3206 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3208 * src/lyx.fd: removed code pertaining to form_ref
3209 * src/lyx.[Ch]: ditto
3210 * src/lyx_cb.C: ditto
3211 * src/lyx_gui.C: ditto
3212 * src/lyx_gui_misc.C: ditto
3214 * src/BufferView_pimpl.C (restorePosition): update buffer only
3217 * src/commandtags.h (LFUN_REFTOGGLE): removed
3218 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3219 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3220 (LFUN_REFBACK): renamed LFUN_REF_BACK
3222 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3223 * src/menus.C: ditto
3224 * src/lyxfunc.C (Dispatch): ditto.
3225 InsertRef dialog is now GUI-independent.
3227 * src/texrow.C: added using std::endl;
3229 * src/insets/insetref.[Ch]: strip out large amounts of code.
3230 The inset is now a container and this functionality is now
3231 managed by a new FormRef dialog
3233 * src/frontends/Dialogs.h (showRef, createRef): new signals
3235 * src/frontends/xforms/FormIndex.[Ch],
3236 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3237 when setting dialog's min/max size
3238 * src/frontends/xforms/FormIndex.[Ch]: ditto
3240 * src/frontends/xforms/FormRef.[Ch],
3241 src/frontends/xforms/forms/form_ref.fd: new xforms
3242 implementation of an InsetRef dialog
3244 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3247 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3248 ios::nocreate is not part of the standard. Removed.
3250 2000-08-07 Baruch Even <baruch.even@writeme.com>
3252 * src/graphics/Renderer.h:
3253 * src/graphics/Renderer.C: Added base class for rendering of different
3254 image formats into Pixmaps.
3256 * src/graphics/XPM_Renderer.h:
3257 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3258 in a different class.
3260 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3261 easily add support for other formats.
3263 * src/insets/figinset.C: plugged a leak of an X resource.
3265 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3267 * src/CutAndPaste.[Ch]: make all metods static.
3269 * development/Code_rules/Rules: more work, added section on
3270 Exceptions, and a References section.
3272 * a lot of header files: work to make doc++ able to generate the
3273 source documentation, some workarounds of doc++ problems. Doc++ is
3274 now able to generate the documentation.
3276 2000-08-07 Juergen Vigna <jug@sad.it>
3278 * src/insets/insettabular.C (recomputeTextInsets): removed function
3280 * src/tabular.C (SetWidthOfMulticolCell):
3282 (calculate_width_of_column_NMC): fixed return value so that it really
3283 only returns true if the column-width has changed (there where
3284 problems with muliticolumn-cells in this column).
3286 2000-08-04 Juergen Vigna <jug@sad.it>
3288 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3289 also on the scrollstatus of the inset.
3290 (workAreaMotionNotify): ditto.
3292 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3294 2000-08-01 Juergen Vigna <jug@sad.it>
3296 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3298 * src/commandtags.h:
3299 * src/LyXAction.C (init):
3300 * src/insets/inset.C (LocalDispatch): added support for
3303 * src/insets/inset.C (scroll): new functions.
3305 * src/insets/insettext.C (removeNewlines): new function.
3306 (SetAutoBreakRows): removes forced newlines in the text of the
3307 paragraph if autoBreakRows is set to false.
3309 * src/tabular.C (Latex): generates a parbox around the cell contents
3312 * src/frontends/xforms/FormTabular.C (local_update): removed
3313 the radio_useparbox button.
3315 * src/tabular.C (UseParbox): new function
3317 2000-08-06 Baruch Even <baruch.even@writeme.com>
3319 * src/graphics/GraphicsCache.h:
3320 * src/graphics/GraphicsCache.C:
3321 * src/graphics/GraphicsCacheItem.h:
3322 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3325 * src/insets/insetgraphics.h:
3326 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3327 and the drawing of the inline image.
3329 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3330 loaded into the wrong position.
3332 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3335 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3337 * src/support/translator.h: move all typedefs to public section
3339 * src/support/filetools.C (MakeLatexName): return string const
3341 (TmpFileName): ditto
3342 (FileOpenSearch): ditto
3344 (LibFileSearch): ditto
3345 (i18nLibFileSearch): ditto
3348 (CreateTmpDir): ditto
3349 (CreateBufferTmpDir): ditto
3350 (CreateLyXTmpDir): ditto
3353 (MakeAbsPath): ditto
3355 (OnlyFilename): ditto
3357 (NormalizePath): ditto
3358 (CleanupPath): ditto
3359 (GetFileContents): ditto
3360 (ReplaceEnvironmentPath): ditto
3361 (MakeRelPath): ditto
3363 (ChangeExtension): ditto
3364 (MakeDisplayPath): ditto
3365 (do_popen): return cmdret const
3366 (findtexfile): return string const
3368 * src/support/DebugStream.h: add some /// to please doc++
3370 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3372 * src/texrow.C (same_rownumber): functor to use with find_if
3373 (getIdFromRow): rewritten to use find_if and to not update the
3374 positions. return true if row is found
3375 (increasePos): new method, use to update positions
3377 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3379 * src/lyxlex_pimpl.C (verifyTable): new method
3382 (GetString): return string const
3383 (pushTable): rewrite to use std::stack
3385 (setFile): better check
3388 * src/lyxlex.h: make LyXLex noncopyable
3390 * src/lyxlex.C (text): return char const * const
3391 (GetString): return string const
3392 (getLongString): return string const
3394 * src/lyx_gui_misc.C (askForText): return pair<...> const
3396 * src/lastfiles.[Ch] (operator): return string const
3398 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3399 istringstream not char const *.
3400 move token.end() out of loop.
3401 (readFile): move initializaton of token
3403 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3404 getIdFromRow is successful.
3406 * lib/bind/emacs.bind: don't include menus bind
3408 * development/Code_rules/Rules: the beginnings of making this
3409 better and covering more of the unwritten rules that we have.
3411 * development/Code_rules/Recommendations: a couple of wording
3414 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3416 * src/support/strerror.c: remove C++ comment.
3418 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3420 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3421 LFUN_INDEX_INSERT_LAST
3423 * src/texrow.C (getIdFromRow): changed from const_iterator to
3424 iterator, allowing code to compile with DEC cxx
3426 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3427 stores part of the class, as suggested by Allan. Will allow
3429 (apply): test to apply uses InsetCommandParams operator!=
3431 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3432 (apply): test to apply uses InsetCommandParams operator!=
3434 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3435 stores part of the class.
3436 (update): removed limits on min/max size.
3438 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3439 (apply): test to apply uses InsetCommandParams operator!=
3441 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3442 (Read, Write, scanCommand, getCommand): moved functionality
3443 into InsetCommandParams.
3445 (getScreenLabel): made pure virtual
3446 new InsetCommandParams operators== and !=
3448 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3449 c-tors based on InsetCommandParams. Removed others.
3450 * src/insets/insetinclude.[Ch]: ditto
3451 * src/insets/insetlabel.[Ch]: ditto
3452 * src/insets/insetparent.[Ch]: ditto
3453 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3455 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3456 insets derived from InsetCommand created using similar c-tors
3457 based on InsetCommandParams
3458 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3459 * src/menus.C (ShowRefsMenu): ditto
3460 * src/paragraph.C (Clone): ditto
3461 * src/text2.C (SetCounter): ditto
3462 * src/lyxfunc.C (Dispatch) ditto
3463 Also recreated old InsetIndex behaviour exactly. Can now
3464 index-insert at the start of a paragraph and index-insert-last
3465 without launching the pop-up.
3467 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3469 * lib/lyxrc.example: mark te pdf options as non functional.
3471 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3472 (isStrDbl): move tmpstr.end() out of loop.
3473 (strToDbl): move intialization of tmpstr
3474 (lowercase): return string const and move tmp.end() out of loop.
3475 (uppercase): return string const and move tmp.edn() out of loop.
3476 (prefixIs): add assertion
3481 (containsOnly): ditto
3482 (containsOnly): ditto
3483 (containsOnly): ditto
3484 (countChar): make last arg char not char const
3485 (token): return string const
3486 (subst): return string const, move tmp.end() out of loop.
3487 (subst): return string const, add assertion
3488 (strip): return string const
3489 (frontStrip): return string const, add assertion
3490 (frontStrip): return string const
3495 * src/support/lstrings.C: add inclde "LAssert.h"
3496 (isStrInt): move tmpstr.end() out of loop.
3498 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3499 toollist.end() out of loop.
3500 (deactivate): move toollist.end() out of loop.
3501 (update): move toollist.end() out of loop.
3502 (updateLayoutList): move tc.end() out of loop.
3503 (add): move toollist.end() out of loop.
3505 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3506 md.end() out of loop.
3508 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3510 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3513 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3514 (Erase): move insetlist.end() out of loop.
3516 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3517 ref to const string as first arg. Move initialization of some
3518 variables, whitespace changes.
3520 * src/kbmap.C (defkey): move table.end() out of loop.
3521 (kb_keymap): move table.end() out of loop.
3522 (findbinding): move table.end() out of loop.
3524 * src/MenuBackend.C (hasMenu): move end() out of loop.
3525 (getMenu): move end() out of loop.
3526 (getMenu): move menulist_.end() out of loop.
3528 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3530 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3533 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3534 (getFromLyXName): move infotab.end() out of loop.
3536 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3537 -fvtable-thunks -ffunction-sections -fdata-sections
3539 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3541 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3544 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3546 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3548 * src/frontends/xforms/FormCitation.[Ch],
3549 src/frontends/xforms/FormIndex.[Ch],
3550 src/frontends/xforms/FormToc.[Ch],
3551 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3553 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3555 * src/commandtags.h: renamed, created some flags for citation
3558 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3560 * src/lyxfunc.C (dispatch): use signals to insert index entry
3562 * src/frontends/Dialogs.h: new signal createIndex
3564 * src/frontends/xforms/FormCommand.[Ch],
3565 src/frontends/xforms/FormCitation.[Ch],
3566 src/frontends/xforms/FormToc.[Ch],
3567 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3569 * src/insets/insetindex.[Ch]: GUI-independent
3571 * src/frontends/xforms/FormIndex.[Ch],
3572 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3575 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3577 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3578 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3580 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3582 * src/insets/insetref.C (Latex): rewrite so that there is now
3583 question that a initialization is requested.
3585 * src/insets/insetcommand.h: reenable the hide signal
3587 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3589 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3590 fix handling of shortcuts (many bugs :)
3591 (add_lastfiles): ditto.
3593 * lib/ui/default.ui: fix a few shortcuts.
3595 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3597 * Makefile.am: Fix ``rpmdist'' target to return the exit
3598 status of the ``rpm'' command, instead of the last command in
3599 the chain (the ``rm lyx.xpm'' command, which always returns
3602 2000-08-02 Allan Rae <rae@lyx.org>
3604 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3605 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3606 * src/frontends/xforms/FormToc.C (FormToc): ditto
3608 * src/frontends/xforms/Makefile.am: A few forgotten files
3610 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3611 Signals-not-copyable-problem Lars' started commenting out.
3613 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3615 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3617 * src/insets/insetcommand.h: Signals is not copyable so anoter
3618 scheme for automatic hiding of forms must be used.
3620 * src/frontends/xforms/FormCitation.h: don't inerit from
3621 noncopyable, FormCommand already does that.
3622 * src/frontends/xforms/FormToc.h: ditto
3623 * src/frontends/xforms/FormUrl.h: ditto
3625 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3627 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3629 * src/insets/insetcommand.h (hide): new SigC::Signal0
3630 (d-tor) new virtual destructor emits hide signal
3632 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3633 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3635 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3636 LOF and LOT. Inset is now GUI-independent
3638 * src/insets/insetloa.[Ch]: redundant
3639 * src/insets/insetlof.[Ch]: ditto
3640 * src/insets/insetlot.[Ch]: ditto
3642 * src/frontends/xforms/forms/form_url.fd: tweaked!
3643 * src/frontends/xforms/forms/form_citation.fd: ditto
3645 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3646 dialogs dealing with InsetCommand insets
3648 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3649 FormCommand base class
3650 * src/frontends/xforms/FormUrl.[Ch]: ditto
3652 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3654 * src/frontends/xforms/FormToc.[Ch]: ditto
3656 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3657 passed a generic InsetCommand pointer
3658 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3660 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3661 and modified InsetTOC class
3662 * src/buffer.C: ditto
3664 * forms/lyx.fd: strip out old FD_form_toc code
3665 * src/lyx_gui_misc.C: ditto
3666 * src/lyx_gui.C: ditto
3667 * src/lyx_cb.C: ditto
3668 * src/lyx.[Ch]: ditto
3670 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3672 * src/support/utility.hpp: tr -d '\r'
3674 2000-08-01 Juergen Vigna <jug@sad.it>
3676 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3678 * src/commandtags.h:
3679 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3680 LFUN_TABULAR_FEATURES.
3682 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3683 LFUN_LAYOUT_TABULAR.
3685 * src/insets/insettabular.C (getStatus): implemented helper function.
3687 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3689 2000-07-31 Juergen Vigna <jug@sad.it>
3691 * src/text.C (draw): fixed screen update problem for text-insets.
3693 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3694 something changed probably this has to be added in various other
3697 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3699 2000-07-31 Baruch Even <baruch.even@writeme.com>
3701 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3702 templates to satisfy compaq cxx.
3705 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3707 * src/support/translator.h (equal_1st_in_pair::operator()): take
3708 const ref pair_type as arg.
3709 (equal_2nd_in_pair::operator()): ditto
3710 (Translator::~Translator): remove empty d-tor.
3712 * src/graphics/GraphicsCache.C: move include config.h to top, also
3713 put initialization of GraphicsCache::singleton here.
3714 (~GraphicsCache): move here
3715 (addFile): take const ref as arg
3718 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3720 * src/BufferView2.C (insertLyXFile): change te with/without header
3723 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3725 * src/frontends/xforms/FormGraphics.C (apply): add some
3726 static_cast. Not very nice, but required by compaq cxx.
3728 * src/frontends/xforms/RadioButtonGroup.h: include header
3729 <utility> instead of <pair.h>
3731 * src/insets/insetgraphicsParams.C: add using directive.
3732 (readResize): change return type to void.
3733 (readOrigin): ditto.
3735 * src/lyxfunc.C (getStatus): add missing break for build-program
3736 function; add test for Literate for export functions.
3738 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3739 entries in Options menu.
3741 2000-07-31 Baruch Even <baruch.even@writeme.com>
3743 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3744 protect against auto-allocation; release icon when needed.
3746 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3748 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3749 on usual typewriter.
3751 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3752 earlier czech.kmap), useful only for programming.
3754 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3756 * src/frontends/xforms/FormCitation.h: fix conditioning around
3759 2000-07-31 Juergen Vigna <jug@sad.it>
3761 * src/frontends/xforms/FormTabular.C (local_update): changed
3762 radio_linebreaks to radio_useparbox and added radio_useminipage.
3764 * src/tabular.C: made support for using minipages/parboxes.
3766 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3768 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3770 (descent): so the cursor is in the middle.
3771 (width): bit smaller box.
3773 * src/insets/insetgraphics.h: added display() function.
3775 2000-07-31 Baruch Even <baruch.even@writeme.com>
3777 * src/frontends/Dialogs.h: Added showGraphics signals.
3779 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3780 xforms form definition of the graphics dialog.
3782 * src/frontends/xforms/FormGraphics.h:
3783 * src/frontends/xforms/FormGraphics.C: Added files, the
3784 GUIndependent code of InsetGraphics
3786 * src/insets/insetgraphics.h:
3787 * src/insets/insetgraphics.C: Major writing to make it work.
3789 * src/insets/insetgraphicsParams.h:
3790 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3791 struct between InsetGraphics and GUI.
3793 * src/LaTeXFeatures.h:
3794 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3795 support for graphicx package.
3797 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3798 for the graphics inset.
3800 * src/support/translator.h: Added file, used in
3801 InsetGraphicsParams. this is a template to translate between two
3804 * src/frontends/xforms/RadioButtonGroup.h:
3805 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3806 way to easily control a radio button group.
3808 2000-07-28 Juergen Vigna <jug@sad.it>
3810 * src/insets/insettabular.C (LocalDispatch):
3811 (TabularFeatures): added support for lyx-functions of tabular features.
3812 (cellstart): refixed this function after someone wrongly changed it.
3814 * src/commandtags.h:
3815 * src/LyXAction.C (init): added support for tabular-features
3817 2000-07-28 Allan Rae <rae@lyx.org>
3819 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3820 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3821 triggers the callback for input checking. As a result we sometimes get
3822 "LyX: This shouldn't happen..." printed to cerr.
3823 (input): Started using status variable since I only free() on
3824 destruction. Some input checking for paths and font sizes.
3826 * src/frontends/xforms/FormPreferences.h: Use status to control
3827 activation of Ok and Apply
3829 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3830 callback. Also resized to stop segfaults with 0.88. The problem is
3831 that xforms-0.88 requires the folder to be wide enough to fit all the
3832 tabs. If it isn't it causes all sorts of problems.
3834 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3836 * src/frontends/xforms/forms/README: Reflect reality.
3838 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3839 * src/frontends/xforms/forms/makefile: ditto.
3841 * src/commandtags.h: Get access to new Preferences dialog
3842 * src/LyXAction.C: ditto
3843 * src/lyxfunc.C: ditto
3844 * lib/ui/default.ui: ditto
3846 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3848 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3850 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3853 * src/frontends/xforms/form_url.[Ch]: added.
3855 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3857 * src/insets/insetbib.h: fixed bug in previous commit
3859 * src/frontends/xforms/FormUrl.h: ditto
3861 * src/frontends/xforms/FormPrint.h: ditto
3863 * src/frontends/xforms/FormPreferences.h: ditto
3865 * src/frontends/xforms/FormCopyright.h: ditto
3867 * src/frontends/xforms/FormCitation.C: ditto
3869 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3870 private copyconstructor and private default contructor
3872 * src/support/Makefile.am: add utility.hpp
3874 * src/support/utility.hpp: new file from boost
3876 * src/insets/insetbib.h: set owner in clone
3878 * src/frontends/xforms/FormCitation.C: added missing include
3881 * src/insets/form_url.[Ch]: removed
3883 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3885 * development/lyx.spec.in
3886 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3887 file/directory re-organization.
3889 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3891 * src/insets/insetcommand.[Ch]: moved the string data and
3892 associated manipulation methods into a new stand-alone class
3893 InsetCommandParams. This class has two additional methods
3894 getAsString() and setFromString() allowing the contents to be
3895 moved around as a single string.
3896 (addContents) method removed.
3897 (setContents) method no longer virtual.
3899 * src/buffer.C (readInset): made use of new InsetCitation,
3900 InsetUrl constructors based on InsetCommandParams.
3902 * src/commandtags.h: add LFUN_INSERT_URL
3904 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3905 independent InsetUrl and use InsetCommandParams to extract
3906 string info and create new Insets.
3908 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3910 * src/frontends/xforms/FormCitation.C (apply): uses
3913 * src/frontends/xforms/form_url.C
3914 * src/frontends/xforms/form_url.h
3915 * src/frontends/xforms/FormUrl.h
3916 * src/frontends/xforms/FormUrl.C
3917 * src/frontends/xforms/forms/form_url.fd: new files
3919 * src/insets/insetcite.[Ch]: removed unused constructors.
3921 * src/insets/insetinclude.[Ch]: no longer store filename
3923 * src/insets/inseturl.[Ch]: GUI-independent.
3925 2000-07-26 Juergen Vigna <jug@sad.it>
3926 * renamed frontend from gtk to gnome as it is that what is realized
3927 and did the necessary changes in the files.
3929 2000-07-26 Marko Vendelin <markov@ioc.ee>
3931 * configure.in: cleaning up gnome configuration scripts
3933 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3935 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3936 shortcuts syndrom by redrawing them explicitely (a better solution
3937 would be appreciated).
3939 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3941 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3944 * src/lyx_cb.C (MenuExport): change html export to do the right
3945 thing depending of the document type (instead of having
3946 html-linuxdoc and html-docbook).
3947 * src/lyxfunc.C (getStatus): update for html
3948 * lib/ui/default.ui: simplify due to the above change.
3949 * src/menus.C (ShowFileMenu): update too (in case we need it).
3951 * src/MenuBackend.C (read): if a menu is defined twice, add the
3952 new entries to the exiting one.
3954 2000-07-26 Juergen Vigna <jug@sad.it>
3956 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3958 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3959 and return a bool if it did actual save the file.
3960 (AutoSave): don't autosave a unnamed doc.
3962 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3963 check if this is an UNNAMED new file and react to it.
3964 (newFile): set buffer to unnamed and change to not mark a new
3965 buffer dirty if I didn't do anything with it.
3967 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3969 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3971 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3972 friend as per Angus's patch posted to lyx-devel.
3974 * src/ext_l10n.h: updated
3976 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3977 gettext on the style string right before inserting them into the
3980 * autogen.sh: add code to extract style strings form layout files,
3981 not good enough yet.
3983 * src/frontends/gtk/.cvsignore: add MAKEFILE
3985 * src/MenuBackend.C (read): run the label strings through gettext
3986 before storing them in the containers.
3988 * src/ext_l10n.h: new file
3990 * autogen.sh : generate the ext_l10n.h file here
3992 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3994 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3997 * lib/ui/default.ui: fix a couple of typos.
3999 * config/gnome/gtk.m4: added (and added to the list of files in
4002 * src/insets/insetinclude.C (unique_id): fix when we are using
4003 lyxstring instead of basic_string<>.
4004 * src/insets/insettext.C (LocalDispatch): ditto.
4005 * src/support/filetools.C: ditto.
4007 * lib/configure.m4: create the ui/ directory if necessary.
4009 * src/LyXView.[Ch] (updateToolbar): new method.
4011 * src/BufferView_pimpl.C (buffer): update the toolbar when
4012 opening/closing buffer.
4014 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4016 * src/LyXAction.C (getActionName): enhance to return also the name
4017 and options of pseudo-actions.
4018 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4020 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4021 as an example of what is possible). Used in File->Build too (more
4022 useful) and in the import/export menus (to mimick the complicated
4023 handling of linuxdoc and friends). Try to update all the entries.
4025 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4028 * src/MenuBackend.C (read): Parse the new OptItem tag.
4030 * src/MenuBackend.h: Add a new optional_ data member (used if the
4031 entry should be omitted when the lyxfunc is disabled).
4033 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4034 function, used as a shortcut.
4035 (create_submenu): align correctly the shortcuts on the widest
4038 * src/MenuBackend.h: MenuItem.label() only returns the label of
4039 the menu without shortcut; new method shortcut().
4041 2000-07-14 Marko Vendelin <markov@ioc.ee>
4043 * src/frontends/gtk/Dialogs.C:
4044 * src/frontends/gtk/FormCopyright.C:
4045 * src/frontends/gtk/FormCopyright.h:
4046 * src/frontends/gtk/Makefile.am: added these source-files for the
4047 Gtk/Gnome support of the Copyright-Dialog.
4049 * src/main.C: added Gnome::Main initialization if using
4050 Gtk/Gnome frontend-GUI.
4052 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4054 * config/gnome/aclocal-include.m4
4055 * config/gnome/compiler-flags.m4
4056 * config/gnome/curses.m4
4057 * config/gnome/gnome--.m4
4058 * config/gnome/gnome-bonobo-check.m4
4059 * config/gnome/gnome-common.m4
4060 * config/gnome/gnome-fileutils.m4
4061 * config/gnome/gnome-ghttp-check.m4
4062 * config/gnome/gnome-gnorba-check.m4
4063 * config/gnome/gnome-guile-checks.m4
4064 * config/gnome/gnome-libgtop-check.m4
4065 * config/gnome/gnome-objc-checks.m4
4066 * config/gnome/gnome-orbit-check.m4
4067 * config/gnome/gnome-print-check.m4
4068 * config/gnome/gnome-pthread-check.m4
4069 * config/gnome/gnome-support.m4
4070 * config/gnome/gnome-undelfs.m4
4071 * config/gnome/gnome-vfs.m4
4072 * config/gnome/gnome-x-checks.m4
4073 * config/gnome/gnome-xml-check.m4
4074 * config/gnome/gnome.m4
4075 * config/gnome/gperf-check.m4
4076 * config/gnome/gtk--.m4
4077 * config/gnome/linger.m4
4078 * config/gnome/need-declaration.m4: added configuration scripts
4079 for Gtk/Gnome frontend-GUI
4081 * configure.in: added support for the --with-frontend=gtk option
4083 * autogen.sh: added config/gnome/* to list of config-files
4085 * acconfig.h: added define for GTKGUI-support
4087 * config/lyxinclude.m4: added --with-frontend[=value] option value
4088 for Gtk/Gnome frontend-GUI support.
4090 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4092 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4096 * src/paragraph.C (GetChar): remove non-const version
4098 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4099 (search_kw): use it.
4101 * src/lyx_main.C (init): if "preferences" exist, read that instead
4103 (ReadRcFile): return bool if the file could be read ok.
4104 (ReadUIFile): add a check to see if lex file is set ok.
4106 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4107 bastring can be used instead of lyxstring (still uses the old code
4108 if std::string is good enough or if lyxstring is used.)
4110 * src/encoding.C: make the arrays static, move ininle functions
4112 * src/encoding.h: from here.
4114 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4115 (parseSingleLyXformat2Token): move inset parsing to separate method
4116 (readInset): new private method
4118 * src/Variables.h: remove virtual from get().
4120 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4121 access to NEW_INSETS and NEW_TABULAR
4123 * src/MenuBackend.h: remove superfluous forward declaration of
4124 MenuItem. Add documentations tags "///", remove empty MenuItem
4125 destructor, remove private default contructor.
4127 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4129 (read): more string mlabel and mname to where they are used
4130 (read): remove unused variables mlabel and mname
4131 (defaults): unconditional clear, make menusetup take advantage of
4132 add returning Menu &.
4134 * src/LyXView.h: define NEW_MENUBAR as default
4136 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4137 to NEW_INSETS and NEW_TABULAR.
4138 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4139 defined. Change some of the "xxxx-inset-insert" functions names to
4142 * several files: more enahncements to NEW_INSETS and the resulting
4145 * lib/lyxrc.example (\date_insert_format): move to misc section
4147 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4148 bastring and use AC_CACHE_CHECK.
4149 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4150 the system have the newest methods. uses AC_CACHE_CHECK
4151 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4152 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4153 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4155 * configure.in: add LYX_CXX_GOOD_STD_STRING
4157 * acinclude.m4: recreated
4159 2000-07-24 Amir Karger <karger@lyx.org>
4161 * README: add Hebrew, Arabic kmaps
4164 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4166 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4169 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4171 * Lot of files: add pragma interface/implementation.
4173 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4175 * lib/ui/default.ui: new file (ans new directory). Contains the
4176 default menu and toolbar.
4178 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4179 global space. Toolbars are now read (as menus) in ui files.
4181 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4183 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4184 is disabled because the document is read-only. We want to have the
4185 toggle state of the function anyway.
4186 (getStatus): add code for LFUN_VC* functions (mimicking what is
4187 done in old-style menus)
4189 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4190 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4192 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4193 * src/BufferView_pimpl.C: ditto.
4194 * src/lyxfunc.C: ditto.
4196 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4197 default). This replaces old-style menus by new ones.
4199 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4200 MenuItem. Contain the data structure of a menu.
4202 * src/insets/insettext.C: use LyXView::setLayout instead of
4203 accessing directly the toolbar combox.
4204 * src/lyxfunc.C (Dispatch): ditto.
4206 * src/LyXView.C (setLayout): new method, which just calls
4207 Toolbar::setLayout().
4208 (updateLayoutChoice): move part of this method in Toolbar.
4210 * src/toolbar.[Ch]: removed.
4212 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4213 implementation the toolbar.
4215 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4216 the toolbar. It might make sense to merge it with ToolbarDefaults
4218 (setLayout): new function.
4219 (updateLayoutList): ditto.
4220 (openLayoutList): ditto.
4222 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4223 xforms implementation of the toolbar.
4224 (get_toolbar_func): comment out, since I do not
4225 know what it is good for.
4227 * src/ToolbarDefaults.h: Add the ItemType enum.
4229 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4230 for a list of allocated C strings. Used in Menubar xforms
4231 implementation to avoid memory leaks.
4233 * src/support/lstrings.[Ch] (uppercase): new version taking and
4237 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4238 * lib/bind/emacs.bind: ditto.
4240 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4242 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4243 forward decl of LyXView.
4245 * src/toolbar.C (toolbarItem): moved from toolbar.h
4246 (toolbarItem::clean): ditto
4247 (toolbarItem::~toolbarItem): ditto
4248 (toolbarItem::operator): ditto
4250 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4252 * src/paragraph.h: control the NEW_TABULAR define from here
4254 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4255 USE_TABULAR_INSETS to NEW_TABULAR
4257 * src/ToolbarDefaults.C: add include "lyxlex.h"
4259 * files using the old table/tabular: use NEW_TABULAR to control
4260 compilation of old tabular stuff.
4262 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4265 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4266 planemet in reading of old style floats, fix the \end_deeper
4267 problem when reading old style floats.
4269 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4271 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4273 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4275 * lib/bind/sciword.bind: updated.
4277 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4279 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4280 layout write problem
4282 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4284 * src/Makefile.am (INCLUDES): remove image directory from include
4287 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4288 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4290 * src/LyXView.C (create_form_form_main): read the application icon
4293 * lib/images/*.xpm: change the icons to use transparent color for
4296 * src/toolbar.C (update): change the color of the button when it
4299 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4301 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4302 setting explicitely the minibuffer.
4303 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4305 * src/LyXView.C (showState): new function. Shows font information
4306 in minibuffer and update toolbar state.
4307 (LyXView): call Toolbar::update after creating the
4310 * src/toolbar.C: change toollist to be a vector instead of a
4312 (BubbleTimerCB): get help string directly from the callback
4313 argument of the corresponding icon (which is the action)
4314 (set): remove unnecessary ugliness.
4315 (update): new function. update the icons (depressed, disabled)
4316 depending of the status of the corresponding action.
4318 * src/toolbar.h: remove help in toolbarItem
4320 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4322 * src/Painter.C (text): Added code for using symbol glyphs from
4323 iso10646 fonts. Currently diabled.
4325 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4328 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4329 magyar,turkish and usorbian.
4331 * src/paragraph.C (isMultiLingual): Made more efficient.
4333 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4336 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4337 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4338 Also changed the prototype to "bool math_insert_greek(char)".
4340 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4342 * lots of files: apply the NEW_INSETS on all code that will not be
4343 needed when we move to use the new insets. Enable the define in
4344 lyxparagrah.h to try it.
4346 * src/insets/insettabular.C (cellstart): change to be a static
4348 (InsetTabular): initialize buffer in the initializer list.
4350 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4352 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4353 form_print.h out of the header file. Replaced with forward
4354 declarations of the relevant struct.
4356 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4359 * src/commandtags.h: do not include "debug.h" which does not
4360 belong there. #include it in some other places because of this
4363 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4365 * src/insets/insetcaption.C: add a couple "using" directives.
4367 * src/toolbar.C (add): get the help text directly from lyxaction.
4369 (setPixmap): new function. Loads from disk and sets a pixmap on a
4370 botton; the name of the pixmap file is derived from the command
4373 * src/toolbar.h: remove members isBitmap and pixmap from
4376 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4377 * lib/images/: move many files from images/banner.xpm.
4379 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4381 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4382 * src/toolbar.C: ditto.
4383 * configure.in: ditto.
4384 * INSTALL: document.
4386 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4387 the spellchecker popup is closed from the WM.
4389 2000-07-19 Juergen Vigna <jug@sad.it>
4391 * src/insets/insetfloat.C (Write): small fix because we use the
4392 insetname for the type now!
4394 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4396 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4399 * src/frontends/Dialogs.h: removed hideCitation signal
4401 * src/insets/insetcite.h: added hide signal
4403 * src/insets/insetcite.C (~InsetCitation): emits new signal
4404 (getScreenLabel): "intelligent" label should now fit on the screen!
4406 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4408 * src/frontends/xforms/FormCitation.C (showInset): connects
4409 hide() to the inset's hide signal
4410 (show): modified to use fl_set_object_position rather than
4411 fl_set_object_geometry wherever possible
4413 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4415 * src/insets/lyxinset.h: add caption code
4417 * src/insets/insetfloat.C (type): new method
4419 * src/insets/insetcaption.C (Write): new method
4421 (LyxCode): new method
4423 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4424 to get it right together with using the FloatList.
4426 * src/commandtags.h: add LFUN_INSET_CAPTION
4427 * src/lyxfunc.C (Dispatch): handle it
4429 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4432 * src/Variables.[Ch]: make expand take a const reference, remove
4433 the destructor, some whitespace changes.
4435 * src/LyXAction.C (init): add caption-inset-insert
4437 * src/FloatList.C (FloatList): update the default floats a bit.
4439 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4441 * src/Variables.[Ch]: new files. Intended to be used for language
4442 specific strings (like \chaptername) and filename substitution in
4445 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4447 * lib/kbd/american.kmap: update
4449 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4451 * src/bufferparams.[Ch]: remove member allowAccents.
4453 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4455 * src/LaTeXLog.C: use the log_form.h header.
4456 * src/lyx_gui.C: ditto.
4457 * src/lyx_gui_misc.C: ditto.
4458 * src/lyxvc.h: ditto.
4460 * forms/log_form.fd: new file, created from latexoptions.fd. I
4461 kept the log popup and nuked the options form.
4463 * src/{la,}texoptions.[Ch]: removed.
4464 * src/lyx_cb.C (LaTeXOptions): ditto
4466 * src/lyx_gui.C (create_forms): do not handle the
4467 fd_latex_options form.
4469 2000-07-18 Juergen Vigna <jug@sad.it>
4471 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4472 name of the inset so that it can be requested outside (text2.C).
4474 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4477 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4479 * src/mathed/formula.h (ConvertFont): constify
4481 * src/mathed/formula.C (Read): add warning if \end_inset is not
4482 found on expected place.
4484 * src/insets/lyxinset.h (ConvertFont): consify
4486 * src/insets/insetquotes.C (ConvertFont): constify
4487 * src/insets/insetquotes.h: ditto
4489 * src/insets/insetinfo.h: add labelfont
4491 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4492 (ascent): use labelfont
4496 (Write): make .lyx file a bit nicer
4498 * src/insets/insetfloat.C (Write): simplify somewhat...
4499 (Read): add warning if arg is not found
4501 * src/insets/insetcollapsable.C: add using std::max
4502 (Read): move string token and add warning in arg is not found
4503 (draw): use std::max to get the right ty
4504 (getMaxWidth): simplify by using std::max
4506 * src/insets/insetsection.h: new file
4507 * src/insets/insetsection.C: new file
4508 * src/insets/insetcaption.h: new file
4509 * src/insets/insetcaption.C: new file
4511 * src/insets/inset.C (ConvertFont): constify signature
4513 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4514 insetcaption.[Ch] and insetsection.[Ch]
4516 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4517 uses to use LABEL_COUNTER_CHAPTER instead.
4518 * src/text2.C (SetCounter): here
4520 * src/counters.h: new file
4521 * src/counters.C: new file
4522 * src/Sectioning.h: new file
4523 * src/Sectioning.C: new file
4525 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4527 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4529 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4532 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4535 2000-07-17 Juergen Vigna <jug@sad.it>
4537 * src/tabular.C (Validate): check if array-package is needed.
4538 (SetVAlignment): added support for vertical alignment.
4539 (SetLTFoot): better support for longtable header/footers
4540 (Latex): modified to support added features.
4542 * src/LaTeXFeatures.[Ch]: added array-package.
4544 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4546 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4549 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4551 * configure.in: do not forget to put a space after -isystem.
4553 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4555 * lib/kbd/arabic.kmap: a few fixes.
4557 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4559 * some whitespace chagnes to a number of files.
4561 * src/support/DebugStream.h: change to make it easier for
4562 doc++ to parse correctly.
4563 * src/support/lyxstring.h: ditto
4565 * src/mathed/math_utils.C (compara): change to have only one
4567 (MathedLookupBOP): change because of the above.
4569 * src/mathed/math_delim.C (math_deco_compare): change to have only
4571 (search_deco): change becasue of the above.
4573 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4574 instead of manually coded one.
4576 * src/insets/insetquotes.C (Read): read the \end_inset too
4578 * src/insets/insetlatex.h: remove file
4579 * src/insets/insetlatex.C: remove file
4581 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4583 (InsetPrintIndex): remove destructor
4585 * src/insets/insetinclude.h: remove default constructor
4587 * src/insets/insetfloat.C: work to make it work better
4589 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4591 * src/insets/insetcite.h (InsetCitation): remove default constructor
4593 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4595 * src/text.C (GetColumnNearX): comment out some currently unused code.
4597 * src/paragraph.C (writeFile): move some initializations closer to
4599 (CutIntoMinibuffer): small change to use new matchIT operator
4603 (InsertInset): ditto
4606 (InsetIterator): ditto
4607 (Erase): small change to use new matchFT operator
4609 (GetFontSettings): ditto
4610 (HighestFontInRange): ditto
4613 * src/lyxparagraph.h: some chars changed to value_type
4614 (matchIT): because of some stronger checking (perhaps too strong)
4615 in SGI STL, the two operator() unified to one.
4618 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4620 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4621 the last inset read added
4622 (parseSingleLyXformat2Token): some more (future) compability code added
4623 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4624 (parseSingleLyXformat2Token): set last_inset_read
4625 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4626 (parseSingleLyXformat2Token): don't double intializw string next_token
4628 * src/TextCache.C (text_fits::operator()): add const's to the signature
4629 (has_buffer::operator()): ditto
4631 * src/Floating.h: add some comments on the class
4633 * src/FloatList.[Ch] (typeExist): new method
4636 * src/BackStack.h: added default constructor, wanted by Gcc.
4638 2000-07-14 Juergen Vigna <jug@sad.it>
4640 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4642 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4644 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4645 do a redraw when the window is resized!
4646 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4648 * src/insets/insettext.C (resizeLyXText): added function to correctly
4649 being able to resize the LyXWindow.
4651 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4653 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4655 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4656 crashes when closing dialog to a deleted inset.
4658 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4659 method! Now similar to other insets.
4661 2000-07-13 Juergen Vigna <jug@sad.it>
4663 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4665 * lib/examples/Literate.lyx: small patch!
4667 * src/insets/insetbib.C (Read): added this function because of wrong
4668 Write (without [begin|end]_inset).
4670 2000-07-11 Juergen Vigna <jug@sad.it>
4672 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4673 as the insertInset could not be good!
4675 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4676 the bool param should not be last.
4678 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4680 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4681 did submit that to Karl).
4683 * configure.in: use -isystem instead of -I for X headers. This
4684 fixes a problem on solaris with a recent gcc;
4685 put the front-end code after the X detection code;
4686 configure in sigc++ before lib/
4688 * src/lyx_main.C (commandLineHelp): remove -display from command
4691 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4693 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4694 Also put in Makefile rules for building the ``listerrors''
4695 program for parsing errors from literate programs written in LyX.
4697 * lib/build-listerrors: Added small shell script as part of compile
4698 process. This builds a working ``listerrors'' binary if noweb is
4699 installed and either 1) the VNC X server is installed on the machine,
4700 or 2) the user is compiling from within a GUI. The existence of a GUI
4701 is necessary to use the ``lyx --export'' feature for now. This
4702 hack can be removed once ``lyx --export'' no longer requires a GUI to
4705 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4707 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4708 now passed back correctly from gcc and placed "under" error
4709 buttons in a Literate LyX source.
4711 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4713 * src/text.C (GetColumnNearX): Better behavior when a RTL
4714 paragraph is ended by LTR text.
4716 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4719 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4721 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4722 true when clipboard is empty.
4724 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4726 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4727 row of the paragraph.
4728 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4729 to prevent calculation of bidi tables
4731 2000-07-07 Juergen Vigna <jug@sad.it>
4733 * src/screen.C (ToggleSelection): added y_offset and x_offset
4736 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4739 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4741 * src/insets/insettext.C: fixed Layout-Display!
4743 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4745 * configure.in: add check for strings.h header.
4747 * src/spellchecker.C: include <strings.h> in order to have a
4748 definition for bzero().
4750 2000-07-07 Juergen Vigna <jug@sad.it>
4752 * src/insets/insettext.C (draw): set the status of the bv->text to
4753 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4755 * src/screen.C (DrawOneRow):
4756 (DrawFromTo): redraw the actual row if something has changed in it
4759 * src/text.C (draw): call an update of the toplevel-inset if something
4760 has changed inside while drawing.
4762 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4764 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4766 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4767 processing inside class.
4769 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4770 processing inside class.
4772 * src/insets/insetindex.h new struct Holder, consistent with other
4775 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4776 citation dialog from main code and placed it in src/frontends/xforms.
4777 Dialog launched through signals instead of callbacks
4779 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4781 * lyx.man: update the options description.
4783 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4785 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4786 handle neg values, set min width to 590, add doc about -display
4788 2000-07-05 Juergen Vigna <jug@sad.it>
4790 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4791 calls to BufferView *.
4793 * src/insets/insettext.C (checkAndActivateInset): small fix non
4794 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4796 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4797 their \end_inset token!
4799 2000-07-04 edscott <edscott@imp.mx>
4801 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4802 lib/lyxrc.example: added option \wheel_jump
4804 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4806 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4807 remove support for -width,-height,-xpos and -ypos.
4809 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4811 * src/encoding.[Ch]: New files.
4813 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4814 (text): Call to the underline() method only when needed.
4816 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4818 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4819 encoding(s) for the document.
4821 * src/bufferparams.C (BufferParams): Changed default value of
4824 * src/language.C (newLang): Removed.
4825 (items[]): Added encoding information for all defined languages.
4827 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4828 encoding choice button.
4830 * src/lyxrc.h (font_norm_type): New member variable.
4831 (set_font_norm_type): New method.
4833 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4834 paragraphs with different encodings.
4836 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4837 (TransformChar): Changed to work correctly with Arabic points.
4838 (draw): Added support for drawing Arabic points.
4839 (draw): Removed code for drawing underbars (this is done by
4842 * src/support/textutils.h (IsPrintableNonspace): New function.
4844 * src/BufferView_pimpl.h: Added "using SigC::Object".
4845 * src/LyXView.h: ditto.
4847 * src/insets/insetinclude.h (include_label): Changed to mutable.
4849 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4851 * src/mathed/math_iter.h: remove empty destructor
4853 * src/mathed/math_cursor.h: remove empty destructor
4855 * src/insets/lyxinset.h: add THEOREM_CODE
4857 * src/insets/insettheorem.[Ch]: new files
4859 * src/insets/insetminipage.C: (InsertInset): remove
4861 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4863 (InsertInset): remove
4865 * src/insets/insetlist.C: (InsertList): remove
4867 * src/insets/insetfootlike.[Ch]: new files
4869 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4872 (InsertInset): ditto
4874 * src/insets/insetert.C: remove include Painter.h, reindent
4875 (InsertInset): move to header
4877 * src/insets/insetcollapsable.h: remove explicit from default
4878 contructor, remove empty destructor, add InsertInset
4880 * src/insets/insetcollapsable.C (InsertInset): new func
4882 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4884 * src/vspace.h: add explicit to constructor
4886 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4887 \textcompwordmark, please test this.
4889 * src/lyxrc.C: set ascii_linelen to 65 by default
4891 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4893 * src/commandtags.h: add LFUN_INSET_THEOREM
4895 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4896 (makeLinuxDocFile): remove _some_ of the nice logic
4897 (makeDocBookFile): ditto
4899 * src/Painter.[Ch]: (~Painter): removed
4901 * src/LyXAction.C (init): entry for insettheorem added
4903 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4905 (deplog): code to detect files generated by LaTeX, needs testing
4908 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4910 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4912 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4914 * src/LaTeX.C (deplog): Add a check for files that are going to be
4915 created by the first latex run, part of the project to remove the
4918 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4919 contents to the extension list.
4921 2000-07-04 Juergen Vigna <jug@sad.it>
4923 * src/text.C (NextBreakPoint): added support for needFullRow()
4925 * src/insets/lyxinset.h: added needFullRow()
4927 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4930 * src/insets/insettext.C: lots of changes for update!
4932 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4934 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4936 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4938 * src/insets/insetinclude.C (InsetInclude): fixed
4939 initialization of include_label.
4940 (unique_id): now returns a string.
4942 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4944 * src/LaTeXFeatures.h: new member IncludedFiles, for
4945 a map of key, included file name.
4947 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4948 with the included files for inclusion in SGML preamble,
4949 i. e., linuxdoc and docbook.
4952 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4953 nice (is the generated linuxdoc code to be exported?), that
4954 allows to remove column, and only_body that will be true for
4955 slave documents. Insets are allowed inside SGML font type.
4956 New handling of the SGML preamble for included files.
4957 (makeDocBookFile): the same for docbook.
4959 * src/insets/insetinclude.h:
4960 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4962 (DocBook): new export methods.
4964 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4965 and makeDocBookFile.
4967 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4968 formats to export with command line argument -x.
4970 2000-06-29 Juergen Vigna <jug@sad.it>
4972 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4973 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4975 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4976 region could already been cleared by an inset!
4978 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4980 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4983 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4985 (cursorToggle): remove special handling of lyx focus.
4987 2000-06-28 Juergen Vigna <jug@sad.it>
4989 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4992 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4994 * src/insets/insetindex.C (Edit): add a callback when popup is
4997 * src/insets/insettext.C (LocalDispatch):
4998 * src/insets/insetmarginal.h:
4999 * src/insets/insetlist.h:
5000 * src/insets/insetfoot.h:
5001 * src/insets/insetfloat.h:
5002 * src/insets/insetert.h: add a missing std:: qualifier.
5004 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5006 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5009 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5011 * src/insets/insettext.C (Read): remove tmptok unused variable
5012 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5013 (InsertInset): change for new InsetInset code
5015 * src/insets/insettext.h: add TEXT inline method
5017 * src/insets/insettext.C: remove TEXT macro
5019 * src/insets/insetmarginal.C (Write): new method
5020 (Latex): change output slightly
5022 * src/insets/insetfoot.C (Write): new method
5023 (Latex): change output slightly (don't use endl when no need)
5025 * src/insets/insetert.C (Write): new method
5027 * src/insets/insetcollapsable.h: make button_length, button_top_y
5028 and button_bottm_y protected.
5030 * src/insets/insetcollapsable.C (Write): simplify code by using
5031 tostr. Also do not output the float name, the children class
5032 should to that to get control over own arguments
5034 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5035 src/insets/insetminipage.[Ch]:
5038 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5040 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5042 * src/Makefile.am (lyx_SOURCES): add the new files
5044 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5045 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5046 * src/commandtags.h: ditto
5048 * src/LaTeXFeatures.h: add a std::set of used floattypes
5050 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5052 * src/FloatList.[Ch] src/Floating.h: new files
5054 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5056 * src/lyx_cb.C (TableApplyCB): ditto
5058 * src/text2.C: ditto
5059 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5060 (parseSingleLyXformat2Token): ditto + add code for
5061 backwards compability for old float styles + add code for new insets
5063 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5065 (InsertInset(size_type, Inset *, LyXFont)): new method
5066 (InsetChar(size_type, char)): changed to use the other InsetChar
5067 with a LyXFont(ALL_INHERIT).
5068 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5069 insert the META_INSET.
5071 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5073 * sigc++/thread.h (Threads): from here
5075 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5076 definition out of line
5077 * sigc++/scope.h: from here
5079 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5081 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5082 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5084 * Makefile.am (bindist): new target.
5086 * INSTALL: add instructions for doing a binary distribution.
5088 * development/tools/README.bin.example: update a bit.
5090 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5093 * lib/lyxrc.example: new lyxrc tag \set_color.
5095 * src/lyxfunc.C (Dispatch):
5096 * src/commandtags.h:
5097 * src/LyXAction.C: new lyxfunc "set-color".
5099 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5100 and an x11name given as strings.
5102 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5103 cache when a color is changed.
5105 2000-06-26 Juergen Vigna <jug@sad.it>
5107 * src/lyxrow.C (width): added this functions and variable.
5109 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5112 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5114 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5116 * images/undo_bw.xpm: new icon.
5117 * images/redo_bw.xpm: ditto.
5119 * configure.in (INSTALL_SCRIPT): change value to
5120 ${INSTALL} to avoid failures of install-script target.
5121 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5123 * src/BufferView.h: add a magic "friend" declaration to please
5126 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5128 * forms/cite.fd: modified to allow resizing without messing
5131 * src/insetcite.C: Uses code from cite.fd almost without
5133 User can now resize dialog in the x-direction.
5134 Resizing the dialog in the y-direction is prevented, as the
5135 code does this intelligently already.
5137 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5139 * INSTALL: remove obsolete entry in "problems" section.
5141 * lib/examples/sl_*.lyx: update of the slovenian examples.
5143 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5145 2000-06-23 Juergen Vigna <jug@sad.it>
5147 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5149 * src/buffer.C (resize): delete the LyXText of textinsets.
5151 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5153 * src/insets/lyxinset.h: added another parameter 'cleared' to
5154 the draw() function.
5156 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5157 unlocking inset in inset.
5159 2000-06-22 Juergen Vigna <jug@sad.it>
5161 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5162 of insets and moved first to LyXText.
5164 * src/mathed/formulamacro.[Ch]:
5165 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5167 2000-06-21 Juergen Vigna <jug@sad.it>
5169 * src/text.C (GetVisibleRow): look if I should clear the area or not
5170 using Inset::doClearArea() function.
5172 * src/insets/lyxinset.h: added doClearArea() function and
5173 modified draw(Painter &, ...) to draw(BufferView *, ...)
5175 * src/text2.C (UpdateInset): return bool insted of int
5177 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5179 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5180 combox in the character popup
5182 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5183 BufferParams const & params
5185 2000-06-20 Juergen Vigna <jug@sad.it>
5187 * src/insets/insettext.C (SetParagraphData): set insetowner on
5190 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5192 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5193 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5195 (form_main_): remove
5197 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5198 (create_form_form_main): remove FD_form_main stuff, connect to
5199 autosave_timeout signal
5201 * src/LyXView.[Ch] (getMainForm): remove
5202 (UpdateTimerCB): remove
5203 * src/BufferView_pimpl.h: inherit from SigC::Object
5205 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5206 signal instead of callback
5208 * src/BufferView.[Ch] (cursorToggleCB): remove
5210 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5212 * src/BufferView_pimpl.C: changes because of the one below
5214 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5215 instead of storing a pointer to a LyXText.
5217 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5219 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5221 * src/lyxparagraph.h
5223 * src/paragraph.C: Changed fontlist to a sorted vector.
5225 2000-06-19 Juergen Vigna <jug@sad.it>
5227 * src/BufferView.h: added screen() function.
5229 * src/insets/insettext.C (LocalDispatch): some selection code
5232 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5234 * src/insets/insettext.C (SetParagraphData):
5236 (InsetText): fixes for multiple paragraphs.
5238 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5240 * development/lyx.spec.in: Call configure with ``--without-warnings''
5241 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5242 This should be fine, however, since we generally don't want to be
5243 verbose when making an RPM.
5245 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5247 * lib/scripts/fig2pstex.py: New file
5249 2000-06-16 Juergen Vigna <jug@sad.it>
5251 * src/insets/insettabular.C (UpdateLocal):
5252 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5253 (LocalDispatch): Changed all functions to use LyXText.
5255 2000-06-15 Juergen Vigna <jug@sad.it>
5257 * src/text.C (SetHeightOfRow): call inset::update before requesting
5260 * src/insets/insettext.C (update):
5261 * src/insets/insettabular.C (update): added implementation
5263 * src/insets/lyxinset.h: added update function
5265 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5267 * src/text.C (SelectNextWord): protect against null pointers with
5268 old-style string streams. (fix from Paul Theo Gonciari
5271 * src/cite.[Ch]: remove erroneous files.
5273 * lib/configure.m4: update the list of created directories.
5275 * src/lyxrow.C: include <config.h>
5276 * src/lyxcursor.C: ditto.
5278 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5280 * lib/examples/decimal.lyx: new example file from Mike.
5282 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5283 to find template definitions (from Dekel)
5285 * src/frontends/.cvsignore: add a few things.
5287 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5289 * src/Timeout.C (TimeOut): remove default argument.
5291 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5294 * src/insets/ExternalTemplate.C: add a "using" directive.
5296 * src/lyx_main.h: remove the act_ struct, which seems unused
5299 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5301 * LyX Developers Meeting: All files changed, due to random C++ (by
5302 coincidence) code generator script.
5304 - external inset (cool!)
5305 - initial online editing of preferences
5306 - insettabular breaks insettext(s contents)
5308 - some DocBook fixes
5309 - example files update
5310 - other cool stuff, create a diff and look for yourself.
5312 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5314 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5315 -1 this is a non-line-breaking textinset.
5317 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5318 if there is no width set.
5320 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5322 * Lots of files: Merged the dialogbase branch.
5324 2000-06-09 Allan Rae <rae@lyx.org>
5326 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5327 and the Dispatch methods that used it.
5329 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5330 access to functions formerly kept in Dispatch.
5332 2000-05-19 Allan Rae <rae@lyx.org>
5334 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5335 made to_page and count_copies integers again. from_page remains a
5336 string however because I want to allow entry of a print range like
5337 "1,4,22-25" using this field.
5339 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5340 and printer-params-get. These aren't useful from the minibuffer but
5341 could be used by a script/LyXServer app provided it passes a suitable
5342 auto_mem_buffer. I guess I should take a look at how the LyXServer
5343 works and make it support xtl buffers.
5345 * sigc++/: updated to libsigc++-1.0.1
5347 * src/xtl/: updated to xtl-1.3.pl.11
5349 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5350 those changes done to the files in src/ are actually recreated when
5351 they get regenerated. Please don't ever accept a patch that changes a
5352 dialog unless that patch includes the changes to the corresponding *.fd
5355 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5356 stringOnlyContains, renamed it and generalised it.
5358 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5359 branch. Removed the remaining old form_print code.
5361 2000-04-26 Allan Rae <rae@lyx.org>
5363 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5364 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5366 2000-04-25 Allan Rae <rae@lyx.org>
5368 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5369 against a base of xtl-1.3.pl.4
5371 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5372 filter the Id: entries so they still show the xtl version number
5375 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5376 into the src/xtl code. Patch still pending with José (XTL)
5378 2000-04-24 Allan Rae <rae@lyx.org>
5380 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5381 both more generic and much safer. Use the new template functions.
5382 * src/buffer.[Ch] (Dispatch): ditto.
5384 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5385 and mem buffer more intelligently. Also a little general cleanup.
5388 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5389 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5390 * src/xtl/Makefile.am: ditto.
5391 * src/xtl/.cvsignore: ditto.
5392 * src/Makefile.am: ditto.
5394 * src/PrinterParams.h: Removed the macros member functions. Added a
5395 testInvariant member function. A bit of tidying up and commenting.
5396 Included Angus's idea for fixing operation with egcs-1.1.2.
5398 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5399 cool expansion of XTL's mem_buffer to support automatic memory
5400 management within the buffer itself. Removed the various macros and
5401 replaced them with template functions that use either auto_mem_buffer
5402 or mem_buffer depending on a #define. The mem_buffer support will
5403 disappear as soon as the auto_mem_buffer is confirmed to be good on
5404 other platforms/compilers. That is, it's there so you've got something
5407 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5408 effectively forked XTL. However I expect José will include my code
5409 into the next major release. Also fixed a memory leak.
5410 * src/xtl/text.h: ditto.
5411 * src/xtl/xdr.h: ditto.
5412 * src/xtl/giop.h: ditto.
5414 2000-04-16 Allan Rae <rae@lyx.org>
5416 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5417 by autogen.sh and removed by maintainer-clean anyway.
5418 * .cvsignore, sigc++/.cvsignore: Support the above.
5420 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5422 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5424 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5425 macros, renamed static callback-target member functions to suit new
5426 scheme and made them public.
5427 * src/frontends/xforms/forms/form_print.fd: ditto.
5428 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5430 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5433 * src/xtl/: New directory containing a minimal distribution of XTL.
5434 This is XTL-1.3.pl.4.
5436 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5438 2000-04-15 Allan Rae <rae@lyx.org>
5440 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5442 * sigc++/: Updated to libsigc++-1.0.0
5444 2000-04-14 Allan Rae <rae@lyx.org>
5446 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5447 use the generic ones in future. I'll modify my conversion script.
5449 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5451 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5452 (CloseAllBufferRelatedDialogs): Renamed.
5453 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5455 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5456 of the generic ones. These are the same ones my conversion script
5459 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5460 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5461 * src/buffer.C (Dispatch): ditto
5463 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5464 functions for updating and hiding buffer dependent dialogs.
5465 * src/BufferView.C (buffer): ditto
5466 * src/buffer.C (setReadonly): ditto
5467 * src/lyxfunc.C (CloseBuffer): ditto
5469 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5470 Dialogs.h, and hence all the SigC stuff, into every file that includes
5471 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5473 * src/BufferView2.C: reduce the number of headers included by buffer.h
5475 2000-04-11 Allan Rae <rae@lyx.org>
5477 * src/frontends/xforms/xform_macros.h: A small collection of macros
5478 for building C callbacks.
5480 * src/frontends/xforms/Makefile.am: Added above file.
5482 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5483 scheme again. This time it should work for JMarc. If this is
5484 successful I'll revise my conversion script to automate some of this.
5485 The static member functions in the class also have to be public for
5486 this scheme will work. If the scheme works (it's almost identical to
5487 the way BufferView::cursorToggleCB is handled so it should work) then
5488 FormCopyright and FormPrint will be ready for inclusion into the main
5489 trunk immediately after 1.1.5 is released -- provided we're prepared
5490 for complaints about lame compilers not handling XTL.
5492 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5494 2000-04-07 Allan Rae <rae@lyx.org>
5496 * config/lyxinclude.m4: A bit more tidying up (Angus)
5498 * src/LString.h: JMarc's <string> header fix
5500 * src/PrinterParams.h: Used string for most data to remove some
5501 ugly code in the Print dialog and avoid even uglier code when
5502 appending the ints to a string for output.
5504 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5505 and moved "default:" back to the end of switch statement. Cleaned
5506 up the printing so it uses the right function calls and so the
5507 "print to file" option actually puts the file in the right directory.
5509 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5511 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5512 and Ok+Apply button control into a separate method: input (Angus).
5513 (input) Cleaned it up and improved it to be very thorough now.
5514 (All CB) static_cast used instead of C style cast (Angus). This will
5515 probably change again once we've worked out how to keep gcc-2.8.1 happy
5516 with real C callbacks.
5517 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5518 ignore some of the bool settings and has random numbers instead. Needs
5519 some more investigation. Added other input length checks and checking
5520 of file and printer names.
5522 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5523 would link (Angus). Seems the old code doesn't compile with the pragma
5524 statement either. Separated callback entries from internal methods.
5526 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5528 2000-03-17 Allan Rae <rae@lyx.org>
5530 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5531 need it? Maybe it could go in Dialogs instead? I could make it a
5532 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5533 values to get the bool return value.
5534 (Dispatch): New overloaded method for xtl support.
5536 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5537 extern "C" callback instead of static member functions. Hopefully,
5538 JMarc will be able to compile this. I haven't changed
5539 forms/form_copyright.fd yet. Breaking one of my own rules already.
5541 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5542 because they aren't useful from the minibuffer. Maybe a LyXServer
5543 might want a help message though?
5545 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5547 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5548 xtl which needs both rtti and exceptions.
5550 * src/support/Makefile.am:
5551 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5553 * src/frontends/xforms/input_validators.[ch]: input filters and
5554 validators. These conrol what keys are valid in input boxes.
5555 Use them and write some more. Much better idea than waiting till
5556 after the user has pressed Ok to say that the input fields don't make
5559 * src/frontends/xforms/Makefile.am:
5560 * src/frontends/xforms/forms/form_print.fd:
5561 * src/frontends/xforms/forms/makefile:
5562 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5563 new scheme. Still have to make sure I haven't missed anything from
5564 the current implementation.
5566 * src/Makefile.am, src/PrinterParams.h: New data store.
5568 * other files: Added a couple of copyright notices.
5570 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5572 * src/insets/insetbib.h: move Holder struct in public space.
5574 * src/frontends/include/DialogBase.h: use SigC:: only when
5575 SIGC_CXX_NAMESPACES is defined.
5576 * src/frontends/include/Dialogs.h: ditto.
5578 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5580 * src/frontends/xforms/FormCopyright.[Ch]: do not
5581 mention SigC:: explicitely.
5583 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5585 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5586 deals with testing KDE in main configure.in
5587 * configure.in: ditto.
5589 2000-02-22 Allan Rae <rae@lyx.org>
5591 * Lots of files: Merged from HEAD
5593 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5594 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5596 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5598 * sigc++/: new minidist.
5600 2000-02-14 Allan Rae <rae@lyx.org>
5602 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5604 2000-02-08 Juergen Vigna <jug@sad.it>
5606 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5607 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5609 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5610 for this port and so it is much easier for other people to port
5611 dialogs in a common development environment.
5613 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5614 the QT/KDE implementation.
5616 * src/frontends/kde/Dialogs.C:
5617 * src/frontends/kde/FormCopyright.C:
5618 * src/frontends/kde/FormCopyright.h:
5619 * src/frontends/kde/Makefile.am:
5620 * src/frontends/kde/formcopyrightdialog.C:
5621 * src/frontends/kde/formcopyrightdialog.h:
5622 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5623 for the kde support of the Copyright-Dialog.
5625 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5626 subdir-substitution instead of hardcoded 'xforms' as we now have also
5629 * src/frontends/include/DialogBase.h (Object): just commented the
5630 label after #endif (nasty warning and I don't like warnings ;)
5632 * src/main.C (main): added KApplication initialization if using
5635 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5636 For now only the KDE event-loop is added if frontend==kde.
5638 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5640 * configure.in: added support for the --with-frontend[=value] option
5642 * autogen.sh: added kde.m4 file to list of config-files
5644 * acconfig.h: added define for KDEGUI-support
5646 * config/kde.m4: added configuration functions for KDE-port
5648 * config/lyxinclude.m4: added --with-frontend[=value] option with
5649 support for xforms and KDE.
5651 2000-02-08 Allan Rae <rae@lyx.org>
5653 * all Makefile.am: Fixed up so the make targets dist, distclean,
5654 install and uninstall all work even if builddir != srcdir. Still
5655 have a new sigc++ minidist update to come.
5657 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5659 2000-02-01 Allan Rae <rae@lyx.org>
5661 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5662 Many mods to get builddir != srcdir working.
5664 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5665 for building on NT and so we can do the builddir != srcdir stuff.
5667 2000-01-30 Allan Rae <rae@lyx.org>
5669 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5670 This will stay in "rae" branch. We probably don't really need it in
5671 the main trunk as anyone who wants to help programming it should get
5672 a full library installed also. So they can check both included and
5673 system supplied library compilation.
5675 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5676 Added a 'mini' distribution of libsigc++. If you feel the urge to
5677 change something in these directories - Resist it. If you can't
5678 resist the urge then you should modify the following script and rebuild
5679 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5680 all happen. Still uses a hacked version of libsigc++'s configure.in.
5681 I'm quite happy with the results. I'm not sure the extra work to turn
5682 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5683 worth the trouble and would probably lead to extra maintenance
5685 I haven't tested the following important make targets: install, dist.
5686 Not ready for prime time but very close. Maybe 1.1.5.
5688 * development/tools/makeLyXsigc.sh: A shell script to automatically
5689 generate our mini-dist of libsigc++. It can only be used with a CVS
5690 checkout of libsigc++ not a tarball distribution. It's well commented.
5691 This will end up as part of the libsigc++ distribution so other apps
5692 can easily have an included mini-dist. If someone makes mods to the
5693 sigc++ subpackage without modifying this script to generate those
5694 changes I'll be very upset!
5696 * src/frontends/: Started the gui/system indep structure.
5698 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5699 to access the gui-indep dialogs are in this class. Much improved
5700 design compared to previous revision. Lars, please refrain from
5701 moving this header into src/ like you did with Popups.h last time.
5703 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5705 * src/frontends/xforms/: Started the gui-indep system with a single
5706 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5709 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5710 Here you'll find a very useful makefile and automated fdfix.sh that
5711 makes updating dailogs a no-brainer -- provided you follow the rules
5712 set out in the README. I'm thinking about adding another script to
5713 automatically generate skeleton code for a new dialog given just the
5716 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5717 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5718 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5720 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5722 * src/support/LSubstring.C (operator): simplify
5724 * src/lyxtext.h: removed bparams, use buffer_->params instead
5726 * src/lyxrow.h: make Row a real class, move all variables to
5727 private and use accessors.
5729 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5731 (isRightToLeftPar): ditto
5732 (ChangeLanguage): ditto
5733 (isMultiLingual): ditto
5736 (SimpleTeXOnePar): ditto
5737 (TeXEnvironment): ditto
5738 (GetEndLabel): ditto
5740 (SetOnlyLayout): ditto
5741 (BreakParagraph): ditto
5742 (BreakParagraphConservative): ditto
5743 (GetFontSettings): ditto
5745 (CopyIntoMinibuffer): ditto
5746 (CutIntoMinibuffer): ditto
5747 (PasteParagraph): ditto
5748 (SetPExtraType): ditto
5749 (UnsetPExtraType): ditto
5750 (DocBookContTableRows): ditto
5751 (SimpleDocBookOneTablePar): ditto
5753 (TeXFootnote): ditto
5754 (SimpleTeXOneTablePar): ditto
5755 (TeXContTableRows): ditto
5756 (SimpleTeXSpecialChars): ditto
5759 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5760 to private and use accessors.
5762 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5763 this, we did not use it anymore and has not been for ages. Just a
5764 waste of cpu cycles.
5766 * src/language.h: make Language a real class, move all variables
5767 to private and use accessors.
5769 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5770 (create_view): remove
5771 (update): some changes for new timer
5772 (cursorToggle): use new timer
5773 (beforeChange): change for new timer
5775 * src/BufferView.h (cursorToggleCB): removed last paramter because
5778 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5779 (cursorToggleCB): change because of new timer code
5781 * lib/CREDITS: updated own mailaddress
5783 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5785 * src/support/filetools.C (PutEnv): fix the code in case neither
5786 putenv() nor setenv() have been found.
5788 * INSTALL: mention the install-strip Makefile target.
5790 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5791 read-only documents.
5793 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5795 * lib/reLyX/configure.in (VERSION): avoid using a previously
5796 generated reLyX wrapper to find out $prefix.
5798 * lib/examples/eu_adibide_lyx-atua.lyx:
5799 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5800 translation of the Tutorial (Dooteo)
5802 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5804 * forms/cite.fd: new citation dialog
5806 * src/insetcite.[Ch]: the new citation dialog is moved into
5809 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5812 * src/insets/insetcommand.h: data members made private.
5814 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5816 * LyX 1.1.5 released
5818 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5820 * src/version.h (LYX_RELEASE): to 1.1.5
5822 * src/spellchecker.C (RunSpellChecker): return false if the
5823 spellchecker dies upon creation.
5825 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5827 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5828 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5832 * lib/CREDITS: update entry for Martin Vermeer.
5834 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5836 * src/text.C (draw): Draw foreign language bars at the bottom of
5837 the row instead of at the baseline.
5839 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5841 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5843 * lib/bind/de_menus.bind: updated
5845 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5847 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5849 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5851 * src/menus.C (Limit_string_length): New function
5852 (ShowTocMenu): Limit the number of items/length of items in the
5855 * src/paragraph.C (String): Correct result for a paragraph inside
5858 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5860 * src/bufferlist.C (close): test of buf->getuser() == NULL
5862 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5864 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5865 Do not call to SetCursor when the paragraph is a closed footnote!
5867 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5869 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5872 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5874 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5877 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5878 reference popup, that activates the reference-back action
5880 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5882 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5883 the menus. Also fixed a bug.
5885 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5886 the math panels when switching buffers (unless new buffer is readonly).
5888 * src/BufferView.C (NoSavedPositions)
5889 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5891 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5893 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5894 less of dvi dirty or not.
5896 * src/trans_mgr.[Ch] (insert): change first parameter to string
5899 * src/chset.[Ch] (encodeString): add const to first parameter
5901 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5903 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5907 * src/LaTeX.C (deplog): better searching for dependency files in
5908 the latex log. Uses now regexps.
5910 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5911 instead of the box hack or \hfill.
5913 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5915 * src/lyxfunc.C (doImportHelper): do not create the file before
5916 doing the actual import.
5917 (doImportASCIIasLines): create a new file before doing the insert.
5918 (doImportASCIIasParagraphs): ditto.
5920 * lib/lyxrc.example: remove mention of non-existing commands
5922 * lyx.man: remove mention of color-related switches.
5924 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5926 * src/lyx_gui.C: remove all the color-related ressources, which
5927 are not used anymore.
5929 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5932 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5934 * src/lyxrc.C (read): Add a missing break in the switch
5936 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5938 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5940 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5943 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5945 * src/text.C (draw): draw bars under foreign language words.
5947 * src/LColor.[Ch]: add LColor::language
5949 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5951 * src/lyxcursor.h (boundary): New member variable
5953 * src/text.C (IsBoundary): New methods
5955 * src/text.C: Use the above for currect cursor movement when there
5956 is both RTL & LTR text.
5958 * src/text2.C: ditto
5960 * src/bufferview_funcs.C (ToggleAndShow): ditto
5962 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5964 * src/text.C (DeleteLineForward): set selection to true to avoid
5965 that DeleteEmptyParagraphMechanism does some magic. This is how it
5966 is done in all other functions, and seems reasonable.
5967 (DeleteWordForward): do not jump over non-word stuff, since
5968 CursorRightOneWord() already does it.
5970 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5971 DeleteWordBackward, since they seem safe to me (since selection is
5972 set to "true") DeleteEmptyParagraphMechanism does nothing.
5974 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5976 * src/lyx_main.C (easyParse): simplify the code by factoring the
5977 part that removes parameters from the command line.
5978 (LyX): check wether wrong command line options have been given.
5980 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5982 * src/lyx_main.C : add support for specifying user LyX
5983 directory via command line option -userdir.
5985 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5987 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5988 the number of items per popup.
5989 (Add_to_refs_menu): Ditto.
5991 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5993 * src/lyxparagraph.h: renamed ClearParagraph() to
5994 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5995 textclass as parameter, and do nothing if free_spacing is
5996 true. This fixes part of the line-delete-forward problems.
5998 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5999 (pasteSelection): ditto.
6000 (SwitchLayoutsBetweenClasses): more translatable strings.
6002 * src/text2.C (CutSelection): use StripLeadingSpaces.
6003 (PasteSelection): ditto.
6004 (DeleteEmptyParagraphMechanism): ditto.
6006 2000-05-26 Juergen Vigna <jug@sad.it>
6008 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6009 is not needed in tabular insets.
6011 * src/insets/insettabular.C (TabularFeatures): added missing features.
6013 * src/tabular.C (DeleteColumn):
6015 (AppendRow): implemented this functions
6016 (cellsturct::operator=): clone the inset too;
6018 2000-05-23 Juergen Vigna <jug@sad.it>
6020 * src/insets/insettabular.C (LocalDispatch): better selection support
6021 when having multicolumn-cells.
6023 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6025 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6027 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6029 * src/ColorHandler.C (getGCForeground): put more test into _()
6031 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6034 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6037 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6039 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6040 there are no labels, or when buffer is readonly.
6042 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6043 there are no labels, buffer is SGML, or when buffer is readonly.
6045 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6047 * src/LColor.C (LColor): change a couple of grey40 to grey60
6048 (LColor): rewore initalization to make compiles go some magnitude
6050 (getGUIName): don't use gettext until we need the string.
6052 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6054 * src/Bullet.[Ch]: Fixed a small bug.
6056 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6058 * src/paragraph.C (String): Several fixes/improvements
6060 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6062 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6064 * src/paragraph.C (String): give more correct output.
6066 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6068 * src/lyxfont.C (stateText) Do not output the language if it is
6069 eqaul to the language of the document.
6071 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6072 between two paragraphs with the same language.
6074 * src/paragraph.C (getParLanguage) Return a correct answer for an
6075 empty dummy paragraph.
6077 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6080 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6083 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6084 the menus/popup, if requested fonts are unavailable.
6086 2000-05-22 Juergen Vigna <jug@sad.it>
6088 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6089 movement support (Up/Down/Tab/Shift-Tab).
6090 (LocalDispatch): added also preliminari cursor-selection.
6092 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6094 * src/paragraph.C (PasteParagraph): Hopefully now right!
6096 2000-05-22 Garst R. Reese <reese@isn.net>
6098 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6099 of list, change all references to Environment to Command
6100 * tex/hollywood.cls : rewrite environments as commands, add
6101 \uppercase to interiorshot and exteriorshot to force uppecase.
6102 * tex/broadway.cls : rewrite environments as commands. Tweak
6105 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6107 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6108 size of items: use a constant intead of the hardcoded 40, and more
6109 importantly do not remove the %m and %x tags added at the end.
6110 (Add_to_refs_menu): use vector::size_type instead of
6111 unsigned int as basic types for the variables. _Please_ do not
6112 assume that size_t is equal to unsigned int. On an alpha, this is
6113 unsigned long, which is _not_ the same.
6115 * src/language.C (initL): remove language "hungarian", since it
6116 seems that "magyar" is better.
6118 2000-05-22 Juergen Vigna <jug@sad.it>
6120 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6122 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6125 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6126 next was deleted but not set to 0.
6128 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6130 * src/language.C (initL): change the initialization of languages
6131 so that compiles goes _fast_.
6133 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6136 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6138 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6142 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6144 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6146 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6150 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6153 * src/insets/insetlo*.[Ch]: Made editable
6155 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6157 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6158 the current selection.
6160 * src/BufferView_pimpl.C (stuffClipboard): new method
6162 * src/BufferView.C (stuffClipboard): new method
6164 * src/paragraph.C (String): new method
6166 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6167 LColor::ignore when lyxname is not found.
6169 * src/BufferView.C (pasteSelection): new method
6171 * src/BufferView_pimpl.C (pasteSelection): new method
6173 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6175 * src/WorkArea.C (request_clipboard_cb): new static function
6176 (getClipboard): new method
6177 (putClipboard): new method
6179 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6181 * LyX 1.1.5pre2 released
6183 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6185 * src/vspace.C (operator=): removed
6186 (operator=): removed
6188 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6190 * src/layout.C (NumberOfClass): manually set the type in make_pair
6191 (NumberOfLayout): ditto
6193 * src/language.C: use the Language constructor for ignore_lang
6195 * src/language.h: add constructors to struct Language
6197 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6199 * src/text2.C (SetCursorIntern): comment out #warning
6201 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6203 * src/mathed/math_iter.h: initialize sx and sw to 0
6205 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6207 * forms/lyx.fd: Redesign of form_ref
6209 * src/LaTeXFeatures.[Ch]
6213 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6216 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6217 and Buffer::inset_iterator.
6219 * src/menus.C: Added new menus: TOC and Refs.
6221 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6223 * src/buffer.C (getTocList): New method.
6225 * src/BufferView2.C (ChangeRefs): New method.
6227 * src/buffer.C (getLabelList): New method. It replaces the old
6228 getReferenceList. The return type is vector<string> instead of
6231 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6232 the old getLabel() and GetNumberOfLabels() methods.
6233 * src/insets/insetlabel.C (getLabelList): ditto
6234 * src/mathed/formula.C (getLabelList): ditto
6236 * src/paragraph.C (String): New method.
6238 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6239 Uses the new getTocList() method.
6240 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6241 which automatically updates the contents of the browser.
6242 (RefUpdateCB): Use the new getLabelList method.
6244 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6246 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6248 * src/spellchecker.C: Added using std::reverse;
6250 2000-05-19 Juergen Vigna <jug@sad.it>
6252 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6254 * src/insets/insettext.C (computeTextRows): small fix for display of
6255 1 character after a newline.
6257 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6260 2000-05-18 Juergen Vigna <jug@sad.it>
6262 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6263 when changing width of column.
6265 * src/tabular.C (set_row_column_number_info): setting of
6266 autobreak rows if necessary.
6268 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6270 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6272 * src/vc-backend.*: renamed stat() to status() and vcstat to
6273 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6274 compilation broke. The new name seems more relevant, anyway.
6276 2000-05-17 Juergen Vigna <jug@sad.it>
6278 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6279 which was wrong if the removing caused removing of rows!
6281 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6282 (pushToken): new function.
6284 * src/text2.C (CutSelection): fix problem discovered with purify
6286 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6288 * src/debug.C (showTags): enlarge the first column, now that we
6289 have 6-digits debug codes.
6291 * lib/layouts/hollywood.layout:
6292 * lib/tex/hollywood.cls:
6293 * lib/tex/brodway.cls:
6294 * lib/layouts/brodway.layout: more commands and fewer
6295 environments. Preambles moved in the .cls files. Broadway now has
6296 more options on scene numbering and less whitespace (from Garst)
6298 * src/insets/insetbib.C (getKeys): make sure that we are in the
6299 document directory, in case the bib file is there.
6301 * src/insets/insetbib.C (Latex): revert bogus change.
6303 2000-05-16 Juergen Vigna <jug@sad.it>
6305 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6306 the TabularLayout on cursor move.
6308 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6310 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6313 (draw): fixed cursor position and drawing so that the cursor is
6314 visible when before the tabular-inset.
6316 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6317 when creating from old insettext.
6319 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6321 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6323 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6324 * lib/tex/brodway.cls: ditto
6326 * lib/layouts/brodway.layout: change alignment of parenthical
6329 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6331 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6332 versions 0.88 and 0.89 are supported.
6334 2000-05-15 Juergen Vigna <jug@sad.it>
6336 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6339 * src/insets/insettext.C (computeTextRows): redone completely this
6340 function in a much cleaner way, because of problems when having a
6342 (draw): added a frame border when the inset is locked.
6343 (SetDrawLockedFrame): this sets if we draw the border or not.
6344 (SetFrameColor): this sets the frame color (default=insetframe).
6346 * src/insets/lyxinset.h: added x() and y() functions which return
6347 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6348 function which is needed to see if we have a locking inset of some
6349 type in this inset (needed for now in insettabular).
6351 * src/vspace.C (inPixels): the same function also without a BufferView
6352 parameter as so it is easier to use it in some ocasions.
6354 * src/lyxfunc.C: changed all places where insertInset was used so
6355 that now if it couldn't be inserted it is deleted!
6357 * src/TabularLayout.C:
6358 * src/TableLayout.C: added support for new tabular-inset!
6360 * src/BufferView2.C (insertInset): this now returns a bool if the
6361 inset was really inserted!!!
6363 * src/tabular.C (GetLastCellInRow):
6364 (GetFirstCellInRow): new helper functions.
6365 (Latex): implemented for new tabular class.
6369 (TeXTopHLine): new Latex() helper functions.
6371 2000-05-12 Juergen Vigna <jug@sad.it>
6373 * src/mathed/formulamacro.C (Read):
6374 * src/mathed/formula.C (Read): read also the \end_inset here!
6376 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6378 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6379 crush when saving formulae with unbalanced parenthesis.
6381 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6383 * src/layout.C: Add new keyword "endlabelstring" to layout file
6385 * src/text.C (GetVisibleRow): Draw endlabel string.
6387 * lib/layouts/broadway.layout
6388 * lib/layouts/hollywood.layout: Added endlabel for the
6389 Parenthetical layout.
6391 * lib/layouts/heb-article.layout: Do not use slanted font shape
6392 for Theorem like environments.
6394 * src/buffer.C (makeLaTeXFile): Always add "american" to
6395 the UsedLanguages list if document language is RTL.
6397 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6399 * add addendum to README.OS2 and small patch (from SMiyata)
6401 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6403 * many files: correct the calls to ChangeExtension().
6405 * src/support/filetools.C (ChangeExtension): remove the no_path
6406 argument, which does not belong there. Use OnlyFileName() instead.
6408 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6409 files when LaTeXing a non-nice latex file.
6411 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6412 a chain of "if". Return false when deadkeys are not handled.
6414 * src/lyx_main.C (LyX): adapted the code for default bindings.
6416 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6417 bindings for basic functionality (except deadkeys).
6418 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6420 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6421 several methods: handle override_x_deadkeys.
6423 * src/lyxrc.h: remove the "bindings" map, which did not make much
6424 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6426 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6428 * src/lyxfont.C (stateText): use a saner method to determine
6429 whether the font is "default". Seems to fix the crash with DEC
6432 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6434 2000-05-08 Juergen Vigna <jug@sad.it>
6436 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6437 TabularLayoutMenu with mouse-button-3
6438 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6440 * src/TabularLayout.C: added this file for having a Layout for
6443 2000-05-05 Juergen Vigna <jug@sad.it>
6445 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6446 recalculating inset-widths.
6447 (TabularFeatures): activated this function so that I can change
6448 tabular-features via menu.
6450 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6451 that I can test some functions with the Table menu.
6453 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6455 * src/lyxfont.C (stateText): guard against stupid c++libs.
6457 * src/tabular.C: add using std::vector
6458 some whitespace changes, + removed som autogenerated code.
6460 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6462 2000-05-05 Juergen Vigna <jug@sad.it>
6464 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6465 row, columns and cellstructures.
6467 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6469 * lib/lyxrc.example: remove obsolete entries.
6471 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6472 reading of protected_separator for free_spacing.
6474 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6476 * src/text.C (draw): do not display an exclamation mark in the
6477 margin for margin notes. This is confusing, ugly and
6480 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6481 AMS math' is checked.
6483 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6484 name to see whether including the amsmath package is needed.
6486 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6488 * src/paragraph.C (validate): Compute UsedLanguages correctly
6489 (don't insert the american language if it doesn't appear in the
6492 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6493 The argument of \thanks{} command is considered moving argument
6495 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6498 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6500 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6501 for appendix/minipage/depth. The lines can be now both in the footnote
6502 frame, and outside the frame.
6504 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6507 2000-05-05 Juergen Vigna <jug@sad.it>
6509 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6510 neede only in tabular.[Ch].
6512 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6514 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6516 (Write): write '~' for PROTECTED_SEPARATOR
6518 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6520 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6523 * src/mathed/formula.C (drawStr): rename size to siz.
6525 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6526 possibly fix a bug by not changing the pflags = flags to piflags =
6529 2000-05-05 Juergen Vigna <jug@sad.it>
6531 * src/insets/insetbib.C: moved using directive
6533 * src/ImportNoweb.C: small fix for being able to compile (missing
6536 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6538 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6539 to use clear, since we don't depend on this in the code. Add test
6542 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6544 * (various *.C files): add using std::foo directives to please dec
6547 * replace calls to string::clear() to string::erase() (Angus)
6549 * src/cheaders/cmath: modified to provide std::abs.
6551 2000-05-04 Juergen Vigna <jug@sad.it>
6553 * src/insets/insettext.C: Prepared all for inserting of multiple
6554 paragraphs. Still display stuff to do (alignment and other things),
6555 but I would like to use LyXText to do this when we cleaned out the
6556 table-support stuff.
6558 * src/insets/insettabular.C: Changed lot of stuff and added lots
6559 of functionality still a lot to do.
6561 * src/tabular.C: Various functions changed name and moved to be
6562 const functions. Added new Read and Write functions and changed
6563 lots of things so it works good with tabular-insets (also removed
6564 some stuff which is not needed anymore * hacks *).
6566 * src/lyxcursor.h: added operators == and != which just look if
6567 par and pos are (not) equal.
6569 * src/buffer.C (latexParagraphs): inserted this function to latex
6570 all paragraphs form par to endpar as then I can use this too for
6573 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6574 so that I can call this to from text insets with their own cursor.
6576 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6577 output off all paragraphs (because of the fix below)!
6579 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6580 the very last paragraph (this could be also the last paragraph of an
6583 * src/texrow.h: added rows() call which returns the count-variable.
6585 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6587 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6589 * lib/configure.m4: better autodetection of DocBook tools.
6591 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6593 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6595 * src/lyx_cb.C: add using std::reverse;
6597 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6600 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6601 selected files. Should fix repeated errors from generated files.
6603 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6605 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6607 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6608 the spellchecker popup.
6610 * lib/lyxrc.example: Removed the \number_inset section
6612 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6614 * src/insets/figinset.C (various): Use IsFileReadable() to make
6615 sure that the file actually exist. Relying on ghostscripts errors
6616 is a bad idea since they can lead to X server crashes.
6618 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6620 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6623 * lib/lyxrc.example: smallish typo in description of
6624 \view_dvi_paper_option
6626 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6629 * src/lyxfunc.C: doImportHelper to factor out common code of the
6630 various import methods. New functions doImportASCIIasLines,
6631 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6632 doImportLinuxDoc for the format specific parts.
6635 * buffer.C: Dispatch returns now a bool to indicate success
6638 * lyx_gui.C: Add getLyXView() for member access
6640 * lyx_main.C: Change logic for batch commands: First try
6641 Buffer::Dispatch (possibly without GUI), if that fails, use
6644 * lyx_main.C: Add support for --import command line switch.
6645 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6646 Available Formats: Everything accepted by 'buffer-import <format>'
6648 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6650 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6653 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6654 documents will be reformatted upon reentry.
6656 2000-04-27 Juergen Vigna <jug@sad.it>
6658 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6659 correctly only last pos this was a bug.
6661 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6663 * release of lyx-1.1.5pre1
6665 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6667 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6669 * src/menus.C: revert the change of naming (Figure->Graphic...)
6670 from 2000-04-11. It was incomplete and bad.
6672 * src/LColor.[Ch]: add LColor::depthbar.
6673 * src/text.C (GetVisibleRow): use it.
6675 * README: update the languages list.
6677 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6679 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6682 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6684 * README: remove sections that were just wrong.
6686 * src/text2.C (GetRowNearY): remove currentrow code
6688 * src/text.C (GetRow): remove currentrow code
6690 * src/screen.C (Update): rewritten a bit.
6691 (SmallUpdate): removed func
6693 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6695 (FullRebreak): return bool
6696 (currentrow): remove var
6697 (currentrow_y): ditto
6699 * src/lyxscreen.h (Draw): change arg to unsigned long
6700 (FitCursor): return bool
6701 (FitManualCursor): ditto
6702 (Smallpdate): remove func
6703 (first): change to unsigned long
6704 (DrawOneRow): change second arg to long (from long &)
6705 (screen_refresh_y): remove var
6706 (scree_refresh_row): ditto
6708 * src/lyxrow.h: change baseline to usigned int from unsigned
6709 short, this brings some implicit/unsigned issues out in the open.
6711 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6713 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6714 instead of smallUpdate.
6716 * src/lyxcursor.h: change y to unsigned long
6718 * src/buffer.h: don't call updateScrollbar after fitcursor
6720 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6721 where they are used. Removed "\\direction", this was not present
6722 in 1.1.4 and is already obsolete. Commented out some code that I
6723 believe to never be called.
6724 (runLiterate): don't call updateScrollbar after fitCursor
6726 (buildProgram): ditto
6729 * src/WorkArea.h (workWidth): change return val to unsigned
6732 (redraw): remove the button redraws
6733 (setScrollbarValue): change for scrollbar
6734 (getScrollbarValue): change for scrollbar
6735 (getScrollbarBounds): change for scrollbar
6737 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6738 (C_WorkArea_down_cb): removed func
6739 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6740 (resize): change for scrollbar
6741 (setScrollbar): ditto
6742 (setScrollbarBounds): ditto
6743 (setScrollbarIncrements): ditto
6744 (up_cb): removed func
6745 (down_cb): removed func
6746 (scroll_cb): change for scrollbar
6747 (work_area_handler): ditto
6749 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6750 when FitCursor did something.
6751 (updateScrollbar): some unsigned changes
6752 (downCB): removed func
6753 (scrollUpOnePage): removed func
6754 (scrollDownOnePage): remvoed func
6755 (workAreaMotionNotify): don't call screen->FitCursor but use
6756 fitCursor instead. and bool return val
6757 (workAreaButtonPress): ditto
6758 (workAreaButtonRelease): some unsigned changes
6759 (checkInsetHit): ditto
6760 (workAreaExpose): ditto
6761 (update): parts rewritten, comments about the signed char arg added
6762 (smallUpdate): removed func
6763 (cursorPrevious): call needed updateScrollbar
6766 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6769 * src/BufferView.[Ch] (upCB): removed func
6770 (downCB): removed func
6771 (smallUpdate): removed func
6773 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6775 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6776 currentrow, currentrow_y optimization. This did not help a lot and
6777 if we want to do this kind of optimization we should rather use
6778 cursor.row instead of the currentrow.
6780 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6781 buffer spacing and klyx spacing support.
6783 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6785 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6788 2000-04-26 Juergen Vigna <jug@sad.it>
6790 * src/insets/figinset.C: fixes to Lars sstream changes!
6792 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6794 * A lot of files: Added Ascii(ostream &) methods to all inset
6795 classes. Used when exporting to ASCII.
6797 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6798 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6801 * src/text2.C (ToggleFree): Disabled implicit word selection when
6802 there is a change in the language
6804 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6805 no output was generated for end-of-sentence inset.
6807 * src/insets/lyxinset.h
6810 * src/paragraph.C: Removed the insetnumber code
6812 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6814 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6816 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6817 no_babel and no_epsfig completely from the file.
6818 (parseSingleLyXformat2Token): add handling for per-paragraph
6819 spacing as written by klyx.
6821 * src/insets/figinset.C: applied patch by Andre. Made it work with
6824 2000-04-20 Juergen Vigna <jug@sad.it>
6826 * src/insets/insettext.C (cutSelection):
6827 (copySelection): Fixed with selection from right to left.
6828 (draw): now the rows are not recalculated at every draw.
6829 (computeTextRows): for now reset the inset-owner here (this is
6830 important for an undo or copy where the inset-owner is not set
6833 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6834 motion to the_locking_inset screen->first was forgotten, this was
6835 not important till we got multiline insets.
6837 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6839 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6840 code seems to be alright (it is code changed by Dekel, and the
6841 intent is indeed that all macros should be defined \protect'ed)
6843 * NEWS: a bit of reorganisation of the new user-visible features.
6845 2000-04-19 Juergen Vigna <jug@sad.it>
6847 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6848 position. Set the inset_owner of the used paragraph so that it knows
6849 that it is inside an inset. Fixed cursor handling with mouse and
6850 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6851 and cleanups to make TextInsets work better.
6853 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6854 Changed parameters of various functions and added LockInsetInInset().
6856 * src/insets/insettext.C:
6858 * src/insets/insetcollapsable.h:
6859 * src/insets/insetcollapsable.C:
6860 * src/insets/insetfoot.h:
6861 * src/insets/insetfoot.C:
6862 * src/insets/insetert.h:
6863 * src/insets/insetert.C: cleaned up the code so that it works now
6864 correctly with insettext.
6866 * src/insets/inset.C:
6867 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6868 that insets in insets are supported right.
6871 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6873 * src/paragraph.C: some small fixes
6875 * src/debug.h: inserted INSETS debug info
6877 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6878 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6880 * src/commandtags.h:
6881 * src/LyXAction.C: insert code for InsetTabular.
6883 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6884 not Button1MotionMask.
6885 (workAreaButtonRelease): send always a InsetButtonRelease event to
6887 (checkInsetHit): some setCursor fixes (always with insets).
6889 * src/BufferView2.C (lockInset): returns a bool now and extended for
6890 locking insets inside insets.
6891 (showLockedInsetCursor): it is important to have the cursor always
6892 before the locked inset.
6893 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6895 * src/BufferView.h: made lockInset return a bool.
6897 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6899 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6900 that is used also internally but can be called as public to have back
6901 a cursor pos which is not set internally.
6902 (SetCursorIntern): Changed to use above function.
6904 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6906 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6911 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6912 patches for things that should be in or should be changed.
6914 * src/* [insetfiles]: change "usigned char fragile" to bool
6915 fragile. There was only one point that could that be questioned
6916 and that is commented in formulamacro.C. Grep for "CHECK".
6918 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6919 (DeleteBuffer): take it out of CutAndPaste and make it static.
6921 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6923 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6924 output the spacing envir commands. Also the new commands used in
6925 the LaTeX output makes the result better.
6927 * src/Spacing.C (writeEnvirBegin): new method
6928 (writeEnvirEnd): new method
6930 2000-04-18 Juergen Vigna <jug@sad.it>
6932 * src/CutAndPaste.C: made textclass a static member of the class
6933 as otherwise it is not accesed right!!!
6935 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6937 * forms/layout_forms.fd
6938 * src/layout_forms.h
6939 * src/layout_forms.C (create_form_form_character)
6940 * src/lyx_cb.C (UserFreeFont)
6941 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6942 documents (in the layout->character popup).
6944 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6946 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6947 \spell_command was in fact not honored (from Kevin Atkinson).
6949 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6952 * src/lyx_gui.h: make lyxViews private (Angus)
6954 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6956 * src/mathed/math_write.C
6957 (MathMatrixInset::Write) Put \protect before \begin{array} and
6958 \end{array} if fragile
6959 (MathParInset::Write): Put \protect before \\ if fragile
6961 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6963 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6964 initialization if the LyXColorHandler must be done after the
6965 connections to the XServer has been established.
6967 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6968 get the background pixel from the lyxColorhandler so that the
6969 figures are rendered with the correct background color.
6970 (NextToken): removed functions.
6971 (GetPSSizes): use ifs >> string instead of NextToken.
6973 * src/Painter.[Ch]: the color cache moved out of this file.
6975 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6978 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6980 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6981 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6983 * src/BufferView.C (enterView): new func
6984 (leaveView): new func
6986 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6988 (leaveView): new func, undefines xterm cursor when approp.
6990 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6991 (AllowInput): delete the Workarea cursor handling from this func.
6993 * src/Painter.C (underline): draw a slimer underline in most cases.
6995 * src/lyx_main.C (error_handler): use extern "C"
6997 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6999 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7000 sent directly to me.
7002 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7003 to the list by Dekel.
7005 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7008 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7009 methods from lyx_cb.here.
7011 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7014 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7016 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7017 instead of using current_view directly.
7019 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7021 * src/LyXAction.C (init): add the paragraph-spacing command.
7023 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7025 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7027 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7028 different from the documents.
7030 * src/text.C (SetHeightOfRow): take paragraph spacing into
7031 account, paragraph spacing takes precedence over buffer spacing
7032 (GetVisibleRow): ditto
7034 * src/paragraph.C (writeFile): output the spacing parameter too.
7035 (validate): set the correct features if spacing is used in the
7037 (Clear): set spacing to default
7038 (MakeSameLayout): spacing too
7039 (HasSameLayout): spacing too
7040 (SetLayout): spacing too
7041 (TeXOnePar): output the spacing commands
7043 * src/lyxparagraph.h: added a spacing variable for use with
7044 per-paragraph spacing.
7046 * src/Spacing.h: add a Default spacing and a method to check if
7047 the current spacing is default. also added an operator==
7049 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7052 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7054 * src/lyxserver.C (callback): fix dispatch of functions
7056 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7057 printf() into lyxerr call.
7059 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7062 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7063 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7064 the "Float" from each of the subitems.
7065 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7067 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7068 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7069 documented the change so that the workaround can be nuked later.
7071 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7074 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7076 * src/buffer.C (getLatexName): ditto
7077 (setReadonly): ditto
7079 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7081 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7082 avoid some uses of current_view. Added also a bufferParams()
7083 method to get at this.
7085 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7087 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7089 * src/lyxparagraph.[Ch]: removed
7090 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7091 with operators used by lower_bound and
7092 upper_bound in InsetTable's
7093 Make struct InsetTable private again. Used matchpos.
7095 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7097 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7098 document, the language of existing text is changed (unless the
7099 document is multi-lingual)
7101 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7103 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7105 * A lot of files: A rewrite of the Right-to-Left support.
7107 2000-04-10 Juergen Vigna <jug@sad.it>
7109 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7110 misplaced cursor when inset in inset is locked.
7112 * src/insets/insettext.C (LocalDispatch): small fix so that a
7113 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7115 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7116 footnote font should be decreased in size twice when displaying.
7118 * src/insets/insettext.C (GetDrawFont): inserted this function as
7119 the drawing-font may differ from the real paragraph font.
7121 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7122 insets (inset in inset!).
7124 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7125 function here because we don't want footnotes inside footnotes.
7127 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7129 (init): now set the inset_owner in paragraph.C
7130 (LocalDispatch): added some resetPos() in the right position
7133 (pasteSelection): changed to use the new CutAndPaste-Class.
7135 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7136 which tells if it is allowed to insert another inset inside this one.
7138 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7139 SwitchLayoutsBetweenClasses.
7141 * src/text2.C (InsertInset): checking of the new paragraph-function
7143 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7144 is not needed anymore here!
7147 (PasteSelection): redone (also with #ifdef) so that now this uses
7148 the CutAndPaste-Class.
7149 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7152 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7153 from/to text/insets.
7155 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7156 so that the paragraph knows if it is inside an (text)-inset.
7157 (InsertFromMinibuffer): changed return-value to bool as now it
7158 may happen that an inset is not inserted in the paragraph.
7159 (InsertInsetAllowed): this checks if it is allowed to insert an
7160 inset in this paragraph.
7162 (BreakParagraphConservative):
7163 (BreakParagraph) : small change for the above change of the return
7164 value of InsertFromMinibuffer.
7166 * src/lyxparagraph.h: added inset_owner and the functions to handle
7167 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7169 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7171 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7172 functions from BufferView to BufferView::Pimpl to ease maintence.
7174 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7175 correctly. Also use SetCursorIntern instead of SetCursor.
7177 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7180 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7182 * src/WorkArea.C (belowMouse): manually implement below mouse.
7184 * src/*: Add "explicit" on several constructors, I added probably
7185 some unneeded ones. A couple of changes to code because of this.
7187 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7188 implementation and private parts from the users of BufferView. Not
7191 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7192 implementation and private parts from the users of LyXLex. Not
7195 * src/BufferView_pimpl.[Ch]: new files
7197 * src/lyxlex_pimpl.[Ch]: new files
7199 * src/LyXView.[Ch]: some inline functions move out-of-line
7201 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7203 * src/lyxparagraph.h: make struct InsetTable public.
7205 * src/support/lyxstring.h: change lyxstring::difference_type to be
7206 ptrdiff_t. Add std:: modifiers to streams.
7208 * src/font.C: include the <cctype> header, for islower() and
7211 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7213 * src/font.[Ch]: new files. Contains the metric functions for
7214 fonts, takes a LyXFont as parameter. Better separation of concepts.
7216 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7217 changes because of this.
7219 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7221 * src/*: compile with -Winline and move functions that don't
7224 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7227 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7229 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7230 (various files changed because of this)
7232 * src/Painter.C (text): fixed the drawing of smallcaps.
7234 * src/lyxfont.[Ch] (drawText): removed unused member func.
7237 * src/*.C: added needed "using" statements and "std::" qualifiers.
7239 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7241 * src/*.h: removed all use of "using" from header files use
7242 qualifier std:: instead.
7244 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7246 * src/text.C (Backspace): some additional cleanups (we already
7247 know whether cursor.pos is 0 or not).
7249 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7250 automake does not provide one).
7252 * src/bmtable.h: replace C++ comments with C comments.
7254 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7256 * src/screen.C (ShowCursor): Change the shape of the cursor if
7257 the current language is not equal to the language of the document.
7258 (If the cursor change its shape unexpectedly, then you've found a bug)
7260 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7263 * src/insets/insetnumber.[Ch]: New files.
7265 * src/LyXAction.C (init)
7266 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7269 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7271 * src/lyxparagraph.h
7272 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7273 (the vector is kept sorted).
7275 * src/text.C (GetVisibleRow): Draw selection correctly when there
7276 is both LTR and RTL text.
7278 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7279 which is much faster.
7281 * src/text.C (GetVisibleRow and other): Do not draw the last space
7282 in a row if the direction of the last letter is not equal to the
7283 direction of the paragraph.
7285 * src/lyxfont.C (latexWriteStartChanges):
7286 Check that font language is not equal to basefont language.
7287 (latexWriteEndChanges): ditto
7289 * src/lyx_cb.C (StyleReset): Don't change the language while using
7290 the font-default command.
7292 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7293 empty paragraph before a footnote.
7295 * src/insets/insetcommand.C (draw): Increase x correctly.
7297 * src/screen.C (ShowCursor): Change cursor shape if
7298 current language != document language.
7300 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7302 2000-03-31 Juergen Vigna <jug@sad.it>
7304 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7305 (Clone): changed mode how the paragraph-data is copied to the
7306 new clone-paragraph.
7308 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7309 GetInset(pos) with no inset anymore there (in inset UNDO)
7311 * src/insets/insetcommand.C (draw): small fix as here x is
7312 incremented not as much as width() returns (2 before, 2 behind = 4)
7314 2000-03-30 Juergen Vigna <jug@sad.it>
7316 * src/insets/insettext.C (InsetText): small fix in initialize
7317 widthOffset (should not be done in the init() function)
7319 2000-03-29 Amir Karger <karger@lyx.org>
7321 * lib/examples/it_ItemizeBullets.lyx: translation by
7324 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7326 2000-03-29 Juergen Vigna <jug@sad.it>
7328 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7330 * src/insets/insetfoot.C (Clone): small change as for the below
7331 new init function in the text-inset
7333 * src/insets/insettext.C (init): new function as I've seen that
7334 clone did not copy the Paragraph-Data!
7335 (LocalDispatch): Added code so that now we have some sort of Undo
7336 functionality (well actually we HAVE Undo ;)
7338 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7340 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7342 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7345 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7347 * src/main.C: added a runtime check that verifies that the xforms
7348 header used when building LyX and the library used when running
7349 LyX match. Exit with a message if they don't match. This is a
7350 version number check only.
7352 * src/buffer.C (save): Don't allocate memory on the heap for
7353 struct utimbuf times.
7355 * *: some using changes, use iosfwd instead of the real headers.
7357 * src/lyxfont.C use char const * instead of string for the static
7358 strings. Rewrite some functions to use sstream.
7360 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7362 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7365 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7367 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7368 of Geodesy (from Martin Vermeer)
7370 * lib/layouts/svjour.inc: include file for the Springer svjour
7371 class. It can be used to support journals other than JoG.
7373 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7374 Miskiewicz <misiek@pld.org.pl>)
7375 * lib/reLyX/Makefile.am: ditto.
7377 2000-03-27 Juergen Vigna <jug@sad.it>
7379 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7380 also some modifications with operations on selected text.
7382 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7383 problems with clicking on insets (last famous words ;)
7385 * src/insets/insetcommand.C (draw):
7386 (width): Changed to have a bit of space before and after the inset so
7387 that the blinking cursor can be seen (otherwise it was hidden)
7389 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7391 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7392 would not be added to the link list when an installed gettext (not
7393 part of libc) is found.
7395 2000-03-24 Juergen Vigna <jug@sad.it>
7397 * src/insets/insetcollapsable.C (Edit):
7398 * src/mathed/formula.C (InsetButtonRelease):
7399 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7402 * src/BufferView.C (workAreaButtonPress):
7403 (workAreaButtonRelease):
7404 (checkInsetHit): Finally fixed the clicking on insets be handled
7407 * src/insets/insetert.C (Edit): inserted this call so that ERT
7408 insets work always with LaTeX-font
7410 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7412 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7413 caused lyx to startup with no GUI in place, causing in a crash
7414 upon startup when called with arguments.
7416 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7418 * src/FontLoader.C: better initialization of dummyXFontStruct.
7420 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7422 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7423 for linuxdoc and docbook import and export format options.
7425 * lib/lyxrc.example Example of default values for the previous flags.
7427 * src/lyx_cb.C Use those flags instead of the hardwired values for
7428 linuxdoc and docbook export.
7430 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7433 * src/menus.C Added menus entries for the new import/exports formats.
7435 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7437 * src/lyxrc.*: Added support for running without Gui
7440 * src/FontLoader.C: sensible defaults if no fonts are needed
7442 * src/lyx_cb.C: New function ShowMessage (writes either to the
7443 minibuffer or cout in case of no gui
7444 New function AskOverwrite for common stuff
7445 Consequently various changes to call these functions
7447 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7448 wild guess at sensible screen resolution when having no gui
7450 * src/lyxfont.C: no gui, no fonts... set some defaults
7452 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7454 * src/LColor.C: made the command inset background a bit lighter.
7456 2000-03-20 Hartmut Goebel <goebel@noris.net>
7458 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7459 stdstruct.inc. Koma-Script added some title elements which
7460 otherwise have been listed below "bibliography". This split allows
7461 adding title elements to where they belong.
7463 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7464 define the additional title elements and then include
7467 * many other layout files: changed to include stdtitle.inc just
7468 before stdstruct.inc.
7470 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7472 * src/buffer.C: (save) Added the option to store all backup files
7473 in a single directory
7475 * src/lyxrc.[Ch]: Added variable \backupdir_path
7477 * lib/lyxrc.example: Added descriptions of recently added variables
7479 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7480 bibtex inset, not closing the bibtex popup when deleting the inset)
7482 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7484 * src/lyx_cb.C: add a couple using directives.
7486 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7487 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7488 import based on the filename.
7490 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7491 file would be imported at start, if the filename where of a sgml file.
7493 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7495 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7497 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7498 * src/lyxfont.h Replaced the member variable bits.direction by the
7499 member variable lang. Made many changes in other files.
7500 This allows having a multi-lingual document
7502 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7503 that change the current language to <l>.
7504 Removed the command "font-rtl"
7506 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7507 format for Hebrew documents)
7509 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7510 When auto_mathmode is "true", pressing a digit key in normal mode
7511 will cause entering into mathmode.
7512 If auto_mathmode is "rtl" then this behavior will be active only
7513 when writing right-to-left text.
7515 * src/text2.C (InsertStringA) The string is inserted using the
7518 * src/paragraph.C (GetEndLabel) Gives a correct result for
7519 footnote paragraphs.
7521 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7523 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7525 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7526 front of PasteParagraph. Never insert a ' '. This should at least
7527 fix some cause for the segfaults that we have been experiencing,
7528 it also fixes backspace behaviour slightly. (Phu!)
7530 * src/support/lstrings.C (compare_no_case): some change to make it
7531 compile with gcc 2.95.2 and stdlibc++-v3
7533 * src/text2.C (MeltFootnoteEnvironment): change type o
7534 first_footnote_par_is_not_empty to bool.
7536 * src/lyxparagraph.h: make text private. Changes in other files
7538 (fitToSize): new function
7539 (setContentsFromPar): new function
7540 (clearContents): new function
7541 (SetChar): new function
7543 * src/paragraph.C (readSimpleWholeFile): deleted.
7545 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7546 the file, just use a simple string instead. Also read the file in
7547 a more maintainable manner.
7549 * src/text2.C (InsertStringA): deleted.
7550 (InsertStringB): deleted.
7552 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7554 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7555 RedoParagraphs from the doublespace handling part, just set status
7556 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7557 done, but perhaps not like this.)
7559 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7561 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7562 character when inserting an inset.
7564 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7566 * src/bufferparams.C (readLanguage): now takes "default" into
7569 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7570 also initialize the toplevel_keymap with the default bindings from
7573 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7575 * all files using lyxrc: have lyxrc as a real variable and not a
7576 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7579 * src/lyxrc.C: remove double call to defaultKeyBindings
7581 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7582 toolbar defauls using lyxlex. Remove enums, structs, functions
7585 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7586 toolbar defaults. Also store default keybindings in a map.
7588 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7589 storing the toolbar defaults without any xforms dependencies.
7591 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7592 applied. Changed to use iterators.
7594 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7596 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7597 systems that don't have LINGUAS set to begin with.
7599 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7601 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7602 the list by Dekel Tsur.
7604 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7606 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7607 * src/insets/form_graphics.C: ditto.
7609 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7611 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7613 * src/bufferparams.C (readLanguage): use the new language map
7615 * src/intl.C (InitKeyMapper): use the new language map
7617 * src/lyx_gui.C (create_forms): use the new language map
7619 * src/language.[Ch]: New files. Used for holding the information
7620 about each language. Now! Use this new language map enhance it and
7621 make it really usable for our needs.
7623 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7625 * screen.C (ShowCursor): Removed duplicate code.
7626 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7627 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7629 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7632 * src/text.C Added TransformChar method. Used for rendering Arabic
7633 text correctly (change the glyphs of the letter according to the
7634 position in the word)
7639 * src/lyxrc.C Added lyxrc command {language_command_begin,
7640 language_command_end,language_command_ltr,language_command_rtl,
7641 language_package} which allows the use of either arabtex or Omega
7644 * src/lyx_gui.C (init)
7646 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7647 to use encoding for menu fonts which is different than the encoding
7650 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7651 do not load the babel package.
7652 To write an English document with Hebrew/Arabic, change the document
7653 language to "english".
7655 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7656 (alphaCounter): changed to return char
7657 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7659 * lib/lyxrc.example Added examples for Hebrew/Arabic
7662 * src/layout.C Added layout command endlabeltype
7664 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7666 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7668 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7670 * src/mathed/math_delim.C (search_deco): return a
7671 math_deco_struct* instead of index.
7673 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7675 * All files with a USE_OSTREAM_ONLY within: removed all code that
7676 was unused when USE_OSTREAM_ONLY is defined.
7678 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7679 of any less. Removed header and using.
7681 * src/text.C (GetVisibleRow): draw the string "Page Break
7682 (top/bottom)" on screen when drawing a pagebreak line.
7684 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7686 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7688 * src/mathed/math_macro.C (draw): do some cast magic.
7691 * src/mathed/math_defs.h: change byte* argument to byte const*.
7693 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7695 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7696 know it is right to return InsetFoot* too, but cxx does not like
7699 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7701 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7703 * src/mathed/math_delim.C: change == to proper assignment.
7705 2000-03-09 Juergen Vigna <jug@sad.it>
7707 * src/insets/insettext.C (setPos): fixed various cursor positioning
7708 problems (via mouse and cursor-keys)
7709 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7710 inset (still a small display problem but it works ;)
7712 * src/insets/insetcollapsable.C (draw): added button_top_y and
7713 button_bottom_y to have correct values for clicking on the inset.
7715 * src/support/lyxalgo.h: commented out 'using std::less'
7717 2000-03-08 Juergen Vigna <jug@sad.it>
7719 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7720 Button-Release event closes as it is alos the Release-Event
7723 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7725 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7727 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7728 can add multiple spaces in Scrap (literate programming) styles...
7729 which, by the way, is how I got hooked on LyX to begin with.
7731 * src/mathed/formula.C (Write): Added dummy variable to an
7732 inset::Latex() call.
7733 (Latex): Add free_spacing boolean to inset::Latex()
7735 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7737 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7738 virtual function to include the free_spacing boolean from
7739 the containing paragraph's style.
7741 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7742 Added free_spacing boolean arg to match inset.h
7744 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7745 Added free_spacing boolean arg to match inset.h
7747 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7748 Added free_spacing boolean and made sure that if in a free_spacing
7749 paragraph, that we output normal space if there is a protected space.
7751 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7752 Added free_spacing boolean arg to match inset.h
7754 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7755 Added free_spacing boolean arg to match inset.h
7757 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7758 Added free_spacing boolean arg to match inset.h
7760 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7761 Added free_spacing boolean arg to match inset.h
7763 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7764 Added free_spacing boolean arg to match inset.h
7766 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7767 free_spacing boolean arg to match inset.h
7769 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7770 Added free_spacing boolean arg to match inset.h
7772 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7773 Added free_spacing boolean arg to match inset.h
7775 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7776 Added free_spacing boolean arg to match inset.h
7778 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7779 Added free_spacing boolean arg to match inset.h
7781 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7782 Added free_spacing boolean arg to match inset.h
7784 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7785 free_spacing boolean arg to match inset.h
7787 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7788 free_spacing boolean arg to match inset.h
7790 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7791 ignore free_spacing paragraphs. The user's spaces are left
7794 * src/text.C (InsertChar): Fixed the free_spacing layout
7795 attribute behavior. Now, if free_spacing is set, you can
7796 add multiple spaces in a paragraph with impunity (and they
7797 get output verbatim).
7798 (SelectSelectedWord): Added dummy argument to inset::Latex()
7801 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7804 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7805 paragraph layouts now only input a simple space instead.
7806 Special character insets don't make any sense in free-spacing
7809 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7810 hard-spaces in the *input* file to simple spaces if the layout
7811 is free-spacing. This converts old files which had to have
7812 hard-spaces in free-spacing layouts where a simple space was
7814 (writeFileAscii): Added free_spacing check to pass to the newly
7815 reworked inset::Latex(...) methods. The inset::Latex() code
7816 ensures that hard-spaces in free-spacing paragraphs get output
7817 as spaces (rather than "~").
7819 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7821 * src/mathed/math_delim.C (draw): draw the empty placeholder
7822 delims with a onoffdash line.
7823 (struct math_deco_compare): struct that holds the "functors" used
7824 for the sort and the binary search in math_deco_table.
7825 (class init_deco_table): class used for initial sort of the
7827 (search_deco): use lower_bound to do a binary search in the
7830 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7832 * src/lyxrc.C: a small secret thingie...
7834 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7835 and to not flush the stream as often as it used to.
7837 * src/support/lyxalgo.h: new file
7838 (sorted): template function used for checking if a sequence is
7839 sorted or not. Two versions with and without user supplied
7840 compare. Uses same compare as std::sort.
7842 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7843 it and give warning on lyxerr.
7845 (struct compare_tags): struct with function operators used for
7846 checking if sorted, sorting and lower_bound.
7847 (search_kw): use lower_bound instead of manually implemented
7850 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7852 * src/insets/insetcollapsable.h: fix Clone() declaration.
7853 * src/insets/insetfoot.h: ditto.
7855 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7857 2000-03-08 Juergen Vigna <jug@sad.it>
7859 * src/insets/lyxinset.h: added owner call which tells us if
7860 this inset is inside another inset. Changed also the return-type
7861 of Editable to an enum so it tells clearer what the return-value is.
7863 * src/insets/insettext.C (computeTextRows): fixed computing of
7864 textinsets which split automatically on more rows.
7866 * src/insets/insetert.[Ch]: changed this to be of BaseType
7869 * src/insets/insetfoot.[Ch]: added footnote inset
7871 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7872 collapsable insets (like footnote, ert, ...)
7874 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7876 * src/lyxdraw.h: remvoe file
7878 * src/lyxdraw.C: remove file
7880 * src/insets/insettext.C: added <algorithm>.
7882 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7884 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7885 (matrix_cb): case MM_OK use string stream
7887 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7890 * src/mathed/math_macro.C (draw): use string stream
7891 (Metrics): use string stream
7893 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7894 directly to the ostream.
7896 * src/vspace.C (asString): use string stream.
7897 (asString): use string stream
7898 (asLatexString): use string stream
7900 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7901 setting Spacing::Other.
7903 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7904 sprintf when creating the stretch vale.
7906 * src/text2.C (alphaCounter): changed to return a string and to
7907 not use a static variable internally. Also fixed a one-off bug.
7908 (SetCounter): changed the drawing of the labels to use string
7909 streams instead of sprintf.
7911 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7912 manipulator to use a scheme that does not require library support.
7913 This is also the way it is done in the new GNU libstdc++. Should
7914 work with DEC cxx now.
7916 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7918 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7919 end. This fixes a bug.
7921 * src/mathed (all files concerned with file writing): apply the
7922 USE_OSTREAM_ONLY changes to mathed too.
7924 * src/support/DebugStream.h: make the constructor explicit.
7926 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7927 count and ostream squashed.
7929 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7931 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7933 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7934 ostringstream uses STL strings, and we might not.
7936 * src/insets/insetspecialchar.C: add using directive.
7937 * src/insets/insettext.C: ditto.
7939 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7941 * lib/layouts/seminar.layout: feeble attempt at a layout for
7942 seminar.cls, far from completet and could really use some looking
7943 at from people used to write layout files.
7945 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7946 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7947 a lot nicer and works nicely with ostreams.
7949 * src/mathed/formula.C (draw): a slightly different solution that
7950 the one posted to the list, but I think this one works too. (font
7951 size wrong in headers.)
7953 * src/insets/insettext.C (computeTextRows): some fiddling on
7954 Jürgens turf, added some comments that he should read.
7956 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7957 used and it gave compiler warnings.
7958 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7961 * src/lyx_gui.C (create_forms): do the right thing when
7962 show_banner is true/false.
7964 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7965 show_banner is false.
7967 * most file writing files: Now use iostreams to do almost all of
7968 the writing. Also instead of passing string &, we now use
7969 stringstreams. mathed output is still not adapted to iostreams.
7970 This change can be turned off by commenting out all the occurences
7971 of the "#define USE_OSTREAM_ONLY 1" lines.
7973 * src/WorkArea.C (createPixmap): don't output debug messages.
7974 (WorkArea): don't output debug messages.
7976 * lib/lyxrc.example: added a comment about the new variable
7979 * development/Code_rules/Rules: Added some more commente about how
7980 to build class interfaces and on how better encapsulation can be
7983 2000-03-03 Juergen Vigna <jug@sad.it>
7985 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7986 automatically with the width of the LyX-Window
7988 * src/insets/insettext.C (computeTextRows): fixed update bug in
7989 displaying text-insets (scrollvalues where not initialized!)
7991 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7993 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7994 id in the check of the result from lower_bound is not enough since
7995 lower_bound can return last too, and then res->id will not be a
7998 * all insets and some code that use them: I have conditionalized
7999 removed the Latex(string & out, ...) this means that only the
8000 Latex(ostream &, ...) will be used. This is a work in progress to
8001 move towards using streams for all output of files.
8003 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8006 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8008 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8009 routine (this fixes bug where greek letters were surrounded by too
8012 * src/support/filetools.C (findtexfile): change a bit the search
8013 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8014 no longer passed to kpsewhich, we may have to change that later.
8016 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8017 warning options to avoid problems with X header files (from Angus
8019 * acinclude.m4: regenerated.
8021 2000-03-02 Juergen Vigna <jug@sad.it>
8023 * src/insets/insettext.C (WriteParagraphData): Using the
8024 par->writeFile() function for writing paragraph-data.
8025 (Read): Using buffer->parseSingleLyXformat2Token()-function
8026 for parsing paragraph data!
8028 * src/buffer.C (readLyXformat2): removed all parse data and using
8029 the new parseSingleLyXformat2Token()-function.
8030 (parseSingleLyXformat2Token): added this function to parse (read)
8031 lyx-file-format (this is called also from text-insets now!)
8033 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8035 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8038 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8039 directly instead of going through a func. One very bad thing: a
8040 static LyXFindReplace, but I don't know where to place it.
8042 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8043 string instead of char[]. Also changed to static.
8044 (GetSelectionOrWordAtCursor): changed to static inline
8045 (SetSelectionOverLenChars): ditto.
8047 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8048 current_view and global variables. both classes has changed names
8049 and LyXFindReplace is not inherited from SearchForm.
8051 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8052 fl_form_search form.
8054 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8056 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8058 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8059 bound (from Kayvan).
8061 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8063 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8065 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8067 * some things that I should comment but the local pub says head to
8070 * comment out all code that belongs to the Roff code for Ascii
8071 export of tables. (this is unused)
8073 * src/LyXView.C: use correct type for global variable
8074 current_layout. (LyXTextClass::size_type)
8076 * some code to get the new insetgraphics closer to working I'd be
8077 grateful for any help.
8079 * src/BufferView2.C (insertInset): use the return type of
8080 NumberOfLayout properly. (also changes in other files)
8082 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8083 this as a test. I want to know what breaks because of this.
8085 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8087 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8089 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8090 to use a \makebox in the label, this allows proper justification
8091 with out using protected spaces or multiple hfills. Now it is
8092 "label" for left justified, "\hfill label\hfill" for center, and
8093 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8094 should be changed accordingly.
8096 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8098 * src/lyxtext.h: change SetLayout() to take a
8099 LyXTextClass::size_type instead of a char (when there is more than
8100 127 layouts in a class); also change type of copylayouttype.
8101 * src/text2.C (SetLayout): ditto.
8102 * src/LyXView.C (updateLayoutChoice): ditto.
8104 * src/LaTeX.C (scanLogFile): errors where the line number was not
8105 given just after the '!'-line were ignored (from Dekel Tsur).
8107 * lib/lyxrc.example: fix description of \date_insert_format
8109 * lib/layouts/llncs.layout: new layout, contributed by Martin
8112 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8114 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8115 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8116 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8117 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8118 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8119 paragraph.C, text.C, text2.C)
8121 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8123 * src/insets/insettext.C (LocalDispatch): remove extra break
8126 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8127 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8129 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8130 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8132 * src/insets/insetbib.h: move InsetBibkey::Holder and
8133 InsetCitation::Holder in public space.
8135 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8137 * src/insets/insettext.h: small change to get the new files from
8138 Juergen to compile (use "string", not "class string").
8140 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8141 const & as parameter to LocalDispatch, use LyXFont const & as
8142 paramter to some other func. This also had impacto on lyxinsets.h
8143 and the two mathed insets.
8145 2000-02-24 Juergen Vigna <jug@sad.it>
8148 * src/commandtags.h:
8150 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8154 * src/BufferView2.C: added/updated code for various inset-functions
8156 * src/insets/insetert.[Ch]: added implementation of InsetERT
8158 * src/insets/insettext.[Ch]: added implementation of InsetText
8160 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8161 (draw): added preliminary code for inset scrolling not finshed yet
8163 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8164 as it is in lyxfunc.C now
8166 * src/insets/lyxinset.h: Added functions for text-insets
8168 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8170 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8171 BufferView and reimplement the list as a queue put inside its own
8174 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8176 * several files: use the new interface to the "updateinsetlist"
8178 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8180 (work_area_handler): call BufferView::trippleClick on trippleclick.
8182 * src/BufferView.C (doubleClick): new function, selects word on
8184 (trippleClick): new function, selects line on trippleclick.
8186 2000-02-22 Allan Rae <rae@lyx.org>
8188 * lib/bind/xemacs.bind: buffer-previous not supported
8190 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8192 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8195 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8197 * src/bufferlist.C: get rid of current_view from this file
8199 * src/spellchecker.C: get rid of current_view from this file
8201 * src/vspace.C: get rid of current_view from this file
8202 (inPixels): added BufferView parameter for this func
8203 (asLatexCommand): added a BufferParams for this func
8205 * src/text.C src/text2.C: get rid of current_view from these
8208 * src/lyxfont.C (getFontDirection): move this function here from
8211 * src/bufferparams.C (getDocumentDirection): move this function
8214 * src/paragraph.C (getParDirection): move this function here from
8216 (getLetterDirection): ditto
8218 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8220 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8221 resize due to wrong pixmap beeing used. Also took the opurtunity
8222 to make the LyXScreen stateless on regard to WorkArea and some
8223 general cleanup in the same files.
8225 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8227 * src/Makefile.am: add missing direction.h
8229 * src/PainterBase.h: made the width functions const.
8231 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8234 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8236 * src/insets/insetlatexaccent.C (draw): make the accents draw
8237 better, at present this will only work well with iso8859-1.
8239 * several files: remove the old drawing code, now we use the new
8242 * several files: remove support for mono_video, reverse_video and
8245 2000-02-17 Juergen Vigna <jug@sad.it>
8247 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8248 int ** as we have to return the pointer, otherwise we have only
8249 NULL pointers in the returning function.
8251 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8253 * src/LaTeX.C (operator()): quote file name when running latex.
8255 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8257 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8258 (bubble tip), this removes our special handling of this.
8260 * Remove all code that is unused now that we have the new
8261 workarea. (Code that are not active when NEW_WA is defined.)
8263 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8265 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8267 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8268 nonexisting layout; correctly redirect obsoleted layouts.
8270 * lib/lyxrc.example: document \view_dvi_paper_option
8272 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8275 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8276 (PreviewDVI): handle the view_dvi_paper_option variable.
8277 [Both from Roland Krause]
8279 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8281 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8282 char const *, int, LyXFont)
8283 (text(int, int, string, LyXFont)): ditto
8285 * src/text.C (InsertCharInTable): attempt to fix the double-space
8286 feature in tables too.
8287 (BackspaceInTable): ditto.
8288 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8290 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8292 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8294 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8295 newly found text in textcache to this.
8296 (buffer): set the owner of the text put into the textcache to 0
8298 * src/insets/figinset.C (draw): fixed the drawing of figures with
8301 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8302 drawing of mathframe, hfills, protected space, table lines. I have
8303 now no outstanding drawing problems with the new Painter code.
8305 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8307 * src/PainterBase.C (ellipse, circle): do not specify the default
8310 * src/LColor.h: add using directive.
8312 * src/Painter.[Ch]: change return type of methods from Painter& to
8313 PainterBase&. Add a using directive.
8315 * src/WorkArea.C: wrap xforms callbacks in C functions
8318 * lib/layouts/foils.layout: font fix and simplifications from Carl
8321 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8323 * a lot of files: The Painter, LColor and WorkArea from the old
8324 devel branch has been ported to lyx-devel. Some new files and a
8325 lot of #ifdeffed code. The new workarea is enabled by default, but
8326 if you want to test the new Painter and LColor you have to compile
8327 with USE_PAINTER defined (do this in config.h f.ex.) There are
8328 still some rought edges, and I'd like some help to clear those
8329 out. It looks stable (loads and displays the Userguide very well).
8332 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8334 * src/buffer.C (pop_tag): revert to the previous implementation
8335 (use a global variable for both loops).
8337 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8339 * src/lyxrc.C (LyXRC): change slightly default date format.
8341 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8342 there is an English text with a footnote that starts with a Hebrew
8343 paragraph, or vice versa.
8344 (TeXFootnote): ditto.
8346 * src/text.C (LeftMargin): allow for negative values for
8347 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8350 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8351 for input encoding (cyrillic)
8353 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8355 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8358 * src/toolbar.C (set): ditto
8359 * src/insets/insetbib.C (create_form_citation_form): ditto
8361 * lib/CREDITS: added Dekel Tsur.
8363 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8364 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8365 hebrew supports files from Dekel Tsur.
8367 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8368 <tzafrir@technion.ac.il>
8370 * src/lyxrc.C: put \date_insert_format at the right place.
8372 * src/buffer.C (makeLaTeXFile): fix the handling of
8373 BufferParams::sides when writing out latex files.
8375 * src/BufferView2.C: add a "using" directive.
8377 * src/support/lyxsum.C (sum): when we use lyxstring,
8378 ostringstream::str needs an additional .c_str().
8380 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8382 * src/support/filetools.C (ChangeExtension): patch from Etienne
8385 * src/TextCache.C (show): remove const_cast and make second
8386 parameter non-const LyXText *.
8388 * src/TextCache.h: use non const LyXText in show.
8390 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8393 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8395 * src/support/lyxsum.C: rework to be more flexible.
8397 * several places: don't check if a pointer is 0 if you are going
8400 * src/text.C: remove some dead code.
8402 * src/insets/figinset.C: remove some dead code
8404 * src/buffer.C: move the BufferView funcs to BufferView2.C
8405 remove all support for insetlatexdel
8406 remove support for oldpapersize stuff
8407 made some member funcs const
8409 * src/kbmap.C: use a std::list to store the bindings in.
8411 * src/BufferView2.C: new file
8413 * src/kbsequence.[Ch]: new files
8415 * src/LyXAction.C + others: remove all trace of buffer-previous
8417 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8418 only have one copy in the binary of this table.
8420 * hebrew patch: moved some functions from LyXText to more
8421 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8423 * several files: remove support for XForms older than 0.88
8425 remove some #if 0 #endif code
8427 * src/TextCache.[Ch]: new file. Holds the textcache.
8429 * src/BufferView.C: changes to use the new TextCache interface.
8430 (waitForX): remove the now unused code.
8432 * src/BackStack.h: remove some commented code
8434 * lib/bind/emacs.bind: remove binding for buffer-previous
8436 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8438 * applied the hebrew patch.
8440 * src/lyxrow.h: make sure that all Row variables are initialized.
8442 * src/text2.C (TextHandleUndo): comment out a delete, this might
8443 introduce a memory leak, but should also help us to not try to
8444 read freed memory. We need to look at this one.
8446 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8447 (LyXParagraph): initalize footnotekind.
8449 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8450 forgot this when applying the patch. Please heed the warnings.
8452 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8453 (aka. reformat problem)
8455 * src/bufferlist.C (exists): made const, and use const_iterator
8456 (isLoaded): new func.
8457 (release): use std::find to find the correct buffer.
8459 * src/bufferlist.h: made getState a const func.
8460 made empty a const func.
8461 made exists a const func.
8464 2000-02-01 Juergen Vigna <jug@sad.it>
8466 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8468 * po/it.po: updated a bit the italian po file and also changed the
8469 'file nuovo' for newfile to 'filenuovo' without a space, this did
8472 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8473 for the new insert_date command.
8475 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8476 from jdblair, to insert a date into the current text conforming to
8477 a strftime format (for now only considering the locale-set and not
8478 the document-language).
8480 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8482 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8483 Bounds Read error seen by purify. The problem was that islower is
8484 a macros which takes an unsigned char and uses it as an index for
8485 in array of characters properties (and is thus subject to the
8489 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8490 correctly the paper sides radio buttons.
8491 (UpdateDocumentButtons): ditto.
8493 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8495 * src/kbmap.C (getsym + others): change to return unsigned int,
8496 returning a long can give problems on 64 bit systems. (I assume
8497 that int is 32bit on 64bit systems)
8499 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8501 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8502 LyXLookupString to be zero-terminated. Really fixes problems seen
8505 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8507 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8508 write a (char*)0 to the lyxerr stream.
8510 * src/lastfiles.C: move algorithm before the using statemets.
8512 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8514 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8515 complains otherwise).
8516 * src/table.C: ditto
8518 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8521 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8522 that I removed earlier... It is really needed.
8524 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8526 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8528 * INSTALL: update xforms home page URL.
8530 * lib/configure.m4: fix a bug with unreadable layout files.
8532 * src/table.C (calculate_width_of_column): add "using std::max"
8535 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8537 * several files: marked several lines with "DEL LINE", this is
8538 lines that can be deleted without changing anything.
8539 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8540 checks this anyway */
8543 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8545 * src/DepTable.C (update): add a "+" at the end when the checksum
8546 is different. (debugging string only)
8548 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8549 the next inset to not be displayed. This should also fix the list
8550 of labels in the "Insert Crossreference" dialog.
8552 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8554 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8555 when regex was not found.
8557 * src/support/lstrings.C (lowercase): use handcoded transform always.
8560 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8561 old_cursor.par->prev could be 0.
8563 * several files: changed post inc/dec to pre inc/dec
8565 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8566 write the lastfiles to file.
8568 * src/BufferView.C (buffer): only show TextCache info when debugging
8570 (resizeCurrentBuffer): ditto
8571 (workAreaExpose): ditto
8573 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8575 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8577 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8578 a bit better by removing the special case for \i and \j.
8580 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8582 * src/lyx_main.C (easyParse): remove test for bad comand line
8583 options, since this broke all xforms-related parsing.
8585 * src/kbmap.C (getsym): set return type to unsigned long, as
8586 declared in header. On an alpha, long is _not_ the same as int.
8588 * src/support/LOstream.h: add a "using std::flush;"
8590 * src/insets/figinset.C: ditto.
8592 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8594 * src/bufferlist.C (write): use blinding fast file copy instead of
8595 "a char at a time", now we are doing it the C++ way.
8597 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8598 std::list<int> instead.
8599 (addpidwait): reflect move to std::list<int>
8600 (sigchldchecker): ditto
8602 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8605 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8606 that obviously was wrong...
8608 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8609 c, this avoids warnings with purify and islower.
8611 * src/insets/figinset.C: rename struct queue to struct
8612 queue_element and rewrite to use a std::queue. gsqueue is now a
8613 std::queue<queue_element>
8614 (runqueue): reflect move to std::queue
8617 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8618 we would get "1" "0" instead of "true" "false. Also make the tostr
8621 2000-01-21 Juergen Vigna <jug@sad.it>
8623 * src/buffer.C (writeFileAscii): Disabled code for special groff
8624 handling of tabulars till I fix this in table.C
8626 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8628 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8630 * src/support/lyxlib.h: ditto.
8632 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8634 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8635 and 'j' look better. This might fix the "macron" bug that has been
8638 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8639 functions as one template function. Delete the old versions.
8641 * src/support/lyxsum.C: move using std::ifstream inside
8644 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8647 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8649 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8651 * src/insets/figinset.C (InitFigures): use new instead of malloc
8652 to allocate memory for figures and bitmaps.
8653 (DoneFigures): use delete[] instead of free to deallocate memory
8654 for figures and bitmaps.
8655 (runqueue): use new to allocate
8656 (getfigdata): use new/delete[] instead of malloc/free
8657 (RegisterFigure): ditto
8659 * some files: moved some declarations closer to first use, small
8660 whitespace changes use preincrement instead of postincrement where
8661 it does not make a difference.
8663 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8664 step on the way to use stl::containers for key maps.
8666 * src/bufferlist.h: add a typedef for const_iterator and const
8667 versions of begin and end.
8669 * src/bufferlist.[Ch]: change name of member variable _state to
8670 state_. (avoid reserved names)
8672 (getFileNames): returns the filenames of the buffers in a vector.
8674 * configure.in (ALL_LINGUAS): added ro
8676 * src/support/putenv.C: new file
8678 * src/support/mkdir.C: new file
8680 2000-01-20 Allan Rae <rae@lyx.org>
8682 * lib/layouts/IEEEtran.layout: Added several theorem environments
8684 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8685 couple of minor additions.
8687 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8688 (except for those in footnotes of course)
8690 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8692 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8694 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8695 std::sort and std::lower_bound instead of qsort and handwritten
8697 (struct compara): struct that holds the functors used by std::sort
8698 and std::lower_bound in MathedLookupBOP.
8700 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8702 * src/support/LAssert.h: do not do partial specialization. We do
8705 * src/support/lyxlib.h: note that lyx::getUserName() and
8706 lyx::date() are not in use right now. Should these be suppressed?
8708 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8709 (makeLinuxDocFile): do not put date and user name in linuxdoc
8712 * src/support/lyxlib.h (kill): change first argument to long int,
8713 since that's what solaris uses.
8715 * src/support/kill.C (kill): fix declaration to match prototype.
8717 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8718 actually check whether namespaces are supported. This is not what
8721 * src/support/lyxsum.C: add a using directive.
8723 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8725 * src/support/kill.C: if we have namespace support we don't have
8726 to include lyxlib.h.
8728 * src/support/lyxlib.h: use namespace lyx if supported.
8730 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8732 * src/support/date.C: new file
8734 * src/support/chdir.C: new file
8736 * src/support/getUserName.C: new file
8738 * src/support/getcwd.C: new file
8740 * src/support/abort.C: new file
8742 * src/support/kill.C: new file
8744 * src/support/lyxlib.h: moved all the functions in this file
8745 insede struct lyx. Added also kill and abort to this struct. This
8746 is a way to avoid the "kill is not defined in <csignal>", we make
8747 C++ wrappers for functions that are not ANSI C or ANSI C++.
8749 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8750 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8751 lyx it has been renamed to sum.
8753 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8755 * src/text.C: add using directives for std::min and std::max.
8757 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8759 * src/texrow.C (getIdFromRow): actually return something useful in
8760 id and pos. Hopefully fixes the bug with positionning of errorbox
8763 * src/lyx_main.C (easyParse): output an error and exit if an
8764 incorrect command line option has been given.
8766 * src/spellchecker.C (ispell_check_word): document a memory leak.
8768 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8769 where a "struct utimbuf" is allocated with "new" and deleted with
8772 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8774 * src/text2.C (CutSelection): don't delete double spaces.
8775 (PasteSelection): ditto
8776 (CopySelection): ditto
8778 * src/text.C (Backspace): don't delete double spaces.
8780 * src/lyxlex.C (next): fix a bug that were only present with
8781 conformant std::istream::get to read comment lines, use
8782 std::istream::getline instead. This seems to fix the problem.
8784 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8786 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8787 allowed to insert space before space" editing problem. Please read
8788 commends at the beginning of the function. Comments about usage
8791 * src/text.C (InsertChar): fix for the "not allowed to insert
8792 space before space" editing problem.
8794 * src/text2.C (DeleteEmptyParagraphMechanism): when
8795 IsEmptyTableRow can only return false this last "else if" will
8796 always be a no-op. Commented out.
8798 * src/text.C (RedoParagraph): As far as I can understand tmp
8799 cursor is not really needed.
8801 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8802 present it could only return false anyway.
8803 (several functions): Did something not so smart...added a const
8804 specifier on a lot of methods.
8806 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8807 and add a tmp->text.resize. The LyXParagraph constructor does the
8809 (BreakParagraphConservative): ditto
8811 * src/support/path.h (Path): add a define so that the wrong usage
8812 "Path("/tmp") will be flagged as a compilation error:
8813 "`unnamed_Path' undeclared (first use this function)"
8815 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8817 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8818 which was bogus for several reasons.
8820 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8824 * autogen.sh: do not use "type -path" (what's that anyway?).
8826 * src/support/filetools.C (findtexfile): remove extraneous space
8827 which caused a kpsewhich warning (at least with kpathsea version
8830 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8832 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8834 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8836 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8838 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8840 * src/paragraph.C (BreakParagraph): do not reserve space on text
8841 if we don't need to (otherwise, if pos_end < pos, we end up
8842 reserving huge amounts of memory due to bad unsigned karma).
8843 (BreakParagraphConservative): ditto, although I have not seen
8844 evidence the bug can happen here.
8846 * src/lyxparagraph.h: add a using std::list.
8848 2000-01-11 Juergen Vigna <jug@sad.it>
8850 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8853 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8855 * src/vc-backend.C (doVCCommand): change to be static and take one
8856 more parameter: the path to chdir too be fore executing the command.
8857 (retrive): new function equiv to "co -r"
8859 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8860 file_not_found_hook is true.
8862 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8864 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8865 if a file is readwrite,readonly...anything else.
8867 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8869 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8870 (CreatePostscript): name change from MenuRunDVIPS (or something)
8871 (PreviewPostscript): name change from MenuPreviewPS
8872 (PreviewDVI): name change from MenuPreviewDVI
8874 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8875 \view_pdf_command., \pdf_to_ps_command
8877 * lib/configure.m4: added search for PDF viewer, and search for
8878 PDF to PS converter.
8879 (lyxrc.defaults output): add \pdflatex_command,
8880 \view_pdf_command and \pdf_to_ps_command.
8882 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8884 * src/bufferlist.C (write): we don't use blocksize for anything so
8887 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8889 * src/support/block.h: disable operator T* (), since it causes
8890 problems with both compilers I tried. See comments in the file.
8892 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8895 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8896 variable LYX_DIR_10x to LYX_DIR_11x.
8898 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8900 * INSTALL: document --with-lyxname.
8903 * configure.in: new configure flag --with-lyxname which allows to
8904 choose the name under which lyx is installed. Default is "lyx", of
8905 course. It used to be possible to do this with --program-suffix,
8906 but the later has in fact a different meaning for autoconf.
8908 * src/support/lstrings.h (lstrchr): reformat a bit.
8910 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8911 * src/mathed/math_defs.h: ditto.
8913 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8915 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8916 true, decides if we create a backup file or not when saving. New
8917 tag and variable \pdf_mode, defaults to false. New tag and
8918 variable \pdflatex_command, defaults to pdflatex. New tag and
8919 variable \view_pdf_command, defaults to xpdf. New tag and variable
8920 \pdf_to_ps_command, defaults to pdf2ps.
8922 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8924 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8925 does not have a BufferView.
8926 (unlockInset): ditto + don't access the_locking_inset if the
8927 buffer does not have a BufferView.
8929 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8930 certain circumstances so that we don't continue a keyboard
8931 operation long after the key was released. Try f.ex. to load a
8932 large document, press PageDown for some seconds and then release
8933 it. Before this change the document would contine to scroll for
8934 some time, with this change it stops imidiatly.
8936 * src/support/block.h: don't allocate more space than needed. As
8937 long as we don't try to write to the arr[x] in a array_type arr[x]
8938 it is perfectly ok. (if you write to it you might segfault).
8939 added operator value_type*() so that is possible to pass the array
8940 to functions expecting a C-pointer.
8942 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8945 * intl/*: updated to gettext 0.10.35, tried to add our own
8946 required modifications. Please verify.
8948 * po/*: updated to gettext 0.10.35, tried to add our own required
8949 modifications. Please verify.
8951 * src/support/lstrings.C (tostr): go at fixing the problem with
8952 cxx and stringstream. When stringstream is used return
8953 oss.str().c_str() so that problems with lyxstring and basic_string
8954 are avoided. Note that the best solution would be for cxx to use
8955 basic_string all the way, but it is not conformant yet. (it seems)
8957 * src/lyx_cb.C + other files: moved several global functions to
8958 class BufferView, some have been moved to BufferView.[Ch] others
8959 are still located in lyx_cb.C. Code changes because of this. (part
8960 of "get rid of current_view project".)
8962 * src/buffer.C + other files: moved several Buffer functions to
8963 class BufferView, the functions are still present in buffer.C.
8964 Code changes because of this.
8966 * config/lcmessage.m4: updated to most recent. used when creating
8969 * config/progtest.m4: updated to most recent. used when creating
8972 * config/gettext.m4: updated to most recent. applied patch for
8975 * config/gettext.m4.patch: new file that shows what changes we
8976 have done to the local copy of gettext.m4.
8978 * config/libtool.m4: new file, used in creation of acinclude.m4
8980 * config/lyxinclude.m4: new file, this is the lyx created m4
8981 macros, used in making acinclude.m4.
8983 * autogen.sh: GNU m4 discovered as a separate task not as part of
8984 the lib/configure creation.
8985 Generate acinlucde from files in config. Actually cat
8986 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8987 easier to upgrade .m4 files that really are external.
8989 * src/Spacing.h: moved using std::istringstream to right after
8990 <sstream>. This should fix the problem seen with some compilers.
8992 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8994 * src/lyx_cb.C: began some work to remove the dependency a lot of
8995 functions have on BufferView::text, even if not really needed.
8996 (GetCurrentTextClass): removed this func, it only hid the
8999 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9000 forgot this in last commit.
9002 * src/Bullet.C (bulletEntry): use static char const *[] for the
9003 tables, becuase of this the return arg had to change to string.
9005 (~Bullet): removed unneeded destructor
9007 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9008 (insetSleep): moved from Buffer
9009 (insetWakeup): moved from Buffer
9010 (insetUnlock): moved from Buffer
9012 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9013 from Buffer to BufferView.
9015 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9017 * config/ltmain.sh: updated to version 1.3.4 of libtool
9019 * config/ltconfig: updated to version 1.3.4 of libtool
9021 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9024 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9025 Did I get that right?
9027 * src/lyxlex.h: add a "using" directive or two.
9028 * src/Spacing.h: ditto.
9029 * src/insets/figinset.C: ditto.
9030 * src/support/filetools.C: ditto.
9031 * src/support/lstrings.C: ditto.
9032 * src/BufferView.C: ditto.
9033 * src/bufferlist.C: ditto.
9034 * src/lyx_cb.C: ditto.
9035 * src/lyxlex.C: ditto.
9037 * NEWS: add some changes for 1.1.4.
9039 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9041 * src/BufferView.C: first go at a TextCache to speed up switching
9044 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9046 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9047 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9048 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9049 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9052 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9053 members of the struct are correctly initialized to 0 (detected by
9055 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9056 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9058 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9059 pidwait, since it was allocated with "new". This was potentially
9060 very bad. Thanks to Michael Schmitt for running purify for us.
9063 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9065 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9067 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9069 1999-12-30 Allan Rae <rae@lyx.org>
9071 * lib/templates/IEEEtran.lyx: minor change
9073 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9074 src/mathed/formula.C (LocalDispatch): askForText changes
9076 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9077 know when a user has cancelled input. Fixes annoying problems with
9078 inserting labels and version control.
9080 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9082 * src/support/lstrings.C (tostr): rewritten to use strstream and
9085 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9087 * src/support/filetools.C (IsFileWriteable): use fstream to check
9088 (IsDirWriteable): use fileinfo to check
9090 * src/support/filetools.h (FilePtr): whole class deleted
9092 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9094 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9096 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9098 * src/bufferlist.C (write): use ifstream and ofstream instead of
9101 * src/Spacing.h: use istrstream instead of sscanf
9103 * src/mathed/math_defs.h: change first arg to istream from FILE*
9105 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9107 * src/mathed/math_parser.C: have yyis to be an istream
9108 (LexGetArg): use istream (yyis)
9110 (mathed_parse): ditto
9111 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9113 * src/mathed/formula.C (Read): rewritten to use istream
9115 * src/mathed/formulamacro.C (Read): rewritten to use istream
9117 * src/lyxlex.h (~LyXLex): deleted desturctor
9118 (getStream): new function, returns an istream
9119 (getFile): deleted funtion
9120 (IsOK): return is.good();
9122 * src/lyxlex.C (LyXLex): delete file and owns_file
9123 (setFile): open an filebuf and assign that to a istream instead of
9125 (setStream): new function, takes an istream as arg.
9126 (setFile): deleted function
9127 (EatLine): rewritten us use istream instead of FILE*
9131 * src/table.C (LyXTable): use istream instead of FILE*
9132 (Read): rewritten to take an istream instead of FILE*
9134 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9136 * src/buffer.C (Dispatch): remove an extraneous break statement.
9138 * src/support/filetools.C (QuoteName): change to do simple
9139 'quoting'. More work is necessary. Also changed to do nothing
9140 under emx (needs fix too).
9141 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9143 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9144 config.h.in to the AC_DEFINE_UNQUOTED() call.
9145 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9146 needs char * as argument (because Solaris 7 declares it like
9149 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9150 remove definition of BZERO.
9152 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9154 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9155 defined, "lyxregex.h" if not.
9157 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9159 (REGEX): new variable that is set to regex.c lyxregex.h when
9160 AM_CONDITIONAL USE_REGEX is set.
9161 (libsupport_la_SOURCES): add $(REGEX)
9163 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9166 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9169 * configure.in: add call to LYX_REGEX
9171 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9172 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9174 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9176 * lib/bind/fi_menus.bind: new file, from
9177 pauli.virtanen@saunalahti.fi.
9179 * src/buffer.C (getBibkeyList): pass the parameter delim to
9180 InsetInclude::getKeys and InsetBibtex::getKeys.
9182 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9183 is passed to Buffer::getBibkeyList
9185 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9186 instead of the hardcoded comma.
9188 * src/insets/insetbib.C (getKeys): make sure that there are not
9189 leading blanks in bibtex keys. Normal latex does not care, but
9190 harvard.sty seems to dislike blanks at the beginning of citation
9191 keys. In particular, the retturn value of the function is
9193 * INSTALL: make it clear that libstdc++ is needed and that gcc
9194 2.7.x probably does not work.
9196 * src/support/filetools.C (findtexfile): make debug message go to
9198 * src/insets/insetbib.C (getKeys): ditto
9200 * src/debug.C (showTags): make sure that the output is correctly
9203 * configure.in: add a comment for TWO_COLOR_ICON define.
9205 * acconfig.h: remove all the entries that already defined in
9206 configure.in or acinclude.m4.
9208 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9209 to avoid user name, date and copyright.
9211 1999-12-21 Juergen Vigna <jug@sad.it>
9213 * src/table.C (Read): Now read bogus row format informations
9214 if the format is < 5 so that afterwards the table can
9215 be read by lyx but without any format-info. Fixed the
9216 crash we experienced when not doing this.
9218 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9220 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9221 (RedoDrawingOfParagraph): ditto
9222 (RedoParagraphs): ditto
9223 (RemoveTableRow): ditto
9225 * src/text.C (Fill): rename arg paperwidth -> paper_width
9227 * src/buffer.C (insertLyXFile): rename var filename -> fname
9228 (writeFile): rename arg filename -> fname
9229 (writeFileAscii): ditto
9230 (makeLaTeXFile): ditto
9231 (makeLinuxDocFile): ditto
9232 (makeDocBookFile): ditto
9234 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9237 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9239 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9242 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9243 compiled by a C compiler not C++.
9245 * src/layout.h (LyXTextClass): added typedef for const_iterator
9246 (LyXTextClassList): added typedef for const_iterator + member
9247 functions begin and end.
9249 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9250 iterators to fill the choice_class.
9251 (updateLayoutChoice): rewritten to use iterators to fill the
9252 layoutlist in the toolbar.
9254 * src/BufferView.h (BufferView::work_area_width): removed unused
9257 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9259 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9260 (sgmlCloseTag): ditto
9262 * src/support/lstrings.h: return type of countChar changed to
9265 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9266 what version of this func to use. Also made to return unsigned int.
9268 * configure.in: call LYX_STD_COUNT
9270 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9271 conforming std::count.
9273 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9275 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9276 and a subscript would give bad display (patch from Dekel Tsur
9277 <dekel@math.tau.ac.il>).
9279 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9281 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9284 * src/chset.h: add a few 'using' directives
9286 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9287 triggered when no buffer is active
9289 * src/layout.C: removed `break' after `return' in switch(), since
9292 * src/lyx_main.C (init): make sure LyX can be ran in place even
9293 when libtool has done its magic with shared libraries. Fix the
9294 test for the case when the system directory has not been found.
9296 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9297 name for the latex file.
9298 (MenuMakeHTML): ditto
9300 * src/buffer.h: add an optional boolean argument, which is passed
9303 1999-12-20 Allan Rae <rae@lyx.org>
9305 * lib/templates/IEEEtran.lyx: small correction and update.
9307 * configure.in: Attempted to use LYX_PATH_HEADER
9309 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9311 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9312 input from JMarc. Now use preprocessor to find the header.
9313 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9314 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9315 LYX_STL_STRING_FWD. See comments in file.
9317 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9319 * The global MiniBuffer * minibuffer variable is dead.
9321 * The global FD_form_main * fd_form_main variable is dead.
9323 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9325 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9327 * src/table.h: add the LOstream.h header
9328 * src/debug.h: ditto
9330 * src/LyXAction.h: change the explaination of the ReadOnly
9331 attribute: is indicates that the function _can_ be used.
9333 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9336 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9338 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9344 * src/paragraph.C (GetWord): assert on pos>=0
9347 * src/support/lyxstring.C: condition the use of an invariant on
9349 * src/support/lyxstring.h: ditto
9351 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9352 Use LAssert.h instead of plain assert().
9354 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9356 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9357 * src/support/filetools.C: ditto
9359 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9362 * INSTALL: document the new configure flags
9364 * configure.in: suppress --with-debug; add --enable-assertions
9366 * acinclude.m4: various changes in alignment of help strings.
9368 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9370 * src/kbmap.C: commented out the use of the hash map in kb_map,
9371 beginning of movement to a stl::container.
9373 * several files: removed code that was not in effect when
9374 MOVE_TEXT was defined.
9376 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9377 for escaping should not be used. We can discuss if the string
9378 should be enclosed in f.ex. [] instead of "".
9380 * src/trans_mgr.C (insert): use the new returned value from
9381 encodeString to get deadkeys and keymaps done correctly.
9383 * src/chset.C (encodeString): changed to return a pair, to tell
9384 what to use if we know the string.
9386 * src/lyxscreen.h (fillArc): new function.
9388 * src/FontInfo.C (resize): rewritten to use more std::string like
9389 structore, especially string::replace.
9391 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9394 * configure.in (chmod +x some scripts): remove config/gcc-hack
9396 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9398 * src/buffer.C (writeFile): change once again the top comment in a
9399 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9400 instead of an hardcoded version number.
9401 (makeDocBookFile): ditto
9403 * src/version.h: add new define LYX_DOCVERSION
9405 * po/de.po: update from Pit Sütterlin
9406 * lib/bind/de_menus.bind: ditto.
9408 * src/lyxfunc.C (Dispatch): call MenuExport()
9409 * src/buffer.C (Dispatch): ditto
9411 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9412 LyXFunc::Dispatch().
9413 (MenuExport): new function, moved from
9414 LyXFunc::Dispatch().
9416 * src/trans_mgr.C (insert): small cleanup
9417 * src/chset.C (loadFile): ditto
9419 * lib/kbd/iso8859-1.cdef: add missing backslashes
9421 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9423 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9424 help with placing the manually drawn accents better.
9426 (Draw): x2 and hg changed to float to minimize rounding errors and
9427 help place the accents better.
9429 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9430 unsigned short to char is just wrong...cast the char to unsigned
9431 char instead so that the two values can compare sanely. This
9432 should also make the display of insetlatexaccents better and
9433 perhaps also some other insets.
9435 (lbearing): new function
9438 1999-12-15 Allan Rae <rae@lyx.org>
9440 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9441 header that provides a wrapper around the very annoying SGI STL header
9444 * src/support/lyxstring.C, src/LString.h:
9445 removed old SGI-STL-compatability attempts.
9447 * configure.in: Use LYX_STL_STRING_FWD.
9449 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9450 stl_string_fwd.h is around and try to determine it's location.
9451 Major improvement over previous SGI STL 3.2 compatability.
9452 Three small problems remain with this function due to my zero
9453 knowledge of autoconf. JMarc and lgb see the comments in the code.
9455 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9457 * src/broken_const.h, config/hack-gcc, config/README: removed
9459 * configure.in: remove --with-gcc-hack option; do not call
9462 * INSTALL: remove documentation of --with-broken-const and
9465 * acconfig.h: remove all trace of BROKEN_CONST define
9467 * src/buffer.C (makeDocBookFile): update version number in output
9469 (SimpleDocBookOnePar): fix an assert when trying to a character
9470 access beyond string length
9473 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9475 * po/de.po: fix the Export menu
9477 * lyx.man: update the description of -dbg
9479 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9480 (commandLineHelp): updated
9481 (easyParse): show list of available debug levels if -dbg is passed
9484 * src/Makefile.am: add debug.C
9486 * src/debug.h: moved some code to debug.C
9488 * src/debug.C: new file. Contains code to set and show debug
9491 * src/layout.C: remove 'break' after 'continue' in switch
9492 statements, since these cannot be reached.
9494 1999-12-13 Allan Rae <rae@lyx.org>
9496 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9497 (in_word_set): hash() -> math_hash()
9499 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9501 * acconfig.h: Added a test for whether we are using exceptions in the
9502 current compilation run. If so USING_EXCEPTIONS is defined.
9504 * config.in: Check for existance of stl_string_fwd.h
9505 * src/LString.h: If compiling --with-included-string and SGI's
9506 STL version 3.2 is present (see above test) we need to block their
9507 forward declaration of string and supply a __get_c_string().
9508 However, it turns out this is only necessary if compiling with
9509 exceptions enabled so I've a bit more to add yet.
9511 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9512 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9513 src/support/LRegex.h, src/undo.h:
9514 Shuffle the order of the included files a little to ensure that
9515 LString.h gets included before anything that includes stl_string_fwd.h
9517 * src/support/lyxstring.C: We need to #include LString.h instead of
9518 lyxstring.h to get the necessary definition of __get_c_string.
9519 (__get_c_string): New function. This is defined static just like SGI's
9520 although why they need to do this I'm not sure. Perhaps it should be
9521 in lstrings.C instead.
9523 * lib/templates/IEEEtran.lyx: New template file.
9525 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9527 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9528 * intl/Makefile.in (MKINSTALLDIRS): ditto
9530 * src/LyXAction.C (init): changed to hold the LFUN data in a
9531 automatic array in stead of in callso to newFunc, this speeds up
9532 compilation a lot. Also all the memory used by the array is
9533 returned when the init is completed.
9535 * a lot of files: compiled with -Wold-style-cast, changed most of
9536 the reported offenders to C++ style casts. Did not change the
9537 offenders in C files.
9539 * src/trans.h (Match): change argument type to unsigned int.
9541 * src/support/DebugStream.C: fix some types on the streambufs so
9542 that it works on a conforming implementation.
9544 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9546 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9548 * src/support/lyxstring.C: remove the inline added earlier since
9549 they cause a bunch of unsatisfied symbols when linking with dec
9550 cxx. Cxx likes to have the body of inlines at the place where they
9553 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9554 accessing negative bounds in array. This fixes the crash when
9555 inserting accented characters.
9556 * src/trans.h (Match): ditto
9558 * src/buffer.C (Dispatch): since this is a void, it should not try
9559 to return anything...
9561 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9563 * src/buffer.h: removed the two friends from Buffer. Some changes
9564 because of this. Buffer::getFileName and Buffer::setFileName
9565 renamed to Buffer::fileName() and Buffer::fileName(...).
9567 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9569 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9570 and Buffer::update(short) to BufferView. This move is currently
9571 controlled by a define MOVE_TEXT, this will be removed when all
9572 shows to be ok. This move paves the way for better separation
9573 between buffer contents and buffer view. One side effect is that
9574 the BufferView needs a rebreak when swiching buffers, if we want
9575 to avoid this we can add a cache that holds pointers to LyXText's
9576 that is not currently in use.
9578 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9581 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9583 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9585 * lyx_main.C: new command line option -x (or --execute) and
9586 -e (or --export). Now direct conversion from .lyx to .tex
9587 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9588 Unfortunately, X is still needed and the GUI pops up during the
9591 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9593 * src/Spacing.C: add a using directive to bring stream stuff into
9595 * src/paragraph.C: ditto
9596 * src/buffer.C: ditto
9598 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9599 from Lars' announcement).
9601 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9602 example files from Tino Meinen.
9604 1999-12-06 Allan Rae <rae@lyx.org>
9606 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9608 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9610 * src/support/lyxstring.C: added a lot of inline for no good
9613 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9614 latexWriteEndChanges, they were not used.
9616 * src/layout.h (operator<<): output operator for PageSides
9618 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9620 * some example files: loaded in LyX 1.0.4 and saved again to update
9621 certain constructs (table format)
9623 * a lot of files: did the change to use fstream/iostream for all
9624 writing of files. Done with a close look at Andre Poenitz's patch.
9626 * some files: whitespace changes.
9628 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9630 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9631 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9632 architecture, we provide our own. It is used unconditionnally, but
9633 I do not think this is a performance problem. Thanks to Angus
9634 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9635 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9637 (GetInset): use my_memcpy.
9641 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9642 it is easier to understand, but it uses less TeX-only constructs now.
9644 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9645 elements contain spaces
9647 * lib/configure: regenerated
9649 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9650 elements contain spaces; display the list of programs that are
9653 * autogen.sh: make sure lib/configure is executable
9655 * lib/examples/*: rename the tutorial examples to begin with the
9656 two-letters language code.
9658 * src/lyxfunc.C (getStatus): do not query current font if no
9661 * src/lyx_cb.C (RunScript): use QuoteName
9662 (MenuRunDvips): ditto
9663 (PrintApplyCB): ditto
9665 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9666 around argument, so that it works well with the current shell.
9667 Does not work properly with OS/2 shells currently.
9669 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9670 * src/LyXSendto.C (SendtoApplyCB): ditto
9671 * src/lyxfunc.C (Dispatch): ditto
9672 * src/buffer.C (runLaTeX): ditto
9673 (runLiterate): ditto
9674 (buildProgram): ditto
9676 * src/lyx_cb.C (RunScript): ditto
9677 (MenuMakeLaTeX): ditto
9679 * src/buffer.h (getLatexName): new method
9681 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9683 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9685 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9686 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9687 (create_math_panel): ditto
9689 * src/lyxfunc.C (getStatus): re-activate the code which gets
9690 current font and cursor; add test for export to html.
9692 * src/lyxrc.C (read): remove unreachable break statements; add a
9695 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9697 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9699 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9700 introduced by faulty regex.
9701 * src/buffer.C: ditto
9702 * src/lastfiles.C: ditto
9703 * src/paragraph.C: ditto
9704 * src/table.C: ditto
9705 * src/vspace.C: ditto
9706 * src/insets/figinset.C: ditto
9707 Note: most of these is absolutely harmless, except the one in
9708 src/mathed formula.C.
9710 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9712 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9713 operation, yielding correct results for the reLyX command.
9715 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9717 * src/support/filetools.C (ExpandPath): removed an over eager
9719 (ReplaceEnvironmentPath): ditto
9721 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9722 shows that we are doing something fishy in our code...
9726 * src/lyxrc.C (read): use a double switch trick to get more help
9727 from the compiler. (the same trick is used in layout.C)
9728 (write): new function. opens a ofstream and pass that to output
9729 (output): new function, takes a ostream and writes the lyxrc
9730 elemts to it. uses a dummy switch to make sure no elements are
9733 * src/lyxlex.h: added a struct pushpophelper for use in functions
9734 with more than one exit point.
9736 * src/lyxlex.[Ch] (GetInteger): made it const
9740 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9742 * src/layout.[hC] : LayoutTags splitted into several enums, new
9743 methods created, better error handling cleaner use of lyxlex. Read
9746 * src/bmtable.[Ch]: change some member prototypes because of the
9747 image const changes.
9749 * commandtags.h, src/LyXAction.C (init): new function:
9750 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9751 This file is not read automatically but you can add \input
9752 preferences to your lyxrc if you want to. We need to discuss how
9755 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9756 in .aux, also remove .bib and .bst files from dependencies when
9759 * src/BufferView.C, src/LyXView.C: add const_cast several places
9760 because of changes to images.
9762 * lib/images/*: same change as for images/*
9764 * lib/lyxrc.example: Default for accept_compound is false not no.
9766 * images/*: changed to be const, however I have som misgivings
9767 about this change so it might be changed back.
9769 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9771 * lib/configure, po/POTFILES.in: regenerated
9773 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9775 * config/lib_configure.m4: removed
9777 * lib/configure.m4: new file (was config/lib_configure.m4)
9779 * configure.in: do not test for rtti, since we do not use it.
9781 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9783 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9784 doubling of allocated space scheme. This makes it faster for large
9785 strings end to use less memory for small strings. xtra rememoved.
9787 * src/insets/figinset.C (waitalarm): commented out.
9788 (GhostscriptMsg): use static_cast
9789 (GhostscriptMsg): use new instead of malloc to allocate memory for
9790 cmap. also delete the memory after use.
9792 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9794 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9795 for changes in bibtex database or style.
9796 (runBibTeX): remove all .bib and .bst files from dep before we
9798 (run): use scanAuc in when dep file already exist.
9800 * src/DepTable.C (remove_files_with_extension): new method
9803 * src/DepTable.[Ch]: made many of the methods const.
9805 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9807 * src/bufferparams.C: make sure that the default textclass is
9808 "article". It used to be the first one by description order, but
9809 now the first one is "docbook".
9811 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9812 string; call Debug::value.
9813 (easyParse): pass complete argument to setDebuggingLevel().
9815 * src/debug.h (value): fix the code that parses debug levels.
9817 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9820 * src/LyXAction.C: use Debug::ACTION as debug channel.
9822 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9824 * NEWS: updated for the future 1.1.3 release.
9826 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9827 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9828 it should. This is of course a controversial change (since many
9829 people will find that their lyx workscreen is suddenly full of
9830 red), but done for the sake of correctness.
9832 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9833 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9835 * src/insets/inseterror.h, src/insets/inseturl.h,
9836 src/insets/insetinfo.h, src/insets/figinset.h,
9837 src/mathed/formulamacro.h, src/mathed/math_macro.h
9838 (EditMessage): add a missing const and add _() to make sure that
9841 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9842 src/insets/insetbib.C, src/support/filetools.C: add `using'
9845 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9846 doing 'Insert index of last word' at the beginning of a paragraph.
9848 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9850 * several files: white-space changes.
9852 * src/mathed/formula.C: removed IsAlpha and IsDigit
9854 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9855 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9858 * src/insets/figinset.C (GetPSSizes): don't break when
9859 "EndComments" is seen. But break when a boundingbox is read.
9861 * all classes inherited from Inset: return value of Clone
9862 changed back to Inset *.
9864 * all classes inherited form MathInset: return value of Clone
9865 changed back to MathedInset *.
9867 * src/insets/figinset.C (runqueue): use a ofstream to output the
9868 gs/ps file. Might need some setpresicion or setw. However I can
9869 see no problem with the current code.
9870 (runqueue): use sleep instead of the alarm/signal code. I just
9871 can't see the difference.
9873 * src/paragraph.C (LyXParagraph): reserve space in the new
9874 paragraph and resize the inserted paragraph to just fit.
9876 * src/lyxfunc.h (operator|=): added operator for func_status.
9878 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9879 check for readable file.
9881 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9882 check for readable file.
9883 (MenuMakeLinuxDoc): ditto
9884 (MenuMakeDocBook): ditto
9885 (MenuMakeAscii): ditto
9886 (InsertAsciiFile): split the test for openable and readable
9888 * src/bmtable.C (draw_bitmaptable): use
9889 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9891 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9892 findtexfile from LaTeX to filetools.
9894 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9895 instead of FilePtr. Needs to be verified by a literate user.
9897 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9899 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9900 (EditMessage): likewise.
9902 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9903 respectively as \textasciitilde and \textasciicircum.
9905 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9907 * src/support/lyxstring.h: made the methods that take iterators
9910 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9911 (regexMatch): made is use the real regex class.
9913 * src/support/Makefile.am: changed to use libtool
9915 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9917 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9919 (MathIsInset ++): changed several macros to be inline functions
9922 * src/mathed/Makefile.am: changed to use libtool
9924 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9926 * src/insets/inset* : Clone changed to const and return type is
9927 the true insettype not just Inset*.
9929 * src/insets/Makefile.am: changed to use libtool
9931 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9933 * src/undo.[Ch] : added empty() and changed some of the method
9936 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9938 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9939 setID use block<> for the bullets array, added const several places.
9941 * src/lyxfunc.C (getStatus): new function
9943 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9944 LyXAction, added const to several funtions.
9946 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9947 a std::map, and to store the dir items in a vector.
9949 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9952 * src/LyXView.[Ch] + other files : changed currentView to view.
9954 * src/LyXAction.[Ch] : ported from the old devel branch.
9956 * src/.cvsignore: added .libs and a.out
9958 * configure.in : changes to use libtool.
9960 * acinclude.m4 : inserted libtool.m4
9962 * .cvsignore: added libtool
9964 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9966 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9967 file name in insets and mathed directories (otherwise the
9968 dependency is not taken in account under cygwin).
9970 * src/text2.C (InsertString[AB]): make sure that we do not try to
9971 read characters past the string length.
9973 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9975 * lib/doc/LaTeXConfig.lyx.in,
9976 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9978 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9979 file saying who created them and when this heppened; this is
9980 useless and annoys tools like cvs.
9982 * lib/layouts/g-brief-{en,de}.layout,
9983 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9984 from Thomas Hartkens <thomas@hartkens.de>.
9986 * src/{insets,mathed}/Makefile.am: do not declare an empty
9987 LDFLAGS, so that it can be set at configure time (useful on Irix
9990 * lib/reLyX/configure.in: make sure that the prefix is set
9991 correctly in LYX_DIR.
9993 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9995 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9996 be used by 'command-sequence' this allows to bind a key to a
9997 sequence of LyX-commands
9998 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10000 * src/LyXAction.C: add "command-sequence"
10002 * src/LyXFunction.C: handling of "command-sequence"
10004 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10005 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10007 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10009 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10011 * src/buffer.C (writeFile): Do not output a comment giving user
10012 and date at the beginning of a .lyx file. This is useless and
10013 annoys cvs anyway; update version number to 1.1.
10015 * src/Makefile.am (LYX_DIR): add this definition, so that a
10016 default path is hardcoded in LyX.
10018 * configure.in: Use LYX_GNU_GETTEXT.
10020 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10021 AM_GNU_GETTEXT with a bug fixed.
10023 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10025 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10027 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10028 which is used to point to LyX data is now LYX_DIR_11x.
10030 * lyx.man: convert to a unix text file; small updates.
10032 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10034 * src/support/LSubstring.[Ch]: made the second arg of most of the
10035 constructors be a const reference.
10037 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10040 * src/support/lyxstring.[Ch] (swap): added missing member function
10041 and specialization of swap(str, str);
10043 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10045 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10046 trace of the old one.
10048 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10049 put the member definitions in undo.C.
10051 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10052 NEW_TEXT and have now only code that was included when this was
10055 * src/intl.C (LCombo): use static_cast
10057 (DispatchCallback): ditto
10059 * src/definitions.h: removed whole file
10061 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10063 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10064 parsing and stores in a std:map. a regex defines the file format.
10065 removed unneeded members.
10067 * src/bufferparams.h: added several enums from definitions.h here.
10068 Removed unsused destructor. Changed some types to use proper enum
10069 types. use block to have the temp_bullets and user_defined_bullets
10070 and to make the whole class assignable.
10072 * src/bufferparams.C (Copy): removed this functions, use a default
10073 assignment instead.
10075 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10078 * src/buffer.C (readLyXformat2): commend out all that have with
10079 oldpapersize to do. also comment out all that hve to do with
10080 insetlatex and insetlatexdel.
10081 (setOldPaperStuff): commented out
10083 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10085 * src/LyXAction.C: remove use of inset-latex-insert
10087 * src/mathed/math_panel.C (button_cb): use static_cast
10089 * src/insets/Makefile.am (insets_o_SOURCES): removed
10092 * src/support/lyxstring.C (helper): use the unsigned long
10093 specifier, UL, instead of a static_cast.
10095 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10097 * src/support/block.h: new file. to be used as a c-style array in
10098 classes, so that the class can be assignable.
10100 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10102 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10103 NULL, make sure to return an empty string (it is not possible to
10104 set a string to NULL).
10106 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10108 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10110 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10112 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10113 link line, so that Irix users (for example) can set it explicitely to
10116 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10117 it can be overidden at make time (static or dynamic link, for
10120 * src/vc-backend.C, src/LaTeXFeatures.h,
10121 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10122 statements to bring templates to global namespace.
10124 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10126 * src/support/lyxstring.C (operator[] const): make it standard
10129 * src/minibuffer.C (Init): changed to reflect that more
10130 information is given from the lyxvc and need not be provided here.
10132 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10134 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10136 * src/LyXView.C (UpdateTimerCB): use static_cast
10137 (KeyPressMask_raw_callback): ditto
10139 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10140 buffer_, a lot of changes because of this. currentBuffer() ->
10141 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10142 also changes to other files because of this.
10144 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10146 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10147 have no support for RCS and partial support for CVS, will be
10150 * src/insets/ several files: changes because of function name
10151 changes in Bufferview and LyXView.
10153 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10155 * src/support/LSubstring.[Ch]: new files. These implement a
10156 Substring that can be very convenient to use. i.e. is this
10158 string a = "Mary had a little sheep";
10159 Substring(a, "sheep") = "lamb";
10160 a is now "Mary has a little lamb".
10162 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10163 out patterns and subpatterns of strings. It is used by LSubstring
10164 and also by vc-backend.C
10166 * src/support/lyxstring.C: went over all the assertions used and
10167 tried to correct the wrong ones and flag which of them is required
10168 by the standard. some bugs found because of this. Also removed a
10169 couple of assertions.
10171 * src/support/Makefile.am (libsupport_a_SOURCES): added
10172 LSubstring.[Ch] and LRegex.[Ch]
10174 * src/support/FileInfo.h: have struct stat buf as an object and
10175 not a pointer to one, some changes because of this.
10177 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10178 information in layout when adding the layouts preamble to the
10179 textclass preamble.
10181 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10184 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10185 because of bug in OS/2.
10187 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10189 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10190 \verbatim@font instead of \ttfamily, so that it can be redefined.
10192 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10193 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10194 src/layout.h, src/text2.C: add 'using' directive to bring the
10195 STL templates we need from the std:: namespace to the global one.
10196 Needed by DEC cxx in strict ansi mode.
10198 * src/support/LIstream.h,src/support/LOstream.h,
10199 src/support/lyxstring.h,src/table.h,
10200 src/lyxlookup.h: do not include <config.h> in header
10201 files. This should be done in the .C files only.
10203 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10207 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10209 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10210 from Kayvan to fix the tth invokation.
10212 * development/lyx.spec.in: updates from Kayvan to reflect the
10213 changes of file names.
10215 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10217 * src/text2.C (InsertStringB): use std::copy
10218 (InsertStringA): use std::copy
10220 * src/bufferlist.C: use a vector to store the buffers in. This is
10221 an internal change and should not affect any other thing.
10223 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10226 * src/text.C (Fill): fix potential bug, one off bug.
10228 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10230 * src/Makefile.am (lyx_main.o): add more files it depends on.
10232 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10234 * src/support/lyxstring.C: use size_t for the reference count,
10235 size, reserved memory and xtra.
10236 (internal_compare): new private member function. Now the compare
10237 functions should work for std::strings that have embedded '\0'
10239 (compare): all compare functions rewritten to use
10242 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10244 * src/support/lyxstring.C (compare): pass c_str()
10245 (compare): pass c_str
10246 (compare): pass c_str
10248 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10250 * src/support/DebugStream.C: <config.h> was not included correctly.
10252 * lib/configure: forgot to re-generate it :( I'll make this file
10253 auto generated soon.
10255 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10257 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10260 * src/support/lyxstring.C: some changes from length() to rep->sz.
10261 avoids a function call.
10263 * src/support/filetools.C (SpaceLess): yet another version of the
10264 algorithm...now per Jean-Marc's suggestions.
10266 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10268 * src/layout.C (less_textclass_desc): functor for use in sorting
10270 (LyXTextClass::Read): sort the textclasses after reading.
10272 * src/support/filetools.C (SpaceLess): new version of the
10273 SpaceLess functions. What problems does this one give? Please
10276 * images/banner_bw.xbm: made the arrays unsigned char *
10278 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10280 * src/support/lyxstring.C (find): remove bogus assertion in the
10281 two versions of find where this has not been done yet.
10283 * src/support/lyxlib.h: add missing int return type to
10286 * src/menus.C (ShowFileMenu): disable exporting to html if no
10287 html export command is present.
10289 * config/lib_configure.m4: add a test for an HTML converter. The
10290 programs checked for are, in this order: tth, latex2html and
10293 * lib/configure: generated from config/lib_configure.m4.
10295 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10296 html converter. The parameters are now passed through $$FName and
10297 $$OutName, instead of standard input/output.
10299 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10301 * lib/lyxrc.example: update description of \html_command.
10302 add "quotes" around \screen_font_xxx font setting examples to help
10303 people who use fonts with spaces in their names.
10305 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10307 * Distribution files: updates for v1.1.2
10309 * src/support/lyxstring.C (find): remove bogus assert and return
10310 npos for the same condition.
10312 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10314 * added patch for OS/2 from SMiyata.
10316 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10318 * src/text2.C (CutSelection): make space_wrapped a bool
10319 (CutSelection): dont declare int i until we have to.
10320 (alphaCounter): return a char const *.
10322 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10324 * src/support/syscall.C (Systemcalls::kill):
10325 src/support/filetools.C (PutEnv, PutEnvPath):
10326 src/lyx_cb.C (addNewlineAndDepth):
10327 src/FontInfo.C (FontInfo::resize): condition some #warning
10328 directives with WITH_WARNINGS.
10331 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10333 * src/layout.[Ch] + several files: access to class variables
10334 limited and made accessor functions instead a lot of code changed
10335 becuase of this. Also instead of returning pointers often a const
10336 reference is returned instead.
10338 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10340 * src/Makefile.am (dist-hook): added used to remove the CVS from
10341 cheaders upon creating a dist
10342 (EXTRA_DIST): added cheaders
10344 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10345 a character not as a small integer.
10347 * src/support/lyxstring.C (find): removed Assert and added i >=
10348 rep->sz to the first if.
10350 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10352 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10353 src/LyXView.C src/buffer.C src/bufferparams.C
10354 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10355 src/text2.C src/insets/insetinclude.C:
10356 lyxlayout renamed to textclasslist.
10358 * src/layout.C: some lyxerr changes.
10360 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10361 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10362 (LyXLayoutList): removed all traces of this class.
10363 (LyXTextClass::Read): rewrote LT_STYLE
10364 (LyXTextClass::hasLayout): new function
10365 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10366 both const and nonconst version.
10367 (LyXTextClass::delete_layout): new function.
10368 (LyXTextClassList::Style): bug fix. do the right thing if layout
10370 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10371 (LyXTextClassList::NameOfLayout): ditto
10372 (LyXTextClassList::Load): ditto
10374 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10376 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10378 * src/LyXAction.C (LookupFunc): added a workaround for sun
10379 compiler, on the other hand...we don't know if the current code
10380 compiles on sun at all...
10382 * src/support/filetools.C (CleanupPath): subst fix
10384 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10387 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10388 complained about this one?
10390 * src/insets/insetinclude.C (Latex): subst fix
10392 * src/insets/insetbib.C (getKeys): subst fix
10394 * src/LyXSendto.C (SendtoApplyCB): subst fix
10396 * src/lyx_main.C (init): subst fix
10398 * src/layout.C (Read): subst fix
10400 * src/lyx_sendfax_main.C (button_send): subst fix
10402 * src/buffer.C (RoffAsciiTable): subst fix
10404 * src/lyx_cb.C (MenuFax): subst fix
10405 (PrintApplyCB): subst fix
10407 1999-10-26 Juergen Vigna <jug@sad.it>
10409 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10411 (Read): Cleaned up this code so now we read only format vestion >= 5
10413 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10415 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10416 come nobody has complained about this one?
10418 * src/insets/insetinclude.C (Latex): subst fix
10420 * src/insets/insetbib.C (getKeys): subst fix
10422 * src/lyx_main.C (init): subst fix
10424 * src/layout.C (Read): subst fix
10426 * src/buffer.C (RoffAsciiTable): subst fix
10428 * src/lyx_cb.C (MenuFax): subst fix.
10430 * src/layout.[hC] + some other files: rewrote to use
10431 std::container to store textclasses and layouts in.
10432 Simplified, removed a lot of code. Make all classes
10433 assignable. Further simplifications and review of type
10434 use still to be one.
10436 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10437 lastfiles to create the lastfiles partr of the menu.
10439 * src/lastfiles.[Ch]: rewritten to use deque to store the
10440 lastfiles in. Uses fstream for reading and writing. Simplifies
10443 * src/support/syscall.C: remove explicit cast.
10445 * src/BufferView.C (CursorToggleCB): removed code snippets that
10446 were commented out.
10447 use explicat C++ style casts instead of C style casts. also use
10448 u_vdata instea of passing pointers in longs.
10450 * src/PaperLayout.C: removed code snippets that were commented out.
10452 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10454 * src/lyx_main.C: removed code snippets that wer commented out.
10456 * src/paragraph.C: removed code snippets that were commented out.
10458 * src/lyxvc.C (logClose): use static_cast
10460 (viewLog): remove explicit cast to void*
10461 (showLog): removed old commented code
10463 * src/menus.C: use static_cast instead of C style casts. use
10464 u_vdata instead of u_ldata. remove explicit cast to (long) for
10465 pointers. Removed old code that was commented out.
10467 * src/insets/inset.C: removed old commented func
10469 * src/insets/insetref.C (InsetRef): removed old code that had been
10470 commented out for a long time.
10472 (escape): removed C style cast
10474 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10476 * src/insets/insetlatex.C (Draw): removed old commented code
10477 (Read): rewritten to use string
10479 * src/insets/insetlabel.C (escape): removed C style cast
10481 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10483 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10484 old commented code.
10486 * src/insets/insetinclude.h: removed a couple of stupid bools
10488 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10489 (Clone): remove C style cast
10490 (getKeys): changed list to lst because of std::list
10492 * src/insets/inseterror.C (Draw): removed som old commented code.
10494 * src/insets/insetcommand.C (Draw): removed some old commented code.
10496 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10497 commented out forever.
10498 (bibitem_cb): use static_cast instead of C style cast
10499 use of vdata changed to u_vdata.
10501 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10503 (CloseUrlCB): use static_cast instead of C style cast.
10504 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10506 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10507 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10508 (CloseInfoCB): static_cast from ob->u_vdata instead.
10509 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10512 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10513 (C_InsetError_CloseErrorCB): forward the ob parameter
10514 (CloseErrorCB): static_cast from ob->u_vdata instead.
10516 * src/vspace.h: include LString.h since we use string in this class.
10518 * src/vspace.C (lyx_advance): changed name from advance because of
10519 nameclash with stl. And since we cannot use namespaces yet...I
10520 used a lyx_ prefix instead. Expect this to change when we begin
10523 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10525 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10526 and removed now defunct constructor and deconstructor.
10528 * src/BufferView.h: have backstack as a object not as a pointer.
10529 removed initialization from constructor. added include for BackStack
10531 * development/lyx.spec.in (%build): add CFLAGS also.
10533 * src/screen.C (drawFrame): removed another warning.
10535 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10537 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10538 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10539 README and ANNOUNCE a bit for the next release. More work is
10542 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10543 unbreakable if we are in freespacing mode (LyX-Code), but not in
10546 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10548 * src/BackStack.h: fixed initialization order in constructor
10550 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10552 * acinclude.m4 (VERSION): new rules for when a version is
10553 development, added also a variable for prerelease.
10554 (warnings): we set with_warnings=yes for prereleases
10555 (lyx_opt): prereleases compile with same optimization as development
10556 (CXXFLAGS): only use pedantic if we are a development version
10558 * src/BufferView.C (restorePosition): don't do anything if the
10559 backstack is empty.
10561 * src/BackStack.h: added member empty, use this to test if there
10562 is anything to pop...
10564 1999-10-25 Juergen Vigna <jug@sad.it>
10567 * forms/layout_forms.fd +
10568 * forms/latexoptions.fd +
10569 * lyx.fd: changed for various form resize issues
10571 * src/mathed/math_panel.C +
10572 * src/insets/inseterror.C +
10573 * src/insets/insetinfo.C +
10574 * src/insets/inseturl.C +
10575 * src/insets/inseturl.h +
10577 * src/LyXSendto.C +
10578 * src/PaperLayout.C +
10579 * src/ParagraphExtra.C +
10580 * src/TableLayout.C +
10582 * src/layout_forms.C +
10589 * src/menus.C: fixed various resize issues. So now forms can be
10590 resized savely or not be resized at all.
10592 * forms/form_url.fd +
10593 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10596 * src/insets/Makefile.am: added files form_url.[Ch]
10598 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10600 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10601 (and presumably 6.2).
10603 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10604 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10605 remaining static member callbacks.
10607 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10610 * src/support/lyxstring.h: declare struct Srep as friend of
10611 lyxstring, since DEC cxx complains otherwise.
10613 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10615 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10617 * src/LaTeX.C (run): made run_bibtex also depend on files with
10619 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10620 are put into the dependency file.
10622 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10623 the code has shown itself to work
10624 (create_ispell_pipe): removed another warning, added a comment
10627 * src/minibuffer.C (ExecutingCB): removed code that has been
10628 commented out a long time
10630 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10631 out code + a warning.
10633 * src/support/lyxstring.h: comment out the three private
10634 operators, when compiling with string ansi conforming compilers
10635 they make problems.
10637 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10639 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10640 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10643 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10646 * src/mathed/math_panel.C (create_math_panel): remove explicit
10649 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10652 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10653 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10654 to XCreatePixmapFromBitmapData
10655 (fl_set_bmtable_data): change the last argument to be unsigned
10657 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10658 and bh to be unsigned int, remove explicit casts in call to
10659 XReadBitmapFileData.
10661 * images/arrows.xbm: made the arrays unsigned char *
10662 * images/varsz.xbm: ditto
10663 * images/misc.xbm: ditto
10664 * images/greek.xbm: ditto
10665 * images/dots.xbm: ditto
10666 * images/brel.xbm: ditto
10667 * images/bop.xbm: ditto
10669 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10671 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10672 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10673 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10675 (LYX_CXX_CHEADERS): added <clocale> to the test.
10677 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10679 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10681 * src/support/lyxstring.C (append): fixed something that must be a
10682 bug, rep->assign was used instead of rep->append.
10684 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10687 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10688 lyx insert double chars. Fix spotted by Kayvan.
10690 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10692 * Fixed the tth support. I messed up with the Emacs patch apply feature
10693 and omitted the changes in lyxrc.C.
10695 1999-10-22 Juergen Vigna <jug@sad.it>
10697 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10699 * src/lyx_cb.C (MenuInsertRef) +
10700 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10701 the form cannot be resized under it limits (fixes a segfault)
10703 * src/lyx.C (create_form_form_ref) +
10704 * forms/lyx.fd: Changed Gravity on name input field so that it is
10707 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10709 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10710 <ostream> and <istream>.
10712 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10713 whether <fstream> provides the latest standard features, or if we
10714 have an oldstyle library (like in egcs).
10715 (LYX_CXX_STL_STRING): fix the test.
10717 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10718 code on MODERN_STL_STREAM.
10720 * src/support/lyxstring.h: use L{I,O}stream.h.
10722 * src/support/L{I,O}stream.h: new files, designed to setup
10723 correctly streams for our use
10724 - includes the right header depending on STL capabilities
10725 - puts std::ostream and std::endl (for LOStream.h) or
10726 std::istream (LIStream.h) in toplevel namespace.
10728 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10730 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10731 was a bib file that had been changed we ensure that bibtex is run.
10732 (runBibTeX): enhanced to extract the names of the bib files and
10733 getting their absolute path and enter them into the dep file.
10734 (findtexfile): static func that is used to look for tex-files,
10735 checks for absolute patchs and tries also with kpsewhich.
10736 Alternative ways of finding the correct files are wanted. Will
10738 (do_popen): function that runs a command using popen and returns
10739 the whole output of that command in a string. Should be moved to
10742 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10743 file with extension ext has changed.
10745 * src/insets/figinset.C: added ifdef guards around the fl_free
10746 code that jug commented out. Now it is commented out when
10747 compiling with XForms == 0.89.
10749 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10750 to lyxstring.C, and only keep a forward declaration in
10751 lyxstring.h. Simplifies the header file a bit and should help a
10752 bit on compile time too. Also changes to Srep will not mandate a
10753 recompile of code just using string.
10754 (~lyxstring): definition moved here since it uses srep.
10755 (size): definition moved here since it uses srep.
10757 * src/support/lyxstring.h: removed a couple of "inline" that should
10760 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10762 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10765 1999-10-21 Juergen Vigna <jug@sad.it>
10767 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10768 set to left if I just remove the width entry (or it is empty).
10770 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10771 paragraph when having dummy paragraphs.
10773 1999-10-20 Juergen Vigna <jug@sad.it>
10775 * src/insets/figinset.C: just commented some fl_free_form calls
10776 and added warnings so that this calls should be activated later
10777 again. This avoids for now a segfault, but we have a memory leak!
10779 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10780 'const char * argument' to 'string argument', this should
10781 fix some Asserts() in lyxstring.C.
10783 * src/lyxfunc.h: Removed the function argAsString(const char *)
10784 as it is not used anymore.
10786 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10788 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10791 * src/Literate.h: some funcs moved from public to private to make
10792 interface clearer. Unneeded args removed.
10794 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10796 (scanBuildLogFile): ditto
10798 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10799 normal TeX Error. Still room for improvement.
10801 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10803 * src/buffer.C (insertErrors): changes to make the error
10804 desctription show properly.
10806 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10809 * src/support/lyxstring.C (helper): changed to use
10810 sizeof(object->rep->ref).
10811 (operator>>): changed to use a pointer instead.
10813 * src/support/lyxstring.h: changed const reference & to value_type
10814 const & lets see if that helps.
10816 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10818 * Makefile.am (rpmdist): fixed to have non static package and
10821 * src/support/lyxstring.C: removed the compilation guards
10823 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10826 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10827 conditional compile of lyxstring.Ch
10829 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10830 stupid check, but it is a lot better than the bastring hack.
10831 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10833 * several files: changed string::erase into string::clear. Not
10836 * src/chset.C (encodeString): use a char temporary instead
10838 * src/table.C (TexEndOfCell): added tostr around
10839 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10840 (TexEndOfCell): ditto
10841 (TexEndOfCell): ditto
10842 (TexEndOfCell): ditto
10843 (DocBookEndOfCell): ditto
10844 (DocBookEndOfCell): ditto
10845 (DocBookEndOfCell): ditto
10846 (DocBookEndOfCell): ditto
10848 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10850 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10852 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10853 (MenuBuildProg): added tostr around ret
10854 (MenuRunChktex): added tostr around ret
10855 (DocumentApplyCB): added tostr around ret
10857 * src/chset.C (encodeString): added tostr around t->ic
10859 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10860 (makeLaTeXFile): added tostr around tocdepth
10861 (makeLaTeXFile): added tostr around ftcound - 1
10863 * src/insets/insetbib.C (setCounter): added tostr around counter.
10865 * src/support/lyxstring.h: added an operator+=(int) to catch more
10868 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10869 (lyxstring): We DON'T allow NULL pointers.
10871 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10873 * src/mathed/math_macro.C (MathMacroArgument::Write,
10874 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10875 when writing them out.
10877 * src/LString.C: remove, since it is not used anymore.
10879 * src/support/lyxstring.C: condition the content to
10880 USE_INCLUDED_STRING macro.
10882 * src/mathed/math_symbols.C, src/support/lstrings.C,
10883 src/support/lyxstring.C: add `using' directive to specify what
10884 we need in <algorithm>. I do not think that we need to
10885 conditionalize this, but any thought is appreciated.
10887 * many files: change all callback functions to "C" linkage
10888 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10889 strict_ansi. Those who were static are now global.
10890 The case of callbacks which are static class members is
10891 trickier, since we have to make C wrappers around them (see
10892 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10893 did not finish this yet, since it defeats the purpose of
10894 encapsulation, and I am not sure what the best route is.
10896 1999-10-19 Juergen Vigna <jug@sad.it>
10898 * src/support/lyxstring.C (lyxstring): we permit to have a null
10899 pointer as assignment value and just don't assign it.
10901 * src/vspace.C (nextToken): corrected this function substituting
10902 find_first(_not)_of with find_last_of.
10904 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10905 (TableOptCloseCB) (TableSpeCloseCB):
10906 inserted fl_set_focus call for problem with fl_hide_form() in
10909 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10911 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10914 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10916 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10917 LyXLex::next() and not eatline() to get its argument.
10919 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10921 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10922 instead, use fstreams for io of the depfile, removed unneeded
10923 functions and variables.
10925 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10926 vector instead, removed all functions and variables that is not in
10929 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10931 * src/buffer.C (insertErrors): use new interface to TeXError
10933 * Makefile.am (rpmdist): added a rpmdist target
10935 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10936 per Kayvan's instructions.
10938 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10940 * src/Makefile.am: add a definition for localedir, so that locales
10941 are found after installation (Kayvan)
10943 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10945 * development/.cvsignore: new file.
10947 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10949 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10950 C++ compiler provides wrappers for C headers and use our alternate
10953 * configure.in: use LYX_CXX_CHEADERS.
10955 * src/cheader/: new directory, populated with cname headers from
10956 libstdc++-2.8.1. They are a bit old, but probably good enough for
10957 what we want (support compilers who lack them).
10959 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10960 from includes. It turns out is was stupid.
10962 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10964 * lib/Makefile.am (install-data-local): forgot a ';'
10965 (install-data-local): forgot a '\'
10966 (libinstalldirs): needed after all. reintroduced.
10968 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10970 * configure.in (AC_OUTPUT): added lyx.spec
10972 * development/lyx.spec: removed file
10974 * development/lyx.spec.in: new file
10976 * po/*.po: merged with lyx.pot becuase of make distcheck
10978 * lib/Makefile.am (dist-hook): added dist-hook so that
10979 documentation files will be included when doing a make
10980 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10981 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10983 more: tried to make install do the right thing, exclude CVS dirs
10986 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10987 Path would fit in more nicely.
10989 * all files that used to use pathstack: uses now Path instead.
10990 This change was a lot easier than expected.
10992 * src/support/path.h: new file
10994 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10996 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10998 * src/support/lyxstring.C (getline): Default arg was given for
11001 * Configure.cmd: removed file
11003 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11005 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11006 streams classes and types, add the proper 'using' statements when
11007 MODERN_STL is defined.
11009 * src/debug.h: move the << operator definition after the inclusion
11012 * src/support/filetools.C: include "LAssert.h", which is needed
11015 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11018 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11019 include "debug.h" to define a proper ostream.
11021 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11023 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11024 method to the SystemCall class which can kill a process, but it's
11025 not fully implemented yet.
11027 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11029 * src/support/FileInfo.h: Better documentation
11031 * src/lyxfunc.C: Added support for buffer-export html
11033 * src/menus.C: Added Export->As HTML...
11035 * lib/bind/*.bind: Added short-cut for buffer-export html
11037 * src/lyxrc.*: Added support for new \tth_command
11039 * lib/lyxrc.example: Added stuff for new \tth_command
11041 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11043 * lib/Makefile.am (IMAGES): removed images/README
11044 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11045 installes in correct place. Check permisions is installed
11048 * src/LaTeX.C: some no-op changes moved declaration of some
11051 * src/LaTeX.h (LATEX_H): changed include guard name
11053 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11055 * lib/reLyX/Makefile.am: install noweb2lyx.
11057 * lib/Makefile.am: install configure.
11059 * lib/reLyX/configure.in: declare a config aux dir; set package
11060 name to lyx (not sure what the best solution is); generate noweb2lyx.
11062 * lib/layouts/egs.layout: fix the bibliography layout.
11064 1999-10-08 Jürgen Vigna <jug@sad.it>
11066 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11067 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11068 it returned without continuing to search the path.
11070 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11072 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11073 also fixes a bug. It is not allowed to do tricks with std::strings
11074 like: string a("hei"); &a[e]; this will not give what you
11075 think... Any reason for the complexity in this func?
11077 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11079 * Updated README and INSTALL a bit, mostly to check that my
11080 CVS rights are correctly set up.
11082 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11084 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11085 does not allow '\0' chars but lyxstring and std::string does.
11087 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11089 * autogen.sh (AUTOCONF): let the autogen script create the
11090 POTFILES.in file too. POTFILES.in should perhaps now not be
11091 included in the cvs module.
11093 * some more files changed to use C++ includes instead of C ones.
11095 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11097 (Reread): added tostr to nlink. buggy output otherwise.
11098 (Reread): added a string() around szMode when assigning to Buffer,
11099 without this I got a log of garbled info strings.
11101 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11104 * I have added several ostream & operator<<(ostream &, some_type)
11105 functions. This has been done to avoid casting and warnings when
11106 outputting enums to lyxerr. This as thus eliminated a lot of
11107 explicit casts and has made the code clearer. Among the enums
11108 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11109 mathed enums, some font enum the Debug::type enum.
11111 * src/support/lyxstring.h (clear): missing method. equivalent of
11114 * all files that contained "stderr": rewrote constructs that used
11115 stderr to use lyxerr instead. (except bmtable)
11117 * src/support/DebugStream.h (level): and the passed t with
11118 Debug::ANY to avoid spurious bits set.
11120 * src/debug.h (Debug::type value): made it accept strings of the
11121 type INFO,INIT,KEY.
11123 * configure.in (Check for programs): Added a check for kpsewhich,
11124 the latex generation will use this later to better the dicovery of
11127 * src/BufferView.C (create_view): we don't need to cast this to
11128 (void*) that is done automatically.
11129 (WorkAreaButtonPress): removed some dead code.
11131 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11133 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11134 is not overwritten when translated (David Sua'rez de Lis).
11136 * lib/CREDITS: Added David Sua'rez de Lis
11138 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11140 * src/bufferparams.C (BufferParams): default input encoding is now
11143 * acinclude.m4 (cross_compiling): comment out macro
11144 LYX_GXX_STRENGTH_REDUCE.
11146 * acconfig.h: make sure that const is not defined (to empty) when
11147 we are compiling C++. Remove commented out code using SIZEOF_xx
11150 * configure.in : move the test for const and inline as late as
11151 possible so that these C tests do not interefere with C++ ones.
11152 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11153 has not been proven.
11155 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11157 * src/table.C (getDocBookAlign): remove bad default value for
11158 isColumn parameter.
11160 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11162 (ShowFileMenu2): ditto.
11164 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11165 of files to ignore.
11167 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11169 * Most files: finished the change from the old error code to use
11170 DebugStream for all lyxerr debugging. Only minor changes remain
11171 (e.g. the setting of debug levels using strings instead of number)
11173 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11175 * src/layout.C (Add): Changed to use compare_no_case instead of
11178 * src/FontInfo.C: changed loop variable type too string::size_type.
11180 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11182 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11183 set ETAGS_ARGS to --c++
11185 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11187 * src/table.C (DocBookEndOfCell): commented out two unused variables
11189 * src/paragraph.C: commented out four unused variables.
11191 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11192 insed a if clause with type string::size_type.
11194 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11197 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11199 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11200 variable, also changed loop to go from 0 to lenght + 1, instead of
11201 -1 to length. This should be correct.
11203 * src/LaTeX.C (scanError): use string::size_type as loop variable
11206 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11207 (l.896) since y_tmp and row was not used anyway.
11209 * src/insets/insetref.C (escape): use string::size_type as loop
11212 * src/insets/insetquotes.C (Width): use string::size_type as loop
11214 (Draw): use string::size_type as loop variable type.
11216 * src/insets/insetlatexaccent.C (checkContents): use
11217 string::size_type as loop variable type.
11219 * src/insets/insetlabel.C (escape): use string::size_type as loop
11222 * src/insets/insetinfo.C: added an extern for current_view.
11224 * src/insets/insetcommand.C (scanCommand): use string::size_type
11225 as loop variable type.
11227 * most files: removed the RCS tags. With them we had to recompile
11228 a lot of files after a simple cvs commit. Also we have never used
11229 them for anything meaningful.
11231 * most files: tags-query-replace NULL 0. As adviced several plases
11232 we now use "0" instead of "NULL" in our code.
11234 * src/support/filetools.C (SpaceLess): use string::size_type as
11235 loop variable type.
11237 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11239 * src/paragraph.C: fixed up some more string stuff.
11241 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11243 * src/support/filetools.h: make modestr a std::string.
11245 * src/filetools.C (GetEnv): made ch really const.
11247 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11248 made code that used these use max/min from <algorithm> instead.
11250 * changed several c library include files to their equivalent c++
11251 library include files. All is not changed yet.
11253 * created a support subdir in src, put lyxstring and lstrings
11254 there + the extra files atexit, fileblock, strerror. Created
11255 Makefile.am. edited configure.in and src/Makefile.am to use this
11256 new subdir. More files moved to support.
11258 * imported som of the functions from repository lyx, filetools
11260 * ran tags-query-replace on LString -> string, corrected the bogus
11261 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11262 is still some errors in there. This is errors where too much or
11263 too litle get deleted from strings (string::erase, string::substr,
11264 string::replace), there can also be some off by one errors, or
11265 just plain wrong use of functions from lstrings. Viewing of quotes
11268 * LyX is now running fairly well with string, but there are
11269 certainly some bugs yet (see above) also string is quite different
11270 from LString among others in that it does not allow null pointers
11271 passed in and will abort if it gets any.
11273 * Added the revtex4 files I forgot when setting up the repository.
11275 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11277 * All over: Tried to clean everything up so that only the files
11278 that we really need are included in the cvs repository.
11279 * Switched to use automake.
11280 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11281 * Install has not been checked.
11283 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11285 * po/pt.po: Three errors:
11286 l.533 and l.538 format specification error
11287 l. 402 duplicate entry, I just deleted it.