1 2000-12-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/WorkArea.C (work_area_handler): simplify the key/keysym
4 handling for XForms 0.89, this might have rendered some cases
5 unusable. I have at least deadkeys, accent-xxx and KP_x working.
6 Please report proplems.
8 * src/lyxfunc.C (processKeySym): make the self-insert handling
11 2000-12-18 Baruch Even <baruch.even@writeme.com>
13 * src/LaTeX.C (deplog): fix spelling errors
14 * src/text2.C (CutSelection): ditto
15 * src/lyxfunc.C (Dispatch): ditto
17 2000-12-18 Lars Gullik Bjønnes <larsbj@lyx.org>
19 * lib/layouts/stdlayouts.inc: only allow align Center for Caption
21 * src/mathed/math_inset.C (MathMatrixInset): initialize v_align
22 and h_align in default init.
23 adjust calls to MathedRowSt
25 * src/mathed/math_iter.C: adjust calls to MathedRowSt
26 * src/mathed/math_iter.h (getAD): ditto
28 * src/mathed/math_defs.h (class MathedRowSt): remove friends, add
29 methods setBaseline, ascent, descent
30 (class MathMatrixInset): remove method GetAlign, change h_align
33 * src/lyxfunc.C (processKeySym): discover the correct argument if
34 the action is LFUN_SELFINSERT
36 2000-12-18 Dekel Tsur <dekelts@tau.ac.il>
38 * src/mathed/math_cursor.C (Interpret) Suppress a debug message
41 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
43 * src/support/copy.C: don't include filetools.h
45 * lib/images: revert to old banner, drop the cucumber.
47 2000-12-12 Dekel Tsur <dekelts@tau.ac.il>
49 * src/converter.C (Formats::View): Change the current directory to
50 the directory of the file.
52 2000-12-17 Lars Gullik Bjønnes <larsbj@lyx.org>
54 * src/kbsequence.C (addkey): also clear sequence and modifiers if
57 * src/BufferView2.C (theLockingInset): return 0 if text is 0
59 2000-12-17 Dekel Tsur <dekelts@tau.ac.il>
61 * Many files: Fix RTL support for insettext.
63 2000-12-11 John Levon <moz@compsoc.man.ac.uk>
65 * README: add mention of broken ghostscript versions, remove
66 reference to non-existent BUGS file
68 2000-12-13 Angus Leeming <a.leeming@ic.ac.uk>
70 * src/support/lstrings.C (compare_no_case): small fix. When passed
71 length, should use it in the size comparison.
73 2000-12-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
75 * src/insets/insetexternal.C (getScreenLabel): Return a default
76 value if the template label is empty.
78 * src/lyxlookup.C: do not condition on FL_REVISION.
81 * src/sp_form.C: fix the font size of some text entries
83 * src/frontends/xforms/Menubar_pimpl.C (add_toc): honor separator
84 after TOC when there is no TOC.
86 * src/lyxrc.C (readBindFileIfNeeded): new method. Reads the main
87 bind file if it has not been done yet.
88 (read): remove local bindFile variable. Try to fix the handling of
89 RC_BIND and RC_BINDFILE.
91 * src/lyx_main.C (init): use readBindFileIfNeeded().
93 * lib/languages: Change description of german to "German (new
96 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
98 * src/frontends/xforms/FormInset.C (createInset): activate "Ok",
99 "Apply" buttons if arg is non-zero.
101 * src/lyxfunc.C (Dispatch): enable citation to be inserted without
102 launching the popup if sufficient info is passed to
103 LFUN_CITATION_CREATE.
105 2000-11-23 Dekel Tsur <dekelts@tau.ac.il>
107 * src/lyx_cb.C (MenuInsertLabel): Compute a default value for new
108 labels (disabled in 1.1.6).
110 * src/lyxrc.[Ch]: New variable label_init_length
112 * mathed/formula.C (LocalDispatch): Preserve the label when
113 changing from display math to eqnarray (however, the label
114 do not appear at the first line, as one might expects, but at the
116 (LocalDispatch): When inserting a label to a formula which already
117 have a label, the old label is used as default value.
118 Also, if the label is changed, then all references to the label
121 * src/mathed/math_iter.C (setLabel): Allow to set the label
122 even if it is empty. This is needed to allow deletion of a label
125 * src/BufferView2.C (ChangeRefsIfUnique): New method. Changes the
126 refernces only if the old label appears once in the document.
128 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
130 * lib/languages: added ngerman. Patch courtesy of Andreas Gehlert
131 <gehlert@Rcs1.urz.tu-dresden.de>
133 * src/frontends/xforms/FormBase.C: comment out debug.h
135 * src/frontends/xforms/FormGraphics.[Ch] (browseFile): removed. Reuse
136 code in xform_helpers instead.
137 (d-tor): comment out "delete dialog;" and so prevent a crash on exit.
139 * src/frontends/xforms/FormPreferences.C: use AddName() in more places.
140 Use N_(), rather than _() when creating strings to pass to browseFile()
141 because browseFile calls gettext() itself now.
143 * src/frontends/xforms/xform_helpers.C (browseFile): call gettext() and
144 display the filename correctly.
146 2000-12-09 Dekel Tsur <dekelts@tau.ac.il>
148 * src/converter.C (Move): New method. Used to move file or files
149 from temp dir to the output dir. (this fixes the bug that
150 exporting linuxdoc/docbook document to html would not move all
151 html file from temp directory).
153 * src/support/filetools.C (DirList): Fixed.
155 * src/lstrings.C (prefixIs): Fixed (how nobody noticed it before??).
157 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
159 * src/converter.C (Add): Remove $$i when setting latex_command.
161 * src/text.C (IsBoundary): Return false when pos = 0.
163 2000-12-08 Dekel Tsur <dekelts@tau.ac.il>
165 * lib/kbd/hebrew.kmap: Add Hebrew points (nikud).
167 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
169 * src/frontends/xforms/FormDocument.C (checkMarginValues): you don't
170 need to empty the fields to turn off use of the geometry package!
172 2000-12-07 Angus Leeming <a.leeming@ic.ac.uk>
174 * src/lyxparagraph.h, src/paragraph.C (CopyIntoMinibuffer): pass a
175 (Buffer const &), not a (BufferParams const &) and so fix a crash
176 caused by using current_view before it had been initialised. Not
177 the best way to do this, but much easier than changing
178 Inset::Clone(Buffer const &) to Inset::Clone().
181 * src/tabular.C: changed call to CopyIntoMinibuffer().
183 2000-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
185 * lib/ui/default.ui: put TOC at the beginning of the TOC menu.
187 * src/lyxfunc.C (getStatus): disable insertion of floats in a
190 2000-12-06 Angus Leeming <a.leeming@ic.ac.uk>
192 * src/frontends/xforms/FormPreferences.C (ScreenFonts::build):
193 changed filter for screen fonts input filter from int to float
195 * src/frontends/xforms/input_validators.c: removed.
196 * src/frontends/xforms/input_validators.C: new file. Can now call C++
197 functions from within the filter functions.
199 * src/frontends/xforms/input_validators.[Ch]
200 (fl_unsigned_float_filter): new filter function.
202 * src/frontends/xforms/forms/fdfixc.sed: I defy gettext to get
203 confused now! And if you think I'm going to do this in
204 ./forms/fdfix.sh with its "sed -e" declarations, then think again!
206 2000-12-06 Lars Gullik Bjønnes <larsbj@lyx.org>
208 * src/buffer.C (asciiParagraph): small NEW_INSETS fix from Levon
210 * src/WorkArea.C (work_area_handler): don't handle button requests
211 if xbutton.button == 0
213 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
215 * lib/layouts/lyxmacros.inc: do not use \verbatim@font in lyxcode.
216 It creates a lot of interesting problems.
218 2000-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
220 * src/frontends/xforms/Menubar_pimpl.C (openByName): check that
221 the menu exists in the current menubar before opening it.
223 * src/MenuBackend.C (hasSubmenu): new method.
225 * src/frontends/xforms/Menubar_pimpl.C: fix problem with bogus
226 action value by offsetting actions by a large constant (so that
227 bogs choice result will be less than this constant).
229 * lib/bind/fi_menus.bind: more cleanup to menus.
230 * lib/bind/sciword.bind: ditto.
231 * lib/bind/xemacs.bind: ditto.
232 * lib/bind/emacs.bind: ditto.
233 * lib/bind/pt_menus.bind: ditto.
234 * lib/bind/hu_menus.bind: ditto.
236 * src/gettext.h (locale_init): set locale LC_NUMERIC to "C".
238 * INSTALL: update PROBLEMS section.
240 * src/lyxlookup.h: remove condition on xforms version, since we
241 should not include it if not appropriate.
243 2000-12-05 John Levon <moz@compsoc.man.ac.uk>
245 * src/LColor.C: "latex text" -> "latex inset" (from
248 * src/lyxrc.C: "it's" -> "its" (from Angus Leeming)
250 * src/frontends/kde/FormTabularCreate.C:
251 * src/frontends/kde/citationdlg.C:
252 * src/frontends/kde/copyrightdlg.C:
253 * src/frontends/kde/paradlg.C:
254 * src/frontends/kde/paraextradlg.C:
255 * src/frontends/kde/parageneraldlg.C:
256 * src/frontends/kde/printdlg.C:
257 * src/frontends/kde/refdlg.C:
258 * src/frontends/kde/tabcreatedlg.C:
259 * src/frontends/kde/tocdlg.C:
260 * src/frontends/kde/urldlg.C: add necessary headers
263 * src/frontends/kde/dlg/emptytable.C:
264 * src/frontends/kde/dlg/tabstack.C: ctors shouldn't have
265 default parameters (from Angus Leeming)
267 * src/frontends/kde/dlg/moc/.cvsignore:
268 * src/frontends/kde/dlg/.cvsignore:
269 * src/frontends/kde/moc/.cvsignore: fix the library name
272 * src/frontends/kde/paradlg.C:
273 * src/frontends/kde/parageneraldlg.C:
274 * src/frontends/kde/dlg/para.dlg:
275 * src/frontends/kde/dlg/paradlgdata.C: added accelerators
277 * src/frontends/kde/dlg/README: clarified qtarch version
279 * src/frontends/kde/dlg/Makefile.am: removed the
280 dlg rules as they created spontaneous rebuilds
281 (not a good idea as it requires qtarch)
283 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
285 * config/lyxinclude.m4 (LYX_PATH_XFORMS): display also the
286 fixlevel along with xforms version.
288 * src/WorkArea.C (work_area_handler): use stuff in lyxlookup.h when
289 xforms version is strictly less than 0.89.5.
290 * src/lyx_gui.C (LyXGUI): ditto.
291 * src/LyXView.C (show): ditto.
293 2000-12-02 Dekel Tsur <dekelts@tau.ac.il>
295 * src/BufferView_pimpl.C (workAreaMotionNotify): Fixed mouse
296 movement in inset in RTL text.
297 (checkInsetHit): Fixed mouse movement in scrolled inset in RTL text.
298 (workAreaButtonRelease): Do not open a float when there is a selection.
300 * src/insets/insettext.C (cx): Fixed for insets in RTL text.
302 * src/spellchecker.C (RunSpellChecker): Open all floats before
305 * src/text.C (InsertChar): Consider "," as a part of a number
306 (for LTR numbers in RTL text code).
307 (IsBoundary): Fixed (and simplified).
308 (InsertChar): Recalculate cursor boundary.
311 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
313 * src/spellchecker.C: fix figures with pspell enabled
315 * src/insets/figinset.C: workaround for gs hang xforms bug
317 2000-12-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
319 * lib/bind/??_menus.bind: comment out the entries corresponding to
320 real menus. They should be eventually removed, but I'll let the
321 language maintainers do that.
323 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
325 * src/frontends/kde/parageneraldlg.C:
326 * src/frontends/kde/parageneraldlg.h: don't use
327 a derived class for SpaceAbove/Below
329 * src/frontends/kde/dlg/README: add some info
331 * src/frontends/kde/dlg/*: update data files, update
334 * src/frontends/kde/dlg/moc/Makefile.am: add
337 2000-12-04 John Levon <moz@compsoc.man.ac.uk>
339 * configure.in: add new KDE Makefiles
340 * src/vspace.h: return GlueLength not a normal one
341 * src/support/lstrings.h:
342 * src/support/lstrings.C: add isStrUnsignedInt(),
345 * src/frontends/kde/*: big reorganisation, update
346 FormParagraph, add FormTabCreate
348 2000-12-04 Angus Leeming <a.leeming@ic.ac.uk>
350 * lib/ui/default.ui: small grammatical change.
352 * src/frontends/xforms/xform_macros.h: removed.
354 * src/frontends/xforms/FormBase.C:
355 * src/frontends/xforms/FormPreferences.C:
356 * src/frontends/xforms/Makefile.am: changes associated with removing
357 xform_macros.h. Should make Lars' debugging a little easier.
359 * src/frontends/xforms/FormPreferences.C:
360 * src/frontends/xforms/FormPreferences.h:
361 * src/frontends/xforms/forms/form_preferences.fd (Colors tab): no
362 longer use X11 color name database. HSV and RGB dials/sliders.
363 Please let this be the end of this!
365 2000-11-30 Dekel Tsur <dekelts@tau.ac.il>
367 * Several files: Allow compilation when the compiler doesn't
370 2000-11-30 Angus Leeming <a.leeming@ic.ac.uk>
373 * src/lyx_main.C (commandLineHelp, easyParse): documented remaining
374 command line options.
376 2000-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
378 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use
379 FL_MENU_BUTTON for items in menu bar. Not sure what difference it
382 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
384 * src/frontends/xforms/FormRef.C (updateBrowser):
385 * src/frontends/xforms/forms/form_ref.fd: try clicking on
386 different insets with the sort key active. Now apply this patch!
388 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
390 * src/frontends/xforms/FormPrint.C: set to valid()
391 when we update from the passed parameters.
393 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
395 * src/LColor.C (getFromGUIName): internationalise the comparison.
397 * src/lyx_gui_misc.h (LyXBell): turn off that BLOODY bell until it's a
398 FormPreferences choice.
400 * src/frontends/xforms/FormPreferences.C: some additional Color safety.
403 2000-11-29 John Levon <moz@compsoc.man.ac.uk>
405 * src/lyxrc.C: more detail for the printer program config
408 * src/LColor.C: ert->latex text. LColor needs a big revamp
409 but will have to wait till after 1.1.6
411 * src/buffer.C: bring up a dialog if we load a document
412 with an un-installed text class, rather than just complain
415 2000-11-29 Angus Leeming <a.leeming@ic.ac.uk>
417 * src/combox.[Ch] )(add, Show): workaround xforms bug when Show()ing
418 the browser form for a combox in a tabbed folder. Bug fix courtesy of
419 Steve Lamont <spl@ncmir.ucsd.edu>.
421 * src/frontends/xforms/FormDocument.C (build):
422 * src/frontends/xforms/FormPreferences.C (Language::build):
423 pass tabfolders to Combox::add() in order to use this work around.
425 * src/frontends/xforms/FormCitation.C (connect): remove max size
427 (update): sort list of bibliography keys.
429 * src/frontends/xforms/FormRef.[Ch] (connect, showBrowser, hideBrowser,
431 No max size limitation. Same popup for new and existing insets. Fixes
432 bugs reported by Rob Lahaye.
434 * src/frontends/xforms/FormCitation.C (c-tor):
435 * src/frontends/xforms/FormCopyright.C (c-tor):
436 * src/frontends/xforms/FormError.C (c-tor):
437 * src/frontends/xforms/FormGraphics.C (c-tor):
438 * src/frontends/xforms/FormIndex.C (c-tor):
439 * src/frontends/xforms/FormRef.C (c-tor):
440 * src/frontends/xforms/FormToc.C (c-tor):
441 * src/frontends/xforms/FormUrl.C (c-tor):
442 use correct policy for ButtonController.
444 * src/frontends/xforms/FormPreferences.[Ch]: cleaned up a little more.
446 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): modified lyxerr
449 * src/frontends/xforms/forms/form_citation.fd: some resizing changes.
451 * src/frontends/xforms/forms/form_ref.fd: new Restore, Apply buutons.
452 Some resizing changes.
454 2000-11-28 Lars Gullik Bjønnes <larsbj@lyx.org>
456 * configure.in: fix typo
458 * lib/languages: add ukraninian and change no to no_NO
460 * src/lyxfont.[Ch] (setGUISize): comment out setGUISize
462 * src/bufferview_funcs.C (FontSize): use setLyXSize
464 2000-11-24 Kayvan A. Sylvan <kayvan@sylvan.com>
466 * acconfig.h, configure.in, config/lyxinclude.m4: Added autoconf tests
467 to check for systems where mkstemp() is available but not declared
468 in headers. The new autoconf macro lyx_CHECK_DECL can be used
469 to check for declarations in headers.
471 2000-11-23 Angus Leeming <a.leeming@ic.ac.uk>
473 * forms/bibforms.fd: tiny fix to get it to run with fdesign.
475 * forms/makefile: added bibforms.fd, include_form.fd.
476 Removed lyx_sendfax.fd.
478 * src/LaTeXLog.C (ShowLatexLog):
479 * src/LyXAction.C (init):
480 * src/bufferparams.C (readLanguage): altered messages as suggested by
483 * src/LyXView.C (c-tor): connected RedrawAllBufferRelatedDialogs() to
486 * src/credits.C: made fd_form_credits non-static, so that it can be
487 redrawn should the xforms colors be re-mapped.
488 * src/spellchecker.C ditto fd_form_spell_options.
490 * src/filedlg.[Ch] (redraw):
491 * src/intl.[Ch] (redraw):
492 * src/lyxfr0.[Ch] (redraw):
493 * src/insets/figinset.[Ch] (redraw):
494 * src/insets/insetexternal.[Ch] (redraw):
495 new methods, connected to Dialogs::redrawGUI.
497 * src/lyx_gui_misc.[Ch] (RedrawAllBufferRelatedDialogs): new function
498 to be connected to Dialogs::redrawGUI.
500 * src/frontends/xforms/FormCitation.C (build):
501 * src/frontends/xforms/FormCopyright.C (build):
502 * src/frontends/xforms/FormError.C (build):
503 * src/frontends/xforms/FormGraphics.C (build):
504 * src/frontends/xforms/FormIndex.C (build):
505 * src/frontends/xforms/FormTabularCreate.[Ch] (update):
506 * src/frontends/xforms/FormToc.C (build):
507 * src/frontends/xforms/FormUrl.C (build):
508 use the ButtonController correctly.
510 * src/frontends/xforms/FormCopyright.C (build):
511 * src/frontends/xforms/forms/form_copyright.fd: moved the text out of
512 the .fd file and into build().
514 * src/frontends/xforms/FormPreferences.C: tiny clean-up.
516 * src/frontends/xforms/FormToc.[Ch]: Don't use apply(). Use input().
518 * src/frontends/xforms/forms/form_citation.fd:
519 * src/frontends/xforms/forms/form_copyright.fd:
520 * src/frontends/xforms/forms/form_error.fd:
521 * src/frontends/xforms/forms/form_graphics.fd:
522 * src/frontends/xforms/forms/form_index.fd:
523 * src/frontends/xforms/forms/form_toc.fd:
524 * src/frontends/xforms/forms/form_url.fd:
525 renamed some of the objects. Named others explicitly for the first time.
526 Added Restore and Apply buttons where appropriate.
528 * src/insets/Makefile.am: removed form_graphics.[Ch] as they are not
531 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
533 * src/version.h: try the pre2 again
535 2000-11-22 Angus Leeming <a.leeming@ic.ac.uk>
537 * src/frontends/kde/Dialogs.C: added signal Dialogs::redrawGUI.
539 * src/frontends/kde/FormParagraph.C: added using directive.
541 * src/frontends/kde/paradlg.C: added config.h and using directive.
543 * src/frontends/kde/paradlg.h: added std::qualifier.
545 * src/frontends/kde/Makefile.am: added Color.lo to libkde_la_OBJADD.
547 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
549 * configure.in (AC_OUTPUT): don't output src/xtl/Makefile
551 * src/lyx_sendfax.[Ch] src/lyx_sendfax_main.C: delete files
553 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
555 * src/version.h: set back to 1.1.6cvs
557 2000-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
559 * src/version.h: set to 1.1.6pre2
561 2000-11-20 Marko Vendelin <markov@ioc.ee>
563 * src/frontends/gnome/Dialogs.C: added signal Dialogs::redrawGUI
565 * src/frontends/gnome/Makefile.am: updated list of XForms object files
567 2000-11-21 Angus Leeming <a.leeming@ic.ac.uk>
569 * src/LColor.C (init):
570 * src/lyxrc.C (getDescription): changed some comments as suggested by
573 * src/frontends/xforms/FormBase.[Ch]: modified to connect and
574 disconnect the redrawGUI signal in best-practice fashion.
576 * src/frontends/xforms/FormPreferences.[Ch]: renamed usage_tab_ as
577 long_opts_tab to reflect the change in name of this tabfolder, as
578 suggested by John Levon.
579 (connect, disconnect): new methods. Don't do much at present other than
580 ensuring that we can't resize the dialog. This just makes xforms go
582 (lots of methods in Colors): made void rather than bool. The idea is
583 to have an isOk() function that keeps track of whether any input is
584 genuinely invalid and should therefore block Save, Apply.
585 Easier to manipulate the counters rapidly.
586 (Colors::InputBrowserLyX, Colors::Modify): rewritten so that Amir's
587 compiler will like this code. Much cleaner way of doing things.
589 * src/frontends/xforms/forms/fdfix.sh: a little speed up fix.
591 * src/frontends/xforms/forms/form_preferences.fd: used normal counters
592 rather than simple counters, following suggestion by John Levon.
594 * src/frontends/xforms/forms/form_print.fd: used labelframe rather
595 than engraved frame + text.
597 * src/frontends/xforms/forms/makefile: removed spurious command.
599 2000-11-17 Angus Leeming <a.leeming@ic.ac.uk>
601 * src/LColor.C (c-tor): fixed a couple of items in the ColorEntry
603 * src/LyXAction.C (init): LFUN_SET_COLOR now has the attrib
606 * src/frontends/xforms/Color.C: (HSVColor c-tor): another bug fix.
608 * src/frontends/xforms/FormPreferences.C: re-formatted so that I can
609 see what Lars has changed and what is just white space!
610 Now used X directly to ascertain the RGB color associated with the
612 Replaced the RGB sliders with HSV equivalent. Should be more intuitive
614 Added some sort capability.
615 The X11 color name database input is only displayed if the database
616 isn't found in the standard place.
617 Got rid of struct compare_converter; it wasn't used.
618 Probably some other stuff that I've forgotten.
620 * src/frontends/xforms/FormPreferences.h: changed the names of some
621 methods in the Colors struct. Added a couple of structs to help sort
622 colors by name and by RGBColor.
624 * src/frontends/xforms/xform_helpers.[Ch]: moved the ReadableDir etc
625 functions into a new class RWInfo.
627 * src/frontends/xforms/forms/form_citation.fd: Added some shortcuts.
628 The dialog is now almost navigable using the keyboard. Unfortunately,
629 the cursor has to be inside a browser for it to be activated. There is
630 no visual feedback for the key shortcuts to the arrow keys (use
631 Alt-appropriate arrow key, Alt-x).
633 * src/frontends/xforms/forms/form_preferences.fd: hacked the Colors tab
636 * src/support/filetools.[Ch]: moved out ReadableFile etc and into
637 xform_helpers.[Ch]. See above.
639 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
641 * config/lyxinclude.m4 (LYX_PROG_CXX): please somebody
643 * src/screen.C (setCursorColor): new method. Sets the color of the
645 (ShowManualCursor): call it.
646 Constify some local variables.
648 * src/LColor.[Ch] (LColor): add entry for cursor
649 * lib/configure(.m4) (word_to_latex_command): add quotes, removes
652 2000-11-19 Juergen Vigna <jug@sad.it>
654 * src/insets/insettabular.C (draw): fixed text border redraw problem.
655 (calculate_dimensions_of_cells): try to boost up when inserting chars.
657 2000-11-15 Rob Lahaye <lahaye@postech.edu>
659 * lib/ui/default.ui: OptItem used for Fax entry
661 2000-11-17 Matej Cepl <cepl@bigfoot.com>
663 * lib/kbd/czech.kmap: add apostroph mark to the Czech keyboard.
665 2000-11-15 John Levon <moz@compsoc.man.ac.uk>
667 * src/vspace.C (nextToken): fix so it can handle length phrases like
668 "10mm+-20mm", "40inplus16mmminus10cm" etc.
670 2000-11-17 Lars Gullik Bjønnes <larsbj@lyx.org>
672 * src/frontends/xforms/FormPreferences.C: constify several variables
673 (BrowserLyX): rewrite to not need the choice variable
674 (Modify): rewrite to not need the choide variable
675 (compare_converter): make operator const
677 * src/lyxrc.C (output): be a bit nicer og os usage, and try to
678 correct the writing of \set_color
679 (getDescription): return a const string
681 * src/kbsequence.[Ch] (addkey): remove dead code
683 * src/Painter.C (text): remove some commented code
685 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
687 * src/ColorHandler.[Ch]: removed some header files from .h file.
688 Included LColor.h in .C file.
690 * src/LColor.[Ch]: made class copyable so that I could create a
691 system_lcolor instance.
693 * src/Painter.h: removed LColor.h.
695 * src/lyx_gui.C (create_forms): used AddName.
697 * src/lyx_main.C (init): copied lcolor to system_lcolr prior to reading
698 of user preferences/lyxrc file.
700 * src/lyxrc.C (output): output changes to lcolor.
702 * src/frontends/xforms/Color.[Ch]: Changed X11Color to a new struct,
704 Moved class xformColor to files xform_helpers.[Ch]. These files,
705 Color.[Ch], could now be moved into src if they would be useful to
708 * src/frontends/xforms/xform_helpers.[Ch]: moved class XformColor here.
709 Also moved FormPreferences::browseFile here as it can be used by any
710 xform dialog with a "Browse" button. FormGraphics is a perfect example.
712 * src/support/filetools.[Ch] (WriteableDir, ReadableDir, WriteableFile,
713 ReadableFile): changed the FormPreferences methods a little and moved
714 them here as they'll be useful elsewhere also.
716 * src/frontends/xforms/FormPreferences.h: a bit more cleaning up.
717 Removed some header files and used forward declarations instead.
719 Removed some methods as they'll be useful elsewhere (see above).
721 * src/frontends/xforms/FormPreferences.C: a bit more cleaning up.
722 Can also now modify the LyX LColors. However, for reasons that I don't
723 yet understand, it appears that we can use
724 LyXFunc::Dispatch(LFUN_SET_COLOR, arg) only when we have a buffer
725 present. The problem appears to lie in ColorHandler, because I can
726 change the color using LColor.SetColor(). Similarly, when reading in a
727 preferences file with some set_color instances, I'll get a warning
728 like: Color sea green is undefined or may not be redefined
729 Bad lyxrc set_color for sea green
731 Once the buffer is loaded, however, I can happily change to this color.
733 Finally, it appears that I have to set the color of "inset frame"
734 explicitly, or it oscillates from "black" to "indian red" with each
737 2000-11-15 Angus Leeming <a.leeming@ic.ac.uk>
739 * ANNOUNCE: corrected a spelling mistake.
741 * src/tabular.C (OldFormatRead): variable "h" was set but never used.
744 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
746 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
748 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
751 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
752 match the requirements from the standard better. This is required
753 to work with gnu libstdc++-v3
755 * src/frontends/xforms/FormPreferences.C: add explict pair
756 arguments to browse calls. include support/lyxmanip.h remvoe
757 extern fmt. whitespace changes. reorder variables in
758 FormPreferences.h, to match initalizaton order.
760 * several files: constify more local variables.
762 * src/buffer.C: remove some commented functions.
764 * src/DepTable.C (remove_files_with_extension): temporary
765 work around for gcc 2.97
766 * src/filedlg.C (find): ditto
767 * src/Variables.C (set): ditto
768 * src/LyXAction.C (searchActionArg): ditto
769 (retrieveActionArg): ditto
771 * configure.in: check for mktemp too
773 * UPGRADING: prepare for 1.1.6
775 * Makefile.am (lgbtags): add backup tags for when etags are
776 different than usual.
778 * ANNOUNCE: prepare for 1.1.6
780 * src/support/tempname.C (make_tempfile): new function, wrapper
781 around mkstemp and mktemp. Only mkstemp has been tested.
784 2000-11-14 Rob Lahaye <lahaye@postech.edu>
786 * default.ui: capitalized some menu items to improve shortcuts.
788 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
790 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
792 * src/frontends/xforms/Dialogs.C: add "using" directive.
794 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
796 * src/filedlg.C (Select): highlight suggested file in browser, if
799 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
800 each tab folder is encapsulated in its own class.
801 The Language keymaps are now chosen using a text input and a
802 browser button, rather than a Combox.
803 All the browser buttons are now functional, although LyXFileDlg
804 still needs to be modified to make it straighhtforward to return a
805 directory if that is what is desired.
807 * src/frontends/xforms/forms/form_preferences.fd: use text input
808 and browse button to input the Language keymaps. Add a few
809 callbacks for the browse buttons.
811 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
813 * src/support/tempname.C (tempName): small changes to make it
814 safer. remove the '.' before XXXXXX
816 * src/support/filetools.C (TmpFileName): remove func
819 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
820 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
821 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
822 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
824 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
827 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
830 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
831 for bp (this fixes a reproducible hard crash)
833 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
836 * src/frontends/xforms/FormBase.h: make bp_ private
837 (FormBaseBI): remove default for bp
840 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
843 * src/frontends/xforms/Color.C (RGBColor): made several vars
844 const, changed initialization of j to allow it to be const
847 * several files: added const to local variables.
849 * src/lyx_cb.C: removed several function prototypes and moved them
853 (UpdateLayoutPreamble):
855 (MenuInsertLabel): add BufferView as arguemnt
856 (LayoutsCB): make tmp const
858 * src/layout_forms.h: regenerated
860 * src/debug.C: add Debug::FILES
861 (showLevel) (showTags): translate the desc
863 * src/debug.h: add FILES as debug target
865 * src/bufferlist.C: use current_view as an interim measure becuase
866 of added arguments to MenuWrite and MenuWriteAs
868 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
870 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
872 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
873 libstdc++ is compiled with.
875 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
877 * lib/layouts/docbook-book.layout
878 * lib/layouts/docbook.layout
879 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
880 those paragraphs are expresse as SGML comments <!-- -->.
882 * src/LaTeXFeatures.h
883 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
884 parameter, this allows to express all the include files as relative
885 paths to the master buffer. The verbatim insert works as the other
888 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
890 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
892 (MakeDocBookFile): top_element is always written. Some clean up, as
893 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
895 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
896 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
897 a reference is written instead of the name.
898 (Validate): use the relative path for the filename.
900 * src/insets/insetlabel.C (DocBook): write end tag, for XML
903 * src/support/filetools.h
904 * src/support/filetools.C (IsSGMLFilename): added.
907 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
909 * development/OS2/quick_fix.patch:
911 * README.OS2: quick update to the OS/2 port.
913 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
915 * src/converter.C: add "using" directive.
917 * src/frontends/xforms/FormPreferences.C: add "using" directive.
918 (compare_converter): add "int" as return type.
920 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
923 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
925 * src/lyx_gui.C (create_forms): map the xform colours, should a
926 mapping exist. Ie, call XformColor::read().
928 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
929 and struct HSV as HSVColor.
930 (XformColor::read, XformColor::write) : new methods that
931 input/output any changes to the cform GUI colors.
933 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
936 * src/frontends/xforms/FormPreferences.C Lots of little changes
937 associated with the changed name of the RGB and HSV structs. Can
938 now save changes to xforms GUI to file. Commented out
939 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
940 used currently anyway.
942 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
944 * src/converter.C: A lot of changes:
945 - It is no longer possible to choose between two or more ways to
946 export to some format (the new code uses only the shortest path).
947 However, it is still possible to choose between pdflatex/ps2pdf
948 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
949 - Added several methods that makes the FormPreferences code simpler.
950 - Changed the tokens $$FName and $$OutName to $$i and $$o.
952 * src/exporter.C (Export): lyxrc.use_pdf is set before
953 makeLaTeXFile is called. This works but not very nice.
955 * src/frontends/xforms/FormPreferences.C: The formats/converters
956 tabs are now fully functional.
958 * src/buffer.C (getTocList): Add numbers to the captions.
960 * lib/lyxrc.example: Removed fax section
962 * src/support/rename.C (rename): Delete the old file if lyx::copy
965 2000-11-13 Rob Lahaye <lahaye@postech.edu>
967 * lib/ui/default.ui: minor polishing.
969 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
971 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
974 * lib/Makefile.am (DOCINST): do not install everything in the
975 documentation directory.
977 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
979 * src/bufferlist.C (newFile): set the filename to the constructed
982 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
983 constructed "newfileXX.lyx" name to the dialog
985 * src/frontends/DialogBase.h: make update() non-abstract so
986 KDE doesn't need to implement two update methods for every form
988 * src/frontends/kde/Makefile.am: add missing xforms objects
991 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
993 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
995 * src/frontends/xforms/Color.[Ch]: new files, defining the color
996 structs RGB and HSV. May not be the best place for these files.
997 Perhaps move them into src ?
999 * src/frontends/xforms/Makefile.am: added new files.
1001 * src/frontends/xforms/forms/form_preferences.fd:
1002 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
1003 replaced all instances of "colour" with "color"!
1005 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
1008 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
1009 tab. Can now alter the colors of the xform's GUI on the fly. With
1010 the aid of a single static Signal (see below), can "Apply" these
1011 changes to all currently open dialogs. (Well, to all of the NEW
1012 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
1013 subsequently opened dialogs will, of course, also have the new
1014 color scheme. Cannot yet save (or load) the choices to file, so
1015 they are lost when exiting LyX.
1017 * src/frontends/Dialogs.h:
1018 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
1019 Used to trigger a redraw of any dialogs connected to it because,
1020 for example, the GUI colours have been re-mapped.
1022 * src/frontends/xforms/FormBase.[Ch]:
1023 * src/frontends/xforms/FormDocument.[Ch]:
1024 * src/frontends/xforms/FormParagraph.[Ch]:
1025 * src/frontends/xforms/FormPreferences.[Ch]:
1026 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
1027 method, to be connected to Dialogs::redrawGUI. Method must be
1028 virtual, because dialogs with tabbed folders need to redraw the
1029 forms of each tab folder.
1031 * src/LyXView.C (d-tor):
1032 * src/frontends/xforms/FormBase.C (d-tor): connected
1033 Dialogs::redrawGUI signal to redraw().
1035 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
1036 removed Assert, because it is identical to that in FormBase.
1038 2000-11-10 Rob Lahaye <lahaye@postech.edu>
1040 * lib/ui/default.ui: minor polishing.
1042 2000-11-10 Juergen Vigna <jug@sad.it>
1044 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
1045 (deleteLyXText): ditto
1047 * src/insets/insettabular.C (InsetButtonPress): don't clear the
1048 selection on mouse-button-3.
1050 * src/insets/insettabular.h: new function clearSelection(), use this
1051 functions inside insettabular.C.
1053 * src/insets/insettabular.C (TabularFeatures): clear the selection
1054 on remove_row/column.
1056 * src/insets/inset.C (scroll): fixed some scroll stuff.
1058 * src/insets/insettabular.C (draw): fixed another minor draw problem.
1060 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1062 * lib/CREDITS: add Yves Bastide
1064 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
1066 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
1067 check whether C library functions are in the global namespace.
1069 * configure.in: calls it.
1071 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
1072 #ifndef __GLIBCPP__.
1074 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
1076 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
1077 iterators to prevent crash.
1079 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
1081 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
1083 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
1084 shortcut for xforms CB to the preemptive or post-handler function.
1086 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
1087 removed the HIDDEN_TIMER as it's no longer used.
1088 Various other small changes.
1090 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
1091 preemptive handler to obtain feedback, rather than the post-handler.
1092 (ColoursLoadBrowser): find "black" and "white" based on RGB values
1094 Formats tab is now complete. Converters tab is nearly so.
1096 2000-11-09 Juergen Vigna <jug@sad.it>
1098 * src/insets/insettext.C (~InsetText):
1101 (SetParagraphData): set cache.second to 0 after deleting it!
1102 (getLyXText): check if cache.second is not 0 if finding it.
1104 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1106 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
1107 lyxlex to parse the rgb.txt file.
1110 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
1111 replace the default '#' comment character.
1113 * src/support/tempname.C: add "using" directive
1114 * src/frontends/ButtonPolicies.C: ditto.
1116 * src/support/filetools.C (DirList): add an explicit cast to avoid
1117 a compile error (probably not the right fix)
1119 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
1121 * src/support/filetools.C (DirList): implement using system functions
1123 * src/support/tempname.C: new file
1125 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
1127 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
1129 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
1132 * src/frontends/xforms/ButtonController.C: new file
1134 * src/os2_defines.h: remove getcwd define
1136 * src/lyxvc.C: include support/lyxlib.h
1137 (showLog): use lyx::tempName
1139 * src/lyx_cb.C: comment out includes that we don't need
1140 (AutoSave): use lyx::tempName
1142 * src/filedlg.C: include support/lyxlib.h
1143 (Reread): use lyx::getcwd
1145 * src/converter.C: include support/filetools.h
1146 (add_options): change to static inline, make tail const
1147 (Add): make old_viewer const
1148 (GetAllFormats): make it a const method, use const_iterator
1149 (enable): make static inline
1150 (SplitFormat): make using_format const
1152 * src/LaTeX.C (run): use lyx::getcwd
1154 * configure.in: check for mkstemp as well
1156 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1158 * src/converter.[Ch] (GetAllCommands): new method.
1160 * src/support/filetools.[Ch] (DirList): new method.
1162 * src/frontends/xforms/FormPreferences.C: started (just!) adding
1163 functionality to the converters tab.
1164 The formats tab is now nearly complete.
1165 The kbmap choices in Languages tab now display the contents of
1166 system_lyxdir/kbd/*.kmap in readable form.
1168 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
1169 Moved some variables into the class.
1171 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
1172 inactive tab folder to FL_COL1. Haven't yet worked out how to change
1173 colour of active folder to lighter grey instead. Any takers?
1174 (form_colours): added an "Apply" button.
1175 (form_converters): added a "Flags" input field.
1176 (form_formats): added a "Shortcut" input field. Note that we can't use
1177 names such as "input_shortcut" as this buggers up the sed script stuff.
1179 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1187 * src/lyx_sendfax_main.C:
1190 * src/spellchecker.C:
1191 * src/insets/figinset.C:
1192 * src/insets/insetbib.C:
1193 * src/insets/insetexternal.C:
1194 * src/insets/insetinclude.C:
1195 * src/insets/insetinfo.C:
1196 * src/mathed/math_panel.C:
1197 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
1198 all "daughter" dialogs now have identical "feel".
1200 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
1202 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
1203 used (and was only used in one place prior to this patch. Incorrectly!)
1205 * src/frontends/xforms/FormDocument.C: changed some instances of
1206 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
1207 sense. Also added fl_set_input_return() for class_->input_doc_extra and
1208 for options_->input_float_placement. This fixes a bug reported by
1211 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
1212 functionality into d-tor.
1214 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
1215 input of numerals also.
1217 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
1218 fl_set_form_atclose(). Can now close dialog from window manager,
1219 fixing a bug reported by Rob Lahaye.
1221 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
1223 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
1224 are no longer dark. Haven't yet worked out how to lighten the colour of
1225 the active tabfolder. Any ideas anybody?
1226 Adjusted Colours tab a little.
1227 Added Shortcut field to converters tab. Note that we can't create an
1228 fdesign label like "input_shortcut" as this buggers up the sed-script
1231 * src/frontends/xforms/FormPreferences.[Ch]:
1232 (feedback): fixed crash due to to ob=0.
1233 (LanguagesXXX): the kbmap choices now contain the files
1234 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
1235 be replaced by an input with a file browse button, but since the browse
1236 buttons don'y yet work, this'll do for the moment.
1237 (FormatsXXX): think that this is now nearly fully functional.
1238 Some points/questions though:
1239 1. Does "Apply" remove formats if no longer present?
1240 2. I think that the browser should list the GUI names rather than the
1242 3. Must ensure that we can't delete Formats used by an existing
1245 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
1246 if this is the best way to do this.
1248 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1250 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
1252 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
1253 for variable assignment.
1255 2000-11-07 Rob Lahaye <lahaye@postech.edu>
1257 * src/lib/ui/default.ui: added sub/superscripts to menu as
1258 Insert->Special characters and cleaned-up the file a bit
1260 2000-11-07 Allan Rae <rae@lyx.org>
1262 * src/frontends/xforms/FormPreferences.C (feedback): make sure
1263 ob isn't 0 before using it. See comments in function.
1265 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
1267 * src/frontends/xforms/form_*.C: regenerated
1269 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1271 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
1273 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
1274 compiling with gcc-2.96
1276 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1278 * src/support/lyxstring.C: add a couple "using" directives.
1280 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
1281 a .c_str() here too for good measure.
1282 * src/Spacing.C (set): ditto.
1283 * src/lyxfunc.C (Dispatch): ditto.
1285 * src/insets/insettabular.C (copySelection): change .str() to
1286 .str().c_str() to fix problems with lyxstring.
1287 * src/support/filetools.C (GetFileContents): ditto.
1288 * src/buffer.C (asciiParagraph): ditto.
1289 * src/paragraph.C (String): ditto.
1291 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
1292 * lib/bind/sciword.bind: ditto.
1294 * src/LyXAction.C (init): remove "symbol-insert" function, which
1295 shared LFUN_INSERT_MATH with "math-insert".
1297 * lib/configure.m4: == is not a valid operator for command test.
1299 * src/lyxrc.C: add using directive.
1301 * src/converter.h: add std:: qualifier.
1303 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
1305 * src/converter.[Ch] and other files: Change the Format class to a
1306 real class, and create two instances: formats and system_format.
1308 * src/lyxrc.C (output): Output the difference between formats and
1311 * src/frontends/xforms/FormPreferences.C (input): Simplify.
1312 (buildFormats): Insert formats into browser.
1313 (inputFormats): Made the browser and add button functional.
1314 (applyFormats): Update formats from format_vec.
1316 * src/converter.C: Changed all (*it). to it->
1317 (Format::dummy): New method.
1318 (Format::importer): New format flag.
1319 (Formats::GetAllFormats): New method.
1320 (Formats::Add): Delete format from the map if prettyname is empty.
1321 (Converter::Convert): Print an error message if moving the file fails.
1322 (Converter::GetReachableTo): New method
1324 * src/MenuBackend.[Ch]: Add support for importformats tag.
1326 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
1328 * lib/configure.m4: Add word->tex and ps->fax converters.
1330 * lib/ui/default.ui: Use ImportFormats on file->import menu.
1331 Return fax to file menu.
1335 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
1337 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
1340 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
1343 * src/lyxfunc.C (processKeyEvent): removed
1345 * src/bufferlist.C (emergencyWrite): removed the out commented
1346 emergency write code.
1348 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
1350 * src/LyXView.[Ch]: remove the outcommented raw_callback code
1352 * many files: change formatting to be a bit more uniform for
1353 if,while,for,switch statements, remove some parantesis not needed.
1356 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
1358 * config/kde.m4: make config more robust when KDEDIR is set
1360 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1362 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
1363 not returned a pixmap for "math-insert".
1365 * src/LyXAction.C (init): sort the entries a bit.
1367 2000-11-03 Juergen Vigna <jug@sad.it>
1369 * src/insets/insettabular.h: added fixed number to update codes so
1370 that update is only in one direction.
1372 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
1375 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
1376 before call to edit because of redraw.
1378 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
1380 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1382 * lib/ui/default.ui: Populate "edit_float" menu
1384 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
1386 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
1387 "floats-operate". The name is ugly (and the func also), but this
1388 is just a band-aid until we switch to new insets.
1390 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1392 * lib/ui/default.ui: update again the menu layout (fix some
1395 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1397 * src/MenuBackend.h (fulllabel): new method.
1399 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
1400 the menu shortcuts of a menu are unique and whether they
1401 correspond to a letter of the label.
1402 (expand): call checkShortcuts when debugging.
1404 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
1406 * src/insets/insettext.C (InsetButtonPress): shut off warning.
1408 2000-11-02 Lior Silberman <lior@Princeton.EDU>
1410 * lib/examples/*.lyx : '\language default' => '\language english'
1412 * lib/examples/it_splash.lyx : except where it should be italian
1414 * lib/templates/*.lyx : the same
1416 * doc/*.lyx* : the same
1418 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1420 * lib/bind/menus.bind: remove the Layout menu entries, which I
1421 somehow forgot earlier.
1423 2000-11-03 Rob Lahaye <lahaye@postech.edu>
1425 * lib/ui/old-default.ui: keep the old one here for reference (to
1428 * lib/ui/default.ui: update the menu layout
1430 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
1432 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
1433 Can now Apply to different insets without closing the dialog.
1435 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
1436 Can't actually DO anything with them yet, but I'd like a little
1439 * src/frontends/xforms/input_validators.[ch]
1440 (fl_lowercase_filter): new.
1442 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
1444 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
1445 of MATH_CODE. This fixes a bug with math-macros in RTL text.
1447 * src/text.C (PrepareToPrint): Show math-macros block aligned.
1449 2000-11-02 Juergen Vigna <jug@sad.it>
1451 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
1452 on char insertion as it has already be updated by bv->updateInset().
1454 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
1455 if an inset inside was updated.
1457 * lib/configure.cmd: commented out fax-search code
1459 2000-11-01 Yves Bastide <stid@acm.org>
1461 * src/tabular.C (OldFormatRead): set tabular language to the
1464 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1466 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
1467 class names with non-letter characters (from Yves Bastide).
1469 * lib/ui/default.ui: change Item to OptItem in import menu.
1470 Comment out fax stuff.
1472 * lib/configure.m4: comment out fax-related stuff.
1474 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
1476 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
1477 useful xforms helper functions. At present contains only formatted().
1478 Input a string and it returns it with line breaks so that in fits
1481 * src/frontends/xforms/Makefile.am: add new files.
1483 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
1484 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
1487 * src/frontends/xforms/FormPreferences.[Ch]:
1488 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
1489 but lots of little clean ups. Removed enum State. Make use of
1490 formatted(). Constify lots of methods. Perhaps best of all: removed
1491 requirement for that horrible reinterpret_cast from pointer to long in
1494 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1496 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
1497 conditionalize build on xforms < 0.89
1499 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
1501 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
1503 * src/LyXAction.C (init): comment out fax
1505 * src/lyxrc.h: comment out the fax enums
1506 comment out the fax variables
1508 * src/commandtags.h: comment out LFUN_FAX
1510 * src/lyxrc.C: disable fax variables.
1511 (read): disable parsing of fax variables
1512 (output): disable writing of fax variables
1513 (getFeedback): now description for fax variables
1515 * src/lyxfunc.C: comment out MenuFax
1516 (Dispatch): disable LFUN_FAX
1518 * src/lyx_cb.C (MenuFax): comment out
1520 * src/WorkArea.C: add <cctype>
1521 (work_area_handler): better key handling, should be ok now.
1522 for accented chars + etc
1524 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
1525 lyx_sendfax.h and lyx_sendfax_man.C
1527 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
1528 (show): don't call InitLyXLookup when using xforms 0.89
1530 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1532 * src/trans.C (AddDeadkey): better fix, the other one could crash...
1534 * src/support/filetools.C (GetFileContents): close to dummy change
1536 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1538 * src/trans.C (AddDeadkey): workaround stupid compilers.
1540 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1542 * src/frontends/xforms/FormDocument.C (class_update): fix setting
1543 of two-sided document.
1545 2000-10-31 Juergen Vigna <jug@sad.it>
1547 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
1549 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
1550 xposition to the Edit call.
1552 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1554 * src/trans.C (AddDeadkey): cast explicitly to char.
1556 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
1558 * src/tabular.C (AsciiBottomHLine): simplify?
1559 (AsciiTopHLine): simplify?
1560 (print_n_chars): simplify
1561 (DocBook): remove most of the << endl; we should flush the stream
1562 as seldom as possible.
1564 (TeXBottomHLine): ditto
1565 (TeXTopHLine): ditto
1567 (write_attribute): try a templified version.
1568 (set_row_column_number_info): lesson scope of variables
1570 * src/support/lstrings.h (tostr): new specialization of tostr
1572 * src/trans.C (AddDeadkey): slightly cleaner fix.
1574 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
1576 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
1577 '%%' in Toc menu labels.
1580 * src/insets/insetlatexaccent.C (draw): Correct rendering when
1581 font_norm is iso10646-1.
1583 * src/font.C (ascent): Fixed for 16bit fonts
1584 (descent,lbearing,rbearing): ditto
1586 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
1588 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
1589 (getFeedback): new static method.
1591 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
1592 Now use combox rather than choice to display languages.
1593 Feedback is now output using a new timer callback mechanism, identical
1594 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
1596 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1598 * src/minibuffer.C: fix for older compilers
1600 2000-10-30 Juergen Vigna <jug@sad.it>
1602 * src/insets/insettext.C (InsertInset): fixed this as the cursor
1603 has to be Left of the inset otherwise LyXText won't find it!
1605 * src/BufferView2.C (open_new_inset): delete the inset if it can
1608 2000-10-30 Rob Lahaye <lahaye@postech.edu>
1610 * lyx.man: fix typo.
1612 2000-10-29 Marko Vendelin <markov@ioc.ee>
1613 * src/frontends/gnome/FormCitation.C
1614 * src/frontends/gnome/FormCitation.h
1615 * src/frontends/gnome/FormCopyright.C
1616 * src/frontends/gnome/FormCopyright.h
1617 * src/frontends/gnome/FormError.C
1618 * src/frontends/gnome/FormError.h
1619 * src/frontends/gnome/FormIndex.C
1620 * src/frontends/gnome/FormIndex.h
1621 * src/frontends/gnome/FormPrint.C
1622 * src/frontends/gnome/FormPrint.h
1623 * src/frontends/gnome/FormRef.C
1624 * src/frontends/gnome/FormRef.h
1625 * src/frontends/gnome/FormToc.C
1626 * src/frontends/gnome/FormToc.h
1627 * src/frontends/gnome/FormUrl.C
1628 * src/frontends/gnome/FormUrl.h
1629 * src/frontends/gnome/Menubar_pimpl.C
1630 * src/frontends/gnome/mainapp.C
1631 * src/frontends/gnome/mainapp.h
1632 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
1633 changing update() to updateSlot() where appropriate
1635 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1637 * src/frontends/xforms/FormPreferences.[Ch]:
1638 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
1641 2000-10-28 Juergen Vigna <jug@sad.it>
1643 * src/insets/insettabular.C (draw): fixed drawing bug.
1645 * src/insets/insettext.C (clear):
1647 (SetParagraphData): clearing the TEXT buffers when deleting the
1648 paragraphs used by it.
1650 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
1652 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
1654 2000-10-27 Juergen Vigna <jug@sad.it>
1656 * src/tabular.C (~LyXTabular): removed not needed anymore.
1658 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
1661 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
1663 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
1666 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
1669 * src/frontends/xforms/FormPreferences.[Ch]:
1670 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
1671 Reorganised as modules based on tabs. Much easier to follow the
1672 flow and to add new tabs. Added warning and feedback messages.
1675 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1677 * src/tabular.h (DocBook): add std:: qualifier.
1679 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
1681 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
1682 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
1685 * insettabular.C (DocBook): uses the tabular methods to export
1688 * src/insets/insettext.h
1689 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
1691 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1693 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
1696 * src/lyxfunc.C (MenuNew): lessen the scope of fname
1697 moved misplaced AllowInput two lines up.
1699 * src/buffer.C (readFile): compare float with float, not with int
1701 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1703 * src/minibuffer.C: add "using SigC::slot" statement.
1705 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
1707 * src/frontends/xforms/forms/README: updated section about make.
1709 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
1710 Tidied some forms up, made two of form_tabular's tabs more
1711 self-consistent, fixed Jean-Marc's size problem in form_preferences,
1712 fixed translation problem with "Column".
1714 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1716 * src/minibuffer.h: use Timeout instead of the xforms timer
1718 (setTimer) rewrite for the Timeout, change to unsigned arg
1719 (set): change to unsigned timer arg
1722 * src/minibuffer.C (TimerCB): removed func
1723 (C_MiniBuffer_TimerCB): removed func
1724 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
1725 (peek_event): use a switch statement
1726 (add): don't use fl_add_timer.
1727 (Set): rewrite to use the Timeout
1730 * src/Timeout.[Ch] (setType): return a Timeout &
1731 (setTimeout): ditto, change to unsigned arg for timeout
1733 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
1735 * src/mathed/formula.C (mathed_string_width): Use string instead
1736 of a constant size char array.
1738 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1740 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
1741 the two recently added operator<< for SMInput and State.
1743 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1745 (OkCancelPolicy): ditto
1746 (OkCancelReadOnlyPolicy): ditto
1747 (NoRepeatedApplyReadOnlyPolicy): ditto
1748 (OkApplyCancelReadOnlyPolicy): ditto
1749 (OkApplyCancelPolicy): ditto
1750 (NoRepeatedApplyPolicy): ditto
1752 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1754 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1755 add the usual std:: qualifiers.
1757 2000-10-25 Juergen Vigna <jug@sad.it>
1759 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1761 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1763 * src/support/filetools.C (MakeRelPath): change some types to
1766 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1767 ButtonPolicy::SMInput and ButtonPolicy::State.
1769 * src/FontLoader.C (reset): small cleanup
1770 (unload): small cleanup
1772 * src/FontInfo.C (getFontname): initialize error to 10000.0
1774 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1776 * src/frontends/xforms/FormPreferences.[Ch]:
1777 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1778 TeX encoding and default paper size sections.
1780 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1782 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1785 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1786 make the message_ empty.
1787 (FormError): don't initialize message_ in initializer list.
1789 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1791 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1793 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1795 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1797 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1799 * src/frontends/kde/*data.[Ch]: _("") is not
1802 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1804 * src/buffer.C: removed redundant using directive.
1806 * src/frontends/DialogBase.h: revert to original definition of
1809 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1810 stuff into two classes, one for each dialog, requires a new
1811 element in the dialogs vector, FormTabularCreate.
1813 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1816 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1817 method. Continues Allan's idea, but means that derived classes
1818 don't need to worry about "update or hide?".
1820 * src/frontends/xforms/FormError.C (showInset): add connection
1823 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1824 one for each dialog. FormTabular now contains main tabular dialog
1827 * src/frontends/xforms/FormTabularCreate.[Ch]:
1828 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1831 * src/frontends/xforms/FormGraphics.[Ch]:
1832 * src/frontends/xforms/forms/form_graphics.fd
1833 * src/frontends/xforms/FormTabular.[Ch]:
1834 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1835 classes of FormInset.
1837 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1838 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1840 * src/frontends/xforms/Makefile.am:
1841 * src/frontends/xforms/forms/makefile: added new files.
1843 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1844 variable. added Signal0 hide signal, in keeping with other GUI-I
1847 * src/support/lstrings.h: removed redundant std:: qualifier as
1848 it's already declared in Lsstream.h.
1850 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1852 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1856 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1858 * src/tabular.C (Ascii): minimize scope of cell.
1860 * src/BufferView2.C (nextWord): return string() instead of 0;
1862 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1864 * src/converter.h: add a std:: qualifier
1866 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1868 * src/importer.[Ch]: New files. Used for importing files into LyX.
1870 * src/lyxfunc.C (doImport): Use the new Importer class.
1872 * src/converter.h: Add shortcut member to the Format class.
1873 Used for holding the menu shortcut.
1875 * src/converter.C and other files: Made a distinction between
1876 format name and format extension. New formats can be defined using
1877 the \format lyxrc tag.
1878 Added two new converter flags: latex and disable.
1880 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1882 * src/support/lyxlib.h: unify namespace/struct implementation.
1883 Remove extra declarations.
1885 * src/support/chdir.C (chdir): remove version taking char const *
1887 * src/support/rename.C: ditto.
1888 * src/support/lyxsum.C: ditto.
1890 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1892 * src/frontends/xforms/FormBase.[Ch]:
1893 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1894 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1895 work only for the next call to fl_show_form(). The correct place to set
1896 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1897 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1898 from FormBase have the minimum size set; no more stupid crashes with
1901 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1903 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1905 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1907 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1909 * src/support/lyxlib.h: changed second argument of mkdir to
1910 unsigned long int (unsigned int would probably have been enough,
1911 but...). Removed <sys/types.h> header.
1912 * src/support/mkdir.C (mkdir): ditto.
1916 2000-10-19 Juergen Vigna <jug@sad.it>
1918 * src/lyxfunc.C (MenuNew): small fix (form John)
1920 * src/screen.C (Update): removed unneeded code.
1922 * src/tabular.C (Ascii): refixed int != uint bug!
1924 * src/support/lyxlib.h: added sys/types.h include for now permits
1925 compiling, but I don't like this!
1927 2000-10-18 Juergen Vigna <jug@sad.it>
1929 * src/text2.C (ClearSelection): if we clear the selection we need
1930 more refresh so set the status apropriately
1932 * src/insets/insettext.C (draw): hopefully finally fixed draw
1935 2000-10-12 Juergen Vigna <jug@sad.it>
1937 * src/insets/insettext.C (draw): another small fix and make a block
1938 so that variables are localized.
1940 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1942 * src/support/lstrings.C (lowercase, uppercase):
1943 use explicit casts to remove compiler warnings.
1945 * src/support/LRegex.C (Impl):
1946 * src/support/StrPool.C (add):
1947 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1948 (AddPath, MakeDisplayPath):
1949 * src/support/lstrings.C (prefixIs, subst):
1950 use correct type to remove compiler warnings.
1952 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1954 * src/support/lyxlib.h:
1955 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1956 portability and to remove compiler warning with DEC cxx.
1958 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1960 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1962 * src/minibuffer.C (peek_event): retun 1 when there has been a
1963 mouseclick in the minibuffer.
1967 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1969 * src/frontends/xforms/FormParagraph.C: more space above/below
1972 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1974 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1975 a char only if real_current_font was changed.
1977 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1979 * NEWS: update somewhat for 1.1.6
1981 * lib/ui/default.ui: clean up.
1983 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1985 * lib/CREDITS: clean up
1987 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1989 * src/combox.[Ch] (select): changed argument back to int
1990 * src/combox.C (peek_event): removed num_bytes as it is declared but
1993 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1994 modified calls to Combox::select() to remove warnings about type
1997 * src/insets/insetbutton.C (width): explicit cast to remove warning
1998 about type conversion.
2000 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
2003 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
2004 sel_pos_end, refering to cursor position are changed to
2005 LyXParagraph::size_type.
2007 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
2008 consistent with LyXCursor::pos().
2009 (inset_pos): changed to LyXParagraph::size_type for same reason.
2011 * src/insets/insettext.C (resizeLyXText): changed some temporary
2012 variables refing to cursor position to LyXParagraph::size_type.
2014 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
2016 * src/frontends/kde/<various>: The Great Renaming,
2019 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2021 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
2023 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2025 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
2026 0 when there are no arguments.
2028 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2030 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
2031 to segfaults when pressing Ok in InsetBibtex dialog.
2033 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
2035 * forms/layout_forms.fd:
2036 * src/layout_forms.C (create_form_form_character): small change to use
2037 labelframe rather than engraved frame + text
2039 * src/lyx_gui.C (create_forms): initialise choice_language with some
2040 arbitrary value to prevent segfault when dialog is shown.
2042 2000-10-16 Baruch Even <baruch.even@writeme.com>
2044 * src/converter.C (runLaTeX, scanLog): Added a warning when there
2045 is no resulting file. This pertains only to LaTeX output.
2047 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
2049 * src/text.C (Backspace): Make sure that the row of the cursor is
2052 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
2055 * src/lyx_gui.C (init): Prevent a crash when only one font from
2056 menu/popup fonts is not found.
2058 * lib/lyxrc.example: Add an example for binding a key for language
2061 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
2063 * src/converter.C (GetReachable): Changed the returned type to
2065 (IsReachable): New method
2067 * src/MenuBackend.C (expand): Handle formats that appear more
2070 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2072 * src/frontends/support/Makefile.am
2073 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
2076 * lib/CREDITS: add Garst Reese.
2078 * src/support/snprintf.h: add extern "C" {} around the definitions.
2080 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
2082 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2085 * src/frontends/xforms/FormDocument.C:
2086 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
2087 compile without "conversion to integral type of smaller size"
2090 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2092 * src/text.C (GetColumnNearX): Fixed disabled code.
2094 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2096 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
2099 * src/support/snprintf.[ch]: new files
2101 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2103 * src/frontends/kde/formprintdialog.C: add
2104 file browser for selecting postscript output
2106 * src/frontends/kde/formprintdialogdata.C:
2107 * src/frontends/kde/formprintdialogdata.h: re-generate
2110 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
2112 * src/frontends/gnome/Makefile.am:
2113 * src/frontends/kde/Makefile.am: FormCommand.C
2114 disappeared from xforms
2116 * src/frontends/kde/FormCitation.C:
2117 * src/frontends/kde/FormIndex.C: read-only
2120 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2122 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
2125 * src/bufferlist.C: add using directive.
2127 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
2129 * src/support/lyxfunctional.h: version of class_fun for void
2130 returns added, const versions of back_inseter_fun and compare_fun
2133 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
2135 * src/frontends/xforms/FormInset.C (showInset): fix typo.
2137 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2139 * ChangeLog: cleanup.
2141 * lib/CREDITS: update to add all the contributors we've forgotten.
2142 I have obviously missed some, so tell me whether there were
2145 2000-10-13 Marko Vendelin <markov@ioc.ee>
2147 * src/frontends/gnome/FormCitation.C
2148 * src/frontends/gnome/FormCitation.h
2149 * src/frontends/gnome/FormError.C
2150 * src/frontends/gnome/FormIndex.C
2151 * src/frontends/gnome/FormRef.C
2152 * src/frontends/gnome/FormRef.h
2153 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
2155 * src/frontends/gnome/FormCitation.C
2156 * src/frontends/gnome/FormCopyright.C
2157 * src/frontends/gnome/FormError.C
2158 * src/frontends/gnome/FormIndex.C
2159 * src/frontends/gnome/FormRef.C
2160 * src/frontends/gnome/FormToc.C
2161 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
2164 * src/frontends/gnome/Menubar_pimpl.C
2165 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
2168 2000-10-11 Baruch Even <baruch.even@writeme.com>
2171 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
2172 to convey its real action.
2174 * src/minibuffer.C (peek_event): Added action when mouse clicks to
2175 clear the minibuffer and prepare to enter a command.
2177 * src/mathed/formula.C (LocalDispatch): Changed to conform with
2178 the rename from ExecCommand to PrepareForCommand.
2179 * src/lyxfunc.C (Dispatch): ditto.
2181 2000-10-11 Baruch Even <baruch.even@writeme.com>
2183 * src/buffer.C (writeFile): Added test for errors on writing, this
2184 catches all errors and not only file system full errors as intended.
2186 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
2188 * src/lyx_gui.C (create_forms): better fix for crash with
2189 translated interface.
2191 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
2193 * src/frontends/kde/Makefile.am:
2194 * src/frontends/kde/FormCopyright.C:
2195 * src/frontends/kde/formcopyrightdialog.C:
2196 * src/frontends/kde/formcopyrightdialog.h:
2197 * src/frontends/kde/formcopyrightdialogdata.C:
2198 * src/frontends/kde/formcopyrightdialogdata.h:
2199 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
2200 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
2201 copyright to use qtarch
2203 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
2205 * src/encoding.C (read): Fixed bug that caused an error message at
2206 the end of the file.
2208 * po/Makefile.in.in: Fixed rule for ext_l10n.h
2210 * lib/lyxrc.example: Fixed hebrew example.
2212 2000-10-13 Allan Rae <rae@lyx.org>
2214 * src/frontends/xforms/FormPreferences.C (input): reworking the
2216 (build, update, apply): New inputs in various tabfolders
2218 * src/frontends/xforms/FormToc.C: use new button policy.
2219 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
2220 dialogs that either can't use any existing policy or where it just
2223 * src/frontends/xforms/FormTabular.h: removed copyright notice that
2226 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
2227 added a bool parameter which is ignored.
2229 * src/buffer.C (setReadonly):
2230 * src/BufferView_pimpl.C (buffer):
2231 * src/frontends/kde/FormCopyright.h (update):
2232 * src/frontends/kde/FormCitation.[Ch] (update):
2233 * src/frontends/kde/FormIndex.[Ch] (update):
2234 * src/frontends/kde/FormPrint.[Ch] (update):
2235 * src/frontends/kde/FormRef.[Ch] (update):
2236 * src/frontends/kde/FormToc.[Ch] (update):
2237 * src/frontends/kde/FormUrl.[Ch] (update):
2238 * src/frontends/gnome/FormCopyright.h (update):
2239 * src/frontends/gnome/FormCitation.[Ch] (update):
2240 * src/frontends/gnome/FormError.[Ch] (update):
2241 * src/frontends/gnome/FormIndex.[Ch] (update):
2242 * src/frontends/gnome/FormPrint.[Ch] (update):
2243 * src/frontends/gnome/FormRef.h (update):
2244 * src/frontends/gnome/FormToc.[Ch] (update):
2245 * src/frontends/gnome/FormUrl.[Ch] (update):
2246 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
2247 to updateBufferDependent and DialogBase
2249 * src/frontends/xforms/FormCitation.[hC]:
2250 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
2251 * src/frontends/xforms/FormError.[Ch]:
2252 * src/frontends/xforms/FormGraphics.[Ch]:
2253 * src/frontends/xforms/FormIndex.[Ch]:
2254 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
2255 and fixed readOnly handling.
2256 * src/frontends/xforms/FormPrint.[Ch]:
2257 * src/frontends/xforms/FormRef.[Ch]:
2258 * src/frontends/xforms/FormTabular.[Ch]:
2259 * src/frontends/xforms/FormToc.[Ch]:
2260 * src/frontends/xforms/FormUrl.[Ch]:
2261 * src/frontends/xforms/FormInset.[Ch]:
2262 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
2263 form of updateBufferDependent.
2265 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
2266 if form()->visible just in case someone does stuff to the form in a
2269 * src/frontends/DialogBase.h (enum): removed enum since we can now use
2270 the buttoncontroller for everything the enum used to be used for.
2271 (update) It would seem we need to force all dialogs to use a bool
2272 parameter or have two update functions. I chose to go with one.
2273 I did try removing update() from here and FormBase and defining the
2274 appropriate update signatures in FormBaseB[DI] but then ran into the
2275 problem of the update() call in FormBase::show(). Whatever I did
2276 to get around that would require another function and that just
2277 got more confusing. Hence the decision to make everyone have an
2278 update(bool). An alternative might have been to override show() in
2279 FormBaseB[DI] and that would allow the different and appropriate
2282 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
2283 true == buffer change occurred. I decided against using a default
2284 template parameter since not all compilers support that at present.
2286 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
2288 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
2289 army knife" by removing functionality.
2290 (clearStore): removed. All such housekeeping on hide()ing the dialog
2291 is to be carried out by overloaded disconnect() methods.
2292 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
2293 superceded by Baruch's neat test (FormGraphics) to update an existing
2294 dialog if a new signal is recieved rather than block all new signals
2296 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
2297 only to Inset dialogs.
2298 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
2299 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
2301 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
2303 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
2304 as a base class to all inset dialogs. Used solely to connect/disconnect
2305 the Inset::hide signal and to define what action to take on receipt of
2306 a UpdateBufferDependent signal.
2307 (FormCommand): now derived from FormInset.
2309 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
2312 * src/frontends/xforms/FormCopyright.[Ch]:
2313 * src/frontends/xforms/FormPreferences.[Ch]:
2314 now derived from FormBaseBI.
2316 * src/frontends/xforms/FormDocument.[Ch]:
2317 * src/frontends/xforms/FormParagraph.[Ch]:
2318 * src/frontends/xforms/FormPrint.[Ch]:
2319 now derived from FormBaseBD.
2321 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
2323 * src/frontends/xforms/FormCitation.[Ch]:
2324 * src/frontends/xforms/FormError.[Ch]:
2325 * src/frontends/xforms/FormRef.[Ch]:
2326 * src/frontends/xforms/FormToc.[Ch]:
2327 (clearStore): reworked as disconnect().
2329 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
2332 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2334 * src/converter.C (runLaTeX): constify buffer argument
2337 * src/frontends/support/Makefile.am (INCLUDES): fix.
2339 * src/buffer.h: add std:: qualifier
2340 * src/insets/figinset.C (addpidwait): ditto
2341 * src/MenuBackend.C: ditto
2342 * src/buffer.C: ditto
2343 * src/bufferlist.C: ditto
2344 * src/layout.C: ditto
2345 * src/lyxfunc.C: ditto
2347 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2349 * src/lyxtext.h (bidi_level): change return type to
2350 LyXParagraph::size_type.
2352 * src/lyxparagraph.h: change size_type to
2353 TextContainer::difference_type. This should really be
2354 TextContainer::size_type, but we need currently to support signed
2357 2000-10-11 Marko Vendelin <markov@ioc.ee>
2358 * src/frontends/gnome/FormError.h
2359 * src/frontends/gnome/FormRef.C
2360 * src/frontends/gnome/FormRef.h
2361 * src/frontends/gnome/FormError.C
2362 * src/frontends/gnome/Makefile.am
2363 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
2364 to Gnome frontend. Both dialogs use "action" area.
2366 2000-10-12 Baruch Even <baruch.even@writeme.com>
2368 * src/graphics/GraphicsCacheItem_pimpl.C:
2369 * src/graphics/Renderer.C:
2370 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
2373 2000-10-12 Juergen Vigna <jug@sad.it>
2375 * src/insets/insettext.C (draw): fixed drawing bug (specifically
2376 visible when selecting).
2378 * development/Code_rules/Rules: fixed some typos.
2380 2000-10-09 Baruch Even <baruch.even@writeme.com>
2382 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
2383 compiling on egcs 1.1.2 possible.
2385 * src/filedlg.C (comp_direntry::operator() ): ditto.
2387 2000-08-31 Baruch Even <baruch.even@writeme.com>
2389 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
2392 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
2393 transient it now only gets freed when the object is destructed.
2395 2000-08-24 Baruch Even <baruch.even@writeme.com>
2397 * src/frontends/FormGraphics.h:
2398 * src/frontends/FormGraphics.C: Changed to use ButtonController and
2401 2000-08-20 Baruch Even <baruch.even@writeme.com>
2403 * src/insets/insetgraphics.C:
2404 (draw): Added messages to the drawn rectangle to report status.
2405 (updateInset): Disabled the use of the inline graphics,
2408 2000-08-17 Baruch Even <baruch.even@writeme.com>
2410 * src/frontends/support: Directory added for the support of GUII LyX.
2412 * src/frontends/support/LyXImage.h:
2413 * src/frontends/support/LyXImage.C: Base class for GUII holding of
2416 * src/frontends/support/LyXImage_X.h:
2417 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
2418 version of LyXImage, this uses the Xlib Pixmap.
2420 * src/PainterBase.h:
2421 * src/PainterBase.C:
2423 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
2424 replacement to Pixmap.
2426 * src/insets/insetgraphics.h:
2427 * src/insets/insetgraphics.C:
2428 * src/graphics/GraphicsCacheItem.h:
2429 * src/graphics/GraphicsCacheItem.C:
2430 * src/graphics/GraphicsCacheItem_pimpl.h:
2431 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
2434 * src/graphics/GraphicsCacheItem.h:
2435 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
2436 another copy of the object.
2438 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
2439 of cacheHandle, this fixed a bug that sent LyX crashing.
2441 * src/graphics/XPM_Renderer.h:
2442 * src/graphics/XPM_Renderer.C:
2443 * src/graphics/EPS_Renderer.h:
2444 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
2446 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2448 * src/lyxfunc.C (processKeySym): only handle the
2449 lockinginset/inset stuff if we have a buffer and text loaded...
2451 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
2453 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2455 * src/support/lyxfunctional.h: add operator= that takes a reference
2457 * src/lyxserver.C (mkfifo): make first arg const
2459 * src/layout.h: renamed name(...) to setName(...) to work around
2462 * src/buffer.C (setFileName): had to change name of function to
2463 work around bugs in egcs. (renamed from fileName)
2465 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
2467 * src/support/translator.h: move helper template classes to
2468 lyxfunctional.h, include "support/lyxfunctional.h"
2470 * src/support/lyxmanip.h: add delaration of fmt
2472 * src/support/lyxfunctional.h: new file
2473 (class_fun_t): new template class
2474 (class_fun): helper template function
2475 (back_insert_fun_iterator): new template class
2476 (back_inserter_fun): helper template function
2477 (compare_memfun_t): new template class
2478 (compare_memfun): helper template function
2479 (equal_1st_in_pair): moved here from translator
2480 (equal_2nd_in_pair): moved here from translator
2482 * src/support/fmt.C: new file
2483 (fmt): new func, can be used for a printf substitute when still
2484 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
2486 * src/support/StrPool.C: add some comments
2488 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
2491 * src/insets/figinset.C (addpidwait): use std::copy with
2492 ostream_iterator to fill the pidwaitlist
2494 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
2496 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
2499 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
2502 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
2504 * src/frontends/xforms/FormDocument.C (build): remove c_str()
2505 (class_update): ditto
2506 (BulletPanel): ditto
2507 (CheckChoiceClass): move initialization of tc and tct
2509 * src/tabular.C: remove current_view
2510 (OldFormatRead): similar to right below [istream::ignore]
2512 * src/lyxlex_pimpl.C (next): add code for faster skipping of
2513 chars, unfortunately this is buggy on gcc 2.95.2, so currently
2514 unused [istream::ignore]
2516 * src/lyxfunc.C: include "support/lyxfunctional.h"
2517 (getInsetByCode): use std::find_if and compare_memfun
2519 * src/lyxfont.C (stateText): remove c_str()
2521 * src/lyx_main.C (setDebuggingLevel): make static
2522 (commandLineHelp): make static
2524 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
2525 Screen* together with fl_get_display() and fl_screen
2527 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
2528 togheter with fl_get_display() and fl_screen
2529 (create_forms): remove c_str()
2531 * src/layout.C: include "support/lyxfunctional.h"
2532 (hasLayout): use std::find_if and compare_memfun
2533 (GetLayout): use std::find_if and comapre_memfun
2534 (delete_layout): use std::remove_if and compare_memfun
2535 (NumberOfClass): use std:.find_if and compare_memfun
2537 * src/gettext.h: change for the new functions
2539 * src/gettext.C: new file, make _(char const * str) and _(string
2540 const & str) real functions.
2542 * src/font.C (width): rewrite slightly to avoid one extra variable
2544 * src/debug.C: initialize Debug::ANY here
2546 * src/commandtags.h: update number comments
2548 * src/combox.h (get): make const func
2550 (getline): make const
2552 * src/combox.C (input_cb): handle case where fl_get_input can
2555 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
2556 "support/lyxfunctional.h", remove current_view variable.
2557 (resize): use std::for_each with std::mem_fun
2558 (getFileNames): use std::copy with back_inserter_fun
2559 (getBuffer): change arg type to unsigned int
2560 (emergencyWriteAll): call emergencyWrite with std::for_each and
2562 (emergencyWrite): new method, the for loop in emergencyWriteAll
2564 (exists): use std::find_if with compare_memfun
2565 (getBuffer): use std::find_if and compare_memfun
2567 * src/buffer.h: add typedefs for iterator_category, value_type
2568 difference_type, pointer and reference for inset_iterator
2569 add postfix ++ for inset_iterator
2570 make inset_iterator::getPos() const
2572 * src/buffer.C: added support/lyxmanip.h
2573 (readFile): use lyxerr << fmt instead of printf
2574 (makeLaTeXFile): use std::copy to write out encodings
2576 * src/Painter.C (text): rewrite slightly to avoid extra font variable
2578 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
2579 free and the char * temp.
2580 (hasMenu): use std::find_if and compare_memfun
2583 * src/Makefile.am (lyx_SOURCES): added gettext.C
2585 * src/LyXAction.C (retrieveActionArg): clear the arg, use
2586 string::insert small change to avoid temporary
2588 * src/LColor.C (getGUIName): remove c_str()
2590 * several files: change all occurrences of fl_display to
2593 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
2594 that -pedantic is not used for gcc 2.97 (cvs gcc)
2596 * boost/Makefile.am: begin slowly to prepare for a real boost lib
2598 2000-10-11 Allan Rae <rae@lyx.org>
2600 * src/frontends/xforms/FormPreferences.C (input): template path must be
2601 a readable directory. It doesn't need to be writeable.
2602 (build, delete, update, apply): New inputs in the various tabfolders
2604 * src/frontends/xforms/forms/form_preferences.fd:
2605 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
2606 several new entries to existing folders. Shuffled some existing stuff
2609 * src/frontends/xforms/forms/form_print.fd:
2610 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
2611 Should probably rework PrinterParams as well. Note that the switch to
2612 collated is effectively the same as !unsorted so changing PrinterParams
2613 will require a lot of fiddly changes to reverse the existing logic.
2615 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
2617 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2619 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
2621 2000-10-10 Allan Rae <rae@lyx.org>
2624 * src/lyxfunc.C (Dispatch):
2626 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
2629 * src/lyxrc.C (output): Only write the differences between system lyxrc
2630 and the users settings.
2633 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
2635 I'll rewrite this later, after 1.1.6 probably, to keep a single
2636 LyXRC but two instances of a LyXRCStruct.
2638 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2640 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
2642 * src/tabular.h: add a few std:: qualifiers.
2644 * src/encoding.C: add using directive.
2645 * src/language.C: ditto.
2647 * src/insets/insetquotes.C (Validate): use languages->lang()
2648 instead of only language.
2650 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
2652 * lib/languages: New file.
2654 * lib/encodings: New file.
2656 * src/language.C (Languages): New class.
2657 (read): New method. Reads the languages from the 'languages' file.
2659 * src/encoding.C (Encodings): New class.
2660 (read): New method. Reads the encodings from the 'encodings' file.
2662 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
2665 * src/bufferparams.h and a lot of files: Deleted the member language,
2666 and renamed language_info to language
2668 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
2669 * src/lyxfont.C (latexWriteStartChanges): ditto.
2670 * src/paragraph.C (validate,TeXOnePar): ditto.
2672 * src/lyxfont.C (update): Restored deleted code.
2674 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
2676 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
2678 * src/BufferView_pimpl.C (buffer): cleaned up a little.
2680 * src/insets/figinset.[Ch]:
2681 * src/insets/insetinclude.[Ch]:
2682 * src/insets/insetinclude.[Ch]:
2683 * src/insets/insetparent.[Ch]:
2684 * src/insets/insetref.[Ch]:
2685 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
2687 * src/insets/*.[Ch]:
2688 * src/mathed/formula.[Ch]:
2689 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
2691 * src/buffer.C (parseSingleLyXformat2Token, readInset):
2692 * src/lyx_cb.C (FigureApplyCB):
2693 * src/lyxfunc.C (getStatus, Dispatch):
2694 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
2697 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
2699 * src/converter.[Ch] (Formats::View):
2700 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
2702 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
2703 *current_view->buffer(). This will change later, but this patch is way
2706 2000-10-09 Juergen Vigna <jug@sad.it>
2708 * src/text.C (GetRow): small fix.
2710 * src/BufferView_pimpl.C (cursorPrevious):
2711 (cursorNext): added LyXText parameter to function.
2713 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
2714 keypress depending on cursor position.
2716 2000-10-06 Juergen Vigna <jug@sad.it>
2718 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
2719 (copySelection): redone this function and also copy ascii representa-
2722 * src/tabular.C (Ascii):
2726 (print_n_chars): new functions to realize the ascii export of tabulars.
2728 2000-10-05 Juergen Vigna <jug@sad.it>
2730 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
2731 if we don't have a buffer.
2733 2000-10-10 Allan Rae <rae@lyx.org>
2735 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
2736 with closing dialog. It seems that nested tabfolders require hiding
2737 of inner tabfolders before hiding the dialog itself. Actually all I
2738 did was hide the active outer folder.
2740 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
2741 unless there really is a buffer. hideBufferDependent is called
2744 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2745 POTFILES.in stays in $(srcdir).
2747 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2749 * lib/lyxrc.example: Few changes.
2751 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2753 * src/BufferView_pimpl.C (buffer): only need one the
2754 updateBufferDependent signal to be emitted once! Moved to the end of
2755 the method to allow bv_->text to be updated first.
2757 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2758 and hSignal_ with Dialogs * and BufferDependency variables.
2759 New Buffer * parent_, initialised when the dialog is launched. Used to
2760 check whether to update() or hide() dialog in the new, private
2761 updateOrHide() method that is connected to the updateBufferDependent
2762 signal. Daughter classes dictate what to do using the
2763 ChangedBufferAction enum, passed to the c-tor.
2765 * src/frontends/xforms/FormCitation.C:
2766 * src/frontends/xforms/FormCommand.C:
2767 * src/frontends/xforms/FormCopyright.C:
2768 * src/frontends/xforms/FormDocument.C:
2769 * src/frontends/xforms/FormError.C:
2770 * src/frontends/xforms/FormIndex.C:
2771 * src/frontends/xforms/FormPreferences.C:
2772 * src/frontends/xforms/FormPrint.C:
2773 * src/frontends/xforms/FormRef.C:
2774 * src/frontends/xforms/FormToc.C:
2775 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2778 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2779 ChangedBufferAction enum.
2781 * src/frontends/xforms/FormParagraph.[Ch]
2782 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2785 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2787 * lib/bind/cua.bind: fix a bit.
2788 * lib/bind/emacs.bind: ditto.
2790 * lib/bind/menus.bind: remove real menu entries from there.
2792 * src/spellchecker.C: make sure we only include strings.h when
2795 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2797 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2798 function. It enlarges the maximum number of pup when needed.
2799 (add_toc2): Open a new menu if maximum number of items per menu has
2802 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2804 * src/frontends/kde/FormPrint.C: fix error reporting
2806 * src/frontends/xforms/FormDocument.C: fix compiler
2809 * lib/.cvsignore: add Literate.nw
2811 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2814 * bufferview_funcs.[Ch]
2817 * text2.C: Add support for numbers in RTL text.
2819 2000-10-06 Allan Rae <rae@lyx.org>
2821 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2822 to be gettext.m4 friendly again. ext_l10n.h is now
2823 generated into $top_srcdir instead of $top_builddir
2824 so that lyx.pot will be built correctly -- without
2825 duplicate parsing of ext_l10n.h.
2827 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2829 * src/frontends/kde/FormCitation.C: make the dialog
2830 behave more sensibly
2832 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2834 * config/kde.m4: fix consecutive ./configure runs,
2835 look for qtarch, fix library order
2837 * src/frontends/kde/Makefile.am: tidy up,
2838 add Print dialog, add .dlg dependencies
2840 * src/frontends/kde/FormPrint.C:
2841 * src/frontends/kde/FormPrint.h:
2842 * src/frontends/kde/formprintdialog.C:
2843 * src/frontends/kde/formprintdialog.h:
2844 * src/frontends/kde/formprintdialogdata.C:
2845 * src/frontends/kde/formprintdialogdata.h:
2846 * src/frontends/kde/dlg/formprintdialog.dlg: add
2849 * src/frontends/kde/dlg/README: Added explanatory readme
2851 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2852 script to double-check qtarch's output
2854 * src/frontends/kde/formindexdialog.C:
2855 * src/frontends/kde/formindexdialogdata.C:
2856 * src/frontends/kde/formindexdialogdata.h:
2857 * src/frontends/kde/dlg/formindexdialog.dlg: update
2858 for qtarch, minor fixes
2860 2000-10-05 Allan Rae <rae@lyx.org>
2862 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2863 dialogs when switching buffers update them instead. It's up to each
2864 dialog to decide if it should still be visible or not.
2865 update() should return a bool to control visiblity within show().
2866 Or perhaps better to set a member variable and use that to control
2869 * lib/build-listerrors: create an empty "listerrors" file just to stop
2870 make trying to regenerate it all the time if you don't have noweb
2873 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2875 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2876 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2877 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2878 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2879 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2881 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2883 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2885 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2886 deleting buffer. Closes all buffer-dependent dialogs.
2888 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2890 * src/frontends/xforms/FormCitation.[Ch]:
2891 * src/frontends/xforms/FormPreferences.[Ch]:
2892 * src/frontends/xforms/FormPrint.[Ch]:
2893 * src/frontends/xforms/FormRef.[Ch]:
2894 * src/frontends/xforms/FormUrl.[Ch]: ditto
2896 * src/frontends/xforms/FormDocument.[Ch]:
2897 * src/frontends/xforms/forms/form_document.C.patch:
2898 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2899 pass through a single input() function.
2901 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2903 * lib/build-listerrors: return status as OK
2905 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2907 * lib/lyxrc.example: Updated to new export code
2909 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2911 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2914 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2917 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2918 LyX-Code is defined.
2919 * lib/layouts/amsbook.layout: ditto.
2921 * boost/Makefile.am: fix typo.
2923 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2925 (add_lastfiles): removed.
2926 (add_documents): removed.
2927 (add_formats): removed.
2929 * src/frontends/Menubar.C: remove useless "using" directive.
2931 * src/MenuBackend.h: add a new MenuItem constructor.
2933 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2936 2000-10-04 Allan Rae <rae@lyx.org>
2938 * lib/Makefile.am (listerrors):
2939 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2940 I haven't got notangle installed so Kayvan please test. The output
2941 should end up in $builddir. This also allows people who don't have
2942 noweb installed to complete the make process without error.
2944 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2945 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2946 by JMarc's picky compiler.
2948 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2951 * src/insets/insettabular.C (setPos): change for loop to not use
2952 sequencing operator. Please check this Jürgen.
2954 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2956 * src/insets/insetcite.C (getScreenLabel): ditto
2957 * src/support/filetools.C (QuoteName): ditto
2958 (ChangeExtension): ditto
2960 * src/BufferView_pimpl.C (scrollCB): make heigt int
2962 * src/BufferView2.C (insertInset): comment out unused arg
2964 * boost/Makefile.am (EXTRADIST): new variable
2966 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2968 * src/exporter.C (IsExportable): Fixed
2970 * lib/configure.m4: Small fix
2972 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2974 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2975 * src/insets/insetbib.C (bibitemWidest): ditto.
2976 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2978 2000-10-03 Juergen Vigna <jug@sad.it>
2980 * src/BufferView2.C (theLockingInset): removed const because of
2981 Agnus's compile problems.
2983 * src/insets/insettext.C (LocalDispatch): set the language of the
2984 surronding paragraph on inserting the first character.
2986 * various files: changed use of BufferView::the_locking_inset.
2988 * src/BufferView2.C (theLockingInset):
2989 (theLockingInset): new functions.
2991 * src/BufferView.h: removed the_locking_inset.
2993 * src/lyxtext.h: added the_locking_inset
2995 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2997 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2999 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3001 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
3002 * src/mathed/math_cursor.C (IsAlpha): ditto.
3003 * src/mathed/math_inset.C (strnew): ditto.
3004 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
3005 (IMetrics): cxp set but never used; removed.
3006 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
3007 that the variable in question has been removed also!
3010 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
3011 using the Buffer * passed to Latex(), using the BufferView * passed to
3012 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
3014 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
3015 Linuxdoc() and DocBook() rather than the stored Buffer * master.
3017 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
3018 * src/buffer.C (readInset): used new InsetBibtex c-tor
3019 * (getBibkeyList): used new InsetBibtex::getKeys
3021 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3024 * lib/build-listerrors
3026 * src/exporter.C: Add literate programming support to the export code
3029 * src/lyx_cb.C: Remove old literate code.
3031 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
3034 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
3035 * src/converter.C (View, Convert): Use QuoteName.
3037 * src/insets/figinset.C (Preview): Use Formats::View.
3039 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
3041 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3043 * src/lyxfunc.C (Dispatch): move declaration of text variable at
3044 the top of the function, because compaq cxx complains that the
3045 "goto exit_with_message" when the function is disabled bypasses
3047 (MenuNew): try a better fix for the generation of new file names.
3048 This time, I used AddName() instead of AddPath(), hoping Juergen
3051 2000-10-03 Allan Rae <rae@lyx.org>
3053 * src/frontends/xforms/forms/form_preferences.fd:
3054 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
3055 nested tabfolders has begun. The old "Miscellaneous" was renamed as
3056 "Look and Feel"->"General" but will need to be split up further into
3057 general output and general input tabs. Current plan is for four outer
3058 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
3059 stuff; "Inputs" for input and import configuration; "Outputs" for
3060 output and export configuration; and one more whatever is left over
3061 called "General". The leftovers at present look like being which
3062 viewers to use, spellchecker, language support and might be better
3063 named "Support". I've put "Paths" in "Inputs" for the moment as this
3064 seems reasonable for now at least.
3065 One problem remains: X error kills LyX when you close Preferences.
3067 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
3069 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
3070 qualifier from form()
3071 * src/frontends/xforms/FormCitation.[Ch]:
3072 * src/frontends/xforms/FormCopyright.[Ch]:
3073 * src/frontends/xforms/FormDocument.[Ch]:
3074 * src/frontends/xforms/FormError.[Ch]:
3075 * src/frontends/xforms/FormIndex.[Ch]:
3076 * src/frontends/xforms/FormPreferences.[Ch]:
3077 * src/frontends/xforms/FormPrint.[Ch]:
3078 * src/frontends/xforms/FormRef.[Ch]:
3079 * src/frontends/xforms/FormToc.[Ch]:
3080 * src/frontends/xforms/FormUrl.[Ch]: ditto.
3082 * src/frontends/xforms/FormCitation.[Ch]:
3083 * src/frontends/xforms/FormIndex.[Ch]:
3084 * src/frontends/xforms/FormRef.[Ch]:
3085 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
3086 with Allan's naming policy
3088 * src/frontends/xforms/FormCitation.C: some static casts to remove
3091 2000-10-02 Juergen Vigna <jug@sad.it>
3093 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
3094 now you can type or do stuff inside the table-cell also when in dummy
3095 position, fixed visible cursor.
3097 * src/insets/insettext.C (Edit): fixing cursor-view position.
3099 * src/lyxfunc.C (Dispatch): use * text variable so that it can
3100 be used for equal functions in lyxfunc and insettext.
3102 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
3104 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
3106 * src/frontends/gnome/FormCitation.h:
3107 * src/frontends/gnome/FormCopyright.h:
3108 * src/frontends/gnome/FormIndex.h:
3109 * src/frontends/gnome/FormPrint.h:
3110 * src/frontends/gnome/FormToc.h:
3111 * src/frontends/gnome/FormUrl.h:
3112 * src/frontends/kde/FormCitation.h:
3113 * src/frontends/kde/FormCopyright.h:
3114 * src/frontends/kde/FormIndex.h:
3115 * src/frontends/kde/FormRef.h:
3116 * src/frontends/kde/FormToc.h:
3117 * src/frontends/kde/FormUrl.h: fix remaining users of
3120 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3122 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
3123 from depth argument.
3124 (DocBookHandleCaption): ditto.
3125 (DocBookHandleFootnote): ditto.
3126 (SimpleDocBookOnePar): ditto.
3128 * src/frontends/xforms/FormDocument.h (form): remove extra
3129 FormDocument:: qualifier.
3131 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
3133 * sigc++/handle.h: ditto.
3135 * src/lyx_gui_misc.C: add "using" directive.
3137 * src/cheaders/cstddef: new file, needed by the boost library (for
3140 2000-10-02 Juergen Vigna <jug@sad.it>
3142 * src/insets/insettext.C (SetFont): better support.
3144 * src/insets/insettabular.C (draw): fixed drawing of single cell.
3146 * src/screen.C (DrawOneRow): some uint refixes!
3148 2000-10-02 Allan Rae <rae@lyx.org>
3150 * boost/.cvsignore: ignore Makefile as well
3152 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
3153 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
3155 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
3156 Left this one out by accident.
3158 * src/frontends/xforms/FormBase.h (restore): default to calling
3159 update() since that will restore the original/currently-applied values.
3160 Any input() triggered error messages will require the derived classes
3161 to redefine restore().
3163 * src/frontends/xforms/FormDocument.C: initialize a few variables to
3164 avoid a segfault. combo_doc_class is the main concern.
3166 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
3168 * Simplify build-listerrors in view of GUI-less export ability!
3170 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3172 * src/lyx_main.C (easyParse): Disable gui when exporting
3174 * src/insets/figinset.C:
3177 * src/lyx_gui_misc.C
3178 * src/tabular.C: Changes to allow no-gui.
3180 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3182 * src/support/utility.hpp: removed file
3183 * src/support/block.h: removed file
3185 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
3188 * src/mathed/formula.C: add support/lyxlib.h
3189 * src/mathed/formulamacro.C: ditto
3191 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
3192 * src/lyxparagraph.h: ditto
3194 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
3195 * src/frontends/Makefile.am (INCLUDES): ditto
3196 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
3197 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
3198 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
3199 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
3200 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
3201 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
3203 * src/BufferView.h: use boost/utility.hpp
3204 * src/LColor.h: ditto
3205 * src/LaTeX.h: ditto
3206 * src/LyXAction.h: ditto
3207 * src/LyXView.h: ditto
3208 * src/bufferlist.h: ditto
3209 * src/lastfiles.h: ditto
3210 * src/layout.h: ditto
3211 * src/lyx_gui.h: ditto
3212 * src/lyx_main.h: ditto
3213 * src/lyxlex.h: ditto
3214 * src/lyxrc.h: ditto
3215 * src/frontends/ButtonPolicies.h: ditto
3216 * src/frontends/Dialogs.h: ditto
3217 * src/frontends/xforms/FormBase.h: ditto
3218 * src/frontends/xforms/FormGraphics.h: ditto
3219 * src/frontends/xforms/FormParagraph.h: ditto
3220 * src/frontends/xforms/FormTabular.h: ditto
3221 * src/graphics/GraphicsCache.h: ditto
3222 * src/graphics/Renderer.h: ditto
3223 * src/insets/ExternalTemplate.h: ditto
3224 * src/insets/insetcommand.h: ditto
3225 * src/support/path.h: ditto
3227 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
3228 and introduce clause for 2.97.
3230 * boost/libs/README: new file
3232 * boost/boost/utility.hpp: new file
3234 * boost/boost/config.hpp: new file
3236 * boost/boost/array.hpp: new file
3238 * boost/Makefile.am: new file
3240 * boost/.cvsignore: new file
3242 * configure.in (AC_OUTPUT): add boost/Makefile
3244 * Makefile.am (SUBDIRS): add boost
3246 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
3248 * src/support/lstrings.C (suffixIs): Fixed.
3250 2000-10-01 Allan Rae <rae@lyx.org>
3252 * src/PrinterParams.h: moved things around to avoid the "can't
3253 inline call" warning.
3255 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
3256 into doc++ documentation.
3258 * src/frontends/xforms/FormCommand.[Ch]: support button policy
3260 * src/frontends/xforms/FormRef.C: make use of button controller
3261 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
3262 cleaned up button controller usage.
3263 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
3264 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
3265 use the button controller
3267 * src/frontends/xforms/forms/*.fd: and associated generated files
3268 updated to reflect changes to FormBase. Some other FormXxxx files
3269 also got minor updates to reflect changes to FormBase.
3271 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
3272 (hide): made virtual.
3273 (input): return a bool. true == valid input
3274 (RestoreCB, restore): new
3275 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
3276 Changes to allow derived dialogs to use a ButtonController and
3277 make sense when doing so: OK button calls ok() and so on.
3279 * src/frontends/xforms/ButtonController.h (class ButtonController):
3280 Switch from template implementation to taking Policy parameter.
3281 Allows FormBase to provide a ButtonController for any dialog.
3283 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
3284 Probably should rename connect and disconnect.
3285 (apply): use the radio button groups
3286 (form): needed by FormBase
3287 (build): setup the radio button groups
3289 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
3291 * several files: type changes to reduce the number of warnings and
3292 to unify type hangling a bit. Still much to do.
3294 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3296 * lib/images/*: rename a bunch of icons to match Dekel converter
3299 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
3302 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
3304 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
3306 * sigc++/handle.h: ditto for class Handle.
3308 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
3310 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
3312 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
3314 * src/intl.C (InitKeyMapper): Correct the value of n due to the
3315 removal of the "default" language.
3317 * src/combox.h (getline): Check that sel > 0
3319 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
3321 * lib/examples/docbook_example.lyx
3322 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
3324 * lib/layouts/docbook-book.layout: new docbook book layout.
3326 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
3328 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
3330 * src/insets/figinset.C (DocBook):fixed small typo.
3332 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
3334 * src/insets/insetinclude.h: string include_label doesn't need to be
3337 2000-09-29 Allan Rae <rae@lyx.org>
3339 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
3340 Allow derived type to control connection and disconnection from signals
3341 of its choice if desired.
3343 2000-09-28 Juergen Vigna <jug@sad.it>
3345 * src/insets/insettabular.C (update): fixed cursor setting when
3346 the_locking_inset changed.
3347 (draw): made this a bit cleaner.
3348 (InsetButtonPress): fixed!
3350 * various files: added LyXText Parameter to fitCursor call.
3352 * src/BufferView.C (fitCursor): added LyXText parameter.
3354 * src/insets/insettabular.C (draw): small draw fix.
3356 * src/tabular.C: right setting of left/right celllines.
3358 * src/tabular.[Ch]: fixed various types in funcions and structures.
3359 * src/insets/insettabular.C: ditto
3360 * src/frontends/xforms/FormTabular.C: ditto
3362 2000-09-28 Allan Rae <rae@lyx.org>
3364 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
3365 that the #ifdef's had been applied to part of what should have been
3366 a complete condition. It's possible there are other tests that
3367 were specific to tables that are also wrong now that InsetTabular is
3368 being used. Now we need to fix the output of '\n' after a table in a
3369 float for the same reason as the original condition:
3370 "don't insert this if we would be adding it before or after a table
3371 in a float. This little trick is needed in order to allow use of
3372 tables in \subfigures or \subtables."
3373 Juergen can you check this?
3375 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3377 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
3378 output to the ostream.
3380 * several files: fixed types based on warnings from cxx
3382 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
3384 * src/frontends/kde/Makefile.am: fix rule for
3385 formindexdialogdata_moc.C
3387 * src/.cvsignore: add ext_l10n.h to ignore
3389 * acconfig.h: stop messing with __STRICT_ANSI__
3390 * config/gnome.m4: remove option to set -ansi
3391 * config/kde.m4: remove option to set -ansi
3392 * config/lyxinclude.m4: don't set -ansi
3394 2000-09-27 Juergen Vigna <jug@sad.it>
3396 * various files: remove "default" language check.
3398 * src/insets/insetquotes.C: removed use of current_view.
3400 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
3401 the one should have red ears by now!
3403 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
3404 in more then one paragraph. Fixed cursor-movement/selection.
3406 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
3407 paragraphs inside a text inset.
3409 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
3410 text-inset if this owner is an inset.
3412 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3414 * src/Bullet.h: changed type of font, character and size to int
3416 * src/buffer.C (asciiParagraph): remove actcell and fname1.
3418 * src/insets/inseturl.[Ch]:
3419 * src/insets/insetref.[Ch]:
3420 * src/insets/insetlabel.[Ch]: add linelen to Ascii
3422 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
3424 * src/buffer.C (readFile): block-if statement rearranged to minimise
3425 bloat. Patch does not reverse Jean-Marc's change ;-)
3427 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
3428 Class rewritten to store pointers to hide/update signals directly,
3429 rather than Dialogs *. Also defined an enum to ease use. All xforms
3430 forms can now be derived from this class.
3432 * src/frontends/xforms/FormCommand.[Ch]
3433 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
3435 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
3438 * src/frontends/xforms/forms/form_citation.fd
3439 * src/frontends/xforms/forms/form_copyright.fd
3440 * src/frontends/xforms/forms/form_error.fd
3441 * src/frontends/xforms/forms/form_index.fd
3442 * src/frontends/xforms/forms/form_ref.fd
3443 * src/frontends/xforms/forms/form_toc.fd
3444 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
3446 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
3448 * src/insets/insetfoot.C: removed redundent using directive.
3450 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3452 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
3453 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
3455 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
3456 created in the constructors in different groups. Then set() just
3457 have to show the groups as needed. This fixes the redraw problems
3458 (and is how the old menu code worked).
3460 * src/support/lyxlib.h: declare the methods as static when we do
3461 not have namespaces.
3463 2000-09-26 Juergen Vigna <jug@sad.it>
3465 * src/buffer.C (asciiParagraph): new function.
3466 (writeFileAscii): new function with parameter ostream.
3467 (writeFileAscii): use now asciiParagraph.
3469 * various inset files: added the linelen parameter to the Ascii-func.
3471 * src/tabular.C (Write): fixed error in writing file introduced by
3472 the last changes from Lars.
3474 * lib/bind/menus.bind: removed not supported functions.
3476 * src/insets/insettext.C (Ascii): implemented this function.
3478 * src/insets/lyxinset.h (Ascii): added linelen parameter.
3480 * src/tabular.C (write_attribute[int,string,bool]): new functions.
3481 (Write): use of the write_attribute functions.
3483 * src/bufferlist.C (close): fixed reasking question!
3485 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3487 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
3488 new files use the everwhere possible.
3491 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
3492 src/log_form.C src/lyx.C:
3495 * src/buffer.C (runLaTeX): remove func
3497 * src/PaperLayout.C: removed file
3498 * src/ParagraphExtra.C: likewise
3499 * src/bullet_forms.C: likewise
3500 * src/bullet_forms.h: likewise
3501 * src/bullet_forms_cb.C: likewise
3503 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
3504 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
3507 * several files: remove all traces of the old fd_form_paragraph,
3508 and functions belonging to that.
3510 * several files: remove all traces of the old fd_form_document,
3511 and functions belonging to that.
3513 * several files: constify local variables were possible.
3515 * several files: remove all code that was dead when NEW_EXPORT was
3518 * several files: removed string::c_str in as many places as
3521 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
3522 (e): be a bit more outspoken when patching
3523 (updatesrc): only move files if changed.
3525 * forms/layout_forms.h.patch: regenerated
3527 * forms/layout_forms.fd: remove form_document and form_paragraph
3528 and form_quotes and form_paper and form_table_options and
3529 form_paragraph_extra
3531 * forms/form1.fd: remove form_table
3533 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
3534 the fdui->... rewrite. Update some comments to xforms 0.88
3536 * forms/bullet_forms.C.patch: removed file
3537 * forms/bullet_forms.fd: likewise
3538 * forms/bullet_forms.h.patch: likewise
3540 * development/Code_rules/Rules: added a section on switch
3541 statements. Updated some comment to xforms 0.88.
3543 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3545 * src/buffer.C (readFile): make sure that the whole version number
3546 is read after \lyxformat (even when it contains a comma)
3548 * lib/ui/default.ui: change shortcut of math menu to M-a.
3550 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3552 * src/vspace.C (nextToken): use isStrDbl() to check for proper
3555 * src/LyXView.C (updateWindowTitle): show the full files name in
3556 window title, limited to 30 characters.
3558 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
3559 When a number of characters has been given, we should not assume
3560 that the string is 0-terminated.
3562 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
3563 calls (fixes some memory leaks)
3565 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
3566 trans member on exit.
3568 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3570 * src/converter.C (GetReachable): fix typo.
3572 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
3573 understand ',' instead of '.'.
3574 (GetInteger): rewrite to use strToInt().
3576 2000-09-26 Juergen Vigna <jug@sad.it>
3578 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
3579 better visibility and error-message on wrong VSpace input.
3581 * src/language.C (initL): added english again.
3583 2000-09-25 Juergen Vigna <jug@sad.it>
3585 * src/frontends/kde/Dialogs.C (Dialogs):
3586 * src/frontends/gnome/Dialogs.C (Dialogs):
3587 * src/frontends/kde/Makefile.am:
3588 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
3590 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
3592 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
3594 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
3596 * src/frontends/xforms/FormParagraph.C:
3597 * src/frontends/xforms/FormParagraph.h:
3598 * src/frontends/xforms/form_paragraph.C:
3599 * src/frontends/xforms/form_paragraph.h:
3600 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
3603 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
3605 * src/tabular.C (OldFormatRead): forgot to delete the temporary
3606 Paragraph-Data after use.
3608 * src/insets/insettext.C (LocalDispatch): don't set the layout on
3609 non breakable paragraphs.
3611 2000-09-25 Garst R. Reese <reese@isn.net>
3613 * src/language.C (initL): added missing language_country codes.
3615 2000-09-25 Juergen Vigna <jug@sad.it>
3617 * src/insets/insettext.C (InsetText):
3618 (deleteLyXText): remove the not released LyXText structure!
3620 2000-09-24 Marko Vendelin <markov@ioc.ee>
3622 * src/frontends/gnome/mainapp.C
3623 * src/frontends/gnome/mainapp.h: added support for keyboard
3626 * src/frontends/gnome/FormCitation.C
3627 * src/frontends/gnome/FormCitation.h
3628 * src/frontends/gnome/Makefile.am
3629 * src/frontends/gnome/pixbutton.h: completed the rewrite of
3630 FormCitation to use "action area" in mainapp window
3632 * src/frontends/gnome/Menubar_pimpl.C
3633 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
3636 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
3638 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
3639 width/descent/ascent values if name is empty.
3640 (mathed_string_height): Use std::max.
3642 2000-09-25 Allan Rae <rae@lyx.org>
3644 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
3645 segfault. This will be completely redesigned soon.
3647 * sigc++: updated libsigc++. Fixes struct timespec bug.
3649 * development/tools/makeLyXsigc.sh: .cvsignore addition
3651 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
3653 * several files: removed almost all traces of the old table
3656 * src/TableLayout.C: removed file
3658 2000-09-22 Juergen Vigna <jug@sad.it>
3660 * src/frontends/kde/Dialogs.C: added credits forms.
3662 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
3664 * src/frontends/gnome/Dialogs.C: added some forms.
3666 * src/spellchecker.C (init_spell_checker): set language in pspell code
3667 (RunSpellChecker): some modifications for setting language string.
3669 * src/language.[Ch]: added language_country code.
3671 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
3673 * src/frontends/Dialogs.h: added new signal showError.
3674 Rearranged existing signals in some sort of alphabetical order.
3676 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
3677 FormError.[Ch], form_error.[Ch]
3678 * src/frontends/xforms/forms/makefile: added new file form_error.fd
3679 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
3681 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
3682 dialogs. I think that this can be used as the base to all these
3685 * src/frontends/xforms/FormError.[Ch]
3686 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
3687 implementation of InsetError dialog.
3689 * src/insets/inseterror.[Ch]: rendered GUI-independent.
3691 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
3692 * src/frontends/kde/Makefile.am: ditto
3694 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
3696 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
3697 macrobf. This fixes a bug of invisible text.
3699 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3701 * lib/doc/LaTeXConfig.lyx.in: updated.
3703 * src/language.C (initL): remove language "francais" and change a
3704 bit the names of the two other french variations.
3706 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
3707 string that may not be 0-terminated.
3709 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3711 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
3713 2000-09-20 Marko Vendelin <markov@ioc.ee>
3715 * src/frontends/gnome/FormCitation.C
3716 * src/frontends/gnome/FormIndex.C
3717 * src/frontends/gnome/FormToc.C
3718 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
3719 the variable initialization to shut up the warnings
3721 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3723 * src/table.[Ch]: deleted files
3725 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
3728 2000-09-18 Juergen Vigna <jug@sad.it>
3730 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
3731 problems with selection. Inserted new LFUN_PASTESELECTION.
3732 (InsetButtonPress): inserted handling of middle mouse-button paste.
3734 * src/spellchecker.C: changed word to word.c_str().
3736 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
3738 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
3739 included in the ``make dist'' tarball.
3741 2000-09-15 Juergen Vigna <jug@sad.it>
3743 * src/CutAndPaste.C (cutSelection): small fix return the right
3744 end position after cut inside one paragraph only.
3746 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3747 we are locked as otherwise we don't have a valid cursor position!
3749 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3751 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3753 * src/frontends/kde/FormRef.C: added using directive.
3754 * src/frontends/kde/FormToc.C: ditto
3756 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3758 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3760 2000-09-19 Marko Vendelin <markov@ioc.ee>
3762 * src/frontends/gnome/Menubar_pimpl.C
3763 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3764 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3766 * src/frontends/gnome/mainapp.C
3767 * src/frontends/gnome/mainapp.h: support for menu update used
3770 * src/frontends/gnome/mainapp.C
3771 * src/frontends/gnome/mainapp.h: support for "action" area in the
3772 main window. This area is used by small simple dialogs, such as
3775 * src/frontends/gnome/FormIndex.C
3776 * src/frontends/gnome/FormIndex.h
3777 * src/frontends/gnome/FormUrl.C
3778 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3781 * src/frontends/gnome/FormCitation.C
3782 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3783 action area. Only "Insert new citation" is implemented.
3785 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3787 * src/buffer.C (Dispatch): fix call to Dispatch
3788 * src/insets/insetref.C (Edit): likewise
3789 * src/insets/insetparent.C (Edit): likewise
3790 * src/insets/insetinclude.C (include_cb): likewise
3791 * src/frontends/xforms/FormUrl.C (apply): likewise
3792 * src/frontends/xforms/FormToc.C (apply): likewise
3793 * src/frontends/xforms/FormRef.C (apply): likewise
3794 * src/frontends/xforms/FormIndex.C (apply): likewise
3795 * src/frontends/xforms/FormCitation.C (apply): likewise
3796 * src/lyxserver.C (callback): likewise
3797 * src/lyxfunc.C (processKeySym): likewise
3798 (Dispatch): likewise
3799 (Dispatch): likewise
3800 * src/lyx_cb.C (LayoutsCB): likewise
3802 * Makefile.am (sourcedoc): small change
3804 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3806 * src/main.C (main): Don't make an empty GUIRunTime object. all
3807 methods are static. constify a bit remove unneded using + headers.
3809 * src/tabular.C: some more const to local vars move some loop vars
3811 * src/spellchecker.C: added some c_str after some word for pspell
3813 * src/frontends/GUIRunTime.h: add new static method setDefaults
3814 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3815 * src/frontends/kde/GUIRunTime.C (setDefaults):
3816 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3818 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3819 with strnew in arg, use correct emptystring when calling SetName.
3821 * several files: remove all commented code with relation to
3822 HAVE_SSTREAM beeing false. We now only support stringstream and
3825 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3827 * src/lyxfunc.C: construct correctly the automatic new file
3830 * src/text2.C (IsStringInText): change type of variable i to shut
3833 * src/support/sstream.h: do not use namespaces if the compiler
3834 does not support them.
3836 2000-09-15 Marko Vendelin <markov@ioc.ee>
3837 * src/frontends/gnome/FormCitation.C
3838 * src/frontends/gnome/FormCitation.h
3839 * src/frontends/gnome/diainsertcitation_interface.c
3840 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3841 regexp support to FormCitation [Gnome].
3843 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3846 * configure.in: remove unused KDE/GTKGUI define
3848 * src/frontends/kde/FormRef.C
3849 * src/frontends/kde/FormRef.h
3850 * src/frontends/kde/formrefdialog.C
3851 * src/frontends/kde/formrefdialog.h: double click will
3852 go to reference, now it is possible to change a cross-ref
3855 * src/frontends/kde/FormToc.C
3856 * src/frontends/kde/FormToc.h
3857 * src/frontends/kde/formtocdialog.C
3858 * src/frontends/kde/formtocdialog.h: add a depth
3861 * src/frontends/kde/Makefile.am: add QtLyXView.h
3864 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3866 * src/frontends/kde/FormCitation.h: added some using directives.
3868 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3870 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3873 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3876 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3878 * src/buffer.C (pop_tag): revert for the second time a change by
3879 Lars, who seems to really hate having non-local loop variables :)
3881 * src/Lsstream.h: add "using" statements.
3883 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3884 * src/buffer.C (writeFile): ditto
3886 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3888 * src/buffer.C (writeFile): try to fix the locale modified format
3889 number to always be as we want it.
3891 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3892 in XForms 0.89. C-space is now working again.
3894 * src/Lsstream.h src/support/sstream.h: new files.
3896 * also commented out all cases where strstream were used.
3898 * src/Bullet.h (c_str): remove method.
3900 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3902 * a lot of files: get rid of "char const *" and "char *" is as
3903 many places as possible. We only want to use them in interaction
3904 with system of other libraries, not inside lyx.
3906 * a lot of files: return const object is not of pod type. This
3907 helps ensure that temporary objects is not modified. And fits well
3908 with "programming by contract".
3910 * configure.in: check for the locale header too
3912 * Makefile.am (sourcedoc): new tag for generation of doc++
3915 2000-09-14 Juergen Vigna <jug@sad.it>
3917 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3918 callback to check which combo called it and do the right action.
3920 * src/combox.C (combo_cb): added combo * to the callbacks.
3921 (Hide): moved call of callback after Ungrab of the pointer.
3923 * src/intl.h: removed LCombo2 function.
3925 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3926 function as this can now be handled in one function.
3928 * src/combox.h: added Combox * to callback prototype.
3930 * src/frontends/xforms/Toolbar_pimpl.C:
3931 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3933 2000-09-14 Garst Reese <reese@isn.net>
3935 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3936 moved usepackage{xxx}'s to beginning of file. Changed left margin
3937 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3938 underlining from title. Thanks to John Culleton for useful suggestions.
3940 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3942 * src/lyxlex_pimpl.C (setFile): change error message to debug
3945 2000-09-13 Juergen Vigna <jug@sad.it>
3947 * src/frontends/xforms/FormDocument.C: implemented choice_class
3948 as combox and give callback to combo_language so OK/Apply is activated
3951 * src/bufferlist.C (newFile): small fix so already named files
3952 (via an open call) are not requested to be named again on the
3955 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3957 * src/frontends/kde/Makefile.am
3958 * src/frontends/kde/FormRef.C
3959 * src/frontends/kde/FormRef.h
3960 * src/frontends/kde/formrefdialog.C
3961 * src/frontends/kde/formrefdialog.h: implement
3964 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3966 * src/frontends/kde/formtocdialog.C
3967 * src/frontends/kde/formtocdialog.h
3968 * src/frontends/kde/FormToc.C
3969 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3971 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3973 * src/frontends/kde/FormCitation.C: fix thinko
3974 where we didn't always display the reference text
3977 * src/frontends/kde/formurldialog.C
3978 * src/frontends/kde/formurldialog.h
3979 * src/frontends/kde/FormUrl.C
3980 * src/frontends/kde/FormUrl.h: minor cleanups
3982 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3984 * src/frontends/kde/Makefile.am
3985 * src/frontends/kde/FormToc.C
3986 * src/frontends/kde/FormToc.h
3987 * src/frontends/kde/FormCitation.C
3988 * src/frontends/kde/FormCitation.h
3989 * src/frontends/kde/FormIndex.C
3990 * src/frontends/kde/FormIndex.h
3991 * src/frontends/kde/formtocdialog.C
3992 * src/frontends/kde/formtocdialog.h
3993 * src/frontends/kde/formcitationdialog.C
3994 * src/frontends/kde/formcitationdialog.h
3995 * src/frontends/kde/formindexdialog.C
3996 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3998 2000-09-12 Juergen Vigna <jug@sad.it>
4000 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
4003 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4005 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
4008 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
4010 * src/converter.C (Add, Convert): Added support for converter flags:
4011 needaux, resultdir, resultfile.
4012 (Convert): Added new parameter view_file.
4013 (dvips_options): Fixed letter paper option.
4015 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
4016 (Export, GetExportableFormats, GetViewableFormats): Added support
4019 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
4021 (easyParse): Fixed to work with new export code.
4023 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
4026 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
4028 * lib/bind/*.bind: Replaced
4029 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
4030 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
4032 2000-09-11 Juergen Vigna <jug@sad.it>
4034 * src/lyx_gui.C (runTime): uses global guiruntime variable.
4036 * src/main.C (main): now GUII defines global guiruntime!
4038 * src/frontends/gnome/GUIRunTime.C (initApplication):
4039 * src/frontends/kde/GUIRunTime.C (initApplication):
4040 * src/frontends/xforms/GUIRunTime.C (initApplication):
4041 * src/frontends/GUIRunTime.h: added new function initApplication.
4043 * src/spellchecker.C (sc_accept_word): change to add_to_session.
4045 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
4047 2000-09-08 Juergen Vigna <jug@sad.it>
4049 * src/lyx_gui.C (create_forms): don't display the "default" entry as
4050 we have already "Reset".
4052 * src/language.C (initL): inserted "default" language and made this
4053 THE default language (and not american!)
4055 * src/paragraph.C: inserted handling of "default" language!
4057 * src/lyxfont.C: ditto
4061 * src/paragraph.C: output the \\par only if we have a following
4062 paragraph otherwise it's not needed.
4064 2000-09-05 Juergen Vigna <jug@sad.it>
4066 * config/pspell.m4: added entry to lyx-flags
4068 * src/spellchecker.C: modified version from Kevin for using pspell
4070 2000-09-01 Marko Vendelin <markov@ioc.ee>
4071 * src/frontends/gnome/Makefile.am
4072 * src/frontends/gnome/FormCitation.C
4073 * src/frontends/gnome/FormCitation.h
4074 * src/frontends/gnome/diainsertcitation_callbacks.c
4075 * src/frontends/gnome/diainsertcitation_callbacks.h
4076 * src/frontends/gnome/diainsertcitation_interface.c
4077 * src/frontends/gnome/diainsertcitation_interface.h
4078 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
4079 dialog for Gnome frontend
4081 * src/main.C: Gnome libraries require keeping application name
4082 and its version as strings
4084 * src/frontends/gnome/mainapp.C: Change the name of the main window
4085 from GnomeLyX to PACKAGE
4087 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4089 * src/frontends/Liason.C: add "using: declaration.
4091 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
4093 * src/mathed/math_macro.C (Metrics): Set the size of the template
4095 * src/mathed/formulamacro.C (Latex): Fixed the returned value
4097 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
4099 * src/converter.C (add_options): New function.
4100 (SetViewer): Change $$FName into '$$FName'.
4101 (View): Add options when running xdvi
4102 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
4103 (Convert): The 3rd parameter is now the desired filename. Converts
4104 calls to lyx::rename if necessary.
4105 Add options when running dvips.
4106 (dvi_papersize,dvips_options): New methods.
4108 * src/exporter.C (Export): Use getLatexName() instead of fileName().
4110 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
4111 using a call to Converter::dvips_options.
4112 Fixed to work with nex export code.
4114 * src/support/copy.C
4115 * src/support/rename.C: New files
4117 * src/support/syscall.h
4118 * src/support/syscall.C: Added Starttype SystemDontWait.
4120 * lib/ui/default.ui: Changed to work with new export code
4122 * lib/configure.m4: Changed to work with new export code
4124 * src/encoding.C: Changed latex name for iso8859_7 encoding.
4126 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
4128 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
4129 so that code compiles with DEC cxx.
4131 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
4132 to work correctly! Also now supports the additional elements
4135 2000-09-01 Allan Rae <rae@lyx.org>
4137 * src/frontends/ButtonPolicies.C: renamed all the references to
4138 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
4140 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
4141 since it's a const not a type.
4143 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
4145 2000-08-31 Juergen Vigna <jug@sad.it>
4147 * src/insets/figinset.C: Various changes to look if the filename has
4148 an extension and if not add it for inline previewing.
4150 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4152 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
4153 make buttonStatus and isReadOnly be const methods. (also reflect
4154 this in derived classes.)
4156 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
4157 (nextState): change to be static inline, pass the StateMachine as
4159 (PreferencesPolicy): remove casts
4160 (OkCancelPolicy): remvoe casts
4161 (OkCancelReadOnlyPolicy): remove casts
4162 (NoRepeatedApplyReadOnlyPolicy): remove casts
4163 (OkApplyCancelReadOnlyPolicy): remove casts
4164 (OkApplyCancelPolicy): remove casts
4165 (NoRepeatedApplyPolicy): remove casts
4167 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
4169 * src/converter.C: added some using directives
4171 * src/frontends/ButtonPolicies.C: changes to overcome
4172 "need lvalue" error with DEC c++
4174 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
4175 to WMHideCB for DEC c++
4177 * src/frontends/xforms/Menubar_pimpl.C: added using directive
4179 * src/frontends/xforms/forms/form_document.C.patch: use C callback
4180 to BulletBMTableCB for DEC c++
4182 2000-08-31 Allan Rae <rae@lyx.org>
4184 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
4185 character dialog separately from old document dialogs combo_language.
4188 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4190 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
4191 Removed LFUN_REF_CREATE.
4193 * src/MenuBackend.C: Added new tags: toc and references
4195 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
4196 (add_lastfiles, add_documents, add_formats): Removed the unused smn
4198 (add_toc, add_references): New methods.
4199 (create_submenu): Handle correctly the case when there is a
4200 seperator after optional menu items.
4202 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
4203 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
4204 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
4206 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
4208 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
4210 * src/converter.[Ch]: New file for converting between different
4213 * src/export.[Ch]: New file for exporting a LyX file to different
4216 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
4217 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
4218 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
4219 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
4220 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
4221 RunDocBook, MenuExport.
4223 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
4224 Exporter::Preview methods if NEW_EXPORT is defined.
4226 * src/buffer.C (Dispatch): Use Exporter::Export.
4228 * src/lyxrc.C: Added new tags: \converter and \viewer.
4231 * src/LyXAction.C: Define new lyx-function: buffer-update.
4232 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
4233 when NEW_EXPORT is defined.
4235 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
4237 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
4239 * lib/ui/default.ui: Added submenus "view" and "update" to the
4242 * src/filetools.C (GetExtension): New function.
4244 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
4246 2000-08-29 Allan Rae <rae@lyx.org>
4248 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
4250 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
4251 (EnableDocumentLayout): removed
4252 (DisableDocumentLayout): removed
4253 (build): make use of ButtonController's read-only handling to
4254 de/activate various objects. Replaces both of the above functions.
4256 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
4257 (readOnly): was read_only
4258 (refresh): fixed dumb mistakes with read_only_ handling
4260 * src/frontends/xforms/forms/form_document.fd:
4261 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
4262 tabbed dialogs so the tabs look more like tabs and so its easier to
4263 work out which is the current tab.
4265 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
4266 segfault with form_table
4268 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
4270 2000-08-28 Juergen Vigna <jug@sad.it>
4272 * acconfig.h: added USE_PSPELL.
4274 * src/config.h.in: added USE_PSPELL.
4276 * autogen.sh: added pspell.m4
4278 * config/pspell.m4: new file.
4280 * src/spellchecker.C: implemented support for pspell libary.
4282 2000-08-25 Juergen Vigna <jug@sad.it>
4284 * src/LyXAction.C (init): renamed LFUN_TABLE to
4285 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
4287 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
4289 * src/lyxscreen.h: add force_clear variable and fuction to force
4290 a clear area when redrawing in LyXText.
4292 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
4294 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4296 * some whitespace and comment changes.
4298 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
4300 * src/buffer.C: up te LYX_FORMAT to 2.17
4302 2000-08-23 Juergen Vigna <jug@sad.it>
4304 * src/BufferView_pimpl.C (tripleClick): disable this when in a
4307 * src/insets/insettabular.C (pasteSelection): delete the insets
4308 LyXText as it is not valid anymore.
4309 (copySelection): new function.
4310 (pasteSelection): new function.
4311 (cutSelection): new function.
4312 (LocalDispatch): implemented cut/copy/paste of cell selections.
4314 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
4315 don't have a LyXText.
4317 * src/LyXAction.C (init): a NEW_TABULAR define too much.
4319 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
4322 2000-08-22 Juergen Vigna <jug@sad.it>
4324 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
4325 ifdef form_table out if NEW_TABULAR.
4327 2000-08-21 Juergen Vigna <jug@sad.it>
4329 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
4330 (draw): fixed draw position so that the cursor is positioned in the
4332 (InsetMotionNotify): hide/show cursor so the position is updated.
4333 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
4334 using cellstart() function where it should be used.
4336 * src/insets/insettext.C (draw): ditto.
4338 * src/tabular.C: fixed initialization of some missing variables and
4339 made BoxType into an enum.
4341 2000-08-22 Marko Vendelin <markov@ioc.ee>
4342 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
4343 stock menu item using action numerical value, not its string
4347 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4349 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
4350 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
4352 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
4354 * src/frontends/xforms/GUIRunTime.C: new file
4356 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
4357 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4359 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
4361 * src/frontends/kde/GUIRunTime.C: new file
4363 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
4364 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
4366 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
4368 * src/frontends/gnome/GUIRunTime.C: new file
4370 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
4373 * src/frontends/GUIRunTime.h: removed constructor and destructor,
4374 small change to documetentation.
4376 * src/frontends/GUIRunTime.C: removed file
4378 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
4380 * src/lyxparagraph.h: enable NEW_TABULAR as default
4382 * src/lyxfunc.C (processKeySym): remove some commented code
4384 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
4385 NEW_TABULAR around the fd_form_table_options.
4387 * src/lyx_gui.C (runTime): call the static member function as
4388 GUIRunTime::runTime().
4390 2000-08-21 Allan Rae <rae@lyx.org>
4392 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
4395 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
4397 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
4399 2000-08-21 Allan Rae <rae@lyx.org>
4401 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
4402 keep Garst happy ;-)
4403 * src/frontends/xforms/FormPreferences.C (build): use setOK
4404 * src/frontends/xforms/FormDocument.C (build): use setOK
4405 (FormDocument): use the appropriate policy.
4407 2000-08-21 Allan Rae <rae@lyx.org>
4409 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
4410 automatic [de]activation of arbitrary objects when in a read-only state.
4412 * src/frontends/ButtonPolicies.h: More documentation
4413 (isReadOnly): added to support the above.
4415 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
4417 2000-08-18 Juergen Vigna <jug@sad.it>
4419 * src/insets/insettabular.C (getStatus): changed to return func_status.
4421 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
4422 display toggle menu entries if they are.
4424 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
4425 new document layout now.
4427 * src/lyxfunc.C: ditto
4429 * src/lyx_gui_misc.C: ditto
4431 * src/lyx_gui.C: ditto
4433 * lib/ui/default.ui: removed paper and quotes layout as they are now
4434 all in the document layout tabbed folder.
4436 * src/frontends/xforms/forms/form_document.fd: added Restore
4437 button and callbacks for all inputs for Allan's ButtonPolicy.
4439 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
4440 (CheckChoiceClass): added missing params setting on class change.
4441 (UpdateLayoutDocument): added for updating the layout on params.
4442 (build): forgot to RETURN_ALWAYS input_doc_spacing.
4443 (FormDocument): Implemented Allan's ButtonPolicy with the
4446 2000-08-17 Allan Rae <rae@lyx.org>
4448 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
4449 so we can at least see the credits again.
4451 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
4452 controller calls for the appropriate callbacks. Note that since Ok
4453 calls apply followed by cancel, and apply isn't a valid input for the
4454 APPLIED state, the bc_ calls have to be made in the static callback not
4455 within each of the real callbacks.
4457 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
4458 (setOk): renamed from setOkay()
4460 2000-08-17 Juergen Vigna <jug@sad.it>
4462 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
4463 in the implementation part.
4464 (composeUIInfo): don't show optional menu-items.
4466 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
4468 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
4470 * src/bufferview_funcs.C (CurrentState): fixed to show also the
4471 text-state when in a text-inset.
4473 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
4475 2000-08-17 Marko Vendelin <markov@ioc.ee>
4476 * src/frontends/gnome/FormIndex.C
4477 * src/frontends/gnome/FormIndex.h
4478 * src/frontends/gnome/FormToc.C
4479 * src/frontends/gnome/FormToc.h
4480 * src/frontends/gnome/dialogs
4481 * src/frontends/gnome/diatoc_callbacks.c
4482 * src/frontends/gnome/diatoc_callbacks.h
4483 * src/frontends/gnome/diainsertindex_callbacks.h
4484 * src/frontends/gnome/diainsertindex_callbacks.c
4485 * src/frontends/gnome/diainsertindex_interface.c
4486 * src/frontends/gnome/diainsertindex_interface.h
4487 * src/frontends/gnome/diatoc_interface.h
4488 * src/frontends/gnome/diatoc_interface.c
4489 * src/frontends/gnome/Makefile.am: Table of Contents and
4490 Insert Index dialogs implementation for Gnome frontend
4492 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
4494 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
4496 * src/frontends/gnome/diainserturl_interface.c: make the dialog
4499 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4501 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
4502 destructor. Don't definde if you don't need it
4503 (processEvents): made static, non-blocking events processing for
4505 (runTime): static method. event loop for xforms
4506 * similar as above for kde and gnome.
4508 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
4509 new Pimpl is correct
4510 (runTime): new method calss the real frontends runtime func.
4512 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
4514 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4516 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
4518 2000-08-16 Juergen Vigna <jug@sad.it>
4520 * src/lyx_gui.C (runTime): added GUII RunTime support.
4522 * src/frontends/Makefile.am:
4523 * src/frontends/GUIRunTime.[Ch]:
4524 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
4525 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
4526 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
4528 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
4530 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
4531 as this is already set in ${FRONTEND_INCLUDE} if needed.
4533 * configure.in (CPPFLAGS): setting the include dir for the frontend
4534 directory and don't set FRONTEND=xforms for now as this is executed
4537 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
4539 * src/frontends/kde/Makefile.am:
4540 * src/frontends/kde/FormUrl.C:
4541 * src/frontends/kde/FormUrl.h:
4542 * src/frontends/kde/formurldialog.h:
4543 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
4545 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
4547 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
4549 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4551 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
4554 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4556 * src/WorkArea.C (work_area_handler): more work to get te
4557 FL_KEYBOARD to work with xforms 0.88 too, please test.
4559 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
4561 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
4563 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
4566 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4568 * src/Timeout.h: remove Qt::emit hack.
4570 * several files: changes to allo doc++ compilation
4572 * src/lyxfunc.C (processKeySym): new method
4573 (processKeyEvent): comment out if FL_REVISION < 89
4575 * src/WorkArea.C: change some debugging levels.
4576 (WorkArea): set wantkey to FL_KEY_ALL
4577 (work_area_handler): enable the FL_KEYBOARD clause, this enables
4578 clearer code and the use of compose with XForms 0.89. Change to
4579 use signals instead of calling methods in bufferview directly.
4581 * src/Painter.C: change some debugging levels.
4583 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
4586 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
4587 (workAreaKeyPress): new method
4589 2000-08-14 Juergen Vigna <jug@sad.it>
4591 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
4593 * config/kde.m4: addes some features
4595 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
4596 include missing xforms dialogs.
4598 * src/Timeout.h: a hack to be able to compile with qt/kde.
4600 * sigc++/.cvsignore: added acinclude.m4
4602 * lib/.cvsignore: added listerros
4604 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
4605 xforms tree as objects are needed for other frontends.
4607 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
4608 linking with not yet implemented xforms objects.
4610 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
4612 2000-08-14 Baruch Even <baruch.even@writeme.com>
4614 * src/frontends/xforms/FormGraphics.h:
4615 * src/frontends/xforms/FormGraphics.C:
4616 * src/frontends/xforms/RadioButtonGroup.h:
4617 * src/frontends/xforms/RadioButtonGroup.C:
4618 * src/insets/insetgraphics.h:
4619 * src/insets/insetgraphics.C:
4620 * src/insets/insetgraphicsParams.h:
4621 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
4622 instead of spaces, and various other indentation issues to make the
4623 sources more consistent.
4625 2000-08-14 Marko Vendelin <markov@ioc.ee>
4627 * src/frontends/gnome/dialogs/diaprint.glade
4628 * src/frontends/gnome/FormPrint.C
4629 * src/frontends/gnome/FormPrint.h
4630 * src/frontends/gnome/diaprint_callbacks.c
4631 * src/frontends/gnome/diaprint_callbacks.h
4632 * src/frontends/gnome/diaprint_interface.c
4633 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
4636 * src/frontends/gnome/dialogs/diainserturl.glade
4637 * src/frontends/gnome/FormUrl.C
4638 * src/frontends/gnome/FormUrl.h
4639 * src/frontends/gnome/diainserturl_callbacks.c
4640 * src/frontends/gnome/diainserturl_callbacks.h
4641 * src/frontends/gnome/diainserturl_interface.c
4642 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
4643 Gnome implementation
4645 * src/frontends/gnome/Dialogs.C
4646 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
4647 all other dialogs. Copy all unimplemented dialogs from Xforms
4650 * src/frontends/gnome/support.c
4651 * src/frontends/gnome/support.h: support files generated by Glade
4655 * config/gnome.m4: Gnome configuration scripts
4657 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
4658 configure --help message
4660 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
4661 only if there are no events pendling in Gnome/Gtk. This enhances
4662 the performance of menus.
4665 2000-08-14 Allan Rae <rae@lyx.org>
4667 * lib/Makefile.am: listerrors cleaning
4669 * lib/listerrors: removed -- generated file
4670 * acinclude.m4: ditto
4671 * sigc++/acinclude.m4: ditto
4673 * src/frontends/xforms/forms/form_citation.fd:
4674 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
4677 * src/frontends/xforms/forms/makefile: I renamed the `install` target
4678 `updatesrc` and now we have a `test` target that does what `updatesrc`
4679 used to do. I didn't like having an install target that wasn't related
4682 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
4683 on all except FormGraphics. This may yet happen. Followed by a major
4684 cleanup including using FL_TRANSIENT for most of the dialogs. More
4685 changes to come when the ButtonController below is introduced.
4687 * src/frontends/xforms/ButtonController.h: New file for managing up to
4688 four buttons on a dialog according to an externally defined policy.
4689 * src/frontends/xforms/Makefile.am: added above
4691 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
4692 Apply and Cancel/Close buttons and everything in between and beyond.
4693 * src/frontends/Makefile.am: added above.
4695 * src/frontends/xforms/forms/form_preferences.fd:
4696 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
4697 and removed variable 'status' as a result. Fixed the set_minsize thing.
4698 Use the new screen-font-update after checking screen fonts were changed
4699 Added a "Restore" button to restore the original lyxrc values while
4700 editing. This restores everything not just the last input changed.
4701 That's still a tricky one. As is the "LyX: this shouldn't happen..."
4703 * src/LyXAction.C: screen-font-update added for updating buffers after
4704 screen font settings have been changed.
4705 * src/commandtags.h: ditto
4706 * src/lyxfunc.C: ditto
4708 * forms/lyx.fd: removed screen fonts dialog.
4709 * src/lyx_gui.C: ditto
4710 * src/menus.[Ch]: ditto
4711 * src/lyx.[Ch]: ditto
4712 * src/lyx_cb.C: ditto + code from here moved to make
4713 screen-font-update. And people wonder why progress on GUII is
4714 slow. Look at how scattered this stuff was! It takes forever
4717 * forms/fdfix.sh: Fixup the spacing after commas.
4718 * forms/makefile: Remove date from generated files. Fewer clashes now.
4719 * forms/bullet_forms.C.patch: included someones handwritten changes
4721 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
4722 once I've discovered why LyXRC was made noncopyable.
4723 * src/lyx_main.C: ditto
4725 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
4727 * src/frontends/xforms/forms/fdfix.sh:
4728 * src/frontends/xforms/forms/fdfixh.sed:
4729 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
4730 * src/frontends/xforms/Form*.[hC]:
4731 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
4732 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
4733 provide a destructor for the struct FD_form_xxxx. Another version of
4734 the set_[max|min]size workaround and a few other cleanups. Actually,
4735 Angus' patch from 20000809.
4737 2000-08-13 Baruch Even <baruch.even@writeme.com>
4739 * src/insets/insetgraphics.C (Clone): Added several fields that needed
4742 2000-08-11 Juergen Vigna <jug@sad.it>
4744 * src/insets/insetgraphics.C (InsetGraphics): changing init
4745 order because of warnings.
4747 * src/frontends/xforms/forms/makefile: adding patching .C with
4750 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4751 from .C.patch to .c.patch
4753 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4754 order because of warning.
4756 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4758 * src/frontends/Liason.C (setMinibuffer): new helper function
4760 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4762 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4764 * lib/ui/default.ui: commented out PaperLayout entry
4766 * src/frontends/xforms/form_document.[Ch]: new added files
4768 * src/frontends/xforms/FormDocument.[Ch]: ditto
4770 * src/frontends/xforms/forms/form_document.fd: ditto
4772 * src/frontends/xforms/forms/form_document.C.patch: ditto
4774 2000-08-10 Juergen Vigna <jug@sad.it>
4776 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4777 (InsetGraphics): initialized cacheHandle to 0.
4778 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4780 2000-08-10 Baruch Even <baruch.even@writeme.com>
4782 * src/graphics/GraphicsCache.h:
4783 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4784 correctly as a cache.
4786 * src/graphics/GraphicsCacheItem.h:
4787 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4790 * src/graphics/GraphicsCacheItem_pimpl.h:
4791 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4794 * src/insets/insetgraphics.h:
4795 * src/insets/insetgraphics.C: Changed from using a signal notification
4796 to polling when image is not loaded.
4798 2000-08-10 Allan Rae <rae@lyx.org>
4800 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4801 that there are two functions that have to been taken out of line by
4802 hand and aren't taken care of in the script. (Just a reminder note)
4804 * sigc++/macros/*.h.m4: Updated as above.
4806 2000-08-09 Juergen Vigna <jug@sad.it>
4808 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4810 * src/insets/insettabular.C: make drawing of single cell smarter.
4812 2000-08-09 Marko Vendelin <markov@ioc.ee>
4813 * src/frontends/gnome/Menubar_pimpl.C
4814 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4815 implementation: new files
4817 * src/frontends/gnome/mainapp.C
4818 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4821 * src/main.C: create Gnome main window
4823 * src/frontends/xforms/Menubar_pimpl.h
4824 * src/frontends/Menubar.C
4825 * src/frontends/Menubar.h: added method Menubar::update that calls
4826 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4828 * src/LyXView.C: calls Menubar::update to update the state
4831 * src/frontends/gnome/Makefile.am: added new files
4833 * src/frontends/Makefile.am: added frontend compiler options
4835 2000-08-08 Juergen Vigna <jug@sad.it>
4837 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4839 * src/bufferlist.C (close):
4840 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4841 documents if exiting without saving.
4843 * src/buffer.C (save): use removeAutosaveFile()
4845 * src/support/filetools.C (removeAutosaveFile): new function.
4847 * src/lyx_cb.C (MenuWrite): returns a bool now.
4848 (MenuWriteAs): check if file could really be saved and revert to the
4850 (MenuWriteAs): removing old autosavefile if existant.
4852 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4853 before Goto toggle declaration, because of compiler warning.
4855 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4857 * src/lyxfunc.C (MenuNew): small fix.
4859 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4861 * src/bufferlist.C (newFile):
4862 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4864 * src/lyxrc.C: added new_ask_filename tag
4866 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4868 * src/lyx.fd: removed code pertaining to form_ref
4869 * src/lyx.[Ch]: ditto
4870 * src/lyx_cb.C: ditto
4871 * src/lyx_gui.C: ditto
4872 * src/lyx_gui_misc.C: ditto
4874 * src/BufferView_pimpl.C (restorePosition): update buffer only
4877 * src/commandtags.h (LFUN_REFTOGGLE): removed
4878 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4879 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4880 (LFUN_REFBACK): renamed LFUN_REF_BACK
4882 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4883 * src/menus.C: ditto
4884 * src/lyxfunc.C (Dispatch): ditto.
4885 InsertRef dialog is now GUI-independent.
4887 * src/texrow.C: added using std::endl;
4889 * src/insets/insetref.[Ch]: strip out large amounts of code.
4890 The inset is now a container and this functionality is now
4891 managed by a new FormRef dialog
4893 * src/frontends/Dialogs.h (showRef, createRef): new signals
4895 * src/frontends/xforms/FormIndex.[Ch],
4896 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4897 when setting dialog's min/max size
4898 * src/frontends/xforms/FormIndex.[Ch]: ditto
4900 * src/frontends/xforms/FormRef.[Ch],
4901 src/frontends/xforms/forms/form_ref.fd: new xforms
4902 implementation of an InsetRef dialog
4904 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4907 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4908 ios::nocreate is not part of the standard. Removed.
4910 2000-08-07 Baruch Even <baruch.even@writeme.com>
4912 * src/graphics/Renderer.h:
4913 * src/graphics/Renderer.C: Added base class for rendering of different
4914 image formats into Pixmaps.
4916 * src/graphics/XPM_Renderer.h:
4917 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4918 in a different class.
4920 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4921 easily add support for other formats.
4923 * src/insets/figinset.C: plugged a leak of an X resource.
4925 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4927 * src/CutAndPaste.[Ch]: make all metods static.
4929 * development/Code_rules/Rules: more work, added section on
4930 Exceptions, and a References section.
4932 * a lot of header files: work to make doc++ able to generate the
4933 source documentation, some workarounds of doc++ problems. Doc++ is
4934 now able to generate the documentation.
4936 2000-08-07 Juergen Vigna <jug@sad.it>
4938 * src/insets/insettabular.C (recomputeTextInsets): removed function
4940 * src/tabular.C (SetWidthOfMulticolCell):
4942 (calculate_width_of_column_NMC): fixed return value so that it really
4943 only returns true if the column-width has changed (there where
4944 problems with muliticolumn-cells in this column).
4946 2000-08-04 Juergen Vigna <jug@sad.it>
4948 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4949 also on the scrollstatus of the inset.
4950 (workAreaMotionNotify): ditto.
4952 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4954 2000-08-01 Juergen Vigna <jug@sad.it>
4956 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4958 * src/commandtags.h:
4959 * src/LyXAction.C (init):
4960 * src/insets/inset.C (LocalDispatch): added support for
4963 * src/insets/inset.C (scroll): new functions.
4965 * src/insets/insettext.C (removeNewlines): new function.
4966 (SetAutoBreakRows): removes forced newlines in the text of the
4967 paragraph if autoBreakRows is set to false.
4969 * src/tabular.C (Latex): generates a parbox around the cell contents
4972 * src/frontends/xforms/FormTabular.C (local_update): removed
4973 the radio_useparbox button.
4975 * src/tabular.C (UseParbox): new function
4977 2000-08-06 Baruch Even <baruch.even@writeme.com>
4979 * src/graphics/GraphicsCache.h:
4980 * src/graphics/GraphicsCache.C:
4981 * src/graphics/GraphicsCacheItem.h:
4982 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4985 * src/insets/insetgraphics.h:
4986 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4987 and the drawing of the inline image.
4989 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4990 loaded into the wrong position.
4992 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4995 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4997 * src/support/translator.h: move all typedefs to public section
4999 * src/support/filetools.C (MakeLatexName): return string const
5001 (TmpFileName): ditto
5002 (FileOpenSearch): ditto
5004 (LibFileSearch): ditto
5005 (i18nLibFileSearch): ditto
5008 (CreateTmpDir): ditto
5009 (CreateBufferTmpDir): ditto
5010 (CreateLyXTmpDir): ditto
5013 (MakeAbsPath): ditto
5015 (OnlyFilename): ditto
5017 (NormalizePath): ditto
5018 (CleanupPath): ditto
5019 (GetFileContents): ditto
5020 (ReplaceEnvironmentPath): ditto
5021 (MakeRelPath): ditto
5023 (ChangeExtension): ditto
5024 (MakeDisplayPath): ditto
5025 (do_popen): return cmdret const
5026 (findtexfile): return string const
5028 * src/support/DebugStream.h: add some /// to please doc++
5030 * src/frontends/DialogBase.h (endif): add some /// to please doc++
5032 * src/texrow.C (same_rownumber): functor to use with find_if
5033 (getIdFromRow): rewritten to use find_if and to not update the
5034 positions. return true if row is found
5035 (increasePos): new method, use to update positions
5037 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
5039 * src/lyxlex_pimpl.C (verifyTable): new method
5042 (GetString): return string const
5043 (pushTable): rewrite to use std::stack
5045 (setFile): better check
5048 * src/lyxlex.h: make LyXLex noncopyable
5050 * src/lyxlex.C (text): return char const * const
5051 (GetString): return string const
5052 (getLongString): return string const
5054 * src/lyx_gui_misc.C (askForText): return pair<...> const
5056 * src/lastfiles.[Ch] (operator): return string const
5058 * src/buffer.C (parseSingleLyXformat2Token): pass string to
5059 istringstream not char const *.
5060 move token.end() out of loop.
5061 (readFile): move initializaton of token
5063 * src/BufferView2.C (insertErrors): run texrow.increasePos if
5064 getIdFromRow is successful.
5066 * lib/bind/emacs.bind: don't include menus bind
5068 * development/Code_rules/Rules: the beginnings of making this
5069 better and covering more of the unwritten rules that we have.
5071 * development/Code_rules/Recommendations: a couple of wording
5074 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5076 * src/support/strerror.c: remove C++ comment.
5078 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
5080 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
5081 LFUN_INDEX_INSERT_LAST
5083 * src/texrow.C (getIdFromRow): changed from const_iterator to
5084 iterator, allowing code to compile with DEC cxx
5086 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
5087 stores part of the class, as suggested by Allan. Will allow
5089 (apply): test to apply uses InsetCommandParams operator!=
5091 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
5092 (apply): test to apply uses InsetCommandParams operator!=
5094 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
5095 stores part of the class.
5096 (update): removed limits on min/max size.
5098 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
5099 (apply): test to apply uses InsetCommandParams operator!=
5101 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
5102 (Read, Write, scanCommand, getCommand): moved functionality
5103 into InsetCommandParams.
5105 (getScreenLabel): made pure virtual
5106 new InsetCommandParams operators== and !=
5108 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
5109 c-tors based on InsetCommandParams. Removed others.
5110 * src/insets/insetinclude.[Ch]: ditto
5111 * src/insets/insetlabel.[Ch]: ditto
5112 * src/insets/insetparent.[Ch]: ditto
5113 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
5115 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
5116 insets derived from InsetCommand created using similar c-tors
5117 based on InsetCommandParams
5118 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
5119 * src/menus.C (ShowRefsMenu): ditto
5120 * src/paragraph.C (Clone): ditto
5121 * src/text2.C (SetCounter): ditto
5122 * src/lyxfunc.C (Dispatch) ditto
5123 Also recreated old InsetIndex behaviour exactly. Can now
5124 index-insert at the start of a paragraph and index-insert-last
5125 without launching the pop-up.
5127 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5129 * lib/lyxrc.example: mark te pdf options as non functional.
5131 * src/support/lstrings.C (strToInt): move initalization of tmpstr
5132 (isStrDbl): move tmpstr.end() out of loop.
5133 (strToDbl): move intialization of tmpstr
5134 (lowercase): return string const and move tmp.end() out of loop.
5135 (uppercase): return string const and move tmp.edn() out of loop.
5136 (prefixIs): add assertion
5141 (containsOnly): ditto
5142 (containsOnly): ditto
5143 (containsOnly): ditto
5144 (countChar): make last arg char not char const
5145 (token): return string const
5146 (subst): return string const, move tmp.end() out of loop.
5147 (subst): return string const, add assertion
5148 (strip): return string const
5149 (frontStrip): return string const, add assertion
5150 (frontStrip): return string const
5155 * src/support/lstrings.C: add inclde "LAssert.h"
5156 (isStrInt): move tmpstr.end() out of loop.
5158 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
5159 toollist.end() out of loop.
5160 (deactivate): move toollist.end() out of loop.
5161 (update): move toollist.end() out of loop.
5162 (updateLayoutList): move tc.end() out of loop.
5163 (add): move toollist.end() out of loop.
5165 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
5166 md.end() out of loop.
5168 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
5170 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
5173 * src/paragraph.C (Erase): move fontlist.end() out of loop.
5174 (Erase): move insetlist.end() out of loop.
5176 * src/lyx_sendfax_main.C: make show_logfile static and to take a
5177 ref to const string as first arg. Move initialization of some
5178 variables, whitespace changes.
5180 * src/kbmap.C (defkey): move table.end() out of loop.
5181 (kb_keymap): move table.end() out of loop.
5182 (findbinding): move table.end() out of loop.
5184 * src/MenuBackend.C (hasMenu): move end() out of loop.
5185 (getMenu): move end() out of loop.
5186 (getMenu): move menulist_.end() out of loop.
5188 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
5190 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
5193 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
5194 (getFromLyXName): move infotab.end() out of loop.
5196 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
5197 -fvtable-thunks -ffunction-sections -fdata-sections
5199 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
5201 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
5204 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5206 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
5208 * src/frontends/xforms/FormCitation.[Ch],
5209 src/frontends/xforms/FormIndex.[Ch],
5210 src/frontends/xforms/FormToc.[Ch],
5211 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
5213 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
5215 * src/commandtags.h: renamed, created some flags for citation
5218 * src/lyx_gui_misc.C: stripped out old FD_index_form code
5220 * src/lyxfunc.C (dispatch): use signals to insert index entry
5222 * src/frontends/Dialogs.h: new signal createIndex
5224 * src/frontends/xforms/FormCommand.[Ch],
5225 src/frontends/xforms/FormCitation.[Ch],
5226 src/frontends/xforms/FormToc.[Ch],
5227 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
5229 * src/insets/insetindex.[Ch]: GUI-independent
5231 * src/frontends/xforms/FormIndex.[Ch],
5232 * src/frontends/xforms/forms/form_index.fd: xforms implementation
5235 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
5237 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
5238 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
5240 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5242 * src/insets/insetref.C (Latex): rewrite so that there is now
5243 question that a initialization is requested.
5245 * src/insets/insetcommand.h: reenable the hide signal
5247 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5249 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
5250 fix handling of shortcuts (many bugs :)
5251 (add_lastfiles): ditto.
5253 * lib/ui/default.ui: fix a few shortcuts.
5255 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
5257 * Makefile.am: Fix ``rpmdist'' target to return the exit
5258 status of the ``rpm'' command, instead of the last command in
5259 the chain (the ``rm lyx.xpm'' command, which always returns
5262 2000-08-02 Allan Rae <rae@lyx.org>
5264 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
5265 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
5266 * src/frontends/xforms/FormToc.C (FormToc): ditto
5268 * src/frontends/xforms/Makefile.am: A few forgotten files
5270 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
5271 Signals-not-copyable-problem Lars' started commenting out.
5273 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
5275 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5277 * src/insets/insetcommand.h: Signals is not copyable so anoter
5278 scheme for automatic hiding of forms must be used.
5280 * src/frontends/xforms/FormCitation.h: don't inerit from
5281 noncopyable, FormCommand already does that.
5282 * src/frontends/xforms/FormToc.h: ditto
5283 * src/frontends/xforms/FormUrl.h: ditto
5285 * src/frontends/xforms/FormCitation.C: add include <algorithm>
5287 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
5289 * src/insets/insetcommand.h (hide): new SigC::Signal0
5290 (d-tor) new virtual destructor emits hide signal
5292 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
5293 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
5295 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
5296 LOF and LOT. Inset is now GUI-independent
5298 * src/insets/insetloa.[Ch]: redundant
5299 * src/insets/insetlof.[Ch]: ditto
5300 * src/insets/insetlot.[Ch]: ditto
5302 * src/frontends/xforms/forms/form_url.fd: tweaked!
5303 * src/frontends/xforms/forms/form_citation.fd: ditto
5305 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
5306 dialogs dealing with InsetCommand insets
5308 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
5309 FormCommand base class
5310 * src/frontends/xforms/FormUrl.[Ch]: ditto
5312 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
5314 * src/frontends/xforms/FormToc.[Ch]: ditto
5316 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
5317 passed a generic InsetCommand pointer
5318 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
5320 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
5321 and modified InsetTOC class
5322 * src/buffer.C: ditto
5324 * forms/lyx.fd: strip out old FD_form_toc code
5325 * src/lyx_gui_misc.C: ditto
5326 * src/lyx_gui.C: ditto
5327 * src/lyx_cb.C: ditto
5328 * src/lyx.[Ch]: ditto
5330 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5332 * src/support/utility.hpp: tr -d '\r'
5334 2000-08-01 Juergen Vigna <jug@sad.it>
5336 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
5338 * src/commandtags.h:
5339 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
5340 LFUN_TABULAR_FEATURES.
5342 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
5343 LFUN_LAYOUT_TABULAR.
5345 * src/insets/insettabular.C (getStatus): implemented helper function.
5347 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
5349 2000-07-31 Juergen Vigna <jug@sad.it>
5351 * src/text.C (draw): fixed screen update problem for text-insets.
5353 * src/text2.C (SetParagrpah): call an update of the inset-owner when
5354 something changed probably this has to be added in various other
5357 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
5359 2000-07-31 Baruch Even <baruch.even@writeme.com>
5361 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
5362 templates to satisfy compaq cxx.
5365 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5367 * src/support/translator.h (equal_1st_in_pair::operator()): take
5368 const ref pair_type as arg.
5369 (equal_2nd_in_pair::operator()): ditto
5370 (Translator::~Translator): remove empty d-tor.
5372 * src/graphics/GraphicsCache.C: move include config.h to top, also
5373 put initialization of GraphicsCache::singleton here.
5374 (~GraphicsCache): move here
5375 (addFile): take const ref as arg
5378 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
5380 * src/BufferView2.C (insertLyXFile): change te with/without header
5383 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5385 * src/frontends/xforms/FormGraphics.C (apply): add some
5386 static_cast. Not very nice, but required by compaq cxx.
5388 * src/frontends/xforms/RadioButtonGroup.h: include header
5389 <utility> instead of <pair.h>
5391 * src/insets/insetgraphicsParams.C: add using directive.
5392 (readResize): change return type to void.
5393 (readOrigin): ditto.
5395 * src/lyxfunc.C (getStatus): add missing break for build-program
5396 function; add test for Literate for export functions.
5398 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
5399 entries in Options menu.
5401 2000-07-31 Baruch Even <baruch.even@writeme.com>
5403 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
5404 protect against auto-allocation; release icon when needed.
5406 2000-07-31 Matej Cepl <CeplM@seznam.cz>
5408 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
5409 on usual typewriter.
5411 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
5412 earlier czech.kmap), useful only for programming.
5414 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5416 * src/frontends/xforms/FormCitation.h: fix conditioning around
5419 2000-07-31 Juergen Vigna <jug@sad.it>
5421 * src/frontends/xforms/FormTabular.C (local_update): changed
5422 radio_linebreaks to radio_useparbox and added radio_useminipage.
5424 * src/tabular.C: made support for using minipages/parboxes.
5426 * src/bufferlist.C (QwriteAll): small fix for asking for save.
5428 * src/insets/insetgraphics.C (draw): just draw the inset so that the
5430 (descent): so the cursor is in the middle.
5431 (width): bit smaller box.
5433 * src/insets/insetgraphics.h: added display() function.
5435 2000-07-31 Baruch Even <baruch.even@writeme.com>
5437 * src/frontends/Dialogs.h: Added showGraphics signals.
5439 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
5440 xforms form definition of the graphics dialog.
5442 * src/frontends/xforms/FormGraphics.h:
5443 * src/frontends/xforms/FormGraphics.C: Added files, the
5444 GUIndependent code of InsetGraphics
5446 * src/insets/insetgraphics.h:
5447 * src/insets/insetgraphics.C: Major writing to make it work.
5449 * src/insets/insetgraphicsParams.h:
5450 * src/insets/insetgraphicsParams.C: Added files, parameter passing
5451 struct between InsetGraphics and GUI.
5453 * src/LaTeXFeatures.h:
5454 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
5455 support for graphicx package.
5457 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
5458 for the graphics inset.
5460 * src/support/translator.h: Added file, used in
5461 InsetGraphicsParams. this is a template to translate between two
5464 * src/frontends/xforms/RadioButtonGroup.h:
5465 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
5466 way to easily control a radio button group.
5468 2000-07-28 Juergen Vigna <jug@sad.it>
5470 * src/insets/insettabular.C (LocalDispatch):
5471 (TabularFeatures): added support for lyx-functions of tabular features.
5472 (cellstart): refixed this function after someone wrongly changed it.
5474 * src/commandtags.h:
5475 * src/LyXAction.C (init): added support for tabular-features
5477 2000-07-28 Allan Rae <rae@lyx.org>
5479 * src/frontends/xforms/FormPreferences.C (build): Setup input return
5480 checking. NOTE: It seems that pressing ESC to cancel the dialog also
5481 triggers the callback for input checking. As a result we sometimes get
5482 "LyX: This shouldn't happen..." printed to cerr.
5483 (input): Started using status variable since I only free() on
5484 destruction. Some input checking for paths and font sizes.
5486 * src/frontends/xforms/FormPreferences.h: Use status to control
5487 activation of Ok and Apply
5489 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
5490 callback. Also resized to stop segfaults with 0.88. The problem is
5491 that xforms-0.88 requires the folder to be wide enough to fit all the
5492 tabs. If it isn't it causes all sorts of problems.
5494 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
5496 * src/frontends/xforms/forms/README: Reflect reality.
5498 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
5499 * src/frontends/xforms/forms/makefile: ditto.
5501 * src/commandtags.h: Get access to new Preferences dialog
5502 * src/LyXAction.C: ditto
5503 * src/lyxfunc.C: ditto
5504 * lib/ui/default.ui: ditto
5506 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5508 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
5510 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
5513 * src/frontends/xforms/form_url.[Ch]: added.
5515 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5517 * src/insets/insetbib.h: fixed bug in previous commit
5519 * src/frontends/xforms/FormUrl.h: ditto
5521 * src/frontends/xforms/FormPrint.h: ditto
5523 * src/frontends/xforms/FormPreferences.h: ditto
5525 * src/frontends/xforms/FormCopyright.h: ditto
5527 * src/frontends/xforms/FormCitation.C: ditto
5529 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
5530 private copyconstructor and private default contructor
5532 * src/support/Makefile.am: add utility.hpp
5534 * src/support/utility.hpp: new file from boost
5536 * src/insets/insetbib.h: set owner in clone
5538 * src/frontends/xforms/FormCitation.C: added missing include
5541 * src/insets/form_url.[Ch]: removed
5543 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
5545 * development/lyx.spec.in
5546 * Makefile.am: Fix buglet for LyX RPM generation resulting from
5547 file/directory re-organization.
5549 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
5551 * src/insets/insetcommand.[Ch]: moved the string data and
5552 associated manipulation methods into a new stand-alone class
5553 InsetCommandParams. This class has two additional methods
5554 getAsString() and setFromString() allowing the contents to be
5555 moved around as a single string.
5556 (addContents) method removed.
5557 (setContents) method no longer virtual.
5559 * src/buffer.C (readInset): made use of new InsetCitation,
5560 InsetUrl constructors based on InsetCommandParams.
5562 * src/commandtags.h: add LFUN_INSERT_URL
5564 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
5565 independent InsetUrl and use InsetCommandParams to extract
5566 string info and create new Insets.
5568 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
5570 * src/frontends/xforms/FormCitation.C (apply): uses
5573 * src/frontends/xforms/form_url.C
5574 * src/frontends/xforms/form_url.h
5575 * src/frontends/xforms/FormUrl.h
5576 * src/frontends/xforms/FormUrl.C
5577 * src/frontends/xforms/forms/form_url.fd: new files
5579 * src/insets/insetcite.[Ch]: removed unused constructors.
5581 * src/insets/insetinclude.[Ch]: no longer store filename
5583 * src/insets/inseturl.[Ch]: GUI-independent.
5585 2000-07-26 Juergen Vigna <jug@sad.it>
5586 * renamed frontend from gtk to gnome as it is that what is realized
5587 and did the necessary changes in the files.
5589 2000-07-26 Marko Vendelin <markov@ioc.ee>
5591 * configure.in: cleaning up gnome configuration scripts
5593 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5595 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
5596 shortcuts syndrom by redrawing them explicitely (a better solution
5597 would be appreciated).
5599 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
5601 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
5604 * src/lyx_cb.C (MenuExport): change html export to do the right
5605 thing depending of the document type (instead of having
5606 html-linuxdoc and html-docbook).
5607 * src/lyxfunc.C (getStatus): update for html
5608 * lib/ui/default.ui: simplify due to the above change.
5609 * src/menus.C (ShowFileMenu): update too (in case we need it).
5611 * src/MenuBackend.C (read): if a menu is defined twice, add the
5612 new entries to the exiting one.
5614 2000-07-26 Juergen Vigna <jug@sad.it>
5616 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
5618 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
5619 and return a bool if it did actual save the file.
5620 (AutoSave): don't autosave a unnamed doc.
5622 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
5623 check if this is an UNNAMED new file and react to it.
5624 (newFile): set buffer to unnamed and change to not mark a new
5625 buffer dirty if I didn't do anything with it.
5627 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
5629 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5631 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
5632 friend as per Angus's patch posted to lyx-devel.
5634 * src/ext_l10n.h: updated
5636 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
5637 gettext on the style string right before inserting them into the
5640 * autogen.sh: add code to extract style strings form layout files,
5641 not good enough yet.
5643 * src/frontends/gtk/.cvsignore: add MAKEFILE
5645 * src/MenuBackend.C (read): run the label strings through gettext
5646 before storing them in the containers.
5648 * src/ext_l10n.h: new file
5650 * autogen.sh : generate the ext_l10n.h file here
5652 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5654 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
5657 * lib/ui/default.ui: fix a couple of typos.
5659 * config/gnome/gtk.m4: added (and added to the list of files in
5662 * src/insets/insetinclude.C (unique_id): fix when we are using
5663 lyxstring instead of basic_string<>.
5664 * src/insets/insettext.C (LocalDispatch): ditto.
5665 * src/support/filetools.C: ditto.
5667 * lib/configure.m4: create the ui/ directory if necessary.
5669 * src/LyXView.[Ch] (updateToolbar): new method.
5671 * src/BufferView_pimpl.C (buffer): update the toolbar when
5672 opening/closing buffer.
5674 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5676 * src/LyXAction.C (getActionName): enhance to return also the name
5677 and options of pseudo-actions.
5678 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
5680 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
5681 as an example of what is possible). Used in File->Build too (more
5682 useful) and in the import/export menus (to mimick the complicated
5683 handling of linuxdoc and friends). Try to update all the entries.
5685 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
5688 * src/MenuBackend.C (read): Parse the new OptItem tag.
5690 * src/MenuBackend.h: Add a new optional_ data member (used if the
5691 entry should be omitted when the lyxfunc is disabled).
5693 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
5694 function, used as a shortcut.
5695 (create_submenu): align correctly the shortcuts on the widest
5698 * src/MenuBackend.h: MenuItem.label() only returns the label of
5699 the menu without shortcut; new method shortcut().
5701 2000-07-14 Marko Vendelin <markov@ioc.ee>
5703 * src/frontends/gtk/Dialogs.C:
5704 * src/frontends/gtk/FormCopyright.C:
5705 * src/frontends/gtk/FormCopyright.h:
5706 * src/frontends/gtk/Makefile.am: added these source-files for the
5707 Gtk/Gnome support of the Copyright-Dialog.
5709 * src/main.C: added Gnome::Main initialization if using
5710 Gtk/Gnome frontend-GUI.
5712 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
5714 * config/gnome/aclocal-include.m4
5715 * config/gnome/compiler-flags.m4
5716 * config/gnome/curses.m4
5717 * config/gnome/gnome--.m4
5718 * config/gnome/gnome-bonobo-check.m4
5719 * config/gnome/gnome-common.m4
5720 * config/gnome/gnome-fileutils.m4
5721 * config/gnome/gnome-ghttp-check.m4
5722 * config/gnome/gnome-gnorba-check.m4
5723 * config/gnome/gnome-guile-checks.m4
5724 * config/gnome/gnome-libgtop-check.m4
5725 * config/gnome/gnome-objc-checks.m4
5726 * config/gnome/gnome-orbit-check.m4
5727 * config/gnome/gnome-print-check.m4
5728 * config/gnome/gnome-pthread-check.m4
5729 * config/gnome/gnome-support.m4
5730 * config/gnome/gnome-undelfs.m4
5731 * config/gnome/gnome-vfs.m4
5732 * config/gnome/gnome-x-checks.m4
5733 * config/gnome/gnome-xml-check.m4
5734 * config/gnome/gnome.m4
5735 * config/gnome/gperf-check.m4
5736 * config/gnome/gtk--.m4
5737 * config/gnome/linger.m4
5738 * config/gnome/need-declaration.m4: added configuration scripts
5739 for Gtk/Gnome frontend-GUI
5741 * configure.in: added support for the --with-frontend=gtk option
5743 * autogen.sh: added config/gnome/* to list of config-files
5745 * acconfig.h: added define for GTKGUI-support
5747 * config/lyxinclude.m4: added --with-frontend[=value] option value
5748 for Gtk/Gnome frontend-GUI support.
5750 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5752 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5756 * src/paragraph.C (GetChar): remove non-const version
5758 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5759 (search_kw): use it.
5761 * src/lyx_main.C (init): if "preferences" exist, read that instead
5763 (ReadRcFile): return bool if the file could be read ok.
5764 (ReadUIFile): add a check to see if lex file is set ok.
5766 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5767 bastring can be used instead of lyxstring (still uses the old code
5768 if std::string is good enough or if lyxstring is used.)
5770 * src/encoding.C: make the arrays static, move ininle functions
5772 * src/encoding.h: from here.
5774 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5775 (parseSingleLyXformat2Token): move inset parsing to separate method
5776 (readInset): new private method
5778 * src/Variables.h: remove virtual from get().
5780 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5781 access to NEW_INSETS and NEW_TABULAR
5783 * src/MenuBackend.h: remove superfluous forward declaration of
5784 MenuItem. Add documentations tags "///", remove empty MenuItem
5785 destructor, remove private default contructor.
5787 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5789 (read): more string mlabel and mname to where they are used
5790 (read): remove unused variables mlabel and mname
5791 (defaults): unconditional clear, make menusetup take advantage of
5792 add returning Menu &.
5794 * src/LyXView.h: define NEW_MENUBAR as default
5796 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5797 to NEW_INSETS and NEW_TABULAR.
5798 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5799 defined. Change some of the "xxxx-inset-insert" functions names to
5802 * several files: more enahncements to NEW_INSETS and the resulting
5805 * lib/lyxrc.example (\date_insert_format): move to misc section
5807 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5808 bastring and use AC_CACHE_CHECK.
5809 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5810 the system have the newest methods. uses AC_CACHE_CHECK
5811 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5812 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5813 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5815 * configure.in: add LYX_CXX_GOOD_STD_STRING
5817 * acinclude.m4: recreated
5819 2000-07-24 Amir Karger <karger@lyx.org>
5821 * README: add Hebrew, Arabic kmaps
5824 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5826 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5829 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5831 * Lot of files: add pragma interface/implementation.
5833 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5835 * lib/ui/default.ui: new file (ans new directory). Contains the
5836 default menu and toolbar.
5838 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5839 global space. Toolbars are now read (as menus) in ui files.
5841 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5843 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5844 is disabled because the document is read-only. We want to have the
5845 toggle state of the function anyway.
5846 (getStatus): add code for LFUN_VC* functions (mimicking what is
5847 done in old-style menus)
5849 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5850 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5852 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5853 * src/BufferView_pimpl.C: ditto.
5854 * src/lyxfunc.C: ditto.
5856 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5857 default). This replaces old-style menus by new ones.
5859 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5860 MenuItem. Contain the data structure of a menu.
5862 * src/insets/insettext.C: use LyXView::setLayout instead of
5863 accessing directly the toolbar combox.
5864 * src/lyxfunc.C (Dispatch): ditto.
5866 * src/LyXView.C (setLayout): new method, which just calls
5867 Toolbar::setLayout().
5868 (updateLayoutChoice): move part of this method in Toolbar.
5870 * src/toolbar.[Ch]: removed.
5872 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5873 implementation the toolbar.
5875 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5876 the toolbar. It might make sense to merge it with ToolbarDefaults
5878 (setLayout): new function.
5879 (updateLayoutList): ditto.
5880 (openLayoutList): ditto.
5882 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5883 xforms implementation of the toolbar.
5884 (get_toolbar_func): comment out, since I do not
5885 know what it is good for.
5887 * src/ToolbarDefaults.h: Add the ItemType enum.
5889 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5890 for a list of allocated C strings. Used in Menubar xforms
5891 implementation to avoid memory leaks.
5893 * src/support/lstrings.[Ch] (uppercase): new version taking and
5897 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5898 * lib/bind/emacs.bind: ditto.
5900 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5902 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5903 forward decl of LyXView.
5905 * src/toolbar.C (toolbarItem): moved from toolbar.h
5906 (toolbarItem::clean): ditto
5907 (toolbarItem::~toolbarItem): ditto
5908 (toolbarItem::operator): ditto
5910 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5912 * src/paragraph.h: control the NEW_TABULAR define from here
5914 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5915 USE_TABULAR_INSETS to NEW_TABULAR
5917 * src/ToolbarDefaults.C: add include "lyxlex.h"
5919 * files using the old table/tabular: use NEW_TABULAR to control
5920 compilation of old tabular stuff.
5922 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5925 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5926 planemet in reading of old style floats, fix the \end_deeper
5927 problem when reading old style floats.
5929 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5931 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5933 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5935 * lib/bind/sciword.bind: updated.
5937 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5939 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5940 layout write problem
5942 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5944 * src/Makefile.am (INCLUDES): remove image directory from include
5947 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5948 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5950 * src/LyXView.C (create_form_form_main): read the application icon
5953 * lib/images/*.xpm: change the icons to use transparent color for
5956 * src/toolbar.C (update): change the color of the button when it
5959 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5961 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5962 setting explicitely the minibuffer.
5963 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5965 * src/LyXView.C (showState): new function. Shows font information
5966 in minibuffer and update toolbar state.
5967 (LyXView): call Toolbar::update after creating the
5970 * src/toolbar.C: change toollist to be a vector instead of a
5972 (BubbleTimerCB): get help string directly from the callback
5973 argument of the corresponding icon (which is the action)
5974 (set): remove unnecessary ugliness.
5975 (update): new function. update the icons (depressed, disabled)
5976 depending of the status of the corresponding action.
5978 * src/toolbar.h: remove help in toolbarItem
5980 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5982 * src/Painter.C (text): Added code for using symbol glyphs from
5983 iso10646 fonts. Currently diabled.
5985 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5988 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5989 magyar,turkish and usorbian.
5991 * src/paragraph.C (isMultiLingual): Made more efficient.
5993 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5996 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5997 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5998 Also changed the prototype to "bool math_insert_greek(char)".
6000 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6002 * lots of files: apply the NEW_INSETS on all code that will not be
6003 needed when we move to use the new insets. Enable the define in
6004 lyxparagrah.h to try it.
6006 * src/insets/insettabular.C (cellstart): change to be a static
6008 (InsetTabular): initialize buffer in the initializer list.
6010 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
6012 * src/frontends/xforms/FormPrint.[Ch] : moved #include
6013 form_print.h out of the header file. Replaced with forward
6014 declarations of the relevant struct.
6016 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
6019 * src/commandtags.h: do not include "debug.h" which does not
6020 belong there. #include it in some other places because of this
6023 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6025 * src/insets/insetcaption.C: add a couple "using" directives.
6027 * src/toolbar.C (add): get the help text directly from lyxaction.
6029 (setPixmap): new function. Loads from disk and sets a pixmap on a
6030 botton; the name of the pixmap file is derived from the command
6033 * src/toolbar.h: remove members isBitmap and pixmap from
6036 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
6037 * lib/images/: move many files from images/banner.xpm.
6039 * src/lyx_gui.C (create_forms): read banner pixmap from file.
6041 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
6042 * src/toolbar.C: ditto.
6043 * configure.in: ditto.
6044 * INSTALL: document.
6046 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
6047 the spellchecker popup is closed from the WM.
6049 2000-07-19 Juergen Vigna <jug@sad.it>
6051 * src/insets/insetfloat.C (Write): small fix because we use the
6052 insetname for the type now!
6054 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
6056 * src/frontends/xforms/forms/form_citation.fd: object sizes are
6059 * src/frontends/Dialogs.h: removed hideCitation signal
6061 * src/insets/insetcite.h: added hide signal
6063 * src/insets/insetcite.C (~InsetCitation): emits new signal
6064 (getScreenLabel): "intelligent" label should now fit on the screen!
6066 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
6068 * src/frontends/xforms/FormCitation.C (showInset): connects
6069 hide() to the inset's hide signal
6070 (show): modified to use fl_set_object_position rather than
6071 fl_set_object_geometry wherever possible
6073 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6075 * src/insets/lyxinset.h: add caption code
6077 * src/insets/insetfloat.C (type): new method
6079 * src/insets/insetcaption.C (Write): new method
6081 (LyxCode): new method
6083 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
6084 to get it right together with using the FloatList.
6086 * src/commandtags.h: add LFUN_INSET_CAPTION
6087 * src/lyxfunc.C (Dispatch): handle it
6089 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
6092 * src/Variables.[Ch]: make expand take a const reference, remove
6093 the destructor, some whitespace changes.
6095 * src/LyXAction.C (init): add caption-inset-insert
6097 * src/FloatList.C (FloatList): update the default floats a bit.
6099 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6101 * src/Variables.[Ch]: new files. Intended to be used for language
6102 specific strings (like \chaptername) and filename substitution in
6105 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
6107 * lib/kbd/american.kmap: update
6109 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
6111 * src/bufferparams.[Ch]: remove member allowAccents.
6113 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
6115 * src/LaTeXLog.C: use the log_form.h header.
6116 * src/lyx_gui.C: ditto.
6117 * src/lyx_gui_misc.C: ditto.
6118 * src/lyxvc.h: ditto.
6120 * forms/log_form.fd: new file, created from latexoptions.fd. I
6121 kept the log popup and nuked the options form.
6123 * src/{la,}texoptions.[Ch]: removed.
6124 * src/lyx_cb.C (LaTeXOptions): ditto
6126 * src/lyx_gui.C (create_forms): do not handle the
6127 fd_latex_options form.
6129 2000-07-18 Juergen Vigna <jug@sad.it>
6131 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
6132 name of the inset so that it can be requested outside (text2.C).
6134 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
6137 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6139 * src/mathed/formula.h (ConvertFont): constify
6141 * src/mathed/formula.C (Read): add warning if \end_inset is not
6142 found on expected place.
6144 * src/insets/lyxinset.h (ConvertFont): consify
6146 * src/insets/insetquotes.C (ConvertFont): constify
6147 * src/insets/insetquotes.h: ditto
6149 * src/insets/insetinfo.h: add labelfont
6151 * src/insets/insetinfo.C (InsetInfo): set the labelfont
6152 (ascent): use labelfont
6156 (Write): make .lyx file a bit nicer
6158 * src/insets/insetfloat.C (Write): simplify somewhat...
6159 (Read): add warning if arg is not found
6161 * src/insets/insetcollapsable.C: add using std::max
6162 (Read): move string token and add warning in arg is not found
6163 (draw): use std::max to get the right ty
6164 (getMaxWidth): simplify by using std::max
6166 * src/insets/insetsection.h: new file
6167 * src/insets/insetsection.C: new file
6168 * src/insets/insetcaption.h: new file
6169 * src/insets/insetcaption.C: new file
6171 * src/insets/inset.C (ConvertFont): constify signature
6173 * src/insets/Makefile.am (libinsets_la_SOURCES): add
6174 insetcaption.[Ch] and insetsection.[Ch]
6176 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
6177 uses to use LABEL_COUNTER_CHAPTER instead.
6178 * src/text2.C (SetCounter): here
6180 * src/counters.h: new file
6181 * src/counters.C: new file
6182 * src/Sectioning.h: new file
6183 * src/Sectioning.C: new file
6185 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
6187 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6189 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
6192 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
6195 2000-07-17 Juergen Vigna <jug@sad.it>
6197 * src/tabular.C (Validate): check if array-package is needed.
6198 (SetVAlignment): added support for vertical alignment.
6199 (SetLTFoot): better support for longtable header/footers
6200 (Latex): modified to support added features.
6202 * src/LaTeXFeatures.[Ch]: added array-package.
6204 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
6206 * src/lyx_gui.C (LyXGUI): make sure that the height is large
6209 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
6211 * configure.in: do not forget to put a space after -isystem.
6213 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
6215 * lib/kbd/arabic.kmap: a few fixes.
6217 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6219 * some whitespace chagnes to a number of files.
6221 * src/support/DebugStream.h: change to make it easier for
6222 doc++ to parse correctly.
6223 * src/support/lyxstring.h: ditto
6225 * src/mathed/math_utils.C (compara): change to have only one
6227 (MathedLookupBOP): change because of the above.
6229 * src/mathed/math_delim.C (math_deco_compare): change to have only
6231 (search_deco): change becasue of the above.
6233 * src/insets/insettabular.C (DrawCellSelection): use std::swap
6234 instead of manually coded one.
6236 * src/insets/insetquotes.C (Read): read the \end_inset too
6238 * src/insets/insetlatex.h: remove file
6239 * src/insets/insetlatex.C: remove file
6241 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
6243 (InsetPrintIndex): remove destructor
6245 * src/insets/insetinclude.h: remove default constructor
6247 * src/insets/insetfloat.C: work to make it work better
6249 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
6251 * src/insets/insetcite.h (InsetCitation): remove default constructor
6253 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
6255 * src/text.C (GetColumnNearX): comment out some currently unused code.
6257 * src/paragraph.C (writeFile): move some initializations closer to
6259 (CutIntoMinibuffer): small change to use new matchIT operator
6263 (InsertInset): ditto
6266 (InsetIterator): ditto
6267 (Erase): small change to use new matchFT operator
6269 (GetFontSettings): ditto
6270 (HighestFontInRange): ditto
6273 * src/lyxparagraph.h: some chars changed to value_type
6274 (matchIT): because of some stronger checking (perhaps too strong)
6275 in SGI STL, the two operator() unified to one.
6278 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
6280 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
6281 the last inset read added
6282 (parseSingleLyXformat2Token): some more (future) compability code added
6283 (parseSingleLyXformat2Token): warning about solitary \end_inset added
6284 (parseSingleLyXformat2Token): set last_inset_read
6285 (parseSingleLyXformat2Token): more code to read new "Float" correctly
6286 (parseSingleLyXformat2Token): don't double intializw string next_token
6288 * src/TextCache.C (text_fits::operator()): add const's to the signature
6289 (has_buffer::operator()): ditto
6291 * src/Floating.h: add some comments on the class
6293 * src/FloatList.[Ch] (typeExist): new method
6296 * src/BackStack.h: added default constructor, wanted by Gcc.
6298 2000-07-14 Juergen Vigna <jug@sad.it>
6300 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
6302 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
6304 * src/insets/insettabular.C (resizeLyXText): need this to be able to
6305 do a redraw when the window is resized!
6306 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
6308 * src/insets/insettext.C (resizeLyXText): added function to correctly
6309 being able to resize the LyXWindow.
6311 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
6313 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
6315 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
6316 crashes when closing dialog to a deleted inset.
6318 * src/insets/insetcite.[Ch] (Edit) : the return of this former
6319 method! Now similar to other insets.
6321 2000-07-13 Juergen Vigna <jug@sad.it>
6323 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
6325 * lib/examples/Literate.lyx: small patch!
6327 * src/insets/insetbib.C (Read): added this function because of wrong
6328 Write (without [begin|end]_inset).
6330 2000-07-11 Juergen Vigna <jug@sad.it>
6332 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
6333 as the insertInset could not be good!
6335 * src/screen.C (ToggleSelection): fixed toggle selection bug as
6336 the bool param should not be last.
6338 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6340 * sigc++/configure.in: fix bug in threading-related code (Yes, I
6341 did submit that to Karl).
6343 * configure.in: use -isystem instead of -I for X headers. This
6344 fixes a problem on solaris with a recent gcc;
6345 put the front-end code after the X detection code;
6346 configure in sigc++ before lib/
6348 * src/lyx_main.C (commandLineHelp): remove -display from command
6351 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
6353 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
6354 Also put in Makefile rules for building the ``listerrors''
6355 program for parsing errors from literate programs written in LyX.
6357 * lib/build-listerrors: Added small shell script as part of compile
6358 process. This builds a working ``listerrors'' binary if noweb is
6359 installed and either 1) the VNC X server is installed on the machine,
6360 or 2) the user is compiling from within a GUI. The existence of a GUI
6361 is necessary to use the ``lyx --export'' feature for now. This
6362 hack can be removed once ``lyx --export'' no longer requires a GUI to
6365 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
6367 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
6368 now passed back correctly from gcc and placed "under" error
6369 buttons in a Literate LyX source.
6371 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6373 * src/text.C (GetColumnNearX): Better behavior when a RTL
6374 paragraph is ended by LTR text.
6376 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
6379 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6381 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
6382 true when clipboard is empty.
6384 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
6386 * text.C (Backspace): Prevent rebreaking of a row if it is the last
6387 row of the paragraph.
6388 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
6389 to prevent calculation of bidi tables
6391 2000-07-07 Juergen Vigna <jug@sad.it>
6393 * src/screen.C (ToggleSelection): added y_offset and x_offset
6396 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
6399 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
6401 * src/insets/insettext.C: fixed Layout-Display!
6403 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6405 * configure.in: add check for strings.h header.
6407 * src/spellchecker.C: include <strings.h> in order to have a
6408 definition for bzero().
6410 2000-07-07 Juergen Vigna <jug@sad.it>
6412 * src/insets/insettext.C (draw): set the status of the bv->text to
6413 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
6415 * src/screen.C (DrawOneRow):
6416 (DrawFromTo): redraw the actual row if something has changed in it
6419 * src/text.C (draw): call an update of the toplevel-inset if something
6420 has changed inside while drawing.
6422 * src/lyxtext.h: added CHANGED_IN_DRAW status.
6424 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
6426 * src/insets/insetbib.[Ch] (callback) new method, moving callback
6427 processing inside class.
6429 * src/insets/insetindex.[Ch] (callback) new method, moving callback
6430 processing inside class.
6432 * src/insets/insetindex.h new struct Holder, consistent with other
6435 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
6436 citation dialog from main code and placed it in src/frontends/xforms.
6437 Dialog launched through signals instead of callbacks
6439 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
6441 * lyx.man: update the options description.
6443 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
6445 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
6446 handle neg values, set min width to 590, add doc about -display
6448 2000-07-05 Juergen Vigna <jug@sad.it>
6450 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
6451 calls to BufferView *.
6453 * src/insets/insettext.C (checkAndActivateInset): small fix non
6454 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
6456 * src/insets/insetcommand.C (Read): Fixed as insets should read till
6457 their \end_inset token!
6459 2000-07-04 edscott <edscott@imp.mx>
6461 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
6462 lib/lyxrc.example: added option \wheel_jump
6464 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
6466 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
6467 remove support for -width,-height,-xpos and -ypos.
6469 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
6471 * src/encoding.[Ch]: New files.
6473 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
6474 (text): Call to the underline() method only when needed.
6476 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
6478 * src/buffer.C (makeLaTeXFile): Compute automatically the input
6479 encoding(s) for the document.
6481 * src/bufferparams.C (BufferParams): Changed default value of
6484 * src/language.C (newLang): Removed.
6485 (items[]): Added encoding information for all defined languages.
6487 * src/lyx_gui.C (create_forms): Added "auto" option to the input
6488 encoding choice button.
6490 * src/lyxrc.h (font_norm_type): New member variable.
6491 (set_font_norm_type): New method.
6493 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
6494 paragraphs with different encodings.
6496 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
6497 (TransformChar): Changed to work correctly with Arabic points.
6498 (draw): Added support for drawing Arabic points.
6499 (draw): Removed code for drawing underbars (this is done by
6502 * src/support/textutils.h (IsPrintableNonspace): New function.
6504 * src/BufferView_pimpl.h: Added "using SigC::Object".
6505 * src/LyXView.h: ditto.
6507 * src/insets/insetinclude.h (include_label): Changed to mutable.
6509 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6511 * src/mathed/math_iter.h: remove empty destructor
6513 * src/mathed/math_cursor.h: remove empty destructor
6515 * src/insets/lyxinset.h: add THEOREM_CODE
6517 * src/insets/insettheorem.[Ch]: new files
6519 * src/insets/insetminipage.C: (InsertInset): remove
6521 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
6523 (InsertInset): remove
6525 * src/insets/insetlist.C: (InsertList): remove
6527 * src/insets/insetfootlike.[Ch]: new files
6529 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
6532 (InsertInset): ditto
6534 * src/insets/insetert.C: remove include Painter.h, reindent
6535 (InsertInset): move to header
6537 * src/insets/insetcollapsable.h: remove explicit from default
6538 contructor, remove empty destructor, add InsertInset
6540 * src/insets/insetcollapsable.C (InsertInset): new func
6542 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6544 * src/vspace.h: add explicit to constructor
6546 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
6547 \textcompwordmark, please test this.
6549 * src/lyxrc.C: set ascii_linelen to 65 by default
6551 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
6553 * src/commandtags.h: add LFUN_INSET_THEOREM
6555 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
6556 (makeLinuxDocFile): remove _some_ of the nice logic
6557 (makeDocBookFile): ditto
6559 * src/Painter.[Ch]: (~Painter): removed
6561 * src/LyXAction.C (init): entry for insettheorem added
6563 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
6565 (deplog): code to detect files generated by LaTeX, needs testing
6568 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6570 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
6572 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6574 * src/LaTeX.C (deplog): Add a check for files that are going to be
6575 created by the first latex run, part of the project to remove the
6578 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
6579 contents to the extension list.
6581 2000-07-04 Juergen Vigna <jug@sad.it>
6583 * src/text.C (NextBreakPoint): added support for needFullRow()
6585 * src/insets/lyxinset.h: added needFullRow()
6587 * src/insets/insetcollapsable.C: redone now this uses a text-inset
6590 * src/insets/insettext.C: lots of changes for update!
6592 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
6594 * src/LaTeXFeatures.h: add a missing std:: qualifier.
6596 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
6598 * src/insets/insetinclude.C (InsetInclude): fixed
6599 initialization of include_label.
6600 (unique_id): now returns a string.
6602 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
6604 * src/LaTeXFeatures.h: new member IncludedFiles, for
6605 a map of key, included file name.
6607 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
6608 with the included files for inclusion in SGML preamble,
6609 i. e., linuxdoc and docbook.
6612 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
6613 nice (is the generated linuxdoc code to be exported?), that
6614 allows to remove column, and only_body that will be true for
6615 slave documents. Insets are allowed inside SGML font type.
6616 New handling of the SGML preamble for included files.
6617 (makeDocBookFile): the same for docbook.
6619 * src/insets/insetinclude.h:
6620 * src/insets/insetinclude.C (Validate): keeps a list of included files.
6622 (DocBook): new export methods.
6624 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
6625 and makeDocBookFile.
6627 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
6628 formats to export with command line argument -x.
6630 2000-06-29 Juergen Vigna <jug@sad.it>
6632 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
6633 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
6635 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
6636 region could already been cleared by an inset!
6638 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6640 * src/BufferView_pimpl.h: remove member variables lyx_focus and
6643 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
6645 (cursorToggle): remove special handling of lyx focus.
6647 2000-06-28 Juergen Vigna <jug@sad.it>
6649 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
6652 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6654 * src/insets/insetindex.C (Edit): add a callback when popup is
6657 * src/insets/insettext.C (LocalDispatch):
6658 * src/insets/insetmarginal.h:
6659 * src/insets/insetlist.h:
6660 * src/insets/insetfoot.h:
6661 * src/insets/insetfloat.h:
6662 * src/insets/insetert.h: add a missing std:: qualifier.
6664 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6666 * src/support/lyxsum.C (sum): '\0' teminate file read when using
6669 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
6671 * src/insets/insettext.C (Read): remove tmptok unused variable
6672 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
6673 (InsertInset): change for new InsetInset code
6675 * src/insets/insettext.h: add TEXT inline method
6677 * src/insets/insettext.C: remove TEXT macro
6679 * src/insets/insetmarginal.C (Write): new method
6680 (Latex): change output slightly
6682 * src/insets/insetfoot.C (Write): new method
6683 (Latex): change output slightly (don't use endl when no need)
6685 * src/insets/insetert.C (Write): new method
6687 * src/insets/insetcollapsable.h: make button_length, button_top_y
6688 and button_bottm_y protected.
6690 * src/insets/insetcollapsable.C (Write): simplify code by using
6691 tostr. Also do not output the float name, the children class
6692 should to that to get control over own arguments
6694 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
6695 src/insets/insetminipage.[Ch]:
6698 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
6700 * src/lyxfunc.C (Dispatch): cases for new insets/commands
6702 * src/Makefile.am (lyx_SOURCES): add the new files
6704 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
6705 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
6706 * src/commandtags.h: ditto
6708 * src/LaTeXFeatures.h: add a std::set of used floattypes
6710 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
6712 * src/FloatList.[Ch] src/Floating.h: new files
6714 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
6716 * src/lyx_cb.C (TableApplyCB): ditto
6718 * src/text2.C: ditto
6719 * src/buffer.C (SimpleLinuxDocOnePar): ditto
6720 (parseSingleLyXformat2Token): ditto + add code for
6721 backwards compability for old float styles + add code for new insets
6723 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
6725 (InsertInset(size_type, Inset *, LyXFont)): new method
6726 (InsetChar(size_type, char)): changed to use the other InsetChar
6727 with a LyXFont(ALL_INHERIT).
6728 (InsetInset(size_type, Inset*)): changed to use InsetChar to
6729 insert the META_INSET.
6731 * sigc++/thread.cc (Privete<int>::operator int&): move definition
6733 * sigc++/thread.h (Threads): from here
6735 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
6736 definition out of line
6737 * sigc++/scope.h: from here
6739 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6741 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
6742 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6744 * Makefile.am (bindist): new target.
6746 * INSTALL: add instructions for doing a binary distribution.
6748 * development/tools/README.bin.example: update a bit.
6750 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6753 * lib/lyxrc.example: new lyxrc tag \set_color.
6755 * src/lyxfunc.C (Dispatch):
6756 * src/commandtags.h:
6757 * src/LyXAction.C: new lyxfunc "set-color".
6759 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6760 and an x11name given as strings.
6762 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6763 cache when a color is changed.
6765 2000-06-26 Juergen Vigna <jug@sad.it>
6767 * src/lyxrow.C (width): added this functions and variable.
6769 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6772 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6774 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6776 * images/undo_bw.xpm: new icon.
6777 * images/redo_bw.xpm: ditto.
6779 * configure.in (INSTALL_SCRIPT): change value to
6780 ${INSTALL} to avoid failures of install-script target.
6781 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6783 * src/BufferView.h: add a magic "friend" declaration to please
6786 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6788 * forms/cite.fd: modified to allow resizing without messing
6791 * src/insetcite.C: Uses code from cite.fd almost without
6793 User can now resize dialog in the x-direction.
6794 Resizing the dialog in the y-direction is prevented, as the
6795 code does this intelligently already.
6797 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6799 * INSTALL: remove obsolete entry in "problems" section.
6801 * lib/examples/sl_*.lyx: update of the slovenian examples.
6803 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6805 2000-06-23 Juergen Vigna <jug@sad.it>
6807 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6809 * src/buffer.C (resize): delete the LyXText of textinsets.
6811 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6813 * src/insets/lyxinset.h: added another parameter 'cleared' to
6814 the draw() function.
6816 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6817 unlocking inset in inset.
6819 2000-06-22 Juergen Vigna <jug@sad.it>
6821 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6822 of insets and moved first to LyXText.
6824 * src/mathed/formulamacro.[Ch]:
6825 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6827 2000-06-21 Juergen Vigna <jug@sad.it>
6829 * src/text.C (GetVisibleRow): look if I should clear the area or not
6830 using Inset::doClearArea() function.
6832 * src/insets/lyxinset.h: added doClearArea() function and
6833 modified draw(Painter &, ...) to draw(BufferView *, ...)
6835 * src/text2.C (UpdateInset): return bool insted of int
6837 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6839 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6840 combox in the character popup
6842 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6843 BufferParams const & params
6845 2000-06-20 Juergen Vigna <jug@sad.it>
6847 * src/insets/insettext.C (SetParagraphData): set insetowner on
6850 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6852 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6853 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6855 (form_main_): remove
6857 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6858 (create_form_form_main): remove FD_form_main stuff, connect to
6859 autosave_timeout signal
6861 * src/LyXView.[Ch] (getMainForm): remove
6862 (UpdateTimerCB): remove
6863 * src/BufferView_pimpl.h: inherit from SigC::Object
6865 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6866 signal instead of callback
6868 * src/BufferView.[Ch] (cursorToggleCB): remove
6870 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6872 * src/BufferView_pimpl.C: changes because of the one below
6874 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6875 instead of storing a pointer to a LyXText.
6877 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6879 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6881 * src/lyxparagraph.h
6883 * src/paragraph.C: Changed fontlist to a sorted vector.
6885 2000-06-19 Juergen Vigna <jug@sad.it>
6887 * src/BufferView.h: added screen() function.
6889 * src/insets/insettext.C (LocalDispatch): some selection code
6892 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6894 * src/insets/insettext.C (SetParagraphData):
6896 (InsetText): fixes for multiple paragraphs.
6898 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6900 * development/lyx.spec.in: Call configure with ``--without-warnings''
6901 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6902 This should be fine, however, since we generally don't want to be
6903 verbose when making an RPM.
6905 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6907 * lib/scripts/fig2pstex.py: New file
6909 2000-06-16 Juergen Vigna <jug@sad.it>
6911 * src/insets/insettabular.C (UpdateLocal):
6912 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6913 (LocalDispatch): Changed all functions to use LyXText.
6915 2000-06-15 Juergen Vigna <jug@sad.it>
6917 * src/text.C (SetHeightOfRow): call inset::update before requesting
6920 * src/insets/insettext.C (update):
6921 * src/insets/insettabular.C (update): added implementation
6923 * src/insets/lyxinset.h: added update function
6925 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6927 * src/text.C (SelectNextWord): protect against null pointers with
6928 old-style string streams. (fix from Paul Theo Gonciari
6931 * src/cite.[Ch]: remove erroneous files.
6933 * lib/configure.m4: update the list of created directories.
6935 * src/lyxrow.C: include <config.h>
6936 * src/lyxcursor.C: ditto.
6938 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6940 * lib/examples/decimal.lyx: new example file from Mike.
6942 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6943 to find template definitions (from Dekel)
6945 * src/frontends/.cvsignore: add a few things.
6947 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6949 * src/Timeout.C (TimeOut): remove default argument.
6951 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6954 * src/insets/ExternalTemplate.C: add a "using" directive.
6956 * src/lyx_main.h: remove the act_ struct, which seems unused
6959 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6961 * LyX Developers Meeting: All files changed, due to random C++ (by
6962 coincidence) code generator script.
6964 - external inset (cool!)
6965 - initial online editing of preferences
6966 - insettabular breaks insettext(s contents)
6968 - some DocBook fixes
6969 - example files update
6970 - other cool stuff, create a diff and look for yourself.
6972 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6974 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6975 -1 this is a non-line-breaking textinset.
6977 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6978 if there is no width set.
6980 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6982 * Lots of files: Merged the dialogbase branch.
6984 2000-06-09 Allan Rae <rae@lyx.org>
6986 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6987 and the Dispatch methods that used it.
6989 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6990 access to functions formerly kept in Dispatch.
6992 2000-05-19 Allan Rae <rae@lyx.org>
6994 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6995 made to_page and count_copies integers again. from_page remains a
6996 string however because I want to allow entry of a print range like
6997 "1,4,22-25" using this field.
6999 * src/LyXAction.C: added action info and commands for buffer-print-xtl
7000 and printer-params-get. These aren't useful from the minibuffer but
7001 could be used by a script/LyXServer app provided it passes a suitable
7002 auto_mem_buffer. I guess I should take a look at how the LyXServer
7003 works and make it support xtl buffers.
7005 * sigc++/: updated to libsigc++-1.0.1
7007 * src/xtl/: updated to xtl-1.3.pl.11
7009 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
7010 those changes done to the files in src/ are actually recreated when
7011 they get regenerated. Please don't ever accept a patch that changes a
7012 dialog unless that patch includes the changes to the corresponding *.fd
7015 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
7016 stringOnlyContains, renamed it and generalised it.
7018 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
7019 branch. Removed the remaining old form_print code.
7021 2000-04-26 Allan Rae <rae@lyx.org>
7023 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
7024 trap I was trying to fix with the ID: fields in src/xtl/ :-)
7026 2000-04-25 Allan Rae <rae@lyx.org>
7028 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
7029 against a base of xtl-1.3.pl.4
7031 * development/tools/lxtl.sh: fixed a couple of silly typos and now
7032 filter the Id: entries so they still show the xtl version number
7035 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
7036 into the src/xtl code. Patch still pending with José (XTL)
7038 2000-04-24 Allan Rae <rae@lyx.org>
7040 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
7041 both more generic and much safer. Use the new template functions.
7042 * src/buffer.[Ch] (Dispatch): ditto.
7044 * src/frontends/xforms/FormPrint.C (update): Use new template functions
7045 and mem buffer more intelligently. Also a little general cleanup.
7048 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
7049 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
7050 * src/xtl/Makefile.am: ditto.
7051 * src/xtl/.cvsignore: ditto.
7052 * src/Makefile.am: ditto.
7054 * src/PrinterParams.h: Removed the macros member functions. Added a
7055 testInvariant member function. A bit of tidying up and commenting.
7056 Included Angus's idea for fixing operation with egcs-1.1.2.
7058 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
7059 cool expansion of XTL's mem_buffer to support automatic memory
7060 management within the buffer itself. Removed the various macros and
7061 replaced them with template functions that use either auto_mem_buffer
7062 or mem_buffer depending on a #define. The mem_buffer support will
7063 disappear as soon as the auto_mem_buffer is confirmed to be good on
7064 other platforms/compilers. That is, it's there so you've got something
7067 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
7068 effectively forked XTL. However I expect José will include my code
7069 into the next major release. Also fixed a memory leak.
7070 * src/xtl/text.h: ditto.
7071 * src/xtl/xdr.h: ditto.
7072 * src/xtl/giop.h: ditto.
7074 2000-04-16 Allan Rae <rae@lyx.org>
7076 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
7077 by autogen.sh and removed by maintainer-clean anyway.
7078 * .cvsignore, sigc++/.cvsignore: Support the above.
7080 * sigc++/.cvsignore: Forgot that retbind.h was generated.
7082 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
7084 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
7085 macros, renamed static callback-target member functions to suit new
7086 scheme and made them public.
7087 * src/frontends/xforms/forms/form_print.fd: ditto.
7088 * src/frontends/xforms/forms/form_copyright.fd: ditto.
7090 * src/support/lxtl.h: small cleanup to use typedef instead of #define
7093 * src/xtl/: New directory containing a minimal distribution of XTL.
7094 This is XTL-1.3.pl.4.
7096 * development/tools/lxtl.sh: A script to generate the above mini-dist.
7098 2000-04-15 Allan Rae <rae@lyx.org>
7100 * development/tools/makeLyXsigc.sh: Remove the library version numbers
7102 * sigc++/: Updated to libsigc++-1.0.0
7104 2000-04-14 Allan Rae <rae@lyx.org>
7106 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
7107 use the generic ones in future. I'll modify my conversion script.
7109 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
7111 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
7112 (CloseAllBufferRelatedDialogs): Renamed.
7113 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
7115 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
7116 of the generic ones. These are the same ones my conversion script
7119 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
7120 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
7121 * src/buffer.C (Dispatch): ditto
7123 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
7124 functions for updating and hiding buffer dependent dialogs.
7125 * src/BufferView.C (buffer): ditto
7126 * src/buffer.C (setReadonly): ditto
7127 * src/lyxfunc.C (CloseBuffer): ditto
7129 * src/buffer.h: Take setReadonly() out of line so I don't have to include
7130 Dialogs.h, and hence all the SigC stuff, into every file that includes
7131 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
7133 * src/BufferView2.C: reduce the number of headers included by buffer.h
7135 2000-04-11 Allan Rae <rae@lyx.org>
7137 * src/frontends/xforms/xform_macros.h: A small collection of macros
7138 for building C callbacks.
7140 * src/frontends/xforms/Makefile.am: Added above file.
7142 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
7143 scheme again. This time it should work for JMarc. If this is
7144 successful I'll revise my conversion script to automate some of this.
7145 The static member functions in the class also have to be public for
7146 this scheme will work. If the scheme works (it's almost identical to
7147 the way BufferView::cursorToggleCB is handled so it should work) then
7148 FormCopyright and FormPrint will be ready for inclusion into the main
7149 trunk immediately after 1.1.5 is released -- provided we're prepared
7150 for complaints about lame compilers not handling XTL.
7152 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
7154 2000-04-07 Allan Rae <rae@lyx.org>
7156 * config/lyxinclude.m4: A bit more tidying up (Angus)
7158 * src/LString.h: JMarc's <string> header fix
7160 * src/PrinterParams.h: Used string for most data to remove some
7161 ugly code in the Print dialog and avoid even uglier code when
7162 appending the ints to a string for output.
7164 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
7165 and moved "default:" back to the end of switch statement. Cleaned
7166 up the printing so it uses the right function calls and so the
7167 "print to file" option actually puts the file in the right directory.
7169 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
7171 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
7172 and Ok+Apply button control into a separate method: input (Angus).
7173 (input) Cleaned it up and improved it to be very thorough now.
7174 (All CB) static_cast used instead of C style cast (Angus). This will
7175 probably change again once we've worked out how to keep gcc-2.8.1 happy
7176 with real C callbacks.
7177 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
7178 ignore some of the bool settings and has random numbers instead. Needs
7179 some more investigation. Added other input length checks and checking
7180 of file and printer names.
7182 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
7183 would link (Angus). Seems the old code doesn't compile with the pragma
7184 statement either. Separated callback entries from internal methods.
7186 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
7188 2000-03-17 Allan Rae <rae@lyx.org>
7190 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
7191 need it? Maybe it could go in Dialogs instead? I could make it a
7192 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
7193 values to get the bool return value.
7194 (Dispatch): New overloaded method for xtl support.
7196 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
7197 extern "C" callback instead of static member functions. Hopefully,
7198 JMarc will be able to compile this. I haven't changed
7199 forms/form_copyright.fd yet. Breaking one of my own rules already.
7201 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
7202 because they aren't useful from the minibuffer. Maybe a LyXServer
7203 might want a help message though?
7205 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
7207 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
7208 xtl which needs both rtti and exceptions.
7210 * src/support/Makefile.am:
7211 * src/support/lxtl.h: New file. Some helper macros for using XTL.
7213 * src/frontends/xforms/input_validators.[ch]: input filters and
7214 validators. These conrol what keys are valid in input boxes.
7215 Use them and write some more. Much better idea than waiting till
7216 after the user has pressed Ok to say that the input fields don't make
7219 * src/frontends/xforms/Makefile.am:
7220 * src/frontends/xforms/forms/form_print.fd:
7221 * src/frontends/xforms/forms/makefile:
7222 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
7223 new scheme. Still have to make sure I haven't missed anything from
7224 the current implementation.
7226 * src/Makefile.am, src/PrinterParams.h: New data store.
7228 * other files: Added a couple of copyright notices.
7230 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7232 * src/insets/insetbib.h: move Holder struct in public space.
7234 * src/frontends/include/DialogBase.h: use SigC:: only when
7235 SIGC_CXX_NAMESPACES is defined.
7236 * src/frontends/include/Dialogs.h: ditto.
7238 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
7240 * src/frontends/xforms/FormCopyright.[Ch]: do not
7241 mention SigC:: explicitely.
7243 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7245 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
7246 deals with testing KDE in main configure.in
7247 * configure.in: ditto.
7249 2000-02-22 Allan Rae <rae@lyx.org>
7251 * Lots of files: Merged from HEAD
7253 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
7254 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
7256 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
7258 * sigc++/: new minidist.
7260 2000-02-14 Allan Rae <rae@lyx.org>
7262 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
7264 2000-02-08 Juergen Vigna <jug@sad.it>
7266 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
7267 file for the buildin GUI builder of KDevelop of the copyright-dialog.
7269 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
7270 for this port and so it is much easier for other people to port
7271 dialogs in a common development environment.
7273 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
7274 the QT/KDE implementation.
7276 * src/frontends/kde/Dialogs.C:
7277 * src/frontends/kde/FormCopyright.C:
7278 * src/frontends/kde/FormCopyright.h:
7279 * src/frontends/kde/Makefile.am:
7280 * src/frontends/kde/formcopyrightdialog.C:
7281 * src/frontends/kde/formcopyrightdialog.h:
7282 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
7283 for the kde support of the Copyright-Dialog.
7285 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
7286 subdir-substitution instead of hardcoded 'xforms' as we now have also
7289 * src/frontends/include/DialogBase.h (Object): just commented the
7290 label after #endif (nasty warning and I don't like warnings ;)
7292 * src/main.C (main): added KApplication initialization if using
7295 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
7296 For now only the KDE event-loop is added if frontend==kde.
7298 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
7300 * configure.in: added support for the --with-frontend[=value] option
7302 * autogen.sh: added kde.m4 file to list of config-files
7304 * acconfig.h: added define for KDEGUI-support
7306 * config/kde.m4: added configuration functions for KDE-port
7308 * config/lyxinclude.m4: added --with-frontend[=value] option with
7309 support for xforms and KDE.
7311 2000-02-08 Allan Rae <rae@lyx.org>
7313 * all Makefile.am: Fixed up so the make targets dist, distclean,
7314 install and uninstall all work even if builddir != srcdir. Still
7315 have a new sigc++ minidist update to come.
7317 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
7319 2000-02-01 Allan Rae <rae@lyx.org>
7321 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
7322 Many mods to get builddir != srcdir working.
7324 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
7325 for building on NT and so we can do the builddir != srcdir stuff.
7327 2000-01-30 Allan Rae <rae@lyx.org>
7329 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
7330 This will stay in "rae" branch. We probably don't really need it in
7331 the main trunk as anyone who wants to help programming it should get
7332 a full library installed also. So they can check both included and
7333 system supplied library compilation.
7335 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
7336 Added a 'mini' distribution of libsigc++. If you feel the urge to
7337 change something in these directories - Resist it. If you can't
7338 resist the urge then you should modify the following script and rebuild
7339 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
7340 all happen. Still uses a hacked version of libsigc++'s configure.in.
7341 I'm quite happy with the results. I'm not sure the extra work to turn
7342 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
7343 worth the trouble and would probably lead to extra maintenance
7345 I haven't tested the following important make targets: install, dist.
7346 Not ready for prime time but very close. Maybe 1.1.5.
7348 * development/tools/makeLyXsigc.sh: A shell script to automatically
7349 generate our mini-dist of libsigc++. It can only be used with a CVS
7350 checkout of libsigc++ not a tarball distribution. It's well commented.
7351 This will end up as part of the libsigc++ distribution so other apps
7352 can easily have an included mini-dist. If someone makes mods to the
7353 sigc++ subpackage without modifying this script to generate those
7354 changes I'll be very upset!
7356 * src/frontends/: Started the gui/system indep structure.
7358 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
7359 to access the gui-indep dialogs are in this class. Much improved
7360 design compared to previous revision. Lars, please refrain from
7361 moving this header into src/ like you did with Popups.h last time.
7363 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
7365 * src/frontends/xforms/: Started the gui-indep system with a single
7366 dialog: FormCopyright. Initial testing of use of libsigc++ was very
7369 * src/frontends/xforms/forms: Repository for the xforms .fd files.
7370 Here you'll find a very useful makefile and automated fdfix.sh that
7371 makes updating dailogs a no-brainer -- provided you follow the rules
7372 set out in the README. I'm thinking about adding another script to
7373 automatically generate skeleton code for a new dialog given just the
7376 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
7377 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
7378 Made FormCopyright gui-indep and added a lyxfunc to get to it.
7380 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7382 * src/support/LSubstring.C (operator): simplify
7384 * src/lyxtext.h: removed bparams, use buffer_->params instead
7386 * src/lyxrow.h: make Row a real class, move all variables to
7387 private and use accessors.
7389 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
7391 (isRightToLeftPar): ditto
7392 (ChangeLanguage): ditto
7393 (isMultiLingual): ditto
7396 (SimpleTeXOnePar): ditto
7397 (TeXEnvironment): ditto
7398 (GetEndLabel): ditto
7400 (SetOnlyLayout): ditto
7401 (BreakParagraph): ditto
7402 (BreakParagraphConservative): ditto
7403 (GetFontSettings): ditto
7405 (CopyIntoMinibuffer): ditto
7406 (CutIntoMinibuffer): ditto
7407 (PasteParagraph): ditto
7408 (SetPExtraType): ditto
7409 (UnsetPExtraType): ditto
7410 (DocBookContTableRows): ditto
7411 (SimpleDocBookOneTablePar): ditto
7413 (TeXFootnote): ditto
7414 (SimpleTeXOneTablePar): ditto
7415 (TeXContTableRows): ditto
7416 (SimpleTeXSpecialChars): ditto
7419 * src/lyxcursor.h: make LyXCursor a real class, move all variables
7420 to private and use accessors.
7422 * src/lyx_cb.C: remove char updatetimer, and all code that uses
7423 this, we did not use it anymore and has not been for ages. Just a
7424 waste of cpu cycles.
7426 * src/language.h: make Language a real class, move all variables
7427 to private and use accessors.
7429 * src/BufferView_pimpl.C (Pimpl): use new timer code.
7430 (create_view): remove
7431 (update): some changes for new timer
7432 (cursorToggle): use new timer
7433 (beforeChange): change for new timer
7435 * src/BufferView.h (cursorToggleCB): removed last paramter because
7438 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
7439 (cursorToggleCB): change because of new timer code
7441 * lib/CREDITS: updated own mailaddress
7443 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7445 * src/support/filetools.C (PutEnv): fix the code in case neither
7446 putenv() nor setenv() have been found.
7448 * INSTALL: mention the install-strip Makefile target.
7450 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
7451 read-only documents.
7453 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7455 * lib/reLyX/configure.in (VERSION): avoid using a previously
7456 generated reLyX wrapper to find out $prefix.
7458 * lib/examples/eu_adibide_lyx-atua.lyx:
7459 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
7460 translation of the Tutorial (Dooteo)
7462 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
7464 * forms/cite.fd: new citation dialog
7466 * src/insetcite.[Ch]: the new citation dialog is moved into
7469 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
7472 * src/insets/insetcommand.h: data members made private.
7474 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7476 * LyX 1.1.5 released
7478 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7480 * src/version.h (LYX_RELEASE): to 1.1.5
7482 * src/spellchecker.C (RunSpellChecker): return false if the
7483 spellchecker dies upon creation.
7485 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7487 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
7488 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
7492 * lib/CREDITS: update entry for Martin Vermeer.
7494 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
7496 * src/text.C (draw): Draw foreign language bars at the bottom of
7497 the row instead of at the baseline.
7499 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
7501 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7503 * lib/bind/de_menus.bind: updated
7505 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7507 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
7509 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
7511 * src/menus.C (Limit_string_length): New function
7512 (ShowTocMenu): Limit the number of items/length of items in the
7515 * src/paragraph.C (String): Correct result for a paragraph inside
7518 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7520 * src/bufferlist.C (close): test of buf->getuser() == NULL
7522 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
7524 * src/BufferView2.C (removeAutoInsets): Fix a bug:
7525 Do not call to SetCursor when the paragraph is a closed footnote!
7527 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
7529 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
7532 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
7534 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7537 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
7538 reference popup, that activates the reference-back action
7540 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
7542 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
7543 the menus. Also fixed a bug.
7545 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
7546 the math panels when switching buffers (unless new buffer is readonly).
7548 * src/BufferView.C (NoSavedPositions)
7549 * src/BufferView_pimpl.C (NoSavedPositions): New methods
7551 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7553 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
7554 less of dvi dirty or not.
7556 * src/trans_mgr.[Ch] (insert): change first parameter to string
7559 * src/chset.[Ch] (encodeString): add const to first parameter
7561 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7563 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
7567 * src/LaTeX.C (deplog): better searching for dependency files in
7568 the latex log. Uses now regexps.
7570 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
7571 instead of the box hack or \hfill.
7573 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7575 * src/lyxfunc.C (doImportHelper): do not create the file before
7576 doing the actual import.
7577 (doImportASCIIasLines): create a new file before doing the insert.
7578 (doImportASCIIasParagraphs): ditto.
7580 * lib/lyxrc.example: remove mention of non-existing commands
7582 * lyx.man: remove mention of color-related switches.
7584 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
7586 * src/lyx_gui.C: remove all the color-related ressources, which
7587 are not used anymore.
7589 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
7592 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
7594 * src/lyxrc.C (read): Add a missing break in the switch
7596 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
7598 * src/text2.C (InsertStringA): Fix a bug with insertion into table
7600 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
7603 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7605 * src/text.C (draw): draw bars under foreign language words.
7607 * src/LColor.[Ch]: add LColor::language
7609 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
7611 * src/lyxcursor.h (boundary): New member variable
7613 * src/text.C (IsBoundary): New methods
7615 * src/text.C: Use the above for currect cursor movement when there
7616 is both RTL & LTR text.
7618 * src/text2.C: ditto
7620 * src/bufferview_funcs.C (ToggleAndShow): ditto
7622 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7624 * src/text.C (DeleteLineForward): set selection to true to avoid
7625 that DeleteEmptyParagraphMechanism does some magic. This is how it
7626 is done in all other functions, and seems reasonable.
7627 (DeleteWordForward): do not jump over non-word stuff, since
7628 CursorRightOneWord() already does it.
7630 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
7631 DeleteWordBackward, since they seem safe to me (since selection is
7632 set to "true") DeleteEmptyParagraphMechanism does nothing.
7634 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7636 * src/lyx_main.C (easyParse): simplify the code by factoring the
7637 part that removes parameters from the command line.
7638 (LyX): check wether wrong command line options have been given.
7640 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
7642 * src/lyx_main.C : add support for specifying user LyX
7643 directory via command line option -userdir.
7645 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
7647 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
7648 the number of items per popup.
7649 (Add_to_refs_menu): Ditto.
7651 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7653 * src/lyxparagraph.h: renamed ClearParagraph() to
7654 StripLeadingSpaces() and moved it to paragraph.C. We pass the
7655 textclass as parameter, and do nothing if free_spacing is
7656 true. This fixes part of the line-delete-forward problems.
7658 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
7659 (pasteSelection): ditto.
7660 (SwitchLayoutsBetweenClasses): more translatable strings.
7662 * src/text2.C (CutSelection): use StripLeadingSpaces.
7663 (PasteSelection): ditto.
7664 (DeleteEmptyParagraphMechanism): ditto.
7666 2000-05-26 Juergen Vigna <jug@sad.it>
7668 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
7669 is not needed in tabular insets.
7671 * src/insets/insettabular.C (TabularFeatures): added missing features.
7673 * src/tabular.C (DeleteColumn):
7675 (AppendRow): implemented this functions
7676 (cellsturct::operator=): clone the inset too;
7678 2000-05-23 Juergen Vigna <jug@sad.it>
7680 * src/insets/insettabular.C (LocalDispatch): better selection support
7681 when having multicolumn-cells.
7683 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7685 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
7687 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7689 * src/ColorHandler.C (getGCForeground): put more test into _()
7691 * lib/examples/eu_splash.lyx: new file (Basque translation) from
7694 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
7697 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
7699 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
7700 there are no labels, or when buffer is readonly.
7702 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
7703 there are no labels, buffer is SGML, or when buffer is readonly.
7705 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7707 * src/LColor.C (LColor): change a couple of grey40 to grey60
7708 (LColor): rewore initalization to make compiles go some magnitude
7710 (getGUIName): don't use gettext until we need the string.
7712 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
7714 * src/Bullet.[Ch]: Fixed a small bug.
7716 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
7718 * src/paragraph.C (String): Several fixes/improvements
7720 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
7722 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7724 * src/paragraph.C (String): give more correct output.
7726 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
7728 * src/lyxfont.C (stateText) Do not output the language if it is
7729 eqaul to the language of the document.
7731 * src/paragraph.C (TeXOnePar): Do not put language switch commands
7732 between two paragraphs with the same language.
7734 * src/paragraph.C (getParLanguage) Return a correct answer for an
7735 empty dummy paragraph.
7737 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
7740 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7743 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7744 the menus/popup, if requested fonts are unavailable.
7746 2000-05-22 Juergen Vigna <jug@sad.it>
7748 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7749 movement support (Up/Down/Tab/Shift-Tab).
7750 (LocalDispatch): added also preliminari cursor-selection.
7752 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7754 * src/paragraph.C (PasteParagraph): Hopefully now right!
7756 2000-05-22 Garst R. Reese <reese@isn.net>
7758 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7759 of list, change all references to Environment to Command
7760 * tex/hollywood.cls : rewrite environments as commands, add
7761 \uppercase to interiorshot and exteriorshot to force uppecase.
7762 * tex/broadway.cls : rewrite environments as commands. Tweak
7765 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7767 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7768 size of items: use a constant intead of the hardcoded 40, and more
7769 importantly do not remove the %m and %x tags added at the end.
7770 (Add_to_refs_menu): use vector::size_type instead of
7771 unsigned int as basic types for the variables. _Please_ do not
7772 assume that size_t is equal to unsigned int. On an alpha, this is
7773 unsigned long, which is _not_ the same.
7775 * src/language.C (initL): remove language "hungarian", since it
7776 seems that "magyar" is better.
7778 2000-05-22 Juergen Vigna <jug@sad.it>
7780 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7782 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7785 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7786 next was deleted but not set to 0.
7788 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7790 * src/language.C (initL): change the initialization of languages
7791 so that compiles goes _fast_.
7793 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7796 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7798 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7802 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7804 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7806 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7810 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7813 * src/insets/insetlo*.[Ch]: Made editable
7815 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7817 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7818 the current selection.
7820 * src/BufferView_pimpl.C (stuffClipboard): new method
7822 * src/BufferView.C (stuffClipboard): new method
7824 * src/paragraph.C (String): new method
7826 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7827 LColor::ignore when lyxname is not found.
7829 * src/BufferView.C (pasteSelection): new method
7831 * src/BufferView_pimpl.C (pasteSelection): new method
7833 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7835 * src/WorkArea.C (request_clipboard_cb): new static function
7836 (getClipboard): new method
7837 (putClipboard): new method
7839 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7841 * LyX 1.1.5pre2 released
7843 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7845 * src/vspace.C (operator=): removed
7846 (operator=): removed
7848 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7850 * src/layout.C (NumberOfClass): manually set the type in make_pair
7851 (NumberOfLayout): ditto
7853 * src/language.C: use the Language constructor for ignore_lang
7855 * src/language.h: add constructors to struct Language
7857 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7859 * src/text2.C (SetCursorIntern): comment out #warning
7861 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7863 * src/mathed/math_iter.h: initialize sx and sw to 0
7865 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7867 * forms/lyx.fd: Redesign of form_ref
7869 * src/LaTeXFeatures.[Ch]
7873 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7876 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7877 and Buffer::inset_iterator.
7879 * src/menus.C: Added new menus: TOC and Refs.
7881 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7883 * src/buffer.C (getTocList): New method.
7885 * src/BufferView2.C (ChangeRefs): New method.
7887 * src/buffer.C (getLabelList): New method. It replaces the old
7888 getReferenceList. The return type is vector<string> instead of
7891 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7892 the old getLabel() and GetNumberOfLabels() methods.
7893 * src/insets/insetlabel.C (getLabelList): ditto
7894 * src/mathed/formula.C (getLabelList): ditto
7896 * src/paragraph.C (String): New method.
7898 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7899 Uses the new getTocList() method.
7900 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7901 which automatically updates the contents of the browser.
7902 (RefUpdateCB): Use the new getLabelList method.
7904 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7906 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7908 * src/spellchecker.C: Added using std::reverse;
7910 2000-05-19 Juergen Vigna <jug@sad.it>
7912 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7914 * src/insets/insettext.C (computeTextRows): small fix for display of
7915 1 character after a newline.
7917 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7920 2000-05-18 Juergen Vigna <jug@sad.it>
7922 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7923 when changing width of column.
7925 * src/tabular.C (set_row_column_number_info): setting of
7926 autobreak rows if necessary.
7928 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7930 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7932 * src/vc-backend.*: renamed stat() to status() and vcstat to
7933 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7934 compilation broke. The new name seems more relevant, anyway.
7936 2000-05-17 Juergen Vigna <jug@sad.it>
7938 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7939 which was wrong if the removing caused removing of rows!
7941 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7942 (pushToken): new function.
7944 * src/text2.C (CutSelection): fix problem discovered with purify
7946 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7948 * src/debug.C (showTags): enlarge the first column, now that we
7949 have 6-digits debug codes.
7951 * lib/layouts/hollywood.layout:
7952 * lib/tex/hollywood.cls:
7953 * lib/tex/brodway.cls:
7954 * lib/layouts/brodway.layout: more commands and fewer
7955 environments. Preambles moved in the .cls files. Broadway now has
7956 more options on scene numbering and less whitespace (from Garst)
7958 * src/insets/insetbib.C (getKeys): make sure that we are in the
7959 document directory, in case the bib file is there.
7961 * src/insets/insetbib.C (Latex): revert bogus change.
7963 2000-05-16 Juergen Vigna <jug@sad.it>
7965 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7966 the TabularLayout on cursor move.
7968 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7970 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7973 (draw): fixed cursor position and drawing so that the cursor is
7974 visible when before the tabular-inset.
7976 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7977 when creating from old insettext.
7979 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7981 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7983 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7984 * lib/tex/brodway.cls: ditto
7986 * lib/layouts/brodway.layout: change alignment of parenthical
7989 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7991 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7992 versions 0.88 and 0.89 are supported.
7994 2000-05-15 Juergen Vigna <jug@sad.it>
7996 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7999 * src/insets/insettext.C (computeTextRows): redone completely this
8000 function in a much cleaner way, because of problems when having a
8002 (draw): added a frame border when the inset is locked.
8003 (SetDrawLockedFrame): this sets if we draw the border or not.
8004 (SetFrameColor): this sets the frame color (default=insetframe).
8006 * src/insets/lyxinset.h: added x() and y() functions which return
8007 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
8008 function which is needed to see if we have a locking inset of some
8009 type in this inset (needed for now in insettabular).
8011 * src/vspace.C (inPixels): the same function also without a BufferView
8012 parameter as so it is easier to use it in some ocasions.
8014 * src/lyxfunc.C: changed all places where insertInset was used so
8015 that now if it couldn't be inserted it is deleted!
8017 * src/TabularLayout.C:
8018 * src/TableLayout.C: added support for new tabular-inset!
8020 * src/BufferView2.C (insertInset): this now returns a bool if the
8021 inset was really inserted!!!
8023 * src/tabular.C (GetLastCellInRow):
8024 (GetFirstCellInRow): new helper functions.
8025 (Latex): implemented for new tabular class.
8029 (TeXTopHLine): new Latex() helper functions.
8031 2000-05-12 Juergen Vigna <jug@sad.it>
8033 * src/mathed/formulamacro.C (Read):
8034 * src/mathed/formula.C (Read): read also the \end_inset here!
8036 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
8038 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
8039 crush when saving formulae with unbalanced parenthesis.
8041 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
8043 * src/layout.C: Add new keyword "endlabelstring" to layout file
8045 * src/text.C (GetVisibleRow): Draw endlabel string.
8047 * lib/layouts/broadway.layout
8048 * lib/layouts/hollywood.layout: Added endlabel for the
8049 Parenthetical layout.
8051 * lib/layouts/heb-article.layout: Do not use slanted font shape
8052 for Theorem like environments.
8054 * src/buffer.C (makeLaTeXFile): Always add "american" to
8055 the UsedLanguages list if document language is RTL.
8057 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8059 * add addendum to README.OS2 and small patch (from SMiyata)
8061 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8063 * many files: correct the calls to ChangeExtension().
8065 * src/support/filetools.C (ChangeExtension): remove the no_path
8066 argument, which does not belong there. Use OnlyFileName() instead.
8068 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
8069 files when LaTeXing a non-nice latex file.
8071 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
8072 a chain of "if". Return false when deadkeys are not handled.
8074 * src/lyx_main.C (LyX): adapted the code for default bindings.
8076 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
8077 bindings for basic functionality (except deadkeys).
8078 (deadKeyBindings): new method. Performs the bindings of deadkeys.
8080 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
8081 several methods: handle override_x_deadkeys.
8083 * src/lyxrc.h: remove the "bindings" map, which did not make much
8084 sense anyway. New variable override_x_deadkeys, defaulting to "true".
8086 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8088 * src/lyxfont.C (stateText): use a saner method to determine
8089 whether the font is "default". Seems to fix the crash with DEC
8092 * src/Bullet.[Ch] (Bullet): remove const on parameters.
8094 2000-05-08 Juergen Vigna <jug@sad.it>
8096 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
8097 TabularLayoutMenu with mouse-button-3
8098 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
8100 * src/TabularLayout.C: added this file for having a Layout for
8103 2000-05-05 Juergen Vigna <jug@sad.it>
8105 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
8106 recalculating inset-widths.
8107 (TabularFeatures): activated this function so that I can change
8108 tabular-features via menu.
8110 * src/menus.C (ShowEditMenu): inserted support for insettabular so
8111 that I can test some functions with the Table menu.
8113 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8115 * src/lyxfont.C (stateText): guard against stupid c++libs.
8117 * src/tabular.C: add using std::vector
8118 some whitespace changes, + removed som autogenerated code.
8120 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
8122 2000-05-05 Juergen Vigna <jug@sad.it>
8124 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
8125 row, columns and cellstructures.
8127 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8129 * lib/lyxrc.example: remove obsolete entries.
8131 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
8132 reading of protected_separator for free_spacing.
8134 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8136 * src/text.C (draw): do not display an exclamation mark in the
8137 margin for margin notes. This is confusing, ugly and
8140 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
8141 AMS math' is checked.
8143 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
8144 name to see whether including the amsmath package is needed.
8146 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
8148 * src/paragraph.C (validate): Compute UsedLanguages correctly
8149 (don't insert the american language if it doesn't appear in the
8152 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
8153 The argument of \thanks{} command is considered moving argument
8155 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
8158 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
8160 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
8161 for appendix/minipage/depth. The lines can be now both in the footnote
8162 frame, and outside the frame.
8164 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
8167 2000-05-05 Juergen Vigna <jug@sad.it>
8169 * src/table.[Ch]: removed the inset and buffer stuff as this is now
8170 neede only in tabular.[Ch].
8172 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8174 * src/insets/insetspecialchar.C (Read): allow command == '~' for
8176 (Write): write '~' for PROTECTED_SEPARATOR
8178 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8180 * src/lyxparagraph.h: add a friend struct matchIT after the struct
8183 * src/mathed/formula.C (drawStr): rename size to siz.
8185 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
8186 possibly fix a bug by not changing the pflags = flags to piflags =
8189 2000-05-05 Juergen Vigna <jug@sad.it>
8191 * src/insets/insetbib.C: moved using directive
8193 * src/ImportNoweb.C: small fix for being able to compile (missing
8196 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8198 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
8199 to use clear, since we don't depend on this in the code. Add test
8202 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8204 * (various *.C files): add using std::foo directives to please dec
8207 * replace calls to string::clear() to string::erase() (Angus)
8209 * src/cheaders/cmath: modified to provide std::abs.
8211 2000-05-04 Juergen Vigna <jug@sad.it>
8213 * src/insets/insettext.C: Prepared all for inserting of multiple
8214 paragraphs. Still display stuff to do (alignment and other things),
8215 but I would like to use LyXText to do this when we cleaned out the
8216 table-support stuff.
8218 * src/insets/insettabular.C: Changed lot of stuff and added lots
8219 of functionality still a lot to do.
8221 * src/tabular.C: Various functions changed name and moved to be
8222 const functions. Added new Read and Write functions and changed
8223 lots of things so it works good with tabular-insets (also removed
8224 some stuff which is not needed anymore * hacks *).
8226 * src/lyxcursor.h: added operators == and != which just look if
8227 par and pos are (not) equal.
8229 * src/buffer.C (latexParagraphs): inserted this function to latex
8230 all paragraphs form par to endpar as then I can use this too for
8233 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
8234 so that I can call this to from text insets with their own cursor.
8236 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
8237 output off all paragraphs (because of the fix below)!
8239 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
8240 the very last paragraph (this could be also the last paragraph of an
8243 * src/texrow.h: added rows() call which returns the count-variable.
8245 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
8247 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
8249 * lib/configure.m4: better autodetection of DocBook tools.
8251 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8253 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
8255 * src/lyx_cb.C: add using std::reverse;
8257 * src/LaTeX.C (run): on error always run deleteFilesOnError before
8260 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
8261 selected files. Should fix repeated errors from generated files.
8263 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
8265 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
8267 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
8268 the spellchecker popup.
8270 * lib/lyxrc.example: Removed the \number_inset section
8272 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8274 * src/insets/figinset.C (various): Use IsFileReadable() to make
8275 sure that the file actually exist. Relying on ghostscripts errors
8276 is a bad idea since they can lead to X server crashes.
8278 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
8280 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
8283 * lib/lyxrc.example: smallish typo in description of
8284 \view_dvi_paper_option
8286 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8289 * src/lyxfunc.C: doImportHelper to factor out common code of the
8290 various import methods. New functions doImportASCIIasLines,
8291 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
8292 doImportLinuxDoc for the format specific parts.
8295 * buffer.C: Dispatch returns now a bool to indicate success
8298 * lyx_gui.C: Add getLyXView() for member access
8300 * lyx_main.C: Change logic for batch commands: First try
8301 Buffer::Dispatch (possibly without GUI), if that fails, use
8304 * lyx_main.C: Add support for --import command line switch.
8305 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
8306 Available Formats: Everything accepted by 'buffer-import <format>'
8308 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8310 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
8313 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
8314 documents will be reformatted upon reentry.
8316 2000-04-27 Juergen Vigna <jug@sad.it>
8318 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
8319 correctly only last pos this was a bug.
8321 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8323 * release of lyx-1.1.5pre1
8325 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8327 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
8329 * src/menus.C: revert the change of naming (Figure->Graphic...)
8330 from 2000-04-11. It was incomplete and bad.
8332 * src/LColor.[Ch]: add LColor::depthbar.
8333 * src/text.C (GetVisibleRow): use it.
8335 * README: update the languages list.
8337 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8339 * src/text.C (GetVisibleRow): show the depth of paragraphs using
8342 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8344 * README: remove sections that were just wrong.
8346 * src/text2.C (GetRowNearY): remove currentrow code
8348 * src/text.C (GetRow): remove currentrow code
8350 * src/screen.C (Update): rewritten a bit.
8351 (SmallUpdate): removed func
8353 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
8355 (FullRebreak): return bool
8356 (currentrow): remove var
8357 (currentrow_y): ditto
8359 * src/lyxscreen.h (Draw): change arg to unsigned long
8360 (FitCursor): return bool
8361 (FitManualCursor): ditto
8362 (Smallpdate): remove func
8363 (first): change to unsigned long
8364 (DrawOneRow): change second arg to long (from long &)
8365 (screen_refresh_y): remove var
8366 (scree_refresh_row): ditto
8368 * src/lyxrow.h: change baseline to usigned int from unsigned
8369 short, this brings some implicit/unsigned issues out in the open.
8371 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
8373 (Dispatch): don't call updateScrollbar after fitCursor. Use update
8374 instead of smallUpdate.
8376 * src/lyxcursor.h: change y to unsigned long
8378 * src/buffer.h: don't call updateScrollbar after fitcursor
8380 * src/buffer.C (parseSingleLyXformat2Token): move variables to
8381 where they are used. Removed "\\direction", this was not present
8382 in 1.1.4 and is already obsolete. Commented out some code that I
8383 believe to never be called.
8384 (runLiterate): don't call updateScrollbar after fitCursor
8386 (buildProgram): ditto
8389 * src/WorkArea.h (workWidth): change return val to unsigned
8392 (redraw): remove the button redraws
8393 (setScrollbarValue): change for scrollbar
8394 (getScrollbarValue): change for scrollbar
8395 (getScrollbarBounds): change for scrollbar
8397 * src/WorkArea.C (C_WorkArea_up_cb): removed func
8398 (C_WorkArea_down_cb): removed func
8399 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
8400 (resize): change for scrollbar
8401 (setScrollbar): ditto
8402 (setScrollbarBounds): ditto
8403 (setScrollbarIncrements): ditto
8404 (up_cb): removed func
8405 (down_cb): removed func
8406 (scroll_cb): change for scrollbar
8407 (work_area_handler): ditto
8409 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
8410 when FitCursor did something.
8411 (updateScrollbar): some unsigned changes
8412 (downCB): removed func
8413 (scrollUpOnePage): removed func
8414 (scrollDownOnePage): remvoed func
8415 (workAreaMotionNotify): don't call screen->FitCursor but use
8416 fitCursor instead. and bool return val
8417 (workAreaButtonPress): ditto
8418 (workAreaButtonRelease): some unsigned changes
8419 (checkInsetHit): ditto
8420 (workAreaExpose): ditto
8421 (update): parts rewritten, comments about the signed char arg added
8422 (smallUpdate): removed func
8423 (cursorPrevious): call needed updateScrollbar
8426 * src/BufferView2.C (allFloats): don't call updateScrollbar after
8429 * src/BufferView.[Ch] (upCB): removed func
8430 (downCB): removed func
8431 (smallUpdate): removed func
8433 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8435 * src/lyxtext.h src/text.C src/text2.C: removed support for the
8436 currentrow, currentrow_y optimization. This did not help a lot and
8437 if we want to do this kind of optimization we should rather use
8438 cursor.row instead of the currentrow.
8440 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
8441 buffer spacing and klyx spacing support.
8443 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
8445 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
8448 2000-04-26 Juergen Vigna <jug@sad.it>
8450 * src/insets/figinset.C: fixes to Lars sstream changes!
8452 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
8454 * A lot of files: Added Ascii(ostream &) methods to all inset
8455 classes. Used when exporting to ASCII.
8457 * src/buffer.C (writeFileAscii,RoffAsciiTable)
8458 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
8461 * src/text2.C (ToggleFree): Disabled implicit word selection when
8462 there is a change in the language
8464 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
8465 no output was generated for end-of-sentence inset.
8467 * src/insets/lyxinset.h
8470 * src/paragraph.C: Removed the insetnumber code
8472 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
8474 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8476 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
8477 no_babel and no_epsfig completely from the file.
8478 (parseSingleLyXformat2Token): add handling for per-paragraph
8479 spacing as written by klyx.
8481 * src/insets/figinset.C: applied patch by Andre. Made it work with
8484 2000-04-20 Juergen Vigna <jug@sad.it>
8486 * src/insets/insettext.C (cutSelection):
8487 (copySelection): Fixed with selection from right to left.
8488 (draw): now the rows are not recalculated at every draw.
8489 (computeTextRows): for now reset the inset-owner here (this is
8490 important for an undo or copy where the inset-owner is not set
8493 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
8494 motion to the_locking_inset screen->first was forgotten, this was
8495 not important till we got multiline insets.
8497 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8499 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
8500 code seems to be alright (it is code changed by Dekel, and the
8501 intent is indeed that all macros should be defined \protect'ed)
8503 * NEWS: a bit of reorganisation of the new user-visible features.
8505 2000-04-19 Juergen Vigna <jug@sad.it>
8507 * src/insets/insettext.C (init): using a LyXCursor now for cursor
8508 position. Set the inset_owner of the used paragraph so that it knows
8509 that it is inside an inset. Fixed cursor handling with mouse and
8510 cursor keys. Fixed wrong timed inset redraws and lots of other changes
8511 and cleanups to make TextInsets work better.
8513 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
8514 Changed parameters of various functions and added LockInsetInInset().
8516 * src/insets/insettext.C:
8518 * src/insets/insetcollapsable.h:
8519 * src/insets/insetcollapsable.C:
8520 * src/insets/insetfoot.h:
8521 * src/insets/insetfoot.C:
8522 * src/insets/insetert.h:
8523 * src/insets/insetert.C: cleaned up the code so that it works now
8524 correctly with insettext.
8526 * src/insets/inset.C:
8527 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
8528 that insets in insets are supported right.
8531 * src/table.C: lots of changes for use with inset tabular (and cleanup)
8533 * src/paragraph.C: some small fixes
8535 * src/debug.h: inserted INSETS debug info
8537 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
8538 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
8540 * src/commandtags.h:
8541 * src/LyXAction.C: insert code for InsetTabular.
8543 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
8544 not Button1MotionMask.
8545 (workAreaButtonRelease): send always a InsetButtonRelease event to
8547 (checkInsetHit): some setCursor fixes (always with insets).
8549 * src/BufferView2.C (lockInset): returns a bool now and extended for
8550 locking insets inside insets.
8551 (showLockedInsetCursor): it is important to have the cursor always
8552 before the locked inset.
8553 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
8555 * src/BufferView.h: made lockInset return a bool.
8557 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
8559 * src/text2.C (SetCursor): This now has a version with a LyXCursor
8560 that is used also internally but can be called as public to have back
8561 a cursor pos which is not set internally.
8562 (SetCursorIntern): Changed to use above function.
8564 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
8566 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8571 * NEWS: updated for prerelease of 1.1.5. Please comment and send
8572 patches for things that should be in or should be changed.
8574 * src/* [insetfiles]: change "usigned char fragile" to bool
8575 fragile. There was only one point that could that be questioned
8576 and that is commented in formulamacro.C. Grep for "CHECK".
8578 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
8579 (DeleteBuffer): take it out of CutAndPaste and make it static.
8581 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8583 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
8584 output the spacing envir commands. Also the new commands used in
8585 the LaTeX output makes the result better.
8587 * src/Spacing.C (writeEnvirBegin): new method
8588 (writeEnvirEnd): new method
8590 2000-04-18 Juergen Vigna <jug@sad.it>
8592 * src/CutAndPaste.C: made textclass a static member of the class
8593 as otherwise it is not accesed right!!!
8595 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
8597 * forms/layout_forms.fd
8598 * src/layout_forms.h
8599 * src/layout_forms.C (create_form_form_character)
8600 * src/lyx_cb.C (UserFreeFont)
8601 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
8602 documents (in the layout->character popup).
8604 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8606 * src/spellchecker.C (create_ispell_pipe): fix a bug where
8607 \spell_command was in fact not honored (from Kevin Atkinson).
8609 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
8612 * src/lyx_gui.h: make lyxViews private (Angus)
8614 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
8616 * src/mathed/math_write.C
8617 (MathMatrixInset::Write) Put \protect before \begin{array} and
8618 \end{array} if fragile
8619 (MathParInset::Write): Put \protect before \\ if fragile
8621 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8623 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
8624 initialization if the LyXColorHandler must be done after the
8625 connections to the XServer has been established.
8627 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
8628 get the background pixel from the lyxColorhandler so that the
8629 figures are rendered with the correct background color.
8630 (NextToken): removed functions.
8631 (GetPSSizes): use ifs >> string instead of NextToken.
8633 * src/Painter.[Ch]: the color cache moved out of this file.
8635 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
8638 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8640 * src/WorkArea.C (work_area_handler): call BufferView::enterView
8641 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
8643 * src/BufferView.C (enterView): new func
8644 (leaveView): new func
8646 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
8648 (leaveView): new func, undefines xterm cursor when approp.
8650 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
8651 (AllowInput): delete the Workarea cursor handling from this func.
8653 * src/Painter.C (underline): draw a slimer underline in most cases.
8655 * src/lyx_main.C (error_handler): use extern "C"
8657 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8659 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
8660 sent directly to me.
8662 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
8663 to the list by Dekel.
8665 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
8668 * src/bufferview_funcs.[Ch]: two new files, moved several of the
8669 methods from lyx_cb.here.
8671 * src/lyx_cb.C: in addition to the above; removed input_prohibited
8674 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8676 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
8677 instead of using current_view directly.
8679 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
8681 * src/LyXAction.C (init): add the paragraph-spacing command.
8683 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
8685 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
8687 * src/lyx_cb.C (CurrentState): output a string when the spacing is
8688 different from the documents.
8690 * src/text.C (SetHeightOfRow): take paragraph spacing into
8691 account, paragraph spacing takes precedence over buffer spacing
8692 (GetVisibleRow): ditto
8694 * src/paragraph.C (writeFile): output the spacing parameter too.
8695 (validate): set the correct features if spacing is used in the
8697 (Clear): set spacing to default
8698 (MakeSameLayout): spacing too
8699 (HasSameLayout): spacing too
8700 (SetLayout): spacing too
8701 (TeXOnePar): output the spacing commands
8703 * src/lyxparagraph.h: added a spacing variable for use with
8704 per-paragraph spacing.
8706 * src/Spacing.h: add a Default spacing and a method to check if
8707 the current spacing is default. also added an operator==
8709 * src/text2.C (DeleteEmptyParagraphMechanism): added a
8712 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8714 * src/lyxserver.C (callback): fix dispatch of functions
8716 * src/insets/insetlatexaccent.C (checkContents): turn bogus
8717 printf() into lyxerr call.
8719 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
8722 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
8723 "Table" to "Table Box", "Float" to "Floating Material"; deletes
8724 the "Float" from each of the subitems.
8725 (ShowHelpMenu): add entry for "FAQ" and "TOC".
8727 * src/support/DebugStream.h: add an #ifdef to work around a gcc
8728 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
8729 documented the change so that the workaround can be nuked later.
8731 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
8734 * src/lyxlex_pimpl.C (next): do not re-declare the default value
8736 * src/buffer.C (getLatexName): ditto
8737 (setReadonly): ditto
8739 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8741 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
8742 avoid some uses of current_view. Added also a bufferParams()
8743 method to get at this.
8745 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8747 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8749 * src/lyxparagraph.[Ch]: removed
8750 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8751 with operators used by lower_bound and
8752 upper_bound in InsetTable's
8753 Make struct InsetTable private again. Used matchpos.
8755 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8757 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8758 document, the language of existing text is changed (unless the
8759 document is multi-lingual)
8761 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8763 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8765 * A lot of files: A rewrite of the Right-to-Left support.
8767 2000-04-10 Juergen Vigna <jug@sad.it>
8769 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8770 misplaced cursor when inset in inset is locked.
8772 * src/insets/insettext.C (LocalDispatch): small fix so that a
8773 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8775 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8776 footnote font should be decreased in size twice when displaying.
8778 * src/insets/insettext.C (GetDrawFont): inserted this function as
8779 the drawing-font may differ from the real paragraph font.
8781 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8782 insets (inset in inset!).
8784 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8785 function here because we don't want footnotes inside footnotes.
8787 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8789 (init): now set the inset_owner in paragraph.C
8790 (LocalDispatch): added some resetPos() in the right position
8793 (pasteSelection): changed to use the new CutAndPaste-Class.
8795 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8796 which tells if it is allowed to insert another inset inside this one.
8798 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8799 SwitchLayoutsBetweenClasses.
8801 * src/text2.C (InsertInset): checking of the new paragraph-function
8803 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8804 is not needed anymore here!
8807 (PasteSelection): redone (also with #ifdef) so that now this uses
8808 the CutAndPaste-Class.
8809 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8812 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8813 from/to text/insets.
8815 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8816 so that the paragraph knows if it is inside an (text)-inset.
8817 (InsertFromMinibuffer): changed return-value to bool as now it
8818 may happen that an inset is not inserted in the paragraph.
8819 (InsertInsetAllowed): this checks if it is allowed to insert an
8820 inset in this paragraph.
8822 (BreakParagraphConservative):
8823 (BreakParagraph) : small change for the above change of the return
8824 value of InsertFromMinibuffer.
8826 * src/lyxparagraph.h: added inset_owner and the functions to handle
8827 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8829 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8831 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8832 functions from BufferView to BufferView::Pimpl to ease maintence.
8834 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8835 correctly. Also use SetCursorIntern instead of SetCursor.
8837 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8840 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8842 * src/WorkArea.C (belowMouse): manually implement below mouse.
8844 * src/*: Add "explicit" on several constructors, I added probably
8845 some unneeded ones. A couple of changes to code because of this.
8847 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8848 implementation and private parts from the users of BufferView. Not
8851 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8852 implementation and private parts from the users of LyXLex. Not
8855 * src/BufferView_pimpl.[Ch]: new files
8857 * src/lyxlex_pimpl.[Ch]: new files
8859 * src/LyXView.[Ch]: some inline functions move out-of-line
8861 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8863 * src/lyxparagraph.h: make struct InsetTable public.
8865 * src/support/lyxstring.h: change lyxstring::difference_type to be
8866 ptrdiff_t. Add std:: modifiers to streams.
8868 * src/font.C: include the <cctype> header, for islower() and
8871 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8873 * src/font.[Ch]: new files. Contains the metric functions for
8874 fonts, takes a LyXFont as parameter. Better separation of concepts.
8876 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8877 changes because of this.
8879 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8881 * src/*: compile with -Winline and move functions that don't
8884 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8887 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8889 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8890 (various files changed because of this)
8892 * src/Painter.C (text): fixed the drawing of smallcaps.
8894 * src/lyxfont.[Ch] (drawText): removed unused member func.
8897 * src/*.C: added needed "using" statements and "std::" qualifiers.
8899 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8901 * src/*.h: removed all use of "using" from header files use
8902 qualifier std:: instead.
8904 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8906 * src/text.C (Backspace): some additional cleanups (we already
8907 know whether cursor.pos is 0 or not).
8909 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8910 automake does not provide one).
8912 * src/bmtable.h: replace C++ comments with C comments.
8914 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8916 * src/screen.C (ShowCursor): Change the shape of the cursor if
8917 the current language is not equal to the language of the document.
8918 (If the cursor change its shape unexpectedly, then you've found a bug)
8920 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8923 * src/insets/insetnumber.[Ch]: New files.
8925 * src/LyXAction.C (init)
8926 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8929 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8931 * src/lyxparagraph.h
8932 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8933 (the vector is kept sorted).
8935 * src/text.C (GetVisibleRow): Draw selection correctly when there
8936 is both LTR and RTL text.
8938 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8939 which is much faster.
8941 * src/text.C (GetVisibleRow and other): Do not draw the last space
8942 in a row if the direction of the last letter is not equal to the
8943 direction of the paragraph.
8945 * src/lyxfont.C (latexWriteStartChanges):
8946 Check that font language is not equal to basefont language.
8947 (latexWriteEndChanges): ditto
8949 * src/lyx_cb.C (StyleReset): Don't change the language while using
8950 the font-default command.
8952 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8953 empty paragraph before a footnote.
8955 * src/insets/insetcommand.C (draw): Increase x correctly.
8957 * src/screen.C (ShowCursor): Change cursor shape if
8958 current language != document language.
8960 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8962 2000-03-31 Juergen Vigna <jug@sad.it>
8964 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8965 (Clone): changed mode how the paragraph-data is copied to the
8966 new clone-paragraph.
8968 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8969 GetInset(pos) with no inset anymore there (in inset UNDO)
8971 * src/insets/insetcommand.C (draw): small fix as here x is
8972 incremented not as much as width() returns (2 before, 2 behind = 4)
8974 2000-03-30 Juergen Vigna <jug@sad.it>
8976 * src/insets/insettext.C (InsetText): small fix in initialize
8977 widthOffset (should not be done in the init() function)
8979 2000-03-29 Amir Karger <karger@lyx.org>
8981 * lib/examples/it_ItemizeBullets.lyx: translation by
8984 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8986 2000-03-29 Juergen Vigna <jug@sad.it>
8988 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8990 * src/insets/insetfoot.C (Clone): small change as for the below
8991 new init function in the text-inset
8993 * src/insets/insettext.C (init): new function as I've seen that
8994 clone did not copy the Paragraph-Data!
8995 (LocalDispatch): Added code so that now we have some sort of Undo
8996 functionality (well actually we HAVE Undo ;)
8998 * src/text.C (Backspace): Small fix for the a | a Backspace problem
9000 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
9002 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
9005 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9007 * src/main.C: added a runtime check that verifies that the xforms
9008 header used when building LyX and the library used when running
9009 LyX match. Exit with a message if they don't match. This is a
9010 version number check only.
9012 * src/buffer.C (save): Don't allocate memory on the heap for
9013 struct utimbuf times.
9015 * *: some using changes, use iosfwd instead of the real headers.
9017 * src/lyxfont.C use char const * instead of string for the static
9018 strings. Rewrite some functions to use sstream.
9020 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9022 * src/text.C (Backspace): hopefully fix the dreaded backaspace
9025 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9027 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
9028 of Geodesy (from Martin Vermeer)
9030 * lib/layouts/svjour.inc: include file for the Springer svjour
9031 class. It can be used to support journals other than JoG.
9033 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
9034 Miskiewicz <misiek@pld.org.pl>)
9035 * lib/reLyX/Makefile.am: ditto.
9037 2000-03-27 Juergen Vigna <jug@sad.it>
9039 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
9040 also some modifications with operations on selected text.
9042 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
9043 problems with clicking on insets (last famous words ;)
9045 * src/insets/insetcommand.C (draw):
9046 (width): Changed to have a bit of space before and after the inset so
9047 that the blinking cursor can be seen (otherwise it was hidden)
9049 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9051 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
9052 would not be added to the link list when an installed gettext (not
9053 part of libc) is found.
9055 2000-03-24 Juergen Vigna <jug@sad.it>
9057 * src/insets/insetcollapsable.C (Edit):
9058 * src/mathed/formula.C (InsetButtonRelease):
9059 (InsetButtonPress): fixed for new handling of ButtonPress/Release
9062 * src/BufferView.C (workAreaButtonPress):
9063 (workAreaButtonRelease):
9064 (checkInsetHit): Finally fixed the clicking on insets be handled
9067 * src/insets/insetert.C (Edit): inserted this call so that ERT
9068 insets work always with LaTeX-font
9070 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9072 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
9073 caused lyx to startup with no GUI in place, causing in a crash
9074 upon startup when called with arguments.
9076 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9078 * src/FontLoader.C: better initialization of dummyXFontStruct.
9080 2000-03-20 José Abílio Matos <jamatos@lyx.org>
9082 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
9083 for linuxdoc and docbook import and export format options.
9085 * lib/lyxrc.example Example of default values for the previous flags.
9087 * src/lyx_cb.C Use those flags instead of the hardwired values for
9088 linuxdoc and docbook export.
9090 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
9093 * src/menus.C Added menus entries for the new import/exports formats.
9095 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9097 * src/lyxrc.*: Added support for running without Gui
9100 * src/FontLoader.C: sensible defaults if no fonts are needed
9102 * src/lyx_cb.C: New function ShowMessage (writes either to the
9103 minibuffer or cout in case of no gui
9104 New function AskOverwrite for common stuff
9105 Consequently various changes to call these functions
9107 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
9108 wild guess at sensible screen resolution when having no gui
9110 * src/lyxfont.C: no gui, no fonts... set some defaults
9112 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9114 * src/LColor.C: made the command inset background a bit lighter.
9116 2000-03-20 Hartmut Goebel <goebel@noris.net>
9118 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
9119 stdstruct.inc. Koma-Script added some title elements which
9120 otherwise have been listed below "bibliography". This split allows
9121 adding title elements to where they belong.
9123 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
9124 define the additional title elements and then include
9127 * many other layout files: changed to include stdtitle.inc just
9128 before stdstruct.inc.
9130 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
9132 * src/buffer.C: (save) Added the option to store all backup files
9133 in a single directory
9135 * src/lyxrc.[Ch]: Added variable \backupdir_path
9137 * lib/lyxrc.example: Added descriptions of recently added variables
9139 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
9140 bibtex inset, not closing the bibtex popup when deleting the inset)
9142 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9144 * src/lyx_cb.C: add a couple using directives.
9146 2000-03-17 José Abílio Matos <jamatos@lyx.org>
9147 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
9148 import based on the filename.
9150 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
9151 file would be imported at start, if the filename where of a sgml file.
9153 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
9155 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
9157 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
9158 * src/lyxfont.h Replaced the member variable bits.direction by the
9159 member variable lang. Made many changes in other files.
9160 This allows having a multi-lingual document
9162 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
9163 that change the current language to <l>.
9164 Removed the command "font-rtl"
9166 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
9167 format for Hebrew documents)
9169 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
9170 When auto_mathmode is "true", pressing a digit key in normal mode
9171 will cause entering into mathmode.
9172 If auto_mathmode is "rtl" then this behavior will be active only
9173 when writing right-to-left text.
9175 * src/text2.C (InsertStringA) The string is inserted using the
9178 * src/paragraph.C (GetEndLabel) Gives a correct result for
9179 footnote paragraphs.
9181 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
9183 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9185 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
9186 front of PasteParagraph. Never insert a ' '. This should at least
9187 fix some cause for the segfaults that we have been experiencing,
9188 it also fixes backspace behaviour slightly. (Phu!)
9190 * src/support/lstrings.C (compare_no_case): some change to make it
9191 compile with gcc 2.95.2 and stdlibc++-v3
9193 * src/text2.C (MeltFootnoteEnvironment): change type o
9194 first_footnote_par_is_not_empty to bool.
9196 * src/lyxparagraph.h: make text private. Changes in other files
9198 (fitToSize): new function
9199 (setContentsFromPar): new function
9200 (clearContents): new function
9201 (SetChar): new function
9203 * src/paragraph.C (readSimpleWholeFile): deleted.
9205 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
9206 the file, just use a simple string instead. Also read the file in
9207 a more maintainable manner.
9209 * src/text2.C (InsertStringA): deleted.
9210 (InsertStringB): deleted.
9212 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9214 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
9215 RedoParagraphs from the doublespace handling part, just set status
9216 to NEED_MORE_REFRESH. Also don't update cursor position (should be
9217 done, but perhaps not like this.)
9219 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9221 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
9222 character when inserting an inset.
9224 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9226 * src/bufferparams.C (readLanguage): now takes "default" into
9229 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
9230 also initialize the toplevel_keymap with the default bindings from
9233 * src/buffer.C (Buffer): remove lyxrc from the parameters.
9235 * all files using lyxrc: have lyxrc as a real variable and not a
9236 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
9239 * src/lyxrc.C: remove double call to defaultKeyBindings
9241 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
9242 toolbar defauls using lyxlex. Remove enums, structs, functions
9245 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
9246 toolbar defaults. Also store default keybindings in a map.
9248 * src/ToolbarDefaults.[Ch]: New file. This class is used for
9249 storing the toolbar defaults without any xforms dependencies.
9251 * src/insets/figinset.C: patch posted to list by Andre Poenitz
9252 applied. Changed to use iterators.
9254 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9256 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
9257 systems that don't have LINGUAS set to begin with.
9259 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9261 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
9262 the list by Dekel Tsur.
9264 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9266 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
9267 * src/insets/form_graphics.C: ditto.
9269 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
9271 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9273 * src/bufferparams.C (readLanguage): use the new language map
9275 * src/intl.C (InitKeyMapper): use the new language map
9277 * src/lyx_gui.C (create_forms): use the new language map
9279 * src/language.[Ch]: New files. Used for holding the information
9280 about each language. Now! Use this new language map enhance it and
9281 make it really usable for our needs.
9283 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
9285 * screen.C (ShowCursor): Removed duplicate code.
9286 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
9287 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
9289 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
9292 * src/text.C Added TransformChar method. Used for rendering Arabic
9293 text correctly (change the glyphs of the letter according to the
9294 position in the word)
9299 * src/lyxrc.C Added lyxrc command {language_command_begin,
9300 language_command_end,language_command_ltr,language_command_rtl,
9301 language_package} which allows the use of either arabtex or Omega
9304 * src/lyx_gui.C (init)
9306 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
9307 to use encoding for menu fonts which is different than the encoding
9310 * src/buffer.C (makeLaTeXFile): If params.language = "default",
9311 do not load the babel package.
9312 To write an English document with Hebrew/Arabic, change the document
9313 language to "english".
9315 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
9316 (alphaCounter): changed to return char
9317 (loweralphaCounter, hebrewCounter, romanCounter): New functions
9319 * lib/lyxrc.example Added examples for Hebrew/Arabic
9322 * src/layout.C Added layout command endlabeltype
9324 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
9326 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
9328 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9330 * src/mathed/math_delim.C (search_deco): return a
9331 math_deco_struct* instead of index.
9333 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9335 * All files with a USE_OSTREAM_ONLY within: removed all code that
9336 was unused when USE_OSTREAM_ONLY is defined.
9338 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
9339 of any less. Removed header and using.
9341 * src/text.C (GetVisibleRow): draw the string "Page Break
9342 (top/bottom)" on screen when drawing a pagebreak line.
9344 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9346 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
9348 * src/mathed/math_macro.C (draw): do some cast magic.
9351 * src/mathed/math_defs.h: change byte* argument to byte const*.
9353 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
9355 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
9356 know it is right to return InsetFoot* too, but cxx does not like
9359 * src/insets/insetcollapsable.[Ch] (Clone): make const.
9361 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
9363 * src/mathed/math_delim.C: change == to proper assignment.
9365 2000-03-09 Juergen Vigna <jug@sad.it>
9367 * src/insets/insettext.C (setPos): fixed various cursor positioning
9368 problems (via mouse and cursor-keys)
9369 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
9370 inset (still a small display problem but it works ;)
9372 * src/insets/insetcollapsable.C (draw): added button_top_y and
9373 button_bottom_y to have correct values for clicking on the inset.
9375 * src/support/lyxalgo.h: commented out 'using std::less'
9377 2000-03-08 Juergen Vigna <jug@sad.it>
9379 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
9380 Button-Release event closes as it is alos the Release-Event
9383 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
9385 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
9387 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
9388 can add multiple spaces in Scrap (literate programming) styles...
9389 which, by the way, is how I got hooked on LyX to begin with.
9391 * src/mathed/formula.C (Write): Added dummy variable to an
9392 inset::Latex() call.
9393 (Latex): Add free_spacing boolean to inset::Latex()
9395 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
9397 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
9398 virtual function to include the free_spacing boolean from
9399 the containing paragraph's style.
9401 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
9402 Added free_spacing boolean arg to match inset.h
9404 * src/insets/insettext.C, src/insets/insettext.h (Latex):
9405 Added free_spacing boolean arg to match inset.h
9407 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
9408 Added free_spacing boolean and made sure that if in a free_spacing
9409 paragraph, that we output normal space if there is a protected space.
9411 * src/insets/insetref.C, src/insets/insetref.h (Latex):
9412 Added free_spacing boolean arg to match inset.h
9414 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
9415 Added free_spacing boolean arg to match inset.h
9417 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
9418 Added free_spacing boolean arg to match inset.h
9420 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
9421 Added free_spacing boolean arg to match inset.h
9423 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
9424 Added free_spacing boolean arg to match inset.h
9426 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
9427 free_spacing boolean arg to match inset.h
9429 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
9430 Added free_spacing boolean arg to match inset.h
9432 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
9433 Added free_spacing boolean arg to match inset.h
9435 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
9436 Added free_spacing boolean arg to match inset.h
9438 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
9439 Added free_spacing boolean arg to match inset.h
9441 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
9442 Added free_spacing boolean arg to match inset.h
9444 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
9445 free_spacing boolean arg to match inset.h
9447 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
9448 free_spacing boolean arg to match inset.h
9450 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
9451 ignore free_spacing paragraphs. The user's spaces are left
9454 * src/text.C (InsertChar): Fixed the free_spacing layout
9455 attribute behavior. Now, if free_spacing is set, you can
9456 add multiple spaces in a paragraph with impunity (and they
9457 get output verbatim).
9458 (SelectSelectedWord): Added dummy argument to inset::Latex()
9461 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
9464 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
9465 paragraph layouts now only input a simple space instead.
9466 Special character insets don't make any sense in free-spacing
9469 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
9470 hard-spaces in the *input* file to simple spaces if the layout
9471 is free-spacing. This converts old files which had to have
9472 hard-spaces in free-spacing layouts where a simple space was
9474 (writeFileAscii): Added free_spacing check to pass to the newly
9475 reworked inset::Latex(...) methods. The inset::Latex() code
9476 ensures that hard-spaces in free-spacing paragraphs get output
9477 as spaces (rather than "~").
9479 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9481 * src/mathed/math_delim.C (draw): draw the empty placeholder
9482 delims with a onoffdash line.
9483 (struct math_deco_compare): struct that holds the "functors" used
9484 for the sort and the binary search in math_deco_table.
9485 (class init_deco_table): class used for initial sort of the
9487 (search_deco): use lower_bound to do a binary search in the
9490 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9492 * src/lyxrc.C: a small secret thingie...
9494 * src/lyxlex.C (printTable): changed to take a ostream as paramter
9495 and to not flush the stream as often as it used to.
9497 * src/support/lyxalgo.h: new file
9498 (sorted): template function used for checking if a sequence is
9499 sorted or not. Two versions with and without user supplied
9500 compare. Uses same compare as std::sort.
9502 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
9503 it and give warning on lyxerr.
9505 (struct compare_tags): struct with function operators used for
9506 checking if sorted, sorting and lower_bound.
9507 (search_kw): use lower_bound instead of manually implemented
9510 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9512 * src/insets/insetcollapsable.h: fix Clone() declaration.
9513 * src/insets/insetfoot.h: ditto.
9515 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
9517 2000-03-08 Juergen Vigna <jug@sad.it>
9519 * src/insets/lyxinset.h: added owner call which tells us if
9520 this inset is inside another inset. Changed also the return-type
9521 of Editable to an enum so it tells clearer what the return-value is.
9523 * src/insets/insettext.C (computeTextRows): fixed computing of
9524 textinsets which split automatically on more rows.
9526 * src/insets/insetert.[Ch]: changed this to be of BaseType
9529 * src/insets/insetfoot.[Ch]: added footnote inset
9531 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
9532 collapsable insets (like footnote, ert, ...)
9534 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9536 * src/lyxdraw.h: remvoe file
9538 * src/lyxdraw.C: remove file
9540 * src/insets/insettext.C: added <algorithm>.
9542 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9544 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
9545 (matrix_cb): case MM_OK use string stream
9547 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
9550 * src/mathed/math_macro.C (draw): use string stream
9551 (Metrics): use string stream
9553 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
9554 directly to the ostream.
9556 * src/vspace.C (asString): use string stream.
9557 (asString): use string stream
9558 (asLatexString): use string stream
9560 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
9561 setting Spacing::Other.
9563 * src/LaTeXFeatures.C (getPackages): use string stream instead of
9564 sprintf when creating the stretch vale.
9566 * src/text2.C (alphaCounter): changed to return a string and to
9567 not use a static variable internally. Also fixed a one-off bug.
9568 (SetCounter): changed the drawing of the labels to use string
9569 streams instead of sprintf.
9571 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
9572 manipulator to use a scheme that does not require library support.
9573 This is also the way it is done in the new GNU libstdc++. Should
9574 work with DEC cxx now.
9576 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9578 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
9579 end. This fixes a bug.
9581 * src/mathed (all files concerned with file writing): apply the
9582 USE_OSTREAM_ONLY changes to mathed too.
9584 * src/support/DebugStream.h: make the constructor explicit.
9586 * src/lyxfont.C (latexWriteStartChanges): small bug related to
9587 count and ostream squashed.
9589 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9591 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
9593 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
9594 ostringstream uses STL strings, and we might not.
9596 * src/insets/insetspecialchar.C: add using directive.
9597 * src/insets/insettext.C: ditto.
9599 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9601 * lib/layouts/seminar.layout: feeble attempt at a layout for
9602 seminar.cls, far from completet and could really use some looking
9603 at from people used to write layout files.
9605 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
9606 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
9607 a lot nicer and works nicely with ostreams.
9609 * src/mathed/formula.C (draw): a slightly different solution that
9610 the one posted to the list, but I think this one works too. (font
9611 size wrong in headers.)
9613 * src/insets/insettext.C (computeTextRows): some fiddling on
9614 Jürgens turf, added some comments that he should read.
9616 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
9617 used and it gave compiler warnings.
9618 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
9621 * src/lyx_gui.C (create_forms): do the right thing when
9622 show_banner is true/false.
9624 * src/lyx_cb.C (TimerCB): no need to close or do anything if
9625 show_banner is false.
9627 * most file writing files: Now use iostreams to do almost all of
9628 the writing. Also instead of passing string &, we now use
9629 stringstreams. mathed output is still not adapted to iostreams.
9630 This change can be turned off by commenting out all the occurences
9631 of the "#define USE_OSTREAM_ONLY 1" lines.
9633 * src/WorkArea.C (createPixmap): don't output debug messages.
9634 (WorkArea): don't output debug messages.
9636 * lib/lyxrc.example: added a comment about the new variable
9639 * development/Code_rules/Rules: Added some more commente about how
9640 to build class interfaces and on how better encapsulation can be
9643 2000-03-03 Juergen Vigna <jug@sad.it>
9645 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
9646 automatically with the width of the LyX-Window
9648 * src/insets/insettext.C (computeTextRows): fixed update bug in
9649 displaying text-insets (scrollvalues where not initialized!)
9651 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9653 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
9654 id in the check of the result from lower_bound is not enough since
9655 lower_bound can return last too, and then res->id will not be a
9658 * all insets and some code that use them: I have conditionalized
9659 removed the Latex(string & out, ...) this means that only the
9660 Latex(ostream &, ...) will be used. This is a work in progress to
9661 move towards using streams for all output of files.
9663 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
9666 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9668 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
9669 routine (this fixes bug where greek letters were surrounded by too
9672 * src/support/filetools.C (findtexfile): change a bit the search
9673 algorithm, to fix bug introduced in 1.1.4. Note that --format is
9674 no longer passed to kpsewhich, we may have to change that later.
9676 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
9677 warning options to avoid problems with X header files (from Angus
9679 * acinclude.m4: regenerated.
9681 2000-03-02 Juergen Vigna <jug@sad.it>
9683 * src/insets/insettext.C (WriteParagraphData): Using the
9684 par->writeFile() function for writing paragraph-data.
9685 (Read): Using buffer->parseSingleLyXformat2Token()-function
9686 for parsing paragraph data!
9688 * src/buffer.C (readLyXformat2): removed all parse data and using
9689 the new parseSingleLyXformat2Token()-function.
9690 (parseSingleLyXformat2Token): added this function to parse (read)
9691 lyx-file-format (this is called also from text-insets now!)
9693 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9695 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
9698 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
9699 directly instead of going through a func. One very bad thing: a
9700 static LyXFindReplace, but I don't know where to place it.
9702 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
9703 string instead of char[]. Also changed to static.
9704 (GetSelectionOrWordAtCursor): changed to static inline
9705 (SetSelectionOverLenChars): ditto.
9707 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
9708 current_view and global variables. both classes has changed names
9709 and LyXFindReplace is not inherited from SearchForm.
9711 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
9712 fl_form_search form.
9714 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
9716 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9718 * lib/bind/*.bind: make sure 'buffer-previous' function is not
9719 bound (from Kayvan).
9721 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
9723 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
9725 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9727 * some things that I should comment but the local pub says head to
9730 * comment out all code that belongs to the Roff code for Ascii
9731 export of tables. (this is unused)
9733 * src/LyXView.C: use correct type for global variable
9734 current_layout. (LyXTextClass::size_type)
9736 * some code to get the new insetgraphics closer to working I'd be
9737 grateful for any help.
9739 * src/BufferView2.C (insertInset): use the return type of
9740 NumberOfLayout properly. (also changes in other files)
9742 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9743 this as a test. I want to know what breaks because of this.
9745 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9747 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9749 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9750 to use a \makebox in the label, this allows proper justification
9751 with out using protected spaces or multiple hfills. Now it is
9752 "label" for left justified, "\hfill label\hfill" for center, and
9753 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9754 should be changed accordingly.
9756 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9758 * src/lyxtext.h: change SetLayout() to take a
9759 LyXTextClass::size_type instead of a char (when there is more than
9760 127 layouts in a class); also change type of copylayouttype.
9761 * src/text2.C (SetLayout): ditto.
9762 * src/LyXView.C (updateLayoutChoice): ditto.
9764 * src/LaTeX.C (scanLogFile): errors where the line number was not
9765 given just after the '!'-line were ignored (from Dekel Tsur).
9767 * lib/lyxrc.example: fix description of \date_insert_format
9769 * lib/layouts/llncs.layout: new layout, contributed by Martin
9772 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9774 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9775 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9776 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9777 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9778 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9779 paragraph.C, text.C, text2.C)
9781 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9783 * src/insets/insettext.C (LocalDispatch): remove extra break
9786 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9787 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9789 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9790 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9792 * src/insets/insetbib.h: move InsetBibkey::Holder and
9793 InsetCitation::Holder in public space.
9795 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9797 * src/insets/insettext.h: small change to get the new files from
9798 Juergen to compile (use "string", not "class string").
9800 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9801 const & as parameter to LocalDispatch, use LyXFont const & as
9802 paramter to some other func. This also had impacto on lyxinsets.h
9803 and the two mathed insets.
9805 2000-02-24 Juergen Vigna <jug@sad.it>
9808 * src/commandtags.h:
9810 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9814 * src/BufferView2.C: added/updated code for various inset-functions
9816 * src/insets/insetert.[Ch]: added implementation of InsetERT
9818 * src/insets/insettext.[Ch]: added implementation of InsetText
9820 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9821 (draw): added preliminary code for inset scrolling not finshed yet
9823 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9824 as it is in lyxfunc.C now
9826 * src/insets/lyxinset.h: Added functions for text-insets
9828 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9830 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9831 BufferView and reimplement the list as a queue put inside its own
9834 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9836 * several files: use the new interface to the "updateinsetlist"
9838 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9840 (work_area_handler): call BufferView::trippleClick on trippleclick.
9842 * src/BufferView.C (doubleClick): new function, selects word on
9844 (trippleClick): new function, selects line on trippleclick.
9846 2000-02-22 Allan Rae <rae@lyx.org>
9848 * lib/bind/xemacs.bind: buffer-previous not supported
9850 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9852 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9855 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9857 * src/bufferlist.C: get rid of current_view from this file
9859 * src/spellchecker.C: get rid of current_view from this file
9861 * src/vspace.C: get rid of current_view from this file
9862 (inPixels): added BufferView parameter for this func
9863 (asLatexCommand): added a BufferParams for this func
9865 * src/text.C src/text2.C: get rid of current_view from these
9868 * src/lyxfont.C (getFontDirection): move this function here from
9871 * src/bufferparams.C (getDocumentDirection): move this function
9874 * src/paragraph.C (getParDirection): move this function here from
9876 (getLetterDirection): ditto
9878 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9880 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9881 resize due to wrong pixmap beeing used. Also took the opurtunity
9882 to make the LyXScreen stateless on regard to WorkArea and some
9883 general cleanup in the same files.
9885 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9887 * src/Makefile.am: add missing direction.h
9889 * src/PainterBase.h: made the width functions const.
9891 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9894 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9896 * src/insets/insetlatexaccent.C (draw): make the accents draw
9897 better, at present this will only work well with iso8859-1.
9899 * several files: remove the old drawing code, now we use the new
9902 * several files: remove support for mono_video, reverse_video and
9905 2000-02-17 Juergen Vigna <jug@sad.it>
9907 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9908 int ** as we have to return the pointer, otherwise we have only
9909 NULL pointers in the returning function.
9911 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9913 * src/LaTeX.C (operator()): quote file name when running latex.
9915 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9917 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9918 (bubble tip), this removes our special handling of this.
9920 * Remove all code that is unused now that we have the new
9921 workarea. (Code that are not active when NEW_WA is defined.)
9923 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9925 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9927 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9928 nonexisting layout; correctly redirect obsoleted layouts.
9930 * lib/lyxrc.example: document \view_dvi_paper_option
9932 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9935 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9936 (PreviewDVI): handle the view_dvi_paper_option variable.
9937 [Both from Roland Krause]
9939 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9941 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9942 char const *, int, LyXFont)
9943 (text(int, int, string, LyXFont)): ditto
9945 * src/text.C (InsertCharInTable): attempt to fix the double-space
9946 feature in tables too.
9947 (BackspaceInTable): ditto.
9948 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9950 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9952 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9954 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9955 newly found text in textcache to this.
9956 (buffer): set the owner of the text put into the textcache to 0
9958 * src/insets/figinset.C (draw): fixed the drawing of figures with
9961 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9962 drawing of mathframe, hfills, protected space, table lines. I have
9963 now no outstanding drawing problems with the new Painter code.
9965 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9967 * src/PainterBase.C (ellipse, circle): do not specify the default
9970 * src/LColor.h: add using directive.
9972 * src/Painter.[Ch]: change return type of methods from Painter& to
9973 PainterBase&. Add a using directive.
9975 * src/WorkArea.C: wrap xforms callbacks in C functions
9978 * lib/layouts/foils.layout: font fix and simplifications from Carl
9981 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9983 * a lot of files: The Painter, LColor and WorkArea from the old
9984 devel branch has been ported to lyx-devel. Some new files and a
9985 lot of #ifdeffed code. The new workarea is enabled by default, but
9986 if you want to test the new Painter and LColor you have to compile
9987 with USE_PAINTER defined (do this in config.h f.ex.) There are
9988 still some rought edges, and I'd like some help to clear those
9989 out. It looks stable (loads and displays the Userguide very well).
9992 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9994 * src/buffer.C (pop_tag): revert to the previous implementation
9995 (use a global variable for both loops).
9997 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9999 * src/lyxrc.C (LyXRC): change slightly default date format.
10001 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
10002 there is an English text with a footnote that starts with a Hebrew
10003 paragraph, or vice versa.
10004 (TeXFootnote): ditto.
10006 * src/text.C (LeftMargin): allow for negative values for
10007 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
10010 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
10011 for input encoding (cyrillic)
10013 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10015 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
10018 * src/toolbar.C (set): ditto
10019 * src/insets/insetbib.C (create_form_citation_form): ditto
10021 * lib/CREDITS: added Dekel Tsur.
10023 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
10024 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
10025 hebrew supports files from Dekel Tsur.
10027 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
10028 <tzafrir@technion.ac.il>
10030 * src/lyxrc.C: put \date_insert_format at the right place.
10032 * src/buffer.C (makeLaTeXFile): fix the handling of
10033 BufferParams::sides when writing out latex files.
10035 * src/BufferView2.C: add a "using" directive.
10037 * src/support/lyxsum.C (sum): when we use lyxstring,
10038 ostringstream::str needs an additional .c_str().
10040 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10042 * src/support/filetools.C (ChangeExtension): patch from Etienne
10045 * src/TextCache.C (show): remove const_cast and make second
10046 parameter non-const LyXText *.
10048 * src/TextCache.h: use non const LyXText in show.
10050 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
10053 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10055 * src/support/lyxsum.C: rework to be more flexible.
10057 * several places: don't check if a pointer is 0 if you are going
10060 * src/text.C: remove some dead code.
10062 * src/insets/figinset.C: remove some dead code
10064 * src/buffer.C: move the BufferView funcs to BufferView2.C
10065 remove all support for insetlatexdel
10066 remove support for oldpapersize stuff
10067 made some member funcs const
10069 * src/kbmap.C: use a std::list to store the bindings in.
10071 * src/BufferView2.C: new file
10073 * src/kbsequence.[Ch]: new files
10075 * src/LyXAction.C + others: remove all trace of buffer-previous
10077 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
10078 only have one copy in the binary of this table.
10080 * hebrew patch: moved some functions from LyXText to more
10081 appropriate places. (LyXParagraph, BufferParams, LyXFont)
10083 * several files: remove support for XForms older than 0.88
10084 whitespace changes.
10085 remove some #if 0 #endif code
10087 * src/TextCache.[Ch]: new file. Holds the textcache.
10089 * src/BufferView.C: changes to use the new TextCache interface.
10090 (waitForX): remove the now unused code.
10092 * src/BackStack.h: remove some commented code
10094 * lib/bind/emacs.bind: remove binding for buffer-previous
10096 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10098 * applied the hebrew patch.
10100 * src/lyxrow.h: make sure that all Row variables are initialized.
10102 * src/text2.C (TextHandleUndo): comment out a delete, this might
10103 introduce a memory leak, but should also help us to not try to
10104 read freed memory. We need to look at this one.
10106 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
10107 (LyXParagraph): initalize footnotekind.
10109 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
10110 forgot this when applying the patch. Please heed the warnings.
10112 * src/BufferView.C (buffer): a fix for the buffer-reload problem
10113 (aka. reformat problem)
10115 * src/bufferlist.C (exists): made const, and use const_iterator
10116 (isLoaded): new func.
10117 (release): use std::find to find the correct buffer.
10119 * src/bufferlist.h: made getState a const func.
10120 made empty a const func.
10121 made exists a const func.
10124 2000-02-01 Juergen Vigna <jug@sad.it>
10126 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
10128 * po/it.po: updated a bit the italian po file and also changed the
10129 'file nuovo' for newfile to 'filenuovo' without a space, this did
10132 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
10133 for the new insert_date command.
10135 * src/lyxfunc.C (Dispatch): added support for a insert_date function
10136 from jdblair, to insert a date into the current text conforming to
10137 a strftime format (for now only considering the locale-set and not
10138 the document-language).
10140 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10142 * src/lyxfont.C (textWidth): hopefully better fix for the Array
10143 Bounds Read error seen by purify. The problem was that islower is
10144 a macros which takes an unsigned char and uses it as an index for
10145 in array of characters properties (and is thus subject to the
10149 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
10150 correctly the paper sides radio buttons.
10151 (UpdateDocumentButtons): ditto.
10153 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10155 * src/kbmap.C (getsym + others): change to return unsigned int,
10156 returning a long can give problems on 64 bit systems. (I assume
10157 that int is 32bit on 64bit systems)
10159 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10161 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
10162 LyXLookupString to be zero-terminated. Really fixes problems seen
10163 by purify, I think.
10165 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10167 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
10168 write a (char*)0 to the lyxerr stream.
10170 * src/lastfiles.C: move algorithm before the using statemets.
10172 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10174 * src/lastfiles.C: move using directives in global scope (egcs 1.x
10175 complains otherwise).
10176 * src/table.C: ditto
10178 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
10181 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
10182 that I removed earlier... It is really needed.
10184 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
10186 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10188 * INSTALL: update xforms home page URL.
10190 * lib/configure.m4: fix a bug with unreadable layout files.
10192 * src/table.C (calculate_width_of_column): add "using std::max"
10195 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10197 * several files: marked several lines with "DEL LINE", this is
10198 lines that can be deleted without changing anything.
10199 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
10200 checks this anyway */
10203 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
10205 * src/DepTable.C (update): add a "+" at the end when the checksum
10206 is different. (debugging string only)
10208 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
10209 the next inset to not be displayed. This should also fix the list
10210 of labels in the "Insert Crossreference" dialog.
10212 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10214 * src/support/LSubstring.C (LSubstring): set pos to string::npos
10215 when regex was not found.
10217 * src/support/lstrings.C (lowercase): use handcoded transform always.
10220 * src/text.C (Delete): fixed the crash. cursor.par->prev and
10221 old_cursor.par->prev could be 0.
10223 * several files: changed post inc/dec to pre inc/dec
10225 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
10226 write the lastfiles to file.
10228 * src/BufferView.C (buffer): only show TextCache info when debugging
10230 (resizeCurrentBuffer): ditto
10231 (workAreaExpose): ditto
10233 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
10235 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
10237 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
10238 a bit better by removing the special case for \i and \j.
10240 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10242 * src/lyx_main.C (easyParse): remove test for bad comand line
10243 options, since this broke all xforms-related parsing.
10245 * src/kbmap.C (getsym): set return type to unsigned long, as
10246 declared in header. On an alpha, long is _not_ the same as int.
10248 * src/support/LOstream.h: add a "using std::flush;"
10250 * src/insets/figinset.C: ditto.
10252 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10254 * src/bufferlist.C (write): use blinding fast file copy instead of
10255 "a char at a time", now we are doing it the C++ way.
10257 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
10258 std::list<int> instead.
10259 (addpidwait): reflect move to std::list<int>
10260 (sigchldchecker): ditto
10262 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
10265 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
10266 that obviously was wrong...
10268 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
10269 c, this avoids warnings with purify and islower.
10271 * src/insets/figinset.C: rename struct queue to struct
10272 queue_element and rewrite to use a std::queue. gsqueue is now a
10273 std::queue<queue_element>
10274 (runqueue): reflect move to std::queue
10277 * src/support/lstrings.h (tostr): specialize for bool, otherwise
10278 we would get "1" "0" instead of "true" "false. Also make the tostr
10281 2000-01-21 Juergen Vigna <jug@sad.it>
10283 * src/buffer.C (writeFileAscii): Disabled code for special groff
10284 handling of tabulars till I fix this in table.C
10286 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10288 * src/support/mkdir.C (mkdir): change second argument of mkdir to
10290 * src/support/lyxlib.h: ditto.
10292 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10294 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
10295 and 'j' look better. This might fix the "macron" bug that has been
10298 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
10299 functions as one template function. Delete the old versions.
10301 * src/support/lyxsum.C: move using std::ifstream inside
10304 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
10307 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
10309 * src/mathed/formula.C: delete #include "bufferlist.h" never used
10311 * src/insets/figinset.C (InitFigures): use new instead of malloc
10312 to allocate memory for figures and bitmaps.
10313 (DoneFigures): use delete[] instead of free to deallocate memory
10314 for figures and bitmaps.
10315 (runqueue): use new to allocate
10316 (getfigdata): use new/delete[] instead of malloc/free
10317 (RegisterFigure): ditto
10319 * some files: moved some declarations closer to first use, small
10320 whitespace changes use preincrement instead of postincrement where
10321 it does not make a difference.
10323 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
10324 step on the way to use stl::containers for key maps.
10326 * src/bufferlist.h: add a typedef for const_iterator and const
10327 versions of begin and end.
10329 * src/bufferlist.[Ch]: change name of member variable _state to
10330 state_. (avoid reserved names)
10332 (getFileNames): returns the filenames of the buffers in a vector.
10334 * configure.in (ALL_LINGUAS): added ro
10336 * src/support/putenv.C: new file
10338 * src/support/mkdir.C: new file
10340 2000-01-20 Allan Rae <rae@lyx.org>
10342 * lib/layouts/IEEEtran.layout: Added several theorem environments
10344 * lib/templates/IEEEtran.lyx: Example theorem environments and a
10345 couple of minor additions.
10347 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
10348 (except for those in footnotes of course)
10350 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10352 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
10354 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
10355 std::sort and std::lower_bound instead of qsort and handwritten
10357 (struct compara): struct that holds the functors used by std::sort
10358 and std::lower_bound in MathedLookupBOP.
10360 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10362 * src/support/LAssert.h: do not do partial specialization. We do
10363 not really need it.
10365 * src/support/lyxlib.h: note that lyx::getUserName() and
10366 lyx::date() are not in use right now. Should these be suppressed?
10368 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
10369 (makeLinuxDocFile): do not put date and user name in linuxdoc
10372 * src/support/lyxlib.h (kill): change first argument to long int,
10373 since that's what solaris uses.
10375 * src/support/kill.C (kill): fix declaration to match prototype.
10377 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
10378 actually check whether namespaces are supported. This is not what
10381 * src/support/lyxsum.C: add a using directive.
10383 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10385 * src/support/kill.C: if we have namespace support we don't have
10386 to include lyxlib.h.
10388 * src/support/lyxlib.h: use namespace lyx if supported.
10390 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10392 * src/support/date.C: new file
10394 * src/support/chdir.C: new file
10396 * src/support/getUserName.C: new file
10398 * src/support/getcwd.C: new file
10400 * src/support/abort.C: new file
10402 * src/support/kill.C: new file
10404 * src/support/lyxlib.h: moved all the functions in this file
10405 insede struct lyx. Added also kill and abort to this struct. This
10406 is a way to avoid the "kill is not defined in <csignal>", we make
10407 C++ wrappers for functions that are not ANSI C or ANSI C++.
10409 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
10410 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
10411 lyx it has been renamed to sum.
10413 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10415 * src/text.C: add using directives for std::min and std::max.
10417 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10419 * src/texrow.C (getIdFromRow): actually return something useful in
10420 id and pos. Hopefully fixes the bug with positionning of errorbox
10423 * src/lyx_main.C (easyParse): output an error and exit if an
10424 incorrect command line option has been given.
10426 * src/spellchecker.C (ispell_check_word): document a memory leak.
10428 * src/bufferlist.C (write): fix mismatched allocation/deletion,
10429 where a "struct utimbuf" is allocated with "new" and deleted with
10432 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10434 * src/text2.C (CutSelection): don't delete double spaces.
10435 (PasteSelection): ditto
10436 (CopySelection): ditto
10438 * src/text.C (Backspace): don't delete double spaces.
10440 * src/lyxlex.C (next): fix a bug that were only present with
10441 conformant std::istream::get to read comment lines, use
10442 std::istream::getline instead. This seems to fix the problem.
10444 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10446 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
10447 allowed to insert space before space" editing problem. Please read
10448 commends at the beginning of the function. Comments about usage
10451 * src/text.C (InsertChar): fix for the "not allowed to insert
10452 space before space" editing problem.
10454 * src/text2.C (DeleteEmptyParagraphMechanism): when
10455 IsEmptyTableRow can only return false this last "else if" will
10456 always be a no-op. Commented out.
10458 * src/text.C (RedoParagraph): As far as I can understand tmp
10459 cursor is not really needed.
10461 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
10462 present it could only return false anyway.
10463 (several functions): Did something not so smart...added a const
10464 specifier on a lot of methods.
10466 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
10467 and add a tmp->text.resize. The LyXParagraph constructor does the
10469 (BreakParagraphConservative): ditto
10471 * src/support/path.h (Path): add a define so that the wrong usage
10472 "Path("/tmp") will be flagged as a compilation error:
10473 "`unnamed_Path' undeclared (first use this function)"
10475 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10477 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
10478 which was bogus for several reasons.
10480 * src/LaTeX.C (scanAux): fix the regular expression used to scan
10482 (runBibTeX): ditto.
10484 * autogen.sh: do not use "type -path" (what's that anyway?).
10486 * src/support/filetools.C (findtexfile): remove extraneous space
10487 which caused a kpsewhich warning (at least with kpathsea version
10490 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10492 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
10494 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
10496 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
10498 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10500 * src/paragraph.C (BreakParagraph): do not reserve space on text
10501 if we don't need to (otherwise, if pos_end < pos, we end up
10502 reserving huge amounts of memory due to bad unsigned karma).
10503 (BreakParagraphConservative): ditto, although I have not seen
10504 evidence the bug can happen here.
10506 * src/lyxparagraph.h: add a using std::list.
10508 2000-01-11 Juergen Vigna <jug@sad.it>
10510 * src/menus.C (MenuDocu): output an Alert if the documentation-file
10511 could not be found.
10513 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
10515 * src/vc-backend.C (doVCCommand): change to be static and take one
10516 more parameter: the path to chdir too be fore executing the command.
10517 (retrive): new function equiv to "co -r"
10519 * src/bufferlist.C (loadLyXFile): implement the missing parts if
10520 file_not_found_hook is true.
10522 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
10524 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
10525 if a file is readwrite,readonly...anything else.
10527 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10529 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
10530 (CreatePostscript): name change from MenuRunDVIPS (or something)
10531 (PreviewPostscript): name change from MenuPreviewPS
10532 (PreviewDVI): name change from MenuPreviewDVI
10534 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
10535 \view_pdf_command., \pdf_to_ps_command
10537 * lib/configure.m4: added search for PDF viewer, and search for
10538 PDF to PS converter.
10539 (lyxrc.defaults output): add \pdflatex_command,
10540 \view_pdf_command and \pdf_to_ps_command.
10542 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
10544 * src/bufferlist.C (write): we don't use blocksize for anything so
10547 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10549 * src/support/block.h: disable operator T* (), since it causes
10550 problems with both compilers I tried. See comments in the file.
10552 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
10555 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
10556 variable LYX_DIR_10x to LYX_DIR_11x.
10558 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
10560 * INSTALL: document --with-lyxname.
10563 * configure.in: new configure flag --with-lyxname which allows to
10564 choose the name under which lyx is installed. Default is "lyx", of
10565 course. It used to be possible to do this with --program-suffix,
10566 but the later has in fact a different meaning for autoconf.
10568 * src/support/lstrings.h (lstrchr): reformat a bit.
10570 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
10571 * src/mathed/math_defs.h: ditto.
10573 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10575 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
10576 true, decides if we create a backup file or not when saving. New
10577 tag and variable \pdf_mode, defaults to false. New tag and
10578 variable \pdflatex_command, defaults to pdflatex. New tag and
10579 variable \view_pdf_command, defaults to xpdf. New tag and variable
10580 \pdf_to_ps_command, defaults to pdf2ps.
10582 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
10584 * src/bufferlist.C (close): don't call insetUnlock if the buffer
10585 does not have a BufferView.
10586 (unlockInset): ditto + don't access the_locking_inset if the
10587 buffer does not have a BufferView.
10589 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
10590 certain circumstances so that we don't continue a keyboard
10591 operation long after the key was released. Try f.ex. to load a
10592 large document, press PageDown for some seconds and then release
10593 it. Before this change the document would contine to scroll for
10594 some time, with this change it stops imidiatly.
10596 * src/support/block.h: don't allocate more space than needed. As
10597 long as we don't try to write to the arr[x] in a array_type arr[x]
10598 it is perfectly ok. (if you write to it you might segfault).
10599 added operator value_type*() so that is possible to pass the array
10600 to functions expecting a C-pointer.
10602 * lib/Makefile.am (dist-hook): don't fail completely if unable to
10605 * intl/*: updated to gettext 0.10.35, tried to add our own
10606 required modifications. Please verify.
10608 * po/*: updated to gettext 0.10.35, tried to add our own required
10609 modifications. Please verify.
10611 * src/support/lstrings.C (tostr): go at fixing the problem with
10612 cxx and stringstream. When stringstream is used return
10613 oss.str().c_str() so that problems with lyxstring and basic_string
10614 are avoided. Note that the best solution would be for cxx to use
10615 basic_string all the way, but it is not conformant yet. (it seems)
10617 * src/lyx_cb.C + other files: moved several global functions to
10618 class BufferView, some have been moved to BufferView.[Ch] others
10619 are still located in lyx_cb.C. Code changes because of this. (part
10620 of "get rid of current_view project".)
10622 * src/buffer.C + other files: moved several Buffer functions to
10623 class BufferView, the functions are still present in buffer.C.
10624 Code changes because of this.
10626 * config/lcmessage.m4: updated to most recent. used when creating
10629 * config/progtest.m4: updated to most recent. used when creating
10632 * config/gettext.m4: updated to most recent. applied patch for
10635 * config/gettext.m4.patch: new file that shows what changes we
10636 have done to the local copy of gettext.m4.
10638 * config/libtool.m4: new file, used in creation of acinclude.m4
10640 * config/lyxinclude.m4: new file, this is the lyx created m4
10641 macros, used in making acinclude.m4.
10643 * autogen.sh: GNU m4 discovered as a separate task not as part of
10644 the lib/configure creation.
10645 Generate acinlucde from files in config. Actually cat
10646 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
10647 easier to upgrade .m4 files that really are external.
10649 * src/Spacing.h: moved using std::istringstream to right after
10650 <sstream>. This should fix the problem seen with some compilers.
10652 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10654 * src/lyx_cb.C: began some work to remove the dependency a lot of
10655 functions have on BufferView::text, even if not really needed.
10656 (GetCurrentTextClass): removed this func, it only hid the
10659 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
10660 forgot this in last commit.
10662 * src/Bullet.C (bulletEntry): use static char const *[] for the
10663 tables, becuase of this the return arg had to change to string.
10664 (bulletSize): ditto
10665 (~Bullet): removed unneeded destructor
10667 * src/BufferView.C (beforeChange): moved from lyx_cb.C
10668 (insetSleep): moved from Buffer
10669 (insetWakeup): moved from Buffer
10670 (insetUnlock): moved from Buffer
10672 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
10673 from Buffer to BufferView.
10675 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
10677 * config/ltmain.sh: updated to version 1.3.4 of libtool
10679 * config/ltconfig: updated to version 1.3.4 of libtool
10681 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10684 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
10685 Did I get that right?
10687 * src/lyxlex.h: add a "using" directive or two.
10688 * src/Spacing.h: ditto.
10689 * src/insets/figinset.C: ditto.
10690 * src/support/filetools.C: ditto.
10691 * src/support/lstrings.C: ditto.
10692 * src/BufferView.C: ditto.
10693 * src/bufferlist.C: ditto.
10694 * src/lyx_cb.C: ditto.
10695 * src/lyxlex.C: ditto.
10697 * NEWS: add some changes for 1.1.4.
10699 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10701 * src/BufferView.C: first go at a TextCache to speed up switching
10704 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10706 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
10707 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
10708 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
10709 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
10712 * src/mathed/math_defs.h (MathedRowSt): make sure that all
10713 members of the struct are correctly initialized to 0 (detected by
10715 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
10716 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
10718 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
10719 pidwait, since it was allocated with "new". This was potentially
10720 very bad. Thanks to Michael Schmitt for running purify for us.
10723 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10725 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
10727 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
10729 1999-12-30 Allan Rae <rae@lyx.org>
10731 * lib/templates/IEEEtran.lyx: minor change
10733 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
10734 src/mathed/formula.C (LocalDispatch): askForText changes
10736 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
10737 know when a user has cancelled input. Fixes annoying problems with
10738 inserting labels and version control.
10740 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10742 * src/support/lstrings.C (tostr): rewritten to use strstream and
10745 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10747 * src/support/filetools.C (IsFileWriteable): use fstream to check
10748 (IsDirWriteable): use fileinfo to check
10750 * src/support/filetools.h (FilePtr): whole class deleted
10752 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10754 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10756 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10758 * src/bufferlist.C (write): use ifstream and ofstream instead of
10761 * src/Spacing.h: use istrstream instead of sscanf
10763 * src/mathed/math_defs.h: change first arg to istream from FILE*
10765 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10767 * src/mathed/math_parser.C: have yyis to be an istream
10768 (LexGetArg): use istream (yyis)
10770 (mathed_parse): ditto
10771 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10773 * src/mathed/formula.C (Read): rewritten to use istream
10775 * src/mathed/formulamacro.C (Read): rewritten to use istream
10777 * src/lyxlex.h (~LyXLex): deleted desturctor
10778 (getStream): new function, returns an istream
10779 (getFile): deleted funtion
10780 (IsOK): return is.good();
10782 * src/lyxlex.C (LyXLex): delete file and owns_file
10783 (setFile): open an filebuf and assign that to a istream instead of
10785 (setStream): new function, takes an istream as arg.
10786 (setFile): deleted function
10787 (EatLine): rewritten us use istream instead of FILE*
10791 * src/table.C (LyXTable): use istream instead of FILE*
10792 (Read): rewritten to take an istream instead of FILE*
10794 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10796 * src/buffer.C (Dispatch): remove an extraneous break statement.
10798 * src/support/filetools.C (QuoteName): change to do simple
10799 'quoting'. More work is necessary. Also changed to do nothing
10800 under emx (needs fix too).
10801 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10803 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10804 config.h.in to the AC_DEFINE_UNQUOTED() call.
10805 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10806 needs char * as argument (because Solaris 7 declares it like
10809 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10810 remove definition of BZERO.
10812 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10814 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10815 defined, "lyxregex.h" if not.
10817 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10819 (REGEX): new variable that is set to regex.c lyxregex.h when
10820 AM_CONDITIONAL USE_REGEX is set.
10821 (libsupport_la_SOURCES): add $(REGEX)
10823 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10826 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10829 * configure.in: add call to LYX_REGEX
10831 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10832 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10834 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10836 * lib/bind/fi_menus.bind: new file, from
10837 pauli.virtanen@saunalahti.fi.
10839 * src/buffer.C (getBibkeyList): pass the parameter delim to
10840 InsetInclude::getKeys and InsetBibtex::getKeys.
10842 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10843 is passed to Buffer::getBibkeyList
10845 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10846 instead of the hardcoded comma.
10848 * src/insets/insetbib.C (getKeys): make sure that there are not
10849 leading blanks in bibtex keys. Normal latex does not care, but
10850 harvard.sty seems to dislike blanks at the beginning of citation
10851 keys. In particular, the retturn value of the function is
10853 * INSTALL: make it clear that libstdc++ is needed and that gcc
10854 2.7.x probably does not work.
10856 * src/support/filetools.C (findtexfile): make debug message go to
10858 * src/insets/insetbib.C (getKeys): ditto
10860 * src/debug.C (showTags): make sure that the output is correctly
10863 * configure.in: add a comment for TWO_COLOR_ICON define.
10865 * acconfig.h: remove all the entries that already defined in
10866 configure.in or acinclude.m4.
10868 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10869 to avoid user name, date and copyright.
10871 1999-12-21 Juergen Vigna <jug@sad.it>
10873 * src/table.C (Read): Now read bogus row format informations
10874 if the format is < 5 so that afterwards the table can
10875 be read by lyx but without any format-info. Fixed the
10876 crash we experienced when not doing this.
10878 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10880 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10881 (RedoDrawingOfParagraph): ditto
10882 (RedoParagraphs): ditto
10883 (RemoveTableRow): ditto
10885 * src/text.C (Fill): rename arg paperwidth -> paper_width
10887 * src/buffer.C (insertLyXFile): rename var filename -> fname
10888 (writeFile): rename arg filename -> fname
10889 (writeFileAscii): ditto
10890 (makeLaTeXFile): ditto
10891 (makeLinuxDocFile): ditto
10892 (makeDocBookFile): ditto
10894 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10897 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10899 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10902 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10903 compiled by a C compiler not C++.
10905 * src/layout.h (LyXTextClass): added typedef for const_iterator
10906 (LyXTextClassList): added typedef for const_iterator + member
10907 functions begin and end.
10909 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10910 iterators to fill the choice_class.
10911 (updateLayoutChoice): rewritten to use iterators to fill the
10912 layoutlist in the toolbar.
10914 * src/BufferView.h (BufferView::work_area_width): removed unused
10917 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10919 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10920 (sgmlCloseTag): ditto
10922 * src/support/lstrings.h: return type of countChar changed to
10925 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10926 what version of this func to use. Also made to return unsigned int.
10928 * configure.in: call LYX_STD_COUNT
10930 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10931 conforming std::count.
10933 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10935 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10936 and a subscript would give bad display (patch from Dekel Tsur
10937 <dekel@math.tau.ac.il>).
10939 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10941 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10944 * src/chset.h: add a few 'using' directives
10946 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10947 triggered when no buffer is active
10949 * src/layout.C: removed `break' after `return' in switch(), since
10952 * src/lyx_main.C (init): make sure LyX can be ran in place even
10953 when libtool has done its magic with shared libraries. Fix the
10954 test for the case when the system directory has not been found.
10956 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10957 name for the latex file.
10958 (MenuMakeHTML): ditto
10960 * src/buffer.h: add an optional boolean argument, which is passed
10961 to ChangeExtension.
10963 1999-12-20 Allan Rae <rae@lyx.org>
10965 * lib/templates/IEEEtran.lyx: small correction and update.
10967 * configure.in: Attempted to use LYX_PATH_HEADER
10969 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10971 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10972 input from JMarc. Now use preprocessor to find the header.
10973 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10974 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10975 LYX_STL_STRING_FWD. See comments in file.
10977 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10979 * The global MiniBuffer * minibuffer variable is dead.
10981 * The global FD_form_main * fd_form_main variable is dead.
10983 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10985 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10987 * src/table.h: add the LOstream.h header
10988 * src/debug.h: ditto
10990 * src/LyXAction.h: change the explaination of the ReadOnly
10991 attribute: is indicates that the function _can_ be used.
10993 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10996 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10998 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
11004 * src/paragraph.C (GetWord): assert on pos>=0
11007 * src/support/lyxstring.C: condition the use of an invariant on
11009 * src/support/lyxstring.h: ditto
11011 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
11012 Use LAssert.h instead of plain assert().
11014 * src/support/lstrings.h: add LAssert.h, in case it is needed.
11016 * src/lyxfunc.C: do not include LAssert.h, it is not used.
11017 * src/support/filetools.C: ditto
11019 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
11022 * INSTALL: document the new configure flags
11024 * configure.in: suppress --with-debug; add --enable-assertions
11026 * acinclude.m4: various changes in alignment of help strings.
11028 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11030 * src/kbmap.C: commented out the use of the hash map in kb_map,
11031 beginning of movement to a stl::container.
11033 * several files: removed code that was not in effect when
11034 MOVE_TEXT was defined.
11036 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
11037 for escaping should not be used. We can discuss if the string
11038 should be enclosed in f.ex. [] instead of "".
11040 * src/trans_mgr.C (insert): use the new returned value from
11041 encodeString to get deadkeys and keymaps done correctly.
11043 * src/chset.C (encodeString): changed to return a pair, to tell
11044 what to use if we know the string.
11046 * src/lyxscreen.h (fillArc): new function.
11048 * src/FontInfo.C (resize): rewritten to use more std::string like
11049 structore, especially string::replace.
11051 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
11054 * configure.in (chmod +x some scripts): remove config/gcc-hack
11056 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11058 * src/buffer.C (writeFile): change once again the top comment in a
11059 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
11060 instead of an hardcoded version number.
11061 (makeDocBookFile): ditto
11063 * src/version.h: add new define LYX_DOCVERSION
11065 * po/de.po: update from Pit Sütterlin
11066 * lib/bind/de_menus.bind: ditto.
11068 * src/lyxfunc.C (Dispatch): call MenuExport()
11069 * src/buffer.C (Dispatch): ditto
11071 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
11072 LyXFunc::Dispatch().
11073 (MenuExport): new function, moved from
11074 LyXFunc::Dispatch().
11076 * src/trans_mgr.C (insert): small cleanup
11077 * src/chset.C (loadFile): ditto
11079 * lib/kbd/iso8859-1.cdef: add missing backslashes
11081 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11083 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
11084 help with placing the manually drawn accents better.
11086 (Draw): x2 and hg changed to float to minimize rounding errors and
11087 help place the accents better.
11089 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
11090 unsigned short to char is just wrong...cast the char to unsigned
11091 char instead so that the two values can compare sanely. This
11092 should also make the display of insetlatexaccents better and
11093 perhaps also some other insets.
11095 (lbearing): new function
11098 1999-12-15 Allan Rae <rae@lyx.org>
11100 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
11101 header that provides a wrapper around the very annoying SGI STL header
11104 * src/support/lyxstring.C, src/LString.h:
11105 removed old SGI-STL-compatability attempts.
11107 * configure.in: Use LYX_STL_STRING_FWD.
11109 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
11110 stl_string_fwd.h is around and try to determine it's location.
11111 Major improvement over previous SGI STL 3.2 compatability.
11112 Three small problems remain with this function due to my zero
11113 knowledge of autoconf. JMarc and lgb see the comments in the code.
11115 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11117 * src/broken_const.h, config/hack-gcc, config/README: removed
11119 * configure.in: remove --with-gcc-hack option; do not call
11122 * INSTALL: remove documentation of --with-broken-const and
11125 * acconfig.h: remove all trace of BROKEN_CONST define
11127 * src/buffer.C (makeDocBookFile): update version number in output
11129 (SimpleDocBookOnePar): fix an assert when trying to a character
11130 access beyond string length
11133 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11135 * po/de.po: fix the Export menu
11137 * lyx.man: update the description of -dbg
11139 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
11140 (commandLineHelp): updated
11141 (easyParse): show list of available debug levels if -dbg is passed
11144 * src/Makefile.am: add debug.C
11146 * src/debug.h: moved some code to debug.C
11148 * src/debug.C: new file. Contains code to set and show debug
11151 * src/layout.C: remove 'break' after 'continue' in switch
11152 statements, since these cannot be reached.
11154 1999-12-13 Allan Rae <rae@lyx.org>
11156 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
11157 (in_word_set): hash() -> math_hash()
11159 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
11161 * acconfig.h: Added a test for whether we are using exceptions in the
11162 current compilation run. If so USING_EXCEPTIONS is defined.
11164 * config.in: Check for existance of stl_string_fwd.h
11165 * src/LString.h: If compiling --with-included-string and SGI's
11166 STL version 3.2 is present (see above test) we need to block their
11167 forward declaration of string and supply a __get_c_string().
11168 However, it turns out this is only necessary if compiling with
11169 exceptions enabled so I've a bit more to add yet.
11171 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
11172 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
11173 src/support/LRegex.h, src/undo.h:
11174 Shuffle the order of the included files a little to ensure that
11175 LString.h gets included before anything that includes stl_string_fwd.h
11177 * src/support/lyxstring.C: We need to #include LString.h instead of
11178 lyxstring.h to get the necessary definition of __get_c_string.
11179 (__get_c_string): New function. This is defined static just like SGI's
11180 although why they need to do this I'm not sure. Perhaps it should be
11181 in lstrings.C instead.
11183 * lib/templates/IEEEtran.lyx: New template file.
11185 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11187 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
11188 * intl/Makefile.in (MKINSTALLDIRS): ditto
11190 * src/LyXAction.C (init): changed to hold the LFUN data in a
11191 automatic array in stead of in callso to newFunc, this speeds up
11192 compilation a lot. Also all the memory used by the array is
11193 returned when the init is completed.
11195 * a lot of files: compiled with -Wold-style-cast, changed most of
11196 the reported offenders to C++ style casts. Did not change the
11197 offenders in C files.
11199 * src/trans.h (Match): change argument type to unsigned int.
11201 * src/support/DebugStream.C: fix some types on the streambufs so
11202 that it works on a conforming implementation.
11204 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11206 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
11208 * src/support/lyxstring.C: remove the inline added earlier since
11209 they cause a bunch of unsatisfied symbols when linking with dec
11210 cxx. Cxx likes to have the body of inlines at the place where they
11213 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
11214 accessing negative bounds in array. This fixes the crash when
11215 inserting accented characters.
11216 * src/trans.h (Match): ditto
11218 * src/buffer.C (Dispatch): since this is a void, it should not try
11219 to return anything...
11221 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11223 * src/buffer.h: removed the two friends from Buffer. Some changes
11224 because of this. Buffer::getFileName and Buffer::setFileName
11225 renamed to Buffer::fileName() and Buffer::fileName(...).
11227 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11229 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
11230 and Buffer::update(short) to BufferView. This move is currently
11231 controlled by a define MOVE_TEXT, this will be removed when all
11232 shows to be ok. This move paves the way for better separation
11233 between buffer contents and buffer view. One side effect is that
11234 the BufferView needs a rebreak when swiching buffers, if we want
11235 to avoid this we can add a cache that holds pointers to LyXText's
11236 that is not currently in use.
11238 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
11241 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11243 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
11245 * lyx_main.C: new command line option -x (or --execute) and
11246 -e (or --export). Now direct conversion from .lyx to .tex
11247 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
11248 Unfortunately, X is still needed and the GUI pops up during the
11251 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11253 * src/Spacing.C: add a using directive to bring stream stuff into
11255 * src/paragraph.C: ditto
11256 * src/buffer.C: ditto
11258 * NEWS: updated a bit the new features of 1.1.3 (took a few things
11259 from Lars' announcement).
11261 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
11262 example files from Tino Meinen.
11264 1999-12-06 Allan Rae <rae@lyx.org>
11266 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
11268 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11270 * src/support/lyxstring.C: added a lot of inline for no good
11273 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
11274 latexWriteEndChanges, they were not used.
11276 * src/layout.h (operator<<): output operator for PageSides
11278 * src/mathed/math_iter.C (my_memcpy): slightly changed.
11280 * some example files: loaded in LyX 1.0.4 and saved again to update
11281 certain constructs (table format)
11283 * a lot of files: did the change to use fstream/iostream for all
11284 writing of files. Done with a close look at Andre Poenitz's patch.
11286 * some files: whitespace changes.
11288 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11290 * src/mathed/math_iter.C (my_memcpy): new function. Since the
11291 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
11292 architecture, we provide our own. It is used unconditionnally, but
11293 I do not think this is a performance problem. Thanks to Angus
11294 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
11295 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
11297 (GetInset): use my_memcpy.
11301 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
11302 it is easier to understand, but it uses less TeX-only constructs now.
11304 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
11305 elements contain spaces
11307 * lib/configure: regenerated
11309 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
11310 elements contain spaces; display the list of programs that are
11313 * autogen.sh: make sure lib/configure is executable
11315 * lib/examples/*: rename the tutorial examples to begin with the
11316 two-letters language code.
11318 * src/lyxfunc.C (getStatus): do not query current font if no
11321 * src/lyx_cb.C (RunScript): use QuoteName
11322 (MenuRunDvips): ditto
11323 (PrintApplyCB): ditto
11325 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
11326 around argument, so that it works well with the current shell.
11327 Does not work properly with OS/2 shells currently.
11329 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
11330 * src/LyXSendto.C (SendtoApplyCB): ditto
11331 * src/lyxfunc.C (Dispatch): ditto
11332 * src/buffer.C (runLaTeX): ditto
11333 (runLiterate): ditto
11334 (buildProgram): ditto
11336 * src/lyx_cb.C (RunScript): ditto
11337 (MenuMakeLaTeX): ditto
11339 * src/buffer.h (getLatexName): new method
11341 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
11343 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11345 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
11346 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
11347 (create_math_panel): ditto
11349 * src/lyxfunc.C (getStatus): re-activate the code which gets
11350 current font and cursor; add test for export to html.
11352 * src/lyxrc.C (read): remove unreachable break statements; add a
11355 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
11357 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11359 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
11360 introduced by faulty regex.
11361 * src/buffer.C: ditto
11362 * src/lastfiles.C: ditto
11363 * src/paragraph.C: ditto
11364 * src/table.C: ditto
11365 * src/vspace.C: ditto
11366 * src/insets/figinset.C: ditto
11367 Note: most of these is absolutely harmless, except the one in
11368 src/mathed formula.C.
11370 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
11372 * src/ImportNoweb.C (documentclass): fixed bounds for substr
11373 operation, yielding correct results for the reLyX command.
11375 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11377 * src/support/filetools.C (ExpandPath): removed an over eager
11379 (ReplaceEnvironmentPath): ditto
11381 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
11382 shows that we are doing something fishy in our code...
11383 (BubblePost): ditto
11386 * src/lyxrc.C (read): use a double switch trick to get more help
11387 from the compiler. (the same trick is used in layout.C)
11388 (write): new function. opens a ofstream and pass that to output
11389 (output): new function, takes a ostream and writes the lyxrc
11390 elemts to it. uses a dummy switch to make sure no elements are
11393 * src/lyxlex.h: added a struct pushpophelper for use in functions
11394 with more than one exit point.
11396 * src/lyxlex.[Ch] (GetInteger): made it const
11400 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
11402 * src/layout.[hC] : LayoutTags splitted into several enums, new
11403 methods created, better error handling cleaner use of lyxlex. Read
11406 * src/bmtable.[Ch]: change some member prototypes because of the
11407 image const changes.
11409 * commandtags.h, src/LyXAction.C (init): new function:
11410 "preferences-save", saves the lyxrc entries into .lyx/preferences.
11411 This file is not read automatically but you can add \input
11412 preferences to your lyxrc if you want to. We need to discuss how
11415 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
11416 in .aux, also remove .bib and .bst files from dependencies when
11419 * src/BufferView.C, src/LyXView.C: add const_cast several places
11420 because of changes to images.
11422 * lib/images/*: same change as for images/*
11424 * lib/lyxrc.example: Default for accept_compound is false not no.
11426 * images/*: changed to be const, however I have som misgivings
11427 about this change so it might be changed back.
11429 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11431 * lib/configure, po/POTFILES.in: regenerated
11433 * autogen.sh: autogenerate lib/configure from lib/configure.m4
11435 * config/lib_configure.m4: removed
11437 * lib/configure.m4: new file (was config/lib_configure.m4)
11439 * configure.in: do not test for rtti, since we do not use it.
11441 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11443 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
11444 doubling of allocated space scheme. This makes it faster for large
11445 strings end to use less memory for small strings. xtra rememoved.
11447 * src/insets/figinset.C (waitalarm): commented out.
11448 (GhostscriptMsg): use static_cast
11449 (GhostscriptMsg): use new instead of malloc to allocate memory for
11450 cmap. also delete the memory after use.
11452 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
11454 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
11455 for changes in bibtex database or style.
11456 (runBibTeX): remove all .bib and .bst files from dep before we
11458 (run): use scanAuc in when dep file already exist.
11460 * src/DepTable.C (remove_files_with_extension): new method
11461 (exist): new method
11463 * src/DepTable.[Ch]: made many of the methods const.
11465 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11467 * src/bufferparams.C: make sure that the default textclass is
11468 "article". It used to be the first one by description order, but
11469 now the first one is "docbook".
11471 * src/lyx_main.C (setDebuggingLevel): change type of argument to
11472 string; call Debug::value.
11473 (easyParse): pass complete argument to setDebuggingLevel().
11475 * src/debug.h (value): fix the code that parses debug levels.
11477 * src/debug.h: add new debug type ACTION, reserved for LyXAction
11480 * src/LyXAction.C: use Debug::ACTION as debug channel.
11482 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
11484 * NEWS: updated for the future 1.1.3 release.
11486 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
11487 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
11488 it should. This is of course a controversial change (since many
11489 people will find that their lyx workscreen is suddenly full of
11490 red), but done for the sake of correctness.
11492 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
11493 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
11495 * src/insets/inseterror.h, src/insets/inseturl.h,
11496 src/insets/insetinfo.h, src/insets/figinset.h,
11497 src/mathed/formulamacro.h, src/mathed/math_macro.h
11498 (EditMessage): add a missing const and add _() to make sure that
11499 translation happens
11501 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
11502 src/insets/insetbib.C, src/support/filetools.C: add `using'
11503 directives for cxx.
11505 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
11506 doing 'Insert index of last word' at the beginning of a paragraph.
11508 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11510 * several files: white-space changes.
11512 * src/mathed/formula.C: removed IsAlpha and IsDigit
11514 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
11515 .bib file. use a ifstream instead of FilePtr when parsing the .bib
11518 * src/insets/figinset.C (GetPSSizes): don't break when
11519 "EndComments" is seen. But break when a boundingbox is read.
11521 * all classes inherited from Inset: return value of Clone
11522 changed back to Inset *.
11524 * all classes inherited form MathInset: return value of Clone
11525 changed back to MathedInset *.
11527 * src/insets/figinset.C (runqueue): use a ofstream to output the
11528 gs/ps file. Might need some setpresicion or setw. However I can
11529 see no problem with the current code.
11530 (runqueue): use sleep instead of the alarm/signal code. I just
11531 can't see the difference.
11533 * src/paragraph.C (LyXParagraph): reserve space in the new
11534 paragraph and resize the inserted paragraph to just fit.
11536 * src/lyxfunc.h (operator|=): added operator for func_status.
11538 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
11539 check for readable file.
11541 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
11542 check for readable file.
11543 (MenuMakeLinuxDoc): ditto
11544 (MenuMakeDocBook): ditto
11545 (MenuMakeAscii): ditto
11546 (InsertAsciiFile): split the test for openable and readable
11548 * src/bmtable.C (draw_bitmaptable): use
11549 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
11551 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
11552 findtexfile from LaTeX to filetools.
11554 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
11555 instead of FilePtr. Needs to be verified by a literate user.
11557 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11559 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
11560 (EditMessage): likewise.
11562 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
11563 respectively as \textasciitilde and \textasciicircum.
11565 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11567 * src/support/lyxstring.h: made the methods that take iterators
11568 use const_iterator.
11570 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
11571 (regexMatch): made is use the real regex class.
11573 * src/support/Makefile.am: changed to use libtool
11575 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
11577 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
11579 (MathIsInset ++): changed several macros to be inline functions
11582 * src/mathed/Makefile.am: changed to use libtool
11584 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
11586 * src/insets/inset* : Clone changed to const and return type is
11587 the true insettype not just Inset*.
11589 * src/insets/Makefile.am: changed to use libtool
11591 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
11593 * src/undo.[Ch] : added empty() and changed some of the method
11596 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
11598 * src/lyxparagraph.h: use id() and id(...) instead of getID and
11599 setID use block<> for the bullets array, added const several places.
11601 * src/lyxfunc.C (getStatus): new function
11603 * src/lyxfunc.[Ch] : small changes to take advantage of the new
11604 LyXAction, added const to several funtions.
11606 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
11607 a std::map, and to store the dir items in a vector.
11609 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
11612 * src/LyXView.[Ch] + other files : changed currentView to view.
11614 * src/LyXAction.[Ch] : ported from the old devel branch.
11616 * src/.cvsignore: added .libs and a.out
11618 * configure.in : changes to use libtool.
11620 * acinclude.m4 : inserted libtool.m4
11622 * .cvsignore: added libtool
11624 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11626 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
11627 file name in insets and mathed directories (otherwise the
11628 dependency is not taken in account under cygwin).
11630 * src/text2.C (InsertString[AB]): make sure that we do not try to
11631 read characters past the string length.
11633 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11635 * lib/doc/LaTeXConfig.lyx.in,
11636 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
11638 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
11639 file saying who created them and when this heppened; this is
11640 useless and annoys tools like cvs.
11642 * lib/layouts/g-brief-{en,de}.layout,
11643 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
11644 from Thomas Hartkens <thomas@hartkens.de>.
11646 * src/{insets,mathed}/Makefile.am: do not declare an empty
11647 LDFLAGS, so that it can be set at configure time (useful on Irix
11650 * lib/reLyX/configure.in: make sure that the prefix is set
11651 correctly in LYX_DIR.
11653 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
11655 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
11656 be used by 'command-sequence' this allows to bind a key to a
11657 sequence of LyX-commands
11658 (Example: 'command-sequence math-insert alpha; math-insert beta;")
11660 * src/LyXAction.C: add "command-sequence"
11662 * src/LyXFunction.C: handling of "command-sequence"
11664 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
11665 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
11667 * src/lyxserver.C, src/minibuffer.C: Use this new interface
11669 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11671 * src/buffer.C (writeFile): Do not output a comment giving user
11672 and date at the beginning of a .lyx file. This is useless and
11673 annoys cvs anyway; update version number to 1.1.
11675 * src/Makefile.am (LYX_DIR): add this definition, so that a
11676 default path is hardcoded in LyX.
11678 * configure.in: Use LYX_GNU_GETTEXT.
11680 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
11681 AM_GNU_GETTEXT with a bug fixed.
11683 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
11685 * src/chset.C: add "using std::ifstream;" to please dec cxx.
11687 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
11688 which is used to point to LyX data is now LYX_DIR_11x.
11690 * lyx.man: convert to a unix text file; small updates.
11692 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
11694 * src/support/LSubstring.[Ch]: made the second arg of most of the
11695 constructors be a const reference.
11697 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
11700 * src/support/lyxstring.[Ch] (swap): added missing member function
11701 and specialization of swap(str, str);
11703 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
11705 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
11706 trace of the old one.
11708 * src/undo.[Ch]: made the undostack use std::list to store undo's in
11709 put the member definitions in undo.C.
11711 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
11712 NEW_TEXT and have now only code that was included when this was
11715 * src/intl.C (LCombo): use static_cast
11717 (DispatchCallback): ditto
11719 * src/definitions.h: removed whole file
11721 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
11723 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
11724 parsing and stores in a std:map. a regex defines the file format.
11725 removed unneeded members.
11727 * src/bufferparams.h: added several enums from definitions.h here.
11728 Removed unsused destructor. Changed some types to use proper enum
11729 types. use block to have the temp_bullets and user_defined_bullets
11730 and to make the whole class assignable.
11732 * src/bufferparams.C (Copy): removed this functions, use a default
11733 assignment instead.
11735 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
11738 * src/buffer.C (readLyXformat2): commend out all that have with
11739 oldpapersize to do. also comment out all that hve to do with
11740 insetlatex and insetlatexdel.
11741 (setOldPaperStuff): commented out
11743 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11745 * src/LyXAction.C: remove use of inset-latex-insert
11747 * src/mathed/math_panel.C (button_cb): use static_cast
11749 * src/insets/Makefile.am (insets_o_SOURCES): removed
11752 * src/support/lyxstring.C (helper): use the unsigned long
11753 specifier, UL, instead of a static_cast.
11755 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11757 * src/support/block.h: new file. to be used as a c-style array in
11758 classes, so that the class can be assignable.
11760 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11762 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11763 NULL, make sure to return an empty string (it is not possible to
11764 set a string to NULL).
11766 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11768 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11770 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11772 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11773 link line, so that Irix users (for example) can set it explicitely to
11776 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11777 it can be overidden at make time (static or dynamic link, for
11780 * src/vc-backend.C, src/LaTeXFeatures.h,
11781 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11782 statements to bring templates to global namespace.
11784 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11786 * src/support/lyxstring.C (operator[] const): make it standard
11789 * src/minibuffer.C (Init): changed to reflect that more
11790 information is given from the lyxvc and need not be provided here.
11792 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11794 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11796 * src/LyXView.C (UpdateTimerCB): use static_cast
11797 (KeyPressMask_raw_callback): ditto
11799 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11800 buffer_, a lot of changes because of this. currentBuffer() ->
11801 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11802 also changes to other files because of this.
11804 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11806 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11807 have no support for RCS and partial support for CVS, will be
11810 * src/insets/ several files: changes because of function name
11811 changes in Bufferview and LyXView.
11813 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11815 * src/support/LSubstring.[Ch]: new files. These implement a
11816 Substring that can be very convenient to use. i.e. is this
11818 string a = "Mary had a little sheep";
11819 Substring(a, "sheep") = "lamb";
11820 a is now "Mary has a little lamb".
11822 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11823 out patterns and subpatterns of strings. It is used by LSubstring
11824 and also by vc-backend.C
11826 * src/support/lyxstring.C: went over all the assertions used and
11827 tried to correct the wrong ones and flag which of them is required
11828 by the standard. some bugs found because of this. Also removed a
11829 couple of assertions.
11831 * src/support/Makefile.am (libsupport_a_SOURCES): added
11832 LSubstring.[Ch] and LRegex.[Ch]
11834 * src/support/FileInfo.h: have struct stat buf as an object and
11835 not a pointer to one, some changes because of this.
11837 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11838 information in layout when adding the layouts preamble to the
11839 textclass preamble.
11841 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11844 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11845 because of bug in OS/2.
11847 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11849 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11850 \verbatim@font instead of \ttfamily, so that it can be redefined.
11852 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11853 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11854 src/layout.h, src/text2.C: add 'using' directive to bring the
11855 STL templates we need from the std:: namespace to the global one.
11856 Needed by DEC cxx in strict ansi mode.
11858 * src/support/LIstream.h,src/support/LOstream.h,
11859 src/support/lyxstring.h,src/table.h,
11860 src/lyxlookup.h: do not include <config.h> in header
11861 files. This should be done in the .C files only.
11863 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11867 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11869 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11870 from Kayvan to fix the tth invokation.
11872 * development/lyx.spec.in: updates from Kayvan to reflect the
11873 changes of file names.
11875 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11877 * src/text2.C (InsertStringB): use std::copy
11878 (InsertStringA): use std::copy
11880 * src/bufferlist.C: use a vector to store the buffers in. This is
11881 an internal change and should not affect any other thing.
11883 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11886 * src/text.C (Fill): fix potential bug, one off bug.
11888 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11890 * src/Makefile.am (lyx_main.o): add more files it depends on.
11892 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11894 * src/support/lyxstring.C: use size_t for the reference count,
11895 size, reserved memory and xtra.
11896 (internal_compare): new private member function. Now the compare
11897 functions should work for std::strings that have embedded '\0'
11899 (compare): all compare functions rewritten to use
11902 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11904 * src/support/lyxstring.C (compare): pass c_str()
11905 (compare): pass c_str
11906 (compare): pass c_str
11908 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11910 * src/support/DebugStream.C: <config.h> was not included correctly.
11912 * lib/configure: forgot to re-generate it :( I'll make this file
11913 auto generated soon.
11915 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11917 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11920 * src/support/lyxstring.C: some changes from length() to rep->sz.
11921 avoids a function call.
11923 * src/support/filetools.C (SpaceLess): yet another version of the
11924 algorithm...now per Jean-Marc's suggestions.
11926 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11928 * src/layout.C (less_textclass_desc): functor for use in sorting
11930 (LyXTextClass::Read): sort the textclasses after reading.
11932 * src/support/filetools.C (SpaceLess): new version of the
11933 SpaceLess functions. What problems does this one give? Please
11936 * images/banner_bw.xbm: made the arrays unsigned char *
11938 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11940 * src/support/lyxstring.C (find): remove bogus assertion in the
11941 two versions of find where this has not been done yet.
11943 * src/support/lyxlib.h: add missing int return type to
11946 * src/menus.C (ShowFileMenu): disable exporting to html if no
11947 html export command is present.
11949 * config/lib_configure.m4: add a test for an HTML converter. The
11950 programs checked for are, in this order: tth, latex2html and
11953 * lib/configure: generated from config/lib_configure.m4.
11955 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11956 html converter. The parameters are now passed through $$FName and
11957 $$OutName, instead of standard input/output.
11959 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11961 * lib/lyxrc.example: update description of \html_command.
11962 add "quotes" around \screen_font_xxx font setting examples to help
11963 people who use fonts with spaces in their names.
11965 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11967 * Distribution files: updates for v1.1.2
11969 * src/support/lyxstring.C (find): remove bogus assert and return
11970 npos for the same condition.
11972 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11974 * added patch for OS/2 from SMiyata.
11976 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11978 * src/text2.C (CutSelection): make space_wrapped a bool
11979 (CutSelection): dont declare int i until we have to.
11980 (alphaCounter): return a char const *.
11982 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11984 * src/support/syscall.C (Systemcalls::kill):
11985 src/support/filetools.C (PutEnv, PutEnvPath):
11986 src/lyx_cb.C (addNewlineAndDepth):
11987 src/FontInfo.C (FontInfo::resize): condition some #warning
11988 directives with WITH_WARNINGS.
11991 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11993 * src/layout.[Ch] + several files: access to class variables
11994 limited and made accessor functions instead a lot of code changed
11995 becuase of this. Also instead of returning pointers often a const
11996 reference is returned instead.
11998 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
12000 * src/Makefile.am (dist-hook): added used to remove the CVS from
12001 cheaders upon creating a dist
12002 (EXTRA_DIST): added cheaders
12004 * src/support/lstrings.C (tostr(char)): fix it to handle param as
12005 a character not as a small integer.
12007 * src/support/lyxstring.C (find): removed Assert and added i >=
12008 rep->sz to the first if.
12010 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12012 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
12013 src/LyXView.C src/buffer.C src/bufferparams.C
12014 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
12015 src/text2.C src/insets/insetinclude.C:
12016 lyxlayout renamed to textclasslist.
12018 * src/layout.C: some lyxerr changes.
12020 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
12021 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
12022 (LyXLayoutList): removed all traces of this class.
12023 (LyXTextClass::Read): rewrote LT_STYLE
12024 (LyXTextClass::hasLayout): new function
12025 (LyXTextClass::GetLayout): rewritten to return an iterator + has
12026 both const and nonconst version.
12027 (LyXTextClass::delete_layout): new function.
12028 (LyXTextClassList::Style): bug fix. do the right thing if layout
12030 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
12031 (LyXTextClassList::NameOfLayout): ditto
12032 (LyXTextClassList::Load): ditto
12034 * src/buffer.C (makeLaTeXFile): new access to layoutlist
12036 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
12038 * src/LyXAction.C (LookupFunc): added a workaround for sun
12039 compiler, on the other hand...we don't know if the current code
12040 compiles on sun at all...
12042 * src/support/filetools.C (CleanupPath): subst fix
12044 * src/insets/insetbib.C (delDatabase): subst fix, this looks
12047 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
12048 complained about this one?
12050 * src/insets/insetinclude.C (Latex): subst fix
12052 * src/insets/insetbib.C (getKeys): subst fix
12054 * src/LyXSendto.C (SendtoApplyCB): subst fix
12056 * src/lyx_main.C (init): subst fix
12058 * src/layout.C (Read): subst fix
12060 * src/lyx_sendfax_main.C (button_send): subst fix
12062 * src/buffer.C (RoffAsciiTable): subst fix
12064 * src/lyx_cb.C (MenuFax): subst fix
12065 (PrintApplyCB): subst fix
12067 1999-10-26 Juergen Vigna <jug@sad.it>
12069 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
12071 (Read): Cleaned up this code so now we read only format vestion >= 5
12073 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
12075 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
12076 come nobody has complained about this one?
12078 * src/insets/insetinclude.C (Latex): subst fix
12080 * src/insets/insetbib.C (getKeys): subst fix
12082 * src/lyx_main.C (init): subst fix
12084 * src/layout.C (Read): subst fix
12086 * src/buffer.C (RoffAsciiTable): subst fix
12088 * src/lyx_cb.C (MenuFax): subst fix.
12090 * src/layout.[hC] + some other files: rewrote to use
12091 std::container to store textclasses and layouts in.
12092 Simplified, removed a lot of code. Make all classes
12093 assignable. Further simplifications and review of type
12094 use still to be one.
12096 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
12097 lastfiles to create the lastfiles partr of the menu.
12099 * src/lastfiles.[Ch]: rewritten to use deque to store the
12100 lastfiles in. Uses fstream for reading and writing. Simplifies
12103 * src/support/syscall.C: remove explicit cast.
12105 * src/BufferView.C (CursorToggleCB): removed code snippets that
12106 were commented out.
12107 use explicat C++ style casts instead of C style casts. also use
12108 u_vdata instea of passing pointers in longs.
12110 * src/PaperLayout.C: removed code snippets that were commented out.
12112 * src/lyx_gui_misc.C: removed code snippets that were commented out.
12114 * src/lyx_main.C: removed code snippets that wer commented out.
12116 * src/paragraph.C: removed code snippets that were commented out.
12118 * src/lyxvc.C (logClose): use static_cast
12120 (viewLog): remove explicit cast to void*
12121 (showLog): removed old commented code
12123 * src/menus.C: use static_cast instead of C style casts. use
12124 u_vdata instead of u_ldata. remove explicit cast to (long) for
12125 pointers. Removed old code that was commented out.
12127 * src/insets/inset.C: removed old commented func
12129 * src/insets/insetref.C (InsetRef): removed old code that had been
12130 commented out for a long time.
12132 (escape): removed C style cast
12134 * src/insets/insetlatexaccent.C (Draw): removed old commented code
12136 * src/insets/insetlatex.C (Draw): removed old commented code
12137 (Read): rewritten to use string
12139 * src/insets/insetlabel.C (escape): removed C style cast
12141 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
12143 * src/insets/insetindex.C: use static_cast and u_vdata, removed
12144 old commented code.
12146 * src/insets/insetinclude.h: removed a couple of stupid bools
12148 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
12149 (Clone): remove C style cast
12150 (getKeys): changed list to lst because of std::list
12152 * src/insets/inseterror.C (Draw): removed som old commented code.
12154 * src/insets/insetcommand.C (Draw): removed some old commented code.
12156 * src/insets/insetbib.C (bibitem_cb): removed code that has been
12157 commented out forever.
12158 (bibitem_cb): use static_cast instead of C style cast
12159 use of vdata changed to u_vdata.
12161 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
12163 (CloseUrlCB): use static_cast instead of C style cast.
12164 (CloseUrlCB): added a fl_free form...it seemed to be missing.
12166 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
12167 (C_InsetInfo_CloseInfoCB): forward the ob parameter
12168 (CloseInfoCB): static_cast from ob->u_vdata instead.
12169 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
12172 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
12173 (C_InsetError_CloseErrorCB): forward the ob parameter
12174 (CloseErrorCB): static_cast from ob->u_vdata instead.
12176 * src/vspace.h: include LString.h since we use string in this class.
12178 * src/vspace.C (lyx_advance): changed name from advance because of
12179 nameclash with stl. And since we cannot use namespaces yet...I
12180 used a lyx_ prefix instead. Expect this to change when we begin
12183 * src/BufferView.[Ch] (BufferView::~BufferView): removed
12185 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
12186 and removed now defunct constructor and deconstructor.
12188 * src/BufferView.h: have backstack as a object not as a pointer.
12189 removed initialization from constructor. added include for BackStack
12191 * development/lyx.spec.in (%build): add CFLAGS also.
12193 * src/screen.C (drawFrame): removed another warning.
12195 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12197 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
12198 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
12199 README and ANNOUNCE a bit for the next release. More work is
12202 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
12203 unbreakable if we are in freespacing mode (LyX-Code), but not in
12206 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
12208 * src/BackStack.h: fixed initialization order in constructor
12210 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
12212 * acinclude.m4 (VERSION): new rules for when a version is
12213 development, added also a variable for prerelease.
12214 (warnings): we set with_warnings=yes for prereleases
12215 (lyx_opt): prereleases compile with same optimization as development
12216 (CXXFLAGS): only use pedantic if we are a development version
12218 * src/BufferView.C (restorePosition): don't do anything if the
12219 backstack is empty.
12221 * src/BackStack.h: added member empty, use this to test if there
12222 is anything to pop...
12224 1999-10-25 Juergen Vigna <jug@sad.it>
12227 * forms/layout_forms.fd +
12228 * forms/latexoptions.fd +
12229 * lyx.fd: changed for various form resize issues
12231 * src/mathed/math_panel.C +
12232 * src/insets/inseterror.C +
12233 * src/insets/insetinfo.C +
12234 * src/insets/inseturl.C +
12235 * src/insets/inseturl.h +
12237 * src/LyXSendto.C +
12238 * src/PaperLayout.C +
12239 * src/ParagraphExtra.C +
12240 * src/TableLayout.C +
12242 * src/layout_forms.C +
12249 * src/menus.C: fixed various resize issues. So now forms can be
12250 resized savely or not be resized at all.
12252 * forms/form_url.fd +
12253 * src/insets/form_url.[Ch]: added because it's cleaner and easier
12256 * src/insets/Makefile.am: added files form_url.[Ch]
12258 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12260 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
12261 (and presumably 6.2).
12263 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
12264 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
12265 remaining static member callbacks.
12267 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
12270 * src/support/lyxstring.h: declare struct Srep as friend of
12271 lyxstring, since DEC cxx complains otherwise.
12273 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12275 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
12277 * src/LaTeX.C (run): made run_bibtex also depend on files with
12279 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
12280 are put into the dependency file.
12282 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
12283 the code has shown itself to work
12284 (create_ispell_pipe): removed another warning, added a comment
12287 * src/minibuffer.C (ExecutingCB): removed code that has been
12288 commented out a long time
12290 * src/lyxfunc.C (processKeyEvent): removed some very old commented
12291 out code + a warning.
12293 * src/support/lyxstring.h: comment out the three private
12294 operators, when compiling with string ansi conforming compilers
12295 they make problems.
12297 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
12299 (pixmapFromBitmapData): change type of bdata to be unsigned char *
12300 (pixmapFromBitmapData): add a reinterpret_cast in the call to
12303 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
12306 * src/mathed/math_panel.C (create_math_panel): remove explicit
12309 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
12312 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
12313 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
12314 to XCreatePixmapFromBitmapData
12315 (fl_set_bmtable_data): change the last argument to be unsigned
12317 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
12318 and bh to be unsigned int, remove explicit casts in call to
12319 XReadBitmapFileData.
12321 * images/arrows.xbm: made the arrays unsigned char *
12322 * images/varsz.xbm: ditto
12323 * images/misc.xbm: ditto
12324 * images/greek.xbm: ditto
12325 * images/dots.xbm: ditto
12326 * images/brel.xbm: ditto
12327 * images/bop.xbm: ditto
12329 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
12331 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
12332 (LYX_PROG_CXX): added -pedantic to g++ compile options when
12333 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
12335 (LYX_CXX_CHEADERS): added <clocale> to the test.
12337 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
12339 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
12341 * src/support/lyxstring.C (append): fixed something that must be a
12342 bug, rep->assign was used instead of rep->append.
12344 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
12347 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
12348 lyx insert double chars. Fix spotted by Kayvan.
12350 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12352 * Fixed the tth support. I messed up with the Emacs patch apply feature
12353 and omitted the changes in lyxrc.C.
12355 1999-10-22 Juergen Vigna <jug@sad.it>
12357 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
12359 * src/lyx_cb.C (MenuInsertRef) +
12360 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
12361 the form cannot be resized under it limits (fixes a segfault)
12363 * src/lyx.C (create_form_form_ref) +
12364 * forms/lyx.fd: Changed Gravity on name input field so that it is
12367 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12369 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
12370 <ostream> and <istream>.
12372 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
12373 whether <fstream> provides the latest standard features, or if we
12374 have an oldstyle library (like in egcs).
12375 (LYX_CXX_STL_STRING): fix the test.
12377 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
12378 code on MODERN_STL_STREAM.
12380 * src/support/lyxstring.h: use L{I,O}stream.h.
12382 * src/support/L{I,O}stream.h: new files, designed to setup
12383 correctly streams for our use
12384 - includes the right header depending on STL capabilities
12385 - puts std::ostream and std::endl (for LOStream.h) or
12386 std::istream (LIStream.h) in toplevel namespace.
12388 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12390 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
12391 was a bib file that had been changed we ensure that bibtex is run.
12392 (runBibTeX): enhanced to extract the names of the bib files and
12393 getting their absolute path and enter them into the dep file.
12394 (findtexfile): static func that is used to look for tex-files,
12395 checks for absolute patchs and tries also with kpsewhich.
12396 Alternative ways of finding the correct files are wanted. Will
12398 (do_popen): function that runs a command using popen and returns
12399 the whole output of that command in a string. Should be moved to
12402 * src/DepTable.[Ch] (extchanged): new function that returns true if a
12403 file with extension ext has changed.
12405 * src/insets/figinset.C: added ifdef guards around the fl_free
12406 code that jug commented out. Now it is commented out when
12407 compiling with XForms == 0.89.
12409 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
12410 to lyxstring.C, and only keep a forward declaration in
12411 lyxstring.h. Simplifies the header file a bit and should help a
12412 bit on compile time too. Also changes to Srep will not mandate a
12413 recompile of code just using string.
12414 (~lyxstring): definition moved here since it uses srep.
12415 (size): definition moved here since it uses srep.
12417 * src/support/lyxstring.h: removed a couple of "inline" that should
12420 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12422 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
12425 1999-10-21 Juergen Vigna <jug@sad.it>
12427 * src/table.C (SetPWidth): Just a small fix so the alignment is not
12428 set to left if I just remove the width entry (or it is empty).
12430 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
12431 paragraph when having dummy paragraphs.
12433 1999-10-20 Juergen Vigna <jug@sad.it>
12435 * src/insets/figinset.C: just commented some fl_free_form calls
12436 and added warnings so that this calls should be activated later
12437 again. This avoids for now a segfault, but we have a memory leak!
12439 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
12440 'const char * argument' to 'string argument', this should
12441 fix some Asserts() in lyxstring.C.
12443 * src/lyxfunc.h: Removed the function argAsString(const char *)
12444 as it is not used anymore.
12446 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
12448 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
12451 * src/Literate.h: some funcs moved from public to private to make
12452 interface clearer. Unneeded args removed.
12454 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
12456 (scanBuildLogFile): ditto
12458 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
12459 normal TeX Error. Still room for improvement.
12461 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
12463 * src/buffer.C (insertErrors): changes to make the error
12464 desctription show properly.
12466 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
12469 * src/support/lyxstring.C (helper): changed to use
12470 sizeof(object->rep->ref).
12471 (operator>>): changed to use a pointer instead.
12473 * src/support/lyxstring.h: changed const reference & to value_type
12474 const & lets see if that helps.
12476 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
12478 * Makefile.am (rpmdist): fixed to have non static package and
12481 * src/support/lyxstring.C: removed the compilation guards
12483 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
12486 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
12487 conditional compile of lyxstring.Ch
12489 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
12490 stupid check, but it is a lot better than the bastring hack.
12491 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
12493 * several files: changed string::erase into string::clear. Not
12496 * src/chset.C (encodeString): use a char temporary instead
12498 * src/table.C (TexEndOfCell): added tostr around
12499 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
12500 (TexEndOfCell): ditto
12501 (TexEndOfCell): ditto
12502 (TexEndOfCell): ditto
12503 (DocBookEndOfCell): ditto
12504 (DocBookEndOfCell): ditto
12505 (DocBookEndOfCell): ditto
12506 (DocBookEndOfCell): ditto
12508 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
12510 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
12512 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
12513 (MenuBuildProg): added tostr around ret
12514 (MenuRunChktex): added tostr around ret
12515 (DocumentApplyCB): added tostr around ret
12517 * src/chset.C (encodeString): added tostr around t->ic
12519 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
12520 (makeLaTeXFile): added tostr around tocdepth
12521 (makeLaTeXFile): added tostr around ftcound - 1
12523 * src/insets/insetbib.C (setCounter): added tostr around counter.
12525 * src/support/lyxstring.h: added an operator+=(int) to catch more
12528 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
12529 (lyxstring): We DON'T allow NULL pointers.
12531 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12533 * src/mathed/math_macro.C (MathMacroArgument::Write,
12534 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
12535 when writing them out.
12537 * src/LString.C: remove, since it is not used anymore.
12539 * src/support/lyxstring.C: condition the content to
12540 USE_INCLUDED_STRING macro.
12542 * src/mathed/math_symbols.C, src/support/lstrings.C,
12543 src/support/lyxstring.C: add `using' directive to specify what
12544 we need in <algorithm>. I do not think that we need to
12545 conditionalize this, but any thought is appreciated.
12547 * many files: change all callback functions to "C" linkage
12548 functions to please strict C++ compilers like DEC cxx 6.1 in mode
12549 strict_ansi. Those who were static are now global.
12550 The case of callbacks which are static class members is
12551 trickier, since we have to make C wrappers around them (see
12552 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
12553 did not finish this yet, since it defeats the purpose of
12554 encapsulation, and I am not sure what the best route is.
12556 1999-10-19 Juergen Vigna <jug@sad.it>
12558 * src/support/lyxstring.C (lyxstring): we permit to have a null
12559 pointer as assignment value and just don't assign it.
12561 * src/vspace.C (nextToken): corrected this function substituting
12562 find_first(_not)_of with find_last_of.
12564 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
12565 (TableOptCloseCB) (TableSpeCloseCB):
12566 inserted fl_set_focus call for problem with fl_hide_form() in
12569 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12571 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
12574 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12576 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
12577 LyXLex::next() and not eatline() to get its argument.
12579 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
12581 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
12582 instead, use fstreams for io of the depfile, removed unneeded
12583 functions and variables.
12585 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
12586 vector instead, removed all functions and variables that is not in
12589 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
12591 * src/buffer.C (insertErrors): use new interface to TeXError
12593 * Makefile.am (rpmdist): added a rpmdist target
12595 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
12596 per Kayvan's instructions.
12598 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12600 * src/Makefile.am: add a definition for localedir, so that locales
12601 are found after installation (Kayvan)
12603 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12605 * development/.cvsignore: new file.
12607 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12609 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
12610 C++ compiler provides wrappers for C headers and use our alternate
12613 * configure.in: use LYX_CXX_CHEADERS.
12615 * src/cheader/: new directory, populated with cname headers from
12616 libstdc++-2.8.1. They are a bit old, but probably good enough for
12617 what we want (support compilers who lack them).
12619 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
12620 from includes. It turns out is was stupid.
12622 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
12624 * lib/Makefile.am (install-data-local): forgot a ';'
12625 (install-data-local): forgot a '\'
12626 (libinstalldirs): needed after all. reintroduced.
12628 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
12630 * configure.in (AC_OUTPUT): added lyx.spec
12632 * development/lyx.spec: removed file
12634 * development/lyx.spec.in: new file
12636 * po/*.po: merged with lyx.pot becuase of make distcheck
12638 * lib/Makefile.am (dist-hook): added dist-hook so that
12639 documentation files will be included when doing a make
12640 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
12641 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
12643 more: tried to make install do the right thing, exclude CVS dirs
12646 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
12647 Path would fit in more nicely.
12649 * all files that used to use pathstack: uses now Path instead.
12650 This change was a lot easier than expected.
12652 * src/support/path.h: new file
12654 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
12656 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
12658 * src/support/lyxstring.C (getline): Default arg was given for
12661 * Configure.cmd: removed file
12663 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12665 * src/support/DebugStream.[Ch]: remove the explicit std:: before
12666 streams classes and types, add the proper 'using' statements when
12667 MODERN_STL is defined.
12669 * src/debug.h: move the << operator definition after the inclusion
12672 * src/support/filetools.C: include "LAssert.h", which is needed
12675 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
12678 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
12679 include "debug.h" to define a proper ostream.
12681 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
12683 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
12684 method to the SystemCall class which can kill a process, but it's
12685 not fully implemented yet.
12687 * src/*.C: Changed Systemcalls::Startscript() to startscript()
12689 * src/support/FileInfo.h: Better documentation
12691 * src/lyxfunc.C: Added support for buffer-export html
12693 * src/menus.C: Added Export->As HTML...
12695 * lib/bind/*.bind: Added short-cut for buffer-export html
12697 * src/lyxrc.*: Added support for new \tth_command
12699 * lib/lyxrc.example: Added stuff for new \tth_command
12701 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
12703 * lib/Makefile.am (IMAGES): removed images/README
12704 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
12705 installes in correct place. Check permisions is installed
12708 * src/LaTeX.C: some no-op changes moved declaration of some
12711 * src/LaTeX.h (LATEX_H): changed include guard name
12713 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12715 * lib/reLyX/Makefile.am: install noweb2lyx.
12717 * lib/Makefile.am: install configure.
12719 * lib/reLyX/configure.in: declare a config aux dir; set package
12720 name to lyx (not sure what the best solution is); generate noweb2lyx.
12722 * lib/layouts/egs.layout: fix the bibliography layout.
12724 1999-10-08 Jürgen Vigna <jug@sad.it>
12726 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
12727 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
12728 it returned without continuing to search the path.
12730 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
12732 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
12733 also fixes a bug. It is not allowed to do tricks with std::strings
12734 like: string a("hei"); &a[e]; this will not give what you
12735 think... Any reason for the complexity in this func?
12737 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
12739 * Updated README and INSTALL a bit, mostly to check that my
12740 CVS rights are correctly set up.
12742 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12744 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12745 does not allow '\0' chars but lyxstring and std::string does.
12747 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12749 * autogen.sh (AUTOCONF): let the autogen script create the
12750 POTFILES.in file too. POTFILES.in should perhaps now not be
12751 included in the cvs module.
12753 * some more files changed to use C++ includes instead of C ones.
12755 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12757 (Reread): added tostr to nlink. buggy output otherwise.
12758 (Reread): added a string() around szMode when assigning to Buffer,
12759 without this I got a log of garbled info strings.
12761 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12764 * I have added several ostream & operator<<(ostream &, some_type)
12765 functions. This has been done to avoid casting and warnings when
12766 outputting enums to lyxerr. This as thus eliminated a lot of
12767 explicit casts and has made the code clearer. Among the enums
12768 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12769 mathed enums, some font enum the Debug::type enum.
12771 * src/support/lyxstring.h (clear): missing method. equivalent of
12774 * all files that contained "stderr": rewrote constructs that used
12775 stderr to use lyxerr instead. (except bmtable)
12777 * src/support/DebugStream.h (level): and the passed t with
12778 Debug::ANY to avoid spurious bits set.
12780 * src/debug.h (Debug::type value): made it accept strings of the
12781 type INFO,INIT,KEY.
12783 * configure.in (Check for programs): Added a check for kpsewhich,
12784 the latex generation will use this later to better the dicovery of
12787 * src/BufferView.C (create_view): we don't need to cast this to
12788 (void*) that is done automatically.
12789 (WorkAreaButtonPress): removed some dead code.
12791 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12793 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12794 is not overwritten when translated (David Sua'rez de Lis).
12796 * lib/CREDITS: Added David Sua'rez de Lis
12798 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12800 * src/bufferparams.C (BufferParams): default input encoding is now
12803 * acinclude.m4 (cross_compiling): comment out macro
12804 LYX_GXX_STRENGTH_REDUCE.
12806 * acconfig.h: make sure that const is not defined (to empty) when
12807 we are compiling C++. Remove commented out code using SIZEOF_xx
12810 * configure.in : move the test for const and inline as late as
12811 possible so that these C tests do not interefere with C++ ones.
12812 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12813 has not been proven.
12815 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12817 * src/table.C (getDocBookAlign): remove bad default value for
12818 isColumn parameter.
12820 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12822 (ShowFileMenu2): ditto.
12824 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12825 of files to ignore.
12827 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12829 * Most files: finished the change from the old error code to use
12830 DebugStream for all lyxerr debugging. Only minor changes remain
12831 (e.g. the setting of debug levels using strings instead of number)
12833 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12835 * src/layout.C (Add): Changed to use compare_no_case instead of
12838 * src/FontInfo.C: changed loop variable type too string::size_type.
12840 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12842 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12843 set ETAGS_ARGS to --c++
12845 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12847 * src/table.C (DocBookEndOfCell): commented out two unused variables
12849 * src/paragraph.C: commented out four unused variables.
12851 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12852 insed a if clause with type string::size_type.
12854 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12857 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12859 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12860 variable, also changed loop to go from 0 to lenght + 1, instead of
12861 -1 to length. This should be correct.
12863 * src/LaTeX.C (scanError): use string::size_type as loop variable
12866 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12867 (l.896) since y_tmp and row was not used anyway.
12869 * src/insets/insetref.C (escape): use string::size_type as loop
12872 * src/insets/insetquotes.C (Width): use string::size_type as loop
12874 (Draw): use string::size_type as loop variable type.
12876 * src/insets/insetlatexaccent.C (checkContents): use
12877 string::size_type as loop variable type.
12879 * src/insets/insetlabel.C (escape): use string::size_type as loop
12882 * src/insets/insetinfo.C: added an extern for current_view.
12884 * src/insets/insetcommand.C (scanCommand): use string::size_type
12885 as loop variable type.
12887 * most files: removed the RCS tags. With them we had to recompile
12888 a lot of files after a simple cvs commit. Also we have never used
12889 them for anything meaningful.
12891 * most files: tags-query-replace NULL 0. As adviced several plases
12892 we now use "0" instead of "NULL" in our code.
12894 * src/support/filetools.C (SpaceLess): use string::size_type as
12895 loop variable type.
12897 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12899 * src/paragraph.C: fixed up some more string stuff.
12901 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12903 * src/support/filetools.h: make modestr a std::string.
12905 * src/filetools.C (GetEnv): made ch really const.
12907 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12908 made code that used these use max/min from <algorithm> instead.
12910 * changed several c library include files to their equivalent c++
12911 library include files. All is not changed yet.
12913 * created a support subdir in src, put lyxstring and lstrings
12914 there + the extra files atexit, fileblock, strerror. Created
12915 Makefile.am. edited configure.in and src/Makefile.am to use this
12916 new subdir. More files moved to support.
12918 * imported som of the functions from repository lyx, filetools
12920 * ran tags-query-replace on LString -> string, corrected the bogus
12921 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12922 is still some errors in there. This is errors where too much or
12923 too litle get deleted from strings (string::erase, string::substr,
12924 string::replace), there can also be some off by one errors, or
12925 just plain wrong use of functions from lstrings. Viewing of quotes
12928 * LyX is now running fairly well with string, but there are
12929 certainly some bugs yet (see above) also string is quite different
12930 from LString among others in that it does not allow null pointers
12931 passed in and will abort if it gets any.
12933 * Added the revtex4 files I forgot when setting up the repository.
12935 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12937 * All over: Tried to clean everything up so that only the files
12938 that we really need are included in the cvs repository.
12939 * Switched to use automake.
12940 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12941 * Install has not been checked.
12943 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12945 * po/pt.po: Three errors:
12946 l.533 and l.538 format specification error
12947 l. 402 duplicate entry, I just deleted it.