1 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/converter.C (runLaTeX): constify buffer argument
6 * src/frontends/support/Makefile.am (INCLUDES): fix.
8 * src/buffer.h: add std:: qualifier
9 * src/insets/figinset.C (addpidwait): ditto
10 * src/MenuBackend.C: ditto
12 * src/bufferlist.C: ditto
14 * src/lyxfunc.C: ditto
16 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
18 * src/lyxtext.h (bidi_level): change return type to
19 LyXParagraph::size_type.
21 * src/lyxparagraph.h: change size_type to
22 TextContainer::difference_type. This should really be
23 TextContainer::size_type, but we need currently to support signed
26 2000-10-11 Marko Vendelin <markov@ioc.ee>
27 * src/frontends/gnome/FormError.h
28 * src/frontends/gnome/FormRef.C
29 * src/frontends/gnome/FormRef.h
30 * src/frontends/gnome/FormError.C
31 * src/frontends/gnome/Makefile.am
32 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
33 to Gnome frontend. Both dialogs use "action" area.
35 2000-10-12 Baruch Even <baruch.even@writeme.com>
37 * src/graphics/GraphicsCacheItem_pimpl.C:
38 * src/graphics/Renderer.C:
39 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
42 2000-10-12 Juergen Vigna <jug@sad.it>
44 * src/insets/insettext.C (draw): fixed drawing bug (specifically
45 visible when selecting).
47 * development/Code_rules/Rules: fixed some typos.
49 2000-10-09 Baruch Even <baruch.even@writeme.com>
51 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
52 compiling on egcs 1.1.2 possible.
54 * src/filedlg.C (comp_direntry::operator() ): ditto.
56 2000-08-31 Baruch Even <baruch.even@writeme.com>
58 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
61 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
62 transient it now only gets freed when the object is destructed.
64 2000-08-24 Baruch Even <baruch.even@writeme.com>
66 * src/frontends/FormGraphics.h:
67 * src/frontends/FormGraphics.C: Changed to use ButtonController and
70 2000-08-20 Baruch Even <baruch.even@writeme.com>
72 * src/insets/insetgraphics.C:
73 (draw): Added messages to the drawn rectangle to report status.
74 (updateInset): Disabled the use of the inline graphics,
77 2000-08-17 Baruch Even <baruch.even@writeme.com>
79 * src/frontends/support: Directory added for the support of GUII LyX.
81 * src/frontends/support/LyXImage.h:
82 * src/frontends/support/LyXImage.C: Base class for GUII holding of
85 * src/frontends/support/LyXImage_X.h:
86 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
87 version of LyXImage, this uses the Xlib Pixmap.
92 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
93 replacement to Pixmap.
95 * src/insets/insetgraphics.h:
96 * src/insets/insetgraphics.C:
97 * src/graphics/GraphicsCacheItem.h:
98 * src/graphics/GraphicsCacheItem.C:
99 * src/graphics/GraphicsCacheItem_pimpl.h:
100 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
103 * src/graphics/GraphicsCacheItem.h:
104 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
105 another copy of the object.
107 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
108 of cacheHandle, this fixed a bug that sent LyX crashing.
110 * src/graphics/XPM_Renderer.h:
111 * src/graphics/XPM_Renderer.C:
112 * src/graphics/EPS_Renderer.h:
113 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
115 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
117 * src/lyxfunc.C (processKeySym): only handle the
118 lockinginset/inset stuff if we have a buffer and text loaded...
120 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
122 2000-10-12 <larsbj@baywatch.lyx.org>
124 * src/support/lyxfunctional.h: add operator= that takes a reference
126 * src/lyxserver.C (mkfifo): make first arg const
128 * src/layout.h: renamed name(...) to setName(...) to work around
131 * src/buffer.C (setFileName): had to change name of function to
132 work around bugs in egcs. (renamed from fileName)
134 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
136 * src/support/translator.h: move helper template classes to
137 lyxfunctional.h, include "support/lyxfunctional.h"
139 * src/support/lyxmanip.h: add delaration of fmt
141 * src/support/lyxfunctional.h: new file
142 (class_fun_t): new template class
143 (class_fun): helper template function
144 (back_insert_fun_iterator): new template class
145 (back_inserter_fun): helper template function
146 (compare_memfun_t): new template class
147 (compare_memfun): helper template function
148 (equal_1st_in_pair): moved here from translator
149 (equal_2nd_in_pair): moved here from translator
151 * src/support/fmt.C: new file
152 (fmt): new func, can be used for a printf substitute when still
153 using iostreams ex. lyxerr << fmg("Hello %s", "Jürgen") << endl;
155 * src/support/StrPool.C: add some comments
157 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
160 * src/insets/figinset.C (addpidwait): use std::copy with
161 ostream_iterator to fill the pidwaitlist
163 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
165 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
168 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
171 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
173 * src/frontends/xforms/FormDocument.C (build): remove c_str()
174 (class_update): ditto
176 (CheckChoiceClass): move initialization of tc and tct
178 * src/tabular.C: remove current_view
179 (OldFormatRead): similar to right below [istream::ignore]
181 * src/lyxlex_pimpl.C (next): add code for faster skipping of
182 chars, unfortunately this is buggy on gcc 2.95.2, so currently
183 unused [istream::ignore]
185 * src/lyxfunc.C: include "support/lyxfunctional.h"
186 (getInsetByCode): use std::find_if and compare_memfun
188 * src/lyxfont.C (stateText): remove c_str()
190 * src/lyx_main.C (setDebuggingLevel): make static
191 (commandLineHelp): make static
193 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
194 Screen* together with fl_get_display() and fl_screen
196 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
197 togheter with fl_get_display() and fl_screen
198 (create_forms): remove c_str()
200 * src/layout.C: include "support/lyxfunctional.h"
201 (hasLayout): use std::find_if and compare_memfun
202 (GetLayout): use std::find_if and comapre_memfun
203 (delete_layout): use std::remove_if and compare_memfun
204 (NumberOfClass): use std:.find_if and compare_memfun
206 * src/gettext.h: change for the new functions
208 * src/gettext.C: new file, make _(char const * str) and _(string
209 const & str) real functions.
211 * src/font.C (width): rewrite slightly to avoid one extra variable
213 * src/debug.C: initialize Debug::ANY here
215 * src/commandtags.h: update number comments
217 * src/combox.h (get): make const func
219 (getline): make const
221 * src/combox.C (input_cb): handle case where fl_get_input can
224 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
225 "support/lyxfunctional.h", remove current_view variable.
226 (resize): use std::for_each with std::mem_fun
227 (getFileNames): use std::copy with back_inserter_fun
228 (getBuffer): change arg type to unsigned int
229 (emergencyWriteAll): call emergencyWrite with std::for_each and
231 (emergencyWrite): new method, the for loop in emergencyWriteAll
233 (exists): use std::find_if with compare_memfun
234 (getBuffer): use std::find_if and compare_memfun
236 * src/buffer.h: add typedefs for iterator_category, value_type
237 difference_type, pointer and reference for inset_iterator
238 add postfix ++ for inset_iterator
239 make inset_iterator::getPos() const
241 * src/buffer.C: added support/lyxmanip.h
242 (readFile): use lyxerr << fmt instead of printf
243 (makeLaTeXFile): use std::copy to write out encodings
245 * src/Painter.C (text): rewrite slightly to avoid extra font variable
247 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
248 free and the char * temp.
249 (hasMenu): use std::find_if and compare_memfun
252 * src/Makefile.am (lyx_SOURCES): added gettext.C
254 * src/LyXAction.C (retrieveActionArg): clear the arg, use
255 string::insert small change to avoid temporary
257 * src/LColor.C (getGUIName): remove c_str()
259 * several files: change all occurrences of fl_display to
262 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
263 that -pedantic is not used for gcc 2.97 (cvs gcc)
265 * boost/Makefile.am: begin slowly to prepare for a real boost lib
267 2000-10-11 Allan Rae <rae@lyx.org>
269 * src/frontends/xforms/FormPreferences.C (input): template path must be
270 a readable directory. It doesn't need to be writeable.
271 (build, delete, update, apply): New inputs in the various tabfolders
273 * src/frontends/xforms/forms/form_preferences.fd:
274 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
275 several new entries to existing folders. Shuffled some existing stuff
278 * src/frontends/xforms/forms/form_print.fd:
279 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
280 Should probably rework PrinterParams as well. Note that the switch to
281 collated is effectively the same as !unsorted so changing PrinterParams
282 will require a lot of fiddly changes to reverse the existing logic.
284 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
286 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
288 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
290 2000-10-10 Allan Rae <rae@lyx.org>
293 * src/lyxfunc.C (Dispatch):
295 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
298 * src/lyxrc.C (output): Only write the differences between system lyxrc
299 and the users settings.
302 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
304 I'll rewrite this later, after 1.1.6 probably, to keep a single
305 LyXRC but two instances of a LyXRCStruct.
307 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
309 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
311 * src/tabular.h: add a few std:: qualifiers.
313 * src/encoding.C: add using directive.
314 * src/language.C: ditto.
316 * src/insets/insetquotes.C (Validate): use languages->lang()
317 instead of only language.
319 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
321 * lib/languages: New file.
323 * lib/encodings: New file.
325 * src/language.C (Languages): New class.
326 (read): New method. Reads the languages from the 'languages' file.
328 * src/encoding.C (Encodings): New class.
329 (read): New method. Reads the encodings from the 'encodings' file.
331 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
334 * src/bufferparams.h and a lot of files: Deleted the member language,
335 and renamed language_info to language
337 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
338 * src/lyxfont.C (latexWriteStartChanges): ditto.
339 * src/paragraph.C (validate,TeXOnePar): ditto.
341 * src/lyxfont.C (update): Restored deleted code.
343 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
345 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
347 * src/BufferView_pimpl.C (buffer): cleaned up a little.
349 * src/insets/figinset.[Ch]:
350 * src/insets/insetinclude.[Ch]:
351 * src/insets/insetinclude.[Ch]:
352 * src/insets/insetparent.[Ch]:
353 * src/insets/insetref.[Ch]:
354 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
357 * src/mathed/formula.[Ch]:
358 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
360 * src/buffer.C (parseSingleLyXformat2Token, readInset):
361 * src/lyx_cb.C (FigureApplyCB):
362 * src/lyxfunc.C (getStatus, Dispatch):
363 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
366 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
368 * src/converter.[Ch] (Formats::View):
369 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
371 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
372 *current_view->buffer(). This will change later, but this patch is way
375 2000-10-09 Juergen Vigna <jug@sad.it>
377 * src/text.C (GetRow): small fix.
379 * src/BufferView_pimpl.C (cursorPrevious):
380 (cursorNext): added LyXText parameter to function.
382 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
383 keypress depending on cursor position.
385 2000-10-06 Juergen Vigna <jug@sad.it>
387 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
388 (copySelection): redone this function and also copy ascii representa-
391 * src/tabular.C (Ascii):
395 (print_n_chars): new functions to realize the ascii export of tabulars.
397 2000-10-05 Juergen Vigna <jug@sad.it>
399 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
400 if we don't have a buffer.
402 2000-10-10 Allan Rae <rae@lyx.org>
404 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
405 with closing dialog. It seems that nested tabfolders require hiding
406 of inner tabfolders before hiding the dialog itself. Actually all I
407 did was hide the active outer folder.
409 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
410 unless there really is a buffer. hideBufferDependent is called
413 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
414 POTFILES.in stays in $(srcdir).
416 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
418 * lib/lyxrc.example: Few changes.
420 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
422 * src/BufferView_pimpl.C (buffer): only need one the
423 updateBufferDependent signal to be emitted once! Moved to the end of
424 the method to allow bv_->text to be updated first.
426 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
427 and hSignal_ with Dialogs * and BufferDependency variables.
428 New Buffer * parent_, initialised when the dialog is launched. Used to
429 check whether to update() or hide() dialog in the new, private
430 updateOrHide() method that is connected to the updateBufferDependent
431 signal. Daughter classes dictate what to do using the
432 ChangedBufferAction enum, passed to the c-tor.
434 * src/frontends/xforms/FormCitation.C:
435 * src/frontends/xforms/FormCommand.C:
436 * src/frontends/xforms/FormCopyright.C:
437 * src/frontends/xforms/FormDocument.C:
438 * src/frontends/xforms/FormError.C:
439 * src/frontends/xforms/FormIndex.C:
440 * src/frontends/xforms/FormPreferences.C:
441 * src/frontends/xforms/FormPrint.C:
442 * src/frontends/xforms/FormRef.C:
443 * src/frontends/xforms/FormToc.C:
444 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
447 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
448 ChangedBufferAction enum.
450 * src/frontends/xforms/FormParagraph.[Ch]
451 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
454 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
456 * lib/bind/cua.bind: fix a bit.
457 * lib/bind/emacs.bind: ditto.
459 * lib/bind/menus.bind: remove real menu entries from there.
461 * src/spellchecker.C: make sure we only include strings.h when
464 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
466 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
467 function. It enlarges the maximum number of pup when needed.
468 (add_toc2): Open a new menu if maximum number of items per menu has
471 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
473 * src/frontends/kde/FormPrint.C: fix error reporting
475 * src/frontends/xforms/FormDocument.C: fix compiler
478 * lib/.cvsignore: add Literate.nw
480 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
483 * bufferview_funcs.[Ch]
486 * text2.C: Add support for numbers in RTL text.
488 2000-10-06 Allan Rae <rae@lyx.org>
490 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
491 to be gettext.m4 friendly again. ext_l10n.h is now
492 generated into $top_srcdir instead of $top_builddir
493 so that lyx.pot will be built correctly -- without
494 duplicate parsing of ext_l10n.h.
496 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
498 * src/frontends/kde/FormCitation.C: make the dialog
501 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
503 * config/kde.m4: fix consecutive ./configure runs,
504 look for qtarch, fix library order
506 * src/frontends/kde/Makefile.am: tidy up,
507 add Print dialog, add .dlg dependencies
509 * src/frontends/kde/FormPrint.C:
510 * src/frontends/kde/FormPrint.h:
511 * src/frontends/kde/formprintdialog.C:
512 * src/frontends/kde/formprintdialog.h:
513 * src/frontends/kde/formprintdialogdata.C:
514 * src/frontends/kde/formprintdialogdata.h:
515 * src/frontends/kde/dlg/formprintdialog.dlg: add
518 * src/frontends/kde/dlg/README: Added explanatory readme
520 * src/frontends/kde/dlg/checkinitorder.pl: small perl
521 script to double-check qtarch's output
523 * src/frontends/kde/formindexdialog.C:
524 * src/frontends/kde/formindexdialogdata.C:
525 * src/frontends/kde/formindexdialogdata.h:
526 * src/frontends/kde/dlg/formindexdialog.dlg: update
527 for qtarch, minor fixes
529 2000-10-05 Allan Rae <rae@lyx.org>
531 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
532 dialogs when switching buffers update them instead. It's up to each
533 dialog to decide if it should still be visible or not.
534 update() should return a bool to control visiblity within show().
535 Or perhaps better to set a member variable and use that to control
538 * lib/build-listerrors: create an empty "listerrors" file just to stop
539 make trying to regenerate it all the time if you don't have noweb
542 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
544 * po/Makefile.in.in (ext_l10n.h): added a rule to build
545 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
546 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
547 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
548 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
550 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
552 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
554 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
555 deleting buffer. Closes all buffer-dependent dialogs.
557 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
559 * src/frontends/xforms/FormCitation.[Ch]:
560 * src/frontends/xforms/FormPreferences.[Ch]:
561 * src/frontends/xforms/FormPrint.[Ch]:
562 * src/frontends/xforms/FormRef.[Ch]:
563 * src/frontends/xforms/FormUrl.[Ch]: ditto
565 * src/frontends/xforms/FormDocument.[Ch]:
566 * src/frontends/xforms/forms/form_document.C.patch:
567 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
568 pass through a single input() function.
570 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
572 * lib/build-listerrors: return status as OK
574 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
576 * lib/lyxrc.example: Updated to new export code
578 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
580 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
583 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
586 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
588 * lib/layouts/amsbook.layout: ditto.
590 * boost/Makefile.am: fix typo.
592 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
594 (add_lastfiles): removed.
595 (add_documents): removed.
596 (add_formats): removed.
598 * src/frontends/Menubar.C: remove useless "using" directive.
600 * src/MenuBackend.h: add a new MenuItem constructor.
602 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
605 2000-10-04 Allan Rae <rae@lyx.org>
607 * lib/Makefile.am (listerrors):
608 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
609 I haven't got notangle installed so Kayvan please test. The output
610 should end up in $builddir. This also allows people who don't have
611 noweb installed to complete the make process without error.
613 * src/frontends/xforms/FormCommand.[Ch] (showInset):
614 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
615 by JMarc's picky compiler.
617 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
620 * src/insets/insettabular.C (setPos): change for loop to not use
621 sequencing operator. Please check this Jürgen.
623 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
625 * src/insets/insetcite.C (getScreenLabel): ditto
626 * src/support/filetools.C (QuoteName): ditto
627 (ChangeExtension): ditto
629 * src/BufferView_pimpl.C (scrollCB): make heigt int
631 * src/BufferView2.C (insertInset): comment out unused arg
633 * boost/Makefile.am (EXTRADIST): new variable
635 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
637 * src/exporter.C (IsExportable): Fixed
639 * lib/configure.m4: Small fix
641 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
643 * src/insets/insetbutton.C (width): Changed to work with no GUI.
644 * src/insets/insetbib.C (bibitemWidest): ditto.
645 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
647 2000-10-03 Juergen Vigna <jug@sad.it>
649 * src/BufferView2.C (theLockingInset): removed const because of
650 Agnus's compile problems.
652 * src/insets/insettext.C (LocalDispatch): set the language of the
653 surronding paragraph on inserting the first character.
655 * various files: changed use of BufferView::the_locking_inset.
657 * src/BufferView2.C (theLockingInset):
658 (theLockingInset): new functions.
660 * src/BufferView.h: removed the_locking_inset.
662 * src/lyxtext.h: added the_locking_inset
664 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
666 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
668 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
670 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
671 * src/mathed/math_cursor.C (IsAlpha): ditto.
672 * src/mathed/math_inset.C (strnew): ditto.
673 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
674 (IMetrics): cxp set but never used; removed.
675 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
676 that the variable in question has been removed also!
679 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
680 using the Buffer * passed to Latex(), using the BufferView * passed to
681 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
683 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
684 Linuxdoc() and DocBook() rather than the stored Buffer * master.
686 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
687 * src/buffer.C (readInset): used new InsetBibtex c-tor
688 * (getBibkeyList): used new InsetBibtex::getKeys
690 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
693 * lib/build-listerrors
695 * src/exporter.C: Add literate programming support to the export code
698 * src/lyx_cb.C: Remove old literate code.
700 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
703 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
704 * src/converter.C (View, Convert): Use QuoteName.
706 * src/insets/figinset.C (Preview): Use Formats::View.
708 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
710 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
712 * src/lyxfunc.C (Dispatch): move declaration of text variable at
713 the top of the function, because compaq cxx complains that the
714 "goto exit_with_message" when the function is disabled bypasses
716 (MenuNew): try a better fix for the generation of new file names.
717 This time, I used AddName() instead of AddPath(), hoping Juergen
720 2000-10-03 Allan Rae <rae@lyx.org>
722 * src/frontends/xforms/forms/form_preferences.fd:
723 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
724 nested tabfolders has begun. The old "Miscellaneous" was renamed as
725 "Look and Feel"->"General" but will need to be split up further into
726 general output and general input tabs. Current plan is for four outer
727 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
728 stuff; "Inputs" for input and import configuration; "Outputs" for
729 output and export configuration; and one more whatever is left over
730 called "General". The leftovers at present look like being which
731 viewers to use, spellchecker, language support and might be better
732 named "Support". I've put "Paths" in "Inputs" for the moment as this
733 seems reasonable for now at least.
734 One problem remains: X error kills LyX when you close Preferences.
736 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
738 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
739 qualifier from form()
740 * src/frontends/xforms/FormCitation.[Ch]:
741 * src/frontends/xforms/FormCopyright.[Ch]:
742 * src/frontends/xforms/FormDocument.[Ch]:
743 * src/frontends/xforms/FormError.[Ch]:
744 * src/frontends/xforms/FormIndex.[Ch]:
745 * src/frontends/xforms/FormPreferences.[Ch]:
746 * src/frontends/xforms/FormPrint.[Ch]:
747 * src/frontends/xforms/FormRef.[Ch]:
748 * src/frontends/xforms/FormToc.[Ch]:
749 * src/frontends/xforms/FormUrl.[Ch]: ditto.
751 * src/frontends/xforms/FormCitation.[Ch]:
752 * src/frontends/xforms/FormIndex.[Ch]:
753 * src/frontends/xforms/FormRef.[Ch]:
754 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
755 with Allan's naming policy
757 * src/frontends/xforms/FormCitation.C: some static casts to remove
760 2000-10-02 Juergen Vigna <jug@sad.it>
762 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
763 now you can type or do stuff inside the table-cell also when in dummy
764 position, fixed visible cursor.
766 * src/insets/insettext.C (Edit): fixing cursor-view position.
768 * src/lyxfunc.C (Dispatch): use * text variable so that it can
769 be used for equal functions in lyxfunc and insettext.
771 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
773 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
775 * src/frontends/gnome/FormCitation.h:
776 * src/frontends/gnome/FormCopyright.h:
777 * src/frontends/gnome/FormIndex.h:
778 * src/frontends/gnome/FormPrint.h:
779 * src/frontends/gnome/FormToc.h:
780 * src/frontends/gnome/FormUrl.h:
781 * src/frontends/kde/FormCitation.h:
782 * src/frontends/kde/FormCopyright.h:
783 * src/frontends/kde/FormIndex.h:
784 * src/frontends/kde/FormRef.h:
785 * src/frontends/kde/FormToc.h:
786 * src/frontends/kde/FormUrl.h: fix remaining users of
789 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
791 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
793 (DocBookHandleCaption): ditto.
794 (DocBookHandleFootnote): ditto.
795 (SimpleDocBookOnePar): ditto.
797 * src/frontends/xforms/FormDocument.h (form): remove extra
798 FormDocument:: qualifier.
800 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
802 * sigc++/handle.h: ditto.
804 * src/lyx_gui_misc.C: add "using" directive.
806 * src/cheaders/cstddef: new file, needed by the boost library (for
809 2000-10-02 Juergen Vigna <jug@sad.it>
811 * src/insets/insettext.C (SetFont): better support.
813 * src/insets/insettabular.C (draw): fixed drawing of single cell.
815 * src/screen.C (DrawOneRow): some uint refixes!
817 2000-10-02 Allan Rae <rae@lyx.org>
819 * boost/.cvsignore: ignore Makefile as well
821 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
822 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
824 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
825 Left this one out by accident.
827 * src/frontends/xforms/FormBase.h (restore): default to calling
828 update() since that will restore the original/currently-applied values.
829 Any input() triggered error messages will require the derived classes
830 to redefine restore().
832 * src/frontends/xforms/FormDocument.C: initialize a few variables to
833 avoid a segfault. combo_doc_class is the main concern.
835 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
837 * Simplify build-listerrors in view of GUI-less export ability!
839 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
841 * src/lyx_main.C (easyParse): Disable gui when exporting
843 * src/insets/figinset.C:
847 * src/tabular.C: Changes to allow no-gui.
849 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
851 * src/support/utility.hpp: removed file
852 * src/support/block.h: removed file
854 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
857 * src/mathed/formula.C: add support/lyxlib.h
858 * src/mathed/formulamacro.C: ditto
860 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
861 * src/lyxparagraph.h: ditto
863 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
864 * src/frontends/Makefile.am (INCLUDES): ditto
865 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
866 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
867 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
868 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
869 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
870 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
872 * src/BufferView.h: use boost/utility.hpp
873 * src/LColor.h: ditto
875 * src/LyXAction.h: ditto
876 * src/LyXView.h: ditto
877 * src/bufferlist.h: ditto
878 * src/lastfiles.h: ditto
879 * src/layout.h: ditto
880 * src/lyx_gui.h: ditto
881 * src/lyx_main.h: ditto
882 * src/lyxlex.h: ditto
884 * src/frontends/ButtonPolicies.h: ditto
885 * src/frontends/Dialogs.h: ditto
886 * src/frontends/xforms/FormBase.h: ditto
887 * src/frontends/xforms/FormGraphics.h: ditto
888 * src/frontends/xforms/FormParagraph.h: ditto
889 * src/frontends/xforms/FormTabular.h: ditto
890 * src/graphics/GraphicsCache.h: ditto
891 * src/graphics/Renderer.h: ditto
892 * src/insets/ExternalTemplate.h: ditto
893 * src/insets/insetcommand.h: ditto
894 * src/support/path.h: ditto
896 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
897 and introduce clause for 2.97.
899 * boost/libs/README: new file
901 * boost/boost/utility.hpp: new file
903 * boost/boost/config.hpp: new file
905 * boost/boost/array.hpp: new file
907 * boost/Makefile.am: new file
909 * boost/.cvsignore: new file
911 * configure.in (AC_OUTPUT): add boost/Makefile
913 * Makefile.am (SUBDIRS): add boost
915 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
917 * src/support/lstrings.C (suffixIs): Fixed.
919 2000-10-01 Allan Rae <rae@lyx.org>
921 * src/PrinterParams.h: moved things around to avoid the "can't
922 inline call" warning.
924 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
925 into doc++ documentation.
927 * src/frontends/xforms/FormCommand.[Ch]: support button policy
929 * src/frontends/xforms/FormRef.C: make use of button controller
930 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
931 cleaned up button controller usage.
932 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
933 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
934 use the button controller
936 * src/frontends/xforms/forms/*.fd: and associated generated files
937 updated to reflect changes to FormBase. Some other FormXxxx files
938 also got minor updates to reflect changes to FormBase.
940 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
941 (hide): made virtual.
942 (input): return a bool. true == valid input
943 (RestoreCB, restore): new
944 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
945 Changes to allow derived dialogs to use a ButtonController and
946 make sense when doing so: OK button calls ok() and so on.
948 * src/frontends/xforms/ButtonController.h (class ButtonController):
949 Switch from template implementation to taking Policy parameter.
950 Allows FormBase to provide a ButtonController for any dialog.
952 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
953 Probably should rename connect and disconnect.
954 (apply): use the radio button groups
955 (form): needed by FormBase
956 (build): setup the radio button groups
958 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
960 * several files: type changes to reduce the number of warnings and
961 to unify type hangling a bit. Still much to do.
963 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
965 * lib/images/*: rename a bunch of icons to match Dekel converter
968 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
971 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
973 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
975 * sigc++/handle.h: ditto for class Handle.
977 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
979 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
981 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
983 * src/intl.C (InitKeyMapper): Correct the value of n due to the
984 removal of the "default" language.
986 * src/combox.h (getline): Check that sel > 0
988 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
990 * lib/examples/docbook_example.lyx
991 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
993 * lib/layouts/docbook-book.layout: new docbook book layout.
995 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
997 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
999 * src/insets/figinset.C (DocBook):fixed small typo.
1001 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1003 * src/insets/insetinclude.h: string include_label doesn't need to be
1006 2000-09-29 Allan Rae <rae@lyx.org>
1008 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1009 Allow derived type to control connection and disconnection from signals
1010 of its choice if desired.
1012 2000-09-28 Juergen Vigna <jug@sad.it>
1014 * src/insets/insettabular.C (update): fixed cursor setting when
1015 the_locking_inset changed.
1016 (draw): made this a bit cleaner.
1017 (InsetButtonPress): fixed!
1019 * various files: added LyXText Parameter to fitCursor call.
1021 * src/BufferView.C (fitCursor): added LyXText parameter.
1023 * src/insets/insettabular.C (draw): small draw fix.
1025 * src/tabular.C: right setting of left/right celllines.
1027 * src/tabular.[Ch]: fixed various types in funcions and structures.
1028 * src/insets/insettabular.C: ditto
1029 * src/frontends/xforms/FormTabular.C: ditto
1031 2000-09-28 Allan Rae <rae@lyx.org>
1033 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1034 that the #ifdef's had been applied to part of what should have been
1035 a complete condition. It's possible there are other tests that
1036 were specific to tables that are also wrong now that InsetTabular is
1037 being used. Now we need to fix the output of '\n' after a table in a
1038 float for the same reason as the original condition:
1039 "don't insert this if we would be adding it before or after a table
1040 in a float. This little trick is needed in order to allow use of
1041 tables in \subfigures or \subtables."
1042 Juergen can you check this?
1044 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1046 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1047 outputed to the ostream.
1049 * several files: fixed types based on warnings from cxx
1051 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1053 * src/frontends/kde/Makefile.am: fix rule for
1054 formindexdialogdata_moc.C
1056 * src/.cvsignore: add ext_l10n.h to ignore
1058 * acconfig.h: stop messing with __STRICT_ANSI__
1059 * config/gnome.m4: remove option to set -ansi
1060 * config/kde.m4: remove option to set -ansi
1061 * config/lyxinclude.m4: don't set -ansi
1063 2000-09-27 Juergen Vigna <jug@sad.it>
1065 * various files: remove "default" language check.
1067 * src/insets/insetquotes.C: removed use of current_view.
1069 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1070 the one should have red ears by now!
1072 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1073 in more then one paragraph. Fixed cursor-movement/selection.
1075 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1076 paragraphs inside a text inset.
1078 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1079 text-inset if this owner is an inset.
1081 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1083 * src/Bullet.h: changed type of font, character and size to int
1085 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1087 * src/insets/inseturl.[Ch]:
1088 * src/insets/insetref.[Ch]:
1089 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1091 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1093 * src/buffer.C (readFile): block-if statement rearranged to minimise
1094 bloat. Patch does not reverse Jean-Marc's change ;-)
1096 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1097 Class rewritten to store pointers to hide/update signals directly,
1098 rather than Dialogs *. Also defined an enum to ease use. All xforms
1099 forms can now be derived from this class.
1101 * src/frontends/xforms/FormCommand.[Ch]
1102 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1104 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1107 * src/frontends/xforms/forms/form_citation.fd
1108 * src/frontends/xforms/forms/form_copyright.fd
1109 * src/frontends/xforms/forms/form_error.fd
1110 * src/frontends/xforms/forms/form_index.fd
1111 * src/frontends/xforms/forms/form_ref.fd
1112 * src/frontends/xforms/forms/form_toc.fd
1113 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1115 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1117 * src/insets/insetfoot.C: removed redundent using directive.
1119 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1121 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1122 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1124 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1125 created in the constructors in different groups. Then set() just
1126 have to show the groups as needed. This fixes the redraw problems
1127 (and is how the old menu code worked).
1129 * src/support/lyxlib.h: declare the methods as static when we do
1130 not have namespaces.
1132 2000-09-26 Juergen Vigna <jug@sad.it>
1134 * src/buffer.C (asciiParagraph): new function.
1135 (writeFileAscii): new function with parameter ostream.
1136 (writeFileAscii): use now asciiParagraph.
1138 * various inset files: added the linelen parameter to the Ascii-func.
1140 * src/tabular.C (Write): fixed error in writing file introduced by
1141 the last changes from Lars.
1143 * lib/bind/menus.bind: removed not supported functions.
1145 * src/insets/insettext.C (Ascii): implemented this function.
1147 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1149 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1150 (Write): use of the write_attribute functions.
1152 * src/bufferlist.C (close): fixed reasking question!
1154 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1156 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1157 new files use the everwhere possible.
1160 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1161 src/log_form.C src/lyx.C:
1164 * src/buffer.C (runLaTeX): remove func
1166 * src/PaperLayout.C: removed file
1167 * src/ParagraphExtra.C: likewise
1168 * src/bullet_forms.C: likewise
1169 * src/bullet_forms.h: likewise
1170 * src/bullet_forms_cb.C: likewise
1172 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1173 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1176 * several files: remove all traces of the old fd_form_paragraph,
1177 and functions belonging to that.
1179 * several files: remove all traces of the old fd_form_document,
1180 and functions belonging to that.
1182 * several files: constify local variables were possible.
1184 * several files: remove all code that was dead when NEW_EXPORT was
1187 * several files: removed string::c_str in as many places as
1190 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1191 (e): be a bit more outspoken when patching
1192 (updatesrc): only move files if changed.
1194 * forms/layout_forms.h.patch: regenerated
1196 * forms/layout_forms.fd: remove form_document and form_paragraph
1197 and form_quotes and form_paper and form_table_options and
1198 form_paragraph_extra
1200 * forms/form1.fd: remove form_table
1202 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1203 the fdui->... rewrite. Update some comments to xforms 0.88
1205 * forms/bullet_forms.C.patch: removed file
1206 * forms/bullet_forms.fd: likewise
1207 * forms/bullet_forms.h.patch: likewise
1209 * development/Code_rules/Rules: added a section on switch
1210 statements. Updated some comment to xforms 0.88.
1212 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1214 * src/buffer.C (readFile): make sure that the whole version number
1215 is read after \lyxformat (even when it contains a comma)
1217 * lib/ui/default.ui: change shortcut of math menu to M-a.
1219 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1221 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1224 * src/LyXView.C (updateWindowTitle): show the full files name in
1225 window title, limited to 30 characters.
1227 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1228 When a number of characters has been given, we should not assume
1229 that the string is 0-terminated.
1231 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1232 calls (fixes some memory leaks)
1234 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1235 trans member on exit.
1237 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1239 * src/converter.C (GetReachable): fix typo.
1241 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1242 understand ',' instead of '.'.
1243 (GetInteger): rewrite to use strToInt().
1245 2000-09-26 Juergen Vigna <jug@sad.it>
1247 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1248 better visibility and error-message on wrong VSpace input.
1250 * src/language.C (initL): added english again.
1252 2000-09-25 Juergen Vigna <jug@sad.it>
1254 * src/frontends/kde/Dialogs.C (Dialogs):
1255 * src/frontends/gnome/Dialogs.C (Dialogs):
1256 * src/frontends/kde/Makefile.am:
1257 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1259 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1261 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1263 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1265 * src/frontends/xforms/FormParagraph.C:
1266 * src/frontends/xforms/FormParagraph.h:
1267 * src/frontends/xforms/form_paragraph.C:
1268 * src/frontends/xforms/form_paragraph.h:
1269 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1272 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1274 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1275 Paragraph-Data after use.
1277 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1278 non breakable paragraphs.
1280 2000-09-25 Garst R. Reese <reese@isn.net>
1282 * src/language.C (initL): added missing language_country codes.
1284 2000-09-25 Juergen Vigna <jug@sad.it>
1286 * src/insets/insettext.C (InsetText):
1287 (deleteLyXText): remove the not released LyXText structure!
1289 2000-09-24 Marko Vendelin <markov@ioc.ee>
1291 * src/frontends/gnome/mainapp.C
1292 * src/frontends/gnome/mainapp.h: added support for keyboard
1295 * src/frontends/gnome/FormCitation.C
1296 * src/frontends/gnome/FormCitation.h
1297 * src/frontends/gnome/Makefile.am
1298 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1299 FormCitation to use "action area" in mainapp window
1301 * src/frontends/gnome/Menubar_pimpl.C
1302 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1305 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1307 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1308 width/descent/ascent values if name is empty.
1309 (mathed_string_height): Use std::max.
1311 2000-09-25 Allan Rae <rae@lyx.org>
1313 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1314 segfault. This will be completely redesigned soon.
1316 * sigc++: updated libsigc++. Fixes struct timespec bug.
1318 * development/tools/makeLyXsigc.sh: .cvsignore addition
1320 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1322 * several files: removed almost all traces of the old table
1325 * src/TableLayout.C: removed file
1327 2000-09-22 Juergen Vigna <jug@sad.it>
1329 * src/frontends/kde/Dialogs.C: added credits forms.
1331 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1333 * src/frontends/gnome/Dialogs.C: added some forms.
1335 * src/spellchecker.C (init_spell_checker): set language in pspell code
1336 (RunSpellChecker): some modifications for setting language string.
1338 * src/language.[Ch]: added language_country code.
1340 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1342 * src/frontends/Dialogs.h: added new signal showError.
1343 Rearranged existing signals in some sort of alphabetical order.
1345 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1346 FormError.[Ch], form_error.[Ch]
1347 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1348 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1350 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1351 dialogs. I think that this can be used as the base to all these
1354 * src/frontends/xforms/FormError.[Ch]
1355 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1356 implementation of InsetError dialog.
1358 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1360 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1361 * src/frontends/kde/Makefile.am: ditto
1363 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1365 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1366 macrobf. This fixes a bug of invisible text.
1368 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1370 * lib/doc/LaTeXConfig.lyx.in: updated.
1372 * src/language.C (initL): remove language "francais" and change a
1373 bit the names of the two other french variations.
1375 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1376 string that may not be 0-terminated.
1378 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1380 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1382 2000-09-20 Marko Vendelin <markov@ioc.ee>
1384 * src/frontends/gnome/FormCitation.C
1385 * src/frontends/gnome/FormIndex.C
1386 * src/frontends/gnome/FormToc.C
1387 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1388 the variable initialization to shut up the warnings
1390 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1392 * src/table.[Ch]: deleted files
1394 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1397 2000-09-18 Juergen Vigna <jug@sad.it>
1399 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1400 problems with selection. Inserted new LFUN_PASTESELECTION.
1401 (InsetButtonPress): inserted handling of middle mouse-button paste.
1403 * src/spellchecker.C: changed word to word.c_str().
1405 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1407 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1408 included in the ``make dist'' tarball.
1410 2000-09-15 Juergen Vigna <jug@sad.it>
1412 * src/CutAndPaste.C (cutSelection): small fix return the right
1413 end position after cut inside one paragraph only.
1415 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1416 we are locked as otherwise we don't have a valid cursor position!
1418 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1420 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1422 * src/frontends/kde/FormRef.C: added using directive.
1423 * src/frontends/kde/FormToc.C: ditto
1425 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1427 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1429 2000-09-19 Marko Vendelin <markov@ioc.ee>
1431 * src/frontends/gnome/Menubar_pimpl.C
1432 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1433 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1435 * src/frontends/gnome/mainapp.C
1436 * src/frontends/gnome/mainapp.h: support for menu update used
1439 * src/frontends/gnome/mainapp.C
1440 * src/frontends/gnome/mainapp.h: support for "action" area in the
1441 main window. This area is used by small simple dialogs, such as
1444 * src/frontends/gnome/FormIndex.C
1445 * src/frontends/gnome/FormIndex.h
1446 * src/frontends/gnome/FormUrl.C
1447 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
1450 * src/frontends/gnome/FormCitation.C
1451 * src/frontends/gnome/FormCitation.h: rewrite to use main window
1452 action area. Only "Insert new citation" is implemented.
1454 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1456 * src/buffer.C (Dispatch): fix call to Dispatch
1457 * src/insets/insetref.C (Edit): likewise
1458 * src/insets/insetparent.C (Edit): likewise
1459 * src/insets/insetinclude.C (include_cb): likewise
1460 * src/frontends/xforms/FormUrl.C (apply): likewise
1461 * src/frontends/xforms/FormToc.C (apply): likewise
1462 * src/frontends/xforms/FormRef.C (apply): likewise
1463 * src/frontends/xforms/FormIndex.C (apply): likewise
1464 * src/frontends/xforms/FormCitation.C (apply): likewise
1465 * src/lyxserver.C (callback): likewise
1466 * src/lyxfunc.C (processKeySym): likewise
1467 (Dispatch): likewise
1468 (Dispatch): likewise
1469 * src/lyx_cb.C (LayoutsCB): likewise
1471 * Makefile.am (sourcedoc): small change
1473 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1475 * src/main.C (main): Don't make an empty GUIRunTime object. all
1476 methods are static. constify a bit remove unneded using + headers.
1478 * src/tabular.C: some more const to local vars move some loop vars
1480 * src/spellchecker.C: added some c_str after some word for pspell
1482 * src/frontends/GUIRunTime.h: add new static method setDefaults
1483 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1484 * src/frontends/kde/GUIRunTime.C (setDefaults):
1485 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1487 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1488 with strnew in arg, use correct emptystring when calling SetName.
1490 * several files: remove all commented code with relation to
1491 HAVE_SSTREAM beeing false. We now only support stringstream and
1494 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1496 * src/lyxfunc.C: construct correctly the automatic new file
1499 * src/text2.C (IsStringInText): change type of variable i to shut
1502 * src/support/sstream.h: do not use namespaces if the compiler
1503 does not support them.
1505 2000-09-15 Marko Vendelin <markov@ioc.ee>
1506 * src/frontends/gnome/FormCitation.C
1507 * src/frontends/gnome/FormCitation.h
1508 * src/frontends/gnome/diainsertcitation_interface.c
1509 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1510 regexp support to FormCitation [Gnome].
1512 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1515 * configure.in: remove unused KDE/GTKGUI define
1517 * src/frontends/kde/FormRef.C
1518 * src/frontends/kde/FormRef.h
1519 * src/frontends/kde/formrefdialog.C
1520 * src/frontends/kde/formrefdialog.h: double click will
1521 go to reference, now it is possible to change a cross-ref
1524 * src/frontends/kde/FormToc.C
1525 * src/frontends/kde/FormToc.h
1526 * src/frontends/kde/formtocdialog.C
1527 * src/frontends/kde/formtocdialog.h: add a depth
1530 * src/frontends/kde/Makefile.am: add QtLyXView.h
1533 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1535 * src/frontends/kde/FormCitation.h: added some using directives.
1537 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1539 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1542 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1545 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1547 * src/buffer.C (pop_tag): revert for the second time a change by
1548 Lars, who seems to really hate having non-local loop variables :)
1550 * src/Lsstream.h: add "using" statements.
1552 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1553 * src/buffer.C (writeFile): ditto
1555 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1557 * src/buffer.C (writeFile): try to fix the locale modified format
1558 number to always be as we want it.
1560 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1561 in XForms 0.89. C-space is now working again.
1563 * src/Lsstream.h src/support/sstream.h: new files.
1565 * also commented out all cases where strstream were used.
1567 * src/Bullet.h (c_str): remove method.
1569 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1571 * a lot of files: get rid of "char const *" and "char *" is as
1572 many places as possible. We only want to use them in interaction
1573 with system of other libraries, not inside lyx.
1575 * a lot of files: return const object is not of pod type. This
1576 helps ensure that temporary objects is not modified. And fits well
1577 with "programming by contract".
1579 * configure.in: check for the locale header too
1581 * Makefile.am (sourcedoc): new tag for generation of doc++
1584 2000-09-14 Juergen Vigna <jug@sad.it>
1586 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1587 callback to check which combo called it and do the right action.
1589 * src/combox.C (combo_cb): added combo * to the callbacks.
1590 (Hide): moved call of callback after Ungrab of the pointer.
1592 * src/intl.h: removed LCombo2 function.
1594 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1595 function as this can now be handled in one function.
1597 * src/combox.h: added Combox * to callback prototype.
1599 * src/frontends/xforms/Toolbar_pimpl.C:
1600 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1602 2000-09-14 Garst Reese <reese@isn.net>
1604 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1605 moved usepackage{xxx}'s to beginning of file. Changed left margin
1606 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1607 underlining from title. Thanks to John Culleton for useful suggestions.
1609 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1611 * src/lyxlex_pimpl.C (setFile): change error message to debug
1614 2000-09-13 Juergen Vigna <jug@sad.it>
1616 * src/frontends/xforms/FormDocument.C: implemented choice_class
1617 as combox and give callback to combo_language so OK/Apply is activated
1620 * src/bufferlist.C (newFile): small fix so already named files
1621 (via an open call) are not requested to be named again on the
1624 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1626 * src/frontends/kde/Makefile.am
1627 * src/frontends/kde/FormRef.C
1628 * src/frontends/kde/FormRef.h
1629 * src/frontends/kde/formrefdialog.C
1630 * src/frontends/kde/formrefdialog.h: implement
1633 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1635 * src/frontends/kde/formtocdialog.C
1636 * src/frontends/kde/formtocdialog.h
1637 * src/frontends/kde/FormToc.C
1638 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1640 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1642 * src/frontends/kde/FormCitation.C: fix thinko
1643 where we didn't always display the reference text
1646 * src/frontends/kde/formurldialog.C
1647 * src/frontends/kde/formurldialog.h
1648 * src/frontends/kde/FormUrl.C
1649 * src/frontends/kde/FormUrl.h: minor cleanups
1651 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
1653 * src/frontends/kde/Makefile.am
1654 * src/frontends/kde/FormToc.C
1655 * src/frontends/kde/FormToc.h
1656 * src/frontends/kde/FormCitation.C
1657 * src/frontends/kde/FormCitation.h
1658 * src/frontends/kde/FormIndex.C
1659 * src/frontends/kde/FormIndex.h
1660 * src/frontends/kde/formtocdialog.C
1661 * src/frontends/kde/formtocdialog.h
1662 * src/frontends/kde/formcitationdialog.C
1663 * src/frontends/kde/formcitationdialog.h
1664 * src/frontends/kde/formindexdialog.C
1665 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
1667 2000-09-12 Juergen Vigna <jug@sad.it>
1669 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
1672 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1674 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
1677 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
1679 * src/converter.C (Add, Convert): Added support for converter flags:
1680 needaux, resultdir, resultfile.
1681 (Convert): Added new parameter view_file.
1682 (dvips_options): Fixed letter paper option.
1684 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
1685 (Export, GetExportableFormats, GetViewableFormats): Added support
1688 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
1690 (easyParse): Fixed to work with new export code.
1692 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
1695 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
1697 * lib/bind/*.bind: Replaced
1698 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
1699 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
1701 2000-09-11 Juergen Vigna <jug@sad.it>
1703 * src/lyx_gui.C (runTime): uses global guiruntime variable.
1705 * src/main.C (main): now GUII defines global guiruntime!
1707 * src/frontends/gnome/GUIRunTime.C (initApplication):
1708 * src/frontends/kde/GUIRunTime.C (initApplication):
1709 * src/frontends/xforms/GUIRunTime.C (initApplication):
1710 * src/frontends/GUIRunTime.h: added new function initApplication.
1712 * src/spellchecker.C (sc_accept_word): change to add_to_session.
1714 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
1716 2000-09-08 Juergen Vigna <jug@sad.it>
1718 * src/lyx_gui.C (create_forms): don't display the "default" entry as
1719 we have already "Reset".
1721 * src/language.C (initL): inserted "default" language and made this
1722 THE default language (and not american!)
1724 * src/paragraph.C: inserted handling of "default" language!
1726 * src/lyxfont.C: ditto
1730 * src/paragraph.C: output the \\par only if we have a following
1731 paragraph otherwise it's not needed.
1733 2000-09-05 Juergen Vigna <jug@sad.it>
1735 * config/pspell.m4: added entry to lyx-flags
1737 * src/spellchecker.C: modified version from Kevin for using pspell
1739 2000-09-01 Marko Vendelin <markov@ioc.ee>
1740 * src/frontends/gnome/Makefile.am
1741 * src/frontends/gnome/FormCitation.C
1742 * src/frontends/gnome/FormCitation.h
1743 * src/frontends/gnome/diainsertcitation_callbacks.c
1744 * src/frontends/gnome/diainsertcitation_callbacks.h
1745 * src/frontends/gnome/diainsertcitation_interface.c
1746 * src/frontends/gnome/diainsertcitation_interface.h
1747 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
1748 dialog for Gnome frontend
1750 * src/main.C: Gnome libraries require keeping application name
1751 and its version as strings
1753 * src/frontends/gnome/mainapp.C: Change the name of the main window
1754 from GnomeLyX to PACKAGE
1756 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1758 * src/frontends/Liason.C: add "using: declaration.
1760 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
1762 * src/mathed/math_macro.C (Metrics): Set the size of the template
1764 * src/mathed/formulamacro.C (Latex): Fixed the returned value
1766 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
1768 * src/converter.C (add_options): New function.
1769 (SetViewer): Change $$FName into '$$FName'.
1770 (View): Add options when running xdvi
1771 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
1772 (Convert): The 3rd parameter is now the desired filename. Converts
1773 calls to lyx::rename if necessary.
1774 Add options when running dvips.
1775 (dvi_papersize,dvips_options): New methods.
1777 * src/exporter.C (Export): Use getLatexName() instead of fileName().
1779 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
1780 using a call to Converter::dvips_options.
1781 Fixed to work with nex export code.
1783 * src/support/copy.C
1784 * src/support/rename.C: New files
1786 * src/support/syscall.h
1787 * src/support/syscall.C: Added Starttype SystemDontWait.
1789 * lib/ui/default.ui: Changed to work with new export code
1791 * lib/configure.m4: Changed to work with new export code
1793 * src/encoding.C: Changed latex name for iso8859_7 encoding.
1795 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
1797 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
1798 so that code compiles with DEC cxx.
1800 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
1801 to work correctly! Also now supports the additional elements
1804 2000-09-01 Allan Rae <rae@lyx.org>
1806 * src/frontends/ButtonPolicies.C: renamed all the references to
1807 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
1809 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
1810 since it's a const not a type.
1812 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
1814 2000-08-31 Juergen Vigna <jug@sad.it>
1816 * src/insets/figinset.C: Various changes to look if the filename has
1817 an extension and if not add it for inline previewing.
1819 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1821 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
1822 make buttonStatus and isReadOnly be const methods. (also reflect
1823 this in derived classes.)
1825 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
1826 (nextState): change to be static inline, pass the StateMachine as
1828 (PreferencesPolicy): remove casts
1829 (OkCancelPolicy): remvoe casts
1830 (OkCancelReadOnlyPolicy): remove casts
1831 (NoRepeatedApplyReadOnlyPolicy): remove casts
1832 (OkApplyCancelReadOnlyPolicy): remove casts
1833 (OkApplyCancelPolicy): remove casts
1834 (NoRepeatedApplyPolicy): remove casts
1836 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
1838 * src/converter.C: added some using directives
1840 * src/frontends/ButtonPolicies.C: changes to overcome
1841 "need lvalue" error with DEC c++
1843 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
1844 to WMHideCB for DEC c++
1846 * src/frontends/xforms/Menubar_pimpl.C: added using directive
1848 * src/frontends/xforms/forms/form_document.C.patch: use C callback
1849 to BulletBMTableCB for DEC c++
1851 2000-08-31 Allan Rae <rae@lyx.org>
1853 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
1854 character dialog separately from old document dialogs combo_language.
1857 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1859 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
1860 Removed LFUN_REF_CREATE.
1862 * src/MenuBackend.C: Added new tags: toc and references
1864 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
1865 (add_lastfiles, add_documents, add_formats): Removed the unused smn
1867 (add_toc, add_references): New methods.
1868 (create_submenu): Handle correctly the case when there is a
1869 seperator after optional menu items.
1871 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
1872 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
1873 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
1875 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
1877 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
1879 * src/converter.[Ch]: New file for converting between different
1882 * src/export.[Ch]: New file for exporting a LyX file to different
1885 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
1886 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
1887 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
1888 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
1889 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
1890 RunDocBook, MenuExport.
1892 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
1893 Exporter::Preview methods if NEW_EXPORT is defined.
1895 * src/buffer.C (Dispatch): Use Exporter::Export.
1897 * src/lyxrc.C: Added new tags: \converter and \viewer.
1900 * src/LyXAction.C: Define new lyx-function: buffer-update.
1901 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
1902 when NEW_EXPORT is defined.
1904 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
1906 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
1908 * lib/ui/default.ui: Added submenus "view" and "update" to the
1911 * src/filetools.C (GetExtension): New function.
1913 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
1915 2000-08-29 Allan Rae <rae@lyx.org>
1917 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
1919 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
1920 (EnableDocumentLayout): removed
1921 (DisableDocumentLayout): removed
1922 (build): make use of ButtonController's read-only handling to
1923 de/activate various objects. Replaces both of the above functions.
1925 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
1926 (readOnly): was read_only
1927 (refresh): fixed dumb mistakes with read_only_ handling
1929 * src/frontends/xforms/forms/form_document.fd:
1930 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
1931 tabbed dialogs so the tabs look more like tabs and so its easier to
1932 work out which is the current tab.
1934 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
1935 segfault with form_table
1937 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
1939 2000-08-28 Juergen Vigna <jug@sad.it>
1941 * acconfig.h: added USE_PSPELL.
1943 * src/config.h.in: added USE_PSPELL.
1945 * autogen.sh: added pspell.m4
1947 * config/pspell.m4: new file.
1949 * src/spellchecker.C: implemented support for pspell libary.
1951 2000-08-25 Juergen Vigna <jug@sad.it>
1953 * src/LyXAction.C (init): renamed LFUN_TABLE to
1954 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
1956 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
1958 * src/lyxscreen.h: add force_clear variable and fuction to force
1959 a clear area when redrawing in LyXText.
1961 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
1963 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1965 * some whitespace and comment changes.
1967 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
1969 * src/buffer.C: up te LYX_FORMAT to 2.17
1971 2000-08-23 Juergen Vigna <jug@sad.it>
1973 * src/BufferView_pimpl.C (tripleClick): disable this when in a
1976 * src/insets/insettabular.C (pasteSelection): delete the insets
1977 LyXText as it is not valid anymore.
1978 (copySelection): new function.
1979 (pasteSelection): new function.
1980 (cutSelection): new function.
1981 (LocalDispatch): implemented cut/copy/paste of cell selections.
1983 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
1984 don't have a LyXText.
1986 * src/LyXAction.C (init): a NEW_TABULAR define too much.
1988 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
1991 2000-08-22 Juergen Vigna <jug@sad.it>
1993 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
1994 ifdef form_table out if NEW_TABULAR.
1996 2000-08-21 Juergen Vigna <jug@sad.it>
1998 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
1999 (draw): fixed draw position so that the cursor is positioned in the
2001 (InsetMotionNotify): hide/show cursor so the position is updated.
2002 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2003 using cellstart() function where it should be used.
2005 * src/insets/insettext.C (draw): ditto.
2007 * src/tabular.C: fixed initialization of some missing variables and
2008 made BoxType into an enum.
2010 2000-08-22 Marko Vendelin <markov@ioc.ee>
2011 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2012 stock menu item using action numerical value, not its string
2016 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2018 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2019 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2021 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2023 * src/frontends/xforms/GUIRunTime.C: new file
2025 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2026 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2028 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2030 * src/frontends/kde/GUIRunTime.C: new file
2032 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2033 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2035 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2037 * src/frontends/gnome/GUIRunTime.C: new file
2039 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2042 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2043 small change to documetentation.
2045 * src/frontends/GUIRunTime.C: removed file
2047 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2049 * src/lyxparagraph.h: enable NEW_TABULAR as default
2051 * src/lyxfunc.C (processKeySym): remove some commented code
2053 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2054 NEW_TABULAR around the fd_form_table_options.
2056 * src/lyx_gui.C (runTime): call the static member function as
2057 GUIRunTime::runTime().
2059 2000-08-21 Allan Rae <rae@lyx.org>
2061 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2064 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2066 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2068 2000-08-21 Allan Rae <rae@lyx.org>
2070 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2071 keep Garst happy ;-)
2072 * src/frontends/xforms/FormPreferences.C (build): use setOK
2073 * src/frontends/xforms/FormDocument.C (build): use setOK
2074 (FormDocument): use the appropriate policy.
2076 2000-08-21 Allan Rae <rae@lyx.org>
2078 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2079 automatic [de]activation of arbitrary objects when in a read-only state.
2081 * src/frontends/ButtonPolicies.h: More documentation
2082 (isReadOnly): added to support the above.
2084 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2086 2000-08-18 Juergen Vigna <jug@sad.it>
2088 * src/insets/insettabular.C (getStatus): changed to return func_status.
2090 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2091 display toggle menu entries if they are.
2093 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2094 new document layout now.
2096 * src/lyxfunc.C: ditto
2098 * src/lyx_gui_misc.C: ditto
2100 * src/lyx_gui.C: ditto
2102 * lib/ui/default.ui: removed paper and quotes layout as they are now
2103 all in the document layout tabbed folder.
2105 * src/frontends/xforms/forms/form_document.fd: added Restore
2106 button and callbacks for all inputs for Allan's ButtonPolicy.
2108 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2109 (CheckChoiceClass): added missing params setting on class change.
2110 (UpdateLayoutDocument): added for updating the layout on params.
2111 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2112 (FormDocument): Implemented Allan's ButtonPolicy with the
2115 2000-08-17 Allan Rae <rae@lyx.org>
2117 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2118 so we can at least see the credits again.
2120 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2121 controller calls for the appropriate callbacks. Note that since Ok
2122 calls apply followed by cancel, and apply isn't a valid input for the
2123 APPLIED state, the bc_ calls have to be made in the static callback not
2124 within each of the real callbacks.
2126 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2127 (setOk): renamed from setOkay()
2129 2000-08-17 Juergen Vigna <jug@sad.it>
2131 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2132 in the implementation part.
2133 (composeUIInfo): don't show optional menu-items.
2135 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2137 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2139 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2140 text-state when in a text-inset.
2142 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2144 2000-08-17 Marko Vendelin <markov@ioc.ee>
2145 * src/frontends/gnome/FormIndex.C
2146 * src/frontends/gnome/FormIndex.h
2147 * src/frontends/gnome/FormToc.C
2148 * src/frontends/gnome/FormToc.h
2149 * src/frontends/gnome/dialogs
2150 * src/frontends/gnome/diatoc_callbacks.c
2151 * src/frontends/gnome/diatoc_callbacks.h
2152 * src/frontends/gnome/diainsertindex_callbacks.h
2153 * src/frontends/gnome/diainsertindex_callbacks.c
2154 * src/frontends/gnome/diainsertindex_interface.c
2155 * src/frontends/gnome/diainsertindex_interface.h
2156 * src/frontends/gnome/diatoc_interface.h
2157 * src/frontends/gnome/diatoc_interface.c
2158 * src/frontends/gnome/Makefile.am: Table of Contents and
2159 Insert Index dialogs implementation for Gnome frontend
2161 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2163 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2165 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2168 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2170 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2171 destructor. Don't definde if you don't need it
2172 (processEvents): made static, non-blocking events processing for
2174 (runTime): static method. event loop for xforms
2175 * similar as above for kde and gnome.
2177 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2178 new Pimpl is correct
2179 (runTime): new method calss the real frontends runtime func.
2181 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2183 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2185 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2187 2000-08-16 Juergen Vigna <jug@sad.it>
2189 * src/lyx_gui.C (runTime): added GUII RunTime support.
2191 * src/frontends/Makefile.am:
2192 * src/frontends/GUIRunTime.[Ch]:
2193 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2194 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2195 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2197 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2199 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2200 as this is already set in ${FRONTEND_INCLUDE} if needed.
2202 * configure.in (CPPFLAGS): setting the include dir for the frontend
2203 directory and don't set FRONTEND=xforms for now as this is executed
2206 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2208 * src/frontends/kde/Makefile.am:
2209 * src/frontends/kde/FormUrl.C:
2210 * src/frontends/kde/FormUrl.h:
2211 * src/frontends/kde/formurldialog.h:
2212 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2214 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2216 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2218 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2220 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2223 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2225 * src/WorkArea.C (work_area_handler): more work to get te
2226 FL_KEYBOARD to work with xforms 0.88 too, please test.
2228 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2230 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2232 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2235 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2237 * src/Timeout.h: remove Qt::emit hack.
2239 * several files: changes to allo doc++ compilation
2241 * src/lyxfunc.C (processKeySym): new method
2242 (processKeyEvent): comment out if FL_REVISION < 89
2244 * src/WorkArea.C: change some debugging levels.
2245 (WorkArea): set wantkey to FL_KEY_ALL
2246 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2247 clearer code and the use of compose with XForms 0.89. Change to
2248 use signals instead of calling methods in bufferview directly.
2250 * src/Painter.C: change some debugging levels.
2252 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2255 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2256 (workAreaKeyPress): new method
2258 2000-08-14 Juergen Vigna <jug@sad.it>
2260 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2262 * config/kde.m4: addes some features
2264 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2265 include missing xforms dialogs.
2267 * src/Timeout.h: a hack to be able to compile with qt/kde.
2269 * sigc++/.cvsignore: added acinclude.m4
2271 * lib/.cvsignore: added listerros
2273 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2274 xforms tree as objects are needed for other frontends.
2276 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2277 linking with not yet implemented xforms objects.
2279 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2281 2000-08-14 Baruch Even <baruch.even@writeme.com>
2283 * src/frontends/xforms/FormGraphics.h:
2284 * src/frontends/xforms/FormGraphics.C:
2285 * src/frontends/xforms/RadioButtonGroup.h:
2286 * src/frontends/xforms/RadioButtonGroup.C:
2287 * src/insets/insetgraphics.h:
2288 * src/insets/insetgraphics.C:
2289 * src/insets/insetgraphicsParams.h:
2290 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2291 instead of spaces, and various other indentation issues to make the
2292 sources more consistent.
2294 2000-08-14 Marko Vendelin <markov@ioc.ee>
2296 * src/frontends/gnome/dialogs/diaprint.glade
2297 * src/frontends/gnome/FormPrint.C
2298 * src/frontends/gnome/FormPrint.h
2299 * src/frontends/gnome/diaprint_callbacks.c
2300 * src/frontends/gnome/diaprint_callbacks.h
2301 * src/frontends/gnome/diaprint_interface.c
2302 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2305 * src/frontends/gnome/dialogs/diainserturl.glade
2306 * src/frontends/gnome/FormUrl.C
2307 * src/frontends/gnome/FormUrl.h
2308 * src/frontends/gnome/diainserturl_callbacks.c
2309 * src/frontends/gnome/diainserturl_callbacks.h
2310 * src/frontends/gnome/diainserturl_interface.c
2311 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2312 Gnome implementation
2314 * src/frontends/gnome/Dialogs.C
2315 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2316 all other dialogs. Copy all unimplemented dialogs from Xforms
2319 * src/frontends/gnome/support.c
2320 * src/frontends/gnome/support.h: support files generated by Glade
2324 * config/gnome.m4: Gnome configuration scripts
2326 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2327 configure --help message
2329 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2330 only if there are no events pendling in Gnome/Gtk. This enhances
2331 the performance of menus.
2334 2000-08-14 Allan Rae <rae@lyx.org>
2336 * lib/Makefile.am: listerrors cleaning
2338 * lib/listerrors: removed -- generated file
2339 * acinclude.m4: ditto
2340 * sigc++/acinclude.m4: ditto
2342 * src/frontends/xforms/forms/form_citation.fd:
2343 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2346 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2347 `updatesrc` and now we have a `test` target that does what `updatesrc`
2348 used to do. I didn't like having an install target that wasn't related
2351 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2352 on all except FormGraphics. This may yet happen. Followed by a major
2353 cleanup including using FL_TRANSIENT for most of the dialogs. More
2354 changes to come when the ButtonController below is introduced.
2356 * src/frontends/xforms/ButtonController.h: New file for managing up to
2357 four buttons on a dialog according to an externally defined policy.
2358 * src/frontends/xforms/Makefile.am: added above
2360 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2361 Apply and Cancel/Close buttons and everything in between and beyond.
2362 * src/frontends/Makefile.am: added above.
2364 * src/frontends/xforms/forms/form_preferences.fd:
2365 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2366 and removed variable 'status' as a result. Fixed the set_minsize thing.
2367 Use the new screen-font-update after checking screen fonts were changed
2368 Added a "Restore" button to restore the original lyxrc values while
2369 editing. This restores everything not just the last input changed.
2370 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2372 * src/LyXAction.C: screen-font-update added for updating buffers after
2373 screen font settings have been changed.
2374 * src/commandtags.h: ditto
2375 * src/lyxfunc.C: ditto
2377 * forms/lyx.fd: removed screen fonts dialog.
2378 * src/lyx_gui.C: ditto
2379 * src/menus.[Ch]: ditto
2380 * src/lyx.[Ch]: ditto
2381 * src/lyx_cb.C: ditto + code from here moved to make
2382 screen-font-update. And people wonder why progress on GUII is
2383 slow. Look at how scattered this stuff was! It takes forever
2386 * forms/fdfix.sh: Fixup the spacing after commas.
2387 * forms/makefile: Remove date from generated files. Fewer clashes now.
2388 * forms/bullet_forms.C.patch: included someones handwritten changes
2390 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2391 once I've discovered why LyXRC was made noncopyable.
2392 * src/lyx_main.C: ditto
2394 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2396 * src/frontends/xforms/forms/fdfix.sh:
2397 * src/frontends/xforms/forms/fdfixh.sed:
2398 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2399 * src/frontends/xforms/Form*.[hC]:
2400 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2401 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2402 provide a destructor for the struct FD_form_xxxx. Another version of
2403 the set_[max|min]size workaround and a few other cleanups. Actually,
2404 Angus' patch from 20000809.
2406 2000-08-13 Baruch Even <baruch.even@writeme.com>
2408 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2411 2000-08-11 Juergen Vigna <jug@sad.it>
2413 * src/insets/insetgraphics.C (InsetGraphics): changing init
2414 order because of warnings.
2416 * src/frontends/xforms/forms/makefile: adding patching .C with
2419 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2420 from .C.patch to .c.patch
2422 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2423 order because of warning.
2425 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2427 * src/frontends/Liason.C (setMinibuffer): new helper function
2429 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2431 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2433 * lib/ui/default.ui: commented out PaperLayout entry
2435 * src/frontends/xforms/form_document.[Ch]: new added files
2437 * src/frontends/xforms/FormDocument.[Ch]: ditto
2439 * src/frontends/xforms/forms/form_document.fd: ditto
2441 * src/frontends/xforms/forms/form_document.C.patch: ditto
2443 2000-08-10 Juergen Vigna <jug@sad.it>
2445 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2446 (InsetGraphics): initialized cacheHandle to 0.
2447 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2449 2000-08-10 Baruch Even <baruch.even@writeme.com>
2451 * src/graphics/GraphicsCache.h:
2452 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2453 correctly as a cache.
2455 * src/graphics/GraphicsCacheItem.h:
2456 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2459 * src/graphics/GraphicsCacheItem_pimpl.h:
2460 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2463 * src/insets/insetgraphics.h:
2464 * src/insets/insetgraphics.C: Changed from using a signal notification
2465 to polling when image is not loaded.
2467 2000-08-10 Allan Rae <rae@lyx.org>
2469 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2470 that there are two functions that have to been taken out of line by
2471 hand and aren't taken care of in the script. (Just a reminder note)
2473 * sigc++/macros/*.h.m4: Updated as above.
2475 2000-08-09 Juergen Vigna <jug@sad.it>
2477 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2479 * src/insets/insettabular.C: make drawing of single cell smarter.
2481 2000-08-09 Marko Vendelin <markov@ioc.ee>
2482 * src/frontends/gnome/Menubar_pimpl.C
2483 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2484 implementation: new files
2486 * src/frontends/gnome/mainapp.C
2487 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2490 * src/main.C: create Gnome main window
2492 * src/frontends/xforms/Menubar_pimpl.h
2493 * src/frontends/Menubar.C
2494 * src/frontends/Menubar.h: added method Menubar::update that calls
2495 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2497 * src/LyXView.C: calls Menubar::update to update the state
2500 * src/frontends/gnome/Makefile.am: added new files
2502 * src/frontends/Makefile.am: added frontend compiler options
2504 2000-08-08 Juergen Vigna <jug@sad.it>
2506 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2508 * src/bufferlist.C (close):
2509 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2510 documents if exiting without saving.
2512 * src/buffer.C (save): use removeAutosaveFile()
2514 * src/support/filetools.C (removeAutosaveFile): new function.
2516 * src/lyx_cb.C (MenuWrite): returns a bool now.
2517 (MenuWriteAs): check if file could really be saved and revert to the
2519 (MenuWriteAs): removing old autosavefile if existant.
2521 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2522 before Goto toggle declaration, because of compiler warning.
2524 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2526 * src/lyxfunc.C (MenuNew): small fix.
2528 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2530 * src/bufferlist.C (newFile):
2531 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2533 * src/lyxrc.C: added new_ask_filename tag
2535 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2537 * src/lyx.fd: removed code pertaining to form_ref
2538 * src/lyx.[Ch]: ditto
2539 * src/lyx_cb.C: ditto
2540 * src/lyx_gui.C: ditto
2541 * src/lyx_gui_misc.C: ditto
2543 * src/BufferView_pimpl.C (restorePosition): update buffer only
2546 * src/commandtags.h (LFUN_REFTOGGLE): removed
2547 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2548 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2549 (LFUN_REFBACK): renamed LFUN_REF_BACK
2551 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2552 * src/menus.C: ditto
2553 * src/lyxfunc.C (Dispatch): ditto.
2554 InsertRef dialog is now GUI-independent.
2556 * src/texrow.C: added using std::endl;
2558 * src/insets/insetref.[Ch]: strip out large amounts of code.
2559 The inset is now a container and this functionality is now
2560 managed by a new FormRef dialog
2562 * src/frontends/Dialogs.h (showRef, createRef): new signals
2564 * src/frontends/xforms/FormIndex.[Ch],
2565 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2566 when setting dialog's min/max size
2567 * src/frontends/xforms/FormIndex.[Ch]: ditto
2569 * src/frontends/xforms/FormRef.[Ch],
2570 src/frontends/xforms/forms/form_ref.fd: new xforms
2571 implementation of an InsetRef dialog
2573 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2576 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2577 ios::nocreate is not part of the standard. Removed.
2579 2000-08-07 Baruch Even <baruch.even@writeme.com>
2581 * src/graphics/Renderer.h:
2582 * src/graphics/Renderer.C: Added base class for rendering of different
2583 image formats into Pixmaps.
2585 * src/graphics/XPM_Renderer.h:
2586 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2587 in a different class.
2589 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2590 easily add support for other formats.
2592 * src/insets/figinset.C: plugged a leak of an X resource.
2594 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2596 * src/CutAndPaste.[Ch]: make all metods static.
2598 * development/Code_rules/Rules: more work, added section on
2599 Exceptions, and a References section.
2601 * a lot of header files: work to make doc++ able to generate the
2602 source documentation, some workarounds of doc++ problems. Doc++ is
2603 now able to generate the documentation.
2605 2000-08-07 Juergen Vigna <jug@sad.it>
2607 * src/insets/insettabular.C (recomputeTextInsets): removed function
2609 * src/tabular.C (SetWidthOfMulticolCell):
2611 (calculate_width_of_column_NMC): fixed return value so that it really
2612 only returns true if the column-width has changed (there where
2613 problems with muliticolumn-cells in this column).
2615 2000-08-04 Juergen Vigna <jug@sad.it>
2617 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2618 also on the scrollstatus of the inset.
2619 (workAreaMotionNotify): ditto.
2621 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2623 2000-08-01 Juergen Vigna <jug@sad.it>
2625 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2627 * src/commandtags.h:
2628 * src/LyXAction.C (init):
2629 * src/insets/inset.C (LocalDispatch): added support for
2632 * src/insets/inset.C (scroll): new functions.
2634 * src/insets/insettext.C (removeNewlines): new function.
2635 (SetAutoBreakRows): removes forced newlines in the text of the
2636 paragraph if autoBreakRows is set to false.
2638 * src/tabular.C (Latex): generates a parbox around the cell contents
2641 * src/frontends/xforms/FormTabular.C (local_update): removed
2642 the radio_useparbox button.
2644 * src/tabular.C (UseParbox): new function
2646 2000-08-06 Baruch Even <baruch.even@writeme.com>
2648 * src/graphics/GraphicsCache.h:
2649 * src/graphics/GraphicsCache.C:
2650 * src/graphics/GraphicsCacheItem.h:
2651 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
2654 * src/insets/insetgraphics.h:
2655 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
2656 drawing of the inline image.
2658 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
2659 into the wrong position.
2661 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
2664 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
2666 * src/support/translator.h: move all typedefs to public section
2668 * src/support/filetools.C (MakeLatexName): return string const
2670 (TmpFileName): ditto
2671 (FileOpenSearch): ditto
2673 (LibFileSearch): ditto
2674 (i18nLibFileSearch): ditto
2677 (CreateTmpDir): ditto
2678 (CreateBufferTmpDir): ditto
2679 (CreateLyXTmpDir): ditto
2682 (MakeAbsPath): ditto
2684 (OnlyFilename): ditto
2686 (NormalizePath): ditto
2687 (CleanupPath): ditto
2688 (GetFileContents): ditto
2689 (ReplaceEnvironmentPath): ditto
2690 (MakeRelPath): ditto
2692 (ChangeExtension): ditto
2693 (MakeDisplayPath): ditto
2694 (do_popen): return cmdret const
2695 (findtexfile): return string const
2697 * src/support/DebugStream.h: add some /// to please doc++
2699 * src/frontends/DialogBase.h (endif): add some /// to please doc++
2701 * src/texrow.C (same_rownumber): functor to use with find_if
2702 (getIdFromRow): rewritten to use find_if and to not update the
2703 positions. return true if row is found
2704 (increasePos): new method, use to update positions
2706 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
2708 * src/lyxlex_pimpl.C (verifyTable): new method
2711 (GetString): return string const
2712 (pushTable): rewrite to use std::stack
2714 (setFile): better check
2717 * src/lyxlex.h: make LyXLex noncopyable
2719 * src/lyxlex.C (text): return char const * const
2720 (GetString): return string const
2721 (getLongString): return string const
2723 * src/lyx_gui_misc.C (askForText): return pair<...> const
2725 * src/lastfiles.[Ch] (operator): return string const
2727 * src/buffer.C (parseSingleLyXformat2Token): pass string to
2728 istringstream not char const *.
2729 move token.end() out of loop.
2730 (readFile): move initializaton of token
2732 * src/BufferView2.C (insertErrors): run texrow.increasePos if
2733 getIdFromRow is successful.
2735 * lib/bind/emacs.bind: don't include menus bind
2737 * development/Code_rules/Rules: the beginnings of making this
2738 better and covering more of the unwritten rules that we have.
2740 * development/Code_rules/Recommendations: a couple of wording
2743 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2745 * src/support/strerror.c: remove C++ comment.
2747 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
2749 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
2750 LFUN_INDEX_INSERT_LAST
2752 * src/texrow.C (getIdFromRow): changed from const_iterator to
2753 iterator, allowing code to compile with DEC cxx
2755 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
2756 stores part of the class, as suggested by Allan. Will allow
2758 (apply): test to apply uses InsetCommandParams operator!=
2760 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
2761 (apply): test to apply uses InsetCommandParams operator!=
2763 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
2764 stores part of the class.
2765 (update): removed limits on min/max size.
2767 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
2768 (apply): test to apply uses InsetCommandParams operator!=
2770 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
2771 (Read, Write, scanCommand, getCommand): moved functionality
2772 into InsetCommandParams.
2774 (getScreenLabel): made pure virtual
2775 new InsetCommandParams operators== and !=
2777 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
2778 c-tors based on InsetCommandParams. Removed others.
2779 * src/insets/insetinclude.[Ch]: ditto
2780 * src/insets/insetlabel.[Ch]: ditto
2781 * src/insets/insetparent.[Ch]: ditto
2782 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
2784 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
2785 insets derived from InsetCommand created using similar c-tors
2786 based on InsetCommandParams
2787 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
2788 * src/menus.C (ShowRefsMenu): ditto
2789 * src/paragraph.C (Clone): ditto
2790 * src/text2.C (SetCounter): ditto
2791 * src/lyxfunc.C (Dispatch) ditto
2792 Also recreated old InsetIndex behaviour exactly. Can now
2793 index-insert at the start of a paragraph and index-insert-last
2794 without launching the pop-up.
2796 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2798 * lib/lyxrc.example: mark te pdf options as non functional.
2800 * src/support/lstrings.C (strToInt): move initalization of tmpstr
2801 (isStrDbl): move tmpstr.end() out of loop.
2802 (strToDbl): move intialization of tmpstr
2803 (lowercase): return string const and move tmp.end() out of loop.
2804 (uppercase): return string const and move tmp.edn() out of loop.
2805 (prefixIs): add assertion
2810 (containsOnly): ditto
2811 (containsOnly): ditto
2812 (containsOnly): ditto
2813 (countChar): make last arg char not char const
2814 (token): return string const
2815 (subst): return string const, move tmp.end() out of loop.
2816 (subst): return string const, add assertion
2817 (strip): return string const
2818 (frontStrip): return string const, add assertion
2819 (frontStrip): return string const
2824 * src/support/lstrings.C: add inclde "LAssert.h"
2825 (isStrInt): move tmpstr.end() out of loop.
2827 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
2828 toollist.end() out of loop.
2829 (deactivate): move toollist.end() out of loop.
2830 (update): move toollist.end() out of loop.
2831 (updateLayoutList): move tc.end() out of loop.
2832 (add): move toollist.end() out of loop.
2834 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
2835 md.end() out of loop.
2837 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
2839 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
2842 * src/paragraph.C (Erase): move fontlist.end() out of loop.
2843 (Erase): move insetlist.end() out of loop.
2845 * src/lyx_sendfax_main.C: make show_logfile static and to take a
2846 ref to const string as first arg. Move initialization of some
2847 variables, whitespace changes.
2849 * src/kbmap.C (defkey): move table.end() out of loop.
2850 (kb_keymap): move table.end() out of loop.
2851 (findbinding): move table.end() out of loop.
2853 * src/MenuBackend.C (hasMenu): move end() out of loop.
2854 (getMenu): move end() out of loop.
2855 (getMenu): move menulist_.end() out of loop.
2857 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
2859 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
2862 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
2863 (getFromLyXName): move infotab.end() out of loop.
2865 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
2866 -fvtable-thunks -ffunction-sections -fdata-sections
2868 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
2870 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
2873 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2875 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
2877 * src/frontends/xforms/FormCitation.[Ch],
2878 src/frontends/xforms/FormIndex.[Ch],
2879 src/frontends/xforms/FormToc.[Ch],
2880 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
2882 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
2884 * src/commandtags.h: renamed, created some flags for citation
2887 * src/lyx_gui_misc.C: stripped out old FD_index_form code
2889 * src/lyxfunc.C (dispatch): use signals to insert index entry
2891 * src/frontends/Dialogs.h: new signal createIndex
2893 * src/frontends/xforms/FormCommand.[Ch],
2894 src/frontends/xforms/FormCitation.[Ch],
2895 src/frontends/xforms/FormToc.[Ch],
2896 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
2898 * src/insets/insetindex.[Ch]: GUI-independent
2900 * src/frontends/xforms/FormIndex.[Ch],
2901 * src/frontends/xforms/forms/form_index.fd: xforms implementation
2904 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
2906 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
2907 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
2909 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2911 * src/insets/insetref.C (Latex): rewrite so that there is now
2912 question that a initialization is requested.
2914 * src/insets/insetcommand.h: reenable the hide signal
2916 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2918 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
2919 fix handling of shortcuts (many bugs :)
2920 (add_lastfiles): ditto.
2922 * lib/ui/default.ui: fix a few shortcuts.
2924 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
2926 * Makefile.am: Fix ``rpmdist'' target to return the exit
2927 status of the ``rpm'' command, instead of the last command in
2928 the chain (the ``rm lyx.xpm'' command, which always returns
2931 2000-08-02 Allan Rae <rae@lyx.org>
2933 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
2934 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
2935 * src/frontends/xforms/FormToc.C (FormToc): ditto
2937 * src/frontends/xforms/Makefile.am: A few forgotten files
2939 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
2940 Signals-not-copyable-problem Lars' started commenting out.
2942 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
2944 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
2946 * src/insets/insetcommand.h: Signals is not copyable so anoter
2947 scheme for automatic hiding of forms must be used.
2949 * src/frontends/xforms/FormCitation.h: don't inerit from
2950 noncopyable, FormCommand already does that.
2951 * src/frontends/xforms/FormToc.h: ditto
2952 * src/frontends/xforms/FormUrl.h: ditto
2954 * src/frontends/xforms/FormCitation.C: add include <algorithm>
2956 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
2958 * src/insets/insetcommand.h (hide): new SigC::Signal0
2959 (d-tor) new virtual destructor emits hide signal
2961 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
2962 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
2964 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
2965 LOF and LOT. Inset is now GUI-independent
2967 * src/insets/insetloa.[Ch]: redundant
2968 * src/insets/insetlof.[Ch]: ditto
2969 * src/insets/insetlot.[Ch]: ditto
2971 * src/frontends/xforms/forms/form_url.fd: tweaked!
2972 * src/frontends/xforms/forms/form_citation.fd: ditto
2974 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
2975 dialogs dealing with InsetCommand insets
2977 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
2978 FormCommand base class
2979 * src/frontends/xforms/FormUrl.[Ch]: ditto
2981 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
2983 * src/frontends/xforms/FormToc.[Ch]: ditto
2985 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
2986 passed a generic InsetCommand pointer
2987 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
2989 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
2990 and modified InsetTOC class
2991 * src/buffer.C: ditto
2993 * forms/lyx.fd: strip out old FD_form_toc code
2994 * src/lyx_gui_misc.C: ditto
2995 * src/lyx_gui.C: ditto
2996 * src/lyx_cb.C: ditto
2997 * src/lyx.[Ch]: ditto
2999 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3001 * src/support/utility.hpp: tr -d '\r'
3003 2000-08-01 Juergen Vigna <jug@sad.it>
3005 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3007 * src/commandtags.h:
3008 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3009 LFUN_TABULAR_FEATURES.
3011 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3012 LFUN_LAYOUT_TABULAR.
3014 * src/insets/insettabular.C (getStatus): implemented helper function.
3016 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3018 2000-07-31 Juergen Vigna <jug@sad.it>
3020 * src/text.C (draw): fixed screen update problem for text-insets.
3022 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3023 something changed probably this has to be added in various other
3026 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3028 2000-07-31 Baruch Even <baruch.even@writeme.com>
3030 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3031 templates to satisfy compaq cxx.
3034 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3036 * src/support/translator.h (equal_1st_in_pair::operator()): take
3037 const ref pair_type as arg.
3038 (equal_2nd_in_pair::operator()): ditto
3039 (Translator::~Translator): remove empty d-tor.
3041 * src/graphics/GraphicsCache.C: move include config.h to top, also
3042 put initialization of GraphicsCache::singleton here.
3043 (~GraphicsCache): move here
3044 (addFile): take const ref as arg
3047 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3049 * src/BufferView2.C (insertLyXFile): change te with/without header
3052 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3054 * src/frontends/xforms/FormGraphics.C (apply): add some
3055 static_cast. Not very nice, but required by compaq cxx.
3057 * src/frontends/xforms/RadioButtonGroup.h: include header
3058 <utility> instead of <pair.h>
3060 * src/insets/insetgraphicsParams.C: add using directive.
3061 (readResize): change return type to void.
3062 (readOrigin): ditto.
3064 * src/lyxfunc.C (getStatus): add missing break for build-program
3065 function; add test for Literate for export functions.
3067 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3068 entries in Options menu.
3070 2000-07-31 Baruch Even <baruch.even@writeme.com>
3072 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3073 protect against auto-allocation; release icon when needed.
3075 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3077 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3078 on usual typewriter.
3080 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3081 earlier czech.kmap), useful only for programming.
3083 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3085 * src/frontends/xforms/FormCitation.h: fix conditioning around
3088 2000-07-31 Juergen Vigna <jug@sad.it>
3090 * src/frontends/xforms/FormTabular.C (local_update): changed
3091 radio_linebreaks to radio_useparbox and added radio_useminipage.
3093 * src/tabular.C: made support for using minipages/parboxes.
3095 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3097 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3099 (descent): so the cursor is in the middle.
3100 (width): bit smaller box.
3102 * src/insets/insetgraphics.h: added display() function.
3104 2000-07-31 Baruch Even <baruch.even@writeme.com>
3106 * src/frontends/Dialogs.h: Added showGraphics signals.
3108 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3109 xforms form definition of the graphics dialog.
3111 * src/frontends/xforms/FormGraphics.h:
3112 * src/frontends/xforms/FormGraphics.C: Added files, the
3113 GUIndependent code of InsetGraphics
3115 * src/insets/insetgraphics.h:
3116 * src/insets/insetgraphics.C: Major writing to make it work.
3118 * src/insets/insetgraphicsParams.h:
3119 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3120 struct between InsetGraphics and GUI.
3122 * src/LaTeXFeatures.h:
3123 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3124 support for graphicx package.
3126 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3127 for the graphics inset.
3129 * src/support/translator.h: Added file, used in
3130 InsetGraphicsParams. this is a template to translate between two
3133 * src/frontends/xforms/RadioButtonGroup.h:
3134 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3135 way to easily control a radio button group.
3137 2000-07-28 Juergen Vigna <jug@sad.it>
3139 * src/insets/insettabular.C (LocalDispatch):
3140 (TabularFeatures): added support for lyx-functions of tabular features.
3141 (cellstart): refixed this function after someone wrongly changed it.
3143 * src/commandtags.h:
3144 * src/LyXAction.C (init): added support for tabular-features
3146 2000-07-28 Allan Rae <rae@lyx.org>
3148 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3149 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3150 triggers the callback for input checking. As a result we sometimes get
3151 "LyX: This shouldn't happen..." printed to cerr.
3152 (input): Started using status variable since I only free() on
3153 destruction. Some input checking for paths and font sizes.
3155 * src/frontends/xforms/FormPreferences.h: Use status to control
3156 activation of Ok and Apply
3158 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3159 callback. Also resized to stop segfaults with 0.88. The problem is
3160 that xforms-0.88 requires the folder to be wide enough to fit all the
3161 tabs. If it isn't it causes all sorts of problems.
3163 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3165 * src/frontends/xforms/forms/README: Reflect reality.
3167 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3168 * src/frontends/xforms/forms/makefile: ditto.
3170 * src/commandtags.h: Get access to new Preferences dialog
3171 * src/LyXAction.C: ditto
3172 * src/lyxfunc.C: ditto
3173 * lib/ui/default.ui: ditto
3175 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3177 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3179 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3182 * src/frontends/xforms/form_url.[Ch]: added.
3184 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3186 * src/insets/insetbib.h: fixed bug in previous commit
3188 * src/frontends/xforms/FormUrl.h: ditto
3190 * src/frontends/xforms/FormPrint.h: ditto
3192 * src/frontends/xforms/FormPreferences.h: ditto
3194 * src/frontends/xforms/FormCopyright.h: ditto
3196 * src/frontends/xforms/FormCitation.C: ditto
3198 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3199 private copyconstructor and private default contructor
3201 * src/support/Makefile.am: add utility.hpp
3203 * src/support/utility.hpp: new file from boost
3205 * src/insets/insetbib.h: set owner in clone
3207 * src/frontends/xforms/FormCitation.C: added missing include
3210 * src/insets/form_url.[Ch]: removed
3212 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3214 * development/lyx.spec.in
3215 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3216 file/directory re-organization.
3218 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3220 * src/insets/insetcommand.[Ch]: moved the string data and
3221 associated manipulation methods into a new stand-alone class
3222 InsetCommandParams. This class has two additional methods
3223 getAsString() and setFromString() allowing the contents to be
3224 moved around as a single string.
3225 (addContents) method removed.
3226 (setContents) method no longer virtual.
3228 * src/buffer.C (readInset): made use of new InsetCitation,
3229 InsetUrl constructors based on InsetCommandParams.
3231 * src/commandtags.h: add LFUN_INSERT_URL
3233 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3234 independent InsetUrl and use InsetCommandParams to extract
3235 string info and create new Insets.
3237 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3239 * src/frontends/xforms/FormCitation.C (apply): uses
3242 * src/frontends/xforms/form_url.C
3243 * src/frontends/xforms/form_url.h
3244 * src/frontends/xforms/FormUrl.h
3245 * src/frontends/xforms/FormUrl.C
3246 * src/frontends/xforms/forms/form_url.fd: new files
3248 * src/insets/insetcite.[Ch]: removed unused constructors.
3250 * src/insets/insetinclude.[Ch]: no longer store filename
3252 * src/insets/inseturl.[Ch]: GUI-independent.
3254 2000-07-26 Juergen Vigna <jug@sad.it>
3255 * renamed frontend from gtk to gnome as it is that what is realized
3256 and did the necessary changes in the files.
3258 2000-07-26 Marko Vendelin <markov@ioc.ee>
3260 * configure.in: cleaning up gnome configuration scripts
3262 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3264 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3265 shortcuts syndrom by redrawing them explicitely (a better solution
3266 would be appreciated).
3268 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3270 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3273 * src/lyx_cb.C (MenuExport): change html export to do the right
3274 thing depending of the document type (instead of having
3275 html-linuxdoc and html-docbook).
3276 * src/lyxfunc.C (getStatus): update for html
3277 * lib/ui/default.ui: simplify due to the above change.
3278 * src/menus.C (ShowFileMenu): update too (in case we need it).
3280 * src/MenuBackend.C (read): if a menu is defined twice, add the
3281 new entries to the exiting one.
3283 2000-07-26 Juergen Vigna <jug@sad.it>
3285 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3287 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3288 and return a bool if it did actual save the file.
3289 (AutoSave): don't autosave a unnamed doc.
3291 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3292 check if this is an UNNAMED new file and react to it.
3293 (newFile): set buffer to unnamed and change to not mark a new
3294 buffer dirty if I didn't do anything with it.
3296 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3298 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3300 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3301 friend as per Angus's patch posted to lyx-devel.
3303 * src/ext_l10n.h: updated
3305 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3306 gettext on the style string right before inserting them into the
3309 * autogen.sh: add code to extract style strings form layout files,
3310 not good enough yet.
3312 * src/frontends/gtk/.cvsignore: add MAKEFILE
3314 * src/MenuBackend.C (read): run the label strings through gettext
3315 before storing them in the containers.
3317 * src/ext_l10n.h: new file
3319 * autogen.sh : generate the ext_l10n.h file here
3321 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3323 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3326 * lib/ui/default.ui: fix a couple of typos.
3328 * config/gnome/gtk.m4: added (and added to the list of files in
3331 * src/insets/insetinclude.C (unique_id): fix when we are using
3332 lyxstring instead of basic_string<>.
3333 * src/insets/insettext.C (LocalDispatch): ditto.
3334 * src/support/filetools.C: ditto.
3336 * lib/configure.m4: create the ui/ directory if necessary.
3338 * src/LyXView.[Ch] (updateToolbar): new method.
3340 * src/BufferView_pimpl.C (buffer): update the toolbar when
3341 opening/closing buffer.
3343 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3345 * src/LyXAction.C (getActionName): enhance to return also the name
3346 and options of pseudo-actions.
3347 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3349 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3350 as an example of what is possible). Used in File->Build too (more
3351 useful) and in the import/export menus (to mimick the complicated
3352 handling of linuxdoc and friends). Try to update all the entries.
3354 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3357 * src/MenuBackend.C (read): Parse the new OptItem tag.
3359 * src/MenuBackend.h: Add a new optional_ data member (used if the
3360 entry should be omitted when the lyxfunc is disabled).
3362 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3363 function, used as a shortcut.
3364 (create_submenu): align correctly the shortcuts on the widest
3367 * src/MenuBackend.h: MenuItem.label() only returns the label of
3368 the menu without shortcut; new method shortcut().
3370 2000-07-14 Marko Vendelin <markov@ioc.ee>
3372 * src/frontends/gtk/Dialogs.C:
3373 * src/frontends/gtk/FormCopyright.C:
3374 * src/frontends/gtk/FormCopyright.h:
3375 * src/frontends/gtk/Makefile.am: added these source-files for the
3376 Gtk/Gnome support of the Copyright-Dialog.
3378 * src/main.C: added Gnome::Main initialization if using
3379 Gtk/Gnome frontend-GUI.
3381 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3383 * config/gnome/aclocal-include.m4
3384 * config/gnome/compiler-flags.m4
3385 * config/gnome/curses.m4
3386 * config/gnome/gnome--.m4
3387 * config/gnome/gnome-bonobo-check.m4
3388 * config/gnome/gnome-common.m4
3389 * config/gnome/gnome-fileutils.m4
3390 * config/gnome/gnome-ghttp-check.m4
3391 * config/gnome/gnome-gnorba-check.m4
3392 * config/gnome/gnome-guile-checks.m4
3393 * config/gnome/gnome-libgtop-check.m4
3394 * config/gnome/gnome-objc-checks.m4
3395 * config/gnome/gnome-orbit-check.m4
3396 * config/gnome/gnome-print-check.m4
3397 * config/gnome/gnome-pthread-check.m4
3398 * config/gnome/gnome-support.m4
3399 * config/gnome/gnome-undelfs.m4
3400 * config/gnome/gnome-vfs.m4
3401 * config/gnome/gnome-x-checks.m4
3402 * config/gnome/gnome-xml-check.m4
3403 * config/gnome/gnome.m4
3404 * config/gnome/gperf-check.m4
3405 * config/gnome/gtk--.m4
3406 * config/gnome/linger.m4
3407 * config/gnome/need-declaration.m4: added configuration scripts
3408 for Gtk/Gnome frontend-GUI
3410 * configure.in: added support for the --with-frontend=gtk option
3412 * autogen.sh: added config/gnome/* to list of config-files
3414 * acconfig.h: added define for GTKGUI-support
3416 * config/lyxinclude.m4: added --with-frontend[=value] option value
3417 for Gtk/Gnome frontend-GUI support.
3419 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3421 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3425 * src/paragraph.C (GetChar): remove non-const version
3427 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3428 (search_kw): use it.
3430 * src/lyx_main.C (init): if "preferences" exist, read that instead
3432 (ReadRcFile): return bool if the file could be read ok.
3433 (ReadUIFile): add a check to see if lex file is set ok.
3435 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3436 bastring can be used instead of lyxstring (still uses the old code
3437 if std::string is good enough or if lyxstring is used.)
3439 * src/encoding.C: make the arrays static, move ininle functions
3441 * src/encoding.h: from here.
3443 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3444 (parseSingleLyXformat2Token): move inset parsing to separate method
3445 (readInset): new private method
3447 * src/Variables.h: remove virtual from get().
3449 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
3450 access to NEW_INSETS and NEW_TABULAR
3452 * src/MenuBackend.h: remove superfluous forward declaration of
3453 MenuItem. Add documentations tags "///", remove empty MenuItem
3454 destructor, remove private default contructor.
3456 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3458 (read): more string mlabel and mname to where they are used
3459 (read): remove unused variables mlabel and mname
3460 (defaults): unconditional clear, make menusetup take advantage of
3461 add returning Menu &.
3463 * src/LyXView.h: define NEW_MENUBAR as default
3465 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3466 to NEW_INSETS and NEW_TABULAR.
3467 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3468 defined. Change some of the "xxxx-inset-insert" functions names to
3471 * several files: more enahncements to NEW_INSETS and the resulting
3474 * lib/lyxrc.example (\date_insert_format): move to misc section
3476 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3477 bastring and use AC_CACHE_CHECK.
3478 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3479 the system have the newest methods. uses AC_CACHE_CHECK
3480 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3481 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3482 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3484 * configure.in: add LYX_CXX_GOOD_STD_STRING
3486 * acinclude.m4: recreated
3488 2000-07-24 Amir Karger
3490 * README: add Hebrew, Arabic kmaps
3493 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3495 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3498 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3500 * Lot of files: add pragma interface/implementation.
3502 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3504 * lib/ui/default.ui: new file (ans new directory). Contains the
3505 default menu and toolbar.
3507 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3508 global space. Toolbars are now read (as menus) in ui files.
3510 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3512 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3513 is disabled because the document is read-only. We want to have the
3514 toggle state of the function anyway.
3515 (getStatus): add code for LFUN_VC* functions (mimicking what is
3516 done in old-style menus)
3518 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3519 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3521 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3522 * src/BufferView_pimpl.C: ditto.
3523 * src/lyxfunc.C: ditto.
3525 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3526 default). This replaces old-style menus by new ones.
3528 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3529 MenuItem. Contain the data structure of a menu.
3531 * src/insets/insettext.C: use LyXView::setLayout instead of
3532 accessing directly the toolbar combox.
3533 * src/lyxfunc.C (Dispatch): ditto.
3535 * src/LyXView.C (setLayout): new method, which just calls
3536 Toolbar::setLayout().
3537 (updateLayoutChoice): move part of this method in Toolbar.
3539 * src/toolbar.[Ch]: removed.
3541 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3542 implementation the toolbar.
3544 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3545 the toolbar. It might make sense to merge it with ToolbarDefaults
3547 (setLayout): new function.
3548 (updateLayoutList): ditto.
3549 (openLayoutList): ditto.
3551 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3552 xforms implementation of the toolbar.
3553 (get_toolbar_func): comment out, since I do not
3554 know what it is good for.
3556 * src/ToolbarDefaults.h: Add the ItemType enum.
3558 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3559 for a list of allocated C strings. Used in Menubar xforms
3560 implementation to avoid memory leaks.
3562 * src/support/lstrings.[Ch] (uppercase): new version taking and
3566 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3567 * lib/bind/emacs.bind: ditto.
3569 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3571 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3572 forward decl of LyXView.
3574 * src/toolbar.C (toolbarItem): moved from toolbar.h
3575 (toolbarItem::clean): ditto
3576 (toolbarItem::~toolbarItem): ditto
3577 (toolbarItem::operator): ditto
3579 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3581 * src/paragraph.h: control the NEW_TABULAR define from here
3583 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3584 USE_TABULAR_INSETS to NEW_TABULAR
3586 * src/ToolbarDefaults.C: add include "lyxlex.h"
3588 * files using the old table/tabular: use NEW_TABULAR to control
3589 compilation of old tabular stuff.
3591 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3594 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3595 planemet in reading of old style floats, fix the \end_deeper
3596 problem when reading old style floats.
3598 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3600 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3602 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3604 * lib/bind/sciword.bind: updated.
3606 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3608 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3609 layout write problem
3611 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3613 * src/Makefile.am (INCLUDES): remove image directory from include
3616 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3617 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3619 * src/LyXView.C (create_form_form_main): read the application icon
3622 * lib/images/*.xpm: change the icons to use transparent color for
3625 * src/toolbar.C (update): change the color of the button when it
3628 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3630 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3631 setting explicitely the minibuffer.
3632 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3634 * src/LyXView.C (showState): new function. Shows font information
3635 in minibuffer and update toolbar state.
3636 (LyXView): call Toolbar::update after creating the
3639 * src/toolbar.C: change toollist to be a vector instead of a
3641 (BubbleTimerCB): get help string directly from the callback
3642 argument of the corresponding icon (which is the action)
3643 (set): remove unnecessary ugliness.
3644 (update): new function. update the icons (depressed, disabled)
3645 depending of the status of the corresponding action.
3647 * src/toolbar.h: remove help in toolbarItem
3649 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
3651 * src/Painter.C (text): Added code for using symbol glyphs from
3652 iso10646 fonts. Currently diabled.
3654 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
3657 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
3658 magyar,turkish and usorbian.
3660 * src/paragraph.C (isMultiLingual): Made more efficient.
3662 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
3665 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
3666 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
3667 Also changed the prototype to "bool math_insert_greek(char)".
3669 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3671 * lots of files: apply the NEW_INSETS on all code that will not be
3672 needed when we move to use the new insets. Enable the define in
3673 lyxparagrah.h to try it.
3675 * src/insets/insettabular.C (cellstart): change to be a static
3677 (InsetTabular): initialize buffer in the initializer list.
3679 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
3681 * src/frontends/xforms/FormPrint.[Ch] : moved #include
3682 form_print.h out of the header file. Replaced with forward
3683 declarations of the relevant struct.
3685 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
3688 * src/commandtags.h: do not include "debug.h" which does not
3689 belong there. #include it in some other places because of this
3692 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3694 * src/insets/insetcaption.C: add a couple "using" directives.
3696 * src/toolbar.C (add): get the help text directly from lyxaction.
3698 (setPixmap): new function. Loads from disk and sets a pixmap on a
3699 botton; the name of the pixmap file is derived from the command
3702 * src/toolbar.h: remove members isBitmap and pixmap from
3705 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
3706 * lib/images/: move many files from images/banner.xpm.
3708 * src/lyx_gui.C (create_forms): read banner pixmap from file.
3710 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
3711 * src/toolbar.C: ditto.
3712 * configure.in: ditto.
3713 * INSTALL: document.
3715 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
3716 the spellchecker popup is closed from the WM.
3718 2000-07-19 Juergen Vigna <jug@sad.it>
3720 * src/insets/insetfloat.C (Write): small fix because we use the
3721 insetname for the type now!
3723 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
3725 * src/frontends/xforms/forms/form_citation.fd: object sizes are
3728 * src/frontends/Dialogs.h: removed hideCitation signal
3730 * src/insets/insetcite.h: added hide signal
3732 * src/insets/insetcite.C (~InsetCitation): emits new signal
3733 (getScreenLabel): "intelligent" label should now fit on the screen!
3735 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
3737 * src/frontends/xforms/FormCitation.C (showInset): connects
3738 hide() to the inset's hide signal
3739 (show): modified to use fl_set_object_position rather than
3740 fl_set_object_geometry wherever possible
3742 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3744 * src/insets/lyxinset.h: add caption code
3746 * src/insets/insetfloat.C (type): new method
3748 * src/insets/insetcaption.C (Write): new method
3750 (LyxCode): new method
3752 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
3753 to get it right together with using the FloatList.
3755 * src/commandtags.h: add LFUN_INSET_CAPTION
3756 * src/lyxfunc.C (Dispatch): handle it
3758 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
3761 * src/Variables.[Ch]: make expand take a const reference, remove
3762 the destructor, some whitespace changes.
3764 * src/LyXAction.C (init): add caption-inset-insert
3766 * src/FloatList.C (FloatList): update the default floats a bit.
3768 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3770 * src/Variables.[Ch]: new files. Intended to be used for language
3771 specific strings (like \chaptername) and filename substitution in
3774 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
3776 * lib/kbd/american.kmap: update
3778 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
3780 * src/bufferparams.[Ch]: remove member allowAccents.
3782 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
3784 * src/LaTeXLog.C: use the log_form.h header.
3785 * src/lyx_gui.C: ditto.
3786 * src/lyx_gui_misc.C: ditto.
3787 * src/lyxvc.h: ditto.
3789 * forms/log_form.fd: new file, created from latexoptions.fd. I
3790 kept the log popup and nuked the options form.
3792 * src/{la,}texoptions.[Ch]: removed.
3793 * src/lyx_cb.C (LaTeXOptions): ditto
3795 * src/lyx_gui.C (create_forms): do not handle the
3796 fd_latex_options form.
3798 2000-07-18 Juergen Vigna <jug@sad.it>
3800 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
3801 name of the inset so that it can be requested outside (text2.C).
3803 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
3806 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3808 * src/mathed/formula.h (ConvertFont): constify
3810 * src/mathed/formula.C (Read): add warning if \end_inset is not
3811 found on expected place.
3813 * src/insets/lyxinset.h (ConvertFont): consify
3815 * src/insets/insetquotes.C (ConvertFont): constify
3816 * src/insets/insetquotes.h: ditto
3818 * src/insets/insetinfo.h: add labelfont
3820 * src/insets/insetinfo.C (InsetInfo): set the labelfont
3821 (ascent): use labelfont
3825 (Write): make .lyx file a bit nicer
3827 * src/insets/insetfloat.C (Write): simplify somewhat...
3828 (Read): add warning if arg is not found
3830 * src/insets/insetcollapsable.C: add using std::max
3831 (Read): move string token and add warning in arg is not found
3832 (draw): use std::max to get the right ty
3833 (getMaxWidth): simplify by using std::max
3835 * src/insets/insetsection.h: new file
3836 * src/insets/insetsection.C: new file
3837 * src/insets/insetcaption.h: new file
3838 * src/insets/insetcaption.C: new file
3840 * src/insets/inset.C (ConvertFont): constify signature
3842 * src/insets/Makefile.am (libinsets_la_SOURCES): add
3843 insetcaption.[Ch] and insetsection.[Ch]
3845 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
3846 uses to use LABEL_COUNTER_CHAPTER instead.
3847 * src/text2.C (SetCounter): here
3849 * src/counters.h: new file
3850 * src/counters.C: new file
3851 * src/Sectioning.h: new file
3852 * src/Sectioning.C: new file
3854 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
3856 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3858 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
3861 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
3864 2000-07-17 Juergen Vigna <jug@sad.it>
3866 * src/tabular.C (Validate): check if array-package is needed.
3867 (SetVAlignment): added support for vertical alignment.
3868 (SetLTFoot): better support for longtable header/footers
3869 (Latex): modified to support added features.
3871 * src/LaTeXFeatures.[Ch]: added array-package.
3873 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
3875 * src/lyx_gui.C (LyXGUI): make sure that the height is large
3878 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
3880 * configure.in: do not forget to put a space after -isystem.
3882 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
3884 * lib/kbd/arabic.kmap: a few fixes.
3886 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3888 * some whitespace chagnes to a number of files.
3890 * src/support/DebugStream.h: change to make it easier for
3891 doc++ to parse correctly.
3892 * src/support/lyxstring.h: ditto
3894 * src/mathed/math_utils.C (compara): change to have only one
3896 (MathedLookupBOP): change because of the above.
3898 * src/mathed/math_delim.C (math_deco_compare): change to have only
3900 (search_deco): change becasue of the above.
3902 * src/insets/insettabular.C (DrawCellSelection): use std::swap
3903 instead of manually coded one.
3905 * src/insets/insetquotes.C (Read): read the \end_inset too
3907 * src/insets/insetlatex.h: remove file
3908 * src/insets/insetlatex.C: remove file
3910 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
3912 (InsetPrintIndex): remove destructor
3914 * src/insets/insetinclude.h: remove default constructor
3916 * src/insets/insetfloat.C: work to make it work better
3918 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
3920 * src/insets/insetcite.h (InsetCitation): remove default constructor
3922 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
3924 * src/text.C (GetColumnNearX): comment out some currently unused code.
3926 * src/paragraph.C (writeFile): move some initializations closer to
3928 (CutIntoMinibuffer): small change to use new matchIT operator
3932 (InsertInset): ditto
3935 (InsetIterator): ditto
3936 (Erase): small change to use new matchFT operator
3938 (GetFontSettings): ditto
3939 (HighestFontInRange): ditto
3942 * src/lyxparagraph.h: some chars changed to value_type
3943 (matchIT): because of some stronger checking (perhaps too strong)
3944 in SGI STL, the two operator() unified to one.
3947 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
3949 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
3950 the last inset read added
3951 (parseSingleLyXformat2Token): some more (future) compability code added
3952 (parseSingleLyXformat2Token): warning about solitary \end_inset added
3953 (parseSingleLyXformat2Token): set last_inset_read
3954 (parseSingleLyXformat2Token): more code to read new "Float" correctly
3955 (parseSingleLyXformat2Token): don't double intializw string next_token
3957 * src/TextCache.C (text_fits::operator()): add const's to the signature
3958 (has_buffer::operator()): ditto
3960 * src/Floating.h: add some comments on the class
3962 * src/FloatList.[Ch] (typeExist): new method
3965 * src/BackStack.h: added default constructor, wanted by Gcc.
3967 2000-07-14 Juergen Vigna <jug@sad.it>
3969 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
3971 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
3973 * src/insets/insettabular.C (resizeLyXText): need this to be able to
3974 do a redraw when the window is resized!
3975 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
3977 * src/insets/insettext.C (resizeLyXText): added function to correctly
3978 being able to resize the LyXWindow.
3980 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
3982 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
3984 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
3985 crashes when closing dialog to a deleted inset.
3987 * src/insets/insetcite.[Ch] (Edit) : the return of this former
3988 method! Now similar to other insets.
3990 2000-07-13 Juergen Vigna <jug@sad.it>
3992 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
3994 * lib/examples/Literate.lyx: small patch!
3996 * src/insets/insetbib.C (Read): added this function because of wrong
3997 Write (without [begin|end]_inset).
3999 2000-07-11 Juergen Vigna <jug@sad.it>
4001 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4002 as the insertInset could not be good!
4004 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4005 the bool param should not be last.
4007 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4009 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4010 did submit that to Karl).
4012 * configure.in: use -isystem instead of -I for X headers. This
4013 fixes a problem on solaris with a recent gcc;
4014 put the front-end code after the X detection code;
4015 configure in sigc++ before lib/
4017 * src/lyx_main.C (commandLineHelp): remove -display from command
4020 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4022 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4023 Also put in Makefile rules for building the ``listerrors''
4024 program for parsing errors from literate programs written in LyX.
4026 * lib/build-listerrors: Added small shell script as part of compile
4027 process. This builds a working ``listerrors'' binary if noweb is
4028 installed and either 1) the VNC X server is installed on the machine,
4029 or 2) the user is compiling from within a GUI. The existence of a GUI
4030 is necessary to use the ``lyx --export'' feature for now. This
4031 hack can be removed once ``lyx --export'' no longer requires a GUI to
4034 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4036 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4037 now passed back correctly from gcc and placed "under" error
4038 buttons in a Literate LyX source.
4040 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4042 * src/text.C (GetColumnNearX): Better behavior when a RTL
4043 paragraph is ended by LTR text.
4045 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4048 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4050 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4051 true when clipboard is empty.
4053 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4055 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4056 row of the paragraph.
4057 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4058 to prevent calculation of bidi tables
4060 2000-07-07 Juergen Vigna <jug@sad.it>
4062 * src/screen.C (ToggleSelection): added y_offset and x_offset
4065 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4068 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4070 * src/insets/insettext.C: fixed Layout-Display!
4072 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4074 * configure.in: add check for strings.h header.
4076 * src/spellchecker.C: include <strings.h> in order to have a
4077 definition for bzero().
4079 2000-07-07 Juergen Vigna <jug@sad.it>
4081 * src/insets/insettext.C (draw): set the status of the bv->text to
4082 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4084 * src/screen.C (DrawOneRow):
4085 (DrawFromTo): redraw the actual row if something has changed in it
4088 * src/text.C (draw): call an update of the toplevel-inset if something
4089 has changed inside while drawing.
4091 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4093 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4095 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4096 processing inside class.
4098 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4099 processing inside class.
4101 * src/insets/insetindex.h new struct Holder, consistent with other
4104 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4105 citation dialog from main code and placed it in src/frontends/xforms.
4106 Dialog launched through signals instead of callbacks
4108 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4110 * lyx.man: update the options description.
4112 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4114 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4115 handle neg values, set min width to 590, add doc about -display
4117 2000-07-05 Juergen Vigna <jug@sad.it>
4119 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4120 calls to BufferView *.
4122 * src/insets/insettext.C (checkAndActivateInset): small fix non
4123 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4125 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4126 their \end_inset token!
4128 2000-07-04 edscott <edscott@imp.mx>
4130 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4131 lib/lyxrc.example: added option \wheel_jump
4133 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4135 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4136 remove support for -width,-height,-xpos and -ypos.
4138 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4140 * src/encoding.[Ch]: New files.
4142 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4143 (text): Call to the underline() method only when needed.
4145 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4147 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4148 encoding(s) for the document.
4150 * src/bufferparams.C (BufferParams): Changed default value of
4153 * src/language.C (newLang): Removed.
4154 (items[]): Added encoding information for all defined languages.
4156 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4157 encoding choice button.
4159 * src/lyxrc.h (font_norm_type): New member variable.
4160 (set_font_norm_type): New method.
4162 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4163 paragraphs with different encodings.
4165 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4166 (TransformChar): Changed to work correctly with Arabic points.
4167 (draw): Added support for drawing Arabic points.
4168 (draw): Removed code for drawing underbars (this is done by
4171 * src/support/textutils.h (IsPrintableNonspace): New function.
4173 * src/BufferView_pimpl.h: Added "using SigC::Object".
4174 * src/LyXView.h: ditto.
4176 * src/insets/insetinclude.h (include_label): Changed to mutable.
4178 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4180 * src/mathed/math_iter.h: remove empty destructor
4182 * src/mathed/math_cursor.h: remove empty destructor
4184 * src/insets/lyxinset.h: add THEOREM_CODE
4186 * src/insets/insettheorem.[Ch]: new files
4188 * src/insets/insetminipage.C: (InsertInset): remove
4190 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4192 (InsertInset): remove
4194 * src/insets/insetlist.C: (InsertList): remove
4196 * src/insets/insetfootlike.[Ch]: new files
4198 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4201 (InsertInset): ditto
4203 * src/insets/insetert.C: remove include Painter.h, reindent
4204 (InsertInset): move to header
4206 * src/insets/insetcollapsable.h: remove explicit from default
4207 contructor, remove empty destructor, add InsertInset
4209 * src/insets/insetcollapsable.C (InsertInset): new func
4211 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4213 * src/vspace.h: add explicit to constructor
4215 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4216 \textcompwordmark, please test this.
4218 * src/lyxrc.C: set ascii_linelen to 65 by default
4220 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4222 * src/commandtags.h: add LFUN_INSET_THEOREM
4224 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4225 (makeLinuxDocFile): remove _some_ of the nice logic
4226 (makeDocBookFile): ditto
4228 * src/Painter.[Ch]: (~Painter): removed
4230 * src/LyXAction.C (init): entry for insettheorem added
4232 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4234 (deplog): code to detect files generated by LaTeX, needs testing
4237 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4239 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4241 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4243 * src/LaTeX.C (deplog): Add a check for files that are going to be
4244 created by the first latex run, part of the project to remove the
4247 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4248 contents to the extension list.
4250 2000-07-04 Juergen Vigna <jug@sad.it>
4252 * src/text.C (NextBreakPoint): added support for needFullRow()
4254 * src/insets/lyxinset.h: added needFullRow()
4256 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4259 * src/insets/insettext.C: lots of changes for update!
4261 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4263 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4265 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4267 * src/insets/insetinclude.C (InsetInclude): fixed
4268 initialization of include_label.
4269 (unique_id): now returns a string.
4271 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4273 * src/LaTeXFeatures.h: new member IncludedFiles, for
4274 a map of key, included file name.
4276 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4277 with the included files for inclusion in SGML preamble,
4278 i. e., linuxdoc and docbook.
4281 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4282 nice (is the generated linuxdoc code to be exported?), that
4283 allows to remove column, and only_body that will be true for
4284 slave documents. Insets are allowed inside SGML font type.
4285 New handling of the SGML preamble for included files.
4286 (makeDocBookFile): the same for docbook.
4288 * src/insets/insetinclude.h:
4289 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4291 (DocBook): new export methods.
4293 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4294 and makeDocBookFile.
4296 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4297 formats to export with command line argument -x.
4299 2000-06-29 Juergen Vigna <jug@sad.it>
4301 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4302 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4304 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4305 region could already been cleared by an inset!
4307 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4309 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4312 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4314 (cursorToggle): remove special handling of lyx focus.
4316 2000-06-28 Juergen Vigna <jug@sad.it>
4318 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4321 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4323 * src/insets/insetindex.C (Edit): add a callback when popup is
4326 * src/insets/insettext.C (LocalDispatch):
4327 * src/insets/insetmarginal.h:
4328 * src/insets/insetlist.h:
4329 * src/insets/insetfoot.h:
4330 * src/insets/insetfloat.h:
4331 * src/insets/insetert.h: add a missing std:: qualifier.
4333 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4335 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4338 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4340 * src/insets/insettext.C (Read): remove tmptok unused variable
4341 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4342 (InsertInset): change for new InsetInset code
4344 * src/insets/insettext.h: add TEXT inline method
4346 * src/insets/insettext.C: remove TEXT macro
4348 * src/insets/insetmarginal.C (Write): new method
4349 (Latex): change output slightly
4351 * src/insets/insetfoot.C (Write): new method
4352 (Latex): change output slightly (don't use endl when no need)
4354 * src/insets/insetert.C (Write): new method
4356 * src/insets/insetcollapsable.h: make button_length, button_top_y
4357 and button_bottm_y protected.
4359 * src/insets/insetcollapsable.C (Write): simplify code by using
4360 tostr. Also do not output the float name, the children class
4361 should to that to get control over own arguments
4363 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4364 src/insets/insetminipage.[Ch]:
4367 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4369 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4371 * src/Makefile.am (lyx_SOURCES): add the new files
4373 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4374 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4375 * src/commandtags.h: ditto
4377 * src/LaTeXFeatures.h: add a std::set of used floattypes
4379 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4381 * src/FloatList.[Ch] src/Floating.h: new files
4383 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4385 * src/lyx_cb.C (TableApplyCB): ditto
4387 * src/text2.C: ditto
4388 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4389 (parseSingleLyXformat2Token): ditto + add code for
4390 backwards compability for old float styles + add code for new insets
4392 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4394 (InsertInset(size_type, Inset *, LyXFont)): new method
4395 (InsetChar(size_type, char)): changed to use the other InsetChar
4396 with a LyXFont(ALL_INHERIT).
4397 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4398 insert the META_INSET.
4400 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4402 * sigc++/thread.h (Threads): from here
4404 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4405 definition out of line
4406 * sigc++/scope.h: from here
4408 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4410 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4411 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4413 * Makefile.am (bindist): new target.
4415 * INSTALL: add instructions for doing a binary distribution.
4417 * development/tools/README.bin.example: update a bit.
4419 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4422 * lib/lyxrc.example: new lyxrc tag \set_color.
4424 * src/lyxfunc.C (Dispatch):
4425 * src/commandtags.h:
4426 * src/LyXAction.C: new lyxfunc "set-color".
4428 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4429 and an x11name given as strings.
4431 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4432 cache when a color is changed.
4434 2000-06-26 Juergen Vigna <jug@sad.it>
4436 * src/lyxrow.C (width): added this functions and variable.
4438 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4441 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4443 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4445 * images/undo_bw.xpm: new icon.
4446 * images/redo_bw.xpm: ditto.
4448 * configure.in (INSTALL_SCRIPT): change value to
4449 ${INSTALL} to avoid failures of install-script target.
4450 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
4452 * src/BufferView.h: add a magic "friend" declaration to please
4455 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4457 * forms/cite.fd: modified to allow resizing without messing
4460 * src/insetcite.C: Uses code from cite.fd almost without
4462 User can now resize dialog in the x-direction.
4463 Resizing the dialog in the y-direction is prevented, as the
4464 code does this intelligently already.
4466 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4468 * INSTALL: remove obsolete entry in "problems" section.
4470 * lib/examples/sl_*.lyx: update of the slovenian examples.
4472 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4474 2000-06-23 Juergen Vigna <jug@sad.it>
4476 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4478 * src/buffer.C (resize): delete the LyXText of textinsets.
4480 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4482 * src/insets/lyxinset.h: added another parameter 'cleared' to
4483 the draw() function.
4485 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4486 unlocking inset in inset.
4488 2000-06-22 Juergen Vigna <jug@sad.it>
4490 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4491 of insets and moved first to LyXText.
4493 * src/mathed/formulamacro.[Ch]:
4494 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4496 2000-06-21 Juergen Vigna <jug@sad.it>
4498 * src/text.C (GetVisibleRow): look if I should clear the area or not
4499 using Inset::doClearArea() function.
4501 * src/insets/lyxinset.h: added doClearArea() function and
4502 modified draw(Painter &, ...) to draw(BufferView *, ...)
4504 * src/text2.C (UpdateInset): return bool insted of int
4506 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4508 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4509 combox in the character popup
4511 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4512 BufferParams const & params
4514 2000-06-20 Juergen Vigna <jug@sad.it>
4516 * src/insets/insettext.C (SetParagraphData): set insetowner on
4519 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4521 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4522 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4524 (form_main_): remove
4526 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4527 (create_form_form_main): remove FD_form_main stuff, connect to
4528 autosave_timeout signal
4530 * src/LyXView.[Ch] (getMainForm): remove
4531 (UpdateTimerCB): remove
4532 * src/BufferView_pimpl.h: inherit from SigC::Object
4534 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4535 signal instead of callback
4537 * src/BufferView.[Ch] (cursorToggleCB): remove
4539 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4541 * src/BufferView_pimpl.C: changes because of the one below
4543 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4544 instead of storing a pointer to a LyXText.
4546 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4548 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4550 * src/lyxparagraph.h
4552 * src/paragraph.C: Changed fontlist to a sorted vector.
4554 2000-06-19 Juergen Vigna <jug@sad.it>
4556 * src/BufferView.h: added screen() function.
4558 * src/insets/insettext.C (LocalDispatch): some selection code
4561 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4563 * src/insets/insettext.C (SetParagraphData):
4565 (InsetText): fixes for multiple paragraphs.
4567 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4569 * development/lyx.spec.in: Call configure with ``--without-warnings''
4570 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4571 This should be fine, however, since we generally don't want to be
4572 verbose when making an RPM.
4574 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4576 * lib/scripts/fig2pstex.py: New file
4578 2000-06-16 Juergen Vigna <jug@sad.it>
4580 * src/insets/insettabular.C (UpdateLocal):
4581 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4582 (LocalDispatch): Changed all functions to use LyXText.
4584 2000-06-15 Juergen Vigna <jug@sad.it>
4586 * src/text.C (SetHeightOfRow): call inset::update before requesting
4589 * src/insets/insettext.C (update):
4590 * src/insets/insettabular.C (update): added implementation
4592 * src/insets/lyxinset.h: added update function
4594 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4596 * src/text.C (SelectNextWord): protect against null pointers with
4597 old-style string streams. (fix from Paul Theo Gonciari
4600 * src/cite.[Ch]: remove erroneous files.
4602 * lib/configure.m4: update the list of created directories.
4604 * src/lyxrow.C: include <config.h>
4605 * src/lyxcursor.C: ditto.
4607 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4609 * lib/examples/decimal.lyx: new example file from Mike.
4611 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4612 to find template definitions (from Dekel)
4614 * src/frontends/.cvsignore: add a few things.
4616 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4618 * src/Timeout.C (TimeOut): remove default argument.
4620 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4623 * src/insets/ExternalTemplate.C: add a "using" directive.
4625 * src/lyx_main.h: remove the act_ struct, which seems unused
4628 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4630 * LyX Developers Meeting: All files changed, due to random C++ (by
4631 coincidence) code generator script.
4633 - external inset (cool!)
4634 - initial online editing of preferences
4635 - insettabular breaks insettext(s contents)
4637 - some DocBook fixes
4638 - example files update
4639 - other cool stuff, create a diff and look for yourself.
4641 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4643 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4644 -1 this is a non-line-breaking textinset.
4646 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
4647 if there is no width set.
4649 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4651 * Lots of files: Merged the dialogbase branch.
4653 2000-06-09 Allan Rae <rae@lyx.org>
4655 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
4656 and the Dispatch methods that used it.
4658 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
4659 access to functions formerly kept in Dispatch.
4661 2000-05-19 Allan Rae <rae@lyx.org>
4663 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
4664 made to_page and count_copies integers again. from_page remains a
4665 string however because I want to allow entry of a print range like
4666 "1,4,22-25" using this field.
4668 * src/LyXAction.C: added action info and commands for buffer-print-xtl
4669 and printer-params-get. These aren't useful from the minibuffer but
4670 could be used by a script/LyXServer app provided it passes a suitable
4671 auto_mem_buffer. I guess I should take a look at how the LyXServer
4672 works and make it support xtl buffers.
4674 * sigc++/: updated to libsigc++-1.0.1
4676 * src/xtl/: updated to xtl-1.3.pl.11
4678 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
4679 those changes done to the files in src/ are actually recreated when
4680 they get regenerated. Please don't ever accept a patch that changes a
4681 dialog unless that patch includes the changes to the corresponding *.fd
4684 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
4685 stringOnlyContains, renamed it and generalised it.
4687 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
4688 branch. Removed the remaining old form_print code.
4690 2000-04-26 Allan Rae <rae@lyx.org>
4692 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
4693 trap I was trying to fix with the ID: fields in src/xtl/ :-)
4695 2000-04-25 Allan Rae <rae@lyx.org>
4697 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
4698 against a base of xtl-1.3.pl.4
4700 * development/tools/lxtl.sh: fixed a couple of silly typos and now
4701 filter the Id: entries so they still show the xtl version number
4704 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
4705 into the src/xtl code. Patch still pending with José (XTL)
4707 2000-04-24 Allan Rae <rae@lyx.org>
4709 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
4710 both more generic and much safer. Use the new template functions.
4711 * src/buffer.[Ch] (Dispatch): ditto.
4713 * src/frontends/xforms/FormPrint.C (update): Use new template functions
4714 and mem buffer more intelligently. Also a little general cleanup.
4717 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
4718 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
4719 * src/xtl/Makefile.am: ditto.
4720 * src/xtl/.cvsignore: ditto.
4721 * src/Makefile.am: ditto.
4723 * src/PrinterParams.h: Removed the macros member functions. Added a
4724 testInvariant member function. A bit of tidying up and commenting.
4725 Included Angus's idea for fixing operation with egcs-1.1.2.
4727 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
4728 cool expansion of XTL's mem_buffer to support automatic memory
4729 management within the buffer itself. Removed the various macros and
4730 replaced them with template functions that use either auto_mem_buffer
4731 or mem_buffer depending on a #define. The mem_buffer support will
4732 disappear as soon as the auto_mem_buffer is confirmed to be good on
4733 other platforms/compilers. That is, it's there so you've got something
4736 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
4737 effectively forked XTL. However I expect José will include my code
4738 into the next major release. Also fixed a memory leak.
4739 * src/xtl/text.h: ditto.
4740 * src/xtl/xdr.h: ditto.
4741 * src/xtl/giop.h: ditto.
4743 2000-04-16 Allan Rae <rae@lyx.org>
4745 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
4746 by autogen.sh and removed by maintainer-clean anyway.
4747 * .cvsignore, sigc++/.cvsignore: Support the above.
4749 * sigc++/.cvsignore: Forgot that retbind.h was generated.
4751 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
4753 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
4754 macros, renamed static callback-target member functions to suit new
4755 scheme and made them public.
4756 * src/frontends/xforms/forms/form_print.fd: ditto.
4757 * src/frontends/xforms/forms/form_copyright.fd: ditto.
4759 * src/support/lxtl.h: small cleanup to use typedef instead of #define
4762 * src/xtl/: New directory containing a minimal distribution of XTL.
4763 This is XTL-1.3.pl.4.
4765 * development/tools/lxtl.sh: A script to generate the above mini-dist.
4767 2000-04-15 Allan Rae <rae@lyx.org>
4769 * development/tools/makeLyXsigc.sh: Remove the library version numbers
4771 * sigc++/: Updated to libsigc++-1.0.0
4773 2000-04-14 Allan Rae <rae@lyx.org>
4775 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
4776 use the generic ones in future. I'll modify my conversion script.
4778 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
4780 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
4781 (CloseAllBufferRelatedDialogs): Renamed.
4782 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
4784 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
4785 of the generic ones. These are the same ones my conversion script
4788 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
4789 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
4790 * src/buffer.C (Dispatch): ditto
4792 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
4793 functions for updating and hiding buffer dependent dialogs.
4794 * src/BufferView.C (buffer): ditto
4795 * src/buffer.C (setReadonly): ditto
4796 * src/lyxfunc.C (CloseBuffer): ditto
4798 * src/buffer.h: Take setReadonly() out of line so I don't have to include
4799 Dialogs.h, and hence all the SigC stuff, into every file that includes
4800 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
4802 * src/BufferView2.C: reduce the number of headers included by buffer.h
4804 2000-04-11 Allan Rae <rae@lyx.org>
4806 * src/frontends/xforms/xform_macros.h: A small collection of macros
4807 for building C callbacks.
4809 * src/frontends/xforms/Makefile.am: Added above file.
4811 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
4812 scheme again. This time it should work for JMarc. If this is
4813 successful I'll revise my conversion script to automate some of this.
4814 The static member functions in the class also have to be public for
4815 this scheme will work. If the scheme works (it's almost identical to
4816 the way BufferView::cursorToggleCB is handled so it should work) then
4817 FormCopyright and FormPrint will be ready for inclusion into the main
4818 trunk immediately after 1.1.5 is released -- provided we're prepared
4819 for complaints about lame compilers not handling XTL.
4821 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
4823 2000-04-07 Allan Rae <rae@lyx.org>
4825 * config/lyxinclude.m4: A bit more tidying up (Angus)
4827 * src/LString.h: JMarc's <string> header fix
4829 * src/PrinterParams.h: Used string for most data to remove some
4830 ugly code in the Print dialog and avoid even uglier code when
4831 appending the ints to a string for output.
4833 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
4834 and moved "default:" back to the end of switch statement. Cleaned
4835 up the printing so it uses the right function calls and so the
4836 "print to file" option actually puts the file in the right directory.
4838 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
4840 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
4841 and Ok+Apply button control into a separate method: input (Angus).
4842 (input) Cleaned it up and improved it to be very thorough now.
4843 (All CB) static_cast used instead of C style cast (Angus). This will
4844 probably change again once we've worked out how to keep gcc-2.8.1 happy
4845 with real C callbacks.
4846 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
4847 ignore some of the bool settings and has random numbers instead. Needs
4848 some more investigation. Added other input length checks and checking
4849 of file and printer names.
4851 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
4852 would link (Angus). Seems the old code doesn't compile with the pragma
4853 statement either. Separated callback entries from internal methods.
4855 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
4857 2000-03-17 Allan Rae <rae@lyx.org>
4859 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
4860 need it? Maybe it could go in Dialogs instead? I could make it a
4861 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
4862 values to get the bool return value.
4863 (Dispatch): New overloaded method for xtl support.
4865 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
4866 extern "C" callback instead of static member functions. Hopefully,
4867 JMarc will be able to compile this. I haven't changed
4868 forms/form_copyright.fd yet. Breaking one of my own rules already.
4870 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
4871 because they aren't useful from the minibuffer. Maybe a LyXServer
4872 might want a help message though?
4874 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
4876 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
4877 xtl which needs both rtti and exceptions.
4879 * src/support/Makefile.am:
4880 * src/support/lxtl.h: New file. Some helper macros for using XTL.
4882 * src/frontends/xforms/input_validators.[ch]: input filters and
4883 validators. These conrol what keys are valid in input boxes.
4884 Use them and write some more. Much better idea than waiting till
4885 after the user has pressed Ok to say that the input fields don't make
4888 * src/frontends/xforms/Makefile.am:
4889 * src/frontends/xforms/forms/form_print.fd:
4890 * src/frontends/xforms/forms/makefile:
4891 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
4892 new scheme. Still have to make sure I haven't missed anything from
4893 the current implementation.
4895 * src/Makefile.am, src/PrinterParams.h: New data store.
4897 * other files: Added a couple of copyright notices.
4899 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4901 * src/insets/insetbib.h: move Holder struct in public space.
4903 * src/frontends/include/DialogBase.h: use SigC:: only when
4904 SIGC_CXX_NAMESPACES is defined.
4905 * src/frontends/include/Dialogs.h: ditto.
4907 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
4909 * src/frontends/xforms/FormCopyright.[Ch]: do not
4910 mention SigC:: explicitely.
4912 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4914 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
4915 deals with testing KDE in main configure.in
4916 * configure.in: ditto.
4918 2000-02-22 Allan Rae <rae@lyx.org>
4920 * Lots of files: Merged from HEAD
4922 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
4923 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
4925 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
4927 * sigc++/: new minidist.
4929 2000-02-14 Allan Rae <rae@lyx.org>
4931 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
4933 2000-02-08 Juergen Vigna <jug@sad.it>
4935 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
4936 file for the buildin GUI builder of KDevelop of the copyright-dialog.
4938 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
4939 for this port and so it is much easier for other people to port
4940 dialogs in a common development environment.
4942 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
4943 the QT/KDE implementation.
4945 * src/frontends/kde/Dialogs.C:
4946 * src/frontends/kde/FormCopyright.C:
4947 * src/frontends/kde/FormCopyright.h:
4948 * src/frontends/kde/Makefile.am:
4949 * src/frontends/kde/formcopyrightdialog.C:
4950 * src/frontends/kde/formcopyrightdialog.h:
4951 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
4952 for the kde support of the Copyright-Dialog.
4954 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
4955 subdir-substitution instead of hardcoded 'xforms' as we now have also
4958 * src/frontends/include/DialogBase.h (Object): just commented the
4959 label after #endif (nasty warning and I don't like warnings ;)
4961 * src/main.C (main): added KApplication initialization if using
4964 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
4965 For now only the KDE event-loop is added if frontend==kde.
4967 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
4969 * configure.in: added support for the --with-frontend[=value] option
4971 * autogen.sh: added kde.m4 file to list of config-files
4973 * acconfig.h: added define for KDEGUI-support
4975 * config/kde.m4: added configuration functions for KDE-port
4977 * config/lyxinclude.m4: added --with-frontend[=value] option with
4978 support for xforms and KDE.
4980 2000-02-08 Allan Rae <rae@lyx.org>
4982 * all Makefile.am: Fixed up so the make targets dist, distclean,
4983 install and uninstall all work even if builddir != srcdir. Still
4984 have a new sigc++ minidist update to come.
4986 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
4988 2000-02-01 Allan Rae <rae@lyx.org>
4990 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
4991 Many mods to get builddir != srcdir working.
4993 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
4994 for building on NT and so we can do the builddir != srcdir stuff.
4996 2000-01-30 Allan Rae <rae@lyx.org>
4998 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
4999 This will stay in "rae" branch. We probably don't really need it in
5000 the main trunk as anyone who wants to help programming it should get
5001 a full library installed also. So they can check both included and
5002 system supplied library compilation.
5004 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5005 Added a 'mini' distribution of libsigc++. If you feel the urge to
5006 change something in these directories - Resist it. If you can't
5007 resist the urge then you should modify the following script and rebuild
5008 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5009 all happen. Still uses a hacked version of libsigc++'s configure.in.
5010 I'm quite happy with the results. I'm not sure the extra work to turn
5011 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5012 worth the trouble and would probably lead to extra maintenance
5014 I haven't tested the following important make targets: install, dist.
5015 Not ready for prime time but very close. Maybe 1.1.5.
5017 * development/tools/makeLyXsigc.sh: A shell script to automatically
5018 generate our mini-dist of libsigc++. It can only be used with a CVS
5019 checkout of libsigc++ not a tarball distribution. It's well commented.
5020 This will end up as part of the libsigc++ distribution so other apps
5021 can easily have an included mini-dist. If someone makes mods to the
5022 sigc++ subpackage without modifying this script to generate those
5023 changes I'll be very upset!
5025 * src/frontends/: Started the gui/system indep structure.
5027 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5028 to access the gui-indep dialogs are in this class. Much improved
5029 design compared to previous revision. Lars, please refrain from
5030 moving this header into src/ like you did with Popups.h last time.
5032 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5034 * src/frontends/xforms/: Started the gui-indep system with a single
5035 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5038 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5039 Here you'll find a very useful makefile and automated fdfix.sh that
5040 makes updating dailogs a no-brainer -- provided you follow the rules
5041 set out in the README. I'm thinking about adding another script to
5042 automatically generate skeleton code for a new dialog given just the
5045 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5046 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5047 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5049 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5051 * src/support/LSubstring.C (operator): simplify
5053 * src/lyxtext.h: removed bparams, use buffer_->params instead
5055 * src/lyxrow.h: make Row a real class, move all variables to
5056 private and use accessors.
5058 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5060 (isRightToLeftPar): ditto
5061 (ChangeLanguage): ditto
5062 (isMultiLingual): ditto
5065 (SimpleTeXOnePar): ditto
5066 (TeXEnvironment): ditto
5067 (GetEndLabel): ditto
5069 (SetOnlyLayout): ditto
5070 (BreakParagraph): ditto
5071 (BreakParagraphConservative): ditto
5072 (GetFontSettings): ditto
5074 (CopyIntoMinibuffer): ditto
5075 (CutIntoMinibuffer): ditto
5076 (PasteParagraph): ditto
5077 (SetPExtraType): ditto
5078 (UnsetPExtraType): ditto
5079 (DocBookContTableRows): ditto
5080 (SimpleDocBookOneTablePar): ditto
5082 (TeXFootnote): ditto
5083 (SimpleTeXOneTablePar): ditto
5084 (TeXContTableRows): ditto
5085 (SimpleTeXSpecialChars): ditto
5088 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5089 to private and use accessors.
5091 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5092 this, we did not use it anymore and has not been for ages. Just a
5093 waste of cpu cycles.
5095 * src/language.h: make Language a real class, move all variables
5096 to private and use accessors.
5098 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5099 (create_view): remove
5100 (update): some changes for new timer
5101 (cursorToggle): use new timer
5102 (beforeChange): change for new timer
5104 * src/BufferView.h (cursorToggleCB): removed last paramter because
5107 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5108 (cursorToggleCB): change because of new timer code
5110 * lib/CREDITS: updated own mailaddress
5112 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5114 * src/support/filetools.C (PutEnv): fix the code in case neither
5115 putenv() nor setenv() have been found.
5117 * INSTALL: mention the install-strip Makefile target.
5119 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5120 read-only documents.
5122 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5124 * lib/reLyX/configure.in (VERSION): avoid using a previously
5125 generated reLyX wrapper to find out $prefix.
5127 * lib/examples/eu_adibide_lyx-atua.lyx:
5128 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5129 translation of the Tutorial (Dooteo)
5131 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5133 * forms/cite.fd: new citation dialog
5135 * src/insetcite.[Ch]: the new citation dialog is moved into
5138 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5141 * src/insets/insetcommand.h: data members made private.
5143 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5145 * LyX 1.1.5 released
5147 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5149 * src/version.h (LYX_RELEASE): to 1.1.5
5151 * src/spellchecker.C (RunSpellChecker): return false if the
5152 spellchecker dies upon creation.
5154 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5156 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5157 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5161 * lib/CREDITS: update entry for Martin Vermeer.
5163 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5165 * src/text.C (draw): Draw foreign language bars at the bottom of
5166 the row instead of at the baseline.
5168 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5170 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5172 * lib/bind/de_menus.bind: updated
5174 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5176 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5178 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5180 * src/menus.C (Limit_string_length): New function
5181 (ShowTocMenu): Limit the number of items/length of items in the
5184 * src/paragraph.C (String): Correct result for a paragraph inside
5187 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5189 * src/bufferlist.C (close): test of buf->getuser() == NULL
5191 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5193 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5194 Do not call to SetCursor when the paragraph is a closed footnote!
5196 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5198 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5201 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5203 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5206 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5207 reference popup, that activates the reference-back action
5209 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5211 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5212 the menus. Also fixed a bug.
5214 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5215 the math panels when switching buffers (unless new buffer is readonly).
5217 * src/BufferView.C (NoSavedPositions)
5218 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5220 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5222 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5223 less of dvi dirty or not.
5225 * src/trans_mgr.[Ch] (insert): change first parameter to string
5228 * src/chset.[Ch] (encodeString): add const to first parameter
5230 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5232 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5236 * src/LaTeX.C (deplog): better searching for dependency files in
5237 the latex log. Uses now regexps.
5239 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5240 instead of the box hack or \hfill.
5242 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5244 * src/lyxfunc.C (doImportHelper): do not create the file before
5245 doing the actual import.
5246 (doImportASCIIasLines): create a new file before doing the insert.
5247 (doImportASCIIasParagraphs): ditto.
5249 * lib/lyxrc.example: remove mention of non-existing commands
5251 * lyx.man: remove mention of color-related switches.
5253 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5255 * src/lyx_gui.C: remove all the color-related ressources, which
5256 are not used anymore.
5258 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5261 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5263 * src/lyxrc.C (read): Add a missing break in the switch
5265 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5267 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5269 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5272 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5274 * src/text.C (draw): draw bars under foreign language words.
5276 * src/LColor.[Ch]: add LColor::language
5278 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5280 * src/lyxcursor.h (boundary): New member variable
5282 * src/text.C (IsBoundary): New methods
5284 * src/text.C: Use the above for currect cursor movement when there
5285 is both RTL & LTR text.
5287 * src/text2.C: ditto
5289 * src/bufferview_funcs.C (ToggleAndShow): ditto
5291 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5293 * src/text.C (DeleteLineForward): set selection to true to avoid
5294 that DeleteEmptyParagraphMechanism does some magic. This is how it
5295 is done in all other functions, and seems reasonable.
5296 (DeleteWordForward): do not jump over non-word stuff, since
5297 CursorRightOneWord() already does it.
5299 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5300 DeleteWordBackward, since they seem safe to me (since selection is
5301 set to "true") DeleteEmptyParagraphMechanism does nothing.
5303 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5305 * src/lyx_main.C (easyParse): simplify the code by factoring the
5306 part that removes parameters from the command line.
5307 (LyX): check wether wrong command line options have been given.
5309 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5311 * src/lyx_main.C : add support for specifying user LyX
5312 directory via command line option -userdir.
5314 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5316 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5317 the number of items per popup.
5318 (Add_to_refs_menu): Ditto.
5320 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5322 * src/lyxparagraph.h: renamed ClearParagraph() to
5323 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5324 textclass as parameter, and do nothing if free_spacing is
5325 true. This fixes part of the line-delete-forward problems.
5327 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5328 (pasteSelection): ditto.
5329 (SwitchLayoutsBetweenClasses): more translatable strings.
5331 * src/text2.C (CutSelection): use StripLeadingSpaces.
5332 (PasteSelection): ditto.
5333 (DeleteEmptyParagraphMechanism): ditto.
5335 2000-05-26 Juergen Vigna <jug@sad.it>
5337 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5338 is not needed in tabular insets.
5340 * src/insets/insettabular.C (TabularFeatures): added missing features.
5342 * src/tabular.C (DeleteColumn):
5344 (AppendRow): implemented this functions
5345 (cellsturct::operator=): clone the inset too;
5347 2000-05-23 Juergen Vigna <jug@sad.it>
5349 * src/insets/insettabular.C (LocalDispatch): better selection support
5350 when having multicolumn-cells.
5352 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5354 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5356 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5358 * src/ColorHandler.C (getGCForeground): put more test into _()
5360 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5363 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5366 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5368 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5369 there are no labels, or when buffer is readonly.
5371 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5372 there are no labels, buffer is SGML, or when buffer is readonly.
5374 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5376 * src/LColor.C (LColor): change a couple of grey40 to grey60
5377 (LColor): rewore initalization to make compiles go some magnitude
5379 (getGUIName): don't use gettext until we need the string.
5381 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5383 * src/Bullet.[Ch]: Fixed a small bug.
5385 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5387 * src/paragraph.C (String): Several fixes/improvements
5389 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5391 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5393 * src/paragraph.C (String): give more correct output.
5395 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5397 * src/lyxfont.C (stateText) Do not output the language if it is
5398 eqaul to the language of the document.
5400 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5401 between two paragraphs with the same language.
5403 * src/paragraph.C (getParLanguage) Return a correct answer for an
5404 empty dummy paragraph.
5406 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5409 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5412 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5413 the menus/popup, if requested fonts are unavailable.
5415 2000-05-22 Juergen Vigna <jug@sad.it>
5417 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5418 movement support (Up/Down/Tab/Shift-Tab).
5419 (LocalDispatch): added also preliminari cursor-selection.
5421 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5423 * src/paragraph.C (PasteParagraph): Hopefully now right!
5425 2000-05-22 Garst R. Reese <reese@isn.net>
5427 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5428 of list, change all references to Environment to Command
5429 * tex/hollywood.cls : rewrite environments as commands, add
5430 \uppercase to interiorshot and exteriorshot to force uppecase.
5431 * tex/broadway.cls : rewrite environments as commands. Tweak
5434 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5436 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5437 size of items: use a constant intead of the hardcoded 40, and more
5438 importantly do not remove the %m and %x tags added at the end.
5439 (Add_to_refs_menu): use vector::size_type instead of
5440 unsigned int as basic types for the variables. _Please_ do not
5441 assume that size_t is equal to unsigned int. On an alpha, this is
5442 unsigned long, which is _not_ the same.
5444 * src/language.C (initL): remove language "hungarian", since it
5445 seems that "magyar" is better.
5447 2000-05-22 Juergen Vigna <jug@sad.it>
5449 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
5451 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5454 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5455 next was deleted but not set to 0.
5457 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5459 * src/language.C (initL): change the initialization of languages
5460 so that compiles goes _fast_.
5462 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5465 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5467 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5471 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5473 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5475 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5479 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5482 * src/insets/insetlo*.[Ch]: Made editable
5484 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5486 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5487 the current selection.
5489 * src/BufferView_pimpl.C (stuffClipboard): new method
5491 * src/BufferView.C (stuffClipboard): new method
5493 * src/paragraph.C (String): new method
5495 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5496 LColor::ignore when lyxname is not found.
5498 * src/BufferView.C (pasteSelection): new method
5500 * src/BufferView_pimpl.C (pasteSelection): new method
5502 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5504 * src/WorkArea.C (request_clipboard_cb): new static function
5505 (getClipboard): new method
5506 (putClipboard): new method
5508 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5510 * LyX 1.1.5pre2 released
5512 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5514 * src/vspace.C (operator=): removed
5515 (operator=): removed
5517 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5519 * src/layout.C (NumberOfClass): manually set the type in make_pair
5520 (NumberOfLayout): ditto
5522 * src/language.C: use the Language constructor for ignore_lang
5524 * src/language.h: add constructors to struct Language
5526 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5528 * src/text2.C (SetCursorIntern): comment out #warning
5530 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5532 * src/mathed/math_iter.h: initialize sx and sw to 0
5534 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5536 * forms/lyx.fd: Redesign of form_ref
5538 * src/LaTeXFeatures.[Ch]
5542 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5545 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5546 and Buffer::inset_iterator.
5548 * src/menus.C: Added new menus: TOC and Refs.
5550 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5552 * src/buffer.C (getTocList): New method.
5554 * src/BufferView2.C (ChangeRefs): New method.
5556 * src/buffer.C (getLabelList): New method. It replaces the old
5557 getReferenceList. The return type is vector<string> instead of
5560 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5561 the old getLabel() and GetNumberOfLabels() methods.
5562 * src/insets/insetlabel.C (getLabelList): ditto
5563 * src/mathed/formula.C (getLabelList): ditto
5565 * src/paragraph.C (String): New method.
5567 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5568 Uses the new getTocList() method.
5569 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5570 which automatically updates the contents of the browser.
5571 (RefUpdateCB): Use the new getLabelList method.
5573 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5575 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5577 * src/spellchecker.C: Added using std::reverse;
5579 2000-05-19 Juergen Vigna <jug@sad.it>
5581 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5583 * src/insets/insettext.C (computeTextRows): small fix for display of
5584 1 character after a newline.
5586 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5589 2000-05-18 Juergen Vigna <jug@sad.it>
5591 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5592 when changing width of column.
5594 * src/tabular.C (set_row_column_number_info): setting of
5595 autobreak rows if necessary.
5597 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5599 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5601 * src/vc-backend.*: renamed stat() to status() and vcstat to
5602 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5603 compilation broke. The new name seems more relevant, anyway.
5605 2000-05-17 Juergen Vigna <jug@sad.it>
5607 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5608 which was wrong if the removing caused removing of rows!
5610 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5611 (pushToken): new function.
5613 * src/text2.C (CutSelection): fix problem discovered with purify
5615 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5617 * src/debug.C (showTags): enlarge the first column, now that we
5618 have 6-digits debug codes.
5620 * lib/layouts/hollywood.layout:
5621 * lib/tex/hollywood.cls:
5622 * lib/tex/brodway.cls:
5623 * lib/layouts/brodway.layout: more commands and fewer
5624 environments. Preambles moved in the .cls files. Broadway now has
5625 more options on scene numbering and less whitespace (from Garst)
5627 * src/insets/insetbib.C (getKeys): make sure that we are in the
5628 document directory, in case the bib file is there.
5630 * src/insets/insetbib.C (Latex): revert bogus change.
5632 2000-05-16 Juergen Vigna <jug@sad.it>
5634 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5635 the TabularLayout on cursor move.
5637 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5639 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5642 (draw): fixed cursor position and drawing so that the cursor is
5643 visible when before the tabular-inset.
5645 * src/insets/insettext.C (init): drawLockedFrame was not initialized
5646 when creating from old insettext.
5648 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
5650 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5652 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
5653 * lib/tex/brodway.cls: ditto
5655 * lib/layouts/brodway.layout: change alignment of parenthical
5658 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5660 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
5661 versions 0.88 and 0.89 are supported.
5663 2000-05-15 Juergen Vigna <jug@sad.it>
5665 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
5668 * src/insets/insettext.C (computeTextRows): redone completely this
5669 function in a much cleaner way, because of problems when having a
5671 (draw): added a frame border when the inset is locked.
5672 (SetDrawLockedFrame): this sets if we draw the border or not.
5673 (SetFrameColor): this sets the frame color (default=insetframe).
5675 * src/insets/lyxinset.h: added x() and y() functions which return
5676 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
5677 function which is needed to see if we have a locking inset of some
5678 type in this inset (needed for now in insettabular).
5680 * src/vspace.C (inPixels): the same function also without a BufferView
5681 parameter as so it is easier to use it in some ocasions.
5683 * src/lyxfunc.C: changed all places where insertInset was used so
5684 that now if it couldn't be inserted it is deleted!
5686 * src/TabularLayout.C:
5687 * src/TableLayout.C: added support for new tabular-inset!
5689 * src/BufferView2.C (insertInset): this now returns a bool if the
5690 inset was really inserted!!!
5692 * src/tabular.C (GetLastCellInRow):
5693 (GetFirstCellInRow): new helper functions.
5694 (Latex): implemented for new tabular class.
5698 (TeXTopHLine): new Latex() helper functions.
5700 2000-05-12 Juergen Vigna <jug@sad.it>
5702 * src/mathed/formulamacro.C (Read):
5703 * src/mathed/formula.C (Read): read also the \end_inset here!
5705 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5707 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
5708 crush when saving formulae with unbalanced parenthesis.
5710 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
5712 * src/layout.C: Add new keyword "endlabelstring" to layout file
5714 * src/text.C (GetVisibleRow): Draw endlabel string.
5716 * lib/layouts/broadway.layout
5717 * lib/layouts/hollywood.layout: Added endlabel for the
5718 Parenthetical layout.
5720 * lib/layouts/heb-article.layout: Do not use slanted font shape
5721 for Theorem like environments.
5723 * src/buffer.C (makeLaTeXFile): Always add "american" to
5724 the UsedLanguages list if document language is RTL.
5726 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5728 * add addendum to README.OS2 and small patch (from SMiyata)
5730 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5732 * many files: correct the calls to ChangeExtension().
5734 * src/support/filetools.C (ChangeExtension): remove the no_path
5735 argument, which does not belong there. Use OnlyFileName() instead.
5737 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
5738 files when LaTeXing a non-nice latex file.
5740 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
5741 a chain of "if". Return false when deadkeys are not handled.
5743 * src/lyx_main.C (LyX): adapted the code for default bindings.
5745 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
5746 bindings for basic functionality (except deadkeys).
5747 (deadKeyBindings): new method. Performs the bindings of deadkeys.
5749 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
5750 several methods: handle override_x_deadkeys.
5752 * src/lyxrc.h: remove the "bindings" map, which did not make much
5753 sense anyway. New variable override_x_deadkeys, defaulting to "true".
5755 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5757 * src/lyxfont.C (stateText): use a saner method to determine
5758 whether the font is "default". Seems to fix the crash with DEC
5761 * src/Bullet.[Ch] (Bullet): remove const on parameters.
5763 2000-05-08 Juergen Vigna <jug@sad.it>
5765 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
5766 TabularLayoutMenu with mouse-button-3
5767 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
5769 * src/TabularLayout.C: added this file for having a Layout for
5772 2000-05-05 Juergen Vigna <jug@sad.it>
5774 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
5775 recalculating inset-widths.
5776 (TabularFeatures): activated this function so that I can change
5777 tabular-features via menu.
5779 * src/menus.C (ShowEditMenu): inserted support for insettabular so
5780 that I can test some functions with the Table menu.
5782 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5784 * src/lyxfont.C (stateText): guard against stupid c++libs.
5786 * src/tabular.C: add using std::vector
5787 some whitespace changes, + removed som autogenerated code.
5789 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
5791 2000-05-05 Juergen Vigna <jug@sad.it>
5793 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
5794 row, columns and cellstructures.
5796 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5798 * lib/lyxrc.example: remove obsolete entries.
5800 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
5801 reading of protected_separator for free_spacing.
5803 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5805 * src/text.C (draw): do not display an exclamation mark in the
5806 margin for margin notes. This is confusing, ugly and
5809 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
5810 AMS math' is checked.
5812 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
5813 name to see whether including the amsmath package is needed.
5815 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
5817 * src/paragraph.C (validate): Compute UsedLanguages correctly
5818 (don't insert the american language if it doesn't appear in the
5821 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
5822 The argument of \thanks{} command is considered moving argument
5824 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
5827 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
5829 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
5830 for appendix/minipage/depth. The lines can be now both in the footnote
5831 frame, and outside the frame.
5833 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
5836 2000-05-05 Juergen Vigna <jug@sad.it>
5838 * src/table.[Ch]: removed the inset and buffer stuff as this is now
5839 neede only in tabular.[Ch].
5841 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5843 * src/insets/insetspecialchar.C (Read): allow command == '~' for
5845 (Write): write '~' for PROTECTED_SEPARATOR
5847 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5849 * src/lyxparagraph.h: add a friend struct matchIT after the struct
5852 * src/mathed/formula.C (drawStr): rename size to siz.
5854 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
5855 possibly fix a bug by not changing the pflags = flags to piflags =
5858 2000-05-05 Juergen Vigna <jug@sad.it>
5860 * src/insets/insetbib.C: moved using directive
5862 * src/ImportNoweb.C: small fix for being able to compile (missing
5865 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5867 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
5868 to use clear, since we don't depend on this in the code. Add test
5871 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5873 * (various *.C files): add using std::foo directives to please dec
5876 * replace calls to string::clear() to string::erase() (Angus)
5878 * src/cheaders/cmath: modified to provide std::abs.
5880 2000-05-04 Juergen Vigna <jug@sad.it>
5882 * src/insets/insettext.C: Prepared all for inserting of multiple
5883 paragraphs. Still display stuff to do (alignment and other things),
5884 but I would like to use LyXText to do this when we cleaned out the
5885 table-support stuff.
5887 * src/insets/insettabular.C: Changed lot of stuff and added lots
5888 of functionality still a lot to do.
5890 * src/tabular.C: Various functions changed name and moved to be
5891 const functions. Added new Read and Write functions and changed
5892 lots of things so it works good with tabular-insets (also removed
5893 some stuff which is not needed anymore * hacks *).
5895 * src/lyxcursor.h: added operators == and != which just look if
5896 par and pos are (not) equal.
5898 * src/buffer.C (latexParagraphs): inserted this function to latex
5899 all paragraphs form par to endpar as then I can use this too for
5902 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
5903 so that I can call this to from text insets with their own cursor.
5905 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
5906 output off all paragraphs (because of the fix below)!
5908 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
5909 the very last paragraph (this could be also the last paragraph of an
5912 * src/texrow.h: added rows() call which returns the count-variable.
5914 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5916 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
5918 * lib/configure.m4: better autodetection of DocBook tools.
5920 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5922 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
5924 * src/lyx_cb.C: add using std::reverse;
5926 * src/LaTeX.C (run): on error always run deleteFilesOnError before
5929 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
5930 selected files. Should fix repeated errors from generated files.
5932 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
5934 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
5936 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
5937 the spellchecker popup.
5939 * lib/lyxrc.example: Removed the \number_inset section
5941 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5943 * src/insets/figinset.C (various): Use IsFileReadable() to make
5944 sure that the file actually exist. Relying on ghostscripts errors
5945 is a bad idea since they can lead to X server crashes.
5947 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
5949 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
5952 * lib/lyxrc.example: smallish typo in description of
5953 \view_dvi_paper_option
5955 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5958 * src/lyxfunc.C: doImportHelper to factor out common code of the
5959 various import methods. New functions doImportASCIIasLines,
5960 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
5961 doImportLinuxDoc for the format specific parts.
5964 * buffer.C: Dispatch returns now a bool to indicate success
5967 * lyx_gui.C: Add getLyXView() for member access
5969 * lyx_main.C: Change logic for batch commands: First try
5970 Buffer::Dispatch (possibly without GUI), if that fails, use
5973 * lyx_main.C: Add support for --import command line switch.
5974 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
5975 Available Formats: Everything accepted by 'buffer-import <format>'
5977 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
5979 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
5982 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
5983 documents will be reformatted upon reentry.
5985 2000-04-27 Juergen Vigna <jug@sad.it>
5987 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
5988 correctly only last pos this was a bug.
5990 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
5992 * release of lyx-1.1.5pre1
5994 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5996 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
5998 * src/menus.C: revert the change of naming (Figure->Graphic...)
5999 from 2000-04-11. It was incomplete and bad.
6001 * src/LColor.[Ch]: add LColor::depthbar.
6002 * src/text.C (GetVisibleRow): use it.
6004 * README: update the languages list.
6006 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6008 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6011 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6013 * README: remove sections that were just wrong.
6015 * src/text2.C (GetRowNearY): remove currentrow code
6017 * src/text.C (GetRow): remove currentrow code
6019 * src/screen.C (Update): rewritten a bit.
6020 (SmallUpdate): removed func
6022 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6024 (FullRebreak): return bool
6025 (currentrow): remove var
6026 (currentrow_y): ditto
6028 * src/lyxscreen.h (Draw): change arg to unsigned long
6029 (FitCursor): return bool
6030 (FitManualCursor): ditto
6031 (Smallpdate): remove func
6032 (first): change to unsigned long
6033 (DrawOneRow): change second arg to long (from long &)
6034 (screen_refresh_y): remove var
6035 (scree_refresh_row): ditto
6037 * src/lyxrow.h: change baseline to usigned int from unsigned
6038 short, this brings some implicit/unsigned issues out in the open.
6040 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6042 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6043 instead of smallUpdate.
6045 * src/lyxcursor.h: change y to unsigned long
6047 * src/buffer.h: don't call updateScrollbar after fitcursor
6049 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6050 where they are used. Removed "\\direction", this was not present
6051 in 1.1.4 and is already obsolete. Commented out some code that I
6052 believe to never be called.
6053 (runLiterate): don't call updateScrollbar after fitCursor
6055 (buildProgram): ditto
6058 * src/WorkArea.h (workWidth): change return val to unsigned
6061 (redraw): remove the button redraws
6062 (setScrollbarValue): change for scrollbar
6063 (getScrollbarValue): change for scrollbar
6064 (getScrollbarBounds): change for scrollbar
6066 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6067 (C_WorkArea_down_cb): removed func
6068 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6069 (resize): change for scrollbar
6070 (setScrollbar): ditto
6071 (setScrollbarBounds): ditto
6072 (setScrollbarIncrements): ditto
6073 (up_cb): removed func
6074 (down_cb): removed func
6075 (scroll_cb): change for scrollbar
6076 (work_area_handler): ditto
6078 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6079 when FitCursor did something.
6080 (updateScrollbar): some unsigned changes
6081 (downCB): removed func
6082 (scrollUpOnePage): removed func
6083 (scrollDownOnePage): remvoed func
6084 (workAreaMotionNotify): don't call screen->FitCursor but use
6085 fitCursor instead. and bool return val
6086 (workAreaButtonPress): ditto
6087 (workAreaButtonRelease): some unsigned changes
6088 (checkInsetHit): ditto
6089 (workAreaExpose): ditto
6090 (update): parts rewritten, comments about the signed char arg added
6091 (smallUpdate): removed func
6092 (cursorPrevious): call needed updateScrollbar
6095 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6098 * src/BufferView.[Ch] (upCB): removed func
6099 (downCB): removed func
6100 (smallUpdate): removed func
6102 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6104 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6105 currentrow, currentrow_y optimization. This did not help a lot and
6106 if we want to do this kind of optimization we should rather use
6107 cursor.row instead of the currentrow.
6109 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6110 buffer spacing and klyx spacing support.
6112 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6114 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6117 2000-04-26 Juergen Vigna <jug@sad.it>
6119 * src/insets/figinset.C: fixes to Lars sstream changes!
6121 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6123 * A lot of files: Added Ascii(ostream &) methods to all inset
6124 classes. Used when exporting to ASCII.
6126 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6127 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6130 * src/text2.C (ToggleFree): Disabled implicit word selection when
6131 there is a change in the language
6133 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6134 no output was generated for end-of-sentence inset.
6136 * src/insets/lyxinset.h
6139 * src/paragraph.C: Removed the insetnumber code
6141 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6143 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6145 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6146 no_babel and no_epsfig completely from the file.
6147 (parseSingleLyXformat2Token): add handling for per-paragraph
6148 spacing as written by klyx.
6150 * src/insets/figinset.C: applied patch by Andre. Made it work with
6153 2000-04-20 Juergen Vigna <jug@sad.it>
6155 * src/insets/insettext.C (cutSelection):
6156 (copySelection): Fixed with selection from right to left.
6157 (draw): now the rows are not recalculated at every draw.
6158 (computeTextRows): for now reset the inset-owner here (this is
6159 important for an undo or copy where the inset-owner is not set
6162 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6163 motion to the_locking_inset screen->first was forgotten, this was
6164 not important till we got multiline insets.
6166 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6168 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6169 code seems to be alright (it is code changed by Dekel, and the
6170 intent is indeed that all macros should be defined \protect'ed)
6172 * NEWS: a bit of reorganisation of the new user-visible features.
6174 2000-04-19 Juergen Vigna <jug@sad.it>
6176 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6177 position. Set the inset_owner of the used paragraph so that it knows
6178 that it is inside an inset. Fixed cursor handling with mouse and
6179 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6180 and cleanups to make TextInsets work better.
6182 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6183 Changed parameters of various functions and added LockInsetInInset().
6185 * src/insets/insettext.C:
6187 * src/insets/insetcollapsable.h:
6188 * src/insets/insetcollapsable.C:
6189 * src/insets/insetfoot.h:
6190 * src/insets/insetfoot.C:
6191 * src/insets/insetert.h:
6192 * src/insets/insetert.C: cleaned up the code so that it works now
6193 correctly with insettext.
6195 * src/insets/inset.C:
6196 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6197 that insets in insets are supported right.
6200 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6202 * src/paragraph.C: some small fixes
6204 * src/debug.h: inserted INSETS debug info
6206 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6207 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6209 * src/commandtags.h:
6210 * src/LyXAction.C: insert code for InsetTabular.
6212 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6213 not Button1MotionMask.
6214 (workAreaButtonRelease): send always a InsetButtonRelease event to
6216 (checkInsetHit): some setCursor fixes (always with insets).
6218 * src/BufferView2.C (lockInset): returns a bool now and extended for
6219 locking insets inside insets.
6220 (showLockedInsetCursor): it is important to have the cursor always
6221 before the locked inset.
6222 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6224 * src/BufferView.h: made lockInset return a bool.
6226 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6228 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6229 that is used also internally but can be called as public to have back
6230 a cursor pos which is not set internally.
6231 (SetCursorIntern): Changed to use above function.
6233 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6235 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6240 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6241 patches for things that should be in or should be changed.
6243 * src/* [insetfiles]: change "usigned char fragile" to bool
6244 fragile. There was only one point that could that be questioned
6245 and that is commented in formulamacro.C. Grep for "CHECK".
6247 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6248 (DeleteBuffer): take it out of CutAndPaste and make it static.
6250 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6252 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6253 output the spacing envir commands. Also the new commands used in
6254 the LaTeX output makes the result better.
6256 * src/Spacing.C (writeEnvirBegin): new method
6257 (writeEnvirEnd): new method
6259 2000-04-18 Juergen Vigna <jug@sad.it>
6261 * src/CutAndPaste.C: made textclass a static member of the class
6262 as otherwise it is not accesed right!!!
6264 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6266 * forms/layout_forms.fd
6267 * src/layout_forms.h
6268 * src/layout_forms.C (create_form_form_character)
6269 * src/lyx_cb.C (UserFreeFont)
6270 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6271 documents (in the layout->character popup).
6273 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6275 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6276 \spell_command was in fact not honored (from Kevin Atkinson).
6278 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6281 * src/lyx_gui.h: make lyxViews private (Angus)
6283 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6285 * src/mathed/math_write.C
6286 (MathMatrixInset::Write) Put \protect before \begin{array} and
6287 \end{array} if fragile
6288 (MathParInset::Write): Put \protect before \\ if fragile
6290 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6292 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6293 initialization if the LyXColorHandler must be done after the
6294 connections to the XServer has been established.
6296 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6297 get the background pixel from the lyxColorhandler so that the
6298 figures are rendered with the correct background color.
6299 (NextToken): removed functions.
6300 (GetPSSizes): use ifs >> string instead of NextToken.
6302 * src/Painter.[Ch]: the color cache moved out of this file.
6304 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6307 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6309 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6310 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6312 * src/BufferView.C (enterView): new func
6313 (leaveView): new func
6315 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6317 (leaveView): new func, undefines xterm cursor when approp.
6319 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6320 (AllowInput): delete the Workarea cursor handling from this func.
6322 * src/Painter.C (underline): draw a slimer underline in most cases.
6324 * src/lyx_main.C (error_handler): use extern "C"
6326 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6328 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6329 sent directly to me.
6331 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6332 to the list by Dekel.
6334 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6337 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6338 methods from lyx_cb.here.
6340 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6343 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6345 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6346 instead of using current_view directly.
6348 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6350 * src/LyXAction.C (init): add the paragraph-spacing command.
6352 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6354 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6356 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6357 different from the documents.
6359 * src/text.C (SetHeightOfRow): take paragraph spacing into
6360 account, paragraph spacing takes precedence over buffer spacing
6361 (GetVisibleRow): ditto
6363 * src/paragraph.C (writeFile): output the spacing parameter too.
6364 (validate): set the correct features if spacing is used in the
6366 (Clear): set spacing to default
6367 (MakeSameLayout): spacing too
6368 (HasSameLayout): spacing too
6369 (SetLayout): spacing too
6370 (TeXOnePar): output the spacing commands
6372 * src/lyxparagraph.h: added a spacing variable for use with
6373 per-paragraph spacing.
6375 * src/Spacing.h: add a Default spacing and a method to check if
6376 the current spacing is default. also added an operator==
6378 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6381 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6383 * src/lyxserver.C (callback): fix dispatch of functions
6385 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6386 printf() into lyxerr call.
6388 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6391 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6392 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6393 the "Float" from each of the subitems.
6394 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6396 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6397 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6398 documented the change so that the workaround can be nuked later.
6400 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6403 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6405 * src/buffer.C (getLatexName): ditto
6406 (setReadonly): ditto
6408 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6410 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6411 avoid some uses of current_view. Added also a bufferParams()
6412 method to get at this.
6414 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6416 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6418 * src/lyxparagraph.[Ch]: removed
6419 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6420 with operators used by lower_bound and
6421 upper_bound in InsetTable's
6422 Make struct InsetTable private again. Used matchpos.
6424 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6426 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6427 document, the language of existing text is changed (unless the
6428 document is multi-lingual)
6430 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6432 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6434 * A lot of files: A rewrite of the Right-to-Left support.
6436 2000-04-10 Juergen Vigna <jug@sad.it>
6438 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6439 misplaced cursor when inset in inset is locked.
6441 * src/insets/insettext.C (LocalDispatch): small fix so that a
6442 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6444 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6445 footnote font should be decreased in size twice when displaying.
6447 * src/insets/insettext.C (GetDrawFont): inserted this function as
6448 the drawing-font may differ from the real paragraph font.
6450 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
6451 insets (inset in inset!).
6453 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6454 function here because we don't want footnotes inside footnotes.
6456 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6458 (init): now set the inset_owner in paragraph.C
6459 (LocalDispatch): added some resetPos() in the right position
6462 (pasteSelection): changed to use the new CutAndPaste-Class.
6464 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6465 which tells if it is allowed to insert another inset inside this one.
6467 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6468 SwitchLayoutsBetweenClasses.
6470 * src/text2.C (InsertInset): checking of the new paragraph-function
6472 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6473 is not needed anymore here!
6476 (PasteSelection): redone (also with #ifdef) so that now this uses
6477 the CutAndPaste-Class.
6478 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6481 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6482 from/to text/insets.
6484 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6485 so that the paragraph knows if it is inside an (text)-inset.
6486 (InsertFromMinibuffer): changed return-value to bool as now it
6487 may happen that an inset is not inserted in the paragraph.
6488 (InsertInsetAllowed): this checks if it is allowed to insert an
6489 inset in this paragraph.
6491 (BreakParagraphConservative):
6492 (BreakParagraph) : small change for the above change of the return
6493 value of InsertFromMinibuffer.
6495 * src/lyxparagraph.h: added inset_owner and the functions to handle
6496 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6498 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6500 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6501 functions from BufferView to BufferView::Pimpl to ease maintence.
6503 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6504 correctly. Also use SetCursorIntern instead of SetCursor.
6506 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6509 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6511 * src/WorkArea.C (belowMouse): manually implement below mouse.
6513 * src/*: Add "explicit" on several constructors, I added probably
6514 some unneeded ones. A couple of changes to code because of this.
6516 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6517 implementation and private parts from the users of BufferView. Not
6520 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6521 implementation and private parts from the users of LyXLex. Not
6524 * src/BufferView_pimpl.[Ch]: new files
6526 * src/lyxlex_pimpl.[Ch]: new files
6528 * src/LyXView.[Ch]: some inline functions move out-of-line
6530 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6532 * src/lyxparagraph.h: make struct InsetTable public.
6534 * src/support/lyxstring.h: change lyxstring::difference_type to be
6535 ptrdiff_t. Add std:: modifiers to streams.
6537 * src/font.C: include the <cctype> header, for islower() and
6540 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6542 * src/font.[Ch]: new files. Contains the metric functions for
6543 fonts, takes a LyXFont as parameter. Better separation of concepts.
6545 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6546 changes because of this.
6548 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6550 * src/*: compile with -Winline and move functions that don't
6553 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6556 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6558 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6559 (various files changed because of this)
6561 * src/Painter.C (text): fixed the drawing of smallcaps.
6563 * src/lyxfont.[Ch] (drawText): removed unused member func.
6566 * src/*.C: added needed "using" statements and "std::" qualifiers.
6568 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6570 * src/*.h: removed all use of "using" from header files use
6571 qualifier std:: instead.
6573 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6575 * src/text.C (Backspace): some additional cleanups (we already
6576 know whether cursor.pos is 0 or not).
6578 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6579 automake does not provide one).
6581 * src/bmtable.h: replace C++ comments with C comments.
6583 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6585 * src/screen.C (ShowCursor): Change the shape of the cursor if
6586 the current language is not equal to the language of the document.
6587 (If the cursor change its shape unexpectedly, then you've found a bug)
6589 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6592 * src/insets/insetnumber.[Ch]: New files.
6594 * src/LyXAction.C (init)
6595 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6598 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6600 * src/lyxparagraph.h
6601 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6602 (the vector is kept sorted).
6604 * src/text.C (GetVisibleRow): Draw selection correctly when there
6605 is both LTR and RTL text.
6607 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6608 which is much faster.
6610 * src/text.C (GetVisibleRow and other): Do not draw the last space
6611 in a row if the direction of the last letter is not equal to the
6612 direction of the paragraph.
6614 * src/lyxfont.C (latexWriteStartChanges):
6615 Check that font language is not equal to basefont language.
6616 (latexWriteEndChanges): ditto
6618 * src/lyx_cb.C (StyleReset): Don't change the language while using
6619 the font-default command.
6621 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6622 empty paragraph before a footnote.
6624 * src/insets/insetcommand.C (draw): Increase x correctly.
6626 * src/screen.C (ShowCursor): Change cursor shape if
6627 current language != document language.
6629 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6631 2000-03-31 Juergen Vigna <jug@sad.it>
6633 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6634 (Clone): changed mode how the paragraph-data is copied to the
6635 new clone-paragraph.
6637 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6638 GetInset(pos) with no inset anymore there (in inset UNDO)
6640 * src/insets/insetcommand.C (draw): small fix as here x is
6641 incremented not as much as width() returns (2 before, 2 behind = 4)
6643 2000-03-30 Juergen Vigna <jug@sad.it>
6645 * src/insets/insettext.C (InsetText): small fix in initialize
6646 widthOffset (should not be done in the init() function)
6648 2000-03-29 Amir Karger <karger@lyx.org>
6650 * lib/examples/it_ItemizeBullets.lyx: translation by
6653 * Implemented \textasciitilde and fixed a tiny bug in reLyX
6655 2000-03-29 Juergen Vigna <jug@sad.it>
6657 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
6659 * src/insets/insetfoot.C (Clone): small change as for the below
6660 new init function in the text-inset
6662 * src/insets/insettext.C (init): new function as I've seen that
6663 clone did not copy the Paragraph-Data!
6664 (LocalDispatch): Added code so that now we have some sort of Undo
6665 functionality (well actually we HAVE Undo ;)
6667 * src/text.C (Backspace): Small fix for the a | a Backspace problem
6669 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
6671 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
6674 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6676 * src/main.C: added a runtime check that verifies that the xforms
6677 header used when building LyX and the library used when running
6678 LyX match. Exit with a message if they don't match. This is a
6679 version number check only.
6681 * src/buffer.C (save): Don't allocate memory on the heap for
6682 struct utimbuf times.
6684 * *: some using changes, use iosfwd instead of the real headers.
6686 * src/lyxfont.C use char const * instead of string for the static
6687 strings. Rewrite some functions to use sstream.
6689 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6691 * src/text.C (Backspace): hopefully fix the dreaded backaspace
6694 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6696 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
6697 of Geodesy (from Martin Vermeer)
6699 * lib/layouts/svjour.inc: include file for the Springer svjour
6700 class. It can be used to support journals other than JoG.
6702 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
6703 Miskiewicz <misiek@pld.org.pl>)
6704 * lib/reLyX/Makefile.am: ditto.
6706 2000-03-27 Juergen Vigna <jug@sad.it>
6708 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
6709 also some modifications with operations on selected text.
6711 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
6712 problems with clicking on insets (last famous words ;)
6714 * src/insets/insetcommand.C (draw):
6715 (width): Changed to have a bit of space before and after the inset so
6716 that the blinking cursor can be seen (otherwise it was hidden)
6718 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6720 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
6721 would not be added to the link list when an installed gettext (not
6722 part of libc) is found.
6724 2000-03-24 Juergen Vigna <jug@sad.it>
6726 * src/insets/insetcollapsable.C (Edit):
6727 * src/mathed/formula.C (InsetButtonRelease):
6728 (InsetButtonPress): fixed for new handling of ButtonPress/Release
6731 * src/BufferView.C (workAreaButtonPress):
6732 (workAreaButtonRelease):
6733 (checkInsetHit): Finally fixed the clicking on insets be handled
6736 * src/insets/insetert.C (Edit): inserted this call so that ERT
6737 insets work always with LaTeX-font
6739 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
6741 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
6742 caused lyx to startup with no GUI in place, causing in a crash
6743 upon startup when called with arguments.
6745 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6747 * src/FontLoader.C: better initialization of dummyXFontStruct.
6749 2000-03-20 José Abílio Matos <jamatos@lyx.org>
6751 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
6752 for linuxdoc and docbook import and export format options.
6754 * lib/lyxrc.example Example of default values for the previous flags.
6756 * src/lyx_cb.C Use those flags instead of the hardwired values for
6757 linuxdoc and docbook export.
6759 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
6762 * src/menus.C Added menus entries for the new import/exports formats.
6764 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6766 * src/lyxrc.*: Added support for running without Gui
6769 * src/FontLoader.C: sensible defaults if no fonts are needed
6771 * src/lyx_cb.C: New function ShowMessage (writes either to the
6772 minibuffer or cout in case of no gui
6773 New function AskOverwrite for common stuff
6774 Consequently various changes to call these functions
6776 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
6777 wild guess at sensible screen resolution when having no gui
6779 * src/lyxfont.C: no gui, no fonts... set some defaults
6781 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6783 * src/LColor.C: made the command inset background a bit lighter.
6785 2000-03-20 Hartmut Goebel <goebel@noris.net>
6787 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
6788 stdstruct.inc. Koma-Script added some title elements which
6789 otherwise have been listed below "bibliography". This split allows
6790 adding title elements to where they belong.
6792 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
6793 define the additional tilte elements and then include
6796 * many other layout files: changed to include stdtitle.inc just
6797 before stdstruct.inc.
6799 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
6801 * src/buffer.C: (save) Added the option to store all backup files
6802 in a single directory
6804 * src/lyxrc.[Ch]: Added variable \backupdir_path
6806 * lib/lyxrc.example: Added descriptions of recently added variables
6808 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
6809 bibtex inset, not closing the bibtex popup when deleting the inset)
6811 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6813 * src/lyx_cb.C: add a couple using directives.
6815 2000-03-17 José Abílio Matos <jamatos@lyx.org>
6816 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
6817 import based on the filename.
6819 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
6820 file would be imported at start, if the filename where of a sgml file.
6822 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
6824 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
6826 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
6827 * src/lyxfont.h Replaced the member variable bits.direction by the
6828 member variable lang. Made many changes in other files.
6829 This allows having a multi-lingual document
6831 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
6832 that change the current language to <l>.
6833 Removed the command "font-rtl"
6835 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
6836 format for Hebrew documents)
6838 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
6839 When auto_mathmode is "true", pressing a digit key in normal mode
6840 will cause entering into mathmode.
6841 If auto_mathmode is "rtl" then this behavior will be active only
6842 when writing right-to-left text.
6844 * src/text2.C (InsertStringA) The string is inserted using the
6847 * src/paragraph.C (GetEndLabel) Gives a correct result for
6848 footnote paragraphs.
6850 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
6852 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6854 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
6855 front of PasteParagraph. Never insert a ' '. This should at least
6856 fix some cause for the segfaults that we have been experiencing,
6857 it also fixes backspace behaviour slightly. (Phu!)
6859 * src/support/lstrings.C (compare_no_case): some change to make it
6860 compile with gcc 2.95.2 and stdlibc++-v3
6862 * src/text2.C (MeltFootnoteEnvironment): change type o
6863 first_footnote_par_is_not_empty to bool.
6865 * src/lyxparagraph.h: make text private. Changes in other files
6867 (fitToSize): new function
6868 (setContentsFromPar): new function
6869 (clearContents): new function
6870 (SetChar): new function
6872 * src/paragraph.C (readSimpleWholeFile): deleted.
6874 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
6875 the file, just use a simple string instead. Also read the file in
6876 a more maintainable manner.
6878 * src/text2.C (InsertStringA): deleted.
6879 (InsertStringB): deleted.
6881 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6883 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
6884 RedoParagraphs from the doublespace handling part, just set status
6885 to NEED_MORE_REFRESH. Also don't update cursor position (should be
6886 done, but perhaps not like this.)
6888 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6890 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
6891 character when inserting an inset.
6893 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6895 * src/bufferparams.C (readLanguage): now takes "default" into
6898 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
6899 also initialize the toplevel_keymap with the default bindings from
6902 * src/buffer.C (Buffer): remove lyxrc from the parameters.
6904 * all files using lyxrc: have lyxrc as a real variable and not a
6905 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
6908 * src/lyxrc.C: remove double call to defaultKeyBindings
6910 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
6911 toolbar defauls using lyxlex. Remove enums, structs, functions
6914 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
6915 toolbar defaults. Also store default keybindings in a map.
6917 * src/ToolbarDefaults.[Ch]: New file. This class is used for
6918 storing the toolbar defaults without any xforms dependencies.
6920 * src/insets/figinset.C: patch posted to list by Andre Poenitz
6921 applied. Changed to use iterators.
6923 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
6925 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
6926 systems that don't have LINGUAS set to begin with.
6928 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6930 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
6931 the list by Dekel Tsur.
6933 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6935 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
6936 * src/insets/form_graphics.C: ditto.
6938 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
6940 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6942 * src/bufferparams.C (readLanguage): use the new language map
6944 * src/intl.C (InitKeyMapper): use the new language map
6946 * src/lyx_gui.C (create_forms): use the new language map
6948 * src/language.[Ch]: New files. Used for holding the information
6949 about each language. Now! Use this new language map enhance it and
6950 make it really usable for our needs.
6952 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
6954 * screen.C (ShowCursor): Removed duplicate code.
6955 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
6956 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
6958 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
6961 * src/text.C Added TransformChar method. Used for rendering Arabic
6962 text correctly (change the glyphs of the letter according to the
6963 position in the word)
6968 * src/lyxrc.C Added lyxrc command {language_command_begin,
6969 language_command_end,language_command_ltr,language_command_rtl,
6970 language_package} which allows the use of either arabtex or Omega
6973 * src/lyx_gui.C (init)
6975 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
6976 to use encoding for menu fonts which is different than the encoding
6979 * src/buffer.C (makeLaTeXFile): If params.language = "default",
6980 do not load the babel package.
6981 To write an English document with Hebrew/Arabic, change the document
6982 language to "english".
6984 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
6985 (alphaCounter): changed to return char
6986 (loweralphaCounter, hebrewCounter, romanCounter): New functions
6988 * lib/lyxrc.example Added examples for Hebrew/Arabic
6991 * src/layout.C Added layout command endlabeltype
6993 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
6995 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
6997 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6999 * src/mathed/math_delim.C (search_deco): return a
7000 math_deco_struct* instead of index.
7002 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7004 * All files with a USE_OSTREAM_ONLY within: removed all code that
7005 was unused when USE_OSTREAM_ONLY is defined.
7007 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7008 of any less. Removed header and using.
7010 * src/text.C (GetVisibleRow): draw the string "Page Break
7011 (top/bottom)" on screen when drawing a pagebreak line.
7013 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7015 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7017 * src/mathed/math_macro.C (draw): do some cast magic.
7020 * src/mathed/math_defs.h: change byte* argument to byte const*.
7022 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7024 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7025 know it is right to return InsetFoot* too, but cxx does not like
7028 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7030 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7032 * src/mathed/math_delim.C: change == to proper assignment.
7034 2000-03-09 Juergen Vigna <jug@sad.it>
7036 * src/insets/insettext.C (setPos): fixed various cursor positioning
7037 problems (via mouse and cursor-keys)
7038 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7039 inset (still a small display problem but it works ;)
7041 * src/insets/insetcollapsable.C (draw): added button_top_y and
7042 button_bottom_y to have correct values for clicking on the inset.
7044 * src/support/lyxalgo.h: commented out 'using std::less'
7046 2000-03-08 Juergen Vigna <jug@sad.it>
7048 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7049 Button-Release event closes as it is alos the Release-Event
7052 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7054 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7056 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7057 can add multiple spaces in Scrap (literate programming) styles...
7058 which, by the way, is how I got hooked on LyX to begin with.
7060 * src/mathed/formula.C (Write): Added dummy variable to an
7061 inset::Latex() call.
7062 (Latex): Add free_spacing boolean to inset::Latex()
7064 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7066 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7067 virtual function to include the free_spacing boolean from
7068 the containing paragraph's style.
7070 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7071 Added free_spacing boolean arg to match inset.h
7073 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7074 Added free_spacing boolean arg to match inset.h
7076 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7077 Added free_spacing boolean and made sure that if in a free_spacing
7078 paragraph, that we output normal space if there is a protected space.
7080 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7081 Added free_spacing boolean arg to match inset.h
7083 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7084 Added free_spacing boolean arg to match inset.h
7086 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7087 Added free_spacing boolean arg to match inset.h
7089 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7090 Added free_spacing boolean arg to match inset.h
7092 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7093 Added free_spacing boolean arg to match inset.h
7095 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7096 free_spacing boolean arg to match inset.h
7098 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7099 Added free_spacing boolean arg to match inset.h
7101 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7102 Added free_spacing boolean arg to match inset.h
7104 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7105 Added free_spacing boolean arg to match inset.h
7107 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7108 Added free_spacing boolean arg to match inset.h
7110 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7111 Added free_spacing boolean arg to match inset.h
7113 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7114 free_spacing boolean arg to match inset.h
7116 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7117 free_spacing boolean arg to match inset.h
7119 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7120 ignore free_spacing paragraphs. The user's spaces are left
7123 * src/text.C (InsertChar): Fixed the free_spacing layout
7124 attribute behavior. Now, if free_spacing is set, you can
7125 add multiple spaces in a paragraph with impunity (and they
7126 get output verbatim).
7127 (SelectSelectedWord): Added dummy argument to inset::Latex()
7130 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7133 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7134 paragraph layouts now only input a simple space instead.
7135 Special character insets don't make any sense in free-spacing
7138 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7139 hard-spaces in the *input* file to simple spaces if the layout
7140 is free-spacing. This converts old files which had to have
7141 hard-spaces in free-spacing layouts where a simple space was
7143 (writeFileAscii): Added free_spacing check to pass to the newly
7144 reworked inset::Latex(...) methods. The inset::Latex() code
7145 ensures that hard-spaces in free-spacing paragraphs get output
7146 as spaces (rather than "~").
7148 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7150 * src/mathed/math_delim.C (draw): draw the empty placeholder
7151 delims with a onoffdash line.
7152 (struct math_deco_compare): struct that holds the "functors" used
7153 for the sort and the binary search in math_deco_table.
7154 (class init_deco_table): class used for initial sort of the
7156 (search_deco): use lower_bound to do a binary search in the
7159 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7161 * src/lyxrc.C: a small secret thingie...
7163 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7164 and to not flush the stream as often as it used to.
7166 * src/support/lyxalgo.h: new file
7167 (sorted): template function used for checking if a sequence is
7168 sorted or not. Two versions with and without user supplied
7169 compare. Uses same compare as std::sort.
7171 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7172 it and give warning on lyxerr.
7174 (struct compare_tags): struct with function operators used for
7175 checking if sorted, sorting and lower_bound.
7176 (search_kw): use lower_bound instead of manually implemented
7179 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7181 * src/insets/insetcollapsable.h: fix Clone() declaration.
7182 * src/insets/insetfoot.h: ditto.
7184 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7186 2000-03-08 Juergen Vigna <jug@sad.it>
7188 * src/insets/lyxinset.h: added owner call which tells us if
7189 this inset is inside another inset. Changed also the return-type
7190 of Editable to an enum so it tells clearer what the return-value is.
7192 * src/insets/insettext.C (computeTextRows): fixed computing of
7193 textinsets which split automatically on more rows.
7195 * src/insets/insetert.[Ch]: changed this to be of BaseType
7198 * src/insets/insetfoot.[Ch]: added footnote inset
7200 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7201 collapsable insets (like footnote, ert, ...)
7203 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7205 * src/lyxdraw.h: remvoe file
7207 * src/lyxdraw.C: remove file
7209 * src/insets/insettext.C: added <algorithm>.
7211 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7213 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7214 (matrix_cb): case MM_OK use string stream
7216 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7219 * src/mathed/math_macro.C (draw): use string stream
7220 (Metrics): use string stream
7222 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7223 directly to the ostream.
7225 * src/vspace.C (asString): use string stream.
7226 (asString): use string stream
7227 (asLatexString): use string stream
7229 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7230 setting Spacing::Other.
7232 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7233 sprintf when creating the stretch vale.
7235 * src/text2.C (alphaCounter): changed to return a string and to
7236 not use a static variable internally. Also fixed a one-off bug.
7237 (SetCounter): changed the drawing of the labels to use string
7238 streams instead of sprintf.
7240 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7241 manipulator to use a scheme that does not require library support.
7242 This is also the way it is done in the new GNU libstdc++. Should
7243 work with DEC cxx now.
7245 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7247 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7248 end. This fixes a bug.
7250 * src/mathed (all files concerned with file writing): apply the
7251 USE_OSTREAM_ONLY changes to mathed too.
7253 * src/support/DebugStream.h: make the constructor explicit.
7255 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7256 count and ostream squashed.
7258 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7260 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7262 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7263 ostringstream uses STL strings, and we might not.
7265 * src/insets/insetspecialchar.C: add using directive.
7266 * src/insets/insettext.C: ditto.
7268 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7270 * lib/layouts/seminar.layout: feeble attempt at a layout for
7271 seminar.cls, far from completet and could really use some looking
7272 at from people used to write layout files.
7274 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7275 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7276 a lot nicer and works nicely with ostreams.
7278 * src/mathed/formula.C (draw): a slightly different solution that
7279 the one posted to the list, but I think this one works too. (font
7280 size wrong in headers.)
7282 * src/insets/insettext.C (computeTextRows): some fiddling on
7283 Jürgens turf, added some comments that he should read.
7285 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7286 used and it gave compiler warnings.
7287 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7290 * src/lyx_gui.C (create_forms): do the right thing when
7291 show_banner is true/false.
7293 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7294 show_banner is false.
7296 * most file writing files: Now use iostreams to do almost all of
7297 the writing. Also instead of passing string &, we now use
7298 stringstreams. mathed output is still not adapted to iostreams.
7299 This change can be turned off by commenting out all the occurences
7300 of the "#define USE_OSTREAM_ONLY 1" lines.
7302 * src/WorkArea.C (createPixmap): don't output debug messages.
7303 (WorkArea): don't output debug messages.
7305 * lib/lyxrc.example: added a comment about the new variable
7308 * development/Code_rules/Rules: Added some more commente about how
7309 to build class interfaces and on how better encapsulation can be
7312 2000-03-03 Juergen Vigna <jug@sad.it>
7314 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7315 automatically with the width of the LyX-Window
7317 * src/insets/insettext.C (computeTextRows): fixed update bug in
7318 displaying text-insets (scrollvalues where not initialized!)
7320 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7322 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7323 id in the check of the result from lower_bound is not enough since
7324 lower_bound can return last too, and then res->id will not be a
7327 * all insets and some code that use them: I have conditionalized
7328 removed the Latex(string & out, ...) this means that only the
7329 Latex(ostream &, ...) will be used. This is a work in progress to
7330 move towards using streams for all output of files.
7332 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7335 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7337 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7338 routine (this fixes bug where greek letters were surrounded by too
7341 * src/support/filetools.C (findtexfile): change a bit the search
7342 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7343 no longer passed to kpsewhich, we may have to change that later.
7345 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7346 warning options to avoid problems with X header files (from Angus
7348 * acinclude.m4: regenerated.
7350 2000-03-02 Juergen Vigna <jug@sad.it>
7352 * src/insets/insettext.C (WriteParagraphData): Using the
7353 par->writeFile() function for writing paragraph-data.
7354 (Read): Using buffer->parseSingleLyXformat2Token()-function
7355 for parsing paragraph data!
7357 * src/buffer.C (readLyXformat2): removed all parse data and using
7358 the new parseSingleLyXformat2Token()-function.
7359 (parseSingleLyXformat2Token): added this function to parse (read)
7360 lyx-file-format (this is called also from text-insets now!)
7362 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7364 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7367 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7368 directly instead of going through a func. One very bad thing: a
7369 static LyXFindReplace, but I don't know where to place it.
7371 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7372 string instead of char[]. Also changed to static.
7373 (GetSelectionOrWordAtCursor): changed to static inline
7374 (SetSelectionOverLenChars): ditto.
7376 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7377 current_view and global variables. both classes has changed names
7378 and LyXFindReplace is not inherited from SearchForm.
7380 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7381 fl_form_search form.
7383 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7385 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7387 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7388 bound (from Kayvan).
7390 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7392 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7394 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7396 * some things that I should comment but the local pub says head to
7399 * comment out all code that belongs to the Roff code for Ascii
7400 export of tables. (this is unused)
7402 * src/LyXView.C: use correct type for global variable
7403 current_layout. (LyXTextClass::size_type)
7405 * some code to get the new insetgraphics closer to working I'd be
7406 grateful for any help.
7408 * src/BufferView2.C (insertInset): use the return type of
7409 NumberOfLayout properly. (also changes in other files)
7411 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7412 this as a test. I want to know what breaks because of this.
7414 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7416 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7418 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7419 to use a \makebox in the label, this allows proper justification
7420 with out using protected spaces or multiple hfills. Now it is
7421 "label" for left justified, "\hfill label\hfill" for center, and
7422 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7423 should be changed accordingly.
7425 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7427 * src/lyxtext.h: change SetLayout() to take a
7428 LyXTextClass::size_type instead of a char (when there is more than
7429 127 layouts in a class); also change type of copylayouttype.
7430 * src/text2.C (SetLayout): ditto.
7431 * src/LyXView.C (updateLayoutChoice): ditto.
7433 * src/LaTeX.C (scanLogFile): errors where the line number was not
7434 given just after the '!'-line were ignored (from Dekel Tsur).
7436 * lib/lyxrc.example: fix description of \date_insert_format
7438 * lib/layouts/llncs.layout: new layout, contributed by Martin
7441 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7443 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7444 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7445 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7446 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7447 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
7448 paragraph.C, text.C, text2.C)
7450 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7452 * src/insets/insettext.C (LocalDispatch): remove extra break
7455 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7456 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7458 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7459 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7461 * src/insets/insetbib.h: move InsetBibkey::Holder and
7462 InsetCitation::Holder in public space.
7464 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7466 * src/insets/insettext.h: small change to get the new files from
7467 Juergen to compile (use "string", not "class string").
7469 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7470 const & as parameter to LocalDispatch, use LyXFont const & as
7471 paramter to some other func. This also had impacto on lyxinsets.h
7472 and the two mathed insets.
7474 2000-02-24 Juergen Vigna <jug@sad.it>
7477 * src/commandtags.h:
7479 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7483 * src/BufferView2.C: added/updated code for various inset-functions
7485 * src/insets/insetert.[Ch]: added implementation of InsetERT
7487 * src/insets/insettext.[Ch]: added implementation of InsetText
7489 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7490 (draw): added preliminary code for inset scrolling not finshed yet
7492 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7493 as it is in lyxfunc.C now
7495 * src/insets/lyxinset.h: Added functions for text-insets
7497 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7499 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7500 BufferView and reimplement the list as a queue put inside its own
7503 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7505 * several files: use the new interface to the "updateinsetlist"
7507 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7509 (work_area_handler): call BufferView::trippleClick on trippleclick.
7511 * src/BufferView.C (doubleClick): new function, selects word on
7513 (trippleClick): new function, selects line on trippleclick.
7515 2000-02-22 Allan Rae <rae@lyx.org>
7517 * lib/bind/xemacs.bind: buffer-previous not supported
7519 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7521 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7524 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7526 * src/bufferlist.C: get rid of current_view from this file
7528 * src/spellchecker.C: get rid of current_view from this file
7530 * src/vspace.C: get rid of current_view from this file
7531 (inPixels): added BufferView parameter for this func
7532 (asLatexCommand): added a BufferParams for this func
7534 * src/text.C src/text2.C: get rid of current_view from these
7537 * src/lyxfont.C (getFontDirection): move this function here from
7540 * src/bufferparams.C (getDocumentDirection): move this function
7543 * src/paragraph.C (getParDirection): move this function here from
7545 (getLetterDirection): ditto
7547 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7549 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7550 resize due to wrong pixmap beeing used. Also took the opurtunity
7551 to make the LyXScreen stateless on regard to WorkArea and some
7552 general cleanup in the same files.
7554 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7556 * src/Makefile.am: add missing direction.h
7558 * src/PainterBase.h: made the width functions const.
7560 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7563 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7565 * src/insets/insetlatexaccent.C (draw): make the accents draw
7566 better, at present this will only work well with iso8859-1.
7568 * several files: remove the old drawing code, now we use the new
7571 * several files: remove support for mono_video, reverse_video and
7574 2000-02-17 Juergen Vigna <jug@sad.it>
7576 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7577 int ** as we have to return the pointer, otherwise we have only
7578 NULL pointers in the returning function.
7580 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7582 * src/LaTeX.C (operator()): quote file name when running latex.
7584 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7586 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7587 (bubble tip), this removes our special handling of this.
7589 * Remove all code that is unused now that we have the new
7590 workarea. (Code that are not active when NEW_WA is defined.)
7592 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7594 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7596 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7597 nonexisting layout; correctly redirect obsoleted layouts.
7599 * lib/lyxrc.example: document \view_dvi_paper_option
7601 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7604 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7605 (PreviewDVI): handle the view_dvi_paper_option variable.
7606 [Both from Roland Krause]
7608 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7610 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7611 char const *, int, LyXFont)
7612 (text(int, int, string, LyXFont)): ditto
7614 * src/text.C (InsertCharInTable): attempt to fix the double-space
7615 feature in tables too.
7616 (BackspaceInTable): ditto.
7617 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7619 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7621 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7623 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7624 newly found text in textcache to this.
7625 (buffer): set the owner of the text put into the textcache to 0
7627 * src/insets/figinset.C (draw): fixed the drawing of figures with
7630 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7631 drawing of mathframe, hfills, protected space, table lines. I have
7632 now no outstanding drawing problems with the new Painter code.
7634 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7636 * src/PainterBase.C (ellipse, circle): do not specify the default
7639 * src/LColor.h: add using directive.
7641 * src/Painter.[Ch]: change return type of methods from Painter& to
7642 PainterBase&. Add a using directive.
7644 * src/WorkArea.C: wrap xforms callbacks in C functions
7647 * lib/layouts/foils.layout: font fix and simplifications from Carl
7650 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7652 * a lot of files: The Painter, LColor and WorkArea from the old
7653 devel branch has been ported to lyx-devel. Some new files and a
7654 lot of #ifdeffed code. The new workarea is enabled by default, but
7655 if you want to test the new Painter and LColor you have to compile
7656 with USE_PAINTER defined (do this in config.h f.ex.) There are
7657 still some rought edges, and I'd like some help to clear those
7658 out. It looks stable (loads and displays the Userguide very well).
7661 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7663 * src/buffer.C (pop_tag): revert to the previous implementation
7664 (use a global variable for both loops).
7666 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
7668 * src/lyxrc.C (LyXRC): change slightly default date format.
7670 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
7671 there is an English text with a footnote that starts with a Hebrew
7672 paragraph, or vice versa.
7673 (TeXFootnote): ditto.
7675 * src/text.C (LeftMargin): allow for negative values for
7676 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
7679 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
7680 for input encoding (cyrillic)
7682 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7684 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
7687 * src/toolbar.C (set): ditto
7688 * src/insets/insetbib.C (create_form_citation_form): ditto
7690 * lib/CREDITS: added Dekel Tsur.
7692 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
7693 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
7694 hebrew supports files from Dekel Tsur.
7696 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
7697 <tzafrir@technion.ac.il>
7699 * src/lyxrc.C: put \date_insert_format at the right place.
7701 * src/buffer.C (makeLaTeXFile): fix the handling of
7702 BufferParams::sides when writing out latex files.
7704 * src/BufferView2.C: add a "using" directive.
7706 * src/support/lyxsum.C (sum): when we use lyxstring,
7707 ostringstream::str needs an additional .c_str().
7709 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7711 * src/support/filetools.C (ChangeExtension): patch from Etienne
7714 * src/TextCache.C (show): remove const_cast and make second
7715 parameter non-const LyXText *.
7717 * src/TextCache.h: use non const LyXText in show.
7719 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
7722 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7724 * src/support/lyxsum.C: rework to be more flexible.
7726 * several places: don't check if a pointer is 0 if you are going
7729 * src/text.C: remove some dead code.
7731 * src/insets/figinset.C: remove some dead code
7733 * src/buffer.C: move the BufferView funcs to BufferView2.C
7734 remove all support for insetlatexdel
7735 remove support for oldpapersize stuff
7736 made some member funcs const
7738 * src/kbmap.C: use a std::list to store the bindings in.
7740 * src/BufferView2.C: new file
7742 * src/kbsequence.[Ch]: new files
7744 * src/LyXAction.C + others: remove all trace of buffer-previous
7746 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
7747 only have one copy in the binary of this table.
7749 * hebrew patch: moved some functions from LyXText to more
7750 appropriate places. (LyXParagraph, BufferParams, LyXFont)
7752 * several files: remove support for XForms older than 0.88
7754 remove some #if 0 #endif code
7756 * src/TextCache.[Ch]: new file. Holds the textcache.
7758 * src/BufferView.C: changes to use the new TextCache interface.
7759 (waitForX): remove the now unused code.
7761 * src/BackStack.h: remove some commented code
7763 * lib/bind/emacs.bind: remove binding for buffer-previous
7765 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7767 * applied the hebrew patch.
7769 * src/lyxrow.h: make sure that all Row variables are initialized.
7771 * src/text2.C (TextHandleUndo): comment out a delete, this might
7772 introduce a memory leak, but should also help us to not try to
7773 read freed memory. We need to look at this one.
7775 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
7776 (LyXParagraph): initalize footnotekind.
7778 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
7779 forgot this when applying the patch. Please heed the warnings.
7781 * src/BufferView.C (buffer): a fix for the buffer-reload problem
7782 (aka. reformat problem)
7784 * src/bufferlist.C (exists): made const, and use const_iterator
7785 (isLoaded): new func.
7786 (release): use std::find to find the correct buffer.
7788 * src/bufferlist.h: made getState a const func.
7789 made empty a const func.
7790 made exists a const func.
7793 2000-02-01 Juergen Vigna <jug@sad.it>
7795 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
7797 * po/it.po: updated a bit the italian po file and also changed the
7798 'file nuovo' for newfile to 'filenuovo' without a space, this did
7801 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
7802 for the new insert_date command.
7804 * src/lyxfunc.C (Dispatch): added support for a insert_date function
7805 from jdblair, to insert a date into the current text conforming to
7806 a strftime format (for now only considering the locale-set and not
7807 the document-language).
7809 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7811 * src/lyxfont.C (textWidth): hopefully better fix for the Array
7812 Bounds Read error seen by purify. The problem was that islower is
7813 a macros which takes an unsigned char and uses it as an index for
7814 in array of characters properties (and is thus subject to the
7818 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
7819 correctly the paper sides radio buttons.
7820 (UpdateDocumentButtons): ditto.
7822 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7824 * src/kbmap.C (getsym + others): change to return unsigned int,
7825 returning a long can give problems on 64 bit systems. (I assume
7826 that int is 32bit on 64bit systems)
7828 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7830 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
7831 LyXLookupString to be zero-terminated. Really fixes problems seen
7834 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7836 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
7837 write a (char*)0 to the lyxerr stream.
7839 * src/lastfiles.C: move algorithm before the using statemets.
7841 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7843 * src/lastfiles.C: move using directives in global scope (egcs 1.x
7844 complains otherwise).
7845 * src/table.C: ditto
7847 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
7850 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
7851 that I removed earlier... It is really needed.
7853 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
7855 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7857 * INSTALL: update xforms home page URL.
7859 * lib/configure.m4: fix a bug with unreadable layout files.
7861 * src/table.C (calculate_width_of_column): add "using std::max"
7864 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7866 * several files: marked several lines with "DEL LINE", this is
7867 lines that can be deleted without changing anything.
7868 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
7869 checks this anyway */
7872 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
7874 * src/DepTable.C (update): add a "+" at the end when the checksum
7875 is different. (debugging string only)
7877 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
7878 the next inset to not be displayed. This should also fix the list
7879 of labels in the "Insert Crossreference" dialog.
7881 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7883 * src/support/LSubstring.C (LSubstring): set pos to string::npos
7884 when regex was not found.
7886 * src/support/lstrings.C (lowercase): use handcoded transform always.
7889 * src/text.C (Delete): fixed the crash. cursor.par->prev and
7890 old_cursor.par->prev could be 0.
7892 * several files: changed post inc/dec to pre inc/dec
7894 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
7895 write the lastfiles to file.
7897 * src/BufferView.C (buffer): only show TextCache info when debugging
7899 (resizeCurrentBuffer): ditto
7900 (workAreaExpose): ditto
7902 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
7904 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
7906 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
7907 a bit better by removing the special case for \i and \j.
7909 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7911 * src/lyx_main.C (easyParse): remove test for bad comand line
7912 options, since this broke all xforms-related parsing.
7914 * src/kbmap.C (getsym): set return type to unsigned long, as
7915 declared in header. On an alpha, long is _not_ the same as int.
7917 * src/support/LOstream.h: add a "using std::flush;"
7919 * src/insets/figinset.C: ditto.
7921 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7923 * src/bufferlist.C (write): use blinding fast file copy instead of
7924 "a char at a time", now we are doing it the C++ way.
7926 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
7927 std::list<int> instead.
7928 (addpidwait): reflect move to std::list<int>
7929 (sigchldchecker): ditto
7931 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
7934 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
7935 that obviously was wrong...
7937 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
7938 c, this avoids warnings with purify and islower.
7940 * src/insets/figinset.C: rename struct queue to struct
7941 queue_element and rewrite to use a std::queue. gsqueue is now a
7942 std::queue<queue_element>
7943 (runqueue): reflect move to std::queue
7946 * src/support/lstrings.h (tostr): specialize for bool, otherwise
7947 we would get "1" "0" instead of "true" "false. Also make the tostr
7950 2000-01-21 Juergen Vigna <jug@sad.it>
7952 * src/buffer.C (writeFileAscii): Disabled code for special groff
7953 handling of tabulars till I fix this in table.C
7955 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7957 * src/support/mkdir.C (mkdir): change second argument of mkdir to
7959 * src/support/lyxlib.h: ditto.
7961 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7963 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
7964 and 'j' look better. This might fix the "macron" bug that has been
7967 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
7968 functions as one template function. Delete the old versions.
7970 * src/support/lyxsum.C: move using std::ifstream inside
7973 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
7976 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
7978 * src/mathed/formula.C: delete #include "bufferlist.h" never used
7980 * src/insets/figinset.C (InitFigures): use new instead of malloc
7981 to allocate memory for figures and bitmaps.
7982 (DoneFigures): use delete[] instead of free to deallocate memory
7983 for figures and bitmaps.
7984 (runqueue): use new to allocate
7985 (getfigdata): use new/delete[] instead of malloc/free
7986 (RegisterFigure): ditto
7988 * some files: moved some declarations closer to first use, small
7989 whitespace changes use preincrement instead of postincrement where
7990 it does not make a difference.
7992 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
7993 step on the way to use stl::containers for key maps.
7995 * src/bufferlist.h: add a typedef for const_iterator and const
7996 versions of begin and end.
7998 * src/bufferlist.[Ch]: change name of member variable _state to
7999 state_. (avoid reserved names)
8001 (getFileNames): returns the filenames of the buffers in a vector.
8003 * configure.in (ALL_LINGUAS): added ro
8005 * src/support/putenv.C: new file
8007 * src/support/mkdir.C: new file
8009 2000-01-20 Allan Rae <rae@lyx.org>
8011 * lib/layouts/IEEEtran.layout: Added several theorem environments
8013 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8014 couple of minor additions.
8016 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8017 (except for those in footnotes of course)
8019 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8021 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8023 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8024 std::sort and std::lower_bound instead of qsort and handwritten
8026 (struct compara): struct that holds the functors used by std::sort
8027 and std::lower_bound in MathedLookupBOP.
8029 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8031 * src/support/LAssert.h: do not do partial specialization. We do
8034 * src/support/lyxlib.h: note that lyx::getUserName() and
8035 lyx::date() are not in use right now. Should these be suppressed?
8037 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8038 (makeLinuxDocFile): do not put date and user name in linuxdoc
8041 * src/support/lyxlib.h (kill): change first argument to long int,
8042 since that's what solaris uses.
8044 * src/support/kill.C (kill): fix declaration to match prototype.
8046 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8047 actually check whether namespaces are supported. This is not what
8050 * src/support/lyxsum.C: add a using directive.
8052 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8054 * src/support/kill.C: if we have namespace support we don't have
8055 to include lyxlib.h.
8057 * src/support/lyxlib.h: use namespace lyx if supported.
8059 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8061 * src/support/date.C: new file
8063 * src/support/chdir.C: new file
8065 * src/support/getUserName.C: new file
8067 * src/support/getcwd.C: new file
8069 * src/support/abort.C: new file
8071 * src/support/kill.C: new file
8073 * src/support/lyxlib.h: moved all the functions in this file
8074 insede struct lyx. Added also kill and abort to this struct. This
8075 is a way to avoid the "kill is not defined in <csignal>", we make
8076 C++ wrappers for functions that are not ANSI C or ANSI C++.
8078 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8079 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8080 lyx it has been renamed to sum.
8082 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8084 * src/text.C: add using directives for std::min and std::max.
8086 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8088 * src/texrow.C (getIdFromRow): actually return something useful in
8089 id and pos. Hopefully fixes the bug with positionning of errorbox
8092 * src/lyx_main.C (easyParse): output an error and exit if an
8093 incorrect command line option has been given.
8095 * src/spellchecker.C (ispell_check_word): document a memory leak.
8097 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8098 where a "struct utimbuf" is allocated with "new" and deleted with
8101 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8103 * src/text2.C (CutSelection): don't delete double spaces.
8104 (PasteSelection): ditto
8105 (CopySelection): ditto
8107 * src/text.C (Backspace): don't delete double spaces.
8109 * src/lyxlex.C (next): fix a bug that were only present with
8110 conformant std::istream::get to read comment lines, use
8111 std::istream::getline instead. This seems to fix the problem.
8113 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8115 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8116 allowed to insert space before space" editing problem. Please read
8117 commends at the beginning of the function. Comments about usage
8120 * src/text.C (InsertChar): fix for the "not allowed to insert
8121 space before space" editing problem.
8123 * src/text2.C (DeleteEmptyParagraphMechanism): when
8124 IsEmptyTableRow can only return false this last "else if" will
8125 always be a no-op. Commented out.
8127 * src/text.C (RedoParagraph): As far as I can understand tmp
8128 cursor is not really needed.
8130 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8131 present it could only return false anyway.
8132 (several functions): Did something not so smart...added a const
8133 specifier on a lot of methods.
8135 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8136 and add a tmp->text.resize. The LyXParagraph constructor does the
8138 (BreakParagraphConservative): ditto
8140 * src/support/path.h (Path): add a define so that the wrong usage
8141 "Path("/tmp") will be flagged as a compilation error:
8142 "`unnamed_Path' undeclared (first use this function)"
8144 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8146 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8147 which was bogus for several reasons.
8149 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8153 * autogen.sh: do not use "type -path" (what's that anyway?).
8155 * src/support/filetools.C (findtexfile): remove extraneous space
8156 which caused a kpsewhich warning (at least with kpathsea version
8159 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8161 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8163 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8165 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8167 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8169 * src/paragraph.C (BreakParagraph): do not reserve space on text
8170 if we don't need to (otherwise, if pos_end < pos, we end up
8171 reserving huge amounts of memory due to bad unsigned karma).
8172 (BreakParagraphConservative): ditto, although I have not seen
8173 evidence the bug can happen here.
8175 * src/lyxparagraph.h: add a using std::list.
8177 2000-01-11 Juergen Vigna <jug@sad.it>
8179 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8182 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8184 * src/vc-backend.C (doVCCommand): change to be static and take one
8185 more parameter: the path to chdir too be fore executing the command.
8186 (retrive): new function equiv to "co -r"
8188 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8189 file_not_found_hook is true.
8191 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8193 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8194 if a file is readwrite,readonly...anything else.
8196 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8198 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8199 (CreatePostscript): name change from MenuRunDVIPS (or something)
8200 (PreviewPostscript): name change from MenuPreviewPS
8201 (PreviewDVI): name change from MenuPreviewDVI
8203 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8204 \view_pdf_command., \pdf_to_ps_command
8206 * lib/configure.m4: added search for PDF viewer, and search for
8207 PDF to PS converter.
8208 (lyxrc.defaults output): add \pdflatex_command,
8209 \view_pdf_command and \pdf_to_ps_command.
8211 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8213 * src/bufferlist.C (write): we don't use blocksize for anything so
8216 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8218 * src/support/block.h: disable operator T* (), since it causes
8219 problems with both compilers I tried. See comments in the file.
8221 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8224 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8225 variable LYX_DIR_10x to LYX_DIR_11x.
8227 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8229 * INSTALL: document --with-lyxname.
8232 * configure.in: new configure flag --with-lyxname which allows to
8233 choose the name under which lyx is installed. Default is "lyx", of
8234 course. It used to be possible to do this with --program-suffix,
8235 but the later has in fact a different meaning for autoconf.
8237 * src/support/lstrings.h (lstrchr): reformat a bit.
8239 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8240 * src/mathed/math_defs.h: ditto.
8242 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8244 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8245 true, decides if we create a backup file or not when saving. New
8246 tag and variable \pdf_mode, defaults to false. New tag and
8247 variable \pdflatex_command, defaults to pdflatex. New tag and
8248 variable \view_pdf_command, defaults to xpdf. New tag and variable
8249 \pdf_to_ps_command, defaults to pdf2ps.
8251 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8253 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8254 does not have a BufferView.
8255 (unlockInset): ditto + don't access the_locking_inset if the
8256 buffer does not have a BufferView.
8258 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8259 certain circumstances so that we don't continue a keyboard
8260 operation long after the key was released. Try f.ex. to load a
8261 large document, press PageDown for some seconds and then release
8262 it. Before this change the document would contine to scroll for
8263 some time, with this change it stops imidiatly.
8265 * src/support/block.h: don't allocate more space than needed. As
8266 long as we don't try to write to the arr[x] in a array_type arr[x]
8267 it is perfectly ok. (if you write to it you might segfault).
8268 added operator value_type*() so that is possible to pass the array
8269 to functions expecting a C-pointer.
8271 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8274 * intl/*: updated to gettext 0.10.35, tried to add our own
8275 required modifications. Please verify.
8277 * po/*: updated to gettext 0.10.35, tried to add our own required
8278 modifications. Please verify.
8280 * src/support/lstrings.C (tostr): go at fixing the problem with
8281 cxx and stringstream. When stringstream is used return
8282 oss.str().c_str() so that problems with lyxstring and basic_string
8283 are avoided. Note that the best solution would be for cxx to use
8284 basic_string all the way, but it is not conformant yet. (it seems)
8286 * src/lyx_cb.C + other files: moved several global functions to
8287 class BufferView, some have been moved to BufferView.[Ch] others
8288 are still located in lyx_cb.C. Code changes because of this. (part
8289 of "get rid of current_view project".)
8291 * src/buffer.C + other files: moved several Buffer functions to
8292 class BufferView, the functions are still present in buffer.C.
8293 Code changes because of this.
8295 * config/lcmessage.m4: updated to most recent. used when creating
8298 * config/progtest.m4: updated to most recent. used when creating
8301 * config/gettext.m4: updated to most recent. applied patch for
8304 * config/gettext.m4.patch: new file that shows what changes we
8305 have done to the local copy of gettext.m4.
8307 * config/libtool.m4: new file, used in creation of acinclude.m4
8309 * config/lyxinclude.m4: new file, this is the lyx created m4
8310 macros, used in making acinclude.m4.
8312 * autogen.sh: GNU m4 discovered as a separate task not as part of
8313 the lib/configure creation.
8314 Generate acinlucde from files in config. Actually cat
8315 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8316 easier to upgrade .m4 files that really are external.
8318 * src/Spacing.h: moved using std::istringstream to right after
8319 <sstream>. This should fix the problem seen with some compilers.
8321 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8323 * src/lyx_cb.C: began some work to remove the dependency a lot of
8324 functions have on BufferView::text, even if not really needed.
8325 (GetCurrentTextClass): removed this func, it only hid the
8328 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8329 forgot this in last commit.
8331 * src/Bullet.C (bulletEntry): use static char const *[] for the
8332 tables, becuase of this the return arg had to change to string.
8334 (~Bullet): removed unneeded destructor
8336 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8337 (insetSleep): moved from Buffer
8338 (insetWakeup): moved from Buffer
8339 (insetUnlock): moved from Buffer
8341 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8342 from Buffer to BufferView.
8344 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8346 * config/ltmain.sh: updated to version 1.3.4 of libtool
8348 * config/ltconfig: updated to version 1.3.4 of libtool
8350 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8353 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8354 Did I get that right?
8356 * src/lyxlex.h: add a "using" directive or two.
8357 * src/Spacing.h: ditto.
8358 * src/insets/figinset.C: ditto.
8359 * src/support/filetools.C: ditto.
8360 * src/support/lstrings.C: ditto.
8361 * src/BufferView.C: ditto.
8362 * src/bufferlist.C: ditto.
8363 * src/lyx_cb.C: ditto.
8364 * src/lyxlex.C: ditto.
8366 * NEWS: add some changes for 1.1.4.
8368 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8370 * src/BufferView.C: first go at a TextCache to speed up switching
8373 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8375 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8376 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8377 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8378 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8381 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8382 members of the struct are correctly initialized to 0 (detected by
8384 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8385 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8387 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8388 pidwait, since it was allocated with "new". This was potentially
8389 very bad. Thanks to Michael Schmitt for running purify for us.
8392 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8394 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8396 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8398 1999-12-30 Allan Rae <rae@lyx.org>
8400 * lib/templates/IEEEtran.lyx: minor change
8402 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8403 src/mathed/formula.C (LocalDispatch): askForText changes
8405 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8406 know when a user has cancelled input. Fixes annoying problems with
8407 inserting labels and version control.
8409 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8411 * src/support/lstrings.C (tostr): rewritten to use strstream and
8414 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8416 * src/support/filetools.C (IsFileWriteable): use fstream to check
8417 (IsDirWriteable): use fileinfo to check
8419 * src/support/filetools.h (FilePtr): whole class deleted
8421 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8423 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8425 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8427 * src/bufferlist.C (write): use ifstream and ofstream instead of
8430 * src/Spacing.h: use istrstream instead of sscanf
8432 * src/mathed/math_defs.h: change first arg to istream from FILE*
8434 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8436 * src/mathed/math_parser.C: have yyis to be an istream
8437 (LexGetArg): use istream (yyis)
8439 (mathed_parse): ditto
8440 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8442 * src/mathed/formula.C (Read): rewritten to use istream
8444 * src/mathed/formulamacro.C (Read): rewritten to use istream
8446 * src/lyxlex.h (~LyXLex): deleted desturctor
8447 (getStream): new function, returns an istream
8448 (getFile): deleted funtion
8449 (IsOK): return is.good();
8451 * src/lyxlex.C (LyXLex): delete file and owns_file
8452 (setFile): open an filebuf and assign that to a istream instead of
8454 (setStream): new function, takes an istream as arg.
8455 (setFile): deleted function
8456 (EatLine): rewritten us use istream instead of FILE*
8460 * src/table.C (LyXTable): use istream instead of FILE*
8461 (Read): rewritten to take an istream instead of FILE*
8463 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8465 * src/buffer.C (Dispatch): remove an extraneous break statement.
8467 * src/support/filetools.C (QuoteName): change to do simple
8468 'quoting'. More work is necessary. Also changed to do nothing
8469 under emx (needs fix too).
8470 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8472 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8473 config.h.in to the AC_DEFINE_UNQUOTED() call.
8474 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8475 needs char * as argument (because Solaris 7 declares it like
8478 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8479 remove definition of BZERO.
8481 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8483 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8484 defined, "lyxregex.h" if not.
8486 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8488 (REGEX): new variable that is set to regex.c lyxregex.h when
8489 AM_CONDITIONAL USE_REGEX is set.
8490 (libsupport_la_SOURCES): add $(REGEX)
8492 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8495 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8498 * configure.in: add call to LYX_REGEX
8500 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8501 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8503 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8505 * lib/bind/fi_menus.bind: new file, from
8506 pauli.virtanen@saunalahti.fi.
8508 * src/buffer.C (getBibkeyList): pass the parameter delim to
8509 InsetInclude::getKeys and InsetBibtex::getKeys.
8511 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8512 is passed to Buffer::getBibkeyList
8514 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8515 instead of the hardcoded comma.
8517 * src/insets/insetbib.C (getKeys): make sure that there are not
8518 leading blanks in bibtex keys. Normal latex does not care, but
8519 harvard.sty seems to dislike blanks at the beginning of citation
8520 keys. In particular, the retturn value of the function is
8522 * INSTALL: make it clear that libstdc++ is needed and that gcc
8523 2.7.x probably does not work.
8525 * src/support/filetools.C (findtexfile): make debug message go to
8527 * src/insets/insetbib.C (getKeys): ditto
8529 * src/debug.C (showTags): make sure that the output is correctly
8532 * configure.in: add a comment for TWO_COLOR_ICON define.
8534 * acconfig.h: remove all the entries that already defined in
8535 configure.in or acinclude.m4.
8537 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8538 to avoid user name, date and copyright.
8540 1999-12-21 Juergen Vigna <jug@sad.it>
8542 * src/table.C (Read): Now read bogus row format informations
8543 if the format is < 5 so that afterwards the table can
8544 be read by lyx but without any format-info. Fixed the
8545 crash we experienced when not doing this.
8547 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8549 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8550 (RedoDrawingOfParagraph): ditto
8551 (RedoParagraphs): ditto
8552 (RemoveTableRow): ditto
8554 * src/text.C (Fill): rename arg paperwidth -> paper_width
8556 * src/buffer.C (insertLyXFile): rename var filename -> fname
8557 (writeFile): rename arg filename -> fname
8558 (writeFileAscii): ditto
8559 (makeLaTeXFile): ditto
8560 (makeLinuxDocFile): ditto
8561 (makeDocBookFile): ditto
8563 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8566 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8568 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8571 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8572 compiled by a C compiler not C++.
8574 * src/layout.h (LyXTextClass): added typedef for const_iterator
8575 (LyXTextClassList): added typedef for const_iterator + member
8576 functions begin and end.
8578 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8579 iterators to fill the choice_class.
8580 (updateLayoutChoice): rewritten to use iterators to fill the
8581 layoutlist in the toolbar.
8583 * src/BufferView.h (BufferView::work_area_width): removed unused
8586 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8588 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8589 (sgmlCloseTag): ditto
8591 * src/support/lstrings.h: return type of countChar changed to
8594 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8595 what version of this func to use. Also made to return unsigned int.
8597 * configure.in: call LYX_STD_COUNT
8599 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8600 conforming std::count.
8602 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8604 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8605 and a subscript would give bad display (patch from Dekel Tsur
8606 <dekel@math.tau.ac.il>).
8608 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8610 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8613 * src/chset.h: add a few 'using' directives
8615 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8616 triggered when no buffer is active
8618 * src/layout.C: removed `break' after `return' in switch(), since
8621 * src/lyx_main.C (init): make sure LyX can be ran in place even
8622 when libtool has done its magic with shared libraries. Fix the
8623 test for the case when the system directory has not been found.
8625 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8626 name for the latex file.
8627 (MenuMakeHTML): ditto
8629 * src/buffer.h: add an optional boolean argument, which is passed
8632 1999-12-20 Allan Rae <rae@lyx.org>
8634 * lib/templates/IEEEtran.lyx: small correction and update.
8636 * configure.in: Attempted to use LYX_PATH_HEADER
8638 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8640 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8641 input from JMarc. Now use preprocessor to find the header.
8642 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8643 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8644 LYX_STL_STRING_FWD. See comments in file.
8646 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
8648 * The global MiniBuffer * minibuffer variable is dead.
8650 * The global FD_form_main * fd_form_main variable is dead.
8652 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8654 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
8656 * src/table.h: add the LOstream.h header
8657 * src/debug.h: ditto
8659 * src/LyXAction.h: change the explaination of the ReadOnly
8660 attribute: is indicates that the function _can_ be used.
8662 * src/LyXAction.C (init): find-replace _can_ be used in read-only
8665 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8667 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
8673 * src/paragraph.C (GetWord): assert on pos>=0
8676 * src/support/lyxstring.C: condition the use of an invariant on
8678 * src/support/lyxstring.h: ditto
8680 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
8681 Use LAssert.h instead of plain assert().
8683 * src/support/lstrings.h: add LAssert.h, in case it is needed.
8685 * src/lyxfunc.C: do not include LAssert.h, it is not used.
8686 * src/support/filetools.C: ditto
8688 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
8691 * INSTALL: document the new configure flags
8693 * configure.in: suppress --with-debug; add --enable-assertions
8695 * acinclude.m4: various changes in alignment of help strings.
8697 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8699 * src/kbmap.C: commented out the use of the hash map in kb_map,
8700 beginning of movement to a stl::container.
8702 * several files: removed code that was not in effect when
8703 MOVE_TEXT was defined.
8705 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
8706 for escaping should not be used. We can discuss if the string
8707 should be enclosed in f.ex. [] instead of "".
8709 * src/trans_mgr.C (insert): use the new returned value from
8710 encodeString to get deadkeys and keymaps done correctly.
8712 * src/chset.C (encodeString): changed to return a pair, to tell
8713 what to use if we know the string.
8715 * src/lyxscreen.h (fillArc): new function.
8717 * src/FontInfo.C (resize): rewritten to use more std::string like
8718 structore, especially string::replace.
8720 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
8723 * configure.in (chmod +x some scripts): remove config/gcc-hack
8725 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8727 * src/buffer.C (writeFile): change once again the top comment in a
8728 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
8729 instead of an hardcoded version number.
8730 (makeDocBookFile): ditto
8732 * src/version.h: add new define LYX_DOCVERSION
8734 * po/de.po: update from Pit Sütterlin
8735 * lib/bind/de_menus.bind: ditto.
8737 * src/lyxfunc.C (Dispatch): call MenuExport()
8738 * src/buffer.C (Dispatch): ditto
8740 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
8741 LyXFunc::Dispatch().
8742 (MenuExport): new function, moved from
8743 LyXFunc::Dispatch().
8745 * src/trans_mgr.C (insert): small cleanup
8746 * src/chset.C (loadFile): ditto
8748 * lib/kbd/iso8859-1.cdef: add missing backslashes
8750 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8752 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
8753 help with placing the manually drawn accents better.
8755 (Draw): x2 and hg changed to float to minimize rounding errors and
8756 help place the accents better.
8758 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
8759 unsigned short to char is just wrong...cast the char to unsigned
8760 char instead so that the two values can compare sanely. This
8761 should also make the display of insetlatexaccents better and
8762 perhaps also some other insets.
8764 (lbearing): new function
8767 1999-12-15 Allan Rae <rae@lyx.org>
8769 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
8770 header that provides a wrapper around the very annoying SGI STL header
8773 * src/support/lyxstring.C, src/LString.h:
8774 removed old SGI-STL-compatability attempts.
8776 * configure.in: Use LYX_STL_STRING_FWD.
8778 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
8779 stl_string_fwd.h is around and try to determine it's location.
8780 Major improvement over previous SGI STL 3.2 compatability.
8781 Three small problems remain with this function due to my zero
8782 knowledge of autoconf. JMarc and lgb see the comments in the code.
8784 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8786 * src/broken_const.h, config/hack-gcc, config/README: removed
8788 * configure.in: remove --with-gcc-hack option; do not call
8791 * INSTALL: remove documentation of --with-broken-const and
8794 * acconfig.h: remove all trace of BROKEN_CONST define
8796 * src/buffer.C (makeDocBookFile): update version number in output
8798 (SimpleDocBookOnePar): fix an assert when trying to a character
8799 access beyond string length
8802 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8804 * po/de.po: fix the Export menu
8806 * lyx.man: update the description of -dbg
8808 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
8809 (commandLineHelp): updated
8810 (easyParse): show list of available debug levels if -dbg is passed
8813 * src/Makefile.am: add debug.C
8815 * src/debug.h: moved some code to debug.C
8817 * src/debug.C: new file. Contains code to set and show debug
8820 * src/layout.C: remove 'break' after 'continue' in switch
8821 statements, since these cannot be reached.
8823 1999-12-13 Allan Rae <rae@lyx.org>
8825 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
8826 (in_word_set): hash() -> math_hash()
8828 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
8830 * acconfig.h: Added a test for whether we are using exceptions in the
8831 current compilation run. If so USING_EXCEPTIONS is defined.
8833 * config.in: Check for existance of stl_string_fwd.h
8834 * src/LString.h: If compiling --with-included-string and SGI's
8835 STL version 3.2 is present (see above test) we need to block their
8836 forward declaration of string and supply a __get_c_string().
8837 However, it turns out this is only necessary if compiling with
8838 exceptions enabled so I've a bit more to add yet.
8840 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
8841 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
8842 src/support/LRegex.h, src/undo.h:
8843 Shuffle the order of the included files a little to ensure that
8844 LString.h gets included before anything that includes stl_string_fwd.h
8846 * src/support/lyxstring.C: We need to #include LString.h instead of
8847 lyxstring.h to get the necessary definition of __get_c_string.
8848 (__get_c_string): New function. This is defined static just like SGI's
8849 although why they need to do this I'm not sure. Perhaps it should be
8850 in lstrings.C instead.
8852 * lib/templates/IEEEtran.lyx: New template file.
8854 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8856 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
8857 * intl/Makefile.in (MKINSTALLDIRS): ditto
8859 * src/LyXAction.C (init): changed to hold the LFUN data in a
8860 automatic array in stead of in callso to newFunc, this speeds up
8861 compilation a lot. Also all the memory used by the array is
8862 returned when the init is completed.
8864 * a lot of files: compiled with -Wold-style-cast, changed most of
8865 the reported offenders to C++ style casts. Did not change the
8866 offenders in C files.
8868 * src/trans.h (Match): change argument type to unsigned int.
8870 * src/support/DebugStream.C: fix some types on the streambufs so
8871 that it works on a conforming implementation.
8873 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8875 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
8877 * src/support/lyxstring.C: remove the inline added earlier since
8878 they cause a bunch of unsatisfied symbols when linking with dec
8879 cxx. Cxx likes to have the body of inlines at the place where they
8882 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
8883 accessing negative bounds in array. This fixes the crash when
8884 inserting accented characters.
8885 * src/trans.h (Match): ditto
8887 * src/buffer.C (Dispatch): since this is a void, it should not try
8888 to return anything...
8890 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8892 * src/buffer.h: removed the two friends from Buffer. Some changes
8893 because of this. Buffer::getFileName and Buffer::setFileName
8894 renamed to Buffer::fileName() and Buffer::fileName(...).
8896 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8898 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
8899 and Buffer::update(short) to BufferView. This move is currently
8900 controlled by a define MOVE_TEXT, this will be removed when all
8901 shows to be ok. This move paves the way for better separation
8902 between buffer contents and buffer view. One side effect is that
8903 the BufferView needs a rebreak when swiching buffers, if we want
8904 to avoid this we can add a cache that holds pointers to LyXText's
8905 that is not currently in use.
8907 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
8910 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8912 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
8914 * lyx_main.C: new command line option -x (or --execute) and
8915 -e (or --export). Now direct conversion from .lyx to .tex
8916 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
8917 Unfortunately, X is still needed and the GUI pops up during the
8920 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8922 * src/Spacing.C: add a using directive to bring stream stuff into
8924 * src/paragraph.C: ditto
8925 * src/buffer.C: ditto
8927 * NEWS: updated a bit the new features of 1.1.3 (took a few things
8928 from Lars' announcement).
8930 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
8931 example files from Tino Meinen.
8933 1999-12-06 Allan Rae <rae@lyx.org>
8935 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
8937 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8939 * src/support/lyxstring.C: added a lot of inline for no good
8942 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
8943 latexWriteEndChanges, they were not used.
8945 * src/layout.h (operator<<): output operator for PageSides
8947 * src/mathed/math_iter.C (my_memcpy): slightly changed.
8949 * some example files: loaded in LyX 1.0.4 and saved again to update
8950 certain constructs (table format)
8952 * a lot of files: did the change to use fstream/iostream for all
8953 writing of files. Done with a close look at Andre Poenitz's patch.
8955 * some files: whitespace changes.
8957 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8959 * src/mathed/math_iter.C (my_memcpy): new function. Since the
8960 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
8961 architecture, we provide our own. It is used unconditionnally, but
8962 I do not think this is a performance problem. Thanks to Angus
8963 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
8964 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
8966 (GetInset): use my_memcpy.
8970 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
8971 it is easier to understand, but it uses less TeX-only constructs now.
8973 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
8974 elements contain spaces
8976 * lib/configure: regenerated
8978 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
8979 elements contain spaces; display the list of programs that are
8982 * autogen.sh: make sure lib/configure is executable
8984 * lib/examples/*: rename the tutorial examples to begin with the
8985 two-letters language code.
8987 * src/lyxfunc.C (getStatus): do not query current font if no
8990 * src/lyx_cb.C (RunScript): use QuoteName
8991 (MenuRunDvips): ditto
8992 (PrintApplyCB): ditto
8994 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
8995 around argument, so that it works well with the current shell.
8996 Does not work properly with OS/2 shells currently.
8998 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
8999 * src/LyXSendto.C (SendtoApplyCB): ditto
9000 * src/lyxfunc.C (Dispatch): ditto
9001 * src/buffer.C (runLaTeX): ditto
9002 (runLiterate): ditto
9003 (buildProgram): ditto
9005 * src/lyx_cb.C (RunScript): ditto
9006 (MenuMakeLaTeX): ditto
9008 * src/buffer.h (getLatexName): new method
9010 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9012 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9014 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9015 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9016 (create_math_panel): ditto
9018 * src/lyxfunc.C (getStatus): re-activate the code which gets
9019 current font and cursor; add test for export to html.
9021 * src/lyxrc.C (read): remove unreachable break statements; add a
9024 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9026 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9028 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9029 introduced by faulty regex.
9030 * src/buffer.C: ditto
9031 * src/lastfiles.C: ditto
9032 * src/paragraph.C: ditto
9033 * src/table.C: ditto
9034 * src/vspace.C: ditto
9035 * src/insets/figinset.C: ditto
9036 Note: most of these is absolutely harmless, except the one in
9037 src/mathed formula.C.
9039 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9041 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9042 operation, yielding correct results for the reLyX command.
9044 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9046 * src/support/filetools.C (ExpandPath): removed an over eager
9048 (ReplaceEnvironmentPath): ditto
9050 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9051 shows that we are doing something fishy in our code...
9055 * src/lyxrc.C (read): use a double switch trick to get more help
9056 from the compiler. (the same trick is used in layout.C)
9057 (write): new function. opens a ofstream and pass that to output
9058 (output): new function, takes a ostream and writes the lyxrc
9059 elemts to it. uses a dummy switch to make sure no elements are
9062 * src/lyxlex.h: added a struct pushpophelper for use in functions
9063 with more than one exit point.
9065 * src/lyxlex.[Ch] (GetInteger): made it const
9069 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9071 * src/layout.[hC] : LayoutTags splitted into several enums, new
9072 methods created, better error handling cleaner use of lyxlex. Read
9075 * src/bmtable.[Ch]: change some member prototypes because of the
9076 image const changes.
9078 * commandtags.h, src/LyXAction.C (init): new function:
9079 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9080 This file is not read automatically but you can add \input
9081 preferences to your lyxrc if you want to. We need to discuss how
9084 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9085 in .aux, also remove .bib and .bst files from dependencies when
9088 * src/BufferView.C, src/LyXView.C: add const_cast several places
9089 because of changes to images.
9091 * lib/images/*: same change as for images/*
9093 * lib/lyxrc.example: Default for accept_compound is false not no.
9095 * images/*: changed to be const, however I have som misgivings
9096 about this change so it might be changed back.
9098 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9100 * lib/configure, po/POTFILES.in: regenerated
9102 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9104 * config/lib_configure.m4: removed
9106 * lib/configure.m4: new file (was config/lib_configure.m4)
9108 * configure.in: do not test for rtti, since we do not use it.
9110 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9112 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9113 doubling of allocated space scheme. This makes it faster for large
9114 strings end to use less memory for small strings. xtra rememoved.
9116 * src/insets/figinset.C (waitalarm): commented out.
9117 (GhostscriptMsg): use static_cast
9118 (GhostscriptMsg): use new instead of malloc to allocate memory for
9119 cmap. also delete the memory after use.
9121 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9123 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9124 for changes in bibtex database or style.
9125 (runBibTeX): remove all .bib and .bst files from dep before we
9127 (run): use scanAuc in when dep file already exist.
9129 * src/DepTable.C (remove_files_with_extension): new method
9132 * src/DepTable.[Ch]: made many of the methods const.
9134 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9136 * src/bufferparams.C: make sure that the default textclass is
9137 "article". It used to be the first one by description order, but
9138 now the first one is "docbook".
9140 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9141 string; call Debug::value.
9142 (easyParse): pass complete argument to setDebuggingLevel().
9144 * src/debug.h (value): fix the code that parses debug levels.
9146 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9149 * src/LyXAction.C: use Debug::ACTION as debug channel.
9151 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9153 * NEWS: updated for the future 1.1.3 release.
9155 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9156 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9157 it should. This is of course a controversial change (since many
9158 people will find that their lyx workscreen is suddenly full of
9159 red), but done for the sake of correctness.
9161 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9162 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9164 * src/insets/inseterror.h, src/insets/inseturl.h,
9165 src/insets/insetinfo.h, src/insets/figinset.h,
9166 src/mathed/formulamacro.h, src/mathed/math_macro.h
9167 (EditMessage): add a missing const and add _() to make sure that
9170 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9171 src/insets/insetbib.C, src/support/filetools.C: add `using'
9174 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9175 doing 'Insert index of last word' at the beginning of a paragraph.
9177 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9179 * several files: white-space changes.
9181 * src/mathed/formula.C: removed IsAlpha and IsDigit
9183 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9184 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9187 * src/insets/figinset.C (GetPSSizes): don't break when
9188 "EndComments" is seen. But break when a boundingbox is read.
9190 * all classes inherited from Inset: return value of Clone
9191 changed back to Inset *.
9193 * all classes inherited form MathInset: return value of Clone
9194 changed back to MathedInset *.
9196 * src/insets/figinset.C (runqueue): use a ofstream to output the
9197 gs/ps file. Might need some setpresicion or setw. However I can
9198 see no problem with the current code.
9199 (runqueue): use sleep instead of the alarm/signal code. I just
9200 can't see the difference.
9202 * src/paragraph.C (LyXParagraph): reserve space in the new
9203 paragraph and resize the inserted paragraph to just fit.
9205 * src/lyxfunc.h (operator|=): added operator for func_status.
9207 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9208 check for readable file.
9210 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9211 check for readable file.
9212 (MenuMakeLinuxDoc): ditto
9213 (MenuMakeDocBook): ditto
9214 (MenuMakeAscii): ditto
9215 (InsertAsciiFile): split the test for openable and readable
9217 * src/bmtable.C (draw_bitmaptable): use
9218 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9220 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9221 findtexfile from LaTeX to filetools.
9223 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9224 instead of FilePtr. Needs to be verified by a literate user.
9226 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9228 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9229 (EditMessage): likewise.
9231 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9232 respectively as \textasciitilde and \textasciicircum.
9234 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9236 * src/support/lyxstring.h: made the methods that take iterators
9239 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9240 (regexMatch): made is use the real regex class.
9242 * src/support/Makefile.am: changed to use libtool
9244 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9246 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9248 (MathIsInset ++): changed several macros to be inline functions
9251 * src/mathed/Makefile.am: changed to use libtool
9253 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9255 * src/insets/inset* : Clone changed to const and return type is
9256 the true insettype not just Inset*.
9258 * src/insets/Makefile.am: changed to use libtool
9260 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9262 * src/undo.[Ch] : added empty() and changed some of the method
9265 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9267 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9268 setID use block<> for the bullets array, added const several places.
9270 * src/lyxfunc.C (getStatus): new function
9272 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9273 LyXAction, added const to several funtions.
9275 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9276 a std::map, and to store the dir items in a vector.
9278 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9281 * src/LyXView.[Ch] + other files : changed currentView to view.
9283 * src/LyXAction.[Ch] : ported from the old devel branch.
9285 * src/.cvsignore: added .libs and a.out
9287 * configure.in : changes to use libtool.
9289 * acinclude.m4 : inserted libtool.m4
9291 * .cvsignore: added libtool
9293 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9295 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9296 file name in insets and mathed directories (otherwise the
9297 dependency is not taken in account under cygwin).
9299 * src/text2.C (InsertString[AB]): make sure that we do not try to
9300 read characters past the string length.
9302 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9304 * lib/doc/LaTeXConfig.lyx.in,
9305 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9307 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9308 file saying who created them and when this heppened; this is
9309 useless and annoys tools like cvs.
9311 * lib/layouts/g-brief-{en,de}.layout,
9312 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9313 from Thomas Hartkens <thomas@hartkens.de>.
9315 * src/{insets,mathed}/Makefile.am: do not declare an empty
9316 LDFLAGS, so that it can be set at configure time (useful on Irix
9319 * lib/reLyX/configure.in: make sure that the prefix is set
9320 correctly in LYX_DIR.
9322 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9324 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9325 be used by 'command-sequence' this allows to bind a key to a
9326 sequence of LyX-commands
9327 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9329 * src/LyXAction.C: add "command-sequence"
9331 * src/LyXFunction.C: handling of "command-sequence"
9333 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9334 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9336 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9338 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9340 * src/buffer.C (writeFile): Do not output a comment giving user
9341 and date at the beginning of a .lyx file. This is useless and
9342 annoys cvs anyway; update version number to 1.1.
9344 * src/Makefile.am (LYX_DIR): add this definition, so that a
9345 default path is hardcoded in LyX.
9347 * configure.in: Use LYX_GNU_GETTEXT.
9349 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9350 AM_GNU_GETTEXT with a bug fixed.
9352 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9354 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9356 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9357 which is used to point to LyX data is now LYX_DIR_11x.
9359 * lyx.man: convert to a unix text file; small updates.
9361 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9363 * src/support/LSubstring.[Ch]: made the second arg of most of the
9364 constructors be a const reference.
9366 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9369 * src/support/lyxstring.[Ch] (swap): added missing member function
9370 and specialization of swap(str, str);
9372 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9374 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9375 trace of the old one.
9377 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9378 put the member definitions in undo.C.
9380 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9381 NEW_TEXT and have now only code that was included when this was
9384 * src/intl.C (LCombo): use static_cast
9386 (DispatchCallback): ditto
9388 * src/definitions.h: removed whole file
9390 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9392 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9393 parsing and stores in a std:map. a regex defines the file format.
9394 removed unneeded members.
9396 * src/bufferparams.h: added several enums from definitions.h here.
9397 Removed unsused destructor. Changed some types to use proper enum
9398 types. use block to have the temp_bullets and user_defined_bullets
9399 and to make the whole class assignable.
9401 * src/bufferparams.C (Copy): removed this functions, use a default
9404 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9407 * src/buffer.C (readLyXformat2): commend out all that have with
9408 oldpapersize to do. also comment out all that hve to do with
9409 insetlatex and insetlatexdel.
9410 (setOldPaperStuff): commented out
9412 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9414 * src/LyXAction.C: remove use of inset-latex-insert
9416 * src/mathed/math_panel.C (button_cb): use static_cast
9418 * src/insets/Makefile.am (insets_o_SOURCES): removed
9421 * src/support/lyxstring.C (helper): use the unsigned long
9422 specifier, UL, instead of a static_cast.
9424 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9426 * src/support/block.h: new file. to be used as a c-style array in
9427 classes, so that the class can be assignable.
9429 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9431 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9432 NULL, make sure to return an empty string (it is not possible to
9433 set a string to NULL).
9435 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9437 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9439 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9441 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9442 link line, so that Irix users (for example) can set it explicitely to
9445 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9446 it can be overidden at make time (static or dynamic link, for
9449 * src/vc-backend.C, src/LaTeXFeatures.h,
9450 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
9451 statements to bring templates to global namespace.
9453 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9455 * src/support/lyxstring.C (operator[] const): make it standard
9458 * src/minibuffer.C (Init): changed to reflect that more
9459 information is given from the lyxvc and need not be provided here.
9461 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9463 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9465 * src/LyXView.C (UpdateTimerCB): use static_cast
9466 (KeyPressMask_raw_callback): ditto
9468 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9469 buffer_, a lot of changes because of this. currentBuffer() ->
9470 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9471 also changes to other files because of this.
9473 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9475 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9476 have no support for RCS and partial support for CVS, will be
9479 * src/insets/ several files: changes because of function name
9480 changes in Bufferview and LyXView.
9482 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9484 * src/support/LSubstring.[Ch]: new files. These implement a
9485 Substring that can be very convenient to use. i.e. is this
9487 string a = "Mary had a little sheep";
9488 Substring(a, "sheep") = "lamb";
9489 a is now "Mary has a little lamb".
9491 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9492 out patterns and subpatterns of strings. It is used by LSubstring
9493 and also by vc-backend.C
9495 * src/support/lyxstring.C: went over all the assertions used and
9496 tried to correct the wrong ones and flag which of them is required
9497 by the standard. some bugs found because of this. Also removed a
9498 couple of assertions.
9500 * src/support/Makefile.am (libsupport_a_SOURCES): added
9501 LSubstring.[Ch] and LRegex.[Ch]
9503 * src/support/FileInfo.h: have struct stat buf as an object and
9504 not a pointer to one, some changes because of this.
9506 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9507 information in layout when adding the layouts preamble to the
9510 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9513 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9514 because of bug in OS/2.
9516 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9518 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9519 \verbatim@font instead of \ttfamily, so that it can be redefined.
9521 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9522 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9523 src/layout.h, src/text2.C: add 'using' directive to bring the
9524 STL templates we need from the std:: namespace to the global one.
9525 Needed by DEC cxx in strict ansi mode.
9527 * src/support/LIstream.h,src/support/LOstream.h,
9528 src/support/lyxstring.h,src/table.h,
9529 src/lyxlookup.h: do not include <config.h> in header
9530 files. This should be done in the .C files only.
9532 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9536 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9538 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9539 from Kayvan to fix the tth invokation.
9541 * development/lyx.spec.in: updates from Kayvan to reflect the
9542 changes of file names.
9544 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9546 * src/text2.C (InsertStringB): use std::copy
9547 (InsertStringA): use std::copy
9549 * src/bufferlist.C: use a vector to store the buffers in. This is
9550 an internal change and should not affect any other thing.
9552 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9555 * src/text.C (Fill): fix potential bug, one off bug.
9557 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9559 * src/Makefile.am (lyx_main.o): add more files it depends on.
9561 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9563 * src/support/lyxstring.C: use size_t for the reference count,
9564 size, reserved memory and xtra.
9565 (internal_compare): new private member function. Now the compare
9566 functions should work for std::strings that have embedded '\0'
9568 (compare): all compare functions rewritten to use
9571 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9573 * src/support/lyxstring.C (compare): pass c_str()
9574 (compare): pass c_str
9575 (compare): pass c_str
9577 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9579 * src/support/DebugStream.C: <config.h> was not included correctly.
9581 * lib/configure: forgot to re-generate it :( I'll make this file
9582 auto generated soon.
9584 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9586 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9589 * src/support/lyxstring.C: some changes from length() to rep->sz.
9590 avoids a function call.
9592 * src/support/filetools.C (SpaceLess): yet another version of the
9593 algorithm...now per Jean-Marc's suggestions.
9595 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9597 * src/layout.C (less_textclass_desc): functor for use in sorting
9599 (LyXTextClass::Read): sort the textclasses after reading.
9601 * src/support/filetools.C (SpaceLess): new version of the
9602 SpaceLess functions. What problems does this one give? Please
9605 * images/banner_bw.xbm: made the arrays unsigned char *
9607 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9609 * src/support/lyxstring.C (find): remove bogus assertion in the
9610 two versions of find where this has not been done yet.
9612 * src/support/lyxlib.h: add missing int return type to
9615 * src/menus.C (ShowFileMenu): disable exporting to html if no
9616 html export command is present.
9618 * config/lib_configure.m4: add a test for an HTML converter. The
9619 programs checked for are, in this order: tth, latex2html and
9622 * lib/configure: generated from config/lib_configure.m4.
9624 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9625 html converter. The parameters are now passed through $$FName and
9626 $$OutName, instead of standard input/output.
9628 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9630 * lib/lyxrc.example: update description of \html_command.
9631 add "quotes" around \screen_font_xxx font setting examples to help
9632 people who use fonts with spaces in their names.
9634 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9636 * Distribution files: updates for v1.1.2
9638 * src/support/lyxstring.C (find): remove bogus assert and return
9639 npos for the same condition.
9641 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9643 * added patch for OS/2 from SMiyata.
9645 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9647 * src/text2.C (CutSelection): make space_wrapped a bool
9648 (CutSelection): dont declare int i until we have to.
9649 (alphaCounter): return a char const *.
9651 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9653 * src/support/syscall.C (Systemcalls::kill):
9654 src/support/filetools.C (PutEnv, PutEnvPath):
9655 src/lyx_cb.C (addNewlineAndDepth):
9656 src/FontInfo.C (FontInfo::resize): condition some #warning
9657 directives with WITH_WARNINGS.
9660 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9662 * src/layout.[Ch] + several files: access to class variables
9663 limited and made accessor functions instead a lot of code changed
9664 becuase of this. Also instead of returning pointers often a const
9665 reference is returned instead.
9667 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
9669 * src/Makefile.am (dist-hook): added used to remove the CVS from
9670 cheaders upon creating a dist
9671 (EXTRA_DIST): added cheaders
9673 * src/support/lstrings.C (tostr(char)): fix it to handle param as
9674 a character not as a small integer.
9676 * src/support/lyxstring.C (find): removed Assert and added i >=
9677 rep->sz to the first if.
9679 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9681 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
9682 src/LyXView.C src/buffer.C src/bufferparams.C
9683 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
9684 src/text2.C src/insets/insetinclude.C:
9685 lyxlayout renamed to textclasslist.
9687 * src/layout.C: some lyxerr changes.
9689 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
9690 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
9691 (LyXLayoutList): removed all traces of this class.
9692 (LyXTextClass::Read): rewrote LT_STYLE
9693 (LyXTextClass::hasLayout): new function
9694 (LyXTextClass::GetLayout): rewritten to return an iterator + has
9695 both const and nonconst version.
9696 (LyXTextClass::delete_layout): new function.
9697 (LyXTextClassList::Style): bug fix. do the right thing if layout
9699 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
9700 (LyXTextClassList::NameOfLayout): ditto
9701 (LyXTextClassList::Load): ditto
9703 * src/buffer.C (makeLaTeXFile): new access to layoutlist
9705 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
9707 * src/LyXAction.C (LookupFunc): added a workaround for sun
9708 compiler, on the other hand...we don't know if the current code
9709 compiles on sun at all...
9711 * src/support/filetools.C (CleanupPath): subst fix
9713 * src/insets/insetbib.C (delDatabase): subst fix, this looks
9716 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
9717 complained about this one?
9719 * src/insets/insetinclude.C (Latex): subst fix
9721 * src/insets/insetbib.C (getKeys): subst fix
9723 * src/LyXSendto.C (SendtoApplyCB): subst fix
9725 * src/lyx_main.C (init): subst fix
9727 * src/layout.C (Read): subst fix
9729 * src/lyx_sendfax_main.C (button_send): subst fix
9731 * src/buffer.C (RoffAsciiTable): subst fix
9733 * src/lyx_cb.C (MenuFax): subst fix
9734 (PrintApplyCB): subst fix
9736 1999-10-26 Juergen Vigna <jug@sad.it>
9738 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
9740 (Read): Cleaned up this code so now we read only format vestion >= 5
9742 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9744 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
9745 come nobody has complained about this one?
9747 * src/insets/insetinclude.C (Latex): subst fix
9749 * src/insets/insetbib.C (getKeys): subst fix
9751 * src/lyx_main.C (init): subst fix
9753 * src/layout.C (Read): subst fix
9755 * src/buffer.C (RoffAsciiTable): subst fix
9757 * src/lyx_cb.C (MenuFax): subst fix.
9759 * src/layout.[hC] + some other files: rewrote to use
9760 std::container to store textclasses and layouts in.
9761 Simplified, removed a lot of code. Make all classes
9762 assignable. Further simplifications and review of type
9763 use still to be one.
9765 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
9766 lastfiles to create the lastfiles partr of the menu.
9768 * src/lastfiles.[Ch]: rewritten to use deque to store the
9769 lastfiles in. Uses fstream for reading and writing. Simplifies
9772 * src/support/syscall.C: remove explicit cast.
9774 * src/BufferView.C (CursorToggleCB): removed code snippets that
9776 use explicat C++ style casts instead of C style casts. also use
9777 u_vdata instea of passing pointers in longs.
9779 * src/PaperLayout.C: removed code snippets that were commented out.
9781 * src/lyx_gui_misc.C: removed code snippets that were commented out.
9783 * src/lyx_main.C: removed code snippets that wer commented out.
9785 * src/paragraph.C: removed code snippets that were commented out.
9787 * src/lyxvc.C (logClose): use static_cast
9789 (viewLog): remove explicit cast to void*
9790 (showLog): removed old commented code
9792 * src/menus.C: use static_cast instead of C style casts. use
9793 u_vdata instead of u_ldata. remove explicit cast to (long) for
9794 pointers. Removed old code that was commented out.
9796 * src/insets/inset.C: removed old commented func
9798 * src/insets/insetref.C (InsetRef): removed old code that had been
9799 commented out for a long time.
9801 (escape): removed C style cast
9803 * src/insets/insetlatexaccent.C (Draw): removed old commented code
9805 * src/insets/insetlatex.C (Draw): removed old commented code
9806 (Read): rewritten to use string
9808 * src/insets/insetlabel.C (escape): removed C style cast
9810 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
9812 * src/insets/insetindex.C: use static_cast and u_vdata, removed
9815 * src/insets/insetinclude.h: removed a couple of stupid bools
9817 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
9818 (Clone): remove C style cast
9819 (getKeys): changed list to lst because of std::list
9821 * src/insets/inseterror.C (Draw): removed som old commented code.
9823 * src/insets/insetcommand.C (Draw): removed some old commented code.
9825 * src/insets/insetbib.C (bibitem_cb): removed code that has been
9826 commented out forever.
9827 (bibitem_cb): use static_cast instead of C style cast
9828 use of vdata changed to u_vdata.
9830 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
9832 (CloseUrlCB): use static_cast instead of C style cast.
9833 (CloseUrlCB): added a fl_free form...it seemed to be missing.
9835 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
9836 (C_InsetInfo_CloseInfoCB): forward the ob parameter
9837 (CloseInfoCB): static_cast from ob->u_vdata instead.
9838 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
9841 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
9842 (C_InsetError_CloseErrorCB): forward the ob parameter
9843 (CloseErrorCB): static_cast from ob->u_vdata instead.
9845 * src/vspace.h: include LString.h since we use string in this class.
9847 * src/vspace.C (lyx_advance): changed name from advance because of
9848 nameclash with stl. And since we cannot use namespaces yet...I
9849 used a lyx_ prefix instead. Expect this to change when we begin
9852 * src/BufferView.[Ch] (BufferView::~BufferView): removed
9854 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
9855 and removed now defunct constructor and deconstructor.
9857 * src/BufferView.h: have backstack as a object not as a pointer.
9858 removed initialization from constructor. added include for BackStack
9860 * development/lyx.spec.in (%build): add CFLAGS also.
9862 * src/screen.C (drawFrame): removed another warning.
9864 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9866 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
9867 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
9868 README and ANNOUNCE a bit for the next release. More work is
9871 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
9872 unbreakable if we are in freespacing mode (LyX-Code), but not in
9875 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9877 * src/BackStack.h: fixed initialization order in constructor
9879 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
9881 * acinclude.m4 (VERSION): new rules for when a version is
9882 development, added also a variable for prerelease.
9883 (warnings): we set with_warnings=yes for prereleases
9884 (lyx_opt): prereleases compile with same optimization as development
9885 (CXXFLAGS): only use pedantic if we are a development version
9887 * src/BufferView.C (restorePosition): don't do anything if the
9890 * src/BackStack.h: added member empty, use this to test if there
9891 is anything to pop...
9893 1999-10-25 Juergen Vigna <jug@sad.it>
9896 * forms/layout_forms.fd +
9897 * forms/latexoptions.fd +
9898 * lyx.fd: changed for various form resize issues
9900 * src/mathed/math_panel.C +
9901 * src/insets/inseterror.C +
9902 * src/insets/insetinfo.C +
9903 * src/insets/inseturl.C +
9904 * src/insets/inseturl.h +
9907 * src/PaperLayout.C +
9908 * src/ParagraphExtra.C +
9909 * src/TableLayout.C +
9911 * src/layout_forms.C +
9918 * src/menus.C: fixed various resize issues. So now forms can be
9919 resized savely or not be resized at all.
9921 * forms/form_url.fd +
9922 * src/insets/form_url.[Ch]: added because it's cleaner and easier
9925 * src/insets/Makefile.am: added files form_url.[Ch]
9927 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9929 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
9930 (and presumably 6.2).
9932 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
9933 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
9934 remaining static member callbacks.
9936 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
9939 * src/support/lyxstring.h: declare struct Srep as friend of
9940 lyxstring, since DEC cxx complains otherwise.
9942 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9944 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9946 * src/LaTeX.C (run): made run_bibtex also depend on files with
9948 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
9949 are put into the dependency file.
9951 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
9952 the code has shown itself to work
9953 (create_ispell_pipe): removed another warning, added a comment
9956 * src/minibuffer.C (ExecutingCB): removed code that has been
9957 commented out a long time
9959 * src/lyxfunc.C (processKeyEvent): removed some very old commented
9960 out code + a warning.
9962 * src/support/lyxstring.h: comment out the three private
9963 operators, when compiling with string ansi conforming compilers
9966 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
9968 (pixmapFromBitmapData): change type of bdata to be unsigned char *
9969 (pixmapFromBitmapData): add a reinterpret_cast in the call to
9972 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
9975 * src/mathed/math_panel.C (create_math_panel): remove explicit
9978 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
9981 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
9982 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
9983 to XCreatePixmapFromBitmapData
9984 (fl_set_bmtable_data): change the last argument to be unsigned
9986 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
9987 and bh to be unsigned int, remove explicit casts in call to
9988 XReadBitmapFileData.
9990 * images/arrows.xbm: made the arrays unsigned char *
9991 * images/varsz.xbm: ditto
9992 * images/misc.xbm: ditto
9993 * images/greek.xbm: ditto
9994 * images/dots.xbm: ditto
9995 * images/brel.xbm: ditto
9996 * images/bop.xbm: ditto
9998 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10000 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10001 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10002 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10004 (LYX_CXX_CHEADERS): added <clocale> to the test.
10006 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10008 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10010 * src/support/lyxstring.C (append): fixed something that must be a
10011 bug, rep->assign was used instead of rep->append.
10013 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10016 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10017 lyx insert double chars. Fix spotted by Kayvan.
10019 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10021 * Fixed the tth support. I messed up with the Emacs patch apply feature
10022 and omitted the changes in lyxrc.C.
10024 1999-10-22 Juergen Vigna <jug@sad.it>
10026 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10028 * src/lyx_cb.C (MenuInsertRef) +
10029 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10030 the form cannot be resized under it limits (fixes a segfault)
10032 * src/lyx.C (create_form_form_ref) +
10033 * forms/lyx.fd: Changed Gravity on name input field so that it is
10036 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10038 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10039 <ostream> and <istream>.
10041 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10042 whether <fstream> provides the latest standard features, or if we
10043 have an oldstyle library (like in egcs).
10044 (LYX_CXX_STL_STRING): fix the test.
10046 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10047 code on MODERN_STL_STREAM.
10049 * src/support/lyxstring.h: use L{I,O}stream.h.
10051 * src/support/L{I,O}stream.h: new files, designed to setup
10052 correctly streams for our use
10053 - includes the right header depending on STL capabilities
10054 - puts std::ostream and std::endl (for LOStream.h) or
10055 std::istream (LIStream.h) in toplevel namespace.
10057 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10059 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10060 was a bib file that had been changed we ensure that bibtex is run.
10061 (runBibTeX): enhanced to extract the names of the bib files and
10062 getting their absolute path and enter them into the dep file.
10063 (findtexfile): static func that is used to look for tex-files,
10064 checks for absolute patchs and tries also with kpsewhich.
10065 Alternative ways of finding the correct files are wanted. Will
10067 (do_popen): function that runs a command using popen and returns
10068 the whole output of that command in a string. Should be moved to
10071 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10072 file with extension ext has changed.
10074 * src/insets/figinset.C: added ifdef guards around the fl_free
10075 code that jug commented out. Now it is commented out when
10076 compiling with XForms == 0.89.
10078 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10079 to lyxstring.C, and only keep a forward declaration in
10080 lyxstring.h. Simplifies the header file a bit and should help a
10081 bit on compile time too. Also changes to Srep will not mandate a
10082 recompile of code just using string.
10083 (~lyxstring): definition moved here since it uses srep.
10084 (size): definition moved here since it uses srep.
10086 * src/support/lyxstring.h: removed a couple of "inline" that should
10089 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10091 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10094 1999-10-21 Juergen Vigna <jug@sad.it>
10096 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10097 set to left if I just remove the width entry (or it is empty).
10099 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10100 paragraph when having dummy paragraphs.
10102 1999-10-20 Juergen Vigna <jug@sad.it>
10104 * src/insets/figinset.C: just commented some fl_free_form calls
10105 and added warnings so that this calls should be activated later
10106 again. This avoids for now a segfault, but we have a memory leak!
10108 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10109 'const char * argument' to 'string argument', this should
10110 fix some Asserts() in lyxstring.C.
10112 * src/lyxfunc.h: Removed the function argAsString(const char *)
10113 as it is not used anymore.
10115 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10117 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10120 * src/Literate.h: some funcs moved from public to private to make
10121 interface clearer. Unneeded args removed.
10123 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10125 (scanBuildLogFile): ditto
10127 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10128 normal TeX Error. Still room for improvement.
10130 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10132 * src/buffer.C (insertErrors): changes to make the error
10133 desctription show properly.
10135 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10138 * src/support/lyxstring.C (helper): changed to use
10139 sizeof(object->rep->ref).
10140 (operator>>): changed to use a pointer instead.
10142 * src/support/lyxstring.h: changed const reference & to value_type
10143 const & lets see if that helps.
10145 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10147 * Makefile.am (rpmdist): fixed to have non static package and
10150 * src/support/lyxstring.C: removed the compilation guards
10152 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10155 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10156 conditional compile of lyxstring.Ch
10158 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10159 stupid check, but it is a lot better than the bastring hack.
10160 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10162 * several files: changed string::erase into string::clear. Not
10165 * src/chset.C (encodeString): use a char temporary instead
10167 * src/table.C (TexEndOfCell): added tostr around
10168 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10169 (TexEndOfCell): ditto
10170 (TexEndOfCell): ditto
10171 (TexEndOfCell): ditto
10172 (DocBookEndOfCell): ditto
10173 (DocBookEndOfCell): ditto
10174 (DocBookEndOfCell): ditto
10175 (DocBookEndOfCell): ditto
10177 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10179 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10181 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10182 (MenuBuildProg): added tostr around ret
10183 (MenuRunChktex): added tostr around ret
10184 (DocumentApplyCB): added tostr around ret
10186 * src/chset.C (encodeString): added tostr around t->ic
10188 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10189 (makeLaTeXFile): added tostr around tocdepth
10190 (makeLaTeXFile): added tostr around ftcound - 1
10192 * src/insets/insetbib.C (setCounter): added tostr around counter.
10194 * src/support/lyxstring.h: added an operator+=(int) to catch more
10197 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10198 (lyxstring): We DON'T allow NULL pointers.
10200 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10202 * src/mathed/math_macro.C (MathMacroArgument::Write,
10203 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10204 when writing them out.
10206 * src/LString.C: remove, since it is not used anymore.
10208 * src/support/lyxstring.C: condition the content to
10209 USE_INCLUDED_STRING macro.
10211 * src/mathed/math_symbols.C, src/support/lstrings.C,
10212 src/support/lyxstring.C: add `using' directive to specify what
10213 we need in <algorithm>. I do not think that we need to
10214 conditionalize this, but any thought is appreciated.
10216 * many files: change all callback functions to "C" linkage
10217 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10218 strict_ansi. Those who were static are now global.
10219 The case of callbacks which are static class members is
10220 trickier, since we have to make C wrappers around them (see
10221 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10222 did not finish this yet, since it defeats the purpose of
10223 encapsulation, and I am not sure what the best route is.
10225 1999-10-19 Juergen Vigna <jug@sad.it>
10227 * src/support/lyxstring.C (lyxstring): we permit to have a null
10228 pointer as assignment value and just don't assign it.
10230 * src/vspace.C (nextToken): corrected this function substituting
10231 find_first(_not)_of with find_last_of.
10233 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10234 (TableOptCloseCB) (TableSpeCloseCB):
10235 inserted fl_set_focus call for problem with fl_hide_form() in
10238 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10240 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10243 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10245 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10246 LyXLex::next() and not eatline() to get its argument.
10248 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10250 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10251 instead, use fstreams for io of the depfile, removed unneeded
10252 functions and variables.
10254 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10255 vector instead, removed all functions and variables that is not in
10258 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10260 * src/buffer.C (insertErrors): use new interface to TeXError
10262 * Makefile.am (rpmdist): added a rpmdist target
10264 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10265 per Kayvan's instructions.
10267 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10269 * src/Makefile.am: add a definition for localedir, so that locales
10270 are found after installation (Kayvan)
10272 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10274 * development/.cvsignore: new file.
10276 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10278 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10279 C++ compiler provides wrappers for C headers and use our alternate
10282 * configure.in: use LYX_CXX_CHEADERS.
10284 * src/cheader/: new directory, populated with cname headers from
10285 libstdc++-2.8.1. They are a bit old, but probably good enough for
10286 what we want (support compilers who lack them).
10288 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10289 from includes. It turns out is was stupid.
10291 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10293 * lib/Makefile.am (install-data-local): forgot a ';'
10294 (install-data-local): forgot a '\'
10295 (libinstalldirs): needed after all. reintroduced.
10297 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10299 * configure.in (AC_OUTPUT): added lyx.spec
10301 * development/lyx.spec: removed file
10303 * development/lyx.spec.in: new file
10305 * po/*.po: merged with lyx.pot becuase of make distcheck
10307 * lib/Makefile.am (dist-hook): added dist-hook so that
10308 documentation files will be included when doing a make
10309 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10310 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10312 more: tried to make install do the right thing, exclude CVS dirs
10315 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10316 Path would fit in more nicely.
10318 * all files that used to use pathstack: uses now Path instead.
10319 This change was a lot easier than expected.
10321 * src/support/path.h: new file
10323 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10325 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10327 * src/support/lyxstring.C (getline): Default arg was given for
10330 * Configure.cmd: removed file
10332 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10334 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10335 streams classes and types, add the proper 'using' statements when
10336 MODERN_STL is defined.
10338 * src/debug.h: move the << operator definition after the inclusion
10341 * src/support/filetools.C: include "LAssert.h", which is needed
10344 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10347 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10348 include "debug.h" to define a proper ostream.
10350 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10352 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10353 method to the SystemCall class which can kill a process, but it's
10354 not fully implemented yet.
10356 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10358 * src/support/FileInfo.h: Better documentation
10360 * src/lyxfunc.C: Added support for buffer-export html
10362 * src/menus.C: Added Export->As HTML...
10364 * lib/bind/*.bind: Added short-cut for buffer-export html
10366 * src/lyxrc.*: Added support for new \tth_command
10368 * lib/lyxrc.example: Added stuff for new \tth_command
10370 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10372 * lib/Makefile.am (IMAGES): removed images/README
10373 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10374 installes in correct place. Check permisions is installed
10377 * src/LaTeX.C: some no-op changes moved declaration of some
10380 * src/LaTeX.h (LATEX_H): changed include guard name
10382 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10384 * lib/reLyX/Makefile.am: install noweb2lyx.
10386 * lib/Makefile.am: install configure.
10388 * lib/reLyX/configure.in: declare a config aux dir; set package
10389 name to lyx (not sure what the best solution is); generate noweb2lyx.
10391 * lib/layouts/egs.layout: fix the bibliography layout.
10393 1999-10-08 Jürgen Vigna <jug@sad.it>
10395 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10396 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10397 it returned without continuing to search the path.
10399 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10401 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10402 also fixes a bug. It is not allowed to do tricks with std::strings
10403 like: string a("hei"); &a[e]; this will not give what you
10404 think... Any reason for the complexity in this func?
10406 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10408 * Updated README and INSTALL a bit, mostly to check that my
10409 CVS rights are correctly set up.
10411 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10413 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10414 does not allow '\0' chars but lyxstring and std::string does.
10416 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10418 * autogen.sh (AUTOCONF): let the autogen script create the
10419 POTFILES.in file too. POTFILES.in should perhaps now not be
10420 included in the cvs module.
10422 * some more files changed to use C++ includes instead of C ones.
10424 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10426 (Reread): added tostr to nlink. buggy output otherwise.
10427 (Reread): added a string() around szMode when assigning to Buffer,
10428 without this I got a log of garbled info strings.
10430 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10433 * I have added several ostream & operator<<(ostream &, some_type)
10434 functions. This has been done to avoid casting and warnings when
10435 outputting enums to lyxerr. This as thus eliminated a lot of
10436 explicit casts and has made the code clearer. Among the enums
10437 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10438 mathed enums, some font enum the Debug::type enum.
10440 * src/support/lyxstring.h (clear): missing method. equivalent of
10443 * all files that contained "stderr": rewrote constructs that used
10444 stderr to use lyxerr instead. (except bmtable)
10446 * src/support/DebugStream.h (level): and the passed t with
10447 Debug::ANY to avoid spurious bits set.
10449 * src/debug.h (Debug::type value): made it accept strings of the
10450 type INFO,INIT,KEY.
10452 * configure.in (Check for programs): Added a check for kpsewhich,
10453 the latex generation will use this later to better the dicovery of
10456 * src/BufferView.C (create_view): we don't need to cast this to
10457 (void*) that is done automatically.
10458 (WorkAreaButtonPress): removed some dead code.
10460 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10462 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10463 is not overwritten when translated (David Sua'rez de Lis).
10465 * lib/CREDITS: Added David Sua'rez de Lis
10467 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10469 * src/bufferparams.C (BufferParams): default input encoding is now
10472 * acinclude.m4 (cross_compiling): comment out macro
10473 LYX_GXX_STRENGTH_REDUCE.
10475 * acconfig.h: make sure that const is not defined (to empty) when
10476 we are compiling C++. Remove commented out code using SIZEOF_xx
10479 * configure.in : move the test for const and inline as late as
10480 possible so that these C tests do not interefere with C++ ones.
10481 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10482 has not been proven.
10484 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10486 * src/table.C (getDocBookAlign): remove bad default value for
10487 isColumn parameter.
10489 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10491 (ShowFileMenu2): ditto.
10493 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10494 of files to ignore.
10496 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10498 * Most files: finished the change from the old error code to use
10499 DebugStream for all lyxerr debugging. Only minor changes remain
10500 (e.g. the setting of debug levels using strings instead of number)
10502 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10504 * src/layout.C (Add): Changed to use compare_no_case instead of
10507 * src/FontInfo.C: changed loop variable type too string::size_type.
10509 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10511 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10512 set ETAGS_ARGS to --c++
10514 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10516 * src/table.C (DocBookEndOfCell): commented out two unused variables
10518 * src/paragraph.C: commented out four unused variables.
10520 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10521 insed a if clause with type string::size_type.
10523 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10526 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10528 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10529 variable, also changed loop to go from 0 to lenght + 1, instead of
10530 -1 to length. This should be correct.
10532 * src/LaTeX.C (scanError): use string::size_type as loop variable
10535 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10536 (l.896) since y_tmp and row was not used anyway.
10538 * src/insets/insetref.C (escape): use string::size_type as loop
10541 * src/insets/insetquotes.C (Width): use string::size_type as loop
10543 (Draw): use string::size_type as loop variable type.
10545 * src/insets/insetlatexaccent.C (checkContents): use
10546 string::size_type as loop variable type.
10548 * src/insets/insetlabel.C (escape): use string::size_type as loop
10551 * src/insets/insetinfo.C: added an extern for current_view.
10553 * src/insets/insetcommand.C (scanCommand): use string::size_type
10554 as loop variable type.
10556 * most files: removed the RCS tags. With them we had to recompile
10557 a lot of files after a simple cvs commit. Also we have never used
10558 them for anything meaningful.
10560 * most files: tags-query-replace NULL 0. As adviced several plases
10561 we now use "0" instead of "NULL" in our code.
10563 * src/support/filetools.C (SpaceLess): use string::size_type as
10564 loop variable type.
10566 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10568 * src/paragraph.C: fixed up some more string stuff.
10570 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10572 * src/support/filetools.h: make modestr a std::string.
10574 * src/filetools.C (GetEnv): made ch really const.
10576 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10577 made code that used these use max/min from <algorithm> instead.
10579 * changed several c library include files to their equivalent c++
10580 library include files. All is not changed yet.
10582 * created a support subdir in src, put lyxstring and lstrings
10583 there + the extra files atexit, fileblock, strerror. Created
10584 Makefile.am. edited configure.in and src/Makefile.am to use this
10585 new subdir. More files moved to support.
10587 * imported som of the functions from repository lyx, filetools
10589 * ran tags-query-replace on LString -> string, corrected the bogus
10590 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10591 is still some errors in there. This is errors where too much or
10592 too litle get deleted from strings (string::erase, string::substr,
10593 string::replace), there can also be some off by one errors, or
10594 just plain wrong use of functions from lstrings. Viewing of quotes
10597 * LyX is now running fairly well with string, but there are
10598 certainly some bugs yet (see above) also string is quite different
10599 from LString among others in that it does not allow null pointers
10600 passed in and will abort if it gets any.
10602 * Added the revtex4 files I forgot when setting up the repository.
10604 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10606 * All over: Tried to clean everything up so that only the files
10607 that we really need are included in the cvs repository.
10608 * Switched to use automake.
10609 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10610 * Install has not been checked.
10612 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10614 * po/pt.po: Three errors:
10615 l.533 and l.538 format specification error
10616 l. 402 duplicate entry, I just deleted it.