1 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * lib/ui/default.ui: change Item to OptItem in import menu.
6 * lib/configure.m4: comment out fax-related stuff.
8 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
10 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
11 useful xforms helper functions. At present contains only formatted().
12 Input a string and it returns it with line breaks so that in fits
15 * src/frontends/xforms/Makefile.am: add new files.
17 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
18 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
21 * src/frontends/xforms/FormPreferences.[Ch]:
22 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
23 but lots of little clean ups. Removed enum State. Make use of
24 formatted(). Constify lots of methods. Perhaps best of all: removed
25 requirement for that horrible reinterpret_cast from pointer to long in
28 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
30 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
31 conditionalize build on xforms < 0.89
33 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
35 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
37 * src/LyXAction.C (init): comment out fax
39 * src/lyxrc.h: comment out the fax enums
40 comment out the fax variables
42 * src/commandtags.h: comment out LFUN_FAX
44 * src/lyxrc.C: disable fax variables.
45 (read): disable parsing of fax variables
46 (output): disable writing of fax variables
47 (getFeedback): now description for fax variables
49 * src/lyxfunc.C: comment out MenuFax
50 (Dispatch): disable LFUN_FAX
52 * src/lyx_cb.C (MenuFax): comment out
54 * src/WorkArea.C: add <cctype>
55 (work_area_handler): better key handling, should be ok now.
56 for accented chars + etc
58 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
59 lyx_sendfax.h and lyx_sendfax_man.C
61 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
62 (show): don't call InitLyXLookup when using xforms 0.89
64 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
66 * src/trans.C (AddDeadkey): better fix, the other one could crash...
68 * src/support/filetools.C (GetFileContents): close to dummy change
70 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
72 * src/trans.C (AddDeadkey): workaround stupid compilers.
74 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
76 * src/frontends/xforms/FormDocument.C (class_update): fix setting
77 of two-sided document.
79 2000-10-31 Juergen Vigna <jug@sad.it>
81 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
83 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
84 xposition to the Edit call.
86 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
88 * src/trans.C (AddDeadkey): cast explicitly to char.
90 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
92 * src/tabular.C (AsciiBottomHLine): simplify?
93 (AsciiTopHLine): simplify?
94 (print_n_chars): simplify
95 (DocBook): remove most of the << endl; we should flush the stream
96 as seldom as possible.
98 (TeXBottomHLine): ditto
101 (write_attribute): try a templified version.
102 (set_row_column_number_info): lesson scope of variables
104 * src/support/lstrings.h (tostr): new specialization of tostr
106 * src/trans.C (AddDeadkey): slightly cleaner fix.
108 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
110 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
111 '%%' in Toc menu labels.
114 * src/insets/insetlatexaccent.C (draw): Correct rendering when
115 font_norm is iso10646-1.
117 * src/font.C (ascent): Fixed for 16bit fonts
118 (descent,lbearing,rbearing): ditto
120 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
122 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
123 (getFeedback): new static method.
125 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
126 Now use combox rather than choice to display languages.
127 Feedback is now output using a new timer callback mechanism, identical
128 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
130 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
132 * src/minibuffer.C: fix for older compilers
134 2000-10-30 Juergen Vigna <jug@sad.it>
136 * src/insets/insettext.C (InsertInset): fixed this as the cursor
137 has to be Left of the inset otherwise LyXText won't find it!
139 * src/BufferView2.C (open_new_inset): delete the inset if it can
142 2000-10-30 Rob Lahaye <lahaye@postech.edu>
146 2000-10-29 Marko Vendelin <markov@ioc.ee>
147 * src/frontends/gnome/FormCitation.C
148 * src/frontends/gnome/FormCitation.h
149 * src/frontends/gnome/FormCopyright.C
150 * src/frontends/gnome/FormCopyright.h
151 * src/frontends/gnome/FormError.C
152 * src/frontends/gnome/FormError.h
153 * src/frontends/gnome/FormIndex.C
154 * src/frontends/gnome/FormIndex.h
155 * src/frontends/gnome/FormPrint.C
156 * src/frontends/gnome/FormPrint.h
157 * src/frontends/gnome/FormRef.C
158 * src/frontends/gnome/FormRef.h
159 * src/frontends/gnome/FormToc.C
160 * src/frontends/gnome/FormToc.h
161 * src/frontends/gnome/FormUrl.C
162 * src/frontends/gnome/FormUrl.h
163 * src/frontends/gnome/Menubar_pimpl.C
164 * src/frontends/gnome/mainapp.C
165 * src/frontends/gnome/mainapp.h
166 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
167 changing update() to updateSlot() where appropriate
169 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
171 * src/frontends/xforms/FormPreferences.[Ch]:
172 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
175 2000-10-28 Juergen Vigna <jug@sad.it>
177 * src/insets/insettabular.C (draw): fixed drawing bug.
179 * src/insets/insettext.C (clear):
181 (SetParagraphData): clearing the TEXT buffers when deleting the
182 paragraphs used by it.
184 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
186 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
188 2000-10-27 Juergen Vigna <jug@sad.it>
190 * src/tabular.C (~LyXTabular): removed not needed anymore.
192 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
195 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
197 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
200 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
203 * src/frontends/xforms/FormPreferences.[Ch]:
204 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
205 Reorganised as modules based on tabs. Much easier to follow the
206 flow and to add new tabs. Added warning and feedback messages.
209 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
211 * src/tabular.h (DocBook): add std:: qualifier.
213 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
215 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
216 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
219 * insettabular.C (DocBook): uses the tabular methods to export
222 * src/insets/insettext.h
223 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
225 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
227 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
230 * src/lyxfunc.C (MenuNew): lessen the scope of fname
231 moved misplaced AllowInput two lines up.
233 * src/buffer.C (readFile): compare float with float, not with int
235 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
237 * src/minibuffer.C: add "using SigC::slot" statement.
239 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
241 * src/frontends/xforms/forms/README: updated section about make.
243 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
244 Tidied some forms up, made two of form_tabular's tabs more
245 self-consistent, fixed Jean-Marc's size problem in form_preferences,
246 fixed translation problem with "Column".
248 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
250 * src/minibuffer.h: use Timeout instead of the xforms timer
252 (setTimer) rewrite for the Timeout, change to unsigned arg
253 (set): change to unsigned timer arg
256 * src/minibuffer.C (TimerCB): removed func
257 (C_MiniBuffer_TimerCB): removed func
258 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
259 (peek_event): use a switch statement
260 (add): don't use fl_add_timer.
261 (Set): rewrite to use the Timeout
264 * src/Timeout.[Ch] (setType): return a Timeout &
265 (setTimeout): ditto, change to unsigned arg for timeout
267 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
269 * src/mathed/formula.C (mathed_string_width): Use string instead
270 of a constant size char array.
272 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
274 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
275 the two recently added operator<< for SMInput and State.
277 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
279 (OkCancelPolicy): ditto
280 (OkCancelReadOnlyPolicy): ditto
281 (NoRepeatedApplyReadOnlyPolicy): ditto
282 (OkApplyCancelReadOnlyPolicy): ditto
283 (OkApplyCancelPolicy): ditto
284 (NoRepeatedApplyPolicy): ditto
286 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
288 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
289 add the usual std:: qualifiers.
291 2000-10-25 Juergen Vigna <jug@sad.it>
293 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
295 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
297 * src/support/filetools.C (MakeRelPath): change some types to
300 * src/frontends/ButtonPolicies.h (operator<<): new operator for
301 ButtonPolicy::SMInput and ButtonPolicy::State.
303 * src/FontLoader.C (reset): small cleanup
304 (unload): small cleanup
306 * src/FontInfo.C (getFontname): initialize error to 10000.0
308 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
310 * src/frontends/xforms/FormPreferences.[Ch]:
311 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
312 TeX encoding and default paper size sections.
314 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
316 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
319 * src/frontends/xforms/FormError.C (disconnect): use erase() to
320 make the message_ empty.
321 (FormError): don't initialize message_ in initializer list.
323 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
325 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
327 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
329 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
331 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
333 * src/frontends/kde/*data.[Ch]: _("") is not
336 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
338 * src/buffer.C: removed redundant using directive.
340 * src/frontends/DialogBase.h: revert to original definition of
343 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
344 stuff into two classes, one for each dialog, requires a new
345 element in the dialogs vector, FormTabularCreate.
347 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
350 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
351 method. Continues Allan's idea, but means that derived classes
352 don't need to worry about "update or hide?".
354 * src/frontends/xforms/FormError.C (showInset): add connection
357 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
358 one for each dialog. FormTabular now contains main tabular dialog
361 * src/frontends/xforms/FormTabularCreate.[Ch]:
362 * src/frontends/xforms/forms/form_tabular_create.fd: the create
365 * src/frontends/xforms/FormGraphics.[Ch]:
366 * src/frontends/xforms/forms/form_graphics.fd
367 * src/frontends/xforms/FormTabular.[Ch]:
368 * src/frontends/xforms/forms/form_tabular.fd: made daughter
369 classes of FormInset.
371 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
372 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
374 * src/frontends/xforms/Makefile.am:
375 * src/frontends/xforms/forms/makefile: added new files.
377 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
378 variable. added Signal0 hide signal, in keeping with other GUI-I
381 * src/support/lstrings.h: removed redundant std:: qualifier as
382 it's already declared in Lsstream.h.
384 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
386 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
390 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
392 * src/tabular.C (Ascii): minimize scope of cell.
394 * src/BufferView2.C (nextWord): return string() instead of 0;
396 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
398 * src/converter.h: add a std:: qualifier
400 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
402 * src/importer.[Ch]: New files. Used for importing files into LyX.
404 * src/lyxfunc.C (doImport): Use the new Importer class.
406 * src/converter.h: Add shortcut member to the Format class.
407 Used for holding the menu shortcut.
409 * src/converter.C and other files: Made a distinction between
410 format name and format extension. New formats can be defined using
411 the \format lyxrc tag.
412 Added two new converter flags: latex and disable.
414 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
416 * src/support/lyxlib.h: unify namespace/struct implementation.
417 Remove extra declarations.
419 * src/support/chdir.C (chdir): remove version taking char const *
421 * src/support/rename.C: ditto.
422 * src/support/lyxsum.C: ditto.
424 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
426 * src/frontends/xforms/FormBase.[Ch]:
427 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
428 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
429 work only for the next call to fl_show_form(). The correct place to set
430 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
431 done. FormBase also stores minw_, minh_ itself. All dialogs derived
432 from FormBase have the minimum size set; no more stupid crashes with
435 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
437 * lib/ui/default.ui: fix shortcut for Insert->Include File.
439 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
441 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
443 * src/support/lyxlib.h: changed second argument of mkdir to
444 unsigned long int (unsigned int would probably have been enough,
445 but...). Removed <sys/types.h> header.
446 * src/support/mkdir.C (mkdir): ditto.
450 2000-10-19 Juergen Vigna <jug@sad.it>
452 * src/lyxfunc.C (MenuNew): small fix (form John)
454 * src/screen.C (Update): removed unneeded code.
456 * src/tabular.C (Ascii): refixed int != uint bug!
458 * src/support/lyxlib.h: added sys/types.h include for now permits
459 compiling, but I don't like this!
461 2000-10-18 Juergen Vigna <jug@sad.it>
463 * src/text2.C (ClearSelection): if we clear the selection we need
464 more refresh so set the status apropriately
466 * src/insets/insettext.C (draw): hopefully finally fixed draw
469 2000-10-12 Juergen Vigna <jug@sad.it>
471 * src/insets/insettext.C (draw): another small fix and make a block
472 so that variables are localized.
474 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
476 * src/support/lstrings.C (lowercase, uppercase):
477 use explicit casts to remove compiler warnings.
479 * src/support/LRegex.C (Impl):
480 * src/support/StrPool.C (add):
481 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
482 (AddPath, MakeDisplayPath):
483 * src/support/lstrings.C (prefixIs, subst):
484 use correct type to remove compiler warnings.
486 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
488 * src/support/lyxlib.h:
489 * src/support/mkdir.C (mkdir): change parameter to mode_t for
490 portability and to remove compiler warning with DEC cxx.
492 * src/support/FileInfo.[Ch] (flagRWX): ditto.
494 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
496 * src/minibuffer.C (peek_event): retun 1 when there has been a
497 mouseclick in the minibuffer.
501 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
503 * src/frontends/xforms/FormParagraph.C: more space above/below
506 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
508 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
509 a char only if real_current_font was changed.
511 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
513 * NEWS: update somewhat for 1.1.6
515 * lib/ui/default.ui: clean up.
517 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
519 * lib/CREDITS: clean up
521 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
523 * src/combox.[Ch] (select): changed argument back to int
524 * src/combox.C (peek_event): removed num_bytes as it is declared but
527 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
528 modified calls to Combox::select() to remove warnings about type
531 * src/insets/insetbutton.C (width): explicit cast to remove warning
532 about type conversion.
534 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
537 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
538 sel_pos_end, refering to cursor position are changed to
539 LyXParagraph::size_type.
541 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
542 consistent with LyXCursor::pos().
543 (inset_pos): changed to LyXParagraph::size_type for same reason.
545 * src/insets/insettext.C (resizeLyXText): changed some temporary
546 variables refing to cursor position to LyXParagraph::size_type.
548 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
550 * src/frontends/kde/<various>: The Great Renaming,
553 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
555 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
557 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
559 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
560 0 when there are no arguments.
562 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
564 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
565 to segfaults when pressing Ok in InsetBibtex dialog.
567 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
569 * forms/layout_forms.fd:
570 * src/layout_forms.C (create_form_form_character): small change to use
571 labelframe rather than engraved frame + text
573 * src/lyx_gui.C (create_forms): initialise choice_language with some
574 arbitrary value to prevent segfault when dialog is shown.
576 2000-10-16 Baruch Even <baruch.even@writeme.com>
578 * src/converter.C (runLaTeX, scanLog): Added a warning when there
579 is no resulting file. This pertains only to LaTeX output.
581 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
583 * src/text.C (Backspace): Make sure that the row of the cursor is
586 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
589 * src/lyx_gui.C (init): Prevent a crash when only one font from
590 menu/popup fonts is not found.
592 * lib/lyxrc.example: Add an example for binding a key for language
595 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
597 * src/converter.C (GetReachable): Changed the returned type to
599 (IsReachable): New method
601 * src/MenuBackend.C (expand): Handle formats that appear more
604 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
606 * src/frontends/support/Makefile.am
607 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
610 * lib/CREDITS: add Garst Reese.
612 * src/support/snprintf.h: add extern "C" {} around the definitions.
614 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
616 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
619 * src/frontends/xforms/FormDocument.C:
620 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
621 compile without "conversion to integral type of smaller size"
624 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
626 * src/text.C (GetColumnNearX): Fixed disabled code.
628 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
630 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
633 * src/support/snprintf.[ch]: new files
635 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
637 * src/frontends/kde/formprintdialog.C: add
638 file browser for selecting postscript output
640 * src/frontends/kde/formprintdialogdata.C:
641 * src/frontends/kde/formprintdialogdata.h: re-generate
644 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
646 * src/frontends/gnome/Makefile.am:
647 * src/frontends/kde/Makefile.am: FormCommand.C
648 disappeared from xforms
650 * src/frontends/kde/FormCitation.C:
651 * src/frontends/kde/FormIndex.C: read-only
654 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
656 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
659 * src/bufferlist.C: add using directive.
661 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
663 * src/support/lyxfunctional.h: version of class_fun for void
664 returns added, const versions of back_inseter_fun and compare_fun
667 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
669 * src/frontends/xforms/FormInset.C (showInset): fix typo.
671 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
673 * ChangeLog: cleanup.
675 * lib/CREDITS: update to add all the contributors we've forgotten.
676 I have obviously missed some, so tell me whether there were
679 2000-10-13 Marko Vendelin <markov@ioc.ee>
681 * src/frontends/gnome/FormCitation.C
682 * src/frontends/gnome/FormCitation.h
683 * src/frontends/gnome/FormError.C
684 * src/frontends/gnome/FormIndex.C
685 * src/frontends/gnome/FormRef.C
686 * src/frontends/gnome/FormRef.h
687 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
689 * src/frontends/gnome/FormCitation.C
690 * src/frontends/gnome/FormCopyright.C
691 * src/frontends/gnome/FormError.C
692 * src/frontends/gnome/FormIndex.C
693 * src/frontends/gnome/FormRef.C
694 * src/frontends/gnome/FormToc.C
695 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
698 * src/frontends/gnome/Menubar_pimpl.C
699 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
702 2000-10-11 Baruch Even <baruch.even@writeme.com>
705 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
706 to convey its real action.
708 * src/minibuffer.C (peek_event): Added action when mouse clicks to
709 clear the minibuffer and prepare to enter a command.
711 * src/mathed/formula.C (LocalDispatch): Changed to conform with
712 the rename from ExecCommand to PrepareForCommand.
713 * src/lyxfunc.C (Dispatch): ditto.
715 2000-10-11 Baruch Even <baruch.even@writeme.com>
717 * src/buffer.C (writeFile): Added test for errors on writing, this
718 catches all errors and not only file system full errors as intended.
720 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
722 * src/lyx_gui.C (create_forms): better fix for crash with
723 translated interface.
725 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
727 * src/frontends/kde/Makefile.am:
728 * src/frontends/kde/FormCopyright.C:
729 * src/frontends/kde/formcopyrightdialog.C:
730 * src/frontends/kde/formcopyrightdialog.h:
731 * src/frontends/kde/formcopyrightdialogdata.C:
732 * src/frontends/kde/formcopyrightdialogdata.h:
733 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
734 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
735 copyright to use qtarch
737 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
739 * src/encoding.C (read): Fixed bug that caused an error message at
742 * po/Makefile.in.in: Fixed rule for ext_l10n.h
744 * lib/lyxrc.example: Fixed hebrew example.
746 2000-10-13 Allan Rae <rae@lyx.org>
748 * src/frontends/xforms/FormPreferences.C (input): reworking the
750 (build, update, apply): New inputs in various tabfolders
752 * src/frontends/xforms/FormToc.C: use new button policy.
753 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
754 dialogs that either can't use any existing policy or where it just
757 * src/frontends/xforms/FormTabular.h: removed copyright notice that
760 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
761 added a bool parameter which is ignored.
763 * src/buffer.C (setReadonly):
764 * src/BufferView_pimpl.C (buffer):
765 * src/frontends/kde/FormCopyright.h (update):
766 * src/frontends/kde/FormCitation.[Ch] (update):
767 * src/frontends/kde/FormIndex.[Ch] (update):
768 * src/frontends/kde/FormPrint.[Ch] (update):
769 * src/frontends/kde/FormRef.[Ch] (update):
770 * src/frontends/kde/FormToc.[Ch] (update):
771 * src/frontends/kde/FormUrl.[Ch] (update):
772 * src/frontends/gnome/FormCopyright.h (update):
773 * src/frontends/gnome/FormCitation.[Ch] (update):
774 * src/frontends/gnome/FormError.[Ch] (update):
775 * src/frontends/gnome/FormIndex.[Ch] (update):
776 * src/frontends/gnome/FormPrint.[Ch] (update):
777 * src/frontends/gnome/FormRef.h (update):
778 * src/frontends/gnome/FormToc.[Ch] (update):
779 * src/frontends/gnome/FormUrl.[Ch] (update):
780 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
781 to updateBufferDependent and DialogBase
783 * src/frontends/xforms/FormCitation.[hC]:
784 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
785 * src/frontends/xforms/FormError.[Ch]:
786 * src/frontends/xforms/FormGraphics.[Ch]:
787 * src/frontends/xforms/FormIndex.[Ch]:
788 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
789 and fixed readOnly handling.
790 * src/frontends/xforms/FormPrint.[Ch]:
791 * src/frontends/xforms/FormRef.[Ch]:
792 * src/frontends/xforms/FormTabular.[Ch]:
793 * src/frontends/xforms/FormToc.[Ch]:
794 * src/frontends/xforms/FormUrl.[Ch]:
795 * src/frontends/xforms/FormInset.[Ch]:
796 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
797 form of updateBufferDependent.
799 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
800 if form()->visible just in case someone does stuff to the form in a
803 * src/frontends/DialogBase.h (enum): removed enum since we can now use
804 the buttoncontroller for everything the enum used to be used for.
805 (update) It would seem we need to force all dialogs to use a bool
806 parameter or have two update functions. I chose to go with one.
807 I did try removing update() from here and FormBase and defining the
808 appropriate update signatures in FormBaseB[DI] but then ran into the
809 problem of the update() call in FormBase::show(). Whatever I did
810 to get around that would require another function and that just
811 got more confusing. Hence the decision to make everyone have an
812 update(bool). An alternative might have been to override show() in
813 FormBaseB[DI] and that would allow the different and appropriate
816 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
817 true == buffer change occurred. I decided against using a default
818 template parameter since not all compilers support that at present.
820 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
822 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
823 army knife" by removing functionality.
824 (clearStore): removed. All such housekeeping on hide()ing the dialog
825 is to be carried out by overloaded disconnect() methods.
826 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
827 superceded by Baruch's neat test (FormGraphics) to update an existing
828 dialog if a new signal is recieved rather than block all new signals
830 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
831 only to Inset dialogs.
832 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
833 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
835 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
837 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
838 as a base class to all inset dialogs. Used solely to connect/disconnect
839 the Inset::hide signal and to define what action to take on receipt of
840 a UpdateBufferDependent signal.
841 (FormCommand): now derived from FormInset.
843 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
846 * src/frontends/xforms/FormCopyright.[Ch]:
847 * src/frontends/xforms/FormPreferences.[Ch]:
848 now derived from FormBaseBI.
850 * src/frontends/xforms/FormDocument.[Ch]:
851 * src/frontends/xforms/FormParagraph.[Ch]:
852 * src/frontends/xforms/FormPrint.[Ch]:
853 now derived from FormBaseBD.
855 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
857 * src/frontends/xforms/FormCitation.[Ch]:
858 * src/frontends/xforms/FormError.[Ch]:
859 * src/frontends/xforms/FormRef.[Ch]:
860 * src/frontends/xforms/FormToc.[Ch]:
861 (clearStore): reworked as disconnect().
863 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
866 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
868 * src/converter.C (runLaTeX): constify buffer argument
871 * src/frontends/support/Makefile.am (INCLUDES): fix.
873 * src/buffer.h: add std:: qualifier
874 * src/insets/figinset.C (addpidwait): ditto
875 * src/MenuBackend.C: ditto
876 * src/buffer.C: ditto
877 * src/bufferlist.C: ditto
878 * src/layout.C: ditto
879 * src/lyxfunc.C: ditto
881 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
883 * src/lyxtext.h (bidi_level): change return type to
884 LyXParagraph::size_type.
886 * src/lyxparagraph.h: change size_type to
887 TextContainer::difference_type. This should really be
888 TextContainer::size_type, but we need currently to support signed
891 2000-10-11 Marko Vendelin <markov@ioc.ee>
892 * src/frontends/gnome/FormError.h
893 * src/frontends/gnome/FormRef.C
894 * src/frontends/gnome/FormRef.h
895 * src/frontends/gnome/FormError.C
896 * src/frontends/gnome/Makefile.am
897 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
898 to Gnome frontend. Both dialogs use "action" area.
900 2000-10-12 Baruch Even <baruch.even@writeme.com>
902 * src/graphics/GraphicsCacheItem_pimpl.C:
903 * src/graphics/Renderer.C:
904 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
907 2000-10-12 Juergen Vigna <jug@sad.it>
909 * src/insets/insettext.C (draw): fixed drawing bug (specifically
910 visible when selecting).
912 * development/Code_rules/Rules: fixed some typos.
914 2000-10-09 Baruch Even <baruch.even@writeme.com>
916 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
917 compiling on egcs 1.1.2 possible.
919 * src/filedlg.C (comp_direntry::operator() ): ditto.
921 2000-08-31 Baruch Even <baruch.even@writeme.com>
923 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
926 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
927 transient it now only gets freed when the object is destructed.
929 2000-08-24 Baruch Even <baruch.even@writeme.com>
931 * src/frontends/FormGraphics.h:
932 * src/frontends/FormGraphics.C: Changed to use ButtonController and
935 2000-08-20 Baruch Even <baruch.even@writeme.com>
937 * src/insets/insetgraphics.C:
938 (draw): Added messages to the drawn rectangle to report status.
939 (updateInset): Disabled the use of the inline graphics,
942 2000-08-17 Baruch Even <baruch.even@writeme.com>
944 * src/frontends/support: Directory added for the support of GUII LyX.
946 * src/frontends/support/LyXImage.h:
947 * src/frontends/support/LyXImage.C: Base class for GUII holding of
950 * src/frontends/support/LyXImage_X.h:
951 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
952 version of LyXImage, this uses the Xlib Pixmap.
957 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
958 replacement to Pixmap.
960 * src/insets/insetgraphics.h:
961 * src/insets/insetgraphics.C:
962 * src/graphics/GraphicsCacheItem.h:
963 * src/graphics/GraphicsCacheItem.C:
964 * src/graphics/GraphicsCacheItem_pimpl.h:
965 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
968 * src/graphics/GraphicsCacheItem.h:
969 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
970 another copy of the object.
972 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
973 of cacheHandle, this fixed a bug that sent LyX crashing.
975 * src/graphics/XPM_Renderer.h:
976 * src/graphics/XPM_Renderer.C:
977 * src/graphics/EPS_Renderer.h:
978 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
980 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
982 * src/lyxfunc.C (processKeySym): only handle the
983 lockinginset/inset stuff if we have a buffer and text loaded...
985 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
987 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
989 * src/support/lyxfunctional.h: add operator= that takes a reference
991 * src/lyxserver.C (mkfifo): make first arg const
993 * src/layout.h: renamed name(...) to setName(...) to work around
996 * src/buffer.C (setFileName): had to change name of function to
997 work around bugs in egcs. (renamed from fileName)
999 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1001 * src/support/translator.h: move helper template classes to
1002 lyxfunctional.h, include "support/lyxfunctional.h"
1004 * src/support/lyxmanip.h: add delaration of fmt
1006 * src/support/lyxfunctional.h: new file
1007 (class_fun_t): new template class
1008 (class_fun): helper template function
1009 (back_insert_fun_iterator): new template class
1010 (back_inserter_fun): helper template function
1011 (compare_memfun_t): new template class
1012 (compare_memfun): helper template function
1013 (equal_1st_in_pair): moved here from translator
1014 (equal_2nd_in_pair): moved here from translator
1016 * src/support/fmt.C: new file
1017 (fmt): new func, can be used for a printf substitute when still
1018 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1020 * src/support/StrPool.C: add some comments
1022 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1025 * src/insets/figinset.C (addpidwait): use std::copy with
1026 ostream_iterator to fill the pidwaitlist
1028 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1030 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1033 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1036 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1038 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1039 (class_update): ditto
1040 (BulletPanel): ditto
1041 (CheckChoiceClass): move initialization of tc and tct
1043 * src/tabular.C: remove current_view
1044 (OldFormatRead): similar to right below [istream::ignore]
1046 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1047 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1048 unused [istream::ignore]
1050 * src/lyxfunc.C: include "support/lyxfunctional.h"
1051 (getInsetByCode): use std::find_if and compare_memfun
1053 * src/lyxfont.C (stateText): remove c_str()
1055 * src/lyx_main.C (setDebuggingLevel): make static
1056 (commandLineHelp): make static
1058 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1059 Screen* together with fl_get_display() and fl_screen
1061 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1062 togheter with fl_get_display() and fl_screen
1063 (create_forms): remove c_str()
1065 * src/layout.C: include "support/lyxfunctional.h"
1066 (hasLayout): use std::find_if and compare_memfun
1067 (GetLayout): use std::find_if and comapre_memfun
1068 (delete_layout): use std::remove_if and compare_memfun
1069 (NumberOfClass): use std:.find_if and compare_memfun
1071 * src/gettext.h: change for the new functions
1073 * src/gettext.C: new file, make _(char const * str) and _(string
1074 const & str) real functions.
1076 * src/font.C (width): rewrite slightly to avoid one extra variable
1078 * src/debug.C: initialize Debug::ANY here
1080 * src/commandtags.h: update number comments
1082 * src/combox.h (get): make const func
1084 (getline): make const
1086 * src/combox.C (input_cb): handle case where fl_get_input can
1089 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1090 "support/lyxfunctional.h", remove current_view variable.
1091 (resize): use std::for_each with std::mem_fun
1092 (getFileNames): use std::copy with back_inserter_fun
1093 (getBuffer): change arg type to unsigned int
1094 (emergencyWriteAll): call emergencyWrite with std::for_each and
1096 (emergencyWrite): new method, the for loop in emergencyWriteAll
1098 (exists): use std::find_if with compare_memfun
1099 (getBuffer): use std::find_if and compare_memfun
1101 * src/buffer.h: add typedefs for iterator_category, value_type
1102 difference_type, pointer and reference for inset_iterator
1103 add postfix ++ for inset_iterator
1104 make inset_iterator::getPos() const
1106 * src/buffer.C: added support/lyxmanip.h
1107 (readFile): use lyxerr << fmt instead of printf
1108 (makeLaTeXFile): use std::copy to write out encodings
1110 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1112 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1113 free and the char * temp.
1114 (hasMenu): use std::find_if and compare_memfun
1117 * src/Makefile.am (lyx_SOURCES): added gettext.C
1119 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1120 string::insert small change to avoid temporary
1122 * src/LColor.C (getGUIName): remove c_str()
1124 * several files: change all occurrences of fl_display to
1127 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1128 that -pedantic is not used for gcc 2.97 (cvs gcc)
1130 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1132 2000-10-11 Allan Rae <rae@lyx.org>
1134 * src/frontends/xforms/FormPreferences.C (input): template path must be
1135 a readable directory. It doesn't need to be writeable.
1136 (build, delete, update, apply): New inputs in the various tabfolders
1138 * src/frontends/xforms/forms/form_preferences.fd:
1139 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1140 several new entries to existing folders. Shuffled some existing stuff
1143 * src/frontends/xforms/forms/form_print.fd:
1144 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1145 Should probably rework PrinterParams as well. Note that the switch to
1146 collated is effectively the same as !unsorted so changing PrinterParams
1147 will require a lot of fiddly changes to reverse the existing logic.
1149 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1151 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1153 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1155 2000-10-10 Allan Rae <rae@lyx.org>
1158 * src/lyxfunc.C (Dispatch):
1160 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1163 * src/lyxrc.C (output): Only write the differences between system lyxrc
1164 and the users settings.
1167 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1169 I'll rewrite this later, after 1.1.6 probably, to keep a single
1170 LyXRC but two instances of a LyXRCStruct.
1172 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1174 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1176 * src/tabular.h: add a few std:: qualifiers.
1178 * src/encoding.C: add using directive.
1179 * src/language.C: ditto.
1181 * src/insets/insetquotes.C (Validate): use languages->lang()
1182 instead of only language.
1184 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1186 * lib/languages: New file.
1188 * lib/encodings: New file.
1190 * src/language.C (Languages): New class.
1191 (read): New method. Reads the languages from the 'languages' file.
1193 * src/encoding.C (Encodings): New class.
1194 (read): New method. Reads the encodings from the 'encodings' file.
1196 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1199 * src/bufferparams.h and a lot of files: Deleted the member language,
1200 and renamed language_info to language
1202 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1203 * src/lyxfont.C (latexWriteStartChanges): ditto.
1204 * src/paragraph.C (validate,TeXOnePar): ditto.
1206 * src/lyxfont.C (update): Restored deleted code.
1208 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1210 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1212 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1214 * src/insets/figinset.[Ch]:
1215 * src/insets/insetinclude.[Ch]:
1216 * src/insets/insetinclude.[Ch]:
1217 * src/insets/insetparent.[Ch]:
1218 * src/insets/insetref.[Ch]:
1219 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1221 * src/insets/*.[Ch]:
1222 * src/mathed/formula.[Ch]:
1223 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1225 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1226 * src/lyx_cb.C (FigureApplyCB):
1227 * src/lyxfunc.C (getStatus, Dispatch):
1228 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1231 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1233 * src/converter.[Ch] (Formats::View):
1234 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1236 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1237 *current_view->buffer(). This will change later, but this patch is way
1240 2000-10-09 Juergen Vigna <jug@sad.it>
1242 * src/text.C (GetRow): small fix.
1244 * src/BufferView_pimpl.C (cursorPrevious):
1245 (cursorNext): added LyXText parameter to function.
1247 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1248 keypress depending on cursor position.
1250 2000-10-06 Juergen Vigna <jug@sad.it>
1252 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1253 (copySelection): redone this function and also copy ascii representa-
1256 * src/tabular.C (Ascii):
1260 (print_n_chars): new functions to realize the ascii export of tabulars.
1262 2000-10-05 Juergen Vigna <jug@sad.it>
1264 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1265 if we don't have a buffer.
1267 2000-10-10 Allan Rae <rae@lyx.org>
1269 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1270 with closing dialog. It seems that nested tabfolders require hiding
1271 of inner tabfolders before hiding the dialog itself. Actually all I
1272 did was hide the active outer folder.
1274 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1275 unless there really is a buffer. hideBufferDependent is called
1278 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1279 POTFILES.in stays in $(srcdir).
1281 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1283 * lib/lyxrc.example: Few changes.
1285 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1287 * src/BufferView_pimpl.C (buffer): only need one the
1288 updateBufferDependent signal to be emitted once! Moved to the end of
1289 the method to allow bv_->text to be updated first.
1291 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1292 and hSignal_ with Dialogs * and BufferDependency variables.
1293 New Buffer * parent_, initialised when the dialog is launched. Used to
1294 check whether to update() or hide() dialog in the new, private
1295 updateOrHide() method that is connected to the updateBufferDependent
1296 signal. Daughter classes dictate what to do using the
1297 ChangedBufferAction enum, passed to the c-tor.
1299 * src/frontends/xforms/FormCitation.C:
1300 * src/frontends/xforms/FormCommand.C:
1301 * src/frontends/xforms/FormCopyright.C:
1302 * src/frontends/xforms/FormDocument.C:
1303 * src/frontends/xforms/FormError.C:
1304 * src/frontends/xforms/FormIndex.C:
1305 * src/frontends/xforms/FormPreferences.C:
1306 * src/frontends/xforms/FormPrint.C:
1307 * src/frontends/xforms/FormRef.C:
1308 * src/frontends/xforms/FormToc.C:
1309 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1312 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1313 ChangedBufferAction enum.
1315 * src/frontends/xforms/FormParagraph.[Ch]
1316 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1319 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1321 * lib/bind/cua.bind: fix a bit.
1322 * lib/bind/emacs.bind: ditto.
1324 * lib/bind/menus.bind: remove real menu entries from there.
1326 * src/spellchecker.C: make sure we only include strings.h when
1329 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1331 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1332 function. It enlarges the maximum number of pup when needed.
1333 (add_toc2): Open a new menu if maximum number of items per menu has
1336 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1338 * src/frontends/kde/FormPrint.C: fix error reporting
1340 * src/frontends/xforms/FormDocument.C: fix compiler
1343 * lib/.cvsignore: add Literate.nw
1345 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1348 * bufferview_funcs.[Ch]
1351 * text2.C: Add support for numbers in RTL text.
1353 2000-10-06 Allan Rae <rae@lyx.org>
1355 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1356 to be gettext.m4 friendly again. ext_l10n.h is now
1357 generated into $top_srcdir instead of $top_builddir
1358 so that lyx.pot will be built correctly -- without
1359 duplicate parsing of ext_l10n.h.
1361 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1363 * src/frontends/kde/FormCitation.C: make the dialog
1364 behave more sensibly
1366 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1368 * config/kde.m4: fix consecutive ./configure runs,
1369 look for qtarch, fix library order
1371 * src/frontends/kde/Makefile.am: tidy up,
1372 add Print dialog, add .dlg dependencies
1374 * src/frontends/kde/FormPrint.C:
1375 * src/frontends/kde/FormPrint.h:
1376 * src/frontends/kde/formprintdialog.C:
1377 * src/frontends/kde/formprintdialog.h:
1378 * src/frontends/kde/formprintdialogdata.C:
1379 * src/frontends/kde/formprintdialogdata.h:
1380 * src/frontends/kde/dlg/formprintdialog.dlg: add
1383 * src/frontends/kde/dlg/README: Added explanatory readme
1385 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1386 script to double-check qtarch's output
1388 * src/frontends/kde/formindexdialog.C:
1389 * src/frontends/kde/formindexdialogdata.C:
1390 * src/frontends/kde/formindexdialogdata.h:
1391 * src/frontends/kde/dlg/formindexdialog.dlg: update
1392 for qtarch, minor fixes
1394 2000-10-05 Allan Rae <rae@lyx.org>
1396 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1397 dialogs when switching buffers update them instead. It's up to each
1398 dialog to decide if it should still be visible or not.
1399 update() should return a bool to control visiblity within show().
1400 Or perhaps better to set a member variable and use that to control
1403 * lib/build-listerrors: create an empty "listerrors" file just to stop
1404 make trying to regenerate it all the time if you don't have noweb
1407 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1409 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1410 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1411 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1412 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1413 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1415 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1417 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1419 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1420 deleting buffer. Closes all buffer-dependent dialogs.
1422 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1424 * src/frontends/xforms/FormCitation.[Ch]:
1425 * src/frontends/xforms/FormPreferences.[Ch]:
1426 * src/frontends/xforms/FormPrint.[Ch]:
1427 * src/frontends/xforms/FormRef.[Ch]:
1428 * src/frontends/xforms/FormUrl.[Ch]: ditto
1430 * src/frontends/xforms/FormDocument.[Ch]:
1431 * src/frontends/xforms/forms/form_document.C.patch:
1432 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1433 pass through a single input() function.
1435 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1437 * lib/build-listerrors: return status as OK
1439 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1441 * lib/lyxrc.example: Updated to new export code
1443 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1445 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1448 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1451 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1452 LyX-Code is defined.
1453 * lib/layouts/amsbook.layout: ditto.
1455 * boost/Makefile.am: fix typo.
1457 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1459 (add_lastfiles): removed.
1460 (add_documents): removed.
1461 (add_formats): removed.
1463 * src/frontends/Menubar.C: remove useless "using" directive.
1465 * src/MenuBackend.h: add a new MenuItem constructor.
1467 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1470 2000-10-04 Allan Rae <rae@lyx.org>
1472 * lib/Makefile.am (listerrors):
1473 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1474 I haven't got notangle installed so Kayvan please test. The output
1475 should end up in $builddir. This also allows people who don't have
1476 noweb installed to complete the make process without error.
1478 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1479 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1480 by JMarc's picky compiler.
1482 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1485 * src/insets/insettabular.C (setPos): change for loop to not use
1486 sequencing operator. Please check this Jürgen.
1488 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1490 * src/insets/insetcite.C (getScreenLabel): ditto
1491 * src/support/filetools.C (QuoteName): ditto
1492 (ChangeExtension): ditto
1494 * src/BufferView_pimpl.C (scrollCB): make heigt int
1496 * src/BufferView2.C (insertInset): comment out unused arg
1498 * boost/Makefile.am (EXTRADIST): new variable
1500 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1502 * src/exporter.C (IsExportable): Fixed
1504 * lib/configure.m4: Small fix
1506 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1508 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1509 * src/insets/insetbib.C (bibitemWidest): ditto.
1510 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1512 2000-10-03 Juergen Vigna <jug@sad.it>
1514 * src/BufferView2.C (theLockingInset): removed const because of
1515 Agnus's compile problems.
1517 * src/insets/insettext.C (LocalDispatch): set the language of the
1518 surronding paragraph on inserting the first character.
1520 * various files: changed use of BufferView::the_locking_inset.
1522 * src/BufferView2.C (theLockingInset):
1523 (theLockingInset): new functions.
1525 * src/BufferView.h: removed the_locking_inset.
1527 * src/lyxtext.h: added the_locking_inset
1529 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1531 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1533 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1535 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1536 * src/mathed/math_cursor.C (IsAlpha): ditto.
1537 * src/mathed/math_inset.C (strnew): ditto.
1538 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1539 (IMetrics): cxp set but never used; removed.
1540 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1541 that the variable in question has been removed also!
1544 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1545 using the Buffer * passed to Latex(), using the BufferView * passed to
1546 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1548 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1549 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1551 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1552 * src/buffer.C (readInset): used new InsetBibtex c-tor
1553 * (getBibkeyList): used new InsetBibtex::getKeys
1555 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1558 * lib/build-listerrors
1560 * src/exporter.C: Add literate programming support to the export code
1563 * src/lyx_cb.C: Remove old literate code.
1565 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1568 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1569 * src/converter.C (View, Convert): Use QuoteName.
1571 * src/insets/figinset.C (Preview): Use Formats::View.
1573 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1575 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1577 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1578 the top of the function, because compaq cxx complains that the
1579 "goto exit_with_message" when the function is disabled bypasses
1581 (MenuNew): try a better fix for the generation of new file names.
1582 This time, I used AddName() instead of AddPath(), hoping Juergen
1585 2000-10-03 Allan Rae <rae@lyx.org>
1587 * src/frontends/xforms/forms/form_preferences.fd:
1588 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1589 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1590 "Look and Feel"->"General" but will need to be split up further into
1591 general output and general input tabs. Current plan is for four outer
1592 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1593 stuff; "Inputs" for input and import configuration; "Outputs" for
1594 output and export configuration; and one more whatever is left over
1595 called "General". The leftovers at present look like being which
1596 viewers to use, spellchecker, language support and might be better
1597 named "Support". I've put "Paths" in "Inputs" for the moment as this
1598 seems reasonable for now at least.
1599 One problem remains: X error kills LyX when you close Preferences.
1601 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1603 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1604 qualifier from form()
1605 * src/frontends/xforms/FormCitation.[Ch]:
1606 * src/frontends/xforms/FormCopyright.[Ch]:
1607 * src/frontends/xforms/FormDocument.[Ch]:
1608 * src/frontends/xforms/FormError.[Ch]:
1609 * src/frontends/xforms/FormIndex.[Ch]:
1610 * src/frontends/xforms/FormPreferences.[Ch]:
1611 * src/frontends/xforms/FormPrint.[Ch]:
1612 * src/frontends/xforms/FormRef.[Ch]:
1613 * src/frontends/xforms/FormToc.[Ch]:
1614 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1616 * src/frontends/xforms/FormCitation.[Ch]:
1617 * src/frontends/xforms/FormIndex.[Ch]:
1618 * src/frontends/xforms/FormRef.[Ch]:
1619 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1620 with Allan's naming policy
1622 * src/frontends/xforms/FormCitation.C: some static casts to remove
1625 2000-10-02 Juergen Vigna <jug@sad.it>
1627 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1628 now you can type or do stuff inside the table-cell also when in dummy
1629 position, fixed visible cursor.
1631 * src/insets/insettext.C (Edit): fixing cursor-view position.
1633 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1634 be used for equal functions in lyxfunc and insettext.
1636 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1638 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1640 * src/frontends/gnome/FormCitation.h:
1641 * src/frontends/gnome/FormCopyright.h:
1642 * src/frontends/gnome/FormIndex.h:
1643 * src/frontends/gnome/FormPrint.h:
1644 * src/frontends/gnome/FormToc.h:
1645 * src/frontends/gnome/FormUrl.h:
1646 * src/frontends/kde/FormCitation.h:
1647 * src/frontends/kde/FormCopyright.h:
1648 * src/frontends/kde/FormIndex.h:
1649 * src/frontends/kde/FormRef.h:
1650 * src/frontends/kde/FormToc.h:
1651 * src/frontends/kde/FormUrl.h: fix remaining users of
1654 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1656 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1657 from depth argument.
1658 (DocBookHandleCaption): ditto.
1659 (DocBookHandleFootnote): ditto.
1660 (SimpleDocBookOnePar): ditto.
1662 * src/frontends/xforms/FormDocument.h (form): remove extra
1663 FormDocument:: qualifier.
1665 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1667 * sigc++/handle.h: ditto.
1669 * src/lyx_gui_misc.C: add "using" directive.
1671 * src/cheaders/cstddef: new file, needed by the boost library (for
1674 2000-10-02 Juergen Vigna <jug@sad.it>
1676 * src/insets/insettext.C (SetFont): better support.
1678 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1680 * src/screen.C (DrawOneRow): some uint refixes!
1682 2000-10-02 Allan Rae <rae@lyx.org>
1684 * boost/.cvsignore: ignore Makefile as well
1686 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1687 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1689 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1690 Left this one out by accident.
1692 * src/frontends/xforms/FormBase.h (restore): default to calling
1693 update() since that will restore the original/currently-applied values.
1694 Any input() triggered error messages will require the derived classes
1695 to redefine restore().
1697 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1698 avoid a segfault. combo_doc_class is the main concern.
1700 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1702 * Simplify build-listerrors in view of GUI-less export ability!
1704 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1706 * src/lyx_main.C (easyParse): Disable gui when exporting
1708 * src/insets/figinset.C:
1711 * src/lyx_gui_misc.C
1712 * src/tabular.C: Changes to allow no-gui.
1714 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1716 * src/support/utility.hpp: removed file
1717 * src/support/block.h: removed file
1719 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1722 * src/mathed/formula.C: add support/lyxlib.h
1723 * src/mathed/formulamacro.C: ditto
1725 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1726 * src/lyxparagraph.h: ditto
1728 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1729 * src/frontends/Makefile.am (INCLUDES): ditto
1730 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1731 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1732 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1733 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1734 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1735 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1737 * src/BufferView.h: use boost/utility.hpp
1738 * src/LColor.h: ditto
1739 * src/LaTeX.h: ditto
1740 * src/LyXAction.h: ditto
1741 * src/LyXView.h: ditto
1742 * src/bufferlist.h: ditto
1743 * src/lastfiles.h: ditto
1744 * src/layout.h: ditto
1745 * src/lyx_gui.h: ditto
1746 * src/lyx_main.h: ditto
1747 * src/lyxlex.h: ditto
1748 * src/lyxrc.h: ditto
1749 * src/frontends/ButtonPolicies.h: ditto
1750 * src/frontends/Dialogs.h: ditto
1751 * src/frontends/xforms/FormBase.h: ditto
1752 * src/frontends/xforms/FormGraphics.h: ditto
1753 * src/frontends/xforms/FormParagraph.h: ditto
1754 * src/frontends/xforms/FormTabular.h: ditto
1755 * src/graphics/GraphicsCache.h: ditto
1756 * src/graphics/Renderer.h: ditto
1757 * src/insets/ExternalTemplate.h: ditto
1758 * src/insets/insetcommand.h: ditto
1759 * src/support/path.h: ditto
1761 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1762 and introduce clause for 2.97.
1764 * boost/libs/README: new file
1766 * boost/boost/utility.hpp: new file
1768 * boost/boost/config.hpp: new file
1770 * boost/boost/array.hpp: new file
1772 * boost/Makefile.am: new file
1774 * boost/.cvsignore: new file
1776 * configure.in (AC_OUTPUT): add boost/Makefile
1778 * Makefile.am (SUBDIRS): add boost
1780 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1782 * src/support/lstrings.C (suffixIs): Fixed.
1784 2000-10-01 Allan Rae <rae@lyx.org>
1786 * src/PrinterParams.h: moved things around to avoid the "can't
1787 inline call" warning.
1789 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1790 into doc++ documentation.
1792 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1794 * src/frontends/xforms/FormRef.C: make use of button controller
1795 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1796 cleaned up button controller usage.
1797 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1798 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1799 use the button controller
1801 * src/frontends/xforms/forms/*.fd: and associated generated files
1802 updated to reflect changes to FormBase. Some other FormXxxx files
1803 also got minor updates to reflect changes to FormBase.
1805 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1806 (hide): made virtual.
1807 (input): return a bool. true == valid input
1808 (RestoreCB, restore): new
1809 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1810 Changes to allow derived dialogs to use a ButtonController and
1811 make sense when doing so: OK button calls ok() and so on.
1813 * src/frontends/xforms/ButtonController.h (class ButtonController):
1814 Switch from template implementation to taking Policy parameter.
1815 Allows FormBase to provide a ButtonController for any dialog.
1817 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1818 Probably should rename connect and disconnect.
1819 (apply): use the radio button groups
1820 (form): needed by FormBase
1821 (build): setup the radio button groups
1823 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1825 * several files: type changes to reduce the number of warnings and
1826 to unify type hangling a bit. Still much to do.
1828 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1830 * lib/images/*: rename a bunch of icons to match Dekel converter
1833 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1836 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1838 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1840 * sigc++/handle.h: ditto for class Handle.
1842 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1844 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1846 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1848 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1849 removal of the "default" language.
1851 * src/combox.h (getline): Check that sel > 0
1853 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1855 * lib/examples/docbook_example.lyx
1856 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1858 * lib/layouts/docbook-book.layout: new docbook book layout.
1860 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1862 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1864 * src/insets/figinset.C (DocBook):fixed small typo.
1866 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1868 * src/insets/insetinclude.h: string include_label doesn't need to be
1871 2000-09-29 Allan Rae <rae@lyx.org>
1873 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1874 Allow derived type to control connection and disconnection from signals
1875 of its choice if desired.
1877 2000-09-28 Juergen Vigna <jug@sad.it>
1879 * src/insets/insettabular.C (update): fixed cursor setting when
1880 the_locking_inset changed.
1881 (draw): made this a bit cleaner.
1882 (InsetButtonPress): fixed!
1884 * various files: added LyXText Parameter to fitCursor call.
1886 * src/BufferView.C (fitCursor): added LyXText parameter.
1888 * src/insets/insettabular.C (draw): small draw fix.
1890 * src/tabular.C: right setting of left/right celllines.
1892 * src/tabular.[Ch]: fixed various types in funcions and structures.
1893 * src/insets/insettabular.C: ditto
1894 * src/frontends/xforms/FormTabular.C: ditto
1896 2000-09-28 Allan Rae <rae@lyx.org>
1898 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1899 that the #ifdef's had been applied to part of what should have been
1900 a complete condition. It's possible there are other tests that
1901 were specific to tables that are also wrong now that InsetTabular is
1902 being used. Now we need to fix the output of '\n' after a table in a
1903 float for the same reason as the original condition:
1904 "don't insert this if we would be adding it before or after a table
1905 in a float. This little trick is needed in order to allow use of
1906 tables in \subfigures or \subtables."
1907 Juergen can you check this?
1909 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1911 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1912 output to the ostream.
1914 * several files: fixed types based on warnings from cxx
1916 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1918 * src/frontends/kde/Makefile.am: fix rule for
1919 formindexdialogdata_moc.C
1921 * src/.cvsignore: add ext_l10n.h to ignore
1923 * acconfig.h: stop messing with __STRICT_ANSI__
1924 * config/gnome.m4: remove option to set -ansi
1925 * config/kde.m4: remove option to set -ansi
1926 * config/lyxinclude.m4: don't set -ansi
1928 2000-09-27 Juergen Vigna <jug@sad.it>
1930 * various files: remove "default" language check.
1932 * src/insets/insetquotes.C: removed use of current_view.
1934 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1935 the one should have red ears by now!
1937 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1938 in more then one paragraph. Fixed cursor-movement/selection.
1940 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1941 paragraphs inside a text inset.
1943 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1944 text-inset if this owner is an inset.
1946 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1948 * src/Bullet.h: changed type of font, character and size to int
1950 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1952 * src/insets/inseturl.[Ch]:
1953 * src/insets/insetref.[Ch]:
1954 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1956 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1958 * src/buffer.C (readFile): block-if statement rearranged to minimise
1959 bloat. Patch does not reverse Jean-Marc's change ;-)
1961 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1962 Class rewritten to store pointers to hide/update signals directly,
1963 rather than Dialogs *. Also defined an enum to ease use. All xforms
1964 forms can now be derived from this class.
1966 * src/frontends/xforms/FormCommand.[Ch]
1967 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1969 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1972 * src/frontends/xforms/forms/form_citation.fd
1973 * src/frontends/xforms/forms/form_copyright.fd
1974 * src/frontends/xforms/forms/form_error.fd
1975 * src/frontends/xforms/forms/form_index.fd
1976 * src/frontends/xforms/forms/form_ref.fd
1977 * src/frontends/xforms/forms/form_toc.fd
1978 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1980 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1982 * src/insets/insetfoot.C: removed redundent using directive.
1984 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1986 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1987 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1989 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1990 created in the constructors in different groups. Then set() just
1991 have to show the groups as needed. This fixes the redraw problems
1992 (and is how the old menu code worked).
1994 * src/support/lyxlib.h: declare the methods as static when we do
1995 not have namespaces.
1997 2000-09-26 Juergen Vigna <jug@sad.it>
1999 * src/buffer.C (asciiParagraph): new function.
2000 (writeFileAscii): new function with parameter ostream.
2001 (writeFileAscii): use now asciiParagraph.
2003 * various inset files: added the linelen parameter to the Ascii-func.
2005 * src/tabular.C (Write): fixed error in writing file introduced by
2006 the last changes from Lars.
2008 * lib/bind/menus.bind: removed not supported functions.
2010 * src/insets/insettext.C (Ascii): implemented this function.
2012 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2014 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2015 (Write): use of the write_attribute functions.
2017 * src/bufferlist.C (close): fixed reasking question!
2019 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2021 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2022 new files use the everwhere possible.
2025 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2026 src/log_form.C src/lyx.C:
2029 * src/buffer.C (runLaTeX): remove func
2031 * src/PaperLayout.C: removed file
2032 * src/ParagraphExtra.C: likewise
2033 * src/bullet_forms.C: likewise
2034 * src/bullet_forms.h: likewise
2035 * src/bullet_forms_cb.C: likewise
2037 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2038 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2041 * several files: remove all traces of the old fd_form_paragraph,
2042 and functions belonging to that.
2044 * several files: remove all traces of the old fd_form_document,
2045 and functions belonging to that.
2047 * several files: constify local variables were possible.
2049 * several files: remove all code that was dead when NEW_EXPORT was
2052 * several files: removed string::c_str in as many places as
2055 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2056 (e): be a bit more outspoken when patching
2057 (updatesrc): only move files if changed.
2059 * forms/layout_forms.h.patch: regenerated
2061 * forms/layout_forms.fd: remove form_document and form_paragraph
2062 and form_quotes and form_paper and form_table_options and
2063 form_paragraph_extra
2065 * forms/form1.fd: remove form_table
2067 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2068 the fdui->... rewrite. Update some comments to xforms 0.88
2070 * forms/bullet_forms.C.patch: removed file
2071 * forms/bullet_forms.fd: likewise
2072 * forms/bullet_forms.h.patch: likewise
2074 * development/Code_rules/Rules: added a section on switch
2075 statements. Updated some comment to xforms 0.88.
2077 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2079 * src/buffer.C (readFile): make sure that the whole version number
2080 is read after \lyxformat (even when it contains a comma)
2082 * lib/ui/default.ui: change shortcut of math menu to M-a.
2084 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2086 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2089 * src/LyXView.C (updateWindowTitle): show the full files name in
2090 window title, limited to 30 characters.
2092 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2093 When a number of characters has been given, we should not assume
2094 that the string is 0-terminated.
2096 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2097 calls (fixes some memory leaks)
2099 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2100 trans member on exit.
2102 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2104 * src/converter.C (GetReachable): fix typo.
2106 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2107 understand ',' instead of '.'.
2108 (GetInteger): rewrite to use strToInt().
2110 2000-09-26 Juergen Vigna <jug@sad.it>
2112 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2113 better visibility and error-message on wrong VSpace input.
2115 * src/language.C (initL): added english again.
2117 2000-09-25 Juergen Vigna <jug@sad.it>
2119 * src/frontends/kde/Dialogs.C (Dialogs):
2120 * src/frontends/gnome/Dialogs.C (Dialogs):
2121 * src/frontends/kde/Makefile.am:
2122 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2124 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2126 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2128 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2130 * src/frontends/xforms/FormParagraph.C:
2131 * src/frontends/xforms/FormParagraph.h:
2132 * src/frontends/xforms/form_paragraph.C:
2133 * src/frontends/xforms/form_paragraph.h:
2134 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2137 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2139 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2140 Paragraph-Data after use.
2142 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2143 non breakable paragraphs.
2145 2000-09-25 Garst R. Reese <reese@isn.net>
2147 * src/language.C (initL): added missing language_country codes.
2149 2000-09-25 Juergen Vigna <jug@sad.it>
2151 * src/insets/insettext.C (InsetText):
2152 (deleteLyXText): remove the not released LyXText structure!
2154 2000-09-24 Marko Vendelin <markov@ioc.ee>
2156 * src/frontends/gnome/mainapp.C
2157 * src/frontends/gnome/mainapp.h: added support for keyboard
2160 * src/frontends/gnome/FormCitation.C
2161 * src/frontends/gnome/FormCitation.h
2162 * src/frontends/gnome/Makefile.am
2163 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2164 FormCitation to use "action area" in mainapp window
2166 * src/frontends/gnome/Menubar_pimpl.C
2167 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2170 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2172 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2173 width/descent/ascent values if name is empty.
2174 (mathed_string_height): Use std::max.
2176 2000-09-25 Allan Rae <rae@lyx.org>
2178 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2179 segfault. This will be completely redesigned soon.
2181 * sigc++: updated libsigc++. Fixes struct timespec bug.
2183 * development/tools/makeLyXsigc.sh: .cvsignore addition
2185 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2187 * several files: removed almost all traces of the old table
2190 * src/TableLayout.C: removed file
2192 2000-09-22 Juergen Vigna <jug@sad.it>
2194 * src/frontends/kde/Dialogs.C: added credits forms.
2196 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2198 * src/frontends/gnome/Dialogs.C: added some forms.
2200 * src/spellchecker.C (init_spell_checker): set language in pspell code
2201 (RunSpellChecker): some modifications for setting language string.
2203 * src/language.[Ch]: added language_country code.
2205 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2207 * src/frontends/Dialogs.h: added new signal showError.
2208 Rearranged existing signals in some sort of alphabetical order.
2210 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2211 FormError.[Ch], form_error.[Ch]
2212 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2213 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2215 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2216 dialogs. I think that this can be used as the base to all these
2219 * src/frontends/xforms/FormError.[Ch]
2220 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2221 implementation of InsetError dialog.
2223 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2225 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2226 * src/frontends/kde/Makefile.am: ditto
2228 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2230 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2231 macrobf. This fixes a bug of invisible text.
2233 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2235 * lib/doc/LaTeXConfig.lyx.in: updated.
2237 * src/language.C (initL): remove language "francais" and change a
2238 bit the names of the two other french variations.
2240 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2241 string that may not be 0-terminated.
2243 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2245 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2247 2000-09-20 Marko Vendelin <markov@ioc.ee>
2249 * src/frontends/gnome/FormCitation.C
2250 * src/frontends/gnome/FormIndex.C
2251 * src/frontends/gnome/FormToc.C
2252 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2253 the variable initialization to shut up the warnings
2255 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2257 * src/table.[Ch]: deleted files
2259 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2262 2000-09-18 Juergen Vigna <jug@sad.it>
2264 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2265 problems with selection. Inserted new LFUN_PASTESELECTION.
2266 (InsetButtonPress): inserted handling of middle mouse-button paste.
2268 * src/spellchecker.C: changed word to word.c_str().
2270 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2272 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2273 included in the ``make dist'' tarball.
2275 2000-09-15 Juergen Vigna <jug@sad.it>
2277 * src/CutAndPaste.C (cutSelection): small fix return the right
2278 end position after cut inside one paragraph only.
2280 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2281 we are locked as otherwise we don't have a valid cursor position!
2283 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2285 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2287 * src/frontends/kde/FormRef.C: added using directive.
2288 * src/frontends/kde/FormToc.C: ditto
2290 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2292 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2294 2000-09-19 Marko Vendelin <markov@ioc.ee>
2296 * src/frontends/gnome/Menubar_pimpl.C
2297 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2298 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2300 * src/frontends/gnome/mainapp.C
2301 * src/frontends/gnome/mainapp.h: support for menu update used
2304 * src/frontends/gnome/mainapp.C
2305 * src/frontends/gnome/mainapp.h: support for "action" area in the
2306 main window. This area is used by small simple dialogs, such as
2309 * src/frontends/gnome/FormIndex.C
2310 * src/frontends/gnome/FormIndex.h
2311 * src/frontends/gnome/FormUrl.C
2312 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2315 * src/frontends/gnome/FormCitation.C
2316 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2317 action area. Only "Insert new citation" is implemented.
2319 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2321 * src/buffer.C (Dispatch): fix call to Dispatch
2322 * src/insets/insetref.C (Edit): likewise
2323 * src/insets/insetparent.C (Edit): likewise
2324 * src/insets/insetinclude.C (include_cb): likewise
2325 * src/frontends/xforms/FormUrl.C (apply): likewise
2326 * src/frontends/xforms/FormToc.C (apply): likewise
2327 * src/frontends/xforms/FormRef.C (apply): likewise
2328 * src/frontends/xforms/FormIndex.C (apply): likewise
2329 * src/frontends/xforms/FormCitation.C (apply): likewise
2330 * src/lyxserver.C (callback): likewise
2331 * src/lyxfunc.C (processKeySym): likewise
2332 (Dispatch): likewise
2333 (Dispatch): likewise
2334 * src/lyx_cb.C (LayoutsCB): likewise
2336 * Makefile.am (sourcedoc): small change
2338 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2340 * src/main.C (main): Don't make an empty GUIRunTime object. all
2341 methods are static. constify a bit remove unneded using + headers.
2343 * src/tabular.C: some more const to local vars move some loop vars
2345 * src/spellchecker.C: added some c_str after some word for pspell
2347 * src/frontends/GUIRunTime.h: add new static method setDefaults
2348 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2349 * src/frontends/kde/GUIRunTime.C (setDefaults):
2350 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2352 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2353 with strnew in arg, use correct emptystring when calling SetName.
2355 * several files: remove all commented code with relation to
2356 HAVE_SSTREAM beeing false. We now only support stringstream and
2359 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2361 * src/lyxfunc.C: construct correctly the automatic new file
2364 * src/text2.C (IsStringInText): change type of variable i to shut
2367 * src/support/sstream.h: do not use namespaces if the compiler
2368 does not support them.
2370 2000-09-15 Marko Vendelin <markov@ioc.ee>
2371 * src/frontends/gnome/FormCitation.C
2372 * src/frontends/gnome/FormCitation.h
2373 * src/frontends/gnome/diainsertcitation_interface.c
2374 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2375 regexp support to FormCitation [Gnome].
2377 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2380 * configure.in: remove unused KDE/GTKGUI define
2382 * src/frontends/kde/FormRef.C
2383 * src/frontends/kde/FormRef.h
2384 * src/frontends/kde/formrefdialog.C
2385 * src/frontends/kde/formrefdialog.h: double click will
2386 go to reference, now it is possible to change a cross-ref
2389 * src/frontends/kde/FormToc.C
2390 * src/frontends/kde/FormToc.h
2391 * src/frontends/kde/formtocdialog.C
2392 * src/frontends/kde/formtocdialog.h: add a depth
2395 * src/frontends/kde/Makefile.am: add QtLyXView.h
2398 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2400 * src/frontends/kde/FormCitation.h: added some using directives.
2402 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2404 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2407 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2410 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2412 * src/buffer.C (pop_tag): revert for the second time a change by
2413 Lars, who seems to really hate having non-local loop variables :)
2415 * src/Lsstream.h: add "using" statements.
2417 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2418 * src/buffer.C (writeFile): ditto
2420 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2422 * src/buffer.C (writeFile): try to fix the locale modified format
2423 number to always be as we want it.
2425 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2426 in XForms 0.89. C-space is now working again.
2428 * src/Lsstream.h src/support/sstream.h: new files.
2430 * also commented out all cases where strstream were used.
2432 * src/Bullet.h (c_str): remove method.
2434 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2436 * a lot of files: get rid of "char const *" and "char *" is as
2437 many places as possible. We only want to use them in interaction
2438 with system of other libraries, not inside lyx.
2440 * a lot of files: return const object is not of pod type. This
2441 helps ensure that temporary objects is not modified. And fits well
2442 with "programming by contract".
2444 * configure.in: check for the locale header too
2446 * Makefile.am (sourcedoc): new tag for generation of doc++
2449 2000-09-14 Juergen Vigna <jug@sad.it>
2451 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2452 callback to check which combo called it and do the right action.
2454 * src/combox.C (combo_cb): added combo * to the callbacks.
2455 (Hide): moved call of callback after Ungrab of the pointer.
2457 * src/intl.h: removed LCombo2 function.
2459 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2460 function as this can now be handled in one function.
2462 * src/combox.h: added Combox * to callback prototype.
2464 * src/frontends/xforms/Toolbar_pimpl.C:
2465 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2467 2000-09-14 Garst Reese <reese@isn.net>
2469 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2470 moved usepackage{xxx}'s to beginning of file. Changed left margin
2471 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2472 underlining from title. Thanks to John Culleton for useful suggestions.
2474 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2476 * src/lyxlex_pimpl.C (setFile): change error message to debug
2479 2000-09-13 Juergen Vigna <jug@sad.it>
2481 * src/frontends/xforms/FormDocument.C: implemented choice_class
2482 as combox and give callback to combo_language so OK/Apply is activated
2485 * src/bufferlist.C (newFile): small fix so already named files
2486 (via an open call) are not requested to be named again on the
2489 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2491 * src/frontends/kde/Makefile.am
2492 * src/frontends/kde/FormRef.C
2493 * src/frontends/kde/FormRef.h
2494 * src/frontends/kde/formrefdialog.C
2495 * src/frontends/kde/formrefdialog.h: implement
2498 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2500 * src/frontends/kde/formtocdialog.C
2501 * src/frontends/kde/formtocdialog.h
2502 * src/frontends/kde/FormToc.C
2503 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2505 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2507 * src/frontends/kde/FormCitation.C: fix thinko
2508 where we didn't always display the reference text
2511 * src/frontends/kde/formurldialog.C
2512 * src/frontends/kde/formurldialog.h
2513 * src/frontends/kde/FormUrl.C
2514 * src/frontends/kde/FormUrl.h: minor cleanups
2516 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2518 * src/frontends/kde/Makefile.am
2519 * src/frontends/kde/FormToc.C
2520 * src/frontends/kde/FormToc.h
2521 * src/frontends/kde/FormCitation.C
2522 * src/frontends/kde/FormCitation.h
2523 * src/frontends/kde/FormIndex.C
2524 * src/frontends/kde/FormIndex.h
2525 * src/frontends/kde/formtocdialog.C
2526 * src/frontends/kde/formtocdialog.h
2527 * src/frontends/kde/formcitationdialog.C
2528 * src/frontends/kde/formcitationdialog.h
2529 * src/frontends/kde/formindexdialog.C
2530 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2532 2000-09-12 Juergen Vigna <jug@sad.it>
2534 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2537 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2539 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2542 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2544 * src/converter.C (Add, Convert): Added support for converter flags:
2545 needaux, resultdir, resultfile.
2546 (Convert): Added new parameter view_file.
2547 (dvips_options): Fixed letter paper option.
2549 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2550 (Export, GetExportableFormats, GetViewableFormats): Added support
2553 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2555 (easyParse): Fixed to work with new export code.
2557 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2560 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2562 * lib/bind/*.bind: Replaced
2563 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2564 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2566 2000-09-11 Juergen Vigna <jug@sad.it>
2568 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2570 * src/main.C (main): now GUII defines global guiruntime!
2572 * src/frontends/gnome/GUIRunTime.C (initApplication):
2573 * src/frontends/kde/GUIRunTime.C (initApplication):
2574 * src/frontends/xforms/GUIRunTime.C (initApplication):
2575 * src/frontends/GUIRunTime.h: added new function initApplication.
2577 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2579 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2581 2000-09-08 Juergen Vigna <jug@sad.it>
2583 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2584 we have already "Reset".
2586 * src/language.C (initL): inserted "default" language and made this
2587 THE default language (and not american!)
2589 * src/paragraph.C: inserted handling of "default" language!
2591 * src/lyxfont.C: ditto
2595 * src/paragraph.C: output the \\par only if we have a following
2596 paragraph otherwise it's not needed.
2598 2000-09-05 Juergen Vigna <jug@sad.it>
2600 * config/pspell.m4: added entry to lyx-flags
2602 * src/spellchecker.C: modified version from Kevin for using pspell
2604 2000-09-01 Marko Vendelin <markov@ioc.ee>
2605 * src/frontends/gnome/Makefile.am
2606 * src/frontends/gnome/FormCitation.C
2607 * src/frontends/gnome/FormCitation.h
2608 * src/frontends/gnome/diainsertcitation_callbacks.c
2609 * src/frontends/gnome/diainsertcitation_callbacks.h
2610 * src/frontends/gnome/diainsertcitation_interface.c
2611 * src/frontends/gnome/diainsertcitation_interface.h
2612 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2613 dialog for Gnome frontend
2615 * src/main.C: Gnome libraries require keeping application name
2616 and its version as strings
2618 * src/frontends/gnome/mainapp.C: Change the name of the main window
2619 from GnomeLyX to PACKAGE
2621 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2623 * src/frontends/Liason.C: add "using: declaration.
2625 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2627 * src/mathed/math_macro.C (Metrics): Set the size of the template
2629 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2631 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2633 * src/converter.C (add_options): New function.
2634 (SetViewer): Change $$FName into '$$FName'.
2635 (View): Add options when running xdvi
2636 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2637 (Convert): The 3rd parameter is now the desired filename. Converts
2638 calls to lyx::rename if necessary.
2639 Add options when running dvips.
2640 (dvi_papersize,dvips_options): New methods.
2642 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2644 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2645 using a call to Converter::dvips_options.
2646 Fixed to work with nex export code.
2648 * src/support/copy.C
2649 * src/support/rename.C: New files
2651 * src/support/syscall.h
2652 * src/support/syscall.C: Added Starttype SystemDontWait.
2654 * lib/ui/default.ui: Changed to work with new export code
2656 * lib/configure.m4: Changed to work with new export code
2658 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2660 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2662 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2663 so that code compiles with DEC cxx.
2665 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2666 to work correctly! Also now supports the additional elements
2669 2000-09-01 Allan Rae <rae@lyx.org>
2671 * src/frontends/ButtonPolicies.C: renamed all the references to
2672 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2674 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2675 since it's a const not a type.
2677 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2679 2000-08-31 Juergen Vigna <jug@sad.it>
2681 * src/insets/figinset.C: Various changes to look if the filename has
2682 an extension and if not add it for inline previewing.
2684 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2686 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2687 make buttonStatus and isReadOnly be const methods. (also reflect
2688 this in derived classes.)
2690 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2691 (nextState): change to be static inline, pass the StateMachine as
2693 (PreferencesPolicy): remove casts
2694 (OkCancelPolicy): remvoe casts
2695 (OkCancelReadOnlyPolicy): remove casts
2696 (NoRepeatedApplyReadOnlyPolicy): remove casts
2697 (OkApplyCancelReadOnlyPolicy): remove casts
2698 (OkApplyCancelPolicy): remove casts
2699 (NoRepeatedApplyPolicy): remove casts
2701 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2703 * src/converter.C: added some using directives
2705 * src/frontends/ButtonPolicies.C: changes to overcome
2706 "need lvalue" error with DEC c++
2708 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2709 to WMHideCB for DEC c++
2711 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2713 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2714 to BulletBMTableCB for DEC c++
2716 2000-08-31 Allan Rae <rae@lyx.org>
2718 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2719 character dialog separately from old document dialogs combo_language.
2722 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2724 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2725 Removed LFUN_REF_CREATE.
2727 * src/MenuBackend.C: Added new tags: toc and references
2729 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2730 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2732 (add_toc, add_references): New methods.
2733 (create_submenu): Handle correctly the case when there is a
2734 seperator after optional menu items.
2736 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2737 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2738 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2740 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2742 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2744 * src/converter.[Ch]: New file for converting between different
2747 * src/export.[Ch]: New file for exporting a LyX file to different
2750 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2751 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2752 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2753 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2754 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2755 RunDocBook, MenuExport.
2757 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2758 Exporter::Preview methods if NEW_EXPORT is defined.
2760 * src/buffer.C (Dispatch): Use Exporter::Export.
2762 * src/lyxrc.C: Added new tags: \converter and \viewer.
2765 * src/LyXAction.C: Define new lyx-function: buffer-update.
2766 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2767 when NEW_EXPORT is defined.
2769 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2771 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2773 * lib/ui/default.ui: Added submenus "view" and "update" to the
2776 * src/filetools.C (GetExtension): New function.
2778 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2780 2000-08-29 Allan Rae <rae@lyx.org>
2782 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2784 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2785 (EnableDocumentLayout): removed
2786 (DisableDocumentLayout): removed
2787 (build): make use of ButtonController's read-only handling to
2788 de/activate various objects. Replaces both of the above functions.
2790 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2791 (readOnly): was read_only
2792 (refresh): fixed dumb mistakes with read_only_ handling
2794 * src/frontends/xforms/forms/form_document.fd:
2795 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2796 tabbed dialogs so the tabs look more like tabs and so its easier to
2797 work out which is the current tab.
2799 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2800 segfault with form_table
2802 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2804 2000-08-28 Juergen Vigna <jug@sad.it>
2806 * acconfig.h: added USE_PSPELL.
2808 * src/config.h.in: added USE_PSPELL.
2810 * autogen.sh: added pspell.m4
2812 * config/pspell.m4: new file.
2814 * src/spellchecker.C: implemented support for pspell libary.
2816 2000-08-25 Juergen Vigna <jug@sad.it>
2818 * src/LyXAction.C (init): renamed LFUN_TABLE to
2819 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2821 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2823 * src/lyxscreen.h: add force_clear variable and fuction to force
2824 a clear area when redrawing in LyXText.
2826 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2828 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2830 * some whitespace and comment changes.
2832 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2834 * src/buffer.C: up te LYX_FORMAT to 2.17
2836 2000-08-23 Juergen Vigna <jug@sad.it>
2838 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2841 * src/insets/insettabular.C (pasteSelection): delete the insets
2842 LyXText as it is not valid anymore.
2843 (copySelection): new function.
2844 (pasteSelection): new function.
2845 (cutSelection): new function.
2846 (LocalDispatch): implemented cut/copy/paste of cell selections.
2848 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2849 don't have a LyXText.
2851 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2853 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2856 2000-08-22 Juergen Vigna <jug@sad.it>
2858 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2859 ifdef form_table out if NEW_TABULAR.
2861 2000-08-21 Juergen Vigna <jug@sad.it>
2863 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2864 (draw): fixed draw position so that the cursor is positioned in the
2866 (InsetMotionNotify): hide/show cursor so the position is updated.
2867 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2868 using cellstart() function where it should be used.
2870 * src/insets/insettext.C (draw): ditto.
2872 * src/tabular.C: fixed initialization of some missing variables and
2873 made BoxType into an enum.
2875 2000-08-22 Marko Vendelin <markov@ioc.ee>
2876 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2877 stock menu item using action numerical value, not its string
2881 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2883 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2884 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2886 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2888 * src/frontends/xforms/GUIRunTime.C: new file
2890 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2891 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2893 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2895 * src/frontends/kde/GUIRunTime.C: new file
2897 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2898 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2900 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2902 * src/frontends/gnome/GUIRunTime.C: new file
2904 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2907 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2908 small change to documetentation.
2910 * src/frontends/GUIRunTime.C: removed file
2912 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2914 * src/lyxparagraph.h: enable NEW_TABULAR as default
2916 * src/lyxfunc.C (processKeySym): remove some commented code
2918 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2919 NEW_TABULAR around the fd_form_table_options.
2921 * src/lyx_gui.C (runTime): call the static member function as
2922 GUIRunTime::runTime().
2924 2000-08-21 Allan Rae <rae@lyx.org>
2926 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2929 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2931 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2933 2000-08-21 Allan Rae <rae@lyx.org>
2935 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2936 keep Garst happy ;-)
2937 * src/frontends/xforms/FormPreferences.C (build): use setOK
2938 * src/frontends/xforms/FormDocument.C (build): use setOK
2939 (FormDocument): use the appropriate policy.
2941 2000-08-21 Allan Rae <rae@lyx.org>
2943 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2944 automatic [de]activation of arbitrary objects when in a read-only state.
2946 * src/frontends/ButtonPolicies.h: More documentation
2947 (isReadOnly): added to support the above.
2949 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2951 2000-08-18 Juergen Vigna <jug@sad.it>
2953 * src/insets/insettabular.C (getStatus): changed to return func_status.
2955 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2956 display toggle menu entries if they are.
2958 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2959 new document layout now.
2961 * src/lyxfunc.C: ditto
2963 * src/lyx_gui_misc.C: ditto
2965 * src/lyx_gui.C: ditto
2967 * lib/ui/default.ui: removed paper and quotes layout as they are now
2968 all in the document layout tabbed folder.
2970 * src/frontends/xforms/forms/form_document.fd: added Restore
2971 button and callbacks for all inputs for Allan's ButtonPolicy.
2973 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2974 (CheckChoiceClass): added missing params setting on class change.
2975 (UpdateLayoutDocument): added for updating the layout on params.
2976 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2977 (FormDocument): Implemented Allan's ButtonPolicy with the
2980 2000-08-17 Allan Rae <rae@lyx.org>
2982 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2983 so we can at least see the credits again.
2985 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2986 controller calls for the appropriate callbacks. Note that since Ok
2987 calls apply followed by cancel, and apply isn't a valid input for the
2988 APPLIED state, the bc_ calls have to be made in the static callback not
2989 within each of the real callbacks.
2991 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2992 (setOk): renamed from setOkay()
2994 2000-08-17 Juergen Vigna <jug@sad.it>
2996 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2997 in the implementation part.
2998 (composeUIInfo): don't show optional menu-items.
3000 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3002 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3004 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3005 text-state when in a text-inset.
3007 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3009 2000-08-17 Marko Vendelin <markov@ioc.ee>
3010 * src/frontends/gnome/FormIndex.C
3011 * src/frontends/gnome/FormIndex.h
3012 * src/frontends/gnome/FormToc.C
3013 * src/frontends/gnome/FormToc.h
3014 * src/frontends/gnome/dialogs
3015 * src/frontends/gnome/diatoc_callbacks.c
3016 * src/frontends/gnome/diatoc_callbacks.h
3017 * src/frontends/gnome/diainsertindex_callbacks.h
3018 * src/frontends/gnome/diainsertindex_callbacks.c
3019 * src/frontends/gnome/diainsertindex_interface.c
3020 * src/frontends/gnome/diainsertindex_interface.h
3021 * src/frontends/gnome/diatoc_interface.h
3022 * src/frontends/gnome/diatoc_interface.c
3023 * src/frontends/gnome/Makefile.am: Table of Contents and
3024 Insert Index dialogs implementation for Gnome frontend
3026 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3028 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3030 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3033 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3035 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3036 destructor. Don't definde if you don't need it
3037 (processEvents): made static, non-blocking events processing for
3039 (runTime): static method. event loop for xforms
3040 * similar as above for kde and gnome.
3042 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3043 new Pimpl is correct
3044 (runTime): new method calss the real frontends runtime func.
3046 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3048 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3050 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3052 2000-08-16 Juergen Vigna <jug@sad.it>
3054 * src/lyx_gui.C (runTime): added GUII RunTime support.
3056 * src/frontends/Makefile.am:
3057 * src/frontends/GUIRunTime.[Ch]:
3058 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3059 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3060 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3062 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3064 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3065 as this is already set in ${FRONTEND_INCLUDE} if needed.
3067 * configure.in (CPPFLAGS): setting the include dir for the frontend
3068 directory and don't set FRONTEND=xforms for now as this is executed
3071 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3073 * src/frontends/kde/Makefile.am:
3074 * src/frontends/kde/FormUrl.C:
3075 * src/frontends/kde/FormUrl.h:
3076 * src/frontends/kde/formurldialog.h:
3077 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3079 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3081 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3083 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3085 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3088 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3090 * src/WorkArea.C (work_area_handler): more work to get te
3091 FL_KEYBOARD to work with xforms 0.88 too, please test.
3093 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3095 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3097 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3100 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3102 * src/Timeout.h: remove Qt::emit hack.
3104 * several files: changes to allo doc++ compilation
3106 * src/lyxfunc.C (processKeySym): new method
3107 (processKeyEvent): comment out if FL_REVISION < 89
3109 * src/WorkArea.C: change some debugging levels.
3110 (WorkArea): set wantkey to FL_KEY_ALL
3111 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3112 clearer code and the use of compose with XForms 0.89. Change to
3113 use signals instead of calling methods in bufferview directly.
3115 * src/Painter.C: change some debugging levels.
3117 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3120 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3121 (workAreaKeyPress): new method
3123 2000-08-14 Juergen Vigna <jug@sad.it>
3125 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3127 * config/kde.m4: addes some features
3129 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3130 include missing xforms dialogs.
3132 * src/Timeout.h: a hack to be able to compile with qt/kde.
3134 * sigc++/.cvsignore: added acinclude.m4
3136 * lib/.cvsignore: added listerros
3138 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3139 xforms tree as objects are needed for other frontends.
3141 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3142 linking with not yet implemented xforms objects.
3144 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3146 2000-08-14 Baruch Even <baruch.even@writeme.com>
3148 * src/frontends/xforms/FormGraphics.h:
3149 * src/frontends/xforms/FormGraphics.C:
3150 * src/frontends/xforms/RadioButtonGroup.h:
3151 * src/frontends/xforms/RadioButtonGroup.C:
3152 * src/insets/insetgraphics.h:
3153 * src/insets/insetgraphics.C:
3154 * src/insets/insetgraphicsParams.h:
3155 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3156 instead of spaces, and various other indentation issues to make the
3157 sources more consistent.
3159 2000-08-14 Marko Vendelin <markov@ioc.ee>
3161 * src/frontends/gnome/dialogs/diaprint.glade
3162 * src/frontends/gnome/FormPrint.C
3163 * src/frontends/gnome/FormPrint.h
3164 * src/frontends/gnome/diaprint_callbacks.c
3165 * src/frontends/gnome/diaprint_callbacks.h
3166 * src/frontends/gnome/diaprint_interface.c
3167 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3170 * src/frontends/gnome/dialogs/diainserturl.glade
3171 * src/frontends/gnome/FormUrl.C
3172 * src/frontends/gnome/FormUrl.h
3173 * src/frontends/gnome/diainserturl_callbacks.c
3174 * src/frontends/gnome/diainserturl_callbacks.h
3175 * src/frontends/gnome/diainserturl_interface.c
3176 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3177 Gnome implementation
3179 * src/frontends/gnome/Dialogs.C
3180 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3181 all other dialogs. Copy all unimplemented dialogs from Xforms
3184 * src/frontends/gnome/support.c
3185 * src/frontends/gnome/support.h: support files generated by Glade
3189 * config/gnome.m4: Gnome configuration scripts
3191 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3192 configure --help message
3194 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3195 only if there are no events pendling in Gnome/Gtk. This enhances
3196 the performance of menus.
3199 2000-08-14 Allan Rae <rae@lyx.org>
3201 * lib/Makefile.am: listerrors cleaning
3203 * lib/listerrors: removed -- generated file
3204 * acinclude.m4: ditto
3205 * sigc++/acinclude.m4: ditto
3207 * src/frontends/xforms/forms/form_citation.fd:
3208 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3211 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3212 `updatesrc` and now we have a `test` target that does what `updatesrc`
3213 used to do. I didn't like having an install target that wasn't related
3216 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3217 on all except FormGraphics. This may yet happen. Followed by a major
3218 cleanup including using FL_TRANSIENT for most of the dialogs. More
3219 changes to come when the ButtonController below is introduced.
3221 * src/frontends/xforms/ButtonController.h: New file for managing up to
3222 four buttons on a dialog according to an externally defined policy.
3223 * src/frontends/xforms/Makefile.am: added above
3225 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3226 Apply and Cancel/Close buttons and everything in between and beyond.
3227 * src/frontends/Makefile.am: added above.
3229 * src/frontends/xforms/forms/form_preferences.fd:
3230 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3231 and removed variable 'status' as a result. Fixed the set_minsize thing.
3232 Use the new screen-font-update after checking screen fonts were changed
3233 Added a "Restore" button to restore the original lyxrc values while
3234 editing. This restores everything not just the last input changed.
3235 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3237 * src/LyXAction.C: screen-font-update added for updating buffers after
3238 screen font settings have been changed.
3239 * src/commandtags.h: ditto
3240 * src/lyxfunc.C: ditto
3242 * forms/lyx.fd: removed screen fonts dialog.
3243 * src/lyx_gui.C: ditto
3244 * src/menus.[Ch]: ditto
3245 * src/lyx.[Ch]: ditto
3246 * src/lyx_cb.C: ditto + code from here moved to make
3247 screen-font-update. And people wonder why progress on GUII is
3248 slow. Look at how scattered this stuff was! It takes forever
3251 * forms/fdfix.sh: Fixup the spacing after commas.
3252 * forms/makefile: Remove date from generated files. Fewer clashes now.
3253 * forms/bullet_forms.C.patch: included someones handwritten changes
3255 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3256 once I've discovered why LyXRC was made noncopyable.
3257 * src/lyx_main.C: ditto
3259 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3261 * src/frontends/xforms/forms/fdfix.sh:
3262 * src/frontends/xforms/forms/fdfixh.sed:
3263 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3264 * src/frontends/xforms/Form*.[hC]:
3265 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3266 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3267 provide a destructor for the struct FD_form_xxxx. Another version of
3268 the set_[max|min]size workaround and a few other cleanups. Actually,
3269 Angus' patch from 20000809.
3271 2000-08-13 Baruch Even <baruch.even@writeme.com>
3273 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3276 2000-08-11 Juergen Vigna <jug@sad.it>
3278 * src/insets/insetgraphics.C (InsetGraphics): changing init
3279 order because of warnings.
3281 * src/frontends/xforms/forms/makefile: adding patching .C with
3284 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3285 from .C.patch to .c.patch
3287 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3288 order because of warning.
3290 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3292 * src/frontends/Liason.C (setMinibuffer): new helper function
3294 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3296 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3298 * lib/ui/default.ui: commented out PaperLayout entry
3300 * src/frontends/xforms/form_document.[Ch]: new added files
3302 * src/frontends/xforms/FormDocument.[Ch]: ditto
3304 * src/frontends/xforms/forms/form_document.fd: ditto
3306 * src/frontends/xforms/forms/form_document.C.patch: ditto
3308 2000-08-10 Juergen Vigna <jug@sad.it>
3310 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3311 (InsetGraphics): initialized cacheHandle to 0.
3312 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3314 2000-08-10 Baruch Even <baruch.even@writeme.com>
3316 * src/graphics/GraphicsCache.h:
3317 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3318 correctly as a cache.
3320 * src/graphics/GraphicsCacheItem.h:
3321 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3324 * src/graphics/GraphicsCacheItem_pimpl.h:
3325 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3328 * src/insets/insetgraphics.h:
3329 * src/insets/insetgraphics.C: Changed from using a signal notification
3330 to polling when image is not loaded.
3332 2000-08-10 Allan Rae <rae@lyx.org>
3334 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3335 that there are two functions that have to been taken out of line by
3336 hand and aren't taken care of in the script. (Just a reminder note)
3338 * sigc++/macros/*.h.m4: Updated as above.
3340 2000-08-09 Juergen Vigna <jug@sad.it>
3342 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3344 * src/insets/insettabular.C: make drawing of single cell smarter.
3346 2000-08-09 Marko Vendelin <markov@ioc.ee>
3347 * src/frontends/gnome/Menubar_pimpl.C
3348 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3349 implementation: new files
3351 * src/frontends/gnome/mainapp.C
3352 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3355 * src/main.C: create Gnome main window
3357 * src/frontends/xforms/Menubar_pimpl.h
3358 * src/frontends/Menubar.C
3359 * src/frontends/Menubar.h: added method Menubar::update that calls
3360 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3362 * src/LyXView.C: calls Menubar::update to update the state
3365 * src/frontends/gnome/Makefile.am: added new files
3367 * src/frontends/Makefile.am: added frontend compiler options
3369 2000-08-08 Juergen Vigna <jug@sad.it>
3371 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3373 * src/bufferlist.C (close):
3374 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3375 documents if exiting without saving.
3377 * src/buffer.C (save): use removeAutosaveFile()
3379 * src/support/filetools.C (removeAutosaveFile): new function.
3381 * src/lyx_cb.C (MenuWrite): returns a bool now.
3382 (MenuWriteAs): check if file could really be saved and revert to the
3384 (MenuWriteAs): removing old autosavefile if existant.
3386 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3387 before Goto toggle declaration, because of compiler warning.
3389 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3391 * src/lyxfunc.C (MenuNew): small fix.
3393 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3395 * src/bufferlist.C (newFile):
3396 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3398 * src/lyxrc.C: added new_ask_filename tag
3400 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3402 * src/lyx.fd: removed code pertaining to form_ref
3403 * src/lyx.[Ch]: ditto
3404 * src/lyx_cb.C: ditto
3405 * src/lyx_gui.C: ditto
3406 * src/lyx_gui_misc.C: ditto
3408 * src/BufferView_pimpl.C (restorePosition): update buffer only
3411 * src/commandtags.h (LFUN_REFTOGGLE): removed
3412 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3413 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3414 (LFUN_REFBACK): renamed LFUN_REF_BACK
3416 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3417 * src/menus.C: ditto
3418 * src/lyxfunc.C (Dispatch): ditto.
3419 InsertRef dialog is now GUI-independent.
3421 * src/texrow.C: added using std::endl;
3423 * src/insets/insetref.[Ch]: strip out large amounts of code.
3424 The inset is now a container and this functionality is now
3425 managed by a new FormRef dialog
3427 * src/frontends/Dialogs.h (showRef, createRef): new signals
3429 * src/frontends/xforms/FormIndex.[Ch],
3430 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3431 when setting dialog's min/max size
3432 * src/frontends/xforms/FormIndex.[Ch]: ditto
3434 * src/frontends/xforms/FormRef.[Ch],
3435 src/frontends/xforms/forms/form_ref.fd: new xforms
3436 implementation of an InsetRef dialog
3438 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3441 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3442 ios::nocreate is not part of the standard. Removed.
3444 2000-08-07 Baruch Even <baruch.even@writeme.com>
3446 * src/graphics/Renderer.h:
3447 * src/graphics/Renderer.C: Added base class for rendering of different
3448 image formats into Pixmaps.
3450 * src/graphics/XPM_Renderer.h:
3451 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3452 in a different class.
3454 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3455 easily add support for other formats.
3457 * src/insets/figinset.C: plugged a leak of an X resource.
3459 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3461 * src/CutAndPaste.[Ch]: make all metods static.
3463 * development/Code_rules/Rules: more work, added section on
3464 Exceptions, and a References section.
3466 * a lot of header files: work to make doc++ able to generate the
3467 source documentation, some workarounds of doc++ problems. Doc++ is
3468 now able to generate the documentation.
3470 2000-08-07 Juergen Vigna <jug@sad.it>
3472 * src/insets/insettabular.C (recomputeTextInsets): removed function
3474 * src/tabular.C (SetWidthOfMulticolCell):
3476 (calculate_width_of_column_NMC): fixed return value so that it really
3477 only returns true if the column-width has changed (there where
3478 problems with muliticolumn-cells in this column).
3480 2000-08-04 Juergen Vigna <jug@sad.it>
3482 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3483 also on the scrollstatus of the inset.
3484 (workAreaMotionNotify): ditto.
3486 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3488 2000-08-01 Juergen Vigna <jug@sad.it>
3490 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3492 * src/commandtags.h:
3493 * src/LyXAction.C (init):
3494 * src/insets/inset.C (LocalDispatch): added support for
3497 * src/insets/inset.C (scroll): new functions.
3499 * src/insets/insettext.C (removeNewlines): new function.
3500 (SetAutoBreakRows): removes forced newlines in the text of the
3501 paragraph if autoBreakRows is set to false.
3503 * src/tabular.C (Latex): generates a parbox around the cell contents
3506 * src/frontends/xforms/FormTabular.C (local_update): removed
3507 the radio_useparbox button.
3509 * src/tabular.C (UseParbox): new function
3511 2000-08-06 Baruch Even <baruch.even@writeme.com>
3513 * src/graphics/GraphicsCache.h:
3514 * src/graphics/GraphicsCache.C:
3515 * src/graphics/GraphicsCacheItem.h:
3516 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3519 * src/insets/insetgraphics.h:
3520 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3521 and the drawing of the inline image.
3523 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3524 loaded into the wrong position.
3526 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3529 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3531 * src/support/translator.h: move all typedefs to public section
3533 * src/support/filetools.C (MakeLatexName): return string const
3535 (TmpFileName): ditto
3536 (FileOpenSearch): ditto
3538 (LibFileSearch): ditto
3539 (i18nLibFileSearch): ditto
3542 (CreateTmpDir): ditto
3543 (CreateBufferTmpDir): ditto
3544 (CreateLyXTmpDir): ditto
3547 (MakeAbsPath): ditto
3549 (OnlyFilename): ditto
3551 (NormalizePath): ditto
3552 (CleanupPath): ditto
3553 (GetFileContents): ditto
3554 (ReplaceEnvironmentPath): ditto
3555 (MakeRelPath): ditto
3557 (ChangeExtension): ditto
3558 (MakeDisplayPath): ditto
3559 (do_popen): return cmdret const
3560 (findtexfile): return string const
3562 * src/support/DebugStream.h: add some /// to please doc++
3564 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3566 * src/texrow.C (same_rownumber): functor to use with find_if
3567 (getIdFromRow): rewritten to use find_if and to not update the
3568 positions. return true if row is found
3569 (increasePos): new method, use to update positions
3571 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3573 * src/lyxlex_pimpl.C (verifyTable): new method
3576 (GetString): return string const
3577 (pushTable): rewrite to use std::stack
3579 (setFile): better check
3582 * src/lyxlex.h: make LyXLex noncopyable
3584 * src/lyxlex.C (text): return char const * const
3585 (GetString): return string const
3586 (getLongString): return string const
3588 * src/lyx_gui_misc.C (askForText): return pair<...> const
3590 * src/lastfiles.[Ch] (operator): return string const
3592 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3593 istringstream not char const *.
3594 move token.end() out of loop.
3595 (readFile): move initializaton of token
3597 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3598 getIdFromRow is successful.
3600 * lib/bind/emacs.bind: don't include menus bind
3602 * development/Code_rules/Rules: the beginnings of making this
3603 better and covering more of the unwritten rules that we have.
3605 * development/Code_rules/Recommendations: a couple of wording
3608 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3610 * src/support/strerror.c: remove C++ comment.
3612 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3614 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3615 LFUN_INDEX_INSERT_LAST
3617 * src/texrow.C (getIdFromRow): changed from const_iterator to
3618 iterator, allowing code to compile with DEC cxx
3620 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3621 stores part of the class, as suggested by Allan. Will allow
3623 (apply): test to apply uses InsetCommandParams operator!=
3625 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3626 (apply): test to apply uses InsetCommandParams operator!=
3628 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3629 stores part of the class.
3630 (update): removed limits on min/max size.
3632 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3633 (apply): test to apply uses InsetCommandParams operator!=
3635 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3636 (Read, Write, scanCommand, getCommand): moved functionality
3637 into InsetCommandParams.
3639 (getScreenLabel): made pure virtual
3640 new InsetCommandParams operators== and !=
3642 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3643 c-tors based on InsetCommandParams. Removed others.
3644 * src/insets/insetinclude.[Ch]: ditto
3645 * src/insets/insetlabel.[Ch]: ditto
3646 * src/insets/insetparent.[Ch]: ditto
3647 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3649 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3650 insets derived from InsetCommand created using similar c-tors
3651 based on InsetCommandParams
3652 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3653 * src/menus.C (ShowRefsMenu): ditto
3654 * src/paragraph.C (Clone): ditto
3655 * src/text2.C (SetCounter): ditto
3656 * src/lyxfunc.C (Dispatch) ditto
3657 Also recreated old InsetIndex behaviour exactly. Can now
3658 index-insert at the start of a paragraph and index-insert-last
3659 without launching the pop-up.
3661 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3663 * lib/lyxrc.example: mark te pdf options as non functional.
3665 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3666 (isStrDbl): move tmpstr.end() out of loop.
3667 (strToDbl): move intialization of tmpstr
3668 (lowercase): return string const and move tmp.end() out of loop.
3669 (uppercase): return string const and move tmp.edn() out of loop.
3670 (prefixIs): add assertion
3675 (containsOnly): ditto
3676 (containsOnly): ditto
3677 (containsOnly): ditto
3678 (countChar): make last arg char not char const
3679 (token): return string const
3680 (subst): return string const, move tmp.end() out of loop.
3681 (subst): return string const, add assertion
3682 (strip): return string const
3683 (frontStrip): return string const, add assertion
3684 (frontStrip): return string const
3689 * src/support/lstrings.C: add inclde "LAssert.h"
3690 (isStrInt): move tmpstr.end() out of loop.
3692 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3693 toollist.end() out of loop.
3694 (deactivate): move toollist.end() out of loop.
3695 (update): move toollist.end() out of loop.
3696 (updateLayoutList): move tc.end() out of loop.
3697 (add): move toollist.end() out of loop.
3699 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3700 md.end() out of loop.
3702 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3704 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3707 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3708 (Erase): move insetlist.end() out of loop.
3710 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3711 ref to const string as first arg. Move initialization of some
3712 variables, whitespace changes.
3714 * src/kbmap.C (defkey): move table.end() out of loop.
3715 (kb_keymap): move table.end() out of loop.
3716 (findbinding): move table.end() out of loop.
3718 * src/MenuBackend.C (hasMenu): move end() out of loop.
3719 (getMenu): move end() out of loop.
3720 (getMenu): move menulist_.end() out of loop.
3722 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3724 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3727 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3728 (getFromLyXName): move infotab.end() out of loop.
3730 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3731 -fvtable-thunks -ffunction-sections -fdata-sections
3733 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3735 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3738 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3740 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3742 * src/frontends/xforms/FormCitation.[Ch],
3743 src/frontends/xforms/FormIndex.[Ch],
3744 src/frontends/xforms/FormToc.[Ch],
3745 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3747 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3749 * src/commandtags.h: renamed, created some flags for citation
3752 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3754 * src/lyxfunc.C (dispatch): use signals to insert index entry
3756 * src/frontends/Dialogs.h: new signal createIndex
3758 * src/frontends/xforms/FormCommand.[Ch],
3759 src/frontends/xforms/FormCitation.[Ch],
3760 src/frontends/xforms/FormToc.[Ch],
3761 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3763 * src/insets/insetindex.[Ch]: GUI-independent
3765 * src/frontends/xforms/FormIndex.[Ch],
3766 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3769 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3771 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3772 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3774 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3776 * src/insets/insetref.C (Latex): rewrite so that there is now
3777 question that a initialization is requested.
3779 * src/insets/insetcommand.h: reenable the hide signal
3781 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3783 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3784 fix handling of shortcuts (many bugs :)
3785 (add_lastfiles): ditto.
3787 * lib/ui/default.ui: fix a few shortcuts.
3789 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3791 * Makefile.am: Fix ``rpmdist'' target to return the exit
3792 status of the ``rpm'' command, instead of the last command in
3793 the chain (the ``rm lyx.xpm'' command, which always returns
3796 2000-08-02 Allan Rae <rae@lyx.org>
3798 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3799 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3800 * src/frontends/xforms/FormToc.C (FormToc): ditto
3802 * src/frontends/xforms/Makefile.am: A few forgotten files
3804 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3805 Signals-not-copyable-problem Lars' started commenting out.
3807 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3809 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3811 * src/insets/insetcommand.h: Signals is not copyable so anoter
3812 scheme for automatic hiding of forms must be used.
3814 * src/frontends/xforms/FormCitation.h: don't inerit from
3815 noncopyable, FormCommand already does that.
3816 * src/frontends/xforms/FormToc.h: ditto
3817 * src/frontends/xforms/FormUrl.h: ditto
3819 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3821 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3823 * src/insets/insetcommand.h (hide): new SigC::Signal0
3824 (d-tor) new virtual destructor emits hide signal
3826 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3827 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3829 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3830 LOF and LOT. Inset is now GUI-independent
3832 * src/insets/insetloa.[Ch]: redundant
3833 * src/insets/insetlof.[Ch]: ditto
3834 * src/insets/insetlot.[Ch]: ditto
3836 * src/frontends/xforms/forms/form_url.fd: tweaked!
3837 * src/frontends/xforms/forms/form_citation.fd: ditto
3839 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3840 dialogs dealing with InsetCommand insets
3842 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3843 FormCommand base class
3844 * src/frontends/xforms/FormUrl.[Ch]: ditto
3846 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3848 * src/frontends/xforms/FormToc.[Ch]: ditto
3850 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3851 passed a generic InsetCommand pointer
3852 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3854 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3855 and modified InsetTOC class
3856 * src/buffer.C: ditto
3858 * forms/lyx.fd: strip out old FD_form_toc code
3859 * src/lyx_gui_misc.C: ditto
3860 * src/lyx_gui.C: ditto
3861 * src/lyx_cb.C: ditto
3862 * src/lyx.[Ch]: ditto
3864 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3866 * src/support/utility.hpp: tr -d '\r'
3868 2000-08-01 Juergen Vigna <jug@sad.it>
3870 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3872 * src/commandtags.h:
3873 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3874 LFUN_TABULAR_FEATURES.
3876 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3877 LFUN_LAYOUT_TABULAR.
3879 * src/insets/insettabular.C (getStatus): implemented helper function.
3881 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3883 2000-07-31 Juergen Vigna <jug@sad.it>
3885 * src/text.C (draw): fixed screen update problem for text-insets.
3887 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3888 something changed probably this has to be added in various other
3891 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3893 2000-07-31 Baruch Even <baruch.even@writeme.com>
3895 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3896 templates to satisfy compaq cxx.
3899 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3901 * src/support/translator.h (equal_1st_in_pair::operator()): take
3902 const ref pair_type as arg.
3903 (equal_2nd_in_pair::operator()): ditto
3904 (Translator::~Translator): remove empty d-tor.
3906 * src/graphics/GraphicsCache.C: move include config.h to top, also
3907 put initialization of GraphicsCache::singleton here.
3908 (~GraphicsCache): move here
3909 (addFile): take const ref as arg
3912 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3914 * src/BufferView2.C (insertLyXFile): change te with/without header
3917 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3919 * src/frontends/xforms/FormGraphics.C (apply): add some
3920 static_cast. Not very nice, but required by compaq cxx.
3922 * src/frontends/xforms/RadioButtonGroup.h: include header
3923 <utility> instead of <pair.h>
3925 * src/insets/insetgraphicsParams.C: add using directive.
3926 (readResize): change return type to void.
3927 (readOrigin): ditto.
3929 * src/lyxfunc.C (getStatus): add missing break for build-program
3930 function; add test for Literate for export functions.
3932 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3933 entries in Options menu.
3935 2000-07-31 Baruch Even <baruch.even@writeme.com>
3937 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3938 protect against auto-allocation; release icon when needed.
3940 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3942 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3943 on usual typewriter.
3945 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3946 earlier czech.kmap), useful only for programming.
3948 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3950 * src/frontends/xforms/FormCitation.h: fix conditioning around
3953 2000-07-31 Juergen Vigna <jug@sad.it>
3955 * src/frontends/xforms/FormTabular.C (local_update): changed
3956 radio_linebreaks to radio_useparbox and added radio_useminipage.
3958 * src/tabular.C: made support for using minipages/parboxes.
3960 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3962 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3964 (descent): so the cursor is in the middle.
3965 (width): bit smaller box.
3967 * src/insets/insetgraphics.h: added display() function.
3969 2000-07-31 Baruch Even <baruch.even@writeme.com>
3971 * src/frontends/Dialogs.h: Added showGraphics signals.
3973 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3974 xforms form definition of the graphics dialog.
3976 * src/frontends/xforms/FormGraphics.h:
3977 * src/frontends/xforms/FormGraphics.C: Added files, the
3978 GUIndependent code of InsetGraphics
3980 * src/insets/insetgraphics.h:
3981 * src/insets/insetgraphics.C: Major writing to make it work.
3983 * src/insets/insetgraphicsParams.h:
3984 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3985 struct between InsetGraphics and GUI.
3987 * src/LaTeXFeatures.h:
3988 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3989 support for graphicx package.
3991 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3992 for the graphics inset.
3994 * src/support/translator.h: Added file, used in
3995 InsetGraphicsParams. this is a template to translate between two
3998 * src/frontends/xforms/RadioButtonGroup.h:
3999 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4000 way to easily control a radio button group.
4002 2000-07-28 Juergen Vigna <jug@sad.it>
4004 * src/insets/insettabular.C (LocalDispatch):
4005 (TabularFeatures): added support for lyx-functions of tabular features.
4006 (cellstart): refixed this function after someone wrongly changed it.
4008 * src/commandtags.h:
4009 * src/LyXAction.C (init): added support for tabular-features
4011 2000-07-28 Allan Rae <rae@lyx.org>
4013 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4014 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4015 triggers the callback for input checking. As a result we sometimes get
4016 "LyX: This shouldn't happen..." printed to cerr.
4017 (input): Started using status variable since I only free() on
4018 destruction. Some input checking for paths and font sizes.
4020 * src/frontends/xforms/FormPreferences.h: Use status to control
4021 activation of Ok and Apply
4023 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4024 callback. Also resized to stop segfaults with 0.88. The problem is
4025 that xforms-0.88 requires the folder to be wide enough to fit all the
4026 tabs. If it isn't it causes all sorts of problems.
4028 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4030 * src/frontends/xforms/forms/README: Reflect reality.
4032 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4033 * src/frontends/xforms/forms/makefile: ditto.
4035 * src/commandtags.h: Get access to new Preferences dialog
4036 * src/LyXAction.C: ditto
4037 * src/lyxfunc.C: ditto
4038 * lib/ui/default.ui: ditto
4040 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4042 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4044 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4047 * src/frontends/xforms/form_url.[Ch]: added.
4049 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4051 * src/insets/insetbib.h: fixed bug in previous commit
4053 * src/frontends/xforms/FormUrl.h: ditto
4055 * src/frontends/xforms/FormPrint.h: ditto
4057 * src/frontends/xforms/FormPreferences.h: ditto
4059 * src/frontends/xforms/FormCopyright.h: ditto
4061 * src/frontends/xforms/FormCitation.C: ditto
4063 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4064 private copyconstructor and private default contructor
4066 * src/support/Makefile.am: add utility.hpp
4068 * src/support/utility.hpp: new file from boost
4070 * src/insets/insetbib.h: set owner in clone
4072 * src/frontends/xforms/FormCitation.C: added missing include
4075 * src/insets/form_url.[Ch]: removed
4077 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4079 * development/lyx.spec.in
4080 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4081 file/directory re-organization.
4083 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4085 * src/insets/insetcommand.[Ch]: moved the string data and
4086 associated manipulation methods into a new stand-alone class
4087 InsetCommandParams. This class has two additional methods
4088 getAsString() and setFromString() allowing the contents to be
4089 moved around as a single string.
4090 (addContents) method removed.
4091 (setContents) method no longer virtual.
4093 * src/buffer.C (readInset): made use of new InsetCitation,
4094 InsetUrl constructors based on InsetCommandParams.
4096 * src/commandtags.h: add LFUN_INSERT_URL
4098 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4099 independent InsetUrl and use InsetCommandParams to extract
4100 string info and create new Insets.
4102 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4104 * src/frontends/xforms/FormCitation.C (apply): uses
4107 * src/frontends/xforms/form_url.C
4108 * src/frontends/xforms/form_url.h
4109 * src/frontends/xforms/FormUrl.h
4110 * src/frontends/xforms/FormUrl.C
4111 * src/frontends/xforms/forms/form_url.fd: new files
4113 * src/insets/insetcite.[Ch]: removed unused constructors.
4115 * src/insets/insetinclude.[Ch]: no longer store filename
4117 * src/insets/inseturl.[Ch]: GUI-independent.
4119 2000-07-26 Juergen Vigna <jug@sad.it>
4120 * renamed frontend from gtk to gnome as it is that what is realized
4121 and did the necessary changes in the files.
4123 2000-07-26 Marko Vendelin <markov@ioc.ee>
4125 * configure.in: cleaning up gnome configuration scripts
4127 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4129 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4130 shortcuts syndrom by redrawing them explicitely (a better solution
4131 would be appreciated).
4133 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4135 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4138 * src/lyx_cb.C (MenuExport): change html export to do the right
4139 thing depending of the document type (instead of having
4140 html-linuxdoc and html-docbook).
4141 * src/lyxfunc.C (getStatus): update for html
4142 * lib/ui/default.ui: simplify due to the above change.
4143 * src/menus.C (ShowFileMenu): update too (in case we need it).
4145 * src/MenuBackend.C (read): if a menu is defined twice, add the
4146 new entries to the exiting one.
4148 2000-07-26 Juergen Vigna <jug@sad.it>
4150 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4152 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4153 and return a bool if it did actual save the file.
4154 (AutoSave): don't autosave a unnamed doc.
4156 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4157 check if this is an UNNAMED new file and react to it.
4158 (newFile): set buffer to unnamed and change to not mark a new
4159 buffer dirty if I didn't do anything with it.
4161 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4163 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4165 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4166 friend as per Angus's patch posted to lyx-devel.
4168 * src/ext_l10n.h: updated
4170 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4171 gettext on the style string right before inserting them into the
4174 * autogen.sh: add code to extract style strings form layout files,
4175 not good enough yet.
4177 * src/frontends/gtk/.cvsignore: add MAKEFILE
4179 * src/MenuBackend.C (read): run the label strings through gettext
4180 before storing them in the containers.
4182 * src/ext_l10n.h: new file
4184 * autogen.sh : generate the ext_l10n.h file here
4186 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4188 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4191 * lib/ui/default.ui: fix a couple of typos.
4193 * config/gnome/gtk.m4: added (and added to the list of files in
4196 * src/insets/insetinclude.C (unique_id): fix when we are using
4197 lyxstring instead of basic_string<>.
4198 * src/insets/insettext.C (LocalDispatch): ditto.
4199 * src/support/filetools.C: ditto.
4201 * lib/configure.m4: create the ui/ directory if necessary.
4203 * src/LyXView.[Ch] (updateToolbar): new method.
4205 * src/BufferView_pimpl.C (buffer): update the toolbar when
4206 opening/closing buffer.
4208 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4210 * src/LyXAction.C (getActionName): enhance to return also the name
4211 and options of pseudo-actions.
4212 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4214 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4215 as an example of what is possible). Used in File->Build too (more
4216 useful) and in the import/export menus (to mimick the complicated
4217 handling of linuxdoc and friends). Try to update all the entries.
4219 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4222 * src/MenuBackend.C (read): Parse the new OptItem tag.
4224 * src/MenuBackend.h: Add a new optional_ data member (used if the
4225 entry should be omitted when the lyxfunc is disabled).
4227 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4228 function, used as a shortcut.
4229 (create_submenu): align correctly the shortcuts on the widest
4232 * src/MenuBackend.h: MenuItem.label() only returns the label of
4233 the menu without shortcut; new method shortcut().
4235 2000-07-14 Marko Vendelin <markov@ioc.ee>
4237 * src/frontends/gtk/Dialogs.C:
4238 * src/frontends/gtk/FormCopyright.C:
4239 * src/frontends/gtk/FormCopyright.h:
4240 * src/frontends/gtk/Makefile.am: added these source-files for the
4241 Gtk/Gnome support of the Copyright-Dialog.
4243 * src/main.C: added Gnome::Main initialization if using
4244 Gtk/Gnome frontend-GUI.
4246 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4248 * config/gnome/aclocal-include.m4
4249 * config/gnome/compiler-flags.m4
4250 * config/gnome/curses.m4
4251 * config/gnome/gnome--.m4
4252 * config/gnome/gnome-bonobo-check.m4
4253 * config/gnome/gnome-common.m4
4254 * config/gnome/gnome-fileutils.m4
4255 * config/gnome/gnome-ghttp-check.m4
4256 * config/gnome/gnome-gnorba-check.m4
4257 * config/gnome/gnome-guile-checks.m4
4258 * config/gnome/gnome-libgtop-check.m4
4259 * config/gnome/gnome-objc-checks.m4
4260 * config/gnome/gnome-orbit-check.m4
4261 * config/gnome/gnome-print-check.m4
4262 * config/gnome/gnome-pthread-check.m4
4263 * config/gnome/gnome-support.m4
4264 * config/gnome/gnome-undelfs.m4
4265 * config/gnome/gnome-vfs.m4
4266 * config/gnome/gnome-x-checks.m4
4267 * config/gnome/gnome-xml-check.m4
4268 * config/gnome/gnome.m4
4269 * config/gnome/gperf-check.m4
4270 * config/gnome/gtk--.m4
4271 * config/gnome/linger.m4
4272 * config/gnome/need-declaration.m4: added configuration scripts
4273 for Gtk/Gnome frontend-GUI
4275 * configure.in: added support for the --with-frontend=gtk option
4277 * autogen.sh: added config/gnome/* to list of config-files
4279 * acconfig.h: added define for GTKGUI-support
4281 * config/lyxinclude.m4: added --with-frontend[=value] option value
4282 for Gtk/Gnome frontend-GUI support.
4284 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4286 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4290 * src/paragraph.C (GetChar): remove non-const version
4292 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4293 (search_kw): use it.
4295 * src/lyx_main.C (init): if "preferences" exist, read that instead
4297 (ReadRcFile): return bool if the file could be read ok.
4298 (ReadUIFile): add a check to see if lex file is set ok.
4300 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4301 bastring can be used instead of lyxstring (still uses the old code
4302 if std::string is good enough or if lyxstring is used.)
4304 * src/encoding.C: make the arrays static, move ininle functions
4306 * src/encoding.h: from here.
4308 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4309 (parseSingleLyXformat2Token): move inset parsing to separate method
4310 (readInset): new private method
4312 * src/Variables.h: remove virtual from get().
4314 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4315 access to NEW_INSETS and NEW_TABULAR
4317 * src/MenuBackend.h: remove superfluous forward declaration of
4318 MenuItem. Add documentations tags "///", remove empty MenuItem
4319 destructor, remove private default contructor.
4321 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4323 (read): more string mlabel and mname to where they are used
4324 (read): remove unused variables mlabel and mname
4325 (defaults): unconditional clear, make menusetup take advantage of
4326 add returning Menu &.
4328 * src/LyXView.h: define NEW_MENUBAR as default
4330 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4331 to NEW_INSETS and NEW_TABULAR.
4332 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4333 defined. Change some of the "xxxx-inset-insert" functions names to
4336 * several files: more enahncements to NEW_INSETS and the resulting
4339 * lib/lyxrc.example (\date_insert_format): move to misc section
4341 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4342 bastring and use AC_CACHE_CHECK.
4343 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4344 the system have the newest methods. uses AC_CACHE_CHECK
4345 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4346 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4347 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4349 * configure.in: add LYX_CXX_GOOD_STD_STRING
4351 * acinclude.m4: recreated
4353 2000-07-24 Amir Karger <karger@lyx.org>
4355 * README: add Hebrew, Arabic kmaps
4358 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4360 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4363 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4365 * Lot of files: add pragma interface/implementation.
4367 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4369 * lib/ui/default.ui: new file (ans new directory). Contains the
4370 default menu and toolbar.
4372 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4373 global space. Toolbars are now read (as menus) in ui files.
4375 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4377 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4378 is disabled because the document is read-only. We want to have the
4379 toggle state of the function anyway.
4380 (getStatus): add code for LFUN_VC* functions (mimicking what is
4381 done in old-style menus)
4383 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4384 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4386 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4387 * src/BufferView_pimpl.C: ditto.
4388 * src/lyxfunc.C: ditto.
4390 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4391 default). This replaces old-style menus by new ones.
4393 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4394 MenuItem. Contain the data structure of a menu.
4396 * src/insets/insettext.C: use LyXView::setLayout instead of
4397 accessing directly the toolbar combox.
4398 * src/lyxfunc.C (Dispatch): ditto.
4400 * src/LyXView.C (setLayout): new method, which just calls
4401 Toolbar::setLayout().
4402 (updateLayoutChoice): move part of this method in Toolbar.
4404 * src/toolbar.[Ch]: removed.
4406 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4407 implementation the toolbar.
4409 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4410 the toolbar. It might make sense to merge it with ToolbarDefaults
4412 (setLayout): new function.
4413 (updateLayoutList): ditto.
4414 (openLayoutList): ditto.
4416 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4417 xforms implementation of the toolbar.
4418 (get_toolbar_func): comment out, since I do not
4419 know what it is good for.
4421 * src/ToolbarDefaults.h: Add the ItemType enum.
4423 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4424 for a list of allocated C strings. Used in Menubar xforms
4425 implementation to avoid memory leaks.
4427 * src/support/lstrings.[Ch] (uppercase): new version taking and
4431 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4432 * lib/bind/emacs.bind: ditto.
4434 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4436 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4437 forward decl of LyXView.
4439 * src/toolbar.C (toolbarItem): moved from toolbar.h
4440 (toolbarItem::clean): ditto
4441 (toolbarItem::~toolbarItem): ditto
4442 (toolbarItem::operator): ditto
4444 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4446 * src/paragraph.h: control the NEW_TABULAR define from here
4448 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4449 USE_TABULAR_INSETS to NEW_TABULAR
4451 * src/ToolbarDefaults.C: add include "lyxlex.h"
4453 * files using the old table/tabular: use NEW_TABULAR to control
4454 compilation of old tabular stuff.
4456 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4459 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4460 planemet in reading of old style floats, fix the \end_deeper
4461 problem when reading old style floats.
4463 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4465 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4467 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4469 * lib/bind/sciword.bind: updated.
4471 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4473 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4474 layout write problem
4476 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4478 * src/Makefile.am (INCLUDES): remove image directory from include
4481 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4482 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4484 * src/LyXView.C (create_form_form_main): read the application icon
4487 * lib/images/*.xpm: change the icons to use transparent color for
4490 * src/toolbar.C (update): change the color of the button when it
4493 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4495 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4496 setting explicitely the minibuffer.
4497 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4499 * src/LyXView.C (showState): new function. Shows font information
4500 in minibuffer and update toolbar state.
4501 (LyXView): call Toolbar::update after creating the
4504 * src/toolbar.C: change toollist to be a vector instead of a
4506 (BubbleTimerCB): get help string directly from the callback
4507 argument of the corresponding icon (which is the action)
4508 (set): remove unnecessary ugliness.
4509 (update): new function. update the icons (depressed, disabled)
4510 depending of the status of the corresponding action.
4512 * src/toolbar.h: remove help in toolbarItem
4514 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4516 * src/Painter.C (text): Added code for using symbol glyphs from
4517 iso10646 fonts. Currently diabled.
4519 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4522 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4523 magyar,turkish and usorbian.
4525 * src/paragraph.C (isMultiLingual): Made more efficient.
4527 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4530 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4531 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4532 Also changed the prototype to "bool math_insert_greek(char)".
4534 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4536 * lots of files: apply the NEW_INSETS on all code that will not be
4537 needed when we move to use the new insets. Enable the define in
4538 lyxparagrah.h to try it.
4540 * src/insets/insettabular.C (cellstart): change to be a static
4542 (InsetTabular): initialize buffer in the initializer list.
4544 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4546 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4547 form_print.h out of the header file. Replaced with forward
4548 declarations of the relevant struct.
4550 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4553 * src/commandtags.h: do not include "debug.h" which does not
4554 belong there. #include it in some other places because of this
4557 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4559 * src/insets/insetcaption.C: add a couple "using" directives.
4561 * src/toolbar.C (add): get the help text directly from lyxaction.
4563 (setPixmap): new function. Loads from disk and sets a pixmap on a
4564 botton; the name of the pixmap file is derived from the command
4567 * src/toolbar.h: remove members isBitmap and pixmap from
4570 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4571 * lib/images/: move many files from images/banner.xpm.
4573 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4575 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4576 * src/toolbar.C: ditto.
4577 * configure.in: ditto.
4578 * INSTALL: document.
4580 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4581 the spellchecker popup is closed from the WM.
4583 2000-07-19 Juergen Vigna <jug@sad.it>
4585 * src/insets/insetfloat.C (Write): small fix because we use the
4586 insetname for the type now!
4588 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4590 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4593 * src/frontends/Dialogs.h: removed hideCitation signal
4595 * src/insets/insetcite.h: added hide signal
4597 * src/insets/insetcite.C (~InsetCitation): emits new signal
4598 (getScreenLabel): "intelligent" label should now fit on the screen!
4600 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4602 * src/frontends/xforms/FormCitation.C (showInset): connects
4603 hide() to the inset's hide signal
4604 (show): modified to use fl_set_object_position rather than
4605 fl_set_object_geometry wherever possible
4607 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4609 * src/insets/lyxinset.h: add caption code
4611 * src/insets/insetfloat.C (type): new method
4613 * src/insets/insetcaption.C (Write): new method
4615 (LyxCode): new method
4617 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4618 to get it right together with using the FloatList.
4620 * src/commandtags.h: add LFUN_INSET_CAPTION
4621 * src/lyxfunc.C (Dispatch): handle it
4623 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4626 * src/Variables.[Ch]: make expand take a const reference, remove
4627 the destructor, some whitespace changes.
4629 * src/LyXAction.C (init): add caption-inset-insert
4631 * src/FloatList.C (FloatList): update the default floats a bit.
4633 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4635 * src/Variables.[Ch]: new files. Intended to be used for language
4636 specific strings (like \chaptername) and filename substitution in
4639 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4641 * lib/kbd/american.kmap: update
4643 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4645 * src/bufferparams.[Ch]: remove member allowAccents.
4647 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4649 * src/LaTeXLog.C: use the log_form.h header.
4650 * src/lyx_gui.C: ditto.
4651 * src/lyx_gui_misc.C: ditto.
4652 * src/lyxvc.h: ditto.
4654 * forms/log_form.fd: new file, created from latexoptions.fd. I
4655 kept the log popup and nuked the options form.
4657 * src/{la,}texoptions.[Ch]: removed.
4658 * src/lyx_cb.C (LaTeXOptions): ditto
4660 * src/lyx_gui.C (create_forms): do not handle the
4661 fd_latex_options form.
4663 2000-07-18 Juergen Vigna <jug@sad.it>
4665 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4666 name of the inset so that it can be requested outside (text2.C).
4668 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4671 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4673 * src/mathed/formula.h (ConvertFont): constify
4675 * src/mathed/formula.C (Read): add warning if \end_inset is not
4676 found on expected place.
4678 * src/insets/lyxinset.h (ConvertFont): consify
4680 * src/insets/insetquotes.C (ConvertFont): constify
4681 * src/insets/insetquotes.h: ditto
4683 * src/insets/insetinfo.h: add labelfont
4685 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4686 (ascent): use labelfont
4690 (Write): make .lyx file a bit nicer
4692 * src/insets/insetfloat.C (Write): simplify somewhat...
4693 (Read): add warning if arg is not found
4695 * src/insets/insetcollapsable.C: add using std::max
4696 (Read): move string token and add warning in arg is not found
4697 (draw): use std::max to get the right ty
4698 (getMaxWidth): simplify by using std::max
4700 * src/insets/insetsection.h: new file
4701 * src/insets/insetsection.C: new file
4702 * src/insets/insetcaption.h: new file
4703 * src/insets/insetcaption.C: new file
4705 * src/insets/inset.C (ConvertFont): constify signature
4707 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4708 insetcaption.[Ch] and insetsection.[Ch]
4710 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4711 uses to use LABEL_COUNTER_CHAPTER instead.
4712 * src/text2.C (SetCounter): here
4714 * src/counters.h: new file
4715 * src/counters.C: new file
4716 * src/Sectioning.h: new file
4717 * src/Sectioning.C: new file
4719 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4721 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4723 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4726 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4729 2000-07-17 Juergen Vigna <jug@sad.it>
4731 * src/tabular.C (Validate): check if array-package is needed.
4732 (SetVAlignment): added support for vertical alignment.
4733 (SetLTFoot): better support for longtable header/footers
4734 (Latex): modified to support added features.
4736 * src/LaTeXFeatures.[Ch]: added array-package.
4738 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4740 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4743 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4745 * configure.in: do not forget to put a space after -isystem.
4747 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4749 * lib/kbd/arabic.kmap: a few fixes.
4751 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4753 * some whitespace chagnes to a number of files.
4755 * src/support/DebugStream.h: change to make it easier for
4756 doc++ to parse correctly.
4757 * src/support/lyxstring.h: ditto
4759 * src/mathed/math_utils.C (compara): change to have only one
4761 (MathedLookupBOP): change because of the above.
4763 * src/mathed/math_delim.C (math_deco_compare): change to have only
4765 (search_deco): change becasue of the above.
4767 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4768 instead of manually coded one.
4770 * src/insets/insetquotes.C (Read): read the \end_inset too
4772 * src/insets/insetlatex.h: remove file
4773 * src/insets/insetlatex.C: remove file
4775 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4777 (InsetPrintIndex): remove destructor
4779 * src/insets/insetinclude.h: remove default constructor
4781 * src/insets/insetfloat.C: work to make it work better
4783 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4785 * src/insets/insetcite.h (InsetCitation): remove default constructor
4787 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4789 * src/text.C (GetColumnNearX): comment out some currently unused code.
4791 * src/paragraph.C (writeFile): move some initializations closer to
4793 (CutIntoMinibuffer): small change to use new matchIT operator
4797 (InsertInset): ditto
4800 (InsetIterator): ditto
4801 (Erase): small change to use new matchFT operator
4803 (GetFontSettings): ditto
4804 (HighestFontInRange): ditto
4807 * src/lyxparagraph.h: some chars changed to value_type
4808 (matchIT): because of some stronger checking (perhaps too strong)
4809 in SGI STL, the two operator() unified to one.
4812 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4814 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4815 the last inset read added
4816 (parseSingleLyXformat2Token): some more (future) compability code added
4817 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4818 (parseSingleLyXformat2Token): set last_inset_read
4819 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4820 (parseSingleLyXformat2Token): don't double intializw string next_token
4822 * src/TextCache.C (text_fits::operator()): add const's to the signature
4823 (has_buffer::operator()): ditto
4825 * src/Floating.h: add some comments on the class
4827 * src/FloatList.[Ch] (typeExist): new method
4830 * src/BackStack.h: added default constructor, wanted by Gcc.
4832 2000-07-14 Juergen Vigna <jug@sad.it>
4834 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4836 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4838 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4839 do a redraw when the window is resized!
4840 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4842 * src/insets/insettext.C (resizeLyXText): added function to correctly
4843 being able to resize the LyXWindow.
4845 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4847 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4849 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4850 crashes when closing dialog to a deleted inset.
4852 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4853 method! Now similar to other insets.
4855 2000-07-13 Juergen Vigna <jug@sad.it>
4857 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4859 * lib/examples/Literate.lyx: small patch!
4861 * src/insets/insetbib.C (Read): added this function because of wrong
4862 Write (without [begin|end]_inset).
4864 2000-07-11 Juergen Vigna <jug@sad.it>
4866 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4867 as the insertInset could not be good!
4869 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4870 the bool param should not be last.
4872 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4874 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4875 did submit that to Karl).
4877 * configure.in: use -isystem instead of -I for X headers. This
4878 fixes a problem on solaris with a recent gcc;
4879 put the front-end code after the X detection code;
4880 configure in sigc++ before lib/
4882 * src/lyx_main.C (commandLineHelp): remove -display from command
4885 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4887 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4888 Also put in Makefile rules for building the ``listerrors''
4889 program for parsing errors from literate programs written in LyX.
4891 * lib/build-listerrors: Added small shell script as part of compile
4892 process. This builds a working ``listerrors'' binary if noweb is
4893 installed and either 1) the VNC X server is installed on the machine,
4894 or 2) the user is compiling from within a GUI. The existence of a GUI
4895 is necessary to use the ``lyx --export'' feature for now. This
4896 hack can be removed once ``lyx --export'' no longer requires a GUI to
4899 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4901 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4902 now passed back correctly from gcc and placed "under" error
4903 buttons in a Literate LyX source.
4905 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4907 * src/text.C (GetColumnNearX): Better behavior when a RTL
4908 paragraph is ended by LTR text.
4910 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4913 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4915 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4916 true when clipboard is empty.
4918 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4920 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4921 row of the paragraph.
4922 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4923 to prevent calculation of bidi tables
4925 2000-07-07 Juergen Vigna <jug@sad.it>
4927 * src/screen.C (ToggleSelection): added y_offset and x_offset
4930 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4933 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4935 * src/insets/insettext.C: fixed Layout-Display!
4937 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4939 * configure.in: add check for strings.h header.
4941 * src/spellchecker.C: include <strings.h> in order to have a
4942 definition for bzero().
4944 2000-07-07 Juergen Vigna <jug@sad.it>
4946 * src/insets/insettext.C (draw): set the status of the bv->text to
4947 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4949 * src/screen.C (DrawOneRow):
4950 (DrawFromTo): redraw the actual row if something has changed in it
4953 * src/text.C (draw): call an update of the toplevel-inset if something
4954 has changed inside while drawing.
4956 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4958 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4960 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4961 processing inside class.
4963 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4964 processing inside class.
4966 * src/insets/insetindex.h new struct Holder, consistent with other
4969 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4970 citation dialog from main code and placed it in src/frontends/xforms.
4971 Dialog launched through signals instead of callbacks
4973 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4975 * lyx.man: update the options description.
4977 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4979 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4980 handle neg values, set min width to 590, add doc about -display
4982 2000-07-05 Juergen Vigna <jug@sad.it>
4984 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4985 calls to BufferView *.
4987 * src/insets/insettext.C (checkAndActivateInset): small fix non
4988 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4990 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4991 their \end_inset token!
4993 2000-07-04 edscott <edscott@imp.mx>
4995 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4996 lib/lyxrc.example: added option \wheel_jump
4998 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5000 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5001 remove support for -width,-height,-xpos and -ypos.
5003 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5005 * src/encoding.[Ch]: New files.
5007 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5008 (text): Call to the underline() method only when needed.
5010 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5012 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5013 encoding(s) for the document.
5015 * src/bufferparams.C (BufferParams): Changed default value of
5018 * src/language.C (newLang): Removed.
5019 (items[]): Added encoding information for all defined languages.
5021 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5022 encoding choice button.
5024 * src/lyxrc.h (font_norm_type): New member variable.
5025 (set_font_norm_type): New method.
5027 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5028 paragraphs with different encodings.
5030 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5031 (TransformChar): Changed to work correctly with Arabic points.
5032 (draw): Added support for drawing Arabic points.
5033 (draw): Removed code for drawing underbars (this is done by
5036 * src/support/textutils.h (IsPrintableNonspace): New function.
5038 * src/BufferView_pimpl.h: Added "using SigC::Object".
5039 * src/LyXView.h: ditto.
5041 * src/insets/insetinclude.h (include_label): Changed to mutable.
5043 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5045 * src/mathed/math_iter.h: remove empty destructor
5047 * src/mathed/math_cursor.h: remove empty destructor
5049 * src/insets/lyxinset.h: add THEOREM_CODE
5051 * src/insets/insettheorem.[Ch]: new files
5053 * src/insets/insetminipage.C: (InsertInset): remove
5055 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5057 (InsertInset): remove
5059 * src/insets/insetlist.C: (InsertList): remove
5061 * src/insets/insetfootlike.[Ch]: new files
5063 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5066 (InsertInset): ditto
5068 * src/insets/insetert.C: remove include Painter.h, reindent
5069 (InsertInset): move to header
5071 * src/insets/insetcollapsable.h: remove explicit from default
5072 contructor, remove empty destructor, add InsertInset
5074 * src/insets/insetcollapsable.C (InsertInset): new func
5076 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5078 * src/vspace.h: add explicit to constructor
5080 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5081 \textcompwordmark, please test this.
5083 * src/lyxrc.C: set ascii_linelen to 65 by default
5085 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5087 * src/commandtags.h: add LFUN_INSET_THEOREM
5089 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5090 (makeLinuxDocFile): remove _some_ of the nice logic
5091 (makeDocBookFile): ditto
5093 * src/Painter.[Ch]: (~Painter): removed
5095 * src/LyXAction.C (init): entry for insettheorem added
5097 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5099 (deplog): code to detect files generated by LaTeX, needs testing
5102 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5104 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5106 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5108 * src/LaTeX.C (deplog): Add a check for files that are going to be
5109 created by the first latex run, part of the project to remove the
5112 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5113 contents to the extension list.
5115 2000-07-04 Juergen Vigna <jug@sad.it>
5117 * src/text.C (NextBreakPoint): added support for needFullRow()
5119 * src/insets/lyxinset.h: added needFullRow()
5121 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5124 * src/insets/insettext.C: lots of changes for update!
5126 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5128 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5130 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5132 * src/insets/insetinclude.C (InsetInclude): fixed
5133 initialization of include_label.
5134 (unique_id): now returns a string.
5136 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5138 * src/LaTeXFeatures.h: new member IncludedFiles, for
5139 a map of key, included file name.
5141 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5142 with the included files for inclusion in SGML preamble,
5143 i. e., linuxdoc and docbook.
5146 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5147 nice (is the generated linuxdoc code to be exported?), that
5148 allows to remove column, and only_body that will be true for
5149 slave documents. Insets are allowed inside SGML font type.
5150 New handling of the SGML preamble for included files.
5151 (makeDocBookFile): the same for docbook.
5153 * src/insets/insetinclude.h:
5154 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5156 (DocBook): new export methods.
5158 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5159 and makeDocBookFile.
5161 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5162 formats to export with command line argument -x.
5164 2000-06-29 Juergen Vigna <jug@sad.it>
5166 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5167 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5169 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5170 region could already been cleared by an inset!
5172 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5174 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5177 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5179 (cursorToggle): remove special handling of lyx focus.
5181 2000-06-28 Juergen Vigna <jug@sad.it>
5183 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5186 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5188 * src/insets/insetindex.C (Edit): add a callback when popup is
5191 * src/insets/insettext.C (LocalDispatch):
5192 * src/insets/insetmarginal.h:
5193 * src/insets/insetlist.h:
5194 * src/insets/insetfoot.h:
5195 * src/insets/insetfloat.h:
5196 * src/insets/insetert.h: add a missing std:: qualifier.
5198 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5200 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5203 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5205 * src/insets/insettext.C (Read): remove tmptok unused variable
5206 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5207 (InsertInset): change for new InsetInset code
5209 * src/insets/insettext.h: add TEXT inline method
5211 * src/insets/insettext.C: remove TEXT macro
5213 * src/insets/insetmarginal.C (Write): new method
5214 (Latex): change output slightly
5216 * src/insets/insetfoot.C (Write): new method
5217 (Latex): change output slightly (don't use endl when no need)
5219 * src/insets/insetert.C (Write): new method
5221 * src/insets/insetcollapsable.h: make button_length, button_top_y
5222 and button_bottm_y protected.
5224 * src/insets/insetcollapsable.C (Write): simplify code by using
5225 tostr. Also do not output the float name, the children class
5226 should to that to get control over own arguments
5228 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5229 src/insets/insetminipage.[Ch]:
5232 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5234 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5236 * src/Makefile.am (lyx_SOURCES): add the new files
5238 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5239 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5240 * src/commandtags.h: ditto
5242 * src/LaTeXFeatures.h: add a std::set of used floattypes
5244 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5246 * src/FloatList.[Ch] src/Floating.h: new files
5248 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5250 * src/lyx_cb.C (TableApplyCB): ditto
5252 * src/text2.C: ditto
5253 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5254 (parseSingleLyXformat2Token): ditto + add code for
5255 backwards compability for old float styles + add code for new insets
5257 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5259 (InsertInset(size_type, Inset *, LyXFont)): new method
5260 (InsetChar(size_type, char)): changed to use the other InsetChar
5261 with a LyXFont(ALL_INHERIT).
5262 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5263 insert the META_INSET.
5265 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5267 * sigc++/thread.h (Threads): from here
5269 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5270 definition out of line
5271 * sigc++/scope.h: from here
5273 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5275 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5276 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5278 * Makefile.am (bindist): new target.
5280 * INSTALL: add instructions for doing a binary distribution.
5282 * development/tools/README.bin.example: update a bit.
5284 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5287 * lib/lyxrc.example: new lyxrc tag \set_color.
5289 * src/lyxfunc.C (Dispatch):
5290 * src/commandtags.h:
5291 * src/LyXAction.C: new lyxfunc "set-color".
5293 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5294 and an x11name given as strings.
5296 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5297 cache when a color is changed.
5299 2000-06-26 Juergen Vigna <jug@sad.it>
5301 * src/lyxrow.C (width): added this functions and variable.
5303 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5306 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5308 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5310 * images/undo_bw.xpm: new icon.
5311 * images/redo_bw.xpm: ditto.
5313 * configure.in (INSTALL_SCRIPT): change value to
5314 ${INSTALL} to avoid failures of install-script target.
5315 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5317 * src/BufferView.h: add a magic "friend" declaration to please
5320 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5322 * forms/cite.fd: modified to allow resizing without messing
5325 * src/insetcite.C: Uses code from cite.fd almost without
5327 User can now resize dialog in the x-direction.
5328 Resizing the dialog in the y-direction is prevented, as the
5329 code does this intelligently already.
5331 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5333 * INSTALL: remove obsolete entry in "problems" section.
5335 * lib/examples/sl_*.lyx: update of the slovenian examples.
5337 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5339 2000-06-23 Juergen Vigna <jug@sad.it>
5341 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5343 * src/buffer.C (resize): delete the LyXText of textinsets.
5345 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5347 * src/insets/lyxinset.h: added another parameter 'cleared' to
5348 the draw() function.
5350 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5351 unlocking inset in inset.
5353 2000-06-22 Juergen Vigna <jug@sad.it>
5355 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5356 of insets and moved first to LyXText.
5358 * src/mathed/formulamacro.[Ch]:
5359 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5361 2000-06-21 Juergen Vigna <jug@sad.it>
5363 * src/text.C (GetVisibleRow): look if I should clear the area or not
5364 using Inset::doClearArea() function.
5366 * src/insets/lyxinset.h: added doClearArea() function and
5367 modified draw(Painter &, ...) to draw(BufferView *, ...)
5369 * src/text2.C (UpdateInset): return bool insted of int
5371 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5373 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5374 combox in the character popup
5376 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5377 BufferParams const & params
5379 2000-06-20 Juergen Vigna <jug@sad.it>
5381 * src/insets/insettext.C (SetParagraphData): set insetowner on
5384 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5386 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5387 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5389 (form_main_): remove
5391 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5392 (create_form_form_main): remove FD_form_main stuff, connect to
5393 autosave_timeout signal
5395 * src/LyXView.[Ch] (getMainForm): remove
5396 (UpdateTimerCB): remove
5397 * src/BufferView_pimpl.h: inherit from SigC::Object
5399 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5400 signal instead of callback
5402 * src/BufferView.[Ch] (cursorToggleCB): remove
5404 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5406 * src/BufferView_pimpl.C: changes because of the one below
5408 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5409 instead of storing a pointer to a LyXText.
5411 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5413 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5415 * src/lyxparagraph.h
5417 * src/paragraph.C: Changed fontlist to a sorted vector.
5419 2000-06-19 Juergen Vigna <jug@sad.it>
5421 * src/BufferView.h: added screen() function.
5423 * src/insets/insettext.C (LocalDispatch): some selection code
5426 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5428 * src/insets/insettext.C (SetParagraphData):
5430 (InsetText): fixes for multiple paragraphs.
5432 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5434 * development/lyx.spec.in: Call configure with ``--without-warnings''
5435 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5436 This should be fine, however, since we generally don't want to be
5437 verbose when making an RPM.
5439 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5441 * lib/scripts/fig2pstex.py: New file
5443 2000-06-16 Juergen Vigna <jug@sad.it>
5445 * src/insets/insettabular.C (UpdateLocal):
5446 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5447 (LocalDispatch): Changed all functions to use LyXText.
5449 2000-06-15 Juergen Vigna <jug@sad.it>
5451 * src/text.C (SetHeightOfRow): call inset::update before requesting
5454 * src/insets/insettext.C (update):
5455 * src/insets/insettabular.C (update): added implementation
5457 * src/insets/lyxinset.h: added update function
5459 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5461 * src/text.C (SelectNextWord): protect against null pointers with
5462 old-style string streams. (fix from Paul Theo Gonciari
5465 * src/cite.[Ch]: remove erroneous files.
5467 * lib/configure.m4: update the list of created directories.
5469 * src/lyxrow.C: include <config.h>
5470 * src/lyxcursor.C: ditto.
5472 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5474 * lib/examples/decimal.lyx: new example file from Mike.
5476 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5477 to find template definitions (from Dekel)
5479 * src/frontends/.cvsignore: add a few things.
5481 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5483 * src/Timeout.C (TimeOut): remove default argument.
5485 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5488 * src/insets/ExternalTemplate.C: add a "using" directive.
5490 * src/lyx_main.h: remove the act_ struct, which seems unused
5493 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5495 * LyX Developers Meeting: All files changed, due to random C++ (by
5496 coincidence) code generator script.
5498 - external inset (cool!)
5499 - initial online editing of preferences
5500 - insettabular breaks insettext(s contents)
5502 - some DocBook fixes
5503 - example files update
5504 - other cool stuff, create a diff and look for yourself.
5506 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5508 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5509 -1 this is a non-line-breaking textinset.
5511 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5512 if there is no width set.
5514 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5516 * Lots of files: Merged the dialogbase branch.
5518 2000-06-09 Allan Rae <rae@lyx.org>
5520 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5521 and the Dispatch methods that used it.
5523 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5524 access to functions formerly kept in Dispatch.
5526 2000-05-19 Allan Rae <rae@lyx.org>
5528 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5529 made to_page and count_copies integers again. from_page remains a
5530 string however because I want to allow entry of a print range like
5531 "1,4,22-25" using this field.
5533 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5534 and printer-params-get. These aren't useful from the minibuffer but
5535 could be used by a script/LyXServer app provided it passes a suitable
5536 auto_mem_buffer. I guess I should take a look at how the LyXServer
5537 works and make it support xtl buffers.
5539 * sigc++/: updated to libsigc++-1.0.1
5541 * src/xtl/: updated to xtl-1.3.pl.11
5543 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5544 those changes done to the files in src/ are actually recreated when
5545 they get regenerated. Please don't ever accept a patch that changes a
5546 dialog unless that patch includes the changes to the corresponding *.fd
5549 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5550 stringOnlyContains, renamed it and generalised it.
5552 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5553 branch. Removed the remaining old form_print code.
5555 2000-04-26 Allan Rae <rae@lyx.org>
5557 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5558 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5560 2000-04-25 Allan Rae <rae@lyx.org>
5562 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5563 against a base of xtl-1.3.pl.4
5565 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5566 filter the Id: entries so they still show the xtl version number
5569 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5570 into the src/xtl code. Patch still pending with José (XTL)
5572 2000-04-24 Allan Rae <rae@lyx.org>
5574 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5575 both more generic and much safer. Use the new template functions.
5576 * src/buffer.[Ch] (Dispatch): ditto.
5578 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5579 and mem buffer more intelligently. Also a little general cleanup.
5582 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5583 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5584 * src/xtl/Makefile.am: ditto.
5585 * src/xtl/.cvsignore: ditto.
5586 * src/Makefile.am: ditto.
5588 * src/PrinterParams.h: Removed the macros member functions. Added a
5589 testInvariant member function. A bit of tidying up and commenting.
5590 Included Angus's idea for fixing operation with egcs-1.1.2.
5592 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5593 cool expansion of XTL's mem_buffer to support automatic memory
5594 management within the buffer itself. Removed the various macros and
5595 replaced them with template functions that use either auto_mem_buffer
5596 or mem_buffer depending on a #define. The mem_buffer support will
5597 disappear as soon as the auto_mem_buffer is confirmed to be good on
5598 other platforms/compilers. That is, it's there so you've got something
5601 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5602 effectively forked XTL. However I expect José will include my code
5603 into the next major release. Also fixed a memory leak.
5604 * src/xtl/text.h: ditto.
5605 * src/xtl/xdr.h: ditto.
5606 * src/xtl/giop.h: ditto.
5608 2000-04-16 Allan Rae <rae@lyx.org>
5610 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5611 by autogen.sh and removed by maintainer-clean anyway.
5612 * .cvsignore, sigc++/.cvsignore: Support the above.
5614 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5616 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5618 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5619 macros, renamed static callback-target member functions to suit new
5620 scheme and made them public.
5621 * src/frontends/xforms/forms/form_print.fd: ditto.
5622 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5624 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5627 * src/xtl/: New directory containing a minimal distribution of XTL.
5628 This is XTL-1.3.pl.4.
5630 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5632 2000-04-15 Allan Rae <rae@lyx.org>
5634 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5636 * sigc++/: Updated to libsigc++-1.0.0
5638 2000-04-14 Allan Rae <rae@lyx.org>
5640 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5641 use the generic ones in future. I'll modify my conversion script.
5643 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5645 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5646 (CloseAllBufferRelatedDialogs): Renamed.
5647 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5649 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5650 of the generic ones. These are the same ones my conversion script
5653 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5654 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5655 * src/buffer.C (Dispatch): ditto
5657 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5658 functions for updating and hiding buffer dependent dialogs.
5659 * src/BufferView.C (buffer): ditto
5660 * src/buffer.C (setReadonly): ditto
5661 * src/lyxfunc.C (CloseBuffer): ditto
5663 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5664 Dialogs.h, and hence all the SigC stuff, into every file that includes
5665 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5667 * src/BufferView2.C: reduce the number of headers included by buffer.h
5669 2000-04-11 Allan Rae <rae@lyx.org>
5671 * src/frontends/xforms/xform_macros.h: A small collection of macros
5672 for building C callbacks.
5674 * src/frontends/xforms/Makefile.am: Added above file.
5676 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5677 scheme again. This time it should work for JMarc. If this is
5678 successful I'll revise my conversion script to automate some of this.
5679 The static member functions in the class also have to be public for
5680 this scheme will work. If the scheme works (it's almost identical to
5681 the way BufferView::cursorToggleCB is handled so it should work) then
5682 FormCopyright and FormPrint will be ready for inclusion into the main
5683 trunk immediately after 1.1.5 is released -- provided we're prepared
5684 for complaints about lame compilers not handling XTL.
5686 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5688 2000-04-07 Allan Rae <rae@lyx.org>
5690 * config/lyxinclude.m4: A bit more tidying up (Angus)
5692 * src/LString.h: JMarc's <string> header fix
5694 * src/PrinterParams.h: Used string for most data to remove some
5695 ugly code in the Print dialog and avoid even uglier code when
5696 appending the ints to a string for output.
5698 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5699 and moved "default:" back to the end of switch statement. Cleaned
5700 up the printing so it uses the right function calls and so the
5701 "print to file" option actually puts the file in the right directory.
5703 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5705 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5706 and Ok+Apply button control into a separate method: input (Angus).
5707 (input) Cleaned it up and improved it to be very thorough now.
5708 (All CB) static_cast used instead of C style cast (Angus). This will
5709 probably change again once we've worked out how to keep gcc-2.8.1 happy
5710 with real C callbacks.
5711 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5712 ignore some of the bool settings and has random numbers instead. Needs
5713 some more investigation. Added other input length checks and checking
5714 of file and printer names.
5716 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5717 would link (Angus). Seems the old code doesn't compile with the pragma
5718 statement either. Separated callback entries from internal methods.
5720 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5722 2000-03-17 Allan Rae <rae@lyx.org>
5724 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5725 need it? Maybe it could go in Dialogs instead? I could make it a
5726 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5727 values to get the bool return value.
5728 (Dispatch): New overloaded method for xtl support.
5730 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5731 extern "C" callback instead of static member functions. Hopefully,
5732 JMarc will be able to compile this. I haven't changed
5733 forms/form_copyright.fd yet. Breaking one of my own rules already.
5735 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5736 because they aren't useful from the minibuffer. Maybe a LyXServer
5737 might want a help message though?
5739 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5741 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5742 xtl which needs both rtti and exceptions.
5744 * src/support/Makefile.am:
5745 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5747 * src/frontends/xforms/input_validators.[ch]: input filters and
5748 validators. These conrol what keys are valid in input boxes.
5749 Use them and write some more. Much better idea than waiting till
5750 after the user has pressed Ok to say that the input fields don't make
5753 * src/frontends/xforms/Makefile.am:
5754 * src/frontends/xforms/forms/form_print.fd:
5755 * src/frontends/xforms/forms/makefile:
5756 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5757 new scheme. Still have to make sure I haven't missed anything from
5758 the current implementation.
5760 * src/Makefile.am, src/PrinterParams.h: New data store.
5762 * other files: Added a couple of copyright notices.
5764 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5766 * src/insets/insetbib.h: move Holder struct in public space.
5768 * src/frontends/include/DialogBase.h: use SigC:: only when
5769 SIGC_CXX_NAMESPACES is defined.
5770 * src/frontends/include/Dialogs.h: ditto.
5772 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5774 * src/frontends/xforms/FormCopyright.[Ch]: do not
5775 mention SigC:: explicitely.
5777 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5779 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5780 deals with testing KDE in main configure.in
5781 * configure.in: ditto.
5783 2000-02-22 Allan Rae <rae@lyx.org>
5785 * Lots of files: Merged from HEAD
5787 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5788 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5790 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5792 * sigc++/: new minidist.
5794 2000-02-14 Allan Rae <rae@lyx.org>
5796 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5798 2000-02-08 Juergen Vigna <jug@sad.it>
5800 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5801 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5803 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5804 for this port and so it is much easier for other people to port
5805 dialogs in a common development environment.
5807 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5808 the QT/KDE implementation.
5810 * src/frontends/kde/Dialogs.C:
5811 * src/frontends/kde/FormCopyright.C:
5812 * src/frontends/kde/FormCopyright.h:
5813 * src/frontends/kde/Makefile.am:
5814 * src/frontends/kde/formcopyrightdialog.C:
5815 * src/frontends/kde/formcopyrightdialog.h:
5816 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5817 for the kde support of the Copyright-Dialog.
5819 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5820 subdir-substitution instead of hardcoded 'xforms' as we now have also
5823 * src/frontends/include/DialogBase.h (Object): just commented the
5824 label after #endif (nasty warning and I don't like warnings ;)
5826 * src/main.C (main): added KApplication initialization if using
5829 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5830 For now only the KDE event-loop is added if frontend==kde.
5832 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5834 * configure.in: added support for the --with-frontend[=value] option
5836 * autogen.sh: added kde.m4 file to list of config-files
5838 * acconfig.h: added define for KDEGUI-support
5840 * config/kde.m4: added configuration functions for KDE-port
5842 * config/lyxinclude.m4: added --with-frontend[=value] option with
5843 support for xforms and KDE.
5845 2000-02-08 Allan Rae <rae@lyx.org>
5847 * all Makefile.am: Fixed up so the make targets dist, distclean,
5848 install and uninstall all work even if builddir != srcdir. Still
5849 have a new sigc++ minidist update to come.
5851 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5853 2000-02-01 Allan Rae <rae@lyx.org>
5855 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5856 Many mods to get builddir != srcdir working.
5858 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5859 for building on NT and so we can do the builddir != srcdir stuff.
5861 2000-01-30 Allan Rae <rae@lyx.org>
5863 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5864 This will stay in "rae" branch. We probably don't really need it in
5865 the main trunk as anyone who wants to help programming it should get
5866 a full library installed also. So they can check both included and
5867 system supplied library compilation.
5869 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5870 Added a 'mini' distribution of libsigc++. If you feel the urge to
5871 change something in these directories - Resist it. If you can't
5872 resist the urge then you should modify the following script and rebuild
5873 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5874 all happen. Still uses a hacked version of libsigc++'s configure.in.
5875 I'm quite happy with the results. I'm not sure the extra work to turn
5876 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5877 worth the trouble and would probably lead to extra maintenance
5879 I haven't tested the following important make targets: install, dist.
5880 Not ready for prime time but very close. Maybe 1.1.5.
5882 * development/tools/makeLyXsigc.sh: A shell script to automatically
5883 generate our mini-dist of libsigc++. It can only be used with a CVS
5884 checkout of libsigc++ not a tarball distribution. It's well commented.
5885 This will end up as part of the libsigc++ distribution so other apps
5886 can easily have an included mini-dist. If someone makes mods to the
5887 sigc++ subpackage without modifying this script to generate those
5888 changes I'll be very upset!
5890 * src/frontends/: Started the gui/system indep structure.
5892 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5893 to access the gui-indep dialogs are in this class. Much improved
5894 design compared to previous revision. Lars, please refrain from
5895 moving this header into src/ like you did with Popups.h last time.
5897 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5899 * src/frontends/xforms/: Started the gui-indep system with a single
5900 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5903 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5904 Here you'll find a very useful makefile and automated fdfix.sh that
5905 makes updating dailogs a no-brainer -- provided you follow the rules
5906 set out in the README. I'm thinking about adding another script to
5907 automatically generate skeleton code for a new dialog given just the
5910 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5911 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5912 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5914 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5916 * src/support/LSubstring.C (operator): simplify
5918 * src/lyxtext.h: removed bparams, use buffer_->params instead
5920 * src/lyxrow.h: make Row a real class, move all variables to
5921 private and use accessors.
5923 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5925 (isRightToLeftPar): ditto
5926 (ChangeLanguage): ditto
5927 (isMultiLingual): ditto
5930 (SimpleTeXOnePar): ditto
5931 (TeXEnvironment): ditto
5932 (GetEndLabel): ditto
5934 (SetOnlyLayout): ditto
5935 (BreakParagraph): ditto
5936 (BreakParagraphConservative): ditto
5937 (GetFontSettings): ditto
5939 (CopyIntoMinibuffer): ditto
5940 (CutIntoMinibuffer): ditto
5941 (PasteParagraph): ditto
5942 (SetPExtraType): ditto
5943 (UnsetPExtraType): ditto
5944 (DocBookContTableRows): ditto
5945 (SimpleDocBookOneTablePar): ditto
5947 (TeXFootnote): ditto
5948 (SimpleTeXOneTablePar): ditto
5949 (TeXContTableRows): ditto
5950 (SimpleTeXSpecialChars): ditto
5953 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5954 to private and use accessors.
5956 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5957 this, we did not use it anymore and has not been for ages. Just a
5958 waste of cpu cycles.
5960 * src/language.h: make Language a real class, move all variables
5961 to private and use accessors.
5963 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5964 (create_view): remove
5965 (update): some changes for new timer
5966 (cursorToggle): use new timer
5967 (beforeChange): change for new timer
5969 * src/BufferView.h (cursorToggleCB): removed last paramter because
5972 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5973 (cursorToggleCB): change because of new timer code
5975 * lib/CREDITS: updated own mailaddress
5977 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5979 * src/support/filetools.C (PutEnv): fix the code in case neither
5980 putenv() nor setenv() have been found.
5982 * INSTALL: mention the install-strip Makefile target.
5984 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5985 read-only documents.
5987 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5989 * lib/reLyX/configure.in (VERSION): avoid using a previously
5990 generated reLyX wrapper to find out $prefix.
5992 * lib/examples/eu_adibide_lyx-atua.lyx:
5993 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5994 translation of the Tutorial (Dooteo)
5996 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5998 * forms/cite.fd: new citation dialog
6000 * src/insetcite.[Ch]: the new citation dialog is moved into
6003 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6006 * src/insets/insetcommand.h: data members made private.
6008 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6010 * LyX 1.1.5 released
6012 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6014 * src/version.h (LYX_RELEASE): to 1.1.5
6016 * src/spellchecker.C (RunSpellChecker): return false if the
6017 spellchecker dies upon creation.
6019 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6021 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6022 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6026 * lib/CREDITS: update entry for Martin Vermeer.
6028 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6030 * src/text.C (draw): Draw foreign language bars at the bottom of
6031 the row instead of at the baseline.
6033 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6035 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6037 * lib/bind/de_menus.bind: updated
6039 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6041 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6043 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6045 * src/menus.C (Limit_string_length): New function
6046 (ShowTocMenu): Limit the number of items/length of items in the
6049 * src/paragraph.C (String): Correct result for a paragraph inside
6052 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6054 * src/bufferlist.C (close): test of buf->getuser() == NULL
6056 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6058 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6059 Do not call to SetCursor when the paragraph is a closed footnote!
6061 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6063 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6066 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6068 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6071 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6072 reference popup, that activates the reference-back action
6074 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6076 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6077 the menus. Also fixed a bug.
6079 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6080 the math panels when switching buffers (unless new buffer is readonly).
6082 * src/BufferView.C (NoSavedPositions)
6083 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6085 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6087 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6088 less of dvi dirty or not.
6090 * src/trans_mgr.[Ch] (insert): change first parameter to string
6093 * src/chset.[Ch] (encodeString): add const to first parameter
6095 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6097 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6101 * src/LaTeX.C (deplog): better searching for dependency files in
6102 the latex log. Uses now regexps.
6104 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6105 instead of the box hack or \hfill.
6107 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6109 * src/lyxfunc.C (doImportHelper): do not create the file before
6110 doing the actual import.
6111 (doImportASCIIasLines): create a new file before doing the insert.
6112 (doImportASCIIasParagraphs): ditto.
6114 * lib/lyxrc.example: remove mention of non-existing commands
6116 * lyx.man: remove mention of color-related switches.
6118 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6120 * src/lyx_gui.C: remove all the color-related ressources, which
6121 are not used anymore.
6123 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6126 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6128 * src/lyxrc.C (read): Add a missing break in the switch
6130 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6132 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6134 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6137 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6139 * src/text.C (draw): draw bars under foreign language words.
6141 * src/LColor.[Ch]: add LColor::language
6143 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6145 * src/lyxcursor.h (boundary): New member variable
6147 * src/text.C (IsBoundary): New methods
6149 * src/text.C: Use the above for currect cursor movement when there
6150 is both RTL & LTR text.
6152 * src/text2.C: ditto
6154 * src/bufferview_funcs.C (ToggleAndShow): ditto
6156 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6158 * src/text.C (DeleteLineForward): set selection to true to avoid
6159 that DeleteEmptyParagraphMechanism does some magic. This is how it
6160 is done in all other functions, and seems reasonable.
6161 (DeleteWordForward): do not jump over non-word stuff, since
6162 CursorRightOneWord() already does it.
6164 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6165 DeleteWordBackward, since they seem safe to me (since selection is
6166 set to "true") DeleteEmptyParagraphMechanism does nothing.
6168 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6170 * src/lyx_main.C (easyParse): simplify the code by factoring the
6171 part that removes parameters from the command line.
6172 (LyX): check wether wrong command line options have been given.
6174 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6176 * src/lyx_main.C : add support for specifying user LyX
6177 directory via command line option -userdir.
6179 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6181 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6182 the number of items per popup.
6183 (Add_to_refs_menu): Ditto.
6185 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6187 * src/lyxparagraph.h: renamed ClearParagraph() to
6188 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6189 textclass as parameter, and do nothing if free_spacing is
6190 true. This fixes part of the line-delete-forward problems.
6192 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6193 (pasteSelection): ditto.
6194 (SwitchLayoutsBetweenClasses): more translatable strings.
6196 * src/text2.C (CutSelection): use StripLeadingSpaces.
6197 (PasteSelection): ditto.
6198 (DeleteEmptyParagraphMechanism): ditto.
6200 2000-05-26 Juergen Vigna <jug@sad.it>
6202 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6203 is not needed in tabular insets.
6205 * src/insets/insettabular.C (TabularFeatures): added missing features.
6207 * src/tabular.C (DeleteColumn):
6209 (AppendRow): implemented this functions
6210 (cellsturct::operator=): clone the inset too;
6212 2000-05-23 Juergen Vigna <jug@sad.it>
6214 * src/insets/insettabular.C (LocalDispatch): better selection support
6215 when having multicolumn-cells.
6217 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6219 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6221 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6223 * src/ColorHandler.C (getGCForeground): put more test into _()
6225 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6228 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6231 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6233 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6234 there are no labels, or when buffer is readonly.
6236 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6237 there are no labels, buffer is SGML, or when buffer is readonly.
6239 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6241 * src/LColor.C (LColor): change a couple of grey40 to grey60
6242 (LColor): rewore initalization to make compiles go some magnitude
6244 (getGUIName): don't use gettext until we need the string.
6246 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6248 * src/Bullet.[Ch]: Fixed a small bug.
6250 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6252 * src/paragraph.C (String): Several fixes/improvements
6254 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6256 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6258 * src/paragraph.C (String): give more correct output.
6260 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6262 * src/lyxfont.C (stateText) Do not output the language if it is
6263 eqaul to the language of the document.
6265 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6266 between two paragraphs with the same language.
6268 * src/paragraph.C (getParLanguage) Return a correct answer for an
6269 empty dummy paragraph.
6271 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6274 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6277 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6278 the menus/popup, if requested fonts are unavailable.
6280 2000-05-22 Juergen Vigna <jug@sad.it>
6282 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6283 movement support (Up/Down/Tab/Shift-Tab).
6284 (LocalDispatch): added also preliminari cursor-selection.
6286 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6288 * src/paragraph.C (PasteParagraph): Hopefully now right!
6290 2000-05-22 Garst R. Reese <reese@isn.net>
6292 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6293 of list, change all references to Environment to Command
6294 * tex/hollywood.cls : rewrite environments as commands, add
6295 \uppercase to interiorshot and exteriorshot to force uppecase.
6296 * tex/broadway.cls : rewrite environments as commands. Tweak
6299 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6301 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6302 size of items: use a constant intead of the hardcoded 40, and more
6303 importantly do not remove the %m and %x tags added at the end.
6304 (Add_to_refs_menu): use vector::size_type instead of
6305 unsigned int as basic types for the variables. _Please_ do not
6306 assume that size_t is equal to unsigned int. On an alpha, this is
6307 unsigned long, which is _not_ the same.
6309 * src/language.C (initL): remove language "hungarian", since it
6310 seems that "magyar" is better.
6312 2000-05-22 Juergen Vigna <jug@sad.it>
6314 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6316 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6319 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6320 next was deleted but not set to 0.
6322 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6324 * src/language.C (initL): change the initialization of languages
6325 so that compiles goes _fast_.
6327 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6330 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6332 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6336 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6338 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6340 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6344 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6347 * src/insets/insetlo*.[Ch]: Made editable
6349 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6351 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6352 the current selection.
6354 * src/BufferView_pimpl.C (stuffClipboard): new method
6356 * src/BufferView.C (stuffClipboard): new method
6358 * src/paragraph.C (String): new method
6360 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6361 LColor::ignore when lyxname is not found.
6363 * src/BufferView.C (pasteSelection): new method
6365 * src/BufferView_pimpl.C (pasteSelection): new method
6367 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6369 * src/WorkArea.C (request_clipboard_cb): new static function
6370 (getClipboard): new method
6371 (putClipboard): new method
6373 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6375 * LyX 1.1.5pre2 released
6377 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6379 * src/vspace.C (operator=): removed
6380 (operator=): removed
6382 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6384 * src/layout.C (NumberOfClass): manually set the type in make_pair
6385 (NumberOfLayout): ditto
6387 * src/language.C: use the Language constructor for ignore_lang
6389 * src/language.h: add constructors to struct Language
6391 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6393 * src/text2.C (SetCursorIntern): comment out #warning
6395 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6397 * src/mathed/math_iter.h: initialize sx and sw to 0
6399 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6401 * forms/lyx.fd: Redesign of form_ref
6403 * src/LaTeXFeatures.[Ch]
6407 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6410 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6411 and Buffer::inset_iterator.
6413 * src/menus.C: Added new menus: TOC and Refs.
6415 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6417 * src/buffer.C (getTocList): New method.
6419 * src/BufferView2.C (ChangeRefs): New method.
6421 * src/buffer.C (getLabelList): New method. It replaces the old
6422 getReferenceList. The return type is vector<string> instead of
6425 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6426 the old getLabel() and GetNumberOfLabels() methods.
6427 * src/insets/insetlabel.C (getLabelList): ditto
6428 * src/mathed/formula.C (getLabelList): ditto
6430 * src/paragraph.C (String): New method.
6432 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6433 Uses the new getTocList() method.
6434 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6435 which automatically updates the contents of the browser.
6436 (RefUpdateCB): Use the new getLabelList method.
6438 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6440 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6442 * src/spellchecker.C: Added using std::reverse;
6444 2000-05-19 Juergen Vigna <jug@sad.it>
6446 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6448 * src/insets/insettext.C (computeTextRows): small fix for display of
6449 1 character after a newline.
6451 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6454 2000-05-18 Juergen Vigna <jug@sad.it>
6456 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6457 when changing width of column.
6459 * src/tabular.C (set_row_column_number_info): setting of
6460 autobreak rows if necessary.
6462 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6464 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6466 * src/vc-backend.*: renamed stat() to status() and vcstat to
6467 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6468 compilation broke. The new name seems more relevant, anyway.
6470 2000-05-17 Juergen Vigna <jug@sad.it>
6472 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6473 which was wrong if the removing caused removing of rows!
6475 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6476 (pushToken): new function.
6478 * src/text2.C (CutSelection): fix problem discovered with purify
6480 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6482 * src/debug.C (showTags): enlarge the first column, now that we
6483 have 6-digits debug codes.
6485 * lib/layouts/hollywood.layout:
6486 * lib/tex/hollywood.cls:
6487 * lib/tex/brodway.cls:
6488 * lib/layouts/brodway.layout: more commands and fewer
6489 environments. Preambles moved in the .cls files. Broadway now has
6490 more options on scene numbering and less whitespace (from Garst)
6492 * src/insets/insetbib.C (getKeys): make sure that we are in the
6493 document directory, in case the bib file is there.
6495 * src/insets/insetbib.C (Latex): revert bogus change.
6497 2000-05-16 Juergen Vigna <jug@sad.it>
6499 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6500 the TabularLayout on cursor move.
6502 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6504 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6507 (draw): fixed cursor position and drawing so that the cursor is
6508 visible when before the tabular-inset.
6510 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6511 when creating from old insettext.
6513 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6515 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6517 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6518 * lib/tex/brodway.cls: ditto
6520 * lib/layouts/brodway.layout: change alignment of parenthical
6523 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6525 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6526 versions 0.88 and 0.89 are supported.
6528 2000-05-15 Juergen Vigna <jug@sad.it>
6530 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6533 * src/insets/insettext.C (computeTextRows): redone completely this
6534 function in a much cleaner way, because of problems when having a
6536 (draw): added a frame border when the inset is locked.
6537 (SetDrawLockedFrame): this sets if we draw the border or not.
6538 (SetFrameColor): this sets the frame color (default=insetframe).
6540 * src/insets/lyxinset.h: added x() and y() functions which return
6541 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6542 function which is needed to see if we have a locking inset of some
6543 type in this inset (needed for now in insettabular).
6545 * src/vspace.C (inPixels): the same function also without a BufferView
6546 parameter as so it is easier to use it in some ocasions.
6548 * src/lyxfunc.C: changed all places where insertInset was used so
6549 that now if it couldn't be inserted it is deleted!
6551 * src/TabularLayout.C:
6552 * src/TableLayout.C: added support for new tabular-inset!
6554 * src/BufferView2.C (insertInset): this now returns a bool if the
6555 inset was really inserted!!!
6557 * src/tabular.C (GetLastCellInRow):
6558 (GetFirstCellInRow): new helper functions.
6559 (Latex): implemented for new tabular class.
6563 (TeXTopHLine): new Latex() helper functions.
6565 2000-05-12 Juergen Vigna <jug@sad.it>
6567 * src/mathed/formulamacro.C (Read):
6568 * src/mathed/formula.C (Read): read also the \end_inset here!
6570 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6572 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6573 crush when saving formulae with unbalanced parenthesis.
6575 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6577 * src/layout.C: Add new keyword "endlabelstring" to layout file
6579 * src/text.C (GetVisibleRow): Draw endlabel string.
6581 * lib/layouts/broadway.layout
6582 * lib/layouts/hollywood.layout: Added endlabel for the
6583 Parenthetical layout.
6585 * lib/layouts/heb-article.layout: Do not use slanted font shape
6586 for Theorem like environments.
6588 * src/buffer.C (makeLaTeXFile): Always add "american" to
6589 the UsedLanguages list if document language is RTL.
6591 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6593 * add addendum to README.OS2 and small patch (from SMiyata)
6595 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6597 * many files: correct the calls to ChangeExtension().
6599 * src/support/filetools.C (ChangeExtension): remove the no_path
6600 argument, which does not belong there. Use OnlyFileName() instead.
6602 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6603 files when LaTeXing a non-nice latex file.
6605 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6606 a chain of "if". Return false when deadkeys are not handled.
6608 * src/lyx_main.C (LyX): adapted the code for default bindings.
6610 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6611 bindings for basic functionality (except deadkeys).
6612 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6614 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6615 several methods: handle override_x_deadkeys.
6617 * src/lyxrc.h: remove the "bindings" map, which did not make much
6618 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6620 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6622 * src/lyxfont.C (stateText): use a saner method to determine
6623 whether the font is "default". Seems to fix the crash with DEC
6626 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6628 2000-05-08 Juergen Vigna <jug@sad.it>
6630 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6631 TabularLayoutMenu with mouse-button-3
6632 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6634 * src/TabularLayout.C: added this file for having a Layout for
6637 2000-05-05 Juergen Vigna <jug@sad.it>
6639 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6640 recalculating inset-widths.
6641 (TabularFeatures): activated this function so that I can change
6642 tabular-features via menu.
6644 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6645 that I can test some functions with the Table menu.
6647 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6649 * src/lyxfont.C (stateText): guard against stupid c++libs.
6651 * src/tabular.C: add using std::vector
6652 some whitespace changes, + removed som autogenerated code.
6654 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6656 2000-05-05 Juergen Vigna <jug@sad.it>
6658 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6659 row, columns and cellstructures.
6661 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6663 * lib/lyxrc.example: remove obsolete entries.
6665 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6666 reading of protected_separator for free_spacing.
6668 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6670 * src/text.C (draw): do not display an exclamation mark in the
6671 margin for margin notes. This is confusing, ugly and
6674 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6675 AMS math' is checked.
6677 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6678 name to see whether including the amsmath package is needed.
6680 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6682 * src/paragraph.C (validate): Compute UsedLanguages correctly
6683 (don't insert the american language if it doesn't appear in the
6686 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6687 The argument of \thanks{} command is considered moving argument
6689 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6692 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6694 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6695 for appendix/minipage/depth. The lines can be now both in the footnote
6696 frame, and outside the frame.
6698 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6701 2000-05-05 Juergen Vigna <jug@sad.it>
6703 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6704 neede only in tabular.[Ch].
6706 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6708 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6710 (Write): write '~' for PROTECTED_SEPARATOR
6712 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6714 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6717 * src/mathed/formula.C (drawStr): rename size to siz.
6719 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6720 possibly fix a bug by not changing the pflags = flags to piflags =
6723 2000-05-05 Juergen Vigna <jug@sad.it>
6725 * src/insets/insetbib.C: moved using directive
6727 * src/ImportNoweb.C: small fix for being able to compile (missing
6730 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6732 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6733 to use clear, since we don't depend on this in the code. Add test
6736 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6738 * (various *.C files): add using std::foo directives to please dec
6741 * replace calls to string::clear() to string::erase() (Angus)
6743 * src/cheaders/cmath: modified to provide std::abs.
6745 2000-05-04 Juergen Vigna <jug@sad.it>
6747 * src/insets/insettext.C: Prepared all for inserting of multiple
6748 paragraphs. Still display stuff to do (alignment and other things),
6749 but I would like to use LyXText to do this when we cleaned out the
6750 table-support stuff.
6752 * src/insets/insettabular.C: Changed lot of stuff and added lots
6753 of functionality still a lot to do.
6755 * src/tabular.C: Various functions changed name and moved to be
6756 const functions. Added new Read and Write functions and changed
6757 lots of things so it works good with tabular-insets (also removed
6758 some stuff which is not needed anymore * hacks *).
6760 * src/lyxcursor.h: added operators == and != which just look if
6761 par and pos are (not) equal.
6763 * src/buffer.C (latexParagraphs): inserted this function to latex
6764 all paragraphs form par to endpar as then I can use this too for
6767 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6768 so that I can call this to from text insets with their own cursor.
6770 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6771 output off all paragraphs (because of the fix below)!
6773 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6774 the very last paragraph (this could be also the last paragraph of an
6777 * src/texrow.h: added rows() call which returns the count-variable.
6779 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6781 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6783 * lib/configure.m4: better autodetection of DocBook tools.
6785 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6787 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6789 * src/lyx_cb.C: add using std::reverse;
6791 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6794 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6795 selected files. Should fix repeated errors from generated files.
6797 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6799 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6801 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6802 the spellchecker popup.
6804 * lib/lyxrc.example: Removed the \number_inset section
6806 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6808 * src/insets/figinset.C (various): Use IsFileReadable() to make
6809 sure that the file actually exist. Relying on ghostscripts errors
6810 is a bad idea since they can lead to X server crashes.
6812 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6814 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6817 * lib/lyxrc.example: smallish typo in description of
6818 \view_dvi_paper_option
6820 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6823 * src/lyxfunc.C: doImportHelper to factor out common code of the
6824 various import methods. New functions doImportASCIIasLines,
6825 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6826 doImportLinuxDoc for the format specific parts.
6829 * buffer.C: Dispatch returns now a bool to indicate success
6832 * lyx_gui.C: Add getLyXView() for member access
6834 * lyx_main.C: Change logic for batch commands: First try
6835 Buffer::Dispatch (possibly without GUI), if that fails, use
6838 * lyx_main.C: Add support for --import command line switch.
6839 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6840 Available Formats: Everything accepted by 'buffer-import <format>'
6842 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6844 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6847 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6848 documents will be reformatted upon reentry.
6850 2000-04-27 Juergen Vigna <jug@sad.it>
6852 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6853 correctly only last pos this was a bug.
6855 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6857 * release of lyx-1.1.5pre1
6859 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6861 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6863 * src/menus.C: revert the change of naming (Figure->Graphic...)
6864 from 2000-04-11. It was incomplete and bad.
6866 * src/LColor.[Ch]: add LColor::depthbar.
6867 * src/text.C (GetVisibleRow): use it.
6869 * README: update the languages list.
6871 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6873 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6876 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6878 * README: remove sections that were just wrong.
6880 * src/text2.C (GetRowNearY): remove currentrow code
6882 * src/text.C (GetRow): remove currentrow code
6884 * src/screen.C (Update): rewritten a bit.
6885 (SmallUpdate): removed func
6887 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6889 (FullRebreak): return bool
6890 (currentrow): remove var
6891 (currentrow_y): ditto
6893 * src/lyxscreen.h (Draw): change arg to unsigned long
6894 (FitCursor): return bool
6895 (FitManualCursor): ditto
6896 (Smallpdate): remove func
6897 (first): change to unsigned long
6898 (DrawOneRow): change second arg to long (from long &)
6899 (screen_refresh_y): remove var
6900 (scree_refresh_row): ditto
6902 * src/lyxrow.h: change baseline to usigned int from unsigned
6903 short, this brings some implicit/unsigned issues out in the open.
6905 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6907 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6908 instead of smallUpdate.
6910 * src/lyxcursor.h: change y to unsigned long
6912 * src/buffer.h: don't call updateScrollbar after fitcursor
6914 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6915 where they are used. Removed "\\direction", this was not present
6916 in 1.1.4 and is already obsolete. Commented out some code that I
6917 believe to never be called.
6918 (runLiterate): don't call updateScrollbar after fitCursor
6920 (buildProgram): ditto
6923 * src/WorkArea.h (workWidth): change return val to unsigned
6926 (redraw): remove the button redraws
6927 (setScrollbarValue): change for scrollbar
6928 (getScrollbarValue): change for scrollbar
6929 (getScrollbarBounds): change for scrollbar
6931 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6932 (C_WorkArea_down_cb): removed func
6933 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6934 (resize): change for scrollbar
6935 (setScrollbar): ditto
6936 (setScrollbarBounds): ditto
6937 (setScrollbarIncrements): ditto
6938 (up_cb): removed func
6939 (down_cb): removed func
6940 (scroll_cb): change for scrollbar
6941 (work_area_handler): ditto
6943 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6944 when FitCursor did something.
6945 (updateScrollbar): some unsigned changes
6946 (downCB): removed func
6947 (scrollUpOnePage): removed func
6948 (scrollDownOnePage): remvoed func
6949 (workAreaMotionNotify): don't call screen->FitCursor but use
6950 fitCursor instead. and bool return val
6951 (workAreaButtonPress): ditto
6952 (workAreaButtonRelease): some unsigned changes
6953 (checkInsetHit): ditto
6954 (workAreaExpose): ditto
6955 (update): parts rewritten, comments about the signed char arg added
6956 (smallUpdate): removed func
6957 (cursorPrevious): call needed updateScrollbar
6960 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6963 * src/BufferView.[Ch] (upCB): removed func
6964 (downCB): removed func
6965 (smallUpdate): removed func
6967 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6969 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6970 currentrow, currentrow_y optimization. This did not help a lot and
6971 if we want to do this kind of optimization we should rather use
6972 cursor.row instead of the currentrow.
6974 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6975 buffer spacing and klyx spacing support.
6977 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6979 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6982 2000-04-26 Juergen Vigna <jug@sad.it>
6984 * src/insets/figinset.C: fixes to Lars sstream changes!
6986 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6988 * A lot of files: Added Ascii(ostream &) methods to all inset
6989 classes. Used when exporting to ASCII.
6991 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6992 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6995 * src/text2.C (ToggleFree): Disabled implicit word selection when
6996 there is a change in the language
6998 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6999 no output was generated for end-of-sentence inset.
7001 * src/insets/lyxinset.h
7004 * src/paragraph.C: Removed the insetnumber code
7006 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7008 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7010 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7011 no_babel and no_epsfig completely from the file.
7012 (parseSingleLyXformat2Token): add handling for per-paragraph
7013 spacing as written by klyx.
7015 * src/insets/figinset.C: applied patch by Andre. Made it work with
7018 2000-04-20 Juergen Vigna <jug@sad.it>
7020 * src/insets/insettext.C (cutSelection):
7021 (copySelection): Fixed with selection from right to left.
7022 (draw): now the rows are not recalculated at every draw.
7023 (computeTextRows): for now reset the inset-owner here (this is
7024 important for an undo or copy where the inset-owner is not set
7027 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7028 motion to the_locking_inset screen->first was forgotten, this was
7029 not important till we got multiline insets.
7031 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7033 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7034 code seems to be alright (it is code changed by Dekel, and the
7035 intent is indeed that all macros should be defined \protect'ed)
7037 * NEWS: a bit of reorganisation of the new user-visible features.
7039 2000-04-19 Juergen Vigna <jug@sad.it>
7041 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7042 position. Set the inset_owner of the used paragraph so that it knows
7043 that it is inside an inset. Fixed cursor handling with mouse and
7044 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7045 and cleanups to make TextInsets work better.
7047 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7048 Changed parameters of various functions and added LockInsetInInset().
7050 * src/insets/insettext.C:
7052 * src/insets/insetcollapsable.h:
7053 * src/insets/insetcollapsable.C:
7054 * src/insets/insetfoot.h:
7055 * src/insets/insetfoot.C:
7056 * src/insets/insetert.h:
7057 * src/insets/insetert.C: cleaned up the code so that it works now
7058 correctly with insettext.
7060 * src/insets/inset.C:
7061 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7062 that insets in insets are supported right.
7065 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7067 * src/paragraph.C: some small fixes
7069 * src/debug.h: inserted INSETS debug info
7071 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7072 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7074 * src/commandtags.h:
7075 * src/LyXAction.C: insert code for InsetTabular.
7077 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7078 not Button1MotionMask.
7079 (workAreaButtonRelease): send always a InsetButtonRelease event to
7081 (checkInsetHit): some setCursor fixes (always with insets).
7083 * src/BufferView2.C (lockInset): returns a bool now and extended for
7084 locking insets inside insets.
7085 (showLockedInsetCursor): it is important to have the cursor always
7086 before the locked inset.
7087 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7089 * src/BufferView.h: made lockInset return a bool.
7091 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7093 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7094 that is used also internally but can be called as public to have back
7095 a cursor pos which is not set internally.
7096 (SetCursorIntern): Changed to use above function.
7098 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7100 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7105 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7106 patches for things that should be in or should be changed.
7108 * src/* [insetfiles]: change "usigned char fragile" to bool
7109 fragile. There was only one point that could that be questioned
7110 and that is commented in formulamacro.C. Grep for "CHECK".
7112 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7113 (DeleteBuffer): take it out of CutAndPaste and make it static.
7115 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7117 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7118 output the spacing envir commands. Also the new commands used in
7119 the LaTeX output makes the result better.
7121 * src/Spacing.C (writeEnvirBegin): new method
7122 (writeEnvirEnd): new method
7124 2000-04-18 Juergen Vigna <jug@sad.it>
7126 * src/CutAndPaste.C: made textclass a static member of the class
7127 as otherwise it is not accesed right!!!
7129 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7131 * forms/layout_forms.fd
7132 * src/layout_forms.h
7133 * src/layout_forms.C (create_form_form_character)
7134 * src/lyx_cb.C (UserFreeFont)
7135 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7136 documents (in the layout->character popup).
7138 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7140 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7141 \spell_command was in fact not honored (from Kevin Atkinson).
7143 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7146 * src/lyx_gui.h: make lyxViews private (Angus)
7148 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7150 * src/mathed/math_write.C
7151 (MathMatrixInset::Write) Put \protect before \begin{array} and
7152 \end{array} if fragile
7153 (MathParInset::Write): Put \protect before \\ if fragile
7155 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7157 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7158 initialization if the LyXColorHandler must be done after the
7159 connections to the XServer has been established.
7161 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7162 get the background pixel from the lyxColorhandler so that the
7163 figures are rendered with the correct background color.
7164 (NextToken): removed functions.
7165 (GetPSSizes): use ifs >> string instead of NextToken.
7167 * src/Painter.[Ch]: the color cache moved out of this file.
7169 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7172 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7174 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7175 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7177 * src/BufferView.C (enterView): new func
7178 (leaveView): new func
7180 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7182 (leaveView): new func, undefines xterm cursor when approp.
7184 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7185 (AllowInput): delete the Workarea cursor handling from this func.
7187 * src/Painter.C (underline): draw a slimer underline in most cases.
7189 * src/lyx_main.C (error_handler): use extern "C"
7191 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7193 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7194 sent directly to me.
7196 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7197 to the list by Dekel.
7199 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7202 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7203 methods from lyx_cb.here.
7205 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7208 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7210 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7211 instead of using current_view directly.
7213 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7215 * src/LyXAction.C (init): add the paragraph-spacing command.
7217 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7219 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7221 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7222 different from the documents.
7224 * src/text.C (SetHeightOfRow): take paragraph spacing into
7225 account, paragraph spacing takes precedence over buffer spacing
7226 (GetVisibleRow): ditto
7228 * src/paragraph.C (writeFile): output the spacing parameter too.
7229 (validate): set the correct features if spacing is used in the
7231 (Clear): set spacing to default
7232 (MakeSameLayout): spacing too
7233 (HasSameLayout): spacing too
7234 (SetLayout): spacing too
7235 (TeXOnePar): output the spacing commands
7237 * src/lyxparagraph.h: added a spacing variable for use with
7238 per-paragraph spacing.
7240 * src/Spacing.h: add a Default spacing and a method to check if
7241 the current spacing is default. also added an operator==
7243 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7246 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7248 * src/lyxserver.C (callback): fix dispatch of functions
7250 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7251 printf() into lyxerr call.
7253 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7256 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7257 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7258 the "Float" from each of the subitems.
7259 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7261 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7262 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7263 documented the change so that the workaround can be nuked later.
7265 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7268 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7270 * src/buffer.C (getLatexName): ditto
7271 (setReadonly): ditto
7273 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7275 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7276 avoid some uses of current_view. Added also a bufferParams()
7277 method to get at this.
7279 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7281 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7283 * src/lyxparagraph.[Ch]: removed
7284 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7285 with operators used by lower_bound and
7286 upper_bound in InsetTable's
7287 Make struct InsetTable private again. Used matchpos.
7289 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7291 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7292 document, the language of existing text is changed (unless the
7293 document is multi-lingual)
7295 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7297 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7299 * A lot of files: A rewrite of the Right-to-Left support.
7301 2000-04-10 Juergen Vigna <jug@sad.it>
7303 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7304 misplaced cursor when inset in inset is locked.
7306 * src/insets/insettext.C (LocalDispatch): small fix so that a
7307 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7309 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7310 footnote font should be decreased in size twice when displaying.
7312 * src/insets/insettext.C (GetDrawFont): inserted this function as
7313 the drawing-font may differ from the real paragraph font.
7315 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7316 insets (inset in inset!).
7318 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7319 function here because we don't want footnotes inside footnotes.
7321 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7323 (init): now set the inset_owner in paragraph.C
7324 (LocalDispatch): added some resetPos() in the right position
7327 (pasteSelection): changed to use the new CutAndPaste-Class.
7329 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7330 which tells if it is allowed to insert another inset inside this one.
7332 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7333 SwitchLayoutsBetweenClasses.
7335 * src/text2.C (InsertInset): checking of the new paragraph-function
7337 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7338 is not needed anymore here!
7341 (PasteSelection): redone (also with #ifdef) so that now this uses
7342 the CutAndPaste-Class.
7343 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7346 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7347 from/to text/insets.
7349 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7350 so that the paragraph knows if it is inside an (text)-inset.
7351 (InsertFromMinibuffer): changed return-value to bool as now it
7352 may happen that an inset is not inserted in the paragraph.
7353 (InsertInsetAllowed): this checks if it is allowed to insert an
7354 inset in this paragraph.
7356 (BreakParagraphConservative):
7357 (BreakParagraph) : small change for the above change of the return
7358 value of InsertFromMinibuffer.
7360 * src/lyxparagraph.h: added inset_owner and the functions to handle
7361 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7363 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7365 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7366 functions from BufferView to BufferView::Pimpl to ease maintence.
7368 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7369 correctly. Also use SetCursorIntern instead of SetCursor.
7371 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7374 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7376 * src/WorkArea.C (belowMouse): manually implement below mouse.
7378 * src/*: Add "explicit" on several constructors, I added probably
7379 some unneeded ones. A couple of changes to code because of this.
7381 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7382 implementation and private parts from the users of BufferView. Not
7385 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7386 implementation and private parts from the users of LyXLex. Not
7389 * src/BufferView_pimpl.[Ch]: new files
7391 * src/lyxlex_pimpl.[Ch]: new files
7393 * src/LyXView.[Ch]: some inline functions move out-of-line
7395 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7397 * src/lyxparagraph.h: make struct InsetTable public.
7399 * src/support/lyxstring.h: change lyxstring::difference_type to be
7400 ptrdiff_t. Add std:: modifiers to streams.
7402 * src/font.C: include the <cctype> header, for islower() and
7405 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7407 * src/font.[Ch]: new files. Contains the metric functions for
7408 fonts, takes a LyXFont as parameter. Better separation of concepts.
7410 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7411 changes because of this.
7413 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7415 * src/*: compile with -Winline and move functions that don't
7418 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7421 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7423 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7424 (various files changed because of this)
7426 * src/Painter.C (text): fixed the drawing of smallcaps.
7428 * src/lyxfont.[Ch] (drawText): removed unused member func.
7431 * src/*.C: added needed "using" statements and "std::" qualifiers.
7433 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7435 * src/*.h: removed all use of "using" from header files use
7436 qualifier std:: instead.
7438 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7440 * src/text.C (Backspace): some additional cleanups (we already
7441 know whether cursor.pos is 0 or not).
7443 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7444 automake does not provide one).
7446 * src/bmtable.h: replace C++ comments with C comments.
7448 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7450 * src/screen.C (ShowCursor): Change the shape of the cursor if
7451 the current language is not equal to the language of the document.
7452 (If the cursor change its shape unexpectedly, then you've found a bug)
7454 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7457 * src/insets/insetnumber.[Ch]: New files.
7459 * src/LyXAction.C (init)
7460 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7463 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7465 * src/lyxparagraph.h
7466 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7467 (the vector is kept sorted).
7469 * src/text.C (GetVisibleRow): Draw selection correctly when there
7470 is both LTR and RTL text.
7472 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7473 which is much faster.
7475 * src/text.C (GetVisibleRow and other): Do not draw the last space
7476 in a row if the direction of the last letter is not equal to the
7477 direction of the paragraph.
7479 * src/lyxfont.C (latexWriteStartChanges):
7480 Check that font language is not equal to basefont language.
7481 (latexWriteEndChanges): ditto
7483 * src/lyx_cb.C (StyleReset): Don't change the language while using
7484 the font-default command.
7486 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7487 empty paragraph before a footnote.
7489 * src/insets/insetcommand.C (draw): Increase x correctly.
7491 * src/screen.C (ShowCursor): Change cursor shape if
7492 current language != document language.
7494 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7496 2000-03-31 Juergen Vigna <jug@sad.it>
7498 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7499 (Clone): changed mode how the paragraph-data is copied to the
7500 new clone-paragraph.
7502 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7503 GetInset(pos) with no inset anymore there (in inset UNDO)
7505 * src/insets/insetcommand.C (draw): small fix as here x is
7506 incremented not as much as width() returns (2 before, 2 behind = 4)
7508 2000-03-30 Juergen Vigna <jug@sad.it>
7510 * src/insets/insettext.C (InsetText): small fix in initialize
7511 widthOffset (should not be done in the init() function)
7513 2000-03-29 Amir Karger <karger@lyx.org>
7515 * lib/examples/it_ItemizeBullets.lyx: translation by
7518 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7520 2000-03-29 Juergen Vigna <jug@sad.it>
7522 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7524 * src/insets/insetfoot.C (Clone): small change as for the below
7525 new init function in the text-inset
7527 * src/insets/insettext.C (init): new function as I've seen that
7528 clone did not copy the Paragraph-Data!
7529 (LocalDispatch): Added code so that now we have some sort of Undo
7530 functionality (well actually we HAVE Undo ;)
7532 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7534 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7536 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7539 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7541 * src/main.C: added a runtime check that verifies that the xforms
7542 header used when building LyX and the library used when running
7543 LyX match. Exit with a message if they don't match. This is a
7544 version number check only.
7546 * src/buffer.C (save): Don't allocate memory on the heap for
7547 struct utimbuf times.
7549 * *: some using changes, use iosfwd instead of the real headers.
7551 * src/lyxfont.C use char const * instead of string for the static
7552 strings. Rewrite some functions to use sstream.
7554 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7556 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7559 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7561 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7562 of Geodesy (from Martin Vermeer)
7564 * lib/layouts/svjour.inc: include file for the Springer svjour
7565 class. It can be used to support journals other than JoG.
7567 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7568 Miskiewicz <misiek@pld.org.pl>)
7569 * lib/reLyX/Makefile.am: ditto.
7571 2000-03-27 Juergen Vigna <jug@sad.it>
7573 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7574 also some modifications with operations on selected text.
7576 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7577 problems with clicking on insets (last famous words ;)
7579 * src/insets/insetcommand.C (draw):
7580 (width): Changed to have a bit of space before and after the inset so
7581 that the blinking cursor can be seen (otherwise it was hidden)
7583 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7585 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7586 would not be added to the link list when an installed gettext (not
7587 part of libc) is found.
7589 2000-03-24 Juergen Vigna <jug@sad.it>
7591 * src/insets/insetcollapsable.C (Edit):
7592 * src/mathed/formula.C (InsetButtonRelease):
7593 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7596 * src/BufferView.C (workAreaButtonPress):
7597 (workAreaButtonRelease):
7598 (checkInsetHit): Finally fixed the clicking on insets be handled
7601 * src/insets/insetert.C (Edit): inserted this call so that ERT
7602 insets work always with LaTeX-font
7604 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7606 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7607 caused lyx to startup with no GUI in place, causing in a crash
7608 upon startup when called with arguments.
7610 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7612 * src/FontLoader.C: better initialization of dummyXFontStruct.
7614 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7616 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7617 for linuxdoc and docbook import and export format options.
7619 * lib/lyxrc.example Example of default values for the previous flags.
7621 * src/lyx_cb.C Use those flags instead of the hardwired values for
7622 linuxdoc and docbook export.
7624 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7627 * src/menus.C Added menus entries for the new import/exports formats.
7629 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7631 * src/lyxrc.*: Added support for running without Gui
7634 * src/FontLoader.C: sensible defaults if no fonts are needed
7636 * src/lyx_cb.C: New function ShowMessage (writes either to the
7637 minibuffer or cout in case of no gui
7638 New function AskOverwrite for common stuff
7639 Consequently various changes to call these functions
7641 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7642 wild guess at sensible screen resolution when having no gui
7644 * src/lyxfont.C: no gui, no fonts... set some defaults
7646 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7648 * src/LColor.C: made the command inset background a bit lighter.
7650 2000-03-20 Hartmut Goebel <goebel@noris.net>
7652 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7653 stdstruct.inc. Koma-Script added some title elements which
7654 otherwise have been listed below "bibliography". This split allows
7655 adding title elements to where they belong.
7657 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7658 define the additional title elements and then include
7661 * many other layout files: changed to include stdtitle.inc just
7662 before stdstruct.inc.
7664 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7666 * src/buffer.C: (save) Added the option to store all backup files
7667 in a single directory
7669 * src/lyxrc.[Ch]: Added variable \backupdir_path
7671 * lib/lyxrc.example: Added descriptions of recently added variables
7673 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7674 bibtex inset, not closing the bibtex popup when deleting the inset)
7676 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7678 * src/lyx_cb.C: add a couple using directives.
7680 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7681 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7682 import based on the filename.
7684 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7685 file would be imported at start, if the filename where of a sgml file.
7687 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7689 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7691 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7692 * src/lyxfont.h Replaced the member variable bits.direction by the
7693 member variable lang. Made many changes in other files.
7694 This allows having a multi-lingual document
7696 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7697 that change the current language to <l>.
7698 Removed the command "font-rtl"
7700 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7701 format for Hebrew documents)
7703 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7704 When auto_mathmode is "true", pressing a digit key in normal mode
7705 will cause entering into mathmode.
7706 If auto_mathmode is "rtl" then this behavior will be active only
7707 when writing right-to-left text.
7709 * src/text2.C (InsertStringA) The string is inserted using the
7712 * src/paragraph.C (GetEndLabel) Gives a correct result for
7713 footnote paragraphs.
7715 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7717 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7719 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7720 front of PasteParagraph. Never insert a ' '. This should at least
7721 fix some cause for the segfaults that we have been experiencing,
7722 it also fixes backspace behaviour slightly. (Phu!)
7724 * src/support/lstrings.C (compare_no_case): some change to make it
7725 compile with gcc 2.95.2 and stdlibc++-v3
7727 * src/text2.C (MeltFootnoteEnvironment): change type o
7728 first_footnote_par_is_not_empty to bool.
7730 * src/lyxparagraph.h: make text private. Changes in other files
7732 (fitToSize): new function
7733 (setContentsFromPar): new function
7734 (clearContents): new function
7735 (SetChar): new function
7737 * src/paragraph.C (readSimpleWholeFile): deleted.
7739 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7740 the file, just use a simple string instead. Also read the file in
7741 a more maintainable manner.
7743 * src/text2.C (InsertStringA): deleted.
7744 (InsertStringB): deleted.
7746 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7748 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7749 RedoParagraphs from the doublespace handling part, just set status
7750 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7751 done, but perhaps not like this.)
7753 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7755 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7756 character when inserting an inset.
7758 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7760 * src/bufferparams.C (readLanguage): now takes "default" into
7763 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7764 also initialize the toplevel_keymap with the default bindings from
7767 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7769 * all files using lyxrc: have lyxrc as a real variable and not a
7770 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7773 * src/lyxrc.C: remove double call to defaultKeyBindings
7775 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7776 toolbar defauls using lyxlex. Remove enums, structs, functions
7779 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7780 toolbar defaults. Also store default keybindings in a map.
7782 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7783 storing the toolbar defaults without any xforms dependencies.
7785 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7786 applied. Changed to use iterators.
7788 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7790 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7791 systems that don't have LINGUAS set to begin with.
7793 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7795 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7796 the list by Dekel Tsur.
7798 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7800 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7801 * src/insets/form_graphics.C: ditto.
7803 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7805 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7807 * src/bufferparams.C (readLanguage): use the new language map
7809 * src/intl.C (InitKeyMapper): use the new language map
7811 * src/lyx_gui.C (create_forms): use the new language map
7813 * src/language.[Ch]: New files. Used for holding the information
7814 about each language. Now! Use this new language map enhance it and
7815 make it really usable for our needs.
7817 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7819 * screen.C (ShowCursor): Removed duplicate code.
7820 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7821 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7823 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7826 * src/text.C Added TransformChar method. Used for rendering Arabic
7827 text correctly (change the glyphs of the letter according to the
7828 position in the word)
7833 * src/lyxrc.C Added lyxrc command {language_command_begin,
7834 language_command_end,language_command_ltr,language_command_rtl,
7835 language_package} which allows the use of either arabtex or Omega
7838 * src/lyx_gui.C (init)
7840 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7841 to use encoding for menu fonts which is different than the encoding
7844 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7845 do not load the babel package.
7846 To write an English document with Hebrew/Arabic, change the document
7847 language to "english".
7849 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7850 (alphaCounter): changed to return char
7851 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7853 * lib/lyxrc.example Added examples for Hebrew/Arabic
7856 * src/layout.C Added layout command endlabeltype
7858 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7860 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7862 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7864 * src/mathed/math_delim.C (search_deco): return a
7865 math_deco_struct* instead of index.
7867 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7869 * All files with a USE_OSTREAM_ONLY within: removed all code that
7870 was unused when USE_OSTREAM_ONLY is defined.
7872 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7873 of any less. Removed header and using.
7875 * src/text.C (GetVisibleRow): draw the string "Page Break
7876 (top/bottom)" on screen when drawing a pagebreak line.
7878 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7880 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7882 * src/mathed/math_macro.C (draw): do some cast magic.
7885 * src/mathed/math_defs.h: change byte* argument to byte const*.
7887 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7889 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7890 know it is right to return InsetFoot* too, but cxx does not like
7893 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7895 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7897 * src/mathed/math_delim.C: change == to proper assignment.
7899 2000-03-09 Juergen Vigna <jug@sad.it>
7901 * src/insets/insettext.C (setPos): fixed various cursor positioning
7902 problems (via mouse and cursor-keys)
7903 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7904 inset (still a small display problem but it works ;)
7906 * src/insets/insetcollapsable.C (draw): added button_top_y and
7907 button_bottom_y to have correct values for clicking on the inset.
7909 * src/support/lyxalgo.h: commented out 'using std::less'
7911 2000-03-08 Juergen Vigna <jug@sad.it>
7913 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7914 Button-Release event closes as it is alos the Release-Event
7917 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7919 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7921 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7922 can add multiple spaces in Scrap (literate programming) styles...
7923 which, by the way, is how I got hooked on LyX to begin with.
7925 * src/mathed/formula.C (Write): Added dummy variable to an
7926 inset::Latex() call.
7927 (Latex): Add free_spacing boolean to inset::Latex()
7929 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7931 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7932 virtual function to include the free_spacing boolean from
7933 the containing paragraph's style.
7935 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7936 Added free_spacing boolean arg to match inset.h
7938 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7939 Added free_spacing boolean arg to match inset.h
7941 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7942 Added free_spacing boolean and made sure that if in a free_spacing
7943 paragraph, that we output normal space if there is a protected space.
7945 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7946 Added free_spacing boolean arg to match inset.h
7948 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7949 Added free_spacing boolean arg to match inset.h
7951 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7952 Added free_spacing boolean arg to match inset.h
7954 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7955 Added free_spacing boolean arg to match inset.h
7957 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7958 Added free_spacing boolean arg to match inset.h
7960 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7961 free_spacing boolean arg to match inset.h
7963 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7964 Added free_spacing boolean arg to match inset.h
7966 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7967 Added free_spacing boolean arg to match inset.h
7969 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7970 Added free_spacing boolean arg to match inset.h
7972 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7973 Added free_spacing boolean arg to match inset.h
7975 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7976 Added free_spacing boolean arg to match inset.h
7978 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7979 free_spacing boolean arg to match inset.h
7981 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7982 free_spacing boolean arg to match inset.h
7984 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7985 ignore free_spacing paragraphs. The user's spaces are left
7988 * src/text.C (InsertChar): Fixed the free_spacing layout
7989 attribute behavior. Now, if free_spacing is set, you can
7990 add multiple spaces in a paragraph with impunity (and they
7991 get output verbatim).
7992 (SelectSelectedWord): Added dummy argument to inset::Latex()
7995 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7998 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7999 paragraph layouts now only input a simple space instead.
8000 Special character insets don't make any sense in free-spacing
8003 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8004 hard-spaces in the *input* file to simple spaces if the layout
8005 is free-spacing. This converts old files which had to have
8006 hard-spaces in free-spacing layouts where a simple space was
8008 (writeFileAscii): Added free_spacing check to pass to the newly
8009 reworked inset::Latex(...) methods. The inset::Latex() code
8010 ensures that hard-spaces in free-spacing paragraphs get output
8011 as spaces (rather than "~").
8013 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8015 * src/mathed/math_delim.C (draw): draw the empty placeholder
8016 delims with a onoffdash line.
8017 (struct math_deco_compare): struct that holds the "functors" used
8018 for the sort and the binary search in math_deco_table.
8019 (class init_deco_table): class used for initial sort of the
8021 (search_deco): use lower_bound to do a binary search in the
8024 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8026 * src/lyxrc.C: a small secret thingie...
8028 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8029 and to not flush the stream as often as it used to.
8031 * src/support/lyxalgo.h: new file
8032 (sorted): template function used for checking if a sequence is
8033 sorted or not. Two versions with and without user supplied
8034 compare. Uses same compare as std::sort.
8036 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8037 it and give warning on lyxerr.
8039 (struct compare_tags): struct with function operators used for
8040 checking if sorted, sorting and lower_bound.
8041 (search_kw): use lower_bound instead of manually implemented
8044 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8046 * src/insets/insetcollapsable.h: fix Clone() declaration.
8047 * src/insets/insetfoot.h: ditto.
8049 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8051 2000-03-08 Juergen Vigna <jug@sad.it>
8053 * src/insets/lyxinset.h: added owner call which tells us if
8054 this inset is inside another inset. Changed also the return-type
8055 of Editable to an enum so it tells clearer what the return-value is.
8057 * src/insets/insettext.C (computeTextRows): fixed computing of
8058 textinsets which split automatically on more rows.
8060 * src/insets/insetert.[Ch]: changed this to be of BaseType
8063 * src/insets/insetfoot.[Ch]: added footnote inset
8065 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8066 collapsable insets (like footnote, ert, ...)
8068 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8070 * src/lyxdraw.h: remvoe file
8072 * src/lyxdraw.C: remove file
8074 * src/insets/insettext.C: added <algorithm>.
8076 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8078 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8079 (matrix_cb): case MM_OK use string stream
8081 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8084 * src/mathed/math_macro.C (draw): use string stream
8085 (Metrics): use string stream
8087 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8088 directly to the ostream.
8090 * src/vspace.C (asString): use string stream.
8091 (asString): use string stream
8092 (asLatexString): use string stream
8094 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8095 setting Spacing::Other.
8097 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8098 sprintf when creating the stretch vale.
8100 * src/text2.C (alphaCounter): changed to return a string and to
8101 not use a static variable internally. Also fixed a one-off bug.
8102 (SetCounter): changed the drawing of the labels to use string
8103 streams instead of sprintf.
8105 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8106 manipulator to use a scheme that does not require library support.
8107 This is also the way it is done in the new GNU libstdc++. Should
8108 work with DEC cxx now.
8110 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8112 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8113 end. This fixes a bug.
8115 * src/mathed (all files concerned with file writing): apply the
8116 USE_OSTREAM_ONLY changes to mathed too.
8118 * src/support/DebugStream.h: make the constructor explicit.
8120 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8121 count and ostream squashed.
8123 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8125 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8127 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8128 ostringstream uses STL strings, and we might not.
8130 * src/insets/insetspecialchar.C: add using directive.
8131 * src/insets/insettext.C: ditto.
8133 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8135 * lib/layouts/seminar.layout: feeble attempt at a layout for
8136 seminar.cls, far from completet and could really use some looking
8137 at from people used to write layout files.
8139 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8140 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8141 a lot nicer and works nicely with ostreams.
8143 * src/mathed/formula.C (draw): a slightly different solution that
8144 the one posted to the list, but I think this one works too. (font
8145 size wrong in headers.)
8147 * src/insets/insettext.C (computeTextRows): some fiddling on
8148 Jürgens turf, added some comments that he should read.
8150 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8151 used and it gave compiler warnings.
8152 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8155 * src/lyx_gui.C (create_forms): do the right thing when
8156 show_banner is true/false.
8158 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8159 show_banner is false.
8161 * most file writing files: Now use iostreams to do almost all of
8162 the writing. Also instead of passing string &, we now use
8163 stringstreams. mathed output is still not adapted to iostreams.
8164 This change can be turned off by commenting out all the occurences
8165 of the "#define USE_OSTREAM_ONLY 1" lines.
8167 * src/WorkArea.C (createPixmap): don't output debug messages.
8168 (WorkArea): don't output debug messages.
8170 * lib/lyxrc.example: added a comment about the new variable
8173 * development/Code_rules/Rules: Added some more commente about how
8174 to build class interfaces and on how better encapsulation can be
8177 2000-03-03 Juergen Vigna <jug@sad.it>
8179 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8180 automatically with the width of the LyX-Window
8182 * src/insets/insettext.C (computeTextRows): fixed update bug in
8183 displaying text-insets (scrollvalues where not initialized!)
8185 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8187 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8188 id in the check of the result from lower_bound is not enough since
8189 lower_bound can return last too, and then res->id will not be a
8192 * all insets and some code that use them: I have conditionalized
8193 removed the Latex(string & out, ...) this means that only the
8194 Latex(ostream &, ...) will be used. This is a work in progress to
8195 move towards using streams for all output of files.
8197 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8200 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8202 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8203 routine (this fixes bug where greek letters were surrounded by too
8206 * src/support/filetools.C (findtexfile): change a bit the search
8207 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8208 no longer passed to kpsewhich, we may have to change that later.
8210 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8211 warning options to avoid problems with X header files (from Angus
8213 * acinclude.m4: regenerated.
8215 2000-03-02 Juergen Vigna <jug@sad.it>
8217 * src/insets/insettext.C (WriteParagraphData): Using the
8218 par->writeFile() function for writing paragraph-data.
8219 (Read): Using buffer->parseSingleLyXformat2Token()-function
8220 for parsing paragraph data!
8222 * src/buffer.C (readLyXformat2): removed all parse data and using
8223 the new parseSingleLyXformat2Token()-function.
8224 (parseSingleLyXformat2Token): added this function to parse (read)
8225 lyx-file-format (this is called also from text-insets now!)
8227 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8229 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8232 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8233 directly instead of going through a func. One very bad thing: a
8234 static LyXFindReplace, but I don't know where to place it.
8236 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8237 string instead of char[]. Also changed to static.
8238 (GetSelectionOrWordAtCursor): changed to static inline
8239 (SetSelectionOverLenChars): ditto.
8241 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8242 current_view and global variables. both classes has changed names
8243 and LyXFindReplace is not inherited from SearchForm.
8245 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8246 fl_form_search form.
8248 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8250 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8252 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8253 bound (from Kayvan).
8255 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8257 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8259 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8261 * some things that I should comment but the local pub says head to
8264 * comment out all code that belongs to the Roff code for Ascii
8265 export of tables. (this is unused)
8267 * src/LyXView.C: use correct type for global variable
8268 current_layout. (LyXTextClass::size_type)
8270 * some code to get the new insetgraphics closer to working I'd be
8271 grateful for any help.
8273 * src/BufferView2.C (insertInset): use the return type of
8274 NumberOfLayout properly. (also changes in other files)
8276 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8277 this as a test. I want to know what breaks because of this.
8279 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8281 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8283 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8284 to use a \makebox in the label, this allows proper justification
8285 with out using protected spaces or multiple hfills. Now it is
8286 "label" for left justified, "\hfill label\hfill" for center, and
8287 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8288 should be changed accordingly.
8290 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8292 * src/lyxtext.h: change SetLayout() to take a
8293 LyXTextClass::size_type instead of a char (when there is more than
8294 127 layouts in a class); also change type of copylayouttype.
8295 * src/text2.C (SetLayout): ditto.
8296 * src/LyXView.C (updateLayoutChoice): ditto.
8298 * src/LaTeX.C (scanLogFile): errors where the line number was not
8299 given just after the '!'-line were ignored (from Dekel Tsur).
8301 * lib/lyxrc.example: fix description of \date_insert_format
8303 * lib/layouts/llncs.layout: new layout, contributed by Martin
8306 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8308 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8309 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8310 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8311 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8312 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8313 paragraph.C, text.C, text2.C)
8315 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8317 * src/insets/insettext.C (LocalDispatch): remove extra break
8320 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8321 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8323 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8324 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8326 * src/insets/insetbib.h: move InsetBibkey::Holder and
8327 InsetCitation::Holder in public space.
8329 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8331 * src/insets/insettext.h: small change to get the new files from
8332 Juergen to compile (use "string", not "class string").
8334 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8335 const & as parameter to LocalDispatch, use LyXFont const & as
8336 paramter to some other func. This also had impacto on lyxinsets.h
8337 and the two mathed insets.
8339 2000-02-24 Juergen Vigna <jug@sad.it>
8342 * src/commandtags.h:
8344 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8348 * src/BufferView2.C: added/updated code for various inset-functions
8350 * src/insets/insetert.[Ch]: added implementation of InsetERT
8352 * src/insets/insettext.[Ch]: added implementation of InsetText
8354 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8355 (draw): added preliminary code for inset scrolling not finshed yet
8357 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8358 as it is in lyxfunc.C now
8360 * src/insets/lyxinset.h: Added functions for text-insets
8362 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8364 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8365 BufferView and reimplement the list as a queue put inside its own
8368 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8370 * several files: use the new interface to the "updateinsetlist"
8372 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8374 (work_area_handler): call BufferView::trippleClick on trippleclick.
8376 * src/BufferView.C (doubleClick): new function, selects word on
8378 (trippleClick): new function, selects line on trippleclick.
8380 2000-02-22 Allan Rae <rae@lyx.org>
8382 * lib/bind/xemacs.bind: buffer-previous not supported
8384 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8386 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8389 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8391 * src/bufferlist.C: get rid of current_view from this file
8393 * src/spellchecker.C: get rid of current_view from this file
8395 * src/vspace.C: get rid of current_view from this file
8396 (inPixels): added BufferView parameter for this func
8397 (asLatexCommand): added a BufferParams for this func
8399 * src/text.C src/text2.C: get rid of current_view from these
8402 * src/lyxfont.C (getFontDirection): move this function here from
8405 * src/bufferparams.C (getDocumentDirection): move this function
8408 * src/paragraph.C (getParDirection): move this function here from
8410 (getLetterDirection): ditto
8412 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8414 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8415 resize due to wrong pixmap beeing used. Also took the opurtunity
8416 to make the LyXScreen stateless on regard to WorkArea and some
8417 general cleanup in the same files.
8419 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8421 * src/Makefile.am: add missing direction.h
8423 * src/PainterBase.h: made the width functions const.
8425 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8428 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8430 * src/insets/insetlatexaccent.C (draw): make the accents draw
8431 better, at present this will only work well with iso8859-1.
8433 * several files: remove the old drawing code, now we use the new
8436 * several files: remove support for mono_video, reverse_video and
8439 2000-02-17 Juergen Vigna <jug@sad.it>
8441 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8442 int ** as we have to return the pointer, otherwise we have only
8443 NULL pointers in the returning function.
8445 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8447 * src/LaTeX.C (operator()): quote file name when running latex.
8449 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8451 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8452 (bubble tip), this removes our special handling of this.
8454 * Remove all code that is unused now that we have the new
8455 workarea. (Code that are not active when NEW_WA is defined.)
8457 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8459 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8461 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8462 nonexisting layout; correctly redirect obsoleted layouts.
8464 * lib/lyxrc.example: document \view_dvi_paper_option
8466 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8469 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8470 (PreviewDVI): handle the view_dvi_paper_option variable.
8471 [Both from Roland Krause]
8473 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8475 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8476 char const *, int, LyXFont)
8477 (text(int, int, string, LyXFont)): ditto
8479 * src/text.C (InsertCharInTable): attempt to fix the double-space
8480 feature in tables too.
8481 (BackspaceInTable): ditto.
8482 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8484 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8486 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8488 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8489 newly found text in textcache to this.
8490 (buffer): set the owner of the text put into the textcache to 0
8492 * src/insets/figinset.C (draw): fixed the drawing of figures with
8495 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8496 drawing of mathframe, hfills, protected space, table lines. I have
8497 now no outstanding drawing problems with the new Painter code.
8499 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8501 * src/PainterBase.C (ellipse, circle): do not specify the default
8504 * src/LColor.h: add using directive.
8506 * src/Painter.[Ch]: change return type of methods from Painter& to
8507 PainterBase&. Add a using directive.
8509 * src/WorkArea.C: wrap xforms callbacks in C functions
8512 * lib/layouts/foils.layout: font fix and simplifications from Carl
8515 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8517 * a lot of files: The Painter, LColor and WorkArea from the old
8518 devel branch has been ported to lyx-devel. Some new files and a
8519 lot of #ifdeffed code. The new workarea is enabled by default, but
8520 if you want to test the new Painter and LColor you have to compile
8521 with USE_PAINTER defined (do this in config.h f.ex.) There are
8522 still some rought edges, and I'd like some help to clear those
8523 out. It looks stable (loads and displays the Userguide very well).
8526 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8528 * src/buffer.C (pop_tag): revert to the previous implementation
8529 (use a global variable for both loops).
8531 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8533 * src/lyxrc.C (LyXRC): change slightly default date format.
8535 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8536 there is an English text with a footnote that starts with a Hebrew
8537 paragraph, or vice versa.
8538 (TeXFootnote): ditto.
8540 * src/text.C (LeftMargin): allow for negative values for
8541 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8544 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8545 for input encoding (cyrillic)
8547 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8549 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8552 * src/toolbar.C (set): ditto
8553 * src/insets/insetbib.C (create_form_citation_form): ditto
8555 * lib/CREDITS: added Dekel Tsur.
8557 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8558 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8559 hebrew supports files from Dekel Tsur.
8561 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8562 <tzafrir@technion.ac.il>
8564 * src/lyxrc.C: put \date_insert_format at the right place.
8566 * src/buffer.C (makeLaTeXFile): fix the handling of
8567 BufferParams::sides when writing out latex files.
8569 * src/BufferView2.C: add a "using" directive.
8571 * src/support/lyxsum.C (sum): when we use lyxstring,
8572 ostringstream::str needs an additional .c_str().
8574 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8576 * src/support/filetools.C (ChangeExtension): patch from Etienne
8579 * src/TextCache.C (show): remove const_cast and make second
8580 parameter non-const LyXText *.
8582 * src/TextCache.h: use non const LyXText in show.
8584 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8587 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8589 * src/support/lyxsum.C: rework to be more flexible.
8591 * several places: don't check if a pointer is 0 if you are going
8594 * src/text.C: remove some dead code.
8596 * src/insets/figinset.C: remove some dead code
8598 * src/buffer.C: move the BufferView funcs to BufferView2.C
8599 remove all support for insetlatexdel
8600 remove support for oldpapersize stuff
8601 made some member funcs const
8603 * src/kbmap.C: use a std::list to store the bindings in.
8605 * src/BufferView2.C: new file
8607 * src/kbsequence.[Ch]: new files
8609 * src/LyXAction.C + others: remove all trace of buffer-previous
8611 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8612 only have one copy in the binary of this table.
8614 * hebrew patch: moved some functions from LyXText to more
8615 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8617 * several files: remove support for XForms older than 0.88
8619 remove some #if 0 #endif code
8621 * src/TextCache.[Ch]: new file. Holds the textcache.
8623 * src/BufferView.C: changes to use the new TextCache interface.
8624 (waitForX): remove the now unused code.
8626 * src/BackStack.h: remove some commented code
8628 * lib/bind/emacs.bind: remove binding for buffer-previous
8630 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8632 * applied the hebrew patch.
8634 * src/lyxrow.h: make sure that all Row variables are initialized.
8636 * src/text2.C (TextHandleUndo): comment out a delete, this might
8637 introduce a memory leak, but should also help us to not try to
8638 read freed memory. We need to look at this one.
8640 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8641 (LyXParagraph): initalize footnotekind.
8643 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8644 forgot this when applying the patch. Please heed the warnings.
8646 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8647 (aka. reformat problem)
8649 * src/bufferlist.C (exists): made const, and use const_iterator
8650 (isLoaded): new func.
8651 (release): use std::find to find the correct buffer.
8653 * src/bufferlist.h: made getState a const func.
8654 made empty a const func.
8655 made exists a const func.
8658 2000-02-01 Juergen Vigna <jug@sad.it>
8660 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8662 * po/it.po: updated a bit the italian po file and also changed the
8663 'file nuovo' for newfile to 'filenuovo' without a space, this did
8666 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8667 for the new insert_date command.
8669 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8670 from jdblair, to insert a date into the current text conforming to
8671 a strftime format (for now only considering the locale-set and not
8672 the document-language).
8674 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8676 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8677 Bounds Read error seen by purify. The problem was that islower is
8678 a macros which takes an unsigned char and uses it as an index for
8679 in array of characters properties (and is thus subject to the
8683 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8684 correctly the paper sides radio buttons.
8685 (UpdateDocumentButtons): ditto.
8687 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8689 * src/kbmap.C (getsym + others): change to return unsigned int,
8690 returning a long can give problems on 64 bit systems. (I assume
8691 that int is 32bit on 64bit systems)
8693 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8695 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8696 LyXLookupString to be zero-terminated. Really fixes problems seen
8699 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8701 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8702 write a (char*)0 to the lyxerr stream.
8704 * src/lastfiles.C: move algorithm before the using statemets.
8706 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8708 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8709 complains otherwise).
8710 * src/table.C: ditto
8712 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8715 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8716 that I removed earlier... It is really needed.
8718 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8720 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8722 * INSTALL: update xforms home page URL.
8724 * lib/configure.m4: fix a bug with unreadable layout files.
8726 * src/table.C (calculate_width_of_column): add "using std::max"
8729 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8731 * several files: marked several lines with "DEL LINE", this is
8732 lines that can be deleted without changing anything.
8733 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8734 checks this anyway */
8737 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8739 * src/DepTable.C (update): add a "+" at the end when the checksum
8740 is different. (debugging string only)
8742 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8743 the next inset to not be displayed. This should also fix the list
8744 of labels in the "Insert Crossreference" dialog.
8746 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8748 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8749 when regex was not found.
8751 * src/support/lstrings.C (lowercase): use handcoded transform always.
8754 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8755 old_cursor.par->prev could be 0.
8757 * several files: changed post inc/dec to pre inc/dec
8759 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8760 write the lastfiles to file.
8762 * src/BufferView.C (buffer): only show TextCache info when debugging
8764 (resizeCurrentBuffer): ditto
8765 (workAreaExpose): ditto
8767 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8769 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8771 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8772 a bit better by removing the special case for \i and \j.
8774 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8776 * src/lyx_main.C (easyParse): remove test for bad comand line
8777 options, since this broke all xforms-related parsing.
8779 * src/kbmap.C (getsym): set return type to unsigned long, as
8780 declared in header. On an alpha, long is _not_ the same as int.
8782 * src/support/LOstream.h: add a "using std::flush;"
8784 * src/insets/figinset.C: ditto.
8786 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8788 * src/bufferlist.C (write): use blinding fast file copy instead of
8789 "a char at a time", now we are doing it the C++ way.
8791 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8792 std::list<int> instead.
8793 (addpidwait): reflect move to std::list<int>
8794 (sigchldchecker): ditto
8796 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8799 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8800 that obviously was wrong...
8802 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8803 c, this avoids warnings with purify and islower.
8805 * src/insets/figinset.C: rename struct queue to struct
8806 queue_element and rewrite to use a std::queue. gsqueue is now a
8807 std::queue<queue_element>
8808 (runqueue): reflect move to std::queue
8811 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8812 we would get "1" "0" instead of "true" "false. Also make the tostr
8815 2000-01-21 Juergen Vigna <jug@sad.it>
8817 * src/buffer.C (writeFileAscii): Disabled code for special groff
8818 handling of tabulars till I fix this in table.C
8820 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8822 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8824 * src/support/lyxlib.h: ditto.
8826 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8828 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8829 and 'j' look better. This might fix the "macron" bug that has been
8832 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8833 functions as one template function. Delete the old versions.
8835 * src/support/lyxsum.C: move using std::ifstream inside
8838 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8841 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8843 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8845 * src/insets/figinset.C (InitFigures): use new instead of malloc
8846 to allocate memory for figures and bitmaps.
8847 (DoneFigures): use delete[] instead of free to deallocate memory
8848 for figures and bitmaps.
8849 (runqueue): use new to allocate
8850 (getfigdata): use new/delete[] instead of malloc/free
8851 (RegisterFigure): ditto
8853 * some files: moved some declarations closer to first use, small
8854 whitespace changes use preincrement instead of postincrement where
8855 it does not make a difference.
8857 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8858 step on the way to use stl::containers for key maps.
8860 * src/bufferlist.h: add a typedef for const_iterator and const
8861 versions of begin and end.
8863 * src/bufferlist.[Ch]: change name of member variable _state to
8864 state_. (avoid reserved names)
8866 (getFileNames): returns the filenames of the buffers in a vector.
8868 * configure.in (ALL_LINGUAS): added ro
8870 * src/support/putenv.C: new file
8872 * src/support/mkdir.C: new file
8874 2000-01-20 Allan Rae <rae@lyx.org>
8876 * lib/layouts/IEEEtran.layout: Added several theorem environments
8878 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8879 couple of minor additions.
8881 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8882 (except for those in footnotes of course)
8884 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8886 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8888 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8889 std::sort and std::lower_bound instead of qsort and handwritten
8891 (struct compara): struct that holds the functors used by std::sort
8892 and std::lower_bound in MathedLookupBOP.
8894 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8896 * src/support/LAssert.h: do not do partial specialization. We do
8899 * src/support/lyxlib.h: note that lyx::getUserName() and
8900 lyx::date() are not in use right now. Should these be suppressed?
8902 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8903 (makeLinuxDocFile): do not put date and user name in linuxdoc
8906 * src/support/lyxlib.h (kill): change first argument to long int,
8907 since that's what solaris uses.
8909 * src/support/kill.C (kill): fix declaration to match prototype.
8911 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8912 actually check whether namespaces are supported. This is not what
8915 * src/support/lyxsum.C: add a using directive.
8917 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8919 * src/support/kill.C: if we have namespace support we don't have
8920 to include lyxlib.h.
8922 * src/support/lyxlib.h: use namespace lyx if supported.
8924 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8926 * src/support/date.C: new file
8928 * src/support/chdir.C: new file
8930 * src/support/getUserName.C: new file
8932 * src/support/getcwd.C: new file
8934 * src/support/abort.C: new file
8936 * src/support/kill.C: new file
8938 * src/support/lyxlib.h: moved all the functions in this file
8939 insede struct lyx. Added also kill and abort to this struct. This
8940 is a way to avoid the "kill is not defined in <csignal>", we make
8941 C++ wrappers for functions that are not ANSI C or ANSI C++.
8943 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8944 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8945 lyx it has been renamed to sum.
8947 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8949 * src/text.C: add using directives for std::min and std::max.
8951 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8953 * src/texrow.C (getIdFromRow): actually return something useful in
8954 id and pos. Hopefully fixes the bug with positionning of errorbox
8957 * src/lyx_main.C (easyParse): output an error and exit if an
8958 incorrect command line option has been given.
8960 * src/spellchecker.C (ispell_check_word): document a memory leak.
8962 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8963 where a "struct utimbuf" is allocated with "new" and deleted with
8966 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8968 * src/text2.C (CutSelection): don't delete double spaces.
8969 (PasteSelection): ditto
8970 (CopySelection): ditto
8972 * src/text.C (Backspace): don't delete double spaces.
8974 * src/lyxlex.C (next): fix a bug that were only present with
8975 conformant std::istream::get to read comment lines, use
8976 std::istream::getline instead. This seems to fix the problem.
8978 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8980 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8981 allowed to insert space before space" editing problem. Please read
8982 commends at the beginning of the function. Comments about usage
8985 * src/text.C (InsertChar): fix for the "not allowed to insert
8986 space before space" editing problem.
8988 * src/text2.C (DeleteEmptyParagraphMechanism): when
8989 IsEmptyTableRow can only return false this last "else if" will
8990 always be a no-op. Commented out.
8992 * src/text.C (RedoParagraph): As far as I can understand tmp
8993 cursor is not really needed.
8995 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8996 present it could only return false anyway.
8997 (several functions): Did something not so smart...added a const
8998 specifier on a lot of methods.
9000 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9001 and add a tmp->text.resize. The LyXParagraph constructor does the
9003 (BreakParagraphConservative): ditto
9005 * src/support/path.h (Path): add a define so that the wrong usage
9006 "Path("/tmp") will be flagged as a compilation error:
9007 "`unnamed_Path' undeclared (first use this function)"
9009 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9011 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9012 which was bogus for several reasons.
9014 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9018 * autogen.sh: do not use "type -path" (what's that anyway?).
9020 * src/support/filetools.C (findtexfile): remove extraneous space
9021 which caused a kpsewhich warning (at least with kpathsea version
9024 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9026 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9028 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9030 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9032 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9034 * src/paragraph.C (BreakParagraph): do not reserve space on text
9035 if we don't need to (otherwise, if pos_end < pos, we end up
9036 reserving huge amounts of memory due to bad unsigned karma).
9037 (BreakParagraphConservative): ditto, although I have not seen
9038 evidence the bug can happen here.
9040 * src/lyxparagraph.h: add a using std::list.
9042 2000-01-11 Juergen Vigna <jug@sad.it>
9044 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9047 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9049 * src/vc-backend.C (doVCCommand): change to be static and take one
9050 more parameter: the path to chdir too be fore executing the command.
9051 (retrive): new function equiv to "co -r"
9053 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9054 file_not_found_hook is true.
9056 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9058 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9059 if a file is readwrite,readonly...anything else.
9061 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9063 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9064 (CreatePostscript): name change from MenuRunDVIPS (or something)
9065 (PreviewPostscript): name change from MenuPreviewPS
9066 (PreviewDVI): name change from MenuPreviewDVI
9068 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9069 \view_pdf_command., \pdf_to_ps_command
9071 * lib/configure.m4: added search for PDF viewer, and search for
9072 PDF to PS converter.
9073 (lyxrc.defaults output): add \pdflatex_command,
9074 \view_pdf_command and \pdf_to_ps_command.
9076 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9078 * src/bufferlist.C (write): we don't use blocksize for anything so
9081 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9083 * src/support/block.h: disable operator T* (), since it causes
9084 problems with both compilers I tried. See comments in the file.
9086 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9089 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9090 variable LYX_DIR_10x to LYX_DIR_11x.
9092 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9094 * INSTALL: document --with-lyxname.
9097 * configure.in: new configure flag --with-lyxname which allows to
9098 choose the name under which lyx is installed. Default is "lyx", of
9099 course. It used to be possible to do this with --program-suffix,
9100 but the later has in fact a different meaning for autoconf.
9102 * src/support/lstrings.h (lstrchr): reformat a bit.
9104 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9105 * src/mathed/math_defs.h: ditto.
9107 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9109 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9110 true, decides if we create a backup file or not when saving. New
9111 tag and variable \pdf_mode, defaults to false. New tag and
9112 variable \pdflatex_command, defaults to pdflatex. New tag and
9113 variable \view_pdf_command, defaults to xpdf. New tag and variable
9114 \pdf_to_ps_command, defaults to pdf2ps.
9116 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9118 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9119 does not have a BufferView.
9120 (unlockInset): ditto + don't access the_locking_inset if the
9121 buffer does not have a BufferView.
9123 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9124 certain circumstances so that we don't continue a keyboard
9125 operation long after the key was released. Try f.ex. to load a
9126 large document, press PageDown for some seconds and then release
9127 it. Before this change the document would contine to scroll for
9128 some time, with this change it stops imidiatly.
9130 * src/support/block.h: don't allocate more space than needed. As
9131 long as we don't try to write to the arr[x] in a array_type arr[x]
9132 it is perfectly ok. (if you write to it you might segfault).
9133 added operator value_type*() so that is possible to pass the array
9134 to functions expecting a C-pointer.
9136 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9139 * intl/*: updated to gettext 0.10.35, tried to add our own
9140 required modifications. Please verify.
9142 * po/*: updated to gettext 0.10.35, tried to add our own required
9143 modifications. Please verify.
9145 * src/support/lstrings.C (tostr): go at fixing the problem with
9146 cxx and stringstream. When stringstream is used return
9147 oss.str().c_str() so that problems with lyxstring and basic_string
9148 are avoided. Note that the best solution would be for cxx to use
9149 basic_string all the way, but it is not conformant yet. (it seems)
9151 * src/lyx_cb.C + other files: moved several global functions to
9152 class BufferView, some have been moved to BufferView.[Ch] others
9153 are still located in lyx_cb.C. Code changes because of this. (part
9154 of "get rid of current_view project".)
9156 * src/buffer.C + other files: moved several Buffer functions to
9157 class BufferView, the functions are still present in buffer.C.
9158 Code changes because of this.
9160 * config/lcmessage.m4: updated to most recent. used when creating
9163 * config/progtest.m4: updated to most recent. used when creating
9166 * config/gettext.m4: updated to most recent. applied patch for
9169 * config/gettext.m4.patch: new file that shows what changes we
9170 have done to the local copy of gettext.m4.
9172 * config/libtool.m4: new file, used in creation of acinclude.m4
9174 * config/lyxinclude.m4: new file, this is the lyx created m4
9175 macros, used in making acinclude.m4.
9177 * autogen.sh: GNU m4 discovered as a separate task not as part of
9178 the lib/configure creation.
9179 Generate acinlucde from files in config. Actually cat
9180 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9181 easier to upgrade .m4 files that really are external.
9183 * src/Spacing.h: moved using std::istringstream to right after
9184 <sstream>. This should fix the problem seen with some compilers.
9186 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9188 * src/lyx_cb.C: began some work to remove the dependency a lot of
9189 functions have on BufferView::text, even if not really needed.
9190 (GetCurrentTextClass): removed this func, it only hid the
9193 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9194 forgot this in last commit.
9196 * src/Bullet.C (bulletEntry): use static char const *[] for the
9197 tables, becuase of this the return arg had to change to string.
9199 (~Bullet): removed unneeded destructor
9201 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9202 (insetSleep): moved from Buffer
9203 (insetWakeup): moved from Buffer
9204 (insetUnlock): moved from Buffer
9206 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9207 from Buffer to BufferView.
9209 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9211 * config/ltmain.sh: updated to version 1.3.4 of libtool
9213 * config/ltconfig: updated to version 1.3.4 of libtool
9215 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9218 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9219 Did I get that right?
9221 * src/lyxlex.h: add a "using" directive or two.
9222 * src/Spacing.h: ditto.
9223 * src/insets/figinset.C: ditto.
9224 * src/support/filetools.C: ditto.
9225 * src/support/lstrings.C: ditto.
9226 * src/BufferView.C: ditto.
9227 * src/bufferlist.C: ditto.
9228 * src/lyx_cb.C: ditto.
9229 * src/lyxlex.C: ditto.
9231 * NEWS: add some changes for 1.1.4.
9233 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9235 * src/BufferView.C: first go at a TextCache to speed up switching
9238 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9240 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9241 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9242 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9243 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9246 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9247 members of the struct are correctly initialized to 0 (detected by
9249 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9250 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9252 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9253 pidwait, since it was allocated with "new". This was potentially
9254 very bad. Thanks to Michael Schmitt for running purify for us.
9257 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9259 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9261 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9263 1999-12-30 Allan Rae <rae@lyx.org>
9265 * lib/templates/IEEEtran.lyx: minor change
9267 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9268 src/mathed/formula.C (LocalDispatch): askForText changes
9270 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9271 know when a user has cancelled input. Fixes annoying problems with
9272 inserting labels and version control.
9274 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9276 * src/support/lstrings.C (tostr): rewritten to use strstream and
9279 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9281 * src/support/filetools.C (IsFileWriteable): use fstream to check
9282 (IsDirWriteable): use fileinfo to check
9284 * src/support/filetools.h (FilePtr): whole class deleted
9286 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9288 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9290 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9292 * src/bufferlist.C (write): use ifstream and ofstream instead of
9295 * src/Spacing.h: use istrstream instead of sscanf
9297 * src/mathed/math_defs.h: change first arg to istream from FILE*
9299 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9301 * src/mathed/math_parser.C: have yyis to be an istream
9302 (LexGetArg): use istream (yyis)
9304 (mathed_parse): ditto
9305 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9307 * src/mathed/formula.C (Read): rewritten to use istream
9309 * src/mathed/formulamacro.C (Read): rewritten to use istream
9311 * src/lyxlex.h (~LyXLex): deleted desturctor
9312 (getStream): new function, returns an istream
9313 (getFile): deleted funtion
9314 (IsOK): return is.good();
9316 * src/lyxlex.C (LyXLex): delete file and owns_file
9317 (setFile): open an filebuf and assign that to a istream instead of
9319 (setStream): new function, takes an istream as arg.
9320 (setFile): deleted function
9321 (EatLine): rewritten us use istream instead of FILE*
9325 * src/table.C (LyXTable): use istream instead of FILE*
9326 (Read): rewritten to take an istream instead of FILE*
9328 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9330 * src/buffer.C (Dispatch): remove an extraneous break statement.
9332 * src/support/filetools.C (QuoteName): change to do simple
9333 'quoting'. More work is necessary. Also changed to do nothing
9334 under emx (needs fix too).
9335 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9337 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9338 config.h.in to the AC_DEFINE_UNQUOTED() call.
9339 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9340 needs char * as argument (because Solaris 7 declares it like
9343 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9344 remove definition of BZERO.
9346 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9348 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9349 defined, "lyxregex.h" if not.
9351 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9353 (REGEX): new variable that is set to regex.c lyxregex.h when
9354 AM_CONDITIONAL USE_REGEX is set.
9355 (libsupport_la_SOURCES): add $(REGEX)
9357 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9360 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9363 * configure.in: add call to LYX_REGEX
9365 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9366 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9368 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9370 * lib/bind/fi_menus.bind: new file, from
9371 pauli.virtanen@saunalahti.fi.
9373 * src/buffer.C (getBibkeyList): pass the parameter delim to
9374 InsetInclude::getKeys and InsetBibtex::getKeys.
9376 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9377 is passed to Buffer::getBibkeyList
9379 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9380 instead of the hardcoded comma.
9382 * src/insets/insetbib.C (getKeys): make sure that there are not
9383 leading blanks in bibtex keys. Normal latex does not care, but
9384 harvard.sty seems to dislike blanks at the beginning of citation
9385 keys. In particular, the retturn value of the function is
9387 * INSTALL: make it clear that libstdc++ is needed and that gcc
9388 2.7.x probably does not work.
9390 * src/support/filetools.C (findtexfile): make debug message go to
9392 * src/insets/insetbib.C (getKeys): ditto
9394 * src/debug.C (showTags): make sure that the output is correctly
9397 * configure.in: add a comment for TWO_COLOR_ICON define.
9399 * acconfig.h: remove all the entries that already defined in
9400 configure.in or acinclude.m4.
9402 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9403 to avoid user name, date and copyright.
9405 1999-12-21 Juergen Vigna <jug@sad.it>
9407 * src/table.C (Read): Now read bogus row format informations
9408 if the format is < 5 so that afterwards the table can
9409 be read by lyx but without any format-info. Fixed the
9410 crash we experienced when not doing this.
9412 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9414 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9415 (RedoDrawingOfParagraph): ditto
9416 (RedoParagraphs): ditto
9417 (RemoveTableRow): ditto
9419 * src/text.C (Fill): rename arg paperwidth -> paper_width
9421 * src/buffer.C (insertLyXFile): rename var filename -> fname
9422 (writeFile): rename arg filename -> fname
9423 (writeFileAscii): ditto
9424 (makeLaTeXFile): ditto
9425 (makeLinuxDocFile): ditto
9426 (makeDocBookFile): ditto
9428 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9431 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9433 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9436 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9437 compiled by a C compiler not C++.
9439 * src/layout.h (LyXTextClass): added typedef for const_iterator
9440 (LyXTextClassList): added typedef for const_iterator + member
9441 functions begin and end.
9443 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9444 iterators to fill the choice_class.
9445 (updateLayoutChoice): rewritten to use iterators to fill the
9446 layoutlist in the toolbar.
9448 * src/BufferView.h (BufferView::work_area_width): removed unused
9451 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9453 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9454 (sgmlCloseTag): ditto
9456 * src/support/lstrings.h: return type of countChar changed to
9459 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9460 what version of this func to use. Also made to return unsigned int.
9462 * configure.in: call LYX_STD_COUNT
9464 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9465 conforming std::count.
9467 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9469 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9470 and a subscript would give bad display (patch from Dekel Tsur
9471 <dekel@math.tau.ac.il>).
9473 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9475 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9478 * src/chset.h: add a few 'using' directives
9480 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9481 triggered when no buffer is active
9483 * src/layout.C: removed `break' after `return' in switch(), since
9486 * src/lyx_main.C (init): make sure LyX can be ran in place even
9487 when libtool has done its magic with shared libraries. Fix the
9488 test for the case when the system directory has not been found.
9490 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9491 name for the latex file.
9492 (MenuMakeHTML): ditto
9494 * src/buffer.h: add an optional boolean argument, which is passed
9497 1999-12-20 Allan Rae <rae@lyx.org>
9499 * lib/templates/IEEEtran.lyx: small correction and update.
9501 * configure.in: Attempted to use LYX_PATH_HEADER
9503 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9505 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9506 input from JMarc. Now use preprocessor to find the header.
9507 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9508 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9509 LYX_STL_STRING_FWD. See comments in file.
9511 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9513 * The global MiniBuffer * minibuffer variable is dead.
9515 * The global FD_form_main * fd_form_main variable is dead.
9517 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9519 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9521 * src/table.h: add the LOstream.h header
9522 * src/debug.h: ditto
9524 * src/LyXAction.h: change the explaination of the ReadOnly
9525 attribute: is indicates that the function _can_ be used.
9527 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9530 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9532 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9538 * src/paragraph.C (GetWord): assert on pos>=0
9541 * src/support/lyxstring.C: condition the use of an invariant on
9543 * src/support/lyxstring.h: ditto
9545 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9546 Use LAssert.h instead of plain assert().
9548 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9550 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9551 * src/support/filetools.C: ditto
9553 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9556 * INSTALL: document the new configure flags
9558 * configure.in: suppress --with-debug; add --enable-assertions
9560 * acinclude.m4: various changes in alignment of help strings.
9562 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9564 * src/kbmap.C: commented out the use of the hash map in kb_map,
9565 beginning of movement to a stl::container.
9567 * several files: removed code that was not in effect when
9568 MOVE_TEXT was defined.
9570 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9571 for escaping should not be used. We can discuss if the string
9572 should be enclosed in f.ex. [] instead of "".
9574 * src/trans_mgr.C (insert): use the new returned value from
9575 encodeString to get deadkeys and keymaps done correctly.
9577 * src/chset.C (encodeString): changed to return a pair, to tell
9578 what to use if we know the string.
9580 * src/lyxscreen.h (fillArc): new function.
9582 * src/FontInfo.C (resize): rewritten to use more std::string like
9583 structore, especially string::replace.
9585 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9588 * configure.in (chmod +x some scripts): remove config/gcc-hack
9590 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9592 * src/buffer.C (writeFile): change once again the top comment in a
9593 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9594 instead of an hardcoded version number.
9595 (makeDocBookFile): ditto
9597 * src/version.h: add new define LYX_DOCVERSION
9599 * po/de.po: update from Pit Sütterlin
9600 * lib/bind/de_menus.bind: ditto.
9602 * src/lyxfunc.C (Dispatch): call MenuExport()
9603 * src/buffer.C (Dispatch): ditto
9605 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9606 LyXFunc::Dispatch().
9607 (MenuExport): new function, moved from
9608 LyXFunc::Dispatch().
9610 * src/trans_mgr.C (insert): small cleanup
9611 * src/chset.C (loadFile): ditto
9613 * lib/kbd/iso8859-1.cdef: add missing backslashes
9615 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9617 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9618 help with placing the manually drawn accents better.
9620 (Draw): x2 and hg changed to float to minimize rounding errors and
9621 help place the accents better.
9623 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9624 unsigned short to char is just wrong...cast the char to unsigned
9625 char instead so that the two values can compare sanely. This
9626 should also make the display of insetlatexaccents better and
9627 perhaps also some other insets.
9629 (lbearing): new function
9632 1999-12-15 Allan Rae <rae@lyx.org>
9634 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9635 header that provides a wrapper around the very annoying SGI STL header
9638 * src/support/lyxstring.C, src/LString.h:
9639 removed old SGI-STL-compatability attempts.
9641 * configure.in: Use LYX_STL_STRING_FWD.
9643 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9644 stl_string_fwd.h is around and try to determine it's location.
9645 Major improvement over previous SGI STL 3.2 compatability.
9646 Three small problems remain with this function due to my zero
9647 knowledge of autoconf. JMarc and lgb see the comments in the code.
9649 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9651 * src/broken_const.h, config/hack-gcc, config/README: removed
9653 * configure.in: remove --with-gcc-hack option; do not call
9656 * INSTALL: remove documentation of --with-broken-const and
9659 * acconfig.h: remove all trace of BROKEN_CONST define
9661 * src/buffer.C (makeDocBookFile): update version number in output
9663 (SimpleDocBookOnePar): fix an assert when trying to a character
9664 access beyond string length
9667 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9669 * po/de.po: fix the Export menu
9671 * lyx.man: update the description of -dbg
9673 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9674 (commandLineHelp): updated
9675 (easyParse): show list of available debug levels if -dbg is passed
9678 * src/Makefile.am: add debug.C
9680 * src/debug.h: moved some code to debug.C
9682 * src/debug.C: new file. Contains code to set and show debug
9685 * src/layout.C: remove 'break' after 'continue' in switch
9686 statements, since these cannot be reached.
9688 1999-12-13 Allan Rae <rae@lyx.org>
9690 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9691 (in_word_set): hash() -> math_hash()
9693 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9695 * acconfig.h: Added a test for whether we are using exceptions in the
9696 current compilation run. If so USING_EXCEPTIONS is defined.
9698 * config.in: Check for existance of stl_string_fwd.h
9699 * src/LString.h: If compiling --with-included-string and SGI's
9700 STL version 3.2 is present (see above test) we need to block their
9701 forward declaration of string and supply a __get_c_string().
9702 However, it turns out this is only necessary if compiling with
9703 exceptions enabled so I've a bit more to add yet.
9705 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9706 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9707 src/support/LRegex.h, src/undo.h:
9708 Shuffle the order of the included files a little to ensure that
9709 LString.h gets included before anything that includes stl_string_fwd.h
9711 * src/support/lyxstring.C: We need to #include LString.h instead of
9712 lyxstring.h to get the necessary definition of __get_c_string.
9713 (__get_c_string): New function. This is defined static just like SGI's
9714 although why they need to do this I'm not sure. Perhaps it should be
9715 in lstrings.C instead.
9717 * lib/templates/IEEEtran.lyx: New template file.
9719 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9721 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9722 * intl/Makefile.in (MKINSTALLDIRS): ditto
9724 * src/LyXAction.C (init): changed to hold the LFUN data in a
9725 automatic array in stead of in callso to newFunc, this speeds up
9726 compilation a lot. Also all the memory used by the array is
9727 returned when the init is completed.
9729 * a lot of files: compiled with -Wold-style-cast, changed most of
9730 the reported offenders to C++ style casts. Did not change the
9731 offenders in C files.
9733 * src/trans.h (Match): change argument type to unsigned int.
9735 * src/support/DebugStream.C: fix some types on the streambufs so
9736 that it works on a conforming implementation.
9738 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9740 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9742 * src/support/lyxstring.C: remove the inline added earlier since
9743 they cause a bunch of unsatisfied symbols when linking with dec
9744 cxx. Cxx likes to have the body of inlines at the place where they
9747 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9748 accessing negative bounds in array. This fixes the crash when
9749 inserting accented characters.
9750 * src/trans.h (Match): ditto
9752 * src/buffer.C (Dispatch): since this is a void, it should not try
9753 to return anything...
9755 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9757 * src/buffer.h: removed the two friends from Buffer. Some changes
9758 because of this. Buffer::getFileName and Buffer::setFileName
9759 renamed to Buffer::fileName() and Buffer::fileName(...).
9761 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9763 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9764 and Buffer::update(short) to BufferView. This move is currently
9765 controlled by a define MOVE_TEXT, this will be removed when all
9766 shows to be ok. This move paves the way for better separation
9767 between buffer contents and buffer view. One side effect is that
9768 the BufferView needs a rebreak when swiching buffers, if we want
9769 to avoid this we can add a cache that holds pointers to LyXText's
9770 that is not currently in use.
9772 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9775 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9777 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9779 * lyx_main.C: new command line option -x (or --execute) and
9780 -e (or --export). Now direct conversion from .lyx to .tex
9781 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9782 Unfortunately, X is still needed and the GUI pops up during the
9785 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9787 * src/Spacing.C: add a using directive to bring stream stuff into
9789 * src/paragraph.C: ditto
9790 * src/buffer.C: ditto
9792 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9793 from Lars' announcement).
9795 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9796 example files from Tino Meinen.
9798 1999-12-06 Allan Rae <rae@lyx.org>
9800 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9802 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9804 * src/support/lyxstring.C: added a lot of inline for no good
9807 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9808 latexWriteEndChanges, they were not used.
9810 * src/layout.h (operator<<): output operator for PageSides
9812 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9814 * some example files: loaded in LyX 1.0.4 and saved again to update
9815 certain constructs (table format)
9817 * a lot of files: did the change to use fstream/iostream for all
9818 writing of files. Done with a close look at Andre Poenitz's patch.
9820 * some files: whitespace changes.
9822 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9824 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9825 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9826 architecture, we provide our own. It is used unconditionnally, but
9827 I do not think this is a performance problem. Thanks to Angus
9828 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9829 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9831 (GetInset): use my_memcpy.
9835 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9836 it is easier to understand, but it uses less TeX-only constructs now.
9838 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9839 elements contain spaces
9841 * lib/configure: regenerated
9843 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9844 elements contain spaces; display the list of programs that are
9847 * autogen.sh: make sure lib/configure is executable
9849 * lib/examples/*: rename the tutorial examples to begin with the
9850 two-letters language code.
9852 * src/lyxfunc.C (getStatus): do not query current font if no
9855 * src/lyx_cb.C (RunScript): use QuoteName
9856 (MenuRunDvips): ditto
9857 (PrintApplyCB): ditto
9859 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9860 around argument, so that it works well with the current shell.
9861 Does not work properly with OS/2 shells currently.
9863 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9864 * src/LyXSendto.C (SendtoApplyCB): ditto
9865 * src/lyxfunc.C (Dispatch): ditto
9866 * src/buffer.C (runLaTeX): ditto
9867 (runLiterate): ditto
9868 (buildProgram): ditto
9870 * src/lyx_cb.C (RunScript): ditto
9871 (MenuMakeLaTeX): ditto
9873 * src/buffer.h (getLatexName): new method
9875 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9877 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9879 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9880 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9881 (create_math_panel): ditto
9883 * src/lyxfunc.C (getStatus): re-activate the code which gets
9884 current font and cursor; add test for export to html.
9886 * src/lyxrc.C (read): remove unreachable break statements; add a
9889 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9891 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9893 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9894 introduced by faulty regex.
9895 * src/buffer.C: ditto
9896 * src/lastfiles.C: ditto
9897 * src/paragraph.C: ditto
9898 * src/table.C: ditto
9899 * src/vspace.C: ditto
9900 * src/insets/figinset.C: ditto
9901 Note: most of these is absolutely harmless, except the one in
9902 src/mathed formula.C.
9904 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9906 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9907 operation, yielding correct results for the reLyX command.
9909 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9911 * src/support/filetools.C (ExpandPath): removed an over eager
9913 (ReplaceEnvironmentPath): ditto
9915 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9916 shows that we are doing something fishy in our code...
9920 * src/lyxrc.C (read): use a double switch trick to get more help
9921 from the compiler. (the same trick is used in layout.C)
9922 (write): new function. opens a ofstream and pass that to output
9923 (output): new function, takes a ostream and writes the lyxrc
9924 elemts to it. uses a dummy switch to make sure no elements are
9927 * src/lyxlex.h: added a struct pushpophelper for use in functions
9928 with more than one exit point.
9930 * src/lyxlex.[Ch] (GetInteger): made it const
9934 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9936 * src/layout.[hC] : LayoutTags splitted into several enums, new
9937 methods created, better error handling cleaner use of lyxlex. Read
9940 * src/bmtable.[Ch]: change some member prototypes because of the
9941 image const changes.
9943 * commandtags.h, src/LyXAction.C (init): new function:
9944 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9945 This file is not read automatically but you can add \input
9946 preferences to your lyxrc if you want to. We need to discuss how
9949 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9950 in .aux, also remove .bib and .bst files from dependencies when
9953 * src/BufferView.C, src/LyXView.C: add const_cast several places
9954 because of changes to images.
9956 * lib/images/*: same change as for images/*
9958 * lib/lyxrc.example: Default for accept_compound is false not no.
9960 * images/*: changed to be const, however I have som misgivings
9961 about this change so it might be changed back.
9963 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9965 * lib/configure, po/POTFILES.in: regenerated
9967 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9969 * config/lib_configure.m4: removed
9971 * lib/configure.m4: new file (was config/lib_configure.m4)
9973 * configure.in: do not test for rtti, since we do not use it.
9975 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9977 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9978 doubling of allocated space scheme. This makes it faster for large
9979 strings end to use less memory for small strings. xtra rememoved.
9981 * src/insets/figinset.C (waitalarm): commented out.
9982 (GhostscriptMsg): use static_cast
9983 (GhostscriptMsg): use new instead of malloc to allocate memory for
9984 cmap. also delete the memory after use.
9986 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9988 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9989 for changes in bibtex database or style.
9990 (runBibTeX): remove all .bib and .bst files from dep before we
9992 (run): use scanAuc in when dep file already exist.
9994 * src/DepTable.C (remove_files_with_extension): new method
9997 * src/DepTable.[Ch]: made many of the methods const.
9999 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10001 * src/bufferparams.C: make sure that the default textclass is
10002 "article". It used to be the first one by description order, but
10003 now the first one is "docbook".
10005 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10006 string; call Debug::value.
10007 (easyParse): pass complete argument to setDebuggingLevel().
10009 * src/debug.h (value): fix the code that parses debug levels.
10011 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10014 * src/LyXAction.C: use Debug::ACTION as debug channel.
10016 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10018 * NEWS: updated for the future 1.1.3 release.
10020 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10021 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10022 it should. This is of course a controversial change (since many
10023 people will find that their lyx workscreen is suddenly full of
10024 red), but done for the sake of correctness.
10026 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10027 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10029 * src/insets/inseterror.h, src/insets/inseturl.h,
10030 src/insets/insetinfo.h, src/insets/figinset.h,
10031 src/mathed/formulamacro.h, src/mathed/math_macro.h
10032 (EditMessage): add a missing const and add _() to make sure that
10033 translation happens
10035 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10036 src/insets/insetbib.C, src/support/filetools.C: add `using'
10037 directives for cxx.
10039 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10040 doing 'Insert index of last word' at the beginning of a paragraph.
10042 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10044 * several files: white-space changes.
10046 * src/mathed/formula.C: removed IsAlpha and IsDigit
10048 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10049 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10052 * src/insets/figinset.C (GetPSSizes): don't break when
10053 "EndComments" is seen. But break when a boundingbox is read.
10055 * all classes inherited from Inset: return value of Clone
10056 changed back to Inset *.
10058 * all classes inherited form MathInset: return value of Clone
10059 changed back to MathedInset *.
10061 * src/insets/figinset.C (runqueue): use a ofstream to output the
10062 gs/ps file. Might need some setpresicion or setw. However I can
10063 see no problem with the current code.
10064 (runqueue): use sleep instead of the alarm/signal code. I just
10065 can't see the difference.
10067 * src/paragraph.C (LyXParagraph): reserve space in the new
10068 paragraph and resize the inserted paragraph to just fit.
10070 * src/lyxfunc.h (operator|=): added operator for func_status.
10072 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10073 check for readable file.
10075 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10076 check for readable file.
10077 (MenuMakeLinuxDoc): ditto
10078 (MenuMakeDocBook): ditto
10079 (MenuMakeAscii): ditto
10080 (InsertAsciiFile): split the test for openable and readable
10082 * src/bmtable.C (draw_bitmaptable): use
10083 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10085 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10086 findtexfile from LaTeX to filetools.
10088 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10089 instead of FilePtr. Needs to be verified by a literate user.
10091 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10093 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10094 (EditMessage): likewise.
10096 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10097 respectively as \textasciitilde and \textasciicircum.
10099 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10101 * src/support/lyxstring.h: made the methods that take iterators
10102 use const_iterator.
10104 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10105 (regexMatch): made is use the real regex class.
10107 * src/support/Makefile.am: changed to use libtool
10109 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10111 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10113 (MathIsInset ++): changed several macros to be inline functions
10116 * src/mathed/Makefile.am: changed to use libtool
10118 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10120 * src/insets/inset* : Clone changed to const and return type is
10121 the true insettype not just Inset*.
10123 * src/insets/Makefile.am: changed to use libtool
10125 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10127 * src/undo.[Ch] : added empty() and changed some of the method
10130 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10132 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10133 setID use block<> for the bullets array, added const several places.
10135 * src/lyxfunc.C (getStatus): new function
10137 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10138 LyXAction, added const to several funtions.
10140 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10141 a std::map, and to store the dir items in a vector.
10143 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10146 * src/LyXView.[Ch] + other files : changed currentView to view.
10148 * src/LyXAction.[Ch] : ported from the old devel branch.
10150 * src/.cvsignore: added .libs and a.out
10152 * configure.in : changes to use libtool.
10154 * acinclude.m4 : inserted libtool.m4
10156 * .cvsignore: added libtool
10158 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10160 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10161 file name in insets and mathed directories (otherwise the
10162 dependency is not taken in account under cygwin).
10164 * src/text2.C (InsertString[AB]): make sure that we do not try to
10165 read characters past the string length.
10167 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10169 * lib/doc/LaTeXConfig.lyx.in,
10170 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10172 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10173 file saying who created them and when this heppened; this is
10174 useless and annoys tools like cvs.
10176 * lib/layouts/g-brief-{en,de}.layout,
10177 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10178 from Thomas Hartkens <thomas@hartkens.de>.
10180 * src/{insets,mathed}/Makefile.am: do not declare an empty
10181 LDFLAGS, so that it can be set at configure time (useful on Irix
10184 * lib/reLyX/configure.in: make sure that the prefix is set
10185 correctly in LYX_DIR.
10187 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10189 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10190 be used by 'command-sequence' this allows to bind a key to a
10191 sequence of LyX-commands
10192 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10194 * src/LyXAction.C: add "command-sequence"
10196 * src/LyXFunction.C: handling of "command-sequence"
10198 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10199 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10201 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10203 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10205 * src/buffer.C (writeFile): Do not output a comment giving user
10206 and date at the beginning of a .lyx file. This is useless and
10207 annoys cvs anyway; update version number to 1.1.
10209 * src/Makefile.am (LYX_DIR): add this definition, so that a
10210 default path is hardcoded in LyX.
10212 * configure.in: Use LYX_GNU_GETTEXT.
10214 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10215 AM_GNU_GETTEXT with a bug fixed.
10217 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10219 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10221 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10222 which is used to point to LyX data is now LYX_DIR_11x.
10224 * lyx.man: convert to a unix text file; small updates.
10226 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10228 * src/support/LSubstring.[Ch]: made the second arg of most of the
10229 constructors be a const reference.
10231 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10234 * src/support/lyxstring.[Ch] (swap): added missing member function
10235 and specialization of swap(str, str);
10237 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10239 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10240 trace of the old one.
10242 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10243 put the member definitions in undo.C.
10245 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10246 NEW_TEXT and have now only code that was included when this was
10249 * src/intl.C (LCombo): use static_cast
10251 (DispatchCallback): ditto
10253 * src/definitions.h: removed whole file
10255 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10257 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10258 parsing and stores in a std:map. a regex defines the file format.
10259 removed unneeded members.
10261 * src/bufferparams.h: added several enums from definitions.h here.
10262 Removed unsused destructor. Changed some types to use proper enum
10263 types. use block to have the temp_bullets and user_defined_bullets
10264 and to make the whole class assignable.
10266 * src/bufferparams.C (Copy): removed this functions, use a default
10267 assignment instead.
10269 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10272 * src/buffer.C (readLyXformat2): commend out all that have with
10273 oldpapersize to do. also comment out all that hve to do with
10274 insetlatex and insetlatexdel.
10275 (setOldPaperStuff): commented out
10277 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10279 * src/LyXAction.C: remove use of inset-latex-insert
10281 * src/mathed/math_panel.C (button_cb): use static_cast
10283 * src/insets/Makefile.am (insets_o_SOURCES): removed
10286 * src/support/lyxstring.C (helper): use the unsigned long
10287 specifier, UL, instead of a static_cast.
10289 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10291 * src/support/block.h: new file. to be used as a c-style array in
10292 classes, so that the class can be assignable.
10294 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10296 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10297 NULL, make sure to return an empty string (it is not possible to
10298 set a string to NULL).
10300 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10302 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10304 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10306 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10307 link line, so that Irix users (for example) can set it explicitely to
10310 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10311 it can be overidden at make time (static or dynamic link, for
10314 * src/vc-backend.C, src/LaTeXFeatures.h,
10315 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10316 statements to bring templates to global namespace.
10318 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10320 * src/support/lyxstring.C (operator[] const): make it standard
10323 * src/minibuffer.C (Init): changed to reflect that more
10324 information is given from the lyxvc and need not be provided here.
10326 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10328 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10330 * src/LyXView.C (UpdateTimerCB): use static_cast
10331 (KeyPressMask_raw_callback): ditto
10333 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10334 buffer_, a lot of changes because of this. currentBuffer() ->
10335 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10336 also changes to other files because of this.
10338 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10340 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10341 have no support for RCS and partial support for CVS, will be
10344 * src/insets/ several files: changes because of function name
10345 changes in Bufferview and LyXView.
10347 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10349 * src/support/LSubstring.[Ch]: new files. These implement a
10350 Substring that can be very convenient to use. i.e. is this
10352 string a = "Mary had a little sheep";
10353 Substring(a, "sheep") = "lamb";
10354 a is now "Mary has a little lamb".
10356 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10357 out patterns and subpatterns of strings. It is used by LSubstring
10358 and also by vc-backend.C
10360 * src/support/lyxstring.C: went over all the assertions used and
10361 tried to correct the wrong ones and flag which of them is required
10362 by the standard. some bugs found because of this. Also removed a
10363 couple of assertions.
10365 * src/support/Makefile.am (libsupport_a_SOURCES): added
10366 LSubstring.[Ch] and LRegex.[Ch]
10368 * src/support/FileInfo.h: have struct stat buf as an object and
10369 not a pointer to one, some changes because of this.
10371 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10372 information in layout when adding the layouts preamble to the
10373 textclass preamble.
10375 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10378 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10379 because of bug in OS/2.
10381 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10383 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10384 \verbatim@font instead of \ttfamily, so that it can be redefined.
10386 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10387 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10388 src/layout.h, src/text2.C: add 'using' directive to bring the
10389 STL templates we need from the std:: namespace to the global one.
10390 Needed by DEC cxx in strict ansi mode.
10392 * src/support/LIstream.h,src/support/LOstream.h,
10393 src/support/lyxstring.h,src/table.h,
10394 src/lyxlookup.h: do not include <config.h> in header
10395 files. This should be done in the .C files only.
10397 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10401 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10403 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10404 from Kayvan to fix the tth invokation.
10406 * development/lyx.spec.in: updates from Kayvan to reflect the
10407 changes of file names.
10409 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10411 * src/text2.C (InsertStringB): use std::copy
10412 (InsertStringA): use std::copy
10414 * src/bufferlist.C: use a vector to store the buffers in. This is
10415 an internal change and should not affect any other thing.
10417 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10420 * src/text.C (Fill): fix potential bug, one off bug.
10422 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10424 * src/Makefile.am (lyx_main.o): add more files it depends on.
10426 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10428 * src/support/lyxstring.C: use size_t for the reference count,
10429 size, reserved memory and xtra.
10430 (internal_compare): new private member function. Now the compare
10431 functions should work for std::strings that have embedded '\0'
10433 (compare): all compare functions rewritten to use
10436 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10438 * src/support/lyxstring.C (compare): pass c_str()
10439 (compare): pass c_str
10440 (compare): pass c_str
10442 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10444 * src/support/DebugStream.C: <config.h> was not included correctly.
10446 * lib/configure: forgot to re-generate it :( I'll make this file
10447 auto generated soon.
10449 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10451 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10454 * src/support/lyxstring.C: some changes from length() to rep->sz.
10455 avoids a function call.
10457 * src/support/filetools.C (SpaceLess): yet another version of the
10458 algorithm...now per Jean-Marc's suggestions.
10460 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10462 * src/layout.C (less_textclass_desc): functor for use in sorting
10464 (LyXTextClass::Read): sort the textclasses after reading.
10466 * src/support/filetools.C (SpaceLess): new version of the
10467 SpaceLess functions. What problems does this one give? Please
10470 * images/banner_bw.xbm: made the arrays unsigned char *
10472 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10474 * src/support/lyxstring.C (find): remove bogus assertion in the
10475 two versions of find where this has not been done yet.
10477 * src/support/lyxlib.h: add missing int return type to
10480 * src/menus.C (ShowFileMenu): disable exporting to html if no
10481 html export command is present.
10483 * config/lib_configure.m4: add a test for an HTML converter. The
10484 programs checked for are, in this order: tth, latex2html and
10487 * lib/configure: generated from config/lib_configure.m4.
10489 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10490 html converter. The parameters are now passed through $$FName and
10491 $$OutName, instead of standard input/output.
10493 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10495 * lib/lyxrc.example: update description of \html_command.
10496 add "quotes" around \screen_font_xxx font setting examples to help
10497 people who use fonts with spaces in their names.
10499 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10501 * Distribution files: updates for v1.1.2
10503 * src/support/lyxstring.C (find): remove bogus assert and return
10504 npos for the same condition.
10506 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10508 * added patch for OS/2 from SMiyata.
10510 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10512 * src/text2.C (CutSelection): make space_wrapped a bool
10513 (CutSelection): dont declare int i until we have to.
10514 (alphaCounter): return a char const *.
10516 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10518 * src/support/syscall.C (Systemcalls::kill):
10519 src/support/filetools.C (PutEnv, PutEnvPath):
10520 src/lyx_cb.C (addNewlineAndDepth):
10521 src/FontInfo.C (FontInfo::resize): condition some #warning
10522 directives with WITH_WARNINGS.
10525 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10527 * src/layout.[Ch] + several files: access to class variables
10528 limited and made accessor functions instead a lot of code changed
10529 becuase of this. Also instead of returning pointers often a const
10530 reference is returned instead.
10532 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10534 * src/Makefile.am (dist-hook): added used to remove the CVS from
10535 cheaders upon creating a dist
10536 (EXTRA_DIST): added cheaders
10538 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10539 a character not as a small integer.
10541 * src/support/lyxstring.C (find): removed Assert and added i >=
10542 rep->sz to the first if.
10544 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10546 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10547 src/LyXView.C src/buffer.C src/bufferparams.C
10548 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10549 src/text2.C src/insets/insetinclude.C:
10550 lyxlayout renamed to textclasslist.
10552 * src/layout.C: some lyxerr changes.
10554 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10555 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10556 (LyXLayoutList): removed all traces of this class.
10557 (LyXTextClass::Read): rewrote LT_STYLE
10558 (LyXTextClass::hasLayout): new function
10559 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10560 both const and nonconst version.
10561 (LyXTextClass::delete_layout): new function.
10562 (LyXTextClassList::Style): bug fix. do the right thing if layout
10564 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10565 (LyXTextClassList::NameOfLayout): ditto
10566 (LyXTextClassList::Load): ditto
10568 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10570 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10572 * src/LyXAction.C (LookupFunc): added a workaround for sun
10573 compiler, on the other hand...we don't know if the current code
10574 compiles on sun at all...
10576 * src/support/filetools.C (CleanupPath): subst fix
10578 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10581 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10582 complained about this one?
10584 * src/insets/insetinclude.C (Latex): subst fix
10586 * src/insets/insetbib.C (getKeys): subst fix
10588 * src/LyXSendto.C (SendtoApplyCB): subst fix
10590 * src/lyx_main.C (init): subst fix
10592 * src/layout.C (Read): subst fix
10594 * src/lyx_sendfax_main.C (button_send): subst fix
10596 * src/buffer.C (RoffAsciiTable): subst fix
10598 * src/lyx_cb.C (MenuFax): subst fix
10599 (PrintApplyCB): subst fix
10601 1999-10-26 Juergen Vigna <jug@sad.it>
10603 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10605 (Read): Cleaned up this code so now we read only format vestion >= 5
10607 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10609 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10610 come nobody has complained about this one?
10612 * src/insets/insetinclude.C (Latex): subst fix
10614 * src/insets/insetbib.C (getKeys): subst fix
10616 * src/lyx_main.C (init): subst fix
10618 * src/layout.C (Read): subst fix
10620 * src/buffer.C (RoffAsciiTable): subst fix
10622 * src/lyx_cb.C (MenuFax): subst fix.
10624 * src/layout.[hC] + some other files: rewrote to use
10625 std::container to store textclasses and layouts in.
10626 Simplified, removed a lot of code. Make all classes
10627 assignable. Further simplifications and review of type
10628 use still to be one.
10630 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10631 lastfiles to create the lastfiles partr of the menu.
10633 * src/lastfiles.[Ch]: rewritten to use deque to store the
10634 lastfiles in. Uses fstream for reading and writing. Simplifies
10637 * src/support/syscall.C: remove explicit cast.
10639 * src/BufferView.C (CursorToggleCB): removed code snippets that
10640 were commented out.
10641 use explicat C++ style casts instead of C style casts. also use
10642 u_vdata instea of passing pointers in longs.
10644 * src/PaperLayout.C: removed code snippets that were commented out.
10646 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10648 * src/lyx_main.C: removed code snippets that wer commented out.
10650 * src/paragraph.C: removed code snippets that were commented out.
10652 * src/lyxvc.C (logClose): use static_cast
10654 (viewLog): remove explicit cast to void*
10655 (showLog): removed old commented code
10657 * src/menus.C: use static_cast instead of C style casts. use
10658 u_vdata instead of u_ldata. remove explicit cast to (long) for
10659 pointers. Removed old code that was commented out.
10661 * src/insets/inset.C: removed old commented func
10663 * src/insets/insetref.C (InsetRef): removed old code that had been
10664 commented out for a long time.
10666 (escape): removed C style cast
10668 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10670 * src/insets/insetlatex.C (Draw): removed old commented code
10671 (Read): rewritten to use string
10673 * src/insets/insetlabel.C (escape): removed C style cast
10675 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10677 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10678 old commented code.
10680 * src/insets/insetinclude.h: removed a couple of stupid bools
10682 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10683 (Clone): remove C style cast
10684 (getKeys): changed list to lst because of std::list
10686 * src/insets/inseterror.C (Draw): removed som old commented code.
10688 * src/insets/insetcommand.C (Draw): removed some old commented code.
10690 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10691 commented out forever.
10692 (bibitem_cb): use static_cast instead of C style cast
10693 use of vdata changed to u_vdata.
10695 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10697 (CloseUrlCB): use static_cast instead of C style cast.
10698 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10700 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10701 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10702 (CloseInfoCB): static_cast from ob->u_vdata instead.
10703 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10706 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10707 (C_InsetError_CloseErrorCB): forward the ob parameter
10708 (CloseErrorCB): static_cast from ob->u_vdata instead.
10710 * src/vspace.h: include LString.h since we use string in this class.
10712 * src/vspace.C (lyx_advance): changed name from advance because of
10713 nameclash with stl. And since we cannot use namespaces yet...I
10714 used a lyx_ prefix instead. Expect this to change when we begin
10717 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10719 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10720 and removed now defunct constructor and deconstructor.
10722 * src/BufferView.h: have backstack as a object not as a pointer.
10723 removed initialization from constructor. added include for BackStack
10725 * development/lyx.spec.in (%build): add CFLAGS also.
10727 * src/screen.C (drawFrame): removed another warning.
10729 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10731 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10732 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10733 README and ANNOUNCE a bit for the next release. More work is
10736 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10737 unbreakable if we are in freespacing mode (LyX-Code), but not in
10740 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10742 * src/BackStack.h: fixed initialization order in constructor
10744 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10746 * acinclude.m4 (VERSION): new rules for when a version is
10747 development, added also a variable for prerelease.
10748 (warnings): we set with_warnings=yes for prereleases
10749 (lyx_opt): prereleases compile with same optimization as development
10750 (CXXFLAGS): only use pedantic if we are a development version
10752 * src/BufferView.C (restorePosition): don't do anything if the
10753 backstack is empty.
10755 * src/BackStack.h: added member empty, use this to test if there
10756 is anything to pop...
10758 1999-10-25 Juergen Vigna <jug@sad.it>
10761 * forms/layout_forms.fd +
10762 * forms/latexoptions.fd +
10763 * lyx.fd: changed for various form resize issues
10765 * src/mathed/math_panel.C +
10766 * src/insets/inseterror.C +
10767 * src/insets/insetinfo.C +
10768 * src/insets/inseturl.C +
10769 * src/insets/inseturl.h +
10771 * src/LyXSendto.C +
10772 * src/PaperLayout.C +
10773 * src/ParagraphExtra.C +
10774 * src/TableLayout.C +
10776 * src/layout_forms.C +
10783 * src/menus.C: fixed various resize issues. So now forms can be
10784 resized savely or not be resized at all.
10786 * forms/form_url.fd +
10787 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10790 * src/insets/Makefile.am: added files form_url.[Ch]
10792 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10794 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10795 (and presumably 6.2).
10797 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10798 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10799 remaining static member callbacks.
10801 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10804 * src/support/lyxstring.h: declare struct Srep as friend of
10805 lyxstring, since DEC cxx complains otherwise.
10807 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10809 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10811 * src/LaTeX.C (run): made run_bibtex also depend on files with
10813 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10814 are put into the dependency file.
10816 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10817 the code has shown itself to work
10818 (create_ispell_pipe): removed another warning, added a comment
10821 * src/minibuffer.C (ExecutingCB): removed code that has been
10822 commented out a long time
10824 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10825 out code + a warning.
10827 * src/support/lyxstring.h: comment out the three private
10828 operators, when compiling with string ansi conforming compilers
10829 they make problems.
10831 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10833 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10834 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10837 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10840 * src/mathed/math_panel.C (create_math_panel): remove explicit
10843 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10846 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10847 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10848 to XCreatePixmapFromBitmapData
10849 (fl_set_bmtable_data): change the last argument to be unsigned
10851 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10852 and bh to be unsigned int, remove explicit casts in call to
10853 XReadBitmapFileData.
10855 * images/arrows.xbm: made the arrays unsigned char *
10856 * images/varsz.xbm: ditto
10857 * images/misc.xbm: ditto
10858 * images/greek.xbm: ditto
10859 * images/dots.xbm: ditto
10860 * images/brel.xbm: ditto
10861 * images/bop.xbm: ditto
10863 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10865 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10866 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10867 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10869 (LYX_CXX_CHEADERS): added <clocale> to the test.
10871 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10873 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10875 * src/support/lyxstring.C (append): fixed something that must be a
10876 bug, rep->assign was used instead of rep->append.
10878 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10881 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10882 lyx insert double chars. Fix spotted by Kayvan.
10884 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10886 * Fixed the tth support. I messed up with the Emacs patch apply feature
10887 and omitted the changes in lyxrc.C.
10889 1999-10-22 Juergen Vigna <jug@sad.it>
10891 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10893 * src/lyx_cb.C (MenuInsertRef) +
10894 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10895 the form cannot be resized under it limits (fixes a segfault)
10897 * src/lyx.C (create_form_form_ref) +
10898 * forms/lyx.fd: Changed Gravity on name input field so that it is
10901 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10903 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10904 <ostream> and <istream>.
10906 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10907 whether <fstream> provides the latest standard features, or if we
10908 have an oldstyle library (like in egcs).
10909 (LYX_CXX_STL_STRING): fix the test.
10911 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10912 code on MODERN_STL_STREAM.
10914 * src/support/lyxstring.h: use L{I,O}stream.h.
10916 * src/support/L{I,O}stream.h: new files, designed to setup
10917 correctly streams for our use
10918 - includes the right header depending on STL capabilities
10919 - puts std::ostream and std::endl (for LOStream.h) or
10920 std::istream (LIStream.h) in toplevel namespace.
10922 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10924 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10925 was a bib file that had been changed we ensure that bibtex is run.
10926 (runBibTeX): enhanced to extract the names of the bib files and
10927 getting their absolute path and enter them into the dep file.
10928 (findtexfile): static func that is used to look for tex-files,
10929 checks for absolute patchs and tries also with kpsewhich.
10930 Alternative ways of finding the correct files are wanted. Will
10932 (do_popen): function that runs a command using popen and returns
10933 the whole output of that command in a string. Should be moved to
10936 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10937 file with extension ext has changed.
10939 * src/insets/figinset.C: added ifdef guards around the fl_free
10940 code that jug commented out. Now it is commented out when
10941 compiling with XForms == 0.89.
10943 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10944 to lyxstring.C, and only keep a forward declaration in
10945 lyxstring.h. Simplifies the header file a bit and should help a
10946 bit on compile time too. Also changes to Srep will not mandate a
10947 recompile of code just using string.
10948 (~lyxstring): definition moved here since it uses srep.
10949 (size): definition moved here since it uses srep.
10951 * src/support/lyxstring.h: removed a couple of "inline" that should
10954 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10956 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10959 1999-10-21 Juergen Vigna <jug@sad.it>
10961 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10962 set to left if I just remove the width entry (or it is empty).
10964 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10965 paragraph when having dummy paragraphs.
10967 1999-10-20 Juergen Vigna <jug@sad.it>
10969 * src/insets/figinset.C: just commented some fl_free_form calls
10970 and added warnings so that this calls should be activated later
10971 again. This avoids for now a segfault, but we have a memory leak!
10973 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10974 'const char * argument' to 'string argument', this should
10975 fix some Asserts() in lyxstring.C.
10977 * src/lyxfunc.h: Removed the function argAsString(const char *)
10978 as it is not used anymore.
10980 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10982 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10985 * src/Literate.h: some funcs moved from public to private to make
10986 interface clearer. Unneeded args removed.
10988 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10990 (scanBuildLogFile): ditto
10992 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10993 normal TeX Error. Still room for improvement.
10995 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10997 * src/buffer.C (insertErrors): changes to make the error
10998 desctription show properly.
11000 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11003 * src/support/lyxstring.C (helper): changed to use
11004 sizeof(object->rep->ref).
11005 (operator>>): changed to use a pointer instead.
11007 * src/support/lyxstring.h: changed const reference & to value_type
11008 const & lets see if that helps.
11010 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11012 * Makefile.am (rpmdist): fixed to have non static package and
11015 * src/support/lyxstring.C: removed the compilation guards
11017 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11020 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11021 conditional compile of lyxstring.Ch
11023 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11024 stupid check, but it is a lot better than the bastring hack.
11025 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11027 * several files: changed string::erase into string::clear. Not
11030 * src/chset.C (encodeString): use a char temporary instead
11032 * src/table.C (TexEndOfCell): added tostr around
11033 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11034 (TexEndOfCell): ditto
11035 (TexEndOfCell): ditto
11036 (TexEndOfCell): ditto
11037 (DocBookEndOfCell): ditto
11038 (DocBookEndOfCell): ditto
11039 (DocBookEndOfCell): ditto
11040 (DocBookEndOfCell): ditto
11042 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11044 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11046 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11047 (MenuBuildProg): added tostr around ret
11048 (MenuRunChktex): added tostr around ret
11049 (DocumentApplyCB): added tostr around ret
11051 * src/chset.C (encodeString): added tostr around t->ic
11053 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11054 (makeLaTeXFile): added tostr around tocdepth
11055 (makeLaTeXFile): added tostr around ftcound - 1
11057 * src/insets/insetbib.C (setCounter): added tostr around counter.
11059 * src/support/lyxstring.h: added an operator+=(int) to catch more
11062 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11063 (lyxstring): We DON'T allow NULL pointers.
11065 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11067 * src/mathed/math_macro.C (MathMacroArgument::Write,
11068 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11069 when writing them out.
11071 * src/LString.C: remove, since it is not used anymore.
11073 * src/support/lyxstring.C: condition the content to
11074 USE_INCLUDED_STRING macro.
11076 * src/mathed/math_symbols.C, src/support/lstrings.C,
11077 src/support/lyxstring.C: add `using' directive to specify what
11078 we need in <algorithm>. I do not think that we need to
11079 conditionalize this, but any thought is appreciated.
11081 * many files: change all callback functions to "C" linkage
11082 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11083 strict_ansi. Those who were static are now global.
11084 The case of callbacks which are static class members is
11085 trickier, since we have to make C wrappers around them (see
11086 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11087 did not finish this yet, since it defeats the purpose of
11088 encapsulation, and I am not sure what the best route is.
11090 1999-10-19 Juergen Vigna <jug@sad.it>
11092 * src/support/lyxstring.C (lyxstring): we permit to have a null
11093 pointer as assignment value and just don't assign it.
11095 * src/vspace.C (nextToken): corrected this function substituting
11096 find_first(_not)_of with find_last_of.
11098 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11099 (TableOptCloseCB) (TableSpeCloseCB):
11100 inserted fl_set_focus call for problem with fl_hide_form() in
11103 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11105 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11108 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11110 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11111 LyXLex::next() and not eatline() to get its argument.
11113 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11115 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11116 instead, use fstreams for io of the depfile, removed unneeded
11117 functions and variables.
11119 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11120 vector instead, removed all functions and variables that is not in
11123 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11125 * src/buffer.C (insertErrors): use new interface to TeXError
11127 * Makefile.am (rpmdist): added a rpmdist target
11129 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11130 per Kayvan's instructions.
11132 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11134 * src/Makefile.am: add a definition for localedir, so that locales
11135 are found after installation (Kayvan)
11137 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11139 * development/.cvsignore: new file.
11141 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11143 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11144 C++ compiler provides wrappers for C headers and use our alternate
11147 * configure.in: use LYX_CXX_CHEADERS.
11149 * src/cheader/: new directory, populated with cname headers from
11150 libstdc++-2.8.1. They are a bit old, but probably good enough for
11151 what we want (support compilers who lack them).
11153 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11154 from includes. It turns out is was stupid.
11156 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11158 * lib/Makefile.am (install-data-local): forgot a ';'
11159 (install-data-local): forgot a '\'
11160 (libinstalldirs): needed after all. reintroduced.
11162 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11164 * configure.in (AC_OUTPUT): added lyx.spec
11166 * development/lyx.spec: removed file
11168 * development/lyx.spec.in: new file
11170 * po/*.po: merged with lyx.pot becuase of make distcheck
11172 * lib/Makefile.am (dist-hook): added dist-hook so that
11173 documentation files will be included when doing a make
11174 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11175 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11177 more: tried to make install do the right thing, exclude CVS dirs
11180 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11181 Path would fit in more nicely.
11183 * all files that used to use pathstack: uses now Path instead.
11184 This change was a lot easier than expected.
11186 * src/support/path.h: new file
11188 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11190 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11192 * src/support/lyxstring.C (getline): Default arg was given for
11195 * Configure.cmd: removed file
11197 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11199 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11200 streams classes and types, add the proper 'using' statements when
11201 MODERN_STL is defined.
11203 * src/debug.h: move the << operator definition after the inclusion
11206 * src/support/filetools.C: include "LAssert.h", which is needed
11209 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11212 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11213 include "debug.h" to define a proper ostream.
11215 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11217 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11218 method to the SystemCall class which can kill a process, but it's
11219 not fully implemented yet.
11221 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11223 * src/support/FileInfo.h: Better documentation
11225 * src/lyxfunc.C: Added support for buffer-export html
11227 * src/menus.C: Added Export->As HTML...
11229 * lib/bind/*.bind: Added short-cut for buffer-export html
11231 * src/lyxrc.*: Added support for new \tth_command
11233 * lib/lyxrc.example: Added stuff for new \tth_command
11235 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11237 * lib/Makefile.am (IMAGES): removed images/README
11238 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11239 installes in correct place. Check permisions is installed
11242 * src/LaTeX.C: some no-op changes moved declaration of some
11245 * src/LaTeX.h (LATEX_H): changed include guard name
11247 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11249 * lib/reLyX/Makefile.am: install noweb2lyx.
11251 * lib/Makefile.am: install configure.
11253 * lib/reLyX/configure.in: declare a config aux dir; set package
11254 name to lyx (not sure what the best solution is); generate noweb2lyx.
11256 * lib/layouts/egs.layout: fix the bibliography layout.
11258 1999-10-08 Jürgen Vigna <jug@sad.it>
11260 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11261 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11262 it returned without continuing to search the path.
11264 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11266 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11267 also fixes a bug. It is not allowed to do tricks with std::strings
11268 like: string a("hei"); &a[e]; this will not give what you
11269 think... Any reason for the complexity in this func?
11271 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11273 * Updated README and INSTALL a bit, mostly to check that my
11274 CVS rights are correctly set up.
11276 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11278 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11279 does not allow '\0' chars but lyxstring and std::string does.
11281 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11283 * autogen.sh (AUTOCONF): let the autogen script create the
11284 POTFILES.in file too. POTFILES.in should perhaps now not be
11285 included in the cvs module.
11287 * some more files changed to use C++ includes instead of C ones.
11289 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11291 (Reread): added tostr to nlink. buggy output otherwise.
11292 (Reread): added a string() around szMode when assigning to Buffer,
11293 without this I got a log of garbled info strings.
11295 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11298 * I have added several ostream & operator<<(ostream &, some_type)
11299 functions. This has been done to avoid casting and warnings when
11300 outputting enums to lyxerr. This as thus eliminated a lot of
11301 explicit casts and has made the code clearer. Among the enums
11302 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11303 mathed enums, some font enum the Debug::type enum.
11305 * src/support/lyxstring.h (clear): missing method. equivalent of
11308 * all files that contained "stderr": rewrote constructs that used
11309 stderr to use lyxerr instead. (except bmtable)
11311 * src/support/DebugStream.h (level): and the passed t with
11312 Debug::ANY to avoid spurious bits set.
11314 * src/debug.h (Debug::type value): made it accept strings of the
11315 type INFO,INIT,KEY.
11317 * configure.in (Check for programs): Added a check for kpsewhich,
11318 the latex generation will use this later to better the dicovery of
11321 * src/BufferView.C (create_view): we don't need to cast this to
11322 (void*) that is done automatically.
11323 (WorkAreaButtonPress): removed some dead code.
11325 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11327 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11328 is not overwritten when translated (David Sua'rez de Lis).
11330 * lib/CREDITS: Added David Sua'rez de Lis
11332 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11334 * src/bufferparams.C (BufferParams): default input encoding is now
11337 * acinclude.m4 (cross_compiling): comment out macro
11338 LYX_GXX_STRENGTH_REDUCE.
11340 * acconfig.h: make sure that const is not defined (to empty) when
11341 we are compiling C++. Remove commented out code using SIZEOF_xx
11344 * configure.in : move the test for const and inline as late as
11345 possible so that these C tests do not interefere with C++ ones.
11346 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11347 has not been proven.
11349 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11351 * src/table.C (getDocBookAlign): remove bad default value for
11352 isColumn parameter.
11354 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11356 (ShowFileMenu2): ditto.
11358 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11359 of files to ignore.
11361 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11363 * Most files: finished the change from the old error code to use
11364 DebugStream for all lyxerr debugging. Only minor changes remain
11365 (e.g. the setting of debug levels using strings instead of number)
11367 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11369 * src/layout.C (Add): Changed to use compare_no_case instead of
11372 * src/FontInfo.C: changed loop variable type too string::size_type.
11374 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11376 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11377 set ETAGS_ARGS to --c++
11379 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11381 * src/table.C (DocBookEndOfCell): commented out two unused variables
11383 * src/paragraph.C: commented out four unused variables.
11385 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11386 insed a if clause with type string::size_type.
11388 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11391 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11393 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11394 variable, also changed loop to go from 0 to lenght + 1, instead of
11395 -1 to length. This should be correct.
11397 * src/LaTeX.C (scanError): use string::size_type as loop variable
11400 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11401 (l.896) since y_tmp and row was not used anyway.
11403 * src/insets/insetref.C (escape): use string::size_type as loop
11406 * src/insets/insetquotes.C (Width): use string::size_type as loop
11408 (Draw): use string::size_type as loop variable type.
11410 * src/insets/insetlatexaccent.C (checkContents): use
11411 string::size_type as loop variable type.
11413 * src/insets/insetlabel.C (escape): use string::size_type as loop
11416 * src/insets/insetinfo.C: added an extern for current_view.
11418 * src/insets/insetcommand.C (scanCommand): use string::size_type
11419 as loop variable type.
11421 * most files: removed the RCS tags. With them we had to recompile
11422 a lot of files after a simple cvs commit. Also we have never used
11423 them for anything meaningful.
11425 * most files: tags-query-replace NULL 0. As adviced several plases
11426 we now use "0" instead of "NULL" in our code.
11428 * src/support/filetools.C (SpaceLess): use string::size_type as
11429 loop variable type.
11431 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11433 * src/paragraph.C: fixed up some more string stuff.
11435 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11437 * src/support/filetools.h: make modestr a std::string.
11439 * src/filetools.C (GetEnv): made ch really const.
11441 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11442 made code that used these use max/min from <algorithm> instead.
11444 * changed several c library include files to their equivalent c++
11445 library include files. All is not changed yet.
11447 * created a support subdir in src, put lyxstring and lstrings
11448 there + the extra files atexit, fileblock, strerror. Created
11449 Makefile.am. edited configure.in and src/Makefile.am to use this
11450 new subdir. More files moved to support.
11452 * imported som of the functions from repository lyx, filetools
11454 * ran tags-query-replace on LString -> string, corrected the bogus
11455 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11456 is still some errors in there. This is errors where too much or
11457 too litle get deleted from strings (string::erase, string::substr,
11458 string::replace), there can also be some off by one errors, or
11459 just plain wrong use of functions from lstrings. Viewing of quotes
11462 * LyX is now running fairly well with string, but there are
11463 certainly some bugs yet (see above) also string is quite different
11464 from LString among others in that it does not allow null pointers
11465 passed in and will abort if it gets any.
11467 * Added the revtex4 files I forgot when setting up the repository.
11469 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11471 * All over: Tried to clean everything up so that only the files
11472 that we really need are included in the cvs repository.
11473 * Switched to use automake.
11474 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11475 * Install has not been checked.
11477 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11479 * po/pt.po: Three errors:
11480 l.533 and l.538 format specification error
11481 l. 402 duplicate entry, I just deleted it.