1 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/support/filetools.C (GetFileContents): close to dummy change
5 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7 * src/trans.C (AddDeadkey): workaround stupid compilers.
9 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11 * src/frontends/xforms/FormDocument.C (class_update): fix setting
12 of two-sided document.
14 2000-10-31 Juergen Vigna <jug@sad.it>
16 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
18 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
19 xposition to the Edit call.
21 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
23 * src/trans.C (AddDeadkey): cast explicitly to char.
25 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
27 * src/tabular.C (AsciiBottomHLine): simplify?
28 (AsciiTopHLine): simplify?
29 (print_n_chars): simplify
30 (DocBook): remove most of the << endl; we should flush the stream
31 as seldom as possible.
33 (TeXBottomHLine): ditto
36 (write_attribute): try a templified version.
37 (set_row_column_number_info): lesson scope of variables
39 * src/support/lstrings.h (tostr): new specialization of tostr
41 * src/trans.C (AddDeadkey): slightly cleaner fix.
43 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
45 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
46 '%%' in Toc menu labels.
49 * src/insets/insetlatexaccent.C (draw): Correct rendering when
50 font_norm is iso10646-1.
52 * src/font.C (ascent): Fixed for 16bit fonts
53 (descent,lbearing,rbearing): ditto
55 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
57 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
58 (getFeedback): new static method.
60 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
61 Now use combox rather than choice to display languages.
62 Feedback is now output using a new timer callback mechanism, identical
63 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
65 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
67 * src/minibuffer.C: fix for older compilers
69 2000-10-30 Juergen Vigna <jug@sad.it>
71 * src/insets/insettext.C (InsertInset): fixed this as the cursor
72 has to be Left of the inset otherwise LyXText won't find it!
74 * src/BufferView2.C (open_new_inset): delete the inset if it can
77 2000-10-30 Rob Lahaye <lahaye@postech.edu>
81 2000-10-29 Marko Vendelin <markov@ioc.ee>
82 * src/frontends/gnome/FormCitation.C
83 * src/frontends/gnome/FormCitation.h
84 * src/frontends/gnome/FormCopyright.C
85 * src/frontends/gnome/FormCopyright.h
86 * src/frontends/gnome/FormError.C
87 * src/frontends/gnome/FormError.h
88 * src/frontends/gnome/FormIndex.C
89 * src/frontends/gnome/FormIndex.h
90 * src/frontends/gnome/FormPrint.C
91 * src/frontends/gnome/FormPrint.h
92 * src/frontends/gnome/FormRef.C
93 * src/frontends/gnome/FormRef.h
94 * src/frontends/gnome/FormToc.C
95 * src/frontends/gnome/FormToc.h
96 * src/frontends/gnome/FormUrl.C
97 * src/frontends/gnome/FormUrl.h
98 * src/frontends/gnome/Menubar_pimpl.C
99 * src/frontends/gnome/mainapp.C
100 * src/frontends/gnome/mainapp.h
101 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
102 changing update() to updateSlot() where appropriate
104 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
106 * src/frontends/xforms/FormPreferences.[Ch]:
107 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
110 2000-10-28 Juergen Vigna <jug@sad.it>
112 * src/insets/insettabular.C (draw): fixed drawing bug.
114 * src/insets/insettext.C (clear):
116 (SetParagraphData): clearing the TEXT buffers when deleting the
117 paragraphs used by it.
119 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
121 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
123 2000-10-27 Juergen Vigna <jug@sad.it>
125 * src/tabular.C (~LyXTabular): removed not needed anymore.
127 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
130 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
132 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
135 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
138 * src/frontends/xforms/FormPreferences.[Ch]:
139 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
140 Reorganised as modules based on tabs. Much easier to follow the
141 flow and to add new tabs. Added warning and feedback messages.
144 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
146 * src/tabular.h (DocBook): add std:: qualifier.
148 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
150 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
151 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
154 * insettabular.C (DocBook): uses the tabular methods to export
157 * src/insets/insettext.h
158 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
160 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
162 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
165 * src/lyxfunc.C (MenuNew): lessen the scope of fname
166 moved misplaced AllowInput two lines up.
168 * src/buffer.C (readFile): compare float with float, not with int
170 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
172 * src/minibuffer.C: add "using SigC::slot" statement.
174 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
176 * src/frontends/xforms/forms/README: updated section about make.
178 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
179 Tidied some forms up, made two of form_tabular's tabs more
180 self-consistent, fixed Jean-Marc's size problem in form_preferences,
181 fixed translation problem with "Column".
183 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
185 * src/minibuffer.h: use Timeout instead of the xforms timer
187 (setTimer) rewrite for the Timeout, change to unsigned arg
188 (set): change to unsigned timer arg
191 * src/minibuffer.C (TimerCB): removed func
192 (C_MiniBuffer_TimerCB): removed func
193 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
194 (peek_event): use a switch statement
195 (add): don't use fl_add_timer.
196 (Set): rewrite to use the Timeout
199 * src/Timeout.[Ch] (setType): return a Timeout &
200 (setTimeout): ditto, change to unsigned arg for timeout
202 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
204 * src/mathed/formula.C (mathed_string_width): Use string instead
205 of a constant size char array.
207 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
209 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
210 the two recently added operator<< for SMInput and State.
212 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
214 (OkCancelPolicy): ditto
215 (OkCancelReadOnlyPolicy): ditto
216 (NoRepeatedApplyReadOnlyPolicy): ditto
217 (OkApplyCancelReadOnlyPolicy): ditto
218 (OkApplyCancelPolicy): ditto
219 (NoRepeatedApplyPolicy): ditto
221 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
223 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
224 add the usual std:: qualifiers.
226 2000-10-25 Juergen Vigna <jug@sad.it>
228 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
230 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
232 * src/support/filetools.C (MakeRelPath): change some types to
235 * src/frontends/ButtonPolicies.h (operator<<): new operator for
236 ButtonPolicy::SMInput and ButtonPolicy::State.
238 * src/FontLoader.C (reset): small cleanup
239 (unload): small cleanup
241 * src/FontInfo.C (getFontname): initialize error to 10000.0
243 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
245 * src/frontends/xforms/FormPreferences.[Ch]:
246 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
247 TeX encoding and default paper size sections.
249 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
251 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
254 * src/frontends/xforms/FormError.C (disconnect): use erase() to
255 make the message_ empty.
256 (FormError): don't initialize message_ in initializer list.
258 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
260 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
262 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
264 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
266 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
268 * src/frontends/kde/*data.[Ch]: _("") is not
271 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
273 * src/buffer.C: removed redundant using directive.
275 * src/frontends/DialogBase.h: revert to original definition of
278 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
279 stuff into two classes, one for each dialog, requires a new
280 element in the dialogs vector, FormTabularCreate.
282 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
285 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
286 method. Continues Allan's idea, but means that derived classes
287 don't need to worry about "update or hide?".
289 * src/frontends/xforms/FormError.C (showInset): add connection
292 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
293 one for each dialog. FormTabular now contains main tabular dialog
296 * src/frontends/xforms/FormTabularCreate.[Ch]:
297 * src/frontends/xforms/forms/form_tabular_create.fd: the create
300 * src/frontends/xforms/FormGraphics.[Ch]:
301 * src/frontends/xforms/forms/form_graphics.fd
302 * src/frontends/xforms/FormTabular.[Ch]:
303 * src/frontends/xforms/forms/form_tabular.fd: made daughter
304 classes of FormInset.
306 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
307 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
309 * src/frontends/xforms/Makefile.am:
310 * src/frontends/xforms/forms/makefile: added new files.
312 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
313 variable. added Signal0 hide signal, in keeping with other GUI-I
316 * src/support/lstrings.h: removed redundant std:: qualifier as
317 it's already declared in Lsstream.h.
319 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
321 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
325 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
327 * src/tabular.C (Ascii): minimize scope of cell.
329 * src/BufferView2.C (nextWord): return string() instead of 0;
331 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
333 * src/converter.h: add a std:: qualifier
335 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
337 * src/importer.[Ch]: New files. Used for importing files into LyX.
339 * src/lyxfunc.C (doImport): Use the new Importer class.
341 * src/converter.h: Add shortcut member to the Format class.
342 Used for holding the menu shortcut.
344 * src/converter.C and other files: Made a distinction between
345 format name and format extension. New formats can be defined using
346 the \format lyxrc tag.
347 Added two new converter flags: latex and disable.
349 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
351 * src/support/lyxlib.h: unify namespace/struct implementation.
352 Remove extra declarations.
354 * src/support/chdir.C (chdir): remove version taking char const *
356 * src/support/rename.C: ditto.
357 * src/support/lyxsum.C: ditto.
359 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
361 * src/frontends/xforms/FormBase.[Ch]:
362 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
363 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
364 work only for the next call to fl_show_form(). The correct place to set
365 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
366 done. FormBase also stores minw_, minh_ itself. All dialogs derived
367 from FormBase have the minimum size set; no more stupid crashes with
370 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
372 * lib/ui/default.ui: fix shortcut for Insert->Include File.
374 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
376 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
378 * src/support/lyxlib.h: changed second argument of mkdir to
379 unsigned long int (unsigned int would probably have been enough,
380 but...). Removed <sys/types.h> header.
381 * src/support/mkdir.C (mkdir): ditto.
385 2000-10-19 Juergen Vigna <jug@sad.it>
387 * src/lyxfunc.C (MenuNew): small fix (form John)
389 * src/screen.C (Update): removed unneeded code.
391 * src/tabular.C (Ascii): refixed int != uint bug!
393 * src/support/lyxlib.h: added sys/types.h include for now permits
394 compiling, but I don't like this!
396 2000-10-18 Juergen Vigna <jug@sad.it>
398 * src/text2.C (ClearSelection): if we clear the selection we need
399 more refresh so set the status apropriately
401 * src/insets/insettext.C (draw): hopefully finally fixed draw
404 2000-10-12 Juergen Vigna <jug@sad.it>
406 * src/insets/insettext.C (draw): another small fix and make a block
407 so that variables are localized.
409 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
411 * src/support/lstrings.C (lowercase, uppercase):
412 use explicit casts to remove compiler warnings.
414 * src/support/LRegex.C (Impl):
415 * src/support/StrPool.C (add):
416 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
417 (AddPath, MakeDisplayPath):
418 * src/support/lstrings.C (prefixIs, subst):
419 use correct type to remove compiler warnings.
421 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
423 * src/support/lyxlib.h:
424 * src/support/mkdir.C (mkdir): change parameter to mode_t for
425 portability and to remove compiler warning with DEC cxx.
427 * src/support/FileInfo.[Ch] (flagRWX): ditto.
429 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
431 * src/minibuffer.C (peek_event): retun 1 when there has been a
432 mouseclick in the minibuffer.
436 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
438 * src/frontends/xforms/FormParagraph.C: more space above/below
441 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
443 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
444 a char only if real_current_font was changed.
446 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
448 * NEWS: update somewhat for 1.1.6
450 * lib/ui/default.ui: clean up.
452 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
454 * lib/CREDITS: clean up
456 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
458 * src/combox.[Ch] (select): changed argument back to int
459 * src/combox.C (peek_event): removed num_bytes as it is declared but
462 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
463 modified calls to Combox::select() to remove warnings about type
466 * src/insets/insetbutton.C (width): explicit cast to remove warning
467 about type conversion.
469 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
472 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
473 sel_pos_end, refering to cursor position are changed to
474 LyXParagraph::size_type.
476 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
477 consistent with LyXCursor::pos().
478 (inset_pos): changed to LyXParagraph::size_type for same reason.
480 * src/insets/insettext.C (resizeLyXText): changed some temporary
481 variables refing to cursor position to LyXParagraph::size_type.
483 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
485 * src/frontends/kde/<various>: The Great Renaming,
488 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
490 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
492 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
494 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
495 0 when there are no arguments.
497 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
499 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
500 to segfaults when pressing Ok in InsetBibtex dialog.
502 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
504 * forms/layout_forms.fd:
505 * src/layout_forms.C (create_form_form_character): small change to use
506 labelframe rather than engraved frame + text
508 * src/lyx_gui.C (create_forms): initialise choice_language with some
509 arbitrary value to prevent segfault when dialog is shown.
511 2000-10-16 Baruch Even <baruch.even@writeme.com>
513 * src/converter.C (runLaTeX, scanLog): Added a warning when there
514 is no resulting file. This pertains only to LaTeX output.
516 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
518 * src/text.C (Backspace): Make sure that the row of the cursor is
521 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
524 * src/lyx_gui.C (init): Prevent a crash when only one font from
525 menu/popup fonts is not found.
527 * lib/lyxrc.example: Add an example for binding a key for language
530 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
532 * src/converter.C (GetReachable): Changed the returned type to
534 (IsReachable): New method
536 * src/MenuBackend.C (expand): Handle formats that appear more
539 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
541 * src/frontends/support/Makefile.am
542 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
545 * lib/CREDITS: add Garst Reese.
547 * src/support/snprintf.h: add extern "C" {} around the definitions.
549 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
551 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
554 * src/frontends/xforms/FormDocument.C:
555 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
556 compile without "conversion to integral type of smaller size"
559 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
561 * src/text.C (GetColumnNearX): Fixed disabled code.
563 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
565 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
568 * src/support/snprintf.[ch]: new files
570 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
572 * src/frontends/kde/formprintdialog.C: add
573 file browser for selecting postscript output
575 * src/frontends/kde/formprintdialogdata.C:
576 * src/frontends/kde/formprintdialogdata.h: re-generate
579 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
581 * src/frontends/gnome/Makefile.am:
582 * src/frontends/kde/Makefile.am: FormCommand.C
583 disappeared from xforms
585 * src/frontends/kde/FormCitation.C:
586 * src/frontends/kde/FormIndex.C: read-only
589 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
591 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
594 * src/bufferlist.C: add using directive.
596 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
598 * src/support/lyxfunctional.h: version of class_fun for void
599 returns added, const versions of back_inseter_fun and compare_fun
602 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
604 * src/frontends/xforms/FormInset.C (showInset): fix typo.
606 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
608 * ChangeLog: cleanup.
610 * lib/CREDITS: update to add all the contributors we've forgotten.
611 I have obviously missed some, so tell me whether there were
614 2000-10-13 Marko Vendelin <markov@ioc.ee>
616 * src/frontends/gnome/FormCitation.C
617 * src/frontends/gnome/FormCitation.h
618 * src/frontends/gnome/FormError.C
619 * src/frontends/gnome/FormIndex.C
620 * src/frontends/gnome/FormRef.C
621 * src/frontends/gnome/FormRef.h
622 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
624 * src/frontends/gnome/FormCitation.C
625 * src/frontends/gnome/FormCopyright.C
626 * src/frontends/gnome/FormError.C
627 * src/frontends/gnome/FormIndex.C
628 * src/frontends/gnome/FormRef.C
629 * src/frontends/gnome/FormToc.C
630 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
633 * src/frontends/gnome/Menubar_pimpl.C
634 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
637 2000-10-11 Baruch Even <baruch.even@writeme.com>
640 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
641 to convey its real action.
643 * src/minibuffer.C (peek_event): Added action when mouse clicks to
644 clear the minibuffer and prepare to enter a command.
646 * src/mathed/formula.C (LocalDispatch): Changed to conform with
647 the rename from ExecCommand to PrepareForCommand.
648 * src/lyxfunc.C (Dispatch): ditto.
650 2000-10-11 Baruch Even <baruch.even@writeme.com>
652 * src/buffer.C (writeFile): Added test for errors on writing, this
653 catches all errors and not only file system full errors as intended.
655 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
657 * src/lyx_gui.C (create_forms): better fix for crash with
658 translated interface.
660 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
662 * src/frontends/kde/Makefile.am:
663 * src/frontends/kde/FormCopyright.C:
664 * src/frontends/kde/formcopyrightdialog.C:
665 * src/frontends/kde/formcopyrightdialog.h:
666 * src/frontends/kde/formcopyrightdialogdata.C:
667 * src/frontends/kde/formcopyrightdialogdata.h:
668 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
669 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
670 copyright to use qtarch
672 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
674 * src/encoding.C (read): Fixed bug that caused an error message at
677 * po/Makefile.in.in: Fixed rule for ext_l10n.h
679 * lib/lyxrc.example: Fixed hebrew example.
681 2000-10-13 Allan Rae <rae@lyx.org>
683 * src/frontends/xforms/FormPreferences.C (input): reworking the
685 (build, update, apply): New inputs in various tabfolders
687 * src/frontends/xforms/FormToc.C: use new button policy.
688 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
689 dialogs that either can't use any existing policy or where it just
692 * src/frontends/xforms/FormTabular.h: removed copyright notice that
695 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
696 added a bool parameter which is ignored.
698 * src/buffer.C (setReadonly):
699 * src/BufferView_pimpl.C (buffer):
700 * src/frontends/kde/FormCopyright.h (update):
701 * src/frontends/kde/FormCitation.[Ch] (update):
702 * src/frontends/kde/FormIndex.[Ch] (update):
703 * src/frontends/kde/FormPrint.[Ch] (update):
704 * src/frontends/kde/FormRef.[Ch] (update):
705 * src/frontends/kde/FormToc.[Ch] (update):
706 * src/frontends/kde/FormUrl.[Ch] (update):
707 * src/frontends/gnome/FormCopyright.h (update):
708 * src/frontends/gnome/FormCitation.[Ch] (update):
709 * src/frontends/gnome/FormError.[Ch] (update):
710 * src/frontends/gnome/FormIndex.[Ch] (update):
711 * src/frontends/gnome/FormPrint.[Ch] (update):
712 * src/frontends/gnome/FormRef.h (update):
713 * src/frontends/gnome/FormToc.[Ch] (update):
714 * src/frontends/gnome/FormUrl.[Ch] (update):
715 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
716 to updateBufferDependent and DialogBase
718 * src/frontends/xforms/FormCitation.[hC]:
719 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
720 * src/frontends/xforms/FormError.[Ch]:
721 * src/frontends/xforms/FormGraphics.[Ch]:
722 * src/frontends/xforms/FormIndex.[Ch]:
723 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
724 and fixed readOnly handling.
725 * src/frontends/xforms/FormPrint.[Ch]:
726 * src/frontends/xforms/FormRef.[Ch]:
727 * src/frontends/xforms/FormTabular.[Ch]:
728 * src/frontends/xforms/FormToc.[Ch]:
729 * src/frontends/xforms/FormUrl.[Ch]:
730 * src/frontends/xforms/FormInset.[Ch]:
731 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
732 form of updateBufferDependent.
734 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
735 if form()->visible just in case someone does stuff to the form in a
738 * src/frontends/DialogBase.h (enum): removed enum since we can now use
739 the buttoncontroller for everything the enum used to be used for.
740 (update) It would seem we need to force all dialogs to use a bool
741 parameter or have two update functions. I chose to go with one.
742 I did try removing update() from here and FormBase and defining the
743 appropriate update signatures in FormBaseB[DI] but then ran into the
744 problem of the update() call in FormBase::show(). Whatever I did
745 to get around that would require another function and that just
746 got more confusing. Hence the decision to make everyone have an
747 update(bool). An alternative might have been to override show() in
748 FormBaseB[DI] and that would allow the different and appropriate
751 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
752 true == buffer change occurred. I decided against using a default
753 template parameter since not all compilers support that at present.
755 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
757 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
758 army knife" by removing functionality.
759 (clearStore): removed. All such housekeeping on hide()ing the dialog
760 is to be carried out by overloaded disconnect() methods.
761 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
762 superceded by Baruch's neat test (FormGraphics) to update an existing
763 dialog if a new signal is recieved rather than block all new signals
765 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
766 only to Inset dialogs.
767 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
768 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
770 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
772 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
773 as a base class to all inset dialogs. Used solely to connect/disconnect
774 the Inset::hide signal and to define what action to take on receipt of
775 a UpdateBufferDependent signal.
776 (FormCommand): now derived from FormInset.
778 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
781 * src/frontends/xforms/FormCopyright.[Ch]:
782 * src/frontends/xforms/FormPreferences.[Ch]:
783 now derived from FormBaseBI.
785 * src/frontends/xforms/FormDocument.[Ch]:
786 * src/frontends/xforms/FormParagraph.[Ch]:
787 * src/frontends/xforms/FormPrint.[Ch]:
788 now derived from FormBaseBD.
790 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
792 * src/frontends/xforms/FormCitation.[Ch]:
793 * src/frontends/xforms/FormError.[Ch]:
794 * src/frontends/xforms/FormRef.[Ch]:
795 * src/frontends/xforms/FormToc.[Ch]:
796 (clearStore): reworked as disconnect().
798 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
801 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
803 * src/converter.C (runLaTeX): constify buffer argument
806 * src/frontends/support/Makefile.am (INCLUDES): fix.
808 * src/buffer.h: add std:: qualifier
809 * src/insets/figinset.C (addpidwait): ditto
810 * src/MenuBackend.C: ditto
811 * src/buffer.C: ditto
812 * src/bufferlist.C: ditto
813 * src/layout.C: ditto
814 * src/lyxfunc.C: ditto
816 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
818 * src/lyxtext.h (bidi_level): change return type to
819 LyXParagraph::size_type.
821 * src/lyxparagraph.h: change size_type to
822 TextContainer::difference_type. This should really be
823 TextContainer::size_type, but we need currently to support signed
826 2000-10-11 Marko Vendelin <markov@ioc.ee>
827 * src/frontends/gnome/FormError.h
828 * src/frontends/gnome/FormRef.C
829 * src/frontends/gnome/FormRef.h
830 * src/frontends/gnome/FormError.C
831 * src/frontends/gnome/Makefile.am
832 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
833 to Gnome frontend. Both dialogs use "action" area.
835 2000-10-12 Baruch Even <baruch.even@writeme.com>
837 * src/graphics/GraphicsCacheItem_pimpl.C:
838 * src/graphics/Renderer.C:
839 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
842 2000-10-12 Juergen Vigna <jug@sad.it>
844 * src/insets/insettext.C (draw): fixed drawing bug (specifically
845 visible when selecting).
847 * development/Code_rules/Rules: fixed some typos.
849 2000-10-09 Baruch Even <baruch.even@writeme.com>
851 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
852 compiling on egcs 1.1.2 possible.
854 * src/filedlg.C (comp_direntry::operator() ): ditto.
856 2000-08-31 Baruch Even <baruch.even@writeme.com>
858 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
861 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
862 transient it now only gets freed when the object is destructed.
864 2000-08-24 Baruch Even <baruch.even@writeme.com>
866 * src/frontends/FormGraphics.h:
867 * src/frontends/FormGraphics.C: Changed to use ButtonController and
870 2000-08-20 Baruch Even <baruch.even@writeme.com>
872 * src/insets/insetgraphics.C:
873 (draw): Added messages to the drawn rectangle to report status.
874 (updateInset): Disabled the use of the inline graphics,
877 2000-08-17 Baruch Even <baruch.even@writeme.com>
879 * src/frontends/support: Directory added for the support of GUII LyX.
881 * src/frontends/support/LyXImage.h:
882 * src/frontends/support/LyXImage.C: Base class for GUII holding of
885 * src/frontends/support/LyXImage_X.h:
886 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
887 version of LyXImage, this uses the Xlib Pixmap.
892 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
893 replacement to Pixmap.
895 * src/insets/insetgraphics.h:
896 * src/insets/insetgraphics.C:
897 * src/graphics/GraphicsCacheItem.h:
898 * src/graphics/GraphicsCacheItem.C:
899 * src/graphics/GraphicsCacheItem_pimpl.h:
900 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
903 * src/graphics/GraphicsCacheItem.h:
904 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
905 another copy of the object.
907 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
908 of cacheHandle, this fixed a bug that sent LyX crashing.
910 * src/graphics/XPM_Renderer.h:
911 * src/graphics/XPM_Renderer.C:
912 * src/graphics/EPS_Renderer.h:
913 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
915 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
917 * src/lyxfunc.C (processKeySym): only handle the
918 lockinginset/inset stuff if we have a buffer and text loaded...
920 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
922 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
924 * src/support/lyxfunctional.h: add operator= that takes a reference
926 * src/lyxserver.C (mkfifo): make first arg const
928 * src/layout.h: renamed name(...) to setName(...) to work around
931 * src/buffer.C (setFileName): had to change name of function to
932 work around bugs in egcs. (renamed from fileName)
934 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
936 * src/support/translator.h: move helper template classes to
937 lyxfunctional.h, include "support/lyxfunctional.h"
939 * src/support/lyxmanip.h: add delaration of fmt
941 * src/support/lyxfunctional.h: new file
942 (class_fun_t): new template class
943 (class_fun): helper template function
944 (back_insert_fun_iterator): new template class
945 (back_inserter_fun): helper template function
946 (compare_memfun_t): new template class
947 (compare_memfun): helper template function
948 (equal_1st_in_pair): moved here from translator
949 (equal_2nd_in_pair): moved here from translator
951 * src/support/fmt.C: new file
952 (fmt): new func, can be used for a printf substitute when still
953 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
955 * src/support/StrPool.C: add some comments
957 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
960 * src/insets/figinset.C (addpidwait): use std::copy with
961 ostream_iterator to fill the pidwaitlist
963 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
965 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
968 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
971 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
973 * src/frontends/xforms/FormDocument.C (build): remove c_str()
974 (class_update): ditto
976 (CheckChoiceClass): move initialization of tc and tct
978 * src/tabular.C: remove current_view
979 (OldFormatRead): similar to right below [istream::ignore]
981 * src/lyxlex_pimpl.C (next): add code for faster skipping of
982 chars, unfortunately this is buggy on gcc 2.95.2, so currently
983 unused [istream::ignore]
985 * src/lyxfunc.C: include "support/lyxfunctional.h"
986 (getInsetByCode): use std::find_if and compare_memfun
988 * src/lyxfont.C (stateText): remove c_str()
990 * src/lyx_main.C (setDebuggingLevel): make static
991 (commandLineHelp): make static
993 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
994 Screen* together with fl_get_display() and fl_screen
996 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
997 togheter with fl_get_display() and fl_screen
998 (create_forms): remove c_str()
1000 * src/layout.C: include "support/lyxfunctional.h"
1001 (hasLayout): use std::find_if and compare_memfun
1002 (GetLayout): use std::find_if and comapre_memfun
1003 (delete_layout): use std::remove_if and compare_memfun
1004 (NumberOfClass): use std:.find_if and compare_memfun
1006 * src/gettext.h: change for the new functions
1008 * src/gettext.C: new file, make _(char const * str) and _(string
1009 const & str) real functions.
1011 * src/font.C (width): rewrite slightly to avoid one extra variable
1013 * src/debug.C: initialize Debug::ANY here
1015 * src/commandtags.h: update number comments
1017 * src/combox.h (get): make const func
1019 (getline): make const
1021 * src/combox.C (input_cb): handle case where fl_get_input can
1024 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1025 "support/lyxfunctional.h", remove current_view variable.
1026 (resize): use std::for_each with std::mem_fun
1027 (getFileNames): use std::copy with back_inserter_fun
1028 (getBuffer): change arg type to unsigned int
1029 (emergencyWriteAll): call emergencyWrite with std::for_each and
1031 (emergencyWrite): new method, the for loop in emergencyWriteAll
1033 (exists): use std::find_if with compare_memfun
1034 (getBuffer): use std::find_if and compare_memfun
1036 * src/buffer.h: add typedefs for iterator_category, value_type
1037 difference_type, pointer and reference for inset_iterator
1038 add postfix ++ for inset_iterator
1039 make inset_iterator::getPos() const
1041 * src/buffer.C: added support/lyxmanip.h
1042 (readFile): use lyxerr << fmt instead of printf
1043 (makeLaTeXFile): use std::copy to write out encodings
1045 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1047 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1048 free and the char * temp.
1049 (hasMenu): use std::find_if and compare_memfun
1052 * src/Makefile.am (lyx_SOURCES): added gettext.C
1054 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1055 string::insert small change to avoid temporary
1057 * src/LColor.C (getGUIName): remove c_str()
1059 * several files: change all occurrences of fl_display to
1062 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1063 that -pedantic is not used for gcc 2.97 (cvs gcc)
1065 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1067 2000-10-11 Allan Rae <rae@lyx.org>
1069 * src/frontends/xforms/FormPreferences.C (input): template path must be
1070 a readable directory. It doesn't need to be writeable.
1071 (build, delete, update, apply): New inputs in the various tabfolders
1073 * src/frontends/xforms/forms/form_preferences.fd:
1074 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1075 several new entries to existing folders. Shuffled some existing stuff
1078 * src/frontends/xforms/forms/form_print.fd:
1079 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1080 Should probably rework PrinterParams as well. Note that the switch to
1081 collated is effectively the same as !unsorted so changing PrinterParams
1082 will require a lot of fiddly changes to reverse the existing logic.
1084 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1086 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1088 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1090 2000-10-10 Allan Rae <rae@lyx.org>
1093 * src/lyxfunc.C (Dispatch):
1095 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1098 * src/lyxrc.C (output): Only write the differences between system lyxrc
1099 and the users settings.
1102 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1104 I'll rewrite this later, after 1.1.6 probably, to keep a single
1105 LyXRC but two instances of a LyXRCStruct.
1107 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1109 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1111 * src/tabular.h: add a few std:: qualifiers.
1113 * src/encoding.C: add using directive.
1114 * src/language.C: ditto.
1116 * src/insets/insetquotes.C (Validate): use languages->lang()
1117 instead of only language.
1119 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1121 * lib/languages: New file.
1123 * lib/encodings: New file.
1125 * src/language.C (Languages): New class.
1126 (read): New method. Reads the languages from the 'languages' file.
1128 * src/encoding.C (Encodings): New class.
1129 (read): New method. Reads the encodings from the 'encodings' file.
1131 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1134 * src/bufferparams.h and a lot of files: Deleted the member language,
1135 and renamed language_info to language
1137 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1138 * src/lyxfont.C (latexWriteStartChanges): ditto.
1139 * src/paragraph.C (validate,TeXOnePar): ditto.
1141 * src/lyxfont.C (update): Restored deleted code.
1143 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1145 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1147 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1149 * src/insets/figinset.[Ch]:
1150 * src/insets/insetinclude.[Ch]:
1151 * src/insets/insetinclude.[Ch]:
1152 * src/insets/insetparent.[Ch]:
1153 * src/insets/insetref.[Ch]:
1154 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1156 * src/insets/*.[Ch]:
1157 * src/mathed/formula.[Ch]:
1158 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1160 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1161 * src/lyx_cb.C (FigureApplyCB):
1162 * src/lyxfunc.C (getStatus, Dispatch):
1163 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1166 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1168 * src/converter.[Ch] (Formats::View):
1169 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1171 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1172 *current_view->buffer(). This will change later, but this patch is way
1175 2000-10-09 Juergen Vigna <jug@sad.it>
1177 * src/text.C (GetRow): small fix.
1179 * src/BufferView_pimpl.C (cursorPrevious):
1180 (cursorNext): added LyXText parameter to function.
1182 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1183 keypress depending on cursor position.
1185 2000-10-06 Juergen Vigna <jug@sad.it>
1187 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1188 (copySelection): redone this function and also copy ascii representa-
1191 * src/tabular.C (Ascii):
1195 (print_n_chars): new functions to realize the ascii export of tabulars.
1197 2000-10-05 Juergen Vigna <jug@sad.it>
1199 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1200 if we don't have a buffer.
1202 2000-10-10 Allan Rae <rae@lyx.org>
1204 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1205 with closing dialog. It seems that nested tabfolders require hiding
1206 of inner tabfolders before hiding the dialog itself. Actually all I
1207 did was hide the active outer folder.
1209 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1210 unless there really is a buffer. hideBufferDependent is called
1213 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1214 POTFILES.in stays in $(srcdir).
1216 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1218 * lib/lyxrc.example: Few changes.
1220 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1222 * src/BufferView_pimpl.C (buffer): only need one the
1223 updateBufferDependent signal to be emitted once! Moved to the end of
1224 the method to allow bv_->text to be updated first.
1226 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1227 and hSignal_ with Dialogs * and BufferDependency variables.
1228 New Buffer * parent_, initialised when the dialog is launched. Used to
1229 check whether to update() or hide() dialog in the new, private
1230 updateOrHide() method that is connected to the updateBufferDependent
1231 signal. Daughter classes dictate what to do using the
1232 ChangedBufferAction enum, passed to the c-tor.
1234 * src/frontends/xforms/FormCitation.C:
1235 * src/frontends/xforms/FormCommand.C:
1236 * src/frontends/xforms/FormCopyright.C:
1237 * src/frontends/xforms/FormDocument.C:
1238 * src/frontends/xforms/FormError.C:
1239 * src/frontends/xforms/FormIndex.C:
1240 * src/frontends/xforms/FormPreferences.C:
1241 * src/frontends/xforms/FormPrint.C:
1242 * src/frontends/xforms/FormRef.C:
1243 * src/frontends/xforms/FormToc.C:
1244 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1247 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1248 ChangedBufferAction enum.
1250 * src/frontends/xforms/FormParagraph.[Ch]
1251 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1254 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1256 * lib/bind/cua.bind: fix a bit.
1257 * lib/bind/emacs.bind: ditto.
1259 * lib/bind/menus.bind: remove real menu entries from there.
1261 * src/spellchecker.C: make sure we only include strings.h when
1264 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1266 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1267 function. It enlarges the maximum number of pup when needed.
1268 (add_toc2): Open a new menu if maximum number of items per menu has
1271 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1273 * src/frontends/kde/FormPrint.C: fix error reporting
1275 * src/frontends/xforms/FormDocument.C: fix compiler
1278 * lib/.cvsignore: add Literate.nw
1280 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1283 * bufferview_funcs.[Ch]
1286 * text2.C: Add support for numbers in RTL text.
1288 2000-10-06 Allan Rae <rae@lyx.org>
1290 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1291 to be gettext.m4 friendly again. ext_l10n.h is now
1292 generated into $top_srcdir instead of $top_builddir
1293 so that lyx.pot will be built correctly -- without
1294 duplicate parsing of ext_l10n.h.
1296 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1298 * src/frontends/kde/FormCitation.C: make the dialog
1299 behave more sensibly
1301 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1303 * config/kde.m4: fix consecutive ./configure runs,
1304 look for qtarch, fix library order
1306 * src/frontends/kde/Makefile.am: tidy up,
1307 add Print dialog, add .dlg dependencies
1309 * src/frontends/kde/FormPrint.C:
1310 * src/frontends/kde/FormPrint.h:
1311 * src/frontends/kde/formprintdialog.C:
1312 * src/frontends/kde/formprintdialog.h:
1313 * src/frontends/kde/formprintdialogdata.C:
1314 * src/frontends/kde/formprintdialogdata.h:
1315 * src/frontends/kde/dlg/formprintdialog.dlg: add
1318 * src/frontends/kde/dlg/README: Added explanatory readme
1320 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1321 script to double-check qtarch's output
1323 * src/frontends/kde/formindexdialog.C:
1324 * src/frontends/kde/formindexdialogdata.C:
1325 * src/frontends/kde/formindexdialogdata.h:
1326 * src/frontends/kde/dlg/formindexdialog.dlg: update
1327 for qtarch, minor fixes
1329 2000-10-05 Allan Rae <rae@lyx.org>
1331 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1332 dialogs when switching buffers update them instead. It's up to each
1333 dialog to decide if it should still be visible or not.
1334 update() should return a bool to control visiblity within show().
1335 Or perhaps better to set a member variable and use that to control
1338 * lib/build-listerrors: create an empty "listerrors" file just to stop
1339 make trying to regenerate it all the time if you don't have noweb
1342 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1344 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1345 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1346 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1347 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1348 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1350 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1352 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1354 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1355 deleting buffer. Closes all buffer-dependent dialogs.
1357 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1359 * src/frontends/xforms/FormCitation.[Ch]:
1360 * src/frontends/xforms/FormPreferences.[Ch]:
1361 * src/frontends/xforms/FormPrint.[Ch]:
1362 * src/frontends/xforms/FormRef.[Ch]:
1363 * src/frontends/xforms/FormUrl.[Ch]: ditto
1365 * src/frontends/xforms/FormDocument.[Ch]:
1366 * src/frontends/xforms/forms/form_document.C.patch:
1367 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1368 pass through a single input() function.
1370 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1372 * lib/build-listerrors: return status as OK
1374 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1376 * lib/lyxrc.example: Updated to new export code
1378 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1380 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1383 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1386 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1387 LyX-Code is defined.
1388 * lib/layouts/amsbook.layout: ditto.
1390 * boost/Makefile.am: fix typo.
1392 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1394 (add_lastfiles): removed.
1395 (add_documents): removed.
1396 (add_formats): removed.
1398 * src/frontends/Menubar.C: remove useless "using" directive.
1400 * src/MenuBackend.h: add a new MenuItem constructor.
1402 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1405 2000-10-04 Allan Rae <rae@lyx.org>
1407 * lib/Makefile.am (listerrors):
1408 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1409 I haven't got notangle installed so Kayvan please test. The output
1410 should end up in $builddir. This also allows people who don't have
1411 noweb installed to complete the make process without error.
1413 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1414 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1415 by JMarc's picky compiler.
1417 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1420 * src/insets/insettabular.C (setPos): change for loop to not use
1421 sequencing operator. Please check this Jürgen.
1423 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1425 * src/insets/insetcite.C (getScreenLabel): ditto
1426 * src/support/filetools.C (QuoteName): ditto
1427 (ChangeExtension): ditto
1429 * src/BufferView_pimpl.C (scrollCB): make heigt int
1431 * src/BufferView2.C (insertInset): comment out unused arg
1433 * boost/Makefile.am (EXTRADIST): new variable
1435 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1437 * src/exporter.C (IsExportable): Fixed
1439 * lib/configure.m4: Small fix
1441 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1443 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1444 * src/insets/insetbib.C (bibitemWidest): ditto.
1445 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1447 2000-10-03 Juergen Vigna <jug@sad.it>
1449 * src/BufferView2.C (theLockingInset): removed const because of
1450 Agnus's compile problems.
1452 * src/insets/insettext.C (LocalDispatch): set the language of the
1453 surronding paragraph on inserting the first character.
1455 * various files: changed use of BufferView::the_locking_inset.
1457 * src/BufferView2.C (theLockingInset):
1458 (theLockingInset): new functions.
1460 * src/BufferView.h: removed the_locking_inset.
1462 * src/lyxtext.h: added the_locking_inset
1464 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1466 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1468 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1470 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1471 * src/mathed/math_cursor.C (IsAlpha): ditto.
1472 * src/mathed/math_inset.C (strnew): ditto.
1473 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1474 (IMetrics): cxp set but never used; removed.
1475 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1476 that the variable in question has been removed also!
1479 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1480 using the Buffer * passed to Latex(), using the BufferView * passed to
1481 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1483 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1484 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1486 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1487 * src/buffer.C (readInset): used new InsetBibtex c-tor
1488 * (getBibkeyList): used new InsetBibtex::getKeys
1490 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1493 * lib/build-listerrors
1495 * src/exporter.C: Add literate programming support to the export code
1498 * src/lyx_cb.C: Remove old literate code.
1500 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1503 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1504 * src/converter.C (View, Convert): Use QuoteName.
1506 * src/insets/figinset.C (Preview): Use Formats::View.
1508 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1510 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1512 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1513 the top of the function, because compaq cxx complains that the
1514 "goto exit_with_message" when the function is disabled bypasses
1516 (MenuNew): try a better fix for the generation of new file names.
1517 This time, I used AddName() instead of AddPath(), hoping Juergen
1520 2000-10-03 Allan Rae <rae@lyx.org>
1522 * src/frontends/xforms/forms/form_preferences.fd:
1523 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1524 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1525 "Look and Feel"->"General" but will need to be split up further into
1526 general output and general input tabs. Current plan is for four outer
1527 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1528 stuff; "Inputs" for input and import configuration; "Outputs" for
1529 output and export configuration; and one more whatever is left over
1530 called "General". The leftovers at present look like being which
1531 viewers to use, spellchecker, language support and might be better
1532 named "Support". I've put "Paths" in "Inputs" for the moment as this
1533 seems reasonable for now at least.
1534 One problem remains: X error kills LyX when you close Preferences.
1536 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1538 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1539 qualifier from form()
1540 * src/frontends/xforms/FormCitation.[Ch]:
1541 * src/frontends/xforms/FormCopyright.[Ch]:
1542 * src/frontends/xforms/FormDocument.[Ch]:
1543 * src/frontends/xforms/FormError.[Ch]:
1544 * src/frontends/xforms/FormIndex.[Ch]:
1545 * src/frontends/xforms/FormPreferences.[Ch]:
1546 * src/frontends/xforms/FormPrint.[Ch]:
1547 * src/frontends/xforms/FormRef.[Ch]:
1548 * src/frontends/xforms/FormToc.[Ch]:
1549 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1551 * src/frontends/xforms/FormCitation.[Ch]:
1552 * src/frontends/xforms/FormIndex.[Ch]:
1553 * src/frontends/xforms/FormRef.[Ch]:
1554 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1555 with Allan's naming policy
1557 * src/frontends/xforms/FormCitation.C: some static casts to remove
1560 2000-10-02 Juergen Vigna <jug@sad.it>
1562 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1563 now you can type or do stuff inside the table-cell also when in dummy
1564 position, fixed visible cursor.
1566 * src/insets/insettext.C (Edit): fixing cursor-view position.
1568 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1569 be used for equal functions in lyxfunc and insettext.
1571 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1573 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1575 * src/frontends/gnome/FormCitation.h:
1576 * src/frontends/gnome/FormCopyright.h:
1577 * src/frontends/gnome/FormIndex.h:
1578 * src/frontends/gnome/FormPrint.h:
1579 * src/frontends/gnome/FormToc.h:
1580 * src/frontends/gnome/FormUrl.h:
1581 * src/frontends/kde/FormCitation.h:
1582 * src/frontends/kde/FormCopyright.h:
1583 * src/frontends/kde/FormIndex.h:
1584 * src/frontends/kde/FormRef.h:
1585 * src/frontends/kde/FormToc.h:
1586 * src/frontends/kde/FormUrl.h: fix remaining users of
1589 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1591 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1592 from depth argument.
1593 (DocBookHandleCaption): ditto.
1594 (DocBookHandleFootnote): ditto.
1595 (SimpleDocBookOnePar): ditto.
1597 * src/frontends/xforms/FormDocument.h (form): remove extra
1598 FormDocument:: qualifier.
1600 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1602 * sigc++/handle.h: ditto.
1604 * src/lyx_gui_misc.C: add "using" directive.
1606 * src/cheaders/cstddef: new file, needed by the boost library (for
1609 2000-10-02 Juergen Vigna <jug@sad.it>
1611 * src/insets/insettext.C (SetFont): better support.
1613 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1615 * src/screen.C (DrawOneRow): some uint refixes!
1617 2000-10-02 Allan Rae <rae@lyx.org>
1619 * boost/.cvsignore: ignore Makefile as well
1621 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1622 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1624 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1625 Left this one out by accident.
1627 * src/frontends/xforms/FormBase.h (restore): default to calling
1628 update() since that will restore the original/currently-applied values.
1629 Any input() triggered error messages will require the derived classes
1630 to redefine restore().
1632 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1633 avoid a segfault. combo_doc_class is the main concern.
1635 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1637 * Simplify build-listerrors in view of GUI-less export ability!
1639 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1641 * src/lyx_main.C (easyParse): Disable gui when exporting
1643 * src/insets/figinset.C:
1646 * src/lyx_gui_misc.C
1647 * src/tabular.C: Changes to allow no-gui.
1649 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1651 * src/support/utility.hpp: removed file
1652 * src/support/block.h: removed file
1654 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1657 * src/mathed/formula.C: add support/lyxlib.h
1658 * src/mathed/formulamacro.C: ditto
1660 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1661 * src/lyxparagraph.h: ditto
1663 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1664 * src/frontends/Makefile.am (INCLUDES): ditto
1665 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1666 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1667 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1668 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1669 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1670 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1672 * src/BufferView.h: use boost/utility.hpp
1673 * src/LColor.h: ditto
1674 * src/LaTeX.h: ditto
1675 * src/LyXAction.h: ditto
1676 * src/LyXView.h: ditto
1677 * src/bufferlist.h: ditto
1678 * src/lastfiles.h: ditto
1679 * src/layout.h: ditto
1680 * src/lyx_gui.h: ditto
1681 * src/lyx_main.h: ditto
1682 * src/lyxlex.h: ditto
1683 * src/lyxrc.h: ditto
1684 * src/frontends/ButtonPolicies.h: ditto
1685 * src/frontends/Dialogs.h: ditto
1686 * src/frontends/xforms/FormBase.h: ditto
1687 * src/frontends/xforms/FormGraphics.h: ditto
1688 * src/frontends/xforms/FormParagraph.h: ditto
1689 * src/frontends/xforms/FormTabular.h: ditto
1690 * src/graphics/GraphicsCache.h: ditto
1691 * src/graphics/Renderer.h: ditto
1692 * src/insets/ExternalTemplate.h: ditto
1693 * src/insets/insetcommand.h: ditto
1694 * src/support/path.h: ditto
1696 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1697 and introduce clause for 2.97.
1699 * boost/libs/README: new file
1701 * boost/boost/utility.hpp: new file
1703 * boost/boost/config.hpp: new file
1705 * boost/boost/array.hpp: new file
1707 * boost/Makefile.am: new file
1709 * boost/.cvsignore: new file
1711 * configure.in (AC_OUTPUT): add boost/Makefile
1713 * Makefile.am (SUBDIRS): add boost
1715 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1717 * src/support/lstrings.C (suffixIs): Fixed.
1719 2000-10-01 Allan Rae <rae@lyx.org>
1721 * src/PrinterParams.h: moved things around to avoid the "can't
1722 inline call" warning.
1724 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1725 into doc++ documentation.
1727 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1729 * src/frontends/xforms/FormRef.C: make use of button controller
1730 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1731 cleaned up button controller usage.
1732 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1733 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1734 use the button controller
1736 * src/frontends/xforms/forms/*.fd: and associated generated files
1737 updated to reflect changes to FormBase. Some other FormXxxx files
1738 also got minor updates to reflect changes to FormBase.
1740 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1741 (hide): made virtual.
1742 (input): return a bool. true == valid input
1743 (RestoreCB, restore): new
1744 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1745 Changes to allow derived dialogs to use a ButtonController and
1746 make sense when doing so: OK button calls ok() and so on.
1748 * src/frontends/xforms/ButtonController.h (class ButtonController):
1749 Switch from template implementation to taking Policy parameter.
1750 Allows FormBase to provide a ButtonController for any dialog.
1752 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1753 Probably should rename connect and disconnect.
1754 (apply): use the radio button groups
1755 (form): needed by FormBase
1756 (build): setup the radio button groups
1758 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1760 * several files: type changes to reduce the number of warnings and
1761 to unify type hangling a bit. Still much to do.
1763 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1765 * lib/images/*: rename a bunch of icons to match Dekel converter
1768 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1771 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1773 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1775 * sigc++/handle.h: ditto for class Handle.
1777 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1779 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1781 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1783 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1784 removal of the "default" language.
1786 * src/combox.h (getline): Check that sel > 0
1788 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1790 * lib/examples/docbook_example.lyx
1791 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1793 * lib/layouts/docbook-book.layout: new docbook book layout.
1795 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1797 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1799 * src/insets/figinset.C (DocBook):fixed small typo.
1801 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1803 * src/insets/insetinclude.h: string include_label doesn't need to be
1806 2000-09-29 Allan Rae <rae@lyx.org>
1808 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1809 Allow derived type to control connection and disconnection from signals
1810 of its choice if desired.
1812 2000-09-28 Juergen Vigna <jug@sad.it>
1814 * src/insets/insettabular.C (update): fixed cursor setting when
1815 the_locking_inset changed.
1816 (draw): made this a bit cleaner.
1817 (InsetButtonPress): fixed!
1819 * various files: added LyXText Parameter to fitCursor call.
1821 * src/BufferView.C (fitCursor): added LyXText parameter.
1823 * src/insets/insettabular.C (draw): small draw fix.
1825 * src/tabular.C: right setting of left/right celllines.
1827 * src/tabular.[Ch]: fixed various types in funcions and structures.
1828 * src/insets/insettabular.C: ditto
1829 * src/frontends/xforms/FormTabular.C: ditto
1831 2000-09-28 Allan Rae <rae@lyx.org>
1833 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1834 that the #ifdef's had been applied to part of what should have been
1835 a complete condition. It's possible there are other tests that
1836 were specific to tables that are also wrong now that InsetTabular is
1837 being used. Now we need to fix the output of '\n' after a table in a
1838 float for the same reason as the original condition:
1839 "don't insert this if we would be adding it before or after a table
1840 in a float. This little trick is needed in order to allow use of
1841 tables in \subfigures or \subtables."
1842 Juergen can you check this?
1844 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1846 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1847 output to the ostream.
1849 * several files: fixed types based on warnings from cxx
1851 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1853 * src/frontends/kde/Makefile.am: fix rule for
1854 formindexdialogdata_moc.C
1856 * src/.cvsignore: add ext_l10n.h to ignore
1858 * acconfig.h: stop messing with __STRICT_ANSI__
1859 * config/gnome.m4: remove option to set -ansi
1860 * config/kde.m4: remove option to set -ansi
1861 * config/lyxinclude.m4: don't set -ansi
1863 2000-09-27 Juergen Vigna <jug@sad.it>
1865 * various files: remove "default" language check.
1867 * src/insets/insetquotes.C: removed use of current_view.
1869 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1870 the one should have red ears by now!
1872 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1873 in more then one paragraph. Fixed cursor-movement/selection.
1875 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1876 paragraphs inside a text inset.
1878 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1879 text-inset if this owner is an inset.
1881 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1883 * src/Bullet.h: changed type of font, character and size to int
1885 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1887 * src/insets/inseturl.[Ch]:
1888 * src/insets/insetref.[Ch]:
1889 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1891 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1893 * src/buffer.C (readFile): block-if statement rearranged to minimise
1894 bloat. Patch does not reverse Jean-Marc's change ;-)
1896 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1897 Class rewritten to store pointers to hide/update signals directly,
1898 rather than Dialogs *. Also defined an enum to ease use. All xforms
1899 forms can now be derived from this class.
1901 * src/frontends/xforms/FormCommand.[Ch]
1902 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1904 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1907 * src/frontends/xforms/forms/form_citation.fd
1908 * src/frontends/xforms/forms/form_copyright.fd
1909 * src/frontends/xforms/forms/form_error.fd
1910 * src/frontends/xforms/forms/form_index.fd
1911 * src/frontends/xforms/forms/form_ref.fd
1912 * src/frontends/xforms/forms/form_toc.fd
1913 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1915 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1917 * src/insets/insetfoot.C: removed redundent using directive.
1919 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1921 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1922 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1924 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1925 created in the constructors in different groups. Then set() just
1926 have to show the groups as needed. This fixes the redraw problems
1927 (and is how the old menu code worked).
1929 * src/support/lyxlib.h: declare the methods as static when we do
1930 not have namespaces.
1932 2000-09-26 Juergen Vigna <jug@sad.it>
1934 * src/buffer.C (asciiParagraph): new function.
1935 (writeFileAscii): new function with parameter ostream.
1936 (writeFileAscii): use now asciiParagraph.
1938 * various inset files: added the linelen parameter to the Ascii-func.
1940 * src/tabular.C (Write): fixed error in writing file introduced by
1941 the last changes from Lars.
1943 * lib/bind/menus.bind: removed not supported functions.
1945 * src/insets/insettext.C (Ascii): implemented this function.
1947 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1949 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1950 (Write): use of the write_attribute functions.
1952 * src/bufferlist.C (close): fixed reasking question!
1954 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1956 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1957 new files use the everwhere possible.
1960 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1961 src/log_form.C src/lyx.C:
1964 * src/buffer.C (runLaTeX): remove func
1966 * src/PaperLayout.C: removed file
1967 * src/ParagraphExtra.C: likewise
1968 * src/bullet_forms.C: likewise
1969 * src/bullet_forms.h: likewise
1970 * src/bullet_forms_cb.C: likewise
1972 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1973 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1976 * several files: remove all traces of the old fd_form_paragraph,
1977 and functions belonging to that.
1979 * several files: remove all traces of the old fd_form_document,
1980 and functions belonging to that.
1982 * several files: constify local variables were possible.
1984 * several files: remove all code that was dead when NEW_EXPORT was
1987 * several files: removed string::c_str in as many places as
1990 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1991 (e): be a bit more outspoken when patching
1992 (updatesrc): only move files if changed.
1994 * forms/layout_forms.h.patch: regenerated
1996 * forms/layout_forms.fd: remove form_document and form_paragraph
1997 and form_quotes and form_paper and form_table_options and
1998 form_paragraph_extra
2000 * forms/form1.fd: remove form_table
2002 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2003 the fdui->... rewrite. Update some comments to xforms 0.88
2005 * forms/bullet_forms.C.patch: removed file
2006 * forms/bullet_forms.fd: likewise
2007 * forms/bullet_forms.h.patch: likewise
2009 * development/Code_rules/Rules: added a section on switch
2010 statements. Updated some comment to xforms 0.88.
2012 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2014 * src/buffer.C (readFile): make sure that the whole version number
2015 is read after \lyxformat (even when it contains a comma)
2017 * lib/ui/default.ui: change shortcut of math menu to M-a.
2019 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2021 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2024 * src/LyXView.C (updateWindowTitle): show the full files name in
2025 window title, limited to 30 characters.
2027 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2028 When a number of characters has been given, we should not assume
2029 that the string is 0-terminated.
2031 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2032 calls (fixes some memory leaks)
2034 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2035 trans member on exit.
2037 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2039 * src/converter.C (GetReachable): fix typo.
2041 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2042 understand ',' instead of '.'.
2043 (GetInteger): rewrite to use strToInt().
2045 2000-09-26 Juergen Vigna <jug@sad.it>
2047 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2048 better visibility and error-message on wrong VSpace input.
2050 * src/language.C (initL): added english again.
2052 2000-09-25 Juergen Vigna <jug@sad.it>
2054 * src/frontends/kde/Dialogs.C (Dialogs):
2055 * src/frontends/gnome/Dialogs.C (Dialogs):
2056 * src/frontends/kde/Makefile.am:
2057 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2059 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2061 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2063 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2065 * src/frontends/xforms/FormParagraph.C:
2066 * src/frontends/xforms/FormParagraph.h:
2067 * src/frontends/xforms/form_paragraph.C:
2068 * src/frontends/xforms/form_paragraph.h:
2069 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2072 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2074 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2075 Paragraph-Data after use.
2077 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2078 non breakable paragraphs.
2080 2000-09-25 Garst R. Reese <reese@isn.net>
2082 * src/language.C (initL): added missing language_country codes.
2084 2000-09-25 Juergen Vigna <jug@sad.it>
2086 * src/insets/insettext.C (InsetText):
2087 (deleteLyXText): remove the not released LyXText structure!
2089 2000-09-24 Marko Vendelin <markov@ioc.ee>
2091 * src/frontends/gnome/mainapp.C
2092 * src/frontends/gnome/mainapp.h: added support for keyboard
2095 * src/frontends/gnome/FormCitation.C
2096 * src/frontends/gnome/FormCitation.h
2097 * src/frontends/gnome/Makefile.am
2098 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2099 FormCitation to use "action area" in mainapp window
2101 * src/frontends/gnome/Menubar_pimpl.C
2102 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2105 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2107 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2108 width/descent/ascent values if name is empty.
2109 (mathed_string_height): Use std::max.
2111 2000-09-25 Allan Rae <rae@lyx.org>
2113 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2114 segfault. This will be completely redesigned soon.
2116 * sigc++: updated libsigc++. Fixes struct timespec bug.
2118 * development/tools/makeLyXsigc.sh: .cvsignore addition
2120 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2122 * several files: removed almost all traces of the old table
2125 * src/TableLayout.C: removed file
2127 2000-09-22 Juergen Vigna <jug@sad.it>
2129 * src/frontends/kde/Dialogs.C: added credits forms.
2131 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2133 * src/frontends/gnome/Dialogs.C: added some forms.
2135 * src/spellchecker.C (init_spell_checker): set language in pspell code
2136 (RunSpellChecker): some modifications for setting language string.
2138 * src/language.[Ch]: added language_country code.
2140 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2142 * src/frontends/Dialogs.h: added new signal showError.
2143 Rearranged existing signals in some sort of alphabetical order.
2145 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2146 FormError.[Ch], form_error.[Ch]
2147 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2148 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2150 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2151 dialogs. I think that this can be used as the base to all these
2154 * src/frontends/xforms/FormError.[Ch]
2155 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2156 implementation of InsetError dialog.
2158 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2160 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2161 * src/frontends/kde/Makefile.am: ditto
2163 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2165 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2166 macrobf. This fixes a bug of invisible text.
2168 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2170 * lib/doc/LaTeXConfig.lyx.in: updated.
2172 * src/language.C (initL): remove language "francais" and change a
2173 bit the names of the two other french variations.
2175 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2176 string that may not be 0-terminated.
2178 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2180 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2182 2000-09-20 Marko Vendelin <markov@ioc.ee>
2184 * src/frontends/gnome/FormCitation.C
2185 * src/frontends/gnome/FormIndex.C
2186 * src/frontends/gnome/FormToc.C
2187 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2188 the variable initialization to shut up the warnings
2190 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2192 * src/table.[Ch]: deleted files
2194 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2197 2000-09-18 Juergen Vigna <jug@sad.it>
2199 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2200 problems with selection. Inserted new LFUN_PASTESELECTION.
2201 (InsetButtonPress): inserted handling of middle mouse-button paste.
2203 * src/spellchecker.C: changed word to word.c_str().
2205 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2207 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2208 included in the ``make dist'' tarball.
2210 2000-09-15 Juergen Vigna <jug@sad.it>
2212 * src/CutAndPaste.C (cutSelection): small fix return the right
2213 end position after cut inside one paragraph only.
2215 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2216 we are locked as otherwise we don't have a valid cursor position!
2218 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2220 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2222 * src/frontends/kde/FormRef.C: added using directive.
2223 * src/frontends/kde/FormToc.C: ditto
2225 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2227 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2229 2000-09-19 Marko Vendelin <markov@ioc.ee>
2231 * src/frontends/gnome/Menubar_pimpl.C
2232 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2233 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2235 * src/frontends/gnome/mainapp.C
2236 * src/frontends/gnome/mainapp.h: support for menu update used
2239 * src/frontends/gnome/mainapp.C
2240 * src/frontends/gnome/mainapp.h: support for "action" area in the
2241 main window. This area is used by small simple dialogs, such as
2244 * src/frontends/gnome/FormIndex.C
2245 * src/frontends/gnome/FormIndex.h
2246 * src/frontends/gnome/FormUrl.C
2247 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2250 * src/frontends/gnome/FormCitation.C
2251 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2252 action area. Only "Insert new citation" is implemented.
2254 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2256 * src/buffer.C (Dispatch): fix call to Dispatch
2257 * src/insets/insetref.C (Edit): likewise
2258 * src/insets/insetparent.C (Edit): likewise
2259 * src/insets/insetinclude.C (include_cb): likewise
2260 * src/frontends/xforms/FormUrl.C (apply): likewise
2261 * src/frontends/xforms/FormToc.C (apply): likewise
2262 * src/frontends/xforms/FormRef.C (apply): likewise
2263 * src/frontends/xforms/FormIndex.C (apply): likewise
2264 * src/frontends/xforms/FormCitation.C (apply): likewise
2265 * src/lyxserver.C (callback): likewise
2266 * src/lyxfunc.C (processKeySym): likewise
2267 (Dispatch): likewise
2268 (Dispatch): likewise
2269 * src/lyx_cb.C (LayoutsCB): likewise
2271 * Makefile.am (sourcedoc): small change
2273 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2275 * src/main.C (main): Don't make an empty GUIRunTime object. all
2276 methods are static. constify a bit remove unneded using + headers.
2278 * src/tabular.C: some more const to local vars move some loop vars
2280 * src/spellchecker.C: added some c_str after some word for pspell
2282 * src/frontends/GUIRunTime.h: add new static method setDefaults
2283 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2284 * src/frontends/kde/GUIRunTime.C (setDefaults):
2285 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2287 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2288 with strnew in arg, use correct emptystring when calling SetName.
2290 * several files: remove all commented code with relation to
2291 HAVE_SSTREAM beeing false. We now only support stringstream and
2294 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2296 * src/lyxfunc.C: construct correctly the automatic new file
2299 * src/text2.C (IsStringInText): change type of variable i to shut
2302 * src/support/sstream.h: do not use namespaces if the compiler
2303 does not support them.
2305 2000-09-15 Marko Vendelin <markov@ioc.ee>
2306 * src/frontends/gnome/FormCitation.C
2307 * src/frontends/gnome/FormCitation.h
2308 * src/frontends/gnome/diainsertcitation_interface.c
2309 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2310 regexp support to FormCitation [Gnome].
2312 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2315 * configure.in: remove unused KDE/GTKGUI define
2317 * src/frontends/kde/FormRef.C
2318 * src/frontends/kde/FormRef.h
2319 * src/frontends/kde/formrefdialog.C
2320 * src/frontends/kde/formrefdialog.h: double click will
2321 go to reference, now it is possible to change a cross-ref
2324 * src/frontends/kde/FormToc.C
2325 * src/frontends/kde/FormToc.h
2326 * src/frontends/kde/formtocdialog.C
2327 * src/frontends/kde/formtocdialog.h: add a depth
2330 * src/frontends/kde/Makefile.am: add QtLyXView.h
2333 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2335 * src/frontends/kde/FormCitation.h: added some using directives.
2337 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2339 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2342 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2345 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2347 * src/buffer.C (pop_tag): revert for the second time a change by
2348 Lars, who seems to really hate having non-local loop variables :)
2350 * src/Lsstream.h: add "using" statements.
2352 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2353 * src/buffer.C (writeFile): ditto
2355 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2357 * src/buffer.C (writeFile): try to fix the locale modified format
2358 number to always be as we want it.
2360 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2361 in XForms 0.89. C-space is now working again.
2363 * src/Lsstream.h src/support/sstream.h: new files.
2365 * also commented out all cases where strstream were used.
2367 * src/Bullet.h (c_str): remove method.
2369 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2371 * a lot of files: get rid of "char const *" and "char *" is as
2372 many places as possible. We only want to use them in interaction
2373 with system of other libraries, not inside lyx.
2375 * a lot of files: return const object is not of pod type. This
2376 helps ensure that temporary objects is not modified. And fits well
2377 with "programming by contract".
2379 * configure.in: check for the locale header too
2381 * Makefile.am (sourcedoc): new tag for generation of doc++
2384 2000-09-14 Juergen Vigna <jug@sad.it>
2386 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2387 callback to check which combo called it and do the right action.
2389 * src/combox.C (combo_cb): added combo * to the callbacks.
2390 (Hide): moved call of callback after Ungrab of the pointer.
2392 * src/intl.h: removed LCombo2 function.
2394 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2395 function as this can now be handled in one function.
2397 * src/combox.h: added Combox * to callback prototype.
2399 * src/frontends/xforms/Toolbar_pimpl.C:
2400 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2402 2000-09-14 Garst Reese <reese@isn.net>
2404 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2405 moved usepackage{xxx}'s to beginning of file. Changed left margin
2406 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2407 underlining from title. Thanks to John Culleton for useful suggestions.
2409 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2411 * src/lyxlex_pimpl.C (setFile): change error message to debug
2414 2000-09-13 Juergen Vigna <jug@sad.it>
2416 * src/frontends/xforms/FormDocument.C: implemented choice_class
2417 as combox and give callback to combo_language so OK/Apply is activated
2420 * src/bufferlist.C (newFile): small fix so already named files
2421 (via an open call) are not requested to be named again on the
2424 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2426 * src/frontends/kde/Makefile.am
2427 * src/frontends/kde/FormRef.C
2428 * src/frontends/kde/FormRef.h
2429 * src/frontends/kde/formrefdialog.C
2430 * src/frontends/kde/formrefdialog.h: implement
2433 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2435 * src/frontends/kde/formtocdialog.C
2436 * src/frontends/kde/formtocdialog.h
2437 * src/frontends/kde/FormToc.C
2438 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2440 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2442 * src/frontends/kde/FormCitation.C: fix thinko
2443 where we didn't always display the reference text
2446 * src/frontends/kde/formurldialog.C
2447 * src/frontends/kde/formurldialog.h
2448 * src/frontends/kde/FormUrl.C
2449 * src/frontends/kde/FormUrl.h: minor cleanups
2451 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2453 * src/frontends/kde/Makefile.am
2454 * src/frontends/kde/FormToc.C
2455 * src/frontends/kde/FormToc.h
2456 * src/frontends/kde/FormCitation.C
2457 * src/frontends/kde/FormCitation.h
2458 * src/frontends/kde/FormIndex.C
2459 * src/frontends/kde/FormIndex.h
2460 * src/frontends/kde/formtocdialog.C
2461 * src/frontends/kde/formtocdialog.h
2462 * src/frontends/kde/formcitationdialog.C
2463 * src/frontends/kde/formcitationdialog.h
2464 * src/frontends/kde/formindexdialog.C
2465 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2467 2000-09-12 Juergen Vigna <jug@sad.it>
2469 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2472 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2474 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2477 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2479 * src/converter.C (Add, Convert): Added support for converter flags:
2480 needaux, resultdir, resultfile.
2481 (Convert): Added new parameter view_file.
2482 (dvips_options): Fixed letter paper option.
2484 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2485 (Export, GetExportableFormats, GetViewableFormats): Added support
2488 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2490 (easyParse): Fixed to work with new export code.
2492 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2495 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2497 * lib/bind/*.bind: Replaced
2498 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2499 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2501 2000-09-11 Juergen Vigna <jug@sad.it>
2503 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2505 * src/main.C (main): now GUII defines global guiruntime!
2507 * src/frontends/gnome/GUIRunTime.C (initApplication):
2508 * src/frontends/kde/GUIRunTime.C (initApplication):
2509 * src/frontends/xforms/GUIRunTime.C (initApplication):
2510 * src/frontends/GUIRunTime.h: added new function initApplication.
2512 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2514 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2516 2000-09-08 Juergen Vigna <jug@sad.it>
2518 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2519 we have already "Reset".
2521 * src/language.C (initL): inserted "default" language and made this
2522 THE default language (and not american!)
2524 * src/paragraph.C: inserted handling of "default" language!
2526 * src/lyxfont.C: ditto
2530 * src/paragraph.C: output the \\par only if we have a following
2531 paragraph otherwise it's not needed.
2533 2000-09-05 Juergen Vigna <jug@sad.it>
2535 * config/pspell.m4: added entry to lyx-flags
2537 * src/spellchecker.C: modified version from Kevin for using pspell
2539 2000-09-01 Marko Vendelin <markov@ioc.ee>
2540 * src/frontends/gnome/Makefile.am
2541 * src/frontends/gnome/FormCitation.C
2542 * src/frontends/gnome/FormCitation.h
2543 * src/frontends/gnome/diainsertcitation_callbacks.c
2544 * src/frontends/gnome/diainsertcitation_callbacks.h
2545 * src/frontends/gnome/diainsertcitation_interface.c
2546 * src/frontends/gnome/diainsertcitation_interface.h
2547 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2548 dialog for Gnome frontend
2550 * src/main.C: Gnome libraries require keeping application name
2551 and its version as strings
2553 * src/frontends/gnome/mainapp.C: Change the name of the main window
2554 from GnomeLyX to PACKAGE
2556 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2558 * src/frontends/Liason.C: add "using: declaration.
2560 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2562 * src/mathed/math_macro.C (Metrics): Set the size of the template
2564 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2566 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2568 * src/converter.C (add_options): New function.
2569 (SetViewer): Change $$FName into '$$FName'.
2570 (View): Add options when running xdvi
2571 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2572 (Convert): The 3rd parameter is now the desired filename. Converts
2573 calls to lyx::rename if necessary.
2574 Add options when running dvips.
2575 (dvi_papersize,dvips_options): New methods.
2577 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2579 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2580 using a call to Converter::dvips_options.
2581 Fixed to work with nex export code.
2583 * src/support/copy.C
2584 * src/support/rename.C: New files
2586 * src/support/syscall.h
2587 * src/support/syscall.C: Added Starttype SystemDontWait.
2589 * lib/ui/default.ui: Changed to work with new export code
2591 * lib/configure.m4: Changed to work with new export code
2593 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2595 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2597 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2598 so that code compiles with DEC cxx.
2600 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2601 to work correctly! Also now supports the additional elements
2604 2000-09-01 Allan Rae <rae@lyx.org>
2606 * src/frontends/ButtonPolicies.C: renamed all the references to
2607 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2609 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2610 since it's a const not a type.
2612 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2614 2000-08-31 Juergen Vigna <jug@sad.it>
2616 * src/insets/figinset.C: Various changes to look if the filename has
2617 an extension and if not add it for inline previewing.
2619 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2621 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2622 make buttonStatus and isReadOnly be const methods. (also reflect
2623 this in derived classes.)
2625 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2626 (nextState): change to be static inline, pass the StateMachine as
2628 (PreferencesPolicy): remove casts
2629 (OkCancelPolicy): remvoe casts
2630 (OkCancelReadOnlyPolicy): remove casts
2631 (NoRepeatedApplyReadOnlyPolicy): remove casts
2632 (OkApplyCancelReadOnlyPolicy): remove casts
2633 (OkApplyCancelPolicy): remove casts
2634 (NoRepeatedApplyPolicy): remove casts
2636 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2638 * src/converter.C: added some using directives
2640 * src/frontends/ButtonPolicies.C: changes to overcome
2641 "need lvalue" error with DEC c++
2643 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2644 to WMHideCB for DEC c++
2646 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2648 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2649 to BulletBMTableCB for DEC c++
2651 2000-08-31 Allan Rae <rae@lyx.org>
2653 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2654 character dialog separately from old document dialogs combo_language.
2657 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2659 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2660 Removed LFUN_REF_CREATE.
2662 * src/MenuBackend.C: Added new tags: toc and references
2664 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2665 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2667 (add_toc, add_references): New methods.
2668 (create_submenu): Handle correctly the case when there is a
2669 seperator after optional menu items.
2671 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2672 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2673 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2675 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2677 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2679 * src/converter.[Ch]: New file for converting between different
2682 * src/export.[Ch]: New file for exporting a LyX file to different
2685 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2686 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2687 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2688 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2689 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2690 RunDocBook, MenuExport.
2692 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2693 Exporter::Preview methods if NEW_EXPORT is defined.
2695 * src/buffer.C (Dispatch): Use Exporter::Export.
2697 * src/lyxrc.C: Added new tags: \converter and \viewer.
2700 * src/LyXAction.C: Define new lyx-function: buffer-update.
2701 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2702 when NEW_EXPORT is defined.
2704 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2706 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2708 * lib/ui/default.ui: Added submenus "view" and "update" to the
2711 * src/filetools.C (GetExtension): New function.
2713 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2715 2000-08-29 Allan Rae <rae@lyx.org>
2717 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2719 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2720 (EnableDocumentLayout): removed
2721 (DisableDocumentLayout): removed
2722 (build): make use of ButtonController's read-only handling to
2723 de/activate various objects. Replaces both of the above functions.
2725 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2726 (readOnly): was read_only
2727 (refresh): fixed dumb mistakes with read_only_ handling
2729 * src/frontends/xforms/forms/form_document.fd:
2730 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2731 tabbed dialogs so the tabs look more like tabs and so its easier to
2732 work out which is the current tab.
2734 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2735 segfault with form_table
2737 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2739 2000-08-28 Juergen Vigna <jug@sad.it>
2741 * acconfig.h: added USE_PSPELL.
2743 * src/config.h.in: added USE_PSPELL.
2745 * autogen.sh: added pspell.m4
2747 * config/pspell.m4: new file.
2749 * src/spellchecker.C: implemented support for pspell libary.
2751 2000-08-25 Juergen Vigna <jug@sad.it>
2753 * src/LyXAction.C (init): renamed LFUN_TABLE to
2754 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2756 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2758 * src/lyxscreen.h: add force_clear variable and fuction to force
2759 a clear area when redrawing in LyXText.
2761 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2763 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2765 * some whitespace and comment changes.
2767 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2769 * src/buffer.C: up te LYX_FORMAT to 2.17
2771 2000-08-23 Juergen Vigna <jug@sad.it>
2773 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2776 * src/insets/insettabular.C (pasteSelection): delete the insets
2777 LyXText as it is not valid anymore.
2778 (copySelection): new function.
2779 (pasteSelection): new function.
2780 (cutSelection): new function.
2781 (LocalDispatch): implemented cut/copy/paste of cell selections.
2783 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2784 don't have a LyXText.
2786 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2788 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2791 2000-08-22 Juergen Vigna <jug@sad.it>
2793 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2794 ifdef form_table out if NEW_TABULAR.
2796 2000-08-21 Juergen Vigna <jug@sad.it>
2798 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2799 (draw): fixed draw position so that the cursor is positioned in the
2801 (InsetMotionNotify): hide/show cursor so the position is updated.
2802 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2803 using cellstart() function where it should be used.
2805 * src/insets/insettext.C (draw): ditto.
2807 * src/tabular.C: fixed initialization of some missing variables and
2808 made BoxType into an enum.
2810 2000-08-22 Marko Vendelin <markov@ioc.ee>
2811 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2812 stock menu item using action numerical value, not its string
2816 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2818 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2819 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2821 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2823 * src/frontends/xforms/GUIRunTime.C: new file
2825 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2826 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2828 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2830 * src/frontends/kde/GUIRunTime.C: new file
2832 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2833 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2835 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2837 * src/frontends/gnome/GUIRunTime.C: new file
2839 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2842 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2843 small change to documetentation.
2845 * src/frontends/GUIRunTime.C: removed file
2847 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2849 * src/lyxparagraph.h: enable NEW_TABULAR as default
2851 * src/lyxfunc.C (processKeySym): remove some commented code
2853 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2854 NEW_TABULAR around the fd_form_table_options.
2856 * src/lyx_gui.C (runTime): call the static member function as
2857 GUIRunTime::runTime().
2859 2000-08-21 Allan Rae <rae@lyx.org>
2861 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2864 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2866 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2868 2000-08-21 Allan Rae <rae@lyx.org>
2870 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2871 keep Garst happy ;-)
2872 * src/frontends/xforms/FormPreferences.C (build): use setOK
2873 * src/frontends/xforms/FormDocument.C (build): use setOK
2874 (FormDocument): use the appropriate policy.
2876 2000-08-21 Allan Rae <rae@lyx.org>
2878 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2879 automatic [de]activation of arbitrary objects when in a read-only state.
2881 * src/frontends/ButtonPolicies.h: More documentation
2882 (isReadOnly): added to support the above.
2884 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2886 2000-08-18 Juergen Vigna <jug@sad.it>
2888 * src/insets/insettabular.C (getStatus): changed to return func_status.
2890 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2891 display toggle menu entries if they are.
2893 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2894 new document layout now.
2896 * src/lyxfunc.C: ditto
2898 * src/lyx_gui_misc.C: ditto
2900 * src/lyx_gui.C: ditto
2902 * lib/ui/default.ui: removed paper and quotes layout as they are now
2903 all in the document layout tabbed folder.
2905 * src/frontends/xforms/forms/form_document.fd: added Restore
2906 button and callbacks for all inputs for Allan's ButtonPolicy.
2908 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2909 (CheckChoiceClass): added missing params setting on class change.
2910 (UpdateLayoutDocument): added for updating the layout on params.
2911 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2912 (FormDocument): Implemented Allan's ButtonPolicy with the
2915 2000-08-17 Allan Rae <rae@lyx.org>
2917 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2918 so we can at least see the credits again.
2920 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2921 controller calls for the appropriate callbacks. Note that since Ok
2922 calls apply followed by cancel, and apply isn't a valid input for the
2923 APPLIED state, the bc_ calls have to be made in the static callback not
2924 within each of the real callbacks.
2926 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2927 (setOk): renamed from setOkay()
2929 2000-08-17 Juergen Vigna <jug@sad.it>
2931 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2932 in the implementation part.
2933 (composeUIInfo): don't show optional menu-items.
2935 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2937 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2939 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2940 text-state when in a text-inset.
2942 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2944 2000-08-17 Marko Vendelin <markov@ioc.ee>
2945 * src/frontends/gnome/FormIndex.C
2946 * src/frontends/gnome/FormIndex.h
2947 * src/frontends/gnome/FormToc.C
2948 * src/frontends/gnome/FormToc.h
2949 * src/frontends/gnome/dialogs
2950 * src/frontends/gnome/diatoc_callbacks.c
2951 * src/frontends/gnome/diatoc_callbacks.h
2952 * src/frontends/gnome/diainsertindex_callbacks.h
2953 * src/frontends/gnome/diainsertindex_callbacks.c
2954 * src/frontends/gnome/diainsertindex_interface.c
2955 * src/frontends/gnome/diainsertindex_interface.h
2956 * src/frontends/gnome/diatoc_interface.h
2957 * src/frontends/gnome/diatoc_interface.c
2958 * src/frontends/gnome/Makefile.am: Table of Contents and
2959 Insert Index dialogs implementation for Gnome frontend
2961 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2963 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2965 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2968 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2970 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2971 destructor. Don't definde if you don't need it
2972 (processEvents): made static, non-blocking events processing for
2974 (runTime): static method. event loop for xforms
2975 * similar as above for kde and gnome.
2977 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2978 new Pimpl is correct
2979 (runTime): new method calss the real frontends runtime func.
2981 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2983 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2985 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2987 2000-08-16 Juergen Vigna <jug@sad.it>
2989 * src/lyx_gui.C (runTime): added GUII RunTime support.
2991 * src/frontends/Makefile.am:
2992 * src/frontends/GUIRunTime.[Ch]:
2993 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2994 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2995 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2997 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2999 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3000 as this is already set in ${FRONTEND_INCLUDE} if needed.
3002 * configure.in (CPPFLAGS): setting the include dir for the frontend
3003 directory and don't set FRONTEND=xforms for now as this is executed
3006 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3008 * src/frontends/kde/Makefile.am:
3009 * src/frontends/kde/FormUrl.C:
3010 * src/frontends/kde/FormUrl.h:
3011 * src/frontends/kde/formurldialog.h:
3012 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3014 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3016 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3018 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3020 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3023 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3025 * src/WorkArea.C (work_area_handler): more work to get te
3026 FL_KEYBOARD to work with xforms 0.88 too, please test.
3028 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3030 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3032 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3035 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3037 * src/Timeout.h: remove Qt::emit hack.
3039 * several files: changes to allo doc++ compilation
3041 * src/lyxfunc.C (processKeySym): new method
3042 (processKeyEvent): comment out if FL_REVISION < 89
3044 * src/WorkArea.C: change some debugging levels.
3045 (WorkArea): set wantkey to FL_KEY_ALL
3046 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3047 clearer code and the use of compose with XForms 0.89. Change to
3048 use signals instead of calling methods in bufferview directly.
3050 * src/Painter.C: change some debugging levels.
3052 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3055 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3056 (workAreaKeyPress): new method
3058 2000-08-14 Juergen Vigna <jug@sad.it>
3060 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3062 * config/kde.m4: addes some features
3064 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3065 include missing xforms dialogs.
3067 * src/Timeout.h: a hack to be able to compile with qt/kde.
3069 * sigc++/.cvsignore: added acinclude.m4
3071 * lib/.cvsignore: added listerros
3073 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3074 xforms tree as objects are needed for other frontends.
3076 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3077 linking with not yet implemented xforms objects.
3079 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3081 2000-08-14 Baruch Even <baruch.even@writeme.com>
3083 * src/frontends/xforms/FormGraphics.h:
3084 * src/frontends/xforms/FormGraphics.C:
3085 * src/frontends/xforms/RadioButtonGroup.h:
3086 * src/frontends/xforms/RadioButtonGroup.C:
3087 * src/insets/insetgraphics.h:
3088 * src/insets/insetgraphics.C:
3089 * src/insets/insetgraphicsParams.h:
3090 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3091 instead of spaces, and various other indentation issues to make the
3092 sources more consistent.
3094 2000-08-14 Marko Vendelin <markov@ioc.ee>
3096 * src/frontends/gnome/dialogs/diaprint.glade
3097 * src/frontends/gnome/FormPrint.C
3098 * src/frontends/gnome/FormPrint.h
3099 * src/frontends/gnome/diaprint_callbacks.c
3100 * src/frontends/gnome/diaprint_callbacks.h
3101 * src/frontends/gnome/diaprint_interface.c
3102 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3105 * src/frontends/gnome/dialogs/diainserturl.glade
3106 * src/frontends/gnome/FormUrl.C
3107 * src/frontends/gnome/FormUrl.h
3108 * src/frontends/gnome/diainserturl_callbacks.c
3109 * src/frontends/gnome/diainserturl_callbacks.h
3110 * src/frontends/gnome/diainserturl_interface.c
3111 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3112 Gnome implementation
3114 * src/frontends/gnome/Dialogs.C
3115 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3116 all other dialogs. Copy all unimplemented dialogs from Xforms
3119 * src/frontends/gnome/support.c
3120 * src/frontends/gnome/support.h: support files generated by Glade
3124 * config/gnome.m4: Gnome configuration scripts
3126 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3127 configure --help message
3129 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3130 only if there are no events pendling in Gnome/Gtk. This enhances
3131 the performance of menus.
3134 2000-08-14 Allan Rae <rae@lyx.org>
3136 * lib/Makefile.am: listerrors cleaning
3138 * lib/listerrors: removed -- generated file
3139 * acinclude.m4: ditto
3140 * sigc++/acinclude.m4: ditto
3142 * src/frontends/xforms/forms/form_citation.fd:
3143 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3146 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3147 `updatesrc` and now we have a `test` target that does what `updatesrc`
3148 used to do. I didn't like having an install target that wasn't related
3151 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3152 on all except FormGraphics. This may yet happen. Followed by a major
3153 cleanup including using FL_TRANSIENT for most of the dialogs. More
3154 changes to come when the ButtonController below is introduced.
3156 * src/frontends/xforms/ButtonController.h: New file for managing up to
3157 four buttons on a dialog according to an externally defined policy.
3158 * src/frontends/xforms/Makefile.am: added above
3160 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3161 Apply and Cancel/Close buttons and everything in between and beyond.
3162 * src/frontends/Makefile.am: added above.
3164 * src/frontends/xforms/forms/form_preferences.fd:
3165 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3166 and removed variable 'status' as a result. Fixed the set_minsize thing.
3167 Use the new screen-font-update after checking screen fonts were changed
3168 Added a "Restore" button to restore the original lyxrc values while
3169 editing. This restores everything not just the last input changed.
3170 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3172 * src/LyXAction.C: screen-font-update added for updating buffers after
3173 screen font settings have been changed.
3174 * src/commandtags.h: ditto
3175 * src/lyxfunc.C: ditto
3177 * forms/lyx.fd: removed screen fonts dialog.
3178 * src/lyx_gui.C: ditto
3179 * src/menus.[Ch]: ditto
3180 * src/lyx.[Ch]: ditto
3181 * src/lyx_cb.C: ditto + code from here moved to make
3182 screen-font-update. And people wonder why progress on GUII is
3183 slow. Look at how scattered this stuff was! It takes forever
3186 * forms/fdfix.sh: Fixup the spacing after commas.
3187 * forms/makefile: Remove date from generated files. Fewer clashes now.
3188 * forms/bullet_forms.C.patch: included someones handwritten changes
3190 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3191 once I've discovered why LyXRC was made noncopyable.
3192 * src/lyx_main.C: ditto
3194 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3196 * src/frontends/xforms/forms/fdfix.sh:
3197 * src/frontends/xforms/forms/fdfixh.sed:
3198 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3199 * src/frontends/xforms/Form*.[hC]:
3200 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3201 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3202 provide a destructor for the struct FD_form_xxxx. Another version of
3203 the set_[max|min]size workaround and a few other cleanups. Actually,
3204 Angus' patch from 20000809.
3206 2000-08-13 Baruch Even <baruch.even@writeme.com>
3208 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3211 2000-08-11 Juergen Vigna <jug@sad.it>
3213 * src/insets/insetgraphics.C (InsetGraphics): changing init
3214 order because of warnings.
3216 * src/frontends/xforms/forms/makefile: adding patching .C with
3219 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3220 from .C.patch to .c.patch
3222 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3223 order because of warning.
3225 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3227 * src/frontends/Liason.C (setMinibuffer): new helper function
3229 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3231 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3233 * lib/ui/default.ui: commented out PaperLayout entry
3235 * src/frontends/xforms/form_document.[Ch]: new added files
3237 * src/frontends/xforms/FormDocument.[Ch]: ditto
3239 * src/frontends/xforms/forms/form_document.fd: ditto
3241 * src/frontends/xforms/forms/form_document.C.patch: ditto
3243 2000-08-10 Juergen Vigna <jug@sad.it>
3245 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3246 (InsetGraphics): initialized cacheHandle to 0.
3247 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3249 2000-08-10 Baruch Even <baruch.even@writeme.com>
3251 * src/graphics/GraphicsCache.h:
3252 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3253 correctly as a cache.
3255 * src/graphics/GraphicsCacheItem.h:
3256 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3259 * src/graphics/GraphicsCacheItem_pimpl.h:
3260 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3263 * src/insets/insetgraphics.h:
3264 * src/insets/insetgraphics.C: Changed from using a signal notification
3265 to polling when image is not loaded.
3267 2000-08-10 Allan Rae <rae@lyx.org>
3269 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3270 that there are two functions that have to been taken out of line by
3271 hand and aren't taken care of in the script. (Just a reminder note)
3273 * sigc++/macros/*.h.m4: Updated as above.
3275 2000-08-09 Juergen Vigna <jug@sad.it>
3277 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3279 * src/insets/insettabular.C: make drawing of single cell smarter.
3281 2000-08-09 Marko Vendelin <markov@ioc.ee>
3282 * src/frontends/gnome/Menubar_pimpl.C
3283 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3284 implementation: new files
3286 * src/frontends/gnome/mainapp.C
3287 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3290 * src/main.C: create Gnome main window
3292 * src/frontends/xforms/Menubar_pimpl.h
3293 * src/frontends/Menubar.C
3294 * src/frontends/Menubar.h: added method Menubar::update that calls
3295 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3297 * src/LyXView.C: calls Menubar::update to update the state
3300 * src/frontends/gnome/Makefile.am: added new files
3302 * src/frontends/Makefile.am: added frontend compiler options
3304 2000-08-08 Juergen Vigna <jug@sad.it>
3306 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3308 * src/bufferlist.C (close):
3309 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3310 documents if exiting without saving.
3312 * src/buffer.C (save): use removeAutosaveFile()
3314 * src/support/filetools.C (removeAutosaveFile): new function.
3316 * src/lyx_cb.C (MenuWrite): returns a bool now.
3317 (MenuWriteAs): check if file could really be saved and revert to the
3319 (MenuWriteAs): removing old autosavefile if existant.
3321 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3322 before Goto toggle declaration, because of compiler warning.
3324 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3326 * src/lyxfunc.C (MenuNew): small fix.
3328 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3330 * src/bufferlist.C (newFile):
3331 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3333 * src/lyxrc.C: added new_ask_filename tag
3335 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3337 * src/lyx.fd: removed code pertaining to form_ref
3338 * src/lyx.[Ch]: ditto
3339 * src/lyx_cb.C: ditto
3340 * src/lyx_gui.C: ditto
3341 * src/lyx_gui_misc.C: ditto
3343 * src/BufferView_pimpl.C (restorePosition): update buffer only
3346 * src/commandtags.h (LFUN_REFTOGGLE): removed
3347 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3348 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3349 (LFUN_REFBACK): renamed LFUN_REF_BACK
3351 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3352 * src/menus.C: ditto
3353 * src/lyxfunc.C (Dispatch): ditto.
3354 InsertRef dialog is now GUI-independent.
3356 * src/texrow.C: added using std::endl;
3358 * src/insets/insetref.[Ch]: strip out large amounts of code.
3359 The inset is now a container and this functionality is now
3360 managed by a new FormRef dialog
3362 * src/frontends/Dialogs.h (showRef, createRef): new signals
3364 * src/frontends/xforms/FormIndex.[Ch],
3365 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3366 when setting dialog's min/max size
3367 * src/frontends/xforms/FormIndex.[Ch]: ditto
3369 * src/frontends/xforms/FormRef.[Ch],
3370 src/frontends/xforms/forms/form_ref.fd: new xforms
3371 implementation of an InsetRef dialog
3373 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3376 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3377 ios::nocreate is not part of the standard. Removed.
3379 2000-08-07 Baruch Even <baruch.even@writeme.com>
3381 * src/graphics/Renderer.h:
3382 * src/graphics/Renderer.C: Added base class for rendering of different
3383 image formats into Pixmaps.
3385 * src/graphics/XPM_Renderer.h:
3386 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3387 in a different class.
3389 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3390 easily add support for other formats.
3392 * src/insets/figinset.C: plugged a leak of an X resource.
3394 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3396 * src/CutAndPaste.[Ch]: make all metods static.
3398 * development/Code_rules/Rules: more work, added section on
3399 Exceptions, and a References section.
3401 * a lot of header files: work to make doc++ able to generate the
3402 source documentation, some workarounds of doc++ problems. Doc++ is
3403 now able to generate the documentation.
3405 2000-08-07 Juergen Vigna <jug@sad.it>
3407 * src/insets/insettabular.C (recomputeTextInsets): removed function
3409 * src/tabular.C (SetWidthOfMulticolCell):
3411 (calculate_width_of_column_NMC): fixed return value so that it really
3412 only returns true if the column-width has changed (there where
3413 problems with muliticolumn-cells in this column).
3415 2000-08-04 Juergen Vigna <jug@sad.it>
3417 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3418 also on the scrollstatus of the inset.
3419 (workAreaMotionNotify): ditto.
3421 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3423 2000-08-01 Juergen Vigna <jug@sad.it>
3425 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3427 * src/commandtags.h:
3428 * src/LyXAction.C (init):
3429 * src/insets/inset.C (LocalDispatch): added support for
3432 * src/insets/inset.C (scroll): new functions.
3434 * src/insets/insettext.C (removeNewlines): new function.
3435 (SetAutoBreakRows): removes forced newlines in the text of the
3436 paragraph if autoBreakRows is set to false.
3438 * src/tabular.C (Latex): generates a parbox around the cell contents
3441 * src/frontends/xforms/FormTabular.C (local_update): removed
3442 the radio_useparbox button.
3444 * src/tabular.C (UseParbox): new function
3446 2000-08-06 Baruch Even <baruch.even@writeme.com>
3448 * src/graphics/GraphicsCache.h:
3449 * src/graphics/GraphicsCache.C:
3450 * src/graphics/GraphicsCacheItem.h:
3451 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3454 * src/insets/insetgraphics.h:
3455 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3456 and the drawing of the inline image.
3458 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3459 loaded into the wrong position.
3461 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3464 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3466 * src/support/translator.h: move all typedefs to public section
3468 * src/support/filetools.C (MakeLatexName): return string const
3470 (TmpFileName): ditto
3471 (FileOpenSearch): ditto
3473 (LibFileSearch): ditto
3474 (i18nLibFileSearch): ditto
3477 (CreateTmpDir): ditto
3478 (CreateBufferTmpDir): ditto
3479 (CreateLyXTmpDir): ditto
3482 (MakeAbsPath): ditto
3484 (OnlyFilename): ditto
3486 (NormalizePath): ditto
3487 (CleanupPath): ditto
3488 (GetFileContents): ditto
3489 (ReplaceEnvironmentPath): ditto
3490 (MakeRelPath): ditto
3492 (ChangeExtension): ditto
3493 (MakeDisplayPath): ditto
3494 (do_popen): return cmdret const
3495 (findtexfile): return string const
3497 * src/support/DebugStream.h: add some /// to please doc++
3499 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3501 * src/texrow.C (same_rownumber): functor to use with find_if
3502 (getIdFromRow): rewritten to use find_if and to not update the
3503 positions. return true if row is found
3504 (increasePos): new method, use to update positions
3506 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3508 * src/lyxlex_pimpl.C (verifyTable): new method
3511 (GetString): return string const
3512 (pushTable): rewrite to use std::stack
3514 (setFile): better check
3517 * src/lyxlex.h: make LyXLex noncopyable
3519 * src/lyxlex.C (text): return char const * const
3520 (GetString): return string const
3521 (getLongString): return string const
3523 * src/lyx_gui_misc.C (askForText): return pair<...> const
3525 * src/lastfiles.[Ch] (operator): return string const
3527 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3528 istringstream not char const *.
3529 move token.end() out of loop.
3530 (readFile): move initializaton of token
3532 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3533 getIdFromRow is successful.
3535 * lib/bind/emacs.bind: don't include menus bind
3537 * development/Code_rules/Rules: the beginnings of making this
3538 better and covering more of the unwritten rules that we have.
3540 * development/Code_rules/Recommendations: a couple of wording
3543 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3545 * src/support/strerror.c: remove C++ comment.
3547 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3549 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3550 LFUN_INDEX_INSERT_LAST
3552 * src/texrow.C (getIdFromRow): changed from const_iterator to
3553 iterator, allowing code to compile with DEC cxx
3555 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3556 stores part of the class, as suggested by Allan. Will allow
3558 (apply): test to apply uses InsetCommandParams operator!=
3560 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3561 (apply): test to apply uses InsetCommandParams operator!=
3563 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3564 stores part of the class.
3565 (update): removed limits on min/max size.
3567 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3568 (apply): test to apply uses InsetCommandParams operator!=
3570 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3571 (Read, Write, scanCommand, getCommand): moved functionality
3572 into InsetCommandParams.
3574 (getScreenLabel): made pure virtual
3575 new InsetCommandParams operators== and !=
3577 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3578 c-tors based on InsetCommandParams. Removed others.
3579 * src/insets/insetinclude.[Ch]: ditto
3580 * src/insets/insetlabel.[Ch]: ditto
3581 * src/insets/insetparent.[Ch]: ditto
3582 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3584 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3585 insets derived from InsetCommand created using similar c-tors
3586 based on InsetCommandParams
3587 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3588 * src/menus.C (ShowRefsMenu): ditto
3589 * src/paragraph.C (Clone): ditto
3590 * src/text2.C (SetCounter): ditto
3591 * src/lyxfunc.C (Dispatch) ditto
3592 Also recreated old InsetIndex behaviour exactly. Can now
3593 index-insert at the start of a paragraph and index-insert-last
3594 without launching the pop-up.
3596 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3598 * lib/lyxrc.example: mark te pdf options as non functional.
3600 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3601 (isStrDbl): move tmpstr.end() out of loop.
3602 (strToDbl): move intialization of tmpstr
3603 (lowercase): return string const and move tmp.end() out of loop.
3604 (uppercase): return string const and move tmp.edn() out of loop.
3605 (prefixIs): add assertion
3610 (containsOnly): ditto
3611 (containsOnly): ditto
3612 (containsOnly): ditto
3613 (countChar): make last arg char not char const
3614 (token): return string const
3615 (subst): return string const, move tmp.end() out of loop.
3616 (subst): return string const, add assertion
3617 (strip): return string const
3618 (frontStrip): return string const, add assertion
3619 (frontStrip): return string const
3624 * src/support/lstrings.C: add inclde "LAssert.h"
3625 (isStrInt): move tmpstr.end() out of loop.
3627 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3628 toollist.end() out of loop.
3629 (deactivate): move toollist.end() out of loop.
3630 (update): move toollist.end() out of loop.
3631 (updateLayoutList): move tc.end() out of loop.
3632 (add): move toollist.end() out of loop.
3634 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3635 md.end() out of loop.
3637 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3639 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3642 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3643 (Erase): move insetlist.end() out of loop.
3645 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3646 ref to const string as first arg. Move initialization of some
3647 variables, whitespace changes.
3649 * src/kbmap.C (defkey): move table.end() out of loop.
3650 (kb_keymap): move table.end() out of loop.
3651 (findbinding): move table.end() out of loop.
3653 * src/MenuBackend.C (hasMenu): move end() out of loop.
3654 (getMenu): move end() out of loop.
3655 (getMenu): move menulist_.end() out of loop.
3657 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3659 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3662 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3663 (getFromLyXName): move infotab.end() out of loop.
3665 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3666 -fvtable-thunks -ffunction-sections -fdata-sections
3668 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3670 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3673 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3675 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3677 * src/frontends/xforms/FormCitation.[Ch],
3678 src/frontends/xforms/FormIndex.[Ch],
3679 src/frontends/xforms/FormToc.[Ch],
3680 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3682 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3684 * src/commandtags.h: renamed, created some flags for citation
3687 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3689 * src/lyxfunc.C (dispatch): use signals to insert index entry
3691 * src/frontends/Dialogs.h: new signal createIndex
3693 * src/frontends/xforms/FormCommand.[Ch],
3694 src/frontends/xforms/FormCitation.[Ch],
3695 src/frontends/xforms/FormToc.[Ch],
3696 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3698 * src/insets/insetindex.[Ch]: GUI-independent
3700 * src/frontends/xforms/FormIndex.[Ch],
3701 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3704 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3706 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3707 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3709 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3711 * src/insets/insetref.C (Latex): rewrite so that there is now
3712 question that a initialization is requested.
3714 * src/insets/insetcommand.h: reenable the hide signal
3716 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3718 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3719 fix handling of shortcuts (many bugs :)
3720 (add_lastfiles): ditto.
3722 * lib/ui/default.ui: fix a few shortcuts.
3724 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3726 * Makefile.am: Fix ``rpmdist'' target to return the exit
3727 status of the ``rpm'' command, instead of the last command in
3728 the chain (the ``rm lyx.xpm'' command, which always returns
3731 2000-08-02 Allan Rae <rae@lyx.org>
3733 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3734 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3735 * src/frontends/xforms/FormToc.C (FormToc): ditto
3737 * src/frontends/xforms/Makefile.am: A few forgotten files
3739 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3740 Signals-not-copyable-problem Lars' started commenting out.
3742 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3744 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3746 * src/insets/insetcommand.h: Signals is not copyable so anoter
3747 scheme for automatic hiding of forms must be used.
3749 * src/frontends/xforms/FormCitation.h: don't inerit from
3750 noncopyable, FormCommand already does that.
3751 * src/frontends/xforms/FormToc.h: ditto
3752 * src/frontends/xforms/FormUrl.h: ditto
3754 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3756 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3758 * src/insets/insetcommand.h (hide): new SigC::Signal0
3759 (d-tor) new virtual destructor emits hide signal
3761 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3762 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3764 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3765 LOF and LOT. Inset is now GUI-independent
3767 * src/insets/insetloa.[Ch]: redundant
3768 * src/insets/insetlof.[Ch]: ditto
3769 * src/insets/insetlot.[Ch]: ditto
3771 * src/frontends/xforms/forms/form_url.fd: tweaked!
3772 * src/frontends/xforms/forms/form_citation.fd: ditto
3774 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3775 dialogs dealing with InsetCommand insets
3777 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3778 FormCommand base class
3779 * src/frontends/xforms/FormUrl.[Ch]: ditto
3781 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3783 * src/frontends/xforms/FormToc.[Ch]: ditto
3785 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3786 passed a generic InsetCommand pointer
3787 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3789 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3790 and modified InsetTOC class
3791 * src/buffer.C: ditto
3793 * forms/lyx.fd: strip out old FD_form_toc code
3794 * src/lyx_gui_misc.C: ditto
3795 * src/lyx_gui.C: ditto
3796 * src/lyx_cb.C: ditto
3797 * src/lyx.[Ch]: ditto
3799 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3801 * src/support/utility.hpp: tr -d '\r'
3803 2000-08-01 Juergen Vigna <jug@sad.it>
3805 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3807 * src/commandtags.h:
3808 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3809 LFUN_TABULAR_FEATURES.
3811 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3812 LFUN_LAYOUT_TABULAR.
3814 * src/insets/insettabular.C (getStatus): implemented helper function.
3816 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3818 2000-07-31 Juergen Vigna <jug@sad.it>
3820 * src/text.C (draw): fixed screen update problem for text-insets.
3822 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3823 something changed probably this has to be added in various other
3826 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3828 2000-07-31 Baruch Even <baruch.even@writeme.com>
3830 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3831 templates to satisfy compaq cxx.
3834 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3836 * src/support/translator.h (equal_1st_in_pair::operator()): take
3837 const ref pair_type as arg.
3838 (equal_2nd_in_pair::operator()): ditto
3839 (Translator::~Translator): remove empty d-tor.
3841 * src/graphics/GraphicsCache.C: move include config.h to top, also
3842 put initialization of GraphicsCache::singleton here.
3843 (~GraphicsCache): move here
3844 (addFile): take const ref as arg
3847 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3849 * src/BufferView2.C (insertLyXFile): change te with/without header
3852 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3854 * src/frontends/xforms/FormGraphics.C (apply): add some
3855 static_cast. Not very nice, but required by compaq cxx.
3857 * src/frontends/xforms/RadioButtonGroup.h: include header
3858 <utility> instead of <pair.h>
3860 * src/insets/insetgraphicsParams.C: add using directive.
3861 (readResize): change return type to void.
3862 (readOrigin): ditto.
3864 * src/lyxfunc.C (getStatus): add missing break for build-program
3865 function; add test for Literate for export functions.
3867 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3868 entries in Options menu.
3870 2000-07-31 Baruch Even <baruch.even@writeme.com>
3872 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3873 protect against auto-allocation; release icon when needed.
3875 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3877 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3878 on usual typewriter.
3880 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3881 earlier czech.kmap), useful only for programming.
3883 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3885 * src/frontends/xforms/FormCitation.h: fix conditioning around
3888 2000-07-31 Juergen Vigna <jug@sad.it>
3890 * src/frontends/xforms/FormTabular.C (local_update): changed
3891 radio_linebreaks to radio_useparbox and added radio_useminipage.
3893 * src/tabular.C: made support for using minipages/parboxes.
3895 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3897 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3899 (descent): so the cursor is in the middle.
3900 (width): bit smaller box.
3902 * src/insets/insetgraphics.h: added display() function.
3904 2000-07-31 Baruch Even <baruch.even@writeme.com>
3906 * src/frontends/Dialogs.h: Added showGraphics signals.
3908 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3909 xforms form definition of the graphics dialog.
3911 * src/frontends/xforms/FormGraphics.h:
3912 * src/frontends/xforms/FormGraphics.C: Added files, the
3913 GUIndependent code of InsetGraphics
3915 * src/insets/insetgraphics.h:
3916 * src/insets/insetgraphics.C: Major writing to make it work.
3918 * src/insets/insetgraphicsParams.h:
3919 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3920 struct between InsetGraphics and GUI.
3922 * src/LaTeXFeatures.h:
3923 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3924 support for graphicx package.
3926 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3927 for the graphics inset.
3929 * src/support/translator.h: Added file, used in
3930 InsetGraphicsParams. this is a template to translate between two
3933 * src/frontends/xforms/RadioButtonGroup.h:
3934 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3935 way to easily control a radio button group.
3937 2000-07-28 Juergen Vigna <jug@sad.it>
3939 * src/insets/insettabular.C (LocalDispatch):
3940 (TabularFeatures): added support for lyx-functions of tabular features.
3941 (cellstart): refixed this function after someone wrongly changed it.
3943 * src/commandtags.h:
3944 * src/LyXAction.C (init): added support for tabular-features
3946 2000-07-28 Allan Rae <rae@lyx.org>
3948 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3949 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3950 triggers the callback for input checking. As a result we sometimes get
3951 "LyX: This shouldn't happen..." printed to cerr.
3952 (input): Started using status variable since I only free() on
3953 destruction. Some input checking for paths and font sizes.
3955 * src/frontends/xforms/FormPreferences.h: Use status to control
3956 activation of Ok and Apply
3958 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3959 callback. Also resized to stop segfaults with 0.88. The problem is
3960 that xforms-0.88 requires the folder to be wide enough to fit all the
3961 tabs. If it isn't it causes all sorts of problems.
3963 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3965 * src/frontends/xforms/forms/README: Reflect reality.
3967 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3968 * src/frontends/xforms/forms/makefile: ditto.
3970 * src/commandtags.h: Get access to new Preferences dialog
3971 * src/LyXAction.C: ditto
3972 * src/lyxfunc.C: ditto
3973 * lib/ui/default.ui: ditto
3975 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3977 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3979 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3982 * src/frontends/xforms/form_url.[Ch]: added.
3984 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3986 * src/insets/insetbib.h: fixed bug in previous commit
3988 * src/frontends/xforms/FormUrl.h: ditto
3990 * src/frontends/xforms/FormPrint.h: ditto
3992 * src/frontends/xforms/FormPreferences.h: ditto
3994 * src/frontends/xforms/FormCopyright.h: ditto
3996 * src/frontends/xforms/FormCitation.C: ditto
3998 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3999 private copyconstructor and private default contructor
4001 * src/support/Makefile.am: add utility.hpp
4003 * src/support/utility.hpp: new file from boost
4005 * src/insets/insetbib.h: set owner in clone
4007 * src/frontends/xforms/FormCitation.C: added missing include
4010 * src/insets/form_url.[Ch]: removed
4012 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4014 * development/lyx.spec.in
4015 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4016 file/directory re-organization.
4018 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4020 * src/insets/insetcommand.[Ch]: moved the string data and
4021 associated manipulation methods into a new stand-alone class
4022 InsetCommandParams. This class has two additional methods
4023 getAsString() and setFromString() allowing the contents to be
4024 moved around as a single string.
4025 (addContents) method removed.
4026 (setContents) method no longer virtual.
4028 * src/buffer.C (readInset): made use of new InsetCitation,
4029 InsetUrl constructors based on InsetCommandParams.
4031 * src/commandtags.h: add LFUN_INSERT_URL
4033 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4034 independent InsetUrl and use InsetCommandParams to extract
4035 string info and create new Insets.
4037 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4039 * src/frontends/xforms/FormCitation.C (apply): uses
4042 * src/frontends/xforms/form_url.C
4043 * src/frontends/xforms/form_url.h
4044 * src/frontends/xforms/FormUrl.h
4045 * src/frontends/xforms/FormUrl.C
4046 * src/frontends/xforms/forms/form_url.fd: new files
4048 * src/insets/insetcite.[Ch]: removed unused constructors.
4050 * src/insets/insetinclude.[Ch]: no longer store filename
4052 * src/insets/inseturl.[Ch]: GUI-independent.
4054 2000-07-26 Juergen Vigna <jug@sad.it>
4055 * renamed frontend from gtk to gnome as it is that what is realized
4056 and did the necessary changes in the files.
4058 2000-07-26 Marko Vendelin <markov@ioc.ee>
4060 * configure.in: cleaning up gnome configuration scripts
4062 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4064 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4065 shortcuts syndrom by redrawing them explicitely (a better solution
4066 would be appreciated).
4068 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4070 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4073 * src/lyx_cb.C (MenuExport): change html export to do the right
4074 thing depending of the document type (instead of having
4075 html-linuxdoc and html-docbook).
4076 * src/lyxfunc.C (getStatus): update for html
4077 * lib/ui/default.ui: simplify due to the above change.
4078 * src/menus.C (ShowFileMenu): update too (in case we need it).
4080 * src/MenuBackend.C (read): if a menu is defined twice, add the
4081 new entries to the exiting one.
4083 2000-07-26 Juergen Vigna <jug@sad.it>
4085 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4087 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4088 and return a bool if it did actual save the file.
4089 (AutoSave): don't autosave a unnamed doc.
4091 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4092 check if this is an UNNAMED new file and react to it.
4093 (newFile): set buffer to unnamed and change to not mark a new
4094 buffer dirty if I didn't do anything with it.
4096 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4098 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4100 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4101 friend as per Angus's patch posted to lyx-devel.
4103 * src/ext_l10n.h: updated
4105 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4106 gettext on the style string right before inserting them into the
4109 * autogen.sh: add code to extract style strings form layout files,
4110 not good enough yet.
4112 * src/frontends/gtk/.cvsignore: add MAKEFILE
4114 * src/MenuBackend.C (read): run the label strings through gettext
4115 before storing them in the containers.
4117 * src/ext_l10n.h: new file
4119 * autogen.sh : generate the ext_l10n.h file here
4121 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4123 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4126 * lib/ui/default.ui: fix a couple of typos.
4128 * config/gnome/gtk.m4: added (and added to the list of files in
4131 * src/insets/insetinclude.C (unique_id): fix when we are using
4132 lyxstring instead of basic_string<>.
4133 * src/insets/insettext.C (LocalDispatch): ditto.
4134 * src/support/filetools.C: ditto.
4136 * lib/configure.m4: create the ui/ directory if necessary.
4138 * src/LyXView.[Ch] (updateToolbar): new method.
4140 * src/BufferView_pimpl.C (buffer): update the toolbar when
4141 opening/closing buffer.
4143 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4145 * src/LyXAction.C (getActionName): enhance to return also the name
4146 and options of pseudo-actions.
4147 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4149 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4150 as an example of what is possible). Used in File->Build too (more
4151 useful) and in the import/export menus (to mimick the complicated
4152 handling of linuxdoc and friends). Try to update all the entries.
4154 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4157 * src/MenuBackend.C (read): Parse the new OptItem tag.
4159 * src/MenuBackend.h: Add a new optional_ data member (used if the
4160 entry should be omitted when the lyxfunc is disabled).
4162 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4163 function, used as a shortcut.
4164 (create_submenu): align correctly the shortcuts on the widest
4167 * src/MenuBackend.h: MenuItem.label() only returns the label of
4168 the menu without shortcut; new method shortcut().
4170 2000-07-14 Marko Vendelin <markov@ioc.ee>
4172 * src/frontends/gtk/Dialogs.C:
4173 * src/frontends/gtk/FormCopyright.C:
4174 * src/frontends/gtk/FormCopyright.h:
4175 * src/frontends/gtk/Makefile.am: added these source-files for the
4176 Gtk/Gnome support of the Copyright-Dialog.
4178 * src/main.C: added Gnome::Main initialization if using
4179 Gtk/Gnome frontend-GUI.
4181 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4183 * config/gnome/aclocal-include.m4
4184 * config/gnome/compiler-flags.m4
4185 * config/gnome/curses.m4
4186 * config/gnome/gnome--.m4
4187 * config/gnome/gnome-bonobo-check.m4
4188 * config/gnome/gnome-common.m4
4189 * config/gnome/gnome-fileutils.m4
4190 * config/gnome/gnome-ghttp-check.m4
4191 * config/gnome/gnome-gnorba-check.m4
4192 * config/gnome/gnome-guile-checks.m4
4193 * config/gnome/gnome-libgtop-check.m4
4194 * config/gnome/gnome-objc-checks.m4
4195 * config/gnome/gnome-orbit-check.m4
4196 * config/gnome/gnome-print-check.m4
4197 * config/gnome/gnome-pthread-check.m4
4198 * config/gnome/gnome-support.m4
4199 * config/gnome/gnome-undelfs.m4
4200 * config/gnome/gnome-vfs.m4
4201 * config/gnome/gnome-x-checks.m4
4202 * config/gnome/gnome-xml-check.m4
4203 * config/gnome/gnome.m4
4204 * config/gnome/gperf-check.m4
4205 * config/gnome/gtk--.m4
4206 * config/gnome/linger.m4
4207 * config/gnome/need-declaration.m4: added configuration scripts
4208 for Gtk/Gnome frontend-GUI
4210 * configure.in: added support for the --with-frontend=gtk option
4212 * autogen.sh: added config/gnome/* to list of config-files
4214 * acconfig.h: added define for GTKGUI-support
4216 * config/lyxinclude.m4: added --with-frontend[=value] option value
4217 for Gtk/Gnome frontend-GUI support.
4219 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4221 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4225 * src/paragraph.C (GetChar): remove non-const version
4227 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4228 (search_kw): use it.
4230 * src/lyx_main.C (init): if "preferences" exist, read that instead
4232 (ReadRcFile): return bool if the file could be read ok.
4233 (ReadUIFile): add a check to see if lex file is set ok.
4235 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4236 bastring can be used instead of lyxstring (still uses the old code
4237 if std::string is good enough or if lyxstring is used.)
4239 * src/encoding.C: make the arrays static, move ininle functions
4241 * src/encoding.h: from here.
4243 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4244 (parseSingleLyXformat2Token): move inset parsing to separate method
4245 (readInset): new private method
4247 * src/Variables.h: remove virtual from get().
4249 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4250 access to NEW_INSETS and NEW_TABULAR
4252 * src/MenuBackend.h: remove superfluous forward declaration of
4253 MenuItem. Add documentations tags "///", remove empty MenuItem
4254 destructor, remove private default contructor.
4256 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4258 (read): more string mlabel and mname to where they are used
4259 (read): remove unused variables mlabel and mname
4260 (defaults): unconditional clear, make menusetup take advantage of
4261 add returning Menu &.
4263 * src/LyXView.h: define NEW_MENUBAR as default
4265 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4266 to NEW_INSETS and NEW_TABULAR.
4267 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4268 defined. Change some of the "xxxx-inset-insert" functions names to
4271 * several files: more enahncements to NEW_INSETS and the resulting
4274 * lib/lyxrc.example (\date_insert_format): move to misc section
4276 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4277 bastring and use AC_CACHE_CHECK.
4278 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4279 the system have the newest methods. uses AC_CACHE_CHECK
4280 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4281 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4282 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4284 * configure.in: add LYX_CXX_GOOD_STD_STRING
4286 * acinclude.m4: recreated
4288 2000-07-24 Amir Karger <karger@lyx.org>
4290 * README: add Hebrew, Arabic kmaps
4293 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4295 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4298 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4300 * Lot of files: add pragma interface/implementation.
4302 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4304 * lib/ui/default.ui: new file (ans new directory). Contains the
4305 default menu and toolbar.
4307 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4308 global space. Toolbars are now read (as menus) in ui files.
4310 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4312 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4313 is disabled because the document is read-only. We want to have the
4314 toggle state of the function anyway.
4315 (getStatus): add code for LFUN_VC* functions (mimicking what is
4316 done in old-style menus)
4318 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4319 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4321 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4322 * src/BufferView_pimpl.C: ditto.
4323 * src/lyxfunc.C: ditto.
4325 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4326 default). This replaces old-style menus by new ones.
4328 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4329 MenuItem. Contain the data structure of a menu.
4331 * src/insets/insettext.C: use LyXView::setLayout instead of
4332 accessing directly the toolbar combox.
4333 * src/lyxfunc.C (Dispatch): ditto.
4335 * src/LyXView.C (setLayout): new method, which just calls
4336 Toolbar::setLayout().
4337 (updateLayoutChoice): move part of this method in Toolbar.
4339 * src/toolbar.[Ch]: removed.
4341 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4342 implementation the toolbar.
4344 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4345 the toolbar. It might make sense to merge it with ToolbarDefaults
4347 (setLayout): new function.
4348 (updateLayoutList): ditto.
4349 (openLayoutList): ditto.
4351 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4352 xforms implementation of the toolbar.
4353 (get_toolbar_func): comment out, since I do not
4354 know what it is good for.
4356 * src/ToolbarDefaults.h: Add the ItemType enum.
4358 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4359 for a list of allocated C strings. Used in Menubar xforms
4360 implementation to avoid memory leaks.
4362 * src/support/lstrings.[Ch] (uppercase): new version taking and
4366 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4367 * lib/bind/emacs.bind: ditto.
4369 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4371 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4372 forward decl of LyXView.
4374 * src/toolbar.C (toolbarItem): moved from toolbar.h
4375 (toolbarItem::clean): ditto
4376 (toolbarItem::~toolbarItem): ditto
4377 (toolbarItem::operator): ditto
4379 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4381 * src/paragraph.h: control the NEW_TABULAR define from here
4383 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4384 USE_TABULAR_INSETS to NEW_TABULAR
4386 * src/ToolbarDefaults.C: add include "lyxlex.h"
4388 * files using the old table/tabular: use NEW_TABULAR to control
4389 compilation of old tabular stuff.
4391 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4394 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4395 planemet in reading of old style floats, fix the \end_deeper
4396 problem when reading old style floats.
4398 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4400 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4402 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4404 * lib/bind/sciword.bind: updated.
4406 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4408 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4409 layout write problem
4411 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4413 * src/Makefile.am (INCLUDES): remove image directory from include
4416 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4417 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4419 * src/LyXView.C (create_form_form_main): read the application icon
4422 * lib/images/*.xpm: change the icons to use transparent color for
4425 * src/toolbar.C (update): change the color of the button when it
4428 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4430 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4431 setting explicitely the minibuffer.
4432 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4434 * src/LyXView.C (showState): new function. Shows font information
4435 in minibuffer and update toolbar state.
4436 (LyXView): call Toolbar::update after creating the
4439 * src/toolbar.C: change toollist to be a vector instead of a
4441 (BubbleTimerCB): get help string directly from the callback
4442 argument of the corresponding icon (which is the action)
4443 (set): remove unnecessary ugliness.
4444 (update): new function. update the icons (depressed, disabled)
4445 depending of the status of the corresponding action.
4447 * src/toolbar.h: remove help in toolbarItem
4449 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4451 * src/Painter.C (text): Added code for using symbol glyphs from
4452 iso10646 fonts. Currently diabled.
4454 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4457 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4458 magyar,turkish and usorbian.
4460 * src/paragraph.C (isMultiLingual): Made more efficient.
4462 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4465 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4466 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4467 Also changed the prototype to "bool math_insert_greek(char)".
4469 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4471 * lots of files: apply the NEW_INSETS on all code that will not be
4472 needed when we move to use the new insets. Enable the define in
4473 lyxparagrah.h to try it.
4475 * src/insets/insettabular.C (cellstart): change to be a static
4477 (InsetTabular): initialize buffer in the initializer list.
4479 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4481 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4482 form_print.h out of the header file. Replaced with forward
4483 declarations of the relevant struct.
4485 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4488 * src/commandtags.h: do not include "debug.h" which does not
4489 belong there. #include it in some other places because of this
4492 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4494 * src/insets/insetcaption.C: add a couple "using" directives.
4496 * src/toolbar.C (add): get the help text directly from lyxaction.
4498 (setPixmap): new function. Loads from disk and sets a pixmap on a
4499 botton; the name of the pixmap file is derived from the command
4502 * src/toolbar.h: remove members isBitmap and pixmap from
4505 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4506 * lib/images/: move many files from images/banner.xpm.
4508 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4510 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4511 * src/toolbar.C: ditto.
4512 * configure.in: ditto.
4513 * INSTALL: document.
4515 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4516 the spellchecker popup is closed from the WM.
4518 2000-07-19 Juergen Vigna <jug@sad.it>
4520 * src/insets/insetfloat.C (Write): small fix because we use the
4521 insetname for the type now!
4523 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4525 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4528 * src/frontends/Dialogs.h: removed hideCitation signal
4530 * src/insets/insetcite.h: added hide signal
4532 * src/insets/insetcite.C (~InsetCitation): emits new signal
4533 (getScreenLabel): "intelligent" label should now fit on the screen!
4535 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4537 * src/frontends/xforms/FormCitation.C (showInset): connects
4538 hide() to the inset's hide signal
4539 (show): modified to use fl_set_object_position rather than
4540 fl_set_object_geometry wherever possible
4542 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4544 * src/insets/lyxinset.h: add caption code
4546 * src/insets/insetfloat.C (type): new method
4548 * src/insets/insetcaption.C (Write): new method
4550 (LyxCode): new method
4552 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4553 to get it right together with using the FloatList.
4555 * src/commandtags.h: add LFUN_INSET_CAPTION
4556 * src/lyxfunc.C (Dispatch): handle it
4558 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4561 * src/Variables.[Ch]: make expand take a const reference, remove
4562 the destructor, some whitespace changes.
4564 * src/LyXAction.C (init): add caption-inset-insert
4566 * src/FloatList.C (FloatList): update the default floats a bit.
4568 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4570 * src/Variables.[Ch]: new files. Intended to be used for language
4571 specific strings (like \chaptername) and filename substitution in
4574 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4576 * lib/kbd/american.kmap: update
4578 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4580 * src/bufferparams.[Ch]: remove member allowAccents.
4582 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4584 * src/LaTeXLog.C: use the log_form.h header.
4585 * src/lyx_gui.C: ditto.
4586 * src/lyx_gui_misc.C: ditto.
4587 * src/lyxvc.h: ditto.
4589 * forms/log_form.fd: new file, created from latexoptions.fd. I
4590 kept the log popup and nuked the options form.
4592 * src/{la,}texoptions.[Ch]: removed.
4593 * src/lyx_cb.C (LaTeXOptions): ditto
4595 * src/lyx_gui.C (create_forms): do not handle the
4596 fd_latex_options form.
4598 2000-07-18 Juergen Vigna <jug@sad.it>
4600 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4601 name of the inset so that it can be requested outside (text2.C).
4603 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4606 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4608 * src/mathed/formula.h (ConvertFont): constify
4610 * src/mathed/formula.C (Read): add warning if \end_inset is not
4611 found on expected place.
4613 * src/insets/lyxinset.h (ConvertFont): consify
4615 * src/insets/insetquotes.C (ConvertFont): constify
4616 * src/insets/insetquotes.h: ditto
4618 * src/insets/insetinfo.h: add labelfont
4620 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4621 (ascent): use labelfont
4625 (Write): make .lyx file a bit nicer
4627 * src/insets/insetfloat.C (Write): simplify somewhat...
4628 (Read): add warning if arg is not found
4630 * src/insets/insetcollapsable.C: add using std::max
4631 (Read): move string token and add warning in arg is not found
4632 (draw): use std::max to get the right ty
4633 (getMaxWidth): simplify by using std::max
4635 * src/insets/insetsection.h: new file
4636 * src/insets/insetsection.C: new file
4637 * src/insets/insetcaption.h: new file
4638 * src/insets/insetcaption.C: new file
4640 * src/insets/inset.C (ConvertFont): constify signature
4642 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4643 insetcaption.[Ch] and insetsection.[Ch]
4645 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4646 uses to use LABEL_COUNTER_CHAPTER instead.
4647 * src/text2.C (SetCounter): here
4649 * src/counters.h: new file
4650 * src/counters.C: new file
4651 * src/Sectioning.h: new file
4652 * src/Sectioning.C: new file
4654 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4656 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4658 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4661 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4664 2000-07-17 Juergen Vigna <jug@sad.it>
4666 * src/tabular.C (Validate): check if array-package is needed.
4667 (SetVAlignment): added support for vertical alignment.
4668 (SetLTFoot): better support for longtable header/footers
4669 (Latex): modified to support added features.
4671 * src/LaTeXFeatures.[Ch]: added array-package.
4673 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4675 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4678 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4680 * configure.in: do not forget to put a space after -isystem.
4682 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4684 * lib/kbd/arabic.kmap: a few fixes.
4686 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4688 * some whitespace chagnes to a number of files.
4690 * src/support/DebugStream.h: change to make it easier for
4691 doc++ to parse correctly.
4692 * src/support/lyxstring.h: ditto
4694 * src/mathed/math_utils.C (compara): change to have only one
4696 (MathedLookupBOP): change because of the above.
4698 * src/mathed/math_delim.C (math_deco_compare): change to have only
4700 (search_deco): change becasue of the above.
4702 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4703 instead of manually coded one.
4705 * src/insets/insetquotes.C (Read): read the \end_inset too
4707 * src/insets/insetlatex.h: remove file
4708 * src/insets/insetlatex.C: remove file
4710 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4712 (InsetPrintIndex): remove destructor
4714 * src/insets/insetinclude.h: remove default constructor
4716 * src/insets/insetfloat.C: work to make it work better
4718 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4720 * src/insets/insetcite.h (InsetCitation): remove default constructor
4722 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4724 * src/text.C (GetColumnNearX): comment out some currently unused code.
4726 * src/paragraph.C (writeFile): move some initializations closer to
4728 (CutIntoMinibuffer): small change to use new matchIT operator
4732 (InsertInset): ditto
4735 (InsetIterator): ditto
4736 (Erase): small change to use new matchFT operator
4738 (GetFontSettings): ditto
4739 (HighestFontInRange): ditto
4742 * src/lyxparagraph.h: some chars changed to value_type
4743 (matchIT): because of some stronger checking (perhaps too strong)
4744 in SGI STL, the two operator() unified to one.
4747 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4749 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4750 the last inset read added
4751 (parseSingleLyXformat2Token): some more (future) compability code added
4752 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4753 (parseSingleLyXformat2Token): set last_inset_read
4754 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4755 (parseSingleLyXformat2Token): don't double intializw string next_token
4757 * src/TextCache.C (text_fits::operator()): add const's to the signature
4758 (has_buffer::operator()): ditto
4760 * src/Floating.h: add some comments on the class
4762 * src/FloatList.[Ch] (typeExist): new method
4765 * src/BackStack.h: added default constructor, wanted by Gcc.
4767 2000-07-14 Juergen Vigna <jug@sad.it>
4769 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4771 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4773 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4774 do a redraw when the window is resized!
4775 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4777 * src/insets/insettext.C (resizeLyXText): added function to correctly
4778 being able to resize the LyXWindow.
4780 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4782 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4784 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4785 crashes when closing dialog to a deleted inset.
4787 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4788 method! Now similar to other insets.
4790 2000-07-13 Juergen Vigna <jug@sad.it>
4792 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4794 * lib/examples/Literate.lyx: small patch!
4796 * src/insets/insetbib.C (Read): added this function because of wrong
4797 Write (without [begin|end]_inset).
4799 2000-07-11 Juergen Vigna <jug@sad.it>
4801 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4802 as the insertInset could not be good!
4804 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4805 the bool param should not be last.
4807 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4809 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4810 did submit that to Karl).
4812 * configure.in: use -isystem instead of -I for X headers. This
4813 fixes a problem on solaris with a recent gcc;
4814 put the front-end code after the X detection code;
4815 configure in sigc++ before lib/
4817 * src/lyx_main.C (commandLineHelp): remove -display from command
4820 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4822 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4823 Also put in Makefile rules for building the ``listerrors''
4824 program for parsing errors from literate programs written in LyX.
4826 * lib/build-listerrors: Added small shell script as part of compile
4827 process. This builds a working ``listerrors'' binary if noweb is
4828 installed and either 1) the VNC X server is installed on the machine,
4829 or 2) the user is compiling from within a GUI. The existence of a GUI
4830 is necessary to use the ``lyx --export'' feature for now. This
4831 hack can be removed once ``lyx --export'' no longer requires a GUI to
4834 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4836 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4837 now passed back correctly from gcc and placed "under" error
4838 buttons in a Literate LyX source.
4840 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4842 * src/text.C (GetColumnNearX): Better behavior when a RTL
4843 paragraph is ended by LTR text.
4845 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4848 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4850 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4851 true when clipboard is empty.
4853 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4855 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4856 row of the paragraph.
4857 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4858 to prevent calculation of bidi tables
4860 2000-07-07 Juergen Vigna <jug@sad.it>
4862 * src/screen.C (ToggleSelection): added y_offset and x_offset
4865 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4868 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4870 * src/insets/insettext.C: fixed Layout-Display!
4872 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4874 * configure.in: add check for strings.h header.
4876 * src/spellchecker.C: include <strings.h> in order to have a
4877 definition for bzero().
4879 2000-07-07 Juergen Vigna <jug@sad.it>
4881 * src/insets/insettext.C (draw): set the status of the bv->text to
4882 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4884 * src/screen.C (DrawOneRow):
4885 (DrawFromTo): redraw the actual row if something has changed in it
4888 * src/text.C (draw): call an update of the toplevel-inset if something
4889 has changed inside while drawing.
4891 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4893 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4895 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4896 processing inside class.
4898 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4899 processing inside class.
4901 * src/insets/insetindex.h new struct Holder, consistent with other
4904 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4905 citation dialog from main code and placed it in src/frontends/xforms.
4906 Dialog launched through signals instead of callbacks
4908 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4910 * lyx.man: update the options description.
4912 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4914 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4915 handle neg values, set min width to 590, add doc about -display
4917 2000-07-05 Juergen Vigna <jug@sad.it>
4919 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4920 calls to BufferView *.
4922 * src/insets/insettext.C (checkAndActivateInset): small fix non
4923 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4925 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4926 their \end_inset token!
4928 2000-07-04 edscott <edscott@imp.mx>
4930 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4931 lib/lyxrc.example: added option \wheel_jump
4933 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4935 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4936 remove support for -width,-height,-xpos and -ypos.
4938 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4940 * src/encoding.[Ch]: New files.
4942 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4943 (text): Call to the underline() method only when needed.
4945 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4947 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4948 encoding(s) for the document.
4950 * src/bufferparams.C (BufferParams): Changed default value of
4953 * src/language.C (newLang): Removed.
4954 (items[]): Added encoding information for all defined languages.
4956 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4957 encoding choice button.
4959 * src/lyxrc.h (font_norm_type): New member variable.
4960 (set_font_norm_type): New method.
4962 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4963 paragraphs with different encodings.
4965 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4966 (TransformChar): Changed to work correctly with Arabic points.
4967 (draw): Added support for drawing Arabic points.
4968 (draw): Removed code for drawing underbars (this is done by
4971 * src/support/textutils.h (IsPrintableNonspace): New function.
4973 * src/BufferView_pimpl.h: Added "using SigC::Object".
4974 * src/LyXView.h: ditto.
4976 * src/insets/insetinclude.h (include_label): Changed to mutable.
4978 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4980 * src/mathed/math_iter.h: remove empty destructor
4982 * src/mathed/math_cursor.h: remove empty destructor
4984 * src/insets/lyxinset.h: add THEOREM_CODE
4986 * src/insets/insettheorem.[Ch]: new files
4988 * src/insets/insetminipage.C: (InsertInset): remove
4990 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4992 (InsertInset): remove
4994 * src/insets/insetlist.C: (InsertList): remove
4996 * src/insets/insetfootlike.[Ch]: new files
4998 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5001 (InsertInset): ditto
5003 * src/insets/insetert.C: remove include Painter.h, reindent
5004 (InsertInset): move to header
5006 * src/insets/insetcollapsable.h: remove explicit from default
5007 contructor, remove empty destructor, add InsertInset
5009 * src/insets/insetcollapsable.C (InsertInset): new func
5011 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5013 * src/vspace.h: add explicit to constructor
5015 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5016 \textcompwordmark, please test this.
5018 * src/lyxrc.C: set ascii_linelen to 65 by default
5020 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5022 * src/commandtags.h: add LFUN_INSET_THEOREM
5024 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5025 (makeLinuxDocFile): remove _some_ of the nice logic
5026 (makeDocBookFile): ditto
5028 * src/Painter.[Ch]: (~Painter): removed
5030 * src/LyXAction.C (init): entry for insettheorem added
5032 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5034 (deplog): code to detect files generated by LaTeX, needs testing
5037 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5039 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5041 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5043 * src/LaTeX.C (deplog): Add a check for files that are going to be
5044 created by the first latex run, part of the project to remove the
5047 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5048 contents to the extension list.
5050 2000-07-04 Juergen Vigna <jug@sad.it>
5052 * src/text.C (NextBreakPoint): added support for needFullRow()
5054 * src/insets/lyxinset.h: added needFullRow()
5056 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5059 * src/insets/insettext.C: lots of changes for update!
5061 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5063 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5065 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5067 * src/insets/insetinclude.C (InsetInclude): fixed
5068 initialization of include_label.
5069 (unique_id): now returns a string.
5071 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5073 * src/LaTeXFeatures.h: new member IncludedFiles, for
5074 a map of key, included file name.
5076 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5077 with the included files for inclusion in SGML preamble,
5078 i. e., linuxdoc and docbook.
5081 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5082 nice (is the generated linuxdoc code to be exported?), that
5083 allows to remove column, and only_body that will be true for
5084 slave documents. Insets are allowed inside SGML font type.
5085 New handling of the SGML preamble for included files.
5086 (makeDocBookFile): the same for docbook.
5088 * src/insets/insetinclude.h:
5089 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5091 (DocBook): new export methods.
5093 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5094 and makeDocBookFile.
5096 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5097 formats to export with command line argument -x.
5099 2000-06-29 Juergen Vigna <jug@sad.it>
5101 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5102 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5104 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5105 region could already been cleared by an inset!
5107 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5109 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5112 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5114 (cursorToggle): remove special handling of lyx focus.
5116 2000-06-28 Juergen Vigna <jug@sad.it>
5118 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5121 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5123 * src/insets/insetindex.C (Edit): add a callback when popup is
5126 * src/insets/insettext.C (LocalDispatch):
5127 * src/insets/insetmarginal.h:
5128 * src/insets/insetlist.h:
5129 * src/insets/insetfoot.h:
5130 * src/insets/insetfloat.h:
5131 * src/insets/insetert.h: add a missing std:: qualifier.
5133 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5135 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5138 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5140 * src/insets/insettext.C (Read): remove tmptok unused variable
5141 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5142 (InsertInset): change for new InsetInset code
5144 * src/insets/insettext.h: add TEXT inline method
5146 * src/insets/insettext.C: remove TEXT macro
5148 * src/insets/insetmarginal.C (Write): new method
5149 (Latex): change output slightly
5151 * src/insets/insetfoot.C (Write): new method
5152 (Latex): change output slightly (don't use endl when no need)
5154 * src/insets/insetert.C (Write): new method
5156 * src/insets/insetcollapsable.h: make button_length, button_top_y
5157 and button_bottm_y protected.
5159 * src/insets/insetcollapsable.C (Write): simplify code by using
5160 tostr. Also do not output the float name, the children class
5161 should to that to get control over own arguments
5163 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5164 src/insets/insetminipage.[Ch]:
5167 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5169 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5171 * src/Makefile.am (lyx_SOURCES): add the new files
5173 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5174 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5175 * src/commandtags.h: ditto
5177 * src/LaTeXFeatures.h: add a std::set of used floattypes
5179 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5181 * src/FloatList.[Ch] src/Floating.h: new files
5183 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5185 * src/lyx_cb.C (TableApplyCB): ditto
5187 * src/text2.C: ditto
5188 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5189 (parseSingleLyXformat2Token): ditto + add code for
5190 backwards compability for old float styles + add code for new insets
5192 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5194 (InsertInset(size_type, Inset *, LyXFont)): new method
5195 (InsetChar(size_type, char)): changed to use the other InsetChar
5196 with a LyXFont(ALL_INHERIT).
5197 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5198 insert the META_INSET.
5200 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5202 * sigc++/thread.h (Threads): from here
5204 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5205 definition out of line
5206 * sigc++/scope.h: from here
5208 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5210 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5211 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5213 * Makefile.am (bindist): new target.
5215 * INSTALL: add instructions for doing a binary distribution.
5217 * development/tools/README.bin.example: update a bit.
5219 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5222 * lib/lyxrc.example: new lyxrc tag \set_color.
5224 * src/lyxfunc.C (Dispatch):
5225 * src/commandtags.h:
5226 * src/LyXAction.C: new lyxfunc "set-color".
5228 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5229 and an x11name given as strings.
5231 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5232 cache when a color is changed.
5234 2000-06-26 Juergen Vigna <jug@sad.it>
5236 * src/lyxrow.C (width): added this functions and variable.
5238 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5241 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5243 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5245 * images/undo_bw.xpm: new icon.
5246 * images/redo_bw.xpm: ditto.
5248 * configure.in (INSTALL_SCRIPT): change value to
5249 ${INSTALL} to avoid failures of install-script target.
5250 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5252 * src/BufferView.h: add a magic "friend" declaration to please
5255 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5257 * forms/cite.fd: modified to allow resizing without messing
5260 * src/insetcite.C: Uses code from cite.fd almost without
5262 User can now resize dialog in the x-direction.
5263 Resizing the dialog in the y-direction is prevented, as the
5264 code does this intelligently already.
5266 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5268 * INSTALL: remove obsolete entry in "problems" section.
5270 * lib/examples/sl_*.lyx: update of the slovenian examples.
5272 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5274 2000-06-23 Juergen Vigna <jug@sad.it>
5276 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5278 * src/buffer.C (resize): delete the LyXText of textinsets.
5280 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5282 * src/insets/lyxinset.h: added another parameter 'cleared' to
5283 the draw() function.
5285 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5286 unlocking inset in inset.
5288 2000-06-22 Juergen Vigna <jug@sad.it>
5290 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5291 of insets and moved first to LyXText.
5293 * src/mathed/formulamacro.[Ch]:
5294 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5296 2000-06-21 Juergen Vigna <jug@sad.it>
5298 * src/text.C (GetVisibleRow): look if I should clear the area or not
5299 using Inset::doClearArea() function.
5301 * src/insets/lyxinset.h: added doClearArea() function and
5302 modified draw(Painter &, ...) to draw(BufferView *, ...)
5304 * src/text2.C (UpdateInset): return bool insted of int
5306 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5308 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5309 combox in the character popup
5311 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5312 BufferParams const & params
5314 2000-06-20 Juergen Vigna <jug@sad.it>
5316 * src/insets/insettext.C (SetParagraphData): set insetowner on
5319 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5321 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5322 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5324 (form_main_): remove
5326 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5327 (create_form_form_main): remove FD_form_main stuff, connect to
5328 autosave_timeout signal
5330 * src/LyXView.[Ch] (getMainForm): remove
5331 (UpdateTimerCB): remove
5332 * src/BufferView_pimpl.h: inherit from SigC::Object
5334 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5335 signal instead of callback
5337 * src/BufferView.[Ch] (cursorToggleCB): remove
5339 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5341 * src/BufferView_pimpl.C: changes because of the one below
5343 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5344 instead of storing a pointer to a LyXText.
5346 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5348 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5350 * src/lyxparagraph.h
5352 * src/paragraph.C: Changed fontlist to a sorted vector.
5354 2000-06-19 Juergen Vigna <jug@sad.it>
5356 * src/BufferView.h: added screen() function.
5358 * src/insets/insettext.C (LocalDispatch): some selection code
5361 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5363 * src/insets/insettext.C (SetParagraphData):
5365 (InsetText): fixes for multiple paragraphs.
5367 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5369 * development/lyx.spec.in: Call configure with ``--without-warnings''
5370 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5371 This should be fine, however, since we generally don't want to be
5372 verbose when making an RPM.
5374 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5376 * lib/scripts/fig2pstex.py: New file
5378 2000-06-16 Juergen Vigna <jug@sad.it>
5380 * src/insets/insettabular.C (UpdateLocal):
5381 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5382 (LocalDispatch): Changed all functions to use LyXText.
5384 2000-06-15 Juergen Vigna <jug@sad.it>
5386 * src/text.C (SetHeightOfRow): call inset::update before requesting
5389 * src/insets/insettext.C (update):
5390 * src/insets/insettabular.C (update): added implementation
5392 * src/insets/lyxinset.h: added update function
5394 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5396 * src/text.C (SelectNextWord): protect against null pointers with
5397 old-style string streams. (fix from Paul Theo Gonciari
5400 * src/cite.[Ch]: remove erroneous files.
5402 * lib/configure.m4: update the list of created directories.
5404 * src/lyxrow.C: include <config.h>
5405 * src/lyxcursor.C: ditto.
5407 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5409 * lib/examples/decimal.lyx: new example file from Mike.
5411 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5412 to find template definitions (from Dekel)
5414 * src/frontends/.cvsignore: add a few things.
5416 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5418 * src/Timeout.C (TimeOut): remove default argument.
5420 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5423 * src/insets/ExternalTemplate.C: add a "using" directive.
5425 * src/lyx_main.h: remove the act_ struct, which seems unused
5428 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5430 * LyX Developers Meeting: All files changed, due to random C++ (by
5431 coincidence) code generator script.
5433 - external inset (cool!)
5434 - initial online editing of preferences
5435 - insettabular breaks insettext(s contents)
5437 - some DocBook fixes
5438 - example files update
5439 - other cool stuff, create a diff and look for yourself.
5441 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5443 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5444 -1 this is a non-line-breaking textinset.
5446 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5447 if there is no width set.
5449 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5451 * Lots of files: Merged the dialogbase branch.
5453 2000-06-09 Allan Rae <rae@lyx.org>
5455 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5456 and the Dispatch methods that used it.
5458 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5459 access to functions formerly kept in Dispatch.
5461 2000-05-19 Allan Rae <rae@lyx.org>
5463 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5464 made to_page and count_copies integers again. from_page remains a
5465 string however because I want to allow entry of a print range like
5466 "1,4,22-25" using this field.
5468 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5469 and printer-params-get. These aren't useful from the minibuffer but
5470 could be used by a script/LyXServer app provided it passes a suitable
5471 auto_mem_buffer. I guess I should take a look at how the LyXServer
5472 works and make it support xtl buffers.
5474 * sigc++/: updated to libsigc++-1.0.1
5476 * src/xtl/: updated to xtl-1.3.pl.11
5478 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5479 those changes done to the files in src/ are actually recreated when
5480 they get regenerated. Please don't ever accept a patch that changes a
5481 dialog unless that patch includes the changes to the corresponding *.fd
5484 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5485 stringOnlyContains, renamed it and generalised it.
5487 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5488 branch. Removed the remaining old form_print code.
5490 2000-04-26 Allan Rae <rae@lyx.org>
5492 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5493 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5495 2000-04-25 Allan Rae <rae@lyx.org>
5497 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5498 against a base of xtl-1.3.pl.4
5500 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5501 filter the Id: entries so they still show the xtl version number
5504 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5505 into the src/xtl code. Patch still pending with José (XTL)
5507 2000-04-24 Allan Rae <rae@lyx.org>
5509 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5510 both more generic and much safer. Use the new template functions.
5511 * src/buffer.[Ch] (Dispatch): ditto.
5513 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5514 and mem buffer more intelligently. Also a little general cleanup.
5517 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5518 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5519 * src/xtl/Makefile.am: ditto.
5520 * src/xtl/.cvsignore: ditto.
5521 * src/Makefile.am: ditto.
5523 * src/PrinterParams.h: Removed the macros member functions. Added a
5524 testInvariant member function. A bit of tidying up and commenting.
5525 Included Angus's idea for fixing operation with egcs-1.1.2.
5527 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5528 cool expansion of XTL's mem_buffer to support automatic memory
5529 management within the buffer itself. Removed the various macros and
5530 replaced them with template functions that use either auto_mem_buffer
5531 or mem_buffer depending on a #define. The mem_buffer support will
5532 disappear as soon as the auto_mem_buffer is confirmed to be good on
5533 other platforms/compilers. That is, it's there so you've got something
5536 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5537 effectively forked XTL. However I expect José will include my code
5538 into the next major release. Also fixed a memory leak.
5539 * src/xtl/text.h: ditto.
5540 * src/xtl/xdr.h: ditto.
5541 * src/xtl/giop.h: ditto.
5543 2000-04-16 Allan Rae <rae@lyx.org>
5545 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5546 by autogen.sh and removed by maintainer-clean anyway.
5547 * .cvsignore, sigc++/.cvsignore: Support the above.
5549 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5551 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5553 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5554 macros, renamed static callback-target member functions to suit new
5555 scheme and made them public.
5556 * src/frontends/xforms/forms/form_print.fd: ditto.
5557 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5559 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5562 * src/xtl/: New directory containing a minimal distribution of XTL.
5563 This is XTL-1.3.pl.4.
5565 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5567 2000-04-15 Allan Rae <rae@lyx.org>
5569 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5571 * sigc++/: Updated to libsigc++-1.0.0
5573 2000-04-14 Allan Rae <rae@lyx.org>
5575 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5576 use the generic ones in future. I'll modify my conversion script.
5578 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5580 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5581 (CloseAllBufferRelatedDialogs): Renamed.
5582 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5584 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5585 of the generic ones. These are the same ones my conversion script
5588 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5589 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5590 * src/buffer.C (Dispatch): ditto
5592 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5593 functions for updating and hiding buffer dependent dialogs.
5594 * src/BufferView.C (buffer): ditto
5595 * src/buffer.C (setReadonly): ditto
5596 * src/lyxfunc.C (CloseBuffer): ditto
5598 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5599 Dialogs.h, and hence all the SigC stuff, into every file that includes
5600 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5602 * src/BufferView2.C: reduce the number of headers included by buffer.h
5604 2000-04-11 Allan Rae <rae@lyx.org>
5606 * src/frontends/xforms/xform_macros.h: A small collection of macros
5607 for building C callbacks.
5609 * src/frontends/xforms/Makefile.am: Added above file.
5611 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5612 scheme again. This time it should work for JMarc. If this is
5613 successful I'll revise my conversion script to automate some of this.
5614 The static member functions in the class also have to be public for
5615 this scheme will work. If the scheme works (it's almost identical to
5616 the way BufferView::cursorToggleCB is handled so it should work) then
5617 FormCopyright and FormPrint will be ready for inclusion into the main
5618 trunk immediately after 1.1.5 is released -- provided we're prepared
5619 for complaints about lame compilers not handling XTL.
5621 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5623 2000-04-07 Allan Rae <rae@lyx.org>
5625 * config/lyxinclude.m4: A bit more tidying up (Angus)
5627 * src/LString.h: JMarc's <string> header fix
5629 * src/PrinterParams.h: Used string for most data to remove some
5630 ugly code in the Print dialog and avoid even uglier code when
5631 appending the ints to a string for output.
5633 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5634 and moved "default:" back to the end of switch statement. Cleaned
5635 up the printing so it uses the right function calls and so the
5636 "print to file" option actually puts the file in the right directory.
5638 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5640 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5641 and Ok+Apply button control into a separate method: input (Angus).
5642 (input) Cleaned it up and improved it to be very thorough now.
5643 (All CB) static_cast used instead of C style cast (Angus). This will
5644 probably change again once we've worked out how to keep gcc-2.8.1 happy
5645 with real C callbacks.
5646 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5647 ignore some of the bool settings and has random numbers instead. Needs
5648 some more investigation. Added other input length checks and checking
5649 of file and printer names.
5651 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5652 would link (Angus). Seems the old code doesn't compile with the pragma
5653 statement either. Separated callback entries from internal methods.
5655 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5657 2000-03-17 Allan Rae <rae@lyx.org>
5659 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5660 need it? Maybe it could go in Dialogs instead? I could make it a
5661 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5662 values to get the bool return value.
5663 (Dispatch): New overloaded method for xtl support.
5665 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5666 extern "C" callback instead of static member functions. Hopefully,
5667 JMarc will be able to compile this. I haven't changed
5668 forms/form_copyright.fd yet. Breaking one of my own rules already.
5670 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5671 because they aren't useful from the minibuffer. Maybe a LyXServer
5672 might want a help message though?
5674 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5676 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5677 xtl which needs both rtti and exceptions.
5679 * src/support/Makefile.am:
5680 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5682 * src/frontends/xforms/input_validators.[ch]: input filters and
5683 validators. These conrol what keys are valid in input boxes.
5684 Use them and write some more. Much better idea than waiting till
5685 after the user has pressed Ok to say that the input fields don't make
5688 * src/frontends/xforms/Makefile.am:
5689 * src/frontends/xforms/forms/form_print.fd:
5690 * src/frontends/xforms/forms/makefile:
5691 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5692 new scheme. Still have to make sure I haven't missed anything from
5693 the current implementation.
5695 * src/Makefile.am, src/PrinterParams.h: New data store.
5697 * other files: Added a couple of copyright notices.
5699 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5701 * src/insets/insetbib.h: move Holder struct in public space.
5703 * src/frontends/include/DialogBase.h: use SigC:: only when
5704 SIGC_CXX_NAMESPACES is defined.
5705 * src/frontends/include/Dialogs.h: ditto.
5707 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5709 * src/frontends/xforms/FormCopyright.[Ch]: do not
5710 mention SigC:: explicitely.
5712 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5714 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5715 deals with testing KDE in main configure.in
5716 * configure.in: ditto.
5718 2000-02-22 Allan Rae <rae@lyx.org>
5720 * Lots of files: Merged from HEAD
5722 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5723 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5725 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5727 * sigc++/: new minidist.
5729 2000-02-14 Allan Rae <rae@lyx.org>
5731 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5733 2000-02-08 Juergen Vigna <jug@sad.it>
5735 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5736 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5738 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5739 for this port and so it is much easier for other people to port
5740 dialogs in a common development environment.
5742 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5743 the QT/KDE implementation.
5745 * src/frontends/kde/Dialogs.C:
5746 * src/frontends/kde/FormCopyright.C:
5747 * src/frontends/kde/FormCopyright.h:
5748 * src/frontends/kde/Makefile.am:
5749 * src/frontends/kde/formcopyrightdialog.C:
5750 * src/frontends/kde/formcopyrightdialog.h:
5751 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5752 for the kde support of the Copyright-Dialog.
5754 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5755 subdir-substitution instead of hardcoded 'xforms' as we now have also
5758 * src/frontends/include/DialogBase.h (Object): just commented the
5759 label after #endif (nasty warning and I don't like warnings ;)
5761 * src/main.C (main): added KApplication initialization if using
5764 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5765 For now only the KDE event-loop is added if frontend==kde.
5767 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5769 * configure.in: added support for the --with-frontend[=value] option
5771 * autogen.sh: added kde.m4 file to list of config-files
5773 * acconfig.h: added define for KDEGUI-support
5775 * config/kde.m4: added configuration functions for KDE-port
5777 * config/lyxinclude.m4: added --with-frontend[=value] option with
5778 support for xforms and KDE.
5780 2000-02-08 Allan Rae <rae@lyx.org>
5782 * all Makefile.am: Fixed up so the make targets dist, distclean,
5783 install and uninstall all work even if builddir != srcdir. Still
5784 have a new sigc++ minidist update to come.
5786 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5788 2000-02-01 Allan Rae <rae@lyx.org>
5790 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5791 Many mods to get builddir != srcdir working.
5793 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5794 for building on NT and so we can do the builddir != srcdir stuff.
5796 2000-01-30 Allan Rae <rae@lyx.org>
5798 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5799 This will stay in "rae" branch. We probably don't really need it in
5800 the main trunk as anyone who wants to help programming it should get
5801 a full library installed also. So they can check both included and
5802 system supplied library compilation.
5804 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5805 Added a 'mini' distribution of libsigc++. If you feel the urge to
5806 change something in these directories - Resist it. If you can't
5807 resist the urge then you should modify the following script and rebuild
5808 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5809 all happen. Still uses a hacked version of libsigc++'s configure.in.
5810 I'm quite happy with the results. I'm not sure the extra work to turn
5811 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5812 worth the trouble and would probably lead to extra maintenance
5814 I haven't tested the following important make targets: install, dist.
5815 Not ready for prime time but very close. Maybe 1.1.5.
5817 * development/tools/makeLyXsigc.sh: A shell script to automatically
5818 generate our mini-dist of libsigc++. It can only be used with a CVS
5819 checkout of libsigc++ not a tarball distribution. It's well commented.
5820 This will end up as part of the libsigc++ distribution so other apps
5821 can easily have an included mini-dist. If someone makes mods to the
5822 sigc++ subpackage without modifying this script to generate those
5823 changes I'll be very upset!
5825 * src/frontends/: Started the gui/system indep structure.
5827 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5828 to access the gui-indep dialogs are in this class. Much improved
5829 design compared to previous revision. Lars, please refrain from
5830 moving this header into src/ like you did with Popups.h last time.
5832 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5834 * src/frontends/xforms/: Started the gui-indep system with a single
5835 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5838 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5839 Here you'll find a very useful makefile and automated fdfix.sh that
5840 makes updating dailogs a no-brainer -- provided you follow the rules
5841 set out in the README. I'm thinking about adding another script to
5842 automatically generate skeleton code for a new dialog given just the
5845 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5846 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5847 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5849 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5851 * src/support/LSubstring.C (operator): simplify
5853 * src/lyxtext.h: removed bparams, use buffer_->params instead
5855 * src/lyxrow.h: make Row a real class, move all variables to
5856 private and use accessors.
5858 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5860 (isRightToLeftPar): ditto
5861 (ChangeLanguage): ditto
5862 (isMultiLingual): ditto
5865 (SimpleTeXOnePar): ditto
5866 (TeXEnvironment): ditto
5867 (GetEndLabel): ditto
5869 (SetOnlyLayout): ditto
5870 (BreakParagraph): ditto
5871 (BreakParagraphConservative): ditto
5872 (GetFontSettings): ditto
5874 (CopyIntoMinibuffer): ditto
5875 (CutIntoMinibuffer): ditto
5876 (PasteParagraph): ditto
5877 (SetPExtraType): ditto
5878 (UnsetPExtraType): ditto
5879 (DocBookContTableRows): ditto
5880 (SimpleDocBookOneTablePar): ditto
5882 (TeXFootnote): ditto
5883 (SimpleTeXOneTablePar): ditto
5884 (TeXContTableRows): ditto
5885 (SimpleTeXSpecialChars): ditto
5888 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5889 to private and use accessors.
5891 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5892 this, we did not use it anymore and has not been for ages. Just a
5893 waste of cpu cycles.
5895 * src/language.h: make Language a real class, move all variables
5896 to private and use accessors.
5898 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5899 (create_view): remove
5900 (update): some changes for new timer
5901 (cursorToggle): use new timer
5902 (beforeChange): change for new timer
5904 * src/BufferView.h (cursorToggleCB): removed last paramter because
5907 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5908 (cursorToggleCB): change because of new timer code
5910 * lib/CREDITS: updated own mailaddress
5912 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5914 * src/support/filetools.C (PutEnv): fix the code in case neither
5915 putenv() nor setenv() have been found.
5917 * INSTALL: mention the install-strip Makefile target.
5919 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5920 read-only documents.
5922 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5924 * lib/reLyX/configure.in (VERSION): avoid using a previously
5925 generated reLyX wrapper to find out $prefix.
5927 * lib/examples/eu_adibide_lyx-atua.lyx:
5928 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5929 translation of the Tutorial (Dooteo)
5931 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5933 * forms/cite.fd: new citation dialog
5935 * src/insetcite.[Ch]: the new citation dialog is moved into
5938 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5941 * src/insets/insetcommand.h: data members made private.
5943 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5945 * LyX 1.1.5 released
5947 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5949 * src/version.h (LYX_RELEASE): to 1.1.5
5951 * src/spellchecker.C (RunSpellChecker): return false if the
5952 spellchecker dies upon creation.
5954 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5956 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5957 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5961 * lib/CREDITS: update entry for Martin Vermeer.
5963 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5965 * src/text.C (draw): Draw foreign language bars at the bottom of
5966 the row instead of at the baseline.
5968 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5970 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5972 * lib/bind/de_menus.bind: updated
5974 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5976 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5978 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5980 * src/menus.C (Limit_string_length): New function
5981 (ShowTocMenu): Limit the number of items/length of items in the
5984 * src/paragraph.C (String): Correct result for a paragraph inside
5987 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5989 * src/bufferlist.C (close): test of buf->getuser() == NULL
5991 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5993 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5994 Do not call to SetCursor when the paragraph is a closed footnote!
5996 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5998 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6001 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6003 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6006 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6007 reference popup, that activates the reference-back action
6009 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6011 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6012 the menus. Also fixed a bug.
6014 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6015 the math panels when switching buffers (unless new buffer is readonly).
6017 * src/BufferView.C (NoSavedPositions)
6018 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6020 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6022 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6023 less of dvi dirty or not.
6025 * src/trans_mgr.[Ch] (insert): change first parameter to string
6028 * src/chset.[Ch] (encodeString): add const to first parameter
6030 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6032 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6036 * src/LaTeX.C (deplog): better searching for dependency files in
6037 the latex log. Uses now regexps.
6039 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6040 instead of the box hack or \hfill.
6042 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6044 * src/lyxfunc.C (doImportHelper): do not create the file before
6045 doing the actual import.
6046 (doImportASCIIasLines): create a new file before doing the insert.
6047 (doImportASCIIasParagraphs): ditto.
6049 * lib/lyxrc.example: remove mention of non-existing commands
6051 * lyx.man: remove mention of color-related switches.
6053 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6055 * src/lyx_gui.C: remove all the color-related ressources, which
6056 are not used anymore.
6058 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6061 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6063 * src/lyxrc.C (read): Add a missing break in the switch
6065 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6067 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6069 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6072 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6074 * src/text.C (draw): draw bars under foreign language words.
6076 * src/LColor.[Ch]: add LColor::language
6078 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6080 * src/lyxcursor.h (boundary): New member variable
6082 * src/text.C (IsBoundary): New methods
6084 * src/text.C: Use the above for currect cursor movement when there
6085 is both RTL & LTR text.
6087 * src/text2.C: ditto
6089 * src/bufferview_funcs.C (ToggleAndShow): ditto
6091 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6093 * src/text.C (DeleteLineForward): set selection to true to avoid
6094 that DeleteEmptyParagraphMechanism does some magic. This is how it
6095 is done in all other functions, and seems reasonable.
6096 (DeleteWordForward): do not jump over non-word stuff, since
6097 CursorRightOneWord() already does it.
6099 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6100 DeleteWordBackward, since they seem safe to me (since selection is
6101 set to "true") DeleteEmptyParagraphMechanism does nothing.
6103 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6105 * src/lyx_main.C (easyParse): simplify the code by factoring the
6106 part that removes parameters from the command line.
6107 (LyX): check wether wrong command line options have been given.
6109 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6111 * src/lyx_main.C : add support for specifying user LyX
6112 directory via command line option -userdir.
6114 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6116 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6117 the number of items per popup.
6118 (Add_to_refs_menu): Ditto.
6120 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6122 * src/lyxparagraph.h: renamed ClearParagraph() to
6123 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6124 textclass as parameter, and do nothing if free_spacing is
6125 true. This fixes part of the line-delete-forward problems.
6127 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6128 (pasteSelection): ditto.
6129 (SwitchLayoutsBetweenClasses): more translatable strings.
6131 * src/text2.C (CutSelection): use StripLeadingSpaces.
6132 (PasteSelection): ditto.
6133 (DeleteEmptyParagraphMechanism): ditto.
6135 2000-05-26 Juergen Vigna <jug@sad.it>
6137 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6138 is not needed in tabular insets.
6140 * src/insets/insettabular.C (TabularFeatures): added missing features.
6142 * src/tabular.C (DeleteColumn):
6144 (AppendRow): implemented this functions
6145 (cellsturct::operator=): clone the inset too;
6147 2000-05-23 Juergen Vigna <jug@sad.it>
6149 * src/insets/insettabular.C (LocalDispatch): better selection support
6150 when having multicolumn-cells.
6152 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6154 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6156 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6158 * src/ColorHandler.C (getGCForeground): put more test into _()
6160 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6163 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6166 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6168 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6169 there are no labels, or when buffer is readonly.
6171 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6172 there are no labels, buffer is SGML, or when buffer is readonly.
6174 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6176 * src/LColor.C (LColor): change a couple of grey40 to grey60
6177 (LColor): rewore initalization to make compiles go some magnitude
6179 (getGUIName): don't use gettext until we need the string.
6181 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6183 * src/Bullet.[Ch]: Fixed a small bug.
6185 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6187 * src/paragraph.C (String): Several fixes/improvements
6189 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6191 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6193 * src/paragraph.C (String): give more correct output.
6195 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6197 * src/lyxfont.C (stateText) Do not output the language if it is
6198 eqaul to the language of the document.
6200 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6201 between two paragraphs with the same language.
6203 * src/paragraph.C (getParLanguage) Return a correct answer for an
6204 empty dummy paragraph.
6206 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6209 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6212 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6213 the menus/popup, if requested fonts are unavailable.
6215 2000-05-22 Juergen Vigna <jug@sad.it>
6217 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6218 movement support (Up/Down/Tab/Shift-Tab).
6219 (LocalDispatch): added also preliminari cursor-selection.
6221 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6223 * src/paragraph.C (PasteParagraph): Hopefully now right!
6225 2000-05-22 Garst R. Reese <reese@isn.net>
6227 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6228 of list, change all references to Environment to Command
6229 * tex/hollywood.cls : rewrite environments as commands, add
6230 \uppercase to interiorshot and exteriorshot to force uppecase.
6231 * tex/broadway.cls : rewrite environments as commands. Tweak
6234 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6236 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6237 size of items: use a constant intead of the hardcoded 40, and more
6238 importantly do not remove the %m and %x tags added at the end.
6239 (Add_to_refs_menu): use vector::size_type instead of
6240 unsigned int as basic types for the variables. _Please_ do not
6241 assume that size_t is equal to unsigned int. On an alpha, this is
6242 unsigned long, which is _not_ the same.
6244 * src/language.C (initL): remove language "hungarian", since it
6245 seems that "magyar" is better.
6247 2000-05-22 Juergen Vigna <jug@sad.it>
6249 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6251 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6254 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6255 next was deleted but not set to 0.
6257 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6259 * src/language.C (initL): change the initialization of languages
6260 so that compiles goes _fast_.
6262 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6265 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6267 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6271 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6273 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6275 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6279 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6282 * src/insets/insetlo*.[Ch]: Made editable
6284 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6286 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6287 the current selection.
6289 * src/BufferView_pimpl.C (stuffClipboard): new method
6291 * src/BufferView.C (stuffClipboard): new method
6293 * src/paragraph.C (String): new method
6295 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6296 LColor::ignore when lyxname is not found.
6298 * src/BufferView.C (pasteSelection): new method
6300 * src/BufferView_pimpl.C (pasteSelection): new method
6302 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6304 * src/WorkArea.C (request_clipboard_cb): new static function
6305 (getClipboard): new method
6306 (putClipboard): new method
6308 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6310 * LyX 1.1.5pre2 released
6312 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6314 * src/vspace.C (operator=): removed
6315 (operator=): removed
6317 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6319 * src/layout.C (NumberOfClass): manually set the type in make_pair
6320 (NumberOfLayout): ditto
6322 * src/language.C: use the Language constructor for ignore_lang
6324 * src/language.h: add constructors to struct Language
6326 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6328 * src/text2.C (SetCursorIntern): comment out #warning
6330 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6332 * src/mathed/math_iter.h: initialize sx and sw to 0
6334 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6336 * forms/lyx.fd: Redesign of form_ref
6338 * src/LaTeXFeatures.[Ch]
6342 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6345 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6346 and Buffer::inset_iterator.
6348 * src/menus.C: Added new menus: TOC and Refs.
6350 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6352 * src/buffer.C (getTocList): New method.
6354 * src/BufferView2.C (ChangeRefs): New method.
6356 * src/buffer.C (getLabelList): New method. It replaces the old
6357 getReferenceList. The return type is vector<string> instead of
6360 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6361 the old getLabel() and GetNumberOfLabels() methods.
6362 * src/insets/insetlabel.C (getLabelList): ditto
6363 * src/mathed/formula.C (getLabelList): ditto
6365 * src/paragraph.C (String): New method.
6367 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6368 Uses the new getTocList() method.
6369 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6370 which automatically updates the contents of the browser.
6371 (RefUpdateCB): Use the new getLabelList method.
6373 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6375 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6377 * src/spellchecker.C: Added using std::reverse;
6379 2000-05-19 Juergen Vigna <jug@sad.it>
6381 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6383 * src/insets/insettext.C (computeTextRows): small fix for display of
6384 1 character after a newline.
6386 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6389 2000-05-18 Juergen Vigna <jug@sad.it>
6391 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6392 when changing width of column.
6394 * src/tabular.C (set_row_column_number_info): setting of
6395 autobreak rows if necessary.
6397 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6399 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6401 * src/vc-backend.*: renamed stat() to status() and vcstat to
6402 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6403 compilation broke. The new name seems more relevant, anyway.
6405 2000-05-17 Juergen Vigna <jug@sad.it>
6407 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6408 which was wrong if the removing caused removing of rows!
6410 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6411 (pushToken): new function.
6413 * src/text2.C (CutSelection): fix problem discovered with purify
6415 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6417 * src/debug.C (showTags): enlarge the first column, now that we
6418 have 6-digits debug codes.
6420 * lib/layouts/hollywood.layout:
6421 * lib/tex/hollywood.cls:
6422 * lib/tex/brodway.cls:
6423 * lib/layouts/brodway.layout: more commands and fewer
6424 environments. Preambles moved in the .cls files. Broadway now has
6425 more options on scene numbering and less whitespace (from Garst)
6427 * src/insets/insetbib.C (getKeys): make sure that we are in the
6428 document directory, in case the bib file is there.
6430 * src/insets/insetbib.C (Latex): revert bogus change.
6432 2000-05-16 Juergen Vigna <jug@sad.it>
6434 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6435 the TabularLayout on cursor move.
6437 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6439 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6442 (draw): fixed cursor position and drawing so that the cursor is
6443 visible when before the tabular-inset.
6445 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6446 when creating from old insettext.
6448 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6450 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6452 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6453 * lib/tex/brodway.cls: ditto
6455 * lib/layouts/brodway.layout: change alignment of parenthical
6458 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6460 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6461 versions 0.88 and 0.89 are supported.
6463 2000-05-15 Juergen Vigna <jug@sad.it>
6465 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6468 * src/insets/insettext.C (computeTextRows): redone completely this
6469 function in a much cleaner way, because of problems when having a
6471 (draw): added a frame border when the inset is locked.
6472 (SetDrawLockedFrame): this sets if we draw the border or not.
6473 (SetFrameColor): this sets the frame color (default=insetframe).
6475 * src/insets/lyxinset.h: added x() and y() functions which return
6476 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6477 function which is needed to see if we have a locking inset of some
6478 type in this inset (needed for now in insettabular).
6480 * src/vspace.C (inPixels): the same function also without a BufferView
6481 parameter as so it is easier to use it in some ocasions.
6483 * src/lyxfunc.C: changed all places where insertInset was used so
6484 that now if it couldn't be inserted it is deleted!
6486 * src/TabularLayout.C:
6487 * src/TableLayout.C: added support for new tabular-inset!
6489 * src/BufferView2.C (insertInset): this now returns a bool if the
6490 inset was really inserted!!!
6492 * src/tabular.C (GetLastCellInRow):
6493 (GetFirstCellInRow): new helper functions.
6494 (Latex): implemented for new tabular class.
6498 (TeXTopHLine): new Latex() helper functions.
6500 2000-05-12 Juergen Vigna <jug@sad.it>
6502 * src/mathed/formulamacro.C (Read):
6503 * src/mathed/formula.C (Read): read also the \end_inset here!
6505 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6507 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6508 crush when saving formulae with unbalanced parenthesis.
6510 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6512 * src/layout.C: Add new keyword "endlabelstring" to layout file
6514 * src/text.C (GetVisibleRow): Draw endlabel string.
6516 * lib/layouts/broadway.layout
6517 * lib/layouts/hollywood.layout: Added endlabel for the
6518 Parenthetical layout.
6520 * lib/layouts/heb-article.layout: Do not use slanted font shape
6521 for Theorem like environments.
6523 * src/buffer.C (makeLaTeXFile): Always add "american" to
6524 the UsedLanguages list if document language is RTL.
6526 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6528 * add addendum to README.OS2 and small patch (from SMiyata)
6530 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6532 * many files: correct the calls to ChangeExtension().
6534 * src/support/filetools.C (ChangeExtension): remove the no_path
6535 argument, which does not belong there. Use OnlyFileName() instead.
6537 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6538 files when LaTeXing a non-nice latex file.
6540 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6541 a chain of "if". Return false when deadkeys are not handled.
6543 * src/lyx_main.C (LyX): adapted the code for default bindings.
6545 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6546 bindings for basic functionality (except deadkeys).
6547 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6549 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6550 several methods: handle override_x_deadkeys.
6552 * src/lyxrc.h: remove the "bindings" map, which did not make much
6553 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6555 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6557 * src/lyxfont.C (stateText): use a saner method to determine
6558 whether the font is "default". Seems to fix the crash with DEC
6561 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6563 2000-05-08 Juergen Vigna <jug@sad.it>
6565 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6566 TabularLayoutMenu with mouse-button-3
6567 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6569 * src/TabularLayout.C: added this file for having a Layout for
6572 2000-05-05 Juergen Vigna <jug@sad.it>
6574 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6575 recalculating inset-widths.
6576 (TabularFeatures): activated this function so that I can change
6577 tabular-features via menu.
6579 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6580 that I can test some functions with the Table menu.
6582 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6584 * src/lyxfont.C (stateText): guard against stupid c++libs.
6586 * src/tabular.C: add using std::vector
6587 some whitespace changes, + removed som autogenerated code.
6589 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6591 2000-05-05 Juergen Vigna <jug@sad.it>
6593 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6594 row, columns and cellstructures.
6596 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6598 * lib/lyxrc.example: remove obsolete entries.
6600 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6601 reading of protected_separator for free_spacing.
6603 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6605 * src/text.C (draw): do not display an exclamation mark in the
6606 margin for margin notes. This is confusing, ugly and
6609 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6610 AMS math' is checked.
6612 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6613 name to see whether including the amsmath package is needed.
6615 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6617 * src/paragraph.C (validate): Compute UsedLanguages correctly
6618 (don't insert the american language if it doesn't appear in the
6621 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6622 The argument of \thanks{} command is considered moving argument
6624 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6627 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6629 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6630 for appendix/minipage/depth. The lines can be now both in the footnote
6631 frame, and outside the frame.
6633 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6636 2000-05-05 Juergen Vigna <jug@sad.it>
6638 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6639 neede only in tabular.[Ch].
6641 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6643 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6645 (Write): write '~' for PROTECTED_SEPARATOR
6647 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6649 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6652 * src/mathed/formula.C (drawStr): rename size to siz.
6654 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6655 possibly fix a bug by not changing the pflags = flags to piflags =
6658 2000-05-05 Juergen Vigna <jug@sad.it>
6660 * src/insets/insetbib.C: moved using directive
6662 * src/ImportNoweb.C: small fix for being able to compile (missing
6665 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6667 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6668 to use clear, since we don't depend on this in the code. Add test
6671 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6673 * (various *.C files): add using std::foo directives to please dec
6676 * replace calls to string::clear() to string::erase() (Angus)
6678 * src/cheaders/cmath: modified to provide std::abs.
6680 2000-05-04 Juergen Vigna <jug@sad.it>
6682 * src/insets/insettext.C: Prepared all for inserting of multiple
6683 paragraphs. Still display stuff to do (alignment and other things),
6684 but I would like to use LyXText to do this when we cleaned out the
6685 table-support stuff.
6687 * src/insets/insettabular.C: Changed lot of stuff and added lots
6688 of functionality still a lot to do.
6690 * src/tabular.C: Various functions changed name and moved to be
6691 const functions. Added new Read and Write functions and changed
6692 lots of things so it works good with tabular-insets (also removed
6693 some stuff which is not needed anymore * hacks *).
6695 * src/lyxcursor.h: added operators == and != which just look if
6696 par and pos are (not) equal.
6698 * src/buffer.C (latexParagraphs): inserted this function to latex
6699 all paragraphs form par to endpar as then I can use this too for
6702 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6703 so that I can call this to from text insets with their own cursor.
6705 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6706 output off all paragraphs (because of the fix below)!
6708 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6709 the very last paragraph (this could be also the last paragraph of an
6712 * src/texrow.h: added rows() call which returns the count-variable.
6714 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6716 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6718 * lib/configure.m4: better autodetection of DocBook tools.
6720 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6722 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6724 * src/lyx_cb.C: add using std::reverse;
6726 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6729 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6730 selected files. Should fix repeated errors from generated files.
6732 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6734 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6736 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6737 the spellchecker popup.
6739 * lib/lyxrc.example: Removed the \number_inset section
6741 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6743 * src/insets/figinset.C (various): Use IsFileReadable() to make
6744 sure that the file actually exist. Relying on ghostscripts errors
6745 is a bad idea since they can lead to X server crashes.
6747 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6749 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6752 * lib/lyxrc.example: smallish typo in description of
6753 \view_dvi_paper_option
6755 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6758 * src/lyxfunc.C: doImportHelper to factor out common code of the
6759 various import methods. New functions doImportASCIIasLines,
6760 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6761 doImportLinuxDoc for the format specific parts.
6764 * buffer.C: Dispatch returns now a bool to indicate success
6767 * lyx_gui.C: Add getLyXView() for member access
6769 * lyx_main.C: Change logic for batch commands: First try
6770 Buffer::Dispatch (possibly without GUI), if that fails, use
6773 * lyx_main.C: Add support for --import command line switch.
6774 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6775 Available Formats: Everything accepted by 'buffer-import <format>'
6777 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6779 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6782 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6783 documents will be reformatted upon reentry.
6785 2000-04-27 Juergen Vigna <jug@sad.it>
6787 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6788 correctly only last pos this was a bug.
6790 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6792 * release of lyx-1.1.5pre1
6794 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6796 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6798 * src/menus.C: revert the change of naming (Figure->Graphic...)
6799 from 2000-04-11. It was incomplete and bad.
6801 * src/LColor.[Ch]: add LColor::depthbar.
6802 * src/text.C (GetVisibleRow): use it.
6804 * README: update the languages list.
6806 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6808 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6811 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6813 * README: remove sections that were just wrong.
6815 * src/text2.C (GetRowNearY): remove currentrow code
6817 * src/text.C (GetRow): remove currentrow code
6819 * src/screen.C (Update): rewritten a bit.
6820 (SmallUpdate): removed func
6822 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6824 (FullRebreak): return bool
6825 (currentrow): remove var
6826 (currentrow_y): ditto
6828 * src/lyxscreen.h (Draw): change arg to unsigned long
6829 (FitCursor): return bool
6830 (FitManualCursor): ditto
6831 (Smallpdate): remove func
6832 (first): change to unsigned long
6833 (DrawOneRow): change second arg to long (from long &)
6834 (screen_refresh_y): remove var
6835 (scree_refresh_row): ditto
6837 * src/lyxrow.h: change baseline to usigned int from unsigned
6838 short, this brings some implicit/unsigned issues out in the open.
6840 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6842 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6843 instead of smallUpdate.
6845 * src/lyxcursor.h: change y to unsigned long
6847 * src/buffer.h: don't call updateScrollbar after fitcursor
6849 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6850 where they are used. Removed "\\direction", this was not present
6851 in 1.1.4 and is already obsolete. Commented out some code that I
6852 believe to never be called.
6853 (runLiterate): don't call updateScrollbar after fitCursor
6855 (buildProgram): ditto
6858 * src/WorkArea.h (workWidth): change return val to unsigned
6861 (redraw): remove the button redraws
6862 (setScrollbarValue): change for scrollbar
6863 (getScrollbarValue): change for scrollbar
6864 (getScrollbarBounds): change for scrollbar
6866 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6867 (C_WorkArea_down_cb): removed func
6868 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6869 (resize): change for scrollbar
6870 (setScrollbar): ditto
6871 (setScrollbarBounds): ditto
6872 (setScrollbarIncrements): ditto
6873 (up_cb): removed func
6874 (down_cb): removed func
6875 (scroll_cb): change for scrollbar
6876 (work_area_handler): ditto
6878 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6879 when FitCursor did something.
6880 (updateScrollbar): some unsigned changes
6881 (downCB): removed func
6882 (scrollUpOnePage): removed func
6883 (scrollDownOnePage): remvoed func
6884 (workAreaMotionNotify): don't call screen->FitCursor but use
6885 fitCursor instead. and bool return val
6886 (workAreaButtonPress): ditto
6887 (workAreaButtonRelease): some unsigned changes
6888 (checkInsetHit): ditto
6889 (workAreaExpose): ditto
6890 (update): parts rewritten, comments about the signed char arg added
6891 (smallUpdate): removed func
6892 (cursorPrevious): call needed updateScrollbar
6895 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6898 * src/BufferView.[Ch] (upCB): removed func
6899 (downCB): removed func
6900 (smallUpdate): removed func
6902 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6904 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6905 currentrow, currentrow_y optimization. This did not help a lot and
6906 if we want to do this kind of optimization we should rather use
6907 cursor.row instead of the currentrow.
6909 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6910 buffer spacing and klyx spacing support.
6912 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6914 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6917 2000-04-26 Juergen Vigna <jug@sad.it>
6919 * src/insets/figinset.C: fixes to Lars sstream changes!
6921 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6923 * A lot of files: Added Ascii(ostream &) methods to all inset
6924 classes. Used when exporting to ASCII.
6926 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6927 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6930 * src/text2.C (ToggleFree): Disabled implicit word selection when
6931 there is a change in the language
6933 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6934 no output was generated for end-of-sentence inset.
6936 * src/insets/lyxinset.h
6939 * src/paragraph.C: Removed the insetnumber code
6941 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6943 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6945 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6946 no_babel and no_epsfig completely from the file.
6947 (parseSingleLyXformat2Token): add handling for per-paragraph
6948 spacing as written by klyx.
6950 * src/insets/figinset.C: applied patch by Andre. Made it work with
6953 2000-04-20 Juergen Vigna <jug@sad.it>
6955 * src/insets/insettext.C (cutSelection):
6956 (copySelection): Fixed with selection from right to left.
6957 (draw): now the rows are not recalculated at every draw.
6958 (computeTextRows): for now reset the inset-owner here (this is
6959 important for an undo or copy where the inset-owner is not set
6962 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6963 motion to the_locking_inset screen->first was forgotten, this was
6964 not important till we got multiline insets.
6966 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6968 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6969 code seems to be alright (it is code changed by Dekel, and the
6970 intent is indeed that all macros should be defined \protect'ed)
6972 * NEWS: a bit of reorganisation of the new user-visible features.
6974 2000-04-19 Juergen Vigna <jug@sad.it>
6976 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6977 position. Set the inset_owner of the used paragraph so that it knows
6978 that it is inside an inset. Fixed cursor handling with mouse and
6979 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6980 and cleanups to make TextInsets work better.
6982 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6983 Changed parameters of various functions and added LockInsetInInset().
6985 * src/insets/insettext.C:
6987 * src/insets/insetcollapsable.h:
6988 * src/insets/insetcollapsable.C:
6989 * src/insets/insetfoot.h:
6990 * src/insets/insetfoot.C:
6991 * src/insets/insetert.h:
6992 * src/insets/insetert.C: cleaned up the code so that it works now
6993 correctly with insettext.
6995 * src/insets/inset.C:
6996 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6997 that insets in insets are supported right.
7000 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7002 * src/paragraph.C: some small fixes
7004 * src/debug.h: inserted INSETS debug info
7006 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7007 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7009 * src/commandtags.h:
7010 * src/LyXAction.C: insert code for InsetTabular.
7012 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7013 not Button1MotionMask.
7014 (workAreaButtonRelease): send always a InsetButtonRelease event to
7016 (checkInsetHit): some setCursor fixes (always with insets).
7018 * src/BufferView2.C (lockInset): returns a bool now and extended for
7019 locking insets inside insets.
7020 (showLockedInsetCursor): it is important to have the cursor always
7021 before the locked inset.
7022 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7024 * src/BufferView.h: made lockInset return a bool.
7026 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7028 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7029 that is used also internally but can be called as public to have back
7030 a cursor pos which is not set internally.
7031 (SetCursorIntern): Changed to use above function.
7033 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7035 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7040 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7041 patches for things that should be in or should be changed.
7043 * src/* [insetfiles]: change "usigned char fragile" to bool
7044 fragile. There was only one point that could that be questioned
7045 and that is commented in formulamacro.C. Grep for "CHECK".
7047 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7048 (DeleteBuffer): take it out of CutAndPaste and make it static.
7050 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7052 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7053 output the spacing envir commands. Also the new commands used in
7054 the LaTeX output makes the result better.
7056 * src/Spacing.C (writeEnvirBegin): new method
7057 (writeEnvirEnd): new method
7059 2000-04-18 Juergen Vigna <jug@sad.it>
7061 * src/CutAndPaste.C: made textclass a static member of the class
7062 as otherwise it is not accesed right!!!
7064 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7066 * forms/layout_forms.fd
7067 * src/layout_forms.h
7068 * src/layout_forms.C (create_form_form_character)
7069 * src/lyx_cb.C (UserFreeFont)
7070 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7071 documents (in the layout->character popup).
7073 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7075 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7076 \spell_command was in fact not honored (from Kevin Atkinson).
7078 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7081 * src/lyx_gui.h: make lyxViews private (Angus)
7083 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7085 * src/mathed/math_write.C
7086 (MathMatrixInset::Write) Put \protect before \begin{array} and
7087 \end{array} if fragile
7088 (MathParInset::Write): Put \protect before \\ if fragile
7090 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7092 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7093 initialization if the LyXColorHandler must be done after the
7094 connections to the XServer has been established.
7096 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7097 get the background pixel from the lyxColorhandler so that the
7098 figures are rendered with the correct background color.
7099 (NextToken): removed functions.
7100 (GetPSSizes): use ifs >> string instead of NextToken.
7102 * src/Painter.[Ch]: the color cache moved out of this file.
7104 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7107 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7109 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7110 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7112 * src/BufferView.C (enterView): new func
7113 (leaveView): new func
7115 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7117 (leaveView): new func, undefines xterm cursor when approp.
7119 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7120 (AllowInput): delete the Workarea cursor handling from this func.
7122 * src/Painter.C (underline): draw a slimer underline in most cases.
7124 * src/lyx_main.C (error_handler): use extern "C"
7126 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7128 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7129 sent directly to me.
7131 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7132 to the list by Dekel.
7134 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7137 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7138 methods from lyx_cb.here.
7140 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7143 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7145 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7146 instead of using current_view directly.
7148 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7150 * src/LyXAction.C (init): add the paragraph-spacing command.
7152 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7154 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7156 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7157 different from the documents.
7159 * src/text.C (SetHeightOfRow): take paragraph spacing into
7160 account, paragraph spacing takes precedence over buffer spacing
7161 (GetVisibleRow): ditto
7163 * src/paragraph.C (writeFile): output the spacing parameter too.
7164 (validate): set the correct features if spacing is used in the
7166 (Clear): set spacing to default
7167 (MakeSameLayout): spacing too
7168 (HasSameLayout): spacing too
7169 (SetLayout): spacing too
7170 (TeXOnePar): output the spacing commands
7172 * src/lyxparagraph.h: added a spacing variable for use with
7173 per-paragraph spacing.
7175 * src/Spacing.h: add a Default spacing and a method to check if
7176 the current spacing is default. also added an operator==
7178 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7181 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7183 * src/lyxserver.C (callback): fix dispatch of functions
7185 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7186 printf() into lyxerr call.
7188 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7191 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7192 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7193 the "Float" from each of the subitems.
7194 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7196 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7197 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7198 documented the change so that the workaround can be nuked later.
7200 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7203 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7205 * src/buffer.C (getLatexName): ditto
7206 (setReadonly): ditto
7208 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7210 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7211 avoid some uses of current_view. Added also a bufferParams()
7212 method to get at this.
7214 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7216 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7218 * src/lyxparagraph.[Ch]: removed
7219 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7220 with operators used by lower_bound and
7221 upper_bound in InsetTable's
7222 Make struct InsetTable private again. Used matchpos.
7224 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7226 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7227 document, the language of existing text is changed (unless the
7228 document is multi-lingual)
7230 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7232 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7234 * A lot of files: A rewrite of the Right-to-Left support.
7236 2000-04-10 Juergen Vigna <jug@sad.it>
7238 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7239 misplaced cursor when inset in inset is locked.
7241 * src/insets/insettext.C (LocalDispatch): small fix so that a
7242 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7244 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7245 footnote font should be decreased in size twice when displaying.
7247 * src/insets/insettext.C (GetDrawFont): inserted this function as
7248 the drawing-font may differ from the real paragraph font.
7250 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7251 insets (inset in inset!).
7253 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7254 function here because we don't want footnotes inside footnotes.
7256 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7258 (init): now set the inset_owner in paragraph.C
7259 (LocalDispatch): added some resetPos() in the right position
7262 (pasteSelection): changed to use the new CutAndPaste-Class.
7264 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7265 which tells if it is allowed to insert another inset inside this one.
7267 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7268 SwitchLayoutsBetweenClasses.
7270 * src/text2.C (InsertInset): checking of the new paragraph-function
7272 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7273 is not needed anymore here!
7276 (PasteSelection): redone (also with #ifdef) so that now this uses
7277 the CutAndPaste-Class.
7278 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7281 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7282 from/to text/insets.
7284 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7285 so that the paragraph knows if it is inside an (text)-inset.
7286 (InsertFromMinibuffer): changed return-value to bool as now it
7287 may happen that an inset is not inserted in the paragraph.
7288 (InsertInsetAllowed): this checks if it is allowed to insert an
7289 inset in this paragraph.
7291 (BreakParagraphConservative):
7292 (BreakParagraph) : small change for the above change of the return
7293 value of InsertFromMinibuffer.
7295 * src/lyxparagraph.h: added inset_owner and the functions to handle
7296 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7298 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7300 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7301 functions from BufferView to BufferView::Pimpl to ease maintence.
7303 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7304 correctly. Also use SetCursorIntern instead of SetCursor.
7306 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7309 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7311 * src/WorkArea.C (belowMouse): manually implement below mouse.
7313 * src/*: Add "explicit" on several constructors, I added probably
7314 some unneeded ones. A couple of changes to code because of this.
7316 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7317 implementation and private parts from the users of BufferView. Not
7320 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7321 implementation and private parts from the users of LyXLex. Not
7324 * src/BufferView_pimpl.[Ch]: new files
7326 * src/lyxlex_pimpl.[Ch]: new files
7328 * src/LyXView.[Ch]: some inline functions move out-of-line
7330 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7332 * src/lyxparagraph.h: make struct InsetTable public.
7334 * src/support/lyxstring.h: change lyxstring::difference_type to be
7335 ptrdiff_t. Add std:: modifiers to streams.
7337 * src/font.C: include the <cctype> header, for islower() and
7340 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7342 * src/font.[Ch]: new files. Contains the metric functions for
7343 fonts, takes a LyXFont as parameter. Better separation of concepts.
7345 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7346 changes because of this.
7348 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7350 * src/*: compile with -Winline and move functions that don't
7353 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7356 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7358 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7359 (various files changed because of this)
7361 * src/Painter.C (text): fixed the drawing of smallcaps.
7363 * src/lyxfont.[Ch] (drawText): removed unused member func.
7366 * src/*.C: added needed "using" statements and "std::" qualifiers.
7368 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7370 * src/*.h: removed all use of "using" from header files use
7371 qualifier std:: instead.
7373 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7375 * src/text.C (Backspace): some additional cleanups (we already
7376 know whether cursor.pos is 0 or not).
7378 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7379 automake does not provide one).
7381 * src/bmtable.h: replace C++ comments with C comments.
7383 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7385 * src/screen.C (ShowCursor): Change the shape of the cursor if
7386 the current language is not equal to the language of the document.
7387 (If the cursor change its shape unexpectedly, then you've found a bug)
7389 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7392 * src/insets/insetnumber.[Ch]: New files.
7394 * src/LyXAction.C (init)
7395 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7398 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7400 * src/lyxparagraph.h
7401 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7402 (the vector is kept sorted).
7404 * src/text.C (GetVisibleRow): Draw selection correctly when there
7405 is both LTR and RTL text.
7407 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7408 which is much faster.
7410 * src/text.C (GetVisibleRow and other): Do not draw the last space
7411 in a row if the direction of the last letter is not equal to the
7412 direction of the paragraph.
7414 * src/lyxfont.C (latexWriteStartChanges):
7415 Check that font language is not equal to basefont language.
7416 (latexWriteEndChanges): ditto
7418 * src/lyx_cb.C (StyleReset): Don't change the language while using
7419 the font-default command.
7421 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7422 empty paragraph before a footnote.
7424 * src/insets/insetcommand.C (draw): Increase x correctly.
7426 * src/screen.C (ShowCursor): Change cursor shape if
7427 current language != document language.
7429 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7431 2000-03-31 Juergen Vigna <jug@sad.it>
7433 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7434 (Clone): changed mode how the paragraph-data is copied to the
7435 new clone-paragraph.
7437 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7438 GetInset(pos) with no inset anymore there (in inset UNDO)
7440 * src/insets/insetcommand.C (draw): small fix as here x is
7441 incremented not as much as width() returns (2 before, 2 behind = 4)
7443 2000-03-30 Juergen Vigna <jug@sad.it>
7445 * src/insets/insettext.C (InsetText): small fix in initialize
7446 widthOffset (should not be done in the init() function)
7448 2000-03-29 Amir Karger <karger@lyx.org>
7450 * lib/examples/it_ItemizeBullets.lyx: translation by
7453 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7455 2000-03-29 Juergen Vigna <jug@sad.it>
7457 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7459 * src/insets/insetfoot.C (Clone): small change as for the below
7460 new init function in the text-inset
7462 * src/insets/insettext.C (init): new function as I've seen that
7463 clone did not copy the Paragraph-Data!
7464 (LocalDispatch): Added code so that now we have some sort of Undo
7465 functionality (well actually we HAVE Undo ;)
7467 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7469 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7471 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7474 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7476 * src/main.C: added a runtime check that verifies that the xforms
7477 header used when building LyX and the library used when running
7478 LyX match. Exit with a message if they don't match. This is a
7479 version number check only.
7481 * src/buffer.C (save): Don't allocate memory on the heap for
7482 struct utimbuf times.
7484 * *: some using changes, use iosfwd instead of the real headers.
7486 * src/lyxfont.C use char const * instead of string for the static
7487 strings. Rewrite some functions to use sstream.
7489 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7491 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7494 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7496 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7497 of Geodesy (from Martin Vermeer)
7499 * lib/layouts/svjour.inc: include file for the Springer svjour
7500 class. It can be used to support journals other than JoG.
7502 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7503 Miskiewicz <misiek@pld.org.pl>)
7504 * lib/reLyX/Makefile.am: ditto.
7506 2000-03-27 Juergen Vigna <jug@sad.it>
7508 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7509 also some modifications with operations on selected text.
7511 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7512 problems with clicking on insets (last famous words ;)
7514 * src/insets/insetcommand.C (draw):
7515 (width): Changed to have a bit of space before and after the inset so
7516 that the blinking cursor can be seen (otherwise it was hidden)
7518 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7520 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7521 would not be added to the link list when an installed gettext (not
7522 part of libc) is found.
7524 2000-03-24 Juergen Vigna <jug@sad.it>
7526 * src/insets/insetcollapsable.C (Edit):
7527 * src/mathed/formula.C (InsetButtonRelease):
7528 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7531 * src/BufferView.C (workAreaButtonPress):
7532 (workAreaButtonRelease):
7533 (checkInsetHit): Finally fixed the clicking on insets be handled
7536 * src/insets/insetert.C (Edit): inserted this call so that ERT
7537 insets work always with LaTeX-font
7539 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7541 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7542 caused lyx to startup with no GUI in place, causing in a crash
7543 upon startup when called with arguments.
7545 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7547 * src/FontLoader.C: better initialization of dummyXFontStruct.
7549 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7551 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7552 for linuxdoc and docbook import and export format options.
7554 * lib/lyxrc.example Example of default values for the previous flags.
7556 * src/lyx_cb.C Use those flags instead of the hardwired values for
7557 linuxdoc and docbook export.
7559 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7562 * src/menus.C Added menus entries for the new import/exports formats.
7564 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7566 * src/lyxrc.*: Added support for running without Gui
7569 * src/FontLoader.C: sensible defaults if no fonts are needed
7571 * src/lyx_cb.C: New function ShowMessage (writes either to the
7572 minibuffer or cout in case of no gui
7573 New function AskOverwrite for common stuff
7574 Consequently various changes to call these functions
7576 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7577 wild guess at sensible screen resolution when having no gui
7579 * src/lyxfont.C: no gui, no fonts... set some defaults
7581 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7583 * src/LColor.C: made the command inset background a bit lighter.
7585 2000-03-20 Hartmut Goebel <goebel@noris.net>
7587 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7588 stdstruct.inc. Koma-Script added some title elements which
7589 otherwise have been listed below "bibliography". This split allows
7590 adding title elements to where they belong.
7592 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7593 define the additional title elements and then include
7596 * many other layout files: changed to include stdtitle.inc just
7597 before stdstruct.inc.
7599 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7601 * src/buffer.C: (save) Added the option to store all backup files
7602 in a single directory
7604 * src/lyxrc.[Ch]: Added variable \backupdir_path
7606 * lib/lyxrc.example: Added descriptions of recently added variables
7608 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7609 bibtex inset, not closing the bibtex popup when deleting the inset)
7611 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7613 * src/lyx_cb.C: add a couple using directives.
7615 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7616 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7617 import based on the filename.
7619 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7620 file would be imported at start, if the filename where of a sgml file.
7622 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7624 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7626 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7627 * src/lyxfont.h Replaced the member variable bits.direction by the
7628 member variable lang. Made many changes in other files.
7629 This allows having a multi-lingual document
7631 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7632 that change the current language to <l>.
7633 Removed the command "font-rtl"
7635 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7636 format for Hebrew documents)
7638 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7639 When auto_mathmode is "true", pressing a digit key in normal mode
7640 will cause entering into mathmode.
7641 If auto_mathmode is "rtl" then this behavior will be active only
7642 when writing right-to-left text.
7644 * src/text2.C (InsertStringA) The string is inserted using the
7647 * src/paragraph.C (GetEndLabel) Gives a correct result for
7648 footnote paragraphs.
7650 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7652 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7654 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7655 front of PasteParagraph. Never insert a ' '. This should at least
7656 fix some cause for the segfaults that we have been experiencing,
7657 it also fixes backspace behaviour slightly. (Phu!)
7659 * src/support/lstrings.C (compare_no_case): some change to make it
7660 compile with gcc 2.95.2 and stdlibc++-v3
7662 * src/text2.C (MeltFootnoteEnvironment): change type o
7663 first_footnote_par_is_not_empty to bool.
7665 * src/lyxparagraph.h: make text private. Changes in other files
7667 (fitToSize): new function
7668 (setContentsFromPar): new function
7669 (clearContents): new function
7670 (SetChar): new function
7672 * src/paragraph.C (readSimpleWholeFile): deleted.
7674 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7675 the file, just use a simple string instead. Also read the file in
7676 a more maintainable manner.
7678 * src/text2.C (InsertStringA): deleted.
7679 (InsertStringB): deleted.
7681 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7683 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7684 RedoParagraphs from the doublespace handling part, just set status
7685 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7686 done, but perhaps not like this.)
7688 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7690 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7691 character when inserting an inset.
7693 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7695 * src/bufferparams.C (readLanguage): now takes "default" into
7698 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7699 also initialize the toplevel_keymap with the default bindings from
7702 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7704 * all files using lyxrc: have lyxrc as a real variable and not a
7705 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7708 * src/lyxrc.C: remove double call to defaultKeyBindings
7710 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7711 toolbar defauls using lyxlex. Remove enums, structs, functions
7714 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7715 toolbar defaults. Also store default keybindings in a map.
7717 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7718 storing the toolbar defaults without any xforms dependencies.
7720 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7721 applied. Changed to use iterators.
7723 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7725 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7726 systems that don't have LINGUAS set to begin with.
7728 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7730 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7731 the list by Dekel Tsur.
7733 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7735 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7736 * src/insets/form_graphics.C: ditto.
7738 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7740 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7742 * src/bufferparams.C (readLanguage): use the new language map
7744 * src/intl.C (InitKeyMapper): use the new language map
7746 * src/lyx_gui.C (create_forms): use the new language map
7748 * src/language.[Ch]: New files. Used for holding the information
7749 about each language. Now! Use this new language map enhance it and
7750 make it really usable for our needs.
7752 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7754 * screen.C (ShowCursor): Removed duplicate code.
7755 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7756 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7758 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7761 * src/text.C Added TransformChar method. Used for rendering Arabic
7762 text correctly (change the glyphs of the letter according to the
7763 position in the word)
7768 * src/lyxrc.C Added lyxrc command {language_command_begin,
7769 language_command_end,language_command_ltr,language_command_rtl,
7770 language_package} which allows the use of either arabtex or Omega
7773 * src/lyx_gui.C (init)
7775 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7776 to use encoding for menu fonts which is different than the encoding
7779 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7780 do not load the babel package.
7781 To write an English document with Hebrew/Arabic, change the document
7782 language to "english".
7784 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7785 (alphaCounter): changed to return char
7786 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7788 * lib/lyxrc.example Added examples for Hebrew/Arabic
7791 * src/layout.C Added layout command endlabeltype
7793 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7795 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7797 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7799 * src/mathed/math_delim.C (search_deco): return a
7800 math_deco_struct* instead of index.
7802 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7804 * All files with a USE_OSTREAM_ONLY within: removed all code that
7805 was unused when USE_OSTREAM_ONLY is defined.
7807 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7808 of any less. Removed header and using.
7810 * src/text.C (GetVisibleRow): draw the string "Page Break
7811 (top/bottom)" on screen when drawing a pagebreak line.
7813 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7815 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7817 * src/mathed/math_macro.C (draw): do some cast magic.
7820 * src/mathed/math_defs.h: change byte* argument to byte const*.
7822 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7824 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7825 know it is right to return InsetFoot* too, but cxx does not like
7828 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7830 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7832 * src/mathed/math_delim.C: change == to proper assignment.
7834 2000-03-09 Juergen Vigna <jug@sad.it>
7836 * src/insets/insettext.C (setPos): fixed various cursor positioning
7837 problems (via mouse and cursor-keys)
7838 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7839 inset (still a small display problem but it works ;)
7841 * src/insets/insetcollapsable.C (draw): added button_top_y and
7842 button_bottom_y to have correct values for clicking on the inset.
7844 * src/support/lyxalgo.h: commented out 'using std::less'
7846 2000-03-08 Juergen Vigna <jug@sad.it>
7848 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7849 Button-Release event closes as it is alos the Release-Event
7852 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7854 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7856 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7857 can add multiple spaces in Scrap (literate programming) styles...
7858 which, by the way, is how I got hooked on LyX to begin with.
7860 * src/mathed/formula.C (Write): Added dummy variable to an
7861 inset::Latex() call.
7862 (Latex): Add free_spacing boolean to inset::Latex()
7864 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7866 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7867 virtual function to include the free_spacing boolean from
7868 the containing paragraph's style.
7870 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7871 Added free_spacing boolean arg to match inset.h
7873 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7874 Added free_spacing boolean arg to match inset.h
7876 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7877 Added free_spacing boolean and made sure that if in a free_spacing
7878 paragraph, that we output normal space if there is a protected space.
7880 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7881 Added free_spacing boolean arg to match inset.h
7883 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7884 Added free_spacing boolean arg to match inset.h
7886 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7887 Added free_spacing boolean arg to match inset.h
7889 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7890 Added free_spacing boolean arg to match inset.h
7892 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7893 Added free_spacing boolean arg to match inset.h
7895 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7896 free_spacing boolean arg to match inset.h
7898 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7899 Added free_spacing boolean arg to match inset.h
7901 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7902 Added free_spacing boolean arg to match inset.h
7904 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7905 Added free_spacing boolean arg to match inset.h
7907 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7908 Added free_spacing boolean arg to match inset.h
7910 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7911 Added free_spacing boolean arg to match inset.h
7913 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7914 free_spacing boolean arg to match inset.h
7916 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7917 free_spacing boolean arg to match inset.h
7919 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7920 ignore free_spacing paragraphs. The user's spaces are left
7923 * src/text.C (InsertChar): Fixed the free_spacing layout
7924 attribute behavior. Now, if free_spacing is set, you can
7925 add multiple spaces in a paragraph with impunity (and they
7926 get output verbatim).
7927 (SelectSelectedWord): Added dummy argument to inset::Latex()
7930 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7933 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7934 paragraph layouts now only input a simple space instead.
7935 Special character insets don't make any sense in free-spacing
7938 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7939 hard-spaces in the *input* file to simple spaces if the layout
7940 is free-spacing. This converts old files which had to have
7941 hard-spaces in free-spacing layouts where a simple space was
7943 (writeFileAscii): Added free_spacing check to pass to the newly
7944 reworked inset::Latex(...) methods. The inset::Latex() code
7945 ensures that hard-spaces in free-spacing paragraphs get output
7946 as spaces (rather than "~").
7948 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7950 * src/mathed/math_delim.C (draw): draw the empty placeholder
7951 delims with a onoffdash line.
7952 (struct math_deco_compare): struct that holds the "functors" used
7953 for the sort and the binary search in math_deco_table.
7954 (class init_deco_table): class used for initial sort of the
7956 (search_deco): use lower_bound to do a binary search in the
7959 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7961 * src/lyxrc.C: a small secret thingie...
7963 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7964 and to not flush the stream as often as it used to.
7966 * src/support/lyxalgo.h: new file
7967 (sorted): template function used for checking if a sequence is
7968 sorted or not. Two versions with and without user supplied
7969 compare. Uses same compare as std::sort.
7971 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7972 it and give warning on lyxerr.
7974 (struct compare_tags): struct with function operators used for
7975 checking if sorted, sorting and lower_bound.
7976 (search_kw): use lower_bound instead of manually implemented
7979 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7981 * src/insets/insetcollapsable.h: fix Clone() declaration.
7982 * src/insets/insetfoot.h: ditto.
7984 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7986 2000-03-08 Juergen Vigna <jug@sad.it>
7988 * src/insets/lyxinset.h: added owner call which tells us if
7989 this inset is inside another inset. Changed also the return-type
7990 of Editable to an enum so it tells clearer what the return-value is.
7992 * src/insets/insettext.C (computeTextRows): fixed computing of
7993 textinsets which split automatically on more rows.
7995 * src/insets/insetert.[Ch]: changed this to be of BaseType
7998 * src/insets/insetfoot.[Ch]: added footnote inset
8000 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8001 collapsable insets (like footnote, ert, ...)
8003 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8005 * src/lyxdraw.h: remvoe file
8007 * src/lyxdraw.C: remove file
8009 * src/insets/insettext.C: added <algorithm>.
8011 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8013 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8014 (matrix_cb): case MM_OK use string stream
8016 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8019 * src/mathed/math_macro.C (draw): use string stream
8020 (Metrics): use string stream
8022 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8023 directly to the ostream.
8025 * src/vspace.C (asString): use string stream.
8026 (asString): use string stream
8027 (asLatexString): use string stream
8029 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8030 setting Spacing::Other.
8032 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8033 sprintf when creating the stretch vale.
8035 * src/text2.C (alphaCounter): changed to return a string and to
8036 not use a static variable internally. Also fixed a one-off bug.
8037 (SetCounter): changed the drawing of the labels to use string
8038 streams instead of sprintf.
8040 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8041 manipulator to use a scheme that does not require library support.
8042 This is also the way it is done in the new GNU libstdc++. Should
8043 work with DEC cxx now.
8045 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8047 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8048 end. This fixes a bug.
8050 * src/mathed (all files concerned with file writing): apply the
8051 USE_OSTREAM_ONLY changes to mathed too.
8053 * src/support/DebugStream.h: make the constructor explicit.
8055 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8056 count and ostream squashed.
8058 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8060 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8062 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8063 ostringstream uses STL strings, and we might not.
8065 * src/insets/insetspecialchar.C: add using directive.
8066 * src/insets/insettext.C: ditto.
8068 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8070 * lib/layouts/seminar.layout: feeble attempt at a layout for
8071 seminar.cls, far from completet and could really use some looking
8072 at from people used to write layout files.
8074 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8075 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8076 a lot nicer and works nicely with ostreams.
8078 * src/mathed/formula.C (draw): a slightly different solution that
8079 the one posted to the list, but I think this one works too. (font
8080 size wrong in headers.)
8082 * src/insets/insettext.C (computeTextRows): some fiddling on
8083 Jürgens turf, added some comments that he should read.
8085 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8086 used and it gave compiler warnings.
8087 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8090 * src/lyx_gui.C (create_forms): do the right thing when
8091 show_banner is true/false.
8093 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8094 show_banner is false.
8096 * most file writing files: Now use iostreams to do almost all of
8097 the writing. Also instead of passing string &, we now use
8098 stringstreams. mathed output is still not adapted to iostreams.
8099 This change can be turned off by commenting out all the occurences
8100 of the "#define USE_OSTREAM_ONLY 1" lines.
8102 * src/WorkArea.C (createPixmap): don't output debug messages.
8103 (WorkArea): don't output debug messages.
8105 * lib/lyxrc.example: added a comment about the new variable
8108 * development/Code_rules/Rules: Added some more commente about how
8109 to build class interfaces and on how better encapsulation can be
8112 2000-03-03 Juergen Vigna <jug@sad.it>
8114 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8115 automatically with the width of the LyX-Window
8117 * src/insets/insettext.C (computeTextRows): fixed update bug in
8118 displaying text-insets (scrollvalues where not initialized!)
8120 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8122 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8123 id in the check of the result from lower_bound is not enough since
8124 lower_bound can return last too, and then res->id will not be a
8127 * all insets and some code that use them: I have conditionalized
8128 removed the Latex(string & out, ...) this means that only the
8129 Latex(ostream &, ...) will be used. This is a work in progress to
8130 move towards using streams for all output of files.
8132 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8135 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8137 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8138 routine (this fixes bug where greek letters were surrounded by too
8141 * src/support/filetools.C (findtexfile): change a bit the search
8142 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8143 no longer passed to kpsewhich, we may have to change that later.
8145 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8146 warning options to avoid problems with X header files (from Angus
8148 * acinclude.m4: regenerated.
8150 2000-03-02 Juergen Vigna <jug@sad.it>
8152 * src/insets/insettext.C (WriteParagraphData): Using the
8153 par->writeFile() function for writing paragraph-data.
8154 (Read): Using buffer->parseSingleLyXformat2Token()-function
8155 for parsing paragraph data!
8157 * src/buffer.C (readLyXformat2): removed all parse data and using
8158 the new parseSingleLyXformat2Token()-function.
8159 (parseSingleLyXformat2Token): added this function to parse (read)
8160 lyx-file-format (this is called also from text-insets now!)
8162 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8164 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8167 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8168 directly instead of going through a func. One very bad thing: a
8169 static LyXFindReplace, but I don't know where to place it.
8171 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8172 string instead of char[]. Also changed to static.
8173 (GetSelectionOrWordAtCursor): changed to static inline
8174 (SetSelectionOverLenChars): ditto.
8176 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8177 current_view and global variables. both classes has changed names
8178 and LyXFindReplace is not inherited from SearchForm.
8180 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8181 fl_form_search form.
8183 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8185 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8187 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8188 bound (from Kayvan).
8190 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8192 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8194 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8196 * some things that I should comment but the local pub says head to
8199 * comment out all code that belongs to the Roff code for Ascii
8200 export of tables. (this is unused)
8202 * src/LyXView.C: use correct type for global variable
8203 current_layout. (LyXTextClass::size_type)
8205 * some code to get the new insetgraphics closer to working I'd be
8206 grateful for any help.
8208 * src/BufferView2.C (insertInset): use the return type of
8209 NumberOfLayout properly. (also changes in other files)
8211 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8212 this as a test. I want to know what breaks because of this.
8214 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8216 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8218 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8219 to use a \makebox in the label, this allows proper justification
8220 with out using protected spaces or multiple hfills. Now it is
8221 "label" for left justified, "\hfill label\hfill" for center, and
8222 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8223 should be changed accordingly.
8225 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8227 * src/lyxtext.h: change SetLayout() to take a
8228 LyXTextClass::size_type instead of a char (when there is more than
8229 127 layouts in a class); also change type of copylayouttype.
8230 * src/text2.C (SetLayout): ditto.
8231 * src/LyXView.C (updateLayoutChoice): ditto.
8233 * src/LaTeX.C (scanLogFile): errors where the line number was not
8234 given just after the '!'-line were ignored (from Dekel Tsur).
8236 * lib/lyxrc.example: fix description of \date_insert_format
8238 * lib/layouts/llncs.layout: new layout, contributed by Martin
8241 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8243 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8244 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8245 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8246 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8247 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8248 paragraph.C, text.C, text2.C)
8250 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8252 * src/insets/insettext.C (LocalDispatch): remove extra break
8255 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8256 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8258 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8259 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8261 * src/insets/insetbib.h: move InsetBibkey::Holder and
8262 InsetCitation::Holder in public space.
8264 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8266 * src/insets/insettext.h: small change to get the new files from
8267 Juergen to compile (use "string", not "class string").
8269 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8270 const & as parameter to LocalDispatch, use LyXFont const & as
8271 paramter to some other func. This also had impacto on lyxinsets.h
8272 and the two mathed insets.
8274 2000-02-24 Juergen Vigna <jug@sad.it>
8277 * src/commandtags.h:
8279 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8283 * src/BufferView2.C: added/updated code for various inset-functions
8285 * src/insets/insetert.[Ch]: added implementation of InsetERT
8287 * src/insets/insettext.[Ch]: added implementation of InsetText
8289 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8290 (draw): added preliminary code for inset scrolling not finshed yet
8292 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8293 as it is in lyxfunc.C now
8295 * src/insets/lyxinset.h: Added functions for text-insets
8297 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8299 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8300 BufferView and reimplement the list as a queue put inside its own
8303 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8305 * several files: use the new interface to the "updateinsetlist"
8307 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8309 (work_area_handler): call BufferView::trippleClick on trippleclick.
8311 * src/BufferView.C (doubleClick): new function, selects word on
8313 (trippleClick): new function, selects line on trippleclick.
8315 2000-02-22 Allan Rae <rae@lyx.org>
8317 * lib/bind/xemacs.bind: buffer-previous not supported
8319 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8321 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8324 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8326 * src/bufferlist.C: get rid of current_view from this file
8328 * src/spellchecker.C: get rid of current_view from this file
8330 * src/vspace.C: get rid of current_view from this file
8331 (inPixels): added BufferView parameter for this func
8332 (asLatexCommand): added a BufferParams for this func
8334 * src/text.C src/text2.C: get rid of current_view from these
8337 * src/lyxfont.C (getFontDirection): move this function here from
8340 * src/bufferparams.C (getDocumentDirection): move this function
8343 * src/paragraph.C (getParDirection): move this function here from
8345 (getLetterDirection): ditto
8347 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8349 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8350 resize due to wrong pixmap beeing used. Also took the opurtunity
8351 to make the LyXScreen stateless on regard to WorkArea and some
8352 general cleanup in the same files.
8354 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8356 * src/Makefile.am: add missing direction.h
8358 * src/PainterBase.h: made the width functions const.
8360 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8363 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8365 * src/insets/insetlatexaccent.C (draw): make the accents draw
8366 better, at present this will only work well with iso8859-1.
8368 * several files: remove the old drawing code, now we use the new
8371 * several files: remove support for mono_video, reverse_video and
8374 2000-02-17 Juergen Vigna <jug@sad.it>
8376 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8377 int ** as we have to return the pointer, otherwise we have only
8378 NULL pointers in the returning function.
8380 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8382 * src/LaTeX.C (operator()): quote file name when running latex.
8384 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8386 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8387 (bubble tip), this removes our special handling of this.
8389 * Remove all code that is unused now that we have the new
8390 workarea. (Code that are not active when NEW_WA is defined.)
8392 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8394 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8396 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8397 nonexisting layout; correctly redirect obsoleted layouts.
8399 * lib/lyxrc.example: document \view_dvi_paper_option
8401 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8404 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8405 (PreviewDVI): handle the view_dvi_paper_option variable.
8406 [Both from Roland Krause]
8408 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8410 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8411 char const *, int, LyXFont)
8412 (text(int, int, string, LyXFont)): ditto
8414 * src/text.C (InsertCharInTable): attempt to fix the double-space
8415 feature in tables too.
8416 (BackspaceInTable): ditto.
8417 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8419 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8421 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8423 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8424 newly found text in textcache to this.
8425 (buffer): set the owner of the text put into the textcache to 0
8427 * src/insets/figinset.C (draw): fixed the drawing of figures with
8430 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8431 drawing of mathframe, hfills, protected space, table lines. I have
8432 now no outstanding drawing problems with the new Painter code.
8434 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8436 * src/PainterBase.C (ellipse, circle): do not specify the default
8439 * src/LColor.h: add using directive.
8441 * src/Painter.[Ch]: change return type of methods from Painter& to
8442 PainterBase&. Add a using directive.
8444 * src/WorkArea.C: wrap xforms callbacks in C functions
8447 * lib/layouts/foils.layout: font fix and simplifications from Carl
8450 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8452 * a lot of files: The Painter, LColor and WorkArea from the old
8453 devel branch has been ported to lyx-devel. Some new files and a
8454 lot of #ifdeffed code. The new workarea is enabled by default, but
8455 if you want to test the new Painter and LColor you have to compile
8456 with USE_PAINTER defined (do this in config.h f.ex.) There are
8457 still some rought edges, and I'd like some help to clear those
8458 out. It looks stable (loads and displays the Userguide very well).
8461 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8463 * src/buffer.C (pop_tag): revert to the previous implementation
8464 (use a global variable for both loops).
8466 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8468 * src/lyxrc.C (LyXRC): change slightly default date format.
8470 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8471 there is an English text with a footnote that starts with a Hebrew
8472 paragraph, or vice versa.
8473 (TeXFootnote): ditto.
8475 * src/text.C (LeftMargin): allow for negative values for
8476 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8479 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8480 for input encoding (cyrillic)
8482 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8484 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8487 * src/toolbar.C (set): ditto
8488 * src/insets/insetbib.C (create_form_citation_form): ditto
8490 * lib/CREDITS: added Dekel Tsur.
8492 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8493 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8494 hebrew supports files from Dekel Tsur.
8496 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8497 <tzafrir@technion.ac.il>
8499 * src/lyxrc.C: put \date_insert_format at the right place.
8501 * src/buffer.C (makeLaTeXFile): fix the handling of
8502 BufferParams::sides when writing out latex files.
8504 * src/BufferView2.C: add a "using" directive.
8506 * src/support/lyxsum.C (sum): when we use lyxstring,
8507 ostringstream::str needs an additional .c_str().
8509 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8511 * src/support/filetools.C (ChangeExtension): patch from Etienne
8514 * src/TextCache.C (show): remove const_cast and make second
8515 parameter non-const LyXText *.
8517 * src/TextCache.h: use non const LyXText in show.
8519 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8522 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8524 * src/support/lyxsum.C: rework to be more flexible.
8526 * several places: don't check if a pointer is 0 if you are going
8529 * src/text.C: remove some dead code.
8531 * src/insets/figinset.C: remove some dead code
8533 * src/buffer.C: move the BufferView funcs to BufferView2.C
8534 remove all support for insetlatexdel
8535 remove support for oldpapersize stuff
8536 made some member funcs const
8538 * src/kbmap.C: use a std::list to store the bindings in.
8540 * src/BufferView2.C: new file
8542 * src/kbsequence.[Ch]: new files
8544 * src/LyXAction.C + others: remove all trace of buffer-previous
8546 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8547 only have one copy in the binary of this table.
8549 * hebrew patch: moved some functions from LyXText to more
8550 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8552 * several files: remove support for XForms older than 0.88
8554 remove some #if 0 #endif code
8556 * src/TextCache.[Ch]: new file. Holds the textcache.
8558 * src/BufferView.C: changes to use the new TextCache interface.
8559 (waitForX): remove the now unused code.
8561 * src/BackStack.h: remove some commented code
8563 * lib/bind/emacs.bind: remove binding for buffer-previous
8565 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8567 * applied the hebrew patch.
8569 * src/lyxrow.h: make sure that all Row variables are initialized.
8571 * src/text2.C (TextHandleUndo): comment out a delete, this might
8572 introduce a memory leak, but should also help us to not try to
8573 read freed memory. We need to look at this one.
8575 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8576 (LyXParagraph): initalize footnotekind.
8578 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8579 forgot this when applying the patch. Please heed the warnings.
8581 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8582 (aka. reformat problem)
8584 * src/bufferlist.C (exists): made const, and use const_iterator
8585 (isLoaded): new func.
8586 (release): use std::find to find the correct buffer.
8588 * src/bufferlist.h: made getState a const func.
8589 made empty a const func.
8590 made exists a const func.
8593 2000-02-01 Juergen Vigna <jug@sad.it>
8595 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8597 * po/it.po: updated a bit the italian po file and also changed the
8598 'file nuovo' for newfile to 'filenuovo' without a space, this did
8601 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8602 for the new insert_date command.
8604 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8605 from jdblair, to insert a date into the current text conforming to
8606 a strftime format (for now only considering the locale-set and not
8607 the document-language).
8609 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8611 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8612 Bounds Read error seen by purify. The problem was that islower is
8613 a macros which takes an unsigned char and uses it as an index for
8614 in array of characters properties (and is thus subject to the
8618 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8619 correctly the paper sides radio buttons.
8620 (UpdateDocumentButtons): ditto.
8622 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8624 * src/kbmap.C (getsym + others): change to return unsigned int,
8625 returning a long can give problems on 64 bit systems. (I assume
8626 that int is 32bit on 64bit systems)
8628 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8630 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8631 LyXLookupString to be zero-terminated. Really fixes problems seen
8634 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8636 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8637 write a (char*)0 to the lyxerr stream.
8639 * src/lastfiles.C: move algorithm before the using statemets.
8641 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8643 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8644 complains otherwise).
8645 * src/table.C: ditto
8647 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8650 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8651 that I removed earlier... It is really needed.
8653 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8655 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8657 * INSTALL: update xforms home page URL.
8659 * lib/configure.m4: fix a bug with unreadable layout files.
8661 * src/table.C (calculate_width_of_column): add "using std::max"
8664 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8666 * several files: marked several lines with "DEL LINE", this is
8667 lines that can be deleted without changing anything.
8668 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8669 checks this anyway */
8672 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8674 * src/DepTable.C (update): add a "+" at the end when the checksum
8675 is different. (debugging string only)
8677 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8678 the next inset to not be displayed. This should also fix the list
8679 of labels in the "Insert Crossreference" dialog.
8681 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8683 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8684 when regex was not found.
8686 * src/support/lstrings.C (lowercase): use handcoded transform always.
8689 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8690 old_cursor.par->prev could be 0.
8692 * several files: changed post inc/dec to pre inc/dec
8694 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8695 write the lastfiles to file.
8697 * src/BufferView.C (buffer): only show TextCache info when debugging
8699 (resizeCurrentBuffer): ditto
8700 (workAreaExpose): ditto
8702 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8704 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8706 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8707 a bit better by removing the special case for \i and \j.
8709 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8711 * src/lyx_main.C (easyParse): remove test for bad comand line
8712 options, since this broke all xforms-related parsing.
8714 * src/kbmap.C (getsym): set return type to unsigned long, as
8715 declared in header. On an alpha, long is _not_ the same as int.
8717 * src/support/LOstream.h: add a "using std::flush;"
8719 * src/insets/figinset.C: ditto.
8721 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8723 * src/bufferlist.C (write): use blinding fast file copy instead of
8724 "a char at a time", now we are doing it the C++ way.
8726 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8727 std::list<int> instead.
8728 (addpidwait): reflect move to std::list<int>
8729 (sigchldchecker): ditto
8731 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8734 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8735 that obviously was wrong...
8737 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8738 c, this avoids warnings with purify and islower.
8740 * src/insets/figinset.C: rename struct queue to struct
8741 queue_element and rewrite to use a std::queue. gsqueue is now a
8742 std::queue<queue_element>
8743 (runqueue): reflect move to std::queue
8746 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8747 we would get "1" "0" instead of "true" "false. Also make the tostr
8750 2000-01-21 Juergen Vigna <jug@sad.it>
8752 * src/buffer.C (writeFileAscii): Disabled code for special groff
8753 handling of tabulars till I fix this in table.C
8755 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8757 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8759 * src/support/lyxlib.h: ditto.
8761 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8763 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8764 and 'j' look better. This might fix the "macron" bug that has been
8767 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8768 functions as one template function. Delete the old versions.
8770 * src/support/lyxsum.C: move using std::ifstream inside
8773 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8776 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8778 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8780 * src/insets/figinset.C (InitFigures): use new instead of malloc
8781 to allocate memory for figures and bitmaps.
8782 (DoneFigures): use delete[] instead of free to deallocate memory
8783 for figures and bitmaps.
8784 (runqueue): use new to allocate
8785 (getfigdata): use new/delete[] instead of malloc/free
8786 (RegisterFigure): ditto
8788 * some files: moved some declarations closer to first use, small
8789 whitespace changes use preincrement instead of postincrement where
8790 it does not make a difference.
8792 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8793 step on the way to use stl::containers for key maps.
8795 * src/bufferlist.h: add a typedef for const_iterator and const
8796 versions of begin and end.
8798 * src/bufferlist.[Ch]: change name of member variable _state to
8799 state_. (avoid reserved names)
8801 (getFileNames): returns the filenames of the buffers in a vector.
8803 * configure.in (ALL_LINGUAS): added ro
8805 * src/support/putenv.C: new file
8807 * src/support/mkdir.C: new file
8809 2000-01-20 Allan Rae <rae@lyx.org>
8811 * lib/layouts/IEEEtran.layout: Added several theorem environments
8813 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8814 couple of minor additions.
8816 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8817 (except for those in footnotes of course)
8819 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8821 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8823 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8824 std::sort and std::lower_bound instead of qsort and handwritten
8826 (struct compara): struct that holds the functors used by std::sort
8827 and std::lower_bound in MathedLookupBOP.
8829 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8831 * src/support/LAssert.h: do not do partial specialization. We do
8834 * src/support/lyxlib.h: note that lyx::getUserName() and
8835 lyx::date() are not in use right now. Should these be suppressed?
8837 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8838 (makeLinuxDocFile): do not put date and user name in linuxdoc
8841 * src/support/lyxlib.h (kill): change first argument to long int,
8842 since that's what solaris uses.
8844 * src/support/kill.C (kill): fix declaration to match prototype.
8846 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8847 actually check whether namespaces are supported. This is not what
8850 * src/support/lyxsum.C: add a using directive.
8852 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8854 * src/support/kill.C: if we have namespace support we don't have
8855 to include lyxlib.h.
8857 * src/support/lyxlib.h: use namespace lyx if supported.
8859 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8861 * src/support/date.C: new file
8863 * src/support/chdir.C: new file
8865 * src/support/getUserName.C: new file
8867 * src/support/getcwd.C: new file
8869 * src/support/abort.C: new file
8871 * src/support/kill.C: new file
8873 * src/support/lyxlib.h: moved all the functions in this file
8874 insede struct lyx. Added also kill and abort to this struct. This
8875 is a way to avoid the "kill is not defined in <csignal>", we make
8876 C++ wrappers for functions that are not ANSI C or ANSI C++.
8878 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8879 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8880 lyx it has been renamed to sum.
8882 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8884 * src/text.C: add using directives for std::min and std::max.
8886 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8888 * src/texrow.C (getIdFromRow): actually return something useful in
8889 id and pos. Hopefully fixes the bug with positionning of errorbox
8892 * src/lyx_main.C (easyParse): output an error and exit if an
8893 incorrect command line option has been given.
8895 * src/spellchecker.C (ispell_check_word): document a memory leak.
8897 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8898 where a "struct utimbuf" is allocated with "new" and deleted with
8901 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8903 * src/text2.C (CutSelection): don't delete double spaces.
8904 (PasteSelection): ditto
8905 (CopySelection): ditto
8907 * src/text.C (Backspace): don't delete double spaces.
8909 * src/lyxlex.C (next): fix a bug that were only present with
8910 conformant std::istream::get to read comment lines, use
8911 std::istream::getline instead. This seems to fix the problem.
8913 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8915 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8916 allowed to insert space before space" editing problem. Please read
8917 commends at the beginning of the function. Comments about usage
8920 * src/text.C (InsertChar): fix for the "not allowed to insert
8921 space before space" editing problem.
8923 * src/text2.C (DeleteEmptyParagraphMechanism): when
8924 IsEmptyTableRow can only return false this last "else if" will
8925 always be a no-op. Commented out.
8927 * src/text.C (RedoParagraph): As far as I can understand tmp
8928 cursor is not really needed.
8930 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8931 present it could only return false anyway.
8932 (several functions): Did something not so smart...added a const
8933 specifier on a lot of methods.
8935 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8936 and add a tmp->text.resize. The LyXParagraph constructor does the
8938 (BreakParagraphConservative): ditto
8940 * src/support/path.h (Path): add a define so that the wrong usage
8941 "Path("/tmp") will be flagged as a compilation error:
8942 "`unnamed_Path' undeclared (first use this function)"
8944 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8946 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8947 which was bogus for several reasons.
8949 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8953 * autogen.sh: do not use "type -path" (what's that anyway?).
8955 * src/support/filetools.C (findtexfile): remove extraneous space
8956 which caused a kpsewhich warning (at least with kpathsea version
8959 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8961 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8963 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8965 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8967 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8969 * src/paragraph.C (BreakParagraph): do not reserve space on text
8970 if we don't need to (otherwise, if pos_end < pos, we end up
8971 reserving huge amounts of memory due to bad unsigned karma).
8972 (BreakParagraphConservative): ditto, although I have not seen
8973 evidence the bug can happen here.
8975 * src/lyxparagraph.h: add a using std::list.
8977 2000-01-11 Juergen Vigna <jug@sad.it>
8979 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8982 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8984 * src/vc-backend.C (doVCCommand): change to be static and take one
8985 more parameter: the path to chdir too be fore executing the command.
8986 (retrive): new function equiv to "co -r"
8988 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8989 file_not_found_hook is true.
8991 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8993 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8994 if a file is readwrite,readonly...anything else.
8996 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8998 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8999 (CreatePostscript): name change from MenuRunDVIPS (or something)
9000 (PreviewPostscript): name change from MenuPreviewPS
9001 (PreviewDVI): name change from MenuPreviewDVI
9003 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9004 \view_pdf_command., \pdf_to_ps_command
9006 * lib/configure.m4: added search for PDF viewer, and search for
9007 PDF to PS converter.
9008 (lyxrc.defaults output): add \pdflatex_command,
9009 \view_pdf_command and \pdf_to_ps_command.
9011 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9013 * src/bufferlist.C (write): we don't use blocksize for anything so
9016 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9018 * src/support/block.h: disable operator T* (), since it causes
9019 problems with both compilers I tried. See comments in the file.
9021 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9024 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9025 variable LYX_DIR_10x to LYX_DIR_11x.
9027 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9029 * INSTALL: document --with-lyxname.
9032 * configure.in: new configure flag --with-lyxname which allows to
9033 choose the name under which lyx is installed. Default is "lyx", of
9034 course. It used to be possible to do this with --program-suffix,
9035 but the later has in fact a different meaning for autoconf.
9037 * src/support/lstrings.h (lstrchr): reformat a bit.
9039 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9040 * src/mathed/math_defs.h: ditto.
9042 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9044 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9045 true, decides if we create a backup file or not when saving. New
9046 tag and variable \pdf_mode, defaults to false. New tag and
9047 variable \pdflatex_command, defaults to pdflatex. New tag and
9048 variable \view_pdf_command, defaults to xpdf. New tag and variable
9049 \pdf_to_ps_command, defaults to pdf2ps.
9051 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9053 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9054 does not have a BufferView.
9055 (unlockInset): ditto + don't access the_locking_inset if the
9056 buffer does not have a BufferView.
9058 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9059 certain circumstances so that we don't continue a keyboard
9060 operation long after the key was released. Try f.ex. to load a
9061 large document, press PageDown for some seconds and then release
9062 it. Before this change the document would contine to scroll for
9063 some time, with this change it stops imidiatly.
9065 * src/support/block.h: don't allocate more space than needed. As
9066 long as we don't try to write to the arr[x] in a array_type arr[x]
9067 it is perfectly ok. (if you write to it you might segfault).
9068 added operator value_type*() so that is possible to pass the array
9069 to functions expecting a C-pointer.
9071 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9074 * intl/*: updated to gettext 0.10.35, tried to add our own
9075 required modifications. Please verify.
9077 * po/*: updated to gettext 0.10.35, tried to add our own required
9078 modifications. Please verify.
9080 * src/support/lstrings.C (tostr): go at fixing the problem with
9081 cxx and stringstream. When stringstream is used return
9082 oss.str().c_str() so that problems with lyxstring and basic_string
9083 are avoided. Note that the best solution would be for cxx to use
9084 basic_string all the way, but it is not conformant yet. (it seems)
9086 * src/lyx_cb.C + other files: moved several global functions to
9087 class BufferView, some have been moved to BufferView.[Ch] others
9088 are still located in lyx_cb.C. Code changes because of this. (part
9089 of "get rid of current_view project".)
9091 * src/buffer.C + other files: moved several Buffer functions to
9092 class BufferView, the functions are still present in buffer.C.
9093 Code changes because of this.
9095 * config/lcmessage.m4: updated to most recent. used when creating
9098 * config/progtest.m4: updated to most recent. used when creating
9101 * config/gettext.m4: updated to most recent. applied patch for
9104 * config/gettext.m4.patch: new file that shows what changes we
9105 have done to the local copy of gettext.m4.
9107 * config/libtool.m4: new file, used in creation of acinclude.m4
9109 * config/lyxinclude.m4: new file, this is the lyx created m4
9110 macros, used in making acinclude.m4.
9112 * autogen.sh: GNU m4 discovered as a separate task not as part of
9113 the lib/configure creation.
9114 Generate acinlucde from files in config. Actually cat
9115 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9116 easier to upgrade .m4 files that really are external.
9118 * src/Spacing.h: moved using std::istringstream to right after
9119 <sstream>. This should fix the problem seen with some compilers.
9121 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9123 * src/lyx_cb.C: began some work to remove the dependency a lot of
9124 functions have on BufferView::text, even if not really needed.
9125 (GetCurrentTextClass): removed this func, it only hid the
9128 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9129 forgot this in last commit.
9131 * src/Bullet.C (bulletEntry): use static char const *[] for the
9132 tables, becuase of this the return arg had to change to string.
9134 (~Bullet): removed unneeded destructor
9136 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9137 (insetSleep): moved from Buffer
9138 (insetWakeup): moved from Buffer
9139 (insetUnlock): moved from Buffer
9141 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9142 from Buffer to BufferView.
9144 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9146 * config/ltmain.sh: updated to version 1.3.4 of libtool
9148 * config/ltconfig: updated to version 1.3.4 of libtool
9150 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9153 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9154 Did I get that right?
9156 * src/lyxlex.h: add a "using" directive or two.
9157 * src/Spacing.h: ditto.
9158 * src/insets/figinset.C: ditto.
9159 * src/support/filetools.C: ditto.
9160 * src/support/lstrings.C: ditto.
9161 * src/BufferView.C: ditto.
9162 * src/bufferlist.C: ditto.
9163 * src/lyx_cb.C: ditto.
9164 * src/lyxlex.C: ditto.
9166 * NEWS: add some changes for 1.1.4.
9168 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9170 * src/BufferView.C: first go at a TextCache to speed up switching
9173 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9175 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9176 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9177 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9178 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9181 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9182 members of the struct are correctly initialized to 0 (detected by
9184 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9185 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9187 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9188 pidwait, since it was allocated with "new". This was potentially
9189 very bad. Thanks to Michael Schmitt for running purify for us.
9192 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9194 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9196 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9198 1999-12-30 Allan Rae <rae@lyx.org>
9200 * lib/templates/IEEEtran.lyx: minor change
9202 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9203 src/mathed/formula.C (LocalDispatch): askForText changes
9205 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9206 know when a user has cancelled input. Fixes annoying problems with
9207 inserting labels and version control.
9209 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9211 * src/support/lstrings.C (tostr): rewritten to use strstream and
9214 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9216 * src/support/filetools.C (IsFileWriteable): use fstream to check
9217 (IsDirWriteable): use fileinfo to check
9219 * src/support/filetools.h (FilePtr): whole class deleted
9221 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9223 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9225 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9227 * src/bufferlist.C (write): use ifstream and ofstream instead of
9230 * src/Spacing.h: use istrstream instead of sscanf
9232 * src/mathed/math_defs.h: change first arg to istream from FILE*
9234 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9236 * src/mathed/math_parser.C: have yyis to be an istream
9237 (LexGetArg): use istream (yyis)
9239 (mathed_parse): ditto
9240 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9242 * src/mathed/formula.C (Read): rewritten to use istream
9244 * src/mathed/formulamacro.C (Read): rewritten to use istream
9246 * src/lyxlex.h (~LyXLex): deleted desturctor
9247 (getStream): new function, returns an istream
9248 (getFile): deleted funtion
9249 (IsOK): return is.good();
9251 * src/lyxlex.C (LyXLex): delete file and owns_file
9252 (setFile): open an filebuf and assign that to a istream instead of
9254 (setStream): new function, takes an istream as arg.
9255 (setFile): deleted function
9256 (EatLine): rewritten us use istream instead of FILE*
9260 * src/table.C (LyXTable): use istream instead of FILE*
9261 (Read): rewritten to take an istream instead of FILE*
9263 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9265 * src/buffer.C (Dispatch): remove an extraneous break statement.
9267 * src/support/filetools.C (QuoteName): change to do simple
9268 'quoting'. More work is necessary. Also changed to do nothing
9269 under emx (needs fix too).
9270 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9272 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9273 config.h.in to the AC_DEFINE_UNQUOTED() call.
9274 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9275 needs char * as argument (because Solaris 7 declares it like
9278 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9279 remove definition of BZERO.
9281 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9283 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9284 defined, "lyxregex.h" if not.
9286 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9288 (REGEX): new variable that is set to regex.c lyxregex.h when
9289 AM_CONDITIONAL USE_REGEX is set.
9290 (libsupport_la_SOURCES): add $(REGEX)
9292 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9295 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9298 * configure.in: add call to LYX_REGEX
9300 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9301 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9303 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9305 * lib/bind/fi_menus.bind: new file, from
9306 pauli.virtanen@saunalahti.fi.
9308 * src/buffer.C (getBibkeyList): pass the parameter delim to
9309 InsetInclude::getKeys and InsetBibtex::getKeys.
9311 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9312 is passed to Buffer::getBibkeyList
9314 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9315 instead of the hardcoded comma.
9317 * src/insets/insetbib.C (getKeys): make sure that there are not
9318 leading blanks in bibtex keys. Normal latex does not care, but
9319 harvard.sty seems to dislike blanks at the beginning of citation
9320 keys. In particular, the retturn value of the function is
9322 * INSTALL: make it clear that libstdc++ is needed and that gcc
9323 2.7.x probably does not work.
9325 * src/support/filetools.C (findtexfile): make debug message go to
9327 * src/insets/insetbib.C (getKeys): ditto
9329 * src/debug.C (showTags): make sure that the output is correctly
9332 * configure.in: add a comment for TWO_COLOR_ICON define.
9334 * acconfig.h: remove all the entries that already defined in
9335 configure.in or acinclude.m4.
9337 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9338 to avoid user name, date and copyright.
9340 1999-12-21 Juergen Vigna <jug@sad.it>
9342 * src/table.C (Read): Now read bogus row format informations
9343 if the format is < 5 so that afterwards the table can
9344 be read by lyx but without any format-info. Fixed the
9345 crash we experienced when not doing this.
9347 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9349 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9350 (RedoDrawingOfParagraph): ditto
9351 (RedoParagraphs): ditto
9352 (RemoveTableRow): ditto
9354 * src/text.C (Fill): rename arg paperwidth -> paper_width
9356 * src/buffer.C (insertLyXFile): rename var filename -> fname
9357 (writeFile): rename arg filename -> fname
9358 (writeFileAscii): ditto
9359 (makeLaTeXFile): ditto
9360 (makeLinuxDocFile): ditto
9361 (makeDocBookFile): ditto
9363 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9366 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9368 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9371 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9372 compiled by a C compiler not C++.
9374 * src/layout.h (LyXTextClass): added typedef for const_iterator
9375 (LyXTextClassList): added typedef for const_iterator + member
9376 functions begin and end.
9378 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9379 iterators to fill the choice_class.
9380 (updateLayoutChoice): rewritten to use iterators to fill the
9381 layoutlist in the toolbar.
9383 * src/BufferView.h (BufferView::work_area_width): removed unused
9386 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9388 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9389 (sgmlCloseTag): ditto
9391 * src/support/lstrings.h: return type of countChar changed to
9394 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9395 what version of this func to use. Also made to return unsigned int.
9397 * configure.in: call LYX_STD_COUNT
9399 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9400 conforming std::count.
9402 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9404 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9405 and a subscript would give bad display (patch from Dekel Tsur
9406 <dekel@math.tau.ac.il>).
9408 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9410 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9413 * src/chset.h: add a few 'using' directives
9415 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9416 triggered when no buffer is active
9418 * src/layout.C: removed `break' after `return' in switch(), since
9421 * src/lyx_main.C (init): make sure LyX can be ran in place even
9422 when libtool has done its magic with shared libraries. Fix the
9423 test for the case when the system directory has not been found.
9425 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9426 name for the latex file.
9427 (MenuMakeHTML): ditto
9429 * src/buffer.h: add an optional boolean argument, which is passed
9432 1999-12-20 Allan Rae <rae@lyx.org>
9434 * lib/templates/IEEEtran.lyx: small correction and update.
9436 * configure.in: Attempted to use LYX_PATH_HEADER
9438 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9440 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9441 input from JMarc. Now use preprocessor to find the header.
9442 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9443 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9444 LYX_STL_STRING_FWD. See comments in file.
9446 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9448 * The global MiniBuffer * minibuffer variable is dead.
9450 * The global FD_form_main * fd_form_main variable is dead.
9452 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9454 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9456 * src/table.h: add the LOstream.h header
9457 * src/debug.h: ditto
9459 * src/LyXAction.h: change the explaination of the ReadOnly
9460 attribute: is indicates that the function _can_ be used.
9462 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9465 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9467 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9473 * src/paragraph.C (GetWord): assert on pos>=0
9476 * src/support/lyxstring.C: condition the use of an invariant on
9478 * src/support/lyxstring.h: ditto
9480 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9481 Use LAssert.h instead of plain assert().
9483 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9485 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9486 * src/support/filetools.C: ditto
9488 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9491 * INSTALL: document the new configure flags
9493 * configure.in: suppress --with-debug; add --enable-assertions
9495 * acinclude.m4: various changes in alignment of help strings.
9497 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9499 * src/kbmap.C: commented out the use of the hash map in kb_map,
9500 beginning of movement to a stl::container.
9502 * several files: removed code that was not in effect when
9503 MOVE_TEXT was defined.
9505 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9506 for escaping should not be used. We can discuss if the string
9507 should be enclosed in f.ex. [] instead of "".
9509 * src/trans_mgr.C (insert): use the new returned value from
9510 encodeString to get deadkeys and keymaps done correctly.
9512 * src/chset.C (encodeString): changed to return a pair, to tell
9513 what to use if we know the string.
9515 * src/lyxscreen.h (fillArc): new function.
9517 * src/FontInfo.C (resize): rewritten to use more std::string like
9518 structore, especially string::replace.
9520 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9523 * configure.in (chmod +x some scripts): remove config/gcc-hack
9525 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9527 * src/buffer.C (writeFile): change once again the top comment in a
9528 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9529 instead of an hardcoded version number.
9530 (makeDocBookFile): ditto
9532 * src/version.h: add new define LYX_DOCVERSION
9534 * po/de.po: update from Pit Sütterlin
9535 * lib/bind/de_menus.bind: ditto.
9537 * src/lyxfunc.C (Dispatch): call MenuExport()
9538 * src/buffer.C (Dispatch): ditto
9540 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9541 LyXFunc::Dispatch().
9542 (MenuExport): new function, moved from
9543 LyXFunc::Dispatch().
9545 * src/trans_mgr.C (insert): small cleanup
9546 * src/chset.C (loadFile): ditto
9548 * lib/kbd/iso8859-1.cdef: add missing backslashes
9550 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9552 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9553 help with placing the manually drawn accents better.
9555 (Draw): x2 and hg changed to float to minimize rounding errors and
9556 help place the accents better.
9558 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9559 unsigned short to char is just wrong...cast the char to unsigned
9560 char instead so that the two values can compare sanely. This
9561 should also make the display of insetlatexaccents better and
9562 perhaps also some other insets.
9564 (lbearing): new function
9567 1999-12-15 Allan Rae <rae@lyx.org>
9569 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9570 header that provides a wrapper around the very annoying SGI STL header
9573 * src/support/lyxstring.C, src/LString.h:
9574 removed old SGI-STL-compatability attempts.
9576 * configure.in: Use LYX_STL_STRING_FWD.
9578 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9579 stl_string_fwd.h is around and try to determine it's location.
9580 Major improvement over previous SGI STL 3.2 compatability.
9581 Three small problems remain with this function due to my zero
9582 knowledge of autoconf. JMarc and lgb see the comments in the code.
9584 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9586 * src/broken_const.h, config/hack-gcc, config/README: removed
9588 * configure.in: remove --with-gcc-hack option; do not call
9591 * INSTALL: remove documentation of --with-broken-const and
9594 * acconfig.h: remove all trace of BROKEN_CONST define
9596 * src/buffer.C (makeDocBookFile): update version number in output
9598 (SimpleDocBookOnePar): fix an assert when trying to a character
9599 access beyond string length
9602 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9604 * po/de.po: fix the Export menu
9606 * lyx.man: update the description of -dbg
9608 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9609 (commandLineHelp): updated
9610 (easyParse): show list of available debug levels if -dbg is passed
9613 * src/Makefile.am: add debug.C
9615 * src/debug.h: moved some code to debug.C
9617 * src/debug.C: new file. Contains code to set and show debug
9620 * src/layout.C: remove 'break' after 'continue' in switch
9621 statements, since these cannot be reached.
9623 1999-12-13 Allan Rae <rae@lyx.org>
9625 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9626 (in_word_set): hash() -> math_hash()
9628 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9630 * acconfig.h: Added a test for whether we are using exceptions in the
9631 current compilation run. If so USING_EXCEPTIONS is defined.
9633 * config.in: Check for existance of stl_string_fwd.h
9634 * src/LString.h: If compiling --with-included-string and SGI's
9635 STL version 3.2 is present (see above test) we need to block their
9636 forward declaration of string and supply a __get_c_string().
9637 However, it turns out this is only necessary if compiling with
9638 exceptions enabled so I've a bit more to add yet.
9640 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9641 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9642 src/support/LRegex.h, src/undo.h:
9643 Shuffle the order of the included files a little to ensure that
9644 LString.h gets included before anything that includes stl_string_fwd.h
9646 * src/support/lyxstring.C: We need to #include LString.h instead of
9647 lyxstring.h to get the necessary definition of __get_c_string.
9648 (__get_c_string): New function. This is defined static just like SGI's
9649 although why they need to do this I'm not sure. Perhaps it should be
9650 in lstrings.C instead.
9652 * lib/templates/IEEEtran.lyx: New template file.
9654 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9656 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9657 * intl/Makefile.in (MKINSTALLDIRS): ditto
9659 * src/LyXAction.C (init): changed to hold the LFUN data in a
9660 automatic array in stead of in callso to newFunc, this speeds up
9661 compilation a lot. Also all the memory used by the array is
9662 returned when the init is completed.
9664 * a lot of files: compiled with -Wold-style-cast, changed most of
9665 the reported offenders to C++ style casts. Did not change the
9666 offenders in C files.
9668 * src/trans.h (Match): change argument type to unsigned int.
9670 * src/support/DebugStream.C: fix some types on the streambufs so
9671 that it works on a conforming implementation.
9673 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9675 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9677 * src/support/lyxstring.C: remove the inline added earlier since
9678 they cause a bunch of unsatisfied symbols when linking with dec
9679 cxx. Cxx likes to have the body of inlines at the place where they
9682 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9683 accessing negative bounds in array. This fixes the crash when
9684 inserting accented characters.
9685 * src/trans.h (Match): ditto
9687 * src/buffer.C (Dispatch): since this is a void, it should not try
9688 to return anything...
9690 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9692 * src/buffer.h: removed the two friends from Buffer. Some changes
9693 because of this. Buffer::getFileName and Buffer::setFileName
9694 renamed to Buffer::fileName() and Buffer::fileName(...).
9696 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9698 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9699 and Buffer::update(short) to BufferView. This move is currently
9700 controlled by a define MOVE_TEXT, this will be removed when all
9701 shows to be ok. This move paves the way for better separation
9702 between buffer contents and buffer view. One side effect is that
9703 the BufferView needs a rebreak when swiching buffers, if we want
9704 to avoid this we can add a cache that holds pointers to LyXText's
9705 that is not currently in use.
9707 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9710 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9712 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9714 * lyx_main.C: new command line option -x (or --execute) and
9715 -e (or --export). Now direct conversion from .lyx to .tex
9716 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9717 Unfortunately, X is still needed and the GUI pops up during the
9720 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9722 * src/Spacing.C: add a using directive to bring stream stuff into
9724 * src/paragraph.C: ditto
9725 * src/buffer.C: ditto
9727 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9728 from Lars' announcement).
9730 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9731 example files from Tino Meinen.
9733 1999-12-06 Allan Rae <rae@lyx.org>
9735 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9737 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9739 * src/support/lyxstring.C: added a lot of inline for no good
9742 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9743 latexWriteEndChanges, they were not used.
9745 * src/layout.h (operator<<): output operator for PageSides
9747 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9749 * some example files: loaded in LyX 1.0.4 and saved again to update
9750 certain constructs (table format)
9752 * a lot of files: did the change to use fstream/iostream for all
9753 writing of files. Done with a close look at Andre Poenitz's patch.
9755 * some files: whitespace changes.
9757 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9759 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9760 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9761 architecture, we provide our own. It is used unconditionnally, but
9762 I do not think this is a performance problem. Thanks to Angus
9763 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9764 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9766 (GetInset): use my_memcpy.
9770 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9771 it is easier to understand, but it uses less TeX-only constructs now.
9773 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9774 elements contain spaces
9776 * lib/configure: regenerated
9778 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9779 elements contain spaces; display the list of programs that are
9782 * autogen.sh: make sure lib/configure is executable
9784 * lib/examples/*: rename the tutorial examples to begin with the
9785 two-letters language code.
9787 * src/lyxfunc.C (getStatus): do not query current font if no
9790 * src/lyx_cb.C (RunScript): use QuoteName
9791 (MenuRunDvips): ditto
9792 (PrintApplyCB): ditto
9794 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9795 around argument, so that it works well with the current shell.
9796 Does not work properly with OS/2 shells currently.
9798 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9799 * src/LyXSendto.C (SendtoApplyCB): ditto
9800 * src/lyxfunc.C (Dispatch): ditto
9801 * src/buffer.C (runLaTeX): ditto
9802 (runLiterate): ditto
9803 (buildProgram): ditto
9805 * src/lyx_cb.C (RunScript): ditto
9806 (MenuMakeLaTeX): ditto
9808 * src/buffer.h (getLatexName): new method
9810 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9812 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9814 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9815 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9816 (create_math_panel): ditto
9818 * src/lyxfunc.C (getStatus): re-activate the code which gets
9819 current font and cursor; add test for export to html.
9821 * src/lyxrc.C (read): remove unreachable break statements; add a
9824 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9826 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9828 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9829 introduced by faulty regex.
9830 * src/buffer.C: ditto
9831 * src/lastfiles.C: ditto
9832 * src/paragraph.C: ditto
9833 * src/table.C: ditto
9834 * src/vspace.C: ditto
9835 * src/insets/figinset.C: ditto
9836 Note: most of these is absolutely harmless, except the one in
9837 src/mathed formula.C.
9839 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9841 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9842 operation, yielding correct results for the reLyX command.
9844 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9846 * src/support/filetools.C (ExpandPath): removed an over eager
9848 (ReplaceEnvironmentPath): ditto
9850 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9851 shows that we are doing something fishy in our code...
9855 * src/lyxrc.C (read): use a double switch trick to get more help
9856 from the compiler. (the same trick is used in layout.C)
9857 (write): new function. opens a ofstream and pass that to output
9858 (output): new function, takes a ostream and writes the lyxrc
9859 elemts to it. uses a dummy switch to make sure no elements are
9862 * src/lyxlex.h: added a struct pushpophelper for use in functions
9863 with more than one exit point.
9865 * src/lyxlex.[Ch] (GetInteger): made it const
9869 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9871 * src/layout.[hC] : LayoutTags splitted into several enums, new
9872 methods created, better error handling cleaner use of lyxlex. Read
9875 * src/bmtable.[Ch]: change some member prototypes because of the
9876 image const changes.
9878 * commandtags.h, src/LyXAction.C (init): new function:
9879 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9880 This file is not read automatically but you can add \input
9881 preferences to your lyxrc if you want to. We need to discuss how
9884 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9885 in .aux, also remove .bib and .bst files from dependencies when
9888 * src/BufferView.C, src/LyXView.C: add const_cast several places
9889 because of changes to images.
9891 * lib/images/*: same change as for images/*
9893 * lib/lyxrc.example: Default for accept_compound is false not no.
9895 * images/*: changed to be const, however I have som misgivings
9896 about this change so it might be changed back.
9898 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9900 * lib/configure, po/POTFILES.in: regenerated
9902 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9904 * config/lib_configure.m4: removed
9906 * lib/configure.m4: new file (was config/lib_configure.m4)
9908 * configure.in: do not test for rtti, since we do not use it.
9910 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9912 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9913 doubling of allocated space scheme. This makes it faster for large
9914 strings end to use less memory for small strings. xtra rememoved.
9916 * src/insets/figinset.C (waitalarm): commented out.
9917 (GhostscriptMsg): use static_cast
9918 (GhostscriptMsg): use new instead of malloc to allocate memory for
9919 cmap. also delete the memory after use.
9921 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9923 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9924 for changes in bibtex database or style.
9925 (runBibTeX): remove all .bib and .bst files from dep before we
9927 (run): use scanAuc in when dep file already exist.
9929 * src/DepTable.C (remove_files_with_extension): new method
9932 * src/DepTable.[Ch]: made many of the methods const.
9934 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9936 * src/bufferparams.C: make sure that the default textclass is
9937 "article". It used to be the first one by description order, but
9938 now the first one is "docbook".
9940 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9941 string; call Debug::value.
9942 (easyParse): pass complete argument to setDebuggingLevel().
9944 * src/debug.h (value): fix the code that parses debug levels.
9946 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9949 * src/LyXAction.C: use Debug::ACTION as debug channel.
9951 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9953 * NEWS: updated for the future 1.1.3 release.
9955 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9956 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9957 it should. This is of course a controversial change (since many
9958 people will find that their lyx workscreen is suddenly full of
9959 red), but done for the sake of correctness.
9961 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9962 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9964 * src/insets/inseterror.h, src/insets/inseturl.h,
9965 src/insets/insetinfo.h, src/insets/figinset.h,
9966 src/mathed/formulamacro.h, src/mathed/math_macro.h
9967 (EditMessage): add a missing const and add _() to make sure that
9970 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9971 src/insets/insetbib.C, src/support/filetools.C: add `using'
9974 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9975 doing 'Insert index of last word' at the beginning of a paragraph.
9977 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9979 * several files: white-space changes.
9981 * src/mathed/formula.C: removed IsAlpha and IsDigit
9983 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9984 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9987 * src/insets/figinset.C (GetPSSizes): don't break when
9988 "EndComments" is seen. But break when a boundingbox is read.
9990 * all classes inherited from Inset: return value of Clone
9991 changed back to Inset *.
9993 * all classes inherited form MathInset: return value of Clone
9994 changed back to MathedInset *.
9996 * src/insets/figinset.C (runqueue): use a ofstream to output the
9997 gs/ps file. Might need some setpresicion or setw. However I can
9998 see no problem with the current code.
9999 (runqueue): use sleep instead of the alarm/signal code. I just
10000 can't see the difference.
10002 * src/paragraph.C (LyXParagraph): reserve space in the new
10003 paragraph and resize the inserted paragraph to just fit.
10005 * src/lyxfunc.h (operator|=): added operator for func_status.
10007 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10008 check for readable file.
10010 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10011 check for readable file.
10012 (MenuMakeLinuxDoc): ditto
10013 (MenuMakeDocBook): ditto
10014 (MenuMakeAscii): ditto
10015 (InsertAsciiFile): split the test for openable and readable
10017 * src/bmtable.C (draw_bitmaptable): use
10018 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10020 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10021 findtexfile from LaTeX to filetools.
10023 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10024 instead of FilePtr. Needs to be verified by a literate user.
10026 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10028 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10029 (EditMessage): likewise.
10031 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10032 respectively as \textasciitilde and \textasciicircum.
10034 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10036 * src/support/lyxstring.h: made the methods that take iterators
10037 use const_iterator.
10039 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10040 (regexMatch): made is use the real regex class.
10042 * src/support/Makefile.am: changed to use libtool
10044 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10046 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10048 (MathIsInset ++): changed several macros to be inline functions
10051 * src/mathed/Makefile.am: changed to use libtool
10053 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10055 * src/insets/inset* : Clone changed to const and return type is
10056 the true insettype not just Inset*.
10058 * src/insets/Makefile.am: changed to use libtool
10060 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10062 * src/undo.[Ch] : added empty() and changed some of the method
10065 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10067 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10068 setID use block<> for the bullets array, added const several places.
10070 * src/lyxfunc.C (getStatus): new function
10072 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10073 LyXAction, added const to several funtions.
10075 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10076 a std::map, and to store the dir items in a vector.
10078 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10081 * src/LyXView.[Ch] + other files : changed currentView to view.
10083 * src/LyXAction.[Ch] : ported from the old devel branch.
10085 * src/.cvsignore: added .libs and a.out
10087 * configure.in : changes to use libtool.
10089 * acinclude.m4 : inserted libtool.m4
10091 * .cvsignore: added libtool
10093 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10095 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10096 file name in insets and mathed directories (otherwise the
10097 dependency is not taken in account under cygwin).
10099 * src/text2.C (InsertString[AB]): make sure that we do not try to
10100 read characters past the string length.
10102 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10104 * lib/doc/LaTeXConfig.lyx.in,
10105 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10107 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10108 file saying who created them and when this heppened; this is
10109 useless and annoys tools like cvs.
10111 * lib/layouts/g-brief-{en,de}.layout,
10112 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10113 from Thomas Hartkens <thomas@hartkens.de>.
10115 * src/{insets,mathed}/Makefile.am: do not declare an empty
10116 LDFLAGS, so that it can be set at configure time (useful on Irix
10119 * lib/reLyX/configure.in: make sure that the prefix is set
10120 correctly in LYX_DIR.
10122 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10124 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10125 be used by 'command-sequence' this allows to bind a key to a
10126 sequence of LyX-commands
10127 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10129 * src/LyXAction.C: add "command-sequence"
10131 * src/LyXFunction.C: handling of "command-sequence"
10133 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10134 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10136 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10138 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10140 * src/buffer.C (writeFile): Do not output a comment giving user
10141 and date at the beginning of a .lyx file. This is useless and
10142 annoys cvs anyway; update version number to 1.1.
10144 * src/Makefile.am (LYX_DIR): add this definition, so that a
10145 default path is hardcoded in LyX.
10147 * configure.in: Use LYX_GNU_GETTEXT.
10149 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10150 AM_GNU_GETTEXT with a bug fixed.
10152 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10154 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10156 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10157 which is used to point to LyX data is now LYX_DIR_11x.
10159 * lyx.man: convert to a unix text file; small updates.
10161 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10163 * src/support/LSubstring.[Ch]: made the second arg of most of the
10164 constructors be a const reference.
10166 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10169 * src/support/lyxstring.[Ch] (swap): added missing member function
10170 and specialization of swap(str, str);
10172 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10174 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10175 trace of the old one.
10177 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10178 put the member definitions in undo.C.
10180 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10181 NEW_TEXT and have now only code that was included when this was
10184 * src/intl.C (LCombo): use static_cast
10186 (DispatchCallback): ditto
10188 * src/definitions.h: removed whole file
10190 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10192 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10193 parsing and stores in a std:map. a regex defines the file format.
10194 removed unneeded members.
10196 * src/bufferparams.h: added several enums from definitions.h here.
10197 Removed unsused destructor. Changed some types to use proper enum
10198 types. use block to have the temp_bullets and user_defined_bullets
10199 and to make the whole class assignable.
10201 * src/bufferparams.C (Copy): removed this functions, use a default
10202 assignment instead.
10204 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10207 * src/buffer.C (readLyXformat2): commend out all that have with
10208 oldpapersize to do. also comment out all that hve to do with
10209 insetlatex and insetlatexdel.
10210 (setOldPaperStuff): commented out
10212 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10214 * src/LyXAction.C: remove use of inset-latex-insert
10216 * src/mathed/math_panel.C (button_cb): use static_cast
10218 * src/insets/Makefile.am (insets_o_SOURCES): removed
10221 * src/support/lyxstring.C (helper): use the unsigned long
10222 specifier, UL, instead of a static_cast.
10224 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10226 * src/support/block.h: new file. to be used as a c-style array in
10227 classes, so that the class can be assignable.
10229 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10231 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10232 NULL, make sure to return an empty string (it is not possible to
10233 set a string to NULL).
10235 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10237 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10239 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10241 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10242 link line, so that Irix users (for example) can set it explicitely to
10245 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10246 it can be overidden at make time (static or dynamic link, for
10249 * src/vc-backend.C, src/LaTeXFeatures.h,
10250 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10251 statements to bring templates to global namespace.
10253 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10255 * src/support/lyxstring.C (operator[] const): make it standard
10258 * src/minibuffer.C (Init): changed to reflect that more
10259 information is given from the lyxvc and need not be provided here.
10261 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10263 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10265 * src/LyXView.C (UpdateTimerCB): use static_cast
10266 (KeyPressMask_raw_callback): ditto
10268 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10269 buffer_, a lot of changes because of this. currentBuffer() ->
10270 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10271 also changes to other files because of this.
10273 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10275 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10276 have no support for RCS and partial support for CVS, will be
10279 * src/insets/ several files: changes because of function name
10280 changes in Bufferview and LyXView.
10282 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10284 * src/support/LSubstring.[Ch]: new files. These implement a
10285 Substring that can be very convenient to use. i.e. is this
10287 string a = "Mary had a little sheep";
10288 Substring(a, "sheep") = "lamb";
10289 a is now "Mary has a little lamb".
10291 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10292 out patterns and subpatterns of strings. It is used by LSubstring
10293 and also by vc-backend.C
10295 * src/support/lyxstring.C: went over all the assertions used and
10296 tried to correct the wrong ones and flag which of them is required
10297 by the standard. some bugs found because of this. Also removed a
10298 couple of assertions.
10300 * src/support/Makefile.am (libsupport_a_SOURCES): added
10301 LSubstring.[Ch] and LRegex.[Ch]
10303 * src/support/FileInfo.h: have struct stat buf as an object and
10304 not a pointer to one, some changes because of this.
10306 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10307 information in layout when adding the layouts preamble to the
10308 textclass preamble.
10310 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10313 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10314 because of bug in OS/2.
10316 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10318 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10319 \verbatim@font instead of \ttfamily, so that it can be redefined.
10321 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10322 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10323 src/layout.h, src/text2.C: add 'using' directive to bring the
10324 STL templates we need from the std:: namespace to the global one.
10325 Needed by DEC cxx in strict ansi mode.
10327 * src/support/LIstream.h,src/support/LOstream.h,
10328 src/support/lyxstring.h,src/table.h,
10329 src/lyxlookup.h: do not include <config.h> in header
10330 files. This should be done in the .C files only.
10332 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10336 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10338 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10339 from Kayvan to fix the tth invokation.
10341 * development/lyx.spec.in: updates from Kayvan to reflect the
10342 changes of file names.
10344 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10346 * src/text2.C (InsertStringB): use std::copy
10347 (InsertStringA): use std::copy
10349 * src/bufferlist.C: use a vector to store the buffers in. This is
10350 an internal change and should not affect any other thing.
10352 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10355 * src/text.C (Fill): fix potential bug, one off bug.
10357 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10359 * src/Makefile.am (lyx_main.o): add more files it depends on.
10361 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10363 * src/support/lyxstring.C: use size_t for the reference count,
10364 size, reserved memory and xtra.
10365 (internal_compare): new private member function. Now the compare
10366 functions should work for std::strings that have embedded '\0'
10368 (compare): all compare functions rewritten to use
10371 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10373 * src/support/lyxstring.C (compare): pass c_str()
10374 (compare): pass c_str
10375 (compare): pass c_str
10377 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10379 * src/support/DebugStream.C: <config.h> was not included correctly.
10381 * lib/configure: forgot to re-generate it :( I'll make this file
10382 auto generated soon.
10384 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10386 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10389 * src/support/lyxstring.C: some changes from length() to rep->sz.
10390 avoids a function call.
10392 * src/support/filetools.C (SpaceLess): yet another version of the
10393 algorithm...now per Jean-Marc's suggestions.
10395 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10397 * src/layout.C (less_textclass_desc): functor for use in sorting
10399 (LyXTextClass::Read): sort the textclasses after reading.
10401 * src/support/filetools.C (SpaceLess): new version of the
10402 SpaceLess functions. What problems does this one give? Please
10405 * images/banner_bw.xbm: made the arrays unsigned char *
10407 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10409 * src/support/lyxstring.C (find): remove bogus assertion in the
10410 two versions of find where this has not been done yet.
10412 * src/support/lyxlib.h: add missing int return type to
10415 * src/menus.C (ShowFileMenu): disable exporting to html if no
10416 html export command is present.
10418 * config/lib_configure.m4: add a test for an HTML converter. The
10419 programs checked for are, in this order: tth, latex2html and
10422 * lib/configure: generated from config/lib_configure.m4.
10424 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10425 html converter. The parameters are now passed through $$FName and
10426 $$OutName, instead of standard input/output.
10428 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10430 * lib/lyxrc.example: update description of \html_command.
10431 add "quotes" around \screen_font_xxx font setting examples to help
10432 people who use fonts with spaces in their names.
10434 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10436 * Distribution files: updates for v1.1.2
10438 * src/support/lyxstring.C (find): remove bogus assert and return
10439 npos for the same condition.
10441 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10443 * added patch for OS/2 from SMiyata.
10445 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10447 * src/text2.C (CutSelection): make space_wrapped a bool
10448 (CutSelection): dont declare int i until we have to.
10449 (alphaCounter): return a char const *.
10451 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10453 * src/support/syscall.C (Systemcalls::kill):
10454 src/support/filetools.C (PutEnv, PutEnvPath):
10455 src/lyx_cb.C (addNewlineAndDepth):
10456 src/FontInfo.C (FontInfo::resize): condition some #warning
10457 directives with WITH_WARNINGS.
10460 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10462 * src/layout.[Ch] + several files: access to class variables
10463 limited and made accessor functions instead a lot of code changed
10464 becuase of this. Also instead of returning pointers often a const
10465 reference is returned instead.
10467 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10469 * src/Makefile.am (dist-hook): added used to remove the CVS from
10470 cheaders upon creating a dist
10471 (EXTRA_DIST): added cheaders
10473 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10474 a character not as a small integer.
10476 * src/support/lyxstring.C (find): removed Assert and added i >=
10477 rep->sz to the first if.
10479 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10481 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10482 src/LyXView.C src/buffer.C src/bufferparams.C
10483 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10484 src/text2.C src/insets/insetinclude.C:
10485 lyxlayout renamed to textclasslist.
10487 * src/layout.C: some lyxerr changes.
10489 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10490 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10491 (LyXLayoutList): removed all traces of this class.
10492 (LyXTextClass::Read): rewrote LT_STYLE
10493 (LyXTextClass::hasLayout): new function
10494 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10495 both const and nonconst version.
10496 (LyXTextClass::delete_layout): new function.
10497 (LyXTextClassList::Style): bug fix. do the right thing if layout
10499 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10500 (LyXTextClassList::NameOfLayout): ditto
10501 (LyXTextClassList::Load): ditto
10503 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10505 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10507 * src/LyXAction.C (LookupFunc): added a workaround for sun
10508 compiler, on the other hand...we don't know if the current code
10509 compiles on sun at all...
10511 * src/support/filetools.C (CleanupPath): subst fix
10513 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10516 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10517 complained about this one?
10519 * src/insets/insetinclude.C (Latex): subst fix
10521 * src/insets/insetbib.C (getKeys): subst fix
10523 * src/LyXSendto.C (SendtoApplyCB): subst fix
10525 * src/lyx_main.C (init): subst fix
10527 * src/layout.C (Read): subst fix
10529 * src/lyx_sendfax_main.C (button_send): subst fix
10531 * src/buffer.C (RoffAsciiTable): subst fix
10533 * src/lyx_cb.C (MenuFax): subst fix
10534 (PrintApplyCB): subst fix
10536 1999-10-26 Juergen Vigna <jug@sad.it>
10538 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10540 (Read): Cleaned up this code so now we read only format vestion >= 5
10542 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10544 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10545 come nobody has complained about this one?
10547 * src/insets/insetinclude.C (Latex): subst fix
10549 * src/insets/insetbib.C (getKeys): subst fix
10551 * src/lyx_main.C (init): subst fix
10553 * src/layout.C (Read): subst fix
10555 * src/buffer.C (RoffAsciiTable): subst fix
10557 * src/lyx_cb.C (MenuFax): subst fix.
10559 * src/layout.[hC] + some other files: rewrote to use
10560 std::container to store textclasses and layouts in.
10561 Simplified, removed a lot of code. Make all classes
10562 assignable. Further simplifications and review of type
10563 use still to be one.
10565 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10566 lastfiles to create the lastfiles partr of the menu.
10568 * src/lastfiles.[Ch]: rewritten to use deque to store the
10569 lastfiles in. Uses fstream for reading and writing. Simplifies
10572 * src/support/syscall.C: remove explicit cast.
10574 * src/BufferView.C (CursorToggleCB): removed code snippets that
10575 were commented out.
10576 use explicat C++ style casts instead of C style casts. also use
10577 u_vdata instea of passing pointers in longs.
10579 * src/PaperLayout.C: removed code snippets that were commented out.
10581 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10583 * src/lyx_main.C: removed code snippets that wer commented out.
10585 * src/paragraph.C: removed code snippets that were commented out.
10587 * src/lyxvc.C (logClose): use static_cast
10589 (viewLog): remove explicit cast to void*
10590 (showLog): removed old commented code
10592 * src/menus.C: use static_cast instead of C style casts. use
10593 u_vdata instead of u_ldata. remove explicit cast to (long) for
10594 pointers. Removed old code that was commented out.
10596 * src/insets/inset.C: removed old commented func
10598 * src/insets/insetref.C (InsetRef): removed old code that had been
10599 commented out for a long time.
10601 (escape): removed C style cast
10603 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10605 * src/insets/insetlatex.C (Draw): removed old commented code
10606 (Read): rewritten to use string
10608 * src/insets/insetlabel.C (escape): removed C style cast
10610 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10612 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10613 old commented code.
10615 * src/insets/insetinclude.h: removed a couple of stupid bools
10617 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10618 (Clone): remove C style cast
10619 (getKeys): changed list to lst because of std::list
10621 * src/insets/inseterror.C (Draw): removed som old commented code.
10623 * src/insets/insetcommand.C (Draw): removed some old commented code.
10625 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10626 commented out forever.
10627 (bibitem_cb): use static_cast instead of C style cast
10628 use of vdata changed to u_vdata.
10630 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10632 (CloseUrlCB): use static_cast instead of C style cast.
10633 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10635 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10636 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10637 (CloseInfoCB): static_cast from ob->u_vdata instead.
10638 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10641 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10642 (C_InsetError_CloseErrorCB): forward the ob parameter
10643 (CloseErrorCB): static_cast from ob->u_vdata instead.
10645 * src/vspace.h: include LString.h since we use string in this class.
10647 * src/vspace.C (lyx_advance): changed name from advance because of
10648 nameclash with stl. And since we cannot use namespaces yet...I
10649 used a lyx_ prefix instead. Expect this to change when we begin
10652 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10654 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10655 and removed now defunct constructor and deconstructor.
10657 * src/BufferView.h: have backstack as a object not as a pointer.
10658 removed initialization from constructor. added include for BackStack
10660 * development/lyx.spec.in (%build): add CFLAGS also.
10662 * src/screen.C (drawFrame): removed another warning.
10664 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10666 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10667 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10668 README and ANNOUNCE a bit for the next release. More work is
10671 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10672 unbreakable if we are in freespacing mode (LyX-Code), but not in
10675 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10677 * src/BackStack.h: fixed initialization order in constructor
10679 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10681 * acinclude.m4 (VERSION): new rules for when a version is
10682 development, added also a variable for prerelease.
10683 (warnings): we set with_warnings=yes for prereleases
10684 (lyx_opt): prereleases compile with same optimization as development
10685 (CXXFLAGS): only use pedantic if we are a development version
10687 * src/BufferView.C (restorePosition): don't do anything if the
10688 backstack is empty.
10690 * src/BackStack.h: added member empty, use this to test if there
10691 is anything to pop...
10693 1999-10-25 Juergen Vigna <jug@sad.it>
10696 * forms/layout_forms.fd +
10697 * forms/latexoptions.fd +
10698 * lyx.fd: changed for various form resize issues
10700 * src/mathed/math_panel.C +
10701 * src/insets/inseterror.C +
10702 * src/insets/insetinfo.C +
10703 * src/insets/inseturl.C +
10704 * src/insets/inseturl.h +
10706 * src/LyXSendto.C +
10707 * src/PaperLayout.C +
10708 * src/ParagraphExtra.C +
10709 * src/TableLayout.C +
10711 * src/layout_forms.C +
10718 * src/menus.C: fixed various resize issues. So now forms can be
10719 resized savely or not be resized at all.
10721 * forms/form_url.fd +
10722 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10725 * src/insets/Makefile.am: added files form_url.[Ch]
10727 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10729 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10730 (and presumably 6.2).
10732 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10733 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10734 remaining static member callbacks.
10736 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10739 * src/support/lyxstring.h: declare struct Srep as friend of
10740 lyxstring, since DEC cxx complains otherwise.
10742 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10744 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10746 * src/LaTeX.C (run): made run_bibtex also depend on files with
10748 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10749 are put into the dependency file.
10751 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10752 the code has shown itself to work
10753 (create_ispell_pipe): removed another warning, added a comment
10756 * src/minibuffer.C (ExecutingCB): removed code that has been
10757 commented out a long time
10759 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10760 out code + a warning.
10762 * src/support/lyxstring.h: comment out the three private
10763 operators, when compiling with string ansi conforming compilers
10764 they make problems.
10766 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10768 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10769 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10772 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10775 * src/mathed/math_panel.C (create_math_panel): remove explicit
10778 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10781 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10782 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10783 to XCreatePixmapFromBitmapData
10784 (fl_set_bmtable_data): change the last argument to be unsigned
10786 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10787 and bh to be unsigned int, remove explicit casts in call to
10788 XReadBitmapFileData.
10790 * images/arrows.xbm: made the arrays unsigned char *
10791 * images/varsz.xbm: ditto
10792 * images/misc.xbm: ditto
10793 * images/greek.xbm: ditto
10794 * images/dots.xbm: ditto
10795 * images/brel.xbm: ditto
10796 * images/bop.xbm: ditto
10798 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10800 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10801 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10802 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10804 (LYX_CXX_CHEADERS): added <clocale> to the test.
10806 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10808 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10810 * src/support/lyxstring.C (append): fixed something that must be a
10811 bug, rep->assign was used instead of rep->append.
10813 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10816 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10817 lyx insert double chars. Fix spotted by Kayvan.
10819 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10821 * Fixed the tth support. I messed up with the Emacs patch apply feature
10822 and omitted the changes in lyxrc.C.
10824 1999-10-22 Juergen Vigna <jug@sad.it>
10826 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10828 * src/lyx_cb.C (MenuInsertRef) +
10829 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10830 the form cannot be resized under it limits (fixes a segfault)
10832 * src/lyx.C (create_form_form_ref) +
10833 * forms/lyx.fd: Changed Gravity on name input field so that it is
10836 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10838 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10839 <ostream> and <istream>.
10841 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10842 whether <fstream> provides the latest standard features, or if we
10843 have an oldstyle library (like in egcs).
10844 (LYX_CXX_STL_STRING): fix the test.
10846 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10847 code on MODERN_STL_STREAM.
10849 * src/support/lyxstring.h: use L{I,O}stream.h.
10851 * src/support/L{I,O}stream.h: new files, designed to setup
10852 correctly streams for our use
10853 - includes the right header depending on STL capabilities
10854 - puts std::ostream and std::endl (for LOStream.h) or
10855 std::istream (LIStream.h) in toplevel namespace.
10857 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10859 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10860 was a bib file that had been changed we ensure that bibtex is run.
10861 (runBibTeX): enhanced to extract the names of the bib files and
10862 getting their absolute path and enter them into the dep file.
10863 (findtexfile): static func that is used to look for tex-files,
10864 checks for absolute patchs and tries also with kpsewhich.
10865 Alternative ways of finding the correct files are wanted. Will
10867 (do_popen): function that runs a command using popen and returns
10868 the whole output of that command in a string. Should be moved to
10871 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10872 file with extension ext has changed.
10874 * src/insets/figinset.C: added ifdef guards around the fl_free
10875 code that jug commented out. Now it is commented out when
10876 compiling with XForms == 0.89.
10878 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10879 to lyxstring.C, and only keep a forward declaration in
10880 lyxstring.h. Simplifies the header file a bit and should help a
10881 bit on compile time too. Also changes to Srep will not mandate a
10882 recompile of code just using string.
10883 (~lyxstring): definition moved here since it uses srep.
10884 (size): definition moved here since it uses srep.
10886 * src/support/lyxstring.h: removed a couple of "inline" that should
10889 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10891 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10894 1999-10-21 Juergen Vigna <jug@sad.it>
10896 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10897 set to left if I just remove the width entry (or it is empty).
10899 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10900 paragraph when having dummy paragraphs.
10902 1999-10-20 Juergen Vigna <jug@sad.it>
10904 * src/insets/figinset.C: just commented some fl_free_form calls
10905 and added warnings so that this calls should be activated later
10906 again. This avoids for now a segfault, but we have a memory leak!
10908 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10909 'const char * argument' to 'string argument', this should
10910 fix some Asserts() in lyxstring.C.
10912 * src/lyxfunc.h: Removed the function argAsString(const char *)
10913 as it is not used anymore.
10915 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10917 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10920 * src/Literate.h: some funcs moved from public to private to make
10921 interface clearer. Unneeded args removed.
10923 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10925 (scanBuildLogFile): ditto
10927 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10928 normal TeX Error. Still room for improvement.
10930 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10932 * src/buffer.C (insertErrors): changes to make the error
10933 desctription show properly.
10935 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10938 * src/support/lyxstring.C (helper): changed to use
10939 sizeof(object->rep->ref).
10940 (operator>>): changed to use a pointer instead.
10942 * src/support/lyxstring.h: changed const reference & to value_type
10943 const & lets see if that helps.
10945 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10947 * Makefile.am (rpmdist): fixed to have non static package and
10950 * src/support/lyxstring.C: removed the compilation guards
10952 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10955 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10956 conditional compile of lyxstring.Ch
10958 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10959 stupid check, but it is a lot better than the bastring hack.
10960 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10962 * several files: changed string::erase into string::clear. Not
10965 * src/chset.C (encodeString): use a char temporary instead
10967 * src/table.C (TexEndOfCell): added tostr around
10968 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10969 (TexEndOfCell): ditto
10970 (TexEndOfCell): ditto
10971 (TexEndOfCell): ditto
10972 (DocBookEndOfCell): ditto
10973 (DocBookEndOfCell): ditto
10974 (DocBookEndOfCell): ditto
10975 (DocBookEndOfCell): ditto
10977 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10979 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10981 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10982 (MenuBuildProg): added tostr around ret
10983 (MenuRunChktex): added tostr around ret
10984 (DocumentApplyCB): added tostr around ret
10986 * src/chset.C (encodeString): added tostr around t->ic
10988 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10989 (makeLaTeXFile): added tostr around tocdepth
10990 (makeLaTeXFile): added tostr around ftcound - 1
10992 * src/insets/insetbib.C (setCounter): added tostr around counter.
10994 * src/support/lyxstring.h: added an operator+=(int) to catch more
10997 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10998 (lyxstring): We DON'T allow NULL pointers.
11000 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11002 * src/mathed/math_macro.C (MathMacroArgument::Write,
11003 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11004 when writing them out.
11006 * src/LString.C: remove, since it is not used anymore.
11008 * src/support/lyxstring.C: condition the content to
11009 USE_INCLUDED_STRING macro.
11011 * src/mathed/math_symbols.C, src/support/lstrings.C,
11012 src/support/lyxstring.C: add `using' directive to specify what
11013 we need in <algorithm>. I do not think that we need to
11014 conditionalize this, but any thought is appreciated.
11016 * many files: change all callback functions to "C" linkage
11017 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11018 strict_ansi. Those who were static are now global.
11019 The case of callbacks which are static class members is
11020 trickier, since we have to make C wrappers around them (see
11021 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11022 did not finish this yet, since it defeats the purpose of
11023 encapsulation, and I am not sure what the best route is.
11025 1999-10-19 Juergen Vigna <jug@sad.it>
11027 * src/support/lyxstring.C (lyxstring): we permit to have a null
11028 pointer as assignment value and just don't assign it.
11030 * src/vspace.C (nextToken): corrected this function substituting
11031 find_first(_not)_of with find_last_of.
11033 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11034 (TableOptCloseCB) (TableSpeCloseCB):
11035 inserted fl_set_focus call for problem with fl_hide_form() in
11038 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11040 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11043 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11045 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11046 LyXLex::next() and not eatline() to get its argument.
11048 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11050 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11051 instead, use fstreams for io of the depfile, removed unneeded
11052 functions and variables.
11054 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11055 vector instead, removed all functions and variables that is not in
11058 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11060 * src/buffer.C (insertErrors): use new interface to TeXError
11062 * Makefile.am (rpmdist): added a rpmdist target
11064 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11065 per Kayvan's instructions.
11067 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11069 * src/Makefile.am: add a definition for localedir, so that locales
11070 are found after installation (Kayvan)
11072 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11074 * development/.cvsignore: new file.
11076 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11078 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11079 C++ compiler provides wrappers for C headers and use our alternate
11082 * configure.in: use LYX_CXX_CHEADERS.
11084 * src/cheader/: new directory, populated with cname headers from
11085 libstdc++-2.8.1. They are a bit old, but probably good enough for
11086 what we want (support compilers who lack them).
11088 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11089 from includes. It turns out is was stupid.
11091 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11093 * lib/Makefile.am (install-data-local): forgot a ';'
11094 (install-data-local): forgot a '\'
11095 (libinstalldirs): needed after all. reintroduced.
11097 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11099 * configure.in (AC_OUTPUT): added lyx.spec
11101 * development/lyx.spec: removed file
11103 * development/lyx.spec.in: new file
11105 * po/*.po: merged with lyx.pot becuase of make distcheck
11107 * lib/Makefile.am (dist-hook): added dist-hook so that
11108 documentation files will be included when doing a make
11109 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11110 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11112 more: tried to make install do the right thing, exclude CVS dirs
11115 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11116 Path would fit in more nicely.
11118 * all files that used to use pathstack: uses now Path instead.
11119 This change was a lot easier than expected.
11121 * src/support/path.h: new file
11123 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11125 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11127 * src/support/lyxstring.C (getline): Default arg was given for
11130 * Configure.cmd: removed file
11132 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11134 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11135 streams classes and types, add the proper 'using' statements when
11136 MODERN_STL is defined.
11138 * src/debug.h: move the << operator definition after the inclusion
11141 * src/support/filetools.C: include "LAssert.h", which is needed
11144 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11147 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11148 include "debug.h" to define a proper ostream.
11150 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11152 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11153 method to the SystemCall class which can kill a process, but it's
11154 not fully implemented yet.
11156 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11158 * src/support/FileInfo.h: Better documentation
11160 * src/lyxfunc.C: Added support for buffer-export html
11162 * src/menus.C: Added Export->As HTML...
11164 * lib/bind/*.bind: Added short-cut for buffer-export html
11166 * src/lyxrc.*: Added support for new \tth_command
11168 * lib/lyxrc.example: Added stuff for new \tth_command
11170 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11172 * lib/Makefile.am (IMAGES): removed images/README
11173 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11174 installes in correct place. Check permisions is installed
11177 * src/LaTeX.C: some no-op changes moved declaration of some
11180 * src/LaTeX.h (LATEX_H): changed include guard name
11182 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11184 * lib/reLyX/Makefile.am: install noweb2lyx.
11186 * lib/Makefile.am: install configure.
11188 * lib/reLyX/configure.in: declare a config aux dir; set package
11189 name to lyx (not sure what the best solution is); generate noweb2lyx.
11191 * lib/layouts/egs.layout: fix the bibliography layout.
11193 1999-10-08 Jürgen Vigna <jug@sad.it>
11195 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11196 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11197 it returned without continuing to search the path.
11199 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11201 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11202 also fixes a bug. It is not allowed to do tricks with std::strings
11203 like: string a("hei"); &a[e]; this will not give what you
11204 think... Any reason for the complexity in this func?
11206 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11208 * Updated README and INSTALL a bit, mostly to check that my
11209 CVS rights are correctly set up.
11211 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11213 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11214 does not allow '\0' chars but lyxstring and std::string does.
11216 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11218 * autogen.sh (AUTOCONF): let the autogen script create the
11219 POTFILES.in file too. POTFILES.in should perhaps now not be
11220 included in the cvs module.
11222 * some more files changed to use C++ includes instead of C ones.
11224 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11226 (Reread): added tostr to nlink. buggy output otherwise.
11227 (Reread): added a string() around szMode when assigning to Buffer,
11228 without this I got a log of garbled info strings.
11230 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11233 * I have added several ostream & operator<<(ostream &, some_type)
11234 functions. This has been done to avoid casting and warnings when
11235 outputting enums to lyxerr. This as thus eliminated a lot of
11236 explicit casts and has made the code clearer. Among the enums
11237 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11238 mathed enums, some font enum the Debug::type enum.
11240 * src/support/lyxstring.h (clear): missing method. equivalent of
11243 * all files that contained "stderr": rewrote constructs that used
11244 stderr to use lyxerr instead. (except bmtable)
11246 * src/support/DebugStream.h (level): and the passed t with
11247 Debug::ANY to avoid spurious bits set.
11249 * src/debug.h (Debug::type value): made it accept strings of the
11250 type INFO,INIT,KEY.
11252 * configure.in (Check for programs): Added a check for kpsewhich,
11253 the latex generation will use this later to better the dicovery of
11256 * src/BufferView.C (create_view): we don't need to cast this to
11257 (void*) that is done automatically.
11258 (WorkAreaButtonPress): removed some dead code.
11260 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11262 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11263 is not overwritten when translated (David Sua'rez de Lis).
11265 * lib/CREDITS: Added David Sua'rez de Lis
11267 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11269 * src/bufferparams.C (BufferParams): default input encoding is now
11272 * acinclude.m4 (cross_compiling): comment out macro
11273 LYX_GXX_STRENGTH_REDUCE.
11275 * acconfig.h: make sure that const is not defined (to empty) when
11276 we are compiling C++. Remove commented out code using SIZEOF_xx
11279 * configure.in : move the test for const and inline as late as
11280 possible so that these C tests do not interefere with C++ ones.
11281 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11282 has not been proven.
11284 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11286 * src/table.C (getDocBookAlign): remove bad default value for
11287 isColumn parameter.
11289 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11291 (ShowFileMenu2): ditto.
11293 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11294 of files to ignore.
11296 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11298 * Most files: finished the change from the old error code to use
11299 DebugStream for all lyxerr debugging. Only minor changes remain
11300 (e.g. the setting of debug levels using strings instead of number)
11302 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11304 * src/layout.C (Add): Changed to use compare_no_case instead of
11307 * src/FontInfo.C: changed loop variable type too string::size_type.
11309 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11311 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11312 set ETAGS_ARGS to --c++
11314 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11316 * src/table.C (DocBookEndOfCell): commented out two unused variables
11318 * src/paragraph.C: commented out four unused variables.
11320 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11321 insed a if clause with type string::size_type.
11323 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11326 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11328 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11329 variable, also changed loop to go from 0 to lenght + 1, instead of
11330 -1 to length. This should be correct.
11332 * src/LaTeX.C (scanError): use string::size_type as loop variable
11335 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11336 (l.896) since y_tmp and row was not used anyway.
11338 * src/insets/insetref.C (escape): use string::size_type as loop
11341 * src/insets/insetquotes.C (Width): use string::size_type as loop
11343 (Draw): use string::size_type as loop variable type.
11345 * src/insets/insetlatexaccent.C (checkContents): use
11346 string::size_type as loop variable type.
11348 * src/insets/insetlabel.C (escape): use string::size_type as loop
11351 * src/insets/insetinfo.C: added an extern for current_view.
11353 * src/insets/insetcommand.C (scanCommand): use string::size_type
11354 as loop variable type.
11356 * most files: removed the RCS tags. With them we had to recompile
11357 a lot of files after a simple cvs commit. Also we have never used
11358 them for anything meaningful.
11360 * most files: tags-query-replace NULL 0. As adviced several plases
11361 we now use "0" instead of "NULL" in our code.
11363 * src/support/filetools.C (SpaceLess): use string::size_type as
11364 loop variable type.
11366 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11368 * src/paragraph.C: fixed up some more string stuff.
11370 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11372 * src/support/filetools.h: make modestr a std::string.
11374 * src/filetools.C (GetEnv): made ch really const.
11376 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11377 made code that used these use max/min from <algorithm> instead.
11379 * changed several c library include files to their equivalent c++
11380 library include files. All is not changed yet.
11382 * created a support subdir in src, put lyxstring and lstrings
11383 there + the extra files atexit, fileblock, strerror. Created
11384 Makefile.am. edited configure.in and src/Makefile.am to use this
11385 new subdir. More files moved to support.
11387 * imported som of the functions from repository lyx, filetools
11389 * ran tags-query-replace on LString -> string, corrected the bogus
11390 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11391 is still some errors in there. This is errors where too much or
11392 too litle get deleted from strings (string::erase, string::substr,
11393 string::replace), there can also be some off by one errors, or
11394 just plain wrong use of functions from lstrings. Viewing of quotes
11397 * LyX is now running fairly well with string, but there are
11398 certainly some bugs yet (see above) also string is quite different
11399 from LString among others in that it does not allow null pointers
11400 passed in and will abort if it gets any.
11402 * Added the revtex4 files I forgot when setting up the repository.
11404 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11406 * All over: Tried to clean everything up so that only the files
11407 that we really need are included in the cvs repository.
11408 * Switched to use automake.
11409 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11410 * Install has not been checked.
11412 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11414 * po/pt.po: Three errors:
11415 l.533 and l.538 format specification error
11416 l. 402 duplicate entry, I just deleted it.