1 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/minibuffer.C: add "using SigC::slot" statement.
5 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
7 * src/frontends/xforms/forms/README: updated section about make.
9 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
10 Tidied some forms up, made two of form_tabular's tabs more
11 self-consistent, fixed Jean-Marc's size problem in form_preferences,
12 fixed translation problem with "Column".
14 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
16 * src/minibuffer.h: use Timeout instead of the xforms timer
18 (setTimer) rewrite for the Timeout, change to unsigned arg
19 (set): change to unsigned timer arg
22 * src/minibuffer.C (TimerCB): removed func
23 (C_MiniBuffer_TimerCB): removed func
24 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
25 (peek_event): use a switch statement
26 (add): don't use fl_add_timer.
27 (Set): rewrite to use the Timeout
30 * src/Timeout.[Ch] (setType): return a Timeout &
31 (setTimeout): ditto, change to unsigned arg for timeout
33 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
35 * src/mathed/formula.C (mathed_string_width): Use string instead
36 of a constant size char array.
38 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
40 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
41 the two recently added operator<< for SMInput and State.
43 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
45 (OkCancelPolicy): ditto
46 (OkCancelReadOnlyPolicy): ditto
47 (NoRepeatedApplyReadOnlyPolicy): ditto
48 (OkApplyCancelReadOnlyPolicy): ditto
49 (OkApplyCancelPolicy): ditto
50 (NoRepeatedApplyPolicy): ditto
52 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
54 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
55 add the usual std:: qualifiers.
57 2000-10-25 Juergen Vigna <jug@sad.it>
59 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
61 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
63 * src/support/filetools.C (MakeRelPath): change some types to
66 * src/frontends/ButtonPolicies.h (operator<<): new operator for
67 ButtonPolicy::SMInput and ButtonPolicy::State.
69 * src/FontLoader.C (reset): small cleanup
70 (unload): small cleanup
72 * src/FontInfo.C (getFontname): initialize error to 10000.0
74 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
76 * src/frontends/xforms/FormPreferences.[Ch]:
77 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
78 TeX encoding and default paper size sections.
80 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
82 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
85 * src/frontends/xforms/FormError.C (disconnect): use erase() to
86 make the message_ empty.
87 (FormError): don't initialize message_ in initializer list.
89 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
91 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
93 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
95 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
97 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
99 * src/frontends/kde/*data.[Ch]: _("") is not
102 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
104 * src/buffer.C: removed redundant using directive.
106 * src/frontends/DialogBase.h: revert to original definition of
109 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
110 stuff into two classes, one for each dialog, requires a new
111 element in the dialogs vector, FormTabularCreate.
113 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
116 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
117 method. Continues Allan's idea, but means that derived classes
118 don't need to worry about "update or hide?".
120 * src/frontends/xforms/FormError.C (showInset): add connection
123 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
124 one for each dialog. FormTabular now contains main tabular dialog
127 * src/frontends/xforms/FormTabularCreate.[Ch]:
128 * src/frontends/xforms/forms/form_tabular_create.fd: the create
131 * src/frontends/xforms/FormGraphics.[Ch]:
132 * src/frontends/xforms/forms/form_graphics.fd
133 * src/frontends/xforms/FormTabular.[Ch]:
134 * src/frontends/xforms/forms/form_tabular.fd: made daughter
135 classes of FormInset.
137 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
138 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
140 * src/frontends/xforms/Makefile.am:
141 * src/frontends/xforms/forms/makefile: added new files.
143 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
144 variable. added Signal0 hide signal, in keeping with other GUI-I
147 * src/support/lstrings.h: removed redundant std:: qualifier as
148 it's already declared in Lsstream.h.
150 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
152 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
156 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
158 * src/tabular.C (Ascii): minimize scope of cell.
160 * src/BufferView2.C (nextWord): return string() instead of 0;
162 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
164 * src/converter.h: add a std:: qualifier
166 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
168 * src/importer.[Ch]: New files. Used for importing files into LyX.
170 * src/lyxfunc.C (doImport): Use the new Importer class.
172 * src/converter.h: Add shortcut member to the Format class.
173 Used for holding the menu shortcut.
175 * src/converter.C and other files: Made a distinction between
176 format name and format extension. New formats can be defined using
177 the \format lyxrc tag.
178 Added two new converter flags: latex and disable.
180 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
182 * src/support/lyxlib.h: unify namespace/struct implementation.
183 Remove extra declarations.
185 * src/support/chdir.C (chdir): remove version taking char const *
187 * src/support/rename.C: ditto.
188 * src/support/lyxsum.C: ditto.
190 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
192 * src/frontends/xforms/FormBase.[Ch]:
193 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
194 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
195 work only for the next call to fl_show_form(). The correct place to set
196 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
197 done. FormBase also stores minw_, minh_ itself. All dialogs derived
198 from FormBase have the minimum size set; no more stupid crashes with
201 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
203 * lib/ui/default.ui: fix shortcut for Insert->Include File.
205 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
207 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
209 * src/support/lyxlib.h: changed second argument of mkdir to
210 unsigned long int (unsigned int would probably have been enough,
211 but...). Removed <sys/types.h> header.
212 * src/support/mkdir.C (mkdir): ditto.
216 2000-10-19 Juergen Vigna <jug@sad.it>
218 * src/lyxfunc.C (MenuNew): small fix (form John)
220 * src/screen.C (Update): removed unneeded code.
222 * src/tabular.C (Ascii): refixed int != uint bug!
224 * src/support/lyxlib.h: added sys/types.h include for now permits
225 compiling, but I don't like this!
227 2000-10-18 Juergen Vigna <jug@sad.it>
229 * src/text2.C (ClearSelection): if we clear the selection we need
230 more refresh so set the status apropriately
232 * src/insets/insettext.C (draw): hopefully finally fixed draw
235 2000-10-12 Juergen Vigna <jug@sad.it>
237 * src/insets/insettext.C (draw): another small fix and make a block
238 so that variables are localized.
240 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
242 * src/support/lstrings.C (lowercase, uppercase):
243 use explicit casts to remove compiler warnings.
245 * src/support/LRegex.C (Impl):
246 * src/support/StrPool.C (add):
247 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
248 (AddPath, MakeDisplayPath):
249 * src/support/lstrings.C (prefixIs, subst):
250 use correct type to remove compiler warnings.
252 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
254 * src/support/lyxlib.h:
255 * src/support/mkdir.C (mkdir): change parameter to mode_t for
256 portability and to remove compiler warning with DEC cxx.
258 * src/support/FileInfo.[Ch] (flagRWX): ditto.
260 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
262 * src/minibuffer.C (peek_event): retun 1 when there has been a
263 mouseclick in the minibuffer.
267 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
269 * src/frontends/xforms/FormParagraph.C: more space above/below
272 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
274 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
275 a char only if real_current_font was changed.
277 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
279 * NEWS: update somewhat for 1.1.6
281 * lib/ui/default.ui: clean up.
283 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
285 * lib/CREDITS: clean up
287 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
289 * src/combox.[Ch] (select): changed argument back to int
290 * src/combox.C (peek_event): removed num_bytes as it is declared but
293 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
294 modified calls to Combox::select() to remove warnings about type
297 * src/insets/insetbutton.C (width): explicit cast to remove warning
298 about type conversion.
300 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
303 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
304 sel_pos_end, refering to cursor position are changed to
305 LyXParagraph::size_type.
307 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
308 consistent with LyXCursor::pos().
309 (inset_pos): changed to LyXParagraph::size_type for same reason.
311 * src/insets/insettext.C (resizeLyXText): changed some temporary
312 variables refing to cursor position to LyXParagraph::size_type.
314 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
316 * src/frontends/kde/<various>: The Great Renaming,
319 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
321 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
323 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
325 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
326 0 when there are no arguments.
328 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
330 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
331 to segfaults when pressing Ok in InsetBibtex dialog.
333 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
335 * forms/layout_forms.fd:
336 * src/layout_forms.C (create_form_form_character): small change to use
337 labelframe rather than engraved frame + text
339 * src/lyx_gui.C (create_forms): initialise choice_language with some
340 arbitrary value to prevent segfault when dialog is shown.
342 2000-10-16 Baruch Even <baruch.even@writeme.com>
344 * src/converter.C (runLaTeX, scanLog): Added a warning when there
345 is no resulting file. This pertains only to LaTeX output.
347 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
349 * src/text.C (Backspace): Make sure that the row of the cursor is
352 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
355 * src/lyx_gui.C (init): Prevent a crash when only one font from
356 menu/popup fonts is not found.
358 * lib/lyxrc.example: Add an example for binding a key for language
361 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
363 * src/converter.C (GetReachable): Changed the returned type to
365 (IsReachable): New method
367 * src/MenuBackend.C (expand): Handle formats that appear more
370 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
372 * src/frontends/support/Makefile.am
373 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
376 * lib/CREDITS: add Garst Reese.
378 * src/support/snprintf.h: add extern "C" {} around the definitions.
380 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
382 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
385 * src/frontends/xforms/FormDocument.C:
386 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
387 compile without "conversion to integral type of smaller size"
390 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
392 * src/text.C (GetColumnNearX): Fixed disabled code.
394 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
396 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
399 * src/support/snprintf.[ch]: new files
401 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
403 * src/frontends/kde/formprintdialog.C: add
404 file browser for selecting postscript output
406 * src/frontends/kde/formprintdialogdata.C:
407 * src/frontends/kde/formprintdialogdata.h: re-generate
410 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
412 * src/frontends/gnome/Makefile.am:
413 * src/frontends/kde/Makefile.am: FormCommand.C
414 disappeared from xforms
416 * src/frontends/kde/FormCitation.C:
417 * src/frontends/kde/FormIndex.C: read-only
420 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
422 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
425 * src/bufferlist.C: add using directive.
427 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
429 * src/support/lyxfunctional.h: version of class_fun for void
430 returns added, const versions of back_inseter_fun and compare_fun
433 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
435 * src/frontends/xforms/FormInset.C (showInset): fix typo.
437 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
439 * ChangeLog: cleanup.
441 * lib/CREDITS: update to add all the contributors we've forgotten.
442 I have obviously missed some, so tell me whether there were
445 2000-10-13 Marko Vendelin <markov@ioc.ee>
447 * src/frontends/gnome/FormCitation.C
448 * src/frontends/gnome/FormCitation.h
449 * src/frontends/gnome/FormError.C
450 * src/frontends/gnome/FormIndex.C
451 * src/frontends/gnome/FormRef.C
452 * src/frontends/gnome/FormRef.h
453 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
455 * src/frontends/gnome/FormCitation.C
456 * src/frontends/gnome/FormCopyright.C
457 * src/frontends/gnome/FormError.C
458 * src/frontends/gnome/FormIndex.C
459 * src/frontends/gnome/FormRef.C
460 * src/frontends/gnome/FormToc.C
461 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
464 * src/frontends/gnome/Menubar_pimpl.C
465 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
468 2000-10-11 Baruch Even <baruch.even@writeme.com>
471 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
472 to convey its real action.
474 * src/minibuffer.C (peek_event): Added action when mouse clicks to
475 clear the minibuffer and prepare to enter a command.
477 * src/mathed/formula.C (LocalDispatch): Changed to conform with
478 the rename from ExecCommand to PrepareForCommand.
479 * src/lyxfunc.C (Dispatch): ditto.
481 2000-10-11 Baruch Even <baruch.even@writeme.com>
483 * src/buffer.C (writeFile): Added test for errors on writing, this
484 catches all errors and not only file system full errors as intended.
486 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
488 * src/lyx_gui.C (create_forms): better fix for crash with
489 translated interface.
491 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
493 * src/frontends/kde/Makefile.am:
494 * src/frontends/kde/FormCopyright.C:
495 * src/frontends/kde/formcopyrightdialog.C:
496 * src/frontends/kde/formcopyrightdialog.h:
497 * src/frontends/kde/formcopyrightdialogdata.C:
498 * src/frontends/kde/formcopyrightdialogdata.h:
499 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
500 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
501 copyright to use qtarch
503 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
505 * src/encoding.C (read): Fixed bug that caused an error message at
508 * po/Makefile.in.in: Fixed rule for ext_l10n.h
510 * lib/lyxrc.example: Fixed hebrew example.
512 2000-10-13 Allan Rae <rae@lyx.org>
514 * src/frontends/xforms/FormPreferences.C (input): reworking the
516 (build, update, apply): New inputs in various tabfolders
518 * src/frontends/xforms/FormToc.C: use new button policy.
519 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
520 dialogs that either can't use any existing policy or where it just
523 * src/frontends/xforms/FormTabular.h: removed copyright notice that
526 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
527 added a bool parameter which is ignored.
529 * src/buffer.C (setReadonly):
530 * src/BufferView_pimpl.C (buffer):
531 * src/frontends/kde/FormCopyright.h (update):
532 * src/frontends/kde/FormCitation.[Ch] (update):
533 * src/frontends/kde/FormIndex.[Ch] (update):
534 * src/frontends/kde/FormPrint.[Ch] (update):
535 * src/frontends/kde/FormRef.[Ch] (update):
536 * src/frontends/kde/FormToc.[Ch] (update):
537 * src/frontends/kde/FormUrl.[Ch] (update):
538 * src/frontends/gnome/FormCopyright.h (update):
539 * src/frontends/gnome/FormCitation.[Ch] (update):
540 * src/frontends/gnome/FormError.[Ch] (update):
541 * src/frontends/gnome/FormIndex.[Ch] (update):
542 * src/frontends/gnome/FormPrint.[Ch] (update):
543 * src/frontends/gnome/FormRef.h (update):
544 * src/frontends/gnome/FormToc.[Ch] (update):
545 * src/frontends/gnome/FormUrl.[Ch] (update):
546 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
547 to updateBufferDependent and DialogBase
549 * src/frontends/xforms/FormCitation.[hC]:
550 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
551 * src/frontends/xforms/FormError.[Ch]:
552 * src/frontends/xforms/FormGraphics.[Ch]:
553 * src/frontends/xforms/FormIndex.[Ch]:
554 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
555 and fixed readOnly handling.
556 * src/frontends/xforms/FormPrint.[Ch]:
557 * src/frontends/xforms/FormRef.[Ch]:
558 * src/frontends/xforms/FormTabular.[Ch]:
559 * src/frontends/xforms/FormToc.[Ch]:
560 * src/frontends/xforms/FormUrl.[Ch]:
561 * src/frontends/xforms/FormInset.[Ch]:
562 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
563 form of updateBufferDependent.
565 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
566 if form()->visible just in case someone does stuff to the form in a
569 * src/frontends/DialogBase.h (enum): removed enum since we can now use
570 the buttoncontroller for everything the enum used to be used for.
571 (update) It would seem we need to force all dialogs to use a bool
572 parameter or have two update functions. I chose to go with one.
573 I did try removing update() from here and FormBase and defining the
574 appropriate update signatures in FormBaseB[DI] but then ran into the
575 problem of the update() call in FormBase::show(). Whatever I did
576 to get around that would require another function and that just
577 got more confusing. Hence the decision to make everyone have an
578 update(bool). An alternative might have been to override show() in
579 FormBaseB[DI] and that would allow the different and appropriate
582 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
583 true == buffer change occurred. I decided against using a default
584 template parameter since not all compilers support that at present.
586 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
588 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
589 army knife" by removing functionality.
590 (clearStore): removed. All such housekeeping on hide()ing the dialog
591 is to be carried out by overloaded disconnect() methods.
592 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
593 superceded by Baruch's neat test (FormGraphics) to update an existing
594 dialog if a new signal is recieved rather than block all new signals
596 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
597 only to Inset dialogs.
598 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
599 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
601 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
603 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
604 as a base class to all inset dialogs. Used solely to connect/disconnect
605 the Inset::hide signal and to define what action to take on receipt of
606 a UpdateBufferDependent signal.
607 (FormCommand): now derived from FormInset.
609 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
612 * src/frontends/xforms/FormCopyright.[Ch]:
613 * src/frontends/xforms/FormPreferences.[Ch]:
614 now derived from FormBaseBI.
616 * src/frontends/xforms/FormDocument.[Ch]:
617 * src/frontends/xforms/FormParagraph.[Ch]:
618 * src/frontends/xforms/FormPrint.[Ch]:
619 now derived from FormBaseBD.
621 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
623 * src/frontends/xforms/FormCitation.[Ch]:
624 * src/frontends/xforms/FormError.[Ch]:
625 * src/frontends/xforms/FormRef.[Ch]:
626 * src/frontends/xforms/FormToc.[Ch]:
627 (clearStore): reworked as disconnect().
629 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
632 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
634 * src/converter.C (runLaTeX): constify buffer argument
637 * src/frontends/support/Makefile.am (INCLUDES): fix.
639 * src/buffer.h: add std:: qualifier
640 * src/insets/figinset.C (addpidwait): ditto
641 * src/MenuBackend.C: ditto
642 * src/buffer.C: ditto
643 * src/bufferlist.C: ditto
644 * src/layout.C: ditto
645 * src/lyxfunc.C: ditto
647 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
649 * src/lyxtext.h (bidi_level): change return type to
650 LyXParagraph::size_type.
652 * src/lyxparagraph.h: change size_type to
653 TextContainer::difference_type. This should really be
654 TextContainer::size_type, but we need currently to support signed
657 2000-10-11 Marko Vendelin <markov@ioc.ee>
658 * src/frontends/gnome/FormError.h
659 * src/frontends/gnome/FormRef.C
660 * src/frontends/gnome/FormRef.h
661 * src/frontends/gnome/FormError.C
662 * src/frontends/gnome/Makefile.am
663 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
664 to Gnome frontend. Both dialogs use "action" area.
666 2000-10-12 Baruch Even <baruch.even@writeme.com>
668 * src/graphics/GraphicsCacheItem_pimpl.C:
669 * src/graphics/Renderer.C:
670 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
673 2000-10-12 Juergen Vigna <jug@sad.it>
675 * src/insets/insettext.C (draw): fixed drawing bug (specifically
676 visible when selecting).
678 * development/Code_rules/Rules: fixed some typos.
680 2000-10-09 Baruch Even <baruch.even@writeme.com>
682 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
683 compiling on egcs 1.1.2 possible.
685 * src/filedlg.C (comp_direntry::operator() ): ditto.
687 2000-08-31 Baruch Even <baruch.even@writeme.com>
689 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
692 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
693 transient it now only gets freed when the object is destructed.
695 2000-08-24 Baruch Even <baruch.even@writeme.com>
697 * src/frontends/FormGraphics.h:
698 * src/frontends/FormGraphics.C: Changed to use ButtonController and
701 2000-08-20 Baruch Even <baruch.even@writeme.com>
703 * src/insets/insetgraphics.C:
704 (draw): Added messages to the drawn rectangle to report status.
705 (updateInset): Disabled the use of the inline graphics,
708 2000-08-17 Baruch Even <baruch.even@writeme.com>
710 * src/frontends/support: Directory added for the support of GUII LyX.
712 * src/frontends/support/LyXImage.h:
713 * src/frontends/support/LyXImage.C: Base class for GUII holding of
716 * src/frontends/support/LyXImage_X.h:
717 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
718 version of LyXImage, this uses the Xlib Pixmap.
723 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
724 replacement to Pixmap.
726 * src/insets/insetgraphics.h:
727 * src/insets/insetgraphics.C:
728 * src/graphics/GraphicsCacheItem.h:
729 * src/graphics/GraphicsCacheItem.C:
730 * src/graphics/GraphicsCacheItem_pimpl.h:
731 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
734 * src/graphics/GraphicsCacheItem.h:
735 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
736 another copy of the object.
738 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
739 of cacheHandle, this fixed a bug that sent LyX crashing.
741 * src/graphics/XPM_Renderer.h:
742 * src/graphics/XPM_Renderer.C:
743 * src/graphics/EPS_Renderer.h:
744 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
746 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
748 * src/lyxfunc.C (processKeySym): only handle the
749 lockinginset/inset stuff if we have a buffer and text loaded...
751 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
753 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
755 * src/support/lyxfunctional.h: add operator= that takes a reference
757 * src/lyxserver.C (mkfifo): make first arg const
759 * src/layout.h: renamed name(...) to setName(...) to work around
762 * src/buffer.C (setFileName): had to change name of function to
763 work around bugs in egcs. (renamed from fileName)
765 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
767 * src/support/translator.h: move helper template classes to
768 lyxfunctional.h, include "support/lyxfunctional.h"
770 * src/support/lyxmanip.h: add delaration of fmt
772 * src/support/lyxfunctional.h: new file
773 (class_fun_t): new template class
774 (class_fun): helper template function
775 (back_insert_fun_iterator): new template class
776 (back_inserter_fun): helper template function
777 (compare_memfun_t): new template class
778 (compare_memfun): helper template function
779 (equal_1st_in_pair): moved here from translator
780 (equal_2nd_in_pair): moved here from translator
782 * src/support/fmt.C: new file
783 (fmt): new func, can be used for a printf substitute when still
784 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
786 * src/support/StrPool.C: add some comments
788 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
791 * src/insets/figinset.C (addpidwait): use std::copy with
792 ostream_iterator to fill the pidwaitlist
794 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
796 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
799 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
802 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
804 * src/frontends/xforms/FormDocument.C (build): remove c_str()
805 (class_update): ditto
807 (CheckChoiceClass): move initialization of tc and tct
809 * src/tabular.C: remove current_view
810 (OldFormatRead): similar to right below [istream::ignore]
812 * src/lyxlex_pimpl.C (next): add code for faster skipping of
813 chars, unfortunately this is buggy on gcc 2.95.2, so currently
814 unused [istream::ignore]
816 * src/lyxfunc.C: include "support/lyxfunctional.h"
817 (getInsetByCode): use std::find_if and compare_memfun
819 * src/lyxfont.C (stateText): remove c_str()
821 * src/lyx_main.C (setDebuggingLevel): make static
822 (commandLineHelp): make static
824 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
825 Screen* together with fl_get_display() and fl_screen
827 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
828 togheter with fl_get_display() and fl_screen
829 (create_forms): remove c_str()
831 * src/layout.C: include "support/lyxfunctional.h"
832 (hasLayout): use std::find_if and compare_memfun
833 (GetLayout): use std::find_if and comapre_memfun
834 (delete_layout): use std::remove_if and compare_memfun
835 (NumberOfClass): use std:.find_if and compare_memfun
837 * src/gettext.h: change for the new functions
839 * src/gettext.C: new file, make _(char const * str) and _(string
840 const & str) real functions.
842 * src/font.C (width): rewrite slightly to avoid one extra variable
844 * src/debug.C: initialize Debug::ANY here
846 * src/commandtags.h: update number comments
848 * src/combox.h (get): make const func
850 (getline): make const
852 * src/combox.C (input_cb): handle case where fl_get_input can
855 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
856 "support/lyxfunctional.h", remove current_view variable.
857 (resize): use std::for_each with std::mem_fun
858 (getFileNames): use std::copy with back_inserter_fun
859 (getBuffer): change arg type to unsigned int
860 (emergencyWriteAll): call emergencyWrite with std::for_each and
862 (emergencyWrite): new method, the for loop in emergencyWriteAll
864 (exists): use std::find_if with compare_memfun
865 (getBuffer): use std::find_if and compare_memfun
867 * src/buffer.h: add typedefs for iterator_category, value_type
868 difference_type, pointer and reference for inset_iterator
869 add postfix ++ for inset_iterator
870 make inset_iterator::getPos() const
872 * src/buffer.C: added support/lyxmanip.h
873 (readFile): use lyxerr << fmt instead of printf
874 (makeLaTeXFile): use std::copy to write out encodings
876 * src/Painter.C (text): rewrite slightly to avoid extra font variable
878 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
879 free and the char * temp.
880 (hasMenu): use std::find_if and compare_memfun
883 * src/Makefile.am (lyx_SOURCES): added gettext.C
885 * src/LyXAction.C (retrieveActionArg): clear the arg, use
886 string::insert small change to avoid temporary
888 * src/LColor.C (getGUIName): remove c_str()
890 * several files: change all occurrences of fl_display to
893 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
894 that -pedantic is not used for gcc 2.97 (cvs gcc)
896 * boost/Makefile.am: begin slowly to prepare for a real boost lib
898 2000-10-11 Allan Rae <rae@lyx.org>
900 * src/frontends/xforms/FormPreferences.C (input): template path must be
901 a readable directory. It doesn't need to be writeable.
902 (build, delete, update, apply): New inputs in the various tabfolders
904 * src/frontends/xforms/forms/form_preferences.fd:
905 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
906 several new entries to existing folders. Shuffled some existing stuff
909 * src/frontends/xforms/forms/form_print.fd:
910 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
911 Should probably rework PrinterParams as well. Note that the switch to
912 collated is effectively the same as !unsorted so changing PrinterParams
913 will require a lot of fiddly changes to reverse the existing logic.
915 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
917 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
919 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
921 2000-10-10 Allan Rae <rae@lyx.org>
924 * src/lyxfunc.C (Dispatch):
926 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
929 * src/lyxrc.C (output): Only write the differences between system lyxrc
930 and the users settings.
933 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
935 I'll rewrite this later, after 1.1.6 probably, to keep a single
936 LyXRC but two instances of a LyXRCStruct.
938 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
940 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
942 * src/tabular.h: add a few std:: qualifiers.
944 * src/encoding.C: add using directive.
945 * src/language.C: ditto.
947 * src/insets/insetquotes.C (Validate): use languages->lang()
948 instead of only language.
950 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
952 * lib/languages: New file.
954 * lib/encodings: New file.
956 * src/language.C (Languages): New class.
957 (read): New method. Reads the languages from the 'languages' file.
959 * src/encoding.C (Encodings): New class.
960 (read): New method. Reads the encodings from the 'encodings' file.
962 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
965 * src/bufferparams.h and a lot of files: Deleted the member language,
966 and renamed language_info to language
968 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
969 * src/lyxfont.C (latexWriteStartChanges): ditto.
970 * src/paragraph.C (validate,TeXOnePar): ditto.
972 * src/lyxfont.C (update): Restored deleted code.
974 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
976 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
978 * src/BufferView_pimpl.C (buffer): cleaned up a little.
980 * src/insets/figinset.[Ch]:
981 * src/insets/insetinclude.[Ch]:
982 * src/insets/insetinclude.[Ch]:
983 * src/insets/insetparent.[Ch]:
984 * src/insets/insetref.[Ch]:
985 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
988 * src/mathed/formula.[Ch]:
989 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
991 * src/buffer.C (parseSingleLyXformat2Token, readInset):
992 * src/lyx_cb.C (FigureApplyCB):
993 * src/lyxfunc.C (getStatus, Dispatch):
994 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
997 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
999 * src/converter.[Ch] (Formats::View):
1000 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1002 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1003 *current_view->buffer(). This will change later, but this patch is way
1006 2000-10-09 Juergen Vigna <jug@sad.it>
1008 * src/text.C (GetRow): small fix.
1010 * src/BufferView_pimpl.C (cursorPrevious):
1011 (cursorNext): added LyXText parameter to function.
1013 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1014 keypress depending on cursor position.
1016 2000-10-06 Juergen Vigna <jug@sad.it>
1018 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1019 (copySelection): redone this function and also copy ascii representa-
1022 * src/tabular.C (Ascii):
1026 (print_n_chars): new functions to realize the ascii export of tabulars.
1028 2000-10-05 Juergen Vigna <jug@sad.it>
1030 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1031 if we don't have a buffer.
1033 2000-10-10 Allan Rae <rae@lyx.org>
1035 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1036 with closing dialog. It seems that nested tabfolders require hiding
1037 of inner tabfolders before hiding the dialog itself. Actually all I
1038 did was hide the active outer folder.
1040 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1041 unless there really is a buffer. hideBufferDependent is called
1044 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1045 POTFILES.in stays in $(srcdir).
1047 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1049 * lib/lyxrc.example: Few changes.
1051 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1053 * src/BufferView_pimpl.C (buffer): only need one the
1054 updateBufferDependent signal to be emitted once! Moved to the end of
1055 the method to allow bv_->text to be updated first.
1057 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1058 and hSignal_ with Dialogs * and BufferDependency variables.
1059 New Buffer * parent_, initialised when the dialog is launched. Used to
1060 check whether to update() or hide() dialog in the new, private
1061 updateOrHide() method that is connected to the updateBufferDependent
1062 signal. Daughter classes dictate what to do using the
1063 ChangedBufferAction enum, passed to the c-tor.
1065 * src/frontends/xforms/FormCitation.C:
1066 * src/frontends/xforms/FormCommand.C:
1067 * src/frontends/xforms/FormCopyright.C:
1068 * src/frontends/xforms/FormDocument.C:
1069 * src/frontends/xforms/FormError.C:
1070 * src/frontends/xforms/FormIndex.C:
1071 * src/frontends/xforms/FormPreferences.C:
1072 * src/frontends/xforms/FormPrint.C:
1073 * src/frontends/xforms/FormRef.C:
1074 * src/frontends/xforms/FormToc.C:
1075 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1078 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1079 ChangedBufferAction enum.
1081 * src/frontends/xforms/FormParagraph.[Ch]
1082 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1085 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1087 * lib/bind/cua.bind: fix a bit.
1088 * lib/bind/emacs.bind: ditto.
1090 * lib/bind/menus.bind: remove real menu entries from there.
1092 * src/spellchecker.C: make sure we only include strings.h when
1095 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1097 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
1098 function. It enlarges the maximum number of pup when needed.
1099 (add_toc2): Open a new menu if maximum number of items per menu has
1102 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
1104 * src/frontends/kde/FormPrint.C: fix error reporting
1106 * src/frontends/xforms/FormDocument.C: fix compiler
1109 * lib/.cvsignore: add Literate.nw
1111 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
1114 * bufferview_funcs.[Ch]
1117 * text2.C: Add support for numbers in RTL text.
1119 2000-10-06 Allan Rae <rae@lyx.org>
1121 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
1122 to be gettext.m4 friendly again. ext_l10n.h is now
1123 generated into $top_srcdir instead of $top_builddir
1124 so that lyx.pot will be built correctly -- without
1125 duplicate parsing of ext_l10n.h.
1127 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1129 * src/frontends/kde/FormCitation.C: make the dialog
1130 behave more sensibly
1132 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
1134 * config/kde.m4: fix consecutive ./configure runs,
1135 look for qtarch, fix library order
1137 * src/frontends/kde/Makefile.am: tidy up,
1138 add Print dialog, add .dlg dependencies
1140 * src/frontends/kde/FormPrint.C:
1141 * src/frontends/kde/FormPrint.h:
1142 * src/frontends/kde/formprintdialog.C:
1143 * src/frontends/kde/formprintdialog.h:
1144 * src/frontends/kde/formprintdialogdata.C:
1145 * src/frontends/kde/formprintdialogdata.h:
1146 * src/frontends/kde/dlg/formprintdialog.dlg: add
1149 * src/frontends/kde/dlg/README: Added explanatory readme
1151 * src/frontends/kde/dlg/checkinitorder.pl: small perl
1152 script to double-check qtarch's output
1154 * src/frontends/kde/formindexdialog.C:
1155 * src/frontends/kde/formindexdialogdata.C:
1156 * src/frontends/kde/formindexdialogdata.h:
1157 * src/frontends/kde/dlg/formindexdialog.dlg: update
1158 for qtarch, minor fixes
1160 2000-10-05 Allan Rae <rae@lyx.org>
1162 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
1163 dialogs when switching buffers update them instead. It's up to each
1164 dialog to decide if it should still be visible or not.
1165 update() should return a bool to control visiblity within show().
1166 Or perhaps better to set a member variable and use that to control
1169 * lib/build-listerrors: create an empty "listerrors" file just to stop
1170 make trying to regenerate it all the time if you don't have noweb
1173 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
1175 * po/Makefile.in.in (ext_l10n.h): added a rule to build
1176 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
1177 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
1178 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
1179 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
1181 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
1183 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
1185 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
1186 deleting buffer. Closes all buffer-dependent dialogs.
1188 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
1190 * src/frontends/xforms/FormCitation.[Ch]:
1191 * src/frontends/xforms/FormPreferences.[Ch]:
1192 * src/frontends/xforms/FormPrint.[Ch]:
1193 * src/frontends/xforms/FormRef.[Ch]:
1194 * src/frontends/xforms/FormUrl.[Ch]: ditto
1196 * src/frontends/xforms/FormDocument.[Ch]:
1197 * src/frontends/xforms/forms/form_document.C.patch:
1198 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
1199 pass through a single input() function.
1201 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
1203 * lib/build-listerrors: return status as OK
1205 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
1207 * lib/lyxrc.example: Updated to new export code
1209 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1211 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
1214 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
1217 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
1218 LyX-Code is defined.
1219 * lib/layouts/amsbook.layout: ditto.
1221 * boost/Makefile.am: fix typo.
1223 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
1225 (add_lastfiles): removed.
1226 (add_documents): removed.
1227 (add_formats): removed.
1229 * src/frontends/Menubar.C: remove useless "using" directive.
1231 * src/MenuBackend.h: add a new MenuItem constructor.
1233 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
1236 2000-10-04 Allan Rae <rae@lyx.org>
1238 * lib/Makefile.am (listerrors):
1239 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
1240 I haven't got notangle installed so Kayvan please test. The output
1241 should end up in $builddir. This also allows people who don't have
1242 noweb installed to complete the make process without error.
1244 * src/frontends/xforms/FormCommand.[Ch] (showInset):
1245 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
1246 by JMarc's picky compiler.
1248 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1251 * src/insets/insettabular.C (setPos): change for loop to not use
1252 sequencing operator. Please check this Jürgen.
1254 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
1256 * src/insets/insetcite.C (getScreenLabel): ditto
1257 * src/support/filetools.C (QuoteName): ditto
1258 (ChangeExtension): ditto
1260 * src/BufferView_pimpl.C (scrollCB): make heigt int
1262 * src/BufferView2.C (insertInset): comment out unused arg
1264 * boost/Makefile.am (EXTRADIST): new variable
1266 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1268 * src/exporter.C (IsExportable): Fixed
1270 * lib/configure.m4: Small fix
1272 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
1274 * src/insets/insetbutton.C (width): Changed to work with no GUI.
1275 * src/insets/insetbib.C (bibitemWidest): ditto.
1276 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1278 2000-10-03 Juergen Vigna <jug@sad.it>
1280 * src/BufferView2.C (theLockingInset): removed const because of
1281 Agnus's compile problems.
1283 * src/insets/insettext.C (LocalDispatch): set the language of the
1284 surronding paragraph on inserting the first character.
1286 * various files: changed use of BufferView::the_locking_inset.
1288 * src/BufferView2.C (theLockingInset):
1289 (theLockingInset): new functions.
1291 * src/BufferView.h: removed the_locking_inset.
1293 * src/lyxtext.h: added the_locking_inset
1295 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1297 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1299 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1301 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1302 * src/mathed/math_cursor.C (IsAlpha): ditto.
1303 * src/mathed/math_inset.C (strnew): ditto.
1304 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1305 (IMetrics): cxp set but never used; removed.
1306 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1307 that the variable in question has been removed also!
1310 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1311 using the Buffer * passed to Latex(), using the BufferView * passed to
1312 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1314 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1315 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1317 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1318 * src/buffer.C (readInset): used new InsetBibtex c-tor
1319 * (getBibkeyList): used new InsetBibtex::getKeys
1321 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1324 * lib/build-listerrors
1326 * src/exporter.C: Add literate programming support to the export code
1329 * src/lyx_cb.C: Remove old literate code.
1331 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1334 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1335 * src/converter.C (View, Convert): Use QuoteName.
1337 * src/insets/figinset.C (Preview): Use Formats::View.
1339 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1341 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1343 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1344 the top of the function, because compaq cxx complains that the
1345 "goto exit_with_message" when the function is disabled bypasses
1347 (MenuNew): try a better fix for the generation of new file names.
1348 This time, I used AddName() instead of AddPath(), hoping Juergen
1351 2000-10-03 Allan Rae <rae@lyx.org>
1353 * src/frontends/xforms/forms/form_preferences.fd:
1354 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1355 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1356 "Look and Feel"->"General" but will need to be split up further into
1357 general output and general input tabs. Current plan is for four outer
1358 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1359 stuff; "Inputs" for input and import configuration; "Outputs" for
1360 output and export configuration; and one more whatever is left over
1361 called "General". The leftovers at present look like being which
1362 viewers to use, spellchecker, language support and might be better
1363 named "Support". I've put "Paths" in "Inputs" for the moment as this
1364 seems reasonable for now at least.
1365 One problem remains: X error kills LyX when you close Preferences.
1367 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1369 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1370 qualifier from form()
1371 * src/frontends/xforms/FormCitation.[Ch]:
1372 * src/frontends/xforms/FormCopyright.[Ch]:
1373 * src/frontends/xforms/FormDocument.[Ch]:
1374 * src/frontends/xforms/FormError.[Ch]:
1375 * src/frontends/xforms/FormIndex.[Ch]:
1376 * src/frontends/xforms/FormPreferences.[Ch]:
1377 * src/frontends/xforms/FormPrint.[Ch]:
1378 * src/frontends/xforms/FormRef.[Ch]:
1379 * src/frontends/xforms/FormToc.[Ch]:
1380 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1382 * src/frontends/xforms/FormCitation.[Ch]:
1383 * src/frontends/xforms/FormIndex.[Ch]:
1384 * src/frontends/xforms/FormRef.[Ch]:
1385 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1386 with Allan's naming policy
1388 * src/frontends/xforms/FormCitation.C: some static casts to remove
1391 2000-10-02 Juergen Vigna <jug@sad.it>
1393 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1394 now you can type or do stuff inside the table-cell also when in dummy
1395 position, fixed visible cursor.
1397 * src/insets/insettext.C (Edit): fixing cursor-view position.
1399 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1400 be used for equal functions in lyxfunc and insettext.
1402 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1404 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1406 * src/frontends/gnome/FormCitation.h:
1407 * src/frontends/gnome/FormCopyright.h:
1408 * src/frontends/gnome/FormIndex.h:
1409 * src/frontends/gnome/FormPrint.h:
1410 * src/frontends/gnome/FormToc.h:
1411 * src/frontends/gnome/FormUrl.h:
1412 * src/frontends/kde/FormCitation.h:
1413 * src/frontends/kde/FormCopyright.h:
1414 * src/frontends/kde/FormIndex.h:
1415 * src/frontends/kde/FormRef.h:
1416 * src/frontends/kde/FormToc.h:
1417 * src/frontends/kde/FormUrl.h: fix remaining users of
1420 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1422 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1423 from depth argument.
1424 (DocBookHandleCaption): ditto.
1425 (DocBookHandleFootnote): ditto.
1426 (SimpleDocBookOnePar): ditto.
1428 * src/frontends/xforms/FormDocument.h (form): remove extra
1429 FormDocument:: qualifier.
1431 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1433 * sigc++/handle.h: ditto.
1435 * src/lyx_gui_misc.C: add "using" directive.
1437 * src/cheaders/cstddef: new file, needed by the boost library (for
1440 2000-10-02 Juergen Vigna <jug@sad.it>
1442 * src/insets/insettext.C (SetFont): better support.
1444 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1446 * src/screen.C (DrawOneRow): some uint refixes!
1448 2000-10-02 Allan Rae <rae@lyx.org>
1450 * boost/.cvsignore: ignore Makefile as well
1452 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1453 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1455 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1456 Left this one out by accident.
1458 * src/frontends/xforms/FormBase.h (restore): default to calling
1459 update() since that will restore the original/currently-applied values.
1460 Any input() triggered error messages will require the derived classes
1461 to redefine restore().
1463 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1464 avoid a segfault. combo_doc_class is the main concern.
1466 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1468 * Simplify build-listerrors in view of GUI-less export ability!
1470 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1472 * src/lyx_main.C (easyParse): Disable gui when exporting
1474 * src/insets/figinset.C:
1477 * src/lyx_gui_misc.C
1478 * src/tabular.C: Changes to allow no-gui.
1480 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1482 * src/support/utility.hpp: removed file
1483 * src/support/block.h: removed file
1485 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1488 * src/mathed/formula.C: add support/lyxlib.h
1489 * src/mathed/formulamacro.C: ditto
1491 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1492 * src/lyxparagraph.h: ditto
1494 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1495 * src/frontends/Makefile.am (INCLUDES): ditto
1496 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1497 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1498 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1499 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1500 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1501 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1503 * src/BufferView.h: use boost/utility.hpp
1504 * src/LColor.h: ditto
1505 * src/LaTeX.h: ditto
1506 * src/LyXAction.h: ditto
1507 * src/LyXView.h: ditto
1508 * src/bufferlist.h: ditto
1509 * src/lastfiles.h: ditto
1510 * src/layout.h: ditto
1511 * src/lyx_gui.h: ditto
1512 * src/lyx_main.h: ditto
1513 * src/lyxlex.h: ditto
1514 * src/lyxrc.h: ditto
1515 * src/frontends/ButtonPolicies.h: ditto
1516 * src/frontends/Dialogs.h: ditto
1517 * src/frontends/xforms/FormBase.h: ditto
1518 * src/frontends/xforms/FormGraphics.h: ditto
1519 * src/frontends/xforms/FormParagraph.h: ditto
1520 * src/frontends/xforms/FormTabular.h: ditto
1521 * src/graphics/GraphicsCache.h: ditto
1522 * src/graphics/Renderer.h: ditto
1523 * src/insets/ExternalTemplate.h: ditto
1524 * src/insets/insetcommand.h: ditto
1525 * src/support/path.h: ditto
1527 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1528 and introduce clause for 2.97.
1530 * boost/libs/README: new file
1532 * boost/boost/utility.hpp: new file
1534 * boost/boost/config.hpp: new file
1536 * boost/boost/array.hpp: new file
1538 * boost/Makefile.am: new file
1540 * boost/.cvsignore: new file
1542 * configure.in (AC_OUTPUT): add boost/Makefile
1544 * Makefile.am (SUBDIRS): add boost
1546 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1548 * src/support/lstrings.C (suffixIs): Fixed.
1550 2000-10-01 Allan Rae <rae@lyx.org>
1552 * src/PrinterParams.h: moved things around to avoid the "can't
1553 inline call" warning.
1555 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1556 into doc++ documentation.
1558 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1560 * src/frontends/xforms/FormRef.C: make use of button controller
1561 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1562 cleaned up button controller usage.
1563 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1564 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1565 use the button controller
1567 * src/frontends/xforms/forms/*.fd: and associated generated files
1568 updated to reflect changes to FormBase. Some other FormXxxx files
1569 also got minor updates to reflect changes to FormBase.
1571 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1572 (hide): made virtual.
1573 (input): return a bool. true == valid input
1574 (RestoreCB, restore): new
1575 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1576 Changes to allow derived dialogs to use a ButtonController and
1577 make sense when doing so: OK button calls ok() and so on.
1579 * src/frontends/xforms/ButtonController.h (class ButtonController):
1580 Switch from template implementation to taking Policy parameter.
1581 Allows FormBase to provide a ButtonController for any dialog.
1583 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1584 Probably should rename connect and disconnect.
1585 (apply): use the radio button groups
1586 (form): needed by FormBase
1587 (build): setup the radio button groups
1589 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1591 * several files: type changes to reduce the number of warnings and
1592 to unify type hangling a bit. Still much to do.
1594 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1596 * lib/images/*: rename a bunch of icons to match Dekel converter
1599 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1602 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1604 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1606 * sigc++/handle.h: ditto for class Handle.
1608 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1610 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1612 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1614 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1615 removal of the "default" language.
1617 * src/combox.h (getline): Check that sel > 0
1619 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1621 * lib/examples/docbook_example.lyx
1622 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1624 * lib/layouts/docbook-book.layout: new docbook book layout.
1626 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1628 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1630 * src/insets/figinset.C (DocBook):fixed small typo.
1632 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1634 * src/insets/insetinclude.h: string include_label doesn't need to be
1637 2000-09-29 Allan Rae <rae@lyx.org>
1639 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1640 Allow derived type to control connection and disconnection from signals
1641 of its choice if desired.
1643 2000-09-28 Juergen Vigna <jug@sad.it>
1645 * src/insets/insettabular.C (update): fixed cursor setting when
1646 the_locking_inset changed.
1647 (draw): made this a bit cleaner.
1648 (InsetButtonPress): fixed!
1650 * various files: added LyXText Parameter to fitCursor call.
1652 * src/BufferView.C (fitCursor): added LyXText parameter.
1654 * src/insets/insettabular.C (draw): small draw fix.
1656 * src/tabular.C: right setting of left/right celllines.
1658 * src/tabular.[Ch]: fixed various types in funcions and structures.
1659 * src/insets/insettabular.C: ditto
1660 * src/frontends/xforms/FormTabular.C: ditto
1662 2000-09-28 Allan Rae <rae@lyx.org>
1664 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1665 that the #ifdef's had been applied to part of what should have been
1666 a complete condition. It's possible there are other tests that
1667 were specific to tables that are also wrong now that InsetTabular is
1668 being used. Now we need to fix the output of '\n' after a table in a
1669 float for the same reason as the original condition:
1670 "don't insert this if we would be adding it before or after a table
1671 in a float. This little trick is needed in order to allow use of
1672 tables in \subfigures or \subtables."
1673 Juergen can you check this?
1675 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1677 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1678 output to the ostream.
1680 * several files: fixed types based on warnings from cxx
1682 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1684 * src/frontends/kde/Makefile.am: fix rule for
1685 formindexdialogdata_moc.C
1687 * src/.cvsignore: add ext_l10n.h to ignore
1689 * acconfig.h: stop messing with __STRICT_ANSI__
1690 * config/gnome.m4: remove option to set -ansi
1691 * config/kde.m4: remove option to set -ansi
1692 * config/lyxinclude.m4: don't set -ansi
1694 2000-09-27 Juergen Vigna <jug@sad.it>
1696 * various files: remove "default" language check.
1698 * src/insets/insetquotes.C: removed use of current_view.
1700 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1701 the one should have red ears by now!
1703 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1704 in more then one paragraph. Fixed cursor-movement/selection.
1706 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1707 paragraphs inside a text inset.
1709 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1710 text-inset if this owner is an inset.
1712 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1714 * src/Bullet.h: changed type of font, character and size to int
1716 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1718 * src/insets/inseturl.[Ch]:
1719 * src/insets/insetref.[Ch]:
1720 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1722 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1724 * src/buffer.C (readFile): block-if statement rearranged to minimise
1725 bloat. Patch does not reverse Jean-Marc's change ;-)
1727 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1728 Class rewritten to store pointers to hide/update signals directly,
1729 rather than Dialogs *. Also defined an enum to ease use. All xforms
1730 forms can now be derived from this class.
1732 * src/frontends/xforms/FormCommand.[Ch]
1733 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1735 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1738 * src/frontends/xforms/forms/form_citation.fd
1739 * src/frontends/xforms/forms/form_copyright.fd
1740 * src/frontends/xforms/forms/form_error.fd
1741 * src/frontends/xforms/forms/form_index.fd
1742 * src/frontends/xforms/forms/form_ref.fd
1743 * src/frontends/xforms/forms/form_toc.fd
1744 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1746 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1748 * src/insets/insetfoot.C: removed redundent using directive.
1750 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1752 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1753 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1755 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1756 created in the constructors in different groups. Then set() just
1757 have to show the groups as needed. This fixes the redraw problems
1758 (and is how the old menu code worked).
1760 * src/support/lyxlib.h: declare the methods as static when we do
1761 not have namespaces.
1763 2000-09-26 Juergen Vigna <jug@sad.it>
1765 * src/buffer.C (asciiParagraph): new function.
1766 (writeFileAscii): new function with parameter ostream.
1767 (writeFileAscii): use now asciiParagraph.
1769 * various inset files: added the linelen parameter to the Ascii-func.
1771 * src/tabular.C (Write): fixed error in writing file introduced by
1772 the last changes from Lars.
1774 * lib/bind/menus.bind: removed not supported functions.
1776 * src/insets/insettext.C (Ascii): implemented this function.
1778 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1780 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1781 (Write): use of the write_attribute functions.
1783 * src/bufferlist.C (close): fixed reasking question!
1785 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1787 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1788 new files use the everwhere possible.
1791 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1792 src/log_form.C src/lyx.C:
1795 * src/buffer.C (runLaTeX): remove func
1797 * src/PaperLayout.C: removed file
1798 * src/ParagraphExtra.C: likewise
1799 * src/bullet_forms.C: likewise
1800 * src/bullet_forms.h: likewise
1801 * src/bullet_forms_cb.C: likewise
1803 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1804 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1807 * several files: remove all traces of the old fd_form_paragraph,
1808 and functions belonging to that.
1810 * several files: remove all traces of the old fd_form_document,
1811 and functions belonging to that.
1813 * several files: constify local variables were possible.
1815 * several files: remove all code that was dead when NEW_EXPORT was
1818 * several files: removed string::c_str in as many places as
1821 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1822 (e): be a bit more outspoken when patching
1823 (updatesrc): only move files if changed.
1825 * forms/layout_forms.h.patch: regenerated
1827 * forms/layout_forms.fd: remove form_document and form_paragraph
1828 and form_quotes and form_paper and form_table_options and
1829 form_paragraph_extra
1831 * forms/form1.fd: remove form_table
1833 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1834 the fdui->... rewrite. Update some comments to xforms 0.88
1836 * forms/bullet_forms.C.patch: removed file
1837 * forms/bullet_forms.fd: likewise
1838 * forms/bullet_forms.h.patch: likewise
1840 * development/Code_rules/Rules: added a section on switch
1841 statements. Updated some comment to xforms 0.88.
1843 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1845 * src/buffer.C (readFile): make sure that the whole version number
1846 is read after \lyxformat (even when it contains a comma)
1848 * lib/ui/default.ui: change shortcut of math menu to M-a.
1850 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1852 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1855 * src/LyXView.C (updateWindowTitle): show the full files name in
1856 window title, limited to 30 characters.
1858 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1859 When a number of characters has been given, we should not assume
1860 that the string is 0-terminated.
1862 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1863 calls (fixes some memory leaks)
1865 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1866 trans member on exit.
1868 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1870 * src/converter.C (GetReachable): fix typo.
1872 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1873 understand ',' instead of '.'.
1874 (GetInteger): rewrite to use strToInt().
1876 2000-09-26 Juergen Vigna <jug@sad.it>
1878 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1879 better visibility and error-message on wrong VSpace input.
1881 * src/language.C (initL): added english again.
1883 2000-09-25 Juergen Vigna <jug@sad.it>
1885 * src/frontends/kde/Dialogs.C (Dialogs):
1886 * src/frontends/gnome/Dialogs.C (Dialogs):
1887 * src/frontends/kde/Makefile.am:
1888 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1890 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1892 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1894 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1896 * src/frontends/xforms/FormParagraph.C:
1897 * src/frontends/xforms/FormParagraph.h:
1898 * src/frontends/xforms/form_paragraph.C:
1899 * src/frontends/xforms/form_paragraph.h:
1900 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1903 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1905 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1906 Paragraph-Data after use.
1908 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1909 non breakable paragraphs.
1911 2000-09-25 Garst R. Reese <reese@isn.net>
1913 * src/language.C (initL): added missing language_country codes.
1915 2000-09-25 Juergen Vigna <jug@sad.it>
1917 * src/insets/insettext.C (InsetText):
1918 (deleteLyXText): remove the not released LyXText structure!
1920 2000-09-24 Marko Vendelin <markov@ioc.ee>
1922 * src/frontends/gnome/mainapp.C
1923 * src/frontends/gnome/mainapp.h: added support for keyboard
1926 * src/frontends/gnome/FormCitation.C
1927 * src/frontends/gnome/FormCitation.h
1928 * src/frontends/gnome/Makefile.am
1929 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1930 FormCitation to use "action area" in mainapp window
1932 * src/frontends/gnome/Menubar_pimpl.C
1933 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1936 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1938 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1939 width/descent/ascent values if name is empty.
1940 (mathed_string_height): Use std::max.
1942 2000-09-25 Allan Rae <rae@lyx.org>
1944 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1945 segfault. This will be completely redesigned soon.
1947 * sigc++: updated libsigc++. Fixes struct timespec bug.
1949 * development/tools/makeLyXsigc.sh: .cvsignore addition
1951 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1953 * several files: removed almost all traces of the old table
1956 * src/TableLayout.C: removed file
1958 2000-09-22 Juergen Vigna <jug@sad.it>
1960 * src/frontends/kde/Dialogs.C: added credits forms.
1962 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1964 * src/frontends/gnome/Dialogs.C: added some forms.
1966 * src/spellchecker.C (init_spell_checker): set language in pspell code
1967 (RunSpellChecker): some modifications for setting language string.
1969 * src/language.[Ch]: added language_country code.
1971 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1973 * src/frontends/Dialogs.h: added new signal showError.
1974 Rearranged existing signals in some sort of alphabetical order.
1976 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1977 FormError.[Ch], form_error.[Ch]
1978 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1979 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1981 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1982 dialogs. I think that this can be used as the base to all these
1985 * src/frontends/xforms/FormError.[Ch]
1986 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1987 implementation of InsetError dialog.
1989 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1991 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1992 * src/frontends/kde/Makefile.am: ditto
1994 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1996 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1997 macrobf. This fixes a bug of invisible text.
1999 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2001 * lib/doc/LaTeXConfig.lyx.in: updated.
2003 * src/language.C (initL): remove language "francais" and change a
2004 bit the names of the two other french variations.
2006 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2007 string that may not be 0-terminated.
2009 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2011 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2013 2000-09-20 Marko Vendelin <markov@ioc.ee>
2015 * src/frontends/gnome/FormCitation.C
2016 * src/frontends/gnome/FormIndex.C
2017 * src/frontends/gnome/FormToc.C
2018 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2019 the variable initialization to shut up the warnings
2021 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2023 * src/table.[Ch]: deleted files
2025 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2028 2000-09-18 Juergen Vigna <jug@sad.it>
2030 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2031 problems with selection. Inserted new LFUN_PASTESELECTION.
2032 (InsetButtonPress): inserted handling of middle mouse-button paste.
2034 * src/spellchecker.C: changed word to word.c_str().
2036 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2038 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2039 included in the ``make dist'' tarball.
2041 2000-09-15 Juergen Vigna <jug@sad.it>
2043 * src/CutAndPaste.C (cutSelection): small fix return the right
2044 end position after cut inside one paragraph only.
2046 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2047 we are locked as otherwise we don't have a valid cursor position!
2049 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2051 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2053 * src/frontends/kde/FormRef.C: added using directive.
2054 * src/frontends/kde/FormToc.C: ditto
2056 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2058 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2060 2000-09-19 Marko Vendelin <markov@ioc.ee>
2062 * src/frontends/gnome/Menubar_pimpl.C
2063 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2064 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2066 * src/frontends/gnome/mainapp.C
2067 * src/frontends/gnome/mainapp.h: support for menu update used
2070 * src/frontends/gnome/mainapp.C
2071 * src/frontends/gnome/mainapp.h: support for "action" area in the
2072 main window. This area is used by small simple dialogs, such as
2075 * src/frontends/gnome/FormIndex.C
2076 * src/frontends/gnome/FormIndex.h
2077 * src/frontends/gnome/FormUrl.C
2078 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2081 * src/frontends/gnome/FormCitation.C
2082 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2083 action area. Only "Insert new citation" is implemented.
2085 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2087 * src/buffer.C (Dispatch): fix call to Dispatch
2088 * src/insets/insetref.C (Edit): likewise
2089 * src/insets/insetparent.C (Edit): likewise
2090 * src/insets/insetinclude.C (include_cb): likewise
2091 * src/frontends/xforms/FormUrl.C (apply): likewise
2092 * src/frontends/xforms/FormToc.C (apply): likewise
2093 * src/frontends/xforms/FormRef.C (apply): likewise
2094 * src/frontends/xforms/FormIndex.C (apply): likewise
2095 * src/frontends/xforms/FormCitation.C (apply): likewise
2096 * src/lyxserver.C (callback): likewise
2097 * src/lyxfunc.C (processKeySym): likewise
2098 (Dispatch): likewise
2099 (Dispatch): likewise
2100 * src/lyx_cb.C (LayoutsCB): likewise
2102 * Makefile.am (sourcedoc): small change
2104 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2106 * src/main.C (main): Don't make an empty GUIRunTime object. all
2107 methods are static. constify a bit remove unneded using + headers.
2109 * src/tabular.C: some more const to local vars move some loop vars
2111 * src/spellchecker.C: added some c_str after some word for pspell
2113 * src/frontends/GUIRunTime.h: add new static method setDefaults
2114 * src/frontends/xforms/GUIRunTime.C (setDefaults):
2115 * src/frontends/kde/GUIRunTime.C (setDefaults):
2116 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
2118 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
2119 with strnew in arg, use correct emptystring when calling SetName.
2121 * several files: remove all commented code with relation to
2122 HAVE_SSTREAM beeing false. We now only support stringstream and
2125 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2127 * src/lyxfunc.C: construct correctly the automatic new file
2130 * src/text2.C (IsStringInText): change type of variable i to shut
2133 * src/support/sstream.h: do not use namespaces if the compiler
2134 does not support them.
2136 2000-09-15 Marko Vendelin <markov@ioc.ee>
2137 * src/frontends/gnome/FormCitation.C
2138 * src/frontends/gnome/FormCitation.h
2139 * src/frontends/gnome/diainsertcitation_interface.c
2140 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
2141 regexp support to FormCitation [Gnome].
2143 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
2146 * configure.in: remove unused KDE/GTKGUI define
2148 * src/frontends/kde/FormRef.C
2149 * src/frontends/kde/FormRef.h
2150 * src/frontends/kde/formrefdialog.C
2151 * src/frontends/kde/formrefdialog.h: double click will
2152 go to reference, now it is possible to change a cross-ref
2155 * src/frontends/kde/FormToc.C
2156 * src/frontends/kde/FormToc.h
2157 * src/frontends/kde/formtocdialog.C
2158 * src/frontends/kde/formtocdialog.h: add a depth
2161 * src/frontends/kde/Makefile.am: add QtLyXView.h
2164 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
2166 * src/frontends/kde/FormCitation.h: added some using directives.
2168 * src/frontends/kde/FormToc.h: corrected definition of doTree.
2170 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
2173 * src/mathed/math_defs.h: redefine SetAlign to use string rather
2176 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2178 * src/buffer.C (pop_tag): revert for the second time a change by
2179 Lars, who seems to really hate having non-local loop variables :)
2181 * src/Lsstream.h: add "using" statements.
2183 * src/support/copy.C (copy): add a bunch of std:: qualifiers
2184 * src/buffer.C (writeFile): ditto
2186 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2188 * src/buffer.C (writeFile): try to fix the locale modified format
2189 number to always be as we want it.
2191 * src/WorkArea.C (work_area_handler): try to workaround the bugs
2192 in XForms 0.89. C-space is now working again.
2194 * src/Lsstream.h src/support/sstream.h: new files.
2196 * also commented out all cases where strstream were used.
2198 * src/Bullet.h (c_str): remove method.
2200 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
2202 * a lot of files: get rid of "char const *" and "char *" is as
2203 many places as possible. We only want to use them in interaction
2204 with system of other libraries, not inside lyx.
2206 * a lot of files: return const object is not of pod type. This
2207 helps ensure that temporary objects is not modified. And fits well
2208 with "programming by contract".
2210 * configure.in: check for the locale header too
2212 * Makefile.am (sourcedoc): new tag for generation of doc++
2215 2000-09-14 Juergen Vigna <jug@sad.it>
2217 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
2218 callback to check which combo called it and do the right action.
2220 * src/combox.C (combo_cb): added combo * to the callbacks.
2221 (Hide): moved call of callback after Ungrab of the pointer.
2223 * src/intl.h: removed LCombo2 function.
2225 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
2226 function as this can now be handled in one function.
2228 * src/combox.h: added Combox * to callback prototype.
2230 * src/frontends/xforms/Toolbar_pimpl.C:
2231 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
2233 2000-09-14 Garst Reese <reese@isn.net>
2235 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
2236 moved usepackage{xxx}'s to beginning of file. Changed left margin
2237 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
2238 underlining from title. Thanks to John Culleton for useful suggestions.
2240 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2242 * src/lyxlex_pimpl.C (setFile): change error message to debug
2245 2000-09-13 Juergen Vigna <jug@sad.it>
2247 * src/frontends/xforms/FormDocument.C: implemented choice_class
2248 as combox and give callback to combo_language so OK/Apply is activated
2251 * src/bufferlist.C (newFile): small fix so already named files
2252 (via an open call) are not requested to be named again on the
2255 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2257 * src/frontends/kde/Makefile.am
2258 * src/frontends/kde/FormRef.C
2259 * src/frontends/kde/FormRef.h
2260 * src/frontends/kde/formrefdialog.C
2261 * src/frontends/kde/formrefdialog.h: implement
2264 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
2266 * src/frontends/kde/formtocdialog.C
2267 * src/frontends/kde/formtocdialog.h
2268 * src/frontends/kde/FormToc.C
2269 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
2271 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
2273 * src/frontends/kde/FormCitation.C: fix thinko
2274 where we didn't always display the reference text
2277 * src/frontends/kde/formurldialog.C
2278 * src/frontends/kde/formurldialog.h
2279 * src/frontends/kde/FormUrl.C
2280 * src/frontends/kde/FormUrl.h: minor cleanups
2282 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2284 * src/frontends/kde/Makefile.am
2285 * src/frontends/kde/FormToc.C
2286 * src/frontends/kde/FormToc.h
2287 * src/frontends/kde/FormCitation.C
2288 * src/frontends/kde/FormCitation.h
2289 * src/frontends/kde/FormIndex.C
2290 * src/frontends/kde/FormIndex.h
2291 * src/frontends/kde/formtocdialog.C
2292 * src/frontends/kde/formtocdialog.h
2293 * src/frontends/kde/formcitationdialog.C
2294 * src/frontends/kde/formcitationdialog.h
2295 * src/frontends/kde/formindexdialog.C
2296 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2298 2000-09-12 Juergen Vigna <jug@sad.it>
2300 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2303 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2305 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2308 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2310 * src/converter.C (Add, Convert): Added support for converter flags:
2311 needaux, resultdir, resultfile.
2312 (Convert): Added new parameter view_file.
2313 (dvips_options): Fixed letter paper option.
2315 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2316 (Export, GetExportableFormats, GetViewableFormats): Added support
2319 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2321 (easyParse): Fixed to work with new export code.
2323 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2326 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2328 * lib/bind/*.bind: Replaced
2329 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2330 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2332 2000-09-11 Juergen Vigna <jug@sad.it>
2334 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2336 * src/main.C (main): now GUII defines global guiruntime!
2338 * src/frontends/gnome/GUIRunTime.C (initApplication):
2339 * src/frontends/kde/GUIRunTime.C (initApplication):
2340 * src/frontends/xforms/GUIRunTime.C (initApplication):
2341 * src/frontends/GUIRunTime.h: added new function initApplication.
2343 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2345 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2347 2000-09-08 Juergen Vigna <jug@sad.it>
2349 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2350 we have already "Reset".
2352 * src/language.C (initL): inserted "default" language and made this
2353 THE default language (and not american!)
2355 * src/paragraph.C: inserted handling of "default" language!
2357 * src/lyxfont.C: ditto
2361 * src/paragraph.C: output the \\par only if we have a following
2362 paragraph otherwise it's not needed.
2364 2000-09-05 Juergen Vigna <jug@sad.it>
2366 * config/pspell.m4: added entry to lyx-flags
2368 * src/spellchecker.C: modified version from Kevin for using pspell
2370 2000-09-01 Marko Vendelin <markov@ioc.ee>
2371 * src/frontends/gnome/Makefile.am
2372 * src/frontends/gnome/FormCitation.C
2373 * src/frontends/gnome/FormCitation.h
2374 * src/frontends/gnome/diainsertcitation_callbacks.c
2375 * src/frontends/gnome/diainsertcitation_callbacks.h
2376 * src/frontends/gnome/diainsertcitation_interface.c
2377 * src/frontends/gnome/diainsertcitation_interface.h
2378 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2379 dialog for Gnome frontend
2381 * src/main.C: Gnome libraries require keeping application name
2382 and its version as strings
2384 * src/frontends/gnome/mainapp.C: Change the name of the main window
2385 from GnomeLyX to PACKAGE
2387 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2389 * src/frontends/Liason.C: add "using: declaration.
2391 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2393 * src/mathed/math_macro.C (Metrics): Set the size of the template
2395 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2397 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2399 * src/converter.C (add_options): New function.
2400 (SetViewer): Change $$FName into '$$FName'.
2401 (View): Add options when running xdvi
2402 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2403 (Convert): The 3rd parameter is now the desired filename. Converts
2404 calls to lyx::rename if necessary.
2405 Add options when running dvips.
2406 (dvi_papersize,dvips_options): New methods.
2408 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2410 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2411 using a call to Converter::dvips_options.
2412 Fixed to work with nex export code.
2414 * src/support/copy.C
2415 * src/support/rename.C: New files
2417 * src/support/syscall.h
2418 * src/support/syscall.C: Added Starttype SystemDontWait.
2420 * lib/ui/default.ui: Changed to work with new export code
2422 * lib/configure.m4: Changed to work with new export code
2424 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2426 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2428 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2429 so that code compiles with DEC cxx.
2431 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2432 to work correctly! Also now supports the additional elements
2435 2000-09-01 Allan Rae <rae@lyx.org>
2437 * src/frontends/ButtonPolicies.C: renamed all the references to
2438 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2440 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2441 since it's a const not a type.
2443 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2445 2000-08-31 Juergen Vigna <jug@sad.it>
2447 * src/insets/figinset.C: Various changes to look if the filename has
2448 an extension and if not add it for inline previewing.
2450 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2452 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2453 make buttonStatus and isReadOnly be const methods. (also reflect
2454 this in derived classes.)
2456 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2457 (nextState): change to be static inline, pass the StateMachine as
2459 (PreferencesPolicy): remove casts
2460 (OkCancelPolicy): remvoe casts
2461 (OkCancelReadOnlyPolicy): remove casts
2462 (NoRepeatedApplyReadOnlyPolicy): remove casts
2463 (OkApplyCancelReadOnlyPolicy): remove casts
2464 (OkApplyCancelPolicy): remove casts
2465 (NoRepeatedApplyPolicy): remove casts
2467 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2469 * src/converter.C: added some using directives
2471 * src/frontends/ButtonPolicies.C: changes to overcome
2472 "need lvalue" error with DEC c++
2474 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2475 to WMHideCB for DEC c++
2477 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2479 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2480 to BulletBMTableCB for DEC c++
2482 2000-08-31 Allan Rae <rae@lyx.org>
2484 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2485 character dialog separately from old document dialogs combo_language.
2488 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2490 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2491 Removed LFUN_REF_CREATE.
2493 * src/MenuBackend.C: Added new tags: toc and references
2495 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2496 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2498 (add_toc, add_references): New methods.
2499 (create_submenu): Handle correctly the case when there is a
2500 seperator after optional menu items.
2502 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2503 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2504 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2506 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2508 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2510 * src/converter.[Ch]: New file for converting between different
2513 * src/export.[Ch]: New file for exporting a LyX file to different
2516 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2517 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2518 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2519 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2520 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2521 RunDocBook, MenuExport.
2523 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2524 Exporter::Preview methods if NEW_EXPORT is defined.
2526 * src/buffer.C (Dispatch): Use Exporter::Export.
2528 * src/lyxrc.C: Added new tags: \converter and \viewer.
2531 * src/LyXAction.C: Define new lyx-function: buffer-update.
2532 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2533 when NEW_EXPORT is defined.
2535 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2537 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2539 * lib/ui/default.ui: Added submenus "view" and "update" to the
2542 * src/filetools.C (GetExtension): New function.
2544 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2546 2000-08-29 Allan Rae <rae@lyx.org>
2548 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2550 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2551 (EnableDocumentLayout): removed
2552 (DisableDocumentLayout): removed
2553 (build): make use of ButtonController's read-only handling to
2554 de/activate various objects. Replaces both of the above functions.
2556 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2557 (readOnly): was read_only
2558 (refresh): fixed dumb mistakes with read_only_ handling
2560 * src/frontends/xforms/forms/form_document.fd:
2561 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2562 tabbed dialogs so the tabs look more like tabs and so its easier to
2563 work out which is the current tab.
2565 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2566 segfault with form_table
2568 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2570 2000-08-28 Juergen Vigna <jug@sad.it>
2572 * acconfig.h: added USE_PSPELL.
2574 * src/config.h.in: added USE_PSPELL.
2576 * autogen.sh: added pspell.m4
2578 * config/pspell.m4: new file.
2580 * src/spellchecker.C: implemented support for pspell libary.
2582 2000-08-25 Juergen Vigna <jug@sad.it>
2584 * src/LyXAction.C (init): renamed LFUN_TABLE to
2585 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2587 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2589 * src/lyxscreen.h: add force_clear variable and fuction to force
2590 a clear area when redrawing in LyXText.
2592 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2594 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2596 * some whitespace and comment changes.
2598 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2600 * src/buffer.C: up te LYX_FORMAT to 2.17
2602 2000-08-23 Juergen Vigna <jug@sad.it>
2604 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2607 * src/insets/insettabular.C (pasteSelection): delete the insets
2608 LyXText as it is not valid anymore.
2609 (copySelection): new function.
2610 (pasteSelection): new function.
2611 (cutSelection): new function.
2612 (LocalDispatch): implemented cut/copy/paste of cell selections.
2614 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2615 don't have a LyXText.
2617 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2619 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2622 2000-08-22 Juergen Vigna <jug@sad.it>
2624 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2625 ifdef form_table out if NEW_TABULAR.
2627 2000-08-21 Juergen Vigna <jug@sad.it>
2629 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2630 (draw): fixed draw position so that the cursor is positioned in the
2632 (InsetMotionNotify): hide/show cursor so the position is updated.
2633 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2634 using cellstart() function where it should be used.
2636 * src/insets/insettext.C (draw): ditto.
2638 * src/tabular.C: fixed initialization of some missing variables and
2639 made BoxType into an enum.
2641 2000-08-22 Marko Vendelin <markov@ioc.ee>
2642 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2643 stock menu item using action numerical value, not its string
2647 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2649 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2650 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2652 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2654 * src/frontends/xforms/GUIRunTime.C: new file
2656 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2657 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2659 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2661 * src/frontends/kde/GUIRunTime.C: new file
2663 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2664 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2666 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2668 * src/frontends/gnome/GUIRunTime.C: new file
2670 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2673 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2674 small change to documetentation.
2676 * src/frontends/GUIRunTime.C: removed file
2678 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2680 * src/lyxparagraph.h: enable NEW_TABULAR as default
2682 * src/lyxfunc.C (processKeySym): remove some commented code
2684 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2685 NEW_TABULAR around the fd_form_table_options.
2687 * src/lyx_gui.C (runTime): call the static member function as
2688 GUIRunTime::runTime().
2690 2000-08-21 Allan Rae <rae@lyx.org>
2692 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2695 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2697 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2699 2000-08-21 Allan Rae <rae@lyx.org>
2701 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2702 keep Garst happy ;-)
2703 * src/frontends/xforms/FormPreferences.C (build): use setOK
2704 * src/frontends/xforms/FormDocument.C (build): use setOK
2705 (FormDocument): use the appropriate policy.
2707 2000-08-21 Allan Rae <rae@lyx.org>
2709 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2710 automatic [de]activation of arbitrary objects when in a read-only state.
2712 * src/frontends/ButtonPolicies.h: More documentation
2713 (isReadOnly): added to support the above.
2715 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2717 2000-08-18 Juergen Vigna <jug@sad.it>
2719 * src/insets/insettabular.C (getStatus): changed to return func_status.
2721 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2722 display toggle menu entries if they are.
2724 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2725 new document layout now.
2727 * src/lyxfunc.C: ditto
2729 * src/lyx_gui_misc.C: ditto
2731 * src/lyx_gui.C: ditto
2733 * lib/ui/default.ui: removed paper and quotes layout as they are now
2734 all in the document layout tabbed folder.
2736 * src/frontends/xforms/forms/form_document.fd: added Restore
2737 button and callbacks for all inputs for Allan's ButtonPolicy.
2739 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2740 (CheckChoiceClass): added missing params setting on class change.
2741 (UpdateLayoutDocument): added for updating the layout on params.
2742 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2743 (FormDocument): Implemented Allan's ButtonPolicy with the
2746 2000-08-17 Allan Rae <rae@lyx.org>
2748 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2749 so we can at least see the credits again.
2751 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2752 controller calls for the appropriate callbacks. Note that since Ok
2753 calls apply followed by cancel, and apply isn't a valid input for the
2754 APPLIED state, the bc_ calls have to be made in the static callback not
2755 within each of the real callbacks.
2757 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2758 (setOk): renamed from setOkay()
2760 2000-08-17 Juergen Vigna <jug@sad.it>
2762 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2763 in the implementation part.
2764 (composeUIInfo): don't show optional menu-items.
2766 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2768 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2770 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2771 text-state when in a text-inset.
2773 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2775 2000-08-17 Marko Vendelin <markov@ioc.ee>
2776 * src/frontends/gnome/FormIndex.C
2777 * src/frontends/gnome/FormIndex.h
2778 * src/frontends/gnome/FormToc.C
2779 * src/frontends/gnome/FormToc.h
2780 * src/frontends/gnome/dialogs
2781 * src/frontends/gnome/diatoc_callbacks.c
2782 * src/frontends/gnome/diatoc_callbacks.h
2783 * src/frontends/gnome/diainsertindex_callbacks.h
2784 * src/frontends/gnome/diainsertindex_callbacks.c
2785 * src/frontends/gnome/diainsertindex_interface.c
2786 * src/frontends/gnome/diainsertindex_interface.h
2787 * src/frontends/gnome/diatoc_interface.h
2788 * src/frontends/gnome/diatoc_interface.c
2789 * src/frontends/gnome/Makefile.am: Table of Contents and
2790 Insert Index dialogs implementation for Gnome frontend
2792 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2794 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2796 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2799 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2801 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2802 destructor. Don't definde if you don't need it
2803 (processEvents): made static, non-blocking events processing for
2805 (runTime): static method. event loop for xforms
2806 * similar as above for kde and gnome.
2808 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2809 new Pimpl is correct
2810 (runTime): new method calss the real frontends runtime func.
2812 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2814 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2816 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2818 2000-08-16 Juergen Vigna <jug@sad.it>
2820 * src/lyx_gui.C (runTime): added GUII RunTime support.
2822 * src/frontends/Makefile.am:
2823 * src/frontends/GUIRunTime.[Ch]:
2824 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2825 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2826 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2828 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2830 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2831 as this is already set in ${FRONTEND_INCLUDE} if needed.
2833 * configure.in (CPPFLAGS): setting the include dir for the frontend
2834 directory and don't set FRONTEND=xforms for now as this is executed
2837 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2839 * src/frontends/kde/Makefile.am:
2840 * src/frontends/kde/FormUrl.C:
2841 * src/frontends/kde/FormUrl.h:
2842 * src/frontends/kde/formurldialog.h:
2843 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2845 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2847 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2849 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2851 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2854 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2856 * src/WorkArea.C (work_area_handler): more work to get te
2857 FL_KEYBOARD to work with xforms 0.88 too, please test.
2859 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2861 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2863 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2866 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2868 * src/Timeout.h: remove Qt::emit hack.
2870 * several files: changes to allo doc++ compilation
2872 * src/lyxfunc.C (processKeySym): new method
2873 (processKeyEvent): comment out if FL_REVISION < 89
2875 * src/WorkArea.C: change some debugging levels.
2876 (WorkArea): set wantkey to FL_KEY_ALL
2877 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2878 clearer code and the use of compose with XForms 0.89. Change to
2879 use signals instead of calling methods in bufferview directly.
2881 * src/Painter.C: change some debugging levels.
2883 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2886 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2887 (workAreaKeyPress): new method
2889 2000-08-14 Juergen Vigna <jug@sad.it>
2891 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2893 * config/kde.m4: addes some features
2895 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2896 include missing xforms dialogs.
2898 * src/Timeout.h: a hack to be able to compile with qt/kde.
2900 * sigc++/.cvsignore: added acinclude.m4
2902 * lib/.cvsignore: added listerros
2904 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2905 xforms tree as objects are needed for other frontends.
2907 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2908 linking with not yet implemented xforms objects.
2910 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2912 2000-08-14 Baruch Even <baruch.even@writeme.com>
2914 * src/frontends/xforms/FormGraphics.h:
2915 * src/frontends/xforms/FormGraphics.C:
2916 * src/frontends/xforms/RadioButtonGroup.h:
2917 * src/frontends/xforms/RadioButtonGroup.C:
2918 * src/insets/insetgraphics.h:
2919 * src/insets/insetgraphics.C:
2920 * src/insets/insetgraphicsParams.h:
2921 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2922 instead of spaces, and various other indentation issues to make the
2923 sources more consistent.
2925 2000-08-14 Marko Vendelin <markov@ioc.ee>
2927 * src/frontends/gnome/dialogs/diaprint.glade
2928 * src/frontends/gnome/FormPrint.C
2929 * src/frontends/gnome/FormPrint.h
2930 * src/frontends/gnome/diaprint_callbacks.c
2931 * src/frontends/gnome/diaprint_callbacks.h
2932 * src/frontends/gnome/diaprint_interface.c
2933 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2936 * src/frontends/gnome/dialogs/diainserturl.glade
2937 * src/frontends/gnome/FormUrl.C
2938 * src/frontends/gnome/FormUrl.h
2939 * src/frontends/gnome/diainserturl_callbacks.c
2940 * src/frontends/gnome/diainserturl_callbacks.h
2941 * src/frontends/gnome/diainserturl_interface.c
2942 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2943 Gnome implementation
2945 * src/frontends/gnome/Dialogs.C
2946 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2947 all other dialogs. Copy all unimplemented dialogs from Xforms
2950 * src/frontends/gnome/support.c
2951 * src/frontends/gnome/support.h: support files generated by Glade
2955 * config/gnome.m4: Gnome configuration scripts
2957 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2958 configure --help message
2960 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2961 only if there are no events pendling in Gnome/Gtk. This enhances
2962 the performance of menus.
2965 2000-08-14 Allan Rae <rae@lyx.org>
2967 * lib/Makefile.am: listerrors cleaning
2969 * lib/listerrors: removed -- generated file
2970 * acinclude.m4: ditto
2971 * sigc++/acinclude.m4: ditto
2973 * src/frontends/xforms/forms/form_citation.fd:
2974 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2977 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2978 `updatesrc` and now we have a `test` target that does what `updatesrc`
2979 used to do. I didn't like having an install target that wasn't related
2982 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2983 on all except FormGraphics. This may yet happen. Followed by a major
2984 cleanup including using FL_TRANSIENT for most of the dialogs. More
2985 changes to come when the ButtonController below is introduced.
2987 * src/frontends/xforms/ButtonController.h: New file for managing up to
2988 four buttons on a dialog according to an externally defined policy.
2989 * src/frontends/xforms/Makefile.am: added above
2991 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2992 Apply and Cancel/Close buttons and everything in between and beyond.
2993 * src/frontends/Makefile.am: added above.
2995 * src/frontends/xforms/forms/form_preferences.fd:
2996 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2997 and removed variable 'status' as a result. Fixed the set_minsize thing.
2998 Use the new screen-font-update after checking screen fonts were changed
2999 Added a "Restore" button to restore the original lyxrc values while
3000 editing. This restores everything not just the last input changed.
3001 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3003 * src/LyXAction.C: screen-font-update added for updating buffers after
3004 screen font settings have been changed.
3005 * src/commandtags.h: ditto
3006 * src/lyxfunc.C: ditto
3008 * forms/lyx.fd: removed screen fonts dialog.
3009 * src/lyx_gui.C: ditto
3010 * src/menus.[Ch]: ditto
3011 * src/lyx.[Ch]: ditto
3012 * src/lyx_cb.C: ditto + code from here moved to make
3013 screen-font-update. And people wonder why progress on GUII is
3014 slow. Look at how scattered this stuff was! It takes forever
3017 * forms/fdfix.sh: Fixup the spacing after commas.
3018 * forms/makefile: Remove date from generated files. Fewer clashes now.
3019 * forms/bullet_forms.C.patch: included someones handwritten changes
3021 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3022 once I've discovered why LyXRC was made noncopyable.
3023 * src/lyx_main.C: ditto
3025 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3027 * src/frontends/xforms/forms/fdfix.sh:
3028 * src/frontends/xforms/forms/fdfixh.sed:
3029 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3030 * src/frontends/xforms/Form*.[hC]:
3031 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3032 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3033 provide a destructor for the struct FD_form_xxxx. Another version of
3034 the set_[max|min]size workaround and a few other cleanups. Actually,
3035 Angus' patch from 20000809.
3037 2000-08-13 Baruch Even <baruch.even@writeme.com>
3039 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3042 2000-08-11 Juergen Vigna <jug@sad.it>
3044 * src/insets/insetgraphics.C (InsetGraphics): changing init
3045 order because of warnings.
3047 * src/frontends/xforms/forms/makefile: adding patching .C with
3050 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3051 from .C.patch to .c.patch
3053 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3054 order because of warning.
3056 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3058 * src/frontends/Liason.C (setMinibuffer): new helper function
3060 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3062 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3064 * lib/ui/default.ui: commented out PaperLayout entry
3066 * src/frontends/xforms/form_document.[Ch]: new added files
3068 * src/frontends/xforms/FormDocument.[Ch]: ditto
3070 * src/frontends/xforms/forms/form_document.fd: ditto
3072 * src/frontends/xforms/forms/form_document.C.patch: ditto
3074 2000-08-10 Juergen Vigna <jug@sad.it>
3076 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3077 (InsetGraphics): initialized cacheHandle to 0.
3078 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3080 2000-08-10 Baruch Even <baruch.even@writeme.com>
3082 * src/graphics/GraphicsCache.h:
3083 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3084 correctly as a cache.
3086 * src/graphics/GraphicsCacheItem.h:
3087 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
3090 * src/graphics/GraphicsCacheItem_pimpl.h:
3091 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
3094 * src/insets/insetgraphics.h:
3095 * src/insets/insetgraphics.C: Changed from using a signal notification
3096 to polling when image is not loaded.
3098 2000-08-10 Allan Rae <rae@lyx.org>
3100 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
3101 that there are two functions that have to been taken out of line by
3102 hand and aren't taken care of in the script. (Just a reminder note)
3104 * sigc++/macros/*.h.m4: Updated as above.
3106 2000-08-09 Juergen Vigna <jug@sad.it>
3108 * src/insets/insettext.C (draw): small fix for clearing rectangle.
3110 * src/insets/insettabular.C: make drawing of single cell smarter.
3112 2000-08-09 Marko Vendelin <markov@ioc.ee>
3113 * src/frontends/gnome/Menubar_pimpl.C
3114 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
3115 implementation: new files
3117 * src/frontends/gnome/mainapp.C
3118 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
3121 * src/main.C: create Gnome main window
3123 * src/frontends/xforms/Menubar_pimpl.h
3124 * src/frontends/Menubar.C
3125 * src/frontends/Menubar.h: added method Menubar::update that calls
3126 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
3128 * src/LyXView.C: calls Menubar::update to update the state
3131 * src/frontends/gnome/Makefile.am: added new files
3133 * src/frontends/Makefile.am: added frontend compiler options
3135 2000-08-08 Juergen Vigna <jug@sad.it>
3137 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
3139 * src/bufferlist.C (close):
3140 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
3141 documents if exiting without saving.
3143 * src/buffer.C (save): use removeAutosaveFile()
3145 * src/support/filetools.C (removeAutosaveFile): new function.
3147 * src/lyx_cb.C (MenuWrite): returns a bool now.
3148 (MenuWriteAs): check if file could really be saved and revert to the
3150 (MenuWriteAs): removing old autosavefile if existant.
3152 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
3153 before Goto toggle declaration, because of compiler warning.
3155 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
3157 * src/lyxfunc.C (MenuNew): small fix.
3159 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
3161 * src/bufferlist.C (newFile):
3162 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
3164 * src/lyxrc.C: added new_ask_filename tag
3166 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
3168 * src/lyx.fd: removed code pertaining to form_ref
3169 * src/lyx.[Ch]: ditto
3170 * src/lyx_cb.C: ditto
3171 * src/lyx_gui.C: ditto
3172 * src/lyx_gui_misc.C: ditto
3174 * src/BufferView_pimpl.C (restorePosition): update buffer only
3177 * src/commandtags.h (LFUN_REFTOGGLE): removed
3178 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
3179 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
3180 (LFUN_REFBACK): renamed LFUN_REF_BACK
3182 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
3183 * src/menus.C: ditto
3184 * src/lyxfunc.C (Dispatch): ditto.
3185 InsertRef dialog is now GUI-independent.
3187 * src/texrow.C: added using std::endl;
3189 * src/insets/insetref.[Ch]: strip out large amounts of code.
3190 The inset is now a container and this functionality is now
3191 managed by a new FormRef dialog
3193 * src/frontends/Dialogs.h (showRef, createRef): new signals
3195 * src/frontends/xforms/FormIndex.[Ch],
3196 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
3197 when setting dialog's min/max size
3198 * src/frontends/xforms/FormIndex.[Ch]: ditto
3200 * src/frontends/xforms/FormRef.[Ch],
3201 src/frontends/xforms/forms/form_ref.fd: new xforms
3202 implementation of an InsetRef dialog
3204 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
3207 * src/graphics/XPM_Renderer.C (isImageFormatOK):
3208 ios::nocreate is not part of the standard. Removed.
3210 2000-08-07 Baruch Even <baruch.even@writeme.com>
3212 * src/graphics/Renderer.h:
3213 * src/graphics/Renderer.C: Added base class for rendering of different
3214 image formats into Pixmaps.
3216 * src/graphics/XPM_Renderer.h:
3217 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
3218 in a different class.
3220 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
3221 easily add support for other formats.
3223 * src/insets/figinset.C: plugged a leak of an X resource.
3225 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
3227 * src/CutAndPaste.[Ch]: make all metods static.
3229 * development/Code_rules/Rules: more work, added section on
3230 Exceptions, and a References section.
3232 * a lot of header files: work to make doc++ able to generate the
3233 source documentation, some workarounds of doc++ problems. Doc++ is
3234 now able to generate the documentation.
3236 2000-08-07 Juergen Vigna <jug@sad.it>
3238 * src/insets/insettabular.C (recomputeTextInsets): removed function
3240 * src/tabular.C (SetWidthOfMulticolCell):
3242 (calculate_width_of_column_NMC): fixed return value so that it really
3243 only returns true if the column-width has changed (there where
3244 problems with muliticolumn-cells in this column).
3246 2000-08-04 Juergen Vigna <jug@sad.it>
3248 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
3249 also on the scrollstatus of the inset.
3250 (workAreaMotionNotify): ditto.
3252 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
3254 2000-08-01 Juergen Vigna <jug@sad.it>
3256 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
3258 * src/commandtags.h:
3259 * src/LyXAction.C (init):
3260 * src/insets/inset.C (LocalDispatch): added support for
3263 * src/insets/inset.C (scroll): new functions.
3265 * src/insets/insettext.C (removeNewlines): new function.
3266 (SetAutoBreakRows): removes forced newlines in the text of the
3267 paragraph if autoBreakRows is set to false.
3269 * src/tabular.C (Latex): generates a parbox around the cell contents
3272 * src/frontends/xforms/FormTabular.C (local_update): removed
3273 the radio_useparbox button.
3275 * src/tabular.C (UseParbox): new function
3277 2000-08-06 Baruch Even <baruch.even@writeme.com>
3279 * src/graphics/GraphicsCache.h:
3280 * src/graphics/GraphicsCache.C:
3281 * src/graphics/GraphicsCacheItem.h:
3282 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3285 * src/insets/insetgraphics.h:
3286 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3287 and the drawing of the inline image.
3289 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3290 loaded into the wrong position.
3292 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3295 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3297 * src/support/translator.h: move all typedefs to public section
3299 * src/support/filetools.C (MakeLatexName): return string const
3301 (TmpFileName): ditto
3302 (FileOpenSearch): ditto
3304 (LibFileSearch): ditto
3305 (i18nLibFileSearch): ditto
3308 (CreateTmpDir): ditto
3309 (CreateBufferTmpDir): ditto
3310 (CreateLyXTmpDir): ditto
3313 (MakeAbsPath): ditto
3315 (OnlyFilename): ditto
3317 (NormalizePath): ditto
3318 (CleanupPath): ditto
3319 (GetFileContents): ditto
3320 (ReplaceEnvironmentPath): ditto
3321 (MakeRelPath): ditto
3323 (ChangeExtension): ditto
3324 (MakeDisplayPath): ditto
3325 (do_popen): return cmdret const
3326 (findtexfile): return string const
3328 * src/support/DebugStream.h: add some /// to please doc++
3330 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3332 * src/texrow.C (same_rownumber): functor to use with find_if
3333 (getIdFromRow): rewritten to use find_if and to not update the
3334 positions. return true if row is found
3335 (increasePos): new method, use to update positions
3337 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3339 * src/lyxlex_pimpl.C (verifyTable): new method
3342 (GetString): return string const
3343 (pushTable): rewrite to use std::stack
3345 (setFile): better check
3348 * src/lyxlex.h: make LyXLex noncopyable
3350 * src/lyxlex.C (text): return char const * const
3351 (GetString): return string const
3352 (getLongString): return string const
3354 * src/lyx_gui_misc.C (askForText): return pair<...> const
3356 * src/lastfiles.[Ch] (operator): return string const
3358 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3359 istringstream not char const *.
3360 move token.end() out of loop.
3361 (readFile): move initializaton of token
3363 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3364 getIdFromRow is successful.
3366 * lib/bind/emacs.bind: don't include menus bind
3368 * development/Code_rules/Rules: the beginnings of making this
3369 better and covering more of the unwritten rules that we have.
3371 * development/Code_rules/Recommendations: a couple of wording
3374 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3376 * src/support/strerror.c: remove C++ comment.
3378 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3380 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3381 LFUN_INDEX_INSERT_LAST
3383 * src/texrow.C (getIdFromRow): changed from const_iterator to
3384 iterator, allowing code to compile with DEC cxx
3386 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3387 stores part of the class, as suggested by Allan. Will allow
3389 (apply): test to apply uses InsetCommandParams operator!=
3391 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3392 (apply): test to apply uses InsetCommandParams operator!=
3394 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3395 stores part of the class.
3396 (update): removed limits on min/max size.
3398 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3399 (apply): test to apply uses InsetCommandParams operator!=
3401 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3402 (Read, Write, scanCommand, getCommand): moved functionality
3403 into InsetCommandParams.
3405 (getScreenLabel): made pure virtual
3406 new InsetCommandParams operators== and !=
3408 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3409 c-tors based on InsetCommandParams. Removed others.
3410 * src/insets/insetinclude.[Ch]: ditto
3411 * src/insets/insetlabel.[Ch]: ditto
3412 * src/insets/insetparent.[Ch]: ditto
3413 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3415 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3416 insets derived from InsetCommand created using similar c-tors
3417 based on InsetCommandParams
3418 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3419 * src/menus.C (ShowRefsMenu): ditto
3420 * src/paragraph.C (Clone): ditto
3421 * src/text2.C (SetCounter): ditto
3422 * src/lyxfunc.C (Dispatch) ditto
3423 Also recreated old InsetIndex behaviour exactly. Can now
3424 index-insert at the start of a paragraph and index-insert-last
3425 without launching the pop-up.
3427 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3429 * lib/lyxrc.example: mark te pdf options as non functional.
3431 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3432 (isStrDbl): move tmpstr.end() out of loop.
3433 (strToDbl): move intialization of tmpstr
3434 (lowercase): return string const and move tmp.end() out of loop.
3435 (uppercase): return string const and move tmp.edn() out of loop.
3436 (prefixIs): add assertion
3441 (containsOnly): ditto
3442 (containsOnly): ditto
3443 (containsOnly): ditto
3444 (countChar): make last arg char not char const
3445 (token): return string const
3446 (subst): return string const, move tmp.end() out of loop.
3447 (subst): return string const, add assertion
3448 (strip): return string const
3449 (frontStrip): return string const, add assertion
3450 (frontStrip): return string const
3455 * src/support/lstrings.C: add inclde "LAssert.h"
3456 (isStrInt): move tmpstr.end() out of loop.
3458 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3459 toollist.end() out of loop.
3460 (deactivate): move toollist.end() out of loop.
3461 (update): move toollist.end() out of loop.
3462 (updateLayoutList): move tc.end() out of loop.
3463 (add): move toollist.end() out of loop.
3465 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3466 md.end() out of loop.
3468 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3470 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3473 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3474 (Erase): move insetlist.end() out of loop.
3476 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3477 ref to const string as first arg. Move initialization of some
3478 variables, whitespace changes.
3480 * src/kbmap.C (defkey): move table.end() out of loop.
3481 (kb_keymap): move table.end() out of loop.
3482 (findbinding): move table.end() out of loop.
3484 * src/MenuBackend.C (hasMenu): move end() out of loop.
3485 (getMenu): move end() out of loop.
3486 (getMenu): move menulist_.end() out of loop.
3488 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3490 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3493 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3494 (getFromLyXName): move infotab.end() out of loop.
3496 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3497 -fvtable-thunks -ffunction-sections -fdata-sections
3499 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3501 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3504 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3506 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3508 * src/frontends/xforms/FormCitation.[Ch],
3509 src/frontends/xforms/FormIndex.[Ch],
3510 src/frontends/xforms/FormToc.[Ch],
3511 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3513 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3515 * src/commandtags.h: renamed, created some flags for citation
3518 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3520 * src/lyxfunc.C (dispatch): use signals to insert index entry
3522 * src/frontends/Dialogs.h: new signal createIndex
3524 * src/frontends/xforms/FormCommand.[Ch],
3525 src/frontends/xforms/FormCitation.[Ch],
3526 src/frontends/xforms/FormToc.[Ch],
3527 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3529 * src/insets/insetindex.[Ch]: GUI-independent
3531 * src/frontends/xforms/FormIndex.[Ch],
3532 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3535 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3537 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3538 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3540 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3542 * src/insets/insetref.C (Latex): rewrite so that there is now
3543 question that a initialization is requested.
3545 * src/insets/insetcommand.h: reenable the hide signal
3547 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3549 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3550 fix handling of shortcuts (many bugs :)
3551 (add_lastfiles): ditto.
3553 * lib/ui/default.ui: fix a few shortcuts.
3555 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3557 * Makefile.am: Fix ``rpmdist'' target to return the exit
3558 status of the ``rpm'' command, instead of the last command in
3559 the chain (the ``rm lyx.xpm'' command, which always returns
3562 2000-08-02 Allan Rae <rae@lyx.org>
3564 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3565 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3566 * src/frontends/xforms/FormToc.C (FormToc): ditto
3568 * src/frontends/xforms/Makefile.am: A few forgotten files
3570 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3571 Signals-not-copyable-problem Lars' started commenting out.
3573 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3575 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3577 * src/insets/insetcommand.h: Signals is not copyable so anoter
3578 scheme for automatic hiding of forms must be used.
3580 * src/frontends/xforms/FormCitation.h: don't inerit from
3581 noncopyable, FormCommand already does that.
3582 * src/frontends/xforms/FormToc.h: ditto
3583 * src/frontends/xforms/FormUrl.h: ditto
3585 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3587 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3589 * src/insets/insetcommand.h (hide): new SigC::Signal0
3590 (d-tor) new virtual destructor emits hide signal
3592 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3593 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3595 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3596 LOF and LOT. Inset is now GUI-independent
3598 * src/insets/insetloa.[Ch]: redundant
3599 * src/insets/insetlof.[Ch]: ditto
3600 * src/insets/insetlot.[Ch]: ditto
3602 * src/frontends/xforms/forms/form_url.fd: tweaked!
3603 * src/frontends/xforms/forms/form_citation.fd: ditto
3605 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3606 dialogs dealing with InsetCommand insets
3608 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3609 FormCommand base class
3610 * src/frontends/xforms/FormUrl.[Ch]: ditto
3612 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3614 * src/frontends/xforms/FormToc.[Ch]: ditto
3616 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3617 passed a generic InsetCommand pointer
3618 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3620 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3621 and modified InsetTOC class
3622 * src/buffer.C: ditto
3624 * forms/lyx.fd: strip out old FD_form_toc code
3625 * src/lyx_gui_misc.C: ditto
3626 * src/lyx_gui.C: ditto
3627 * src/lyx_cb.C: ditto
3628 * src/lyx.[Ch]: ditto
3630 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3632 * src/support/utility.hpp: tr -d '\r'
3634 2000-08-01 Juergen Vigna <jug@sad.it>
3636 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3638 * src/commandtags.h:
3639 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3640 LFUN_TABULAR_FEATURES.
3642 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3643 LFUN_LAYOUT_TABULAR.
3645 * src/insets/insettabular.C (getStatus): implemented helper function.
3647 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3649 2000-07-31 Juergen Vigna <jug@sad.it>
3651 * src/text.C (draw): fixed screen update problem for text-insets.
3653 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3654 something changed probably this has to be added in various other
3657 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3659 2000-07-31 Baruch Even <baruch.even@writeme.com>
3661 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3662 templates to satisfy compaq cxx.
3665 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3667 * src/support/translator.h (equal_1st_in_pair::operator()): take
3668 const ref pair_type as arg.
3669 (equal_2nd_in_pair::operator()): ditto
3670 (Translator::~Translator): remove empty d-tor.
3672 * src/graphics/GraphicsCache.C: move include config.h to top, also
3673 put initialization of GraphicsCache::singleton here.
3674 (~GraphicsCache): move here
3675 (addFile): take const ref as arg
3678 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3680 * src/BufferView2.C (insertLyXFile): change te with/without header
3683 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3685 * src/frontends/xforms/FormGraphics.C (apply): add some
3686 static_cast. Not very nice, but required by compaq cxx.
3688 * src/frontends/xforms/RadioButtonGroup.h: include header
3689 <utility> instead of <pair.h>
3691 * src/insets/insetgraphicsParams.C: add using directive.
3692 (readResize): change return type to void.
3693 (readOrigin): ditto.
3695 * src/lyxfunc.C (getStatus): add missing break for build-program
3696 function; add test for Literate for export functions.
3698 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3699 entries in Options menu.
3701 2000-07-31 Baruch Even <baruch.even@writeme.com>
3703 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3704 protect against auto-allocation; release icon when needed.
3706 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3708 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3709 on usual typewriter.
3711 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3712 earlier czech.kmap), useful only for programming.
3714 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3716 * src/frontends/xforms/FormCitation.h: fix conditioning around
3719 2000-07-31 Juergen Vigna <jug@sad.it>
3721 * src/frontends/xforms/FormTabular.C (local_update): changed
3722 radio_linebreaks to radio_useparbox and added radio_useminipage.
3724 * src/tabular.C: made support for using minipages/parboxes.
3726 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3728 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3730 (descent): so the cursor is in the middle.
3731 (width): bit smaller box.
3733 * src/insets/insetgraphics.h: added display() function.
3735 2000-07-31 Baruch Even <baruch.even@writeme.com>
3737 * src/frontends/Dialogs.h: Added showGraphics signals.
3739 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3740 xforms form definition of the graphics dialog.
3742 * src/frontends/xforms/FormGraphics.h:
3743 * src/frontends/xforms/FormGraphics.C: Added files, the
3744 GUIndependent code of InsetGraphics
3746 * src/insets/insetgraphics.h:
3747 * src/insets/insetgraphics.C: Major writing to make it work.
3749 * src/insets/insetgraphicsParams.h:
3750 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3751 struct between InsetGraphics and GUI.
3753 * src/LaTeXFeatures.h:
3754 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3755 support for graphicx package.
3757 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3758 for the graphics inset.
3760 * src/support/translator.h: Added file, used in
3761 InsetGraphicsParams. this is a template to translate between two
3764 * src/frontends/xforms/RadioButtonGroup.h:
3765 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3766 way to easily control a radio button group.
3768 2000-07-28 Juergen Vigna <jug@sad.it>
3770 * src/insets/insettabular.C (LocalDispatch):
3771 (TabularFeatures): added support for lyx-functions of tabular features.
3772 (cellstart): refixed this function after someone wrongly changed it.
3774 * src/commandtags.h:
3775 * src/LyXAction.C (init): added support for tabular-features
3777 2000-07-28 Allan Rae <rae@lyx.org>
3779 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3780 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3781 triggers the callback for input checking. As a result we sometimes get
3782 "LyX: This shouldn't happen..." printed to cerr.
3783 (input): Started using status variable since I only free() on
3784 destruction. Some input checking for paths and font sizes.
3786 * src/frontends/xforms/FormPreferences.h: Use status to control
3787 activation of Ok and Apply
3789 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3790 callback. Also resized to stop segfaults with 0.88. The problem is
3791 that xforms-0.88 requires the folder to be wide enough to fit all the
3792 tabs. If it isn't it causes all sorts of problems.
3794 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3796 * src/frontends/xforms/forms/README: Reflect reality.
3798 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3799 * src/frontends/xforms/forms/makefile: ditto.
3801 * src/commandtags.h: Get access to new Preferences dialog
3802 * src/LyXAction.C: ditto
3803 * src/lyxfunc.C: ditto
3804 * lib/ui/default.ui: ditto
3806 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3808 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3810 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3813 * src/frontends/xforms/form_url.[Ch]: added.
3815 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3817 * src/insets/insetbib.h: fixed bug in previous commit
3819 * src/frontends/xforms/FormUrl.h: ditto
3821 * src/frontends/xforms/FormPrint.h: ditto
3823 * src/frontends/xforms/FormPreferences.h: ditto
3825 * src/frontends/xforms/FormCopyright.h: ditto
3827 * src/frontends/xforms/FormCitation.C: ditto
3829 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3830 private copyconstructor and private default contructor
3832 * src/support/Makefile.am: add utility.hpp
3834 * src/support/utility.hpp: new file from boost
3836 * src/insets/insetbib.h: set owner in clone
3838 * src/frontends/xforms/FormCitation.C: added missing include
3841 * src/insets/form_url.[Ch]: removed
3843 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3845 * development/lyx.spec.in
3846 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3847 file/directory re-organization.
3849 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3851 * src/insets/insetcommand.[Ch]: moved the string data and
3852 associated manipulation methods into a new stand-alone class
3853 InsetCommandParams. This class has two additional methods
3854 getAsString() and setFromString() allowing the contents to be
3855 moved around as a single string.
3856 (addContents) method removed.
3857 (setContents) method no longer virtual.
3859 * src/buffer.C (readInset): made use of new InsetCitation,
3860 InsetUrl constructors based on InsetCommandParams.
3862 * src/commandtags.h: add LFUN_INSERT_URL
3864 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3865 independent InsetUrl and use InsetCommandParams to extract
3866 string info and create new Insets.
3868 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3870 * src/frontends/xforms/FormCitation.C (apply): uses
3873 * src/frontends/xforms/form_url.C
3874 * src/frontends/xforms/form_url.h
3875 * src/frontends/xforms/FormUrl.h
3876 * src/frontends/xforms/FormUrl.C
3877 * src/frontends/xforms/forms/form_url.fd: new files
3879 * src/insets/insetcite.[Ch]: removed unused constructors.
3881 * src/insets/insetinclude.[Ch]: no longer store filename
3883 * src/insets/inseturl.[Ch]: GUI-independent.
3885 2000-07-26 Juergen Vigna <jug@sad.it>
3886 * renamed frontend from gtk to gnome as it is that what is realized
3887 and did the necessary changes in the files.
3889 2000-07-26 Marko Vendelin <markov@ioc.ee>
3891 * configure.in: cleaning up gnome configuration scripts
3893 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3895 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3896 shortcuts syndrom by redrawing them explicitely (a better solution
3897 would be appreciated).
3899 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3901 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3904 * src/lyx_cb.C (MenuExport): change html export to do the right
3905 thing depending of the document type (instead of having
3906 html-linuxdoc and html-docbook).
3907 * src/lyxfunc.C (getStatus): update for html
3908 * lib/ui/default.ui: simplify due to the above change.
3909 * src/menus.C (ShowFileMenu): update too (in case we need it).
3911 * src/MenuBackend.C (read): if a menu is defined twice, add the
3912 new entries to the exiting one.
3914 2000-07-26 Juergen Vigna <jug@sad.it>
3916 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3918 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3919 and return a bool if it did actual save the file.
3920 (AutoSave): don't autosave a unnamed doc.
3922 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3923 check if this is an UNNAMED new file and react to it.
3924 (newFile): set buffer to unnamed and change to not mark a new
3925 buffer dirty if I didn't do anything with it.
3927 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3929 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3931 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3932 friend as per Angus's patch posted to lyx-devel.
3934 * src/ext_l10n.h: updated
3936 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3937 gettext on the style string right before inserting them into the
3940 * autogen.sh: add code to extract style strings form layout files,
3941 not good enough yet.
3943 * src/frontends/gtk/.cvsignore: add MAKEFILE
3945 * src/MenuBackend.C (read): run the label strings through gettext
3946 before storing them in the containers.
3948 * src/ext_l10n.h: new file
3950 * autogen.sh : generate the ext_l10n.h file here
3952 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3954 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3957 * lib/ui/default.ui: fix a couple of typos.
3959 * config/gnome/gtk.m4: added (and added to the list of files in
3962 * src/insets/insetinclude.C (unique_id): fix when we are using
3963 lyxstring instead of basic_string<>.
3964 * src/insets/insettext.C (LocalDispatch): ditto.
3965 * src/support/filetools.C: ditto.
3967 * lib/configure.m4: create the ui/ directory if necessary.
3969 * src/LyXView.[Ch] (updateToolbar): new method.
3971 * src/BufferView_pimpl.C (buffer): update the toolbar when
3972 opening/closing buffer.
3974 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3976 * src/LyXAction.C (getActionName): enhance to return also the name
3977 and options of pseudo-actions.
3978 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3980 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3981 as an example of what is possible). Used in File->Build too (more
3982 useful) and in the import/export menus (to mimick the complicated
3983 handling of linuxdoc and friends). Try to update all the entries.
3985 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3988 * src/MenuBackend.C (read): Parse the new OptItem tag.
3990 * src/MenuBackend.h: Add a new optional_ data member (used if the
3991 entry should be omitted when the lyxfunc is disabled).
3993 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3994 function, used as a shortcut.
3995 (create_submenu): align correctly the shortcuts on the widest
3998 * src/MenuBackend.h: MenuItem.label() only returns the label of
3999 the menu without shortcut; new method shortcut().
4001 2000-07-14 Marko Vendelin <markov@ioc.ee>
4003 * src/frontends/gtk/Dialogs.C:
4004 * src/frontends/gtk/FormCopyright.C:
4005 * src/frontends/gtk/FormCopyright.h:
4006 * src/frontends/gtk/Makefile.am: added these source-files for the
4007 Gtk/Gnome support of the Copyright-Dialog.
4009 * src/main.C: added Gnome::Main initialization if using
4010 Gtk/Gnome frontend-GUI.
4012 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4014 * config/gnome/aclocal-include.m4
4015 * config/gnome/compiler-flags.m4
4016 * config/gnome/curses.m4
4017 * config/gnome/gnome--.m4
4018 * config/gnome/gnome-bonobo-check.m4
4019 * config/gnome/gnome-common.m4
4020 * config/gnome/gnome-fileutils.m4
4021 * config/gnome/gnome-ghttp-check.m4
4022 * config/gnome/gnome-gnorba-check.m4
4023 * config/gnome/gnome-guile-checks.m4
4024 * config/gnome/gnome-libgtop-check.m4
4025 * config/gnome/gnome-objc-checks.m4
4026 * config/gnome/gnome-orbit-check.m4
4027 * config/gnome/gnome-print-check.m4
4028 * config/gnome/gnome-pthread-check.m4
4029 * config/gnome/gnome-support.m4
4030 * config/gnome/gnome-undelfs.m4
4031 * config/gnome/gnome-vfs.m4
4032 * config/gnome/gnome-x-checks.m4
4033 * config/gnome/gnome-xml-check.m4
4034 * config/gnome/gnome.m4
4035 * config/gnome/gperf-check.m4
4036 * config/gnome/gtk--.m4
4037 * config/gnome/linger.m4
4038 * config/gnome/need-declaration.m4: added configuration scripts
4039 for Gtk/Gnome frontend-GUI
4041 * configure.in: added support for the --with-frontend=gtk option
4043 * autogen.sh: added config/gnome/* to list of config-files
4045 * acconfig.h: added define for GTKGUI-support
4047 * config/lyxinclude.m4: added --with-frontend[=value] option value
4048 for Gtk/Gnome frontend-GUI support.
4050 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4052 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4056 * src/paragraph.C (GetChar): remove non-const version
4058 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4059 (search_kw): use it.
4061 * src/lyx_main.C (init): if "preferences" exist, read that instead
4063 (ReadRcFile): return bool if the file could be read ok.
4064 (ReadUIFile): add a check to see if lex file is set ok.
4066 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4067 bastring can be used instead of lyxstring (still uses the old code
4068 if std::string is good enough or if lyxstring is used.)
4070 * src/encoding.C: make the arrays static, move ininle functions
4072 * src/encoding.h: from here.
4074 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4075 (parseSingleLyXformat2Token): move inset parsing to separate method
4076 (readInset): new private method
4078 * src/Variables.h: remove virtual from get().
4080 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4081 access to NEW_INSETS and NEW_TABULAR
4083 * src/MenuBackend.h: remove superfluous forward declaration of
4084 MenuItem. Add documentations tags "///", remove empty MenuItem
4085 destructor, remove private default contructor.
4087 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
4089 (read): more string mlabel and mname to where they are used
4090 (read): remove unused variables mlabel and mname
4091 (defaults): unconditional clear, make menusetup take advantage of
4092 add returning Menu &.
4094 * src/LyXView.h: define NEW_MENUBAR as default
4096 * src/LyXAction.C: include lyxparagraph.h temporary to get access
4097 to NEW_INSETS and NEW_TABULAR.
4098 (init): commetn out some funcs that is obsolete when NEW_INSETS is
4099 defined. Change some of the "xxxx-inset-insert" functions names to
4102 * several files: more enahncements to NEW_INSETS and the resulting
4105 * lib/lyxrc.example (\date_insert_format): move to misc section
4107 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
4108 bastring and use AC_CACHE_CHECK.
4109 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
4110 the system have the newest methods. uses AC_CACHE_CHECK
4111 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
4112 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
4113 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
4115 * configure.in: add LYX_CXX_GOOD_STD_STRING
4117 * acinclude.m4: recreated
4119 2000-07-24 Amir Karger <karger@lyx.org>
4121 * README: add Hebrew, Arabic kmaps
4124 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4126 * src/buffer.C (writeFileAscii): Define actcell as an int instead
4129 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4131 * Lot of files: add pragma interface/implementation.
4133 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
4135 * lib/ui/default.ui: new file (ans new directory). Contains the
4136 default menu and toolbar.
4138 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
4139 global space. Toolbars are now read (as menus) in ui files.
4141 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
4143 * src/lyxfunc.C (getStatus): do not exit immediately if a command
4144 is disabled because the document is read-only. We want to have the
4145 toggle state of the function anyway.
4146 (getStatus): add code for LFUN_VC* functions (mimicking what is
4147 done in old-style menus)
4149 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
4150 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
4152 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
4153 * src/BufferView_pimpl.C: ditto.
4154 * src/lyxfunc.C: ditto.
4156 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
4157 default). This replaces old-style menus by new ones.
4159 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
4160 MenuItem. Contain the data structure of a menu.
4162 * src/insets/insettext.C: use LyXView::setLayout instead of
4163 accessing directly the toolbar combox.
4164 * src/lyxfunc.C (Dispatch): ditto.
4166 * src/LyXView.C (setLayout): new method, which just calls
4167 Toolbar::setLayout().
4168 (updateLayoutChoice): move part of this method in Toolbar.
4170 * src/toolbar.[Ch]: removed.
4172 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
4173 implementation the toolbar.
4175 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
4176 the toolbar. It might make sense to merge it with ToolbarDefaults
4178 (setLayout): new function.
4179 (updateLayoutList): ditto.
4180 (openLayoutList): ditto.
4182 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
4183 xforms implementation of the toolbar.
4184 (get_toolbar_func): comment out, since I do not
4185 know what it is good for.
4187 * src/ToolbarDefaults.h: Add the ItemType enum.
4189 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
4190 for a list of allocated C strings. Used in Menubar xforms
4191 implementation to avoid memory leaks.
4193 * src/support/lstrings.[Ch] (uppercase): new version taking and
4197 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
4198 * lib/bind/emacs.bind: ditto.
4200 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4202 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
4203 forward decl of LyXView.
4205 * src/toolbar.C (toolbarItem): moved from toolbar.h
4206 (toolbarItem::clean): ditto
4207 (toolbarItem::~toolbarItem): ditto
4208 (toolbarItem::operator): ditto
4210 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
4212 * src/paragraph.h: control the NEW_TABULAR define from here
4214 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
4215 USE_TABULAR_INSETS to NEW_TABULAR
4217 * src/ToolbarDefaults.C: add include "lyxlex.h"
4219 * files using the old table/tabular: use NEW_TABULAR to control
4220 compilation of old tabular stuff.
4222 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
4225 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
4226 planemet in reading of old style floats, fix the \end_deeper
4227 problem when reading old style floats.
4229 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4231 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
4233 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
4235 * lib/bind/sciword.bind: updated.
4237 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4239 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
4240 layout write problem
4242 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4244 * src/Makefile.am (INCLUDES): remove image directory from include
4247 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
4248 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
4250 * src/LyXView.C (create_form_form_main): read the application icon
4253 * lib/images/*.xpm: change the icons to use transparent color for
4256 * src/toolbar.C (update): change the color of the button when it
4259 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4261 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
4262 setting explicitely the minibuffer.
4263 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
4265 * src/LyXView.C (showState): new function. Shows font information
4266 in minibuffer and update toolbar state.
4267 (LyXView): call Toolbar::update after creating the
4270 * src/toolbar.C: change toollist to be a vector instead of a
4272 (BubbleTimerCB): get help string directly from the callback
4273 argument of the corresponding icon (which is the action)
4274 (set): remove unnecessary ugliness.
4275 (update): new function. update the icons (depressed, disabled)
4276 depending of the status of the corresponding action.
4278 * src/toolbar.h: remove help in toolbarItem
4280 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4282 * src/Painter.C (text): Added code for using symbol glyphs from
4283 iso10646 fonts. Currently diabled.
4285 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4288 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4289 magyar,turkish and usorbian.
4291 * src/paragraph.C (isMultiLingual): Made more efficient.
4293 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4296 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4297 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4298 Also changed the prototype to "bool math_insert_greek(char)".
4300 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4302 * lots of files: apply the NEW_INSETS on all code that will not be
4303 needed when we move to use the new insets. Enable the define in
4304 lyxparagrah.h to try it.
4306 * src/insets/insettabular.C (cellstart): change to be a static
4308 (InsetTabular): initialize buffer in the initializer list.
4310 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4312 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4313 form_print.h out of the header file. Replaced with forward
4314 declarations of the relevant struct.
4316 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4319 * src/commandtags.h: do not include "debug.h" which does not
4320 belong there. #include it in some other places because of this
4323 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4325 * src/insets/insetcaption.C: add a couple "using" directives.
4327 * src/toolbar.C (add): get the help text directly from lyxaction.
4329 (setPixmap): new function. Loads from disk and sets a pixmap on a
4330 botton; the name of the pixmap file is derived from the command
4333 * src/toolbar.h: remove members isBitmap and pixmap from
4336 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4337 * lib/images/: move many files from images/banner.xpm.
4339 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4341 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4342 * src/toolbar.C: ditto.
4343 * configure.in: ditto.
4344 * INSTALL: document.
4346 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4347 the spellchecker popup is closed from the WM.
4349 2000-07-19 Juergen Vigna <jug@sad.it>
4351 * src/insets/insetfloat.C (Write): small fix because we use the
4352 insetname for the type now!
4354 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4356 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4359 * src/frontends/Dialogs.h: removed hideCitation signal
4361 * src/insets/insetcite.h: added hide signal
4363 * src/insets/insetcite.C (~InsetCitation): emits new signal
4364 (getScreenLabel): "intelligent" label should now fit on the screen!
4366 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4368 * src/frontends/xforms/FormCitation.C (showInset): connects
4369 hide() to the inset's hide signal
4370 (show): modified to use fl_set_object_position rather than
4371 fl_set_object_geometry wherever possible
4373 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4375 * src/insets/lyxinset.h: add caption code
4377 * src/insets/insetfloat.C (type): new method
4379 * src/insets/insetcaption.C (Write): new method
4381 (LyxCode): new method
4383 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4384 to get it right together with using the FloatList.
4386 * src/commandtags.h: add LFUN_INSET_CAPTION
4387 * src/lyxfunc.C (Dispatch): handle it
4389 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4392 * src/Variables.[Ch]: make expand take a const reference, remove
4393 the destructor, some whitespace changes.
4395 * src/LyXAction.C (init): add caption-inset-insert
4397 * src/FloatList.C (FloatList): update the default floats a bit.
4399 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4401 * src/Variables.[Ch]: new files. Intended to be used for language
4402 specific strings (like \chaptername) and filename substitution in
4405 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4407 * lib/kbd/american.kmap: update
4409 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4411 * src/bufferparams.[Ch]: remove member allowAccents.
4413 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4415 * src/LaTeXLog.C: use the log_form.h header.
4416 * src/lyx_gui.C: ditto.
4417 * src/lyx_gui_misc.C: ditto.
4418 * src/lyxvc.h: ditto.
4420 * forms/log_form.fd: new file, created from latexoptions.fd. I
4421 kept the log popup and nuked the options form.
4423 * src/{la,}texoptions.[Ch]: removed.
4424 * src/lyx_cb.C (LaTeXOptions): ditto
4426 * src/lyx_gui.C (create_forms): do not handle the
4427 fd_latex_options form.
4429 2000-07-18 Juergen Vigna <jug@sad.it>
4431 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4432 name of the inset so that it can be requested outside (text2.C).
4434 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4437 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4439 * src/mathed/formula.h (ConvertFont): constify
4441 * src/mathed/formula.C (Read): add warning if \end_inset is not
4442 found on expected place.
4444 * src/insets/lyxinset.h (ConvertFont): consify
4446 * src/insets/insetquotes.C (ConvertFont): constify
4447 * src/insets/insetquotes.h: ditto
4449 * src/insets/insetinfo.h: add labelfont
4451 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4452 (ascent): use labelfont
4456 (Write): make .lyx file a bit nicer
4458 * src/insets/insetfloat.C (Write): simplify somewhat...
4459 (Read): add warning if arg is not found
4461 * src/insets/insetcollapsable.C: add using std::max
4462 (Read): move string token and add warning in arg is not found
4463 (draw): use std::max to get the right ty
4464 (getMaxWidth): simplify by using std::max
4466 * src/insets/insetsection.h: new file
4467 * src/insets/insetsection.C: new file
4468 * src/insets/insetcaption.h: new file
4469 * src/insets/insetcaption.C: new file
4471 * src/insets/inset.C (ConvertFont): constify signature
4473 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4474 insetcaption.[Ch] and insetsection.[Ch]
4476 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4477 uses to use LABEL_COUNTER_CHAPTER instead.
4478 * src/text2.C (SetCounter): here
4480 * src/counters.h: new file
4481 * src/counters.C: new file
4482 * src/Sectioning.h: new file
4483 * src/Sectioning.C: new file
4485 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4487 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4489 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4492 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4495 2000-07-17 Juergen Vigna <jug@sad.it>
4497 * src/tabular.C (Validate): check if array-package is needed.
4498 (SetVAlignment): added support for vertical alignment.
4499 (SetLTFoot): better support for longtable header/footers
4500 (Latex): modified to support added features.
4502 * src/LaTeXFeatures.[Ch]: added array-package.
4504 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4506 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4509 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4511 * configure.in: do not forget to put a space after -isystem.
4513 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4515 * lib/kbd/arabic.kmap: a few fixes.
4517 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4519 * some whitespace chagnes to a number of files.
4521 * src/support/DebugStream.h: change to make it easier for
4522 doc++ to parse correctly.
4523 * src/support/lyxstring.h: ditto
4525 * src/mathed/math_utils.C (compara): change to have only one
4527 (MathedLookupBOP): change because of the above.
4529 * src/mathed/math_delim.C (math_deco_compare): change to have only
4531 (search_deco): change becasue of the above.
4533 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4534 instead of manually coded one.
4536 * src/insets/insetquotes.C (Read): read the \end_inset too
4538 * src/insets/insetlatex.h: remove file
4539 * src/insets/insetlatex.C: remove file
4541 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4543 (InsetPrintIndex): remove destructor
4545 * src/insets/insetinclude.h: remove default constructor
4547 * src/insets/insetfloat.C: work to make it work better
4549 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4551 * src/insets/insetcite.h (InsetCitation): remove default constructor
4553 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4555 * src/text.C (GetColumnNearX): comment out some currently unused code.
4557 * src/paragraph.C (writeFile): move some initializations closer to
4559 (CutIntoMinibuffer): small change to use new matchIT operator
4563 (InsertInset): ditto
4566 (InsetIterator): ditto
4567 (Erase): small change to use new matchFT operator
4569 (GetFontSettings): ditto
4570 (HighestFontInRange): ditto
4573 * src/lyxparagraph.h: some chars changed to value_type
4574 (matchIT): because of some stronger checking (perhaps too strong)
4575 in SGI STL, the two operator() unified to one.
4578 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4580 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4581 the last inset read added
4582 (parseSingleLyXformat2Token): some more (future) compability code added
4583 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4584 (parseSingleLyXformat2Token): set last_inset_read
4585 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4586 (parseSingleLyXformat2Token): don't double intializw string next_token
4588 * src/TextCache.C (text_fits::operator()): add const's to the signature
4589 (has_buffer::operator()): ditto
4591 * src/Floating.h: add some comments on the class
4593 * src/FloatList.[Ch] (typeExist): new method
4596 * src/BackStack.h: added default constructor, wanted by Gcc.
4598 2000-07-14 Juergen Vigna <jug@sad.it>
4600 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4602 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4604 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4605 do a redraw when the window is resized!
4606 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4608 * src/insets/insettext.C (resizeLyXText): added function to correctly
4609 being able to resize the LyXWindow.
4611 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4613 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4615 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4616 crashes when closing dialog to a deleted inset.
4618 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4619 method! Now similar to other insets.
4621 2000-07-13 Juergen Vigna <jug@sad.it>
4623 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4625 * lib/examples/Literate.lyx: small patch!
4627 * src/insets/insetbib.C (Read): added this function because of wrong
4628 Write (without [begin|end]_inset).
4630 2000-07-11 Juergen Vigna <jug@sad.it>
4632 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4633 as the insertInset could not be good!
4635 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4636 the bool param should not be last.
4638 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4640 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4641 did submit that to Karl).
4643 * configure.in: use -isystem instead of -I for X headers. This
4644 fixes a problem on solaris with a recent gcc;
4645 put the front-end code after the X detection code;
4646 configure in sigc++ before lib/
4648 * src/lyx_main.C (commandLineHelp): remove -display from command
4651 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4653 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4654 Also put in Makefile rules for building the ``listerrors''
4655 program for parsing errors from literate programs written in LyX.
4657 * lib/build-listerrors: Added small shell script as part of compile
4658 process. This builds a working ``listerrors'' binary if noweb is
4659 installed and either 1) the VNC X server is installed on the machine,
4660 or 2) the user is compiling from within a GUI. The existence of a GUI
4661 is necessary to use the ``lyx --export'' feature for now. This
4662 hack can be removed once ``lyx --export'' no longer requires a GUI to
4665 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4667 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4668 now passed back correctly from gcc and placed "under" error
4669 buttons in a Literate LyX source.
4671 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4673 * src/text.C (GetColumnNearX): Better behavior when a RTL
4674 paragraph is ended by LTR text.
4676 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4679 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4681 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4682 true when clipboard is empty.
4684 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4686 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4687 row of the paragraph.
4688 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4689 to prevent calculation of bidi tables
4691 2000-07-07 Juergen Vigna <jug@sad.it>
4693 * src/screen.C (ToggleSelection): added y_offset and x_offset
4696 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4699 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4701 * src/insets/insettext.C: fixed Layout-Display!
4703 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4705 * configure.in: add check for strings.h header.
4707 * src/spellchecker.C: include <strings.h> in order to have a
4708 definition for bzero().
4710 2000-07-07 Juergen Vigna <jug@sad.it>
4712 * src/insets/insettext.C (draw): set the status of the bv->text to
4713 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4715 * src/screen.C (DrawOneRow):
4716 (DrawFromTo): redraw the actual row if something has changed in it
4719 * src/text.C (draw): call an update of the toplevel-inset if something
4720 has changed inside while drawing.
4722 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4724 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4726 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4727 processing inside class.
4729 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4730 processing inside class.
4732 * src/insets/insetindex.h new struct Holder, consistent with other
4735 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4736 citation dialog from main code and placed it in src/frontends/xforms.
4737 Dialog launched through signals instead of callbacks
4739 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4741 * lyx.man: update the options description.
4743 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4745 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4746 handle neg values, set min width to 590, add doc about -display
4748 2000-07-05 Juergen Vigna <jug@sad.it>
4750 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4751 calls to BufferView *.
4753 * src/insets/insettext.C (checkAndActivateInset): small fix non
4754 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4756 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4757 their \end_inset token!
4759 2000-07-04 edscott <edscott@imp.mx>
4761 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4762 lib/lyxrc.example: added option \wheel_jump
4764 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4766 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4767 remove support for -width,-height,-xpos and -ypos.
4769 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4771 * src/encoding.[Ch]: New files.
4773 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4774 (text): Call to the underline() method only when needed.
4776 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4778 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4779 encoding(s) for the document.
4781 * src/bufferparams.C (BufferParams): Changed default value of
4784 * src/language.C (newLang): Removed.
4785 (items[]): Added encoding information for all defined languages.
4787 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4788 encoding choice button.
4790 * src/lyxrc.h (font_norm_type): New member variable.
4791 (set_font_norm_type): New method.
4793 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4794 paragraphs with different encodings.
4796 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4797 (TransformChar): Changed to work correctly with Arabic points.
4798 (draw): Added support for drawing Arabic points.
4799 (draw): Removed code for drawing underbars (this is done by
4802 * src/support/textutils.h (IsPrintableNonspace): New function.
4804 * src/BufferView_pimpl.h: Added "using SigC::Object".
4805 * src/LyXView.h: ditto.
4807 * src/insets/insetinclude.h (include_label): Changed to mutable.
4809 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4811 * src/mathed/math_iter.h: remove empty destructor
4813 * src/mathed/math_cursor.h: remove empty destructor
4815 * src/insets/lyxinset.h: add THEOREM_CODE
4817 * src/insets/insettheorem.[Ch]: new files
4819 * src/insets/insetminipage.C: (InsertInset): remove
4821 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4823 (InsertInset): remove
4825 * src/insets/insetlist.C: (InsertList): remove
4827 * src/insets/insetfootlike.[Ch]: new files
4829 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4832 (InsertInset): ditto
4834 * src/insets/insetert.C: remove include Painter.h, reindent
4835 (InsertInset): move to header
4837 * src/insets/insetcollapsable.h: remove explicit from default
4838 contructor, remove empty destructor, add InsertInset
4840 * src/insets/insetcollapsable.C (InsertInset): new func
4842 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4844 * src/vspace.h: add explicit to constructor
4846 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4847 \textcompwordmark, please test this.
4849 * src/lyxrc.C: set ascii_linelen to 65 by default
4851 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4853 * src/commandtags.h: add LFUN_INSET_THEOREM
4855 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4856 (makeLinuxDocFile): remove _some_ of the nice logic
4857 (makeDocBookFile): ditto
4859 * src/Painter.[Ch]: (~Painter): removed
4861 * src/LyXAction.C (init): entry for insettheorem added
4863 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4865 (deplog): code to detect files generated by LaTeX, needs testing
4868 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4870 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4872 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4874 * src/LaTeX.C (deplog): Add a check for files that are going to be
4875 created by the first latex run, part of the project to remove the
4878 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4879 contents to the extension list.
4881 2000-07-04 Juergen Vigna <jug@sad.it>
4883 * src/text.C (NextBreakPoint): added support for needFullRow()
4885 * src/insets/lyxinset.h: added needFullRow()
4887 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4890 * src/insets/insettext.C: lots of changes for update!
4892 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4894 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4896 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4898 * src/insets/insetinclude.C (InsetInclude): fixed
4899 initialization of include_label.
4900 (unique_id): now returns a string.
4902 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4904 * src/LaTeXFeatures.h: new member IncludedFiles, for
4905 a map of key, included file name.
4907 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4908 with the included files for inclusion in SGML preamble,
4909 i. e., linuxdoc and docbook.
4912 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4913 nice (is the generated linuxdoc code to be exported?), that
4914 allows to remove column, and only_body that will be true for
4915 slave documents. Insets are allowed inside SGML font type.
4916 New handling of the SGML preamble for included files.
4917 (makeDocBookFile): the same for docbook.
4919 * src/insets/insetinclude.h:
4920 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4922 (DocBook): new export methods.
4924 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4925 and makeDocBookFile.
4927 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4928 formats to export with command line argument -x.
4930 2000-06-29 Juergen Vigna <jug@sad.it>
4932 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4933 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4935 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4936 region could already been cleared by an inset!
4938 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4940 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4943 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4945 (cursorToggle): remove special handling of lyx focus.
4947 2000-06-28 Juergen Vigna <jug@sad.it>
4949 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4952 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4954 * src/insets/insetindex.C (Edit): add a callback when popup is
4957 * src/insets/insettext.C (LocalDispatch):
4958 * src/insets/insetmarginal.h:
4959 * src/insets/insetlist.h:
4960 * src/insets/insetfoot.h:
4961 * src/insets/insetfloat.h:
4962 * src/insets/insetert.h: add a missing std:: qualifier.
4964 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4966 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4969 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4971 * src/insets/insettext.C (Read): remove tmptok unused variable
4972 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4973 (InsertInset): change for new InsetInset code
4975 * src/insets/insettext.h: add TEXT inline method
4977 * src/insets/insettext.C: remove TEXT macro
4979 * src/insets/insetmarginal.C (Write): new method
4980 (Latex): change output slightly
4982 * src/insets/insetfoot.C (Write): new method
4983 (Latex): change output slightly (don't use endl when no need)
4985 * src/insets/insetert.C (Write): new method
4987 * src/insets/insetcollapsable.h: make button_length, button_top_y
4988 and button_bottm_y protected.
4990 * src/insets/insetcollapsable.C (Write): simplify code by using
4991 tostr. Also do not output the float name, the children class
4992 should to that to get control over own arguments
4994 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4995 src/insets/insetminipage.[Ch]:
4998 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5000 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5002 * src/Makefile.am (lyx_SOURCES): add the new files
5004 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5005 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5006 * src/commandtags.h: ditto
5008 * src/LaTeXFeatures.h: add a std::set of used floattypes
5010 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5012 * src/FloatList.[Ch] src/Floating.h: new files
5014 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5016 * src/lyx_cb.C (TableApplyCB): ditto
5018 * src/text2.C: ditto
5019 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5020 (parseSingleLyXformat2Token): ditto + add code for
5021 backwards compability for old float styles + add code for new insets
5023 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5025 (InsertInset(size_type, Inset *, LyXFont)): new method
5026 (InsetChar(size_type, char)): changed to use the other InsetChar
5027 with a LyXFont(ALL_INHERIT).
5028 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5029 insert the META_INSET.
5031 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5033 * sigc++/thread.h (Threads): from here
5035 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5036 definition out of line
5037 * sigc++/scope.h: from here
5039 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5041 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5042 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5044 * Makefile.am (bindist): new target.
5046 * INSTALL: add instructions for doing a binary distribution.
5048 * development/tools/README.bin.example: update a bit.
5050 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5053 * lib/lyxrc.example: new lyxrc tag \set_color.
5055 * src/lyxfunc.C (Dispatch):
5056 * src/commandtags.h:
5057 * src/LyXAction.C: new lyxfunc "set-color".
5059 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5060 and an x11name given as strings.
5062 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5063 cache when a color is changed.
5065 2000-06-26 Juergen Vigna <jug@sad.it>
5067 * src/lyxrow.C (width): added this functions and variable.
5069 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5072 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5074 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5076 * images/undo_bw.xpm: new icon.
5077 * images/redo_bw.xpm: ditto.
5079 * configure.in (INSTALL_SCRIPT): change value to
5080 ${INSTALL} to avoid failures of install-script target.
5081 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5083 * src/BufferView.h: add a magic "friend" declaration to please
5086 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
5088 * forms/cite.fd: modified to allow resizing without messing
5091 * src/insetcite.C: Uses code from cite.fd almost without
5093 User can now resize dialog in the x-direction.
5094 Resizing the dialog in the y-direction is prevented, as the
5095 code does this intelligently already.
5097 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5099 * INSTALL: remove obsolete entry in "problems" section.
5101 * lib/examples/sl_*.lyx: update of the slovenian examples.
5103 * src/support/FileInfo.[Ch] (getBlockSize): remove.
5105 2000-06-23 Juergen Vigna <jug@sad.it>
5107 * src/lyxtext.h: added a 'cleared' flag to draw() function.
5109 * src/buffer.C (resize): delete the LyXText of textinsets.
5111 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
5113 * src/insets/lyxinset.h: added another parameter 'cleared' to
5114 the draw() function.
5116 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
5117 unlocking inset in inset.
5119 2000-06-22 Juergen Vigna <jug@sad.it>
5121 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
5122 of insets and moved first to LyXText.
5124 * src/mathed/formulamacro.[Ch]:
5125 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
5127 2000-06-21 Juergen Vigna <jug@sad.it>
5129 * src/text.C (GetVisibleRow): look if I should clear the area or not
5130 using Inset::doClearArea() function.
5132 * src/insets/lyxinset.h: added doClearArea() function and
5133 modified draw(Painter &, ...) to draw(BufferView *, ...)
5135 * src/text2.C (UpdateInset): return bool insted of int
5137 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
5139 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
5140 combox in the character popup
5142 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
5143 BufferParams const & params
5145 2000-06-20 Juergen Vigna <jug@sad.it>
5147 * src/insets/insettext.C (SetParagraphData): set insetowner on
5150 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5152 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
5153 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
5155 (form_main_): remove
5157 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
5158 (create_form_form_main): remove FD_form_main stuff, connect to
5159 autosave_timeout signal
5161 * src/LyXView.[Ch] (getMainForm): remove
5162 (UpdateTimerCB): remove
5163 * src/BufferView_pimpl.h: inherit from SigC::Object
5165 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
5166 signal instead of callback
5168 * src/BufferView.[Ch] (cursorToggleCB): remove
5170 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5172 * src/BufferView_pimpl.C: changes because of the one below
5174 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
5175 instead of storing a pointer to a LyXText.
5177 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
5179 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
5181 * src/lyxparagraph.h
5183 * src/paragraph.C: Changed fontlist to a sorted vector.
5185 2000-06-19 Juergen Vigna <jug@sad.it>
5187 * src/BufferView.h: added screen() function.
5189 * src/insets/insettext.C (LocalDispatch): some selection code
5192 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
5194 * src/insets/insettext.C (SetParagraphData):
5196 (InsetText): fixes for multiple paragraphs.
5198 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
5200 * development/lyx.spec.in: Call configure with ``--without-warnings''
5201 to work around a bug with the Makefiles when doing ``make lyxrpm''.
5202 This should be fine, however, since we generally don't want to be
5203 verbose when making an RPM.
5205 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
5207 * lib/scripts/fig2pstex.py: New file
5209 2000-06-16 Juergen Vigna <jug@sad.it>
5211 * src/insets/insettabular.C (UpdateLocal):
5212 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
5213 (LocalDispatch): Changed all functions to use LyXText.
5215 2000-06-15 Juergen Vigna <jug@sad.it>
5217 * src/text.C (SetHeightOfRow): call inset::update before requesting
5220 * src/insets/insettext.C (update):
5221 * src/insets/insettabular.C (update): added implementation
5223 * src/insets/lyxinset.h: added update function
5225 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5227 * src/text.C (SelectNextWord): protect against null pointers with
5228 old-style string streams. (fix from Paul Theo Gonciari
5231 * src/cite.[Ch]: remove erroneous files.
5233 * lib/configure.m4: update the list of created directories.
5235 * src/lyxrow.C: include <config.h>
5236 * src/lyxcursor.C: ditto.
5238 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5240 * lib/examples/decimal.lyx: new example file from Mike.
5242 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
5243 to find template definitions (from Dekel)
5245 * src/frontends/.cvsignore: add a few things.
5247 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
5249 * src/Timeout.C (TimeOut): remove default argument.
5251 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
5254 * src/insets/ExternalTemplate.C: add a "using" directive.
5256 * src/lyx_main.h: remove the act_ struct, which seems unused
5259 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5261 * LyX Developers Meeting: All files changed, due to random C++ (by
5262 coincidence) code generator script.
5264 - external inset (cool!)
5265 - initial online editing of preferences
5266 - insettabular breaks insettext(s contents)
5268 - some DocBook fixes
5269 - example files update
5270 - other cool stuff, create a diff and look for yourself.
5272 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
5274 * src/insets/insettext.C (computeTextRows): if the maxWidth is
5275 -1 this is a non-line-breaking textinset.
5277 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5278 if there is no width set.
5280 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5282 * Lots of files: Merged the dialogbase branch.
5284 2000-06-09 Allan Rae <rae@lyx.org>
5286 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5287 and the Dispatch methods that used it.
5289 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5290 access to functions formerly kept in Dispatch.
5292 2000-05-19 Allan Rae <rae@lyx.org>
5294 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5295 made to_page and count_copies integers again. from_page remains a
5296 string however because I want to allow entry of a print range like
5297 "1,4,22-25" using this field.
5299 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5300 and printer-params-get. These aren't useful from the minibuffer but
5301 could be used by a script/LyXServer app provided it passes a suitable
5302 auto_mem_buffer. I guess I should take a look at how the LyXServer
5303 works and make it support xtl buffers.
5305 * sigc++/: updated to libsigc++-1.0.1
5307 * src/xtl/: updated to xtl-1.3.pl.11
5309 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5310 those changes done to the files in src/ are actually recreated when
5311 they get regenerated. Please don't ever accept a patch that changes a
5312 dialog unless that patch includes the changes to the corresponding *.fd
5315 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5316 stringOnlyContains, renamed it and generalised it.
5318 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5319 branch. Removed the remaining old form_print code.
5321 2000-04-26 Allan Rae <rae@lyx.org>
5323 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5324 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5326 2000-04-25 Allan Rae <rae@lyx.org>
5328 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5329 against a base of xtl-1.3.pl.4
5331 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5332 filter the Id: entries so they still show the xtl version number
5335 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5336 into the src/xtl code. Patch still pending with José (XTL)
5338 2000-04-24 Allan Rae <rae@lyx.org>
5340 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5341 both more generic and much safer. Use the new template functions.
5342 * src/buffer.[Ch] (Dispatch): ditto.
5344 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5345 and mem buffer more intelligently. Also a little general cleanup.
5348 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5349 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5350 * src/xtl/Makefile.am: ditto.
5351 * src/xtl/.cvsignore: ditto.
5352 * src/Makefile.am: ditto.
5354 * src/PrinterParams.h: Removed the macros member functions. Added a
5355 testInvariant member function. A bit of tidying up and commenting.
5356 Included Angus's idea for fixing operation with egcs-1.1.2.
5358 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5359 cool expansion of XTL's mem_buffer to support automatic memory
5360 management within the buffer itself. Removed the various macros and
5361 replaced them with template functions that use either auto_mem_buffer
5362 or mem_buffer depending on a #define. The mem_buffer support will
5363 disappear as soon as the auto_mem_buffer is confirmed to be good on
5364 other platforms/compilers. That is, it's there so you've got something
5367 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5368 effectively forked XTL. However I expect José will include my code
5369 into the next major release. Also fixed a memory leak.
5370 * src/xtl/text.h: ditto.
5371 * src/xtl/xdr.h: ditto.
5372 * src/xtl/giop.h: ditto.
5374 2000-04-16 Allan Rae <rae@lyx.org>
5376 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5377 by autogen.sh and removed by maintainer-clean anyway.
5378 * .cvsignore, sigc++/.cvsignore: Support the above.
5380 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5382 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5384 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5385 macros, renamed static callback-target member functions to suit new
5386 scheme and made them public.
5387 * src/frontends/xforms/forms/form_print.fd: ditto.
5388 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5390 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5393 * src/xtl/: New directory containing a minimal distribution of XTL.
5394 This is XTL-1.3.pl.4.
5396 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5398 2000-04-15 Allan Rae <rae@lyx.org>
5400 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5402 * sigc++/: Updated to libsigc++-1.0.0
5404 2000-04-14 Allan Rae <rae@lyx.org>
5406 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5407 use the generic ones in future. I'll modify my conversion script.
5409 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5411 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5412 (CloseAllBufferRelatedDialogs): Renamed.
5413 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5415 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5416 of the generic ones. These are the same ones my conversion script
5419 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5420 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5421 * src/buffer.C (Dispatch): ditto
5423 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5424 functions for updating and hiding buffer dependent dialogs.
5425 * src/BufferView.C (buffer): ditto
5426 * src/buffer.C (setReadonly): ditto
5427 * src/lyxfunc.C (CloseBuffer): ditto
5429 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5430 Dialogs.h, and hence all the SigC stuff, into every file that includes
5431 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5433 * src/BufferView2.C: reduce the number of headers included by buffer.h
5435 2000-04-11 Allan Rae <rae@lyx.org>
5437 * src/frontends/xforms/xform_macros.h: A small collection of macros
5438 for building C callbacks.
5440 * src/frontends/xforms/Makefile.am: Added above file.
5442 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5443 scheme again. This time it should work for JMarc. If this is
5444 successful I'll revise my conversion script to automate some of this.
5445 The static member functions in the class also have to be public for
5446 this scheme will work. If the scheme works (it's almost identical to
5447 the way BufferView::cursorToggleCB is handled so it should work) then
5448 FormCopyright and FormPrint will be ready for inclusion into the main
5449 trunk immediately after 1.1.5 is released -- provided we're prepared
5450 for complaints about lame compilers not handling XTL.
5452 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5454 2000-04-07 Allan Rae <rae@lyx.org>
5456 * config/lyxinclude.m4: A bit more tidying up (Angus)
5458 * src/LString.h: JMarc's <string> header fix
5460 * src/PrinterParams.h: Used string for most data to remove some
5461 ugly code in the Print dialog and avoid even uglier code when
5462 appending the ints to a string for output.
5464 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5465 and moved "default:" back to the end of switch statement. Cleaned
5466 up the printing so it uses the right function calls and so the
5467 "print to file" option actually puts the file in the right directory.
5469 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5471 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5472 and Ok+Apply button control into a separate method: input (Angus).
5473 (input) Cleaned it up and improved it to be very thorough now.
5474 (All CB) static_cast used instead of C style cast (Angus). This will
5475 probably change again once we've worked out how to keep gcc-2.8.1 happy
5476 with real C callbacks.
5477 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5478 ignore some of the bool settings and has random numbers instead. Needs
5479 some more investigation. Added other input length checks and checking
5480 of file and printer names.
5482 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5483 would link (Angus). Seems the old code doesn't compile with the pragma
5484 statement either. Separated callback entries from internal methods.
5486 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5488 2000-03-17 Allan Rae <rae@lyx.org>
5490 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5491 need it? Maybe it could go in Dialogs instead? I could make it a
5492 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5493 values to get the bool return value.
5494 (Dispatch): New overloaded method for xtl support.
5496 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5497 extern "C" callback instead of static member functions. Hopefully,
5498 JMarc will be able to compile this. I haven't changed
5499 forms/form_copyright.fd yet. Breaking one of my own rules already.
5501 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5502 because they aren't useful from the minibuffer. Maybe a LyXServer
5503 might want a help message though?
5505 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5507 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5508 xtl which needs both rtti and exceptions.
5510 * src/support/Makefile.am:
5511 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5513 * src/frontends/xforms/input_validators.[ch]: input filters and
5514 validators. These conrol what keys are valid in input boxes.
5515 Use them and write some more. Much better idea than waiting till
5516 after the user has pressed Ok to say that the input fields don't make
5519 * src/frontends/xforms/Makefile.am:
5520 * src/frontends/xforms/forms/form_print.fd:
5521 * src/frontends/xforms/forms/makefile:
5522 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5523 new scheme. Still have to make sure I haven't missed anything from
5524 the current implementation.
5526 * src/Makefile.am, src/PrinterParams.h: New data store.
5528 * other files: Added a couple of copyright notices.
5530 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5532 * src/insets/insetbib.h: move Holder struct in public space.
5534 * src/frontends/include/DialogBase.h: use SigC:: only when
5535 SIGC_CXX_NAMESPACES is defined.
5536 * src/frontends/include/Dialogs.h: ditto.
5538 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5540 * src/frontends/xforms/FormCopyright.[Ch]: do not
5541 mention SigC:: explicitely.
5543 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5545 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5546 deals with testing KDE in main configure.in
5547 * configure.in: ditto.
5549 2000-02-22 Allan Rae <rae@lyx.org>
5551 * Lots of files: Merged from HEAD
5553 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5554 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5556 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5558 * sigc++/: new minidist.
5560 2000-02-14 Allan Rae <rae@lyx.org>
5562 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5564 2000-02-08 Juergen Vigna <jug@sad.it>
5566 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5567 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5569 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5570 for this port and so it is much easier for other people to port
5571 dialogs in a common development environment.
5573 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5574 the QT/KDE implementation.
5576 * src/frontends/kde/Dialogs.C:
5577 * src/frontends/kde/FormCopyright.C:
5578 * src/frontends/kde/FormCopyright.h:
5579 * src/frontends/kde/Makefile.am:
5580 * src/frontends/kde/formcopyrightdialog.C:
5581 * src/frontends/kde/formcopyrightdialog.h:
5582 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5583 for the kde support of the Copyright-Dialog.
5585 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5586 subdir-substitution instead of hardcoded 'xforms' as we now have also
5589 * src/frontends/include/DialogBase.h (Object): just commented the
5590 label after #endif (nasty warning and I don't like warnings ;)
5592 * src/main.C (main): added KApplication initialization if using
5595 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5596 For now only the KDE event-loop is added if frontend==kde.
5598 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5600 * configure.in: added support for the --with-frontend[=value] option
5602 * autogen.sh: added kde.m4 file to list of config-files
5604 * acconfig.h: added define for KDEGUI-support
5606 * config/kde.m4: added configuration functions for KDE-port
5608 * config/lyxinclude.m4: added --with-frontend[=value] option with
5609 support for xforms and KDE.
5611 2000-02-08 Allan Rae <rae@lyx.org>
5613 * all Makefile.am: Fixed up so the make targets dist, distclean,
5614 install and uninstall all work even if builddir != srcdir. Still
5615 have a new sigc++ minidist update to come.
5617 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5619 2000-02-01 Allan Rae <rae@lyx.org>
5621 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5622 Many mods to get builddir != srcdir working.
5624 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5625 for building on NT and so we can do the builddir != srcdir stuff.
5627 2000-01-30 Allan Rae <rae@lyx.org>
5629 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5630 This will stay in "rae" branch. We probably don't really need it in
5631 the main trunk as anyone who wants to help programming it should get
5632 a full library installed also. So they can check both included and
5633 system supplied library compilation.
5635 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5636 Added a 'mini' distribution of libsigc++. If you feel the urge to
5637 change something in these directories - Resist it. If you can't
5638 resist the urge then you should modify the following script and rebuild
5639 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5640 all happen. Still uses a hacked version of libsigc++'s configure.in.
5641 I'm quite happy with the results. I'm not sure the extra work to turn
5642 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5643 worth the trouble and would probably lead to extra maintenance
5645 I haven't tested the following important make targets: install, dist.
5646 Not ready for prime time but very close. Maybe 1.1.5.
5648 * development/tools/makeLyXsigc.sh: A shell script to automatically
5649 generate our mini-dist of libsigc++. It can only be used with a CVS
5650 checkout of libsigc++ not a tarball distribution. It's well commented.
5651 This will end up as part of the libsigc++ distribution so other apps
5652 can easily have an included mini-dist. If someone makes mods to the
5653 sigc++ subpackage without modifying this script to generate those
5654 changes I'll be very upset!
5656 * src/frontends/: Started the gui/system indep structure.
5658 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5659 to access the gui-indep dialogs are in this class. Much improved
5660 design compared to previous revision. Lars, please refrain from
5661 moving this header into src/ like you did with Popups.h last time.
5663 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5665 * src/frontends/xforms/: Started the gui-indep system with a single
5666 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5669 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5670 Here you'll find a very useful makefile and automated fdfix.sh that
5671 makes updating dailogs a no-brainer -- provided you follow the rules
5672 set out in the README. I'm thinking about adding another script to
5673 automatically generate skeleton code for a new dialog given just the
5676 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5677 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5678 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5680 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5682 * src/support/LSubstring.C (operator): simplify
5684 * src/lyxtext.h: removed bparams, use buffer_->params instead
5686 * src/lyxrow.h: make Row a real class, move all variables to
5687 private and use accessors.
5689 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5691 (isRightToLeftPar): ditto
5692 (ChangeLanguage): ditto
5693 (isMultiLingual): ditto
5696 (SimpleTeXOnePar): ditto
5697 (TeXEnvironment): ditto
5698 (GetEndLabel): ditto
5700 (SetOnlyLayout): ditto
5701 (BreakParagraph): ditto
5702 (BreakParagraphConservative): ditto
5703 (GetFontSettings): ditto
5705 (CopyIntoMinibuffer): ditto
5706 (CutIntoMinibuffer): ditto
5707 (PasteParagraph): ditto
5708 (SetPExtraType): ditto
5709 (UnsetPExtraType): ditto
5710 (DocBookContTableRows): ditto
5711 (SimpleDocBookOneTablePar): ditto
5713 (TeXFootnote): ditto
5714 (SimpleTeXOneTablePar): ditto
5715 (TeXContTableRows): ditto
5716 (SimpleTeXSpecialChars): ditto
5719 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5720 to private and use accessors.
5722 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5723 this, we did not use it anymore and has not been for ages. Just a
5724 waste of cpu cycles.
5726 * src/language.h: make Language a real class, move all variables
5727 to private and use accessors.
5729 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5730 (create_view): remove
5731 (update): some changes for new timer
5732 (cursorToggle): use new timer
5733 (beforeChange): change for new timer
5735 * src/BufferView.h (cursorToggleCB): removed last paramter because
5738 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5739 (cursorToggleCB): change because of new timer code
5741 * lib/CREDITS: updated own mailaddress
5743 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5745 * src/support/filetools.C (PutEnv): fix the code in case neither
5746 putenv() nor setenv() have been found.
5748 * INSTALL: mention the install-strip Makefile target.
5750 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5751 read-only documents.
5753 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5755 * lib/reLyX/configure.in (VERSION): avoid using a previously
5756 generated reLyX wrapper to find out $prefix.
5758 * lib/examples/eu_adibide_lyx-atua.lyx:
5759 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5760 translation of the Tutorial (Dooteo)
5762 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5764 * forms/cite.fd: new citation dialog
5766 * src/insetcite.[Ch]: the new citation dialog is moved into
5769 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5772 * src/insets/insetcommand.h: data members made private.
5774 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5776 * LyX 1.1.5 released
5778 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5780 * src/version.h (LYX_RELEASE): to 1.1.5
5782 * src/spellchecker.C (RunSpellChecker): return false if the
5783 spellchecker dies upon creation.
5785 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5787 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5788 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5792 * lib/CREDITS: update entry for Martin Vermeer.
5794 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5796 * src/text.C (draw): Draw foreign language bars at the bottom of
5797 the row instead of at the baseline.
5799 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5801 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5803 * lib/bind/de_menus.bind: updated
5805 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5807 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5809 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5811 * src/menus.C (Limit_string_length): New function
5812 (ShowTocMenu): Limit the number of items/length of items in the
5815 * src/paragraph.C (String): Correct result for a paragraph inside
5818 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5820 * src/bufferlist.C (close): test of buf->getuser() == NULL
5822 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5824 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5825 Do not call to SetCursor when the paragraph is a closed footnote!
5827 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5829 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5832 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5834 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5837 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5838 reference popup, that activates the reference-back action
5840 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5842 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5843 the menus. Also fixed a bug.
5845 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5846 the math panels when switching buffers (unless new buffer is readonly).
5848 * src/BufferView.C (NoSavedPositions)
5849 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5851 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5853 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5854 less of dvi dirty or not.
5856 * src/trans_mgr.[Ch] (insert): change first parameter to string
5859 * src/chset.[Ch] (encodeString): add const to first parameter
5861 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5863 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5867 * src/LaTeX.C (deplog): better searching for dependency files in
5868 the latex log. Uses now regexps.
5870 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5871 instead of the box hack or \hfill.
5873 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5875 * src/lyxfunc.C (doImportHelper): do not create the file before
5876 doing the actual import.
5877 (doImportASCIIasLines): create a new file before doing the insert.
5878 (doImportASCIIasParagraphs): ditto.
5880 * lib/lyxrc.example: remove mention of non-existing commands
5882 * lyx.man: remove mention of color-related switches.
5884 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5886 * src/lyx_gui.C: remove all the color-related ressources, which
5887 are not used anymore.
5889 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5892 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5894 * src/lyxrc.C (read): Add a missing break in the switch
5896 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5898 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5900 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5903 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5905 * src/text.C (draw): draw bars under foreign language words.
5907 * src/LColor.[Ch]: add LColor::language
5909 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5911 * src/lyxcursor.h (boundary): New member variable
5913 * src/text.C (IsBoundary): New methods
5915 * src/text.C: Use the above for currect cursor movement when there
5916 is both RTL & LTR text.
5918 * src/text2.C: ditto
5920 * src/bufferview_funcs.C (ToggleAndShow): ditto
5922 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5924 * src/text.C (DeleteLineForward): set selection to true to avoid
5925 that DeleteEmptyParagraphMechanism does some magic. This is how it
5926 is done in all other functions, and seems reasonable.
5927 (DeleteWordForward): do not jump over non-word stuff, since
5928 CursorRightOneWord() already does it.
5930 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5931 DeleteWordBackward, since they seem safe to me (since selection is
5932 set to "true") DeleteEmptyParagraphMechanism does nothing.
5934 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5936 * src/lyx_main.C (easyParse): simplify the code by factoring the
5937 part that removes parameters from the command line.
5938 (LyX): check wether wrong command line options have been given.
5940 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5942 * src/lyx_main.C : add support for specifying user LyX
5943 directory via command line option -userdir.
5945 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5947 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5948 the number of items per popup.
5949 (Add_to_refs_menu): Ditto.
5951 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5953 * src/lyxparagraph.h: renamed ClearParagraph() to
5954 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5955 textclass as parameter, and do nothing if free_spacing is
5956 true. This fixes part of the line-delete-forward problems.
5958 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5959 (pasteSelection): ditto.
5960 (SwitchLayoutsBetweenClasses): more translatable strings.
5962 * src/text2.C (CutSelection): use StripLeadingSpaces.
5963 (PasteSelection): ditto.
5964 (DeleteEmptyParagraphMechanism): ditto.
5966 2000-05-26 Juergen Vigna <jug@sad.it>
5968 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5969 is not needed in tabular insets.
5971 * src/insets/insettabular.C (TabularFeatures): added missing features.
5973 * src/tabular.C (DeleteColumn):
5975 (AppendRow): implemented this functions
5976 (cellsturct::operator=): clone the inset too;
5978 2000-05-23 Juergen Vigna <jug@sad.it>
5980 * src/insets/insettabular.C (LocalDispatch): better selection support
5981 when having multicolumn-cells.
5983 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5985 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5987 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5989 * src/ColorHandler.C (getGCForeground): put more test into _()
5991 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5994 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5997 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5999 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6000 there are no labels, or when buffer is readonly.
6002 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6003 there are no labels, buffer is SGML, or when buffer is readonly.
6005 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6007 * src/LColor.C (LColor): change a couple of grey40 to grey60
6008 (LColor): rewore initalization to make compiles go some magnitude
6010 (getGUIName): don't use gettext until we need the string.
6012 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6014 * src/Bullet.[Ch]: Fixed a small bug.
6016 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6018 * src/paragraph.C (String): Several fixes/improvements
6020 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6022 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6024 * src/paragraph.C (String): give more correct output.
6026 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6028 * src/lyxfont.C (stateText) Do not output the language if it is
6029 eqaul to the language of the document.
6031 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6032 between two paragraphs with the same language.
6034 * src/paragraph.C (getParLanguage) Return a correct answer for an
6035 empty dummy paragraph.
6037 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6040 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6043 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6044 the menus/popup, if requested fonts are unavailable.
6046 2000-05-22 Juergen Vigna <jug@sad.it>
6048 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6049 movement support (Up/Down/Tab/Shift-Tab).
6050 (LocalDispatch): added also preliminari cursor-selection.
6052 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6054 * src/paragraph.C (PasteParagraph): Hopefully now right!
6056 2000-05-22 Garst R. Reese <reese@isn.net>
6058 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6059 of list, change all references to Environment to Command
6060 * tex/hollywood.cls : rewrite environments as commands, add
6061 \uppercase to interiorshot and exteriorshot to force uppecase.
6062 * tex/broadway.cls : rewrite environments as commands. Tweak
6065 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6067 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6068 size of items: use a constant intead of the hardcoded 40, and more
6069 importantly do not remove the %m and %x tags added at the end.
6070 (Add_to_refs_menu): use vector::size_type instead of
6071 unsigned int as basic types for the variables. _Please_ do not
6072 assume that size_t is equal to unsigned int. On an alpha, this is
6073 unsigned long, which is _not_ the same.
6075 * src/language.C (initL): remove language "hungarian", since it
6076 seems that "magyar" is better.
6078 2000-05-22 Juergen Vigna <jug@sad.it>
6080 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6082 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6085 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6086 next was deleted but not set to 0.
6088 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6090 * src/language.C (initL): change the initialization of languages
6091 so that compiles goes _fast_.
6093 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
6096 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
6098 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6102 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6104 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
6106 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
6110 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
6113 * src/insets/insetlo*.[Ch]: Made editable
6115 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6117 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
6118 the current selection.
6120 * src/BufferView_pimpl.C (stuffClipboard): new method
6122 * src/BufferView.C (stuffClipboard): new method
6124 * src/paragraph.C (String): new method
6126 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
6127 LColor::ignore when lyxname is not found.
6129 * src/BufferView.C (pasteSelection): new method
6131 * src/BufferView_pimpl.C (pasteSelection): new method
6133 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
6135 * src/WorkArea.C (request_clipboard_cb): new static function
6136 (getClipboard): new method
6137 (putClipboard): new method
6139 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6141 * LyX 1.1.5pre2 released
6143 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6145 * src/vspace.C (operator=): removed
6146 (operator=): removed
6148 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
6150 * src/layout.C (NumberOfClass): manually set the type in make_pair
6151 (NumberOfLayout): ditto
6153 * src/language.C: use the Language constructor for ignore_lang
6155 * src/language.h: add constructors to struct Language
6157 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
6159 * src/text2.C (SetCursorIntern): comment out #warning
6161 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
6163 * src/mathed/math_iter.h: initialize sx and sw to 0
6165 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6167 * forms/lyx.fd: Redesign of form_ref
6169 * src/LaTeXFeatures.[Ch]
6173 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
6176 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
6177 and Buffer::inset_iterator.
6179 * src/menus.C: Added new menus: TOC and Refs.
6181 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
6183 * src/buffer.C (getTocList): New method.
6185 * src/BufferView2.C (ChangeRefs): New method.
6187 * src/buffer.C (getLabelList): New method. It replaces the old
6188 getReferenceList. The return type is vector<string> instead of
6191 * src/insets/insetinclude.C (getLabelList): New method. Replaces
6192 the old getLabel() and GetNumberOfLabels() methods.
6193 * src/insets/insetlabel.C (getLabelList): ditto
6194 * src/mathed/formula.C (getLabelList): ditto
6196 * src/paragraph.C (String): New method.
6198 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
6199 Uses the new getTocList() method.
6200 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
6201 which automatically updates the contents of the browser.
6202 (RefUpdateCB): Use the new getLabelList method.
6204 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
6206 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
6208 * src/spellchecker.C: Added using std::reverse;
6210 2000-05-19 Juergen Vigna <jug@sad.it>
6212 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
6214 * src/insets/insettext.C (computeTextRows): small fix for display of
6215 1 character after a newline.
6217 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
6220 2000-05-18 Juergen Vigna <jug@sad.it>
6222 * src/insets/insettabular.C (TabularFeatures): fixed update of display
6223 when changing width of column.
6225 * src/tabular.C (set_row_column_number_info): setting of
6226 autobreak rows if necessary.
6228 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6230 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
6232 * src/vc-backend.*: renamed stat() to status() and vcstat to
6233 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
6234 compilation broke. The new name seems more relevant, anyway.
6236 2000-05-17 Juergen Vigna <jug@sad.it>
6238 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
6239 which was wrong if the removing caused removing of rows!
6241 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
6242 (pushToken): new function.
6244 * src/text2.C (CutSelection): fix problem discovered with purify
6246 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6248 * src/debug.C (showTags): enlarge the first column, now that we
6249 have 6-digits debug codes.
6251 * lib/layouts/hollywood.layout:
6252 * lib/tex/hollywood.cls:
6253 * lib/tex/brodway.cls:
6254 * lib/layouts/brodway.layout: more commands and fewer
6255 environments. Preambles moved in the .cls files. Broadway now has
6256 more options on scene numbering and less whitespace (from Garst)
6258 * src/insets/insetbib.C (getKeys): make sure that we are in the
6259 document directory, in case the bib file is there.
6261 * src/insets/insetbib.C (Latex): revert bogus change.
6263 2000-05-16 Juergen Vigna <jug@sad.it>
6265 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
6266 the TabularLayout on cursor move.
6268 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
6270 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
6273 (draw): fixed cursor position and drawing so that the cursor is
6274 visible when before the tabular-inset.
6276 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6277 when creating from old insettext.
6279 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6281 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6283 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6284 * lib/tex/brodway.cls: ditto
6286 * lib/layouts/brodway.layout: change alignment of parenthical
6289 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6291 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6292 versions 0.88 and 0.89 are supported.
6294 2000-05-15 Juergen Vigna <jug@sad.it>
6296 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6299 * src/insets/insettext.C (computeTextRows): redone completely this
6300 function in a much cleaner way, because of problems when having a
6302 (draw): added a frame border when the inset is locked.
6303 (SetDrawLockedFrame): this sets if we draw the border or not.
6304 (SetFrameColor): this sets the frame color (default=insetframe).
6306 * src/insets/lyxinset.h: added x() and y() functions which return
6307 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6308 function which is needed to see if we have a locking inset of some
6309 type in this inset (needed for now in insettabular).
6311 * src/vspace.C (inPixels): the same function also without a BufferView
6312 parameter as so it is easier to use it in some ocasions.
6314 * src/lyxfunc.C: changed all places where insertInset was used so
6315 that now if it couldn't be inserted it is deleted!
6317 * src/TabularLayout.C:
6318 * src/TableLayout.C: added support for new tabular-inset!
6320 * src/BufferView2.C (insertInset): this now returns a bool if the
6321 inset was really inserted!!!
6323 * src/tabular.C (GetLastCellInRow):
6324 (GetFirstCellInRow): new helper functions.
6325 (Latex): implemented for new tabular class.
6329 (TeXTopHLine): new Latex() helper functions.
6331 2000-05-12 Juergen Vigna <jug@sad.it>
6333 * src/mathed/formulamacro.C (Read):
6334 * src/mathed/formula.C (Read): read also the \end_inset here!
6336 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6338 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6339 crush when saving formulae with unbalanced parenthesis.
6341 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6343 * src/layout.C: Add new keyword "endlabelstring" to layout file
6345 * src/text.C (GetVisibleRow): Draw endlabel string.
6347 * lib/layouts/broadway.layout
6348 * lib/layouts/hollywood.layout: Added endlabel for the
6349 Parenthetical layout.
6351 * lib/layouts/heb-article.layout: Do not use slanted font shape
6352 for Theorem like environments.
6354 * src/buffer.C (makeLaTeXFile): Always add "american" to
6355 the UsedLanguages list if document language is RTL.
6357 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6359 * add addendum to README.OS2 and small patch (from SMiyata)
6361 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6363 * many files: correct the calls to ChangeExtension().
6365 * src/support/filetools.C (ChangeExtension): remove the no_path
6366 argument, which does not belong there. Use OnlyFileName() instead.
6368 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6369 files when LaTeXing a non-nice latex file.
6371 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6372 a chain of "if". Return false when deadkeys are not handled.
6374 * src/lyx_main.C (LyX): adapted the code for default bindings.
6376 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6377 bindings for basic functionality (except deadkeys).
6378 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6380 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6381 several methods: handle override_x_deadkeys.
6383 * src/lyxrc.h: remove the "bindings" map, which did not make much
6384 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6386 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6388 * src/lyxfont.C (stateText): use a saner method to determine
6389 whether the font is "default". Seems to fix the crash with DEC
6392 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6394 2000-05-08 Juergen Vigna <jug@sad.it>
6396 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6397 TabularLayoutMenu with mouse-button-3
6398 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6400 * src/TabularLayout.C: added this file for having a Layout for
6403 2000-05-05 Juergen Vigna <jug@sad.it>
6405 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6406 recalculating inset-widths.
6407 (TabularFeatures): activated this function so that I can change
6408 tabular-features via menu.
6410 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6411 that I can test some functions with the Table menu.
6413 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6415 * src/lyxfont.C (stateText): guard against stupid c++libs.
6417 * src/tabular.C: add using std::vector
6418 some whitespace changes, + removed som autogenerated code.
6420 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6422 2000-05-05 Juergen Vigna <jug@sad.it>
6424 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6425 row, columns and cellstructures.
6427 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6429 * lib/lyxrc.example: remove obsolete entries.
6431 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6432 reading of protected_separator for free_spacing.
6434 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6436 * src/text.C (draw): do not display an exclamation mark in the
6437 margin for margin notes. This is confusing, ugly and
6440 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6441 AMS math' is checked.
6443 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6444 name to see whether including the amsmath package is needed.
6446 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6448 * src/paragraph.C (validate): Compute UsedLanguages correctly
6449 (don't insert the american language if it doesn't appear in the
6452 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6453 The argument of \thanks{} command is considered moving argument
6455 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6458 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6460 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6461 for appendix/minipage/depth. The lines can be now both in the footnote
6462 frame, and outside the frame.
6464 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6467 2000-05-05 Juergen Vigna <jug@sad.it>
6469 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6470 neede only in tabular.[Ch].
6472 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6474 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6476 (Write): write '~' for PROTECTED_SEPARATOR
6478 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6480 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6483 * src/mathed/formula.C (drawStr): rename size to siz.
6485 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6486 possibly fix a bug by not changing the pflags = flags to piflags =
6489 2000-05-05 Juergen Vigna <jug@sad.it>
6491 * src/insets/insetbib.C: moved using directive
6493 * src/ImportNoweb.C: small fix for being able to compile (missing
6496 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6498 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6499 to use clear, since we don't depend on this in the code. Add test
6502 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6504 * (various *.C files): add using std::foo directives to please dec
6507 * replace calls to string::clear() to string::erase() (Angus)
6509 * src/cheaders/cmath: modified to provide std::abs.
6511 2000-05-04 Juergen Vigna <jug@sad.it>
6513 * src/insets/insettext.C: Prepared all for inserting of multiple
6514 paragraphs. Still display stuff to do (alignment and other things),
6515 but I would like to use LyXText to do this when we cleaned out the
6516 table-support stuff.
6518 * src/insets/insettabular.C: Changed lot of stuff and added lots
6519 of functionality still a lot to do.
6521 * src/tabular.C: Various functions changed name and moved to be
6522 const functions. Added new Read and Write functions and changed
6523 lots of things so it works good with tabular-insets (also removed
6524 some stuff which is not needed anymore * hacks *).
6526 * src/lyxcursor.h: added operators == and != which just look if
6527 par and pos are (not) equal.
6529 * src/buffer.C (latexParagraphs): inserted this function to latex
6530 all paragraphs form par to endpar as then I can use this too for
6533 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6534 so that I can call this to from text insets with their own cursor.
6536 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6537 output off all paragraphs (because of the fix below)!
6539 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6540 the very last paragraph (this could be also the last paragraph of an
6543 * src/texrow.h: added rows() call which returns the count-variable.
6545 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6547 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6549 * lib/configure.m4: better autodetection of DocBook tools.
6551 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6553 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6555 * src/lyx_cb.C: add using std::reverse;
6557 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6560 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6561 selected files. Should fix repeated errors from generated files.
6563 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6565 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6567 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6568 the spellchecker popup.
6570 * lib/lyxrc.example: Removed the \number_inset section
6572 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6574 * src/insets/figinset.C (various): Use IsFileReadable() to make
6575 sure that the file actually exist. Relying on ghostscripts errors
6576 is a bad idea since they can lead to X server crashes.
6578 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6580 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6583 * lib/lyxrc.example: smallish typo in description of
6584 \view_dvi_paper_option
6586 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6589 * src/lyxfunc.C: doImportHelper to factor out common code of the
6590 various import methods. New functions doImportASCIIasLines,
6591 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6592 doImportLinuxDoc for the format specific parts.
6595 * buffer.C: Dispatch returns now a bool to indicate success
6598 * lyx_gui.C: Add getLyXView() for member access
6600 * lyx_main.C: Change logic for batch commands: First try
6601 Buffer::Dispatch (possibly without GUI), if that fails, use
6604 * lyx_main.C: Add support for --import command line switch.
6605 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6606 Available Formats: Everything accepted by 'buffer-import <format>'
6608 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6610 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6613 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6614 documents will be reformatted upon reentry.
6616 2000-04-27 Juergen Vigna <jug@sad.it>
6618 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6619 correctly only last pos this was a bug.
6621 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6623 * release of lyx-1.1.5pre1
6625 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6627 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6629 * src/menus.C: revert the change of naming (Figure->Graphic...)
6630 from 2000-04-11. It was incomplete and bad.
6632 * src/LColor.[Ch]: add LColor::depthbar.
6633 * src/text.C (GetVisibleRow): use it.
6635 * README: update the languages list.
6637 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6639 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6642 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6644 * README: remove sections that were just wrong.
6646 * src/text2.C (GetRowNearY): remove currentrow code
6648 * src/text.C (GetRow): remove currentrow code
6650 * src/screen.C (Update): rewritten a bit.
6651 (SmallUpdate): removed func
6653 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6655 (FullRebreak): return bool
6656 (currentrow): remove var
6657 (currentrow_y): ditto
6659 * src/lyxscreen.h (Draw): change arg to unsigned long
6660 (FitCursor): return bool
6661 (FitManualCursor): ditto
6662 (Smallpdate): remove func
6663 (first): change to unsigned long
6664 (DrawOneRow): change second arg to long (from long &)
6665 (screen_refresh_y): remove var
6666 (scree_refresh_row): ditto
6668 * src/lyxrow.h: change baseline to usigned int from unsigned
6669 short, this brings some implicit/unsigned issues out in the open.
6671 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6673 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6674 instead of smallUpdate.
6676 * src/lyxcursor.h: change y to unsigned long
6678 * src/buffer.h: don't call updateScrollbar after fitcursor
6680 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6681 where they are used. Removed "\\direction", this was not present
6682 in 1.1.4 and is already obsolete. Commented out some code that I
6683 believe to never be called.
6684 (runLiterate): don't call updateScrollbar after fitCursor
6686 (buildProgram): ditto
6689 * src/WorkArea.h (workWidth): change return val to unsigned
6692 (redraw): remove the button redraws
6693 (setScrollbarValue): change for scrollbar
6694 (getScrollbarValue): change for scrollbar
6695 (getScrollbarBounds): change for scrollbar
6697 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6698 (C_WorkArea_down_cb): removed func
6699 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6700 (resize): change for scrollbar
6701 (setScrollbar): ditto
6702 (setScrollbarBounds): ditto
6703 (setScrollbarIncrements): ditto
6704 (up_cb): removed func
6705 (down_cb): removed func
6706 (scroll_cb): change for scrollbar
6707 (work_area_handler): ditto
6709 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6710 when FitCursor did something.
6711 (updateScrollbar): some unsigned changes
6712 (downCB): removed func
6713 (scrollUpOnePage): removed func
6714 (scrollDownOnePage): remvoed func
6715 (workAreaMotionNotify): don't call screen->FitCursor but use
6716 fitCursor instead. and bool return val
6717 (workAreaButtonPress): ditto
6718 (workAreaButtonRelease): some unsigned changes
6719 (checkInsetHit): ditto
6720 (workAreaExpose): ditto
6721 (update): parts rewritten, comments about the signed char arg added
6722 (smallUpdate): removed func
6723 (cursorPrevious): call needed updateScrollbar
6726 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6729 * src/BufferView.[Ch] (upCB): removed func
6730 (downCB): removed func
6731 (smallUpdate): removed func
6733 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6735 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6736 currentrow, currentrow_y optimization. This did not help a lot and
6737 if we want to do this kind of optimization we should rather use
6738 cursor.row instead of the currentrow.
6740 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6741 buffer spacing and klyx spacing support.
6743 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6745 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6748 2000-04-26 Juergen Vigna <jug@sad.it>
6750 * src/insets/figinset.C: fixes to Lars sstream changes!
6752 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6754 * A lot of files: Added Ascii(ostream &) methods to all inset
6755 classes. Used when exporting to ASCII.
6757 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6758 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6761 * src/text2.C (ToggleFree): Disabled implicit word selection when
6762 there is a change in the language
6764 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6765 no output was generated for end-of-sentence inset.
6767 * src/insets/lyxinset.h
6770 * src/paragraph.C: Removed the insetnumber code
6772 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6774 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6776 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6777 no_babel and no_epsfig completely from the file.
6778 (parseSingleLyXformat2Token): add handling for per-paragraph
6779 spacing as written by klyx.
6781 * src/insets/figinset.C: applied patch by Andre. Made it work with
6784 2000-04-20 Juergen Vigna <jug@sad.it>
6786 * src/insets/insettext.C (cutSelection):
6787 (copySelection): Fixed with selection from right to left.
6788 (draw): now the rows are not recalculated at every draw.
6789 (computeTextRows): for now reset the inset-owner here (this is
6790 important for an undo or copy where the inset-owner is not set
6793 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6794 motion to the_locking_inset screen->first was forgotten, this was
6795 not important till we got multiline insets.
6797 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6799 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6800 code seems to be alright (it is code changed by Dekel, and the
6801 intent is indeed that all macros should be defined \protect'ed)
6803 * NEWS: a bit of reorganisation of the new user-visible features.
6805 2000-04-19 Juergen Vigna <jug@sad.it>
6807 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6808 position. Set the inset_owner of the used paragraph so that it knows
6809 that it is inside an inset. Fixed cursor handling with mouse and
6810 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6811 and cleanups to make TextInsets work better.
6813 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6814 Changed parameters of various functions and added LockInsetInInset().
6816 * src/insets/insettext.C:
6818 * src/insets/insetcollapsable.h:
6819 * src/insets/insetcollapsable.C:
6820 * src/insets/insetfoot.h:
6821 * src/insets/insetfoot.C:
6822 * src/insets/insetert.h:
6823 * src/insets/insetert.C: cleaned up the code so that it works now
6824 correctly with insettext.
6826 * src/insets/inset.C:
6827 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6828 that insets in insets are supported right.
6831 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6833 * src/paragraph.C: some small fixes
6835 * src/debug.h: inserted INSETS debug info
6837 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6838 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6840 * src/commandtags.h:
6841 * src/LyXAction.C: insert code for InsetTabular.
6843 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6844 not Button1MotionMask.
6845 (workAreaButtonRelease): send always a InsetButtonRelease event to
6847 (checkInsetHit): some setCursor fixes (always with insets).
6849 * src/BufferView2.C (lockInset): returns a bool now and extended for
6850 locking insets inside insets.
6851 (showLockedInsetCursor): it is important to have the cursor always
6852 before the locked inset.
6853 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6855 * src/BufferView.h: made lockInset return a bool.
6857 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6859 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6860 that is used also internally but can be called as public to have back
6861 a cursor pos which is not set internally.
6862 (SetCursorIntern): Changed to use above function.
6864 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6866 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6871 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6872 patches for things that should be in or should be changed.
6874 * src/* [insetfiles]: change "usigned char fragile" to bool
6875 fragile. There was only one point that could that be questioned
6876 and that is commented in formulamacro.C. Grep for "CHECK".
6878 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6879 (DeleteBuffer): take it out of CutAndPaste and make it static.
6881 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6883 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6884 output the spacing envir commands. Also the new commands used in
6885 the LaTeX output makes the result better.
6887 * src/Spacing.C (writeEnvirBegin): new method
6888 (writeEnvirEnd): new method
6890 2000-04-18 Juergen Vigna <jug@sad.it>
6892 * src/CutAndPaste.C: made textclass a static member of the class
6893 as otherwise it is not accesed right!!!
6895 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6897 * forms/layout_forms.fd
6898 * src/layout_forms.h
6899 * src/layout_forms.C (create_form_form_character)
6900 * src/lyx_cb.C (UserFreeFont)
6901 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6902 documents (in the layout->character popup).
6904 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6906 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6907 \spell_command was in fact not honored (from Kevin Atkinson).
6909 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6912 * src/lyx_gui.h: make lyxViews private (Angus)
6914 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6916 * src/mathed/math_write.C
6917 (MathMatrixInset::Write) Put \protect before \begin{array} and
6918 \end{array} if fragile
6919 (MathParInset::Write): Put \protect before \\ if fragile
6921 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6923 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6924 initialization if the LyXColorHandler must be done after the
6925 connections to the XServer has been established.
6927 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6928 get the background pixel from the lyxColorhandler so that the
6929 figures are rendered with the correct background color.
6930 (NextToken): removed functions.
6931 (GetPSSizes): use ifs >> string instead of NextToken.
6933 * src/Painter.[Ch]: the color cache moved out of this file.
6935 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6938 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6940 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6941 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6943 * src/BufferView.C (enterView): new func
6944 (leaveView): new func
6946 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6948 (leaveView): new func, undefines xterm cursor when approp.
6950 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6951 (AllowInput): delete the Workarea cursor handling from this func.
6953 * src/Painter.C (underline): draw a slimer underline in most cases.
6955 * src/lyx_main.C (error_handler): use extern "C"
6957 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6959 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6960 sent directly to me.
6962 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6963 to the list by Dekel.
6965 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6968 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6969 methods from lyx_cb.here.
6971 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6974 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6976 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6977 instead of using current_view directly.
6979 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6981 * src/LyXAction.C (init): add the paragraph-spacing command.
6983 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6985 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6987 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6988 different from the documents.
6990 * src/text.C (SetHeightOfRow): take paragraph spacing into
6991 account, paragraph spacing takes precedence over buffer spacing
6992 (GetVisibleRow): ditto
6994 * src/paragraph.C (writeFile): output the spacing parameter too.
6995 (validate): set the correct features if spacing is used in the
6997 (Clear): set spacing to default
6998 (MakeSameLayout): spacing too
6999 (HasSameLayout): spacing too
7000 (SetLayout): spacing too
7001 (TeXOnePar): output the spacing commands
7003 * src/lyxparagraph.h: added a spacing variable for use with
7004 per-paragraph spacing.
7006 * src/Spacing.h: add a Default spacing and a method to check if
7007 the current spacing is default. also added an operator==
7009 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7012 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7014 * src/lyxserver.C (callback): fix dispatch of functions
7016 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7017 printf() into lyxerr call.
7019 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7022 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7023 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7024 the "Float" from each of the subitems.
7025 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7027 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7028 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7029 documented the change so that the workaround can be nuked later.
7031 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7034 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7036 * src/buffer.C (getLatexName): ditto
7037 (setReadonly): ditto
7039 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7041 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7042 avoid some uses of current_view. Added also a bufferParams()
7043 method to get at this.
7045 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7047 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7049 * src/lyxparagraph.[Ch]: removed
7050 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7051 with operators used by lower_bound and
7052 upper_bound in InsetTable's
7053 Make struct InsetTable private again. Used matchpos.
7055 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7057 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7058 document, the language of existing text is changed (unless the
7059 document is multi-lingual)
7061 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7063 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7065 * A lot of files: A rewrite of the Right-to-Left support.
7067 2000-04-10 Juergen Vigna <jug@sad.it>
7069 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7070 misplaced cursor when inset in inset is locked.
7072 * src/insets/insettext.C (LocalDispatch): small fix so that a
7073 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7075 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7076 footnote font should be decreased in size twice when displaying.
7078 * src/insets/insettext.C (GetDrawFont): inserted this function as
7079 the drawing-font may differ from the real paragraph font.
7081 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7082 insets (inset in inset!).
7084 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7085 function here because we don't want footnotes inside footnotes.
7087 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
7089 (init): now set the inset_owner in paragraph.C
7090 (LocalDispatch): added some resetPos() in the right position
7093 (pasteSelection): changed to use the new CutAndPaste-Class.
7095 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
7096 which tells if it is allowed to insert another inset inside this one.
7098 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
7099 SwitchLayoutsBetweenClasses.
7101 * src/text2.C (InsertInset): checking of the new paragraph-function
7103 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
7104 is not needed anymore here!
7107 (PasteSelection): redone (also with #ifdef) so that now this uses
7108 the CutAndPaste-Class.
7109 (SwitchLayoutsBetweenClasses): removed here and implemented in the
7112 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
7113 from/to text/insets.
7115 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
7116 so that the paragraph knows if it is inside an (text)-inset.
7117 (InsertFromMinibuffer): changed return-value to bool as now it
7118 may happen that an inset is not inserted in the paragraph.
7119 (InsertInsetAllowed): this checks if it is allowed to insert an
7120 inset in this paragraph.
7122 (BreakParagraphConservative):
7123 (BreakParagraph) : small change for the above change of the return
7124 value of InsertFromMinibuffer.
7126 * src/lyxparagraph.h: added inset_owner and the functions to handle
7127 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
7129 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7131 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
7132 functions from BufferView to BufferView::Pimpl to ease maintence.
7134 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
7135 correctly. Also use SetCursorIntern instead of SetCursor.
7137 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
7140 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7142 * src/WorkArea.C (belowMouse): manually implement below mouse.
7144 * src/*: Add "explicit" on several constructors, I added probably
7145 some unneeded ones. A couple of changes to code because of this.
7147 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
7148 implementation and private parts from the users of BufferView. Not
7151 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
7152 implementation and private parts from the users of LyXLex. Not
7155 * src/BufferView_pimpl.[Ch]: new files
7157 * src/lyxlex_pimpl.[Ch]: new files
7159 * src/LyXView.[Ch]: some inline functions move out-of-line
7161 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7163 * src/lyxparagraph.h: make struct InsetTable public.
7165 * src/support/lyxstring.h: change lyxstring::difference_type to be
7166 ptrdiff_t. Add std:: modifiers to streams.
7168 * src/font.C: include the <cctype> header, for islower() and
7171 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7173 * src/font.[Ch]: new files. Contains the metric functions for
7174 fonts, takes a LyXFont as parameter. Better separation of concepts.
7176 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
7177 changes because of this.
7179 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
7181 * src/*: compile with -Winline and move functions that don't
7184 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
7187 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7189 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
7190 (various files changed because of this)
7192 * src/Painter.C (text): fixed the drawing of smallcaps.
7194 * src/lyxfont.[Ch] (drawText): removed unused member func.
7197 * src/*.C: added needed "using" statements and "std::" qualifiers.
7199 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
7201 * src/*.h: removed all use of "using" from header files use
7202 qualifier std:: instead.
7204 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7206 * src/text.C (Backspace): some additional cleanups (we already
7207 know whether cursor.pos is 0 or not).
7209 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
7210 automake does not provide one).
7212 * src/bmtable.h: replace C++ comments with C comments.
7214 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
7216 * src/screen.C (ShowCursor): Change the shape of the cursor if
7217 the current language is not equal to the language of the document.
7218 (If the cursor change its shape unexpectedly, then you've found a bug)
7220 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
7223 * src/insets/insetnumber.[Ch]: New files.
7225 * src/LyXAction.C (init)
7226 * src/lyxfunc.C (dispatch): Add command number-inset-insert
7229 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
7231 * src/lyxparagraph.h
7232 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
7233 (the vector is kept sorted).
7235 * src/text.C (GetVisibleRow): Draw selection correctly when there
7236 is both LTR and RTL text.
7238 * src/paragraph.C (Clone): Use the assignment operator for cloning,
7239 which is much faster.
7241 * src/text.C (GetVisibleRow and other): Do not draw the last space
7242 in a row if the direction of the last letter is not equal to the
7243 direction of the paragraph.
7245 * src/lyxfont.C (latexWriteStartChanges):
7246 Check that font language is not equal to basefont language.
7247 (latexWriteEndChanges): ditto
7249 * src/lyx_cb.C (StyleReset): Don't change the language while using
7250 the font-default command.
7252 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
7253 empty paragraph before a footnote.
7255 * src/insets/insetcommand.C (draw): Increase x correctly.
7257 * src/screen.C (ShowCursor): Change cursor shape if
7258 current language != document language.
7260 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
7262 2000-03-31 Juergen Vigna <jug@sad.it>
7264 * src/paragraph.C (GetInset): commented out text[pos] = ' '
7265 (Clone): changed mode how the paragraph-data is copied to the
7266 new clone-paragraph.
7268 * src/lyxfunc.C (Dispatch): fixed small problem when calling
7269 GetInset(pos) with no inset anymore there (in inset UNDO)
7271 * src/insets/insetcommand.C (draw): small fix as here x is
7272 incremented not as much as width() returns (2 before, 2 behind = 4)
7274 2000-03-30 Juergen Vigna <jug@sad.it>
7276 * src/insets/insettext.C (InsetText): small fix in initialize
7277 widthOffset (should not be done in the init() function)
7279 2000-03-29 Amir Karger <karger@lyx.org>
7281 * lib/examples/it_ItemizeBullets.lyx: translation by
7284 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7286 2000-03-29 Juergen Vigna <jug@sad.it>
7288 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7290 * src/insets/insetfoot.C (Clone): small change as for the below
7291 new init function in the text-inset
7293 * src/insets/insettext.C (init): new function as I've seen that
7294 clone did not copy the Paragraph-Data!
7295 (LocalDispatch): Added code so that now we have some sort of Undo
7296 functionality (well actually we HAVE Undo ;)
7298 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7300 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7302 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7305 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7307 * src/main.C: added a runtime check that verifies that the xforms
7308 header used when building LyX and the library used when running
7309 LyX match. Exit with a message if they don't match. This is a
7310 version number check only.
7312 * src/buffer.C (save): Don't allocate memory on the heap for
7313 struct utimbuf times.
7315 * *: some using changes, use iosfwd instead of the real headers.
7317 * src/lyxfont.C use char const * instead of string for the static
7318 strings. Rewrite some functions to use sstream.
7320 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7322 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7325 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7327 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7328 of Geodesy (from Martin Vermeer)
7330 * lib/layouts/svjour.inc: include file for the Springer svjour
7331 class. It can be used to support journals other than JoG.
7333 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7334 Miskiewicz <misiek@pld.org.pl>)
7335 * lib/reLyX/Makefile.am: ditto.
7337 2000-03-27 Juergen Vigna <jug@sad.it>
7339 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7340 also some modifications with operations on selected text.
7342 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7343 problems with clicking on insets (last famous words ;)
7345 * src/insets/insetcommand.C (draw):
7346 (width): Changed to have a bit of space before and after the inset so
7347 that the blinking cursor can be seen (otherwise it was hidden)
7349 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7351 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7352 would not be added to the link list when an installed gettext (not
7353 part of libc) is found.
7355 2000-03-24 Juergen Vigna <jug@sad.it>
7357 * src/insets/insetcollapsable.C (Edit):
7358 * src/mathed/formula.C (InsetButtonRelease):
7359 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7362 * src/BufferView.C (workAreaButtonPress):
7363 (workAreaButtonRelease):
7364 (checkInsetHit): Finally fixed the clicking on insets be handled
7367 * src/insets/insetert.C (Edit): inserted this call so that ERT
7368 insets work always with LaTeX-font
7370 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7372 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7373 caused lyx to startup with no GUI in place, causing in a crash
7374 upon startup when called with arguments.
7376 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7378 * src/FontLoader.C: better initialization of dummyXFontStruct.
7380 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7382 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7383 for linuxdoc and docbook import and export format options.
7385 * lib/lyxrc.example Example of default values for the previous flags.
7387 * src/lyx_cb.C Use those flags instead of the hardwired values for
7388 linuxdoc and docbook export.
7390 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7393 * src/menus.C Added menus entries for the new import/exports formats.
7395 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7397 * src/lyxrc.*: Added support for running without Gui
7400 * src/FontLoader.C: sensible defaults if no fonts are needed
7402 * src/lyx_cb.C: New function ShowMessage (writes either to the
7403 minibuffer or cout in case of no gui
7404 New function AskOverwrite for common stuff
7405 Consequently various changes to call these functions
7407 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7408 wild guess at sensible screen resolution when having no gui
7410 * src/lyxfont.C: no gui, no fonts... set some defaults
7412 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7414 * src/LColor.C: made the command inset background a bit lighter.
7416 2000-03-20 Hartmut Goebel <goebel@noris.net>
7418 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7419 stdstruct.inc. Koma-Script added some title elements which
7420 otherwise have been listed below "bibliography". This split allows
7421 adding title elements to where they belong.
7423 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7424 define the additional title elements and then include
7427 * many other layout files: changed to include stdtitle.inc just
7428 before stdstruct.inc.
7430 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7432 * src/buffer.C: (save) Added the option to store all backup files
7433 in a single directory
7435 * src/lyxrc.[Ch]: Added variable \backupdir_path
7437 * lib/lyxrc.example: Added descriptions of recently added variables
7439 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7440 bibtex inset, not closing the bibtex popup when deleting the inset)
7442 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7444 * src/lyx_cb.C: add a couple using directives.
7446 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7447 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7448 import based on the filename.
7450 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7451 file would be imported at start, if the filename where of a sgml file.
7453 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7455 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7457 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7458 * src/lyxfont.h Replaced the member variable bits.direction by the
7459 member variable lang. Made many changes in other files.
7460 This allows having a multi-lingual document
7462 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7463 that change the current language to <l>.
7464 Removed the command "font-rtl"
7466 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7467 format for Hebrew documents)
7469 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7470 When auto_mathmode is "true", pressing a digit key in normal mode
7471 will cause entering into mathmode.
7472 If auto_mathmode is "rtl" then this behavior will be active only
7473 when writing right-to-left text.
7475 * src/text2.C (InsertStringA) The string is inserted using the
7478 * src/paragraph.C (GetEndLabel) Gives a correct result for
7479 footnote paragraphs.
7481 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7483 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7485 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7486 front of PasteParagraph. Never insert a ' '. This should at least
7487 fix some cause for the segfaults that we have been experiencing,
7488 it also fixes backspace behaviour slightly. (Phu!)
7490 * src/support/lstrings.C (compare_no_case): some change to make it
7491 compile with gcc 2.95.2 and stdlibc++-v3
7493 * src/text2.C (MeltFootnoteEnvironment): change type o
7494 first_footnote_par_is_not_empty to bool.
7496 * src/lyxparagraph.h: make text private. Changes in other files
7498 (fitToSize): new function
7499 (setContentsFromPar): new function
7500 (clearContents): new function
7501 (SetChar): new function
7503 * src/paragraph.C (readSimpleWholeFile): deleted.
7505 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7506 the file, just use a simple string instead. Also read the file in
7507 a more maintainable manner.
7509 * src/text2.C (InsertStringA): deleted.
7510 (InsertStringB): deleted.
7512 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7514 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7515 RedoParagraphs from the doublespace handling part, just set status
7516 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7517 done, but perhaps not like this.)
7519 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7521 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7522 character when inserting an inset.
7524 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7526 * src/bufferparams.C (readLanguage): now takes "default" into
7529 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7530 also initialize the toplevel_keymap with the default bindings from
7533 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7535 * all files using lyxrc: have lyxrc as a real variable and not a
7536 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7539 * src/lyxrc.C: remove double call to defaultKeyBindings
7541 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7542 toolbar defauls using lyxlex. Remove enums, structs, functions
7545 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7546 toolbar defaults. Also store default keybindings in a map.
7548 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7549 storing the toolbar defaults without any xforms dependencies.
7551 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7552 applied. Changed to use iterators.
7554 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7556 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7557 systems that don't have LINGUAS set to begin with.
7559 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7561 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7562 the list by Dekel Tsur.
7564 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7566 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7567 * src/insets/form_graphics.C: ditto.
7569 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7571 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7573 * src/bufferparams.C (readLanguage): use the new language map
7575 * src/intl.C (InitKeyMapper): use the new language map
7577 * src/lyx_gui.C (create_forms): use the new language map
7579 * src/language.[Ch]: New files. Used for holding the information
7580 about each language. Now! Use this new language map enhance it and
7581 make it really usable for our needs.
7583 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7585 * screen.C (ShowCursor): Removed duplicate code.
7586 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7587 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7589 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7592 * src/text.C Added TransformChar method. Used for rendering Arabic
7593 text correctly (change the glyphs of the letter according to the
7594 position in the word)
7599 * src/lyxrc.C Added lyxrc command {language_command_begin,
7600 language_command_end,language_command_ltr,language_command_rtl,
7601 language_package} which allows the use of either arabtex or Omega
7604 * src/lyx_gui.C (init)
7606 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7607 to use encoding for menu fonts which is different than the encoding
7610 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7611 do not load the babel package.
7612 To write an English document with Hebrew/Arabic, change the document
7613 language to "english".
7615 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7616 (alphaCounter): changed to return char
7617 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7619 * lib/lyxrc.example Added examples for Hebrew/Arabic
7622 * src/layout.C Added layout command endlabeltype
7624 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7626 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7628 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7630 * src/mathed/math_delim.C (search_deco): return a
7631 math_deco_struct* instead of index.
7633 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7635 * All files with a USE_OSTREAM_ONLY within: removed all code that
7636 was unused when USE_OSTREAM_ONLY is defined.
7638 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7639 of any less. Removed header and using.
7641 * src/text.C (GetVisibleRow): draw the string "Page Break
7642 (top/bottom)" on screen when drawing a pagebreak line.
7644 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7646 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7648 * src/mathed/math_macro.C (draw): do some cast magic.
7651 * src/mathed/math_defs.h: change byte* argument to byte const*.
7653 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7655 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7656 know it is right to return InsetFoot* too, but cxx does not like
7659 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7661 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7663 * src/mathed/math_delim.C: change == to proper assignment.
7665 2000-03-09 Juergen Vigna <jug@sad.it>
7667 * src/insets/insettext.C (setPos): fixed various cursor positioning
7668 problems (via mouse and cursor-keys)
7669 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7670 inset (still a small display problem but it works ;)
7672 * src/insets/insetcollapsable.C (draw): added button_top_y and
7673 button_bottom_y to have correct values for clicking on the inset.
7675 * src/support/lyxalgo.h: commented out 'using std::less'
7677 2000-03-08 Juergen Vigna <jug@sad.it>
7679 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7680 Button-Release event closes as it is alos the Release-Event
7683 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7685 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7687 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7688 can add multiple spaces in Scrap (literate programming) styles...
7689 which, by the way, is how I got hooked on LyX to begin with.
7691 * src/mathed/formula.C (Write): Added dummy variable to an
7692 inset::Latex() call.
7693 (Latex): Add free_spacing boolean to inset::Latex()
7695 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7697 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7698 virtual function to include the free_spacing boolean from
7699 the containing paragraph's style.
7701 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7702 Added free_spacing boolean arg to match inset.h
7704 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7705 Added free_spacing boolean arg to match inset.h
7707 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7708 Added free_spacing boolean and made sure that if in a free_spacing
7709 paragraph, that we output normal space if there is a protected space.
7711 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7712 Added free_spacing boolean arg to match inset.h
7714 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7715 Added free_spacing boolean arg to match inset.h
7717 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7718 Added free_spacing boolean arg to match inset.h
7720 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7721 Added free_spacing boolean arg to match inset.h
7723 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7724 Added free_spacing boolean arg to match inset.h
7726 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7727 free_spacing boolean arg to match inset.h
7729 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7730 Added free_spacing boolean arg to match inset.h
7732 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7733 Added free_spacing boolean arg to match inset.h
7735 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7736 Added free_spacing boolean arg to match inset.h
7738 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7739 Added free_spacing boolean arg to match inset.h
7741 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7742 Added free_spacing boolean arg to match inset.h
7744 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7745 free_spacing boolean arg to match inset.h
7747 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7748 free_spacing boolean arg to match inset.h
7750 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7751 ignore free_spacing paragraphs. The user's spaces are left
7754 * src/text.C (InsertChar): Fixed the free_spacing layout
7755 attribute behavior. Now, if free_spacing is set, you can
7756 add multiple spaces in a paragraph with impunity (and they
7757 get output verbatim).
7758 (SelectSelectedWord): Added dummy argument to inset::Latex()
7761 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7764 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7765 paragraph layouts now only input a simple space instead.
7766 Special character insets don't make any sense in free-spacing
7769 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7770 hard-spaces in the *input* file to simple spaces if the layout
7771 is free-spacing. This converts old files which had to have
7772 hard-spaces in free-spacing layouts where a simple space was
7774 (writeFileAscii): Added free_spacing check to pass to the newly
7775 reworked inset::Latex(...) methods. The inset::Latex() code
7776 ensures that hard-spaces in free-spacing paragraphs get output
7777 as spaces (rather than "~").
7779 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7781 * src/mathed/math_delim.C (draw): draw the empty placeholder
7782 delims with a onoffdash line.
7783 (struct math_deco_compare): struct that holds the "functors" used
7784 for the sort and the binary search in math_deco_table.
7785 (class init_deco_table): class used for initial sort of the
7787 (search_deco): use lower_bound to do a binary search in the
7790 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7792 * src/lyxrc.C: a small secret thingie...
7794 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7795 and to not flush the stream as often as it used to.
7797 * src/support/lyxalgo.h: new file
7798 (sorted): template function used for checking if a sequence is
7799 sorted or not. Two versions with and without user supplied
7800 compare. Uses same compare as std::sort.
7802 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7803 it and give warning on lyxerr.
7805 (struct compare_tags): struct with function operators used for
7806 checking if sorted, sorting and lower_bound.
7807 (search_kw): use lower_bound instead of manually implemented
7810 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7812 * src/insets/insetcollapsable.h: fix Clone() declaration.
7813 * src/insets/insetfoot.h: ditto.
7815 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7817 2000-03-08 Juergen Vigna <jug@sad.it>
7819 * src/insets/lyxinset.h: added owner call which tells us if
7820 this inset is inside another inset. Changed also the return-type
7821 of Editable to an enum so it tells clearer what the return-value is.
7823 * src/insets/insettext.C (computeTextRows): fixed computing of
7824 textinsets which split automatically on more rows.
7826 * src/insets/insetert.[Ch]: changed this to be of BaseType
7829 * src/insets/insetfoot.[Ch]: added footnote inset
7831 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7832 collapsable insets (like footnote, ert, ...)
7834 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7836 * src/lyxdraw.h: remvoe file
7838 * src/lyxdraw.C: remove file
7840 * src/insets/insettext.C: added <algorithm>.
7842 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7844 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7845 (matrix_cb): case MM_OK use string stream
7847 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7850 * src/mathed/math_macro.C (draw): use string stream
7851 (Metrics): use string stream
7853 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7854 directly to the ostream.
7856 * src/vspace.C (asString): use string stream.
7857 (asString): use string stream
7858 (asLatexString): use string stream
7860 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7861 setting Spacing::Other.
7863 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7864 sprintf when creating the stretch vale.
7866 * src/text2.C (alphaCounter): changed to return a string and to
7867 not use a static variable internally. Also fixed a one-off bug.
7868 (SetCounter): changed the drawing of the labels to use string
7869 streams instead of sprintf.
7871 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7872 manipulator to use a scheme that does not require library support.
7873 This is also the way it is done in the new GNU libstdc++. Should
7874 work with DEC cxx now.
7876 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7878 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7879 end. This fixes a bug.
7881 * src/mathed (all files concerned with file writing): apply the
7882 USE_OSTREAM_ONLY changes to mathed too.
7884 * src/support/DebugStream.h: make the constructor explicit.
7886 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7887 count and ostream squashed.
7889 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7891 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7893 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7894 ostringstream uses STL strings, and we might not.
7896 * src/insets/insetspecialchar.C: add using directive.
7897 * src/insets/insettext.C: ditto.
7899 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7901 * lib/layouts/seminar.layout: feeble attempt at a layout for
7902 seminar.cls, far from completet and could really use some looking
7903 at from people used to write layout files.
7905 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7906 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7907 a lot nicer and works nicely with ostreams.
7909 * src/mathed/formula.C (draw): a slightly different solution that
7910 the one posted to the list, but I think this one works too. (font
7911 size wrong in headers.)
7913 * src/insets/insettext.C (computeTextRows): some fiddling on
7914 Jürgens turf, added some comments that he should read.
7916 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7917 used and it gave compiler warnings.
7918 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7921 * src/lyx_gui.C (create_forms): do the right thing when
7922 show_banner is true/false.
7924 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7925 show_banner is false.
7927 * most file writing files: Now use iostreams to do almost all of
7928 the writing. Also instead of passing string &, we now use
7929 stringstreams. mathed output is still not adapted to iostreams.
7930 This change can be turned off by commenting out all the occurences
7931 of the "#define USE_OSTREAM_ONLY 1" lines.
7933 * src/WorkArea.C (createPixmap): don't output debug messages.
7934 (WorkArea): don't output debug messages.
7936 * lib/lyxrc.example: added a comment about the new variable
7939 * development/Code_rules/Rules: Added some more commente about how
7940 to build class interfaces and on how better encapsulation can be
7943 2000-03-03 Juergen Vigna <jug@sad.it>
7945 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7946 automatically with the width of the LyX-Window
7948 * src/insets/insettext.C (computeTextRows): fixed update bug in
7949 displaying text-insets (scrollvalues where not initialized!)
7951 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7953 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7954 id in the check of the result from lower_bound is not enough since
7955 lower_bound can return last too, and then res->id will not be a
7958 * all insets and some code that use them: I have conditionalized
7959 removed the Latex(string & out, ...) this means that only the
7960 Latex(ostream &, ...) will be used. This is a work in progress to
7961 move towards using streams for all output of files.
7963 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7966 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7968 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7969 routine (this fixes bug where greek letters were surrounded by too
7972 * src/support/filetools.C (findtexfile): change a bit the search
7973 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7974 no longer passed to kpsewhich, we may have to change that later.
7976 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7977 warning options to avoid problems with X header files (from Angus
7979 * acinclude.m4: regenerated.
7981 2000-03-02 Juergen Vigna <jug@sad.it>
7983 * src/insets/insettext.C (WriteParagraphData): Using the
7984 par->writeFile() function for writing paragraph-data.
7985 (Read): Using buffer->parseSingleLyXformat2Token()-function
7986 for parsing paragraph data!
7988 * src/buffer.C (readLyXformat2): removed all parse data and using
7989 the new parseSingleLyXformat2Token()-function.
7990 (parseSingleLyXformat2Token): added this function to parse (read)
7991 lyx-file-format (this is called also from text-insets now!)
7993 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7995 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7998 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7999 directly instead of going through a func. One very bad thing: a
8000 static LyXFindReplace, but I don't know where to place it.
8002 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8003 string instead of char[]. Also changed to static.
8004 (GetSelectionOrWordAtCursor): changed to static inline
8005 (SetSelectionOverLenChars): ditto.
8007 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8008 current_view and global variables. both classes has changed names
8009 and LyXFindReplace is not inherited from SearchForm.
8011 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8012 fl_form_search form.
8014 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8016 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8018 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8019 bound (from Kayvan).
8021 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8023 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8025 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8027 * some things that I should comment but the local pub says head to
8030 * comment out all code that belongs to the Roff code for Ascii
8031 export of tables. (this is unused)
8033 * src/LyXView.C: use correct type for global variable
8034 current_layout. (LyXTextClass::size_type)
8036 * some code to get the new insetgraphics closer to working I'd be
8037 grateful for any help.
8039 * src/BufferView2.C (insertInset): use the return type of
8040 NumberOfLayout properly. (also changes in other files)
8042 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8043 this as a test. I want to know what breaks because of this.
8045 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8047 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8049 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8050 to use a \makebox in the label, this allows proper justification
8051 with out using protected spaces or multiple hfills. Now it is
8052 "label" for left justified, "\hfill label\hfill" for center, and
8053 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8054 should be changed accordingly.
8056 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8058 * src/lyxtext.h: change SetLayout() to take a
8059 LyXTextClass::size_type instead of a char (when there is more than
8060 127 layouts in a class); also change type of copylayouttype.
8061 * src/text2.C (SetLayout): ditto.
8062 * src/LyXView.C (updateLayoutChoice): ditto.
8064 * src/LaTeX.C (scanLogFile): errors where the line number was not
8065 given just after the '!'-line were ignored (from Dekel Tsur).
8067 * lib/lyxrc.example: fix description of \date_insert_format
8069 * lib/layouts/llncs.layout: new layout, contributed by Martin
8072 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8074 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8075 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8076 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8077 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8078 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8079 paragraph.C, text.C, text2.C)
8081 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8083 * src/insets/insettext.C (LocalDispatch): remove extra break
8086 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
8087 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
8089 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
8090 * src/insets/insettext.[Ch] (GetCursorPos): ditto
8092 * src/insets/insetbib.h: move InsetBibkey::Holder and
8093 InsetCitation::Holder in public space.
8095 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8097 * src/insets/insettext.h: small change to get the new files from
8098 Juergen to compile (use "string", not "class string").
8100 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
8101 const & as parameter to LocalDispatch, use LyXFont const & as
8102 paramter to some other func. This also had impacto on lyxinsets.h
8103 and the two mathed insets.
8105 2000-02-24 Juergen Vigna <jug@sad.it>
8108 * src/commandtags.h:
8110 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
8114 * src/BufferView2.C: added/updated code for various inset-functions
8116 * src/insets/insetert.[Ch]: added implementation of InsetERT
8118 * src/insets/insettext.[Ch]: added implementation of InsetText
8120 * src/insets/inset.C (Edit): added "unsigned int button" parameter
8121 (draw): added preliminary code for inset scrolling not finshed yet
8123 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
8124 as it is in lyxfunc.C now
8126 * src/insets/lyxinset.h: Added functions for text-insets
8128 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8130 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
8131 BufferView and reimplement the list as a queue put inside its own
8134 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
8136 * several files: use the new interface to the "updateinsetlist"
8138 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
8140 (work_area_handler): call BufferView::trippleClick on trippleclick.
8142 * src/BufferView.C (doubleClick): new function, selects word on
8144 (trippleClick): new function, selects line on trippleclick.
8146 2000-02-22 Allan Rae <rae@lyx.org>
8148 * lib/bind/xemacs.bind: buffer-previous not supported
8150 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8152 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
8155 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8157 * src/bufferlist.C: get rid of current_view from this file
8159 * src/spellchecker.C: get rid of current_view from this file
8161 * src/vspace.C: get rid of current_view from this file
8162 (inPixels): added BufferView parameter for this func
8163 (asLatexCommand): added a BufferParams for this func
8165 * src/text.C src/text2.C: get rid of current_view from these
8168 * src/lyxfont.C (getFontDirection): move this function here from
8171 * src/bufferparams.C (getDocumentDirection): move this function
8174 * src/paragraph.C (getParDirection): move this function here from
8176 (getLetterDirection): ditto
8178 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
8180 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
8181 resize due to wrong pixmap beeing used. Also took the opurtunity
8182 to make the LyXScreen stateless on regard to WorkArea and some
8183 general cleanup in the same files.
8185 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8187 * src/Makefile.am: add missing direction.h
8189 * src/PainterBase.h: made the width functions const.
8191 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
8194 * src/insets/insetcommand.C (draw): draw Editable as buttons.
8196 * src/insets/insetlatexaccent.C (draw): make the accents draw
8197 better, at present this will only work well with iso8859-1.
8199 * several files: remove the old drawing code, now we use the new
8202 * several files: remove support for mono_video, reverse_video and
8205 2000-02-17 Juergen Vigna <jug@sad.it>
8207 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
8208 int ** as we have to return the pointer, otherwise we have only
8209 NULL pointers in the returning function.
8211 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8213 * src/LaTeX.C (operator()): quote file name when running latex.
8215 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8217 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
8218 (bubble tip), this removes our special handling of this.
8220 * Remove all code that is unused now that we have the new
8221 workarea. (Code that are not active when NEW_WA is defined.)
8223 * Make the uses of XSync not conditionalized on define USE_XSYNC.
8225 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8227 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
8228 nonexisting layout; correctly redirect obsoleted layouts.
8230 * lib/lyxrc.example: document \view_dvi_paper_option
8232 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
8235 * src/lyx_cb.C (RunScript): handle $$FName for command names.
8236 (PreviewDVI): handle the view_dvi_paper_option variable.
8237 [Both from Roland Krause]
8239 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8241 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
8242 char const *, int, LyXFont)
8243 (text(int, int, string, LyXFont)): ditto
8245 * src/text.C (InsertCharInTable): attempt to fix the double-space
8246 feature in tables too.
8247 (BackspaceInTable): ditto.
8248 (GetVisibleRow): make bottom pagebreak line be a onoff line.
8250 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8252 * src/text2.C (owner): only complain if owner_ is set and bv != 0
8254 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
8255 newly found text in textcache to this.
8256 (buffer): set the owner of the text put into the textcache to 0
8258 * src/insets/figinset.C (draw): fixed the drawing of figures with
8261 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
8262 drawing of mathframe, hfills, protected space, table lines. I have
8263 now no outstanding drawing problems with the new Painter code.
8265 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8267 * src/PainterBase.C (ellipse, circle): do not specify the default
8270 * src/LColor.h: add using directive.
8272 * src/Painter.[Ch]: change return type of methods from Painter& to
8273 PainterBase&. Add a using directive.
8275 * src/WorkArea.C: wrap xforms callbacks in C functions
8278 * lib/layouts/foils.layout: font fix and simplifications from Carl
8281 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8283 * a lot of files: The Painter, LColor and WorkArea from the old
8284 devel branch has been ported to lyx-devel. Some new files and a
8285 lot of #ifdeffed code. The new workarea is enabled by default, but
8286 if you want to test the new Painter and LColor you have to compile
8287 with USE_PAINTER defined (do this in config.h f.ex.) There are
8288 still some rought edges, and I'd like some help to clear those
8289 out. It looks stable (loads and displays the Userguide very well).
8292 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8294 * src/buffer.C (pop_tag): revert to the previous implementation
8295 (use a global variable for both loops).
8297 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8299 * src/lyxrc.C (LyXRC): change slightly default date format.
8301 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8302 there is an English text with a footnote that starts with a Hebrew
8303 paragraph, or vice versa.
8304 (TeXFootnote): ditto.
8306 * src/text.C (LeftMargin): allow for negative values for
8307 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8310 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8311 for input encoding (cyrillic)
8313 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8315 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8318 * src/toolbar.C (set): ditto
8319 * src/insets/insetbib.C (create_form_citation_form): ditto
8321 * lib/CREDITS: added Dekel Tsur.
8323 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8324 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8325 hebrew supports files from Dekel Tsur.
8327 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8328 <tzafrir@technion.ac.il>
8330 * src/lyxrc.C: put \date_insert_format at the right place.
8332 * src/buffer.C (makeLaTeXFile): fix the handling of
8333 BufferParams::sides when writing out latex files.
8335 * src/BufferView2.C: add a "using" directive.
8337 * src/support/lyxsum.C (sum): when we use lyxstring,
8338 ostringstream::str needs an additional .c_str().
8340 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8342 * src/support/filetools.C (ChangeExtension): patch from Etienne
8345 * src/TextCache.C (show): remove const_cast and make second
8346 parameter non-const LyXText *.
8348 * src/TextCache.h: use non const LyXText in show.
8350 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8353 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8355 * src/support/lyxsum.C: rework to be more flexible.
8357 * several places: don't check if a pointer is 0 if you are going
8360 * src/text.C: remove some dead code.
8362 * src/insets/figinset.C: remove some dead code
8364 * src/buffer.C: move the BufferView funcs to BufferView2.C
8365 remove all support for insetlatexdel
8366 remove support for oldpapersize stuff
8367 made some member funcs const
8369 * src/kbmap.C: use a std::list to store the bindings in.
8371 * src/BufferView2.C: new file
8373 * src/kbsequence.[Ch]: new files
8375 * src/LyXAction.C + others: remove all trace of buffer-previous
8377 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8378 only have one copy in the binary of this table.
8380 * hebrew patch: moved some functions from LyXText to more
8381 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8383 * several files: remove support for XForms older than 0.88
8385 remove some #if 0 #endif code
8387 * src/TextCache.[Ch]: new file. Holds the textcache.
8389 * src/BufferView.C: changes to use the new TextCache interface.
8390 (waitForX): remove the now unused code.
8392 * src/BackStack.h: remove some commented code
8394 * lib/bind/emacs.bind: remove binding for buffer-previous
8396 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8398 * applied the hebrew patch.
8400 * src/lyxrow.h: make sure that all Row variables are initialized.
8402 * src/text2.C (TextHandleUndo): comment out a delete, this might
8403 introduce a memory leak, but should also help us to not try to
8404 read freed memory. We need to look at this one.
8406 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8407 (LyXParagraph): initalize footnotekind.
8409 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8410 forgot this when applying the patch. Please heed the warnings.
8412 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8413 (aka. reformat problem)
8415 * src/bufferlist.C (exists): made const, and use const_iterator
8416 (isLoaded): new func.
8417 (release): use std::find to find the correct buffer.
8419 * src/bufferlist.h: made getState a const func.
8420 made empty a const func.
8421 made exists a const func.
8424 2000-02-01 Juergen Vigna <jug@sad.it>
8426 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8428 * po/it.po: updated a bit the italian po file and also changed the
8429 'file nuovo' for newfile to 'filenuovo' without a space, this did
8432 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8433 for the new insert_date command.
8435 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8436 from jdblair, to insert a date into the current text conforming to
8437 a strftime format (for now only considering the locale-set and not
8438 the document-language).
8440 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8442 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8443 Bounds Read error seen by purify. The problem was that islower is
8444 a macros which takes an unsigned char and uses it as an index for
8445 in array of characters properties (and is thus subject to the
8449 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8450 correctly the paper sides radio buttons.
8451 (UpdateDocumentButtons): ditto.
8453 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8455 * src/kbmap.C (getsym + others): change to return unsigned int,
8456 returning a long can give problems on 64 bit systems. (I assume
8457 that int is 32bit on 64bit systems)
8459 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8461 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8462 LyXLookupString to be zero-terminated. Really fixes problems seen
8465 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8467 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8468 write a (char*)0 to the lyxerr stream.
8470 * src/lastfiles.C: move algorithm before the using statemets.
8472 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8474 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8475 complains otherwise).
8476 * src/table.C: ditto
8478 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8481 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8482 that I removed earlier... It is really needed.
8484 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8486 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8488 * INSTALL: update xforms home page URL.
8490 * lib/configure.m4: fix a bug with unreadable layout files.
8492 * src/table.C (calculate_width_of_column): add "using std::max"
8495 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8497 * several files: marked several lines with "DEL LINE", this is
8498 lines that can be deleted without changing anything.
8499 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8500 checks this anyway */
8503 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8505 * src/DepTable.C (update): add a "+" at the end when the checksum
8506 is different. (debugging string only)
8508 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8509 the next inset to not be displayed. This should also fix the list
8510 of labels in the "Insert Crossreference" dialog.
8512 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8514 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8515 when regex was not found.
8517 * src/support/lstrings.C (lowercase): use handcoded transform always.
8520 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8521 old_cursor.par->prev could be 0.
8523 * several files: changed post inc/dec to pre inc/dec
8525 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8526 write the lastfiles to file.
8528 * src/BufferView.C (buffer): only show TextCache info when debugging
8530 (resizeCurrentBuffer): ditto
8531 (workAreaExpose): ditto
8533 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8535 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8537 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8538 a bit better by removing the special case for \i and \j.
8540 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8542 * src/lyx_main.C (easyParse): remove test for bad comand line
8543 options, since this broke all xforms-related parsing.
8545 * src/kbmap.C (getsym): set return type to unsigned long, as
8546 declared in header. On an alpha, long is _not_ the same as int.
8548 * src/support/LOstream.h: add a "using std::flush;"
8550 * src/insets/figinset.C: ditto.
8552 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8554 * src/bufferlist.C (write): use blinding fast file copy instead of
8555 "a char at a time", now we are doing it the C++ way.
8557 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8558 std::list<int> instead.
8559 (addpidwait): reflect move to std::list<int>
8560 (sigchldchecker): ditto
8562 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8565 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8566 that obviously was wrong...
8568 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8569 c, this avoids warnings with purify and islower.
8571 * src/insets/figinset.C: rename struct queue to struct
8572 queue_element and rewrite to use a std::queue. gsqueue is now a
8573 std::queue<queue_element>
8574 (runqueue): reflect move to std::queue
8577 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8578 we would get "1" "0" instead of "true" "false. Also make the tostr
8581 2000-01-21 Juergen Vigna <jug@sad.it>
8583 * src/buffer.C (writeFileAscii): Disabled code for special groff
8584 handling of tabulars till I fix this in table.C
8586 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8588 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8590 * src/support/lyxlib.h: ditto.
8592 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8594 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8595 and 'j' look better. This might fix the "macron" bug that has been
8598 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8599 functions as one template function. Delete the old versions.
8601 * src/support/lyxsum.C: move using std::ifstream inside
8604 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8607 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8609 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8611 * src/insets/figinset.C (InitFigures): use new instead of malloc
8612 to allocate memory for figures and bitmaps.
8613 (DoneFigures): use delete[] instead of free to deallocate memory
8614 for figures and bitmaps.
8615 (runqueue): use new to allocate
8616 (getfigdata): use new/delete[] instead of malloc/free
8617 (RegisterFigure): ditto
8619 * some files: moved some declarations closer to first use, small
8620 whitespace changes use preincrement instead of postincrement where
8621 it does not make a difference.
8623 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8624 step on the way to use stl::containers for key maps.
8626 * src/bufferlist.h: add a typedef for const_iterator and const
8627 versions of begin and end.
8629 * src/bufferlist.[Ch]: change name of member variable _state to
8630 state_. (avoid reserved names)
8632 (getFileNames): returns the filenames of the buffers in a vector.
8634 * configure.in (ALL_LINGUAS): added ro
8636 * src/support/putenv.C: new file
8638 * src/support/mkdir.C: new file
8640 2000-01-20 Allan Rae <rae@lyx.org>
8642 * lib/layouts/IEEEtran.layout: Added several theorem environments
8644 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8645 couple of minor additions.
8647 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8648 (except for those in footnotes of course)
8650 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8652 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8654 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8655 std::sort and std::lower_bound instead of qsort and handwritten
8657 (struct compara): struct that holds the functors used by std::sort
8658 and std::lower_bound in MathedLookupBOP.
8660 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8662 * src/support/LAssert.h: do not do partial specialization. We do
8665 * src/support/lyxlib.h: note that lyx::getUserName() and
8666 lyx::date() are not in use right now. Should these be suppressed?
8668 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8669 (makeLinuxDocFile): do not put date and user name in linuxdoc
8672 * src/support/lyxlib.h (kill): change first argument to long int,
8673 since that's what solaris uses.
8675 * src/support/kill.C (kill): fix declaration to match prototype.
8677 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8678 actually check whether namespaces are supported. This is not what
8681 * src/support/lyxsum.C: add a using directive.
8683 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8685 * src/support/kill.C: if we have namespace support we don't have
8686 to include lyxlib.h.
8688 * src/support/lyxlib.h: use namespace lyx if supported.
8690 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8692 * src/support/date.C: new file
8694 * src/support/chdir.C: new file
8696 * src/support/getUserName.C: new file
8698 * src/support/getcwd.C: new file
8700 * src/support/abort.C: new file
8702 * src/support/kill.C: new file
8704 * src/support/lyxlib.h: moved all the functions in this file
8705 insede struct lyx. Added also kill and abort to this struct. This
8706 is a way to avoid the "kill is not defined in <csignal>", we make
8707 C++ wrappers for functions that are not ANSI C or ANSI C++.
8709 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8710 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8711 lyx it has been renamed to sum.
8713 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8715 * src/text.C: add using directives for std::min and std::max.
8717 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8719 * src/texrow.C (getIdFromRow): actually return something useful in
8720 id and pos. Hopefully fixes the bug with positionning of errorbox
8723 * src/lyx_main.C (easyParse): output an error and exit if an
8724 incorrect command line option has been given.
8726 * src/spellchecker.C (ispell_check_word): document a memory leak.
8728 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8729 where a "struct utimbuf" is allocated with "new" and deleted with
8732 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8734 * src/text2.C (CutSelection): don't delete double spaces.
8735 (PasteSelection): ditto
8736 (CopySelection): ditto
8738 * src/text.C (Backspace): don't delete double spaces.
8740 * src/lyxlex.C (next): fix a bug that were only present with
8741 conformant std::istream::get to read comment lines, use
8742 std::istream::getline instead. This seems to fix the problem.
8744 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8746 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8747 allowed to insert space before space" editing problem. Please read
8748 commends at the beginning of the function. Comments about usage
8751 * src/text.C (InsertChar): fix for the "not allowed to insert
8752 space before space" editing problem.
8754 * src/text2.C (DeleteEmptyParagraphMechanism): when
8755 IsEmptyTableRow can only return false this last "else if" will
8756 always be a no-op. Commented out.
8758 * src/text.C (RedoParagraph): As far as I can understand tmp
8759 cursor is not really needed.
8761 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8762 present it could only return false anyway.
8763 (several functions): Did something not so smart...added a const
8764 specifier on a lot of methods.
8766 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8767 and add a tmp->text.resize. The LyXParagraph constructor does the
8769 (BreakParagraphConservative): ditto
8771 * src/support/path.h (Path): add a define so that the wrong usage
8772 "Path("/tmp") will be flagged as a compilation error:
8773 "`unnamed_Path' undeclared (first use this function)"
8775 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8777 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8778 which was bogus for several reasons.
8780 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8784 * autogen.sh: do not use "type -path" (what's that anyway?).
8786 * src/support/filetools.C (findtexfile): remove extraneous space
8787 which caused a kpsewhich warning (at least with kpathsea version
8790 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8792 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8794 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8796 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8798 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8800 * src/paragraph.C (BreakParagraph): do not reserve space on text
8801 if we don't need to (otherwise, if pos_end < pos, we end up
8802 reserving huge amounts of memory due to bad unsigned karma).
8803 (BreakParagraphConservative): ditto, although I have not seen
8804 evidence the bug can happen here.
8806 * src/lyxparagraph.h: add a using std::list.
8808 2000-01-11 Juergen Vigna <jug@sad.it>
8810 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8813 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8815 * src/vc-backend.C (doVCCommand): change to be static and take one
8816 more parameter: the path to chdir too be fore executing the command.
8817 (retrive): new function equiv to "co -r"
8819 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8820 file_not_found_hook is true.
8822 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8824 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8825 if a file is readwrite,readonly...anything else.
8827 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8829 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8830 (CreatePostscript): name change from MenuRunDVIPS (or something)
8831 (PreviewPostscript): name change from MenuPreviewPS
8832 (PreviewDVI): name change from MenuPreviewDVI
8834 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8835 \view_pdf_command., \pdf_to_ps_command
8837 * lib/configure.m4: added search for PDF viewer, and search for
8838 PDF to PS converter.
8839 (lyxrc.defaults output): add \pdflatex_command,
8840 \view_pdf_command and \pdf_to_ps_command.
8842 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8844 * src/bufferlist.C (write): we don't use blocksize for anything so
8847 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8849 * src/support/block.h: disable operator T* (), since it causes
8850 problems with both compilers I tried. See comments in the file.
8852 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8855 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8856 variable LYX_DIR_10x to LYX_DIR_11x.
8858 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8860 * INSTALL: document --with-lyxname.
8863 * configure.in: new configure flag --with-lyxname which allows to
8864 choose the name under which lyx is installed. Default is "lyx", of
8865 course. It used to be possible to do this with --program-suffix,
8866 but the later has in fact a different meaning for autoconf.
8868 * src/support/lstrings.h (lstrchr): reformat a bit.
8870 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8871 * src/mathed/math_defs.h: ditto.
8873 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8875 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8876 true, decides if we create a backup file or not when saving. New
8877 tag and variable \pdf_mode, defaults to false. New tag and
8878 variable \pdflatex_command, defaults to pdflatex. New tag and
8879 variable \view_pdf_command, defaults to xpdf. New tag and variable
8880 \pdf_to_ps_command, defaults to pdf2ps.
8882 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8884 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8885 does not have a BufferView.
8886 (unlockInset): ditto + don't access the_locking_inset if the
8887 buffer does not have a BufferView.
8889 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8890 certain circumstances so that we don't continue a keyboard
8891 operation long after the key was released. Try f.ex. to load a
8892 large document, press PageDown for some seconds and then release
8893 it. Before this change the document would contine to scroll for
8894 some time, with this change it stops imidiatly.
8896 * src/support/block.h: don't allocate more space than needed. As
8897 long as we don't try to write to the arr[x] in a array_type arr[x]
8898 it is perfectly ok. (if you write to it you might segfault).
8899 added operator value_type*() so that is possible to pass the array
8900 to functions expecting a C-pointer.
8902 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8905 * intl/*: updated to gettext 0.10.35, tried to add our own
8906 required modifications. Please verify.
8908 * po/*: updated to gettext 0.10.35, tried to add our own required
8909 modifications. Please verify.
8911 * src/support/lstrings.C (tostr): go at fixing the problem with
8912 cxx and stringstream. When stringstream is used return
8913 oss.str().c_str() so that problems with lyxstring and basic_string
8914 are avoided. Note that the best solution would be for cxx to use
8915 basic_string all the way, but it is not conformant yet. (it seems)
8917 * src/lyx_cb.C + other files: moved several global functions to
8918 class BufferView, some have been moved to BufferView.[Ch] others
8919 are still located in lyx_cb.C. Code changes because of this. (part
8920 of "get rid of current_view project".)
8922 * src/buffer.C + other files: moved several Buffer functions to
8923 class BufferView, the functions are still present in buffer.C.
8924 Code changes because of this.
8926 * config/lcmessage.m4: updated to most recent. used when creating
8929 * config/progtest.m4: updated to most recent. used when creating
8932 * config/gettext.m4: updated to most recent. applied patch for
8935 * config/gettext.m4.patch: new file that shows what changes we
8936 have done to the local copy of gettext.m4.
8938 * config/libtool.m4: new file, used in creation of acinclude.m4
8940 * config/lyxinclude.m4: new file, this is the lyx created m4
8941 macros, used in making acinclude.m4.
8943 * autogen.sh: GNU m4 discovered as a separate task not as part of
8944 the lib/configure creation.
8945 Generate acinlucde from files in config. Actually cat
8946 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8947 easier to upgrade .m4 files that really are external.
8949 * src/Spacing.h: moved using std::istringstream to right after
8950 <sstream>. This should fix the problem seen with some compilers.
8952 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8954 * src/lyx_cb.C: began some work to remove the dependency a lot of
8955 functions have on BufferView::text, even if not really needed.
8956 (GetCurrentTextClass): removed this func, it only hid the
8959 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8960 forgot this in last commit.
8962 * src/Bullet.C (bulletEntry): use static char const *[] for the
8963 tables, becuase of this the return arg had to change to string.
8965 (~Bullet): removed unneeded destructor
8967 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8968 (insetSleep): moved from Buffer
8969 (insetWakeup): moved from Buffer
8970 (insetUnlock): moved from Buffer
8972 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8973 from Buffer to BufferView.
8975 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8977 * config/ltmain.sh: updated to version 1.3.4 of libtool
8979 * config/ltconfig: updated to version 1.3.4 of libtool
8981 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8984 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8985 Did I get that right?
8987 * src/lyxlex.h: add a "using" directive or two.
8988 * src/Spacing.h: ditto.
8989 * src/insets/figinset.C: ditto.
8990 * src/support/filetools.C: ditto.
8991 * src/support/lstrings.C: ditto.
8992 * src/BufferView.C: ditto.
8993 * src/bufferlist.C: ditto.
8994 * src/lyx_cb.C: ditto.
8995 * src/lyxlex.C: ditto.
8997 * NEWS: add some changes for 1.1.4.
8999 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9001 * src/BufferView.C: first go at a TextCache to speed up switching
9004 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9006 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9007 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9008 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9009 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9012 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9013 members of the struct are correctly initialized to 0 (detected by
9015 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9016 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9018 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9019 pidwait, since it was allocated with "new". This was potentially
9020 very bad. Thanks to Michael Schmitt for running purify for us.
9023 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9025 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9027 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9029 1999-12-30 Allan Rae <rae@lyx.org>
9031 * lib/templates/IEEEtran.lyx: minor change
9033 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9034 src/mathed/formula.C (LocalDispatch): askForText changes
9036 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9037 know when a user has cancelled input. Fixes annoying problems with
9038 inserting labels and version control.
9040 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9042 * src/support/lstrings.C (tostr): rewritten to use strstream and
9045 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9047 * src/support/filetools.C (IsFileWriteable): use fstream to check
9048 (IsDirWriteable): use fileinfo to check
9050 * src/support/filetools.h (FilePtr): whole class deleted
9052 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9054 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9056 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9058 * src/bufferlist.C (write): use ifstream and ofstream instead of
9061 * src/Spacing.h: use istrstream instead of sscanf
9063 * src/mathed/math_defs.h: change first arg to istream from FILE*
9065 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9067 * src/mathed/math_parser.C: have yyis to be an istream
9068 (LexGetArg): use istream (yyis)
9070 (mathed_parse): ditto
9071 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9073 * src/mathed/formula.C (Read): rewritten to use istream
9075 * src/mathed/formulamacro.C (Read): rewritten to use istream
9077 * src/lyxlex.h (~LyXLex): deleted desturctor
9078 (getStream): new function, returns an istream
9079 (getFile): deleted funtion
9080 (IsOK): return is.good();
9082 * src/lyxlex.C (LyXLex): delete file and owns_file
9083 (setFile): open an filebuf and assign that to a istream instead of
9085 (setStream): new function, takes an istream as arg.
9086 (setFile): deleted function
9087 (EatLine): rewritten us use istream instead of FILE*
9091 * src/table.C (LyXTable): use istream instead of FILE*
9092 (Read): rewritten to take an istream instead of FILE*
9094 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9096 * src/buffer.C (Dispatch): remove an extraneous break statement.
9098 * src/support/filetools.C (QuoteName): change to do simple
9099 'quoting'. More work is necessary. Also changed to do nothing
9100 under emx (needs fix too).
9101 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
9103 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
9104 config.h.in to the AC_DEFINE_UNQUOTED() call.
9105 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
9106 needs char * as argument (because Solaris 7 declares it like
9109 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
9110 remove definition of BZERO.
9112 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9114 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
9115 defined, "lyxregex.h" if not.
9117 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
9119 (REGEX): new variable that is set to regex.c lyxregex.h when
9120 AM_CONDITIONAL USE_REGEX is set.
9121 (libsupport_la_SOURCES): add $(REGEX)
9123 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
9126 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
9129 * configure.in: add call to LYX_REGEX
9131 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
9132 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
9134 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9136 * lib/bind/fi_menus.bind: new file, from
9137 pauli.virtanen@saunalahti.fi.
9139 * src/buffer.C (getBibkeyList): pass the parameter delim to
9140 InsetInclude::getKeys and InsetBibtex::getKeys.
9142 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
9143 is passed to Buffer::getBibkeyList
9145 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
9146 instead of the hardcoded comma.
9148 * src/insets/insetbib.C (getKeys): make sure that there are not
9149 leading blanks in bibtex keys. Normal latex does not care, but
9150 harvard.sty seems to dislike blanks at the beginning of citation
9151 keys. In particular, the retturn value of the function is
9153 * INSTALL: make it clear that libstdc++ is needed and that gcc
9154 2.7.x probably does not work.
9156 * src/support/filetools.C (findtexfile): make debug message go to
9158 * src/insets/insetbib.C (getKeys): ditto
9160 * src/debug.C (showTags): make sure that the output is correctly
9163 * configure.in: add a comment for TWO_COLOR_ICON define.
9165 * acconfig.h: remove all the entries that already defined in
9166 configure.in or acinclude.m4.
9168 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
9169 to avoid user name, date and copyright.
9171 1999-12-21 Juergen Vigna <jug@sad.it>
9173 * src/table.C (Read): Now read bogus row format informations
9174 if the format is < 5 so that afterwards the table can
9175 be read by lyx but without any format-info. Fixed the
9176 crash we experienced when not doing this.
9178 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9180 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
9181 (RedoDrawingOfParagraph): ditto
9182 (RedoParagraphs): ditto
9183 (RemoveTableRow): ditto
9185 * src/text.C (Fill): rename arg paperwidth -> paper_width
9187 * src/buffer.C (insertLyXFile): rename var filename -> fname
9188 (writeFile): rename arg filename -> fname
9189 (writeFileAscii): ditto
9190 (makeLaTeXFile): ditto
9191 (makeLinuxDocFile): ditto
9192 (makeDocBookFile): ditto
9194 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
9197 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
9199 * src/bmtable.h: add extern "C" on this file when __cplusplus is
9202 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
9203 compiled by a C compiler not C++.
9205 * src/layout.h (LyXTextClass): added typedef for const_iterator
9206 (LyXTextClassList): added typedef for const_iterator + member
9207 functions begin and end.
9209 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
9210 iterators to fill the choice_class.
9211 (updateLayoutChoice): rewritten to use iterators to fill the
9212 layoutlist in the toolbar.
9214 * src/BufferView.h (BufferView::work_area_width): removed unused
9217 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
9219 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
9220 (sgmlCloseTag): ditto
9222 * src/support/lstrings.h: return type of countChar changed to
9225 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
9226 what version of this func to use. Also made to return unsigned int.
9228 * configure.in: call LYX_STD_COUNT
9230 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
9231 conforming std::count.
9233 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9235 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
9236 and a subscript would give bad display (patch from Dekel Tsur
9237 <dekel@math.tau.ac.il>).
9239 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
9241 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
9244 * src/chset.h: add a few 'using' directives
9246 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
9247 triggered when no buffer is active
9249 * src/layout.C: removed `break' after `return' in switch(), since
9252 * src/lyx_main.C (init): make sure LyX can be ran in place even
9253 when libtool has done its magic with shared libraries. Fix the
9254 test for the case when the system directory has not been found.
9256 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
9257 name for the latex file.
9258 (MenuMakeHTML): ditto
9260 * src/buffer.h: add an optional boolean argument, which is passed
9263 1999-12-20 Allan Rae <rae@lyx.org>
9265 * lib/templates/IEEEtran.lyx: small correction and update.
9267 * configure.in: Attempted to use LYX_PATH_HEADER
9269 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
9271 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
9272 input from JMarc. Now use preprocessor to find the header.
9273 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
9274 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
9275 LYX_STL_STRING_FWD. See comments in file.
9277 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9279 * The global MiniBuffer * minibuffer variable is dead.
9281 * The global FD_form_main * fd_form_main variable is dead.
9283 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9285 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9287 * src/table.h: add the LOstream.h header
9288 * src/debug.h: ditto
9290 * src/LyXAction.h: change the explaination of the ReadOnly
9291 attribute: is indicates that the function _can_ be used.
9293 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9296 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9298 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9304 * src/paragraph.C (GetWord): assert on pos>=0
9307 * src/support/lyxstring.C: condition the use of an invariant on
9309 * src/support/lyxstring.h: ditto
9311 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9312 Use LAssert.h instead of plain assert().
9314 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9316 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9317 * src/support/filetools.C: ditto
9319 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9322 * INSTALL: document the new configure flags
9324 * configure.in: suppress --with-debug; add --enable-assertions
9326 * acinclude.m4: various changes in alignment of help strings.
9328 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9330 * src/kbmap.C: commented out the use of the hash map in kb_map,
9331 beginning of movement to a stl::container.
9333 * several files: removed code that was not in effect when
9334 MOVE_TEXT was defined.
9336 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9337 for escaping should not be used. We can discuss if the string
9338 should be enclosed in f.ex. [] instead of "".
9340 * src/trans_mgr.C (insert): use the new returned value from
9341 encodeString to get deadkeys and keymaps done correctly.
9343 * src/chset.C (encodeString): changed to return a pair, to tell
9344 what to use if we know the string.
9346 * src/lyxscreen.h (fillArc): new function.
9348 * src/FontInfo.C (resize): rewritten to use more std::string like
9349 structore, especially string::replace.
9351 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9354 * configure.in (chmod +x some scripts): remove config/gcc-hack
9356 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9358 * src/buffer.C (writeFile): change once again the top comment in a
9359 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9360 instead of an hardcoded version number.
9361 (makeDocBookFile): ditto
9363 * src/version.h: add new define LYX_DOCVERSION
9365 * po/de.po: update from Pit Sütterlin
9366 * lib/bind/de_menus.bind: ditto.
9368 * src/lyxfunc.C (Dispatch): call MenuExport()
9369 * src/buffer.C (Dispatch): ditto
9371 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9372 LyXFunc::Dispatch().
9373 (MenuExport): new function, moved from
9374 LyXFunc::Dispatch().
9376 * src/trans_mgr.C (insert): small cleanup
9377 * src/chset.C (loadFile): ditto
9379 * lib/kbd/iso8859-1.cdef: add missing backslashes
9381 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9383 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9384 help with placing the manually drawn accents better.
9386 (Draw): x2 and hg changed to float to minimize rounding errors and
9387 help place the accents better.
9389 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9390 unsigned short to char is just wrong...cast the char to unsigned
9391 char instead so that the two values can compare sanely. This
9392 should also make the display of insetlatexaccents better and
9393 perhaps also some other insets.
9395 (lbearing): new function
9398 1999-12-15 Allan Rae <rae@lyx.org>
9400 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9401 header that provides a wrapper around the very annoying SGI STL header
9404 * src/support/lyxstring.C, src/LString.h:
9405 removed old SGI-STL-compatability attempts.
9407 * configure.in: Use LYX_STL_STRING_FWD.
9409 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9410 stl_string_fwd.h is around and try to determine it's location.
9411 Major improvement over previous SGI STL 3.2 compatability.
9412 Three small problems remain with this function due to my zero
9413 knowledge of autoconf. JMarc and lgb see the comments in the code.
9415 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9417 * src/broken_const.h, config/hack-gcc, config/README: removed
9419 * configure.in: remove --with-gcc-hack option; do not call
9422 * INSTALL: remove documentation of --with-broken-const and
9425 * acconfig.h: remove all trace of BROKEN_CONST define
9427 * src/buffer.C (makeDocBookFile): update version number in output
9429 (SimpleDocBookOnePar): fix an assert when trying to a character
9430 access beyond string length
9433 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9435 * po/de.po: fix the Export menu
9437 * lyx.man: update the description of -dbg
9439 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9440 (commandLineHelp): updated
9441 (easyParse): show list of available debug levels if -dbg is passed
9444 * src/Makefile.am: add debug.C
9446 * src/debug.h: moved some code to debug.C
9448 * src/debug.C: new file. Contains code to set and show debug
9451 * src/layout.C: remove 'break' after 'continue' in switch
9452 statements, since these cannot be reached.
9454 1999-12-13 Allan Rae <rae@lyx.org>
9456 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9457 (in_word_set): hash() -> math_hash()
9459 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9461 * acconfig.h: Added a test for whether we are using exceptions in the
9462 current compilation run. If so USING_EXCEPTIONS is defined.
9464 * config.in: Check for existance of stl_string_fwd.h
9465 * src/LString.h: If compiling --with-included-string and SGI's
9466 STL version 3.2 is present (see above test) we need to block their
9467 forward declaration of string and supply a __get_c_string().
9468 However, it turns out this is only necessary if compiling with
9469 exceptions enabled so I've a bit more to add yet.
9471 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9472 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9473 src/support/LRegex.h, src/undo.h:
9474 Shuffle the order of the included files a little to ensure that
9475 LString.h gets included before anything that includes stl_string_fwd.h
9477 * src/support/lyxstring.C: We need to #include LString.h instead of
9478 lyxstring.h to get the necessary definition of __get_c_string.
9479 (__get_c_string): New function. This is defined static just like SGI's
9480 although why they need to do this I'm not sure. Perhaps it should be
9481 in lstrings.C instead.
9483 * lib/templates/IEEEtran.lyx: New template file.
9485 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9487 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9488 * intl/Makefile.in (MKINSTALLDIRS): ditto
9490 * src/LyXAction.C (init): changed to hold the LFUN data in a
9491 automatic array in stead of in callso to newFunc, this speeds up
9492 compilation a lot. Also all the memory used by the array is
9493 returned when the init is completed.
9495 * a lot of files: compiled with -Wold-style-cast, changed most of
9496 the reported offenders to C++ style casts. Did not change the
9497 offenders in C files.
9499 * src/trans.h (Match): change argument type to unsigned int.
9501 * src/support/DebugStream.C: fix some types on the streambufs so
9502 that it works on a conforming implementation.
9504 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9506 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9508 * src/support/lyxstring.C: remove the inline added earlier since
9509 they cause a bunch of unsatisfied symbols when linking with dec
9510 cxx. Cxx likes to have the body of inlines at the place where they
9513 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9514 accessing negative bounds in array. This fixes the crash when
9515 inserting accented characters.
9516 * src/trans.h (Match): ditto
9518 * src/buffer.C (Dispatch): since this is a void, it should not try
9519 to return anything...
9521 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9523 * src/buffer.h: removed the two friends from Buffer. Some changes
9524 because of this. Buffer::getFileName and Buffer::setFileName
9525 renamed to Buffer::fileName() and Buffer::fileName(...).
9527 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9529 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9530 and Buffer::update(short) to BufferView. This move is currently
9531 controlled by a define MOVE_TEXT, this will be removed when all
9532 shows to be ok. This move paves the way for better separation
9533 between buffer contents and buffer view. One side effect is that
9534 the BufferView needs a rebreak when swiching buffers, if we want
9535 to avoid this we can add a cache that holds pointers to LyXText's
9536 that is not currently in use.
9538 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9541 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9543 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9545 * lyx_main.C: new command line option -x (or --execute) and
9546 -e (or --export). Now direct conversion from .lyx to .tex
9547 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9548 Unfortunately, X is still needed and the GUI pops up during the
9551 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9553 * src/Spacing.C: add a using directive to bring stream stuff into
9555 * src/paragraph.C: ditto
9556 * src/buffer.C: ditto
9558 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9559 from Lars' announcement).
9561 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9562 example files from Tino Meinen.
9564 1999-12-06 Allan Rae <rae@lyx.org>
9566 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9568 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9570 * src/support/lyxstring.C: added a lot of inline for no good
9573 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9574 latexWriteEndChanges, they were not used.
9576 * src/layout.h (operator<<): output operator for PageSides
9578 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9580 * some example files: loaded in LyX 1.0.4 and saved again to update
9581 certain constructs (table format)
9583 * a lot of files: did the change to use fstream/iostream for all
9584 writing of files. Done with a close look at Andre Poenitz's patch.
9586 * some files: whitespace changes.
9588 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9590 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9591 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9592 architecture, we provide our own. It is used unconditionnally, but
9593 I do not think this is a performance problem. Thanks to Angus
9594 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9595 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9597 (GetInset): use my_memcpy.
9601 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9602 it is easier to understand, but it uses less TeX-only constructs now.
9604 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9605 elements contain spaces
9607 * lib/configure: regenerated
9609 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9610 elements contain spaces; display the list of programs that are
9613 * autogen.sh: make sure lib/configure is executable
9615 * lib/examples/*: rename the tutorial examples to begin with the
9616 two-letters language code.
9618 * src/lyxfunc.C (getStatus): do not query current font if no
9621 * src/lyx_cb.C (RunScript): use QuoteName
9622 (MenuRunDvips): ditto
9623 (PrintApplyCB): ditto
9625 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9626 around argument, so that it works well with the current shell.
9627 Does not work properly with OS/2 shells currently.
9629 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9630 * src/LyXSendto.C (SendtoApplyCB): ditto
9631 * src/lyxfunc.C (Dispatch): ditto
9632 * src/buffer.C (runLaTeX): ditto
9633 (runLiterate): ditto
9634 (buildProgram): ditto
9636 * src/lyx_cb.C (RunScript): ditto
9637 (MenuMakeLaTeX): ditto
9639 * src/buffer.h (getLatexName): new method
9641 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9643 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9645 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9646 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9647 (create_math_panel): ditto
9649 * src/lyxfunc.C (getStatus): re-activate the code which gets
9650 current font and cursor; add test for export to html.
9652 * src/lyxrc.C (read): remove unreachable break statements; add a
9655 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9657 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9659 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9660 introduced by faulty regex.
9661 * src/buffer.C: ditto
9662 * src/lastfiles.C: ditto
9663 * src/paragraph.C: ditto
9664 * src/table.C: ditto
9665 * src/vspace.C: ditto
9666 * src/insets/figinset.C: ditto
9667 Note: most of these is absolutely harmless, except the one in
9668 src/mathed formula.C.
9670 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9672 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9673 operation, yielding correct results for the reLyX command.
9675 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9677 * src/support/filetools.C (ExpandPath): removed an over eager
9679 (ReplaceEnvironmentPath): ditto
9681 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9682 shows that we are doing something fishy in our code...
9686 * src/lyxrc.C (read): use a double switch trick to get more help
9687 from the compiler. (the same trick is used in layout.C)
9688 (write): new function. opens a ofstream and pass that to output
9689 (output): new function, takes a ostream and writes the lyxrc
9690 elemts to it. uses a dummy switch to make sure no elements are
9693 * src/lyxlex.h: added a struct pushpophelper for use in functions
9694 with more than one exit point.
9696 * src/lyxlex.[Ch] (GetInteger): made it const
9700 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9702 * src/layout.[hC] : LayoutTags splitted into several enums, new
9703 methods created, better error handling cleaner use of lyxlex. Read
9706 * src/bmtable.[Ch]: change some member prototypes because of the
9707 image const changes.
9709 * commandtags.h, src/LyXAction.C (init): new function:
9710 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9711 This file is not read automatically but you can add \input
9712 preferences to your lyxrc if you want to. We need to discuss how
9715 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9716 in .aux, also remove .bib and .bst files from dependencies when
9719 * src/BufferView.C, src/LyXView.C: add const_cast several places
9720 because of changes to images.
9722 * lib/images/*: same change as for images/*
9724 * lib/lyxrc.example: Default for accept_compound is false not no.
9726 * images/*: changed to be const, however I have som misgivings
9727 about this change so it might be changed back.
9729 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9731 * lib/configure, po/POTFILES.in: regenerated
9733 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9735 * config/lib_configure.m4: removed
9737 * lib/configure.m4: new file (was config/lib_configure.m4)
9739 * configure.in: do not test for rtti, since we do not use it.
9741 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9743 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9744 doubling of allocated space scheme. This makes it faster for large
9745 strings end to use less memory for small strings. xtra rememoved.
9747 * src/insets/figinset.C (waitalarm): commented out.
9748 (GhostscriptMsg): use static_cast
9749 (GhostscriptMsg): use new instead of malloc to allocate memory for
9750 cmap. also delete the memory after use.
9752 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9754 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9755 for changes in bibtex database or style.
9756 (runBibTeX): remove all .bib and .bst files from dep before we
9758 (run): use scanAuc in when dep file already exist.
9760 * src/DepTable.C (remove_files_with_extension): new method
9763 * src/DepTable.[Ch]: made many of the methods const.
9765 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9767 * src/bufferparams.C: make sure that the default textclass is
9768 "article". It used to be the first one by description order, but
9769 now the first one is "docbook".
9771 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9772 string; call Debug::value.
9773 (easyParse): pass complete argument to setDebuggingLevel().
9775 * src/debug.h (value): fix the code that parses debug levels.
9777 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9780 * src/LyXAction.C: use Debug::ACTION as debug channel.
9782 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9784 * NEWS: updated for the future 1.1.3 release.
9786 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9787 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9788 it should. This is of course a controversial change (since many
9789 people will find that their lyx workscreen is suddenly full of
9790 red), but done for the sake of correctness.
9792 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9793 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9795 * src/insets/inseterror.h, src/insets/inseturl.h,
9796 src/insets/insetinfo.h, src/insets/figinset.h,
9797 src/mathed/formulamacro.h, src/mathed/math_macro.h
9798 (EditMessage): add a missing const and add _() to make sure that
9801 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9802 src/insets/insetbib.C, src/support/filetools.C: add `using'
9805 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9806 doing 'Insert index of last word' at the beginning of a paragraph.
9808 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9810 * several files: white-space changes.
9812 * src/mathed/formula.C: removed IsAlpha and IsDigit
9814 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9815 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9818 * src/insets/figinset.C (GetPSSizes): don't break when
9819 "EndComments" is seen. But break when a boundingbox is read.
9821 * all classes inherited from Inset: return value of Clone
9822 changed back to Inset *.
9824 * all classes inherited form MathInset: return value of Clone
9825 changed back to MathedInset *.
9827 * src/insets/figinset.C (runqueue): use a ofstream to output the
9828 gs/ps file. Might need some setpresicion or setw. However I can
9829 see no problem with the current code.
9830 (runqueue): use sleep instead of the alarm/signal code. I just
9831 can't see the difference.
9833 * src/paragraph.C (LyXParagraph): reserve space in the new
9834 paragraph and resize the inserted paragraph to just fit.
9836 * src/lyxfunc.h (operator|=): added operator for func_status.
9838 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9839 check for readable file.
9841 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9842 check for readable file.
9843 (MenuMakeLinuxDoc): ditto
9844 (MenuMakeDocBook): ditto
9845 (MenuMakeAscii): ditto
9846 (InsertAsciiFile): split the test for openable and readable
9848 * src/bmtable.C (draw_bitmaptable): use
9849 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9851 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9852 findtexfile from LaTeX to filetools.
9854 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9855 instead of FilePtr. Needs to be verified by a literate user.
9857 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9859 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9860 (EditMessage): likewise.
9862 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9863 respectively as \textasciitilde and \textasciicircum.
9865 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9867 * src/support/lyxstring.h: made the methods that take iterators
9870 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9871 (regexMatch): made is use the real regex class.
9873 * src/support/Makefile.am: changed to use libtool
9875 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9877 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9879 (MathIsInset ++): changed several macros to be inline functions
9882 * src/mathed/Makefile.am: changed to use libtool
9884 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9886 * src/insets/inset* : Clone changed to const and return type is
9887 the true insettype not just Inset*.
9889 * src/insets/Makefile.am: changed to use libtool
9891 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9893 * src/undo.[Ch] : added empty() and changed some of the method
9896 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9898 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9899 setID use block<> for the bullets array, added const several places.
9901 * src/lyxfunc.C (getStatus): new function
9903 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9904 LyXAction, added const to several funtions.
9906 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9907 a std::map, and to store the dir items in a vector.
9909 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9912 * src/LyXView.[Ch] + other files : changed currentView to view.
9914 * src/LyXAction.[Ch] : ported from the old devel branch.
9916 * src/.cvsignore: added .libs and a.out
9918 * configure.in : changes to use libtool.
9920 * acinclude.m4 : inserted libtool.m4
9922 * .cvsignore: added libtool
9924 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9926 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9927 file name in insets and mathed directories (otherwise the
9928 dependency is not taken in account under cygwin).
9930 * src/text2.C (InsertString[AB]): make sure that we do not try to
9931 read characters past the string length.
9933 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9935 * lib/doc/LaTeXConfig.lyx.in,
9936 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9938 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9939 file saying who created them and when this heppened; this is
9940 useless and annoys tools like cvs.
9942 * lib/layouts/g-brief-{en,de}.layout,
9943 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9944 from Thomas Hartkens <thomas@hartkens.de>.
9946 * src/{insets,mathed}/Makefile.am: do not declare an empty
9947 LDFLAGS, so that it can be set at configure time (useful on Irix
9950 * lib/reLyX/configure.in: make sure that the prefix is set
9951 correctly in LYX_DIR.
9953 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9955 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9956 be used by 'command-sequence' this allows to bind a key to a
9957 sequence of LyX-commands
9958 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9960 * src/LyXAction.C: add "command-sequence"
9962 * src/LyXFunction.C: handling of "command-sequence"
9964 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9965 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9967 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9969 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9971 * src/buffer.C (writeFile): Do not output a comment giving user
9972 and date at the beginning of a .lyx file. This is useless and
9973 annoys cvs anyway; update version number to 1.1.
9975 * src/Makefile.am (LYX_DIR): add this definition, so that a
9976 default path is hardcoded in LyX.
9978 * configure.in: Use LYX_GNU_GETTEXT.
9980 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9981 AM_GNU_GETTEXT with a bug fixed.
9983 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9985 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9987 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9988 which is used to point to LyX data is now LYX_DIR_11x.
9990 * lyx.man: convert to a unix text file; small updates.
9992 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9994 * src/support/LSubstring.[Ch]: made the second arg of most of the
9995 constructors be a const reference.
9997 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10000 * src/support/lyxstring.[Ch] (swap): added missing member function
10001 and specialization of swap(str, str);
10003 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10005 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10006 trace of the old one.
10008 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10009 put the member definitions in undo.C.
10011 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10012 NEW_TEXT and have now only code that was included when this was
10015 * src/intl.C (LCombo): use static_cast
10017 (DispatchCallback): ditto
10019 * src/definitions.h: removed whole file
10021 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10023 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10024 parsing and stores in a std:map. a regex defines the file format.
10025 removed unneeded members.
10027 * src/bufferparams.h: added several enums from definitions.h here.
10028 Removed unsused destructor. Changed some types to use proper enum
10029 types. use block to have the temp_bullets and user_defined_bullets
10030 and to make the whole class assignable.
10032 * src/bufferparams.C (Copy): removed this functions, use a default
10033 assignment instead.
10035 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10038 * src/buffer.C (readLyXformat2): commend out all that have with
10039 oldpapersize to do. also comment out all that hve to do with
10040 insetlatex and insetlatexdel.
10041 (setOldPaperStuff): commented out
10043 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10045 * src/LyXAction.C: remove use of inset-latex-insert
10047 * src/mathed/math_panel.C (button_cb): use static_cast
10049 * src/insets/Makefile.am (insets_o_SOURCES): removed
10052 * src/support/lyxstring.C (helper): use the unsigned long
10053 specifier, UL, instead of a static_cast.
10055 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10057 * src/support/block.h: new file. to be used as a c-style array in
10058 classes, so that the class can be assignable.
10060 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10062 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10063 NULL, make sure to return an empty string (it is not possible to
10064 set a string to NULL).
10066 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10068 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10070 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10072 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10073 link line, so that Irix users (for example) can set it explicitely to
10076 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10077 it can be overidden at make time (static or dynamic link, for
10080 * src/vc-backend.C, src/LaTeXFeatures.h,
10081 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10082 statements to bring templates to global namespace.
10084 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10086 * src/support/lyxstring.C (operator[] const): make it standard
10089 * src/minibuffer.C (Init): changed to reflect that more
10090 information is given from the lyxvc and need not be provided here.
10092 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
10094 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
10096 * src/LyXView.C (UpdateTimerCB): use static_cast
10097 (KeyPressMask_raw_callback): ditto
10099 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
10100 buffer_, a lot of changes because of this. currentBuffer() ->
10101 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
10102 also changes to other files because of this.
10104 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10106 * src/vc-backend.[Ch]: new files. The backends for vc handling,
10107 have no support for RCS and partial support for CVS, will be
10110 * src/insets/ several files: changes because of function name
10111 changes in Bufferview and LyXView.
10113 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
10115 * src/support/LSubstring.[Ch]: new files. These implement a
10116 Substring that can be very convenient to use. i.e. is this
10118 string a = "Mary had a little sheep";
10119 Substring(a, "sheep") = "lamb";
10120 a is now "Mary has a little lamb".
10122 * src/support/LRegex.[Ch]: a regex class that can be used to pick
10123 out patterns and subpatterns of strings. It is used by LSubstring
10124 and also by vc-backend.C
10126 * src/support/lyxstring.C: went over all the assertions used and
10127 tried to correct the wrong ones and flag which of them is required
10128 by the standard. some bugs found because of this. Also removed a
10129 couple of assertions.
10131 * src/support/Makefile.am (libsupport_a_SOURCES): added
10132 LSubstring.[Ch] and LRegex.[Ch]
10134 * src/support/FileInfo.h: have struct stat buf as an object and
10135 not a pointer to one, some changes because of this.
10137 * src/LaTeXFeatures.C (getTClassPreamble): also use the
10138 information in layout when adding the layouts preamble to the
10139 textclass preamble.
10141 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
10144 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
10145 because of bug in OS/2.
10147 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10149 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
10150 \verbatim@font instead of \ttfamily, so that it can be redefined.
10152 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
10153 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
10154 src/layout.h, src/text2.C: add 'using' directive to bring the
10155 STL templates we need from the std:: namespace to the global one.
10156 Needed by DEC cxx in strict ansi mode.
10158 * src/support/LIstream.h,src/support/LOstream.h,
10159 src/support/lyxstring.h,src/table.h,
10160 src/lyxlookup.h: do not include <config.h> in header
10161 files. This should be done in the .C files only.
10163 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
10167 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10169 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
10170 from Kayvan to fix the tth invokation.
10172 * development/lyx.spec.in: updates from Kayvan to reflect the
10173 changes of file names.
10175 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10177 * src/text2.C (InsertStringB): use std::copy
10178 (InsertStringA): use std::copy
10180 * src/bufferlist.C: use a vector to store the buffers in. This is
10181 an internal change and should not affect any other thing.
10183 * src/BufferView.C (waitForX): use XSync instead of the lengthy
10186 * src/text.C (Fill): fix potential bug, one off bug.
10188 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10190 * src/Makefile.am (lyx_main.o): add more files it depends on.
10192 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
10194 * src/support/lyxstring.C: use size_t for the reference count,
10195 size, reserved memory and xtra.
10196 (internal_compare): new private member function. Now the compare
10197 functions should work for std::strings that have embedded '\0'
10199 (compare): all compare functions rewritten to use
10202 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10204 * src/support/lyxstring.C (compare): pass c_str()
10205 (compare): pass c_str
10206 (compare): pass c_str
10208 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10210 * src/support/DebugStream.C: <config.h> was not included correctly.
10212 * lib/configure: forgot to re-generate it :( I'll make this file
10213 auto generated soon.
10215 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
10217 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
10220 * src/support/lyxstring.C: some changes from length() to rep->sz.
10221 avoids a function call.
10223 * src/support/filetools.C (SpaceLess): yet another version of the
10224 algorithm...now per Jean-Marc's suggestions.
10226 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10228 * src/layout.C (less_textclass_desc): functor for use in sorting
10230 (LyXTextClass::Read): sort the textclasses after reading.
10232 * src/support/filetools.C (SpaceLess): new version of the
10233 SpaceLess functions. What problems does this one give? Please
10236 * images/banner_bw.xbm: made the arrays unsigned char *
10238 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10240 * src/support/lyxstring.C (find): remove bogus assertion in the
10241 two versions of find where this has not been done yet.
10243 * src/support/lyxlib.h: add missing int return type to
10246 * src/menus.C (ShowFileMenu): disable exporting to html if no
10247 html export command is present.
10249 * config/lib_configure.m4: add a test for an HTML converter. The
10250 programs checked for are, in this order: tth, latex2html and
10253 * lib/configure: generated from config/lib_configure.m4.
10255 * src/lyxfunc.C (Dispatch): update and improve the execution of an
10256 html converter. The parameters are now passed through $$FName and
10257 $$OutName, instead of standard input/output.
10259 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
10261 * lib/lyxrc.example: update description of \html_command.
10262 add "quotes" around \screen_font_xxx font setting examples to help
10263 people who use fonts with spaces in their names.
10265 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10267 * Distribution files: updates for v1.1.2
10269 * src/support/lyxstring.C (find): remove bogus assert and return
10270 npos for the same condition.
10272 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10274 * added patch for OS/2 from SMiyata.
10276 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10278 * src/text2.C (CutSelection): make space_wrapped a bool
10279 (CutSelection): dont declare int i until we have to.
10280 (alphaCounter): return a char const *.
10282 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10284 * src/support/syscall.C (Systemcalls::kill):
10285 src/support/filetools.C (PutEnv, PutEnvPath):
10286 src/lyx_cb.C (addNewlineAndDepth):
10287 src/FontInfo.C (FontInfo::resize): condition some #warning
10288 directives with WITH_WARNINGS.
10291 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10293 * src/layout.[Ch] + several files: access to class variables
10294 limited and made accessor functions instead a lot of code changed
10295 becuase of this. Also instead of returning pointers often a const
10296 reference is returned instead.
10298 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10300 * src/Makefile.am (dist-hook): added used to remove the CVS from
10301 cheaders upon creating a dist
10302 (EXTRA_DIST): added cheaders
10304 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10305 a character not as a small integer.
10307 * src/support/lyxstring.C (find): removed Assert and added i >=
10308 rep->sz to the first if.
10310 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10312 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10313 src/LyXView.C src/buffer.C src/bufferparams.C
10314 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10315 src/text2.C src/insets/insetinclude.C:
10316 lyxlayout renamed to textclasslist.
10318 * src/layout.C: some lyxerr changes.
10320 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10321 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10322 (LyXLayoutList): removed all traces of this class.
10323 (LyXTextClass::Read): rewrote LT_STYLE
10324 (LyXTextClass::hasLayout): new function
10325 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10326 both const and nonconst version.
10327 (LyXTextClass::delete_layout): new function.
10328 (LyXTextClassList::Style): bug fix. do the right thing if layout
10330 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10331 (LyXTextClassList::NameOfLayout): ditto
10332 (LyXTextClassList::Load): ditto
10334 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10336 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10338 * src/LyXAction.C (LookupFunc): added a workaround for sun
10339 compiler, on the other hand...we don't know if the current code
10340 compiles on sun at all...
10342 * src/support/filetools.C (CleanupPath): subst fix
10344 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10347 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10348 complained about this one?
10350 * src/insets/insetinclude.C (Latex): subst fix
10352 * src/insets/insetbib.C (getKeys): subst fix
10354 * src/LyXSendto.C (SendtoApplyCB): subst fix
10356 * src/lyx_main.C (init): subst fix
10358 * src/layout.C (Read): subst fix
10360 * src/lyx_sendfax_main.C (button_send): subst fix
10362 * src/buffer.C (RoffAsciiTable): subst fix
10364 * src/lyx_cb.C (MenuFax): subst fix
10365 (PrintApplyCB): subst fix
10367 1999-10-26 Juergen Vigna <jug@sad.it>
10369 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10371 (Read): Cleaned up this code so now we read only format vestion >= 5
10373 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10375 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10376 come nobody has complained about this one?
10378 * src/insets/insetinclude.C (Latex): subst fix
10380 * src/insets/insetbib.C (getKeys): subst fix
10382 * src/lyx_main.C (init): subst fix
10384 * src/layout.C (Read): subst fix
10386 * src/buffer.C (RoffAsciiTable): subst fix
10388 * src/lyx_cb.C (MenuFax): subst fix.
10390 * src/layout.[hC] + some other files: rewrote to use
10391 std::container to store textclasses and layouts in.
10392 Simplified, removed a lot of code. Make all classes
10393 assignable. Further simplifications and review of type
10394 use still to be one.
10396 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10397 lastfiles to create the lastfiles partr of the menu.
10399 * src/lastfiles.[Ch]: rewritten to use deque to store the
10400 lastfiles in. Uses fstream for reading and writing. Simplifies
10403 * src/support/syscall.C: remove explicit cast.
10405 * src/BufferView.C (CursorToggleCB): removed code snippets that
10406 were commented out.
10407 use explicat C++ style casts instead of C style casts. also use
10408 u_vdata instea of passing pointers in longs.
10410 * src/PaperLayout.C: removed code snippets that were commented out.
10412 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10414 * src/lyx_main.C: removed code snippets that wer commented out.
10416 * src/paragraph.C: removed code snippets that were commented out.
10418 * src/lyxvc.C (logClose): use static_cast
10420 (viewLog): remove explicit cast to void*
10421 (showLog): removed old commented code
10423 * src/menus.C: use static_cast instead of C style casts. use
10424 u_vdata instead of u_ldata. remove explicit cast to (long) for
10425 pointers. Removed old code that was commented out.
10427 * src/insets/inset.C: removed old commented func
10429 * src/insets/insetref.C (InsetRef): removed old code that had been
10430 commented out for a long time.
10432 (escape): removed C style cast
10434 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10436 * src/insets/insetlatex.C (Draw): removed old commented code
10437 (Read): rewritten to use string
10439 * src/insets/insetlabel.C (escape): removed C style cast
10441 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10443 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10444 old commented code.
10446 * src/insets/insetinclude.h: removed a couple of stupid bools
10448 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10449 (Clone): remove C style cast
10450 (getKeys): changed list to lst because of std::list
10452 * src/insets/inseterror.C (Draw): removed som old commented code.
10454 * src/insets/insetcommand.C (Draw): removed some old commented code.
10456 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10457 commented out forever.
10458 (bibitem_cb): use static_cast instead of C style cast
10459 use of vdata changed to u_vdata.
10461 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10463 (CloseUrlCB): use static_cast instead of C style cast.
10464 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10466 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10467 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10468 (CloseInfoCB): static_cast from ob->u_vdata instead.
10469 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10472 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10473 (C_InsetError_CloseErrorCB): forward the ob parameter
10474 (CloseErrorCB): static_cast from ob->u_vdata instead.
10476 * src/vspace.h: include LString.h since we use string in this class.
10478 * src/vspace.C (lyx_advance): changed name from advance because of
10479 nameclash with stl. And since we cannot use namespaces yet...I
10480 used a lyx_ prefix instead. Expect this to change when we begin
10483 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10485 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10486 and removed now defunct constructor and deconstructor.
10488 * src/BufferView.h: have backstack as a object not as a pointer.
10489 removed initialization from constructor. added include for BackStack
10491 * development/lyx.spec.in (%build): add CFLAGS also.
10493 * src/screen.C (drawFrame): removed another warning.
10495 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10497 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10498 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10499 README and ANNOUNCE a bit for the next release. More work is
10502 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10503 unbreakable if we are in freespacing mode (LyX-Code), but not in
10506 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10508 * src/BackStack.h: fixed initialization order in constructor
10510 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10512 * acinclude.m4 (VERSION): new rules for when a version is
10513 development, added also a variable for prerelease.
10514 (warnings): we set with_warnings=yes for prereleases
10515 (lyx_opt): prereleases compile with same optimization as development
10516 (CXXFLAGS): only use pedantic if we are a development version
10518 * src/BufferView.C (restorePosition): don't do anything if the
10519 backstack is empty.
10521 * src/BackStack.h: added member empty, use this to test if there
10522 is anything to pop...
10524 1999-10-25 Juergen Vigna <jug@sad.it>
10527 * forms/layout_forms.fd +
10528 * forms/latexoptions.fd +
10529 * lyx.fd: changed for various form resize issues
10531 * src/mathed/math_panel.C +
10532 * src/insets/inseterror.C +
10533 * src/insets/insetinfo.C +
10534 * src/insets/inseturl.C +
10535 * src/insets/inseturl.h +
10537 * src/LyXSendto.C +
10538 * src/PaperLayout.C +
10539 * src/ParagraphExtra.C +
10540 * src/TableLayout.C +
10542 * src/layout_forms.C +
10549 * src/menus.C: fixed various resize issues. So now forms can be
10550 resized savely or not be resized at all.
10552 * forms/form_url.fd +
10553 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10556 * src/insets/Makefile.am: added files form_url.[Ch]
10558 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10560 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10561 (and presumably 6.2).
10563 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10564 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10565 remaining static member callbacks.
10567 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10570 * src/support/lyxstring.h: declare struct Srep as friend of
10571 lyxstring, since DEC cxx complains otherwise.
10573 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10575 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10577 * src/LaTeX.C (run): made run_bibtex also depend on files with
10579 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10580 are put into the dependency file.
10582 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10583 the code has shown itself to work
10584 (create_ispell_pipe): removed another warning, added a comment
10587 * src/minibuffer.C (ExecutingCB): removed code that has been
10588 commented out a long time
10590 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10591 out code + a warning.
10593 * src/support/lyxstring.h: comment out the three private
10594 operators, when compiling with string ansi conforming compilers
10595 they make problems.
10597 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10599 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10600 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10603 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10606 * src/mathed/math_panel.C (create_math_panel): remove explicit
10609 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10612 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10613 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10614 to XCreatePixmapFromBitmapData
10615 (fl_set_bmtable_data): change the last argument to be unsigned
10617 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10618 and bh to be unsigned int, remove explicit casts in call to
10619 XReadBitmapFileData.
10621 * images/arrows.xbm: made the arrays unsigned char *
10622 * images/varsz.xbm: ditto
10623 * images/misc.xbm: ditto
10624 * images/greek.xbm: ditto
10625 * images/dots.xbm: ditto
10626 * images/brel.xbm: ditto
10627 * images/bop.xbm: ditto
10629 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10631 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10632 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10633 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10635 (LYX_CXX_CHEADERS): added <clocale> to the test.
10637 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10639 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10641 * src/support/lyxstring.C (append): fixed something that must be a
10642 bug, rep->assign was used instead of rep->append.
10644 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10647 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10648 lyx insert double chars. Fix spotted by Kayvan.
10650 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10652 * Fixed the tth support. I messed up with the Emacs patch apply feature
10653 and omitted the changes in lyxrc.C.
10655 1999-10-22 Juergen Vigna <jug@sad.it>
10657 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10659 * src/lyx_cb.C (MenuInsertRef) +
10660 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10661 the form cannot be resized under it limits (fixes a segfault)
10663 * src/lyx.C (create_form_form_ref) +
10664 * forms/lyx.fd: Changed Gravity on name input field so that it is
10667 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10669 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10670 <ostream> and <istream>.
10672 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10673 whether <fstream> provides the latest standard features, or if we
10674 have an oldstyle library (like in egcs).
10675 (LYX_CXX_STL_STRING): fix the test.
10677 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10678 code on MODERN_STL_STREAM.
10680 * src/support/lyxstring.h: use L{I,O}stream.h.
10682 * src/support/L{I,O}stream.h: new files, designed to setup
10683 correctly streams for our use
10684 - includes the right header depending on STL capabilities
10685 - puts std::ostream and std::endl (for LOStream.h) or
10686 std::istream (LIStream.h) in toplevel namespace.
10688 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10690 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10691 was a bib file that had been changed we ensure that bibtex is run.
10692 (runBibTeX): enhanced to extract the names of the bib files and
10693 getting their absolute path and enter them into the dep file.
10694 (findtexfile): static func that is used to look for tex-files,
10695 checks for absolute patchs and tries also with kpsewhich.
10696 Alternative ways of finding the correct files are wanted. Will
10698 (do_popen): function that runs a command using popen and returns
10699 the whole output of that command in a string. Should be moved to
10702 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10703 file with extension ext has changed.
10705 * src/insets/figinset.C: added ifdef guards around the fl_free
10706 code that jug commented out. Now it is commented out when
10707 compiling with XForms == 0.89.
10709 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10710 to lyxstring.C, and only keep a forward declaration in
10711 lyxstring.h. Simplifies the header file a bit and should help a
10712 bit on compile time too. Also changes to Srep will not mandate a
10713 recompile of code just using string.
10714 (~lyxstring): definition moved here since it uses srep.
10715 (size): definition moved here since it uses srep.
10717 * src/support/lyxstring.h: removed a couple of "inline" that should
10720 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10722 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10725 1999-10-21 Juergen Vigna <jug@sad.it>
10727 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10728 set to left if I just remove the width entry (or it is empty).
10730 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10731 paragraph when having dummy paragraphs.
10733 1999-10-20 Juergen Vigna <jug@sad.it>
10735 * src/insets/figinset.C: just commented some fl_free_form calls
10736 and added warnings so that this calls should be activated later
10737 again. This avoids for now a segfault, but we have a memory leak!
10739 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10740 'const char * argument' to 'string argument', this should
10741 fix some Asserts() in lyxstring.C.
10743 * src/lyxfunc.h: Removed the function argAsString(const char *)
10744 as it is not used anymore.
10746 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10748 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10751 * src/Literate.h: some funcs moved from public to private to make
10752 interface clearer. Unneeded args removed.
10754 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10756 (scanBuildLogFile): ditto
10758 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10759 normal TeX Error. Still room for improvement.
10761 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10763 * src/buffer.C (insertErrors): changes to make the error
10764 desctription show properly.
10766 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10769 * src/support/lyxstring.C (helper): changed to use
10770 sizeof(object->rep->ref).
10771 (operator>>): changed to use a pointer instead.
10773 * src/support/lyxstring.h: changed const reference & to value_type
10774 const & lets see if that helps.
10776 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10778 * Makefile.am (rpmdist): fixed to have non static package and
10781 * src/support/lyxstring.C: removed the compilation guards
10783 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10786 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10787 conditional compile of lyxstring.Ch
10789 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10790 stupid check, but it is a lot better than the bastring hack.
10791 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10793 * several files: changed string::erase into string::clear. Not
10796 * src/chset.C (encodeString): use a char temporary instead
10798 * src/table.C (TexEndOfCell): added tostr around
10799 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10800 (TexEndOfCell): ditto
10801 (TexEndOfCell): ditto
10802 (TexEndOfCell): ditto
10803 (DocBookEndOfCell): ditto
10804 (DocBookEndOfCell): ditto
10805 (DocBookEndOfCell): ditto
10806 (DocBookEndOfCell): ditto
10808 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10810 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10812 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10813 (MenuBuildProg): added tostr around ret
10814 (MenuRunChktex): added tostr around ret
10815 (DocumentApplyCB): added tostr around ret
10817 * src/chset.C (encodeString): added tostr around t->ic
10819 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10820 (makeLaTeXFile): added tostr around tocdepth
10821 (makeLaTeXFile): added tostr around ftcound - 1
10823 * src/insets/insetbib.C (setCounter): added tostr around counter.
10825 * src/support/lyxstring.h: added an operator+=(int) to catch more
10828 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10829 (lyxstring): We DON'T allow NULL pointers.
10831 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10833 * src/mathed/math_macro.C (MathMacroArgument::Write,
10834 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10835 when writing them out.
10837 * src/LString.C: remove, since it is not used anymore.
10839 * src/support/lyxstring.C: condition the content to
10840 USE_INCLUDED_STRING macro.
10842 * src/mathed/math_symbols.C, src/support/lstrings.C,
10843 src/support/lyxstring.C: add `using' directive to specify what
10844 we need in <algorithm>. I do not think that we need to
10845 conditionalize this, but any thought is appreciated.
10847 * many files: change all callback functions to "C" linkage
10848 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10849 strict_ansi. Those who were static are now global.
10850 The case of callbacks which are static class members is
10851 trickier, since we have to make C wrappers around them (see
10852 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10853 did not finish this yet, since it defeats the purpose of
10854 encapsulation, and I am not sure what the best route is.
10856 1999-10-19 Juergen Vigna <jug@sad.it>
10858 * src/support/lyxstring.C (lyxstring): we permit to have a null
10859 pointer as assignment value and just don't assign it.
10861 * src/vspace.C (nextToken): corrected this function substituting
10862 find_first(_not)_of with find_last_of.
10864 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10865 (TableOptCloseCB) (TableSpeCloseCB):
10866 inserted fl_set_focus call for problem with fl_hide_form() in
10869 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10871 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10874 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10876 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10877 LyXLex::next() and not eatline() to get its argument.
10879 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10881 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10882 instead, use fstreams for io of the depfile, removed unneeded
10883 functions and variables.
10885 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10886 vector instead, removed all functions and variables that is not in
10889 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10891 * src/buffer.C (insertErrors): use new interface to TeXError
10893 * Makefile.am (rpmdist): added a rpmdist target
10895 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10896 per Kayvan's instructions.
10898 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10900 * src/Makefile.am: add a definition for localedir, so that locales
10901 are found after installation (Kayvan)
10903 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10905 * development/.cvsignore: new file.
10907 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10909 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10910 C++ compiler provides wrappers for C headers and use our alternate
10913 * configure.in: use LYX_CXX_CHEADERS.
10915 * src/cheader/: new directory, populated with cname headers from
10916 libstdc++-2.8.1. They are a bit old, but probably good enough for
10917 what we want (support compilers who lack them).
10919 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10920 from includes. It turns out is was stupid.
10922 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10924 * lib/Makefile.am (install-data-local): forgot a ';'
10925 (install-data-local): forgot a '\'
10926 (libinstalldirs): needed after all. reintroduced.
10928 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10930 * configure.in (AC_OUTPUT): added lyx.spec
10932 * development/lyx.spec: removed file
10934 * development/lyx.spec.in: new file
10936 * po/*.po: merged with lyx.pot becuase of make distcheck
10938 * lib/Makefile.am (dist-hook): added dist-hook so that
10939 documentation files will be included when doing a make
10940 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10941 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10943 more: tried to make install do the right thing, exclude CVS dirs
10946 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10947 Path would fit in more nicely.
10949 * all files that used to use pathstack: uses now Path instead.
10950 This change was a lot easier than expected.
10952 * src/support/path.h: new file
10954 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10956 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10958 * src/support/lyxstring.C (getline): Default arg was given for
10961 * Configure.cmd: removed file
10963 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10965 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10966 streams classes and types, add the proper 'using' statements when
10967 MODERN_STL is defined.
10969 * src/debug.h: move the << operator definition after the inclusion
10972 * src/support/filetools.C: include "LAssert.h", which is needed
10975 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10978 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10979 include "debug.h" to define a proper ostream.
10981 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10983 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10984 method to the SystemCall class which can kill a process, but it's
10985 not fully implemented yet.
10987 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10989 * src/support/FileInfo.h: Better documentation
10991 * src/lyxfunc.C: Added support for buffer-export html
10993 * src/menus.C: Added Export->As HTML...
10995 * lib/bind/*.bind: Added short-cut for buffer-export html
10997 * src/lyxrc.*: Added support for new \tth_command
10999 * lib/lyxrc.example: Added stuff for new \tth_command
11001 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11003 * lib/Makefile.am (IMAGES): removed images/README
11004 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11005 installes in correct place. Check permisions is installed
11008 * src/LaTeX.C: some no-op changes moved declaration of some
11011 * src/LaTeX.h (LATEX_H): changed include guard name
11013 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11015 * lib/reLyX/Makefile.am: install noweb2lyx.
11017 * lib/Makefile.am: install configure.
11019 * lib/reLyX/configure.in: declare a config aux dir; set package
11020 name to lyx (not sure what the best solution is); generate noweb2lyx.
11022 * lib/layouts/egs.layout: fix the bibliography layout.
11024 1999-10-08 Jürgen Vigna <jug@sad.it>
11026 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11027 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11028 it returned without continuing to search the path.
11030 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11032 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11033 also fixes a bug. It is not allowed to do tricks with std::strings
11034 like: string a("hei"); &a[e]; this will not give what you
11035 think... Any reason for the complexity in this func?
11037 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11039 * Updated README and INSTALL a bit, mostly to check that my
11040 CVS rights are correctly set up.
11042 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11044 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11045 does not allow '\0' chars but lyxstring and std::string does.
11047 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11049 * autogen.sh (AUTOCONF): let the autogen script create the
11050 POTFILES.in file too. POTFILES.in should perhaps now not be
11051 included in the cvs module.
11053 * some more files changed to use C++ includes instead of C ones.
11055 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11057 (Reread): added tostr to nlink. buggy output otherwise.
11058 (Reread): added a string() around szMode when assigning to Buffer,
11059 without this I got a log of garbled info strings.
11061 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11064 * I have added several ostream & operator<<(ostream &, some_type)
11065 functions. This has been done to avoid casting and warnings when
11066 outputting enums to lyxerr. This as thus eliminated a lot of
11067 explicit casts and has made the code clearer. Among the enums
11068 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11069 mathed enums, some font enum the Debug::type enum.
11071 * src/support/lyxstring.h (clear): missing method. equivalent of
11074 * all files that contained "stderr": rewrote constructs that used
11075 stderr to use lyxerr instead. (except bmtable)
11077 * src/support/DebugStream.h (level): and the passed t with
11078 Debug::ANY to avoid spurious bits set.
11080 * src/debug.h (Debug::type value): made it accept strings of the
11081 type INFO,INIT,KEY.
11083 * configure.in (Check for programs): Added a check for kpsewhich,
11084 the latex generation will use this later to better the dicovery of
11087 * src/BufferView.C (create_view): we don't need to cast this to
11088 (void*) that is done automatically.
11089 (WorkAreaButtonPress): removed some dead code.
11091 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11093 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
11094 is not overwritten when translated (David Sua'rez de Lis).
11096 * lib/CREDITS: Added David Sua'rez de Lis
11098 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
11100 * src/bufferparams.C (BufferParams): default input encoding is now
11103 * acinclude.m4 (cross_compiling): comment out macro
11104 LYX_GXX_STRENGTH_REDUCE.
11106 * acconfig.h: make sure that const is not defined (to empty) when
11107 we are compiling C++. Remove commented out code using SIZEOF_xx
11110 * configure.in : move the test for const and inline as late as
11111 possible so that these C tests do not interefere with C++ ones.
11112 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
11113 has not been proven.
11115 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11117 * src/table.C (getDocBookAlign): remove bad default value for
11118 isColumn parameter.
11120 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
11122 (ShowFileMenu2): ditto.
11124 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
11125 of files to ignore.
11127 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11129 * Most files: finished the change from the old error code to use
11130 DebugStream for all lyxerr debugging. Only minor changes remain
11131 (e.g. the setting of debug levels using strings instead of number)
11133 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11135 * src/layout.C (Add): Changed to use compare_no_case instead of
11138 * src/FontInfo.C: changed loop variable type too string::size_type.
11140 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11142 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
11143 set ETAGS_ARGS to --c++
11145 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
11147 * src/table.C (DocBookEndOfCell): commented out two unused variables
11149 * src/paragraph.C: commented out four unused variables.
11151 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
11152 insed a if clause with type string::size_type.
11154 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
11157 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
11159 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
11160 variable, also changed loop to go from 0 to lenght + 1, instead of
11161 -1 to length. This should be correct.
11163 * src/LaTeX.C (scanError): use string::size_type as loop variable
11166 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
11167 (l.896) since y_tmp and row was not used anyway.
11169 * src/insets/insetref.C (escape): use string::size_type as loop
11172 * src/insets/insetquotes.C (Width): use string::size_type as loop
11174 (Draw): use string::size_type as loop variable type.
11176 * src/insets/insetlatexaccent.C (checkContents): use
11177 string::size_type as loop variable type.
11179 * src/insets/insetlabel.C (escape): use string::size_type as loop
11182 * src/insets/insetinfo.C: added an extern for current_view.
11184 * src/insets/insetcommand.C (scanCommand): use string::size_type
11185 as loop variable type.
11187 * most files: removed the RCS tags. With them we had to recompile
11188 a lot of files after a simple cvs commit. Also we have never used
11189 them for anything meaningful.
11191 * most files: tags-query-replace NULL 0. As adviced several plases
11192 we now use "0" instead of "NULL" in our code.
11194 * src/support/filetools.C (SpaceLess): use string::size_type as
11195 loop variable type.
11197 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11199 * src/paragraph.C: fixed up some more string stuff.
11201 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11203 * src/support/filetools.h: make modestr a std::string.
11205 * src/filetools.C (GetEnv): made ch really const.
11207 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
11208 made code that used these use max/min from <algorithm> instead.
11210 * changed several c library include files to their equivalent c++
11211 library include files. All is not changed yet.
11213 * created a support subdir in src, put lyxstring and lstrings
11214 there + the extra files atexit, fileblock, strerror. Created
11215 Makefile.am. edited configure.in and src/Makefile.am to use this
11216 new subdir. More files moved to support.
11218 * imported som of the functions from repository lyx, filetools
11220 * ran tags-query-replace on LString -> string, corrected the bogus
11221 cases. Tried to make use of lstrings.[hC], debugged a lot. There
11222 is still some errors in there. This is errors where too much or
11223 too litle get deleted from strings (string::erase, string::substr,
11224 string::replace), there can also be some off by one errors, or
11225 just plain wrong use of functions from lstrings. Viewing of quotes
11228 * LyX is now running fairly well with string, but there are
11229 certainly some bugs yet (see above) also string is quite different
11230 from LString among others in that it does not allow null pointers
11231 passed in and will abort if it gets any.
11233 * Added the revtex4 files I forgot when setting up the repository.
11235 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11237 * All over: Tried to clean everything up so that only the files
11238 that we really need are included in the cvs repository.
11239 * Switched to use automake.
11240 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
11241 * Install has not been checked.
11243 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11245 * po/pt.po: Three errors:
11246 l.533 and l.538 format specification error
11247 l. 402 duplicate entry, I just deleted it.