Added preliminary support for pspell-libraries!

[features.git] / ChangeLog

2000-08-28  Juergen Vigna  <jug@sad.it>

        * acconfig.h: added USE_PSPELL.

        * src/config.h.in: added USE_PSPELL.

        * autogen.sh: added pspell.m4

        * config/pspell.m4: new file.

        * src/spellchecker.C: implemented support for pspell libary.

2000-08-25  Juergen Vigna  <jug@sad.it>

        * src/LyXAction.C (init): renamed LFUN_TABLE to
        LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.

        * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.

        * src/lyxscreen.h: add force_clear variable and fuction to force
        a clear area when redrawing in LyXText.

        * src/text.C (GetVisibleRow): look if the screen forces a redraw.

2000-08-25  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * some whitespace and comment changes.
        
        * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.

        * src/buffer.C: up te LYX_FORMAT to 2.17

2000-08-23  Juergen Vigna  <jug@sad.it>

        * src/BufferView_pimpl.C (tripleClick): disable this when in a
        locking_inset.

        * src/insets/insettabular.C (pasteSelection): delete the insets
        LyXText as it is not valid anymore.
        (copySelection): new function.
        (pasteSelection): new function.
        (cutSelection): new function.
        (LocalDispatch): implemented cut/copy/paste of cell selections.

        * src/insets/insettext.C (resizeLyXText): don't need resize if I still
        don't have a LyXText.

        * src/LyXAction.C (init): a NEW_TABULAR define too much.

        * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
        NEW_TABULAR define.

2000-08-22  Juergen Vigna  <jug@sad.it>

        * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): 
        ifdef form_table out if NEW_TABULAR.

2000-08-21  Juergen Vigna  <jug@sad.it>

        * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
        (draw): fixed draw position so that the cursor is positioned in the
        right place.
        (InsetMotionNotify): hide/show cursor so the position is updated.
        (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
        using cellstart() function where it should be used.

        * src/insets/insettext.C (draw): ditto.

        * src/tabular.C: fixed initialization of some missing variables and
        made BoxType into an enum.

2000-08-22  Marko Vendelin <markov@ioc.ee>
        * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome 
        stock menu item using action numerical value, not its string
        representation.


2000-08-22  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
        GUIRunTime.C remove GUIRunTime_pimpl.[Ch]

        * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file

        * src/frontends/xforms/GUIRunTime.C: new file

        * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
        GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]

        * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file

        * src/frontends/kde/GUIRunTime.C: new file

        * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
        GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]

        * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file

        * src/frontends/gnome/GUIRunTime.C: new file

        * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
        GUIRunTime.C 

        * src/frontends/GUIRunTime.h: removed constructor and destructor,
        small change to documetentation.

        * src/frontends/GUIRunTime.C: removed file

        * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR

        * src/lyxparagraph.h: enable NEW_TABULAR as default

        * src/lyxfunc.C (processKeySym): remove some commented code

        * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
        NEW_TABULAR around the fd_form_table_options.

        * src/lyx_gui.C (runTime): call the static member function as
        GUIRunTime::runTime().

2000-08-21  Allan Rae  <rae@lyx.org>

        * src/frontends/xforms/FormDocument.h: D'oh.  Forgot to change the
        policy here also.

2000-08-21  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present

2000-08-21  Allan Rae  <rae@lyx.org>

        * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
        keep Garst happy ;-)
        * src/frontends/xforms/FormPreferences.C (build): use setOK
        * src/frontends/xforms/FormDocument.C (build): use setOK
        (FormDocument): use the appropriate policy.

2000-08-21  Allan Rae  <rae@lyx.org>

        * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
        automatic [de]activation of arbitrary objects when in a read-only state.

        * src/frontends/ButtonPolicies.h: More documentation
        (isReadOnly): added to support the above.

        * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save

2000-08-18  Juergen Vigna  <jug@sad.it>

        * src/insets/insettabular.C (getStatus): changed to return func_status.

        * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
        display toggle menu entries if they are.

        * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
        new document layout now.

        * src/lyxfunc.C: ditto

        * src/lyx_gui_misc.C: ditto

        * src/lyx_gui.C: ditto

        * lib/ui/default.ui: removed paper and quotes layout as they are now
        all in the document layout tabbed folder.

        * src/frontends/xforms/forms/form_document.fd: added Restore
        button and callbacks for all inputs for Allan's ButtonPolicy.

        * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
        (CheckChoiceClass): added missing params setting on class change.
        (UpdateLayoutDocument): added for updating the layout on params.
        (build): forgot to RETURN_ALWAYS input_doc_spacing.
        (FormDocument): Implemented Allan's ButtonPolicy with the
        PreferencesPolicy.

2000-08-17  Allan Rae  <rae@lyx.org>

        * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
        so we can at least see the credits again.

        * src/frontends/xforms/FormPreferences.C: Used the appropriate button
        controller calls for the appropriate callbacks.  Note that since Ok
        calls apply followed by cancel, and apply isn't a valid input for the
        APPLIED state, the bc_ calls have to be made in the static callback not
        within each of the real callbacks.

        * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
        (setOk): renamed from setOkay()

2000-08-17  Juergen Vigna  <jug@sad.it>

        * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
        in the implementation part.
        (composeUIInfo): don't show optional menu-items.

        * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.

        * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()

        * src/bufferview_funcs.C (CurrentState): fixed to show also the
        text-state when in a text-inset.

        * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.

2000-08-17  Marko Vendelin <markov@ioc.ee>
        * src/frontends/gnome/FormIndex.C
        * src/frontends/gnome/FormIndex.h
        * src/frontends/gnome/FormToc.C
        * src/frontends/gnome/FormToc.h
        * src/frontends/gnome/dialogs
        * src/frontends/gnome/diatoc_callbacks.c
        * src/frontends/gnome/diatoc_callbacks.h
        * src/frontends/gnome/diainsertindex_callbacks.h
        * src/frontends/gnome/diainsertindex_callbacks.c
        * src/frontends/gnome/diainsertindex_interface.c
        * src/frontends/gnome/diainsertindex_interface.h
        * src/frontends/gnome/diatoc_interface.h
        * src/frontends/gnome/diatoc_interface.c
        * src/frontends/gnome/Makefile.am: Table of Contents and 
        Insert Index dialogs implementation for Gnome frontend

        * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs

        * src/frontends/gnome/Menubar_pimpl.C: remove historical comments

        * src/frontends/gnome/diainserturl_interface.c: make the dialog
        resizable

2000-08-17  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
        destructor. Don't definde if you don't need it
        (processEvents): made static, non-blocking events processing for
        xforms.
        (runTime): static method. event loop for xforms
        * similar as above for kde and gnome.
        
        * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
        new Pimpl is correct
        (runTime): new method calss the real frontends runtime func.

        * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime

2000-08-16  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyx_gui.C (create_forms): fix the "No change" gettext missing

2000-08-16  Juergen Vigna  <jug@sad.it>

        * src/lyx_gui.C (runTime): added GUII RunTime support.

        * src/frontends/Makefile.am: 
        * src/frontends/GUIRunTime.[Ch]:
        * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
        * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
        * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support

        * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.

        * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
        as this is already set in ${FRONTEND_INCLUDE} if needed.

        * configure.in (CPPFLAGS): setting the include dir for the frontend
        directory and don't set FRONTEND=xforms for now as this is executed
        always.

2000-08-16 John Levon (moz@compsoc.man.ac.uk)
 
        * src/frontends/kde/Makefile.am:
        * src/frontends/kde/FormUrl.C:
        * src/frontends/kde/FormUrl.h:
        * src/frontends/kde/formurldialog.h:
        * src/frontends/kde/formurldialog.C: Add KDE URL dialog

2000-08-15  Kayvan A. Sylvan <kayvan@sylvan.com>

        * src/frontend/Makefile.am: Add gnome and kde to dist tar file.

2000-08-16  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/BufferView_pimpl.C (workAreaKeyPress): enable the
        processKeySym
        
2000-08-15  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/WorkArea.C (work_area_handler): more work to get te
        FL_KEYBOARD to work with xforms 0.88 too, please test.

        * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.

2000-08-15  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
        -pedantic

2000-08-14  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/Timeout.h: remove Qt::emit hack.

        * several files: changes to allo doc++ compilation
        
        * src/lyxfunc.C (processKeySym): new method
        (processKeyEvent): comment out if FL_REVISION < 89

        * src/WorkArea.C: change some debugging levels.
        (WorkArea): set wantkey to FL_KEY_ALL
        (work_area_handler): enable the FL_KEYBOARD clause, this enables
        clearer code and the use of compose with XForms 0.89. Change to
        use signals instead of calling methods in bufferview directly.

        * src/Painter.C: change some debugging levels.

        * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
        if FL_REVISION < 89

        * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
        (workAreaKeyPress): new method

2000-08-14  Juergen Vigna  <jug@sad.it>

        * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.

        * config/kde.m4: addes some features

        * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to 
        include missing xforms dialogs.

        * src/Timeout.h: a hack to be able to compile with qt/kde.

        * sigc++/.cvsignore: added acinclude.m4

        * lib/.cvsignore: added listerros

        * src/frontends/Makefile.am: modified for now to ALWAYS compile the
        xforms tree as objects are needed for other frontends.

        * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
        linking with not yet implemented xforms objects.

        * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.

2000-08-14  Baruch Even  <baruch.even@writeme.com>

        * src/frontends/xforms/FormGraphics.h:
        * src/frontends/xforms/FormGraphics.C:
        * src/frontends/xforms/RadioButtonGroup.h:
        * src/frontends/xforms/RadioButtonGroup.C:
        * src/insets/insetgraphics.h:
        * src/insets/insetgraphics.C:
        * src/insets/insetgraphicsParams.h:
        * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
        instead of spaces, and various other indentation issues to make the
        sources more consistent.

2000-08-14  Marko Vendelin <markov@ioc.ee>

        * src/frontends/gnome/dialogs/diaprint.glade
        * src/frontends/gnome/FormPrint.C
        * src/frontends/gnome/FormPrint.h
        * src/frontends/gnome/diaprint_callbacks.c
        * src/frontends/gnome/diaprint_callbacks.h
        * src/frontends/gnome/diaprint_interface.c
        * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome 
        implementation
        
        * src/frontends/gnome/dialogs/diainserturl.glade
        * src/frontends/gnome/FormUrl.C
        * src/frontends/gnome/FormUrl.h
        * src/frontends/gnome/diainserturl_callbacks.c
        * src/frontends/gnome/diainserturl_callbacks.h
        * src/frontends/gnome/diainserturl_interface.c
        * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
        Gnome implementation

        * src/frontends/gnome/Dialogs.C
        * src/frontends/gnome/Makefile.am: added Print, Insert Url  and
        all other dialogs. Copy all unimplemented dialogs from Xforms
        frontend
        
        * src/frontends/gnome/support.c
        * src/frontends/gnome/support.h: support files generated by Glade

        * autogen.sh
        * configure.in
        * config/gnome.m4: Gnome configuration scripts

        * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
        configure --help message

        * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
        only if there are no events pendling in Gnome/Gtk. This enhances
        the performance of menus.


2000-08-14  Allan Rae  <rae@lyx.org>

        * lib/Makefile.am: listerrors cleaning

        * lib/listerrors: removed -- generated file
        * acinclude.m4: ditto
        * sigc++/acinclude.m4: ditto

        * src/frontends/xforms/forms/form_citation.fd:
        * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
        manageable size.

        * src/frontends/xforms/forms/makefile: I renamed the `install` target
        `updatesrc` and now we have a `test` target that does what `updatesrc`
        used to do. I didn't like having an install target that wasn't related
        to the dist.

        * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
        on all except FormGraphics.  This may yet happen. Followed by a major
        cleanup including using FL_TRANSIENT for most of the dialogs.  More
        changes to come when the ButtonController below is introduced.

        * src/frontends/xforms/ButtonController.h: New file for managing up to
        four buttons on a dialog according to an externally defined policy.
        * src/frontends/xforms/Makefile.am: added above

        * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
        Apply and Cancel/Close buttons and everything in between and beyond.
        * src/frontends/Makefile.am: added above.

        * src/frontends/xforms/forms/form_preferences.fd:
        * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
        and removed variable 'status' as a result. Fixed the set_minsize thing.
        Use the new screen-font-update after checking screen fonts were changed
        Added a "Restore" button to restore the original lyxrc values while
        editing.  This restores everything not just the last input changed.
        That's still a tricky one.  As is the "LyX: this shouldn't happen..."

        * src/LyXAction.C: screen-font-update added for updating buffers after
        screen font settings have been changed.
        * src/commandtags.h: ditto
        * src/lyxfunc.C: ditto

        * forms/lyx.fd: removed screen fonts dialog.
        * src/lyx_gui.C: ditto
        * src/menus.[Ch]: ditto
        * src/lyx.[Ch]: ditto
        * src/lyx_cb.C: ditto + code from here moved to make
        screen-font-update. And people wonder why progress on GUII is
        slow.  Look at how scattered this stuff was!  It takes forever
        just find it all. 

        * forms/fdfix.sh: Fixup the spacing after commas.
        * forms/makefile: Remove date from generated files. Fewer clashes now.
        * forms/bullet_forms.C.patch: included someones handwritten changes

        * src/lyxrc.[Ch]: Added a commented out system_lyxrc.  Will use it RSN
        once I've discovered why LyXRC was made noncopyable.
        * src/lyx_main.C: ditto

2000-08-14  Angus Leeming  <a.leeming@ic.ac.uk>

        * src/frontends/xforms/forms/fdfix.sh:
        * src/frontends/xforms/forms/fdfixh.sed:
        * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
        * src/frontends/xforms/Form*.[hC]:
        * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
        scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
        provide a destructor for the struct FD_form_xxxx. Another version of
        the set_[max|min]size workaround and a few other cleanups. Actually,
        Angus' patch from 20000809.

2000-08-13      Baruch Even  <baruch.even@writeme.com>

        * src/insets/insetgraphics.C (Clone): Added several fields that needed
        copying.

2000-08-11  Juergen Vigna  <jug@sad.it>

        * src/insets/insetgraphics.C (InsetGraphics): changing init
        order because of warnings.

        * src/frontends/xforms/forms/makefile: adding patching .C with
        .C.patch files.

        * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
        from .C.patch to .c.patch

        * src/frontends/xforms/FormCommand.C (FormCommand): changing init
        order because of warning.

        * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog

        * src/frontends/Liason.C (setMinibuffer): new helper function

        * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument

        * src/lyxfunc.C (Dispatch): calling new Document-Layout

        * lib/ui/default.ui: commented out PaperLayout entry

        * src/frontends/xforms/form_document.[Ch]: new added files 
        
        * src/frontends/xforms/FormDocument.[Ch]: ditto

        * src/frontends/xforms/forms/form_document.fd: ditto

        * src/frontends/xforms/forms/form_document.C.patch: ditto

2000-08-10  Juergen Vigna  <jug@sad.it>

        * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
        (InsetGraphics): initialized cacheHandle to 0.
        (draw): changed call to updateInset to status=CHANGE_IN_DRAW.

2000-08-10      Baruch Even  <baruch.even@writeme.com>

        * src/graphics/GraphicsCache.h:
        * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work 
        correctly as a cache.

        * src/graphics/GraphicsCacheItem.h:
        * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
        reference counting.

        * src/graphics/GraphicsCacheItem_pimpl.h:
        * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
        GraphicsCacheItem.

        * src/insets/insetgraphics.h: 
        * src/insets/insetgraphics.C: Changed from using a signal notification
        to polling when image is not loaded.

2000-08-10  Allan Rae  <rae@lyx.org>

        * development/tools/makeLyXsigc.sh: Updated to allow Signal3.  Note
        that there are two functions that have to been taken out of line by
        hand and aren't taken care of in the script.  (Just a reminder note)

        * sigc++/macros/*.h.m4: Updated as above.

2000-08-09  Juergen Vigna  <jug@sad.it>

        * src/insets/insettext.C (draw): small fix for clearing rectangle.

        * src/insets/insettabular.C: make drawing of single cell smarter.

2000-08-09  Marko Vendelin <markov@ioc.ee>
        * src/frontends/gnome/Menubar_pimpl.C
        * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
        implementation: new files
        
        * src/frontends/gnome/mainapp.C
        * src/frontends/gnome/mainapp.h: Gnome main window (temporary
        implementation)

        * src/main.C: create Gnome main window

        * src/frontends/xforms/Menubar_pimpl.h
        * src/frontends/Menubar.C
        * src/frontends/Menubar.h: added method Menubar::update that calls 
        Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)

        * src/LyXView.C: calls Menubar::update to update the state
        of menu items

        * src/frontends/gnome/Makefile.am: added new files
        
        * src/frontends/Makefile.am: added frontend compiler options

2000-08-08  Juergen Vigna  <jug@sad.it>

        * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!

        * src/bufferlist.C (close): 
        * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
        documents if exiting without saving.

        * src/buffer.C (save): use removeAutosaveFile()

        * src/support/filetools.C (removeAutosaveFile): new function.

        * src/lyx_cb.C (MenuWrite): returns a bool now.
        (MenuWriteAs): check if file could really be saved and revert to the
        old name if not.
        (MenuWriteAs): removing old autosavefile if existant.

        * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
        before Goto toggle declaration, because of compiler warning.

        * src/frontends/xforms/FormRef.C: forgot include of <algorithm>

        * src/lyxfunc.C (MenuNew): small fix.

        * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.

        * src/bufferlist.C (newFile):
        * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.

        * src/lyxrc.C: added new_ask_filename tag

2000-08-07  Angus Leeming  <a.leeming@ic.ac.uk>

        * src/lyx.fd: removed code pertaining to form_ref
        * src/lyx.[Ch]: ditto
        * src/lyx_cb.C: ditto
        * src/lyx_gui.C: ditto
        * src/lyx_gui_misc.C: ditto

        * src/BufferView_pimpl.C (restorePosition): update buffer only
        if file has changed

        * src/commandtags.h (LFUN_REFTOGGLE): removed
        (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
        (LFUN_REFGOTO): renamed LFUN_REF_GOTO
        (LFUN_REFBACK): renamed LFUN_REF_BACK

        * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
        * src/menus.C: ditto
        * src/lyxfunc.C (Dispatch): ditto.
        InsertRef dialog is now GUI-independent.

        * src/texrow.C: added using std::endl;

        * src/insets/insetref.[Ch]: strip out large amounts of code.
        The inset is now a container and this functionality is now
        managed by a new FormRef dialog
        
        * src/frontends/Dialogs.h (showRef, createRef): new signals

        * src/frontends/xforms/FormIndex.[Ch],
        src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
        when setting dialog's min/max size
        * src/frontends/xforms/FormIndex.[Ch]: ditto

        * src/frontends/xforms/FormRef.[Ch],
        src/frontends/xforms/forms/form_ref.fd: new xforms
        implementation of an InsetRef dialog

        * src/graphics/GraphicsCache.[Ch]: small changes to compile with
        DEC cxx

        * src/graphics/XPM_Renderer.C (isImageFormatOK):
        ios::nocreate is not part of the standard. Removed.

2000-08-07  Baruch Even  <baruch.even@writeme.com>

        * src/graphics/Renderer.h:
        * src/graphics/Renderer.C: Added base class for rendering of different
        image formats into Pixmaps.

        * src/graphics/XPM_Renderer.h:
        * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
        in a different class.

        * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
        easily add support for other formats.

        * src/insets/figinset.C: plugged a leak of an X resource.

2000-08-07  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/CutAndPaste.[Ch]: make all metods static. 

        * development/Code_rules/Rules: more work, added section on
        Exceptions, and a References section.

        * a lot of header files: work to make doc++ able to generate the
        source documentation, some workarounds of doc++ problems. Doc++ is
        now able to generate the documentation.

2000-08-07  Juergen Vigna  <jug@sad.it>

        * src/insets/insettabular.C (recomputeTextInsets): removed function

        * src/tabular.C (SetWidthOfMulticolCell): 
        (SetWidthOfCell): 
        (calculate_width_of_column_NMC): fixed return value so that it really
        only returns true if the column-width has changed (there where
        problems with muliticolumn-cells in this column).

2000-08-04  Juergen Vigna  <jug@sad.it>

        * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
        also on the scrollstatus of the inset.
        (workAreaMotionNotify): ditto.

        * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.

2000-08-01  Juergen Vigna  <jug@sad.it>

        * src/insets/insettabular.C (resetPos): scroll tabular automatically.

        * src/commandtags.h: 
        * src/LyXAction.C (init): 
        * src/insets/inset.C (LocalDispatch): added support for
        LFUN_SCROLL_INSET.

        * src/insets/inset.C (scroll): new functions.

        * src/insets/insettext.C (removeNewlines): new function.
        (SetAutoBreakRows): removes forced newlines in the text of the
        paragraph if autoBreakRows is set to false.

        * src/tabular.C (Latex): generates a parbox around the cell contents
        if needed.

        * src/frontends/xforms/FormTabular.C (local_update): removed
        the radio_useparbox button.

        * src/tabular.C (UseParbox): new function

2000-08-06  Baruch Even  <baruch.even@writeme.com>

        * src/graphics/GraphicsCache.h:
        * src/graphics/GraphicsCache.C:
        * src/graphics/GraphicsCacheItem.h:
        * src/graphics/GraphicsCacheItem.C: Made them to actually do something
        usefull.

        * src/insets/insetgraphics.h:
        * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
        drawing of the inline image.

        * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded 
        into the wrong position.

        * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
        launched.

2000-08-05  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/translator.h: move all typedefs to public section

        * src/support/filetools.C (MakeLatexName): return string const
        (QuoteName): ditto
        (TmpFileName): ditto
        (FileOpenSearch): ditto
        (FileSearch): ditto
        (LibFileSearch): ditto
        (i18nLibFileSearch): ditto
        (GetEnv): ditto
        (GetEnvPath): ditto
        (CreateTmpDir): ditto
        (CreateBufferTmpDir): ditto
        (CreateLyXTmpDir): ditto
        (GetCWD): ditto
        (OnlyPath): ditto
        (MakeAbsPath): ditto
        (AddName): ditto
        (OnlyFilename): ditto
        (ExpandPath): ditto
        (NormalizePath): ditto
        (CleanupPath): ditto
        (GetFileContents): ditto
        (ReplaceEnvironmentPath): ditto
        (MakeRelPath): ditto
        (AddPath): ditto
        (ChangeExtension): ditto
        (MakeDisplayPath): ditto
        (do_popen): return cmdret const
        (findtexfile): return string const

        * src/support/DebugStream.h: add some /// to please doc++

        * src/frontends/DialogBase.h (endif): add some /// to please doc++

        * src/texrow.C (same_rownumber): functor to use with find_if
        (getIdFromRow): rewritten to use find_if and to not update the
        positions. return true if row is found
        (increasePos): new method, use to update positions

        * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable

        * src/lyxlex_pimpl.C (verifyTable): new method
        (pushTable): use it
        (Pimpl): use it
        (GetString): return string const
        (pushTable): rewrite to use std::stack
        (popTable): ditto
        (setFile): better check
        (setStream): ditto

        * src/lyxlex.h: make LyXLex noncopyable

        * src/lyxlex.C (text): return char const * const
        (GetString): return string const
        (getLongString): return string const

        * src/lyx_gui_misc.C (askForText): return pair<...> const

        * src/lastfiles.[Ch] (operator): return string const

        * src/buffer.C (parseSingleLyXformat2Token): pass string to
        istringstream not char const *. 
        move token.end() out of loop.
        (readFile): move initializaton of token

        * src/BufferView2.C (insertErrors): run texrow.increasePos if
        getIdFromRow is successful.

        * lib/bind/emacs.bind: don't include menus bind

        * development/Code_rules/Rules: the beginnings of making this
        better and covering more of the unwritten rules that we have.

        * development/Code_rules/Recommendations: a couple of wording
        changes. 

2000-08-04  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/support/strerror.c: remove C++ comment.

2000-08-04  Angus Leeming  <a.leeming@ic.ac.uk>

        * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
        LFUN_INDEX_INSERT_LAST

        * src/texrow.C (getIdFromRow): changed from const_iterator to
        iterator, allowing code to compile with DEC cxx

        * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
        stores part of the class, as suggested by Allan. Will allow
        multiple LyXViews.
        (apply): test to apply uses InsetCommandParams operator!=

        * src/frontends/xforms/FormIndex.C: moved set_minsize into build
        (apply): test to apply uses InsetCommandParams operator!=

        * src/frontends/xforms/FormToc.[Ch]: made vector<string>
        stores part of the class.
        (update): removed limits on min/max size.

        * src/frontends/xforms/FormUrl.C: moved set_minsize into build
        (apply): test to apply uses InsetCommandParams operator!=

        * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
        (Read, Write, scanCommand, getCommand): moved functionality
        into InsetCommandParams.
        (Clone): removed
        (getScreenLabel): made pure virtual
        new InsetCommandParams operators== and !=
        
        * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
        c-tors based on InsetCommandParams. Removed others.
        * src/insets/insetinclude.[Ch]: ditto
        * src/insets/insetlabel.[Ch]: ditto
        * src/insets/insetparent.[Ch]: ditto
        * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
        
        * src/buffer.C (parseSingleLyXformat2Token, readInset): all
        insets derived from InsetCommand created using similar c-tors
        based on InsetCommandParams
        * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
        * src/menus.C (ShowRefsMenu): ditto
        * src/paragraph.C (Clone): ditto
        * src/text2.C (SetCounter): ditto
        * src/lyxfunc.C (Dispatch) ditto
        Also recreated old InsetIndex behaviour exactly. Can now
        index-insert at the start of a paragraph and index-insert-last
        without launching the pop-up.

2000-08-03  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * lib/lyxrc.example: mark te pdf options as non functional.

        * src/support/lstrings.C (strToInt): move initalization of tmpstr
        (isStrDbl): move tmpstr.end() out of loop.
        (strToDbl): move intialization of tmpstr
        (lowercase): return string const and move tmp.end() out of loop.
        (uppercase): return string const and move tmp.edn() out of loop.
        (prefixIs): add assertion
        (suffixIs): ditto
        (contains): ditto
        (contains): ditto
        (contains): ditto
        (containsOnly): ditto
        (containsOnly): ditto
        (containsOnly): ditto
        (countChar): make last arg char not char const
        (token): return string const
        (subst): return string const, move tmp.end() out of loop.
        (subst): return string const, add assertion
        (strip): return string const
        (frontStrip): return string const, add assertion
        (frontStrip): return string const
        (split): ditto
        (split): ditto
        (rsplit): ditto

        * src/support/lstrings.C: add inclde "LAssert.h"
        (isStrInt): move tmpstr.end() out of loop.

        * src/frontends/xforms/Toolbar_pimpl.C (activate): move
        toollist.end() out of loop.
        (deactivate): move toollist.end() out of loop.
        (update): move toollist.end() out of loop.
        (updateLayoutList): move tc.end() out of loop.
        (add): move toollist.end() out of loop.

        * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
        md.end() out of loop.

        * src/texrow.h: make getIdFromRow const, make rowlist mutable.

        * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
        of loop.

        * src/paragraph.C (Erase): move fontlist.end() out of loop.
        (Erase): move insetlist.end() out of loop.

        * src/lyx_sendfax_main.C: make show_logfile static and to take a
        ref to const string as first arg. Move initialization of some
        variables, whitespace changes.

        * src/kbmap.C (defkey): move table.end() out of loop.
        (kb_keymap): move table.end() out of loop.
        (findbinding): move table.end() out of loop.

        * src/MenuBackend.C (hasMenu): move end() out of loop.
        (getMenu): move end() out of loop.
        (getMenu): move menulist_.end() out of loop.

        * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.

        * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
        out of loop.

        * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
        (getFromLyXName): move infotab.end() out of loop.

        * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
        -fvtable-thunks -ffunction-sections -fdata-sections 

2000-08-03  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
        FORMS_H_LOCATION.

2000-08-03  Angus Leeming  <a.leeming@ic.ac.uk>

        * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed

        * src/frontends/xforms/FormCitation.[Ch],
        src/frontends/xforms/FormIndex.[Ch],
        src/frontends/xforms/FormToc.[Ch],
        src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()

2000-08-03  Angus Leeming  <a.leeming@ic.ac.uk>

        * src/commandtags.h: renamed, created some flags for citation
        and index

        * src/lyx_gui_misc.C: stripped out old FD_index_form code

        * src/lyxfunc.C (dispatch): use signals to insert index entry
        
        * src/frontends/Dialogs.h: new signal createIndex

        * src/frontends/xforms/FormCommand.[Ch],
        src/frontends/xforms/FormCitation.[Ch],
        src/frontends/xforms/FormToc.[Ch],
        src/frontends/xforms/FormUrl.[Ch]: clean up and comment better

        * src/insets/insetindex.[Ch]: GUI-independent

        * src/frontends/xforms/FormIndex.[Ch],
        * src/frontends/xforms/forms/form_index.fd: xforms implementation
        of the Index dialog
        
2000-08-01  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect 
        before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
        
2000-08-02  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/insets/insetref.C (Latex): rewrite so that there is now
        question that a initialization is requested.

        * src/insets/insetcommand.h: reenable the hide signal

2000-08-01  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
        fix handling of shortcuts (many bugs :)
        (add_lastfiles): ditto.

        * lib/ui/default.ui: fix a few shortcuts.

2000-07-27  Kayvan A. Sylvan  <kayvan@sylvan.com>

        * Makefile.am: Fix ``rpmdist'' target to return the exit
        status of the ``rpm'' command, instead of the last command in
        the chain (the ``rm lyx.xpm'' command, which always returns
        success).

2000-08-02  Allan Rae  <rae@lyx.org>

        * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
        * src/frontends/xforms/FormCitation.C (FormCitation): ditto
        * src/frontends/xforms/FormToc.C (FormToc): ditto

        * src/frontends/xforms/Makefile.am: A few forgotten files

        * src/frontends/xforms/FormCommand.C (showInset): The rest of the
        Signals-not-copyable-problem Lars' started commenting out.

        * src/frontends/xforms/form_toc.[hC]: new files.  TOC crashes lyx.

2000-08-01  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/insets/insetcommand.h: Signals is not copyable so anoter
        scheme for automatic hiding of forms must be used.

        * src/frontends/xforms/FormCitation.h: don't inerit from
        noncopyable, FormCommand already does that.
        * src/frontends/xforms/FormToc.h: ditto
        * src/frontends/xforms/FormUrl.h: ditto

        * src/frontends/xforms/FormCitation.C: add include <algorithm>

2000-08-01  Angus Leeming  <a.leeming@ic.ac.uk>

        * src/insets/insetcommand.h (hide): new SigC::Signal0
        (d-tor) new virtual destructor emits hide signal

        * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
        * src/insets/inseturl.[Ch]  (hide, d-tor): ditto

        * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
        LOF and LOT. Inset is now GUI-independent

        * src/insets/insetloa.[Ch]: redundant
        * src/insets/insetlof.[Ch]: ditto
        * src/insets/insetlot.[Ch]: ditto
        
        * src/frontends/xforms/forms/form_url.fd: tweaked!
        * src/frontends/xforms/forms/form_citation.fd: ditto

        * src/frontends/xforms/FormCommand.[Ch]: new base class to those
        dialogs dealing with InsetCommand insets

        * src/frontends/xforms/FormCitation.[Ch]: now makes use of
        FormCommand base class
        * src/frontends/xforms/FormUrl.[Ch]: ditto

        * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
        of the TOC dialog
        * src/frontends/xforms/FormToc.[Ch]: ditto

        * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
        passed a generic InsetCommand pointer
        * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc

        * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
        and modified InsetTOC class
        * src/buffer.C: ditto            

        * forms/lyx.fd: strip out old FD_form_toc code
        * src/lyx_gui_misc.C: ditto
        * src/lyx_gui.C: ditto
        * src/lyx_cb.C: ditto
        * src/lyx.[Ch]: ditto
                         
2000-08-01  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/utility.hpp: tr -d '\r'

2000-08-01  Juergen Vigna  <jug@sad.it>

        * src/insets/insettabular.h: removed initFeatures() as it's not needed.

        * src/commandtags.h: 
        * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
        LFUN_TABULAR_FEATURES.

        * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
        LFUN_LAYOUT_TABULAR.

        * src/insets/insettabular.C (getStatus): implemented helper function.

        * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.

2000-07-31  Juergen Vigna  <jug@sad.it>

        * src/text.C (draw): fixed screen update problem for text-insets.

        * src/text2.C (SetParagrpah): call an update of the inset-owner when
        something changed probably this has to be added in various other
        functions too.

        * src/insets/insettext.C (cy): fixed to give back the right cursor.y().

2000-07-31  Baruch Even <baruch.even@writeme.com>

        * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
        templates to satisfy compaq cxx.


2000-07-31  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/translator.h (equal_1st_in_pair::operator()): take
        const ref pair_type as arg. 
        (equal_2nd_in_pair::operator()): ditto
        (Translator::~Translator): remove empty d-tor.

        * src/graphics/GraphicsCache.C: move include config.h to top, also
        put initialization of GraphicsCache::singleton here.
        (~GraphicsCache): move here
        (addFile): take const ref as arg
        (removeFile): ditto

        * src/lyxlex_pimpl.C (setFile): comment in old behaviour

        * src/BufferView2.C (insertLyXFile): change te with/without header
        check slightly.

2000-07-31  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/frontends/xforms/FormGraphics.C (apply): add some
        static_cast. Not very nice, but required by compaq cxx.

        * src/frontends/xforms/RadioButtonGroup.h: include header
        <utility> instead of <pair.h>

        * src/insets/insetgraphicsParams.C: add using directive. 
        (readResize): change return type to void. 
        (readOrigin): ditto.

        * src/lyxfunc.C (getStatus): add missing break for build-program
        function; add test for Literate for export functions.

        * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
        entries in Options menu.

2000-07-31  Baruch Even <baruch.even@writeme.com>

        * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
        protect against auto-allocation; release icon when needed.

2000-07-31  Matej Cepl <CeplM@seznam.cz>

        * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
        on usual typewriter.

        * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
        earlier czech.kmap), useful only for programming.

2000-07-28  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/frontends/xforms/FormCitation.h: fix conditioning around
        #pragma. 

2000-07-31  Juergen Vigna  <jug@sad.it>

        * src/frontends/xforms/FormTabular.C (local_update): changed
        radio_linebreaks to radio_useparbox and added radio_useminipage.

        * src/tabular.C: made support for using minipages/parboxes.

        * src/bufferlist.C (QwriteAll): small fix for asking for save.

        * src/insets/insetgraphics.C (draw): just draw the inset so that the
        cursor is visible.
        (descent): so the cursor is in the middle.
        (width): bit smaller box.

        * src/insets/insetgraphics.h: added display() function.

2000-07-31  Baruch Even <baruch.even@writeme.com>

        * src/frontends/Dialogs.h: Added showGraphics signals.
    
        * src/frontends/xforms/forms/form_graphics.fd: Added file, the
                    xforms form definition of the graphics dialog.

        * src/frontends/xforms/FormGraphics.h: 
        * src/frontends/xforms/FormGraphics.C: Added files, the
        GUIndependent code of InsetGraphics
    
        * src/insets/insetgraphics.h: 
        * src/insets/insetgraphics.C: Major writing to make it work.

        * src/insets/insetgraphicsParams.h:     
        * src/insets/insetgraphicsParams.C: Added files, parameter passing
        struct between InsetGraphics and GUI.

        * src/LaTeXFeatures.h:
        * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
        support for graphicx package. 

        * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
        for the graphics inset.

        * src/support/translator.h: Added file, used in
        InsetGraphicsParams. this is a template to translate between two
        types.

        * src/frontends/xforms/RadioButtonGroup.h: 
        * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
        way to easily control a radio button group.

2000-07-28  Juergen Vigna  <jug@sad.it>

        * src/insets/insettabular.C (LocalDispatch): 
        (TabularFeatures): added support for lyx-functions of tabular features.
        (cellstart): refixed this function after someone wrongly changed it.

        * src/commandtags.h:
        * src/LyXAction.C (init): added support for tabular-features

2000-07-28  Allan Rae  <rae@lyx.org>

        * src/frontends/xforms/FormPreferences.C (build): Setup input return
        checking.  NOTE: It seems that pressing ESC to cancel the dialog also
        triggers the callback for input checking. As a result we sometimes get
        "LyX: This shouldn't happen..." printed to cerr.
        (input): Started using status variable since I only free() on 
        destruction.  Some input checking for paths and font sizes.

        * src/frontends/xforms/FormPreferences.h: Use status to control 
        activation of Ok and Apply

        * src/frontends/xforms/forms/form_preferences.fd: Setup input return
        callback.  Also resized to stop segfaults with 0.88.  The problem is
        that xforms-0.88 requires the folder to be wide enough to fit all the
        tabs.  If it isn't it causes all sorts of problems.

        * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...

        * src/frontends/xforms/forms/README: Reflect reality.

        * src/frontends/xforms/forms/fdfix.sh: Clean up comments
        * src/frontends/xforms/forms/makefile: ditto.

        * src/commandtags.h: Get access to new Preferences dialog
        * src/LyXAction.C: ditto
        * src/lyxfunc.C: ditto
        * lib/ui/default.ui: ditto

2000-07-27  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.

        * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
        few files.

        * src/frontends/xforms/form_url.[Ch]: added.

2000-07-27  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/insets/insetbib.h: fixed bug in previous commit

        * src/frontends/xforms/FormUrl.h: ditto

        * src/frontends/xforms/FormPrint.h: ditto

        * src/frontends/xforms/FormPreferences.h: ditto

        * src/frontends/xforms/FormCopyright.h: ditto

        * src/frontends/xforms/FormCitation.C: ditto

        * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
        private copyconstructor and private default contructor

        * src/support/Makefile.am: add utility.hpp

        * src/support/utility.hpp: new file from boost

        * src/insets/insetbib.h: set owner in clone

        * src/frontends/xforms/FormCitation.C: added missing include
        algorithm

        * src/insets/form_url.[Ch]: removed

2000-07-26  Kayvan A. Sylvan <kayvan@sylvan.com>

        * development/lyx.spec.in
        * Makefile.am: Fix buglet for LyX RPM generation resulting from
        file/directory re-organization.
                
2000-07-26  Angus Leeming  <a.leeming@ic.ac.uk>

        * src/insets/insetcommand.[Ch]: moved the string data and
        associated manipulation methods into a new stand-alone class
        InsetCommandParams. This class has two additional methods
        getAsString() and setFromString() allowing the contents to be
        moved around as a single string.
        (addContents) method removed.
        (setContents) method no longer virtual.

        * src/buffer.C (readInset): made use of new InsetCitation,
        InsetUrl constructors based on InsetCommandParams.

        * src/commandtags.h: add LFUN_INSERT_URL

        * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
        independent InsetUrl and use InsetCommandParams to extract
        string info and create new Insets.

        * src/frontends/Dialogs.h: add signals showUrl, createUrl.

        * src/frontends/xforms/FormCitation.C (apply): uses 
        InsetCommandParams.

        * src/frontends/xforms/form_url.C
        * src/frontends/xforms/form_url.h
        * src/frontends/xforms/FormUrl.h
        * src/frontends/xforms/FormUrl.C
        * src/frontends/xforms/forms/form_url.fd: new files

        * src/insets/insetcite.[Ch]: removed unused constructors.

        * src/insets/insetinclude.[Ch]: no longer store filename

        * src/insets/inseturl.[Ch]: GUI-independent.

2000-07-26  Juergen Vigna  <jug@sad.it>
        * renamed frontend from gtk to gnome as it is that what is realized
        and did the necessary changes in the files.
        
2000-07-26  Marko Vendelin <markov@ioc.ee>
        * autogen.sh
        * configure.in: cleaning up gnome configuration scripts

2000-07-26  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
        shortcuts syndrom by redrawing them explicitely (a better solution
        would be appreciated).

        * src/lyxfunc.C (getStatus): fix crash when functions are disabled.

        * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
        the button.

        * src/lyx_cb.C (MenuExport): change html export to do the right
        thing depending of the document type (instead of having
        html-linuxdoc and html-docbook).
        * src/lyxfunc.C (getStatus): update for html
        * lib/ui/default.ui: simplify due to the above change.
        * src/menus.C (ShowFileMenu): update too (in case we need it).

        * src/MenuBackend.C (read): if a menu is defined twice, add the
        new entries to the exiting one.

2000-07-26  Juergen Vigna  <jug@sad.it>

        * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().

        * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
        and return a bool if it did actual save the file.
        (AutoSave): don't autosave a unnamed doc.

        * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
        check if this is an UNNAMED new file and react to it.
        (newFile): set buffer to unnamed and change to not mark a new
        buffer dirty if I didn't do anything with it.

        * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.

2000-07-26  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/frontends/Menubar.h: make "struct Pimpl;" public + the
        friend as per Angus's patch posted to lyx-devel.

        * src/ext_l10n.h: updated

        * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
        gettext on the style string right before inserting them into the
        combox. 

        * autogen.sh: add code to extract style strings form layout files,
        not good enough yet. 

        * src/frontends/gtk/.cvsignore: add MAKEFILE

        * src/MenuBackend.C (read): run the label strings through gettext
        before storing them in the containers.

        * src/ext_l10n.h: new file 

        * autogen.sh : generate the ext_l10n.h file here

2000-07-25  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
        arguments. 

        * lib/ui/default.ui: fix a couple of typos.

        * config/gnome/gtk.m4: added (and added to the list of files in 
        autogen.sh).

        * src/insets/insetinclude.C (unique_id): fix when we are using
        lyxstring instead of basic_string<>. 
        * src/insets/insettext.C (LocalDispatch): ditto.
        * src/support/filetools.C: ditto.

        * lib/configure.m4: create the ui/ directory if necessary.

        * src/LyXView.[Ch] (updateToolbar): new method.

        * src/BufferView_pimpl.C (buffer): update the toolbar when
        opening/closing buffer.

2000-07-24  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/LyXAction.C (getActionName): enhance to return also the name
        and options of pseudo-actions.
        (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".

        * lib/ui/default.ui: use OptItem in the vc submenu (intented just
        as an example of what is possible). Used in File->Build too (more
        useful) and in the import/export menus (to mimick the complicated
        handling of linuxdoc and friends). Try to update all the entries.

        * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
        optional entries.

        * src/MenuBackend.C (read): Parse the new OptItem tag.

        * src/MenuBackend.h: Add a new optional_ data member (used if the
        entry should be omitted when the lyxfunc is disabled).

        * src/frontends/xforms/Menubar_pimpl.C (string_width): new
        function, used as a shortcut.
        (create_submenu): align correctly the shortcuts on the widest
        entry.
        
        * src/MenuBackend.h: MenuItem.label() only returns the label of
        the menu without shortcut; new method shortcut().
        
2000-07-14  Marko Vendelin <markov@ioc.ee>

        * src/frontends/gtk/Dialogs.C:
        * src/frontends/gtk/FormCopyright.C:
        * src/frontends/gtk/FormCopyright.h:
        * src/frontends/gtk/Makefile.am: added these source-files for the
        Gtk/Gnome support of the Copyright-Dialog.

        * src/main.C: added Gnome::Main initialization if using
        Gtk/Gnome frontend-GUI.

        * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
        frontend-GUI.
        * config/gnome/aclocal-include.m4
        * config/gnome/compiler-flags.m4
        * config/gnome/curses.m4
        * config/gnome/gnome--.m4
        * config/gnome/gnome-bonobo-check.m4
        * config/gnome/gnome-common.m4
        * config/gnome/gnome-fileutils.m4
        * config/gnome/gnome-ghttp-check.m4
        * config/gnome/gnome-gnorba-check.m4
        * config/gnome/gnome-guile-checks.m4
        * config/gnome/gnome-libgtop-check.m4
        * config/gnome/gnome-objc-checks.m4
        * config/gnome/gnome-orbit-check.m4
        * config/gnome/gnome-print-check.m4
        * config/gnome/gnome-pthread-check.m4
        * config/gnome/gnome-support.m4
        * config/gnome/gnome-undelfs.m4
        * config/gnome/gnome-vfs.m4
        * config/gnome/gnome-x-checks.m4
        * config/gnome/gnome-xml-check.m4
        * config/gnome/gnome.m4
        * config/gnome/gperf-check.m4
        * config/gnome/gtk--.m4
        * config/gnome/linger.m4
        * config/gnome/need-declaration.m4: added configuration scripts
        for Gtk/Gnome frontend-GUI

        * configure.in: added support for the --with-frontend=gtk option

        * autogen.sh: added config/gnome/* to list of config-files

        * acconfig.h: added define for GTKGUI-support

        * config/lyxinclude.m4: added --with-frontend[=value] option value
        for Gtk/Gnome frontend-GUI support.
                            
2000-07-25  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
        can be used.
        (suffixIs): ditto

        * src/paragraph.C (GetChar): remove non-const version

        * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
        (search_kw): use it.

        * src/lyx_main.C (init): if "preferences" exist, read that instead
        of "lyxrc".
        (ReadRcFile): return bool if the file could be read ok.
        (ReadUIFile): add a check to see if lex file is set ok.

        * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
        bastring can be used instead of lyxstring (still uses the old code
        if std::string is good enough or if lyxstring is used.)

        * src/encoding.C: make the arrays static, move ininle functions
        here
        * src/encoding.h: from here.

        * src/buffer.C: have last_isnet_read as a file scope variable for now.
        (parseSingleLyXformat2Token): move inset parsing to separate method
        (readInset): new private method

        * src/Variables.h: remove virtual from get().

        * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
        access to NEW_INSETS and NEW_TABULAR

        * src/MenuBackend.h: remove superfluous forward declaration of
        MenuItem. Add documentations tags "///", remove empty MenuItem
        destructor, remove private default contructor.

        * src/MenuBackend.C (MenuItem): remove unneeded copy contructor 
        (add): return *this
        (read): more string mlabel and mname to where they are used
        (read): remove unused variables mlabel and mname
        (defaults): unconditional clear, make menusetup take advantage of
        add returning Menu &.

        * src/LyXView.h: define NEW_MENUBAR as default

        * src/LyXAction.C: include lyxparagraph.h temporary to get access
        to NEW_INSETS and NEW_TABULAR.
        (init): commetn out some funcs that is obsolete when NEW_INSETS is
        defined. Change some of the "xxxx-inset-insert" functions names to
        "xxxx-insert".

        * several files: more enahncements to NEW_INSETS and the resulting
        LyXParagraph code.
        
        * lib/lyxrc.example (\date_insert_format): move to misc section 

        * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
        bastring and use AC_CACHE_CHECK. 
        (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
        the system have the newest methods. uses AC_CACHE_CHECK 
        (LYX_CXX_MUTABLE): use AC_CACHE_CHECK 
        (LYX_CXX_PARTIAL): use AC_CACHE_CHECK 
        (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK

        * configure.in: add LYX_CXX_GOOD_STD_STRING

        * acinclude.m4: recreated

2000-07-24  Amir Karger

        * README: add Hebrew, Arabic kmaps
        * ANNOUNCE: typo

2000-07-24  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/buffer.C (writeFileAscii): Define actcell as an int instead
        of int*.

2000-07-23  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * Lot of files: add pragma interface/implementation.
        
        * src/lyx_main.C (ReadUFile): new method. Read the UI file.

        * lib/ui/default.ui: new file (ans new directory). Contains the
        default menu and toolbar.

        * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
        global space. Toolbars are now read (as menus) in ui files. 

        * src/debug.C: change Debug::TOOLBAR to Debug::GUI.

        * src/lyxfunc.C (getStatus): do not exit immediately if a command
        is disabled because the document is read-only. We want to have the
        toggle state of the function anyway.
        (getStatus): add code for LFUN_VC* functions (mimicking what is
        done in old-style menus)
        
        * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
        LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.

        * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
        * src/BufferView_pimpl.C: ditto. 
        * src/lyxfunc.C: ditto.         

        * src/LyXView.h: add a define NEW_MENUBAR (commented out by
        default). This replaces old-style menus by new ones.
        
        * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
        MenuItem. Contain the data structure of a menu.

        * src/insets/insettext.C: use LyXView::setLayout instead of
        accessing directly the toolbar combox.
        * src/lyxfunc.C (Dispatch): ditto.

        * src/LyXView.C (setLayout): new method, which just calls
        Toolbar::setLayout(). 
        (updateLayoutChoice): move part of this method in Toolbar.

        * src/toolbar.[Ch]: removed.
        
        * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
        implementation the toolbar. 

        * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
        the toolbar. It might make sense to merge it with ToolbarDefaults
        later. 
        (setLayout): new function. 
        (updateLayoutList): ditto.
        (openLayoutList): ditto.
        
        * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
        xforms implementation of the toolbar.
        (get_toolbar_func): comment out, since I do not
        know what it is good for. 
        
        * src/ToolbarDefaults.h: Add the ItemType enum.

        * src/support/StrPool.[Ch]: new class. Acts as a reference holder
        for a list of allocated C strings. Used in Menubar xforms
        implementation to avoid memory leaks.

        * src/support/lstrings.[Ch] (uppercase): new version taking and
        returning a char.
        (lowercase): ditto.

        * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
        * lib/bind/emacs.bind: ditto.

2000-07-21  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
        forward decl of LyXView.

        * src/toolbar.C (toolbarItem): moved from toolbar.h
        (toolbarItem::clean): ditto
        (toolbarItem::~toolbarItem): ditto
        (toolbarItem::operator): ditto

        * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff

        * src/paragraph.h: control the NEW_TABULAR define from here

        * src/buffer.C: remove define USE_PARSE_FUNCTION, change
        USE_TABULAR_INSETS to NEW_TABULAR

        * src/ToolbarDefaults.C: add include "lyxlex.h"

        * files using the old table/tabular: use NEW_TABULAR to control
        compilation of old tabular stuff. 

        * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
        to correct place.

        * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
        planemet in reading of old style floats, fix the \end_deeper
        problem when reading old style floats. 

2000-07-20  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif

2000-07-20  Serge Winitzki <winitzki@erebus.phys.cwru.edu>

        * lib/bind/sciword.bind: updated.

2000-07-20  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
        layout write problem

2000-07-20  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/Makefile.am (INCLUDES): remove image directory from include
        path. 

        * src/bullet_forms.C (create_form_form_bullet): small cleanup.
        * src/bullet_forms_cb.C (BulletPanelCB): ditto.

        * src/LyXView.C (create_form_form_main): read the application icon
        from the disk.

        * lib/images/*.xpm: change the icons to use transparent color for
        background. 

        * src/toolbar.C (update): change the color of the button when it
        is toggled on.

2000-07-20  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
        setting explicitely the minibuffer.
        * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.

        * src/LyXView.C (showState): new function. Shows font information
        in minibuffer and update toolbar state.
        (LyXView): call Toolbar::update after creating the
        view. 

        * src/toolbar.C: change toollist to be a vector instead of a
        linked list.
        (BubbleTimerCB): get help string directly from the callback
        argument of the corresponding icon (which is the action) 
        (set): remove unnecessary ugliness.
        (update): new function. update the icons (depressed, disabled)
        depending of the status of the corresponding action.
        
        * src/toolbar.h: remove help in toolbarItem

2000-07-19  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/Painter.C (text): Added code for using symbol glyphs from
        iso10646 fonts. Currently diabled.

        * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
        symbol_encoding.

        * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
        magyar,turkish and usorbian.

        * src/paragraph.C (isMultiLingual): Made more efficient.

        * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
        keyboard.

        * src/mathed/math_symbols.C (math_insert_greek): Changed to use
        LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
        Also changed the prototype to "bool math_insert_greek(char)".
                                                                       
2000-07-19  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * lots of files: apply the NEW_INSETS on all code that will not be
        needed when we move to use the new insets. Enable the define in
        lyxparagrah.h to try it.
        
        * src/insets/insettabular.C (cellstart): change to be a static
        inline function
        (InsetTabular): initialize buffer in the initializer list.

2000-07-19  Angus Leeming  <a.leeming@ic.ac.uk>

        * src/frontends/xforms/FormPrint.[Ch] : moved #include
        form_print.h out of the header file. Replaced with forward
        declarations of the relevant struct.

        * src/frontends/xforms/FormPreferences.[Ch] : ditto for
        form_preferences.h.

        * src/commandtags.h: do not include "debug.h" which does not
        belong there. #include it in some other places because of this
        change. 

2000-07-19  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/insets/insetcaption.C: add a couple "using" directives.

        * src/toolbar.C (add): get the help text directly from lyxaction.
        (getPixmap): nuked.
        (setPixmap): new function. Loads from disk and sets a pixmap on a
        botton; the name of the pixmap file is derived from the command
        name. 

        * src/toolbar.h: remove members isBitmap and pixmap from
        toobarItem struct. 

        * lib/images/*.xbm *_bw.xpm: remove (not used any more).
        * lib/images/: move many files from images/banner.xpm.

        * src/lyx_gui.C (create_forms): read banner pixmap from file.

        * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
        * src/toolbar.C: ditto.
        * configure.in: ditto.
        * INSTALL: document. 

        * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
        the spellchecker popup is closed from the WM.

2000-07-19  Juergen Vigna  <jug@sad.it>

        * src/insets/insetfloat.C (Write): small fix because we use the
        insetname for the type now!

2000-07-18  Angus Leeming  <a.leeming@ic.ac.uk>

        * src/frontends/xforms/forms/form_citation.fd: object sizes are
        now set here

        * src/frontends/Dialogs.h: removed hideCitation signal

        * src/insets/insetcite.h: added hide signal

        * src/insets/insetcite.C (~InsetCitation): emits new signal
        (getScreenLabel): "intelligent" label should now fit on the screen!

        * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed

        * src/frontends/xforms/FormCitation.C (showInset): connects
        hide() to the inset's hide signal
        (show): modified to use fl_set_object_position rather than
        fl_set_object_geometry wherever possible
        
2000-07-18  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/insets/lyxinset.h: add caption code

        * src/insets/insetfloat.C (type): new method

        * src/insets/insetcaption.C (Write): new method
        (Read): new method
        (LyxCode): new method

        * src/text2.C (SetCounter): revert Jürgens code, but use his idea
        to get it right together with using the FloatList.

        * src/commandtags.h: add LFUN_INSET_CAPTION
        * src/lyxfunc.C (Dispatch): handle it

        * src/buffer.C (parseSingleLyXformat2Token): add code to read a
        caption inset.

        * src/Variables.[Ch]: make expand take a const reference, remove
        the destructor, some whitespace changes.

        * src/LyXAction.C (init): add caption-inset-insert

        * src/FloatList.C (FloatList): update the default floats a bit.

2000-07-17  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/Variables.[Ch]: new files. Intended to be used for language
        specific strings (like \chaptername) and filename substitution in
        commands. 

        * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
        kmap files.
        * lib/kbd/american.kmap: update

        * src/trans_mgr.C (normalkey): do not test allowAccent anymore.

        * src/bufferparams.[Ch]: remove member allowAccents.

        * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.

        * src/LaTeXLog.C: use the log_form.h header.
        * src/lyx_gui.C: ditto.
        * src/lyx_gui_misc.C: ditto.
        * src/lyxvc.h: ditto.

        * forms/log_form.fd: new file, created from latexoptions.fd. I
        kept the log popup and nuked the options form.

        * src/{la,}texoptions.[Ch]: removed.
        * src/lyx_cb.C (LaTeXOptions): ditto

        * src/lyx_gui.C (create_forms): do not handle the
        fd_latex_options form. 

2000-07-18  Juergen Vigna  <jug@sad.it>

        * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
        name of the inset so that it can be requested outside (text2.C).

        * src/text2.C (SetCounter): modified so it sees insetfloat for caption
        labels.

2000-07-17  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/mathed/formula.h (ConvertFont): constify

        * src/mathed/formula.C (Read): add warning if \end_inset is not
        found on expected place.

        * src/insets/lyxinset.h (ConvertFont): consify

        * src/insets/insetquotes.C (ConvertFont): constify
        * src/insets/insetquotes.h: ditto

        * src/insets/insetinfo.h: add labelfont

        * src/insets/insetinfo.C (InsetInfo): set the labelfont
        (ascent): use labelfont
        (descent): likewise
        (width): likewise
        (draw): likewise
        (Write): make .lyx file a bit nicer

        * src/insets/insetfloat.C (Write): simplify somewhat...
        (Read): add warning if arg is not found

        * src/insets/insetcollapsable.C: add using std::max
        (Read): move string token and add warning in arg is not found
        (draw): use std::max to get the right ty
        (getMaxWidth): simplify by using std::max

        * src/insets/insetsection.h: new file
        * src/insets/insetsection.C: new file
        * src/insets/insetcaption.h: new file
        * src/insets/insetcaption.C: new file

        * src/insets/inset.C (ConvertFont): constify signature

        * src/insets/Makefile.am (libinsets_la_SOURCES): add
        insetcaption.[Ch] and insetsection.[Ch]

        * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
        uses to use LABEL_COUNTER_CHAPTER instead.
        * src/text2.C (SetCounter): here

        * src/counters.h: new file
        * src/counters.C: new file
        * src/Sectioning.h: new file
        * src/Sectioning.C: new file

        * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]

2000-07-17  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
        not always in "."!

        * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
        the last argument.

2000-07-17  Juergen Vigna  <jug@sad.it>

        * src/tabular.C (Validate): check if array-package is needed.
        (SetVAlignment): added support for vertical alignment.
        (SetLTFoot): better support for longtable header/footers
        (Latex): modified to support added features.

        * src/LaTeXFeatures.[Ch]: added array-package.

2000-07-17  R. Lahaye  <lahaye@postech.ac.kr>

        * src/lyx_gui.C (LyXGUI): make sure that the height is large
        enough. 

2000-07-17  Kayvan Sylvan <ksylvan@synopsys.com>

        * configure.in: do not forget to put a space after -isystem.

2000-07-10  Dekel Tsur  <dekel@math.tau.ac.il>

        * lib/kbd/arabic.kmap: a few fixes.

2000-07-16  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * some whitespace chagnes to a number of files.
        
        * src/support/DebugStream.h: change to make it easier for
        doc++ to parse correctly.
        * src/support/lyxstring.h: ditto

        * src/mathed/math_utils.C (compara): change to have only one
        operator()
        (MathedLookupBOP): change because of the above.

        * src/mathed/math_delim.C (math_deco_compare): change to have only
        one operator()
        (search_deco): change becasue of the above.

        * src/insets/insettabular.C (DrawCellSelection): use std::swap
        instead of manually coded one.

        * src/insets/insetquotes.C (Read): read the \end_inset too

        * src/insets/insetlatex.h: remove file
        * src/insets/insetlatex.C: remove file
        
        * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
        constructor 
        (InsetPrintIndex): remove destructor

        * src/insets/insetinclude.h: remove default constructor

        * src/insets/insetfloat.C: work to make it work better

        * src/insets/inseterror.[Ch] (InsetError): remove default constructor

        * src/insets/insetcite.h (InsetCitation): remove default constructor

        * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor

        * src/text.C (GetColumnNearX): comment out some currently unused code.

        * src/paragraph.C (writeFile): move some initializations closer to
        first use.
        (CutIntoMinibuffer): small change to use new matchIT operator
        (Erase): ditto
        (Erase): ditto
        (InsertChar): ditto
        (InsertInset): ditto
        (GetInset): ditto
        (GetInset): ditto
        (InsetIterator): ditto
        (Erase): small change to use new matchFT operator
        (InsertChar): ditto
        (GetFontSettings): ditto
        (HighestFontInRange): ditto
        (SetFont): ditto

        * src/lyxparagraph.h: some chars changed to value_type
        (matchIT): because of some stronger checking (perhaps too strong)
        in SGI STL, the two operator() unified to one.
        (matchFT): ditto

        * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved

        * src/buffer.C (parseSingleLyXformat2Token): static string to hold
        the last inset read added
        (parseSingleLyXformat2Token): some more (future) compability code added
        (parseSingleLyXformat2Token): warning about solitary \end_inset added
        (parseSingleLyXformat2Token): set last_inset_read
        (parseSingleLyXformat2Token): more code to read new "Float" correctly
        (parseSingleLyXformat2Token): don't double intializw string next_token

        * src/TextCache.C (text_fits::operator()): add const's to the signature
        (has_buffer::operator()): ditto

        * src/Floating.h: add some comments on the class

        * src/FloatList.[Ch] (typeExist): new method
        (getType): ditto

        * src/BackStack.h: added default constructor, wanted by Gcc.

2000-07-14  Juergen Vigna  <jug@sad.it>

        * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.

        * src/frontends/xforms/forms/form_tabular.fd: updated a bit.

        * src/insets/insettabular.C (resizeLyXText): need this to be able to
        do a redraw when the window is resized!
        (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.

        * src/insets/insettext.C (resizeLyXText): added function to correctly
        being able to resize the LyXWindow.

        * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)

2000-07-13  Angus Leeming  <a.leeming@ic.ac.uk>

        * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
        crashes when closing dialog to a deleted inset.

        * src/insets/insetcite.[Ch] (Edit) : the return of this former
        method! Now similar to other insets.

2000-07-13  Juergen Vigna  <jug@sad.it>

        * src/text.C (GetVisibleRow): fixed clearing of rows with insets!

        * lib/examples/Literate.lyx: small patch!

        * src/insets/insetbib.C (Read): added this function because of wrong
        Write (without [begin|end]_inset).

2000-07-11  Juergen Vigna  <jug@sad.it>

        * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
        as the insertInset could not be good!

        * src/screen.C (ToggleSelection): fixed toggle selection bug as
        the bool param should not be last.

2000-07-10  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * sigc++/configure.in: fix bug in threading-related code (Yes, I
        did submit that to Karl).

        * configure.in: use -isystem instead of -I for X headers. This
        fixes a problem on solaris with a recent gcc; 
        put the front-end code after the X detection code;
        configure in sigc++ before lib/

        * src/lyx_main.C (commandLineHelp): remove -display from command
        line help.

2000-07-09  Kayvan A. Sylvan  <kayvan@sylvan.com>

        * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
        Also put in Makefile rules for building the ``listerrors''
        program for parsing errors from literate programs written in LyX.

        * lib/build-listerrors: Added small shell script as part of compile
        process. This builds a working ``listerrors'' binary if noweb is
        installed and either 1) the VNC X server is installed on the machine,
        or 2) the user is compiling from within a GUI. The existence of a GUI
        is necessary to use the ``lyx --export'' feature for now. This
        hack can be removed once ``lyx --export'' no longer requires a GUI to
        function.

2000-07-09  Bernard Michael Hurley <bernardh@westherts.ac.uk>

        * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
        now passed back correctly from gcc and placed "under" error
        buttons in a Literate LyX source.

2000-07-08  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/text.C (GetColumnNearX): Better behavior when a RTL
        paragraph is ended by LTR text.

        * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
        Ditto

2000-07-08  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/WorkArea.C  (request_clipboard_cb): Set clipboard_read to
        true when clipboard is empty.
                                        
2000-07-08  Dekel Tsur  <dekel@math.tau.ac.il>

        * text.C (Backspace): Prevent rebreaking of a row if it is the last
        row of the paragraph.
        (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false 
        to prevent calculation of bidi tables

2000-07-07  Juergen Vigna  <jug@sad.it>

        * src/screen.C (ToggleSelection): added y_offset and x_offset
        parameters.

        * src/insets/insettext.C (InsetMotionNotify): fixed selection with
        mouse.

        * src/text.C (GetVisibleRow): fixed selection drawing in insets.

        * src/insets/insettext.C: fixed Layout-Display!

2000-07-07  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * configure.in: add check for strings.h header.

        * src/spellchecker.C: include <strings.h> in order to have a
        definition for bzero().

2000-07-07  Juergen Vigna  <jug@sad.it>

        * src/insets/insettext.C (draw): set the status of the bv->text to
        CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.

        * src/screen.C (DrawOneRow): 
        (DrawFromTo): redraw the actual row if something has changed in it
        while drawing.

        * src/text.C (draw): call an update of the toplevel-inset if something
        has changed inside while drawing.

        * src/lyxtext.h: added CHANGED_IN_DRAW status.

2000-07-06  Angus Leeming  <a.leeming@ic.ac.uk>

        * src/insets/insetbib.[Ch] (callback) new method, moving callback
        processing inside class.

        * src/insets/insetindex.[Ch] (callback) new method, moving callback
        processing inside class.

        * src/insets/insetindex.h new struct Holder, consistent with other
        insets.

        * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
        citation dialog from main code and placed it in src/frontends/xforms.
        Dialog launched through signals instead of callbacks
        
2000-07-06  R. Lahaye  <lahaye@postech.ac.kr>

        * lyx.man: update the options description.

2000-07-05  R. Lahaye  <lahaye@postech.ac.kr>

        * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
        handle neg values, set min width to 590, add doc about -display  

2000-07-05  Juergen Vigna  <jug@sad.it>

        * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
        calls to BufferView *.

        * src/insets/insettext.C (checkAndActivateInset): small fix non
        HIGHLY_EDITABLE insets should not be entered by cursor-move-over!

        * src/insets/insetcommand.C (Read): Fixed as insets should read till
        their \end_inset token!

2000-07-04  edscott  <edscott@imp.mx>

        * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
        lib/lyxrc.example: added option \wheel_jump

2000-07-04   R. Lahaye  <lahaye@postech.ac.kr>

        * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
        remove support for -width,-height,-xpos and -ypos.

2000-07-01  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/encoding.[Ch]: New files.

        * src/painter.C (text(int,int,XChar2b const *,...)): New method.
        (text): Call to the underline() method only when needed.

        * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.

        * src/buffer.C (makeLaTeXFile): Compute automatically the input
          encoding(s) for the document.

        * src/bufferparams.C (BufferParams): Changed default value of
        inputenc to "auto".

        * src/language.C (newLang): Removed.
        (items[]): Added encoding information for all defined languages.

        * src/lyx_gui.C (create_forms): Added "auto" option to the input
        encoding choice button.

        * src/lyxrc.h (font_norm_type): New member variable.
        (set_font_norm_type): New method.

        * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
        paragraphs with different encodings.                          

        * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
        (TransformChar): Changed to work correctly with Arabic points.
        (draw): Added support for drawing Arabic points.
        (draw): Removed code for drawing underbars (this is done by
        the Painter!)

        * src/support/textutils.h (IsPrintableNonspace): New function.

        * src/BufferView_pimpl.h: Added "using SigC::Object".
        * src/LyXView.h: ditto.

        * src/insets/insetinclude.h (include_label): Changed to mutable.

2000-07-04  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/mathed/math_iter.h: remove empty destructor

        * src/mathed/math_cursor.h: remove empty destructor

        * src/insets/lyxinset.h: add THEOREM_CODE

        * src/insets/insettheorem.[Ch]: new files 

        * src/insets/insetminipage.C: (InsertInset): remove

        * src/insets/insetmarginal.C: inherit from InsetFootLike instead
        of InsetCollapsable
        (InsertInset): remove

        * src/insets/insetlist.C: (InsertList): remove

        * src/insets/insetfootlike.[Ch]: new files 

        * src/insets/insetfoot.C: inherit from InsetFootLike instead of
        InsetCollapsable.
        (Write): remove
        (InsertInset): ditto

        * src/insets/insetert.C: remove include Painter.h, reindent
        (InsertInset): move to header

        * src/insets/insetcollapsable.h: remove explicit from default
        contructor, remove empty destructor, add InsertInset

        * src/insets/insetcollapsable.C (InsertInset): new func

        * src/insets/Makefile.am (libinsets_la_SOURCES): add new files

        * src/vspace.h: add explicit to constructor

        * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
        \textcompwordmark, please test this.

        * src/lyxrc.C: set ascii_linelen to 65 by default

        * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM

        * src/commandtags.h: add LFUN_INSET_THEOREM

        * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
        (makeLinuxDocFile): remove _some_ of the nice logic
        (makeDocBookFile): ditto

        * src/Painter.[Ch]: (~Painter): removed

        * src/LyXAction.C (init): entry for insettheorem added

        * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
        enum
        (deplog): code to detect files generated by LaTeX, needs testing
        (deptex): removed

2000-07-03  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/FloatList.[Ch]: moved inlines out of line to FloatList.C

2000-07-02  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/LaTeX.C (deplog): Add a check for files that are going to be
        created by the first latex run, part of the project to remove the
        all_files array.

        * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
        contents to the extension list.

2000-07-04  Juergen Vigna  <jug@sad.it>

        * src/text.C (NextBreakPoint): added support for needFullRow()

        * src/insets/lyxinset.h: added needFullRow()

        * src/insets/insetcollapsable.C: redone now this uses a text-inset
        and isn't one.

        * src/insets/insettext.C: lots of changes for update!

2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>

        * src/LaTeXFeatures.h: add a missing std:: qualifier.

2000-07-02 José Abílio Matos <jamatos@fep.up.pt>

        *  src/insets/insetinclude.C (InsetInclude): fixed
        initialization of include_label.
        (unique_id): now returns a string.

2000-07-01 José Abílio Matos <jamatos@fep.up.pt>

        * src/LaTeXFeatures.h: new member IncludedFiles, for
        a map of key, included file name.

        * src/LaTeXFeatures.C (getIncludedFiles): returns a string
        with the included files for inclusion in SGML preamble,
        i. e., linuxdoc and docbook.

        * src/buffer.h:
        * src/buffer.C (makeLinuxDocFile): takes two new arguments,
        nice (is the generated linuxdoc code to be exported?), that
        allows to remove column, and only_body that will be true for
        slave documents. Insets are allowed inside SGML font type.
        New handling of the SGML preamble for included files.
        (makeDocBookFile): the same for docbook.

        * src/insets/insetinclude.h:
        * src/insets/insetinclude.C (Validate): keeps a list of included files.
        (Linuxdoc): 
        (DocBook): new export methods.

        * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
        and makeDocBookFile.

        * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
        formats to export with command line argument -x.

2000-06-29  Juergen Vigna  <jug@sad.it>

        * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
        to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!

        * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
        region could already been cleared by an inset!

2000-06-28  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/BufferView_pimpl.h: remove member variables lyx_focus and
        work_area_focus

        * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
        and lyx_focus
        (cursorToggle): remove special handling of lyx focus.

2000-06-28  Juergen Vigna  <jug@sad.it>

        * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
        insetHeight.

2000-06-28  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/insets/insetindex.C (Edit): add a callback when popup is
        closed by the WM.

        * src/insets/insettext.C (LocalDispatch): 
        * src/insets/insetmarginal.h: 
        * src/insets/insetlist.h: 
        * src/insets/insetfoot.h: 
        * src/insets/insetfloat.h: 
        * src/insets/insetert.h: add a missing std:: qualifier.

2000-06-28  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/lyxsum.C (sum): '\0' teminate file read when using
        strstream. 

        * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE

        * src/insets/insettext.C (Read): remove tmptok unused variable
        (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
        (InsertInset): change for new InsetInset code

        * src/insets/insettext.h: add TEXT inline method

        * src/insets/insettext.C: remove TEXT macro

        * src/insets/insetmarginal.C (Write): new method
        (Latex): change output slightly

        * src/insets/insetfoot.C (Write): new method
        (Latex): change output slightly (don't use endl when no need)

        * src/insets/insetert.C (Write): new method

        * src/insets/insetcollapsable.h: make button_length, button_top_y
        and button_bottm_y protected.

        * src/insets/insetcollapsable.C (Write): simplify code by using
        tostr. Also do not output the float name, the children class
        should to that to get control over own arguments

        * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
        src/insets/insetminipage.[Ch]:
        new files

        * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
        
        * src/lyxfunc.C (Dispatch): cases for new insets/commands

        * src/Makefile.am (lyx_SOURCES): add the new files

        * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
        LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
        * src/commandtags.h: ditto
        
        * src/LaTeXFeatures.h: add a std::set of used floattypes

        * src/LaTeXFeatures.C (getPackages): add basic support for float.sty

        * src/FloatList.[Ch] src/Floating.h: new files

        * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
        InsertInset. 
        * src/lyx_cb.C (TableApplyCB): ditto
        * src/text.C: ditto
        * src/text2.C: ditto
        * src/buffer.C (SimpleLinuxDocOnePar): ditto
        (parseSingleLyXformat2Token): ditto + add code for
        backwards compability for old float styles + add code for new insets
        
        * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
        method
        (InsertInset(size_type, Inset *, LyXFont)): new method
        (InsetChar(size_type, char)): changed to use the other InsetChar
        with a LyXFont(ALL_INHERIT).
        (InsetInset(size_type, Inset*)): changed to use InsetChar to
        insert the META_INSET.
        
        * sigc++/thread.cc (Privete<int>::operator int&): move definition
        out of line. 
        * sigc++/thread.h (Threads): from here

        * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
        definition out of line
        * sigc++/scope.h: from here

2000-06-27  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
        is specified (adapted from a patch from edscott <edscott@imp.mx>).

        * Makefile.am (bindist): new target.

        * INSTALL: add instructions for doing a binary distribution.

        * development/tools/README.bin.example: update a bit. 

2000-06-26  Lior Silberman <slior@math.huji.ac.il>

        * src/lyxrc.C: 
        * lib/lyxrc.example: new lyxrc tag \set_color.

        * src/lyxfunc.C (Dispatch): 
        * src/commandtags.h: 
        * src/LyXAction.C: new lyxfunc "set-color".

        * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
        and an x11name given as strings.

        * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
        cache when a color is changed.

2000-06-26  Juergen Vigna  <jug@sad.it>

        * src/lyxrow.C (width): added this functions and variable.

        * src/insets/insetcite.C (create_form_citation_form): some Gravity
        changes.

        * src/text.C (SetHeightOfRow): fixed calcualting of width.

2000-06-26  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * images/undo_bw.xpm: new icon.
        * images/redo_bw.xpm: ditto.

        * configure.in (INSTALL_SCRIPT): change value to
        ${INSTALL} to avoid failures of install-script target.
        * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto

        * src/BufferView.h: add a magic "friend" declaration to please
        compaq cxx.

2000-06-23  Angus Leeming <a.leeming@ic.ac.uk>

        * forms/cite.fd: modified to allow resizing without messing
        up the dialog.

        * src/insetcite.C: Uses code from cite.fd almost without
        tweaking. ;-)
        User can now resize dialog in the x-direction.
        Resizing the dialog in the y-direction is prevented, as the
        code does this intelligently already.

2000-06-22  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * INSTALL: remove obsolete entry in "problems" section.

        * lib/examples/sl_*.lyx: update of the slovenian examples.

        * src/support/FileInfo.[Ch] (getBlockSize): remove.

2000-06-23  Juergen Vigna  <jug@sad.it>

        * src/lyxtext.h: added a 'cleared' flag to draw() function.

        * src/buffer.C (resize): delete the LyXText of textinsets.

        * src/paragraph.C (SetInsetOwner): set the owner in the insets too.

        * src/insets/lyxinset.h: added another parameter 'cleared' to
        the draw() function.

        * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
        unlocking inset in inset.

2000-06-22  Juergen Vigna  <jug@sad.it>

        * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
        of insets and moved first to LyXText.

        * src/mathed/formulamacro.[Ch]:
        * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos

2000-06-21  Juergen Vigna  <jug@sad.it>

        * src/text.C (GetVisibleRow): look if I should clear the area or not
        using Inset::doClearArea() function.

        * src/insets/lyxinset.h: added doClearArea() function and
        modified draw(Painter &, ...) to draw(BufferView *, ...)

        * src/text2.C (UpdateInset): return bool insted of int

2000-06-20  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/lyx_gui.C (create_forms): Add "Reset" option to the language 
        combox in the character popup

        * src/lyx_cb.C (UserFreeFont): Add argument to the method:
        BufferParams const & params

2000-06-20  Juergen Vigna  <jug@sad.it>

        * src/insets/insettext.C (SetParagraphData): set insetowner on
        2- paragraphs.

2000-06-21  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/Timeout.[Ch]: Change to use signals instead of callbacks.
        * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
        from SigC::Object
        (form_main_): remove
        
        * src/LyXView.C (LyXView_AutosaveTimerCB): remove 
        (create_form_form_main): remove FD_form_main stuff, connect to
        autosave_timeout signal

        * src/LyXView.[Ch] (getMainForm): remove 
        (UpdateTimerCB): remove
        * src/BufferView_pimpl.h: inherit from SigC::Object

        * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
        signal instead of callback

        * src/BufferView.[Ch] (cursorToggleCB): remove 

2000-06-20  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/BufferView_pimpl.C: changes because of the one below

        * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
        instead of storing a pointer to a LyXText. 

        * src/buffer.[Ch]: apply Baruch's remove isdviclean patch. 

2000-06-10  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/lyxparagraph.h

        * src/paragraph.C: Changed fontlist to a sorted vector.
                                         
2000-06-19  Juergen Vigna  <jug@sad.it>

        * src/BufferView.h: added screen() function.

        * src/insets/insettext.C (LocalDispatch): some selection code
        fixed.

        * src/vspace.C (nextToken): use stringfunctions instead of sscanf.

        * src/insets/insettext.C (SetParagraphData):
        (Read): 
        (InsetText):  fixes for multiple paragraphs.

2000-06-17  Kayvan A. Sylvan  <kayvan@sylvan.com>

        * development/lyx.spec.in: Call configure with ``--without-warnings''
        to work around a bug with the Makefiles when doing ``make lyxrpm''.
        This should be fine, however, since we generally don't want to be
        verbose when making an RPM.
        
2000-06-16  Dekel Tsur  <dekel@math.tau.ac.il>

        * lib/scripts/fig2pstex.py: New file

2000-06-16  Juergen Vigna  <jug@sad.it>

        * src/insets/insettabular.C (UpdateLocal): 
        * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
        (LocalDispatch): Changed all functions to use LyXText.

2000-06-15  Juergen Vigna  <jug@sad.it>

        * src/text.C (SetHeightOfRow): call inset::update before requesting
        any width/height.

        * src/insets/insettext.C (update): 
        * src/insets/insettabular.C (update): added implementation

        * src/insets/lyxinset.h: added update function

2000-06-15  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/text.C (SelectNextWord): protect against null pointers with
        old-style string streams. (fix from Paul Theo Gonciari
        <gptheo@yahoo.com>) 

        * src/cite.[Ch]: remove erroneous files.

        * lib/configure.m4: update the list of created directories.

        * src/lyxrow.C: include <config.h>
        * src/lyxcursor.C: ditto.

2000-06-13  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/examples/decimal.lyx: new example file from Mike.

        * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
        to find template definitions (from Dekel)

        * src/frontends/.cvsignore: add a few things.

        * src/frontends/xforms/input_validators.[ch]: remove C++ comments.

        * src/Timeout.C (TimeOut): remove default argument.

        * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
        "C" linkage.

        * src/insets/ExternalTemplate.C: add a "using" directive.

        * src/lyx_main.h: remove the act_ struct, which seems unused
        anyway. 

2000-06-12  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * LyX Developers Meeting: All files changed, due to random C++ (by
        coincidence) code generator script.

        - external inset (cool!)
        - initial online editing of preferences
        - insettabular breaks insettext(s contents)
        - cleanup
        - some DocBook fixes
        - example files update
        - other cool stuff, create a diff and look for yourself.

2000-06-09  The Great LyX Application  <lyx@localhost.localdomain>

        * src/insets/insettext.C (computeTextRows): if the maxWidth is
        -1 this is a non-line-breaking textinset.

        * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
        if there is no width set.

2000-06-10  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * Lots of files: Merged the dialogbase branch.

2000-06-09  Allan Rae  <rae@lyx.org>

        * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]:  Removed XTL and
        and the Dispatch methods that used it.

        * src/frontends/Liason.[Ch]: replaced with a Liason namespace for 
        access to functions formerly kept in Dispatch.

2000-05-19  Allan Rae  <rae@lyx.org>

        * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
        made to_page and count_copies integers again.  from_page remains a
        string however because I want to allow entry of a print range like
        "1,4,22-25" using this field.

        * src/LyXAction.C: added action info and commands for buffer-print-xtl
        and printer-params-get.  These aren't useful from the minibuffer but
        could be used by a script/LyXServer app provided it passes a suitable
        auto_mem_buffer.  I guess I should take a look at how the LyXServer
        works and make it support xtl buffers.

        * sigc++/: updated to libsigc++-1.0.1

        * src/xtl/: updated to xtl-1.3.pl.11

        * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
        those changes done to the files in src/ are actually recreated when
        they  get regenerated. Please don't ever accept a patch that changes a
        dialog unless that patch includes the changes to the corresponding *.fd
        file.

        * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
        stringOnlyContains, renamed it and generalised it.

        * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
        branch.  Removed the remaining old form_print code.

2000-04-26  Allan Rae  <rae@lyx.org>

        * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
        trap I was trying to fix with the ID: fields in src/xtl/  :-)

2000-04-25  Allan Rae  <rae@lyx.org>

        * src/xtl/: Updated to incorporate Angus's two patches as well as mine
        against a base of xtl-1.3.pl.4

        * development/tools/lxtl.sh: fixed a couple of silly typos and now
        filter the Id: entries so they still show the xtl version number
        they are based on.

        * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
        into the src/xtl code.  Patch still pending with José (XTL)

2000-04-24  Allan Rae  <rae@lyx.org>

        * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
        both more generic and much safer. Use the new template functions.
        * src/buffer.[Ch] (Dispatch): ditto.

        * src/frontends/xforms/FormPrint.C (update): Use new template functions
        and mem buffer more intelligently. Also a little general cleanup.
        (apply): ditto.

        * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
        * development/tools/lxtl.sh: Ditto.  Makefile.am + .cvsignore
        * src/xtl/Makefile.am: ditto.
        * src/xtl/.cvsignore: ditto.
        * src/Makefile.am: ditto.

        * src/PrinterParams.h: Removed the macros member functions. Added a
        testInvariant member function.  A bit of tidying up and commenting.
        Included Angus's idea for fixing operation with egcs-1.1.2.

        * src/support/lxtl.h: Many changes.  Added auto_mem_buffer -- a really
        cool expansion of XTL's mem_buffer to support automatic memory
        management within the buffer itself.  Removed the various macros and
        replaced them with template functions that use either auto_mem_buffer
        or mem_buffer depending on a #define.  The mem_buffer support will
        disappear as soon as the auto_mem_buffer is confirmed to be good on
        other platforms/compilers.  That is, it's there so you've got something
        to compare against.

        * src/xtl/objio.h: Changes to support auto_mem_buffer.  This has
        effectively forked XTL.  However I expect José will include my code
        into the next major release.  Also fixed a memory leak.
        * src/xtl/text.h: ditto.
        * src/xtl/xdr.h: ditto.
        * src/xtl/giop.h: ditto.

2000-04-16  Allan Rae  <rae@lyx.org>

        * acinclude.m4, sigc++/acinclude.m4:  Removed -- they're generated
        by autogen.sh and removed by maintainer-clean anyway.
        * .cvsignore, sigc++/.cvsignore:  Support the above.

        * sigc++/.cvsignore: Forgot that retbind.h was generated.

        * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.

        * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
        macros, renamed static callback-target member functions to suit new
        scheme and made them public.
        * src/frontends/xforms/forms/form_print.fd: ditto.
        * src/frontends/xforms/forms/form_copyright.fd: ditto.

        * src/support/lxtl.h: small cleanup to use typedef instead of #define
        for gui_format.

        * src/xtl/: New directory containing a minimal distribution of XTL.
        This is XTL-1.3.pl.4.

        * development/tools/lxtl.sh: A script to generate the above mini-dist.

2000-04-15  Allan Rae  <rae@lyx.org>

        * development/tools/makeLyXsigc.sh: Remove the library version numbers

        * sigc++/:  Updated to libsigc++-1.0.0

2000-04-14  Allan Rae  <rae@lyx.org>

        * src/frontends/xforms/xform_macros.h: Remove specific macros and just
        use the generic ones in future.  I'll modify my conversion script.

        * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.

        * src/lyx_gui_misc.[Ch]: Removed references to form_print.
        (CloseAllBufferRelatedDialogs): Renamed.
        (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog

        * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
        of the generic ones.  These are the same ones my conversion script
        generates.

        * src/PrinterParams.h: Allow you to print a range of odd or even pages.
        * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
        * src/buffer.C (Dispatch): ditto

        * src/LyXView.C (LyXView): Use new signals instead of old hard coded
        functions for updating and hiding buffer dependent dialogs.
        * src/BufferView.C (buffer): ditto
        * src/buffer.C (setReadonly): ditto
        * src/lyxfunc.C (CloseBuffer): ditto

        * src/buffer.h: Take setReadonly() out of line so I don't have to include
        Dialogs.h, and hence all the SigC stuff, into every file that includes
        buffer.h.  We also don't need to include lyx_gui_misc.h in everything.

        * src/BufferView2.C: reduce the number of headers included by buffer.h

2000-04-11  Allan Rae  <rae@lyx.org>

        * src/frontends/xforms/xform_macros.h:  A small collection of macros
        for building C callbacks.

        * src/frontends/xforms/Makefile.am: Added above file.

        * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
        scheme again.  This time it should work for JMarc.  If this is
        successful I'll revise my conversion script to automate some of this.
        The static member functions in the class also have to be public for
        this scheme will work.  If the scheme works (it's almost identical to
        the way BufferView::cursorToggleCB is handled so it should work) then
        FormCopyright and FormPrint will be ready for inclusion into the main
        trunk immediately after 1.1.5 is released -- provided we're prepared
        for complaints about lame compilers not handling XTL.

        * src/support/lxtl.h: Switched to XDR_format instead of raw_format.

2000-04-07  Allan Rae  <rae@lyx.org>

        * config/lyxinclude.m4:  A bit more tidying up (Angus)

        * src/LString.h: JMarc's <string> header fix

        * src/PrinterParams.h: Used string for most data to remove some
        ugly code in the Print dialog and avoid even uglier code when 
        appending the ints to a string for output.

        * src/buffer.C (Dispatch): Added a couple of braces to fix an error
        and moved "default:" back to the end of switch statement.  Cleaned
        up the printing so it uses the right function calls and so the
        "print to file" option actually puts the file in the right directory.

        * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).

        * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
        and Ok+Apply button control into a separate method: input (Angus).
        (input) Cleaned it up and improved it to be very thorough now.
        (All CB) static_cast used instead of C style cast (Angus).  This will
        probably change again once we've worked out how to keep gcc-2.8.1 happy
        with real C callbacks.
        (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
        ignore some of the bool settings and has random numbers instead. Needs
        some more investigation.  Added other input length checks and checking
        of file and printer names.

        * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
        would link (Angus).  Seems the old code doesn't compile with the pragma
        statement either.  Separated callback entries from internal methods.

        * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).

2000-03-17  Allan Rae  <rae@lyx.org>

        * src/lyxfunc.[Ch] (isAvailable): This is only temporary.  Do we really
        need it?  Maybe it could go in Dialogs instead?  I could make it a
        LFUN but you'd have to call Dispatch(int, int, char*) with dummy
        values to get the bool return value.
        (Dispatch): New overloaded method for xtl support.

        * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
        extern "C" callback instead of static member functions.  Hopefully,
        JMarc will be able to compile this.  I haven't changed 
        forms/form_copyright.fd yet. Breaking one of my own rules already.

        * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
        because they aren't useful from the minibuffer.  Maybe a LyXServer
        might want a help message though?

        * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.

        * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
        xtl which needs both rtti and exceptions.

        * src/support/Makefile.am:
        * src/support/lxtl.h: New file.  Some helper macros for using XTL.

        * src/frontends/xforms/input_validators.[ch]: input filters and
        validators.  These conrol what keys are valid in input boxes.
        Use them and write some more.  Much better idea than waiting till
        after the user has pressed Ok to say that the input fields don't make
        sense.

        * src/frontends/xforms/Makefile.am:
        * src/frontends/xforms/forms/form_print.fd:
        * src/frontends/xforms/forms/makefile:
        * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
        new scheme.  Still have to make sure I haven't missed anything from
        the current implementation.

        * src/Makefile.am, src/PrinterParams.h: New data store.

        * other files: Added a couple of copyright notices.

2000-03-06  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/insets/insetbib.h: move Holder struct in public space.

        * src/frontends/include/DialogBase.h: use SigC:: only when
        SIGC_CXX_NAMESPACES is defined.
        * src/frontends/include/Dialogs.h: ditto.

        * sigc++/Makefile.am (%.h): use the autodected GNU m4.

        * src/frontends/xforms/FormCopyright.[Ch]: do not
        mention SigC:: explicitely.

2000-03-03  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
        deals with testing KDE in main configure.in
        * configure.in: ditto.

2000-02-22  Allan Rae  <rae@lyx.org>

        * Lots of files: Merged from HEAD

        * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
        with the etags shipped with SuSE-6.3 (fancier than gnu-etags).

        * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4

        * sigc++/: new minidist.

2000-02-14  Allan Rae  <rae@lyx.org>

        * development/tools/makeLyXsigc.sh:  Small fix for Makefile.am

2000-02-08  Juergen Vigna  <jug@sad.it>

        * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
        file for the buildin GUI builder of KDevelop of the copyright-dialog.

        * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
        for this port and so it is much easier for other people to port
        dialogs in a common development environment.

        * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
        the QT/KDE implementation.

        * src/frontends/kde/Dialogs.C:
        * src/frontends/kde/FormCopyright.C:
        * src/frontends/kde/FormCopyright.h:
        * src/frontends/kde/Makefile.am:
        * src/frontends/kde/formcopyrightdialog.C:
        * src/frontends/kde/formcopyrightdialog.h:
        * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
        for the kde support of the Copyright-Dialog.

        * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
        subdir-substitution instead of hardcoded 'xforms' as we now have also
        the kde subdir.

        * src/frontends/include/DialogBase.h (Object): just commented the
        label after #endif (nasty warning and I don't like warnings ;)

        * src/main.C (main): added KApplication initialization if using
        KDE frontend-GUI.

        * src/lyx_gui.C (runTime): added support for multiple toolkit support.
        For now only the KDE event-loop is added if frontend==kde.

        * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support

        * configure.in: added support for the --with-frontend[=value] option

        * autogen.sh: added kde.m4 file to list of config-files

        * acconfig.h: added define for KDEGUI-support

        * config/kde.m4: added configuration functions for KDE-port

        * config/lyxinclude.m4: added --with-frontend[=value] option with
        support for xforms and KDE.

2000-02-08  Allan Rae <rae@lyx.org>

        * all Makefile.am:  Fixed up so the make targets dist, distclean, 
        install and uninstall all work even if builddir != srcdir.  Still
        have a new sigc++ minidist update to come.

        * config/lyxinclude.m4: Some more builddir!=srcdir fixes.

2000-02-01  Allan Rae <rae@lyx.org>

        * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
        Many mods to get builddir != srcdir working.
        
        * sigc++/: Upgraded to 0.8.7.  This includes many needed fixes both
        for building on NT and so we can do the builddir != srcdir stuff.

2000-01-30  Allan Rae <rae@lyx.org>

        * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
        This will stay in "rae" branch.  We probably don't really need it in
        the main trunk as anyone who wants to help programming it should get
        a full library installed also.  So they can check both included and
        system supplied library compilation.

        * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
        Added a 'mini' distribution of libsigc++.  If you feel the urge to 
        change something in these directories - Resist it.  If you can't 
        resist the urge then you should modify the following script and rebuild
        the dist.  LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
        all happen.  Still uses a hacked version of libsigc++'s configure.in.
        I'm quite happy with the results.  I'm not sure the extra work to turn
        the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
        worth the trouble and would probably lead to extra maintenance 
        headaches.
        I haven't tested the following important make targets: install, dist.
        Not ready for prime time but very close.  Maybe 1.1.5.

        * development/tools/makeLyXsigc.sh:  A shell script to automatically
        generate our mini-dist of libsigc++.  It can only be used with a CVS
        checkout of libsigc++ not a tarball distribution.  It's well commented.
        This will end up as part of the libsigc++ distribution so other apps
        can easily have an included mini-dist.  If someone makes mods to the
        sigc++ subpackage without modifying this script to generate those
        changes I'll be very upset!

        * src/frontends/:  Started the gui/system indep structure.

        * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
        to access the gui-indep dialogs are in this class.  Much improved
        design compared to previous revision.  Lars,  please refrain from
        moving this header into src/ like you did with Popups.h last time.

        * src/frontends/include/DialogBase.h: Abstract base class for dialogs.

        * src/frontends/xforms/:  Started the gui-indep system with a single
        dialog: FormCopyright.  Initial testing of use of libsigc++ was very
        successful.

        * src/frontends/xforms/forms: Repository for the xforms .fd files.
        Here you'll find a very useful makefile and automated fdfix.sh that
        makes updating dailogs a no-brainer -- provided you follow the rules
        set out in the README.  I'm thinking about adding another script to
        automatically generate skeleton code for a new dialog given just the
        name of the dialog.

        * src/commandtags.h, src/lyxfunc.C, src/menus.C:
        * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
        Made FormCopyright gui-indep and added a lyxfunc to get to it.

2000-06-09  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/LSubstring.C (operator): simplify

        * src/lyxtext.h: removed bparams, use buffer_->params instead
        
        * src/lyxrow.h: make Row a real class, move all variables to
        private and use accessors.

        * src/lyxparagraph.h (getParLanguage): add BufferParamas as
        arguament.
        (isRightToLeftPar): ditto
        (ChangeLanguage): ditto
        (isMultiLingual): ditto
        (String): ditto
        (TeXOnePar): ditto
        (SimpleTeXOnePar): ditto
        (TeXEnvironment): ditto
        (GetEndLabel): ditto
        (SetLayout): ditto
        (SetOnlyLayout): ditto
        (BreakParagraph): ditto
        (BreakParagraphConservative): ditto
        (GetFontSettings): ditto
        (getFont): ditto
        (CopyIntoMinibuffer): ditto
        (CutIntoMinibuffer): ditto
        (PasteParagraph): ditto
        (SetPExtraType): ditto
        (UnsetPExtraType): ditto
        (DocBookContTableRows): ditto
        (SimpleDocBookOneTablePar): ditto
        (TeXDeeper): ditto
        (TeXFootnote): ditto
        (SimpleTeXOneTablePar): ditto
        (TeXContTableRows): ditto
        (SimpleTeXSpecialChars): ditto
        

        * src/lyxcursor.h: make LyXCursor a real class, move all variables
        to private and use accessors.

        * src/lyx_cb.C: remove char updatetimer, and all code that uses
        this, we did not use it anymore and has not been for ages. Just a
        waste of cpu cycles.

        * src/language.h: make Language a real class, move all variables
        to private and use accessors.

        * src/BufferView_pimpl.C (Pimpl): use new timer code.
        (create_view): remove
        (update): some changes for new timer
        (cursorToggle): use new timer
        (beforeChange): change for new timer

        * src/BufferView.h (cursorToggleCB): removed last paramter because
        of new timer code. 

        * src/BufferView.C (C_BufferView_CursorToggleCB): removed 
        (cursorToggleCB): change because of new timer code

        * lib/CREDITS: updated own mailaddress

2000-06-08  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/support/filetools.C (PutEnv): fix the code in case neither
        putenv() nor setenv() have been found.

        * INSTALL: mention the install-strip Makefile target.

        * src/LyXAction.C (init): make LFUN_BUILDPROG available in
        read-only documents.

2000-06-07  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/reLyX/configure.in (VERSION): avoid using a previously
        generated reLyX wrapper to find out $prefix.

        * lib/examples/eu_adibide_lyx-atua.lyx: 
        * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
        translation of the Tutorial (Dooteo)

2000-06-06  Angus Leeming <a.leeming@ic.ac.uk>

        * forms/cite.fd: new citation dialog

        * src/insetcite.[Ch]: the new citation dialog is moved into
        its own files.

        * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
        (Dekel).

        * src/insets/insetcommand.h: data members made private. 

2000-06-06  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * LyX 1.1.5 released

2000-06-06  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/version.h (LYX_RELEASE): to 1.1.5

        * src/spellchecker.C (RunSpellChecker): return false if the
        spellchecker dies upon creation.

2000-06-06  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
        in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>) 
        
        * NEWS: update.

        * lib/CREDITS: update entry for Martin Vermeer.

2000-06-06  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/text.C (draw): Draw foreign language bars at the bottom of
        the row instead of at the baseline.

        * lib/examples/Minipage.lyx: Use the new multi-lingual support.

2000-06-06  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * lib/bind/de_menus.bind: updated

2000-06-05  Dekel Tsur  <dekel@math.tau.ac.il>

        * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref

2000-06-05  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/menus.C (Limit_string_length): New function
        (ShowTocMenu): Limit the number of items/length of items in the
        LOT/LOF/LOA menus.

        * src/paragraph.C (String): Correct result for a paragraph inside
        a footnote.

2000-06-05  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/bufferlist.C (close): test of buf->getuser() == NULL

2000-06-02  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/BufferView2.C (removeAutoInsets): Fix a bug: 
        Do not call to SetCursor when the paragraph is a closed footnote!

2000-06-01  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
        label is changed.

        * src/text.C (SetCursor): Made the computation of cursor_vpos safer.

2000-05-31 Dekel Tsur  <dekel@math.tau.ac.il>

        * forms/lyx.fd
        * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
        reference popup, that activates the reference-back action

        * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.

        * src/menus.C (Add_to_refs_menu): Limit the size of each item in
        the menus. Also fixed a bug.

        * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close 
        the math panels when switching buffers (unless new buffer is readonly).

        * src/BufferView.C (NoSavedPositions)
        * src/BufferView_pimpl.C (NoSavedPositions): New methods

2000-06-01  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
        less of dvi dirty or not.

        * src/trans_mgr.[Ch] (insert): change first parameter to string
        const &.  

        * src/chset.[Ch] (encodeString): add const to first parameter

2000-05-31  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/lyxstring.C (begin): fix a "shared" string bug. use
        rep->get_own_copy()
        (end): ditto

        * src/LaTeX.C (deplog): better searching for dependency files in
        the latex log. Uses now regexps.

        * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
        instead of the box hack or \hfill. 

2000-05-31  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxfunc.C (doImportHelper): do not create the file before
        doing the actual import. 
        (doImportASCIIasLines): create a new file before doing the insert.
        (doImportASCIIasParagraphs): ditto.

        * lib/lyxrc.example: remove mention of non-existing commands

        * lyx.man: remove mention of color-related switches.

        * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR. 

        * src/lyx_gui.C: remove all the color-related ressources, which
        are not used anymore.

        * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
        name. 

2000-05-31 Dekel Tsur  <dekel@math.tau.ac.il>

        * src/lyxrc.C (read): Add a missing break in the switch

2000-05-30 Dekel Tsur  <dekel@math.tau.ac.il>

        * src/text2.C (InsertStringA): Fix a bug with insertion into table
        
        * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
        text is Hebrew.
                             
2000-05-27  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/text.C (draw): draw bars under foreign language words.
        
        * src/LColor.[Ch]: add LColor::language
                            
2000-05-27 Dekel Tsur  <dekel@math.tau.ac.il>

        * src/lyxcursor.h (boundary): New member variable

        * src/text.C (IsBoundary): New methods

        * src/text.C: Use the above for currect cursor movement when there
        is both RTL & LTR text.
        
        * src/text2.C: ditto
        
        * src/bufferview_funcs.C (ToggleAndShow): ditto

2000-05-30  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/text.C (DeleteLineForward): set selection to true to avoid
        that DeleteEmptyParagraphMechanism does some magic. This is how it
        is done in all other functions, and seems reasonable.
        (DeleteWordForward): do not jump over non-word stuff, since
        CursorRightOneWord() already does it.
        
        Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
        DeleteWordBackward, since they seem safe to me (since selection is
        set to "true") DeleteEmptyParagraphMechanism does nothing.

2000-05-29  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyx_main.C (easyParse): simplify the code by factoring the
        part that removes parameters from the command line.
        (LyX): check wether wrong command line options have been given.

2000-05-29  Lior Silberman <slior@math.huji.ac.il>

        * src/lyx_main.C : add support for specifying user LyX
        directory via command line option -userdir.

2000-05-26 Dekel Tsur  <dekel@math.tau.ac.il>

        * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
        the number of items per popup.
        (Add_to_refs_menu): Ditto.
        
2000-05-26  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxparagraph.h: renamed ClearParagraph() to
        StripLeadingSpaces() and moved it to paragraph.C. We pass the
        textclass as parameter, and do nothing if free_spacing is
        true. This fixes part of the line-delete-forward problems.

        * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
        (pasteSelection): ditto.
        (SwitchLayoutsBetweenClasses): more translatable strings.

        * src/text2.C (CutSelection): use StripLeadingSpaces.
        (PasteSelection): ditto.
        (DeleteEmptyParagraphMechanism): ditto.

2000-05-26  Juergen Vigna  <jug@sad.it>

        * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
        is not needed in tabular insets.

        * src/insets/insettabular.C (TabularFeatures): added missing features.

        * src/tabular.C (DeleteColumn):
        (AppendColumn): 
        (AppendRow): implemented this functions
        (cellsturct::operator=): clone the inset too; 

2000-05-23  Juergen Vigna  <jug@sad.it>

        * src/insets/insettabular.C (LocalDispatch): better selection support
        when having multicolumn-cells.

2000-05-26  Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>

        * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.

2000-05-25  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/ColorHandler.C (getGCForeground): put more test into _()

        * lib/examples/eu_splash.lyx: new file (Basque translation) from
        Dooteo. 

        * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
        get the version.

2000-05-25 Dekel Tsur  <dekel@math.tau.ac.il>

        * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
        there are no labels, or when buffer is readonly.

        * src/menus.C (ShowRefsMenu) disable appropriate menu items when
        there are no labels, buffer is SGML, or when buffer is readonly.

2000-05-25  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/LColor.C (LColor): change a couple of grey40 to grey60
        (LColor): rewore initalization to make compiles go some magnitude
        faster.
        (getGUIName): don't use gettext until we need the string.

2000-05-09  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/Bullet.[Ch]: Fixed a small bug.

2000-05-21  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/paragraph.C (String): Several fixes/improvements

        * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method

2000-05-22  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/paragraph.C (String): give more correct output.

2000-05-20  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/lyxfont.C (stateText) Do not output the language if it is
        eqaul to the language of the document.

        * src/paragraph.C (TeXOnePar): Do not put language switch commands
        between two paragraphs with the same language.

        * src/paragraph.C (getParLanguage) Return a correct answer for an
        empty dummy paragraph.

        * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
        menus.

        * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
        layout menu.

        * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
        the menus/popup, if requested fonts are unavailable.

2000-05-22  Juergen Vigna  <jug@sad.it>

        * src/insets/insettabular.C (LocalDispatch): added some more cursor
        movement support (Up/Down/Tab/Shift-Tab).
        (LocalDispatch): added also preliminari cursor-selection.

        * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.

        * src/paragraph.C (PasteParagraph): Hopefully now right!

2000-05-22  Garst R. Reese  <reese@isn.net>

        * layouts/hollywood.layout, broadway.layout : move Dialogue to top
         of list, change all references to Environment to Command
        * tex/hollywood.cls : rewrite environments as commands, add 
        \uppercase to interiorshot and exteriorshot to force uppecase.
        * tex/broadway.cls : rewrite environments as commands. Tweak
        whitespace.

2000-05-22  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/menus.C (Add_to_toc_menu): fix the code which limits the
        size of items: use a constant intead of the hardcoded 40, and more
        importantly do not remove the %m and %x tags added at the end.
        (Add_to_refs_menu): use vector::size_type instead of
        unsigned int as basic types for the variables. _Please_ do not
        assume that size_t is equal to unsigned int. On an alpha, this is
        unsigned long, which is _not_ the same.

        * src/language.C (initL): remove language "hungarian", since it
        seems that "magyar" is better.

2000-05-22  Juergen Vigna  <jug@sad.it>

        * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!

        * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
        end markers!

        * src/paragraph.C (PasteParagraph): Possibly a memory leak as
        next was deleted but not set to 0.

2000-05-21  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/language.C (initL): change the initialization of languages
        so that compiles goes _fast_.

        * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
        40 chars.

        * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.

2000-05-21  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * release 1.1.5pre3

2000-05-20  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/WorkArea.C (request_clipboard_cb): give "C" linkage.

2000-05-19  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/commandtags.h
        * src/LyXAction.C
        * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
        and LFUN_LOAVIEW
        
        * src/insets/insetlo*.[Ch]: Made editable

2000-05-20  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/text2.C (SetSelection): call BufferView::stuffClipboard with
        the current selection.

        * src/BufferView_pimpl.C (stuffClipboard): new method

        * src/BufferView.C (stuffClipboard): new method

        * src/paragraph.C (String): new method

        * src/LColor.C (getFromLyXName): return LColor::inherit instead of
        LColor::ignore when lyxname is not found.

        * src/BufferView.C (pasteSelection): new method

        * src/BufferView_pimpl.C (pasteSelection): new method

        * src/lyxfunc.C (Dispatch): use the new clipboard functions.

        * src/WorkArea.C (request_clipboard_cb): new static function
        (getClipboard): new method
        (putClipboard): new method

2000-05-19  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * LyX 1.1.5pre2 released

2000-05-19  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/vspace.C (operator=): removed
        (operator=): removed

        * src/lyx_gui_misc.C (askForText): manually set the type in make_pair

        * src/layout.C (NumberOfClass): manually set the type in make_pair
        (NumberOfLayout): ditto

        * src/language.C: use the Language constructor for ignore_lang

        * src/language.h: add constructors to struct Language

        * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>

        * src/text2.C (SetCursorIntern): comment out #warning

        * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast

        * src/mathed/math_iter.h: initialize sx and sw to 0

2000-05-10  Dekel Tsur  <dekel@math.tau.ac.il>

        * forms/lyx.fd: Redesign of form_ref

        * src/LaTeXFeatures.[Ch]
        * src/buffer.C
        * src/lyx_cb.C
        * src/menus.C   
        * src/insets/insetref.[Ch]: Added support for varioref and prettyref.

        * src/buffer.h
        * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
        and Buffer::inset_iterator.

        * src/menus.C: Added new menus: TOC and Refs.

        * src/insets/insetlabel.C (Edit) Made InsetLabel editable.

        * src/buffer.C (getTocList): New method.

        * src/BufferView2.C (ChangeRefs): New method.

        * src/buffer.C (getLabelList): New method. It replaces the old
        getReferenceList. The return type is vector<string> instead of 
        string.

        * src/insets/insetinclude.C (getLabelList): New method. Replaces
        the old getLabel() and GetNumberOfLabels() methods.
        * src/insets/insetlabel.C (getLabelList): ditto
        * src/mathed/formula.C (getLabelList): ditto
        
        * src/paragraph.C (String): New method.

        * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
        Uses the new getTocList() method. 
        TocSelectCB() now calls to TocUpdateCB() before moving the cursor, 
        which automatically updates the contents of the browser.
        (RefUpdateCB): Use the new getLabelList method.

        * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
        
        * src/BufferView2.C (gotoLabel) Use the new getLabelList method.

        * src/spellchecker.C: Added using std::reverse;

2000-05-19  Juergen Vigna  <jug@sad.it>

        * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.

        * src/insets/insettext.C (computeTextRows): small fix for display of
        1 character after a newline.

        * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
        to cont-rows!

2000-05-18  Juergen Vigna  <jug@sad.it>

        * src/insets/insettabular.C (TabularFeatures): fixed update of display
        when changing width of column.

        * src/tabular.C (set_row_column_number_info): setting of
        autobreak rows if necessary.

2000-05-17  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()

        * src/vc-backend.*: renamed stat() to status() and vcstat to
        vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
        compilation broke. The new name seems more relevant, anyway.

2000-05-17  Juergen Vigna  <jug@sad.it>

        * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
        which was wrong if the removing caused removing of rows!

        * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
        (pushToken): new function.

        * src/text2.C (CutSelection): fix problem discovered with purify

2000-05-17  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/debug.C (showTags): enlarge the first column, now that we
        have 6-digits debug codes.

        * lib/layouts/hollywood.layout:
        * lib/tex/hollywood.cls:        
        * lib/tex/brodway.cls: 
        * lib/layouts/brodway.layout: more commands and fewer
        environments. Preambles moved in the .cls files. Broadway now has 
        more options on scene numbering and less whitespace (from Garst)

        * src/insets/insetbib.C (getKeys): make sure that we are in the
        document directory, in case the bib file is there.

        * src/insets/insetbib.C (Latex): revert bogus change.

2000-05-16  Juergen Vigna  <jug@sad.it>

        * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
        the TabularLayout on cursor move.

        * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable

        * src/insets/insettabular.C (Clone): Clone the LyXTabular for
        undo-handling.
        (getCellXPos): 
        (draw): fixed cursor position and drawing so that the cursor is
        visible when before the tabular-inset.

        * src/insets/insettext.C (init): drawLockedFrame was not initialized
        when creating from old insettext.

        * src/tabular.C (Clone): added Clone of text-inset for undo-handling.

2000-05-15  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
        * lib/tex/brodway.cls: ditto 

        * lib/layouts/brodway.layout: change alignment of parenthical
        layout (Garst)
        
2000-05-12  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
        versions 0.88 and 0.89 are supported.

2000-05-15  Juergen Vigna  <jug@sad.it>

        * src/insets/insetcollapsable.C (draw): enhancements in drawing and
        width calculating.

        * src/insets/insettext.C (computeTextRows): redone completely this
        function in a much cleaner way, because of problems when having a
        fixed maxWidth.
        (draw): added a frame border when the inset is locked.
        (SetDrawLockedFrame): this sets if we draw the border or not.
        (SetFrameColor): this sets the frame color (default=insetframe).

        * src/insets/lyxinset.h: added x() and y() functions which return
        the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
        function which is needed to see if we have a locking inset of some
        type in this inset (needed for now in insettabular).

        * src/vspace.C (inPixels): the same function also without a BufferView
        parameter as so it is easier to use it in some ocasions.

        * src/lyxfunc.C: changed all places where insertInset was used so
        that now if it couldn't be inserted it is deleted!

        * src/TabularLayout.C: 
        * src/TableLayout.C: added support for new tabular-inset!

        * src/BufferView2.C (insertInset): this now returns a bool if the
        inset was really inserted!!!

        * src/tabular.C (GetLastCellInRow): 
        (GetFirstCellInRow): new helper functions.
        (Latex): implemented for new tabular class.
        (TeXCellPostamble): 
        (TeXCellPreamble): 
        (TeXBottomHLine): 
        (TeXTopHLine): new Latex() helper functions.

2000-05-12  Juergen Vigna  <jug@sad.it>

        * src/mathed/formulamacro.C (Read): 
        * src/mathed/formula.C (Read): read also the \end_inset here!

2000-05-10  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
        crush when saving formulae with unbalanced parenthesis.

20000-05-11  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/layout.C: Add new keyword "endlabelstring" to layout file

        * src/text.C (GetVisibleRow): Draw endlabel string.

        * lib/layouts/broadway.layout
        * lib/layouts/hollywood.layout: Added endlabel for the
        Parenthetical layout.

        * lib/layouts/heb-article.layout: Do not use slanted font shape
        for Theorem like environments.

        * src/buffer.C (makeLaTeXFile): Always add "american" to 
        the UsedLanguages list if document language is RTL. 

2000-05-11  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * add addendum to README.OS2 and small patch (from SMiyata)

2000-05-10  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * many files: correct the calls to ChangeExtension().

        * src/support/filetools.C (ChangeExtension): remove the no_path
        argument, which does not belong there. Use OnlyFileName() instead.

        * src/insets/insetbib.C (Latex): use absolute paths for bibtex
        files when LaTeXing a non-nice latex file.

        * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
        a chain of "if". Return false when deadkeys are not handled.
        
        * src/lyx_main.C (LyX): adapted the code for default bindings.

        * src/kbmap.C (defaultKeyBindings): new method. Performs the default
        bindings for basic functionality (except deadkeys).
        (deadKeyBindings): new method. Performs the bindings of deadkeys.

        * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C 
        several methods: handle override_x_deadkeys.

        * src/lyxrc.h: remove the "bindings" map, which did not make much
        sense anyway. New variable override_x_deadkeys, defaulting to "true".
        
2000-05-09  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxfont.C (stateText): use a saner method to determine
        whether the font is "default". Seems to fix the crash with DEC
        cxx. 

        * src/Bullet.[Ch] (Bullet): remove const on parameters.

2000-05-08  Juergen Vigna  <jug@sad.it>

        * src/insets/insettabular.C (InsetButtonRelease): Now opens the
        TabularLayoutMenu with mouse-button-3
        (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.

        * src/TabularLayout.C: added this file for having a Layout for
        tabular-insets.

2000-05-05  Juergen Vigna  <jug@sad.it>

        * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
        recalculating inset-widths.
        (TabularFeatures): activated this function so that I can change
        tabular-features via menu.

        * src/menus.C (ShowEditMenu): inserted support for insettabular so
        that I can test some functions with the Table menu.

2000-05-05  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyxfont.C (stateText): guard against stupid c++libs.

        * src/tabular.C: add using std::vector
        some whitespace changes, + removed som autogenerated code.

        * src/buffer.C (parseSingleLyXformat2Token): stupid bug.

2000-05-05  Juergen Vigna  <jug@sad.it>

        * src/tabular.[Ch]: now using std:vector instead of arrays for all the
        row, columns and cellstructures.

2000-05-05  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * lib/lyxrc.example: remove obsolete entries.

        * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
        reading of protected_separator for free_spacing.

2000-05-05  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/text.C (draw): do not display an exclamation mark in the
        margin for margin notes. This is confusing, ugly and
        uninformative. 

        * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
        AMS math' is checked.

        * src/buffer.C (makeLaTeXFile): do not depend on the textclass
        name to see whether including the amsmath package is needed.

2000-05-05  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/paragraph.C (validate): Compute UsedLanguages correctly
        (don't insert the american language if it doesn't appear in the
        document)

        * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
        The argument of \thanks{} command is considered moving argument

        * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
        moving argument.

2000-05-04  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/text.C (GetVisibleRow): Improved drawing of vertical lines
        for appendix/minipage/depth. The lines can be now both in the footnote 
        frame, and outside the frame.

        * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
        points ("nikud")

2000-05-05  Juergen Vigna  <jug@sad.it>

        * src/table.[Ch]: removed the inset and buffer stuff as this is now
        neede only in tabular.[Ch].

2000-05-05  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/insets/insetspecialchar.C (Read): allow command == '~' for
        PROTECTED_SEPARATOR 
        (Write): write '~' for PROTECTED_SEPARATOR

2000-05-04  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyxparagraph.h: add a friend struct matchIT after the struct
        InsetTable.

        * src/mathed/formula.C (drawStr): rename size to siz.

        * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
        possibly fix a bug by not changing the pflags = flags to piflags =
        flags.

2000-05-05  Juergen Vigna  <jug@sad.it>

        * src/insets/insetbib.C: moved using directive

        * src/ImportNoweb.C: small fix for being able to compile (missing
        include cstdlib)

2000-05-04  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
        to use clear, since we don't depend on this in the code. Add test
        for string::compare

2000-05-04  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * (various *.C files): add using std::foo directives to please dec
        cxx.

        * replace calls to string::clear() to string::erase() (Angus)

        * src/cheaders/cmath: modified to provide std::abs.

2000-05-04  Juergen Vigna  <jug@sad.it>

        * src/insets/insettext.C: Prepared all for inserting of multiple
        paragraphs. Still display stuff to do (alignment and other things),
        but I would like to use LyXText to do this when we cleaned out the
        table-support stuff.

        * src/insets/insettabular.C: Changed lot of stuff and added lots
        of functionality still a lot to do.

        * src/tabular.C: Various functions changed name and moved to be
        const functions. Added new Read and Write functions and changed
        lots of things so it works good with tabular-insets (also removed
        some stuff which is not needed anymore * hacks *).

        * src/lyxcursor.h: added operators == and != which just look if
        par and pos are (not) equal.

        * src/buffer.C (latexParagraphs): inserted this function to latex
        all paragraphs form par to endpar as then I can use this too for
        text-insets.

        * src/text2.C (SetLayout): Changed this to use a cursor this is needed
        so that I can call this to from text insets with their own cursor.

        * src/buffer.C (makeLaTeXFile): added the output of one \n after the
        output off all paragraphs (because of the fix below)!

        * src/paragraph.C (TeXOnePar): removed output of \n when we are in
        the very last paragraph (this could be also the last paragraph of an
        inset!)

        * src/texrow.h: added rows() call which returns the count-variable.

2000-05-03  Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>

        * lib/lyxrc.example: fix examples for exporting SGML to HTML.

        * lib/configure.m4: better autodetection of DocBook tools.

2000-04-28  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyx_main.C (easyParse): use lyxerr instead of cerr.

        * src/lyx_cb.C: add using std::reverse;

        * src/LaTeX.C (run): on error always run deleteFilesOnError before
        returning.

        * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
        selected files. Should fix repeated errors from generated files.

2000-04-27  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs

        * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
        the spellchecker popup. 

        * lib/lyxrc.example:  Removed the \number_inset section

2000-04-28  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/insets/figinset.C (various): Use IsFileReadable() to make
        sure that the file actually exist. Relying on ghostscripts errors
        is a bad idea since they can lead to X server crashes.  

2000-04-27  Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>

        * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
        open under CYGWIN 

        * lib/lyxrc.example: smallish typo in description of
        \view_dvi_paper_option 

2000-04-26  André Pönitz <poenitz@mathematik.tu-chemnitz.de>

        * src/lyxfunc.h:
        * src/lyxfunc.C: doImportHelper to factor out common code of the
        various import methods. New functions doImportASCIIasLines,
        doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
        doImportLinuxDoc  for the  format specific parts.

        * buffer.h:
        * buffer.C: Dispatch  returns now a bool to indicate success

        * lyx_gui.h:
        * lyx_gui.C: Add getLyXView() for member access

        * lyx_main.C: Change logic for batch commands: First try
        Buffer::Dispatch (possibly without GUI), if that fails, use
        LyXFunc::Dispatch

        * lyx_main.C: Add support for --import command line switch.
        Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
        Available Formats: Everything  accepted by 'buffer-import <format>'

2000-04-27  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyx_gui.C (create_forms): small oneliner from Garst to have
        unnumbered parts.

        * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
        documents will be reformatted upon reentry.

2000-04-27  Juergen Vigna  <jug@sad.it>

        * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
        correctly only last pos this was a bug.

2000-04-26  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * release of lyx-1.1.5pre1

2000-04-26  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/insets/insettabular.[Ch]: fix the Clone() declaration.

        * src/menus.C: revert the change of naming (Figure->Graphic...)
        from 2000-04-11. It was incomplete and bad.
        
        * src/LColor.[Ch]: add LColor::depthbar.
        * src/text.C (GetVisibleRow): use it.

        * README: update the languages list.

2000-04-25  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/text.C (GetVisibleRow): show the depth of paragraphs using
        vertical bars.

2000-04-26  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * README: remove sections that were just wrong.

        * src/text2.C (GetRowNearY): remove currentrow code

        * src/text.C (GetRow): remove currentrow code

        * src/screen.C (Update): rewritten a bit.
        (SmallUpdate): removed func

        * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
        used.
        (FullRebreak): return bool
        (currentrow): remove var
        (currentrow_y): ditto

        * src/lyxscreen.h (Draw): change arg to unsigned long
        (FitCursor): return bool
        (FitManualCursor): ditto
        (Smallpdate): remove func
        (first): change to unsigned long
        (DrawOneRow): change second arg to long (from long &)
        (screen_refresh_y): remove var
        (scree_refresh_row): ditto
        
        * src/lyxrow.h: change baseline to usigned int from unsigned
        short, this brings some implicit/unsigned issues out in the open.

        * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
        accordingly.
        (Dispatch): don't call updateScrollbar after fitCursor. Use update
        instead of smallUpdate.

        * src/lyxcursor.h: change y to unsigned long

        * src/buffer.h: don't call updateScrollbar after fitcursor

        * src/buffer.C (parseSingleLyXformat2Token): move variables to
        where they are used. Removed "\\direction", this was not present
        in 1.1.4 and is already obsolete. Commented out some code that I
        believe to never be called.
        (runLiterate): don't call updateScrollbar after fitCursor
        (runLaTeX): ditto
        (buildProgram): ditto
        (runChktex): ditto

        * src/WorkArea.h (workWidth): change return val to unsigned
        (width): ditto
        (height): ditto
        (redraw): remove the button redraws
        (setScrollbarValue): change for scrollbar
        (getScrollbarValue): change for scrollbar
        (getScrollbarBounds): change for scrollbar

        * src/WorkArea.C (C_WorkArea_up_cb): removed func
        (C_WorkArea_down_cb): removed func
        (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
        (resize): change for scrollbar
        (setScrollbar): ditto
        (setScrollbarBounds): ditto
        (setScrollbarIncrements): ditto
        (up_cb): removed func
        (down_cb): removed func
        (scroll_cb): change for scrollbar
        (work_area_handler): ditto

        * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
        when FitCursor did something.
        (updateScrollbar): some unsigned changes
        (downCB): removed func
        (scrollUpOnePage): removed func
        (scrollDownOnePage): remvoed func
        (workAreaMotionNotify): don't call screen->FitCursor but use
        fitCursor instead. and bool return val
        (workAreaButtonPress): ditto
        (workAreaButtonRelease): some unsigned changes
        (checkInsetHit): ditto
        (workAreaExpose): ditto
        (update): parts rewritten, comments about the signed char arg added
        (smallUpdate): removed func
        (cursorPrevious): call needed updateScrollbar
        (cursorNext): ditto

        * src/BufferView2.C (allFloats): don't call updateScrollbar after
        fitCursor.

        * src/BufferView.[Ch] (upCB): removed func
        (downCB): removed func
        (smallUpdate): removed func

2000-04-25  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyxtext.h src/text.C src/text2.C: removed support for the
        currentrow, currentrow_y optimization. This did not help a lot and
        if we want to do this kind of optimization we should rather use
        cursor.row instead of the currentrow. 

        * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
        buffer spacing and klyx spacing support.

2000-04-25  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
        a factor of 50!

2000-04-26  Juergen Vigna  <jug@sad.it>

        * src/insets/figinset.C: fixes to Lars sstream changes!

2000-04-23  Dekel Tsur  <dekel@math.tau.ac.il>

        * A lot of files: Added Ascii(ostream &) methods to all inset
        classes. Used when exporting to ASCII.
        
        * src/buffer.C (writeFileAscii,RoffAsciiTable)
        * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
        instead of Latex()

        * src/text2.C (ToggleFree): Disabled implicit word selection when
        there is a change in the language
        
        * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
        no output was generated for end-of-sentence inset.
        
        * src/insets/lyxinset.h
        * src/buffer.C
        * src/lyxfunc.C
        * src/paragraph.C: Removed the insetnumber code

        * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.

2000-04-22  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
        no_babel and no_epsfig completely from the file.
        (parseSingleLyXformat2Token): add handling for per-paragraph
        spacing as written by klyx.

        * src/insets/figinset.C: applied patch by Andre. Made it work with
        ostringstream too.

2000-04-20  Juergen Vigna  <jug@sad.it>

        * src/insets/insettext.C (cutSelection): 
        (copySelection): Fixed with selection from right to left.
        (draw): now the rows are not recalculated at every draw.
        (computeTextRows): for now reset the inset-owner here (this is
        important for an undo or copy where the inset-owner is not set
        automatically!)

        * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
        motion to the_locking_inset screen->first was forgotten, this was
        not important till we got multiline insets.

2000-04-19  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
        code seems to be alright (it is code changed by Dekel, and the
        intent is indeed that all macros should be defined \protect'ed)

        * NEWS: a bit of reorganisation of the new user-visible features.

2000-04-19  Juergen Vigna  <jug@sad.it>

        * src/insets/insettext.C (init): using a LyXCursor now for cursor
        position. Set the inset_owner of the used paragraph so that it knows
        that it is inside an inset. Fixed cursor handling with mouse and
        cursor keys. Fixed wrong timed inset redraws and lots of other changes
        and cleanups to make TextInsets work better.

        * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
        Changed parameters of various functions and added LockInsetInInset().

        * src/insets/insettext.C: 

        * src/insets/insetcollapsable.h: 
        * src/insets/insetcollapsable.C: 
        * src/insets/insetfoot.h: 
        * src/insets/insetfoot.C: 
        * src/insets/insetert.h: 
        * src/insets/insetert.C: cleaned up the code so that it works now
        correctly with insettext.

        * src/insets/inset.C: 
        * src/insets/lyxinset.h: inserted inset_owner and some more changes so
        that insets in insets are supported right.

        * src/table.h: 
        * src/table.C: lots of changes for use with inset tabular (and cleanup)

        * src/paragraph.C: some small fixes

        * src/debug.h: inserted INSETS debug info

        * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
        fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).

        * src/commandtags.h: 
        * src/LyXAction.C: insert code for InsetTabular.

        * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
        not Button1MotionMask.
        (workAreaButtonRelease): send always a InsetButtonRelease event to
        the_locking_inset.
        (checkInsetHit): some setCursor fixes (always with insets).

        * src/BufferView2.C (lockInset): returns a bool now and extended for
        locking insets inside insets.
        (showLockedInsetCursor): it is important to have the cursor always
        before the locked inset.
        (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.

        * src/BufferView.h: made lockInset return a bool.

        * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).

        * src/text2.C (SetCursor): This now has a version with a LyXCursor
        that is used also internally but can be called as public to have back
        a cursor pos which is not set internally.
        (SetCursorIntern): Changed to use above function.

        * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass

2000-04-19  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * ANNOUNCE: 
        * INSTALL: 
        * UPGRADING: 
        * NEWS: updated for prerelease of 1.1.5. Please comment and send
        patches for things that should be in or should be changed.

        * src/* [insetfiles]: change "usigned char fragile" to bool
        fragile. There was only one point that could that be questioned
        and that is commented in formulamacro.C. Grep for "CHECK".
        
        * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
        (DeleteBuffer): take it out of CutAndPaste and make it static.

2000-04-17  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/paragraph.C (TeXOnePar): use the new method in Spacing to
        output the spacing envir commands. Also the new commands used in
        the LaTeX output makes the result better.

        * src/Spacing.C (writeEnvirBegin): new method
        (writeEnvirEnd): new method

2000-04-18  Juergen Vigna  <jug@sad.it>

        * src/CutAndPaste.C: made textclass a static member of the class
        as otherwise it is not accesed right!!!

2000-04-17  Dekel Tsur  <dekel@math.tau.ac.il>

        * forms/layout_forms.fd
        * src/layout_forms.h
        * src/layout_forms.C (create_form_form_character)
        * src/lyx_cb.C (UserFreeFont)
        * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
       documents (in the layout->character popup).

2000-04-17  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/spellchecker.C (create_ispell_pipe): fix a bug where
        \spell_command was in fact not honored (from Kevin Atkinson).

        * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
        quitting (Angus)

        * src/lyx_gui.h: make lyxViews private (Angus)

2000-04-15  Dekel Tsur  <dekel@math.tau.ac.il>

        * src/mathed/math_write.C
        (MathMatrixInset::Write) Put \protect before \begin{array} and
        \end{array} if fragile
        (MathParInset::Write): Put \protect before \\ if fragile

2000-04-15  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
        initialization if the LyXColorHandler must be done after the
        connections to the XServer has been established.

        * src/insets/figinset.C (runqueue): change the grabing a bit. Also
        get the background pixel from the lyxColorhandler so that the
        figures are rendered with the correct background color.
        (NextToken): removed functions.
        (GetPSSizes): use ifs >> string instead of NextToken.

        * src/Painter.[Ch]: the color cache moved out of this file. 

        * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
        and lines.  

2000-04-14  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/WorkArea.C (work_area_handler): call BufferView::enterView
        and Buffer::leaveView when FL_ENTER and FL_LEAVE.

        * src/BufferView.C (enterView): new func
        (leaveView): new func

        * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
        when approp.
        (leaveView): new func, undefines xterm cursor when approp.

        * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
        (AllowInput): delete the Workarea cursor handling from this func.

        * src/Painter.C (underline): draw a slimer underline in most cases.

        * src/lyx_main.C (error_handler): use extern "C"

2000-04-12  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
        sent directly to me.

        * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
        to the list by Dekel.

        * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
        strstream too.

        * src/bufferview_funcs.[Ch]: two new files, moved several of the
        methods from lyx_cb.here.

        * src/lyx_cb.C: in addition to the above; removed input_prohibited
        it was not used.

2000-04-11  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
        instead of using current_view directly. 

        * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation

        * src/LyXAction.C (init): add the paragraph-spacing command.

        * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING

        * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing

        * src/lyx_cb.C (CurrentState): output a string when the spacing is
        different from the documents.

        * src/text.C (SetHeightOfRow): take paragraph spacing into
        account, paragraph spacing takes precedence over buffer spacing
        (GetVisibleRow): ditto

        * src/paragraph.C (writeFile): output the spacing parameter too.
        (validate): set the correct features if spacing is used in the
        paragraph. 
        (Clear): set spacing to default
        (MakeSameLayout): spacing too
        (HasSameLayout): spacing too
        (SetLayout): spacing too
        (TeXOnePar): output the spacing commands

        * src/lyxparagraph.h: added a spacing variable for use with
        per-paragraph spacing.

        * src/Spacing.h: add a Default spacing and a method to check if
        the current spacing is default. also added an operator==

        * src/text2.C (DeleteEmptyParagraphMechanism): added a
        RedoParagraphs.

2000-04-11  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxserver.C (callback): fix dispatch of functions

        * src/insets/insetlatexaccent.C (checkContents): turn bogus
        printf() into lyxerr call. 

        * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
        fonts. 

        * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
        "Table" to "Table Box", "Float" to "Floating Material"; deletes
        the "Float" from each of the subitems.
        (ShowHelpMenu): add entry for "FAQ" and "TOC".

        * src/support/DebugStream.h: add an #ifdef to work around a gcc
        2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
        documented the change so that the workaround can be nuked later.

        * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from 
        LyX::init().
        
        * src/lyxlex_pimpl.C (next): do not re-declare the default value
        of arguments.
        * src/buffer.C (getLatexName): ditto
        (setReadonly): ditto

2000-04-11  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/LaTeXFeatures.h: add a const reference to BufferParams, to
        avoid some uses of current_view. Added also a bufferParams()
        method to get at this.

        * src/lyxtext.h: changed params->buffer and paramters->bparams.

2000-04-10  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyxparagraph.[Ch]: removed
        operator<(LyXParagraph::InsetTable..., added a struct matchIT
        with operators used by lower_bound and
        upper_bound in InsetTable's
        Make struct InsetTable private again. Used matchpos.

2000-04-08  Dekel Tsur  <dekel@math.tau.ac.il>
        
        * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
        document, the language of existing text is changed (unless the
        document is multi-lingual)

        * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.

        * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.

        * A lot of files: A rewrite of the Right-to-Left support.
                                                                           
2000-04-10  Juergen Vigna  <jug@sad.it>

        * src/BufferView2.C (showLockedInsetCursor): small bugfix for
        misplaced cursor when inset in inset is locked.

        * src/insets/insettext.C (LocalDispatch): small fix so that a
        BREAKLINE is not inserted if we don't permit it with autBreakRows.

        * src/insets/insetfoot.C (GetDrawFont): implemented this as the
        footnote font should be decreased in size twice when displaying.

        * src/insets/insettext.C (GetDrawFont): inserted this function as
        the drawing-font may differ from the real paragraph font.

        * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
        insets (inset in inset!).

        * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
        function here because we don't want footnotes inside footnotes.

        * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
        Cloned insets.
        (init): now set the inset_owner in paragraph.C
        (LocalDispatch): added some resetPos() in the right position
        (cutSelection): 
        (copySelection): 
        (pasteSelection): changed to use the new CutAndPaste-Class.

        * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
        which tells if it is allowed to insert another inset inside this one.

        * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
        SwitchLayoutsBetweenClasses.

        * src/text2.C (InsertInset): checking of the new paragraph-function
        InsertInsetAllowed.
        (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
        is not needed anymore here!
        (CutSelection): 
        (CopySelection): 
        (PasteSelection): redone (also with #ifdef) so that now this uses
        the CutAndPaste-Class.
        (SwitchLayoutsBetweenClasses): removed here and implemented in the
        CutAndPaste-Class.
        
        * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
        from/to text/insets.

        * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
        so that the paragraph knows if it is inside an (text)-inset.
        (InsertFromMinibuffer): changed return-value to bool as now it
        may happen that an inset is not inserted in the paragraph.
        (InsertInsetAllowed): this checks if it is allowed to insert an
        inset in this paragraph.
        (PasteParagraph): 
        (BreakParagraphConservative): 
        (BreakParagraph) : small change for the above change of the return
        value of InsertFromMinibuffer.

        * src/lyxparagraph.h: added inset_owner and the functions to handle
        this (SetInsetOwner(), InInset() and InsertInsetAllowed()).

2000-04-10  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
        functions from BufferView to BufferView::Pimpl to ease maintence.
        
        * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
        correctly. Also use SetCursorIntern instead of SetCursor.

        * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
        correct color.

2000-04-08  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/WorkArea.C (belowMouse): manually implement below mouse.

        * src/*: Add "explicit" on several constructors, I added probably
        some unneeded ones. A couple of changes to code because of this.

        * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
        implementation and private parts from the users of BufferView. Not
        quite finished.

        * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
        implementation and private parts from the users of LyXLex. Not
        quite finished.

        * src/BufferView_pimpl.[Ch]: new files

        * src/lyxlex_pimpl.[Ch]: new files

        * src/LyXView.[Ch]: some inline functions move out-of-line

2000-04-04  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxparagraph.h: make struct InsetTable public.

        * src/support/lyxstring.h: change lyxstring::difference_type to be
        ptrdiff_t. Add std:: modifiers to streams.

        * src/font.C: include the <cctype> header, for islower() and
        isupper(). 

2000-04-03  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/font.[Ch]: new files. Contains the metric functions for
        fonts, takes a LyXFont as parameter. Better separation of concepts.
        
        * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
        changes because of this.

        * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead

        * src/*: compile with -Winline and move functions that don't
        inline out of line.
        
        * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
        instead of strspn.

2000-04-02  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
        (various files changed because of this)

        * src/Painter.C (text): fixed the drawing of smallcaps.

        * src/lyxfont.[Ch] (drawText): removed unused member func.
        (drawString): ditto

        * src/*.C: added needed "using" statements and "std::" qualifiers. 

2000-03-31  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/*.h: removed all use of "using" from header files use
        qualifier std:: instead. 

2000-04-03  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/text.C (Backspace): some additional cleanups (we already
        know whether cursor.pos is 0 or not).

        * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
        automake does not provide one).

        * src/bmtable.h: replace C++ comments with C comments.

2000-04-02  Dekel Tsur <dekel@math.tau.ac.il>

        * src/screen.C (ShowCursor): Change the shape of the cursor if
        the current language is not equal to the language of the document.
        (If the cursor change its shape unexpectedly, then you've found a bug)

        * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
        bugs [I hope...]

        * src/insets/insetnumber.[Ch]: New files.

        * src/LyXAction.C (init)
        * src/lyxfunc.C (dispatch): Add command number-inset-insert

        * lyxrc.example
        * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset

        * src/lyxparagraph.h
        * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
        (the vector is kept sorted).

        * src/text.C (GetVisibleRow): Draw selection correctly when there
        is both LTR and RTL text.

        * src/paragraph.C (Clone): Use the assignment operator for cloning,
        which is much faster.

        * src/text.C (GetVisibleRow and other): Do not draw the last space 
        in a row if the direction of the last letter is not equal to the
        direction of the paragraph.

        * src/lyxfont.C (latexWriteStartChanges):
        Check that font language is not equal to basefont language.
        (latexWriteEndChanges): ditto

        * src/lyx_cb.C (StyleReset): Don't change the language while using
        the font-default command.

        * src/paragraph.C (GetFirstFontSettings): Handle correctly an
        empty paragraph before a footnote.

        * src/insets/insetcommand.C (draw): Increase x correctly.

        * src/screen.C (ShowCursor): Change cursor shape if
        current language != document language.

        * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()

2000-03-31  Juergen Vigna  <jug@sad.it>

        * src/paragraph.C (GetInset): commented out text[pos] = ' '
        (Clone): changed mode how the paragraph-data is copied to the
        new clone-paragraph.

        * src/lyxfunc.C (Dispatch): fixed small problem when calling
        GetInset(pos) with no inset anymore there (in inset UNDO)

        * src/insets/insetcommand.C (draw): small fix as here x is
        incremented not as much as width() returns (2 before, 2 behind = 4)

2000-03-30  Juergen Vigna  <jug@sad.it>

        * src/insets/insettext.C (InsetText): small fix in initialize
        widthOffset (should not be done in the init() function)

2000-03-29  Amir Karger <karger@lyx.org>

        * lib/examples/it_ItemizeBullets.lyx: translation by 
        Stefano Mastella

        * Implemented \textasciitilde and fixed a tiny bug in reLyX

2000-03-29  Juergen Vigna  <jug@sad.it>

        * src/insets/insetcollapsable.C (Clone): same as in InsetFoot

        * src/insets/insetfoot.C (Clone): small change as for the below
        new init function in the text-inset

        * src/insets/insettext.C (init): new function as I've seen that
        clone did not copy the Paragraph-Data!
        (LocalDispatch): Added code so that now we have some sort of Undo
        functionality (well actually we HAVE Undo ;)

        * src/text.C (Backspace): Small fix for the a | a Backspace problem

2000-03-24  Dekel Tsur <dekel@math.tau.ac.il>
        
        * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
        were erased)

2000-03-22  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/main.C: added a runtime check that verifies that the xforms
        header used when building LyX and the library used when running
        LyX match. Exit with a message if they don't match. This is a
        version number check only.

        * src/buffer.C (save): Don't allocate memory on the heap for
        struct utimbuf times.

        * *: some using changes, use iosfwd instead of the real headers.

        * src/lyxfont.C use char const * instead of string for the static
        strings. Rewrite some functions to use sstream.

2000-03-28  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/text.C (Backspace): hopefully fix the dreaded backaspace
        bug. 

2000-03-27  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
        of Geodesy (from Martin Vermeer)

        * lib/layouts/svjour.inc: include file for the Springer svjour
        class. It can be used to support journals other than JoG.

        * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
        Miskiewicz <misiek@pld.org.pl>)
        * lib/reLyX/Makefile.am: ditto.

2000-03-27  Juergen Vigna  <jug@sad.it>

        * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
        also some modifications with operations on selected text.

        * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
        problems with clicking on insets (last famous words ;)

        * src/insets/insetcommand.C (draw): 
        (width): Changed to have a bit of space before and after the inset so
        that the blinking cursor can be seen (otherwise it was hidden)

2000-03-22  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
        would not be added to the link list when an installed gettext (not
        part of libc) is found.

2000-03-24  Juergen Vigna  <jug@sad.it>

        * src/insets/insetcollapsable.C (Edit): 
        * src/mathed/formula.C (InsetButtonRelease): 
        (InsetButtonPress): fixed for new handling of ButtonPress/Release
        handling.

        * src/BufferView.C (workAreaButtonPress): 
        (workAreaButtonRelease): 
        (checkInsetHit): Finally fixed the clicking on insets be handled
        correctly!

        * src/insets/insetert.C (Edit): inserted this call so that ERT
        insets work always with LaTeX-font

2000-03-21  Kayvan A. Sylvan  <kayvan@camel.internal.sylvan.com>

        * src/lyx_main.C (easyParse): Removed misplaced gui=false which
        caused lyx to startup with no GUI in place, causing in a crash
        upon startup when called with arguments.

2000-03-21  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/FontLoader.C: better initialization of dummyXFontStruct.

2000-03-20 José Abílio Matos <jamatos@lyx.org>

        * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
        for linuxdoc and docbook import and export format options.

        * lib/lyxrc.example Example of default values for the previous flags.

        * src/lyx_cb.C Use those flags instead of the hardwired values for
        linuxdoc and docbook export.

        * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
        linuxdoc import.

        * src/menus.C Added menus entries for the new import/exports formats.
        
2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>

        * src/lyxrc.*: Added support for running without Gui 
        (\use_gui false)
          
        * src/FontLoader.C: sensible defaults if no fonts are needed

        * src/lyx_cb.C: New function ShowMessage (writes either to the
        minibuffer or cout in case of no gui
        New function AskOverwrite for common stuff
        Consequently various changes to call these functions

        * src/lyx_main.C:  allow gui = false and handle lyxrc \use_gui false
        wild guess at sensible screen resolution when having no gui

        * src/lyxfont.C: no gui, no fonts... set some defaults

2000-03-20  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/LColor.C: made the command inset background a bit lighter.

2000-03-20  Hartmut Goebel <goebel@noris.net>

        * lib/layouts/stdstruct.inc: split into stdtitle.inc and
        stdstruct.inc. Koma-Script added some title elements which
        otherwise have been listed below "bibliography". This split allows
        adding title elements to where they belong.

        * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
        define the additional tilte elements and then include
        stdstruct.inc. 

        * many other layout files: changed to include stdtitle.inc just
        before stdstruct.inc.

2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>

        * src/buffer.C: (save) Added the option to store all backup files
        in a single directory

        * src/lyxrc.[Ch]: Added variable \backupdir_path

        * lib/lyxrc.example: Added descriptions of recently added variables

        * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
        bibtex inset, not closing the bibtex popup when deleting the inset)

2000-03-17  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyx_cb.C: add a couple using directives.

2000-03-17 José Abílio Matos <jamatos@lyx.org>
        * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc 
        import based on the filename.
        
        * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
        file would be imported at start, if the filename where of a sgml file.

        * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
        
        * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
        
2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
        * src/lyxfont.h Replaced the member variable bits.direction by the
        member variable lang. Made many changes in other files.
        This allows having a multi-lingual document

        * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
        that change the current language to <l>.
        Removed the command "font-rtl"

        * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
        format for Hebrew documents)

        * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
        When auto_mathmode is "true", pressing a digit key in normal mode 
        will cause entering into mathmode.
        If auto_mathmode is "rtl" then this behavior will be active only
        when writing right-to-left text.

        * src/text2.C (InsertStringA) The string is inserted using the
        current font.

        * src/paragraph.C (GetEndLabel) Gives a correct result for
        footnote paragraphs.

        * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug

2000-03-16  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
        front of PasteParagraph. Never insert a ' '. This should at least
        fix some cause for the segfaults that we have been experiencing,
        it also fixes backspace behaviour slightly. (Phu!)

        * src/support/lstrings.C (compare_no_case): some change to make it
        compile with gcc 2.95.2 and stdlibc++-v3

        * src/text2.C (MeltFootnoteEnvironment): change type o
        first_footnote_par_is_not_empty to bool.

        * src/lyxparagraph.h: make text private. Changes in other files
        because of this.
        (fitToSize): new function
        (setContentsFromPar): new function
        (clearContents): new function
        (SetChar): new function

        * src/paragraph.C (readSimpleWholeFile): deleted.

        * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
        the file, just use a simple string instead. Also read the file in
        a more maintainable manner.

        * src/text2.C (InsertStringA): deleted.
        (InsertStringB): deleted.

2000-03-15  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
        RedoParagraphs from the doublespace handling part, just set status
        to NEED_MORE_REFRESH. Also don't update cursor position (should be
        done, but perhaps not like this.)

2000-03-14  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/text2.C (InsertStringA): don't forget to insert a META_INSET
        character when inserting an inset.

2000-03-12  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/bufferparams.C (readLanguage): now takes "default" into
        consideration.

        * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
        also initialize the toplevel_keymap with the default bindings from
        lyxrc. 
        
        * src/buffer.C (Buffer): remove lyxrc from the parameters.

        * all files using lyxrc: have lyxrc as a real variable and not a
        pointer. remove all extern LyXRC * lyxrc. The equiv to this is
        done in lyxrc.h.
        
        * src/lyxrc.C: remove double call to defaultKeyBindings

        * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
        toolbar defauls using lyxlex. Remove enums, structs, functions
        related to this. 

        * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
        toolbar defaults. Also store default keybindings in a map.

        * src/ToolbarDefaults.[Ch]: New file. This class is used for
        storing the toolbar defaults without any xforms dependencies. 

        * src/insets/figinset.C: patch posted to list by Andre Poenitz
        applied. Changed to use iterators.

2000-03-11  Kayvan A. Sylvan  <kayvan@satyr.sylvan.com>

        * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
        systems that don't have LINGUAS set to begin with.

2000-03-10  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
        the list by Dekel Tsur.

2000-03-10  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
        * src/insets/form_graphics.C: ditto.

        * src/insets/inseturl.C (Latex): the free_spc argument is not used.

2000-03-10  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/bufferparams.C (readLanguage): use the new language map

        * src/intl.C (InitKeyMapper): use the new language map

        * src/lyx_gui.C (create_forms): use the new language map

        * src/language.[Ch]: New files. Used for holding the information
        about each language. Now! Use this new language map enhance it and
        make it really usable for our needs. 

2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
        
        * screen.C (ShowCursor): Removed duplicate code.
        (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
        L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
        
        * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin

        * src/lyxtext.h
        * src/text.C  Added TransformChar method. Used for rendering Arabic
        text correctly (change the glyphs of the letter according to the
        position in the word)

        * src/buffer.C
        * src/paragraph.C
        * src/lyxrc.h
        * src/lyxrc.C  Added lyxrc command {language_command_begin,
        language_command_end,language_command_ltr,language_command_rtl,
        language_package} which allows the use of either arabtex or Omega
        for Arabic

        * src/lyx_gui.C (init)
        * src/lyxrc.h
        * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
        to use encoding for menu fonts which is different than the encoding
        for screen fonts

        * src/buffer.C (makeLaTeXFile): If params.language = "default",
        do not load the babel package.
        To write an English document with Hebrew/Arabic, change the document
        language to "english".

        * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
        (alphaCounter): changed to return char
        (loweralphaCounter, hebrewCounter, romanCounter): New functions

        * lib/lyxrc.example  Added examples for Hebrew/Arabic

        * src/layout.h
        * src/layout.C  Added layout command endlabeltype

        * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const

        * src/text.C (GetVisibleRow): Draw a box at the end of proof layout

2000-03-10  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/mathed/math_delim.C (search_deco): return a
        math_deco_struct* instead of index.

2000-03-09  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * All files with a USE_OSTREAM_ONLY within: removed all code that
        was unused when USE_OSTREAM_ONLY is defined.
        
        * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
        of any less. Removed header and using.

        * src/text.C (GetVisibleRow): draw the string "Page Break
        (top/bottom)" on screen when drawing a pagebreak line.

2000-03-09  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.

        * src/mathed/math_macro.C (draw): do some cast magic.
        (Metrics): ditto.

        * src/mathed/math_defs.h: change byte* argument to byte const*.

        * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.

        * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
        know it is right to return InsetFoot* too, but cxx does not like
        it...). 

        * src/insets/insetcollapsable.[Ch] (Clone): make const.

        * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.

        * src/mathed/math_delim.C: change == to proper assignment.

2000-03-09  Juergen Vigna  <jug@sad.it>

        * src/insets/insettext.C (setPos): fixed various cursor positioning
        problems (via mouse and cursor-keys)
        (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
        inset (still a small display problem but it works ;)

        * src/insets/insetcollapsable.C (draw): added button_top_y and
        button_bottom_y to have correct values for clicking on the inset.

        * src/support/lyxalgo.h: commented out 'using std::less'

2000-03-08  Juergen Vigna  <jug@sad.it>

        * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
        Button-Release event closes as it is alos the Release-Event
        which opens it.

        * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT

2000-03-07  Kayvan A. Sylvan  <kayvan@camel.internal.sylvan.com>

        * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
        can add multiple spaces in Scrap (literate programming) styles...
        which, by the way, is how I got hooked on LyX to begin with.
 
        * src/mathed/formula.C (Write): Added dummy variable to an
        inset::Latex() call.
        (Latex): Add free_spacing boolean to inset::Latex()

        * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
        
        * src/insets/lyxinset.h: Changed definition of the inset::Latex()
        virtual function to include the free_spacing boolean from
        the containing paragraph's style.
 
        * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
        Added free_spacing boolean arg to match inset.h
        
        * src/insets/insettext.C, src/insets/insettext.h (Latex):
        Added free_spacing boolean arg to match inset.h
        
        * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
        Added free_spacing boolean and made sure that if in a free_spacing
        paragraph, that we output normal space if there is a protected space.
        
        * src/insets/insetref.C, src/insets/insetref.h (Latex):
        Added free_spacing boolean arg to match inset.h
        
        * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
        Added free_spacing boolean arg to match inset.h
        
        * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
        Added free_spacing boolean arg to match inset.h
        
        * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
        Added free_spacing boolean arg to match inset.h
        
        * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
        Added free_spacing boolean arg to match inset.h
        
        * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
        free_spacing boolean arg to match inset.h 
        
        * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
        Added free_spacing boolean arg to match inset.h
        
        * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
        Added free_spacing boolean arg to match inset.h
        
        * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
        Added free_spacing boolean arg to match inset.h
        
        * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
        Added free_spacing boolean arg to match inset.h
        
        * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
        Added free_spacing boolean arg to match inset.h
        
        * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
        free_spacing boolean arg to match inset.h
        
        * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
        free_spacing boolean arg to match inset.h
        
        * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
        ignore free_spacing paragraphs. The user's spaces are left
        alone. 
        
        * src/text.C (InsertChar): Fixed the free_spacing layout
        attribute behavior. Now, if free_spacing is set, you can
        add multiple spaces in a paragraph with impunity (and they
        get output verbatim).
        (SelectSelectedWord): Added dummy argument to inset::Latex()
        call.
        
        * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
        calls.
        
        * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
        paragraph layouts now only input a simple space instead.
        Special character insets don't make any sense in free-spacing
        paragraphs.
        
        * src/buffer.C (parseSingleLyXformat2Token): Code to convert
        hard-spaces in the *input* file to simple spaces if the layout
        is free-spacing. This converts old files which had to have
        hard-spaces in free-spacing layouts where a simple space was
        preferrable.
        (writeFileAscii): Added free_spacing check to pass to the newly
        reworked inset::Latex(...) methods. The inset::Latex() code
        ensures that hard-spaces in free-spacing paragraphs get output
        as spaces (rather than "~").
        
2000-03-09  Lars Gullik Bjønnes  <larsbj@lyx.org>
        
        * src/mathed/math_delim.C (draw): draw the empty placeholder
        delims with a onoffdash line.
        (struct math_deco_compare): struct that holds the "functors" used
        for the sort and the binary search in math_deco_table.
        (class init_deco_table): class used for initial sort of the
        math_deco_table. 
        (search_deco): use lower_bound to do a binary search in the
        math_deco_table.

2000-03-08  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyxrc.C: a small secret thingie...

        * src/lyxlex.C (printTable): changed to take a ostream as paramter
        and to not flush the stream as often as it used to.

        * src/support/lyxalgo.h: new file 
        (sorted): template function used for checking if a sequence is
        sorted or not. Two versions with and without user supplied
        compare. Uses same compare as std::sort.

        * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
        it and give warning on lyxerr.
        (pushTable): ditto
        (struct compare_tags): struct with function operators used for
        checking if sorted, sorting and lower_bound.
        (search_kw): use lower_bound instead of manually implemented
        binary search.

2000-03-08  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/insets/insetcollapsable.h: fix Clone() declaration.
        * src/insets/insetfoot.h: ditto.

        * src/insets/lyxinset.h: remove an extra comma at the end of enum.

2000-03-08  Juergen Vigna  <jug@sad.it>

        * src/insets/lyxinset.h: added owner call which tells us if
        this inset is inside another inset. Changed also the return-type
        of Editable to an enum so it tells clearer what the return-value is.

        * src/insets/insettext.C (computeTextRows): fixed computing of
        textinsets which split automatically on more rows.

        * src/insets/insetert.[Ch]: changed this to be of BaseType
        InsetCollapsable.

        * src/insets/insetfoot.[Ch]: added footnote inset

        * src/insets/insetcollapsable.[Ch]: added this BaseClass for
        collapsable insets (like footnote, ert, ...)

2000-03-08  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyxdraw.h: remvoe file

        * src/lyxdraw.C: remove file

        * src/insets/insettext.C: added <algorithm>.

2000-03-07  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
        (matrix_cb): case MM_OK use string stream

        * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
        stream.

        * src/mathed/math_macro.C (draw): use string stream
        (Metrics): use string stream

        * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
        directly to the ostream.

        * src/vspace.C (asString): use string stream.
        (asString): use string stream
        (asLatexString): use string stream

        * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
        setting Spacing::Other.

        * src/LaTeXFeatures.C (getPackages): use string stream instead of
        sprintf when creating the stretch vale.

        * src/text2.C (alphaCounter): changed to return a string and to
        not use a static variable internally. Also fixed a one-off bug.
        (SetCounter): changed the drawing of the labels to use string
        streams instead of sprintf.

        * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
        manipulator to use a scheme that does not require library support.
        This is also the way it is done in the new GNU libstdc++. Should
        work with DEC cxx now. 

2000-03-06  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/mathed/math_inset.h (Write(ostream & os): add a space at the
        end. This fixes a bug. 

        * src/mathed (all files concerned with file writing): apply the
        USE_OSTREAM_ONLY changes to mathed too.
        
        * src/support/DebugStream.h: make the constructor explicit.

        * src/lyxfont.C (latexWriteStartChanges): small bug related to
        count and ostream squashed.

2000-03-06  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.

        * src/buffer.C (makeLaTeXFile): add a .c_str(), since
        ostringstream uses STL strings, and we might not.

        * src/insets/insetspecialchar.C: add using directive.
        * src/insets/insettext.C: ditto.

2000-03-06  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * lib/layouts/seminar.layout: feeble attempt at a layout for
        seminar.cls, far from completet and could really use some looking
        at from people used to write layout files.

        * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
        use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
        a lot nicer and works nicely with ostreams.

        * src/mathed/formula.C (draw): a slightly different solution that
        the one posted to the list, but I think this one works too. (font
        size wrong in headers.)

        * src/insets/insettext.C (computeTextRows): some fiddling on
        Jürgens turf, added some comments that he should read.

        * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
        used and it gave compiler warnings.
        RC_SHOW_BANNER + "\\show_banner" added, also to reading and
        writing of lyxrc.

        * src/lyx_gui.C (create_forms): do the right thing when
        show_banner is true/false.

        * src/lyx_cb.C (TimerCB): no need to close or do anything if
        show_banner is false.

        * most file writing files: Now use iostreams to do almost all of
        the writing. Also instead of passing string &, we now use
        stringstreams. mathed output is still not adapted to iostreams.
        This change can be turned off by commenting out all the occurences
        of the "#define USE_OSTREAM_ONLY 1" lines.
        
        * src/WorkArea.C (createPixmap): don't output debug messages.
        (WorkArea): don't output debug messages.

        * lib/lyxrc.example: added a comment about the new variable
        \show_banner 

        * development/Code_rules/Rules: Added some more commente about how
        to build class interfaces and on how better encapsulation can be
        achieved. 

2000-03-03  Juergen Vigna  <jug@sad.it>

        * src/insets/insetert.C (InsetERT): Now ERT-insets break row
        automatically with the width of the LyX-Window

        * src/insets/insettext.C (computeTextRows): fixed update bug in
        displaying text-insets (scrollvalues where not initialized!)

2000-03-02  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
        id in the check of the result from lower_bound is not enough since
        lower_bound can return last too, and then res->id will not be a
        valid construct.

        *  all insets and some code that use them: I have conditionalized
        removed the Latex(string & out, ...) this means that only the
        Latex(ostream &, ...) will be used. This is a work in progress to
        move towards using streams for all output of files. 

        * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
        c to 0.

2000-03-02  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/mathed/math_utils.C (MathedLookupBOP): fix the search
        routine (this fixes bug where greek letters were surrounded by too
        much white space).

        * src/support/filetools.C (findtexfile): change a bit the search
        algorithm, to fix bug introduced in 1.1.4. Note that --format is
        no longer passed to kpsewhich, we may have to change that later.

        * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
        warning options to avoid problems with X header files (from Angus
        Leeming).
        * acinclude.m4: regenerated.

2000-03-02  Juergen Vigna  <jug@sad.it>

        * src/insets/insettext.C (WriteParagraphData): Using the
        par->writeFile() function for writing paragraph-data.
        (Read): Using buffer->parseSingleLyXformat2Token()-function
        for parsing paragraph data!

        * src/buffer.C (readLyXformat2): removed all parse data and using
        the new parseSingleLyXformat2Token()-function.
        (parseSingleLyXformat2Token): added this function to parse (read)
        lyx-file-format (this is called also from text-insets now!)

2000-03-01  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/paragraph.C (BeginningOfMainBody): initialize previous_char
        and temp.

        * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
        directly instead of going through a func. One very bad thing: a
        static LyXFindReplace, but I don't know where to place it. 

        * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
        string instead of char[]. Also changed to static.
        (GetSelectionOrWordAtCursor): changed to static inline
        (SetSelectionOverLenChars): ditto.

        * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
        current_view and global variables. both classes has changed names
        and LyXFindReplace is not inherited from SearchForm.
        
        * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
        fl_form_search form.

        * src/lyx_gui.C (create_forms): removed the fl_form_search form.

2000-03-01  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/bind/*.bind: make sure 'buffer-previous' function is not
        bound (from Kayvan).

        * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.

        * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.

2000-03-01  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * some things that I should comment but the local pub says head to
        swirly... 
        
        * comment out all code that belongs to the Roff code for Ascii
        export of tables. (this is unused)
        
        * src/LyXView.C: use correct type for global variable
        current_layout. (LyXTextClass::size_type)

        * some code to get the new insetgraphics closer to working I'd be
        grateful for any help.
        
        * src/BufferView2.C (insertInset): use the return type of
        NumberOfLayout properly. (also changes in other files)

        * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
        this as a test. I want to know what breaks because of this.

        * src/BufferView.[Ch] (tripleClick): name change from trippleClick.

2000-02-29  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * lib/layouts/stdlists.inc: changed the lyxlist latex definition
        to use a \makebox in the label, this allows proper justification
        with out using protected spaces or multiple hfills. Now it is
        "label" for left justified, "\hfill label\hfill" for center, and
        "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
        should be changed accordingly. 

2000-02-28  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxtext.h: change SetLayout() to take a
        LyXTextClass::size_type instead of a char (when there is more than
        127 layouts in a class); also change type of copylayouttype.
        * src/text2.C (SetLayout): ditto.
        * src/LyXView.C (updateLayoutChoice): ditto.

        * src/LaTeX.C (scanLogFile): errors where the line number was not
        given just after the '!'-line were ignored (from Dekel Tsur).

        * lib/lyxrc.example: fix description of \date_insert_format

        * lib/layouts/llncs.layout: new layout, contributed by Martin
        Vermeer. 

2000-02-25  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
        2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
        cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
        insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
        BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
        paragraph.C, text.C, text2.C)

2000-02-25  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/insets/insettext.C (LocalDispatch): remove extra break
        statement. 

        * src/insets/insetert.[Ch] (Clone): change return value to Inset*
        * src/insets/insettext.[Ch] (Clone): change return value to Inset*

        * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
        * src/insets/insettext.[Ch] (GetCursorPos): ditto

        * src/insets/insetbib.h: move InsetBibkey::Holder and
        InsetCitation::Holder in public space.

2000-02-25  Lars Gullik Bjønnes <larsbj@lyx.org>

        * src/insets/insettext.h: small change to get the new files from
        Juergen to compile (use "string", not "class string").

        * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
        const & as parameter to LocalDispatch, use LyXFont const & as
        paramter to some other func. This also had impacto on lyxinsets.h
        and the two mathed insets.

2000-02-24  Juergen Vigna  <jug@sad.it>

        * src/buffer.C:
        * src/commandtags.h: 
        * src/LyXAction.C:
        * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT

        * src/BufferView.h
        * src/BufferView.C
        * src/BufferView2.C: added/updated code for various inset-functions

        * src/insets/insetert.[Ch]: added implementation of InsetERT

        * src/insets/insettext.[Ch]: added implementation of InsetText

        * src/insets/inset.C (Edit): added "unsigned int button" parameter
        (draw): added preliminary code for inset scrolling not finshed yet

        * src/insets/inset.C (LocalDispatch): changed arg parameter to string
        as it is in lyxfunc.C now

        * src/insets/lyxinset.h: Added functions for text-insets

2000-02-22  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
        BufferView and reimplement the list as a queue put inside its own
        class.

        * src/bufferlist.[Ch] (updateInset): remove func, not needed.

        * several files: use the new interface to the "updateinsetlist"
        
        * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
        on doubleclick.
        (work_area_handler): call BufferView::trippleClick on trippleclick.

        * src/BufferView.C (doubleClick): new function, selects word on
        doubleclick. 
        (trippleClick): new function, selects line on trippleclick.

2000-02-22  Allan Rae  <rae@lyx.org>

        * lib/bind/xemacs.bind: buffer-previous not supported

2000-02-21  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
        as const.

2000-02-20  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/bufferlist.C: get rid of current_view from this file

        * src/spellchecker.C: get rid of current_view from this file

        * src/vspace.C: get rid of current_view from this file
        (inPixels): added BufferView parameter for this func
        (asLatexCommand): added a BufferParams for this func

        * src/text.C src/text2.C: get rid of current_view from these
        files.
        
        * src/lyxfont.C (getFontDirection): move this function here from
        text.C
        
        * src/bufferparams.C (getDocumentDirection): move this function
        here from text.C

        * src/paragraph.C (getParDirection): move this function here from
        text.C 
        (getLetterDirection): ditto
        
2000-02-18  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
        resize due to wrong pixmap beeing used. Also took the opurtunity
        to make the LyXScreen stateless on regard to WorkArea and some
        general cleanup in the same files.
        
2000-02-17  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/Makefile.am: add missing direction.h

        * src/PainterBase.h: made the width functions const.
        
        * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
        missing ones.
        
        * src/insets/insetcommand.C (draw): draw Editable as buttons.

        * src/insets/insetlatexaccent.C (draw): make the accents draw
        better, at present this will only work well with iso8859-1.
        
        * several files: remove the old drawing code, now we use the new
        painter only.

        * several files: remove support for mono_video, reverse_video and
        fast selection.

2000-02-17  Juergen Vigna  <jug@sad.it>

        * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
        int ** as we have to return the pointer, otherwise we have only
        NULL pointers in the returning function.

2000-02-16  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/LaTeX.C (operator()): quote file name when running latex.

2000-02-15  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/toolbar.C (set): use fl_set_object_helper for the tooltop
        (bubble tip), this removes our special handling of this.

        * Remove all code that is unused now that we have the new
        workarea. (Code that are not active when NEW_WA is defined.)

        * Make the uses of XSync not conditionalized on define USE_XSYNC.
        
2000-02-15  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
        nonexisting layout; correctly redirect obsoleted layouts.

        * lib/lyxrc.example: document \view_dvi_paper_option

        * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
        variable. 

        * src/lyx_cb.C (RunScript): handle $$FName for command names. 
        (PreviewDVI): handle the view_dvi_paper_option variable.
        [Both from Roland Krause]

2000-02-14  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
        char const *, int, LyXFont)
        (text(int, int, string, LyXFont)): ditto 

        * src/text.C (InsertCharInTable): attempt to fix the double-space
        feature in tables too.
        (BackspaceInTable): ditto.
        (GetVisibleRow): make bottom pagebreak line be a onoff line.

2000-02-11  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/text2.C (owner): only complain if owner_ is set and bv != 0

        * src/BufferView.C (resizeCurrentBuffer): set the owner of the
        newly found text in textcache to this.
        (buffer): set the owner of the text put into the textcache to 0

        * src/insets/figinset.C (draw): fixed the drawing of figures with
        the new Painter.

        * src/text.C src/mathed/math_cursor.C: nailed and fixed the
        drawing of mathframe, hfills, protected space, table lines. I have
        now no outstanding drawing problems with the new Painter code. 

2000-02-11  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/PainterBase.C (ellipse, circle): do not specify the default
        arguments. 

        * src/LColor.h: add using directive.

        * src/Painter.[Ch]: change return type of methods from Painter& to
        PainterBase&. Add a using directive.

        * src/WorkArea.C: wrap xforms callbacks in C functions
        C_WorkArea_xxx. 

        * lib/layouts/foils.layout: font fix and simplifications from Carl
        Ollivier-Gooch.

2000-02-10  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * a lot of files: The Painter, LColor and WorkArea from the old
        devel branch has been ported to lyx-devel. Some new files and a
        lot of #ifdeffed code. The new workarea is enabled by default, but
        if you want to test the new Painter and LColor you have to compile
        with USE_PAINTER defined (do this in config.h f.ex.) There are
        still some rought edges, and I'd like some help to clear those
        out. It looks stable (loads and displays the Userguide very well).
        

2000-02-10  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/buffer.C (pop_tag): revert to the previous implementation
        (use a global variable for both loops).

        * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.

        * src/lyxrc.C (LyXRC): change slightly default date format.

        * src/paragraph.C (TeXOnePar): Generate a correct latex file when
        there is an English text with a footnote that starts with a Hebrew
        paragraph, or vice versa.
        (TeXFootnote): ditto.

        * src/text.C (LeftMargin): allow for negative values for
        parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
        this out.

        * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
        for input encoding (cyrillic)

2000-02-08  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
        Tsur). 

        * src/toolbar.C (set): ditto
        * src/insets/insetbib.C (create_form_citation_form): ditto

        * lib/CREDITS: added Dekel Tsur.

        * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
        lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
        hebrew supports files from Dekel Tsur.
        
        * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
        <tzafrir@technion.ac.il> 

        * src/lyxrc.C: put \date_insert_format at the right place.

        * src/buffer.C (makeLaTeXFile): fix the handling of
        BufferParams::sides when writing out latex files.

        * src/BufferView2.C: add a "using" directive.

        * src/support/lyxsum.C (sum): when we use lyxstring,
        ostringstream::str needs an additional .c_str().

2000-02-07  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/filetools.C (ChangeExtension): patch from Etienne
        applied.

        * src/TextCache.C (show): remove const_cast and make second
        parameter non-const LyXText *.

        * src/TextCache.h: use non const LyXText in show.

        * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
        with hebrew.

2000-02-04  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/lyxsum.C: rework to be more flexible.
        
        * several places: don't check if a pointer is 0 if you are going
        to delete it.

        * src/text.C: remove some dead code.

        * src/insets/figinset.C: remove some dead code
        
        * src/buffer.C: move the BufferView funcs to BufferView2.C
        remove all support for insetlatexdel
        remove support for oldpapersize stuff
        made some member funcs const

        * src/kbmap.C: use a std::list to store the bindings in.
        
        * src/BufferView2.C: new file

        * src/kbsequence.[Ch]: new files
        
        * src/LyXAction.C + others: remove all trace of buffer-previous
        
        * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
        only have one copy in the binary of this table.
        
        * hebrew patch: moved some functions from LyXText to more
        appropriate places. (LyXParagraph, BufferParams, LyXFont)
        
        * several files: remove support for XForms older than 0.88
        whitespace changes.
        remove some #if 0 #endif code
        
        * src/TextCache.[Ch]: new file. Holds the textcache.

        * src/BufferView.C: changes to use the new TextCache interface.
        (waitForX): remove the now unused code.
        
        * src/BackStack.h: remove some commented code

        * lib/bind/emacs.bind: remove binding for buffer-previous

2000-02-03  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * applied the hebrew patch.

        * src/lyxrow.h: make sure that all Row variables are initialized.

        * src/text2.C (TextHandleUndo): comment out a delete, this might
        introduce a memory leak, but should also help us to not try to
        read freed memory. We need to look at this one.

        * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
        (LyXParagraph): initalize footnotekind.

        * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
        forgot this when applying the patch. Please heed the warnings.

        * src/BufferView.C (buffer): a fix for the buffer-reload problem
        (aka. reformat problem)

        * src/bufferlist.C (exists): made const, and use const_iterator
        (isLoaded): new func.
        (release): use std::find to find the correct buffer.

        * src/bufferlist.h: made getState a const func.
        made empty a const func.
        made exists a const func.
        new func: isLoaded

2000-02-01  Juergen Vigna  <jug@sad.it>

        * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert

        * po/it.po: updated a bit the italian po file and also changed the
        'file nuovo' for newfile to 'filenuovo' without a space, this did
        annoy me a lot :)
        
        * src/lyxrc.C (LyXRC): added support for a default insert_date_format
        for the new insert_date command.

        * src/lyxfunc.C (Dispatch): added support for a insert_date function
        from jdblair, to insert a date into the current text conforming to
        a strftime format (for now only considering the locale-set and not
        the document-language).

2000-01-28  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxfont.C (textWidth): hopefully better fix for the Array
        Bounds Read error seen by purify. The problem was that islower is
        a macros which takes an unsigned char and uses it as an index for
        in array of characters properties (and is thus subject to the
        above error).
        (drawText): ditto.

        * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
        correctly the paper sides radio buttons.
        (UpdateDocumentButtons): ditto.

2000-01-27  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/kbmap.C (getsym + others): change to return unsigned int,
        returning a long can give problems on 64 bit systems. (I assume
        that int is 32bit on 64bit systems)

2000-01-27  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
        LyXLookupString to be zero-terminated. Really fixes problems seen
        by purify, I think.

2000-01-27  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
        write a (char*)0 to the lyxerr stream.

        * src/lastfiles.C: move algorithm before the using statemets.

2000-01-26  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lastfiles.C: move using directives in global scope (egcs 1.x
        complains otherwise).
        * src/table.C: ditto

        * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
        directory. 

        * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
        that I removed earlier... It is really needed.

        * lib/examples/multicol.lyx: new file, splitted from Extended.lyx. 

2000-01-25  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * INSTALL: update xforms home page URL.

        * lib/configure.m4: fix a bug with unreadable layout files.

        * src/table.C (calculate_width_of_column): add "using std::max"
        directive. 

2000-01-25  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * several files: marked several lines with "DEL LINE", this is
        lines that can be deleted without changing anything.
        if (<ptr>) // DEL LINE  /* this line is _never_ needed. Delete
                                   checks this anyway */
                delete <ptr>

        * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY

        * src/DepTable.C (update): add a "+" at the end when the checksum
        is different. (debugging string only)

        * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
        the next inset to not be displayed. This should also fix the list
        of labels in the "Insert Crossreference" dialog.

2000-01-24  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/LSubstring.C (LSubstring): set pos to string::npos
        when regex was not found.

        * src/support/lstrings.C (lowercase): use handcoded transform always.
        (uppercase): ditto

        * src/text.C (Delete): fixed the crash. cursor.par->prev and
        old_cursor.par->prev could be 0.

        * several files: changed post inc/dec to pre inc/dec
        
        * src/lastfiles.C (writeFile): use ostream_iterator and copy to
        write the lastfiles to file.

        * src/BufferView.C (buffer): only show TextCache info when debugging
        (buffer): ditto
        (resizeCurrentBuffer): ditto
        (workAreaExpose): ditto

        * lib/kbd/iso8859-7.cdef: changed to new quoting scheme

        * lib/kbd/iso8859-2.cdef: changed to new quoting scheme

        * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
        a bit better by removing the special case for \i and \j.

2000-01-24  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyx_main.C (easyParse): remove test for bad comand line
        options, since this broke all xforms-related parsing.

        * src/kbmap.C (getsym): set return type to unsigned long, as
        declared in header. On an alpha, long is _not_ the same as int.

        * src/support/LOstream.h: add a "using std::flush;"

        * src/insets/figinset.C: ditto.

2000-01-21  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/bufferlist.C (write): use blinding fast file copy instead of
        "a char at a time", now we are doing it the C++ way.

        * src/insets/figinset.C: get rid of struct pidwaitpit, use a
        std::list<int> instead.
        (addpidwait): reflect move to std::list<int>
        (sigchldchecker): ditto

        * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
        version also. 

        * src/paragraph.C (FirstPhysicalPar): remove assert and comment
        that obviously was wrong...

        * src/lyxfont.C (textWidth): have c as char c[2] instead of char
        c, this avoids warnings with purify and islower.

        * src/insets/figinset.C: rename struct queue to struct
        queue_element and rewrite to use a std::queue. gsqueue is now a
        std::queue<queue_element>
        (runqueue): reflect move to std::queue
        (addwait): ditto

        * src/support/lstrings.h (tostr): specialize for bool, otherwise
        we would get "1" "0" instead of "true" "false. Also make the tostr
        functions inline.

2000-01-21  Juergen Vigna  <jug@sad.it>

        * src/buffer.C (writeFileAscii): Disabled code for special groff
        handling of tabulars till I fix this in table.C

2000-01-21  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/support/mkdir.C (mkdir): change second argument of mkdir to
        unsigned long int.
        * src/support/lyxlib.h: ditto.

2000-01-20  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
        and 'j' look better. This might fix the "macron" bug that has been
        observed.

        * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
        functions as one template function. Delete the old versions.

        * src/support/lyxsum.C: move using std::ifstream inside
        MODERN_STL_STREAMS

        * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
        and putenv.C

        * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used

        * src/mathed/formula.C: delete #include "bufferlist.h" never used

        * src/insets/figinset.C (InitFigures): use new instead of malloc
        to allocate memory for figures and bitmaps.
        (DoneFigures): use delete[] instead of free to deallocate memory
        for figures and bitmaps.
        (runqueue): use new to allocate 
        (getfigdata): use new/delete[] instead of malloc/free
        (RegisterFigure): ditto

        * some files: moved some declarations closer to first use, small
        whitespace changes use preincrement instead of postincrement where
        it does not make a difference.
        
        * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
        step on the way to use stl::containers for key maps. 

        * src/bufferlist.h: add a typedef for const_iterator and const
        versions of begin and end.

        * src/bufferlist.[Ch]: change name of member variable _state to
        state_. (avoid reserved names)
        (makePup): removed
        (getFileNames): returns the filenames of the buffers in a vector.

        * configure.in (ALL_LINGUAS): added ro

        * src/support/putenv.C: new file

        * src/support/mkdir.C: new file

2000-01-20  Allan Rae <rae@lyx.org>

        * lib/layouts/IEEEtran.layout: Added several theorem environments

        * lib/templates/IEEEtran.lyx: Example theorem environments and a
        couple of minor additions.

        * lib/doc/LaTeXConfig.lyx.in:  Use URL insets for ftp sites 
        (except for those in footnotes of course)

2000-01-19  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction. 

        * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
        std::sort and std::lower_bound instead of qsort and handwritten
        binarysearch.
        (struct compara): struct that holds the functors used by std::sort
        and std::lower_bound in MathedLookupBOP.

2000-01-19  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/support/LAssert.h: do not do partial specialization. We do
        not really need it.

        * src/support/lyxlib.h: note that lyx::getUserName() and
        lyx::date() are not in use right now. Should these be suppressed?

        * src/buffer.C (makeLaTeXFile): we do not need the user name here.
        (makeLinuxDocFile): do not put date and user name in linuxdoc
        headers. 

        * src/support/lyxlib.h (kill): change first argument to long int,
        since that's what solaris uses.

        * src/support/kill.C (kill): fix declaration to match prototype.

        * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
        actually check whether namespaces are supported. This is not what
        it used to do.

        * src/support/lyxsum.C: add a using directive.

2000-01-17  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/kill.C: if we have namespace support we don't have
        to include lyxlib.h.

        * src/support/lyxlib.h: use namespace lyx if supported.

2000-01-14  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/date.C: new file

        * src/support/chdir.C: new file

        * src/support/getUserName.C: new file

        * src/support/getcwd.C: new file

        * src/support/abort.C: new file

        * src/support/kill.C: new file

        * src/support/lyxlib.h: moved all the functions in this file
        insede struct lyx. Added also kill and abort to this struct. This
        is a way to avoid the "kill is not defined in <csignal>", we make
        C++ wrappers for functions that are not ANSI C or ANSI C++.

        * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
        instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
        lyx it has been renamed to sum.

2000-01-14  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/text.C: add using directives for std::min and std::max.

2000-01-13  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/texrow.C (getIdFromRow): actually return something useful in
        id and pos. Hopefully fixes the bug with positionning of errorbox
        insets. 

        * src/lyx_main.C (easyParse): output an error and exit if an
        incorrect command line option has been given.

        * src/spellchecker.C (ispell_check_word): document a memory leak.

        * src/bufferlist.C (write): fix mismatched allocation/deletion,
        where a "struct utimbuf" is allocated with "new" and deleted with
        "delete[]". 

2000-01-13  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/text2.C (CutSelection): don't delete double spaces.
        (PasteSelection): ditto
        (CopySelection): ditto
        
        * src/text.C (Backspace): don't delete double spaces.

        * src/lyxlex.C (next): fix a bug that were only present with
        conformant std::istream::get to read comment lines, use
        std::istream::getline instead. This seems to fix the problem.

2000-01-12  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
        allowed to insert space before space" editing problem. Please read
        commends at the beginning of the function. Comments about usage
        are very welcome.

        * src/text.C (InsertChar): fix for the "not allowed to insert
        space before space" editing problem.

        * src/text2.C (DeleteEmptyParagraphMechanism): when
        IsEmptyTableRow can only return false this last "else if" will
        always be a no-op. Commented out.

        * src/text.C (RedoParagraph): As far as I can understand tmp
        cursor is not really needed.

        * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
        present it could only return false anyway. 
        (several functions): Did something not so smart...added a const
        specifier on a lot of methods.
        
        * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
        and add a tmp->text.resize. The LyXParagraph constructor does the
        resize for us.
        (BreakParagraphConservative): ditto

        * src/support/path.h (Path): add a define so that the wrong usage
        "Path("/tmp") will be flagged as a compilation error:
        "`unnamed_Path' undeclared (first use this function)"

2000-01-12  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
        which was bogus for several reasons.

        * src/LaTeX.C (scanAux): fix the regular expression used to scan
        .aux files. 
        (runBibTeX): ditto.

        * autogen.sh: do not use "type -path" (what's that anyway?).

        * src/support/filetools.C (findtexfile): remove extraneous space
        which caused a kpsewhich warning (at least with kpathsea version
        3.0). 

2000-01-11  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la

        * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la

        * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs

2000-01-11  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/paragraph.C (BreakParagraph): do not reserve space on text
        if we don't need to (otherwise, if pos_end < pos, we end up
        reserving huge amounts of memory due to bad unsigned karma).
        (BreakParagraphConservative): ditto, although I have not seen
        evidence the bug can happen here.

        * src/lyxparagraph.h: add a using std::list.

2000-01-11  Juergen Vigna  <jug@sad.it>

        * src/menus.C (MenuDocu): output an Alert if the documentation-file
        could not be found.

2000-01-11  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/vc-backend.C (doVCCommand): change to be static and take one
        more parameter: the path to chdir too be fore executing the command.
        (retrive): new function equiv to "co -r"

        * src/bufferlist.C (loadLyXFile): implement the missing parts if
        file_not_found_hook is true.

        * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.

        * src/support/filetools.C (IsFileWriteable): use FileInfo to check
        if a file is readwrite,readonly...anything else.

2000-01-10  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
        (CreatePostscript): name change from MenuRunDVIPS (or something)
        (PreviewPostscript): name change from MenuPreviewPS
        (PreviewDVI): name change from MenuPreviewDVI

        * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
        \view_pdf_command., \pdf_to_ps_command

        * lib/configure.m4: added search for PDF viewer, and search for
        PDF to PS converter. 
        (lyxrc.defaults output): add \pdflatex_command,
        \view_pdf_command and \pdf_to_ps_command.

        * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.

        * src/bufferlist.C (write): we don't use blocksize for anything so
        I removed it.

2000-01-10  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/support/block.h: disable operator T* (), since it causes
        problems with both compilers I tried. See comments in the file.

        * lib/reLyX/configure.in: do not define LYX_DIR. support flag
        --with-lyxname. 

        * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
        variable LYX_DIR_10x to LYX_DIR_11x.

        * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.

        * INSTALL: document --with-lyxname.
        * NEWS: ditto.

        * configure.in: new configure flag --with-lyxname which allows to
        choose the name under which lyx is installed. Default is "lyx", of
        course. It used to be possible to do this with --program-suffix,
        but the later has in fact a different meaning for autoconf.

        * src/support/lstrings.h (lstrchr): reformat a bit.

        * src/lyxlex.h: include LIstream.h, for Sun CC this time.
        * src/mathed/math_defs.h: ditto.

2000-01-09  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
        true, decides if we create a backup file or not when saving. New
        tag and variable \pdf_mode, defaults to false. New tag and
        variable \pdflatex_command, defaults to pdflatex. New tag and
        variable \view_pdf_command, defaults to xpdf. New tag and variable
        \pdf_to_ps_command, defaults to pdf2ps.

2000-01-08  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/bufferlist.C (close): don't call insetUnlock if the buffer
        does not have a BufferView.
        (unlockInset): ditto + don't access the_locking_inset if the
        buffer does not have a BufferView.

        * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
        certain circumstances so that we don't continue a keyboard
        operation long after the key was released. Try f.ex. to load a
        large document, press PageDown for some seconds and then release
        it. Before this change the document would contine to scroll for
        some time, with this change it stops imidiatly.

        * src/support/block.h: don't allocate more space than needed. As
        long as we don't try to write to the arr[x] in a array_type arr[x]
        it is perfectly ok. (if you write to it you might segfault).
        added operator value_type*() so that is possible to pass the array
        to functions expecting a C-pointer.

        * lib/Makefile.am (dist-hook): don't fail completely if unable to
        cvs.

        * intl/*: updated to gettext 0.10.35, tried to add our own
        required modifications. Please verify.

        * po/*: updated to gettext 0.10.35, tried to add our own required
        modifications. Please verify.
        
        * src/support/lstrings.C (tostr): go at fixing the problem with
        cxx and stringstream. When stringstream is used return
        oss.str().c_str() so that problems with lyxstring and basic_string
        are avoided. Note that the best solution would be for cxx to use
        basic_string all the way, but it is not conformant yet. (it seems)

        * src/lyx_cb.C + other files: moved several global functions to
        class BufferView, some have been moved to BufferView.[Ch] others
        are still located in lyx_cb.C. Code changes because of this. (part
        of "get rid of current_view project".)

        * src/buffer.C + other files: moved several Buffer functions to
        class BufferView, the functions are still present in buffer.C.
        Code changes because of this.

        * config/lcmessage.m4: updated to most recent. used when creating
        acinclude.m4.

        * config/progtest.m4: updated to most recent. used when creating
        acinclude.m4.
        
        * config/gettext.m4: updated to most recent. applied patch for
        tmplinguas.

        * config/gettext.m4.patch: new file that shows what changes we
        have done to the local copy of gettext.m4.

        * config/libtool.m4: new file, used in creation of acinclude.m4

        * config/lyxinclude.m4: new file, this is the lyx created m4
        macros, used in making acinclude.m4.
        
        * autogen.sh: GNU m4 discovered as a separate task not as part of
        the lib/configure creation. 
        Generate acinlucde from files in config. Actually cat
        lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
        easier to upgrade .m4 files that really are external.

        * src/Spacing.h: moved using std::istringstream to right after
        <sstream>. This should fix the problem seen with some compilers.

2000-01-06  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyx_cb.C: began some work to remove the dependency a lot of
        functions have on BufferView::text, even if not really needed.
        (GetCurrentTextClass): removed this func, it only hid the
        current_view. 

        * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
        forgot this in last commit.

        * src/Bullet.C (bulletEntry): use static char const *[] for the
        tables, becuase of this the return arg had to change to string.
        (bulletSize): ditto
        (~Bullet): removed unneeded destructor

        * src/BufferView.C (beforeChange): moved from lyx_cb.C
        (insetSleep): moved from Buffer
        (insetWakeup): moved from Buffer
        (insetUnlock): moved from Buffer

        * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
        from Buffer to BufferView.
        
        * acinclude.m4: include libtool.m4 from libtool 1.3.4.

        * config/ltmain.sh: updated to version 1.3.4 of libtool

        * config/ltconfig: updated to version 1.3.4 of libtool

2000-01-06  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>


        * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
        Did I get that right?

        * src/lyxlex.h: add a "using" directive or two.
        * src/Spacing.h: ditto.
        * src/insets/figinset.C: ditto.
        * src/support/filetools.C: ditto.
        * src/support/lstrings.C: ditto.
        * src/BufferView.C: ditto.
        * src/bufferlist.C: ditto.
        * src/lyx_cb.C: ditto.
        * src/lyxlex.C: ditto.

        * NEWS: add some changes for 1.1.4.
        
2000-01-06  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/BufferView.C: first go at a TextCache to speed up switching
        between documents.

2000-01-05  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/examples/ItemizeBullets.lyx: update from Tino Meinen. 
        * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
        * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
        * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
        Meinen.
        
        * src/mathed/math_defs.h (MathedRowSt): make sure that all
        members of the struct are correctly initialized to 0 (detected by
        purify) 
        * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
        * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.

        * src/insets/figinset.C (sigchldchecker): use "delete" to free a
        pidwait, since it was allocated with "new". This was potentially
        very bad. Thanks to Michael Schmitt for running purify for us.


2000-01-04  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.

        * src/lyx_gui_misc.h: add a 'using std::pair;' statement.

1999-12-30  Allan Rae  <rae@lyx.org>

        * lib/templates/IEEEtran.lyx: minor change

        * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
        src/mathed/formula.C (LocalDispatch): askForText changes

        * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we 
        know when a user has cancelled input. Fixes annoying problems with
        inserting labels and version control.

1999-12-29  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/lstrings.C (tostr): rewritten to use strstream and
        stringstream

1999-12-28  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/filetools.C (IsFileWriteable): use fstream to check
        (IsDirWriteable): use fileinfo to check

        * src/support/filetools.h (FilePtr): whole class deleted

        * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.

        * src/lyxparagraph.h (readSimpleWholeFile): make arg istream

        * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr

        * src/bufferlist.C (write): use ifstream and ofstream instead of
        FILE*

        * src/Spacing.h: use istrstream instead of sscanf

        * src/mathed/math_defs.h: change first arg to istream from FILE*

        * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr

        * src/mathed/math_parser.C: have yyis to be an istream 
        (LexGetArg): use istream (yyis)
        (yylex): ditto
        (mathed_parse): ditto
        (mathed_parser_file): first arg istream instead of FILE*, set yyis

        * src/mathed/formula.C (Read): rewritten to use istream

        * src/mathed/formulamacro.C (Read): rewritten to use istream

        * src/lyxlex.h (~LyXLex): deleted desturctor 
        (getStream): new function, returns an istream
        (getFile): deleted funtion
        (IsOK): return is.good();

        * src/lyxlex.C (LyXLex): delete file and owns_file
        (setFile): open an filebuf and assign that to a istream instead of
        using FILE*
        (setStream): new function, takes an istream as arg. 
        (setFile): deleted function
        (EatLine): rewritten us use istream instead of FILE*
        (next): ditto
        (nextToken): ditto

        * src/table.C (LyXTable): use istream instead of FILE*
        (Read): rewritten to take an istream instead of FILE*

1999-12-28  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/buffer.C (Dispatch): remove an extraneous break statement.

        * src/support/filetools.C (QuoteName): change to do simple
        'quoting'. More work is necessary. Also changed to do nothing
        under emx (needs fix too).
        (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.

        * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
        config.h.in to the AC_DEFINE_UNQUOTED() call.
        (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
        needs char * as argument (because Solaris 7 declares it like
        that). 

        * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
        remove definition of BZERO.

1999-12-24  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
        defined, "lyxregex.h" if not.

        * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
        pkglib_ to noinst_
        (REGEX): new variable that is set to regex.c lyxregex.h when
        AM_CONDITIONAL USE_REGEX is set.
        (libsupport_la_SOURCES): add $(REGEX)

        * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
        pkglib_ to noinst_

        * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
        pkglib_ to noinst_

        * configure.in: add call to LYX_REGEX 

        * acinclude.m4 (LYX_REGEX): checks if we need to use the included
        regex or not. Uses a a AM_CONDITIONAL to decide what to compile. 

1999-12-22  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/bind/fi_menus.bind: new file, from
        pauli.virtanen@saunalahti.fi. 

        * src/buffer.C (getBibkeyList): pass the parameter delim to
        InsetInclude::getKeys and InsetBibtex::getKeys.

        * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
        is passed to Buffer::getBibkeyList
        
        * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
        instead of the hardcoded comma.

        * src/insets/insetbib.C (getKeys): make sure that there are not
        leading blanks in bibtex keys. Normal latex does not care, but
        harvard.sty seems to dislike blanks at the beginning of citation
        keys. In particular, the retturn value of the function is

        * INSTALL: make it clear that libstdc++ is needed and that gcc
        2.7.x probably does not work.

        * src/support/filetools.C (findtexfile): make debug message go to
        the LATEX channel
        * src/insets/insetbib.C (getKeys): ditto

        * src/debug.C (showTags): make sure that the output is correctly
        aligned. 

        * configure.in: add a comment for TWO_COLOR_ICON define.

        * acconfig.h: remove all the entries that already defined in
        configure.in or acinclude.m4.

        * src/buffer.C (makeLaTeXFile): headers of latex file also changed
        to avoid user name, date and copyright.

1999-12-21  Juergen Vigna  <jug@sad.it>

        * src/table.C (Read): Now read bogus row format informations
                if the format is < 5 so that afterwards the table can
                be read by lyx but without any format-info. Fixed the
                crash we experienced when not doing this.

1999-12-21  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
        (RedoDrawingOfParagraph): ditto
        (RedoParagraphs): ditto
        (RemoveTableRow): ditto

        * src/text.C (Fill): rename arg paperwidth -> paper_width

        * src/buffer.C (insertLyXFile): rename var filename -> fname
        (writeFile): rename arg filename -> fname
        (writeFileAscii): ditto
        (makeLaTeXFile): ditto
        (makeLinuxDocFile): ditto
        (makeDocBookFile): ditto

        * src/LaTeX.C (runMakeIndex): change arg name from file -> f
        (runBibTeX): ditto

        * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C

        * src/bmtable.h: add extern "C" on this file when __cplusplus is
        defined.

        * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
        compiled by a C compiler not C++. 

        * src/layout.h (LyXTextClass): added typedef for const_iterator
        (LyXTextClassList): added typedef for const_iterator + member
        functions begin and end.

        * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
        iterators to fill the choice_class.
        (updateLayoutChoice): rewritten to use iterators to fill the
        layoutlist in the toolbar.

        * src/BufferView.h (BufferView::work_area_width): removed unused
        variable. 

        * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'

        * src/buffer.C (sgmlOpenTag): drop the use of the static space array
        (sgmlCloseTag): ditto

        * src/support/lstrings.h: return type of countChar changed to
        unsigned char.

        * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
        what version of this func to use. Also made to return unsigned int.

        * configure.in: call LYX_STD_COUNT 

        * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
        conforming std::count. 

1999-12-20  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
        and a subscript would give bad display (patch from Dekel Tsur
        <dekel@math.tau.ac.il>). 

        * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public. 

        * src/spellchecker.C (create_ispell_pipe): use a const_cast to
        please sun CC.

        * src/chset.h: add a few 'using' directives

        * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
        triggered when no buffer is active

        * src/layout.C: removed `break' after `return' in switch(), since
        it is unreachable.

        * src/lyx_main.C (init): make sure LyX can be ran in place even
        when libtool has done its magic with shared libraries. Fix the
        test for the case when the system directory has not been found.

        * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
        name for the latex file.
        (MenuMakeHTML): ditto

        * src/buffer.h: add an optional boolean argument, which is passed
        to ChangeExtension.

1999-12-20  Allan Rae  <rae@lyx.org>

        * lib/templates/IEEEtran.lyx: small correction and update.

        * configure.in: Attempted to use LYX_PATH_HEADER

        * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore

        * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
        input from JMarc.  Now use preprocessor to find the header.
        Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
        (LYX_PATH_HEADER): My, so far, failed attempt to generalize
        LYX_STL_STRING_FWD.  See comments in file.      

1999-12-19  Asger Alstrup Nielsen  <alstrup@diku.dk>

        * The global MiniBuffer * minibuffer variable is dead.
        
        * The global FD_form_main * fd_form_main variable is dead.

1999-12-17  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/toolbar.C (set): condition #warning on WITH_WARNINGS

        * src/table.h: add the LOstream.h header
        * src/debug.h: ditto
        
        * src/LyXAction.h: change the explaination of the ReadOnly
        attribute: is indicates that the function _can_ be used.

        * src/LyXAction.C (init): find-replace _can_ be used in read-only
        mode. 

1999-12-16  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxfont.C (ascent): Make sure that char is _always_ used as
        unsigned. 
        (descent): ditto
        (lbearing): ditto
        (rbearing): ditto

        * src/paragraph.C (GetWord): assert on pos>=0
        (GetChar): ditto
        
        * src/support/lyxstring.C: condition the use of an invariant on
        ENABLE_ASSERTIONS 
        * src/support/lyxstring.h: ditto

        * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
        Use LAssert.h instead of plain assert().

        * src/support/lstrings.h: add LAssert.h, in case it is needed.

        * src/lyxfunc.C: do not include LAssert.h, it is not used.
        * src/support/filetools.C: ditto

        * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
        is not defined. 

        * INSTALL: document the new configure flags
        
        * configure.in: suppress --with-debug; add --enable-assertions

        * acinclude.m4: various changes in alignment of help strings.

1999-12-16  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/kbmap.C: commented out the use of the hash map in kb_map,
        beginning of movement to a stl::container. 

        * several files: removed code that was not in effect when
        MOVE_TEXT was defined.
        
        * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
        for escaping should not be used. We can discuss if the string
        should be enclosed in f.ex. [] instead of "".

        * src/trans_mgr.C (insert): use the new returned value from
        encodeString to get deadkeys and keymaps done correctly.

        * src/chset.C (encodeString): changed to return a pair, to tell
        what to use if we know the string.

        * src/lyxscreen.h (fillArc): new function.

        * src/FontInfo.C (resize): rewritten to use more std::string like
        structore, especially string::replace.

        * src/insets/insetlatexaccent.C (Draw): use fillArc for the
        approp. accents.

        * configure.in (chmod +x some scripts): remove config/gcc-hack 

1999-12-15  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/buffer.C (writeFile): change once again the top comment in a
        .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
        instead of an hardcoded version number.
        (makeDocBookFile): ditto

        * src/version.h: add new define LYX_DOCVERSION

        * po/de.po: update from Pit Sütterlin
        * lib/bind/de_menus.bind: ditto.
        
        * src/lyxfunc.C (Dispatch): call MenuExport()
        * src/buffer.C (Dispatch): ditto

        * src/lyx_cb.C (MenuMakeHTML): new function, moved from
        LyXFunc::Dispatch().
        (MenuExport): new function, moved from
        LyXFunc::Dispatch().

        * src/trans_mgr.C (insert): small cleanup
        * src/chset.C (loadFile): ditto

        * lib/kbd/iso8859-1.cdef: add missing backslashes

1999-12-15  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/insets/insetlatexaccent.C (Lbearing): new function, used to
        help with placing the manually drawn accents better.
        (Rbearing): ditto
        (Draw): x2 and hg changed to float to minimize rounding errors and
        help place the accents better.

        * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
        unsigned short to char is just wrong...cast the char to unsigned
        char instead so that the two values can compare sanely. This
        should also make the display of insetlatexaccents better and
        perhaps also some other insets.
        (descent): ditto
        (lbearing): new function
        (rbearing): ditto

1999-12-15  Allan Rae  <rae@lyx.org>

        * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES):  added new
        header that provides a wrapper around the very annoying SGI STL header
        of the same name.

        * src/support/lyxstring.C, src/LString.h:
        removed old SGI-STL-compatability attempts.

        * configure.in: Use LYX_STL_STRING_FWD.

        * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if 
        stl_string_fwd.h is around and try to determine it's location.
        Major improvement over previous SGI STL 3.2 compatability.
        Three small problems remain with this function due to my zero
        knowledge of autoconf.  JMarc and lgb see the comments in the code.

1999-12-14  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/broken_const.h, config/hack-gcc, config/README: removed
        
        * configure.in: remove --with-gcc-hack option; do not call
        LYX_CXX_STL_STACK 

        * INSTALL: remove documentation of --with-broken-const and
        --with-gcc-hack
        
        * acconfig.h: remove all trace of BROKEN_CONST define

        * src/buffer.C (makeDocBookFile): update version number in output
        file. 
        (SimpleDocBookOnePar): fix an assert when trying to a character
        access beyond string length
        [Patch from Jose']

1999-12-13  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * po/de.po: fix the Export menu

        * lyx.man: update the description of -dbg

        * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
        (commandLineHelp): updated
        (easyParse): show list of available debug levels if -dbg is passed
        without argument.

        * src/Makefile.am: add debug.C

        * src/debug.h: moved some code to debug.C

        * src/debug.C: new file. Contains code to set and show debug
        level. 

        * src/layout.C: remove 'break' after 'continue' in switch
        statements, since these cannot be reached.

1999-12-13  Allan Rae  <rae@lyx.org>

        * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
        (in_word_set): hash() -> math_hash()

        * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support 

        * acconfig.h: Added a test for whether we are using exceptions in the
        current compilation run. If so USING_EXCEPTIONS is defined.

        * config.in: Check for existance of stl_string_fwd.h
        * src/LString.h: If compiling --with-included-string and SGI's
        STL version 3.2 is present (see above test) we need to block their
        forward declaration of string and supply a __get_c_string().
        However, it turns out this is only necessary if compiling with
        exceptions enabled so I've a bit more to add yet.

        * src/insets/figinset.[Ch], src/insets/insetinclude.C,
          src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
          src/support/LRegex.h, src/undo.h:
        Shuffle the order of the included files a little to ensure that
        LString.h gets included before anything that includes stl_string_fwd.h

        *  src/support/lyxstring.C: We need to #include LString.h instead of
        lyxstring.h to get the necessary definition of __get_c_string.
        (__get_c_string): New function.  This is defined static just like SGI's
        although why they need to do this I'm not sure.  Perhaps it should be
        in lstrings.C instead.

        * lib/templates/IEEEtran.lyx:  New template file.

1999-12-12  Lars Gullik Bjønnes  <larsbj@lyx.org>
        
        * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
        * intl/Makefile.in (MKINSTALLDIRS):  ditto

        * src/LyXAction.C (init): changed to hold the LFUN data in a
        automatic array in stead of in callso to newFunc, this speeds up
        compilation a lot. Also all the memory used by the array is
        returned when the init is completed.

        * a lot of files: compiled with -Wold-style-cast, changed most of
        the reported offenders to C++ style casts. Did not change the
        offenders in C files. 

        * src/trans.h (Match): change argument type to unsigned int.

        * src/support/DebugStream.C: fix some types on the streambufs so
        that it works on a conforming implementation.

1999-12-10  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.

        * src/support/lyxstring.C: remove the inline added earlier since
        they cause a bunch of unsatisfied symbols when linking with dec
        cxx. Cxx likes to have the body of inlines at the place where they
        are declared.

        * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
        accessing negative bounds in array. This fixes the crash when
        inserting accented characters.
        * src/trans.h (Match): ditto

        * src/buffer.C (Dispatch): since this is a void, it should not try
        to return anything...

1999-12-10  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/buffer.h: removed the two friends from Buffer. Some changes
        because of this. Buffer::getFileName and Buffer::setFileName
        renamed to Buffer::fileName() and Buffer::fileName(...).

1999-12-09  Lars Gullik Bjønnes <larsbj@lyx.org>

        * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
        and Buffer::update(short) to BufferView. This move is currently
        controlled by a define MOVE_TEXT, this will be removed when all
        shows to be ok. This move paves the way for better separation
        between buffer contents and buffer view. One side effect is that
        the BufferView needs a rebreak when swiching buffers, if we want
        to avoid this we can add a cache that holds pointers to LyXText's
        that is not currently in use. 

        * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
        André Pönitz. 

1999-11-18  André Pönitz <poenitz@mathematik.tu-chemnitz.de>

        * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level

        * lyx_main.C: new command line option -x (or --execute) and
          -e (or --export). Now direct conversion from .lyx to .tex
          (.dvi, .ps, ...) is possible  ('lyx file.lyx --export latex')
          Unfortunately, X is still needed and the GUI pops up during the
          process...

1999-12-07  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/Spacing.C: add a using directive to bring stream stuff into
        normal namespace.
        * src/paragraph.C: ditto
        * src/buffer.C: ditto

        * NEWS: updated a bit the new features of 1.1.3 (took a few things
        from Lars' announcement).

        * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
        example files from Tino Meinen.
        
1999-12-06  Allan Rae  <rae@lyx.org>

        * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.

1999-12-07  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/lyxstring.C: added a lot of inline for no good
        reason
        
        * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
        latexWriteEndChanges, they were not used.
        
        * src/layout.h (operator<<): output operator for PageSides

        * src/mathed/math_iter.C (my_memcpy): slightly changed.

        * some example files: loaded in LyX 1.0.4 and saved again to update
        certain constructs (table format) 

        * a lot of files: did the change to use fstream/iostream for all
        writing of files. Done with a close look at Andre Poenitz's patch.

        * some files: whitespace changes.
        
1999-12-06  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/mathed/math_iter.C (my_memcpy): new function. Since the
        built-in memcpy() is broken on egcs and gcc 2.95 for alpha
        architecture, we provide our own. It is used unconditionnally, but
        I do not think this is a performance problem. Thanks to Angus
        Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
        Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
        first time).
        (GetInset): use my_memcpy.
        (Insert): ditto
        (Copy): ditto

        * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
        it is easier to understand, but it uses less TeX-only constructs now.

        * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
        elements contain spaces

        * lib/configure: regenerated
        
        * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
        elements contain spaces; display the list of programs that are
        tried.

        * autogen.sh: make sure lib/configure is executable

        * lib/examples/*: rename the tutorial examples to begin with the
        two-letters language code.

        * src/lyxfunc.C (getStatus): do not query current font if no
        buffer exists.

        * src/lyx_cb.C (RunScript): use QuoteName
        (MenuRunDvips): ditto
        (PrintApplyCB): ditto

        * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
        around argument, so that it works well with the current shell.
        Does not work properly with OS/2 shells currently.

        * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
        * src/LyXSendto.C (SendtoApplyCB): ditto
        * src/lyxfunc.C (Dispatch): ditto
        * src/buffer.C (runLaTeX): ditto
        (runLiterate): ditto
        (buildProgram): ditto
        (runChktex): ditto
        * src/lyx_cb.C (RunScript): ditto
        (MenuMakeLaTeX): ditto
        
        * src/buffer.h (getLatexName): new method 

        * src/support/filetools.C (MakeLatexName): renamed from SpaceLess

1999-12-02  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
        * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
        (create_math_panel): ditto

        * src/lyxfunc.C (getStatus): re-activate the code which gets
        current font and cursor; add test for export to html.

        * src/lyxrc.C (read): remove unreachable break statements; add a
        few "using".

        * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
        
1999-12-01  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
        introduced by faulty regex.
        * src/buffer.C: ditto
        * src/lastfiles.C: ditto
        * src/paragraph.C: ditto
        * src/table.C: ditto
        * src/vspace.C: ditto
        * src/insets/figinset.C: ditto
        Note: most of these is absolutely harmless, except the one in
        src/mathed formula.C.

1999-11-30  Kayvan A. Sylvan  <kayvan@satyr.sylvan.com>

        * src/ImportNoweb.C (documentclass): fixed bounds for substr
          operation, yielding correct results for the reLyX command.

1999-12-01  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/filetools.C (ExpandPath): removed an over eager
        Assert.
        (ReplaceEnvironmentPath): ditto

        * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
        shows that we are doing something fishy in our code...
        (BubblePost): ditto
        (ToolbarCB): ditto

        * src/lyxrc.C (read): use a double switch trick to get more help
        from the compiler. (the same trick is used in layout.C)
        (write): new function. opens a ofstream and pass that to output
        (output): new function, takes a ostream and writes the lyxrc
        elemts to it. uses a dummy switch to make sure no elements are
        forgotten. 

        * src/lyxlex.h: added a struct pushpophelper for use in functions
        with more than one exit point.

        * src/lyxlex.[Ch] (GetInteger): made it const
        (GetFloat): ditto
        (GetBool): ditto

        * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES

        * src/layout.[hC] : LayoutTags splitted into several enums, new
        methods created, better error handling cleaner use of lyxlex. Read
        the diff.

        * src/bmtable.[Ch]: change some member prototypes because of the
        image const changes. 

        * commandtags.h, src/LyXAction.C (init): new function:
        "preferences-save", saves the lyxrc entries into .lyx/preferences.
        This file is not read automatically but you can add \input
        preferences to your lyxrc if you want to. We need to discuss how
        to handle this. 

        * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
        in .aux, also remove .bib and .bst files from dependencies when
        running bibtex.

        * src/BufferView.C, src/LyXView.C: add const_cast several places
        because of changes to images.

        * lib/images/*: same change as for images/*
        
        * lib/lyxrc.example: Default for accept_compound is false not no.

        * images/*: changed to be const, however I have som misgivings
        about this change so it might be changed back.

1999-11-26  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/configure, po/POTFILES.in: regenerated

        * autogen.sh: autogenerate lib/configure from lib/configure.m4

        * config/lib_configure.m4: removed
        
        * lib/configure.m4: new file (was config/lib_configure.m4)

        * configure.in: do not test for rtti, since we do not use it.
        
1999-11-26  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
        doubling of allocated space scheme. This makes it faster for large
        strings end to use less memory for small strings. xtra rememoved. 

        * src/insets/figinset.C (waitalarm): commented out.
        (GhostscriptMsg): use static_cast
        (GhostscriptMsg): use new instead of malloc to allocate memory for
        cmap. also delete the memory after use.

        * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool

        * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
        for changes in bibtex database or style.
        (runBibTeX): remove all .bib and .bst files from dep before we
        begin. 
        (run): use scanAuc in when dep file already exist.

        * src/DepTable.C (remove_files_with_extension): new method
        (exist): new method

        * src/DepTable.[Ch]: made many of the methods const. 

1999-11-25  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/bufferparams.C: make sure that the default textclass is
        "article". It used to be the first one by description order, but
        now the first one is "docbook".

        * src/lyx_main.C (setDebuggingLevel): change type of argument to
        string; call Debug::value.
        (easyParse): pass complete argument to setDebuggingLevel().

        * src/debug.h (value): fix the code that parses debug levels.

        * src/debug.h: add new debug type ACTION, reserved for LyXAction
        class.  

        * src/LyXAction.C: use Debug::ACTION as debug channel.

        * src/lyxlookup.C: make the debug statements go to Debug::KEY.

        * NEWS: updated for the future 1.1.3 release.

        * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
        \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
        it should. This is of course a controversial change (since many
        people will find that their lyx workscreen is suddenly full of
        red), but done for the sake of correctness.

        * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
          src/mathed/math_root.[Ch] (Clone): return a MathedInset*  

        * src/insets/inseterror.h, src/insets/inseturl.h,
          src/insets/insetinfo.h, src/insets/figinset.h,
          src/mathed/formulamacro.h, src/mathed/math_macro.h
          (EditMessage): add a missing const and add _() to make sure that
        translation happens

        * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
          src/insets/insetbib.C, src/support/filetools.C: add `using'
        directives for cxx.  

        * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
        doing 'Insert index of last word' at the beginning of a paragraph.

1999-11-24  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * several files: white-space changes.

        * src/mathed/formula.C: removed IsAlpha and IsDigit

        * src/insets/insetbib.C (getKeys): use findtexfile to look for the
        .bib file. use a ifstream instead of FilePtr when parsing the .bib
        file for keys.

        * src/insets/figinset.C (GetPSSizes): don't break when
        "EndComments" is seen. But break when a boundingbox is read.

        * all classes inherited from Inset: return value of Clone
        changed back to Inset *.

        * all classes inherited form MathInset: return value of Clone
        changed back to MathedInset *.
        
        * src/insets/figinset.C (runqueue): use a ofstream to output the
        gs/ps file. Might need some setpresicion or setw. However I can
        see no problem with the current code.
        (runqueue): use sleep instead of the alarm/signal code. I just
        can't see the difference.

        * src/paragraph.C (LyXParagraph): reserve space in the new
        paragraph and resize the inserted paragraph to just fit.

        * src/lyxfunc.h (operator|=): added operator for func_status.

        * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
        check for readable file.

        * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
        check for readable file.
        (MenuMakeLinuxDoc): ditto
        (MenuMakeDocBook): ditto
        (MenuMakeAscii): ditto
        (InsertAsciiFile): split the test for openable and readable

        * src/bmtable.C (draw_bitmaptable): use
        fl_state[fl_get_vclass()].depth instead of DefualtScreen.

        * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
        findtexfile from LaTeX to filetools.
        
        * src/ImportNoweb.C (documentclass): rewrote to use ifstream
        instead of FilePtr. Needs to be verified by a literate user.

1999-11-23  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
        (EditMessage): likewise.

        * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
        respectively as \textasciitilde and \textasciicircum.

1999-11-22  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/lyxstring.h: made the methods that take iterators
        use const_iterator.

        * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
        (regexMatch): made is use the real regex class.

        * src/support/Makefile.am: changed to use libtool

        * src/support/.cvsignore: added *.lo, .libs and libsupport.la

        * src/mathed/math_defs.h: made the mathaligns be in a enum instead
        of defines.
        (MathIsInset ++): changed several macros to be inline functions
        instead. 

        * src/mathed/Makefile.am: changed to use libtool

        * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la

        * src/insets/inset* : Clone changed to const and return type is
        the true insettype not just Inset*.
        
        * src/insets/Makefile.am: changed to use libtool

        * src/insets/.cvsignore: added *.lo, .libs and libinsets.la

        * src/undo.[Ch] : added empty() and changed some of the method
        names.
        
        * src/texrow.[Ch]: rewrote to store texrow's in a std::list.

        * src/lyxparagraph.h: use id() and id(...) instead of getID and
        setID use block<> for the bullets array, added const several places.

        * src/lyxfunc.C (getStatus): new function

        * src/lyxfunc.[Ch] : small changes to take advantage of the new
        LyXAction, added const to several funtions.

        * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
        a std::map, and to store the dir items in a vector.

        * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
        as dependencies.

        * src/LyXView.[Ch] + other files : changed currentView to view.
        
        * src/LyXAction.[Ch] : ported from the old devel branch.
        
        * src/.cvsignore: added .libs and a.out

        * configure.in : changes to use libtool. 

        * acinclude.m4 : inserted libtool.m4

        * .cvsignore: added libtool

1999-11-19  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
        file name in insets and mathed directories (otherwise the
        dependency is not taken in account under cygwin).

        * src/text2.C (InsertString[AB]): make sure that we do not try to
        read characters past the string length.

1999-11-18  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/doc/LaTeXConfig.lyx.in, 
          lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.

        * src/buffer.C (writeFile): Do not add a comment on top of .lyx
        file saying who created them and when this heppened; this is
        useless and annoys tools like cvs.

        * lib/layouts/g-brief-{en,de}.layout,
          lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
        from Thomas Hartkens <thomas@hartkens.de>.

        * src/{insets,mathed}/Makefile.am: do not declare an empty
        LDFLAGS, so that it can be set at configure time (useful on Irix
        for -n32 flag).

        * lib/reLyX/configure.in: make sure that the prefix is set
        correctly in LYX_DIR.

1999-11-18  André Pönitz <poenitz@mathematik.tu-chemnitz.de>

        * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
        be used by 'command-sequence' this allows to bind a key to a
        sequence of LyX-commands
        (Example: 'command-sequence math-insert alpha; math-insert beta;")

        * src/LyXAction.C: add "command-sequence"

        * src/LyXFunction.C: handling of "command-sequence"

        * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
         &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)

        * src/lyxserver.C, src/minibuffer.C: Use this new interface

1999-11-17  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/buffer.C (writeFile): Do not output a comment giving user
        and date at the beginning of a .lyx file. This is useless and
        annoys cvs anyway; update version number to 1.1.

        * src/Makefile.am (LYX_DIR): add this definition, so that a
        default path is hardcoded in LyX.

        * configure.in: Use LYX_GNU_GETTEXT.

        * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
        AM_GNU_GETTEXT with a bug fixed. 

        * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.

        * src/chset.C: add "using std::ifstream;" to please dec cxx.

        * src/lyx_main.C (init), INSTALL.OS2: the environment variable
        which is used to point to LyX data is now LYX_DIR_11x.

        * lyx.man: convert to a unix text file; small updates.

1999-11-15  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/LSubstring.[Ch]: made the second arg of most of the
        constructors be a const reference. 

        * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
        me fixed.

        * src/support/lyxstring.[Ch] (swap): added missing member function
        and specialization of swap(str, str); 

        * src/menus.C (ShowBufferMenu): to use the new BufferStorage

        * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
        trace of the old one.

        * src/undo.[Ch]: made the undostack use std::list to store undo's in
        put the member definitions in undo.C.

        * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
        NEW_TEXT and have now only code that was included when this was
        defined. 

        * src/intl.C (LCombo): use static_cast
        (LCombo2): ditto
        (DispatchCallback): ditto

        * src/definitions.h: removed whole file
        
        * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX

        * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
        parsing and stores in a std:map. a regex defines the file format.
        removed unneeded members.

        * src/bufferparams.h: added several enums from definitions.h here.
        Removed unsused destructor. Changed some types to use proper enum
        types. use block to have the temp_bullets and user_defined_bullets
        and to make the whole class assignable.

        * src/bufferparams.C (Copy): removed this functions, use a default
        assignment instead. 

        * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
        isLiterate const.

        * src/buffer.C (readLyXformat2): commend out all that have with
        oldpapersize to do. also comment out all that hve to do with
        insetlatex and insetlatexdel. 
        (setOldPaperStuff): commented out

        * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C

        * src/LyXAction.C: remove use of inset-latex-insert

        * src/mathed/math_panel.C (button_cb): use static_cast

        * src/insets/Makefile.am (insets_o_SOURCES): removed
        insetlatex.[Ch] 

        * src/support/lyxstring.C (helper): use the unsigned long
        specifier, UL, instead of a static_cast.

        * src/support/Makefile.am (libsupport_a_SOURCES): added block.h

        * src/support/block.h: new file. to be used as a c-style array in
        classes, so that the class can be assignable.

1999-11-15  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
        NULL, make sure to return an empty string (it is not possible to
        set a string to NULL).

1999-11-10  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.

        * src/support/lyxstring.C (helper): fix bogus cast in assertion.

        * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
        link line, so that Irix users (for example) can set it explicitely to
        "-n32".
        
        * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
        it can be overidden at make time (static or dynamic link, for
        example).
        
        * src/vc-backend.C, src/LaTeXFeatures.h, 
          src/support/LRegex.C, src/support/LRegex.h: add a few "using" 
        statements to bring templates to global namespace.

1999-11-10  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/lyxstring.C (operator[] const): make it standard
        conforming. 

        * src/minibuffer.C (Init): changed to reflect that more
        information is given from the lyxvc and need not be provided here.

        * src/lyxvc.[Ch]: rewrote to use the vc-backend.
        
        * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]

        * src/LyXView.C (UpdateTimerCB): use static_cast
        (KeyPressMask_raw_callback): ditto

        * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
        buffer_, a lot of changes because of this. currentBuffer() ->
        buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
        also changes to other files because of this.

1999-11-09  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/vc-backend.[Ch]: new files. The backends for vc handling,
        have no support for RCS and partial support for CVS, will be
        improved later.
        
        * src/insets/ several files: changes because of function name
        changes in Bufferview and LyXView.
        
        * src/mathed/math_symbols.C (math_insert_symbol): use static_cast

        * src/support/LSubstring.[Ch]: new files. These implement a
        Substring that can be very convenient to use. i.e. is this
        possible:
        string a = "Mary had a little sheep";
        Substring(a, "sheep") = "lamb";
        a is now "Mary has a little lamb".

        * src/support/LRegex.[Ch]: a regex class that can be used to pick
        out patterns and subpatterns of strings. It is used by LSubstring
        and also by vc-backend.C
        
        * src/support/lyxstring.C: went over all the assertions used and
        tried to correct the wrong ones and flag which of them is required
        by the standard. some bugs found because of this. Also removed a
        couple of assertions.

        * src/support/Makefile.am (libsupport_a_SOURCES): added
        LSubstring.[Ch] and LRegex.[Ch]

        * src/support/FileInfo.h: have struct stat buf as an object and
        not a pointer to one, some changes because of this.

        * src/LaTeXFeatures.C (getTClassPreamble): also use the
        information in layout when adding the layouts preamble to the
        textclass preamble.

        * src/LaTeXFeatures.h: use a vector<bool> to store the layout
        usage in.

        * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
        because of bug in OS/2.

1999-11-08  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/layouts/lyxmacros.inc (lyxcode): set the font with
        \verbatim@font instead of \ttfamily, so that it can be redefined.

        * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
          src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
          src/layout.h, src/text2.C: add 'using' directive to bring the
        STL templates we need from the std:: namespace to the global one.
        Needed by DEC cxx in strict ansi mode.

        * src/support/LIstream.h,src/support/LOstream.h,
          src/support/lyxstring.h,src/table.h,
          src/lyxlookup.h: do not include <config.h> in header
        files. This should be done in the .C files only.

        * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
        (from Kayvan).
        

1999-11-05  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
        from Kayvan to fix the tth invokation.

        * development/lyx.spec.in: updates from Kayvan to reflect the
        changes of file names.

1999-11-05  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/text2.C (InsertStringB): use std::copy
        (InsertStringA): use std::copy

        * src/bufferlist.C: use a vector to store the buffers in. This is
        an internal change and should not affect any other thing.
        
        * src/BufferView.C (waitForX): use XSync instead of the lengthy
        stuff in waitForX.

        * src/text.C (Fill): fix potential bug, one off bug.

1999-11-04  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/Makefile.am (lyx_main.o): add more files it depends on.

        * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.

        * src/support/lyxstring.C: use size_t for the reference count,
        size, reserved memory and xtra.
        (internal_compare): new private member function. Now the compare
        functions should work for std::strings that have embedded '\0'
        characters.
        (compare): all compare functions rewritten to use
        internal_compare.
        
1999-11-03  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/lyxstring.C (compare): pass c_str()
        (compare): pass c_str
        (compare): pass c_str

1999-11-03  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/support/DebugStream.C: <config.h> was not included correctly.

        * lib/configure: forgot to re-generate it :( I'll make this file
        auto generated soon.

1999-11-03  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
        is used.

        * src/support/lyxstring.C: some changes from length() to rep->sz.
        avoids a function call.

        * src/support/filetools.C (SpaceLess): yet another version of the
        algorithm...now per Jean-Marc's suggestions.

1999-11-02  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/layout.C (less_textclass_desc): functor for use in sorting
        of textclasses. 
        (LyXTextClass::Read): sort the textclasses after reading.
        
        * src/support/filetools.C (SpaceLess): new version of the
        SpaceLess functions. What problems does this one give? Please
        report.

        * images/banner_bw.xbm: made the arrays unsigned char *

1999-11-02  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/support/lyxstring.C (find): remove bogus assertion in the
        two versions of find where this has not been done yet.

        * src/support/lyxlib.h: add missing int return type to
        lyx::chdir(). 

        * src/menus.C (ShowFileMenu): disable exporting to html if no
        html export command is present.

        * config/lib_configure.m4: add a test for an HTML converter. The
        programs checked for are, in this order: tth, latex2html and
        hevea. 

        * lib/configure: generated from config/lib_configure.m4.

        * src/lyxfunc.C (Dispatch): update and improve the execution of an
        html converter. The parameters are now passed through $$FName and
        $$OutName, instead of standard input/output.

        * src/lyxrc.{C,h}: rename \tth_command to \html_command.

        * lib/lyxrc.example: update description of \html_command. 
        add "quotes" around \screen_font_xxx font setting examples to help
        people who use fonts with spaces in their names.

1999-11-02  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * Distribution files: updates for v1.1.2

        * src/support/lyxstring.C (find): remove bogus assert and return
        npos for the same condition.

1999-11-01  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * added patch for OS/2 from SMiyata.

1999-10-29  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/text2.C (CutSelection): make space_wrapped a bool
        (CutSelection): dont declare int i until we have to.
        (alphaCounter): return a char const *.

1999-10-28  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/support/syscall.C (Systemcalls::kill): 
          src/support/filetools.C (PutEnv, PutEnvPath): 
          src/lyx_cb.C (addNewlineAndDepth): 
          src/FontInfo.C (FontInfo::resize): condition some #warning
        directives with WITH_WARNINGS.
        

1999-10-28  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/layout.[Ch] + several files: access to class variables
        limited and made accessor functions instead a lot of code changed
        becuase of this. Also instead of returning pointers often a const
        reference is returned instead.
        
        * src/form1.C (create_form_Figure): added a couple fo "no-c-format"

        * src/Makefile.am (dist-hook): added used to remove the CVS from
        cheaders upon creating a dist
        (EXTRA_DIST): added cheaders

        * src/support/lstrings.C (tostr(char)): fix it to handle param as
        a character not as a small integer. 

        * src/support/lyxstring.C (find): removed Assert and added i >=
        rep->sz to the first if.

1999-10-27  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
        src/LyXView.C src/buffer.C src/bufferparams.C
        src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C 
        src/text2.C src/insets/insetinclude.C:
        lyxlayout renamed to textclasslist.

        * src/layout.C: some lyxerr changes.

        * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
        LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
        (LyXLayoutList): removed all traces of this class.
        (LyXTextClass::Read): rewrote LT_STYLE
        (LyXTextClass::hasLayout): new function
        (LyXTextClass::GetLayout): rewritten to return an iterator + has
        both const and nonconst version.
        (LyXTextClass::delete_layout): new function.
        (LyXTextClassList::Style): bug fix. do the right thing if layout
        is to big.
        (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
        (LyXTextClassList::NameOfLayout): ditto 
        (LyXTextClassList::Load): ditto

        * src/buffer.C (makeLaTeXFile): new access to layoutlist

        * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist

        * src/LyXAction.C (LookupFunc): added a workaround for sun
        compiler, on the other hand...we don't know if the current code
        compiles on sun at all...

        * src/support/filetools.C (CleanupPath): subst fix

        * src/insets/insetbib.C (delDatabase): subst fix, this looks
        _really_ weird.

        * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
        complained about this one?

        * src/insets/insetinclude.C (Latex): subst fix

        * src/insets/insetbib.C (getKeys): subst fix

        * src/LyXSendto.C (SendtoApplyCB): subst fix

        * src/lyx_main.C (init): subst fix

        * src/layout.C (Read): subst fix

        * src/lyx_sendfax_main.C (button_send): subst fix

        * src/buffer.C (RoffAsciiTable): subst fix

        * src/lyx_cb.C (MenuFax): subst fix
        (PrintApplyCB): subst fix

1999-10-26  Juergen Vigna  <jug@sad.it>

        * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0

        (Read): Cleaned up this code so now we read only format vestion >= 5

1999-10-26  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
        come nobody has complained about this one?

        * src/insets/insetinclude.C (Latex): subst fix

        * src/insets/insetbib.C (getKeys): subst fix

        * src/lyx_main.C (init): subst fix

        * src/layout.C (Read): subst fix

        * src/buffer.C (RoffAsciiTable): subst fix

        * src/lyx_cb.C (MenuFax): subst fix.

        * src/layout.[hC] + some other files: rewrote to use
        std::container to store textclasses and layouts in.
        Simplified, removed a lot of code. Make all classes
        assignable. Further simplifications and review of type
        use still to be one. 

        * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
        lastfiles to create the lastfiles partr of the menu.

        * src/lastfiles.[Ch]: rewritten to use deque to store the
        lastfiles in. Uses fstream for reading and writing. Simplifies
        code.

        * src/support/syscall.C: remove explicit cast.

        * src/BufferView.C (CursorToggleCB): removed code snippets that
        were commented out.
        use explicat C++ style casts instead of C style casts. also use
        u_vdata instea of passing pointers in longs.

        * src/PaperLayout.C: removed code snippets that were commented out.

        * src/lyx_gui_misc.C: removed code snippets that were commented out. 

        * src/lyx_main.C: removed code snippets that wer commented out.

        * src/paragraph.C: removed code snippets that were commented out.

        * src/lyxvc.C (logClose): use static_cast
        (logUpdate): ditto
        (viewLog): remove explicit cast to void*
        (showLog): removed old commented code

        * src/menus.C: use static_cast instead of C style casts. use
        u_vdata instead of u_ldata. remove explicit cast to (long) for
        pointers. Removed old code that was commented out.

        * src/insets/inset.C: removed old commented func

        * src/insets/insetref.C (InsetRef): removed old code that had been
        commented out for a long time.
        (Edit): ditto
        (escape): removed C style cast

        * src/insets/insetlatexaccent.C (Draw): removed old commented code

        * src/insets/insetlatex.C (Draw): removed old commented code
        (Read): rewritten to use string

        * src/insets/insetlabel.C (escape): removed C style cast

        * src/insets/insetindex.h: removed vdata and ldata from FD_index_form

        * src/insets/insetindex.C: use static_cast and u_vdata, removed
        old commented code.

        * src/insets/insetinclude.h: removed a couple of stupid bools

        * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
        (Clone): remove C style cast
        (getKeys): changed list to lst because of std::list

        * src/insets/inseterror.C (Draw): removed som old commented code.

        * src/insets/insetcommand.C (Draw): removed some old commented code.

        * src/insets/insetbib.C (bibitem_cb): removed code that has been
        commented out forever.
        (bibitem_cb): use static_cast instead of C style cast
        use of vdata changed to u_vdata.

        * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
        parameter.
        (CloseUrlCB): use static_cast instead of C style cast.
        (CloseUrlCB): added a fl_free form...it seemed to be missing.

        * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
        (C_InsetInfo_CloseInfoCB): forward the ob parameter
        (CloseInfoCB): static_cast from ob->u_vdata instead.
        (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
        instead. 

        * src/insets/inseterror.C (Edit): pass object in u_vdata instead
        (C_InsetError_CloseErrorCB): forward the ob parameter
        (CloseErrorCB): static_cast from ob->u_vdata instead.

        * src/vspace.h: include LString.h since we use string in this class.

        * src/vspace.C (lyx_advance): changed name from advance because of
        nameclash with stl. And since we cannot use namespaces yet...I
        used a lyx_ prefix instead. Expect this to change when we begin
        using namespaces.

        * src/BufferView.[Ch] (BufferView::~BufferView): removed 

        * src/BackStack.h: rewrote to use std::stack. made BackStackItem
        and removed now defunct constructor and deconstructor.

        * src/BufferView.h: have backstack as a object not as a pointer.
        removed initialization from constructor. added include for BackStack 

        * development/lyx.spec.in (%build): add CFLAGS also.

        * src/screen.C (drawFrame): removed another warning.

1999-10-25  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
        OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
        README and ANNOUNCE a bit for the next release. More work is
        needed, of course.

        * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
        unbreakable if we are in freespacing mode (LyX-Code), but not in
        latex mode.

1999-10-25  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/BackStack.h: fixed initialization order in constructor

        * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in

        * acinclude.m4 (VERSION): new rules for when a version is
        development, added also a variable for prerelease.
        (warnings): we set with_warnings=yes for prereleases
        (lyx_opt): prereleases compile with same optimization as development 
        (CXXFLAGS): only use pedantic if we are a development version 

        * src/BufferView.C (restorePosition): don't do anything if the
        backstack is empty.

        * src/BackStack.h: added member empty, use this to test if there
        is anything to pop...

1999-10-25  Juergen Vigna  <jug@sad.it>

        * forms/form1.fd +
        * forms/layout_forms.fd +
        * forms/latexoptions.fd +
        * lyx.fd: changed for various form resize issues

        * src/mathed/math_panel.C +
        * src/insets/inseterror.C +
        * src/insets/insetinfo.C +
        * src/insets/inseturl.C +
        * src/insets/inseturl.h +
        * src/LaTeXLog.C +
        * src/LyXSendto.C +
        * src/PaperLayout.C +
        * src/ParagraphExtra.C +
        * src/TableLayout.C +
        * src/form1.C +
        * src/layout_forms.C +
        * src/lyx.C +
        * src/lyx_cb.C +
        * src/lyx_gui.C +
        * src/lyxfr0.C +
        * src/lyxfunc.C +
        * src/lyxvc.C +
        * src/menus.C: fixed various resize issues. So now forms can be
        resized savely or not be resized at all.
        
        * forms/form_url.fd +
        * src/insets/form_url.[Ch]: added because it's cleaner and easier
        to modify IMO.

        * src/insets/Makefile.am: added files form_url.[Ch]
        
1999-10-25  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * INSTALL: it is now possible to compile LyX with digital C++ 6.1
        (and presumably 6.2).

        * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
        menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
        remaining static member callbacks. 

        * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
        messages. 

        * src/support/lyxstring.h: declare struct Srep as friend of
        lyxstring, since DEC cxx complains otherwise.

1999-10-24  Lars Gullik Bjønnes  <larsbj@lyx.org>

1999-10-24  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/LaTeX.C (run): made run_bibtex also depend on files with
        extension ".bst"
        (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
        are put into the dependency file.

        * src/spellchecker.C (create_ispell_pipe): removed old #warning,
        the code has shown itself to work
        (create_ispell_pipe): removed another warning, added a comment
        instead. 

        * src/minibuffer.C (ExecutingCB): removed code that has been
        commented out a long time

        * src/lyxfunc.C (processKeyEvent): removed some very old commented
        out code + a warning.

        * src/support/lyxstring.h: comment out the three private
        operators, when compiling with string ansi conforming compilers
        they make problems.

        * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
        unsigned char *.
        (pixmapFromBitmapData): change type of bdata to be unsigned char *
        (pixmapFromBitmapData): add a reinterpret_cast in the call to
        XCreateImage

        * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
        unsigned char *

        * src/mathed/math_panel.C (create_math_panel): remove explicit
        casts

        * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
        unsigned char *.

        * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
        (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
        to XCreatePixmapFromBitmapData
        (fl_set_bmtable_data): change the last argument to be unsigned
        char *
        (fl_set_bmtable_file): change bdata to unsinged char *, change bw
        and bh to be unsigned int, remove explicit casts in call to
        XReadBitmapFileData.

        * images/arrows.xbm: made the arrays unsigned char *
        * images/varsz.xbm: ditto
        * images/misc.xbm: ditto
        * images/greek.xbm: ditto
        * images/dots.xbm: ditto
        * images/brel.xbm: ditto
        * images/bop.xbm: ditto

        * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in

        * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed. 
        (LYX_PROG_CXX): added -pedantic to g++ compile options when
        with-warnings, removed the __STRING_ANSI__ hack, seems to not be
        needed. 
        (LYX_CXX_CHEADERS): added <clocale> to the test. 

1999-10-23  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.

        * src/support/lyxstring.C (append): fixed something that must be a
        bug, rep->assign was used instead of rep->append.

        * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
        and LOstream.h

        * src/lyxfunc.C (processKeyEvent): removed faulty line that made
        lyx insert double chars. Fix spotted by Kayvan.

1999-10-23  Asger Alstrup Nielsen  <alstrup@alstrup.galaxy.dk>

        * Fixed the tth support. I messed up with the Emacs patch apply feature
        and omitted the changes in lyxrc.C.

1999-10-22  Juergen Vigna  <jug@sad.it>

        * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.

        * src/lyx_cb.C (MenuInsertRef) + 
        * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
        the form cannot be resized under it limits (fixes a segfault)
        
        * src/lyx.C (create_form_form_ref) +
        * forms/lyx.fd: Changed Gravity on name input field so that it is
        resized correctly.

1999-10-22  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
        <ostream> and <istream>.
        
        * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
        whether <fstream> provides the latest standard features, or if we
        have an oldstyle library (like in egcs).
        (LYX_CXX_STL_STRING): fix the test.

        * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
        code on MODERN_STL_STREAM.

        * src/support/lyxstring.h: use L{I,O}stream.h.

        * src/support/L{I,O}stream.h: new files, designed to setup
        correctly streams for our use
          - includes the right header depending on STL capabilities
          - puts std::ostream and std::endl (for LOStream.h) or
          std::istream (LIStream.h) in toplevel namespace.

1999-10-22  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/LaTeX.C (run): added a check in 0 sumchange so that if it
        was a bib file that had been changed we ensure that bibtex is run.
        (runBibTeX): enhanced to extract the names of the bib files and
        getting their absolute path and enter them into the dep file.
        (findtexfile): static func that is used to look for tex-files,
        checks for absolute patchs and tries also with kpsewhich.
        Alternative ways of finding the correct files are wanted. Will
        probably be moved.
        (do_popen): function that runs a command using popen and returns
        the whole output of that command in a string. Should be moved to
        somewhere else.

        * src/DepTable.[Ch] (extchanged): new function that returns true if a
        file with extension ext has changed.

        * src/insets/figinset.C: added ifdef guards around the fl_free
        code that jug commented out. Now it is commented out when
        compiling with XForms == 0.89.

        * src/support/lyxstring.C: moved the definition of lyxstring::Srep
        to lyxstring.C, and only keep a forward declaration in
        lyxstring.h. Simplifies the header file a bit and should help a
        bit on compile time too. Also changes to Srep will not mandate a
        recompile of code just using string.
        (~lyxstring): definition moved here since it uses srep.
        (size): definition moved here since it uses srep.

        * src/support/lyxstring.h: removed a couple of "inline" that should
        not be there.

1999-10-21  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
        the 'ob' argument.

1999-10-21  Juergen Vigna  <jug@sad.it>

        * src/table.C (SetPWidth): Just a small fix so the alignment is not
        set to left if I just remove the width entry (or it is empty).

        * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
        paragraph when having dummy paragraphs.

1999-10-20  Juergen Vigna  <jug@sad.it>

        * src/insets/figinset.C: just commented some fl_free_form calls
        and added warnings so that this calls should be activated later
        again. This avoids for now a segfault, but we have a memory leak!

        * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
        'const char * argument' to 'string argument', this should
        fix some Asserts() in lyxstring.C.

        * src/lyxfunc.h: Removed the function argAsString(const char *)
        as it is not used anymore.

1999-10-20  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/lyxstring.C (getline): reads now _all_ chars. uses
        get instead of >>

        * src/Literate.h: some funcs moved from public to private to make
        interface clearer. Unneeded args removed.

        * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
        instead of lyxlex.
        (scanBuildLogFile): ditto

        * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
        normal TeX Error. Still room for improvement.

        * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.

        * src/buffer.C (insertErrors): changes to make the error
        desctription show properly.

        * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
        could never happen

        * src/support/lyxstring.C (helper): changed to use
        sizeof(object->rep->ref).
        (operator>>): changed to use a pointer instead.

        * src/support/lyxstring.h: changed const reference & to value_type
        const & lets see if that helps.

1999-10-19  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * Makefile.am (rpmdist): fixed to have non static package and
        verison.

        * src/support/lyxstring.C: removed the compilation guards

        * src/vspace.C (nextToken): use i + 1  instead of ++i. Maks things
        a bit clearer.

        * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
        conditional compile of lyxstring.Ch

        * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
        stupid check, but it is a lot better than the bastring hack. 
        (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING  

        * several files: changed string::erase into string::clear. Not
        really needed.
        
        * src/chset.C (encodeString): use a char temporary instead

        * src/table.C (TexEndOfCell): added tostr around
        column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
        (TexEndOfCell): ditto
        (TexEndOfCell): ditto
        (TexEndOfCell): ditto
        (DocBookEndOfCell): ditto
        (DocBookEndOfCell): ditto
        (DocBookEndOfCell): ditto
        (DocBookEndOfCell): ditto

        * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1

        * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count

        * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
        (MenuBuildProg): added tostr around ret
        (MenuRunChktex): added tostr around ret
        (DocumentApplyCB): added tostr around ret

        * src/chset.C (encodeString): added tostr around t->ic

        * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
        (makeLaTeXFile): added tostr around tocdepth
        (makeLaTeXFile): added tostr around ftcound - 1

        * src/insets/insetbib.C (setCounter): added tostr around counter.

        * src/support/lyxstring.h: added an operator+=(int) to catch more
        mistakes. 

        * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
        (lyxstring): We DON'T allow NULL pointers.

1999-10-19  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/mathed/math_macro.C (MathMacroArgument::Write,
        MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
        when writing them out.

        * src/LString.C: remove, since it is not used anymore.
        
        * src/support/lyxstring.C: condition the content to
        USE_INCLUDED_STRING macro.

        * src/mathed/math_symbols.C, src/support/lstrings.C,
        src/support/lyxstring.C: add `using' directive to specify what
        we need in <algorithm>. I do not think that we need to
        conditionalize this, but any thought is appreciated.

        * many files: change all callback functions to "C" linkage
        functions to please strict C++ compilers like DEC cxx 6.1 in mode
        strict_ansi. Those who were static are now global. 
            The case of callbacks which are static class members is
        trickier, since we have to make C wrappers around them (see
        InsetError, InsetInfo and InsetUrl). The same holds for friends. I
        did not finish this yet, since it defeats the purpose of
        encapsulation, and I am not sure what the best route is.

1999-10-19  Juergen Vigna  <jug@sad.it>

        * src/support/lyxstring.C (lyxstring): we permit to have a null
        pointer as assignment value and just don't assign it.

        * src/vspace.C (nextToken): corrected this function substituting
        find_first(_not)_of with find_last_of.

        * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
                (TableOptCloseCB) (TableSpeCloseCB):
        inserted fl_set_focus call for problem with fl_hide_form() in
        xforms-0.89.

1999-10-19  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
        string. 

1999-10-18  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
        LyXLex::next() and not eatline() to get its argument.

1999-10-17  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/DepTable.[Ch]: rewritten to store the dependencies in a map
        instead, use fstreams for io of the depfile, removed unneeded
        functions and variables. 

        * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
        vector instead, removed all functions and variables that is not in
        use.

1999-10-16  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/buffer.C (insertErrors): use new interface to TeXError

        * Makefile.am (rpmdist): added a rpmdist target

        * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
        per Kayvan's instructions.

1999-10-15  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/Makefile.am: add a definition for localedir, so that locales
        are found after installation (Kayvan)

1999-10-14  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * development/.cvsignore: new file.

1999-10-14  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
        C++ compiler provides wrappers for C headers and use our alternate
        version otherwise.

        * configure.in: use LYX_CXX_CHEADERS.

        * src/cheader/: new directory, populated with cname headers from
        libstdc++-2.8.1. They are a bit old, but probably good enough for
        what we want (support compilers who lack them).
        
        * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
        from includes. It turns out is was stupid.
 
1999-10-14  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * lib/Makefile.am (install-data-local): forgot a ';'
        (install-data-local): forgot a '\'
        (libinstalldirs): needed after all. reintroduced.

1999-10-13  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * configure.in (AC_OUTPUT): added lyx.spec

        * development/lyx.spec: removed file

        * development/lyx.spec.in: new file

        * po/*.po: merged with lyx.pot becuase of make distcheck
        
        * lib/Makefile.am (dist-hook): added dist-hook so that
        documentation files will be included when doing a make
        dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
        (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
        conditional later.
        more: tried to make install do the right thing, exclude CVS dirs
        etc.

        * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
        Path would fit in more nicely.

        * all files that used to use pathstack: uses now Path instead.
        This change was a lot easier than expected.
        
        * src/support/path.h: new file

        * src/support/Makefile.am (libsupport_a_SOURCES): added path.h

        * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]

        * src/support/lyxstring.C (getline): Default arg was given for
        para 3. removed.

        * Configure.cmd: removed file 

1999-10-13  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/support/DebugStream.[Ch]: remove the explicit std:: before
        streams classes and types, add the proper 'using' statements when
        MODERN_STL is defined.
        
        * src/debug.h: move the << operator definition after the inclusion
        of DebugStream.h

        * src/support/filetools.C: include "LAssert.h", which is needed
        later. 

        * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
        to includes. 

        * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
        include "debug.h" to define a proper ostream.

1999-10-12  Asger Alstrup Nielsen  <alstrup@alstrup.galaxy.dk>

        * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
          method to the SystemCall class which can kill a process, but it's
          not fully implemented yet.

        * src/*.C: Changed Systemcalls::Startscript() to startscript()

        * src/support/FileInfo.h: Better documentation  

        * src/lyxfunc.C: Added support for buffer-export html
        
        * src/menus.C: Added Export->As HTML...
        
        * lib/bind/*.bind: Added short-cut for buffer-export html

        * src/lyxrc.*: Added support for new \tth_command
        
        * lib/lyxrc.example: Added stuff for new \tth_command

1999-10-12  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * lib/Makefile.am (IMAGES): removed images/README
        (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
        installes in correct place. Check permisions is installed
        correctly.

        * src/LaTeX.C: some no-op changes moved declaration of some
        variables around.

        * src/LaTeX.h (LATEX_H): changed include guard name

1999-10-12  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * lib/reLyX/Makefile.am: install noweb2lyx.

        * lib/Makefile.am: install configure. 

        * lib/reLyX/configure.in: declare a config aux dir; set package
        name to lyx (not sure what the best solution is); generate noweb2lyx.

        * lib/layouts/egs.layout: fix the bibliography layout.

1999-10-08  Jürgen Vigna <jug@sad.it>

        * src/support/filetools.C (FileOpenSearch): Fixed a bug where
        when in the PATH was something like /usr/bin;;/bin (note: the ;;)
        it returned without continuing to search the path.
        
1999-10-07  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
        also fixes a bug. It is not allowed to do tricks with std::strings
        like: string a("hei"); &a[e]; this will not give what you
        think... Any reason for the complexity in this func?

1999-10-06  Asger Alstrup Nielsen  <alstrup@diku.dk>

        * Updated README and INSTALL a bit, mostly to check that my
        CVS rights are correctly set up.

1999-10-06  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/lyxstring.C (helper): removed bogus Assert. strlen
        does not allow '\0' chars but lyxstring and std::string does.

1999-10-05  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * autogen.sh (AUTOCONF): let the autogen script create the
        POTFILES.in file too. POTFILES.in should perhaps now not be
        included in the cvs module.

        * some more files changed to use C++ includes instead of C ones.

        * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
        not assigned.
        (Reread): added tostr to nlink. buggy output otherwise.
        (Reread): added a string() around szMode when assigning to Buffer,
        without this I got a log of garbled info strings.

        * acconfig.h: commented out the PTR_AS_INT macros. They should not
        be needed.

        * I have added several ostream & operator<<(ostream &, some_type)
        functions. This has been done to avoid casting and warnings when
        outputting enums to lyxerr. This as thus eliminated a lot of
        explicit casts and has made the code clearer. Among the enums
        affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
        mathed enums, some font enum the Debug::type enum. 

        * src/support/lyxstring.h (clear): missing method. equivalent of
        erase(0, npos).

        * all files that contained "stderr": rewrote constructs that used
        stderr to use lyxerr instead. (except bmtable)

        * src/support/DebugStream.h (level): and the passed t with
        Debug::ANY to avoid spurious bits set.

        * src/debug.h (Debug::type value): made it accept strings of the
        type INFO,INIT,KEY.

        * configure.in (Check for programs): Added a check for kpsewhich,
        the latex generation will use this later to better the dicovery of
        all used files. 

        * src/BufferView.C (create_view): we don't need to cast this to
        (void*) that is done automatically.
        (WorkAreaButtonPress): removed some dead code.

1999-10-05  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
        is not overwritten when translated (David Sua'rez de Lis).

        * lib/CREDITS: Added David Sua'rez de Lis

        * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.

        * src/bufferparams.C (BufferParams): default input encoding is now
        "latin1" 

        * acinclude.m4 (cross_compiling): comment out macro
        LYX_GXX_STRENGTH_REDUCE. 

        * acconfig.h: make sure that const is not defined (to empty) when
        we are compiling C++. Remove commented out code using SIZEOF_xx
        macros.
        
        * configure.in : move the test for const and inline as late as
        possible so that these C tests do not interefere with C++ ones.
        Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
        has not been proven. 

1999-10-04  Jean-Marc Lasgouttes  <Jean-Marc.Lasgouttes@inria.fr>

        * src/table.C (getDocBookAlign): remove bad default value for
        isColumn parameter.

        * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
        shortcut. 
        (ShowFileMenu2): ditto.

        * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
        of files to ignore.

1999-10-04  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * Most files: finished the change from the old error code to use
        DebugStream for all lyxerr debugging. Only minor changes remain
        (e.g. the setting of debug levels using strings instead of number) 

1999-10-02  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/layout.C (Add): Changed to use compare_no_case instead of
        strcasecmp.

        * src/FontInfo.C: changed loop variable type too string::size_type.

1999-10-01  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
        set ETAGS_ARGS to --c++ 

1999-09-30  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/table.C (DocBookEndOfCell): commented out two unused variables

        * src/paragraph.C: commented out four unused variables. 

        * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
        insed a if clause with type string::size_type.

        * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
        string::size_type.

        * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.

        * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
        variable, also changed loop to go from 0 to lenght + 1, instead of
        -1 to length. This should be correct.

        * src/LaTeX.C (scanError): use string::size_type as loop variable
        type.

        * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
        (l.896) since y_tmp and row was not used anyway.

        * src/insets/insetref.C (escape): use string::size_type as loop
        variable type.

        * src/insets/insetquotes.C (Width): use string::size_type as loop
        variable type.
        (Draw): use string::size_type as loop variable type.

        * src/insets/insetlatexaccent.C (checkContents): use
        string::size_type as loop variable type.

        * src/insets/insetlabel.C (escape): use string::size_type as loop
        variable type.

        * src/insets/insetinfo.C: added an extern for current_view.

        * src/insets/insetcommand.C (scanCommand): use string::size_type
        as loop variable type.

        * most files: removed the RCS tags. With them we had to recompile
        a lot of files after a simple cvs commit. Also we have never used
        them for anything meaningful. 

        * most files: tags-query-replace NULL 0. As adviced several plases
        we now use "0" instead of "NULL" in our code. 

        * src/support/filetools.C (SpaceLess): use string::size_type as
        loop variable type.

1999-09-29  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/paragraph.C: fixed up some more string stuff.

1999-09-28  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * src/support/filetools.h: make modestr a std::string.

        * src/filetools.C (GetEnv): made ch really const.

        * src/lyxlib.h: removed the Maximum and Minimum inline functions,
        made code that used these use max/min from <algorithm> instead.

        * changed several c library include files to their equivalent c++
        library include files. All is not changed yet.

        * created a support subdir in src, put lyxstring and lstrings
        there + the extra files atexit, fileblock, strerror. Created
        Makefile.am. edited configure.in and src/Makefile.am to use this
        new subdir. More files moved to support.

        * imported som of the functions from repository lyx, filetools
        
        * ran tags-query-replace on LString -> string, corrected the bogus
        cases. Tried to make use of lstrings.[hC], debugged a lot. There
        is still some errors in there. This is errors where too much or
        too litle get deleted from strings (string::erase, string::substr,
        string::replace), there can also be some off by one errors, or
        just plain wrong use of functions from lstrings. Viewing of quotes
        is wrong. 

        * LyX is now running fairly well with string, but there are
        certainly some bugs yet (see above) also string is quite different
        from LString among others in that it does not allow null pointers
        passed in and will abort if it gets any.
        
        * Added the revtex4 files I forgot when setting up the repository.

1999-09-27  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * All over: Tried to clean everything up so that only the files
          that we really need are included in the cvs repository.
        * Switched to use automake.
        * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
        * Install has not been checked.

1999-09-22  Lars Gullik Bjønnes  <larsbj@lyx.org>

        * po/pt.po: Three errors:
               l.533 and l.538 format specification error
               l. 402 duplicate entry, I just deleted it.