1 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
4 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
6 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
7 created in the constructors in different groups. Then set() just
8 have to show the groups as needed. This fixes the redraw problems
9 (and is how the old menu code worked).
11 * src/support/lyxlib.h: declare the methods as static when we do
14 2000-09-26 Juergen Vigna <jug@sad.it>
16 * src/buffer.C (asciiParagraph): new function.
17 (writeFileAscii): new function with parameter ostream.
18 (writeFileAscii): use now asciiParagraph.
20 * various inset files: added the linelen parameter to the Ascii-func.
22 * src/tabular.C (Write): fixed error in writing file introduced by
23 the last changes from Lars.
25 * lib/bind/menus.bind: removed not supported functions.
27 * src/insets/insettext.C (Ascii): implemented this function.
29 * src/insets/lyxinset.h (Ascii): added linelen parameter.
31 * src/tabular.C (write_attribute[int,string,bool]): new functions.
32 (Write): use of the write_attribute functions.
34 * src/bufferlist.C (close): fixed reasking question!
36 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
38 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
39 new files use the everwhere possible.
42 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
43 src/log_form.C src/lyx.C:
46 * src/buffer.C (runLaTeX): remove func
48 * src/PaperLayout.C: removed file
49 * src/ParagraphExtra.C: likewise
50 * src/bullet_forms.C: likewise
51 * src/bullet_forms.h: likewise
52 * src/bullet_forms_cb.C: likewise
54 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
55 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
58 * several files: remove all traces of the old fd_form_paragraph,
59 and functions belonging to that.
61 * several files: remove all traces of the old fd_form_document,
62 and functions belonging to that.
64 * several files: constify local variables were possible.
66 * several files: remove all code that was dead when NEW_EXPORT was
69 * several files: removed string::c_str in as many places as
72 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
73 (e): be a bit more outspoken when patching
74 (updatesrc): only move files if changed.
76 * forms/layout_forms.h.patch: regenerated
78 * forms/layout_forms.fd: remove form_document and form_paragraph
79 and form_quotes and form_paper and form_table_options and
82 * forms/form1.fd: remove form_table
84 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
85 the fdui->... rewrite. Update some comments to xforms 0.88
87 * forms/bullet_forms.C.patch: removed file
88 * forms/bullet_forms.fd: likewise
89 * forms/bullet_forms.h.patch: likewise
91 * development/Code_rules/Rules: added a section on switch
92 statements. Updated some comment to xforms 0.88.
94 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
96 * src/buffer.C (readFile): make sure that the whole version number
97 is read after \lyxformat (even when it contains a comma)
99 * lib/ui/default.ui: change shortcut of math menu to M-a.
101 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
103 * src/vspace.C (nextToken): use isStrDbl() to check for proper
106 * src/LyXView.C (updateWindowTitle): show the full files name in
107 window title, limited to 30 characters.
109 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
110 When a number of characters has been given, we should not assume
111 that the string is 0-terminated.
113 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
114 calls (fixes some memory leaks)
116 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
117 trans member on exit.
119 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
121 * src/converter.C (GetReachable): fix typo.
123 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
124 understand ',' instead of '.'.
125 (GetInteger): rewrite to use strToInt().
127 2000-09-26 Juergen Vigna <jug@sad.it>
129 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
130 better visibility and error-message on wrong VSpace input.
132 * src/language.C (initL): added english again.
134 2000-09-25 Juergen Vigna <jug@sad.it>
136 * src/frontends/kde/Dialogs.C (Dialogs):
137 * src/frontends/gnome/Dialogs.C (Dialogs):
138 * src/frontends/kde/Makefile.am:
139 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
141 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
143 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
145 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
147 * src/frontends/xforms/FormParagraph.C:
148 * src/frontends/xforms/FormParagraph.h:
149 * src/frontends/xforms/form_paragraph.C:
150 * src/frontends/xforms/form_paragraph.h:
151 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
154 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
156 * src/tabular.C (OldFormatRead): forgot to delete the temporary
157 Paragraph-Data after use.
159 * src/insets/insettext.C (LocalDispatch): don't set the layout on
160 non breakable paragraphs.
162 2000-09-25 Garst R. Reese <reese@isn.net>
164 * src/language.C (initL): added missing language_country codes.
166 2000-09-25 Juergen Vigna <jug@sad.it>
168 * src/insets/insettext.C (InsetText):
169 (deleteLyXText): remove the not released LyXText structure!
171 2000-09-24 Marko Vendelin <markov@ioc.ee>
173 * src/frontends/gnome/mainapp.C
174 * src/frontends/gnome/mainapp.h: added support for keyboard
177 * src/frontends/gnome/FormCitation.C
178 * src/frontends/gnome/FormCitation.h
179 * src/frontends/gnome/Makefile.am
180 * src/frontends/gnome/pixbutton.h: completed the rewrite of
181 FormCitation to use "action area" in mainapp window
183 * src/frontends/gnome/Menubar_pimpl.C
184 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
187 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
189 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
190 width/descent/ascent values if name is empty.
191 (mathed_string_height): Use std::max.
193 2000-09-25 Allan Rae <rae@lyx.org>
195 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
196 segfault. This will be completely redesigned soon.
198 * sigc++: updated libsigc++. Fixes struct timespec bug.
200 * development/tools/makeLyXsigc.sh: .cvsignore addition
202 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
204 * several files: removed almost all traces of the old table
207 * src/TableLayout.C: removed file
209 2000-09-22 Juergen Vigna <jug@sad.it>
211 * src/frontends/kde/Dialogs.C: added credits forms.
213 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
215 * src/frontends/gnome/Dialogs.C: added some forms.
217 * src/spellchecker.C (init_spell_checker): set language in pspell code
218 (RunSpellChecker): some modifications for setting language string.
220 * src/language.[Ch]: added language_country code.
222 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
224 * src/frontends/Dialogs.h: added new signal showError.
225 Rearranged existing signals in some sort of alphabetical order.
227 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
228 FormError.[Ch], form_error.[Ch]
229 * src/frontends/xforms/forms/makefile: added new file form_error.fd
230 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
232 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
233 dialogs. I think that this can be used as the base to all these
236 * src/frontends/xforms/FormError.[Ch]
237 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
238 implementation of InsetError dialog.
240 * src/insets/inseterror.[Ch]: rendered GUI-independent.
242 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
243 * src/frontends/kde/Makefile.am: ditto
245 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
247 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
248 macrobf. This fixes a bug of invisible text.
250 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
252 * lib/doc/LaTeXConfig.lyx.in: updated.
254 * src/language.C (initL): remove language "francais" and change a
255 bit the names of the two other french variations.
257 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
258 string that may not be 0-terminated.
260 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
262 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
264 2000-09-20 Marko Vendelin <markov@ioc.ee>
266 * src/frontends/gnome/FormCitation.C
267 * src/frontends/gnome/FormIndex.C
268 * src/frontends/gnome/FormToc.C
269 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
270 the variable initialization to shut up the warnings
272 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
274 * src/table.[Ch]: deleted files
276 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
279 2000-09-18 Juergen Vigna <jug@sad.it>
281 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
282 problems with selection. Inserted new LFUN_PASTESELECTION.
283 (InsetButtonPress): inserted handling of middle mouse-button paste.
285 * src/spellchecker.C: changed word to word.c_str().
287 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
289 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
290 included in the ``make dist'' tarball.
292 2000-09-15 Juergen Vigna <jug@sad.it>
294 * src/CutAndPaste.C (cutSelection): small fix return the right
295 end position after cut inside one paragraph only.
297 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
298 we are locked as otherwise we don't have a valid cursor position!
300 * src/insets/figinset.C (draw): small bugfix but why is this needed???
302 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
304 * src/frontends/kde/FormRef.C: added using directive.
305 * src/frontends/kde/FormToc.C: ditto
307 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
309 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
312 2000-09-19 Marko Vendelin <markov@ioc.ee>
314 * src/frontends/gnome/Menubar_pimpl.C
315 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
316 Toc, ViewFormats, UpdateFormats, and ExportFormats.
318 * src/frontends/gnome/mainapp.C
319 * src/frontends/gnome/mainapp.h: support for menu update used
322 * src/frontends/gnome/mainapp.C
323 * src/frontends/gnome/mainapp.h: support for "action" area in the
324 main window. This area is used by small simple dialogs, such as
327 * src/frontends/gnome/FormIndex.C
328 * src/frontends/gnome/FormIndex.h
329 * src/frontends/gnome/FormUrl.C
330 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
333 * src/frontends/gnome/FormCitation.C
334 * src/frontends/gnome/FormCitation.h: rewrite to use main window
335 action area. Only "Insert new citation" is implemented.
339 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
341 * src/buffer.C (Dispatch): fix call to Dispatch
342 * src/insets/insetref.C (Edit): likewise
343 * src/insets/insetparent.C (Edit): likewise
344 * src/insets/insetinclude.C (include_cb): likewise
345 * src/frontends/xforms/FormUrl.C (apply): likewise
346 * src/frontends/xforms/FormToc.C (apply): likewise
347 * src/frontends/xforms/FormRef.C (apply): likewise
348 * src/frontends/xforms/FormIndex.C (apply): likewise
349 * src/frontends/xforms/FormCitation.C (apply): likewise
350 * src/lyxserver.C (callback): likewise
351 * src/lyxfunc.C (processKeySym): likewise
354 * src/lyx_cb.C (LayoutsCB): likewise
356 * Makefile.am (sourcedoc): small change
358 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
360 * src/main.C (main): Don't make an empty GUIRunTime object. all
361 methods are static. constify a bit remove unneded using + headers.
363 * src/tabular.C: some more const to local vars move some loop vars
365 * src/spellchecker.C: added some c_str after some word for pspell
367 * src/frontends/GUIRunTime.h: add new static method setDefaults
368 * src/frontends/xforms/GUIRunTime.C (setDefaults):
369 * src/frontends/kde/GUIRunTime.C (setDefaults):
370 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
372 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
373 with strnew in arg, use correct emptystring when calling SetName.
375 * several files: remove all commented code with relation to
376 HAVE_SSTREAM beeing false. We now only support stringstream and
379 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
381 * src/lyxfunc.C: construct correctly the automatic new file
384 * src/text2.C (IsStringInText): change type of variable i to shut
387 * src/support/sstream.h: do not use namespaces if the compiler
388 does not support them.
390 2000-09-15 Marko Vendelin <markov@ioc.ee>
391 * src/frontends/gnome/FormCitation.C
392 * src/frontends/gnome/FormCitation.h
393 * src/frontends/gnome/diainsertcitation_interface.c
394 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
395 regexp support to FormCitation [Gnome].
397 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
400 * configure.in: remove unused KDE/GTKGUI define
402 * src/frontends/kde/FormRef.C
403 * src/frontends/kde/FormRef.h
404 * src/frontends/kde/formrefdialog.C
405 * src/frontends/kde/formrefdialog.h: double click will
406 go to reference, now it is possible to change a cross-ref
409 * src/frontends/kde/FormToc.C
410 * src/frontends/kde/FormToc.h
411 * src/frontends/kde/formtocdialog.C
412 * src/frontends/kde/formtocdialog.h: add a depth
415 * src/frontends/kde/Makefile.am: add QtLyXView.h
418 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
420 * src/frontends/kde/FormCitation.h: added some using directives.
422 * src/frontends/kde/FormToc.h: corrected definition of doTree.
424 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
427 * src/mathed/math_defs.h: redefine SetAlign to use string rather
430 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
432 * src/buffer.C (pop_tag): revert for the second time a change by
433 Lars, who seems to really hate having non-local loop variables :)
435 * src/Lsstream.h: add "using" statements.
437 * src/support/copy.C (copy): add a bunch of std:: qualifiers
438 * src/buffer.C (writeFile): ditto
440 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
442 * src/buffer.C (writeFile): try to fix the locale modified format
443 number to always be as we want it.
445 * src/WorkArea.C (work_area_handler): try to workaround the bugs
446 in XForms 0.89. C-space is now working again.
448 * src/Lsstream.h src/support/sstream.h: new files.
450 * also commented out all cases where strstream were used.
452 * src/Bullet.h (c_str): remove method.
454 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
456 * a lot of files: get rid of "char const *" and "char *" is as
457 many places as possible. We only want to use them in interaction
458 with system of other libraries, not inside lyx.
460 * a lot of files: return const object is not of pod type. This
461 helps ensure that temporary objects is not modified. And fits well
462 with "programming by contract".
464 * configure.in: check for the locale header too
466 * Makefile.am (sourcedoc): new tag for generation of doc++
469 2000-09-14 Juergen Vigna <jug@sad.it>
471 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
472 callback to check which combo called it and do the right action.
474 * src/combox.C (combo_cb): added combo * to the callbacks.
475 (Hide): moved call of callback after Ungrab of the pointer.
477 * src/intl.h: removed LCombo2 function.
479 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
480 function as this can now be handled in one function.
482 * src/combox.h: added Combox * to callback prototype.
484 * src/frontends/xforms/Toolbar_pimpl.C:
485 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
487 2000-09-14 Garst Reese <reese@isn.net>
489 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
490 moved usepackage{xxx}'s to beginning of file. Changed left margin
491 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
492 underlining from title. Thanks to John Culleton for useful suggestions.
494 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
496 * src/lyxlex_pimpl.C (setFile): change error message to debug
499 2000-09-13 Juergen Vigna <jug@sad.it>
501 * src/frontends/xforms/FormDocument.C: implemented choice_class
502 as combox and give callback to combo_language so OK/Apply is activated
505 * src/bufferlist.C (newFile): small fix so already named files
506 (via an open call) are not requested to be named again on the
509 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
511 * src/frontends/kde/Makefile.am
512 * src/frontends/kde/FormRef.C
513 * src/frontends/kde/FormRef.h
514 * src/frontends/kde/formrefdialog.C
515 * src/frontends/kde/formrefdialog.h: implement
518 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
520 * src/frontends/kde/formtocdialog.C
521 * src/frontends/kde/formtocdialog.h
522 * src/frontends/kde/FormToc.C
523 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
525 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
527 * src/frontends/kde/FormCitation.C: fix thinko
528 where we didn't always display the reference text
531 * src/frontends/kde/formurldialog.C
532 * src/frontends/kde/formurldialog.h
533 * src/frontends/kde/FormUrl.C
534 * src/frontends/kde/FormUrl.h: minor cleanups
536 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
538 * src/frontends/kde/Makefile.am
539 * src/frontends/kde/FormToc.C
540 * src/frontends/kde/FormToc.h
541 * src/frontends/kde/FormCitation.C
542 * src/frontends/kde/FormCitation.h
543 * src/frontends/kde/FormIndex.C
544 * src/frontends/kde/FormIndex.h
545 * src/frontends/kde/formtocdialog.C
546 * src/frontends/kde/formtocdialog.h
547 * src/frontends/kde/formcitationdialog.C
548 * src/frontends/kde/formcitationdialog.h
549 * src/frontends/kde/formindexdialog.C
550 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
552 2000-09-12 Juergen Vigna <jug@sad.it>
554 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
557 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
559 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
562 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
564 * src/converter.C (Add, Convert): Added support for converter flags:
565 needaux, resultdir, resultfile.
566 (Convert): Added new parameter view_file.
567 (dvips_options): Fixed letter paper option.
569 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
570 (Export, GetExportableFormats, GetViewableFormats): Added support
573 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
575 (easyParse): Fixed to work with new export code.
577 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
580 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
582 * lib/bind/*.bind: Replaced
583 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
584 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
586 2000-09-11 Juergen Vigna <jug@sad.it>
588 * src/lyx_gui.C (runTime): uses global guiruntime variable.
590 * src/main.C (main): now GUII defines global guiruntime!
592 * src/frontends/gnome/GUIRunTime.C (initApplication):
593 * src/frontends/kde/GUIRunTime.C (initApplication):
594 * src/frontends/xforms/GUIRunTime.C (initApplication):
595 * src/frontends/GUIRunTime.h: added new function initApplication.
597 * src/spellchecker.C (sc_accept_word): change to add_to_session.
599 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
601 2000-09-08 Juergen Vigna <jug@sad.it>
603 * src/lyx_gui.C (create_forms): don't display the "default" entry as
604 we have already "Reset".
606 * src/language.C (initL): inserted "default" language and made this
607 THE default language (and not american!)
609 * src/paragraph.C: inserted handling of "default" language!
611 * src/lyxfont.C: ditto
615 * src/paragraph.C: output the \\par only if we have a following
616 paragraph otherwise it's not needed.
618 2000-09-05 Juergen Vigna <jug@sad.it>
620 * config/pspell.m4: added entry to lyx-flags
622 * src/spellchecker.C: modified version from Kevin for using pspell
624 2000-09-01 Marko Vendelin <markov@ioc.ee>
625 * src/frontends/gnome/Makefile.am
626 * src/frontends/gnome/FormCitation.C
627 * src/frontends/gnome/FormCitation.h
628 * src/frontends/gnome/diainsertcitation_callbacks.c
629 * src/frontends/gnome/diainsertcitation_callbacks.h
630 * src/frontends/gnome/diainsertcitation_interface.c
631 * src/frontends/gnome/diainsertcitation_interface.h
632 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
633 dialog for Gnome frontend
635 * src/main.C: Gnome libraries require keeping application name
636 and its version as strings
638 * src/frontends/gnome/mainapp.C: Change the name of the main window
639 from GnomeLyX to PACKAGE
641 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
643 * src/frontends/Liason.C: add "using: declaration.
645 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
647 * src/mathed/math_macro.C (Metrics): Set the size of the template
649 * src/mathed/formulamacro.C (Latex): Fixed the returned value
651 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
653 * src/converter.C (add_options): New function.
654 (SetViewer): Change $$FName into '$$FName'.
655 (View): Add options when running xdvi
656 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
657 (Convert): The 3rd parameter is now the desired filename. Converts
658 calls to lyx::rename if necessary.
659 Add options when running dvips.
660 (dvi_papersize,dvips_options): New methods.
662 * src/exporter.C (Export): Use getLatexName() instead of fileName().
664 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
665 using a call to Converter::dvips_options.
666 Fixed to work with nex export code.
669 * src/support/rename.C: New files
671 * src/support/syscall.h
672 * src/support/syscall.C: Added Starttype SystemDontWait.
674 * lib/ui/default.ui: Changed to work with new export code
676 * lib/configure.m4: Changed to work with new export code
678 * src/encoding.C: Changed latex name for iso8859_7 encoding.
680 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
682 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
683 so that code compiles with DEC cxx.
685 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
686 to work correctly! Also now supports the additional elements
689 2000-09-01 Allan Rae <rae@lyx.org>
691 * src/frontends/ButtonPolicies.C: renamed all the references to
692 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
694 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
695 since it's a const not a type.
697 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
699 2000-08-31 Juergen Vigna <jug@sad.it>
701 * src/insets/figinset.C: Various changes to look if the filename has
702 an extension and if not add it for inline previewing.
704 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
706 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
707 make buttonStatus and isReadOnly be const methods. (also reflect
708 this in derived classes.)
710 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
711 (nextState): change to be static inline, pass the StateMachine as
713 (PreferencesPolicy): remove casts
714 (OkCancelPolicy): remvoe casts
715 (OkCancelReadOnlyPolicy): remove casts
716 (NoRepeatedApplyReadOnlyPolicy): remove casts
717 (OkApplyCancelReadOnlyPolicy): remove casts
718 (OkApplyCancelPolicy): remove casts
719 (NoRepeatedApplyPolicy): remove casts
721 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
723 * src/converter.C: added some using directives
725 * src/frontends/ButtonPolicies.C: changes to overcome
726 "need lvalue" error with DEC c++
728 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
729 to WMHideCB for DEC c++
731 * src/frontends/xforms/Menubar_pimpl.C: added using directive
733 * src/frontends/xforms/forms/form_document.C.patch: use C callback
734 to BulletBMTableCB for DEC c++
736 2000-08-31 Allan Rae <rae@lyx.org>
738 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
739 character dialog separately from old document dialogs combo_language.
742 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
744 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
745 Removed LFUN_REF_CREATE.
747 * src/MenuBackend.C: Added new tags: toc and references
749 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
750 (add_lastfiles, add_documents, add_formats): Removed the unused smn
752 (add_toc, add_references): New methods.
753 (create_submenu): Handle correctly the case when there is a
754 seperator after optional menu items.
756 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
757 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
758 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
760 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
762 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
764 * src/converter.[Ch]: New file for converting between different
767 * src/export.[Ch]: New file for exporting a LyX file to different
770 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
771 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
772 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
773 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
774 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
775 RunDocBook, MenuExport.
777 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
778 Exporter::Preview methods if NEW_EXPORT is defined.
780 * src/buffer.C (Dispatch): Use Exporter::Export.
782 * src/lyxrc.C: Added new tags: \converter and \viewer.
785 * src/LyXAction.C: Define new lyx-function: buffer-update.
786 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
787 when NEW_EXPORT is defined.
789 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
791 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
793 * lib/ui/default.ui: Added submenus "view" and "update" to the
796 * src/filetools.C (GetExtension): New function.
798 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
800 2000-08-29 Allan Rae <rae@lyx.org>
802 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
804 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
805 (EnableDocumentLayout): removed
806 (DisableDocumentLayout): removed
807 (build): make use of ButtonController's read-only handling to
808 de/activate various objects. Replaces both of the above functions.
810 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
811 (readOnly): was read_only
812 (refresh): fixed dumb mistakes with read_only_ handling
814 * src/frontends/xforms/forms/form_document.fd:
815 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
816 tabbed dialogs so the tabs look more like tabs and so its easier to
817 work out which is the current tab.
819 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
820 segfault with form_table
822 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
824 2000-08-28 Juergen Vigna <jug@sad.it>
826 * acconfig.h: added USE_PSPELL.
828 * src/config.h.in: added USE_PSPELL.
830 * autogen.sh: added pspell.m4
832 * config/pspell.m4: new file.
834 * src/spellchecker.C: implemented support for pspell libary.
836 2000-08-25 Juergen Vigna <jug@sad.it>
838 * src/LyXAction.C (init): renamed LFUN_TABLE to
839 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
841 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
843 * src/lyxscreen.h: add force_clear variable and fuction to force
844 a clear area when redrawing in LyXText.
846 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
848 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
850 * some whitespace and comment changes.
852 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
854 * src/buffer.C: up te LYX_FORMAT to 2.17
856 2000-08-23 Juergen Vigna <jug@sad.it>
858 * src/BufferView_pimpl.C (tripleClick): disable this when in a
861 * src/insets/insettabular.C (pasteSelection): delete the insets
862 LyXText as it is not valid anymore.
863 (copySelection): new function.
864 (pasteSelection): new function.
865 (cutSelection): new function.
866 (LocalDispatch): implemented cut/copy/paste of cell selections.
868 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
869 don't have a LyXText.
871 * src/LyXAction.C (init): a NEW_TABULAR define too much.
873 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
876 2000-08-22 Juergen Vigna <jug@sad.it>
878 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
879 ifdef form_table out if NEW_TABULAR.
881 2000-08-21 Juergen Vigna <jug@sad.it>
883 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
884 (draw): fixed draw position so that the cursor is positioned in the
886 (InsetMotionNotify): hide/show cursor so the position is updated.
887 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
888 using cellstart() function where it should be used.
890 * src/insets/insettext.C (draw): ditto.
892 * src/tabular.C: fixed initialization of some missing variables and
893 made BoxType into an enum.
895 2000-08-22 Marko Vendelin <markov@ioc.ee>
896 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
897 stock menu item using action numerical value, not its string
901 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
903 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
904 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
906 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
908 * src/frontends/xforms/GUIRunTime.C: new file
910 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
911 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
913 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
915 * src/frontends/kde/GUIRunTime.C: new file
917 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
918 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
920 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
922 * src/frontends/gnome/GUIRunTime.C: new file
924 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
927 * src/frontends/GUIRunTime.h: removed constructor and destructor,
928 small change to documetentation.
930 * src/frontends/GUIRunTime.C: removed file
932 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
934 * src/lyxparagraph.h: enable NEW_TABULAR as default
936 * src/lyxfunc.C (processKeySym): remove some commented code
938 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
939 NEW_TABULAR around the fd_form_table_options.
941 * src/lyx_gui.C (runTime): call the static member function as
942 GUIRunTime::runTime().
944 2000-08-21 Allan Rae <rae@lyx.org>
946 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
949 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
951 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
953 2000-08-21 Allan Rae <rae@lyx.org>
955 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
957 * src/frontends/xforms/FormPreferences.C (build): use setOK
958 * src/frontends/xforms/FormDocument.C (build): use setOK
959 (FormDocument): use the appropriate policy.
961 2000-08-21 Allan Rae <rae@lyx.org>
963 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
964 automatic [de]activation of arbitrary objects when in a read-only state.
966 * src/frontends/ButtonPolicies.h: More documentation
967 (isReadOnly): added to support the above.
969 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
971 2000-08-18 Juergen Vigna <jug@sad.it>
973 * src/insets/insettabular.C (getStatus): changed to return func_status.
975 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
976 display toggle menu entries if they are.
978 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
979 new document layout now.
981 * src/lyxfunc.C: ditto
983 * src/lyx_gui_misc.C: ditto
985 * src/lyx_gui.C: ditto
987 * lib/ui/default.ui: removed paper and quotes layout as they are now
988 all in the document layout tabbed folder.
990 * src/frontends/xforms/forms/form_document.fd: added Restore
991 button and callbacks for all inputs for Allan's ButtonPolicy.
993 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
994 (CheckChoiceClass): added missing params setting on class change.
995 (UpdateLayoutDocument): added for updating the layout on params.
996 (build): forgot to RETURN_ALWAYS input_doc_spacing.
997 (FormDocument): Implemented Allan's ButtonPolicy with the
1000 2000-08-17 Allan Rae <rae@lyx.org>
1002 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
1003 so we can at least see the credits again.
1005 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
1006 controller calls for the appropriate callbacks. Note that since Ok
1007 calls apply followed by cancel, and apply isn't a valid input for the
1008 APPLIED state, the bc_ calls have to be made in the static callback not
1009 within each of the real callbacks.
1011 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
1012 (setOk): renamed from setOkay()
1014 2000-08-17 Juergen Vigna <jug@sad.it>
1016 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1017 in the implementation part.
1018 (composeUIInfo): don't show optional menu-items.
1020 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1022 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1024 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1025 text-state when in a text-inset.
1027 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1029 2000-08-17 Marko Vendelin <markov@ioc.ee>
1030 * src/frontends/gnome/FormIndex.C
1031 * src/frontends/gnome/FormIndex.h
1032 * src/frontends/gnome/FormToc.C
1033 * src/frontends/gnome/FormToc.h
1034 * src/frontends/gnome/dialogs
1035 * src/frontends/gnome/diatoc_callbacks.c
1036 * src/frontends/gnome/diatoc_callbacks.h
1037 * src/frontends/gnome/diainsertindex_callbacks.h
1038 * src/frontends/gnome/diainsertindex_callbacks.c
1039 * src/frontends/gnome/diainsertindex_interface.c
1040 * src/frontends/gnome/diainsertindex_interface.h
1041 * src/frontends/gnome/diatoc_interface.h
1042 * src/frontends/gnome/diatoc_interface.c
1043 * src/frontends/gnome/Makefile.am: Table of Contents and
1044 Insert Index dialogs implementation for Gnome frontend
1046 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1048 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1050 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1053 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1055 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1056 destructor. Don't definde if you don't need it
1057 (processEvents): made static, non-blocking events processing for
1059 (runTime): static method. event loop for xforms
1060 * similar as above for kde and gnome.
1062 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1063 new Pimpl is correct
1064 (runTime): new method calss the real frontends runtime func.
1066 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1068 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1070 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1072 2000-08-16 Juergen Vigna <jug@sad.it>
1074 * src/lyx_gui.C (runTime): added GUII RunTime support.
1076 * src/frontends/Makefile.am:
1077 * src/frontends/GUIRunTime.[Ch]:
1078 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1079 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1080 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1082 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1084 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1085 as this is already set in ${FRONTEND_INCLUDE} if needed.
1087 * configure.in (CPPFLAGS): setting the include dir for the frontend
1088 directory and don't set FRONTEND=xforms for now as this is executed
1091 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1093 * src/frontends/kde/Makefile.am:
1094 * src/frontends/kde/FormUrl.C:
1095 * src/frontends/kde/FormUrl.h:
1096 * src/frontends/kde/formurldialog.h:
1097 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1099 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1101 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1103 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1105 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1108 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1110 * src/WorkArea.C (work_area_handler): more work to get te
1111 FL_KEYBOARD to work with xforms 0.88 too, please test.
1113 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1115 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1117 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1120 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1122 * src/Timeout.h: remove Qt::emit hack.
1124 * several files: changes to allo doc++ compilation
1126 * src/lyxfunc.C (processKeySym): new method
1127 (processKeyEvent): comment out if FL_REVISION < 89
1129 * src/WorkArea.C: change some debugging levels.
1130 (WorkArea): set wantkey to FL_KEY_ALL
1131 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1132 clearer code and the use of compose with XForms 0.89. Change to
1133 use signals instead of calling methods in bufferview directly.
1135 * src/Painter.C: change some debugging levels.
1137 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1140 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1141 (workAreaKeyPress): new method
1143 2000-08-14 Juergen Vigna <jug@sad.it>
1145 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1147 * config/kde.m4: addes some features
1149 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1150 include missing xforms dialogs.
1152 * src/Timeout.h: a hack to be able to compile with qt/kde.
1154 * sigc++/.cvsignore: added acinclude.m4
1156 * lib/.cvsignore: added listerros
1158 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1159 xforms tree as objects are needed for other frontends.
1161 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1162 linking with not yet implemented xforms objects.
1164 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1166 2000-08-14 Baruch Even <baruch.even@writeme.com>
1168 * src/frontends/xforms/FormGraphics.h:
1169 * src/frontends/xforms/FormGraphics.C:
1170 * src/frontends/xforms/RadioButtonGroup.h:
1171 * src/frontends/xforms/RadioButtonGroup.C:
1172 * src/insets/insetgraphics.h:
1173 * src/insets/insetgraphics.C:
1174 * src/insets/insetgraphicsParams.h:
1175 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1176 instead of spaces, and various other indentation issues to make the
1177 sources more consistent.
1179 2000-08-14 Marko Vendelin <markov@ioc.ee>
1181 * src/frontends/gnome/dialogs/diaprint.glade
1182 * src/frontends/gnome/FormPrint.C
1183 * src/frontends/gnome/FormPrint.h
1184 * src/frontends/gnome/diaprint_callbacks.c
1185 * src/frontends/gnome/diaprint_callbacks.h
1186 * src/frontends/gnome/diaprint_interface.c
1187 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1190 * src/frontends/gnome/dialogs/diainserturl.glade
1191 * src/frontends/gnome/FormUrl.C
1192 * src/frontends/gnome/FormUrl.h
1193 * src/frontends/gnome/diainserturl_callbacks.c
1194 * src/frontends/gnome/diainserturl_callbacks.h
1195 * src/frontends/gnome/diainserturl_interface.c
1196 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1197 Gnome implementation
1199 * src/frontends/gnome/Dialogs.C
1200 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1201 all other dialogs. Copy all unimplemented dialogs from Xforms
1204 * src/frontends/gnome/support.c
1205 * src/frontends/gnome/support.h: support files generated by Glade
1209 * config/gnome.m4: Gnome configuration scripts
1211 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1212 configure --help message
1214 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1215 only if there are no events pendling in Gnome/Gtk. This enhances
1216 the performance of menus.
1219 2000-08-14 Allan Rae <rae@lyx.org>
1221 * lib/Makefile.am: listerrors cleaning
1223 * lib/listerrors: removed -- generated file
1224 * acinclude.m4: ditto
1225 * sigc++/acinclude.m4: ditto
1227 * src/frontends/xforms/forms/form_citation.fd:
1228 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1231 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1232 `updatesrc` and now we have a `test` target that does what `updatesrc`
1233 used to do. I didn't like having an install target that wasn't related
1236 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1237 on all except FormGraphics. This may yet happen. Followed by a major
1238 cleanup including using FL_TRANSIENT for most of the dialogs. More
1239 changes to come when the ButtonController below is introduced.
1241 * src/frontends/xforms/ButtonController.h: New file for managing up to
1242 four buttons on a dialog according to an externally defined policy.
1243 * src/frontends/xforms/Makefile.am: added above
1245 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1246 Apply and Cancel/Close buttons and everything in between and beyond.
1247 * src/frontends/Makefile.am: added above.
1249 * src/frontends/xforms/forms/form_preferences.fd:
1250 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1251 and removed variable 'status' as a result. Fixed the set_minsize thing.
1252 Use the new screen-font-update after checking screen fonts were changed
1253 Added a "Restore" button to restore the original lyxrc values while
1254 editing. This restores everything not just the last input changed.
1255 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1257 * src/LyXAction.C: screen-font-update added for updating buffers after
1258 screen font settings have been changed.
1259 * src/commandtags.h: ditto
1260 * src/lyxfunc.C: ditto
1262 * forms/lyx.fd: removed screen fonts dialog.
1263 * src/lyx_gui.C: ditto
1264 * src/menus.[Ch]: ditto
1265 * src/lyx.[Ch]: ditto
1266 * src/lyx_cb.C: ditto + code from here moved to make
1267 screen-font-update. And people wonder why progress on GUII is
1268 slow. Look at how scattered this stuff was! It takes forever
1271 * forms/fdfix.sh: Fixup the spacing after commas.
1272 * forms/makefile: Remove date from generated files. Fewer clashes now.
1273 * forms/bullet_forms.C.patch: included someones handwritten changes
1275 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1276 once I've discovered why LyXRC was made noncopyable.
1277 * src/lyx_main.C: ditto
1279 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1281 * src/frontends/xforms/forms/fdfix.sh:
1282 * src/frontends/xforms/forms/fdfixh.sed:
1283 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1284 * src/frontends/xforms/Form*.[hC]:
1285 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1286 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1287 provide a destructor for the struct FD_form_xxxx. Another version of
1288 the set_[max|min]size workaround and a few other cleanups. Actually,
1289 Angus' patch from 20000809.
1291 2000-08-13 Baruch Even <baruch.even@writeme.com>
1293 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1296 2000-08-11 Juergen Vigna <jug@sad.it>
1298 * src/insets/insetgraphics.C (InsetGraphics): changing init
1299 order because of warnings.
1301 * src/frontends/xforms/forms/makefile: adding patching .C with
1304 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1305 from .C.patch to .c.patch
1307 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1308 order because of warning.
1310 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1312 * src/frontends/Liason.C (setMinibuffer): new helper function
1314 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1316 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1318 * lib/ui/default.ui: commented out PaperLayout entry
1320 * src/frontends/xforms/form_document.[Ch]: new added files
1322 * src/frontends/xforms/FormDocument.[Ch]: ditto
1324 * src/frontends/xforms/forms/form_document.fd: ditto
1326 * src/frontends/xforms/forms/form_document.C.patch: ditto
1328 2000-08-10 Juergen Vigna <jug@sad.it>
1330 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1331 (InsetGraphics): initialized cacheHandle to 0.
1332 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1334 2000-08-10 Baruch Even <baruch.even@writeme.com>
1336 * src/graphics/GraphicsCache.h:
1337 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1338 correctly as a cache.
1340 * src/graphics/GraphicsCacheItem.h:
1341 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1344 * src/graphics/GraphicsCacheItem_pimpl.h:
1345 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1348 * src/insets/insetgraphics.h:
1349 * src/insets/insetgraphics.C: Changed from using a signal notification
1350 to polling when image is not loaded.
1352 2000-08-10 Allan Rae <rae@lyx.org>
1354 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1355 that there are two functions that have to been taken out of line by
1356 hand and aren't taken care of in the script. (Just a reminder note)
1358 * sigc++/macros/*.h.m4: Updated as above.
1360 2000-08-09 Juergen Vigna <jug@sad.it>
1362 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1364 * src/insets/insettabular.C: make drawing of single cell smarter.
1366 2000-08-09 Marko Vendelin <markov@ioc.ee>
1367 * src/frontends/gnome/Menubar_pimpl.C
1368 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1369 implementation: new files
1371 * src/frontends/gnome/mainapp.C
1372 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1375 * src/main.C: create Gnome main window
1377 * src/frontends/xforms/Menubar_pimpl.h
1378 * src/frontends/Menubar.C
1379 * src/frontends/Menubar.h: added method Menubar::update that calls
1380 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1382 * src/LyXView.C: calls Menubar::update to update the state
1385 * src/frontends/gnome/Makefile.am: added new files
1387 * src/frontends/Makefile.am: added frontend compiler options
1389 2000-08-08 Juergen Vigna <jug@sad.it>
1391 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1393 * src/bufferlist.C (close):
1394 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1395 documents if exiting without saving.
1397 * src/buffer.C (save): use removeAutosaveFile()
1399 * src/support/filetools.C (removeAutosaveFile): new function.
1401 * src/lyx_cb.C (MenuWrite): returns a bool now.
1402 (MenuWriteAs): check if file could really be saved and revert to the
1404 (MenuWriteAs): removing old autosavefile if existant.
1406 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1407 before Goto toggle declaration, because of compiler warning.
1409 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1411 * src/lyxfunc.C (MenuNew): small fix.
1413 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1415 * src/bufferlist.C (newFile):
1416 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1418 * src/lyxrc.C: added new_ask_filename tag
1420 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1422 * src/lyx.fd: removed code pertaining to form_ref
1423 * src/lyx.[Ch]: ditto
1424 * src/lyx_cb.C: ditto
1425 * src/lyx_gui.C: ditto
1426 * src/lyx_gui_misc.C: ditto
1428 * src/BufferView_pimpl.C (restorePosition): update buffer only
1431 * src/commandtags.h (LFUN_REFTOGGLE): removed
1432 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1433 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1434 (LFUN_REFBACK): renamed LFUN_REF_BACK
1436 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1437 * src/menus.C: ditto
1438 * src/lyxfunc.C (Dispatch): ditto.
1439 InsertRef dialog is now GUI-independent.
1441 * src/texrow.C: added using std::endl;
1443 * src/insets/insetref.[Ch]: strip out large amounts of code.
1444 The inset is now a container and this functionality is now
1445 managed by a new FormRef dialog
1447 * src/frontends/Dialogs.h (showRef, createRef): new signals
1449 * src/frontends/xforms/FormIndex.[Ch],
1450 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1451 when setting dialog's min/max size
1452 * src/frontends/xforms/FormIndex.[Ch]: ditto
1454 * src/frontends/xforms/FormRef.[Ch],
1455 src/frontends/xforms/forms/form_ref.fd: new xforms
1456 implementation of an InsetRef dialog
1458 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1461 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1462 ios::nocreate is not part of the standard. Removed.
1464 2000-08-07 Baruch Even <baruch.even@writeme.com>
1466 * src/graphics/Renderer.h:
1467 * src/graphics/Renderer.C: Added base class for rendering of different
1468 image formats into Pixmaps.
1470 * src/graphics/XPM_Renderer.h:
1471 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1472 in a different class.
1474 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1475 easily add support for other formats.
1477 * src/insets/figinset.C: plugged a leak of an X resource.
1479 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1481 * src/CutAndPaste.[Ch]: make all metods static.
1483 * development/Code_rules/Rules: more work, added section on
1484 Exceptions, and a References section.
1486 * a lot of header files: work to make doc++ able to generate the
1487 source documentation, some workarounds of doc++ problems. Doc++ is
1488 now able to generate the documentation.
1490 2000-08-07 Juergen Vigna <jug@sad.it>
1492 * src/insets/insettabular.C (recomputeTextInsets): removed function
1494 * src/tabular.C (SetWidthOfMulticolCell):
1496 (calculate_width_of_column_NMC): fixed return value so that it really
1497 only returns true if the column-width has changed (there where
1498 problems with muliticolumn-cells in this column).
1500 2000-08-04 Juergen Vigna <jug@sad.it>
1502 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1503 also on the scrollstatus of the inset.
1504 (workAreaMotionNotify): ditto.
1506 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1508 2000-08-01 Juergen Vigna <jug@sad.it>
1510 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1512 * src/commandtags.h:
1513 * src/LyXAction.C (init):
1514 * src/insets/inset.C (LocalDispatch): added support for
1517 * src/insets/inset.C (scroll): new functions.
1519 * src/insets/insettext.C (removeNewlines): new function.
1520 (SetAutoBreakRows): removes forced newlines in the text of the
1521 paragraph if autoBreakRows is set to false.
1523 * src/tabular.C (Latex): generates a parbox around the cell contents
1526 * src/frontends/xforms/FormTabular.C (local_update): removed
1527 the radio_useparbox button.
1529 * src/tabular.C (UseParbox): new function
1531 2000-08-06 Baruch Even <baruch.even@writeme.com>
1533 * src/graphics/GraphicsCache.h:
1534 * src/graphics/GraphicsCache.C:
1535 * src/graphics/GraphicsCacheItem.h:
1536 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1539 * src/insets/insetgraphics.h:
1540 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1541 drawing of the inline image.
1543 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1544 into the wrong position.
1546 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1549 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1551 * src/support/translator.h: move all typedefs to public section
1553 * src/support/filetools.C (MakeLatexName): return string const
1555 (TmpFileName): ditto
1556 (FileOpenSearch): ditto
1558 (LibFileSearch): ditto
1559 (i18nLibFileSearch): ditto
1562 (CreateTmpDir): ditto
1563 (CreateBufferTmpDir): ditto
1564 (CreateLyXTmpDir): ditto
1567 (MakeAbsPath): ditto
1569 (OnlyFilename): ditto
1571 (NormalizePath): ditto
1572 (CleanupPath): ditto
1573 (GetFileContents): ditto
1574 (ReplaceEnvironmentPath): ditto
1575 (MakeRelPath): ditto
1577 (ChangeExtension): ditto
1578 (MakeDisplayPath): ditto
1579 (do_popen): return cmdret const
1580 (findtexfile): return string const
1582 * src/support/DebugStream.h: add some /// to please doc++
1584 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1586 * src/texrow.C (same_rownumber): functor to use with find_if
1587 (getIdFromRow): rewritten to use find_if and to not update the
1588 positions. return true if row is found
1589 (increasePos): new method, use to update positions
1591 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1593 * src/lyxlex_pimpl.C (verifyTable): new method
1596 (GetString): return string const
1597 (pushTable): rewrite to use std::stack
1599 (setFile): better check
1602 * src/lyxlex.h: make LyXLex noncopyable
1604 * src/lyxlex.C (text): return char const * const
1605 (GetString): return string const
1606 (getLongString): return string const
1608 * src/lyx_gui_misc.C (askForText): return pair<...> const
1610 * src/lastfiles.[Ch] (operator): return string const
1612 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1613 istringstream not char const *.
1614 move token.end() out of loop.
1615 (readFile): move initializaton of token
1617 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1618 getIdFromRow is successful.
1620 * lib/bind/emacs.bind: don't include menus bind
1622 * development/Code_rules/Rules: the beginnings of making this
1623 better and covering more of the unwritten rules that we have.
1625 * development/Code_rules/Recommendations: a couple of wording
1628 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1630 * src/support/strerror.c: remove C++ comment.
1632 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1634 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1635 LFUN_INDEX_INSERT_LAST
1637 * src/texrow.C (getIdFromRow): changed from const_iterator to
1638 iterator, allowing code to compile with DEC cxx
1640 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1641 stores part of the class, as suggested by Allan. Will allow
1643 (apply): test to apply uses InsetCommandParams operator!=
1645 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1646 (apply): test to apply uses InsetCommandParams operator!=
1648 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1649 stores part of the class.
1650 (update): removed limits on min/max size.
1652 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1653 (apply): test to apply uses InsetCommandParams operator!=
1655 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1656 (Read, Write, scanCommand, getCommand): moved functionality
1657 into InsetCommandParams.
1659 (getScreenLabel): made pure virtual
1660 new InsetCommandParams operators== and !=
1662 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1663 c-tors based on InsetCommandParams. Removed others.
1664 * src/insets/insetinclude.[Ch]: ditto
1665 * src/insets/insetlabel.[Ch]: ditto
1666 * src/insets/insetparent.[Ch]: ditto
1667 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1669 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1670 insets derived from InsetCommand created using similar c-tors
1671 based on InsetCommandParams
1672 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1673 * src/menus.C (ShowRefsMenu): ditto
1674 * src/paragraph.C (Clone): ditto
1675 * src/text2.C (SetCounter): ditto
1676 * src/lyxfunc.C (Dispatch) ditto
1677 Also recreated old InsetIndex behaviour exactly. Can now
1678 index-insert at the start of a paragraph and index-insert-last
1679 without launching the pop-up.
1681 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1683 * lib/lyxrc.example: mark te pdf options as non functional.
1685 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1686 (isStrDbl): move tmpstr.end() out of loop.
1687 (strToDbl): move intialization of tmpstr
1688 (lowercase): return string const and move tmp.end() out of loop.
1689 (uppercase): return string const and move tmp.edn() out of loop.
1690 (prefixIs): add assertion
1695 (containsOnly): ditto
1696 (containsOnly): ditto
1697 (containsOnly): ditto
1698 (countChar): make last arg char not char const
1699 (token): return string const
1700 (subst): return string const, move tmp.end() out of loop.
1701 (subst): return string const, add assertion
1702 (strip): return string const
1703 (frontStrip): return string const, add assertion
1704 (frontStrip): return string const
1709 * src/support/lstrings.C: add inclde "LAssert.h"
1710 (isStrInt): move tmpstr.end() out of loop.
1712 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1713 toollist.end() out of loop.
1714 (deactivate): move toollist.end() out of loop.
1715 (update): move toollist.end() out of loop.
1716 (updateLayoutList): move tc.end() out of loop.
1717 (add): move toollist.end() out of loop.
1719 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1720 md.end() out of loop.
1722 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1724 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1727 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1728 (Erase): move insetlist.end() out of loop.
1730 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1731 ref to const string as first arg. Move initialization of some
1732 variables, whitespace changes.
1734 * src/kbmap.C (defkey): move table.end() out of loop.
1735 (kb_keymap): move table.end() out of loop.
1736 (findbinding): move table.end() out of loop.
1738 * src/MenuBackend.C (hasMenu): move end() out of loop.
1739 (getMenu): move end() out of loop.
1740 (getMenu): move menulist_.end() out of loop.
1742 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1744 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1747 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1748 (getFromLyXName): move infotab.end() out of loop.
1750 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1751 -fvtable-thunks -ffunction-sections -fdata-sections
1753 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1755 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1758 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1760 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1762 * src/frontends/xforms/FormCitation.[Ch],
1763 src/frontends/xforms/FormIndex.[Ch],
1764 src/frontends/xforms/FormToc.[Ch],
1765 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1767 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1769 * src/commandtags.h: renamed, created some flags for citation
1772 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1774 * src/lyxfunc.C (dispatch): use signals to insert index entry
1776 * src/frontends/Dialogs.h: new signal createIndex
1778 * src/frontends/xforms/FormCommand.[Ch],
1779 src/frontends/xforms/FormCitation.[Ch],
1780 src/frontends/xforms/FormToc.[Ch],
1781 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1783 * src/insets/insetindex.[Ch]: GUI-independent
1785 * src/frontends/xforms/FormIndex.[Ch],
1786 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1789 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1791 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1792 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1794 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1796 * src/insets/insetref.C (Latex): rewrite so that there is now
1797 question that a initialization is requested.
1799 * src/insets/insetcommand.h: reenable the hide signal
1801 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1803 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1804 fix handling of shortcuts (many bugs :)
1805 (add_lastfiles): ditto.
1807 * lib/ui/default.ui: fix a few shortcuts.
1809 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1811 * Makefile.am: Fix ``rpmdist'' target to return the exit
1812 status of the ``rpm'' command, instead of the last command in
1813 the chain (the ``rm lyx.xpm'' command, which always returns
1816 2000-08-02 Allan Rae <rae@lyx.org>
1818 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1819 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1820 * src/frontends/xforms/FormToc.C (FormToc): ditto
1822 * src/frontends/xforms/Makefile.am: A few forgotten files
1824 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1825 Signals-not-copyable-problem Lars' started commenting out.
1827 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1829 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1831 * src/insets/insetcommand.h: Signals is not copyable so anoter
1832 scheme for automatic hiding of forms must be used.
1834 * src/frontends/xforms/FormCitation.h: don't inerit from
1835 noncopyable, FormCommand already does that.
1836 * src/frontends/xforms/FormToc.h: ditto
1837 * src/frontends/xforms/FormUrl.h: ditto
1839 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1841 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1843 * src/insets/insetcommand.h (hide): new SigC::Signal0
1844 (d-tor) new virtual destructor emits hide signal
1846 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1847 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1849 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1850 LOF and LOT. Inset is now GUI-independent
1852 * src/insets/insetloa.[Ch]: redundant
1853 * src/insets/insetlof.[Ch]: ditto
1854 * src/insets/insetlot.[Ch]: ditto
1856 * src/frontends/xforms/forms/form_url.fd: tweaked!
1857 * src/frontends/xforms/forms/form_citation.fd: ditto
1859 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1860 dialogs dealing with InsetCommand insets
1862 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1863 FormCommand base class
1864 * src/frontends/xforms/FormUrl.[Ch]: ditto
1866 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1868 * src/frontends/xforms/FormToc.[Ch]: ditto
1870 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1871 passed a generic InsetCommand pointer
1872 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1874 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1875 and modified InsetTOC class
1876 * src/buffer.C: ditto
1878 * forms/lyx.fd: strip out old FD_form_toc code
1879 * src/lyx_gui_misc.C: ditto
1880 * src/lyx_gui.C: ditto
1881 * src/lyx_cb.C: ditto
1882 * src/lyx.[Ch]: ditto
1884 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1886 * src/support/utility.hpp: tr -d '\r'
1888 2000-08-01 Juergen Vigna <jug@sad.it>
1890 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1892 * src/commandtags.h:
1893 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1894 LFUN_TABULAR_FEATURES.
1896 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1897 LFUN_LAYOUT_TABULAR.
1899 * src/insets/insettabular.C (getStatus): implemented helper function.
1901 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1903 2000-07-31 Juergen Vigna <jug@sad.it>
1905 * src/text.C (draw): fixed screen update problem for text-insets.
1907 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1908 something changed probably this has to be added in various other
1911 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1913 2000-07-31 Baruch Even <baruch.even@writeme.com>
1915 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1916 templates to satisfy compaq cxx.
1919 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1921 * src/support/translator.h (equal_1st_in_pair::operator()): take
1922 const ref pair_type as arg.
1923 (equal_2nd_in_pair::operator()): ditto
1924 (Translator::~Translator): remove empty d-tor.
1926 * src/graphics/GraphicsCache.C: move include config.h to top, also
1927 put initialization of GraphicsCache::singleton here.
1928 (~GraphicsCache): move here
1929 (addFile): take const ref as arg
1932 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1934 * src/BufferView2.C (insertLyXFile): change te with/without header
1937 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1939 * src/frontends/xforms/FormGraphics.C (apply): add some
1940 static_cast. Not very nice, but required by compaq cxx.
1942 * src/frontends/xforms/RadioButtonGroup.h: include header
1943 <utility> instead of <pair.h>
1945 * src/insets/insetgraphicsParams.C: add using directive.
1946 (readResize): change return type to void.
1947 (readOrigin): ditto.
1949 * src/lyxfunc.C (getStatus): add missing break for build-program
1950 function; add test for Literate for export functions.
1952 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1953 entries in Options menu.
1955 2000-07-31 Baruch Even <baruch.even@writeme.com>
1957 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1958 protect against auto-allocation; release icon when needed.
1960 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1962 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1963 on usual typewriter.
1965 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1966 earlier czech.kmap), useful only for programming.
1968 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1970 * src/frontends/xforms/FormCitation.h: fix conditioning around
1973 2000-07-31 Juergen Vigna <jug@sad.it>
1975 * src/frontends/xforms/FormTabular.C (local_update): changed
1976 radio_linebreaks to radio_useparbox and added radio_useminipage.
1978 * src/tabular.C: made support for using minipages/parboxes.
1980 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1982 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1984 (descent): so the cursor is in the middle.
1985 (width): bit smaller box.
1987 * src/insets/insetgraphics.h: added display() function.
1989 2000-07-31 Baruch Even <baruch.even@writeme.com>
1991 * src/frontends/Dialogs.h: Added showGraphics signals.
1993 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1994 xforms form definition of the graphics dialog.
1996 * src/frontends/xforms/FormGraphics.h:
1997 * src/frontends/xforms/FormGraphics.C: Added files, the
1998 GUIndependent code of InsetGraphics
2000 * src/insets/insetgraphics.h:
2001 * src/insets/insetgraphics.C: Major writing to make it work.
2003 * src/insets/insetgraphicsParams.h:
2004 * src/insets/insetgraphicsParams.C: Added files, parameter passing
2005 struct between InsetGraphics and GUI.
2007 * src/LaTeXFeatures.h:
2008 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
2009 support for graphicx package.
2011 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
2012 for the graphics inset.
2014 * src/support/translator.h: Added file, used in
2015 InsetGraphicsParams. this is a template to translate between two
2018 * src/frontends/xforms/RadioButtonGroup.h:
2019 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2020 way to easily control a radio button group.
2022 2000-07-28 Juergen Vigna <jug@sad.it>
2024 * src/insets/insettabular.C (LocalDispatch):
2025 (TabularFeatures): added support for lyx-functions of tabular features.
2026 (cellstart): refixed this function after someone wrongly changed it.
2028 * src/commandtags.h:
2029 * src/LyXAction.C (init): added support for tabular-features
2031 2000-07-28 Allan Rae <rae@lyx.org>
2033 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2034 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2035 triggers the callback for input checking. As a result we sometimes get
2036 "LyX: This shouldn't happen..." printed to cerr.
2037 (input): Started using status variable since I only free() on
2038 destruction. Some input checking for paths and font sizes.
2040 * src/frontends/xforms/FormPreferences.h: Use status to control
2041 activation of Ok and Apply
2043 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2044 callback. Also resized to stop segfaults with 0.88. The problem is
2045 that xforms-0.88 requires the folder to be wide enough to fit all the
2046 tabs. If it isn't it causes all sorts of problems.
2048 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2050 * src/frontends/xforms/forms/README: Reflect reality.
2052 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2053 * src/frontends/xforms/forms/makefile: ditto.
2055 * src/commandtags.h: Get access to new Preferences dialog
2056 * src/LyXAction.C: ditto
2057 * src/lyxfunc.C: ditto
2058 * lib/ui/default.ui: ditto
2060 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2062 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2064 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2067 * src/frontends/xforms/form_url.[Ch]: added.
2069 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2071 * src/insets/insetbib.h: fixed bug in previous commit
2073 * src/frontends/xforms/FormUrl.h: ditto
2075 * src/frontends/xforms/FormPrint.h: ditto
2077 * src/frontends/xforms/FormPreferences.h: ditto
2079 * src/frontends/xforms/FormCopyright.h: ditto
2081 * src/frontends/xforms/FormCitation.C: ditto
2083 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2084 private copyconstructor and private default contructor
2086 * src/support/Makefile.am: add utility.hpp
2088 * src/support/utility.hpp: new file from boost
2090 * src/insets/insetbib.h: set owner in clone
2092 * src/frontends/xforms/FormCitation.C: added missing include
2095 * src/insets/form_url.[Ch]: removed
2097 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2099 * development/lyx.spec.in
2100 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2101 file/directory re-organization.
2103 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2105 * src/insets/insetcommand.[Ch]: moved the string data and
2106 associated manipulation methods into a new stand-alone class
2107 InsetCommandParams. This class has two additional methods
2108 getAsString() and setFromString() allowing the contents to be
2109 moved around as a single string.
2110 (addContents) method removed.
2111 (setContents) method no longer virtual.
2113 * src/buffer.C (readInset): made use of new InsetCitation,
2114 InsetUrl constructors based on InsetCommandParams.
2116 * src/commandtags.h: add LFUN_INSERT_URL
2118 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2119 independent InsetUrl and use InsetCommandParams to extract
2120 string info and create new Insets.
2122 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2124 * src/frontends/xforms/FormCitation.C (apply): uses
2127 * src/frontends/xforms/form_url.C
2128 * src/frontends/xforms/form_url.h
2129 * src/frontends/xforms/FormUrl.h
2130 * src/frontends/xforms/FormUrl.C
2131 * src/frontends/xforms/forms/form_url.fd: new files
2133 * src/insets/insetcite.[Ch]: removed unused constructors.
2135 * src/insets/insetinclude.[Ch]: no longer store filename
2137 * src/insets/inseturl.[Ch]: GUI-independent.
2139 2000-07-26 Juergen Vigna <jug@sad.it>
2140 * renamed frontend from gtk to gnome as it is that what is realized
2141 and did the necessary changes in the files.
2143 2000-07-26 Marko Vendelin <markov@ioc.ee>
2145 * configure.in: cleaning up gnome configuration scripts
2147 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2149 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2150 shortcuts syndrom by redrawing them explicitely (a better solution
2151 would be appreciated).
2153 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2155 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2158 * src/lyx_cb.C (MenuExport): change html export to do the right
2159 thing depending of the document type (instead of having
2160 html-linuxdoc and html-docbook).
2161 * src/lyxfunc.C (getStatus): update for html
2162 * lib/ui/default.ui: simplify due to the above change.
2163 * src/menus.C (ShowFileMenu): update too (in case we need it).
2165 * src/MenuBackend.C (read): if a menu is defined twice, add the
2166 new entries to the exiting one.
2168 2000-07-26 Juergen Vigna <jug@sad.it>
2170 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2172 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2173 and return a bool if it did actual save the file.
2174 (AutoSave): don't autosave a unnamed doc.
2176 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2177 check if this is an UNNAMED new file and react to it.
2178 (newFile): set buffer to unnamed and change to not mark a new
2179 buffer dirty if I didn't do anything with it.
2181 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2183 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2185 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2186 friend as per Angus's patch posted to lyx-devel.
2188 * src/ext_l10n.h: updated
2190 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2191 gettext on the style string right before inserting them into the
2194 * autogen.sh: add code to extract style strings form layout files,
2195 not good enough yet.
2197 * src/frontends/gtk/.cvsignore: add MAKEFILE
2199 * src/MenuBackend.C (read): run the label strings through gettext
2200 before storing them in the containers.
2202 * src/ext_l10n.h: new file
2204 * autogen.sh : generate the ext_l10n.h file here
2206 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2208 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2211 * lib/ui/default.ui: fix a couple of typos.
2213 * config/gnome/gtk.m4: added (and added to the list of files in
2216 * src/insets/insetinclude.C (unique_id): fix when we are using
2217 lyxstring instead of basic_string<>.
2218 * src/insets/insettext.C (LocalDispatch): ditto.
2219 * src/support/filetools.C: ditto.
2221 * lib/configure.m4: create the ui/ directory if necessary.
2223 * src/LyXView.[Ch] (updateToolbar): new method.
2225 * src/BufferView_pimpl.C (buffer): update the toolbar when
2226 opening/closing buffer.
2228 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2230 * src/LyXAction.C (getActionName): enhance to return also the name
2231 and options of pseudo-actions.
2232 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2234 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2235 as an example of what is possible). Used in File->Build too (more
2236 useful) and in the import/export menus (to mimick the complicated
2237 handling of linuxdoc and friends). Try to update all the entries.
2239 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2242 * src/MenuBackend.C (read): Parse the new OptItem tag.
2244 * src/MenuBackend.h: Add a new optional_ data member (used if the
2245 entry should be omitted when the lyxfunc is disabled).
2247 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2248 function, used as a shortcut.
2249 (create_submenu): align correctly the shortcuts on the widest
2252 * src/MenuBackend.h: MenuItem.label() only returns the label of
2253 the menu without shortcut; new method shortcut().
2255 2000-07-14 Marko Vendelin <markov@ioc.ee>
2257 * src/frontends/gtk/Dialogs.C:
2258 * src/frontends/gtk/FormCopyright.C:
2259 * src/frontends/gtk/FormCopyright.h:
2260 * src/frontends/gtk/Makefile.am: added these source-files for the
2261 Gtk/Gnome support of the Copyright-Dialog.
2263 * src/main.C: added Gnome::Main initialization if using
2264 Gtk/Gnome frontend-GUI.
2266 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2268 * config/gnome/aclocal-include.m4
2269 * config/gnome/compiler-flags.m4
2270 * config/gnome/curses.m4
2271 * config/gnome/gnome--.m4
2272 * config/gnome/gnome-bonobo-check.m4
2273 * config/gnome/gnome-common.m4
2274 * config/gnome/gnome-fileutils.m4
2275 * config/gnome/gnome-ghttp-check.m4
2276 * config/gnome/gnome-gnorba-check.m4
2277 * config/gnome/gnome-guile-checks.m4
2278 * config/gnome/gnome-libgtop-check.m4
2279 * config/gnome/gnome-objc-checks.m4
2280 * config/gnome/gnome-orbit-check.m4
2281 * config/gnome/gnome-print-check.m4
2282 * config/gnome/gnome-pthread-check.m4
2283 * config/gnome/gnome-support.m4
2284 * config/gnome/gnome-undelfs.m4
2285 * config/gnome/gnome-vfs.m4
2286 * config/gnome/gnome-x-checks.m4
2287 * config/gnome/gnome-xml-check.m4
2288 * config/gnome/gnome.m4
2289 * config/gnome/gperf-check.m4
2290 * config/gnome/gtk--.m4
2291 * config/gnome/linger.m4
2292 * config/gnome/need-declaration.m4: added configuration scripts
2293 for Gtk/Gnome frontend-GUI
2295 * configure.in: added support for the --with-frontend=gtk option
2297 * autogen.sh: added config/gnome/* to list of config-files
2299 * acconfig.h: added define for GTKGUI-support
2301 * config/lyxinclude.m4: added --with-frontend[=value] option value
2302 for Gtk/Gnome frontend-GUI support.
2304 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2306 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2310 * src/paragraph.C (GetChar): remove non-const version
2312 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2313 (search_kw): use it.
2315 * src/lyx_main.C (init): if "preferences" exist, read that instead
2317 (ReadRcFile): return bool if the file could be read ok.
2318 (ReadUIFile): add a check to see if lex file is set ok.
2320 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2321 bastring can be used instead of lyxstring (still uses the old code
2322 if std::string is good enough or if lyxstring is used.)
2324 * src/encoding.C: make the arrays static, move ininle functions
2326 * src/encoding.h: from here.
2328 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2329 (parseSingleLyXformat2Token): move inset parsing to separate method
2330 (readInset): new private method
2332 * src/Variables.h: remove virtual from get().
2334 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2335 access to NEW_INSETS and NEW_TABULAR
2337 * src/MenuBackend.h: remove superfluous forward declaration of
2338 MenuItem. Add documentations tags "///", remove empty MenuItem
2339 destructor, remove private default contructor.
2341 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2343 (read): more string mlabel and mname to where they are used
2344 (read): remove unused variables mlabel and mname
2345 (defaults): unconditional clear, make menusetup take advantage of
2346 add returning Menu &.
2348 * src/LyXView.h: define NEW_MENUBAR as default
2350 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2351 to NEW_INSETS and NEW_TABULAR.
2352 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2353 defined. Change some of the "xxxx-inset-insert" functions names to
2356 * several files: more enahncements to NEW_INSETS and the resulting
2359 * lib/lyxrc.example (\date_insert_format): move to misc section
2361 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2362 bastring and use AC_CACHE_CHECK.
2363 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2364 the system have the newest methods. uses AC_CACHE_CHECK
2365 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2366 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2367 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2369 * configure.in: add LYX_CXX_GOOD_STD_STRING
2371 * acinclude.m4: recreated
2373 2000-07-24 Amir Karger
2375 * README: add Hebrew, Arabic kmaps
2378 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2380 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2383 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2385 * Lot of files: add pragma interface/implementation.
2387 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2389 * lib/ui/default.ui: new file (ans new directory). Contains the
2390 default menu and toolbar.
2392 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2393 global space. Toolbars are now read (as menus) in ui files.
2395 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2397 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2398 is disabled because the document is read-only. We want to have the
2399 toggle state of the function anyway.
2400 (getStatus): add code for LFUN_VC* functions (mimicking what is
2401 done in old-style menus)
2403 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2404 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2406 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2407 * src/BufferView_pimpl.C: ditto.
2408 * src/lyxfunc.C: ditto.
2410 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2411 default). This replaces old-style menus by new ones.
2413 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2414 MenuItem. Contain the data structure of a menu.
2416 * src/insets/insettext.C: use LyXView::setLayout instead of
2417 accessing directly the toolbar combox.
2418 * src/lyxfunc.C (Dispatch): ditto.
2420 * src/LyXView.C (setLayout): new method, which just calls
2421 Toolbar::setLayout().
2422 (updateLayoutChoice): move part of this method in Toolbar.
2424 * src/toolbar.[Ch]: removed.
2426 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2427 implementation the toolbar.
2429 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2430 the toolbar. It might make sense to merge it with ToolbarDefaults
2432 (setLayout): new function.
2433 (updateLayoutList): ditto.
2434 (openLayoutList): ditto.
2436 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2437 xforms implementation of the toolbar.
2438 (get_toolbar_func): comment out, since I do not
2439 know what it is good for.
2441 * src/ToolbarDefaults.h: Add the ItemType enum.
2443 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2444 for a list of allocated C strings. Used in Menubar xforms
2445 implementation to avoid memory leaks.
2447 * src/support/lstrings.[Ch] (uppercase): new version taking and
2451 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2452 * lib/bind/emacs.bind: ditto.
2454 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2456 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2457 forward decl of LyXView.
2459 * src/toolbar.C (toolbarItem): moved from toolbar.h
2460 (toolbarItem::clean): ditto
2461 (toolbarItem::~toolbarItem): ditto
2462 (toolbarItem::operator): ditto
2464 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2466 * src/paragraph.h: control the NEW_TABULAR define from here
2468 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2469 USE_TABULAR_INSETS to NEW_TABULAR
2471 * src/ToolbarDefaults.C: add include "lyxlex.h"
2473 * files using the old table/tabular: use NEW_TABULAR to control
2474 compilation of old tabular stuff.
2476 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2479 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2480 planemet in reading of old style floats, fix the \end_deeper
2481 problem when reading old style floats.
2483 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2485 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2487 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2489 * lib/bind/sciword.bind: updated.
2491 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2493 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2494 layout write problem
2496 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2498 * src/Makefile.am (INCLUDES): remove image directory from include
2501 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2502 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2504 * src/LyXView.C (create_form_form_main): read the application icon
2507 * lib/images/*.xpm: change the icons to use transparent color for
2510 * src/toolbar.C (update): change the color of the button when it
2513 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2515 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2516 setting explicitely the minibuffer.
2517 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2519 * src/LyXView.C (showState): new function. Shows font information
2520 in minibuffer and update toolbar state.
2521 (LyXView): call Toolbar::update after creating the
2524 * src/toolbar.C: change toollist to be a vector instead of a
2526 (BubbleTimerCB): get help string directly from the callback
2527 argument of the corresponding icon (which is the action)
2528 (set): remove unnecessary ugliness.
2529 (update): new function. update the icons (depressed, disabled)
2530 depending of the status of the corresponding action.
2532 * src/toolbar.h: remove help in toolbarItem
2534 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2536 * src/Painter.C (text): Added code for using symbol glyphs from
2537 iso10646 fonts. Currently diabled.
2539 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2542 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2543 magyar,turkish and usorbian.
2545 * src/paragraph.C (isMultiLingual): Made more efficient.
2547 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2550 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2551 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2552 Also changed the prototype to "bool math_insert_greek(char)".
2554 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2556 * lots of files: apply the NEW_INSETS on all code that will not be
2557 needed when we move to use the new insets. Enable the define in
2558 lyxparagrah.h to try it.
2560 * src/insets/insettabular.C (cellstart): change to be a static
2562 (InsetTabular): initialize buffer in the initializer list.
2564 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2566 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2567 form_print.h out of the header file. Replaced with forward
2568 declarations of the relevant struct.
2570 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2573 * src/commandtags.h: do not include "debug.h" which does not
2574 belong there. #include it in some other places because of this
2577 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2579 * src/insets/insetcaption.C: add a couple "using" directives.
2581 * src/toolbar.C (add): get the help text directly from lyxaction.
2583 (setPixmap): new function. Loads from disk and sets a pixmap on a
2584 botton; the name of the pixmap file is derived from the command
2587 * src/toolbar.h: remove members isBitmap and pixmap from
2590 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2591 * lib/images/: move many files from images/banner.xpm.
2593 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2595 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2596 * src/toolbar.C: ditto.
2597 * configure.in: ditto.
2598 * INSTALL: document.
2600 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2601 the spellchecker popup is closed from the WM.
2603 2000-07-19 Juergen Vigna <jug@sad.it>
2605 * src/insets/insetfloat.C (Write): small fix because we use the
2606 insetname for the type now!
2608 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2610 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2613 * src/frontends/Dialogs.h: removed hideCitation signal
2615 * src/insets/insetcite.h: added hide signal
2617 * src/insets/insetcite.C (~InsetCitation): emits new signal
2618 (getScreenLabel): "intelligent" label should now fit on the screen!
2620 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2622 * src/frontends/xforms/FormCitation.C (showInset): connects
2623 hide() to the inset's hide signal
2624 (show): modified to use fl_set_object_position rather than
2625 fl_set_object_geometry wherever possible
2627 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2629 * src/insets/lyxinset.h: add caption code
2631 * src/insets/insetfloat.C (type): new method
2633 * src/insets/insetcaption.C (Write): new method
2635 (LyxCode): new method
2637 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2638 to get it right together with using the FloatList.
2640 * src/commandtags.h: add LFUN_INSET_CAPTION
2641 * src/lyxfunc.C (Dispatch): handle it
2643 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2646 * src/Variables.[Ch]: make expand take a const reference, remove
2647 the destructor, some whitespace changes.
2649 * src/LyXAction.C (init): add caption-inset-insert
2651 * src/FloatList.C (FloatList): update the default floats a bit.
2653 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2655 * src/Variables.[Ch]: new files. Intended to be used for language
2656 specific strings (like \chaptername) and filename substitution in
2659 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2661 * lib/kbd/american.kmap: update
2663 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2665 * src/bufferparams.[Ch]: remove member allowAccents.
2667 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2669 * src/LaTeXLog.C: use the log_form.h header.
2670 * src/lyx_gui.C: ditto.
2671 * src/lyx_gui_misc.C: ditto.
2672 * src/lyxvc.h: ditto.
2674 * forms/log_form.fd: new file, created from latexoptions.fd. I
2675 kept the log popup and nuked the options form.
2677 * src/{la,}texoptions.[Ch]: removed.
2678 * src/lyx_cb.C (LaTeXOptions): ditto
2680 * src/lyx_gui.C (create_forms): do not handle the
2681 fd_latex_options form.
2683 2000-07-18 Juergen Vigna <jug@sad.it>
2685 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2686 name of the inset so that it can be requested outside (text2.C).
2688 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2691 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2693 * src/mathed/formula.h (ConvertFont): constify
2695 * src/mathed/formula.C (Read): add warning if \end_inset is not
2696 found on expected place.
2698 * src/insets/lyxinset.h (ConvertFont): consify
2700 * src/insets/insetquotes.C (ConvertFont): constify
2701 * src/insets/insetquotes.h: ditto
2703 * src/insets/insetinfo.h: add labelfont
2705 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2706 (ascent): use labelfont
2710 (Write): make .lyx file a bit nicer
2712 * src/insets/insetfloat.C (Write): simplify somewhat...
2713 (Read): add warning if arg is not found
2715 * src/insets/insetcollapsable.C: add using std::max
2716 (Read): move string token and add warning in arg is not found
2717 (draw): use std::max to get the right ty
2718 (getMaxWidth): simplify by using std::max
2720 * src/insets/insetsection.h: new file
2721 * src/insets/insetsection.C: new file
2722 * src/insets/insetcaption.h: new file
2723 * src/insets/insetcaption.C: new file
2725 * src/insets/inset.C (ConvertFont): constify signature
2727 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2728 insetcaption.[Ch] and insetsection.[Ch]
2730 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2731 uses to use LABEL_COUNTER_CHAPTER instead.
2732 * src/text2.C (SetCounter): here
2734 * src/counters.h: new file
2735 * src/counters.C: new file
2736 * src/Sectioning.h: new file
2737 * src/Sectioning.C: new file
2739 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2741 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2743 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2746 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2749 2000-07-17 Juergen Vigna <jug@sad.it>
2751 * src/tabular.C (Validate): check if array-package is needed.
2752 (SetVAlignment): added support for vertical alignment.
2753 (SetLTFoot): better support for longtable header/footers
2754 (Latex): modified to support added features.
2756 * src/LaTeXFeatures.[Ch]: added array-package.
2758 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2760 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2763 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2765 * configure.in: do not forget to put a space after -isystem.
2767 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2769 * lib/kbd/arabic.kmap: a few fixes.
2771 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2773 * some whitespace chagnes to a number of files.
2775 * src/support/DebugStream.h: change to make it easier for
2776 doc++ to parse correctly.
2777 * src/support/lyxstring.h: ditto
2779 * src/mathed/math_utils.C (compara): change to have only one
2781 (MathedLookupBOP): change because of the above.
2783 * src/mathed/math_delim.C (math_deco_compare): change to have only
2785 (search_deco): change becasue of the above.
2787 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2788 instead of manually coded one.
2790 * src/insets/insetquotes.C (Read): read the \end_inset too
2792 * src/insets/insetlatex.h: remove file
2793 * src/insets/insetlatex.C: remove file
2795 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2797 (InsetPrintIndex): remove destructor
2799 * src/insets/insetinclude.h: remove default constructor
2801 * src/insets/insetfloat.C: work to make it work better
2803 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2805 * src/insets/insetcite.h (InsetCitation): remove default constructor
2807 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2809 * src/text.C (GetColumnNearX): comment out some currently unused code.
2811 * src/paragraph.C (writeFile): move some initializations closer to
2813 (CutIntoMinibuffer): small change to use new matchIT operator
2817 (InsertInset): ditto
2820 (InsetIterator): ditto
2821 (Erase): small change to use new matchFT operator
2823 (GetFontSettings): ditto
2824 (HighestFontInRange): ditto
2827 * src/lyxparagraph.h: some chars changed to value_type
2828 (matchIT): because of some stronger checking (perhaps too strong)
2829 in SGI STL, the two operator() unified to one.
2832 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2834 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2835 the last inset read added
2836 (parseSingleLyXformat2Token): some more (future) compability code added
2837 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2838 (parseSingleLyXformat2Token): set last_inset_read
2839 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2840 (parseSingleLyXformat2Token): don't double intializw string next_token
2842 * src/TextCache.C (text_fits::operator()): add const's to the signature
2843 (has_buffer::operator()): ditto
2845 * src/Floating.h: add some comments on the class
2847 * src/FloatList.[Ch] (typeExist): new method
2850 * src/BackStack.h: added default constructor, wanted by Gcc.
2852 2000-07-14 Juergen Vigna <jug@sad.it>
2854 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2856 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2858 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2859 do a redraw when the window is resized!
2860 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2862 * src/insets/insettext.C (resizeLyXText): added function to correctly
2863 being able to resize the LyXWindow.
2865 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2867 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2869 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2870 crashes when closing dialog to a deleted inset.
2872 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2873 method! Now similar to other insets.
2875 2000-07-13 Juergen Vigna <jug@sad.it>
2877 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2879 * lib/examples/Literate.lyx: small patch!
2881 * src/insets/insetbib.C (Read): added this function because of wrong
2882 Write (without [begin|end]_inset).
2884 2000-07-11 Juergen Vigna <jug@sad.it>
2886 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2887 as the insertInset could not be good!
2889 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2890 the bool param should not be last.
2892 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2894 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2895 did submit that to Karl).
2897 * configure.in: use -isystem instead of -I for X headers. This
2898 fixes a problem on solaris with a recent gcc;
2899 put the front-end code after the X detection code;
2900 configure in sigc++ before lib/
2902 * src/lyx_main.C (commandLineHelp): remove -display from command
2905 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2907 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2908 Also put in Makefile rules for building the ``listerrors''
2909 program for parsing errors from literate programs written in LyX.
2911 * lib/build-listerrors: Added small shell script as part of compile
2912 process. This builds a working ``listerrors'' binary if noweb is
2913 installed and either 1) the VNC X server is installed on the machine,
2914 or 2) the user is compiling from within a GUI. The existence of a GUI
2915 is necessary to use the ``lyx --export'' feature for now. This
2916 hack can be removed once ``lyx --export'' no longer requires a GUI to
2919 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2921 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2922 now passed back correctly from gcc and placed "under" error
2923 buttons in a Literate LyX source.
2925 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2927 * src/text.C (GetColumnNearX): Better behavior when a RTL
2928 paragraph is ended by LTR text.
2930 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2933 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2935 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2936 true when clipboard is empty.
2938 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2940 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2941 row of the paragraph.
2942 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2943 to prevent calculation of bidi tables
2945 2000-07-07 Juergen Vigna <jug@sad.it>
2947 * src/screen.C (ToggleSelection): added y_offset and x_offset
2950 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2953 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2955 * src/insets/insettext.C: fixed Layout-Display!
2957 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2959 * configure.in: add check for strings.h header.
2961 * src/spellchecker.C: include <strings.h> in order to have a
2962 definition for bzero().
2964 2000-07-07 Juergen Vigna <jug@sad.it>
2966 * src/insets/insettext.C (draw): set the status of the bv->text to
2967 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2969 * src/screen.C (DrawOneRow):
2970 (DrawFromTo): redraw the actual row if something has changed in it
2973 * src/text.C (draw): call an update of the toplevel-inset if something
2974 has changed inside while drawing.
2976 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2978 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2980 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2981 processing inside class.
2983 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2984 processing inside class.
2986 * src/insets/insetindex.h new struct Holder, consistent with other
2989 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2990 citation dialog from main code and placed it in src/frontends/xforms.
2991 Dialog launched through signals instead of callbacks
2993 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2995 * lyx.man: update the options description.
2997 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2999 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
3000 handle neg values, set min width to 590, add doc about -display
3002 2000-07-05 Juergen Vigna <jug@sad.it>
3004 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
3005 calls to BufferView *.
3007 * src/insets/insettext.C (checkAndActivateInset): small fix non
3008 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
3010 * src/insets/insetcommand.C (Read): Fixed as insets should read till
3011 their \end_inset token!
3013 2000-07-04 edscott <edscott@imp.mx>
3015 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3016 lib/lyxrc.example: added option \wheel_jump
3018 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3020 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3021 remove support for -width,-height,-xpos and -ypos.
3023 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3025 * src/encoding.[Ch]: New files.
3027 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3028 (text): Call to the underline() method only when needed.
3030 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3032 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3033 encoding(s) for the document.
3035 * src/bufferparams.C (BufferParams): Changed default value of
3038 * src/language.C (newLang): Removed.
3039 (items[]): Added encoding information for all defined languages.
3041 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3042 encoding choice button.
3044 * src/lyxrc.h (font_norm_type): New member variable.
3045 (set_font_norm_type): New method.
3047 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3048 paragraphs with different encodings.
3050 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3051 (TransformChar): Changed to work correctly with Arabic points.
3052 (draw): Added support for drawing Arabic points.
3053 (draw): Removed code for drawing underbars (this is done by
3056 * src/support/textutils.h (IsPrintableNonspace): New function.
3058 * src/BufferView_pimpl.h: Added "using SigC::Object".
3059 * src/LyXView.h: ditto.
3061 * src/insets/insetinclude.h (include_label): Changed to mutable.
3063 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3065 * src/mathed/math_iter.h: remove empty destructor
3067 * src/mathed/math_cursor.h: remove empty destructor
3069 * src/insets/lyxinset.h: add THEOREM_CODE
3071 * src/insets/insettheorem.[Ch]: new files
3073 * src/insets/insetminipage.C: (InsertInset): remove
3075 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3077 (InsertInset): remove
3079 * src/insets/insetlist.C: (InsertList): remove
3081 * src/insets/insetfootlike.[Ch]: new files
3083 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3086 (InsertInset): ditto
3088 * src/insets/insetert.C: remove include Painter.h, reindent
3089 (InsertInset): move to header
3091 * src/insets/insetcollapsable.h: remove explicit from default
3092 contructor, remove empty destructor, add InsertInset
3094 * src/insets/insetcollapsable.C (InsertInset): new func
3096 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3098 * src/vspace.h: add explicit to constructor
3100 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3101 \textcompwordmark, please test this.
3103 * src/lyxrc.C: set ascii_linelen to 65 by default
3105 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3107 * src/commandtags.h: add LFUN_INSET_THEOREM
3109 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3110 (makeLinuxDocFile): remove _some_ of the nice logic
3111 (makeDocBookFile): ditto
3113 * src/Painter.[Ch]: (~Painter): removed
3115 * src/LyXAction.C (init): entry for insettheorem added
3117 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3119 (deplog): code to detect files generated by LaTeX, needs testing
3122 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3124 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3126 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3128 * src/LaTeX.C (deplog): Add a check for files that are going to be
3129 created by the first latex run, part of the project to remove the
3132 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3133 contents to the extension list.
3135 2000-07-04 Juergen Vigna <jug@sad.it>
3137 * src/text.C (NextBreakPoint): added support for needFullRow()
3139 * src/insets/lyxinset.h: added needFullRow()
3141 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3144 * src/insets/insettext.C: lots of changes for update!
3146 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3148 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3150 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3152 * src/insets/insetinclude.C (InsetInclude): fixed
3153 initialization of include_label.
3154 (unique_id): now returns a string.
3156 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3158 * src/LaTeXFeatures.h: new member IncludedFiles, for
3159 a map of key, included file name.
3161 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3162 with the included files for inclusion in SGML preamble,
3163 i. e., linuxdoc and docbook.
3166 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3167 nice (is the generated linuxdoc code to be exported?), that
3168 allows to remove column, and only_body that will be true for
3169 slave documents. Insets are allowed inside SGML font type.
3170 New handling of the SGML preamble for included files.
3171 (makeDocBookFile): the same for docbook.
3173 * src/insets/insetinclude.h:
3174 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3176 (DocBook): new export methods.
3178 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3179 and makeDocBookFile.
3181 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3182 formats to export with command line argument -x.
3184 2000-06-29 Juergen Vigna <jug@sad.it>
3186 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3187 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3189 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3190 region could already been cleared by an inset!
3192 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3194 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3197 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3199 (cursorToggle): remove special handling of lyx focus.
3201 2000-06-28 Juergen Vigna <jug@sad.it>
3203 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3206 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3208 * src/insets/insetindex.C (Edit): add a callback when popup is
3211 * src/insets/insettext.C (LocalDispatch):
3212 * src/insets/insetmarginal.h:
3213 * src/insets/insetlist.h:
3214 * src/insets/insetfoot.h:
3215 * src/insets/insetfloat.h:
3216 * src/insets/insetert.h: add a missing std:: qualifier.
3218 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3220 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3223 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3225 * src/insets/insettext.C (Read): remove tmptok unused variable
3226 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3227 (InsertInset): change for new InsetInset code
3229 * src/insets/insettext.h: add TEXT inline method
3231 * src/insets/insettext.C: remove TEXT macro
3233 * src/insets/insetmarginal.C (Write): new method
3234 (Latex): change output slightly
3236 * src/insets/insetfoot.C (Write): new method
3237 (Latex): change output slightly (don't use endl when no need)
3239 * src/insets/insetert.C (Write): new method
3241 * src/insets/insetcollapsable.h: make button_length, button_top_y
3242 and button_bottm_y protected.
3244 * src/insets/insetcollapsable.C (Write): simplify code by using
3245 tostr. Also do not output the float name, the children class
3246 should to that to get control over own arguments
3248 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3249 src/insets/insetminipage.[Ch]:
3252 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3254 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3256 * src/Makefile.am (lyx_SOURCES): add the new files
3258 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3259 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3260 * src/commandtags.h: ditto
3262 * src/LaTeXFeatures.h: add a std::set of used floattypes
3264 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3266 * src/FloatList.[Ch] src/Floating.h: new files
3268 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3270 * src/lyx_cb.C (TableApplyCB): ditto
3272 * src/text2.C: ditto
3273 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3274 (parseSingleLyXformat2Token): ditto + add code for
3275 backwards compability for old float styles + add code for new insets
3277 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3279 (InsertInset(size_type, Inset *, LyXFont)): new method
3280 (InsetChar(size_type, char)): changed to use the other InsetChar
3281 with a LyXFont(ALL_INHERIT).
3282 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3283 insert the META_INSET.
3285 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3287 * sigc++/thread.h (Threads): from here
3289 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3290 definition out of line
3291 * sigc++/scope.h: from here
3293 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3295 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3296 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3298 * Makefile.am (bindist): new target.
3300 * INSTALL: add instructions for doing a binary distribution.
3302 * development/tools/README.bin.example: update a bit.
3304 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3307 * lib/lyxrc.example: new lyxrc tag \set_color.
3309 * src/lyxfunc.C (Dispatch):
3310 * src/commandtags.h:
3311 * src/LyXAction.C: new lyxfunc "set-color".
3313 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3314 and an x11name given as strings.
3316 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3317 cache when a color is changed.
3319 2000-06-26 Juergen Vigna <jug@sad.it>
3321 * src/lyxrow.C (width): added this functions and variable.
3323 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3326 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3328 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3330 * images/undo_bw.xpm: new icon.
3331 * images/redo_bw.xpm: ditto.
3333 * configure.in (INSTALL_SCRIPT): change value to
3334 ${INSTALL} to avoid failures of install-script target.
3335 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3337 * src/BufferView.h: add a magic "friend" declaration to please
3340 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3342 * forms/cite.fd: modified to allow resizing without messing
3345 * src/insetcite.C: Uses code from cite.fd almost without
3347 User can now resize dialog in the x-direction.
3348 Resizing the dialog in the y-direction is prevented, as the
3349 code does this intelligently already.
3351 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3353 * INSTALL: remove obsolete entry in "problems" section.
3355 * lib/examples/sl_*.lyx: update of the slovenian examples.
3357 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3359 2000-06-23 Juergen Vigna <jug@sad.it>
3361 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3363 * src/buffer.C (resize): delete the LyXText of textinsets.
3365 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3367 * src/insets/lyxinset.h: added another parameter 'cleared' to
3368 the draw() function.
3370 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3371 unlocking inset in inset.
3373 2000-06-22 Juergen Vigna <jug@sad.it>
3375 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3376 of insets and moved first to LyXText.
3378 * src/mathed/formulamacro.[Ch]:
3379 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3381 2000-06-21 Juergen Vigna <jug@sad.it>
3383 * src/text.C (GetVisibleRow): look if I should clear the area or not
3384 using Inset::doClearArea() function.
3386 * src/insets/lyxinset.h: added doClearArea() function and
3387 modified draw(Painter &, ...) to draw(BufferView *, ...)
3389 * src/text2.C (UpdateInset): return bool insted of int
3391 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3393 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3394 combox in the character popup
3396 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3397 BufferParams const & params
3399 2000-06-20 Juergen Vigna <jug@sad.it>
3401 * src/insets/insettext.C (SetParagraphData): set insetowner on
3404 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3406 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3407 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3409 (form_main_): remove
3411 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3412 (create_form_form_main): remove FD_form_main stuff, connect to
3413 autosave_timeout signal
3415 * src/LyXView.[Ch] (getMainForm): remove
3416 (UpdateTimerCB): remove
3417 * src/BufferView_pimpl.h: inherit from SigC::Object
3419 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3420 signal instead of callback
3422 * src/BufferView.[Ch] (cursorToggleCB): remove
3424 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3426 * src/BufferView_pimpl.C: changes because of the one below
3428 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3429 instead of storing a pointer to a LyXText.
3431 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3433 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3435 * src/lyxparagraph.h
3437 * src/paragraph.C: Changed fontlist to a sorted vector.
3439 2000-06-19 Juergen Vigna <jug@sad.it>
3441 * src/BufferView.h: added screen() function.
3443 * src/insets/insettext.C (LocalDispatch): some selection code
3446 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3448 * src/insets/insettext.C (SetParagraphData):
3450 (InsetText): fixes for multiple paragraphs.
3452 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3454 * development/lyx.spec.in: Call configure with ``--without-warnings''
3455 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3456 This should be fine, however, since we generally don't want to be
3457 verbose when making an RPM.
3459 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3461 * lib/scripts/fig2pstex.py: New file
3463 2000-06-16 Juergen Vigna <jug@sad.it>
3465 * src/insets/insettabular.C (UpdateLocal):
3466 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3467 (LocalDispatch): Changed all functions to use LyXText.
3469 2000-06-15 Juergen Vigna <jug@sad.it>
3471 * src/text.C (SetHeightOfRow): call inset::update before requesting
3474 * src/insets/insettext.C (update):
3475 * src/insets/insettabular.C (update): added implementation
3477 * src/insets/lyxinset.h: added update function
3479 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3481 * src/text.C (SelectNextWord): protect against null pointers with
3482 old-style string streams. (fix from Paul Theo Gonciari
3485 * src/cite.[Ch]: remove erroneous files.
3487 * lib/configure.m4: update the list of created directories.
3489 * src/lyxrow.C: include <config.h>
3490 * src/lyxcursor.C: ditto.
3492 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3494 * lib/examples/decimal.lyx: new example file from Mike.
3496 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3497 to find template definitions (from Dekel)
3499 * src/frontends/.cvsignore: add a few things.
3501 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3503 * src/Timeout.C (TimeOut): remove default argument.
3505 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3508 * src/insets/ExternalTemplate.C: add a "using" directive.
3510 * src/lyx_main.h: remove the act_ struct, which seems unused
3513 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3515 * LyX Developers Meeting: All files changed, due to random C++ (by
3516 coincidence) code generator script.
3518 - external inset (cool!)
3519 - initial online editing of preferences
3520 - insettabular breaks insettext(s contents)
3522 - some DocBook fixes
3523 - example files update
3524 - other cool stuff, create a diff and look for yourself.
3526 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3528 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3529 -1 this is a non-line-breaking textinset.
3531 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3532 if there is no width set.
3534 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3536 * Lots of files: Merged the dialogbase branch.
3538 2000-06-09 Allan Rae <rae@lyx.org>
3540 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3541 and the Dispatch methods that used it.
3543 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3544 access to functions formerly kept in Dispatch.
3546 2000-05-19 Allan Rae <rae@lyx.org>
3548 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3549 made to_page and count_copies integers again. from_page remains a
3550 string however because I want to allow entry of a print range like
3551 "1,4,22-25" using this field.
3553 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3554 and printer-params-get. These aren't useful from the minibuffer but
3555 could be used by a script/LyXServer app provided it passes a suitable
3556 auto_mem_buffer. I guess I should take a look at how the LyXServer
3557 works and make it support xtl buffers.
3559 * sigc++/: updated to libsigc++-1.0.1
3561 * src/xtl/: updated to xtl-1.3.pl.11
3563 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3564 those changes done to the files in src/ are actually recreated when
3565 they get regenerated. Please don't ever accept a patch that changes a
3566 dialog unless that patch includes the changes to the corresponding *.fd
3569 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3570 stringOnlyContains, renamed it and generalised it.
3572 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3573 branch. Removed the remaining old form_print code.
3575 2000-04-26 Allan Rae <rae@lyx.org>
3577 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3578 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3580 2000-04-25 Allan Rae <rae@lyx.org>
3582 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3583 against a base of xtl-1.3.pl.4
3585 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3586 filter the Id: entries so they still show the xtl version number
3589 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3590 into the src/xtl code. Patch still pending with José (XTL)
3592 2000-04-24 Allan Rae <rae@lyx.org>
3594 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3595 both more generic and much safer. Use the new template functions.
3596 * src/buffer.[Ch] (Dispatch): ditto.
3598 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3599 and mem buffer more intelligently. Also a little general cleanup.
3602 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3603 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3604 * src/xtl/Makefile.am: ditto.
3605 * src/xtl/.cvsignore: ditto.
3606 * src/Makefile.am: ditto.
3608 * src/PrinterParams.h: Removed the macros member functions. Added a
3609 testInvariant member function. A bit of tidying up and commenting.
3610 Included Angus's idea for fixing operation with egcs-1.1.2.
3612 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3613 cool expansion of XTL's mem_buffer to support automatic memory
3614 management within the buffer itself. Removed the various macros and
3615 replaced them with template functions that use either auto_mem_buffer
3616 or mem_buffer depending on a #define. The mem_buffer support will
3617 disappear as soon as the auto_mem_buffer is confirmed to be good on
3618 other platforms/compilers. That is, it's there so you've got something
3621 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3622 effectively forked XTL. However I expect José will include my code
3623 into the next major release. Also fixed a memory leak.
3624 * src/xtl/text.h: ditto.
3625 * src/xtl/xdr.h: ditto.
3626 * src/xtl/giop.h: ditto.
3628 2000-04-16 Allan Rae <rae@lyx.org>
3630 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3631 by autogen.sh and removed by maintainer-clean anyway.
3632 * .cvsignore, sigc++/.cvsignore: Support the above.
3634 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3636 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3638 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3639 macros, renamed static callback-target member functions to suit new
3640 scheme and made them public.
3641 * src/frontends/xforms/forms/form_print.fd: ditto.
3642 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3644 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3647 * src/xtl/: New directory containing a minimal distribution of XTL.
3648 This is XTL-1.3.pl.4.
3650 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3652 2000-04-15 Allan Rae <rae@lyx.org>
3654 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3656 * sigc++/: Updated to libsigc++-1.0.0
3658 2000-04-14 Allan Rae <rae@lyx.org>
3660 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3661 use the generic ones in future. I'll modify my conversion script.
3663 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3665 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3666 (CloseAllBufferRelatedDialogs): Renamed.
3667 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3669 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3670 of the generic ones. These are the same ones my conversion script
3673 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3674 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3675 * src/buffer.C (Dispatch): ditto
3677 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3678 functions for updating and hiding buffer dependent dialogs.
3679 * src/BufferView.C (buffer): ditto
3680 * src/buffer.C (setReadonly): ditto
3681 * src/lyxfunc.C (CloseBuffer): ditto
3683 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3684 Dialogs.h, and hence all the SigC stuff, into every file that includes
3685 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3687 * src/BufferView2.C: reduce the number of headers included by buffer.h
3689 2000-04-11 Allan Rae <rae@lyx.org>
3691 * src/frontends/xforms/xform_macros.h: A small collection of macros
3692 for building C callbacks.
3694 * src/frontends/xforms/Makefile.am: Added above file.
3696 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3697 scheme again. This time it should work for JMarc. If this is
3698 successful I'll revise my conversion script to automate some of this.
3699 The static member functions in the class also have to be public for
3700 this scheme will work. If the scheme works (it's almost identical to
3701 the way BufferView::cursorToggleCB is handled so it should work) then
3702 FormCopyright and FormPrint will be ready for inclusion into the main
3703 trunk immediately after 1.1.5 is released -- provided we're prepared
3704 for complaints about lame compilers not handling XTL.
3706 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3708 2000-04-07 Allan Rae <rae@lyx.org>
3710 * config/lyxinclude.m4: A bit more tidying up (Angus)
3712 * src/LString.h: JMarc's <string> header fix
3714 * src/PrinterParams.h: Used string for most data to remove some
3715 ugly code in the Print dialog and avoid even uglier code when
3716 appending the ints to a string for output.
3718 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3719 and moved "default:" back to the end of switch statement. Cleaned
3720 up the printing so it uses the right function calls and so the
3721 "print to file" option actually puts the file in the right directory.
3723 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3725 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3726 and Ok+Apply button control into a separate method: input (Angus).
3727 (input) Cleaned it up and improved it to be very thorough now.
3728 (All CB) static_cast used instead of C style cast (Angus). This will
3729 probably change again once we've worked out how to keep gcc-2.8.1 happy
3730 with real C callbacks.
3731 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3732 ignore some of the bool settings and has random numbers instead. Needs
3733 some more investigation. Added other input length checks and checking
3734 of file and printer names.
3736 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3737 would link (Angus). Seems the old code doesn't compile with the pragma
3738 statement either. Separated callback entries from internal methods.
3740 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3742 2000-03-17 Allan Rae <rae@lyx.org>
3744 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3745 need it? Maybe it could go in Dialogs instead? I could make it a
3746 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3747 values to get the bool return value.
3748 (Dispatch): New overloaded method for xtl support.
3750 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3751 extern "C" callback instead of static member functions. Hopefully,
3752 JMarc will be able to compile this. I haven't changed
3753 forms/form_copyright.fd yet. Breaking one of my own rules already.
3755 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3756 because they aren't useful from the minibuffer. Maybe a LyXServer
3757 might want a help message though?
3759 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3761 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3762 xtl which needs both rtti and exceptions.
3764 * src/support/Makefile.am:
3765 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3767 * src/frontends/xforms/input_validators.[ch]: input filters and
3768 validators. These conrol what keys are valid in input boxes.
3769 Use them and write some more. Much better idea than waiting till
3770 after the user has pressed Ok to say that the input fields don't make
3773 * src/frontends/xforms/Makefile.am:
3774 * src/frontends/xforms/forms/form_print.fd:
3775 * src/frontends/xforms/forms/makefile:
3776 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3777 new scheme. Still have to make sure I haven't missed anything from
3778 the current implementation.
3780 * src/Makefile.am, src/PrinterParams.h: New data store.
3782 * other files: Added a couple of copyright notices.
3784 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3786 * src/insets/insetbib.h: move Holder struct in public space.
3788 * src/frontends/include/DialogBase.h: use SigC:: only when
3789 SIGC_CXX_NAMESPACES is defined.
3790 * src/frontends/include/Dialogs.h: ditto.
3792 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3794 * src/frontends/xforms/FormCopyright.[Ch]: do not
3795 mention SigC:: explicitely.
3797 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3799 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3800 deals with testing KDE in main configure.in
3801 * configure.in: ditto.
3803 2000-02-22 Allan Rae <rae@lyx.org>
3805 * Lots of files: Merged from HEAD
3807 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3808 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3810 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3812 * sigc++/: new minidist.
3814 2000-02-14 Allan Rae <rae@lyx.org>
3816 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3818 2000-02-08 Juergen Vigna <jug@sad.it>
3820 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3821 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3823 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3824 for this port and so it is much easier for other people to port
3825 dialogs in a common development environment.
3827 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3828 the QT/KDE implementation.
3830 * src/frontends/kde/Dialogs.C:
3831 * src/frontends/kde/FormCopyright.C:
3832 * src/frontends/kde/FormCopyright.h:
3833 * src/frontends/kde/Makefile.am:
3834 * src/frontends/kde/formcopyrightdialog.C:
3835 * src/frontends/kde/formcopyrightdialog.h:
3836 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3837 for the kde support of the Copyright-Dialog.
3839 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3840 subdir-substitution instead of hardcoded 'xforms' as we now have also
3843 * src/frontends/include/DialogBase.h (Object): just commented the
3844 label after #endif (nasty warning and I don't like warnings ;)
3846 * src/main.C (main): added KApplication initialization if using
3849 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3850 For now only the KDE event-loop is added if frontend==kde.
3852 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3854 * configure.in: added support for the --with-frontend[=value] option
3856 * autogen.sh: added kde.m4 file to list of config-files
3858 * acconfig.h: added define for KDEGUI-support
3860 * config/kde.m4: added configuration functions for KDE-port
3862 * config/lyxinclude.m4: added --with-frontend[=value] option with
3863 support for xforms and KDE.
3865 2000-02-08 Allan Rae <rae@lyx.org>
3867 * all Makefile.am: Fixed up so the make targets dist, distclean,
3868 install and uninstall all work even if builddir != srcdir. Still
3869 have a new sigc++ minidist update to come.
3871 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3873 2000-02-01 Allan Rae <rae@lyx.org>
3875 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3876 Many mods to get builddir != srcdir working.
3878 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3879 for building on NT and so we can do the builddir != srcdir stuff.
3881 2000-01-30 Allan Rae <rae@lyx.org>
3883 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3884 This will stay in "rae" branch. We probably don't really need it in
3885 the main trunk as anyone who wants to help programming it should get
3886 a full library installed also. So they can check both included and
3887 system supplied library compilation.
3889 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3890 Added a 'mini' distribution of libsigc++. If you feel the urge to
3891 change something in these directories - Resist it. If you can't
3892 resist the urge then you should modify the following script and rebuild
3893 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3894 all happen. Still uses a hacked version of libsigc++'s configure.in.
3895 I'm quite happy with the results. I'm not sure the extra work to turn
3896 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3897 worth the trouble and would probably lead to extra maintenance
3899 I haven't tested the following important make targets: install, dist.
3900 Not ready for prime time but very close. Maybe 1.1.5.
3902 * development/tools/makeLyXsigc.sh: A shell script to automatically
3903 generate our mini-dist of libsigc++. It can only be used with a CVS
3904 checkout of libsigc++ not a tarball distribution. It's well commented.
3905 This will end up as part of the libsigc++ distribution so other apps
3906 can easily have an included mini-dist. If someone makes mods to the
3907 sigc++ subpackage without modifying this script to generate those
3908 changes I'll be very upset!
3910 * src/frontends/: Started the gui/system indep structure.
3912 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3913 to access the gui-indep dialogs are in this class. Much improved
3914 design compared to previous revision. Lars, please refrain from
3915 moving this header into src/ like you did with Popups.h last time.
3917 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3919 * src/frontends/xforms/: Started the gui-indep system with a single
3920 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3923 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3924 Here you'll find a very useful makefile and automated fdfix.sh that
3925 makes updating dailogs a no-brainer -- provided you follow the rules
3926 set out in the README. I'm thinking about adding another script to
3927 automatically generate skeleton code for a new dialog given just the
3930 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3931 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3932 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3934 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3936 * src/support/LSubstring.C (operator): simplify
3938 * src/lyxtext.h: removed bparams, use buffer_->params instead
3940 * src/lyxrow.h: make Row a real class, move all variables to
3941 private and use accessors.
3943 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3945 (isRightToLeftPar): ditto
3946 (ChangeLanguage): ditto
3947 (isMultiLingual): ditto
3950 (SimpleTeXOnePar): ditto
3951 (TeXEnvironment): ditto
3952 (GetEndLabel): ditto
3954 (SetOnlyLayout): ditto
3955 (BreakParagraph): ditto
3956 (BreakParagraphConservative): ditto
3957 (GetFontSettings): ditto
3959 (CopyIntoMinibuffer): ditto
3960 (CutIntoMinibuffer): ditto
3961 (PasteParagraph): ditto
3962 (SetPExtraType): ditto
3963 (UnsetPExtraType): ditto
3964 (DocBookContTableRows): ditto
3965 (SimpleDocBookOneTablePar): ditto
3967 (TeXFootnote): ditto
3968 (SimpleTeXOneTablePar): ditto
3969 (TeXContTableRows): ditto
3970 (SimpleTeXSpecialChars): ditto
3973 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3974 to private and use accessors.
3976 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3977 this, we did not use it anymore and has not been for ages. Just a
3978 waste of cpu cycles.
3980 * src/language.h: make Language a real class, move all variables
3981 to private and use accessors.
3983 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3984 (create_view): remove
3985 (update): some changes for new timer
3986 (cursorToggle): use new timer
3987 (beforeChange): change for new timer
3989 * src/BufferView.h (cursorToggleCB): removed last paramter because
3992 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3993 (cursorToggleCB): change because of new timer code
3995 * lib/CREDITS: updated own mailaddress
3997 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3999 * src/support/filetools.C (PutEnv): fix the code in case neither
4000 putenv() nor setenv() have been found.
4002 * INSTALL: mention the install-strip Makefile target.
4004 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
4005 read-only documents.
4007 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4009 * lib/reLyX/configure.in (VERSION): avoid using a previously
4010 generated reLyX wrapper to find out $prefix.
4012 * lib/examples/eu_adibide_lyx-atua.lyx:
4013 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4014 translation of the Tutorial (Dooteo)
4016 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4018 * forms/cite.fd: new citation dialog
4020 * src/insetcite.[Ch]: the new citation dialog is moved into
4023 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4026 * src/insets/insetcommand.h: data members made private.
4028 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4030 * LyX 1.1.5 released
4032 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4034 * src/version.h (LYX_RELEASE): to 1.1.5
4036 * src/spellchecker.C (RunSpellChecker): return false if the
4037 spellchecker dies upon creation.
4039 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4041 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4042 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4046 * lib/CREDITS: update entry for Martin Vermeer.
4048 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4050 * src/text.C (draw): Draw foreign language bars at the bottom of
4051 the row instead of at the baseline.
4053 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4055 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4057 * lib/bind/de_menus.bind: updated
4059 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4061 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4063 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4065 * src/menus.C (Limit_string_length): New function
4066 (ShowTocMenu): Limit the number of items/length of items in the
4069 * src/paragraph.C (String): Correct result for a paragraph inside
4072 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4074 * src/bufferlist.C (close): test of buf->getuser() == NULL
4076 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4078 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4079 Do not call to SetCursor when the paragraph is a closed footnote!
4081 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4083 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4086 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4088 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4091 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4092 reference popup, that activates the reference-back action
4094 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4096 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4097 the menus. Also fixed a bug.
4099 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4100 the math panels when switching buffers (unless new buffer is readonly).
4102 * src/BufferView.C (NoSavedPositions)
4103 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4105 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4107 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4108 less of dvi dirty or not.
4110 * src/trans_mgr.[Ch] (insert): change first parameter to string
4113 * src/chset.[Ch] (encodeString): add const to first parameter
4115 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4117 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4121 * src/LaTeX.C (deplog): better searching for dependency files in
4122 the latex log. Uses now regexps.
4124 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4125 instead of the box hack or \hfill.
4127 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4129 * src/lyxfunc.C (doImportHelper): do not create the file before
4130 doing the actual import.
4131 (doImportASCIIasLines): create a new file before doing the insert.
4132 (doImportASCIIasParagraphs): ditto.
4134 * lib/lyxrc.example: remove mention of non-existing commands
4136 * lyx.man: remove mention of color-related switches.
4138 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4140 * src/lyx_gui.C: remove all the color-related ressources, which
4141 are not used anymore.
4143 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4146 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4148 * src/lyxrc.C (read): Add a missing break in the switch
4150 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4152 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4154 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4157 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4159 * src/text.C (draw): draw bars under foreign language words.
4161 * src/LColor.[Ch]: add LColor::language
4163 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4165 * src/lyxcursor.h (boundary): New member variable
4167 * src/text.C (IsBoundary): New methods
4169 * src/text.C: Use the above for currect cursor movement when there
4170 is both RTL & LTR text.
4172 * src/text2.C: ditto
4174 * src/bufferview_funcs.C (ToggleAndShow): ditto
4176 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4178 * src/text.C (DeleteLineForward): set selection to true to avoid
4179 that DeleteEmptyParagraphMechanism does some magic. This is how it
4180 is done in all other functions, and seems reasonable.
4181 (DeleteWordForward): do not jump over non-word stuff, since
4182 CursorRightOneWord() already does it.
4184 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4185 DeleteWordBackward, since they seem safe to me (since selection is
4186 set to "true") DeleteEmptyParagraphMechanism does nothing.
4188 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4190 * src/lyx_main.C (easyParse): simplify the code by factoring the
4191 part that removes parameters from the command line.
4192 (LyX): check wether wrong command line options have been given.
4194 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4196 * src/lyx_main.C : add support for specifying user LyX
4197 directory via command line option -userdir.
4199 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4201 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4202 the number of items per popup.
4203 (Add_to_refs_menu): Ditto.
4205 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4207 * src/lyxparagraph.h: renamed ClearParagraph() to
4208 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4209 textclass as parameter, and do nothing if free_spacing is
4210 true. This fixes part of the line-delete-forward problems.
4212 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4213 (pasteSelection): ditto.
4214 (SwitchLayoutsBetweenClasses): more translatable strings.
4216 * src/text2.C (CutSelection): use StripLeadingSpaces.
4217 (PasteSelection): ditto.
4218 (DeleteEmptyParagraphMechanism): ditto.
4220 2000-05-26 Juergen Vigna <jug@sad.it>
4222 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4223 is not needed in tabular insets.
4225 * src/insets/insettabular.C (TabularFeatures): added missing features.
4227 * src/tabular.C (DeleteColumn):
4229 (AppendRow): implemented this functions
4230 (cellsturct::operator=): clone the inset too;
4232 2000-05-23 Juergen Vigna <jug@sad.it>
4234 * src/insets/insettabular.C (LocalDispatch): better selection support
4235 when having multicolumn-cells.
4237 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4239 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4241 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4243 * src/ColorHandler.C (getGCForeground): put more test into _()
4245 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4248 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4251 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4253 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4254 there are no labels, or when buffer is readonly.
4256 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4257 there are no labels, buffer is SGML, or when buffer is readonly.
4259 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4261 * src/LColor.C (LColor): change a couple of grey40 to grey60
4262 (LColor): rewore initalization to make compiles go some magnitude
4264 (getGUIName): don't use gettext until we need the string.
4266 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4268 * src/Bullet.[Ch]: Fixed a small bug.
4270 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4272 * src/paragraph.C (String): Several fixes/improvements
4274 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4276 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4278 * src/paragraph.C (String): give more correct output.
4280 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4282 * src/lyxfont.C (stateText) Do not output the language if it is
4283 eqaul to the language of the document.
4285 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4286 between two paragraphs with the same language.
4288 * src/paragraph.C (getParLanguage) Return a correct answer for an
4289 empty dummy paragraph.
4291 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4294 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4297 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4298 the menus/popup, if requested fonts are unavailable.
4300 2000-05-22 Juergen Vigna <jug@sad.it>
4302 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4303 movement support (Up/Down/Tab/Shift-Tab).
4304 (LocalDispatch): added also preliminari cursor-selection.
4306 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4308 * src/paragraph.C (PasteParagraph): Hopefully now right!
4310 2000-05-22 Garst R. Reese <reese@isn.net>
4312 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4313 of list, change all references to Environment to Command
4314 * tex/hollywood.cls : rewrite environments as commands, add
4315 \uppercase to interiorshot and exteriorshot to force uppecase.
4316 * tex/broadway.cls : rewrite environments as commands. Tweak
4319 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4321 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4322 size of items: use a constant intead of the hardcoded 40, and more
4323 importantly do not remove the %m and %x tags added at the end.
4324 (Add_to_refs_menu): use vector::size_type instead of
4325 unsigned int as basic types for the variables. _Please_ do not
4326 assume that size_t is equal to unsigned int. On an alpha, this is
4327 unsigned long, which is _not_ the same.
4329 * src/language.C (initL): remove language "hungarian", since it
4330 seems that "magyar" is better.
4332 2000-05-22 Juergen Vigna <jug@sad.it>
4334 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4336 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4339 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4340 next was deleted but not set to 0.
4342 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4344 * src/language.C (initL): change the initialization of languages
4345 so that compiles goes _fast_.
4347 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4350 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4352 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4356 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4358 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4360 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4364 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4367 * src/insets/insetlo*.[Ch]: Made editable
4369 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4371 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4372 the current selection.
4374 * src/BufferView_pimpl.C (stuffClipboard): new method
4376 * src/BufferView.C (stuffClipboard): new method
4378 * src/paragraph.C (String): new method
4380 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4381 LColor::ignore when lyxname is not found.
4383 * src/BufferView.C (pasteSelection): new method
4385 * src/BufferView_pimpl.C (pasteSelection): new method
4387 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4389 * src/WorkArea.C (request_clipboard_cb): new static function
4390 (getClipboard): new method
4391 (putClipboard): new method
4393 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4395 * LyX 1.1.5pre2 released
4397 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4399 * src/vspace.C (operator=): removed
4400 (operator=): removed
4402 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4404 * src/layout.C (NumberOfClass): manually set the type in make_pair
4405 (NumberOfLayout): ditto
4407 * src/language.C: use the Language constructor for ignore_lang
4409 * src/language.h: add constructors to struct Language
4411 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4413 * src/text2.C (SetCursorIntern): comment out #warning
4415 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4417 * src/mathed/math_iter.h: initialize sx and sw to 0
4419 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4421 * forms/lyx.fd: Redesign of form_ref
4423 * src/LaTeXFeatures.[Ch]
4427 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4430 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4431 and Buffer::inset_iterator.
4433 * src/menus.C: Added new menus: TOC and Refs.
4435 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4437 * src/buffer.C (getTocList): New method.
4439 * src/BufferView2.C (ChangeRefs): New method.
4441 * src/buffer.C (getLabelList): New method. It replaces the old
4442 getReferenceList. The return type is vector<string> instead of
4445 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4446 the old getLabel() and GetNumberOfLabels() methods.
4447 * src/insets/insetlabel.C (getLabelList): ditto
4448 * src/mathed/formula.C (getLabelList): ditto
4450 * src/paragraph.C (String): New method.
4452 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4453 Uses the new getTocList() method.
4454 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4455 which automatically updates the contents of the browser.
4456 (RefUpdateCB): Use the new getLabelList method.
4458 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4460 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4462 * src/spellchecker.C: Added using std::reverse;
4464 2000-05-19 Juergen Vigna <jug@sad.it>
4466 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4468 * src/insets/insettext.C (computeTextRows): small fix for display of
4469 1 character after a newline.
4471 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4474 2000-05-18 Juergen Vigna <jug@sad.it>
4476 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4477 when changing width of column.
4479 * src/tabular.C (set_row_column_number_info): setting of
4480 autobreak rows if necessary.
4482 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4484 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4486 * src/vc-backend.*: renamed stat() to status() and vcstat to
4487 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4488 compilation broke. The new name seems more relevant, anyway.
4490 2000-05-17 Juergen Vigna <jug@sad.it>
4492 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4493 which was wrong if the removing caused removing of rows!
4495 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4496 (pushToken): new function.
4498 * src/text2.C (CutSelection): fix problem discovered with purify
4500 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4502 * src/debug.C (showTags): enlarge the first column, now that we
4503 have 6-digits debug codes.
4505 * lib/layouts/hollywood.layout:
4506 * lib/tex/hollywood.cls:
4507 * lib/tex/brodway.cls:
4508 * lib/layouts/brodway.layout: more commands and fewer
4509 environments. Preambles moved in the .cls files. Broadway now has
4510 more options on scene numbering and less whitespace (from Garst)
4512 * src/insets/insetbib.C (getKeys): make sure that we are in the
4513 document directory, in case the bib file is there.
4515 * src/insets/insetbib.C (Latex): revert bogus change.
4517 2000-05-16 Juergen Vigna <jug@sad.it>
4519 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4520 the TabularLayout on cursor move.
4522 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4524 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4527 (draw): fixed cursor position and drawing so that the cursor is
4528 visible when before the tabular-inset.
4530 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4531 when creating from old insettext.
4533 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4535 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4537 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4538 * lib/tex/brodway.cls: ditto
4540 * lib/layouts/brodway.layout: change alignment of parenthical
4543 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4545 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4546 versions 0.88 and 0.89 are supported.
4548 2000-05-15 Juergen Vigna <jug@sad.it>
4550 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4553 * src/insets/insettext.C (computeTextRows): redone completely this
4554 function in a much cleaner way, because of problems when having a
4556 (draw): added a frame border when the inset is locked.
4557 (SetDrawLockedFrame): this sets if we draw the border or not.
4558 (SetFrameColor): this sets the frame color (default=insetframe).
4560 * src/insets/lyxinset.h: added x() and y() functions which return
4561 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4562 function which is needed to see if we have a locking inset of some
4563 type in this inset (needed for now in insettabular).
4565 * src/vspace.C (inPixels): the same function also without a BufferView
4566 parameter as so it is easier to use it in some ocasions.
4568 * src/lyxfunc.C: changed all places where insertInset was used so
4569 that now if it couldn't be inserted it is deleted!
4571 * src/TabularLayout.C:
4572 * src/TableLayout.C: added support for new tabular-inset!
4574 * src/BufferView2.C (insertInset): this now returns a bool if the
4575 inset was really inserted!!!
4577 * src/tabular.C (GetLastCellInRow):
4578 (GetFirstCellInRow): new helper functions.
4579 (Latex): implemented for new tabular class.
4583 (TeXTopHLine): new Latex() helper functions.
4585 2000-05-12 Juergen Vigna <jug@sad.it>
4587 * src/mathed/formulamacro.C (Read):
4588 * src/mathed/formula.C (Read): read also the \end_inset here!
4590 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4592 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4593 crush when saving formulae with unbalanced parenthesis.
4595 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4597 * src/layout.C: Add new keyword "endlabelstring" to layout file
4599 * src/text.C (GetVisibleRow): Draw endlabel string.
4601 * lib/layouts/broadway.layout
4602 * lib/layouts/hollywood.layout: Added endlabel for the
4603 Parenthetical layout.
4605 * lib/layouts/heb-article.layout: Do not use slanted font shape
4606 for Theorem like environments.
4608 * src/buffer.C (makeLaTeXFile): Always add "american" to
4609 the UsedLanguages list if document language is RTL.
4611 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4613 * add addendum to README.OS2 and small patch (from SMiyata)
4615 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4617 * many files: correct the calls to ChangeExtension().
4619 * src/support/filetools.C (ChangeExtension): remove the no_path
4620 argument, which does not belong there. Use OnlyFileName() instead.
4622 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4623 files when LaTeXing a non-nice latex file.
4625 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4626 a chain of "if". Return false when deadkeys are not handled.
4628 * src/lyx_main.C (LyX): adapted the code for default bindings.
4630 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4631 bindings for basic functionality (except deadkeys).
4632 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4634 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4635 several methods: handle override_x_deadkeys.
4637 * src/lyxrc.h: remove the "bindings" map, which did not make much
4638 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4640 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4642 * src/lyxfont.C (stateText): use a saner method to determine
4643 whether the font is "default". Seems to fix the crash with DEC
4646 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4648 2000-05-08 Juergen Vigna <jug@sad.it>
4650 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4651 TabularLayoutMenu with mouse-button-3
4652 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4654 * src/TabularLayout.C: added this file for having a Layout for
4657 2000-05-05 Juergen Vigna <jug@sad.it>
4659 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4660 recalculating inset-widths.
4661 (TabularFeatures): activated this function so that I can change
4662 tabular-features via menu.
4664 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4665 that I can test some functions with the Table menu.
4667 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4669 * src/lyxfont.C (stateText): guard against stupid c++libs.
4671 * src/tabular.C: add using std::vector
4672 some whitespace changes, + removed som autogenerated code.
4674 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4676 2000-05-05 Juergen Vigna <jug@sad.it>
4678 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4679 row, columns and cellstructures.
4681 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4683 * lib/lyxrc.example: remove obsolete entries.
4685 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4686 reading of protected_separator for free_spacing.
4688 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4690 * src/text.C (draw): do not display an exclamation mark in the
4691 margin for margin notes. This is confusing, ugly and
4694 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4695 AMS math' is checked.
4697 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4698 name to see whether including the amsmath package is needed.
4700 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4702 * src/paragraph.C (validate): Compute UsedLanguages correctly
4703 (don't insert the american language if it doesn't appear in the
4706 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4707 The argument of \thanks{} command is considered moving argument
4709 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4712 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4714 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4715 for appendix/minipage/depth. The lines can be now both in the footnote
4716 frame, and outside the frame.
4718 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4721 2000-05-05 Juergen Vigna <jug@sad.it>
4723 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4724 neede only in tabular.[Ch].
4726 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4728 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4730 (Write): write '~' for PROTECTED_SEPARATOR
4732 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4734 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4737 * src/mathed/formula.C (drawStr): rename size to siz.
4739 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4740 possibly fix a bug by not changing the pflags = flags to piflags =
4743 2000-05-05 Juergen Vigna <jug@sad.it>
4745 * src/insets/insetbib.C: moved using directive
4747 * src/ImportNoweb.C: small fix for being able to compile (missing
4750 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4752 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4753 to use clear, since we don't depend on this in the code. Add test
4756 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4758 * (various *.C files): add using std::foo directives to please dec
4761 * replace calls to string::clear() to string::erase() (Angus)
4763 * src/cheaders/cmath: modified to provide std::abs.
4765 2000-05-04 Juergen Vigna <jug@sad.it>
4767 * src/insets/insettext.C: Prepared all for inserting of multiple
4768 paragraphs. Still display stuff to do (alignment and other things),
4769 but I would like to use LyXText to do this when we cleaned out the
4770 table-support stuff.
4772 * src/insets/insettabular.C: Changed lot of stuff and added lots
4773 of functionality still a lot to do.
4775 * src/tabular.C: Various functions changed name and moved to be
4776 const functions. Added new Read and Write functions and changed
4777 lots of things so it works good with tabular-insets (also removed
4778 some stuff which is not needed anymore * hacks *).
4780 * src/lyxcursor.h: added operators == and != which just look if
4781 par and pos are (not) equal.
4783 * src/buffer.C (latexParagraphs): inserted this function to latex
4784 all paragraphs form par to endpar as then I can use this too for
4787 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4788 so that I can call this to from text insets with their own cursor.
4790 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4791 output off all paragraphs (because of the fix below)!
4793 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4794 the very last paragraph (this could be also the last paragraph of an
4797 * src/texrow.h: added rows() call which returns the count-variable.
4799 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4801 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4803 * lib/configure.m4: better autodetection of DocBook tools.
4805 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4807 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4809 * src/lyx_cb.C: add using std::reverse;
4811 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4814 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4815 selected files. Should fix repeated errors from generated files.
4817 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4819 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4821 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4822 the spellchecker popup.
4824 * lib/lyxrc.example: Removed the \number_inset section
4826 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4828 * src/insets/figinset.C (various): Use IsFileReadable() to make
4829 sure that the file actually exist. Relying on ghostscripts errors
4830 is a bad idea since they can lead to X server crashes.
4832 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4834 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4837 * lib/lyxrc.example: smallish typo in description of
4838 \view_dvi_paper_option
4840 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4843 * src/lyxfunc.C: doImportHelper to factor out common code of the
4844 various import methods. New functions doImportASCIIasLines,
4845 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4846 doImportLinuxDoc for the format specific parts.
4849 * buffer.C: Dispatch returns now a bool to indicate success
4852 * lyx_gui.C: Add getLyXView() for member access
4854 * lyx_main.C: Change logic for batch commands: First try
4855 Buffer::Dispatch (possibly without GUI), if that fails, use
4858 * lyx_main.C: Add support for --import command line switch.
4859 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4860 Available Formats: Everything accepted by 'buffer-import <format>'
4862 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4864 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4867 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4868 documents will be reformatted upon reentry.
4870 2000-04-27 Juergen Vigna <jug@sad.it>
4872 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4873 correctly only last pos this was a bug.
4875 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4877 * release of lyx-1.1.5pre1
4879 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4881 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4883 * src/menus.C: revert the change of naming (Figure->Graphic...)
4884 from 2000-04-11. It was incomplete and bad.
4886 * src/LColor.[Ch]: add LColor::depthbar.
4887 * src/text.C (GetVisibleRow): use it.
4889 * README: update the languages list.
4891 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4893 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4896 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4898 * README: remove sections that were just wrong.
4900 * src/text2.C (GetRowNearY): remove currentrow code
4902 * src/text.C (GetRow): remove currentrow code
4904 * src/screen.C (Update): rewritten a bit.
4905 (SmallUpdate): removed func
4907 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4909 (FullRebreak): return bool
4910 (currentrow): remove var
4911 (currentrow_y): ditto
4913 * src/lyxscreen.h (Draw): change arg to unsigned long
4914 (FitCursor): return bool
4915 (FitManualCursor): ditto
4916 (Smallpdate): remove func
4917 (first): change to unsigned long
4918 (DrawOneRow): change second arg to long (from long &)
4919 (screen_refresh_y): remove var
4920 (scree_refresh_row): ditto
4922 * src/lyxrow.h: change baseline to usigned int from unsigned
4923 short, this brings some implicit/unsigned issues out in the open.
4925 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4927 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4928 instead of smallUpdate.
4930 * src/lyxcursor.h: change y to unsigned long
4932 * src/buffer.h: don't call updateScrollbar after fitcursor
4934 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4935 where they are used. Removed "\\direction", this was not present
4936 in 1.1.4 and is already obsolete. Commented out some code that I
4937 believe to never be called.
4938 (runLiterate): don't call updateScrollbar after fitCursor
4940 (buildProgram): ditto
4943 * src/WorkArea.h (workWidth): change return val to unsigned
4946 (redraw): remove the button redraws
4947 (setScrollbarValue): change for scrollbar
4948 (getScrollbarValue): change for scrollbar
4949 (getScrollbarBounds): change for scrollbar
4951 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4952 (C_WorkArea_down_cb): removed func
4953 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4954 (resize): change for scrollbar
4955 (setScrollbar): ditto
4956 (setScrollbarBounds): ditto
4957 (setScrollbarIncrements): ditto
4958 (up_cb): removed func
4959 (down_cb): removed func
4960 (scroll_cb): change for scrollbar
4961 (work_area_handler): ditto
4963 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4964 when FitCursor did something.
4965 (updateScrollbar): some unsigned changes
4966 (downCB): removed func
4967 (scrollUpOnePage): removed func
4968 (scrollDownOnePage): remvoed func
4969 (workAreaMotionNotify): don't call screen->FitCursor but use
4970 fitCursor instead. and bool return val
4971 (workAreaButtonPress): ditto
4972 (workAreaButtonRelease): some unsigned changes
4973 (checkInsetHit): ditto
4974 (workAreaExpose): ditto
4975 (update): parts rewritten, comments about the signed char arg added
4976 (smallUpdate): removed func
4977 (cursorPrevious): call needed updateScrollbar
4980 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4983 * src/BufferView.[Ch] (upCB): removed func
4984 (downCB): removed func
4985 (smallUpdate): removed func
4987 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4989 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4990 currentrow, currentrow_y optimization. This did not help a lot and
4991 if we want to do this kind of optimization we should rather use
4992 cursor.row instead of the currentrow.
4994 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4995 buffer spacing and klyx spacing support.
4997 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4999 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
5002 2000-04-26 Juergen Vigna <jug@sad.it>
5004 * src/insets/figinset.C: fixes to Lars sstream changes!
5006 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
5008 * A lot of files: Added Ascii(ostream &) methods to all inset
5009 classes. Used when exporting to ASCII.
5011 * src/buffer.C (writeFileAscii,RoffAsciiTable)
5012 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5015 * src/text2.C (ToggleFree): Disabled implicit word selection when
5016 there is a change in the language
5018 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5019 no output was generated for end-of-sentence inset.
5021 * src/insets/lyxinset.h
5024 * src/paragraph.C: Removed the insetnumber code
5026 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5028 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5030 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5031 no_babel and no_epsfig completely from the file.
5032 (parseSingleLyXformat2Token): add handling for per-paragraph
5033 spacing as written by klyx.
5035 * src/insets/figinset.C: applied patch by Andre. Made it work with
5038 2000-04-20 Juergen Vigna <jug@sad.it>
5040 * src/insets/insettext.C (cutSelection):
5041 (copySelection): Fixed with selection from right to left.
5042 (draw): now the rows are not recalculated at every draw.
5043 (computeTextRows): for now reset the inset-owner here (this is
5044 important for an undo or copy where the inset-owner is not set
5047 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5048 motion to the_locking_inset screen->first was forgotten, this was
5049 not important till we got multiline insets.
5051 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5053 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5054 code seems to be alright (it is code changed by Dekel, and the
5055 intent is indeed that all macros should be defined \protect'ed)
5057 * NEWS: a bit of reorganisation of the new user-visible features.
5059 2000-04-19 Juergen Vigna <jug@sad.it>
5061 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5062 position. Set the inset_owner of the used paragraph so that it knows
5063 that it is inside an inset. Fixed cursor handling with mouse and
5064 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5065 and cleanups to make TextInsets work better.
5067 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5068 Changed parameters of various functions and added LockInsetInInset().
5070 * src/insets/insettext.C:
5072 * src/insets/insetcollapsable.h:
5073 * src/insets/insetcollapsable.C:
5074 * src/insets/insetfoot.h:
5075 * src/insets/insetfoot.C:
5076 * src/insets/insetert.h:
5077 * src/insets/insetert.C: cleaned up the code so that it works now
5078 correctly with insettext.
5080 * src/insets/inset.C:
5081 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5082 that insets in insets are supported right.
5085 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5087 * src/paragraph.C: some small fixes
5089 * src/debug.h: inserted INSETS debug info
5091 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5092 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5094 * src/commandtags.h:
5095 * src/LyXAction.C: insert code for InsetTabular.
5097 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5098 not Button1MotionMask.
5099 (workAreaButtonRelease): send always a InsetButtonRelease event to
5101 (checkInsetHit): some setCursor fixes (always with insets).
5103 * src/BufferView2.C (lockInset): returns a bool now and extended for
5104 locking insets inside insets.
5105 (showLockedInsetCursor): it is important to have the cursor always
5106 before the locked inset.
5107 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5109 * src/BufferView.h: made lockInset return a bool.
5111 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5113 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5114 that is used also internally but can be called as public to have back
5115 a cursor pos which is not set internally.
5116 (SetCursorIntern): Changed to use above function.
5118 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5120 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5125 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5126 patches for things that should be in or should be changed.
5128 * src/* [insetfiles]: change "usigned char fragile" to bool
5129 fragile. There was only one point that could that be questioned
5130 and that is commented in formulamacro.C. Grep for "CHECK".
5132 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5133 (DeleteBuffer): take it out of CutAndPaste and make it static.
5135 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5137 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5138 output the spacing envir commands. Also the new commands used in
5139 the LaTeX output makes the result better.
5141 * src/Spacing.C (writeEnvirBegin): new method
5142 (writeEnvirEnd): new method
5144 2000-04-18 Juergen Vigna <jug@sad.it>
5146 * src/CutAndPaste.C: made textclass a static member of the class
5147 as otherwise it is not accesed right!!!
5149 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5151 * forms/layout_forms.fd
5152 * src/layout_forms.h
5153 * src/layout_forms.C (create_form_form_character)
5154 * src/lyx_cb.C (UserFreeFont)
5155 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5156 documents (in the layout->character popup).
5158 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5160 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5161 \spell_command was in fact not honored (from Kevin Atkinson).
5163 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5166 * src/lyx_gui.h: make lyxViews private (Angus)
5168 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5170 * src/mathed/math_write.C
5171 (MathMatrixInset::Write) Put \protect before \begin{array} and
5172 \end{array} if fragile
5173 (MathParInset::Write): Put \protect before \\ if fragile
5175 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5177 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5178 initialization if the LyXColorHandler must be done after the
5179 connections to the XServer has been established.
5181 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5182 get the background pixel from the lyxColorhandler so that the
5183 figures are rendered with the correct background color.
5184 (NextToken): removed functions.
5185 (GetPSSizes): use ifs >> string instead of NextToken.
5187 * src/Painter.[Ch]: the color cache moved out of this file.
5189 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5192 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5194 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5195 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5197 * src/BufferView.C (enterView): new func
5198 (leaveView): new func
5200 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5202 (leaveView): new func, undefines xterm cursor when approp.
5204 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5205 (AllowInput): delete the Workarea cursor handling from this func.
5207 * src/Painter.C (underline): draw a slimer underline in most cases.
5209 * src/lyx_main.C (error_handler): use extern "C"
5211 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5213 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5214 sent directly to me.
5216 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5217 to the list by Dekel.
5219 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5222 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5223 methods from lyx_cb.here.
5225 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5228 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5230 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5231 instead of using current_view directly.
5233 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5235 * src/LyXAction.C (init): add the paragraph-spacing command.
5237 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5239 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5241 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5242 different from the documents.
5244 * src/text.C (SetHeightOfRow): take paragraph spacing into
5245 account, paragraph spacing takes precedence over buffer spacing
5246 (GetVisibleRow): ditto
5248 * src/paragraph.C (writeFile): output the spacing parameter too.
5249 (validate): set the correct features if spacing is used in the
5251 (Clear): set spacing to default
5252 (MakeSameLayout): spacing too
5253 (HasSameLayout): spacing too
5254 (SetLayout): spacing too
5255 (TeXOnePar): output the spacing commands
5257 * src/lyxparagraph.h: added a spacing variable for use with
5258 per-paragraph spacing.
5260 * src/Spacing.h: add a Default spacing and a method to check if
5261 the current spacing is default. also added an operator==
5263 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5266 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5268 * src/lyxserver.C (callback): fix dispatch of functions
5270 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5271 printf() into lyxerr call.
5273 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5276 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5277 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5278 the "Float" from each of the subitems.
5279 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5281 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5282 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5283 documented the change so that the workaround can be nuked later.
5285 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5288 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5290 * src/buffer.C (getLatexName): ditto
5291 (setReadonly): ditto
5293 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5295 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5296 avoid some uses of current_view. Added also a bufferParams()
5297 method to get at this.
5299 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5301 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5303 * src/lyxparagraph.[Ch]: removed
5304 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5305 with operators used by lower_bound and
5306 upper_bound in InsetTable's
5307 Make struct InsetTable private again. Used matchpos.
5309 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5311 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5312 document, the language of existing text is changed (unless the
5313 document is multi-lingual)
5315 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5317 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5319 * A lot of files: A rewrite of the Right-to-Left support.
5321 2000-04-10 Juergen Vigna <jug@sad.it>
5323 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5324 misplaced cursor when inset in inset is locked.
5326 * src/insets/insettext.C (LocalDispatch): small fix so that a
5327 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5329 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5330 footnote font should be decreased in size twice when displaying.
5332 * src/insets/insettext.C (GetDrawFont): inserted this function as
5333 the drawing-font may differ from the real paragraph font.
5335 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5336 insets (inset in inset!).
5338 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5339 function here because we don't want footnotes inside footnotes.
5341 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5343 (init): now set the inset_owner in paragraph.C
5344 (LocalDispatch): added some resetPos() in the right position
5347 (pasteSelection): changed to use the new CutAndPaste-Class.
5349 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5350 which tells if it is allowed to insert another inset inside this one.
5352 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5353 SwitchLayoutsBetweenClasses.
5355 * src/text2.C (InsertInset): checking of the new paragraph-function
5357 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5358 is not needed anymore here!
5361 (PasteSelection): redone (also with #ifdef) so that now this uses
5362 the CutAndPaste-Class.
5363 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5366 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5367 from/to text/insets.
5369 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5370 so that the paragraph knows if it is inside an (text)-inset.
5371 (InsertFromMinibuffer): changed return-value to bool as now it
5372 may happen that an inset is not inserted in the paragraph.
5373 (InsertInsetAllowed): this checks if it is allowed to insert an
5374 inset in this paragraph.
5376 (BreakParagraphConservative):
5377 (BreakParagraph) : small change for the above change of the return
5378 value of InsertFromMinibuffer.
5380 * src/lyxparagraph.h: added inset_owner and the functions to handle
5381 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5383 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5385 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5386 functions from BufferView to BufferView::Pimpl to ease maintence.
5388 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5389 correctly. Also use SetCursorIntern instead of SetCursor.
5391 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5394 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5396 * src/WorkArea.C (belowMouse): manually implement below mouse.
5398 * src/*: Add "explicit" on several constructors, I added probably
5399 some unneeded ones. A couple of changes to code because of this.
5401 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5402 implementation and private parts from the users of BufferView. Not
5405 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5406 implementation and private parts from the users of LyXLex. Not
5409 * src/BufferView_pimpl.[Ch]: new files
5411 * src/lyxlex_pimpl.[Ch]: new files
5413 * src/LyXView.[Ch]: some inline functions move out-of-line
5415 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5417 * src/lyxparagraph.h: make struct InsetTable public.
5419 * src/support/lyxstring.h: change lyxstring::difference_type to be
5420 ptrdiff_t. Add std:: modifiers to streams.
5422 * src/font.C: include the <cctype> header, for islower() and
5425 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5427 * src/font.[Ch]: new files. Contains the metric functions for
5428 fonts, takes a LyXFont as parameter. Better separation of concepts.
5430 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5431 changes because of this.
5433 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5435 * src/*: compile with -Winline and move functions that don't
5438 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5441 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5443 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5444 (various files changed because of this)
5446 * src/Painter.C (text): fixed the drawing of smallcaps.
5448 * src/lyxfont.[Ch] (drawText): removed unused member func.
5451 * src/*.C: added needed "using" statements and "std::" qualifiers.
5453 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5455 * src/*.h: removed all use of "using" from header files use
5456 qualifier std:: instead.
5458 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5460 * src/text.C (Backspace): some additional cleanups (we already
5461 know whether cursor.pos is 0 or not).
5463 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5464 automake does not provide one).
5466 * src/bmtable.h: replace C++ comments with C comments.
5468 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5470 * src/screen.C (ShowCursor): Change the shape of the cursor if
5471 the current language is not equal to the language of the document.
5472 (If the cursor change its shape unexpectedly, then you've found a bug)
5474 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5477 * src/insets/insetnumber.[Ch]: New files.
5479 * src/LyXAction.C (init)
5480 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5483 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5485 * src/lyxparagraph.h
5486 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5487 (the vector is kept sorted).
5489 * src/text.C (GetVisibleRow): Draw selection correctly when there
5490 is both LTR and RTL text.
5492 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5493 which is much faster.
5495 * src/text.C (GetVisibleRow and other): Do not draw the last space
5496 in a row if the direction of the last letter is not equal to the
5497 direction of the paragraph.
5499 * src/lyxfont.C (latexWriteStartChanges):
5500 Check that font language is not equal to basefont language.
5501 (latexWriteEndChanges): ditto
5503 * src/lyx_cb.C (StyleReset): Don't change the language while using
5504 the font-default command.
5506 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5507 empty paragraph before a footnote.
5509 * src/insets/insetcommand.C (draw): Increase x correctly.
5511 * src/screen.C (ShowCursor): Change cursor shape if
5512 current language != document language.
5514 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5516 2000-03-31 Juergen Vigna <jug@sad.it>
5518 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5519 (Clone): changed mode how the paragraph-data is copied to the
5520 new clone-paragraph.
5522 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5523 GetInset(pos) with no inset anymore there (in inset UNDO)
5525 * src/insets/insetcommand.C (draw): small fix as here x is
5526 incremented not as much as width() returns (2 before, 2 behind = 4)
5528 2000-03-30 Juergen Vigna <jug@sad.it>
5530 * src/insets/insettext.C (InsetText): small fix in initialize
5531 widthOffset (should not be done in the init() function)
5533 2000-03-29 Amir Karger <karger@lyx.org>
5535 * lib/examples/it_ItemizeBullets.lyx: translation by
5538 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5540 2000-03-29 Juergen Vigna <jug@sad.it>
5542 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5544 * src/insets/insetfoot.C (Clone): small change as for the below
5545 new init function in the text-inset
5547 * src/insets/insettext.C (init): new function as I've seen that
5548 clone did not copy the Paragraph-Data!
5549 (LocalDispatch): Added code so that now we have some sort of Undo
5550 functionality (well actually we HAVE Undo ;)
5552 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5554 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5556 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5559 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5561 * src/main.C: added a runtime check that verifies that the xforms
5562 header used when building LyX and the library used when running
5563 LyX match. Exit with a message if they don't match. This is a
5564 version number check only.
5566 * src/buffer.C (save): Don't allocate memory on the heap for
5567 struct utimbuf times.
5569 * *: some using changes, use iosfwd instead of the real headers.
5571 * src/lyxfont.C use char const * instead of string for the static
5572 strings. Rewrite some functions to use sstream.
5574 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5576 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5579 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5581 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5582 of Geodesy (from Martin Vermeer)
5584 * lib/layouts/svjour.inc: include file for the Springer svjour
5585 class. It can be used to support journals other than JoG.
5587 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5588 Miskiewicz <misiek@pld.org.pl>)
5589 * lib/reLyX/Makefile.am: ditto.
5591 2000-03-27 Juergen Vigna <jug@sad.it>
5593 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5594 also some modifications with operations on selected text.
5596 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5597 problems with clicking on insets (last famous words ;)
5599 * src/insets/insetcommand.C (draw):
5600 (width): Changed to have a bit of space before and after the inset so
5601 that the blinking cursor can be seen (otherwise it was hidden)
5603 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5605 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5606 would not be added to the link list when an installed gettext (not
5607 part of libc) is found.
5609 2000-03-24 Juergen Vigna <jug@sad.it>
5611 * src/insets/insetcollapsable.C (Edit):
5612 * src/mathed/formula.C (InsetButtonRelease):
5613 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5616 * src/BufferView.C (workAreaButtonPress):
5617 (workAreaButtonRelease):
5618 (checkInsetHit): Finally fixed the clicking on insets be handled
5621 * src/insets/insetert.C (Edit): inserted this call so that ERT
5622 insets work always with LaTeX-font
5624 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5626 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5627 caused lyx to startup with no GUI in place, causing in a crash
5628 upon startup when called with arguments.
5630 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5632 * src/FontLoader.C: better initialization of dummyXFontStruct.
5634 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5636 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5637 for linuxdoc and docbook import and export format options.
5639 * lib/lyxrc.example Example of default values for the previous flags.
5641 * src/lyx_cb.C Use those flags instead of the hardwired values for
5642 linuxdoc and docbook export.
5644 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5647 * src/menus.C Added menus entries for the new import/exports formats.
5649 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5651 * src/lyxrc.*: Added support for running without Gui
5654 * src/FontLoader.C: sensible defaults if no fonts are needed
5656 * src/lyx_cb.C: New function ShowMessage (writes either to the
5657 minibuffer or cout in case of no gui
5658 New function AskOverwrite for common stuff
5659 Consequently various changes to call these functions
5661 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5662 wild guess at sensible screen resolution when having no gui
5664 * src/lyxfont.C: no gui, no fonts... set some defaults
5666 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5668 * src/LColor.C: made the command inset background a bit lighter.
5670 2000-03-20 Hartmut Goebel <goebel@noris.net>
5672 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5673 stdstruct.inc. Koma-Script added some title elements which
5674 otherwise have been listed below "bibliography". This split allows
5675 adding title elements to where they belong.
5677 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5678 define the additional tilte elements and then include
5681 * many other layout files: changed to include stdtitle.inc just
5682 before stdstruct.inc.
5684 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5686 * src/buffer.C: (save) Added the option to store all backup files
5687 in a single directory
5689 * src/lyxrc.[Ch]: Added variable \backupdir_path
5691 * lib/lyxrc.example: Added descriptions of recently added variables
5693 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5694 bibtex inset, not closing the bibtex popup when deleting the inset)
5696 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5698 * src/lyx_cb.C: add a couple using directives.
5700 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5701 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5702 import based on the filename.
5704 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5705 file would be imported at start, if the filename where of a sgml file.
5707 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5709 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5711 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5712 * src/lyxfont.h Replaced the member variable bits.direction by the
5713 member variable lang. Made many changes in other files.
5714 This allows having a multi-lingual document
5716 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5717 that change the current language to <l>.
5718 Removed the command "font-rtl"
5720 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5721 format for Hebrew documents)
5723 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5724 When auto_mathmode is "true", pressing a digit key in normal mode
5725 will cause entering into mathmode.
5726 If auto_mathmode is "rtl" then this behavior will be active only
5727 when writing right-to-left text.
5729 * src/text2.C (InsertStringA) The string is inserted using the
5732 * src/paragraph.C (GetEndLabel) Gives a correct result for
5733 footnote paragraphs.
5735 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5737 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5739 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5740 front of PasteParagraph. Never insert a ' '. This should at least
5741 fix some cause for the segfaults that we have been experiencing,
5742 it also fixes backspace behaviour slightly. (Phu!)
5744 * src/support/lstrings.C (compare_no_case): some change to make it
5745 compile with gcc 2.95.2 and stdlibc++-v3
5747 * src/text2.C (MeltFootnoteEnvironment): change type o
5748 first_footnote_par_is_not_empty to bool.
5750 * src/lyxparagraph.h: make text private. Changes in other files
5752 (fitToSize): new function
5753 (setContentsFromPar): new function
5754 (clearContents): new function
5755 (SetChar): new function
5757 * src/paragraph.C (readSimpleWholeFile): deleted.
5759 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5760 the file, just use a simple string instead. Also read the file in
5761 a more maintainable manner.
5763 * src/text2.C (InsertStringA): deleted.
5764 (InsertStringB): deleted.
5766 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5768 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5769 RedoParagraphs from the doublespace handling part, just set status
5770 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5771 done, but perhaps not like this.)
5773 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5775 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5776 character when inserting an inset.
5778 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5780 * src/bufferparams.C (readLanguage): now takes "default" into
5783 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5784 also initialize the toplevel_keymap with the default bindings from
5787 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5789 * all files using lyxrc: have lyxrc as a real variable and not a
5790 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5793 * src/lyxrc.C: remove double call to defaultKeyBindings
5795 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5796 toolbar defauls using lyxlex. Remove enums, structs, functions
5799 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5800 toolbar defaults. Also store default keybindings in a map.
5802 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5803 storing the toolbar defaults without any xforms dependencies.
5805 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5806 applied. Changed to use iterators.
5808 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5810 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5811 systems that don't have LINGUAS set to begin with.
5813 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5815 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5816 the list by Dekel Tsur.
5818 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5820 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5821 * src/insets/form_graphics.C: ditto.
5823 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5825 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5827 * src/bufferparams.C (readLanguage): use the new language map
5829 * src/intl.C (InitKeyMapper): use the new language map
5831 * src/lyx_gui.C (create_forms): use the new language map
5833 * src/language.[Ch]: New files. Used for holding the information
5834 about each language. Now! Use this new language map enhance it and
5835 make it really usable for our needs.
5837 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5839 * screen.C (ShowCursor): Removed duplicate code.
5840 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5841 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5843 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5846 * src/text.C Added TransformChar method. Used for rendering Arabic
5847 text correctly (change the glyphs of the letter according to the
5848 position in the word)
5853 * src/lyxrc.C Added lyxrc command {language_command_begin,
5854 language_command_end,language_command_ltr,language_command_rtl,
5855 language_package} which allows the use of either arabtex or Omega
5858 * src/lyx_gui.C (init)
5860 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5861 to use encoding for menu fonts which is different than the encoding
5864 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5865 do not load the babel package.
5866 To write an English document with Hebrew/Arabic, change the document
5867 language to "english".
5869 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5870 (alphaCounter): changed to return char
5871 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5873 * lib/lyxrc.example Added examples for Hebrew/Arabic
5876 * src/layout.C Added layout command endlabeltype
5878 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5880 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5882 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5884 * src/mathed/math_delim.C (search_deco): return a
5885 math_deco_struct* instead of index.
5887 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5889 * All files with a USE_OSTREAM_ONLY within: removed all code that
5890 was unused when USE_OSTREAM_ONLY is defined.
5892 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5893 of any less. Removed header and using.
5895 * src/text.C (GetVisibleRow): draw the string "Page Break
5896 (top/bottom)" on screen when drawing a pagebreak line.
5898 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5900 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5902 * src/mathed/math_macro.C (draw): do some cast magic.
5905 * src/mathed/math_defs.h: change byte* argument to byte const*.
5907 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5909 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5910 know it is right to return InsetFoot* too, but cxx does not like
5913 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5915 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5917 * src/mathed/math_delim.C: change == to proper assignment.
5919 2000-03-09 Juergen Vigna <jug@sad.it>
5921 * src/insets/insettext.C (setPos): fixed various cursor positioning
5922 problems (via mouse and cursor-keys)
5923 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5924 inset (still a small display problem but it works ;)
5926 * src/insets/insetcollapsable.C (draw): added button_top_y and
5927 button_bottom_y to have correct values for clicking on the inset.
5929 * src/support/lyxalgo.h: commented out 'using std::less'
5931 2000-03-08 Juergen Vigna <jug@sad.it>
5933 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5934 Button-Release event closes as it is alos the Release-Event
5937 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5939 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5941 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5942 can add multiple spaces in Scrap (literate programming) styles...
5943 which, by the way, is how I got hooked on LyX to begin with.
5945 * src/mathed/formula.C (Write): Added dummy variable to an
5946 inset::Latex() call.
5947 (Latex): Add free_spacing boolean to inset::Latex()
5949 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5951 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5952 virtual function to include the free_spacing boolean from
5953 the containing paragraph's style.
5955 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5956 Added free_spacing boolean arg to match inset.h
5958 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5959 Added free_spacing boolean arg to match inset.h
5961 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5962 Added free_spacing boolean and made sure that if in a free_spacing
5963 paragraph, that we output normal space if there is a protected space.
5965 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5966 Added free_spacing boolean arg to match inset.h
5968 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5969 Added free_spacing boolean arg to match inset.h
5971 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5972 Added free_spacing boolean arg to match inset.h
5974 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5975 Added free_spacing boolean arg to match inset.h
5977 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5978 Added free_spacing boolean arg to match inset.h
5980 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5981 free_spacing boolean arg to match inset.h
5983 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5984 Added free_spacing boolean arg to match inset.h
5986 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5987 Added free_spacing boolean arg to match inset.h
5989 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5990 Added free_spacing boolean arg to match inset.h
5992 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5993 Added free_spacing boolean arg to match inset.h
5995 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5996 Added free_spacing boolean arg to match inset.h
5998 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5999 free_spacing boolean arg to match inset.h
6001 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
6002 free_spacing boolean arg to match inset.h
6004 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
6005 ignore free_spacing paragraphs. The user's spaces are left
6008 * src/text.C (InsertChar): Fixed the free_spacing layout
6009 attribute behavior. Now, if free_spacing is set, you can
6010 add multiple spaces in a paragraph with impunity (and they
6011 get output verbatim).
6012 (SelectSelectedWord): Added dummy argument to inset::Latex()
6015 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6018 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6019 paragraph layouts now only input a simple space instead.
6020 Special character insets don't make any sense in free-spacing
6023 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6024 hard-spaces in the *input* file to simple spaces if the layout
6025 is free-spacing. This converts old files which had to have
6026 hard-spaces in free-spacing layouts where a simple space was
6028 (writeFileAscii): Added free_spacing check to pass to the newly
6029 reworked inset::Latex(...) methods. The inset::Latex() code
6030 ensures that hard-spaces in free-spacing paragraphs get output
6031 as spaces (rather than "~").
6033 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6035 * src/mathed/math_delim.C (draw): draw the empty placeholder
6036 delims with a onoffdash line.
6037 (struct math_deco_compare): struct that holds the "functors" used
6038 for the sort and the binary search in math_deco_table.
6039 (class init_deco_table): class used for initial sort of the
6041 (search_deco): use lower_bound to do a binary search in the
6044 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6046 * src/lyxrc.C: a small secret thingie...
6048 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6049 and to not flush the stream as often as it used to.
6051 * src/support/lyxalgo.h: new file
6052 (sorted): template function used for checking if a sequence is
6053 sorted or not. Two versions with and without user supplied
6054 compare. Uses same compare as std::sort.
6056 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6057 it and give warning on lyxerr.
6059 (struct compare_tags): struct with function operators used for
6060 checking if sorted, sorting and lower_bound.
6061 (search_kw): use lower_bound instead of manually implemented
6064 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6066 * src/insets/insetcollapsable.h: fix Clone() declaration.
6067 * src/insets/insetfoot.h: ditto.
6069 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6071 2000-03-08 Juergen Vigna <jug@sad.it>
6073 * src/insets/lyxinset.h: added owner call which tells us if
6074 this inset is inside another inset. Changed also the return-type
6075 of Editable to an enum so it tells clearer what the return-value is.
6077 * src/insets/insettext.C (computeTextRows): fixed computing of
6078 textinsets which split automatically on more rows.
6080 * src/insets/insetert.[Ch]: changed this to be of BaseType
6083 * src/insets/insetfoot.[Ch]: added footnote inset
6085 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6086 collapsable insets (like footnote, ert, ...)
6088 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6090 * src/lyxdraw.h: remvoe file
6092 * src/lyxdraw.C: remove file
6094 * src/insets/insettext.C: added <algorithm>.
6096 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6098 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6099 (matrix_cb): case MM_OK use string stream
6101 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6104 * src/mathed/math_macro.C (draw): use string stream
6105 (Metrics): use string stream
6107 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6108 directly to the ostream.
6110 * src/vspace.C (asString): use string stream.
6111 (asString): use string stream
6112 (asLatexString): use string stream
6114 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6115 setting Spacing::Other.
6117 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6118 sprintf when creating the stretch vale.
6120 * src/text2.C (alphaCounter): changed to return a string and to
6121 not use a static variable internally. Also fixed a one-off bug.
6122 (SetCounter): changed the drawing of the labels to use string
6123 streams instead of sprintf.
6125 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6126 manipulator to use a scheme that does not require library support.
6127 This is also the way it is done in the new GNU libstdc++. Should
6128 work with DEC cxx now.
6130 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6132 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6133 end. This fixes a bug.
6135 * src/mathed (all files concerned with file writing): apply the
6136 USE_OSTREAM_ONLY changes to mathed too.
6138 * src/support/DebugStream.h: make the constructor explicit.
6140 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6141 count and ostream squashed.
6143 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6145 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6147 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6148 ostringstream uses STL strings, and we might not.
6150 * src/insets/insetspecialchar.C: add using directive.
6151 * src/insets/insettext.C: ditto.
6153 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6155 * lib/layouts/seminar.layout: feeble attempt at a layout for
6156 seminar.cls, far from completet and could really use some looking
6157 at from people used to write layout files.
6159 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6160 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6161 a lot nicer and works nicely with ostreams.
6163 * src/mathed/formula.C (draw): a slightly different solution that
6164 the one posted to the list, but I think this one works too. (font
6165 size wrong in headers.)
6167 * src/insets/insettext.C (computeTextRows): some fiddling on
6168 Jürgens turf, added some comments that he should read.
6170 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6171 used and it gave compiler warnings.
6172 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6175 * src/lyx_gui.C (create_forms): do the right thing when
6176 show_banner is true/false.
6178 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6179 show_banner is false.
6181 * most file writing files: Now use iostreams to do almost all of
6182 the writing. Also instead of passing string &, we now use
6183 stringstreams. mathed output is still not adapted to iostreams.
6184 This change can be turned off by commenting out all the occurences
6185 of the "#define USE_OSTREAM_ONLY 1" lines.
6187 * src/WorkArea.C (createPixmap): don't output debug messages.
6188 (WorkArea): don't output debug messages.
6190 * lib/lyxrc.example: added a comment about the new variable
6193 * development/Code_rules/Rules: Added some more commente about how
6194 to build class interfaces and on how better encapsulation can be
6197 2000-03-03 Juergen Vigna <jug@sad.it>
6199 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6200 automatically with the width of the LyX-Window
6202 * src/insets/insettext.C (computeTextRows): fixed update bug in
6203 displaying text-insets (scrollvalues where not initialized!)
6205 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6207 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6208 id in the check of the result from lower_bound is not enough since
6209 lower_bound can return last too, and then res->id will not be a
6212 * all insets and some code that use them: I have conditionalized
6213 removed the Latex(string & out, ...) this means that only the
6214 Latex(ostream &, ...) will be used. This is a work in progress to
6215 move towards using streams for all output of files.
6217 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6220 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6222 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6223 routine (this fixes bug where greek letters were surrounded by too
6226 * src/support/filetools.C (findtexfile): change a bit the search
6227 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6228 no longer passed to kpsewhich, we may have to change that later.
6230 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6231 warning options to avoid problems with X header files (from Angus
6233 * acinclude.m4: regenerated.
6235 2000-03-02 Juergen Vigna <jug@sad.it>
6237 * src/insets/insettext.C (WriteParagraphData): Using the
6238 par->writeFile() function for writing paragraph-data.
6239 (Read): Using buffer->parseSingleLyXformat2Token()-function
6240 for parsing paragraph data!
6242 * src/buffer.C (readLyXformat2): removed all parse data and using
6243 the new parseSingleLyXformat2Token()-function.
6244 (parseSingleLyXformat2Token): added this function to parse (read)
6245 lyx-file-format (this is called also from text-insets now!)
6247 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6249 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6252 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6253 directly instead of going through a func. One very bad thing: a
6254 static LyXFindReplace, but I don't know where to place it.
6256 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6257 string instead of char[]. Also changed to static.
6258 (GetSelectionOrWordAtCursor): changed to static inline
6259 (SetSelectionOverLenChars): ditto.
6261 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6262 current_view and global variables. both classes has changed names
6263 and LyXFindReplace is not inherited from SearchForm.
6265 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6266 fl_form_search form.
6268 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6270 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6272 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6273 bound (from Kayvan).
6275 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6277 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6279 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6281 * some things that I should comment but the local pub says head to
6284 * comment out all code that belongs to the Roff code for Ascii
6285 export of tables. (this is unused)
6287 * src/LyXView.C: use correct type for global variable
6288 current_layout. (LyXTextClass::size_type)
6290 * some code to get the new insetgraphics closer to working I'd be
6291 grateful for any help.
6293 * src/BufferView2.C (insertInset): use the return type of
6294 NumberOfLayout properly. (also changes in other files)
6296 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6297 this as a test. I want to know what breaks because of this.
6299 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6301 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6303 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6304 to use a \makebox in the label, this allows proper justification
6305 with out using protected spaces or multiple hfills. Now it is
6306 "label" for left justified, "\hfill label\hfill" for center, and
6307 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6308 should be changed accordingly.
6310 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6312 * src/lyxtext.h: change SetLayout() to take a
6313 LyXTextClass::size_type instead of a char (when there is more than
6314 127 layouts in a class); also change type of copylayouttype.
6315 * src/text2.C (SetLayout): ditto.
6316 * src/LyXView.C (updateLayoutChoice): ditto.
6318 * src/LaTeX.C (scanLogFile): errors where the line number was not
6319 given just after the '!'-line were ignored (from Dekel Tsur).
6321 * lib/lyxrc.example: fix description of \date_insert_format
6323 * lib/layouts/llncs.layout: new layout, contributed by Martin
6326 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6328 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6329 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6330 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6331 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6332 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6333 paragraph.C, text.C, text2.C)
6335 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6337 * src/insets/insettext.C (LocalDispatch): remove extra break
6340 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6341 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6343 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6344 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6346 * src/insets/insetbib.h: move InsetBibkey::Holder and
6347 InsetCitation::Holder in public space.
6349 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6351 * src/insets/insettext.h: small change to get the new files from
6352 Juergen to compile (use "string", not "class string").
6354 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6355 const & as parameter to LocalDispatch, use LyXFont const & as
6356 paramter to some other func. This also had impacto on lyxinsets.h
6357 and the two mathed insets.
6359 2000-02-24 Juergen Vigna <jug@sad.it>
6362 * src/commandtags.h:
6364 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6368 * src/BufferView2.C: added/updated code for various inset-functions
6370 * src/insets/insetert.[Ch]: added implementation of InsetERT
6372 * src/insets/insettext.[Ch]: added implementation of InsetText
6374 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6375 (draw): added preliminary code for inset scrolling not finshed yet
6377 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6378 as it is in lyxfunc.C now
6380 * src/insets/lyxinset.h: Added functions for text-insets
6382 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6384 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6385 BufferView and reimplement the list as a queue put inside its own
6388 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6390 * several files: use the new interface to the "updateinsetlist"
6392 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6394 (work_area_handler): call BufferView::trippleClick on trippleclick.
6396 * src/BufferView.C (doubleClick): new function, selects word on
6398 (trippleClick): new function, selects line on trippleclick.
6400 2000-02-22 Allan Rae <rae@lyx.org>
6402 * lib/bind/xemacs.bind: buffer-previous not supported
6404 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6406 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6409 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6411 * src/bufferlist.C: get rid of current_view from this file
6413 * src/spellchecker.C: get rid of current_view from this file
6415 * src/vspace.C: get rid of current_view from this file
6416 (inPixels): added BufferView parameter for this func
6417 (asLatexCommand): added a BufferParams for this func
6419 * src/text.C src/text2.C: get rid of current_view from these
6422 * src/lyxfont.C (getFontDirection): move this function here from
6425 * src/bufferparams.C (getDocumentDirection): move this function
6428 * src/paragraph.C (getParDirection): move this function here from
6430 (getLetterDirection): ditto
6432 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6434 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6435 resize due to wrong pixmap beeing used. Also took the opurtunity
6436 to make the LyXScreen stateless on regard to WorkArea and some
6437 general cleanup in the same files.
6439 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6441 * src/Makefile.am: add missing direction.h
6443 * src/PainterBase.h: made the width functions const.
6445 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6448 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6450 * src/insets/insetlatexaccent.C (draw): make the accents draw
6451 better, at present this will only work well with iso8859-1.
6453 * several files: remove the old drawing code, now we use the new
6456 * several files: remove support for mono_video, reverse_video and
6459 2000-02-17 Juergen Vigna <jug@sad.it>
6461 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6462 int ** as we have to return the pointer, otherwise we have only
6463 NULL pointers in the returning function.
6465 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6467 * src/LaTeX.C (operator()): quote file name when running latex.
6469 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6471 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6472 (bubble tip), this removes our special handling of this.
6474 * Remove all code that is unused now that we have the new
6475 workarea. (Code that are not active when NEW_WA is defined.)
6477 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6479 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6481 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6482 nonexisting layout; correctly redirect obsoleted layouts.
6484 * lib/lyxrc.example: document \view_dvi_paper_option
6486 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6489 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6490 (PreviewDVI): handle the view_dvi_paper_option variable.
6491 [Both from Roland Krause]
6493 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6495 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6496 char const *, int, LyXFont)
6497 (text(int, int, string, LyXFont)): ditto
6499 * src/text.C (InsertCharInTable): attempt to fix the double-space
6500 feature in tables too.
6501 (BackspaceInTable): ditto.
6502 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6504 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6506 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6508 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6509 newly found text in textcache to this.
6510 (buffer): set the owner of the text put into the textcache to 0
6512 * src/insets/figinset.C (draw): fixed the drawing of figures with
6515 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6516 drawing of mathframe, hfills, protected space, table lines. I have
6517 now no outstanding drawing problems with the new Painter code.
6519 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6521 * src/PainterBase.C (ellipse, circle): do not specify the default
6524 * src/LColor.h: add using directive.
6526 * src/Painter.[Ch]: change return type of methods from Painter& to
6527 PainterBase&. Add a using directive.
6529 * src/WorkArea.C: wrap xforms callbacks in C functions
6532 * lib/layouts/foils.layout: font fix and simplifications from Carl
6535 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6537 * a lot of files: The Painter, LColor and WorkArea from the old
6538 devel branch has been ported to lyx-devel. Some new files and a
6539 lot of #ifdeffed code. The new workarea is enabled by default, but
6540 if you want to test the new Painter and LColor you have to compile
6541 with USE_PAINTER defined (do this in config.h f.ex.) There are
6542 still some rought edges, and I'd like some help to clear those
6543 out. It looks stable (loads and displays the Userguide very well).
6546 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6548 * src/buffer.C (pop_tag): revert to the previous implementation
6549 (use a global variable for both loops).
6551 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6553 * src/lyxrc.C (LyXRC): change slightly default date format.
6555 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6556 there is an English text with a footnote that starts with a Hebrew
6557 paragraph, or vice versa.
6558 (TeXFootnote): ditto.
6560 * src/text.C (LeftMargin): allow for negative values for
6561 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6564 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6565 for input encoding (cyrillic)
6567 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6569 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6572 * src/toolbar.C (set): ditto
6573 * src/insets/insetbib.C (create_form_citation_form): ditto
6575 * lib/CREDITS: added Dekel Tsur.
6577 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6578 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6579 hebrew supports files from Dekel Tsur.
6581 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6582 <tzafrir@technion.ac.il>
6584 * src/lyxrc.C: put \date_insert_format at the right place.
6586 * src/buffer.C (makeLaTeXFile): fix the handling of
6587 BufferParams::sides when writing out latex files.
6589 * src/BufferView2.C: add a "using" directive.
6591 * src/support/lyxsum.C (sum): when we use lyxstring,
6592 ostringstream::str needs an additional .c_str().
6594 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6596 * src/support/filetools.C (ChangeExtension): patch from Etienne
6599 * src/TextCache.C (show): remove const_cast and make second
6600 parameter non-const LyXText *.
6602 * src/TextCache.h: use non const LyXText in show.
6604 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6607 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6609 * src/support/lyxsum.C: rework to be more flexible.
6611 * several places: don't check if a pointer is 0 if you are going
6614 * src/text.C: remove some dead code.
6616 * src/insets/figinset.C: remove some dead code
6618 * src/buffer.C: move the BufferView funcs to BufferView2.C
6619 remove all support for insetlatexdel
6620 remove support for oldpapersize stuff
6621 made some member funcs const
6623 * src/kbmap.C: use a std::list to store the bindings in.
6625 * src/BufferView2.C: new file
6627 * src/kbsequence.[Ch]: new files
6629 * src/LyXAction.C + others: remove all trace of buffer-previous
6631 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6632 only have one copy in the binary of this table.
6634 * hebrew patch: moved some functions from LyXText to more
6635 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6637 * several files: remove support for XForms older than 0.88
6639 remove some #if 0 #endif code
6641 * src/TextCache.[Ch]: new file. Holds the textcache.
6643 * src/BufferView.C: changes to use the new TextCache interface.
6644 (waitForX): remove the now unused code.
6646 * src/BackStack.h: remove some commented code
6648 * lib/bind/emacs.bind: remove binding for buffer-previous
6650 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6652 * applied the hebrew patch.
6654 * src/lyxrow.h: make sure that all Row variables are initialized.
6656 * src/text2.C (TextHandleUndo): comment out a delete, this might
6657 introduce a memory leak, but should also help us to not try to
6658 read freed memory. We need to look at this one.
6660 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6661 (LyXParagraph): initalize footnotekind.
6663 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6664 forgot this when applying the patch. Please heed the warnings.
6666 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6667 (aka. reformat problem)
6669 * src/bufferlist.C (exists): made const, and use const_iterator
6670 (isLoaded): new func.
6671 (release): use std::find to find the correct buffer.
6673 * src/bufferlist.h: made getState a const func.
6674 made empty a const func.
6675 made exists a const func.
6678 2000-02-01 Juergen Vigna <jug@sad.it>
6680 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6682 * po/it.po: updated a bit the italian po file and also changed the
6683 'file nuovo' for newfile to 'filenuovo' without a space, this did
6686 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6687 for the new insert_date command.
6689 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6690 from jdblair, to insert a date into the current text conforming to
6691 a strftime format (for now only considering the locale-set and not
6692 the document-language).
6694 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6696 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6697 Bounds Read error seen by purify. The problem was that islower is
6698 a macros which takes an unsigned char and uses it as an index for
6699 in array of characters properties (and is thus subject to the
6703 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6704 correctly the paper sides radio buttons.
6705 (UpdateDocumentButtons): ditto.
6707 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6709 * src/kbmap.C (getsym + others): change to return unsigned int,
6710 returning a long can give problems on 64 bit systems. (I assume
6711 that int is 32bit on 64bit systems)
6713 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6715 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6716 LyXLookupString to be zero-terminated. Really fixes problems seen
6719 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6721 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6722 write a (char*)0 to the lyxerr stream.
6724 * src/lastfiles.C: move algorithm before the using statemets.
6726 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6728 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6729 complains otherwise).
6730 * src/table.C: ditto
6732 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6735 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6736 that I removed earlier... It is really needed.
6738 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6740 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6742 * INSTALL: update xforms home page URL.
6744 * lib/configure.m4: fix a bug with unreadable layout files.
6746 * src/table.C (calculate_width_of_column): add "using std::max"
6749 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6751 * several files: marked several lines with "DEL LINE", this is
6752 lines that can be deleted without changing anything.
6753 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6754 checks this anyway */
6757 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6759 * src/DepTable.C (update): add a "+" at the end when the checksum
6760 is different. (debugging string only)
6762 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6763 the next inset to not be displayed. This should also fix the list
6764 of labels in the "Insert Crossreference" dialog.
6766 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6768 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6769 when regex was not found.
6771 * src/support/lstrings.C (lowercase): use handcoded transform always.
6774 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6775 old_cursor.par->prev could be 0.
6777 * several files: changed post inc/dec to pre inc/dec
6779 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6780 write the lastfiles to file.
6782 * src/BufferView.C (buffer): only show TextCache info when debugging
6784 (resizeCurrentBuffer): ditto
6785 (workAreaExpose): ditto
6787 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6789 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6791 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6792 a bit better by removing the special case for \i and \j.
6794 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6796 * src/lyx_main.C (easyParse): remove test for bad comand line
6797 options, since this broke all xforms-related parsing.
6799 * src/kbmap.C (getsym): set return type to unsigned long, as
6800 declared in header. On an alpha, long is _not_ the same as int.
6802 * src/support/LOstream.h: add a "using std::flush;"
6804 * src/insets/figinset.C: ditto.
6806 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6808 * src/bufferlist.C (write): use blinding fast file copy instead of
6809 "a char at a time", now we are doing it the C++ way.
6811 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6812 std::list<int> instead.
6813 (addpidwait): reflect move to std::list<int>
6814 (sigchldchecker): ditto
6816 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6819 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6820 that obviously was wrong...
6822 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6823 c, this avoids warnings with purify and islower.
6825 * src/insets/figinset.C: rename struct queue to struct
6826 queue_element and rewrite to use a std::queue. gsqueue is now a
6827 std::queue<queue_element>
6828 (runqueue): reflect move to std::queue
6831 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6832 we would get "1" "0" instead of "true" "false. Also make the tostr
6835 2000-01-21 Juergen Vigna <jug@sad.it>
6837 * src/buffer.C (writeFileAscii): Disabled code for special groff
6838 handling of tabulars till I fix this in table.C
6840 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6842 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6844 * src/support/lyxlib.h: ditto.
6846 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6848 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6849 and 'j' look better. This might fix the "macron" bug that has been
6852 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6853 functions as one template function. Delete the old versions.
6855 * src/support/lyxsum.C: move using std::ifstream inside
6858 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6861 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6863 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6865 * src/insets/figinset.C (InitFigures): use new instead of malloc
6866 to allocate memory for figures and bitmaps.
6867 (DoneFigures): use delete[] instead of free to deallocate memory
6868 for figures and bitmaps.
6869 (runqueue): use new to allocate
6870 (getfigdata): use new/delete[] instead of malloc/free
6871 (RegisterFigure): ditto
6873 * some files: moved some declarations closer to first use, small
6874 whitespace changes use preincrement instead of postincrement where
6875 it does not make a difference.
6877 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6878 step on the way to use stl::containers for key maps.
6880 * src/bufferlist.h: add a typedef for const_iterator and const
6881 versions of begin and end.
6883 * src/bufferlist.[Ch]: change name of member variable _state to
6884 state_. (avoid reserved names)
6886 (getFileNames): returns the filenames of the buffers in a vector.
6888 * configure.in (ALL_LINGUAS): added ro
6890 * src/support/putenv.C: new file
6892 * src/support/mkdir.C: new file
6894 2000-01-20 Allan Rae <rae@lyx.org>
6896 * lib/layouts/IEEEtran.layout: Added several theorem environments
6898 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6899 couple of minor additions.
6901 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6902 (except for those in footnotes of course)
6904 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6906 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6908 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6909 std::sort and std::lower_bound instead of qsort and handwritten
6911 (struct compara): struct that holds the functors used by std::sort
6912 and std::lower_bound in MathedLookupBOP.
6914 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6916 * src/support/LAssert.h: do not do partial specialization. We do
6919 * src/support/lyxlib.h: note that lyx::getUserName() and
6920 lyx::date() are not in use right now. Should these be suppressed?
6922 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6923 (makeLinuxDocFile): do not put date and user name in linuxdoc
6926 * src/support/lyxlib.h (kill): change first argument to long int,
6927 since that's what solaris uses.
6929 * src/support/kill.C (kill): fix declaration to match prototype.
6931 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6932 actually check whether namespaces are supported. This is not what
6935 * src/support/lyxsum.C: add a using directive.
6937 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6939 * src/support/kill.C: if we have namespace support we don't have
6940 to include lyxlib.h.
6942 * src/support/lyxlib.h: use namespace lyx if supported.
6944 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6946 * src/support/date.C: new file
6948 * src/support/chdir.C: new file
6950 * src/support/getUserName.C: new file
6952 * src/support/getcwd.C: new file
6954 * src/support/abort.C: new file
6956 * src/support/kill.C: new file
6958 * src/support/lyxlib.h: moved all the functions in this file
6959 insede struct lyx. Added also kill and abort to this struct. This
6960 is a way to avoid the "kill is not defined in <csignal>", we make
6961 C++ wrappers for functions that are not ANSI C or ANSI C++.
6963 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6964 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6965 lyx it has been renamed to sum.
6967 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6969 * src/text.C: add using directives for std::min and std::max.
6971 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6973 * src/texrow.C (getIdFromRow): actually return something useful in
6974 id and pos. Hopefully fixes the bug with positionning of errorbox
6977 * src/lyx_main.C (easyParse): output an error and exit if an
6978 incorrect command line option has been given.
6980 * src/spellchecker.C (ispell_check_word): document a memory leak.
6982 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6983 where a "struct utimbuf" is allocated with "new" and deleted with
6986 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6988 * src/text2.C (CutSelection): don't delete double spaces.
6989 (PasteSelection): ditto
6990 (CopySelection): ditto
6992 * src/text.C (Backspace): don't delete double spaces.
6994 * src/lyxlex.C (next): fix a bug that were only present with
6995 conformant std::istream::get to read comment lines, use
6996 std::istream::getline instead. This seems to fix the problem.
6998 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7000 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
7001 allowed to insert space before space" editing problem. Please read
7002 commends at the beginning of the function. Comments about usage
7005 * src/text.C (InsertChar): fix for the "not allowed to insert
7006 space before space" editing problem.
7008 * src/text2.C (DeleteEmptyParagraphMechanism): when
7009 IsEmptyTableRow can only return false this last "else if" will
7010 always be a no-op. Commented out.
7012 * src/text.C (RedoParagraph): As far as I can understand tmp
7013 cursor is not really needed.
7015 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7016 present it could only return false anyway.
7017 (several functions): Did something not so smart...added a const
7018 specifier on a lot of methods.
7020 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7021 and add a tmp->text.resize. The LyXParagraph constructor does the
7023 (BreakParagraphConservative): ditto
7025 * src/support/path.h (Path): add a define so that the wrong usage
7026 "Path("/tmp") will be flagged as a compilation error:
7027 "`unnamed_Path' undeclared (first use this function)"
7029 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7031 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7032 which was bogus for several reasons.
7034 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7038 * autogen.sh: do not use "type -path" (what's that anyway?).
7040 * src/support/filetools.C (findtexfile): remove extraneous space
7041 which caused a kpsewhich warning (at least with kpathsea version
7044 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7046 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7048 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7050 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7052 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7054 * src/paragraph.C (BreakParagraph): do not reserve space on text
7055 if we don't need to (otherwise, if pos_end < pos, we end up
7056 reserving huge amounts of memory due to bad unsigned karma).
7057 (BreakParagraphConservative): ditto, although I have not seen
7058 evidence the bug can happen here.
7060 * src/lyxparagraph.h: add a using std::list.
7062 2000-01-11 Juergen Vigna <jug@sad.it>
7064 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7067 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7069 * src/vc-backend.C (doVCCommand): change to be static and take one
7070 more parameter: the path to chdir too be fore executing the command.
7071 (retrive): new function equiv to "co -r"
7073 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7074 file_not_found_hook is true.
7076 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7078 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7079 if a file is readwrite,readonly...anything else.
7081 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7083 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7084 (CreatePostscript): name change from MenuRunDVIPS (or something)
7085 (PreviewPostscript): name change from MenuPreviewPS
7086 (PreviewDVI): name change from MenuPreviewDVI
7088 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7089 \view_pdf_command., \pdf_to_ps_command
7091 * lib/configure.m4: added search for PDF viewer, and search for
7092 PDF to PS converter.
7093 (lyxrc.defaults output): add \pdflatex_command,
7094 \view_pdf_command and \pdf_to_ps_command.
7096 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7098 * src/bufferlist.C (write): we don't use blocksize for anything so
7101 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7103 * src/support/block.h: disable operator T* (), since it causes
7104 problems with both compilers I tried. See comments in the file.
7106 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7109 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7110 variable LYX_DIR_10x to LYX_DIR_11x.
7112 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7114 * INSTALL: document --with-lyxname.
7117 * configure.in: new configure flag --with-lyxname which allows to
7118 choose the name under which lyx is installed. Default is "lyx", of
7119 course. It used to be possible to do this with --program-suffix,
7120 but the later has in fact a different meaning for autoconf.
7122 * src/support/lstrings.h (lstrchr): reformat a bit.
7124 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7125 * src/mathed/math_defs.h: ditto.
7127 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7129 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7130 true, decides if we create a backup file or not when saving. New
7131 tag and variable \pdf_mode, defaults to false. New tag and
7132 variable \pdflatex_command, defaults to pdflatex. New tag and
7133 variable \view_pdf_command, defaults to xpdf. New tag and variable
7134 \pdf_to_ps_command, defaults to pdf2ps.
7136 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7138 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7139 does not have a BufferView.
7140 (unlockInset): ditto + don't access the_locking_inset if the
7141 buffer does not have a BufferView.
7143 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7144 certain circumstances so that we don't continue a keyboard
7145 operation long after the key was released. Try f.ex. to load a
7146 large document, press PageDown for some seconds and then release
7147 it. Before this change the document would contine to scroll for
7148 some time, with this change it stops imidiatly.
7150 * src/support/block.h: don't allocate more space than needed. As
7151 long as we don't try to write to the arr[x] in a array_type arr[x]
7152 it is perfectly ok. (if you write to it you might segfault).
7153 added operator value_type*() so that is possible to pass the array
7154 to functions expecting a C-pointer.
7156 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7159 * intl/*: updated to gettext 0.10.35, tried to add our own
7160 required modifications. Please verify.
7162 * po/*: updated to gettext 0.10.35, tried to add our own required
7163 modifications. Please verify.
7165 * src/support/lstrings.C (tostr): go at fixing the problem with
7166 cxx and stringstream. When stringstream is used return
7167 oss.str().c_str() so that problems with lyxstring and basic_string
7168 are avoided. Note that the best solution would be for cxx to use
7169 basic_string all the way, but it is not conformant yet. (it seems)
7171 * src/lyx_cb.C + other files: moved several global functions to
7172 class BufferView, some have been moved to BufferView.[Ch] others
7173 are still located in lyx_cb.C. Code changes because of this. (part
7174 of "get rid of current_view project".)
7176 * src/buffer.C + other files: moved several Buffer functions to
7177 class BufferView, the functions are still present in buffer.C.
7178 Code changes because of this.
7180 * config/lcmessage.m4: updated to most recent. used when creating
7183 * config/progtest.m4: updated to most recent. used when creating
7186 * config/gettext.m4: updated to most recent. applied patch for
7189 * config/gettext.m4.patch: new file that shows what changes we
7190 have done to the local copy of gettext.m4.
7192 * config/libtool.m4: new file, used in creation of acinclude.m4
7194 * config/lyxinclude.m4: new file, this is the lyx created m4
7195 macros, used in making acinclude.m4.
7197 * autogen.sh: GNU m4 discovered as a separate task not as part of
7198 the lib/configure creation.
7199 Generate acinlucde from files in config. Actually cat
7200 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7201 easier to upgrade .m4 files that really are external.
7203 * src/Spacing.h: moved using std::istringstream to right after
7204 <sstream>. This should fix the problem seen with some compilers.
7206 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7208 * src/lyx_cb.C: began some work to remove the dependency a lot of
7209 functions have on BufferView::text, even if not really needed.
7210 (GetCurrentTextClass): removed this func, it only hid the
7213 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7214 forgot this in last commit.
7216 * src/Bullet.C (bulletEntry): use static char const *[] for the
7217 tables, becuase of this the return arg had to change to string.
7219 (~Bullet): removed unneeded destructor
7221 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7222 (insetSleep): moved from Buffer
7223 (insetWakeup): moved from Buffer
7224 (insetUnlock): moved from Buffer
7226 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7227 from Buffer to BufferView.
7229 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7231 * config/ltmain.sh: updated to version 1.3.4 of libtool
7233 * config/ltconfig: updated to version 1.3.4 of libtool
7235 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7238 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7239 Did I get that right?
7241 * src/lyxlex.h: add a "using" directive or two.
7242 * src/Spacing.h: ditto.
7243 * src/insets/figinset.C: ditto.
7244 * src/support/filetools.C: ditto.
7245 * src/support/lstrings.C: ditto.
7246 * src/BufferView.C: ditto.
7247 * src/bufferlist.C: ditto.
7248 * src/lyx_cb.C: ditto.
7249 * src/lyxlex.C: ditto.
7251 * NEWS: add some changes for 1.1.4.
7253 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7255 * src/BufferView.C: first go at a TextCache to speed up switching
7258 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7260 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7261 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7262 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7263 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7266 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7267 members of the struct are correctly initialized to 0 (detected by
7269 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7270 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7272 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7273 pidwait, since it was allocated with "new". This was potentially
7274 very bad. Thanks to Michael Schmitt for running purify for us.
7277 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7279 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7281 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7283 1999-12-30 Allan Rae <rae@lyx.org>
7285 * lib/templates/IEEEtran.lyx: minor change
7287 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7288 src/mathed/formula.C (LocalDispatch): askForText changes
7290 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7291 know when a user has cancelled input. Fixes annoying problems with
7292 inserting labels and version control.
7294 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7296 * src/support/lstrings.C (tostr): rewritten to use strstream and
7299 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7301 * src/support/filetools.C (IsFileWriteable): use fstream to check
7302 (IsDirWriteable): use fileinfo to check
7304 * src/support/filetools.h (FilePtr): whole class deleted
7306 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7308 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7310 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7312 * src/bufferlist.C (write): use ifstream and ofstream instead of
7315 * src/Spacing.h: use istrstream instead of sscanf
7317 * src/mathed/math_defs.h: change first arg to istream from FILE*
7319 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7321 * src/mathed/math_parser.C: have yyis to be an istream
7322 (LexGetArg): use istream (yyis)
7324 (mathed_parse): ditto
7325 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7327 * src/mathed/formula.C (Read): rewritten to use istream
7329 * src/mathed/formulamacro.C (Read): rewritten to use istream
7331 * src/lyxlex.h (~LyXLex): deleted desturctor
7332 (getStream): new function, returns an istream
7333 (getFile): deleted funtion
7334 (IsOK): return is.good();
7336 * src/lyxlex.C (LyXLex): delete file and owns_file
7337 (setFile): open an filebuf and assign that to a istream instead of
7339 (setStream): new function, takes an istream as arg.
7340 (setFile): deleted function
7341 (EatLine): rewritten us use istream instead of FILE*
7345 * src/table.C (LyXTable): use istream instead of FILE*
7346 (Read): rewritten to take an istream instead of FILE*
7348 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7350 * src/buffer.C (Dispatch): remove an extraneous break statement.
7352 * src/support/filetools.C (QuoteName): change to do simple
7353 'quoting'. More work is necessary. Also changed to do nothing
7354 under emx (needs fix too).
7355 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7357 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7358 config.h.in to the AC_DEFINE_UNQUOTED() call.
7359 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7360 needs char * as argument (because Solaris 7 declares it like
7363 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7364 remove definition of BZERO.
7366 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7368 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7369 defined, "lyxregex.h" if not.
7371 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7373 (REGEX): new variable that is set to regex.c lyxregex.h when
7374 AM_CONDITIONAL USE_REGEX is set.
7375 (libsupport_la_SOURCES): add $(REGEX)
7377 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7380 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7383 * configure.in: add call to LYX_REGEX
7385 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7386 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7388 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7390 * lib/bind/fi_menus.bind: new file, from
7391 pauli.virtanen@saunalahti.fi.
7393 * src/buffer.C (getBibkeyList): pass the parameter delim to
7394 InsetInclude::getKeys and InsetBibtex::getKeys.
7396 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7397 is passed to Buffer::getBibkeyList
7399 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7400 instead of the hardcoded comma.
7402 * src/insets/insetbib.C (getKeys): make sure that there are not
7403 leading blanks in bibtex keys. Normal latex does not care, but
7404 harvard.sty seems to dislike blanks at the beginning of citation
7405 keys. In particular, the retturn value of the function is
7407 * INSTALL: make it clear that libstdc++ is needed and that gcc
7408 2.7.x probably does not work.
7410 * src/support/filetools.C (findtexfile): make debug message go to
7412 * src/insets/insetbib.C (getKeys): ditto
7414 * src/debug.C (showTags): make sure that the output is correctly
7417 * configure.in: add a comment for TWO_COLOR_ICON define.
7419 * acconfig.h: remove all the entries that already defined in
7420 configure.in or acinclude.m4.
7422 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7423 to avoid user name, date and copyright.
7425 1999-12-21 Juergen Vigna <jug@sad.it>
7427 * src/table.C (Read): Now read bogus row format informations
7428 if the format is < 5 so that afterwards the table can
7429 be read by lyx but without any format-info. Fixed the
7430 crash we experienced when not doing this.
7432 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7434 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7435 (RedoDrawingOfParagraph): ditto
7436 (RedoParagraphs): ditto
7437 (RemoveTableRow): ditto
7439 * src/text.C (Fill): rename arg paperwidth -> paper_width
7441 * src/buffer.C (insertLyXFile): rename var filename -> fname
7442 (writeFile): rename arg filename -> fname
7443 (writeFileAscii): ditto
7444 (makeLaTeXFile): ditto
7445 (makeLinuxDocFile): ditto
7446 (makeDocBookFile): ditto
7448 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7451 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7453 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7456 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7457 compiled by a C compiler not C++.
7459 * src/layout.h (LyXTextClass): added typedef for const_iterator
7460 (LyXTextClassList): added typedef for const_iterator + member
7461 functions begin and end.
7463 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7464 iterators to fill the choice_class.
7465 (updateLayoutChoice): rewritten to use iterators to fill the
7466 layoutlist in the toolbar.
7468 * src/BufferView.h (BufferView::work_area_width): removed unused
7471 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7473 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7474 (sgmlCloseTag): ditto
7476 * src/support/lstrings.h: return type of countChar changed to
7479 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7480 what version of this func to use. Also made to return unsigned int.
7482 * configure.in: call LYX_STD_COUNT
7484 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7485 conforming std::count.
7487 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7489 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7490 and a subscript would give bad display (patch from Dekel Tsur
7491 <dekel@math.tau.ac.il>).
7493 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7495 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7498 * src/chset.h: add a few 'using' directives
7500 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7501 triggered when no buffer is active
7503 * src/layout.C: removed `break' after `return' in switch(), since
7506 * src/lyx_main.C (init): make sure LyX can be ran in place even
7507 when libtool has done its magic with shared libraries. Fix the
7508 test for the case when the system directory has not been found.
7510 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7511 name for the latex file.
7512 (MenuMakeHTML): ditto
7514 * src/buffer.h: add an optional boolean argument, which is passed
7517 1999-12-20 Allan Rae <rae@lyx.org>
7519 * lib/templates/IEEEtran.lyx: small correction and update.
7521 * configure.in: Attempted to use LYX_PATH_HEADER
7523 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7525 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7526 input from JMarc. Now use preprocessor to find the header.
7527 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7528 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7529 LYX_STL_STRING_FWD. See comments in file.
7531 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7533 * The global MiniBuffer * minibuffer variable is dead.
7535 * The global FD_form_main * fd_form_main variable is dead.
7537 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7539 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7541 * src/table.h: add the LOstream.h header
7542 * src/debug.h: ditto
7544 * src/LyXAction.h: change the explaination of the ReadOnly
7545 attribute: is indicates that the function _can_ be used.
7547 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7550 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7552 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7558 * src/paragraph.C (GetWord): assert on pos>=0
7561 * src/support/lyxstring.C: condition the use of an invariant on
7563 * src/support/lyxstring.h: ditto
7565 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7566 Use LAssert.h instead of plain assert().
7568 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7570 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7571 * src/support/filetools.C: ditto
7573 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7576 * INSTALL: document the new configure flags
7578 * configure.in: suppress --with-debug; add --enable-assertions
7580 * acinclude.m4: various changes in alignment of help strings.
7582 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7584 * src/kbmap.C: commented out the use of the hash map in kb_map,
7585 beginning of movement to a stl::container.
7587 * several files: removed code that was not in effect when
7588 MOVE_TEXT was defined.
7590 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7591 for escaping should not be used. We can discuss if the string
7592 should be enclosed in f.ex. [] instead of "".
7594 * src/trans_mgr.C (insert): use the new returned value from
7595 encodeString to get deadkeys and keymaps done correctly.
7597 * src/chset.C (encodeString): changed to return a pair, to tell
7598 what to use if we know the string.
7600 * src/lyxscreen.h (fillArc): new function.
7602 * src/FontInfo.C (resize): rewritten to use more std::string like
7603 structore, especially string::replace.
7605 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7608 * configure.in (chmod +x some scripts): remove config/gcc-hack
7610 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7612 * src/buffer.C (writeFile): change once again the top comment in a
7613 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7614 instead of an hardcoded version number.
7615 (makeDocBookFile): ditto
7617 * src/version.h: add new define LYX_DOCVERSION
7619 * po/de.po: update from Pit Sütterlin
7620 * lib/bind/de_menus.bind: ditto.
7622 * src/lyxfunc.C (Dispatch): call MenuExport()
7623 * src/buffer.C (Dispatch): ditto
7625 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7626 LyXFunc::Dispatch().
7627 (MenuExport): new function, moved from
7628 LyXFunc::Dispatch().
7630 * src/trans_mgr.C (insert): small cleanup
7631 * src/chset.C (loadFile): ditto
7633 * lib/kbd/iso8859-1.cdef: add missing backslashes
7635 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7637 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7638 help with placing the manually drawn accents better.
7640 (Draw): x2 and hg changed to float to minimize rounding errors and
7641 help place the accents better.
7643 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7644 unsigned short to char is just wrong...cast the char to unsigned
7645 char instead so that the two values can compare sanely. This
7646 should also make the display of insetlatexaccents better and
7647 perhaps also some other insets.
7649 (lbearing): new function
7652 1999-12-15 Allan Rae <rae@lyx.org>
7654 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7655 header that provides a wrapper around the very annoying SGI STL header
7658 * src/support/lyxstring.C, src/LString.h:
7659 removed old SGI-STL-compatability attempts.
7661 * configure.in: Use LYX_STL_STRING_FWD.
7663 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7664 stl_string_fwd.h is around and try to determine it's location.
7665 Major improvement over previous SGI STL 3.2 compatability.
7666 Three small problems remain with this function due to my zero
7667 knowledge of autoconf. JMarc and lgb see the comments in the code.
7669 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7671 * src/broken_const.h, config/hack-gcc, config/README: removed
7673 * configure.in: remove --with-gcc-hack option; do not call
7676 * INSTALL: remove documentation of --with-broken-const and
7679 * acconfig.h: remove all trace of BROKEN_CONST define
7681 * src/buffer.C (makeDocBookFile): update version number in output
7683 (SimpleDocBookOnePar): fix an assert when trying to a character
7684 access beyond string length
7687 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7689 * po/de.po: fix the Export menu
7691 * lyx.man: update the description of -dbg
7693 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7694 (commandLineHelp): updated
7695 (easyParse): show list of available debug levels if -dbg is passed
7698 * src/Makefile.am: add debug.C
7700 * src/debug.h: moved some code to debug.C
7702 * src/debug.C: new file. Contains code to set and show debug
7705 * src/layout.C: remove 'break' after 'continue' in switch
7706 statements, since these cannot be reached.
7708 1999-12-13 Allan Rae <rae@lyx.org>
7710 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7711 (in_word_set): hash() -> math_hash()
7713 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7715 * acconfig.h: Added a test for whether we are using exceptions in the
7716 current compilation run. If so USING_EXCEPTIONS is defined.
7718 * config.in: Check for existance of stl_string_fwd.h
7719 * src/LString.h: If compiling --with-included-string and SGI's
7720 STL version 3.2 is present (see above test) we need to block their
7721 forward declaration of string and supply a __get_c_string().
7722 However, it turns out this is only necessary if compiling with
7723 exceptions enabled so I've a bit more to add yet.
7725 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7726 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7727 src/support/LRegex.h, src/undo.h:
7728 Shuffle the order of the included files a little to ensure that
7729 LString.h gets included before anything that includes stl_string_fwd.h
7731 * src/support/lyxstring.C: We need to #include LString.h instead of
7732 lyxstring.h to get the necessary definition of __get_c_string.
7733 (__get_c_string): New function. This is defined static just like SGI's
7734 although why they need to do this I'm not sure. Perhaps it should be
7735 in lstrings.C instead.
7737 * lib/templates/IEEEtran.lyx: New template file.
7739 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7741 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7742 * intl/Makefile.in (MKINSTALLDIRS): ditto
7744 * src/LyXAction.C (init): changed to hold the LFUN data in a
7745 automatic array in stead of in callso to newFunc, this speeds up
7746 compilation a lot. Also all the memory used by the array is
7747 returned when the init is completed.
7749 * a lot of files: compiled with -Wold-style-cast, changed most of
7750 the reported offenders to C++ style casts. Did not change the
7751 offenders in C files.
7753 * src/trans.h (Match): change argument type to unsigned int.
7755 * src/support/DebugStream.C: fix some types on the streambufs so
7756 that it works on a conforming implementation.
7758 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7760 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7762 * src/support/lyxstring.C: remove the inline added earlier since
7763 they cause a bunch of unsatisfied symbols when linking with dec
7764 cxx. Cxx likes to have the body of inlines at the place where they
7767 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7768 accessing negative bounds in array. This fixes the crash when
7769 inserting accented characters.
7770 * src/trans.h (Match): ditto
7772 * src/buffer.C (Dispatch): since this is a void, it should not try
7773 to return anything...
7775 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7777 * src/buffer.h: removed the two friends from Buffer. Some changes
7778 because of this. Buffer::getFileName and Buffer::setFileName
7779 renamed to Buffer::fileName() and Buffer::fileName(...).
7781 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7783 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7784 and Buffer::update(short) to BufferView. This move is currently
7785 controlled by a define MOVE_TEXT, this will be removed when all
7786 shows to be ok. This move paves the way for better separation
7787 between buffer contents and buffer view. One side effect is that
7788 the BufferView needs a rebreak when swiching buffers, if we want
7789 to avoid this we can add a cache that holds pointers to LyXText's
7790 that is not currently in use.
7792 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7795 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7797 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7799 * lyx_main.C: new command line option -x (or --execute) and
7800 -e (or --export). Now direct conversion from .lyx to .tex
7801 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7802 Unfortunately, X is still needed and the GUI pops up during the
7805 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7807 * src/Spacing.C: add a using directive to bring stream stuff into
7809 * src/paragraph.C: ditto
7810 * src/buffer.C: ditto
7812 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7813 from Lars' announcement).
7815 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7816 example files from Tino Meinen.
7818 1999-12-06 Allan Rae <rae@lyx.org>
7820 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7822 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7824 * src/support/lyxstring.C: added a lot of inline for no good
7827 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7828 latexWriteEndChanges, they were not used.
7830 * src/layout.h (operator<<): output operator for PageSides
7832 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7834 * some example files: loaded in LyX 1.0.4 and saved again to update
7835 certain constructs (table format)
7837 * a lot of files: did the change to use fstream/iostream for all
7838 writing of files. Done with a close look at Andre Poenitz's patch.
7840 * some files: whitespace changes.
7842 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7844 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7845 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7846 architecture, we provide our own. It is used unconditionnally, but
7847 I do not think this is a performance problem. Thanks to Angus
7848 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7849 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7851 (GetInset): use my_memcpy.
7855 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7856 it is easier to understand, but it uses less TeX-only constructs now.
7858 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7859 elements contain spaces
7861 * lib/configure: regenerated
7863 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7864 elements contain spaces; display the list of programs that are
7867 * autogen.sh: make sure lib/configure is executable
7869 * lib/examples/*: rename the tutorial examples to begin with the
7870 two-letters language code.
7872 * src/lyxfunc.C (getStatus): do not query current font if no
7875 * src/lyx_cb.C (RunScript): use QuoteName
7876 (MenuRunDvips): ditto
7877 (PrintApplyCB): ditto
7879 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7880 around argument, so that it works well with the current shell.
7881 Does not work properly with OS/2 shells currently.
7883 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7884 * src/LyXSendto.C (SendtoApplyCB): ditto
7885 * src/lyxfunc.C (Dispatch): ditto
7886 * src/buffer.C (runLaTeX): ditto
7887 (runLiterate): ditto
7888 (buildProgram): ditto
7890 * src/lyx_cb.C (RunScript): ditto
7891 (MenuMakeLaTeX): ditto
7893 * src/buffer.h (getLatexName): new method
7895 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7897 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7899 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7900 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7901 (create_math_panel): ditto
7903 * src/lyxfunc.C (getStatus): re-activate the code which gets
7904 current font and cursor; add test for export to html.
7906 * src/lyxrc.C (read): remove unreachable break statements; add a
7909 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7911 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7913 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7914 introduced by faulty regex.
7915 * src/buffer.C: ditto
7916 * src/lastfiles.C: ditto
7917 * src/paragraph.C: ditto
7918 * src/table.C: ditto
7919 * src/vspace.C: ditto
7920 * src/insets/figinset.C: ditto
7921 Note: most of these is absolutely harmless, except the one in
7922 src/mathed formula.C.
7924 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7926 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7927 operation, yielding correct results for the reLyX command.
7929 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7931 * src/support/filetools.C (ExpandPath): removed an over eager
7933 (ReplaceEnvironmentPath): ditto
7935 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7936 shows that we are doing something fishy in our code...
7940 * src/lyxrc.C (read): use a double switch trick to get more help
7941 from the compiler. (the same trick is used in layout.C)
7942 (write): new function. opens a ofstream and pass that to output
7943 (output): new function, takes a ostream and writes the lyxrc
7944 elemts to it. uses a dummy switch to make sure no elements are
7947 * src/lyxlex.h: added a struct pushpophelper for use in functions
7948 with more than one exit point.
7950 * src/lyxlex.[Ch] (GetInteger): made it const
7954 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7956 * src/layout.[hC] : LayoutTags splitted into several enums, new
7957 methods created, better error handling cleaner use of lyxlex. Read
7960 * src/bmtable.[Ch]: change some member prototypes because of the
7961 image const changes.
7963 * commandtags.h, src/LyXAction.C (init): new function:
7964 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7965 This file is not read automatically but you can add \input
7966 preferences to your lyxrc if you want to. We need to discuss how
7969 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7970 in .aux, also remove .bib and .bst files from dependencies when
7973 * src/BufferView.C, src/LyXView.C: add const_cast several places
7974 because of changes to images.
7976 * lib/images/*: same change as for images/*
7978 * lib/lyxrc.example: Default for accept_compound is false not no.
7980 * images/*: changed to be const, however I have som misgivings
7981 about this change so it might be changed back.
7983 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7985 * lib/configure, po/POTFILES.in: regenerated
7987 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7989 * config/lib_configure.m4: removed
7991 * lib/configure.m4: new file (was config/lib_configure.m4)
7993 * configure.in: do not test for rtti, since we do not use it.
7995 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7997 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7998 doubling of allocated space scheme. This makes it faster for large
7999 strings end to use less memory for small strings. xtra rememoved.
8001 * src/insets/figinset.C (waitalarm): commented out.
8002 (GhostscriptMsg): use static_cast
8003 (GhostscriptMsg): use new instead of malloc to allocate memory for
8004 cmap. also delete the memory after use.
8006 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
8008 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
8009 for changes in bibtex database or style.
8010 (runBibTeX): remove all .bib and .bst files from dep before we
8012 (run): use scanAuc in when dep file already exist.
8014 * src/DepTable.C (remove_files_with_extension): new method
8017 * src/DepTable.[Ch]: made many of the methods const.
8019 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8021 * src/bufferparams.C: make sure that the default textclass is
8022 "article". It used to be the first one by description order, but
8023 now the first one is "docbook".
8025 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8026 string; call Debug::value.
8027 (easyParse): pass complete argument to setDebuggingLevel().
8029 * src/debug.h (value): fix the code that parses debug levels.
8031 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8034 * src/LyXAction.C: use Debug::ACTION as debug channel.
8036 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8038 * NEWS: updated for the future 1.1.3 release.
8040 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8041 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8042 it should. This is of course a controversial change (since many
8043 people will find that their lyx workscreen is suddenly full of
8044 red), but done for the sake of correctness.
8046 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8047 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8049 * src/insets/inseterror.h, src/insets/inseturl.h,
8050 src/insets/insetinfo.h, src/insets/figinset.h,
8051 src/mathed/formulamacro.h, src/mathed/math_macro.h
8052 (EditMessage): add a missing const and add _() to make sure that
8055 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8056 src/insets/insetbib.C, src/support/filetools.C: add `using'
8059 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8060 doing 'Insert index of last word' at the beginning of a paragraph.
8062 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8064 * several files: white-space changes.
8066 * src/mathed/formula.C: removed IsAlpha and IsDigit
8068 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8069 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8072 * src/insets/figinset.C (GetPSSizes): don't break when
8073 "EndComments" is seen. But break when a boundingbox is read.
8075 * all classes inherited from Inset: return value of Clone
8076 changed back to Inset *.
8078 * all classes inherited form MathInset: return value of Clone
8079 changed back to MathedInset *.
8081 * src/insets/figinset.C (runqueue): use a ofstream to output the
8082 gs/ps file. Might need some setpresicion or setw. However I can
8083 see no problem with the current code.
8084 (runqueue): use sleep instead of the alarm/signal code. I just
8085 can't see the difference.
8087 * src/paragraph.C (LyXParagraph): reserve space in the new
8088 paragraph and resize the inserted paragraph to just fit.
8090 * src/lyxfunc.h (operator|=): added operator for func_status.
8092 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8093 check for readable file.
8095 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8096 check for readable file.
8097 (MenuMakeLinuxDoc): ditto
8098 (MenuMakeDocBook): ditto
8099 (MenuMakeAscii): ditto
8100 (InsertAsciiFile): split the test for openable and readable
8102 * src/bmtable.C (draw_bitmaptable): use
8103 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8105 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8106 findtexfile from LaTeX to filetools.
8108 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8109 instead of FilePtr. Needs to be verified by a literate user.
8111 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8113 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8114 (EditMessage): likewise.
8116 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8117 respectively as \textasciitilde and \textasciicircum.
8119 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8121 * src/support/lyxstring.h: made the methods that take iterators
8124 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8125 (regexMatch): made is use the real regex class.
8127 * src/support/Makefile.am: changed to use libtool
8129 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8131 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8133 (MathIsInset ++): changed several macros to be inline functions
8136 * src/mathed/Makefile.am: changed to use libtool
8138 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8140 * src/insets/inset* : Clone changed to const and return type is
8141 the true insettype not just Inset*.
8143 * src/insets/Makefile.am: changed to use libtool
8145 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8147 * src/undo.[Ch] : added empty() and changed some of the method
8150 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8152 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8153 setID use block<> for the bullets array, added const several places.
8155 * src/lyxfunc.C (getStatus): new function
8157 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8158 LyXAction, added const to several funtions.
8160 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8161 a std::map, and to store the dir items in a vector.
8163 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8166 * src/LyXView.[Ch] + other files : changed currentView to view.
8168 * src/LyXAction.[Ch] : ported from the old devel branch.
8170 * src/.cvsignore: added .libs and a.out
8172 * configure.in : changes to use libtool.
8174 * acinclude.m4 : inserted libtool.m4
8176 * .cvsignore: added libtool
8178 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8180 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8181 file name in insets and mathed directories (otherwise the
8182 dependency is not taken in account under cygwin).
8184 * src/text2.C (InsertString[AB]): make sure that we do not try to
8185 read characters past the string length.
8187 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8189 * lib/doc/LaTeXConfig.lyx.in,
8190 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8192 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8193 file saying who created them and when this heppened; this is
8194 useless and annoys tools like cvs.
8196 * lib/layouts/g-brief-{en,de}.layout,
8197 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8198 from Thomas Hartkens <thomas@hartkens.de>.
8200 * src/{insets,mathed}/Makefile.am: do not declare an empty
8201 LDFLAGS, so that it can be set at configure time (useful on Irix
8204 * lib/reLyX/configure.in: make sure that the prefix is set
8205 correctly in LYX_DIR.
8207 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8209 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8210 be used by 'command-sequence' this allows to bind a key to a
8211 sequence of LyX-commands
8212 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8214 * src/LyXAction.C: add "command-sequence"
8216 * src/LyXFunction.C: handling of "command-sequence"
8218 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8219 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8221 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8223 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8225 * src/buffer.C (writeFile): Do not output a comment giving user
8226 and date at the beginning of a .lyx file. This is useless and
8227 annoys cvs anyway; update version number to 1.1.
8229 * src/Makefile.am (LYX_DIR): add this definition, so that a
8230 default path is hardcoded in LyX.
8232 * configure.in: Use LYX_GNU_GETTEXT.
8234 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8235 AM_GNU_GETTEXT with a bug fixed.
8237 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8239 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8241 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8242 which is used to point to LyX data is now LYX_DIR_11x.
8244 * lyx.man: convert to a unix text file; small updates.
8246 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8248 * src/support/LSubstring.[Ch]: made the second arg of most of the
8249 constructors be a const reference.
8251 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8254 * src/support/lyxstring.[Ch] (swap): added missing member function
8255 and specialization of swap(str, str);
8257 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8259 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8260 trace of the old one.
8262 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8263 put the member definitions in undo.C.
8265 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8266 NEW_TEXT and have now only code that was included when this was
8269 * src/intl.C (LCombo): use static_cast
8271 (DispatchCallback): ditto
8273 * src/definitions.h: removed whole file
8275 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8277 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8278 parsing and stores in a std:map. a regex defines the file format.
8279 removed unneeded members.
8281 * src/bufferparams.h: added several enums from definitions.h here.
8282 Removed unsused destructor. Changed some types to use proper enum
8283 types. use block to have the temp_bullets and user_defined_bullets
8284 and to make the whole class assignable.
8286 * src/bufferparams.C (Copy): removed this functions, use a default
8289 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8292 * src/buffer.C (readLyXformat2): commend out all that have with
8293 oldpapersize to do. also comment out all that hve to do with
8294 insetlatex and insetlatexdel.
8295 (setOldPaperStuff): commented out
8297 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8299 * src/LyXAction.C: remove use of inset-latex-insert
8301 * src/mathed/math_panel.C (button_cb): use static_cast
8303 * src/insets/Makefile.am (insets_o_SOURCES): removed
8306 * src/support/lyxstring.C (helper): use the unsigned long
8307 specifier, UL, instead of a static_cast.
8309 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8311 * src/support/block.h: new file. to be used as a c-style array in
8312 classes, so that the class can be assignable.
8314 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8316 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8317 NULL, make sure to return an empty string (it is not possible to
8318 set a string to NULL).
8320 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8322 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8324 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8326 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8327 link line, so that Irix users (for example) can set it explicitely to
8330 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8331 it can be overidden at make time (static or dynamic link, for
8334 * src/vc-backend.C, src/LaTeXFeatures.h,
8335 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8336 statements to bring templates to global namespace.
8338 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8340 * src/support/lyxstring.C (operator[] const): make it standard
8343 * src/minibuffer.C (Init): changed to reflect that more
8344 information is given from the lyxvc and need not be provided here.
8346 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8348 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8350 * src/LyXView.C (UpdateTimerCB): use static_cast
8351 (KeyPressMask_raw_callback): ditto
8353 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8354 buffer_, a lot of changes because of this. currentBuffer() ->
8355 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8356 also changes to other files because of this.
8358 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8360 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8361 have no support for RCS and partial support for CVS, will be
8364 * src/insets/ several files: changes because of function name
8365 changes in Bufferview and LyXView.
8367 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8369 * src/support/LSubstring.[Ch]: new files. These implement a
8370 Substring that can be very convenient to use. i.e. is this
8372 string a = "Mary had a little sheep";
8373 Substring(a, "sheep") = "lamb";
8374 a is now "Mary has a little lamb".
8376 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8377 out patterns and subpatterns of strings. It is used by LSubstring
8378 and also by vc-backend.C
8380 * src/support/lyxstring.C: went over all the assertions used and
8381 tried to correct the wrong ones and flag which of them is required
8382 by the standard. some bugs found because of this. Also removed a
8383 couple of assertions.
8385 * src/support/Makefile.am (libsupport_a_SOURCES): added
8386 LSubstring.[Ch] and LRegex.[Ch]
8388 * src/support/FileInfo.h: have struct stat buf as an object and
8389 not a pointer to one, some changes because of this.
8391 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8392 information in layout when adding the layouts preamble to the
8395 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8398 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8399 because of bug in OS/2.
8401 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8403 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8404 \verbatim@font instead of \ttfamily, so that it can be redefined.
8406 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8407 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8408 src/layout.h, src/text2.C: add 'using' directive to bring the
8409 STL templates we need from the std:: namespace to the global one.
8410 Needed by DEC cxx in strict ansi mode.
8412 * src/support/LIstream.h,src/support/LOstream.h,
8413 src/support/lyxstring.h,src/table.h,
8414 src/lyxlookup.h: do not include <config.h> in header
8415 files. This should be done in the .C files only.
8417 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8421 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8423 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8424 from Kayvan to fix the tth invokation.
8426 * development/lyx.spec.in: updates from Kayvan to reflect the
8427 changes of file names.
8429 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8431 * src/text2.C (InsertStringB): use std::copy
8432 (InsertStringA): use std::copy
8434 * src/bufferlist.C: use a vector to store the buffers in. This is
8435 an internal change and should not affect any other thing.
8437 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8440 * src/text.C (Fill): fix potential bug, one off bug.
8442 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8444 * src/Makefile.am (lyx_main.o): add more files it depends on.
8446 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8448 * src/support/lyxstring.C: use size_t for the reference count,
8449 size, reserved memory and xtra.
8450 (internal_compare): new private member function. Now the compare
8451 functions should work for std::strings that have embedded '\0'
8453 (compare): all compare functions rewritten to use
8456 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8458 * src/support/lyxstring.C (compare): pass c_str()
8459 (compare): pass c_str
8460 (compare): pass c_str
8462 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8464 * src/support/DebugStream.C: <config.h> was not included correctly.
8466 * lib/configure: forgot to re-generate it :( I'll make this file
8467 auto generated soon.
8469 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8471 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8474 * src/support/lyxstring.C: some changes from length() to rep->sz.
8475 avoids a function call.
8477 * src/support/filetools.C (SpaceLess): yet another version of the
8478 algorithm...now per Jean-Marc's suggestions.
8480 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8482 * src/layout.C (less_textclass_desc): functor for use in sorting
8484 (LyXTextClass::Read): sort the textclasses after reading.
8486 * src/support/filetools.C (SpaceLess): new version of the
8487 SpaceLess functions. What problems does this one give? Please
8490 * images/banner_bw.xbm: made the arrays unsigned char *
8492 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8494 * src/support/lyxstring.C (find): remove bogus assertion in the
8495 two versions of find where this has not been done yet.
8497 * src/support/lyxlib.h: add missing int return type to
8500 * src/menus.C (ShowFileMenu): disable exporting to html if no
8501 html export command is present.
8503 * config/lib_configure.m4: add a test for an HTML converter. The
8504 programs checked for are, in this order: tth, latex2html and
8507 * lib/configure: generated from config/lib_configure.m4.
8509 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8510 html converter. The parameters are now passed through $$FName and
8511 $$OutName, instead of standard input/output.
8513 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8515 * lib/lyxrc.example: update description of \html_command.
8516 add "quotes" around \screen_font_xxx font setting examples to help
8517 people who use fonts with spaces in their names.
8519 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8521 * Distribution files: updates for v1.1.2
8523 * src/support/lyxstring.C (find): remove bogus assert and return
8524 npos for the same condition.
8526 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8528 * added patch for OS/2 from SMiyata.
8530 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8532 * src/text2.C (CutSelection): make space_wrapped a bool
8533 (CutSelection): dont declare int i until we have to.
8534 (alphaCounter): return a char const *.
8536 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8538 * src/support/syscall.C (Systemcalls::kill):
8539 src/support/filetools.C (PutEnv, PutEnvPath):
8540 src/lyx_cb.C (addNewlineAndDepth):
8541 src/FontInfo.C (FontInfo::resize): condition some #warning
8542 directives with WITH_WARNINGS.
8545 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8547 * src/layout.[Ch] + several files: access to class variables
8548 limited and made accessor functions instead a lot of code changed
8549 becuase of this. Also instead of returning pointers often a const
8550 reference is returned instead.
8552 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8554 * src/Makefile.am (dist-hook): added used to remove the CVS from
8555 cheaders upon creating a dist
8556 (EXTRA_DIST): added cheaders
8558 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8559 a character not as a small integer.
8561 * src/support/lyxstring.C (find): removed Assert and added i >=
8562 rep->sz to the first if.
8564 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8566 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8567 src/LyXView.C src/buffer.C src/bufferparams.C
8568 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8569 src/text2.C src/insets/insetinclude.C:
8570 lyxlayout renamed to textclasslist.
8572 * src/layout.C: some lyxerr changes.
8574 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8575 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8576 (LyXLayoutList): removed all traces of this class.
8577 (LyXTextClass::Read): rewrote LT_STYLE
8578 (LyXTextClass::hasLayout): new function
8579 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8580 both const and nonconst version.
8581 (LyXTextClass::delete_layout): new function.
8582 (LyXTextClassList::Style): bug fix. do the right thing if layout
8584 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8585 (LyXTextClassList::NameOfLayout): ditto
8586 (LyXTextClassList::Load): ditto
8588 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8590 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8592 * src/LyXAction.C (LookupFunc): added a workaround for sun
8593 compiler, on the other hand...we don't know if the current code
8594 compiles on sun at all...
8596 * src/support/filetools.C (CleanupPath): subst fix
8598 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8601 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8602 complained about this one?
8604 * src/insets/insetinclude.C (Latex): subst fix
8606 * src/insets/insetbib.C (getKeys): subst fix
8608 * src/LyXSendto.C (SendtoApplyCB): subst fix
8610 * src/lyx_main.C (init): subst fix
8612 * src/layout.C (Read): subst fix
8614 * src/lyx_sendfax_main.C (button_send): subst fix
8616 * src/buffer.C (RoffAsciiTable): subst fix
8618 * src/lyx_cb.C (MenuFax): subst fix
8619 (PrintApplyCB): subst fix
8621 1999-10-26 Juergen Vigna <jug@sad.it>
8623 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8625 (Read): Cleaned up this code so now we read only format vestion >= 5
8627 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8629 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8630 come nobody has complained about this one?
8632 * src/insets/insetinclude.C (Latex): subst fix
8634 * src/insets/insetbib.C (getKeys): subst fix
8636 * src/lyx_main.C (init): subst fix
8638 * src/layout.C (Read): subst fix
8640 * src/buffer.C (RoffAsciiTable): subst fix
8642 * src/lyx_cb.C (MenuFax): subst fix.
8644 * src/layout.[hC] + some other files: rewrote to use
8645 std::container to store textclasses and layouts in.
8646 Simplified, removed a lot of code. Make all classes
8647 assignable. Further simplifications and review of type
8648 use still to be one.
8650 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8651 lastfiles to create the lastfiles partr of the menu.
8653 * src/lastfiles.[Ch]: rewritten to use deque to store the
8654 lastfiles in. Uses fstream for reading and writing. Simplifies
8657 * src/support/syscall.C: remove explicit cast.
8659 * src/BufferView.C (CursorToggleCB): removed code snippets that
8661 use explicat C++ style casts instead of C style casts. also use
8662 u_vdata instea of passing pointers in longs.
8664 * src/PaperLayout.C: removed code snippets that were commented out.
8666 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8668 * src/lyx_main.C: removed code snippets that wer commented out.
8670 * src/paragraph.C: removed code snippets that were commented out.
8672 * src/lyxvc.C (logClose): use static_cast
8674 (viewLog): remove explicit cast to void*
8675 (showLog): removed old commented code
8677 * src/menus.C: use static_cast instead of C style casts. use
8678 u_vdata instead of u_ldata. remove explicit cast to (long) for
8679 pointers. Removed old code that was commented out.
8681 * src/insets/inset.C: removed old commented func
8683 * src/insets/insetref.C (InsetRef): removed old code that had been
8684 commented out for a long time.
8686 (escape): removed C style cast
8688 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8690 * src/insets/insetlatex.C (Draw): removed old commented code
8691 (Read): rewritten to use string
8693 * src/insets/insetlabel.C (escape): removed C style cast
8695 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8697 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8700 * src/insets/insetinclude.h: removed a couple of stupid bools
8702 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8703 (Clone): remove C style cast
8704 (getKeys): changed list to lst because of std::list
8706 * src/insets/inseterror.C (Draw): removed som old commented code.
8708 * src/insets/insetcommand.C (Draw): removed some old commented code.
8710 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8711 commented out forever.
8712 (bibitem_cb): use static_cast instead of C style cast
8713 use of vdata changed to u_vdata.
8715 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8717 (CloseUrlCB): use static_cast instead of C style cast.
8718 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8720 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8721 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8722 (CloseInfoCB): static_cast from ob->u_vdata instead.
8723 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8726 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8727 (C_InsetError_CloseErrorCB): forward the ob parameter
8728 (CloseErrorCB): static_cast from ob->u_vdata instead.
8730 * src/vspace.h: include LString.h since we use string in this class.
8732 * src/vspace.C (lyx_advance): changed name from advance because of
8733 nameclash with stl. And since we cannot use namespaces yet...I
8734 used a lyx_ prefix instead. Expect this to change when we begin
8737 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8739 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8740 and removed now defunct constructor and deconstructor.
8742 * src/BufferView.h: have backstack as a object not as a pointer.
8743 removed initialization from constructor. added include for BackStack
8745 * development/lyx.spec.in (%build): add CFLAGS also.
8747 * src/screen.C (drawFrame): removed another warning.
8749 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8751 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8752 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8753 README and ANNOUNCE a bit for the next release. More work is
8756 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8757 unbreakable if we are in freespacing mode (LyX-Code), but not in
8760 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8762 * src/BackStack.h: fixed initialization order in constructor
8764 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8766 * acinclude.m4 (VERSION): new rules for when a version is
8767 development, added also a variable for prerelease.
8768 (warnings): we set with_warnings=yes for prereleases
8769 (lyx_opt): prereleases compile with same optimization as development
8770 (CXXFLAGS): only use pedantic if we are a development version
8772 * src/BufferView.C (restorePosition): don't do anything if the
8775 * src/BackStack.h: added member empty, use this to test if there
8776 is anything to pop...
8778 1999-10-25 Juergen Vigna <jug@sad.it>
8781 * forms/layout_forms.fd +
8782 * forms/latexoptions.fd +
8783 * lyx.fd: changed for various form resize issues
8785 * src/mathed/math_panel.C +
8786 * src/insets/inseterror.C +
8787 * src/insets/insetinfo.C +
8788 * src/insets/inseturl.C +
8789 * src/insets/inseturl.h +
8792 * src/PaperLayout.C +
8793 * src/ParagraphExtra.C +
8794 * src/TableLayout.C +
8796 * src/layout_forms.C +
8803 * src/menus.C: fixed various resize issues. So now forms can be
8804 resized savely or not be resized at all.
8806 * forms/form_url.fd +
8807 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8810 * src/insets/Makefile.am: added files form_url.[Ch]
8812 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8814 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8815 (and presumably 6.2).
8817 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8818 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8819 remaining static member callbacks.
8821 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8824 * src/support/lyxstring.h: declare struct Srep as friend of
8825 lyxstring, since DEC cxx complains otherwise.
8827 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8829 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8831 * src/LaTeX.C (run): made run_bibtex also depend on files with
8833 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8834 are put into the dependency file.
8836 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8837 the code has shown itself to work
8838 (create_ispell_pipe): removed another warning, added a comment
8841 * src/minibuffer.C (ExecutingCB): removed code that has been
8842 commented out a long time
8844 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8845 out code + a warning.
8847 * src/support/lyxstring.h: comment out the three private
8848 operators, when compiling with string ansi conforming compilers
8851 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8853 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8854 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8857 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8860 * src/mathed/math_panel.C (create_math_panel): remove explicit
8863 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8866 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8867 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8868 to XCreatePixmapFromBitmapData
8869 (fl_set_bmtable_data): change the last argument to be unsigned
8871 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8872 and bh to be unsigned int, remove explicit casts in call to
8873 XReadBitmapFileData.
8875 * images/arrows.xbm: made the arrays unsigned char *
8876 * images/varsz.xbm: ditto
8877 * images/misc.xbm: ditto
8878 * images/greek.xbm: ditto
8879 * images/dots.xbm: ditto
8880 * images/brel.xbm: ditto
8881 * images/bop.xbm: ditto
8883 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8885 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8886 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8887 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8889 (LYX_CXX_CHEADERS): added <clocale> to the test.
8891 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8893 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8895 * src/support/lyxstring.C (append): fixed something that must be a
8896 bug, rep->assign was used instead of rep->append.
8898 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8901 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8902 lyx insert double chars. Fix spotted by Kayvan.
8904 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8906 * Fixed the tth support. I messed up with the Emacs patch apply feature
8907 and omitted the changes in lyxrc.C.
8909 1999-10-22 Juergen Vigna <jug@sad.it>
8911 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8913 * src/lyx_cb.C (MenuInsertRef) +
8914 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8915 the form cannot be resized under it limits (fixes a segfault)
8917 * src/lyx.C (create_form_form_ref) +
8918 * forms/lyx.fd: Changed Gravity on name input field so that it is
8921 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8923 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8924 <ostream> and <istream>.
8926 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8927 whether <fstream> provides the latest standard features, or if we
8928 have an oldstyle library (like in egcs).
8929 (LYX_CXX_STL_STRING): fix the test.
8931 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8932 code on MODERN_STL_STREAM.
8934 * src/support/lyxstring.h: use L{I,O}stream.h.
8936 * src/support/L{I,O}stream.h: new files, designed to setup
8937 correctly streams for our use
8938 - includes the right header depending on STL capabilities
8939 - puts std::ostream and std::endl (for LOStream.h) or
8940 std::istream (LIStream.h) in toplevel namespace.
8942 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8944 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8945 was a bib file that had been changed we ensure that bibtex is run.
8946 (runBibTeX): enhanced to extract the names of the bib files and
8947 getting their absolute path and enter them into the dep file.
8948 (findtexfile): static func that is used to look for tex-files,
8949 checks for absolute patchs and tries also with kpsewhich.
8950 Alternative ways of finding the correct files are wanted. Will
8952 (do_popen): function that runs a command using popen and returns
8953 the whole output of that command in a string. Should be moved to
8956 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8957 file with extension ext has changed.
8959 * src/insets/figinset.C: added ifdef guards around the fl_free
8960 code that jug commented out. Now it is commented out when
8961 compiling with XForms == 0.89.
8963 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8964 to lyxstring.C, and only keep a forward declaration in
8965 lyxstring.h. Simplifies the header file a bit and should help a
8966 bit on compile time too. Also changes to Srep will not mandate a
8967 recompile of code just using string.
8968 (~lyxstring): definition moved here since it uses srep.
8969 (size): definition moved here since it uses srep.
8971 * src/support/lyxstring.h: removed a couple of "inline" that should
8974 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8976 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8979 1999-10-21 Juergen Vigna <jug@sad.it>
8981 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8982 set to left if I just remove the width entry (or it is empty).
8984 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8985 paragraph when having dummy paragraphs.
8987 1999-10-20 Juergen Vigna <jug@sad.it>
8989 * src/insets/figinset.C: just commented some fl_free_form calls
8990 and added warnings so that this calls should be activated later
8991 again. This avoids for now a segfault, but we have a memory leak!
8993 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8994 'const char * argument' to 'string argument', this should
8995 fix some Asserts() in lyxstring.C.
8997 * src/lyxfunc.h: Removed the function argAsString(const char *)
8998 as it is not used anymore.
9000 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9002 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
9005 * src/Literate.h: some funcs moved from public to private to make
9006 interface clearer. Unneeded args removed.
9008 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
9010 (scanBuildLogFile): ditto
9012 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9013 normal TeX Error. Still room for improvement.
9015 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9017 * src/buffer.C (insertErrors): changes to make the error
9018 desctription show properly.
9020 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9023 * src/support/lyxstring.C (helper): changed to use
9024 sizeof(object->rep->ref).
9025 (operator>>): changed to use a pointer instead.
9027 * src/support/lyxstring.h: changed const reference & to value_type
9028 const & lets see if that helps.
9030 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9032 * Makefile.am (rpmdist): fixed to have non static package and
9035 * src/support/lyxstring.C: removed the compilation guards
9037 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9040 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9041 conditional compile of lyxstring.Ch
9043 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9044 stupid check, but it is a lot better than the bastring hack.
9045 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9047 * several files: changed string::erase into string::clear. Not
9050 * src/chset.C (encodeString): use a char temporary instead
9052 * src/table.C (TexEndOfCell): added tostr around
9053 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9054 (TexEndOfCell): ditto
9055 (TexEndOfCell): ditto
9056 (TexEndOfCell): ditto
9057 (DocBookEndOfCell): ditto
9058 (DocBookEndOfCell): ditto
9059 (DocBookEndOfCell): ditto
9060 (DocBookEndOfCell): ditto
9062 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9064 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9066 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9067 (MenuBuildProg): added tostr around ret
9068 (MenuRunChktex): added tostr around ret
9069 (DocumentApplyCB): added tostr around ret
9071 * src/chset.C (encodeString): added tostr around t->ic
9073 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9074 (makeLaTeXFile): added tostr around tocdepth
9075 (makeLaTeXFile): added tostr around ftcound - 1
9077 * src/insets/insetbib.C (setCounter): added tostr around counter.
9079 * src/support/lyxstring.h: added an operator+=(int) to catch more
9082 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9083 (lyxstring): We DON'T allow NULL pointers.
9085 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9087 * src/mathed/math_macro.C (MathMacroArgument::Write,
9088 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9089 when writing them out.
9091 * src/LString.C: remove, since it is not used anymore.
9093 * src/support/lyxstring.C: condition the content to
9094 USE_INCLUDED_STRING macro.
9096 * src/mathed/math_symbols.C, src/support/lstrings.C,
9097 src/support/lyxstring.C: add `using' directive to specify what
9098 we need in <algorithm>. I do not think that we need to
9099 conditionalize this, but any thought is appreciated.
9101 * many files: change all callback functions to "C" linkage
9102 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9103 strict_ansi. Those who were static are now global.
9104 The case of callbacks which are static class members is
9105 trickier, since we have to make C wrappers around them (see
9106 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9107 did not finish this yet, since it defeats the purpose of
9108 encapsulation, and I am not sure what the best route is.
9110 1999-10-19 Juergen Vigna <jug@sad.it>
9112 * src/support/lyxstring.C (lyxstring): we permit to have a null
9113 pointer as assignment value and just don't assign it.
9115 * src/vspace.C (nextToken): corrected this function substituting
9116 find_first(_not)_of with find_last_of.
9118 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9119 (TableOptCloseCB) (TableSpeCloseCB):
9120 inserted fl_set_focus call for problem with fl_hide_form() in
9123 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9125 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9128 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9130 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9131 LyXLex::next() and not eatline() to get its argument.
9133 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9135 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9136 instead, use fstreams for io of the depfile, removed unneeded
9137 functions and variables.
9139 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9140 vector instead, removed all functions and variables that is not in
9143 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9145 * src/buffer.C (insertErrors): use new interface to TeXError
9147 * Makefile.am (rpmdist): added a rpmdist target
9149 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9150 per Kayvan's instructions.
9152 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9154 * src/Makefile.am: add a definition for localedir, so that locales
9155 are found after installation (Kayvan)
9157 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9159 * development/.cvsignore: new file.
9161 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9163 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9164 C++ compiler provides wrappers for C headers and use our alternate
9167 * configure.in: use LYX_CXX_CHEADERS.
9169 * src/cheader/: new directory, populated with cname headers from
9170 libstdc++-2.8.1. They are a bit old, but probably good enough for
9171 what we want (support compilers who lack them).
9173 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9174 from includes. It turns out is was stupid.
9176 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9178 * lib/Makefile.am (install-data-local): forgot a ';'
9179 (install-data-local): forgot a '\'
9180 (libinstalldirs): needed after all. reintroduced.
9182 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9184 * configure.in (AC_OUTPUT): added lyx.spec
9186 * development/lyx.spec: removed file
9188 * development/lyx.spec.in: new file
9190 * po/*.po: merged with lyx.pot becuase of make distcheck
9192 * lib/Makefile.am (dist-hook): added dist-hook so that
9193 documentation files will be included when doing a make
9194 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9195 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9197 more: tried to make install do the right thing, exclude CVS dirs
9200 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9201 Path would fit in more nicely.
9203 * all files that used to use pathstack: uses now Path instead.
9204 This change was a lot easier than expected.
9206 * src/support/path.h: new file
9208 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9210 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9212 * src/support/lyxstring.C (getline): Default arg was given for
9215 * Configure.cmd: removed file
9217 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9219 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9220 streams classes and types, add the proper 'using' statements when
9221 MODERN_STL is defined.
9223 * src/debug.h: move the << operator definition after the inclusion
9226 * src/support/filetools.C: include "LAssert.h", which is needed
9229 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9232 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9233 include "debug.h" to define a proper ostream.
9235 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9237 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9238 method to the SystemCall class which can kill a process, but it's
9239 not fully implemented yet.
9241 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9243 * src/support/FileInfo.h: Better documentation
9245 * src/lyxfunc.C: Added support for buffer-export html
9247 * src/menus.C: Added Export->As HTML...
9249 * lib/bind/*.bind: Added short-cut for buffer-export html
9251 * src/lyxrc.*: Added support for new \tth_command
9253 * lib/lyxrc.example: Added stuff for new \tth_command
9255 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9257 * lib/Makefile.am (IMAGES): removed images/README
9258 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9259 installes in correct place. Check permisions is installed
9262 * src/LaTeX.C: some no-op changes moved declaration of some
9265 * src/LaTeX.h (LATEX_H): changed include guard name
9267 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9269 * lib/reLyX/Makefile.am: install noweb2lyx.
9271 * lib/Makefile.am: install configure.
9273 * lib/reLyX/configure.in: declare a config aux dir; set package
9274 name to lyx (not sure what the best solution is); generate noweb2lyx.
9276 * lib/layouts/egs.layout: fix the bibliography layout.
9278 1999-10-08 Jürgen Vigna <jug@sad.it>
9280 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9281 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9282 it returned without continuing to search the path.
9284 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9286 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9287 also fixes a bug. It is not allowed to do tricks with std::strings
9288 like: string a("hei"); &a[e]; this will not give what you
9289 think... Any reason for the complexity in this func?
9291 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9293 * Updated README and INSTALL a bit, mostly to check that my
9294 CVS rights are correctly set up.
9296 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9298 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9299 does not allow '\0' chars but lyxstring and std::string does.
9301 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9303 * autogen.sh (AUTOCONF): let the autogen script create the
9304 POTFILES.in file too. POTFILES.in should perhaps now not be
9305 included in the cvs module.
9307 * some more files changed to use C++ includes instead of C ones.
9309 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9311 (Reread): added tostr to nlink. buggy output otherwise.
9312 (Reread): added a string() around szMode when assigning to Buffer,
9313 without this I got a log of garbled info strings.
9315 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9318 * I have added several ostream & operator<<(ostream &, some_type)
9319 functions. This has been done to avoid casting and warnings when
9320 outputting enums to lyxerr. This as thus eliminated a lot of
9321 explicit casts and has made the code clearer. Among the enums
9322 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9323 mathed enums, some font enum the Debug::type enum.
9325 * src/support/lyxstring.h (clear): missing method. equivalent of
9328 * all files that contained "stderr": rewrote constructs that used
9329 stderr to use lyxerr instead. (except bmtable)
9331 * src/support/DebugStream.h (level): and the passed t with
9332 Debug::ANY to avoid spurious bits set.
9334 * src/debug.h (Debug::type value): made it accept strings of the
9337 * configure.in (Check for programs): Added a check for kpsewhich,
9338 the latex generation will use this later to better the dicovery of
9341 * src/BufferView.C (create_view): we don't need to cast this to
9342 (void*) that is done automatically.
9343 (WorkAreaButtonPress): removed some dead code.
9345 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9347 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9348 is not overwritten when translated (David Sua'rez de Lis).
9350 * lib/CREDITS: Added David Sua'rez de Lis
9352 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9354 * src/bufferparams.C (BufferParams): default input encoding is now
9357 * acinclude.m4 (cross_compiling): comment out macro
9358 LYX_GXX_STRENGTH_REDUCE.
9360 * acconfig.h: make sure that const is not defined (to empty) when
9361 we are compiling C++. Remove commented out code using SIZEOF_xx
9364 * configure.in : move the test for const and inline as late as
9365 possible so that these C tests do not interefere with C++ ones.
9366 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9367 has not been proven.
9369 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9371 * src/table.C (getDocBookAlign): remove bad default value for
9374 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9376 (ShowFileMenu2): ditto.
9378 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9381 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9383 * Most files: finished the change from the old error code to use
9384 DebugStream for all lyxerr debugging. Only minor changes remain
9385 (e.g. the setting of debug levels using strings instead of number)
9387 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9389 * src/layout.C (Add): Changed to use compare_no_case instead of
9392 * src/FontInfo.C: changed loop variable type too string::size_type.
9394 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9396 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9397 set ETAGS_ARGS to --c++
9399 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9401 * src/table.C (DocBookEndOfCell): commented out two unused variables
9403 * src/paragraph.C: commented out four unused variables.
9405 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9406 insed a if clause with type string::size_type.
9408 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9411 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9413 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9414 variable, also changed loop to go from 0 to lenght + 1, instead of
9415 -1 to length. This should be correct.
9417 * src/LaTeX.C (scanError): use string::size_type as loop variable
9420 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9421 (l.896) since y_tmp and row was not used anyway.
9423 * src/insets/insetref.C (escape): use string::size_type as loop
9426 * src/insets/insetquotes.C (Width): use string::size_type as loop
9428 (Draw): use string::size_type as loop variable type.
9430 * src/insets/insetlatexaccent.C (checkContents): use
9431 string::size_type as loop variable type.
9433 * src/insets/insetlabel.C (escape): use string::size_type as loop
9436 * src/insets/insetinfo.C: added an extern for current_view.
9438 * src/insets/insetcommand.C (scanCommand): use string::size_type
9439 as loop variable type.
9441 * most files: removed the RCS tags. With them we had to recompile
9442 a lot of files after a simple cvs commit. Also we have never used
9443 them for anything meaningful.
9445 * most files: tags-query-replace NULL 0. As adviced several plases
9446 we now use "0" instead of "NULL" in our code.
9448 * src/support/filetools.C (SpaceLess): use string::size_type as
9451 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9453 * src/paragraph.C: fixed up some more string stuff.
9455 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9457 * src/support/filetools.h: make modestr a std::string.
9459 * src/filetools.C (GetEnv): made ch really const.
9461 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9462 made code that used these use max/min from <algorithm> instead.
9464 * changed several c library include files to their equivalent c++
9465 library include files. All is not changed yet.
9467 * created a support subdir in src, put lyxstring and lstrings
9468 there + the extra files atexit, fileblock, strerror. Created
9469 Makefile.am. edited configure.in and src/Makefile.am to use this
9470 new subdir. More files moved to support.
9472 * imported som of the functions from repository lyx, filetools
9474 * ran tags-query-replace on LString -> string, corrected the bogus
9475 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9476 is still some errors in there. This is errors where too much or
9477 too litle get deleted from strings (string::erase, string::substr,
9478 string::replace), there can also be some off by one errors, or
9479 just plain wrong use of functions from lstrings. Viewing of quotes
9482 * LyX is now running fairly well with string, but there are
9483 certainly some bugs yet (see above) also string is quite different
9484 from LString among others in that it does not allow null pointers
9485 passed in and will abort if it gets any.
9487 * Added the revtex4 files I forgot when setting up the repository.
9489 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9491 * All over: Tried to clean everything up so that only the files
9492 that we really need are included in the cvs repository.
9493 * Switched to use automake.
9494 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9495 * Install has not been checked.
9497 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9499 * po/pt.po: Three errors:
9500 l.533 and l.538 format specification error
9501 l. 402 duplicate entry, I just deleted it.