1 2000-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3 * src/kbsequence.C (addkey): use a vector as per Andre Poenitz patch.
5 * lib/Makefile.am (dist-hook): also delete doc/.cvsignore from
8 * src/support/lyxfunctional.h: make back_insert_fun_iterator(s)
9 match the requirements from the standard better. This is required
10 to work with gnu libstdc++-v3
12 * src/frontends/xforms/FormPreferences.C: add explict pair
13 arguments to browse calls. include support/lyxmanip.h remvoe
14 extern fmt. whitespace changes. reorder variables in
15 FormPreferences.h, to match initalizaton order.
17 * several files: constify more local variables.
19 * src/buffer.C: remove some commented functions.
21 * src/DepTable.C (remove_files_with_extension): temporary
22 work around for gcc 2.97
23 * src/filedlg.C (find): ditto
24 * src/Variables.C (set): ditto
25 * src/LyXAction.C (searchActionArg): ditto
26 (retrieveActionArg): ditto
28 * configure.in: check for mktemp too
30 * UPGRADING: prepare for 1.1.6
32 * Makefile.am (lgbtags): add backup tags for when etags are
35 * ANNOUNCE: prepare for 1.1.6
37 * src/support/tempname.C (make_tempfile): new function, wrapper
38 around mkstemp and mktemp. Only mkstemp has been tested.
41 2000-11-14 Rob Lahaye <lahaye@postech.edu>
43 * default.ui: capitalized some menu items to improve shortcuts.
45 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
47 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
49 * src/frontends/xforms/Dialogs.C: add "using" directive.
51 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
53 * src/filedlg.C (Select): highlight suggested file in browser, if
56 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
57 each tab folder is encapsulated in its own class.
58 The Language keymaps are now chosen using a text input and a
59 browser button, rather than a Combox.
60 All the browser buttons are now functional, although LyXFileDlg
61 still needs to be modified to make it straighhtforward to return a
62 directory if that is what is desired.
64 * src/frontends/xforms/forms/form_preferences.fd: use text input
65 and browse button to input the Language keymaps. Add a few
66 callbacks for the browse buttons.
68 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
70 * src/support/tempname.C (tempName): small changes to make it
71 safer. remove the '.' before XXXXXX
73 * src/support/filetools.C (TmpFileName): remove func
76 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
77 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
78 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
79 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
81 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
84 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
87 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
88 for bp (this fixes a reproducible hard crash)
90 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
93 * src/frontends/xforms/FormBase.h: make bp_ private
94 (FormBaseBI): remove default for bp
97 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
100 * src/frontends/xforms/Color.C (RGBColor): made several vars
101 const, changed initialization of j to allow it to be const
104 * several files: added const to local variables.
106 * src/lyx_cb.C: removed several function prototypes and moved them
110 (UpdateLayoutPreamble):
112 (MenuInsertLabel): add BufferView as arguemnt
113 (LayoutsCB): make tmp const
115 * src/layout_forms.h: regenerated
117 * src/debug.C: add Debug::FILES
118 (showLevel) (showTags): translate the desc
120 * src/debug.h: add FILES as debug target
122 * src/bufferlist.C: use current_view as an interim measure becuase
123 of added arguments to MenuWrite and MenuWriteAs
125 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
127 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
129 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
130 libstdc++ is compiled with.
132 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
134 * lib/layouts/docbook-book.layout
135 * lib/layouts/docbook.layout
136 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
137 those paragraphs are expresse as SGML comments <!-- -->.
139 * src/LaTeXFeatures.h
140 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
141 parameter, this allows to express all the include files as relative
142 paths to the master buffer. The verbatim insert works as the other
145 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
147 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
149 (MakeDocBookFile): top_element is always written. Some clean up, as
150 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
152 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
153 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
154 a reference is written instead of the name.
155 (Validate): use the relative path for the filename.
157 * src/insets/insetlabel.C (DocBook): write end tag, for XML
160 * src/support/filetools.h
161 * src/support/filetools.C (IsSGMLFilename): added.
164 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
166 * development/OS2/quick_fix.patch:
168 * README.OS2: quick update to the OS/2 port.
170 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
172 * src/converter.C: add "using" directive.
174 * src/frontends/xforms/FormPreferences.C: add "using" directive.
175 (compare_converter): add "int" as return type.
177 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
180 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
182 * src/lyx_gui.C (create_forms): map the xform colours, should a
183 mapping exist. Ie, call XformColor::read().
185 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
186 and struct HSV as HSVColor.
187 (XformColor::read, XformColor::write) : new methods that
188 input/output any changes to the cform GUI colors.
190 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
193 * src/frontends/xforms/FormPreferences.C Lots of little changes
194 associated with the changed name of the RGB and HSV structs. Can
195 now save changes to xforms GUI to file. Commented out
196 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
197 used currently anyway.
199 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
201 * src/converter.C: A lot of changes:
202 - It is no longer possible to choose between two or more ways to
203 export to some format (the new code uses only the shortest path).
204 However, it is still possible to choose between pdflatex/ps2pdf
205 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
206 - Added several methods that makes the FormPreferences code simpler.
207 - Changed the tokens $$FName and $$OutName to $$i and $$o.
209 * src/exporter.C (Export): lyxrc.use_pdf is set before
210 makeLaTeXFile is called. This works but not very nice.
212 * src/frontends/xforms/FormPreferences.C: The formats/converters
213 tabs are now fully functional.
215 * src/buffer.C (getTocList): Add numbers to the captions.
217 * lib/lyxrc.example: Removed fax section
219 * src/support/rename.C (rename): Delete the old file if lyx::copy
222 2000-11-13 Rob Lahaye <lahaye@postech.edu>
224 * lib/ui/default.ui: minor polishing.
226 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
228 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
231 * lib/Makefile.am (DOCINST): do not install everything in the
232 documentation directory.
234 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
236 * src/bufferlist.C (newFile): set the filename to the constructed
239 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
240 constructed "newfileXX.lyx" name to the dialog
242 * src/frontends/DialogBase.h: make update() non-abstract so
243 KDE doesn't need to implement two update methods for every form
245 * src/frontends/kde/Makefile.am: add missing xforms objects
248 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
250 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
252 * src/frontends/xforms/Color.[Ch]: new files, defining the color
253 structs RGB and HSV. May not be the best place for these files.
254 Perhaps move them into src ?
256 * src/frontends/xforms/Makefile.am: added new files.
258 * src/frontends/xforms/forms/form_preferences.fd:
259 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
260 replaced all instances of "colour" with "color"!
262 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
265 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
266 tab. Can now alter the colors of the xform's GUI on the fly. With
267 the aid of a single static Signal (see below), can "Apply" these
268 changes to all currently open dialogs. (Well, to all of the NEW
269 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
270 subsequently opened dialogs will, of course, also have the new
271 color scheme. Cannot yet save (or load) the choices to file, so
272 they are lost when exiting LyX.
274 * src/frontends/Dialogs.h:
275 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
276 Used to trigger a redraw of any dialogs connected to it because,
277 for example, the GUI colours have been re-mapped.
279 * src/frontends/xforms/FormBase.[Ch]:
280 * src/frontends/xforms/FormDocument.[Ch]:
281 * src/frontends/xforms/FormParagraph.[Ch]:
282 * src/frontends/xforms/FormPreferences.[Ch]:
283 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
284 method, to be connected to Dialogs::redrawGUI. Method must be
285 virtual, because dialogs with tabbed folders need to redraw the
286 forms of each tab folder.
288 * src/LyXView.C (d-tor):
289 * src/frontends/xforms/FormBase.C (d-tor): connected
290 Dialogs::redrawGUI signal to redraw().
292 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
293 removed Assert, because it is identical to that in FormBase.
295 2000-11-10 Rob Lahaye <lahaye@postech.edu>
297 * lib/ui/default.ui: minor polishing.
299 2000-11-10 Juergen Vigna <jug@sad.it>
301 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
302 (deleteLyXText): ditto
304 * src/insets/insettabular.C (InsetButtonPress): don't clear the
305 selection on mouse-button-3.
307 * src/insets/insettabular.h: new function clearSelection(), use this
308 functions inside insettabular.C.
310 * src/insets/insettabular.C (TabularFeatures): clear the selection
311 on remove_row/column.
313 * src/insets/inset.C (scroll): fixed some scroll stuff.
315 * src/insets/insettabular.C (draw): fixed another minor draw problem.
317 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
319 * lib/CREDITS: add Yves Bastide
321 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
323 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
324 check whether C library functions are in the global namespace.
326 * configure.in: calls it.
328 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
331 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
333 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
334 iterators to prevent crash.
336 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
338 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
340 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
341 shortcut for xforms CB to the preemptive or post-handler function.
343 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
344 removed the HIDDEN_TIMER as it's no longer used.
345 Various other small changes.
347 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
348 preemptive handler to obtain feedback, rather than the post-handler.
349 (ColoursLoadBrowser): find "black" and "white" based on RGB values
351 Formats tab is now complete. Converters tab is nearly so.
353 2000-11-09 Juergen Vigna <jug@sad.it>
355 * src/insets/insettext.C (~InsetText):
358 (SetParagraphData): set cache.second to 0 after deleting it!
359 (getLyXText): check if cache.second is not 0 if finding it.
361 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
363 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
364 lyxlex to parse the rgb.txt file.
367 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
368 replace the default '#' comment character.
370 * src/support/tempname.C: add "using" directive
371 * src/frontends/ButtonPolicies.C: ditto.
373 * src/support/filetools.C (DirList): add an explicit cast to avoid
374 a compile error (probably not the right fix)
376 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
378 * src/support/filetools.C (DirList): implement using system functions
380 * src/support/tempname.C: new file
382 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
384 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
386 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
389 * src/frontends/xforms/ButtonController.C: new file
391 * src/os2_defines.h: remove getcwd define
393 * src/lyxvc.C: include support/lyxlib.h
394 (showLog): use lyx::tempName
396 * src/lyx_cb.C: comment out includes that we don't need
397 (AutoSave): use lyx::tempName
399 * src/filedlg.C: include support/lyxlib.h
400 (Reread): use lyx::getcwd
402 * src/converter.C: include support/filetools.h
403 (add_options): change to static inline, make tail const
404 (Add): make old_viewer const
405 (GetAllFormats): make it a const method, use const_iterator
406 (enable): make static inline
407 (SplitFormat): make using_format const
409 * src/LaTeX.C (run): use lyx::getcwd
411 * configure.in: check for mkstemp as well
413 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
415 * src/converter.[Ch] (GetAllCommands): new method.
417 * src/support/filetools.[Ch] (DirList): new method.
419 * src/frontends/xforms/FormPreferences.C: started (just!) adding
420 functionality to the converters tab.
421 The formats tab is now nearly complete.
422 The kbmap choices in Languages tab now display the contents of
423 system_lyxdir/kbd/*.kmap in readable form.
425 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
426 Moved some variables into the class.
428 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
429 inactive tab folder to FL_COL1. Haven't yet worked out how to change
430 colour of active folder to lighter grey instead. Any takers?
431 (form_colours): added an "Apply" button.
432 (form_converters): added a "Flags" input field.
433 (form_formats): added a "Shortcut" input field. Note that we can't use
434 names such as "input_shortcut" as this buggers up the sed script stuff.
436 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
444 * src/lyx_sendfax_main.C:
447 * src/spellchecker.C:
448 * src/insets/figinset.C:
449 * src/insets/insetbib.C:
450 * src/insets/insetexternal.C:
451 * src/insets/insetinclude.C:
452 * src/insets/insetinfo.C:
453 * src/mathed/math_panel.C:
454 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
455 all "daughter" dialogs now have identical "feel".
457 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
459 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
460 used (and was only used in one place prior to this patch. Incorrectly!)
462 * src/frontends/xforms/FormDocument.C: changed some instances of
463 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
464 sense. Also added fl_set_input_return() for class_->input_doc_extra and
465 for options_->input_float_placement. This fixes a bug reported by
468 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
469 functionality into d-tor.
471 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
472 input of numerals also.
474 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
475 fl_set_form_atclose(). Can now close dialog from window manager,
476 fixing a bug reported by Rob Lahaye.
478 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
480 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
481 are no longer dark. Haven't yet worked out how to lighten the colour of
482 the active tabfolder. Any ideas anybody?
483 Adjusted Colours tab a little.
484 Added Shortcut field to converters tab. Note that we can't create an
485 fdesign label like "input_shortcut" as this buggers up the sed-script
488 * src/frontends/xforms/FormPreferences.[Ch]:
489 (feedback): fixed crash due to to ob=0.
490 (LanguagesXXX): the kbmap choices now contain the files
491 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
492 be replaced by an input with a file browse button, but since the browse
493 buttons don'y yet work, this'll do for the moment.
494 (FormatsXXX): think that this is now nearly fully functional.
495 Some points/questions though:
496 1. Does "Apply" remove formats if no longer present?
497 2. I think that the browser should list the GUI names rather than the
499 3. Must ensure that we can't delete Formats used by an existing
502 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
503 if this is the best way to do this.
505 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
507 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
509 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
510 for variable assignment.
512 2000-11-07 Rob Lahaye <lahaye@postech.edu>
514 * src/lib/ui/default.ui: added sub/superscripts to menu as
515 Insert->Special characters and cleaned-up the file a bit
517 2000-11-07 Allan Rae <rae@lyx.org>
519 * src/frontends/xforms/FormPreferences.C (feedback): make sure
520 ob isn't 0 before using it. See comments in function.
522 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
524 * src/frontends/xforms/form_*.C: regenerated
526 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
528 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
530 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
531 compiling with gcc-2.96
533 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
535 * src/support/lyxstring.C: add a couple "using" directives.
537 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
538 a .c_str() here too for good measure.
539 * src/Spacing.C (set): ditto.
540 * src/lyxfunc.C (Dispatch): ditto.
542 * src/insets/insettabular.C (copySelection): change .str() to
543 .str().c_str() to fix problems with lyxstring.
544 * src/support/filetools.C (GetFileContents): ditto.
545 * src/buffer.C (asciiParagraph): ditto.
546 * src/paragraph.C (String): ditto.
548 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
549 * lib/bind/sciword.bind: ditto.
551 * src/LyXAction.C (init): remove "symbol-insert" function, which
552 shared LFUN_INSERT_MATH with "math-insert".
554 * lib/configure.m4: == is not a valid operator for command test.
556 * src/lyxrc.C: add using directive.
558 * src/converter.h: add std:: qualifier.
560 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
562 * src/converter.[Ch] and other files: Change the Format class to a
563 real class, and create two instances: formats and system_format.
565 * src/lyxrc.C (output): Output the difference between formats and
568 * src/frontends/xforms/FormPreferences.C (input): Simplify.
569 (buildFormats): Insert formats into browser.
570 (inputFormats): Made the browser and add button functional.
571 (applyFormats): Update formats from format_vec.
573 * src/converter.C: Changed all (*it). to it->
574 (Format::dummy): New method.
575 (Format::importer): New format flag.
576 (Formats::GetAllFormats): New method.
577 (Formats::Add): Delete format from the map if prettyname is empty.
578 (Converter::Convert): Print an error message if moving the file fails.
579 (Converter::GetReachableTo): New method
581 * src/MenuBackend.[Ch]: Add support for importformats tag.
583 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
585 * lib/configure.m4: Add word->tex and ps->fax converters.
587 * lib/ui/default.ui: Use ImportFormats on file->import menu.
588 Return fax to file menu.
592 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
594 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
597 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
600 * src/lyxfunc.C (processKeyEvent): removed
602 * src/bufferlist.C (emergencyWrite): removed the out commented
603 emergency write code.
605 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
607 * src/LyXView.[Ch]: remove the outcommented raw_callback code
609 * many files: change formatting to be a bit more uniform for
610 if,while,for,switch statements, remove some parantesis not needed.
613 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
615 * config/kde.m4: make config more robust when KDEDIR is set
617 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
619 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
620 not returned a pixmap for "math-insert".
622 * src/LyXAction.C (init): sort the entries a bit.
624 2000-11-03 Juergen Vigna <jug@sad.it>
626 * src/insets/insettabular.h: added fixed number to update codes so
627 that update is only in one direction.
629 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
632 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
633 before call to edit because of redraw.
635 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
637 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
639 * lib/ui/default.ui: Populate "edit_float" menu
641 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
643 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
644 "floats-operate". The name is ugly (and the func also), but this
645 is just a band-aid until we switch to new insets.
647 2000-11-03 Rob Lahaye <lahaye@postech.edu>
649 * lib/ui/default.ui: update again the menu layout (fix some
652 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
654 * src/MenuBackend.h (fulllabel): new method.
656 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
657 the menu shortcuts of a menu are unique and whether they
658 correspond to a letter of the label.
659 (expand): call checkShortcuts when debugging.
661 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
663 * src/insets/insettext.C (InsetButtonPress): shut off warning.
665 2000-11-02 Lior Silberman <lior@Princeton.EDU>
667 * lib/examples/*.lyx : '\language default' => '\language english'
669 * lib/examples/it_splash.lyx : except where it should be italian
671 * lib/templates/*.lyx : the same
673 * doc/*.lyx* : the same
675 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
677 * lib/bind/menus.bind: remove the Layout menu entries, which I
678 somehow forgot earlier.
680 2000-11-03 Rob Lahaye <lahaye@postech.edu>
682 * lib/ui/old-default.ui: keep the old one here for reference (to
685 * lib/ui/default.ui: update the menu layout
687 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
689 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
690 Can now Apply to different insets without closing the dialog.
692 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
693 Can't actually DO anything with them yet, but I'd like a little
696 * src/frontends/xforms/input_validators.[ch]
697 (fl_lowercase_filter): new.
699 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
701 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
702 of MATH_CODE. This fixes a bug with math-macros in RTL text.
704 * src/text.C (PrepareToPrint): Show math-macros block aligned.
706 2000-11-02 Juergen Vigna <jug@sad.it>
708 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
709 on char insertion as it has already be updated by bv->updateInset().
711 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
712 if an inset inside was updated.
714 * lib/configure.cmd: commented out fax-search code
716 2000-11-01 Yves Bastide <stid@acm.org>
718 * src/tabular.C (OldFormatRead): set tabular language to the
721 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
723 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
724 class names with non-letter characters (from Yves Bastide).
726 * lib/ui/default.ui: change Item to OptItem in import menu.
727 Comment out fax stuff.
729 * lib/configure.m4: comment out fax-related stuff.
731 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
733 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
734 useful xforms helper functions. At present contains only formatted().
735 Input a string and it returns it with line breaks so that in fits
738 * src/frontends/xforms/Makefile.am: add new files.
740 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
741 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
744 * src/frontends/xforms/FormPreferences.[Ch]:
745 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
746 but lots of little clean ups. Removed enum State. Make use of
747 formatted(). Constify lots of methods. Perhaps best of all: removed
748 requirement for that horrible reinterpret_cast from pointer to long in
751 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
753 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
754 conditionalize build on xforms < 0.89
756 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
758 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
760 * src/LyXAction.C (init): comment out fax
762 * src/lyxrc.h: comment out the fax enums
763 comment out the fax variables
765 * src/commandtags.h: comment out LFUN_FAX
767 * src/lyxrc.C: disable fax variables.
768 (read): disable parsing of fax variables
769 (output): disable writing of fax variables
770 (getFeedback): now description for fax variables
772 * src/lyxfunc.C: comment out MenuFax
773 (Dispatch): disable LFUN_FAX
775 * src/lyx_cb.C (MenuFax): comment out
777 * src/WorkArea.C: add <cctype>
778 (work_area_handler): better key handling, should be ok now.
779 for accented chars + etc
781 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
782 lyx_sendfax.h and lyx_sendfax_man.C
784 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
785 (show): don't call InitLyXLookup when using xforms 0.89
787 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
789 * src/trans.C (AddDeadkey): better fix, the other one could crash...
791 * src/support/filetools.C (GetFileContents): close to dummy change
793 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
795 * src/trans.C (AddDeadkey): workaround stupid compilers.
797 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
799 * src/frontends/xforms/FormDocument.C (class_update): fix setting
800 of two-sided document.
802 2000-10-31 Juergen Vigna <jug@sad.it>
804 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
806 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
807 xposition to the Edit call.
809 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
811 * src/trans.C (AddDeadkey): cast explicitly to char.
813 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
815 * src/tabular.C (AsciiBottomHLine): simplify?
816 (AsciiTopHLine): simplify?
817 (print_n_chars): simplify
818 (DocBook): remove most of the << endl; we should flush the stream
819 as seldom as possible.
821 (TeXBottomHLine): ditto
824 (write_attribute): try a templified version.
825 (set_row_column_number_info): lesson scope of variables
827 * src/support/lstrings.h (tostr): new specialization of tostr
829 * src/trans.C (AddDeadkey): slightly cleaner fix.
831 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
833 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
834 '%%' in Toc menu labels.
837 * src/insets/insetlatexaccent.C (draw): Correct rendering when
838 font_norm is iso10646-1.
840 * src/font.C (ascent): Fixed for 16bit fonts
841 (descent,lbearing,rbearing): ditto
843 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
845 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
846 (getFeedback): new static method.
848 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
849 Now use combox rather than choice to display languages.
850 Feedback is now output using a new timer callback mechanism, identical
851 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
853 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
855 * src/minibuffer.C: fix for older compilers
857 2000-10-30 Juergen Vigna <jug@sad.it>
859 * src/insets/insettext.C (InsertInset): fixed this as the cursor
860 has to be Left of the inset otherwise LyXText won't find it!
862 * src/BufferView2.C (open_new_inset): delete the inset if it can
865 2000-10-30 Rob Lahaye <lahaye@postech.edu>
869 2000-10-29 Marko Vendelin <markov@ioc.ee>
870 * src/frontends/gnome/FormCitation.C
871 * src/frontends/gnome/FormCitation.h
872 * src/frontends/gnome/FormCopyright.C
873 * src/frontends/gnome/FormCopyright.h
874 * src/frontends/gnome/FormError.C
875 * src/frontends/gnome/FormError.h
876 * src/frontends/gnome/FormIndex.C
877 * src/frontends/gnome/FormIndex.h
878 * src/frontends/gnome/FormPrint.C
879 * src/frontends/gnome/FormPrint.h
880 * src/frontends/gnome/FormRef.C
881 * src/frontends/gnome/FormRef.h
882 * src/frontends/gnome/FormToc.C
883 * src/frontends/gnome/FormToc.h
884 * src/frontends/gnome/FormUrl.C
885 * src/frontends/gnome/FormUrl.h
886 * src/frontends/gnome/Menubar_pimpl.C
887 * src/frontends/gnome/mainapp.C
888 * src/frontends/gnome/mainapp.h
889 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
890 changing update() to updateSlot() where appropriate
892 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
894 * src/frontends/xforms/FormPreferences.[Ch]:
895 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
898 2000-10-28 Juergen Vigna <jug@sad.it>
900 * src/insets/insettabular.C (draw): fixed drawing bug.
902 * src/insets/insettext.C (clear):
904 (SetParagraphData): clearing the TEXT buffers when deleting the
905 paragraphs used by it.
907 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
909 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
911 2000-10-27 Juergen Vigna <jug@sad.it>
913 * src/tabular.C (~LyXTabular): removed not needed anymore.
915 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
918 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
920 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
923 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
926 * src/frontends/xforms/FormPreferences.[Ch]:
927 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
928 Reorganised as modules based on tabs. Much easier to follow the
929 flow and to add new tabs. Added warning and feedback messages.
932 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
934 * src/tabular.h (DocBook): add std:: qualifier.
936 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
938 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
939 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
942 * insettabular.C (DocBook): uses the tabular methods to export
945 * src/insets/insettext.h
946 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
948 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
950 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
953 * src/lyxfunc.C (MenuNew): lessen the scope of fname
954 moved misplaced AllowInput two lines up.
956 * src/buffer.C (readFile): compare float with float, not with int
958 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
960 * src/minibuffer.C: add "using SigC::slot" statement.
962 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
964 * src/frontends/xforms/forms/README: updated section about make.
966 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
967 Tidied some forms up, made two of form_tabular's tabs more
968 self-consistent, fixed Jean-Marc's size problem in form_preferences,
969 fixed translation problem with "Column".
971 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
973 * src/minibuffer.h: use Timeout instead of the xforms timer
975 (setTimer) rewrite for the Timeout, change to unsigned arg
976 (set): change to unsigned timer arg
979 * src/minibuffer.C (TimerCB): removed func
980 (C_MiniBuffer_TimerCB): removed func
981 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
982 (peek_event): use a switch statement
983 (add): don't use fl_add_timer.
984 (Set): rewrite to use the Timeout
987 * src/Timeout.[Ch] (setType): return a Timeout &
988 (setTimeout): ditto, change to unsigned arg for timeout
990 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
992 * src/mathed/formula.C (mathed_string_width): Use string instead
993 of a constant size char array.
995 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
997 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
998 the two recently added operator<< for SMInput and State.
1000 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
1002 (OkCancelPolicy): ditto
1003 (OkCancelReadOnlyPolicy): ditto
1004 (NoRepeatedApplyReadOnlyPolicy): ditto
1005 (OkApplyCancelReadOnlyPolicy): ditto
1006 (OkApplyCancelPolicy): ditto
1007 (NoRepeatedApplyPolicy): ditto
1009 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1011 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
1012 add the usual std:: qualifiers.
1014 2000-10-25 Juergen Vigna <jug@sad.it>
1016 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
1018 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1020 * src/support/filetools.C (MakeRelPath): change some types to
1023 * src/frontends/ButtonPolicies.h (operator<<): new operator for
1024 ButtonPolicy::SMInput and ButtonPolicy::State.
1026 * src/FontLoader.C (reset): small cleanup
1027 (unload): small cleanup
1029 * src/FontInfo.C (getFontname): initialize error to 10000.0
1031 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1033 * src/frontends/xforms/FormPreferences.[Ch]:
1034 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
1035 TeX encoding and default paper size sections.
1037 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1039 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
1042 * src/frontends/xforms/FormError.C (disconnect): use erase() to
1043 make the message_ empty.
1044 (FormError): don't initialize message_ in initializer list.
1046 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1048 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1050 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1052 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1054 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1056 * src/frontends/kde/*data.[Ch]: _("") is not
1059 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1061 * src/buffer.C: removed redundant using directive.
1063 * src/frontends/DialogBase.h: revert to original definition of
1066 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1067 stuff into two classes, one for each dialog, requires a new
1068 element in the dialogs vector, FormTabularCreate.
1070 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1073 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1074 method. Continues Allan's idea, but means that derived classes
1075 don't need to worry about "update or hide?".
1077 * src/frontends/xforms/FormError.C (showInset): add connection
1080 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1081 one for each dialog. FormTabular now contains main tabular dialog
1084 * src/frontends/xforms/FormTabularCreate.[Ch]:
1085 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1088 * src/frontends/xforms/FormGraphics.[Ch]:
1089 * src/frontends/xforms/forms/form_graphics.fd
1090 * src/frontends/xforms/FormTabular.[Ch]:
1091 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1092 classes of FormInset.
1094 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1095 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1097 * src/frontends/xforms/Makefile.am:
1098 * src/frontends/xforms/forms/makefile: added new files.
1100 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1101 variable. added Signal0 hide signal, in keeping with other GUI-I
1104 * src/support/lstrings.h: removed redundant std:: qualifier as
1105 it's already declared in Lsstream.h.
1107 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1109 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1113 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1115 * src/tabular.C (Ascii): minimize scope of cell.
1117 * src/BufferView2.C (nextWord): return string() instead of 0;
1119 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1121 * src/converter.h: add a std:: qualifier
1123 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1125 * src/importer.[Ch]: New files. Used for importing files into LyX.
1127 * src/lyxfunc.C (doImport): Use the new Importer class.
1129 * src/converter.h: Add shortcut member to the Format class.
1130 Used for holding the menu shortcut.
1132 * src/converter.C and other files: Made a distinction between
1133 format name and format extension. New formats can be defined using
1134 the \format lyxrc tag.
1135 Added two new converter flags: latex and disable.
1137 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1139 * src/support/lyxlib.h: unify namespace/struct implementation.
1140 Remove extra declarations.
1142 * src/support/chdir.C (chdir): remove version taking char const *
1144 * src/support/rename.C: ditto.
1145 * src/support/lyxsum.C: ditto.
1147 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1149 * src/frontends/xforms/FormBase.[Ch]:
1150 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1151 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1152 work only for the next call to fl_show_form(). The correct place to set
1153 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1154 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1155 from FormBase have the minimum size set; no more stupid crashes with
1158 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1160 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1162 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1164 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1166 * src/support/lyxlib.h: changed second argument of mkdir to
1167 unsigned long int (unsigned int would probably have been enough,
1168 but...). Removed <sys/types.h> header.
1169 * src/support/mkdir.C (mkdir): ditto.
1173 2000-10-19 Juergen Vigna <jug@sad.it>
1175 * src/lyxfunc.C (MenuNew): small fix (form John)
1177 * src/screen.C (Update): removed unneeded code.
1179 * src/tabular.C (Ascii): refixed int != uint bug!
1181 * src/support/lyxlib.h: added sys/types.h include for now permits
1182 compiling, but I don't like this!
1184 2000-10-18 Juergen Vigna <jug@sad.it>
1186 * src/text2.C (ClearSelection): if we clear the selection we need
1187 more refresh so set the status apropriately
1189 * src/insets/insettext.C (draw): hopefully finally fixed draw
1192 2000-10-12 Juergen Vigna <jug@sad.it>
1194 * src/insets/insettext.C (draw): another small fix and make a block
1195 so that variables are localized.
1197 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1199 * src/support/lstrings.C (lowercase, uppercase):
1200 use explicit casts to remove compiler warnings.
1202 * src/support/LRegex.C (Impl):
1203 * src/support/StrPool.C (add):
1204 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1205 (AddPath, MakeDisplayPath):
1206 * src/support/lstrings.C (prefixIs, subst):
1207 use correct type to remove compiler warnings.
1209 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1211 * src/support/lyxlib.h:
1212 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1213 portability and to remove compiler warning with DEC cxx.
1215 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1217 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1219 * src/minibuffer.C (peek_event): retun 1 when there has been a
1220 mouseclick in the minibuffer.
1224 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1226 * src/frontends/xforms/FormParagraph.C: more space above/below
1229 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1231 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1232 a char only if real_current_font was changed.
1234 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1236 * NEWS: update somewhat for 1.1.6
1238 * lib/ui/default.ui: clean up.
1240 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1242 * lib/CREDITS: clean up
1244 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1246 * src/combox.[Ch] (select): changed argument back to int
1247 * src/combox.C (peek_event): removed num_bytes as it is declared but
1250 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1251 modified calls to Combox::select() to remove warnings about type
1254 * src/insets/insetbutton.C (width): explicit cast to remove warning
1255 about type conversion.
1257 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1260 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1261 sel_pos_end, refering to cursor position are changed to
1262 LyXParagraph::size_type.
1264 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1265 consistent with LyXCursor::pos().
1266 (inset_pos): changed to LyXParagraph::size_type for same reason.
1268 * src/insets/insettext.C (resizeLyXText): changed some temporary
1269 variables refing to cursor position to LyXParagraph::size_type.
1271 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1273 * src/frontends/kde/<various>: The Great Renaming,
1276 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1278 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1280 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1282 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1283 0 when there are no arguments.
1285 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1287 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1288 to segfaults when pressing Ok in InsetBibtex dialog.
1290 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1292 * forms/layout_forms.fd:
1293 * src/layout_forms.C (create_form_form_character): small change to use
1294 labelframe rather than engraved frame + text
1296 * src/lyx_gui.C (create_forms): initialise choice_language with some
1297 arbitrary value to prevent segfault when dialog is shown.
1299 2000-10-16 Baruch Even <baruch.even@writeme.com>
1301 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1302 is no resulting file. This pertains only to LaTeX output.
1304 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1306 * src/text.C (Backspace): Make sure that the row of the cursor is
1309 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1312 * src/lyx_gui.C (init): Prevent a crash when only one font from
1313 menu/popup fonts is not found.
1315 * lib/lyxrc.example: Add an example for binding a key for language
1318 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1320 * src/converter.C (GetReachable): Changed the returned type to
1322 (IsReachable): New method
1324 * src/MenuBackend.C (expand): Handle formats that appear more
1327 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1329 * src/frontends/support/Makefile.am
1330 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1333 * lib/CREDITS: add Garst Reese.
1335 * src/support/snprintf.h: add extern "C" {} around the definitions.
1337 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1339 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1342 * src/frontends/xforms/FormDocument.C:
1343 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1344 compile without "conversion to integral type of smaller size"
1347 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1349 * src/text.C (GetColumnNearX): Fixed disabled code.
1351 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1353 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1356 * src/support/snprintf.[ch]: new files
1358 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1360 * src/frontends/kde/formprintdialog.C: add
1361 file browser for selecting postscript output
1363 * src/frontends/kde/formprintdialogdata.C:
1364 * src/frontends/kde/formprintdialogdata.h: re-generate
1367 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1369 * src/frontends/gnome/Makefile.am:
1370 * src/frontends/kde/Makefile.am: FormCommand.C
1371 disappeared from xforms
1373 * src/frontends/kde/FormCitation.C:
1374 * src/frontends/kde/FormIndex.C: read-only
1377 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1379 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1382 * src/bufferlist.C: add using directive.
1384 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1386 * src/support/lyxfunctional.h: version of class_fun for void
1387 returns added, const versions of back_inseter_fun and compare_fun
1390 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1392 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1394 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1396 * ChangeLog: cleanup.
1398 * lib/CREDITS: update to add all the contributors we've forgotten.
1399 I have obviously missed some, so tell me whether there were
1402 2000-10-13 Marko Vendelin <markov@ioc.ee>
1404 * src/frontends/gnome/FormCitation.C
1405 * src/frontends/gnome/FormCitation.h
1406 * src/frontends/gnome/FormError.C
1407 * src/frontends/gnome/FormIndex.C
1408 * src/frontends/gnome/FormRef.C
1409 * src/frontends/gnome/FormRef.h
1410 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1412 * src/frontends/gnome/FormCitation.C
1413 * src/frontends/gnome/FormCopyright.C
1414 * src/frontends/gnome/FormError.C
1415 * src/frontends/gnome/FormIndex.C
1416 * src/frontends/gnome/FormRef.C
1417 * src/frontends/gnome/FormToc.C
1418 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1421 * src/frontends/gnome/Menubar_pimpl.C
1422 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1425 2000-10-11 Baruch Even <baruch.even@writeme.com>
1428 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1429 to convey its real action.
1431 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1432 clear the minibuffer and prepare to enter a command.
1434 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1435 the rename from ExecCommand to PrepareForCommand.
1436 * src/lyxfunc.C (Dispatch): ditto.
1438 2000-10-11 Baruch Even <baruch.even@writeme.com>
1440 * src/buffer.C (writeFile): Added test for errors on writing, this
1441 catches all errors and not only file system full errors as intended.
1443 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1445 * src/lyx_gui.C (create_forms): better fix for crash with
1446 translated interface.
1448 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1450 * src/frontends/kde/Makefile.am:
1451 * src/frontends/kde/FormCopyright.C:
1452 * src/frontends/kde/formcopyrightdialog.C:
1453 * src/frontends/kde/formcopyrightdialog.h:
1454 * src/frontends/kde/formcopyrightdialogdata.C:
1455 * src/frontends/kde/formcopyrightdialogdata.h:
1456 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1457 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1458 copyright to use qtarch
1460 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1462 * src/encoding.C (read): Fixed bug that caused an error message at
1463 the end of the file.
1465 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1467 * lib/lyxrc.example: Fixed hebrew example.
1469 2000-10-13 Allan Rae <rae@lyx.org>
1471 * src/frontends/xforms/FormPreferences.C (input): reworking the
1473 (build, update, apply): New inputs in various tabfolders
1475 * src/frontends/xforms/FormToc.C: use new button policy.
1476 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1477 dialogs that either can't use any existing policy or where it just
1480 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1483 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1484 added a bool parameter which is ignored.
1486 * src/buffer.C (setReadonly):
1487 * src/BufferView_pimpl.C (buffer):
1488 * src/frontends/kde/FormCopyright.h (update):
1489 * src/frontends/kde/FormCitation.[Ch] (update):
1490 * src/frontends/kde/FormIndex.[Ch] (update):
1491 * src/frontends/kde/FormPrint.[Ch] (update):
1492 * src/frontends/kde/FormRef.[Ch] (update):
1493 * src/frontends/kde/FormToc.[Ch] (update):
1494 * src/frontends/kde/FormUrl.[Ch] (update):
1495 * src/frontends/gnome/FormCopyright.h (update):
1496 * src/frontends/gnome/FormCitation.[Ch] (update):
1497 * src/frontends/gnome/FormError.[Ch] (update):
1498 * src/frontends/gnome/FormIndex.[Ch] (update):
1499 * src/frontends/gnome/FormPrint.[Ch] (update):
1500 * src/frontends/gnome/FormRef.h (update):
1501 * src/frontends/gnome/FormToc.[Ch] (update):
1502 * src/frontends/gnome/FormUrl.[Ch] (update):
1503 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1504 to updateBufferDependent and DialogBase
1506 * src/frontends/xforms/FormCitation.[hC]:
1507 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1508 * src/frontends/xforms/FormError.[Ch]:
1509 * src/frontends/xforms/FormGraphics.[Ch]:
1510 * src/frontends/xforms/FormIndex.[Ch]:
1511 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1512 and fixed readOnly handling.
1513 * src/frontends/xforms/FormPrint.[Ch]:
1514 * src/frontends/xforms/FormRef.[Ch]:
1515 * src/frontends/xforms/FormTabular.[Ch]:
1516 * src/frontends/xforms/FormToc.[Ch]:
1517 * src/frontends/xforms/FormUrl.[Ch]:
1518 * src/frontends/xforms/FormInset.[Ch]:
1519 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1520 form of updateBufferDependent.
1522 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1523 if form()->visible just in case someone does stuff to the form in a
1526 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1527 the buttoncontroller for everything the enum used to be used for.
1528 (update) It would seem we need to force all dialogs to use a bool
1529 parameter or have two update functions. I chose to go with one.
1530 I did try removing update() from here and FormBase and defining the
1531 appropriate update signatures in FormBaseB[DI] but then ran into the
1532 problem of the update() call in FormBase::show(). Whatever I did
1533 to get around that would require another function and that just
1534 got more confusing. Hence the decision to make everyone have an
1535 update(bool). An alternative might have been to override show() in
1536 FormBaseB[DI] and that would allow the different and appropriate
1539 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1540 true == buffer change occurred. I decided against using a default
1541 template parameter since not all compilers support that at present.
1543 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1545 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1546 army knife" by removing functionality.
1547 (clearStore): removed. All such housekeeping on hide()ing the dialog
1548 is to be carried out by overloaded disconnect() methods.
1549 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1550 superceded by Baruch's neat test (FormGraphics) to update an existing
1551 dialog if a new signal is recieved rather than block all new signals
1553 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1554 only to Inset dialogs.
1555 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1556 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1558 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1560 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1561 as a base class to all inset dialogs. Used solely to connect/disconnect
1562 the Inset::hide signal and to define what action to take on receipt of
1563 a UpdateBufferDependent signal.
1564 (FormCommand): now derived from FormInset.
1566 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1569 * src/frontends/xforms/FormCopyright.[Ch]:
1570 * src/frontends/xforms/FormPreferences.[Ch]:
1571 now derived from FormBaseBI.
1573 * src/frontends/xforms/FormDocument.[Ch]:
1574 * src/frontends/xforms/FormParagraph.[Ch]:
1575 * src/frontends/xforms/FormPrint.[Ch]:
1576 now derived from FormBaseBD.
1578 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1580 * src/frontends/xforms/FormCitation.[Ch]:
1581 * src/frontends/xforms/FormError.[Ch]:
1582 * src/frontends/xforms/FormRef.[Ch]:
1583 * src/frontends/xforms/FormToc.[Ch]:
1584 (clearStore): reworked as disconnect().
1586 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1589 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1591 * src/converter.C (runLaTeX): constify buffer argument
1594 * src/frontends/support/Makefile.am (INCLUDES): fix.
1596 * src/buffer.h: add std:: qualifier
1597 * src/insets/figinset.C (addpidwait): ditto
1598 * src/MenuBackend.C: ditto
1599 * src/buffer.C: ditto
1600 * src/bufferlist.C: ditto
1601 * src/layout.C: ditto
1602 * src/lyxfunc.C: ditto
1604 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1606 * src/lyxtext.h (bidi_level): change return type to
1607 LyXParagraph::size_type.
1609 * src/lyxparagraph.h: change size_type to
1610 TextContainer::difference_type. This should really be
1611 TextContainer::size_type, but we need currently to support signed
1614 2000-10-11 Marko Vendelin <markov@ioc.ee>
1615 * src/frontends/gnome/FormError.h
1616 * src/frontends/gnome/FormRef.C
1617 * src/frontends/gnome/FormRef.h
1618 * src/frontends/gnome/FormError.C
1619 * src/frontends/gnome/Makefile.am
1620 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1621 to Gnome frontend. Both dialogs use "action" area.
1623 2000-10-12 Baruch Even <baruch.even@writeme.com>
1625 * src/graphics/GraphicsCacheItem_pimpl.C:
1626 * src/graphics/Renderer.C:
1627 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1630 2000-10-12 Juergen Vigna <jug@sad.it>
1632 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1633 visible when selecting).
1635 * development/Code_rules/Rules: fixed some typos.
1637 2000-10-09 Baruch Even <baruch.even@writeme.com>
1639 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1640 compiling on egcs 1.1.2 possible.
1642 * src/filedlg.C (comp_direntry::operator() ): ditto.
1644 2000-08-31 Baruch Even <baruch.even@writeme.com>
1646 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1649 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1650 transient it now only gets freed when the object is destructed.
1652 2000-08-24 Baruch Even <baruch.even@writeme.com>
1654 * src/frontends/FormGraphics.h:
1655 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1658 2000-08-20 Baruch Even <baruch.even@writeme.com>
1660 * src/insets/insetgraphics.C:
1661 (draw): Added messages to the drawn rectangle to report status.
1662 (updateInset): Disabled the use of the inline graphics,
1665 2000-08-17 Baruch Even <baruch.even@writeme.com>
1667 * src/frontends/support: Directory added for the support of GUII LyX.
1669 * src/frontends/support/LyXImage.h:
1670 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1673 * src/frontends/support/LyXImage_X.h:
1674 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1675 version of LyXImage, this uses the Xlib Pixmap.
1677 * src/PainterBase.h:
1678 * src/PainterBase.C:
1680 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1681 replacement to Pixmap.
1683 * src/insets/insetgraphics.h:
1684 * src/insets/insetgraphics.C:
1685 * src/graphics/GraphicsCacheItem.h:
1686 * src/graphics/GraphicsCacheItem.C:
1687 * src/graphics/GraphicsCacheItem_pimpl.h:
1688 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1691 * src/graphics/GraphicsCacheItem.h:
1692 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1693 another copy of the object.
1695 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1696 of cacheHandle, this fixed a bug that sent LyX crashing.
1698 * src/graphics/XPM_Renderer.h:
1699 * src/graphics/XPM_Renderer.C:
1700 * src/graphics/EPS_Renderer.h:
1701 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1703 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1705 * src/lyxfunc.C (processKeySym): only handle the
1706 lockinginset/inset stuff if we have a buffer and text loaded...
1708 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1710 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1712 * src/support/lyxfunctional.h: add operator= that takes a reference
1714 * src/lyxserver.C (mkfifo): make first arg const
1716 * src/layout.h: renamed name(...) to setName(...) to work around
1719 * src/buffer.C (setFileName): had to change name of function to
1720 work around bugs in egcs. (renamed from fileName)
1722 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1724 * src/support/translator.h: move helper template classes to
1725 lyxfunctional.h, include "support/lyxfunctional.h"
1727 * src/support/lyxmanip.h: add delaration of fmt
1729 * src/support/lyxfunctional.h: new file
1730 (class_fun_t): new template class
1731 (class_fun): helper template function
1732 (back_insert_fun_iterator): new template class
1733 (back_inserter_fun): helper template function
1734 (compare_memfun_t): new template class
1735 (compare_memfun): helper template function
1736 (equal_1st_in_pair): moved here from translator
1737 (equal_2nd_in_pair): moved here from translator
1739 * src/support/fmt.C: new file
1740 (fmt): new func, can be used for a printf substitute when still
1741 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1743 * src/support/StrPool.C: add some comments
1745 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1748 * src/insets/figinset.C (addpidwait): use std::copy with
1749 ostream_iterator to fill the pidwaitlist
1751 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1753 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1756 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1759 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1761 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1762 (class_update): ditto
1763 (BulletPanel): ditto
1764 (CheckChoiceClass): move initialization of tc and tct
1766 * src/tabular.C: remove current_view
1767 (OldFormatRead): similar to right below [istream::ignore]
1769 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1770 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1771 unused [istream::ignore]
1773 * src/lyxfunc.C: include "support/lyxfunctional.h"
1774 (getInsetByCode): use std::find_if and compare_memfun
1776 * src/lyxfont.C (stateText): remove c_str()
1778 * src/lyx_main.C (setDebuggingLevel): make static
1779 (commandLineHelp): make static
1781 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1782 Screen* together with fl_get_display() and fl_screen
1784 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1785 togheter with fl_get_display() and fl_screen
1786 (create_forms): remove c_str()
1788 * src/layout.C: include "support/lyxfunctional.h"
1789 (hasLayout): use std::find_if and compare_memfun
1790 (GetLayout): use std::find_if and comapre_memfun
1791 (delete_layout): use std::remove_if and compare_memfun
1792 (NumberOfClass): use std:.find_if and compare_memfun
1794 * src/gettext.h: change for the new functions
1796 * src/gettext.C: new file, make _(char const * str) and _(string
1797 const & str) real functions.
1799 * src/font.C (width): rewrite slightly to avoid one extra variable
1801 * src/debug.C: initialize Debug::ANY here
1803 * src/commandtags.h: update number comments
1805 * src/combox.h (get): make const func
1807 (getline): make const
1809 * src/combox.C (input_cb): handle case where fl_get_input can
1812 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1813 "support/lyxfunctional.h", remove current_view variable.
1814 (resize): use std::for_each with std::mem_fun
1815 (getFileNames): use std::copy with back_inserter_fun
1816 (getBuffer): change arg type to unsigned int
1817 (emergencyWriteAll): call emergencyWrite with std::for_each and
1819 (emergencyWrite): new method, the for loop in emergencyWriteAll
1821 (exists): use std::find_if with compare_memfun
1822 (getBuffer): use std::find_if and compare_memfun
1824 * src/buffer.h: add typedefs for iterator_category, value_type
1825 difference_type, pointer and reference for inset_iterator
1826 add postfix ++ for inset_iterator
1827 make inset_iterator::getPos() const
1829 * src/buffer.C: added support/lyxmanip.h
1830 (readFile): use lyxerr << fmt instead of printf
1831 (makeLaTeXFile): use std::copy to write out encodings
1833 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1835 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1836 free and the char * temp.
1837 (hasMenu): use std::find_if and compare_memfun
1840 * src/Makefile.am (lyx_SOURCES): added gettext.C
1842 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1843 string::insert small change to avoid temporary
1845 * src/LColor.C (getGUIName): remove c_str()
1847 * several files: change all occurrences of fl_display to
1850 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1851 that -pedantic is not used for gcc 2.97 (cvs gcc)
1853 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1855 2000-10-11 Allan Rae <rae@lyx.org>
1857 * src/frontends/xforms/FormPreferences.C (input): template path must be
1858 a readable directory. It doesn't need to be writeable.
1859 (build, delete, update, apply): New inputs in the various tabfolders
1861 * src/frontends/xforms/forms/form_preferences.fd:
1862 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1863 several new entries to existing folders. Shuffled some existing stuff
1866 * src/frontends/xforms/forms/form_print.fd:
1867 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1868 Should probably rework PrinterParams as well. Note that the switch to
1869 collated is effectively the same as !unsorted so changing PrinterParams
1870 will require a lot of fiddly changes to reverse the existing logic.
1872 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1874 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1876 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1878 2000-10-10 Allan Rae <rae@lyx.org>
1881 * src/lyxfunc.C (Dispatch):
1883 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1886 * src/lyxrc.C (output): Only write the differences between system lyxrc
1887 and the users settings.
1890 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1892 I'll rewrite this later, after 1.1.6 probably, to keep a single
1893 LyXRC but two instances of a LyXRCStruct.
1895 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1897 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1899 * src/tabular.h: add a few std:: qualifiers.
1901 * src/encoding.C: add using directive.
1902 * src/language.C: ditto.
1904 * src/insets/insetquotes.C (Validate): use languages->lang()
1905 instead of only language.
1907 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1909 * lib/languages: New file.
1911 * lib/encodings: New file.
1913 * src/language.C (Languages): New class.
1914 (read): New method. Reads the languages from the 'languages' file.
1916 * src/encoding.C (Encodings): New class.
1917 (read): New method. Reads the encodings from the 'encodings' file.
1919 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1922 * src/bufferparams.h and a lot of files: Deleted the member language,
1923 and renamed language_info to language
1925 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1926 * src/lyxfont.C (latexWriteStartChanges): ditto.
1927 * src/paragraph.C (validate,TeXOnePar): ditto.
1929 * src/lyxfont.C (update): Restored deleted code.
1931 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1933 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1935 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1937 * src/insets/figinset.[Ch]:
1938 * src/insets/insetinclude.[Ch]:
1939 * src/insets/insetinclude.[Ch]:
1940 * src/insets/insetparent.[Ch]:
1941 * src/insets/insetref.[Ch]:
1942 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1944 * src/insets/*.[Ch]:
1945 * src/mathed/formula.[Ch]:
1946 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1948 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1949 * src/lyx_cb.C (FigureApplyCB):
1950 * src/lyxfunc.C (getStatus, Dispatch):
1951 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1954 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1956 * src/converter.[Ch] (Formats::View):
1957 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1959 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1960 *current_view->buffer(). This will change later, but this patch is way
1963 2000-10-09 Juergen Vigna <jug@sad.it>
1965 * src/text.C (GetRow): small fix.
1967 * src/BufferView_pimpl.C (cursorPrevious):
1968 (cursorNext): added LyXText parameter to function.
1970 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1971 keypress depending on cursor position.
1973 2000-10-06 Juergen Vigna <jug@sad.it>
1975 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1976 (copySelection): redone this function and also copy ascii representa-
1979 * src/tabular.C (Ascii):
1983 (print_n_chars): new functions to realize the ascii export of tabulars.
1985 2000-10-05 Juergen Vigna <jug@sad.it>
1987 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1988 if we don't have a buffer.
1990 2000-10-10 Allan Rae <rae@lyx.org>
1992 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1993 with closing dialog. It seems that nested tabfolders require hiding
1994 of inner tabfolders before hiding the dialog itself. Actually all I
1995 did was hide the active outer folder.
1997 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1998 unless there really is a buffer. hideBufferDependent is called
2001 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
2002 POTFILES.in stays in $(srcdir).
2004 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
2006 * lib/lyxrc.example: Few changes.
2008 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
2010 * src/BufferView_pimpl.C (buffer): only need one the
2011 updateBufferDependent signal to be emitted once! Moved to the end of
2012 the method to allow bv_->text to be updated first.
2014 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
2015 and hSignal_ with Dialogs * and BufferDependency variables.
2016 New Buffer * parent_, initialised when the dialog is launched. Used to
2017 check whether to update() or hide() dialog in the new, private
2018 updateOrHide() method that is connected to the updateBufferDependent
2019 signal. Daughter classes dictate what to do using the
2020 ChangedBufferAction enum, passed to the c-tor.
2022 * src/frontends/xforms/FormCitation.C:
2023 * src/frontends/xforms/FormCommand.C:
2024 * src/frontends/xforms/FormCopyright.C:
2025 * src/frontends/xforms/FormDocument.C:
2026 * src/frontends/xforms/FormError.C:
2027 * src/frontends/xforms/FormIndex.C:
2028 * src/frontends/xforms/FormPreferences.C:
2029 * src/frontends/xforms/FormPrint.C:
2030 * src/frontends/xforms/FormRef.C:
2031 * src/frontends/xforms/FormToc.C:
2032 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
2035 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
2036 ChangedBufferAction enum.
2038 * src/frontends/xforms/FormParagraph.[Ch]
2039 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
2042 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2044 * lib/bind/cua.bind: fix a bit.
2045 * lib/bind/emacs.bind: ditto.
2047 * lib/bind/menus.bind: remove real menu entries from there.
2049 * src/spellchecker.C: make sure we only include strings.h when
2052 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2054 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2055 function. It enlarges the maximum number of pup when needed.
2056 (add_toc2): Open a new menu if maximum number of items per menu has
2059 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2061 * src/frontends/kde/FormPrint.C: fix error reporting
2063 * src/frontends/xforms/FormDocument.C: fix compiler
2066 * lib/.cvsignore: add Literate.nw
2068 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2071 * bufferview_funcs.[Ch]
2074 * text2.C: Add support for numbers in RTL text.
2076 2000-10-06 Allan Rae <rae@lyx.org>
2078 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2079 to be gettext.m4 friendly again. ext_l10n.h is now
2080 generated into $top_srcdir instead of $top_builddir
2081 so that lyx.pot will be built correctly -- without
2082 duplicate parsing of ext_l10n.h.
2084 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2086 * src/frontends/kde/FormCitation.C: make the dialog
2087 behave more sensibly
2089 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2091 * config/kde.m4: fix consecutive ./configure runs,
2092 look for qtarch, fix library order
2094 * src/frontends/kde/Makefile.am: tidy up,
2095 add Print dialog, add .dlg dependencies
2097 * src/frontends/kde/FormPrint.C:
2098 * src/frontends/kde/FormPrint.h:
2099 * src/frontends/kde/formprintdialog.C:
2100 * src/frontends/kde/formprintdialog.h:
2101 * src/frontends/kde/formprintdialogdata.C:
2102 * src/frontends/kde/formprintdialogdata.h:
2103 * src/frontends/kde/dlg/formprintdialog.dlg: add
2106 * src/frontends/kde/dlg/README: Added explanatory readme
2108 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2109 script to double-check qtarch's output
2111 * src/frontends/kde/formindexdialog.C:
2112 * src/frontends/kde/formindexdialogdata.C:
2113 * src/frontends/kde/formindexdialogdata.h:
2114 * src/frontends/kde/dlg/formindexdialog.dlg: update
2115 for qtarch, minor fixes
2117 2000-10-05 Allan Rae <rae@lyx.org>
2119 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2120 dialogs when switching buffers update them instead. It's up to each
2121 dialog to decide if it should still be visible or not.
2122 update() should return a bool to control visiblity within show().
2123 Or perhaps better to set a member variable and use that to control
2126 * lib/build-listerrors: create an empty "listerrors" file just to stop
2127 make trying to regenerate it all the time if you don't have noweb
2130 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2132 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2133 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2134 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2135 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2136 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2138 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2140 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2142 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2143 deleting buffer. Closes all buffer-dependent dialogs.
2145 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2147 * src/frontends/xforms/FormCitation.[Ch]:
2148 * src/frontends/xforms/FormPreferences.[Ch]:
2149 * src/frontends/xforms/FormPrint.[Ch]:
2150 * src/frontends/xforms/FormRef.[Ch]:
2151 * src/frontends/xforms/FormUrl.[Ch]: ditto
2153 * src/frontends/xforms/FormDocument.[Ch]:
2154 * src/frontends/xforms/forms/form_document.C.patch:
2155 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2156 pass through a single input() function.
2158 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2160 * lib/build-listerrors: return status as OK
2162 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2164 * lib/lyxrc.example: Updated to new export code
2166 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2168 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2171 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2174 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2175 LyX-Code is defined.
2176 * lib/layouts/amsbook.layout: ditto.
2178 * boost/Makefile.am: fix typo.
2180 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2182 (add_lastfiles): removed.
2183 (add_documents): removed.
2184 (add_formats): removed.
2186 * src/frontends/Menubar.C: remove useless "using" directive.
2188 * src/MenuBackend.h: add a new MenuItem constructor.
2190 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2193 2000-10-04 Allan Rae <rae@lyx.org>
2195 * lib/Makefile.am (listerrors):
2196 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2197 I haven't got notangle installed so Kayvan please test. The output
2198 should end up in $builddir. This also allows people who don't have
2199 noweb installed to complete the make process without error.
2201 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2202 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2203 by JMarc's picky compiler.
2205 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2208 * src/insets/insettabular.C (setPos): change for loop to not use
2209 sequencing operator. Please check this Jürgen.
2211 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2213 * src/insets/insetcite.C (getScreenLabel): ditto
2214 * src/support/filetools.C (QuoteName): ditto
2215 (ChangeExtension): ditto
2217 * src/BufferView_pimpl.C (scrollCB): make heigt int
2219 * src/BufferView2.C (insertInset): comment out unused arg
2221 * boost/Makefile.am (EXTRADIST): new variable
2223 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2225 * src/exporter.C (IsExportable): Fixed
2227 * lib/configure.m4: Small fix
2229 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2231 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2232 * src/insets/insetbib.C (bibitemWidest): ditto.
2233 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2235 2000-10-03 Juergen Vigna <jug@sad.it>
2237 * src/BufferView2.C (theLockingInset): removed const because of
2238 Agnus's compile problems.
2240 * src/insets/insettext.C (LocalDispatch): set the language of the
2241 surronding paragraph on inserting the first character.
2243 * various files: changed use of BufferView::the_locking_inset.
2245 * src/BufferView2.C (theLockingInset):
2246 (theLockingInset): new functions.
2248 * src/BufferView.h: removed the_locking_inset.
2250 * src/lyxtext.h: added the_locking_inset
2252 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2254 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2256 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2258 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2259 * src/mathed/math_cursor.C (IsAlpha): ditto.
2260 * src/mathed/math_inset.C (strnew): ditto.
2261 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2262 (IMetrics): cxp set but never used; removed.
2263 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2264 that the variable in question has been removed also!
2267 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2268 using the Buffer * passed to Latex(), using the BufferView * passed to
2269 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2271 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2272 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2274 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2275 * src/buffer.C (readInset): used new InsetBibtex c-tor
2276 * (getBibkeyList): used new InsetBibtex::getKeys
2278 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2281 * lib/build-listerrors
2283 * src/exporter.C: Add literate programming support to the export code
2286 * src/lyx_cb.C: Remove old literate code.
2288 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2291 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2292 * src/converter.C (View, Convert): Use QuoteName.
2294 * src/insets/figinset.C (Preview): Use Formats::View.
2296 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2298 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2300 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2301 the top of the function, because compaq cxx complains that the
2302 "goto exit_with_message" when the function is disabled bypasses
2304 (MenuNew): try a better fix for the generation of new file names.
2305 This time, I used AddName() instead of AddPath(), hoping Juergen
2308 2000-10-03 Allan Rae <rae@lyx.org>
2310 * src/frontends/xforms/forms/form_preferences.fd:
2311 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2312 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2313 "Look and Feel"->"General" but will need to be split up further into
2314 general output and general input tabs. Current plan is for four outer
2315 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2316 stuff; "Inputs" for input and import configuration; "Outputs" for
2317 output and export configuration; and one more whatever is left over
2318 called "General". The leftovers at present look like being which
2319 viewers to use, spellchecker, language support and might be better
2320 named "Support". I've put "Paths" in "Inputs" for the moment as this
2321 seems reasonable for now at least.
2322 One problem remains: X error kills LyX when you close Preferences.
2324 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2326 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2327 qualifier from form()
2328 * src/frontends/xforms/FormCitation.[Ch]:
2329 * src/frontends/xforms/FormCopyright.[Ch]:
2330 * src/frontends/xforms/FormDocument.[Ch]:
2331 * src/frontends/xforms/FormError.[Ch]:
2332 * src/frontends/xforms/FormIndex.[Ch]:
2333 * src/frontends/xforms/FormPreferences.[Ch]:
2334 * src/frontends/xforms/FormPrint.[Ch]:
2335 * src/frontends/xforms/FormRef.[Ch]:
2336 * src/frontends/xforms/FormToc.[Ch]:
2337 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2339 * src/frontends/xforms/FormCitation.[Ch]:
2340 * src/frontends/xforms/FormIndex.[Ch]:
2341 * src/frontends/xforms/FormRef.[Ch]:
2342 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2343 with Allan's naming policy
2345 * src/frontends/xforms/FormCitation.C: some static casts to remove
2348 2000-10-02 Juergen Vigna <jug@sad.it>
2350 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2351 now you can type or do stuff inside the table-cell also when in dummy
2352 position, fixed visible cursor.
2354 * src/insets/insettext.C (Edit): fixing cursor-view position.
2356 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2357 be used for equal functions in lyxfunc and insettext.
2359 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2361 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2363 * src/frontends/gnome/FormCitation.h:
2364 * src/frontends/gnome/FormCopyright.h:
2365 * src/frontends/gnome/FormIndex.h:
2366 * src/frontends/gnome/FormPrint.h:
2367 * src/frontends/gnome/FormToc.h:
2368 * src/frontends/gnome/FormUrl.h:
2369 * src/frontends/kde/FormCitation.h:
2370 * src/frontends/kde/FormCopyright.h:
2371 * src/frontends/kde/FormIndex.h:
2372 * src/frontends/kde/FormRef.h:
2373 * src/frontends/kde/FormToc.h:
2374 * src/frontends/kde/FormUrl.h: fix remaining users of
2377 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2379 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2380 from depth argument.
2381 (DocBookHandleCaption): ditto.
2382 (DocBookHandleFootnote): ditto.
2383 (SimpleDocBookOnePar): ditto.
2385 * src/frontends/xforms/FormDocument.h (form): remove extra
2386 FormDocument:: qualifier.
2388 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2390 * sigc++/handle.h: ditto.
2392 * src/lyx_gui_misc.C: add "using" directive.
2394 * src/cheaders/cstddef: new file, needed by the boost library (for
2397 2000-10-02 Juergen Vigna <jug@sad.it>
2399 * src/insets/insettext.C (SetFont): better support.
2401 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2403 * src/screen.C (DrawOneRow): some uint refixes!
2405 2000-10-02 Allan Rae <rae@lyx.org>
2407 * boost/.cvsignore: ignore Makefile as well
2409 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2410 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2412 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2413 Left this one out by accident.
2415 * src/frontends/xforms/FormBase.h (restore): default to calling
2416 update() since that will restore the original/currently-applied values.
2417 Any input() triggered error messages will require the derived classes
2418 to redefine restore().
2420 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2421 avoid a segfault. combo_doc_class is the main concern.
2423 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2425 * Simplify build-listerrors in view of GUI-less export ability!
2427 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2429 * src/lyx_main.C (easyParse): Disable gui when exporting
2431 * src/insets/figinset.C:
2434 * src/lyx_gui_misc.C
2435 * src/tabular.C: Changes to allow no-gui.
2437 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2439 * src/support/utility.hpp: removed file
2440 * src/support/block.h: removed file
2442 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2445 * src/mathed/formula.C: add support/lyxlib.h
2446 * src/mathed/formulamacro.C: ditto
2448 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2449 * src/lyxparagraph.h: ditto
2451 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2452 * src/frontends/Makefile.am (INCLUDES): ditto
2453 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2454 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2455 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2456 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2457 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2458 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2460 * src/BufferView.h: use boost/utility.hpp
2461 * src/LColor.h: ditto
2462 * src/LaTeX.h: ditto
2463 * src/LyXAction.h: ditto
2464 * src/LyXView.h: ditto
2465 * src/bufferlist.h: ditto
2466 * src/lastfiles.h: ditto
2467 * src/layout.h: ditto
2468 * src/lyx_gui.h: ditto
2469 * src/lyx_main.h: ditto
2470 * src/lyxlex.h: ditto
2471 * src/lyxrc.h: ditto
2472 * src/frontends/ButtonPolicies.h: ditto
2473 * src/frontends/Dialogs.h: ditto
2474 * src/frontends/xforms/FormBase.h: ditto
2475 * src/frontends/xforms/FormGraphics.h: ditto
2476 * src/frontends/xforms/FormParagraph.h: ditto
2477 * src/frontends/xforms/FormTabular.h: ditto
2478 * src/graphics/GraphicsCache.h: ditto
2479 * src/graphics/Renderer.h: ditto
2480 * src/insets/ExternalTemplate.h: ditto
2481 * src/insets/insetcommand.h: ditto
2482 * src/support/path.h: ditto
2484 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2485 and introduce clause for 2.97.
2487 * boost/libs/README: new file
2489 * boost/boost/utility.hpp: new file
2491 * boost/boost/config.hpp: new file
2493 * boost/boost/array.hpp: new file
2495 * boost/Makefile.am: new file
2497 * boost/.cvsignore: new file
2499 * configure.in (AC_OUTPUT): add boost/Makefile
2501 * Makefile.am (SUBDIRS): add boost
2503 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2505 * src/support/lstrings.C (suffixIs): Fixed.
2507 2000-10-01 Allan Rae <rae@lyx.org>
2509 * src/PrinterParams.h: moved things around to avoid the "can't
2510 inline call" warning.
2512 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2513 into doc++ documentation.
2515 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2517 * src/frontends/xforms/FormRef.C: make use of button controller
2518 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2519 cleaned up button controller usage.
2520 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2521 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2522 use the button controller
2524 * src/frontends/xforms/forms/*.fd: and associated generated files
2525 updated to reflect changes to FormBase. Some other FormXxxx files
2526 also got minor updates to reflect changes to FormBase.
2528 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2529 (hide): made virtual.
2530 (input): return a bool. true == valid input
2531 (RestoreCB, restore): new
2532 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2533 Changes to allow derived dialogs to use a ButtonController and
2534 make sense when doing so: OK button calls ok() and so on.
2536 * src/frontends/xforms/ButtonController.h (class ButtonController):
2537 Switch from template implementation to taking Policy parameter.
2538 Allows FormBase to provide a ButtonController for any dialog.
2540 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2541 Probably should rename connect and disconnect.
2542 (apply): use the radio button groups
2543 (form): needed by FormBase
2544 (build): setup the radio button groups
2546 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2548 * several files: type changes to reduce the number of warnings and
2549 to unify type hangling a bit. Still much to do.
2551 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2553 * lib/images/*: rename a bunch of icons to match Dekel converter
2556 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2559 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2561 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2563 * sigc++/handle.h: ditto for class Handle.
2565 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2567 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2569 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2571 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2572 removal of the "default" language.
2574 * src/combox.h (getline): Check that sel > 0
2576 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2578 * lib/examples/docbook_example.lyx
2579 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2581 * lib/layouts/docbook-book.layout: new docbook book layout.
2583 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2585 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2587 * src/insets/figinset.C (DocBook):fixed small typo.
2589 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2591 * src/insets/insetinclude.h: string include_label doesn't need to be
2594 2000-09-29 Allan Rae <rae@lyx.org>
2596 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2597 Allow derived type to control connection and disconnection from signals
2598 of its choice if desired.
2600 2000-09-28 Juergen Vigna <jug@sad.it>
2602 * src/insets/insettabular.C (update): fixed cursor setting when
2603 the_locking_inset changed.
2604 (draw): made this a bit cleaner.
2605 (InsetButtonPress): fixed!
2607 * various files: added LyXText Parameter to fitCursor call.
2609 * src/BufferView.C (fitCursor): added LyXText parameter.
2611 * src/insets/insettabular.C (draw): small draw fix.
2613 * src/tabular.C: right setting of left/right celllines.
2615 * src/tabular.[Ch]: fixed various types in funcions and structures.
2616 * src/insets/insettabular.C: ditto
2617 * src/frontends/xforms/FormTabular.C: ditto
2619 2000-09-28 Allan Rae <rae@lyx.org>
2621 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2622 that the #ifdef's had been applied to part of what should have been
2623 a complete condition. It's possible there are other tests that
2624 were specific to tables that are also wrong now that InsetTabular is
2625 being used. Now we need to fix the output of '\n' after a table in a
2626 float for the same reason as the original condition:
2627 "don't insert this if we would be adding it before or after a table
2628 in a float. This little trick is needed in order to allow use of
2629 tables in \subfigures or \subtables."
2630 Juergen can you check this?
2632 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2634 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2635 output to the ostream.
2637 * several files: fixed types based on warnings from cxx
2639 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2641 * src/frontends/kde/Makefile.am: fix rule for
2642 formindexdialogdata_moc.C
2644 * src/.cvsignore: add ext_l10n.h to ignore
2646 * acconfig.h: stop messing with __STRICT_ANSI__
2647 * config/gnome.m4: remove option to set -ansi
2648 * config/kde.m4: remove option to set -ansi
2649 * config/lyxinclude.m4: don't set -ansi
2651 2000-09-27 Juergen Vigna <jug@sad.it>
2653 * various files: remove "default" language check.
2655 * src/insets/insetquotes.C: removed use of current_view.
2657 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2658 the one should have red ears by now!
2660 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2661 in more then one paragraph. Fixed cursor-movement/selection.
2663 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2664 paragraphs inside a text inset.
2666 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2667 text-inset if this owner is an inset.
2669 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2671 * src/Bullet.h: changed type of font, character and size to int
2673 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2675 * src/insets/inseturl.[Ch]:
2676 * src/insets/insetref.[Ch]:
2677 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2679 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2681 * src/buffer.C (readFile): block-if statement rearranged to minimise
2682 bloat. Patch does not reverse Jean-Marc's change ;-)
2684 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2685 Class rewritten to store pointers to hide/update signals directly,
2686 rather than Dialogs *. Also defined an enum to ease use. All xforms
2687 forms can now be derived from this class.
2689 * src/frontends/xforms/FormCommand.[Ch]
2690 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2692 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2695 * src/frontends/xforms/forms/form_citation.fd
2696 * src/frontends/xforms/forms/form_copyright.fd
2697 * src/frontends/xforms/forms/form_error.fd
2698 * src/frontends/xforms/forms/form_index.fd
2699 * src/frontends/xforms/forms/form_ref.fd
2700 * src/frontends/xforms/forms/form_toc.fd
2701 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2703 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2705 * src/insets/insetfoot.C: removed redundent using directive.
2707 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2709 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2710 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2712 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2713 created in the constructors in different groups. Then set() just
2714 have to show the groups as needed. This fixes the redraw problems
2715 (and is how the old menu code worked).
2717 * src/support/lyxlib.h: declare the methods as static when we do
2718 not have namespaces.
2720 2000-09-26 Juergen Vigna <jug@sad.it>
2722 * src/buffer.C (asciiParagraph): new function.
2723 (writeFileAscii): new function with parameter ostream.
2724 (writeFileAscii): use now asciiParagraph.
2726 * various inset files: added the linelen parameter to the Ascii-func.
2728 * src/tabular.C (Write): fixed error in writing file introduced by
2729 the last changes from Lars.
2731 * lib/bind/menus.bind: removed not supported functions.
2733 * src/insets/insettext.C (Ascii): implemented this function.
2735 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2737 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2738 (Write): use of the write_attribute functions.
2740 * src/bufferlist.C (close): fixed reasking question!
2742 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2744 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2745 new files use the everwhere possible.
2748 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2749 src/log_form.C src/lyx.C:
2752 * src/buffer.C (runLaTeX): remove func
2754 * src/PaperLayout.C: removed file
2755 * src/ParagraphExtra.C: likewise
2756 * src/bullet_forms.C: likewise
2757 * src/bullet_forms.h: likewise
2758 * src/bullet_forms_cb.C: likewise
2760 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2761 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2764 * several files: remove all traces of the old fd_form_paragraph,
2765 and functions belonging to that.
2767 * several files: remove all traces of the old fd_form_document,
2768 and functions belonging to that.
2770 * several files: constify local variables were possible.
2772 * several files: remove all code that was dead when NEW_EXPORT was
2775 * several files: removed string::c_str in as many places as
2778 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2779 (e): be a bit more outspoken when patching
2780 (updatesrc): only move files if changed.
2782 * forms/layout_forms.h.patch: regenerated
2784 * forms/layout_forms.fd: remove form_document and form_paragraph
2785 and form_quotes and form_paper and form_table_options and
2786 form_paragraph_extra
2788 * forms/form1.fd: remove form_table
2790 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2791 the fdui->... rewrite. Update some comments to xforms 0.88
2793 * forms/bullet_forms.C.patch: removed file
2794 * forms/bullet_forms.fd: likewise
2795 * forms/bullet_forms.h.patch: likewise
2797 * development/Code_rules/Rules: added a section on switch
2798 statements. Updated some comment to xforms 0.88.
2800 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2802 * src/buffer.C (readFile): make sure that the whole version number
2803 is read after \lyxformat (even when it contains a comma)
2805 * lib/ui/default.ui: change shortcut of math menu to M-a.
2807 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2809 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2812 * src/LyXView.C (updateWindowTitle): show the full files name in
2813 window title, limited to 30 characters.
2815 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2816 When a number of characters has been given, we should not assume
2817 that the string is 0-terminated.
2819 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2820 calls (fixes some memory leaks)
2822 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2823 trans member on exit.
2825 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2827 * src/converter.C (GetReachable): fix typo.
2829 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2830 understand ',' instead of '.'.
2831 (GetInteger): rewrite to use strToInt().
2833 2000-09-26 Juergen Vigna <jug@sad.it>
2835 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2836 better visibility and error-message on wrong VSpace input.
2838 * src/language.C (initL): added english again.
2840 2000-09-25 Juergen Vigna <jug@sad.it>
2842 * src/frontends/kde/Dialogs.C (Dialogs):
2843 * src/frontends/gnome/Dialogs.C (Dialogs):
2844 * src/frontends/kde/Makefile.am:
2845 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2847 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2849 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2851 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2853 * src/frontends/xforms/FormParagraph.C:
2854 * src/frontends/xforms/FormParagraph.h:
2855 * src/frontends/xforms/form_paragraph.C:
2856 * src/frontends/xforms/form_paragraph.h:
2857 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2860 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2862 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2863 Paragraph-Data after use.
2865 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2866 non breakable paragraphs.
2868 2000-09-25 Garst R. Reese <reese@isn.net>
2870 * src/language.C (initL): added missing language_country codes.
2872 2000-09-25 Juergen Vigna <jug@sad.it>
2874 * src/insets/insettext.C (InsetText):
2875 (deleteLyXText): remove the not released LyXText structure!
2877 2000-09-24 Marko Vendelin <markov@ioc.ee>
2879 * src/frontends/gnome/mainapp.C
2880 * src/frontends/gnome/mainapp.h: added support for keyboard
2883 * src/frontends/gnome/FormCitation.C
2884 * src/frontends/gnome/FormCitation.h
2885 * src/frontends/gnome/Makefile.am
2886 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2887 FormCitation to use "action area" in mainapp window
2889 * src/frontends/gnome/Menubar_pimpl.C
2890 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2893 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2895 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2896 width/descent/ascent values if name is empty.
2897 (mathed_string_height): Use std::max.
2899 2000-09-25 Allan Rae <rae@lyx.org>
2901 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2902 segfault. This will be completely redesigned soon.
2904 * sigc++: updated libsigc++. Fixes struct timespec bug.
2906 * development/tools/makeLyXsigc.sh: .cvsignore addition
2908 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2910 * several files: removed almost all traces of the old table
2913 * src/TableLayout.C: removed file
2915 2000-09-22 Juergen Vigna <jug@sad.it>
2917 * src/frontends/kde/Dialogs.C: added credits forms.
2919 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2921 * src/frontends/gnome/Dialogs.C: added some forms.
2923 * src/spellchecker.C (init_spell_checker): set language in pspell code
2924 (RunSpellChecker): some modifications for setting language string.
2926 * src/language.[Ch]: added language_country code.
2928 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2930 * src/frontends/Dialogs.h: added new signal showError.
2931 Rearranged existing signals in some sort of alphabetical order.
2933 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2934 FormError.[Ch], form_error.[Ch]
2935 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2936 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2938 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2939 dialogs. I think that this can be used as the base to all these
2942 * src/frontends/xforms/FormError.[Ch]
2943 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2944 implementation of InsetError dialog.
2946 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2948 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2949 * src/frontends/kde/Makefile.am: ditto
2951 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2953 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2954 macrobf. This fixes a bug of invisible text.
2956 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2958 * lib/doc/LaTeXConfig.lyx.in: updated.
2960 * src/language.C (initL): remove language "francais" and change a
2961 bit the names of the two other french variations.
2963 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2964 string that may not be 0-terminated.
2966 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2968 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2970 2000-09-20 Marko Vendelin <markov@ioc.ee>
2972 * src/frontends/gnome/FormCitation.C
2973 * src/frontends/gnome/FormIndex.C
2974 * src/frontends/gnome/FormToc.C
2975 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2976 the variable initialization to shut up the warnings
2978 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2980 * src/table.[Ch]: deleted files
2982 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2985 2000-09-18 Juergen Vigna <jug@sad.it>
2987 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2988 problems with selection. Inserted new LFUN_PASTESELECTION.
2989 (InsetButtonPress): inserted handling of middle mouse-button paste.
2991 * src/spellchecker.C: changed word to word.c_str().
2993 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2995 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2996 included in the ``make dist'' tarball.
2998 2000-09-15 Juergen Vigna <jug@sad.it>
3000 * src/CutAndPaste.C (cutSelection): small fix return the right
3001 end position after cut inside one paragraph only.
3003 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
3004 we are locked as otherwise we don't have a valid cursor position!
3006 * src/insets/figinset.C (draw): small bugfix but why is this needed???
3008 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
3010 * src/frontends/kde/FormRef.C: added using directive.
3011 * src/frontends/kde/FormToc.C: ditto
3013 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
3015 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
3017 2000-09-19 Marko Vendelin <markov@ioc.ee>
3019 * src/frontends/gnome/Menubar_pimpl.C
3020 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
3021 Toc, ViewFormats, UpdateFormats, and ExportFormats.
3023 * src/frontends/gnome/mainapp.C
3024 * src/frontends/gnome/mainapp.h: support for menu update used
3027 * src/frontends/gnome/mainapp.C
3028 * src/frontends/gnome/mainapp.h: support for "action" area in the
3029 main window. This area is used by small simple dialogs, such as
3032 * src/frontends/gnome/FormIndex.C
3033 * src/frontends/gnome/FormIndex.h
3034 * src/frontends/gnome/FormUrl.C
3035 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
3038 * src/frontends/gnome/FormCitation.C
3039 * src/frontends/gnome/FormCitation.h: rewrite to use main window
3040 action area. Only "Insert new citation" is implemented.
3042 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3044 * src/buffer.C (Dispatch): fix call to Dispatch
3045 * src/insets/insetref.C (Edit): likewise
3046 * src/insets/insetparent.C (Edit): likewise
3047 * src/insets/insetinclude.C (include_cb): likewise
3048 * src/frontends/xforms/FormUrl.C (apply): likewise
3049 * src/frontends/xforms/FormToc.C (apply): likewise
3050 * src/frontends/xforms/FormRef.C (apply): likewise
3051 * src/frontends/xforms/FormIndex.C (apply): likewise
3052 * src/frontends/xforms/FormCitation.C (apply): likewise
3053 * src/lyxserver.C (callback): likewise
3054 * src/lyxfunc.C (processKeySym): likewise
3055 (Dispatch): likewise
3056 (Dispatch): likewise
3057 * src/lyx_cb.C (LayoutsCB): likewise
3059 * Makefile.am (sourcedoc): small change
3061 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3063 * src/main.C (main): Don't make an empty GUIRunTime object. all
3064 methods are static. constify a bit remove unneded using + headers.
3066 * src/tabular.C: some more const to local vars move some loop vars
3068 * src/spellchecker.C: added some c_str after some word for pspell
3070 * src/frontends/GUIRunTime.h: add new static method setDefaults
3071 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3072 * src/frontends/kde/GUIRunTime.C (setDefaults):
3073 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3075 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3076 with strnew in arg, use correct emptystring when calling SetName.
3078 * several files: remove all commented code with relation to
3079 HAVE_SSTREAM beeing false. We now only support stringstream and
3082 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3084 * src/lyxfunc.C: construct correctly the automatic new file
3087 * src/text2.C (IsStringInText): change type of variable i to shut
3090 * src/support/sstream.h: do not use namespaces if the compiler
3091 does not support them.
3093 2000-09-15 Marko Vendelin <markov@ioc.ee>
3094 * src/frontends/gnome/FormCitation.C
3095 * src/frontends/gnome/FormCitation.h
3096 * src/frontends/gnome/diainsertcitation_interface.c
3097 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3098 regexp support to FormCitation [Gnome].
3100 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3103 * configure.in: remove unused KDE/GTKGUI define
3105 * src/frontends/kde/FormRef.C
3106 * src/frontends/kde/FormRef.h
3107 * src/frontends/kde/formrefdialog.C
3108 * src/frontends/kde/formrefdialog.h: double click will
3109 go to reference, now it is possible to change a cross-ref
3112 * src/frontends/kde/FormToc.C
3113 * src/frontends/kde/FormToc.h
3114 * src/frontends/kde/formtocdialog.C
3115 * src/frontends/kde/formtocdialog.h: add a depth
3118 * src/frontends/kde/Makefile.am: add QtLyXView.h
3121 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3123 * src/frontends/kde/FormCitation.h: added some using directives.
3125 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3127 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3130 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3133 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3135 * src/buffer.C (pop_tag): revert for the second time a change by
3136 Lars, who seems to really hate having non-local loop variables :)
3138 * src/Lsstream.h: add "using" statements.
3140 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3141 * src/buffer.C (writeFile): ditto
3143 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3145 * src/buffer.C (writeFile): try to fix the locale modified format
3146 number to always be as we want it.
3148 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3149 in XForms 0.89. C-space is now working again.
3151 * src/Lsstream.h src/support/sstream.h: new files.
3153 * also commented out all cases where strstream were used.
3155 * src/Bullet.h (c_str): remove method.
3157 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3159 * a lot of files: get rid of "char const *" and "char *" is as
3160 many places as possible. We only want to use them in interaction
3161 with system of other libraries, not inside lyx.
3163 * a lot of files: return const object is not of pod type. This
3164 helps ensure that temporary objects is not modified. And fits well
3165 with "programming by contract".
3167 * configure.in: check for the locale header too
3169 * Makefile.am (sourcedoc): new tag for generation of doc++
3172 2000-09-14 Juergen Vigna <jug@sad.it>
3174 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3175 callback to check which combo called it and do the right action.
3177 * src/combox.C (combo_cb): added combo * to the callbacks.
3178 (Hide): moved call of callback after Ungrab of the pointer.
3180 * src/intl.h: removed LCombo2 function.
3182 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3183 function as this can now be handled in one function.
3185 * src/combox.h: added Combox * to callback prototype.
3187 * src/frontends/xforms/Toolbar_pimpl.C:
3188 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3190 2000-09-14 Garst Reese <reese@isn.net>
3192 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3193 moved usepackage{xxx}'s to beginning of file. Changed left margin
3194 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3195 underlining from title. Thanks to John Culleton for useful suggestions.
3197 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3199 * src/lyxlex_pimpl.C (setFile): change error message to debug
3202 2000-09-13 Juergen Vigna <jug@sad.it>
3204 * src/frontends/xforms/FormDocument.C: implemented choice_class
3205 as combox and give callback to combo_language so OK/Apply is activated
3208 * src/bufferlist.C (newFile): small fix so already named files
3209 (via an open call) are not requested to be named again on the
3212 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3214 * src/frontends/kde/Makefile.am
3215 * src/frontends/kde/FormRef.C
3216 * src/frontends/kde/FormRef.h
3217 * src/frontends/kde/formrefdialog.C
3218 * src/frontends/kde/formrefdialog.h: implement
3221 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3223 * src/frontends/kde/formtocdialog.C
3224 * src/frontends/kde/formtocdialog.h
3225 * src/frontends/kde/FormToc.C
3226 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3228 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3230 * src/frontends/kde/FormCitation.C: fix thinko
3231 where we didn't always display the reference text
3234 * src/frontends/kde/formurldialog.C
3235 * src/frontends/kde/formurldialog.h
3236 * src/frontends/kde/FormUrl.C
3237 * src/frontends/kde/FormUrl.h: minor cleanups
3239 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3241 * src/frontends/kde/Makefile.am
3242 * src/frontends/kde/FormToc.C
3243 * src/frontends/kde/FormToc.h
3244 * src/frontends/kde/FormCitation.C
3245 * src/frontends/kde/FormCitation.h
3246 * src/frontends/kde/FormIndex.C
3247 * src/frontends/kde/FormIndex.h
3248 * src/frontends/kde/formtocdialog.C
3249 * src/frontends/kde/formtocdialog.h
3250 * src/frontends/kde/formcitationdialog.C
3251 * src/frontends/kde/formcitationdialog.h
3252 * src/frontends/kde/formindexdialog.C
3253 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3255 2000-09-12 Juergen Vigna <jug@sad.it>
3257 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3260 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3262 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3265 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3267 * src/converter.C (Add, Convert): Added support for converter flags:
3268 needaux, resultdir, resultfile.
3269 (Convert): Added new parameter view_file.
3270 (dvips_options): Fixed letter paper option.
3272 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3273 (Export, GetExportableFormats, GetViewableFormats): Added support
3276 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3278 (easyParse): Fixed to work with new export code.
3280 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3283 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3285 * lib/bind/*.bind: Replaced
3286 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3287 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3289 2000-09-11 Juergen Vigna <jug@sad.it>
3291 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3293 * src/main.C (main): now GUII defines global guiruntime!
3295 * src/frontends/gnome/GUIRunTime.C (initApplication):
3296 * src/frontends/kde/GUIRunTime.C (initApplication):
3297 * src/frontends/xforms/GUIRunTime.C (initApplication):
3298 * src/frontends/GUIRunTime.h: added new function initApplication.
3300 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3302 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3304 2000-09-08 Juergen Vigna <jug@sad.it>
3306 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3307 we have already "Reset".
3309 * src/language.C (initL): inserted "default" language and made this
3310 THE default language (and not american!)
3312 * src/paragraph.C: inserted handling of "default" language!
3314 * src/lyxfont.C: ditto
3318 * src/paragraph.C: output the \\par only if we have a following
3319 paragraph otherwise it's not needed.
3321 2000-09-05 Juergen Vigna <jug@sad.it>
3323 * config/pspell.m4: added entry to lyx-flags
3325 * src/spellchecker.C: modified version from Kevin for using pspell
3327 2000-09-01 Marko Vendelin <markov@ioc.ee>
3328 * src/frontends/gnome/Makefile.am
3329 * src/frontends/gnome/FormCitation.C
3330 * src/frontends/gnome/FormCitation.h
3331 * src/frontends/gnome/diainsertcitation_callbacks.c
3332 * src/frontends/gnome/diainsertcitation_callbacks.h
3333 * src/frontends/gnome/diainsertcitation_interface.c
3334 * src/frontends/gnome/diainsertcitation_interface.h
3335 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3336 dialog for Gnome frontend
3338 * src/main.C: Gnome libraries require keeping application name
3339 and its version as strings
3341 * src/frontends/gnome/mainapp.C: Change the name of the main window
3342 from GnomeLyX to PACKAGE
3344 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3346 * src/frontends/Liason.C: add "using: declaration.
3348 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3350 * src/mathed/math_macro.C (Metrics): Set the size of the template
3352 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3354 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3356 * src/converter.C (add_options): New function.
3357 (SetViewer): Change $$FName into '$$FName'.
3358 (View): Add options when running xdvi
3359 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3360 (Convert): The 3rd parameter is now the desired filename. Converts
3361 calls to lyx::rename if necessary.
3362 Add options when running dvips.
3363 (dvi_papersize,dvips_options): New methods.
3365 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3367 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3368 using a call to Converter::dvips_options.
3369 Fixed to work with nex export code.
3371 * src/support/copy.C
3372 * src/support/rename.C: New files
3374 * src/support/syscall.h
3375 * src/support/syscall.C: Added Starttype SystemDontWait.
3377 * lib/ui/default.ui: Changed to work with new export code
3379 * lib/configure.m4: Changed to work with new export code
3381 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3383 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3385 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3386 so that code compiles with DEC cxx.
3388 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3389 to work correctly! Also now supports the additional elements
3392 2000-09-01 Allan Rae <rae@lyx.org>
3394 * src/frontends/ButtonPolicies.C: renamed all the references to
3395 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3397 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3398 since it's a const not a type.
3400 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3402 2000-08-31 Juergen Vigna <jug@sad.it>
3404 * src/insets/figinset.C: Various changes to look if the filename has
3405 an extension and if not add it for inline previewing.
3407 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3409 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3410 make buttonStatus and isReadOnly be const methods. (also reflect
3411 this in derived classes.)
3413 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3414 (nextState): change to be static inline, pass the StateMachine as
3416 (PreferencesPolicy): remove casts
3417 (OkCancelPolicy): remvoe casts
3418 (OkCancelReadOnlyPolicy): remove casts
3419 (NoRepeatedApplyReadOnlyPolicy): remove casts
3420 (OkApplyCancelReadOnlyPolicy): remove casts
3421 (OkApplyCancelPolicy): remove casts
3422 (NoRepeatedApplyPolicy): remove casts
3424 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3426 * src/converter.C: added some using directives
3428 * src/frontends/ButtonPolicies.C: changes to overcome
3429 "need lvalue" error with DEC c++
3431 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3432 to WMHideCB for DEC c++
3434 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3436 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3437 to BulletBMTableCB for DEC c++
3439 2000-08-31 Allan Rae <rae@lyx.org>
3441 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3442 character dialog separately from old document dialogs combo_language.
3445 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3447 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3448 Removed LFUN_REF_CREATE.
3450 * src/MenuBackend.C: Added new tags: toc and references
3452 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3453 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3455 (add_toc, add_references): New methods.
3456 (create_submenu): Handle correctly the case when there is a
3457 seperator after optional menu items.
3459 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3460 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3461 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3463 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3465 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3467 * src/converter.[Ch]: New file for converting between different
3470 * src/export.[Ch]: New file for exporting a LyX file to different
3473 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3474 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3475 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3476 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3477 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3478 RunDocBook, MenuExport.
3480 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3481 Exporter::Preview methods if NEW_EXPORT is defined.
3483 * src/buffer.C (Dispatch): Use Exporter::Export.
3485 * src/lyxrc.C: Added new tags: \converter and \viewer.
3488 * src/LyXAction.C: Define new lyx-function: buffer-update.
3489 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3490 when NEW_EXPORT is defined.
3492 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3494 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3496 * lib/ui/default.ui: Added submenus "view" and "update" to the
3499 * src/filetools.C (GetExtension): New function.
3501 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3503 2000-08-29 Allan Rae <rae@lyx.org>
3505 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3507 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3508 (EnableDocumentLayout): removed
3509 (DisableDocumentLayout): removed
3510 (build): make use of ButtonController's read-only handling to
3511 de/activate various objects. Replaces both of the above functions.
3513 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3514 (readOnly): was read_only
3515 (refresh): fixed dumb mistakes with read_only_ handling
3517 * src/frontends/xforms/forms/form_document.fd:
3518 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3519 tabbed dialogs so the tabs look more like tabs and so its easier to
3520 work out which is the current tab.
3522 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3523 segfault with form_table
3525 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3527 2000-08-28 Juergen Vigna <jug@sad.it>
3529 * acconfig.h: added USE_PSPELL.
3531 * src/config.h.in: added USE_PSPELL.
3533 * autogen.sh: added pspell.m4
3535 * config/pspell.m4: new file.
3537 * src/spellchecker.C: implemented support for pspell libary.
3539 2000-08-25 Juergen Vigna <jug@sad.it>
3541 * src/LyXAction.C (init): renamed LFUN_TABLE to
3542 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3544 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3546 * src/lyxscreen.h: add force_clear variable and fuction to force
3547 a clear area when redrawing in LyXText.
3549 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3551 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3553 * some whitespace and comment changes.
3555 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3557 * src/buffer.C: up te LYX_FORMAT to 2.17
3559 2000-08-23 Juergen Vigna <jug@sad.it>
3561 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3564 * src/insets/insettabular.C (pasteSelection): delete the insets
3565 LyXText as it is not valid anymore.
3566 (copySelection): new function.
3567 (pasteSelection): new function.
3568 (cutSelection): new function.
3569 (LocalDispatch): implemented cut/copy/paste of cell selections.
3571 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3572 don't have a LyXText.
3574 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3576 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3579 2000-08-22 Juergen Vigna <jug@sad.it>
3581 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3582 ifdef form_table out if NEW_TABULAR.
3584 2000-08-21 Juergen Vigna <jug@sad.it>
3586 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3587 (draw): fixed draw position so that the cursor is positioned in the
3589 (InsetMotionNotify): hide/show cursor so the position is updated.
3590 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3591 using cellstart() function where it should be used.
3593 * src/insets/insettext.C (draw): ditto.
3595 * src/tabular.C: fixed initialization of some missing variables and
3596 made BoxType into an enum.
3598 2000-08-22 Marko Vendelin <markov@ioc.ee>
3599 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3600 stock menu item using action numerical value, not its string
3604 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3606 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3607 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3609 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3611 * src/frontends/xforms/GUIRunTime.C: new file
3613 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3614 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3616 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3618 * src/frontends/kde/GUIRunTime.C: new file
3620 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3621 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3623 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3625 * src/frontends/gnome/GUIRunTime.C: new file
3627 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3630 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3631 small change to documetentation.
3633 * src/frontends/GUIRunTime.C: removed file
3635 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3637 * src/lyxparagraph.h: enable NEW_TABULAR as default
3639 * src/lyxfunc.C (processKeySym): remove some commented code
3641 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3642 NEW_TABULAR around the fd_form_table_options.
3644 * src/lyx_gui.C (runTime): call the static member function as
3645 GUIRunTime::runTime().
3647 2000-08-21 Allan Rae <rae@lyx.org>
3649 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3652 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3654 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3656 2000-08-21 Allan Rae <rae@lyx.org>
3658 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3659 keep Garst happy ;-)
3660 * src/frontends/xforms/FormPreferences.C (build): use setOK
3661 * src/frontends/xforms/FormDocument.C (build): use setOK
3662 (FormDocument): use the appropriate policy.
3664 2000-08-21 Allan Rae <rae@lyx.org>
3666 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3667 automatic [de]activation of arbitrary objects when in a read-only state.
3669 * src/frontends/ButtonPolicies.h: More documentation
3670 (isReadOnly): added to support the above.
3672 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3674 2000-08-18 Juergen Vigna <jug@sad.it>
3676 * src/insets/insettabular.C (getStatus): changed to return func_status.
3678 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3679 display toggle menu entries if they are.
3681 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3682 new document layout now.
3684 * src/lyxfunc.C: ditto
3686 * src/lyx_gui_misc.C: ditto
3688 * src/lyx_gui.C: ditto
3690 * lib/ui/default.ui: removed paper and quotes layout as they are now
3691 all in the document layout tabbed folder.
3693 * src/frontends/xforms/forms/form_document.fd: added Restore
3694 button and callbacks for all inputs for Allan's ButtonPolicy.
3696 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3697 (CheckChoiceClass): added missing params setting on class change.
3698 (UpdateLayoutDocument): added for updating the layout on params.
3699 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3700 (FormDocument): Implemented Allan's ButtonPolicy with the
3703 2000-08-17 Allan Rae <rae@lyx.org>
3705 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3706 so we can at least see the credits again.
3708 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3709 controller calls for the appropriate callbacks. Note that since Ok
3710 calls apply followed by cancel, and apply isn't a valid input for the
3711 APPLIED state, the bc_ calls have to be made in the static callback not
3712 within each of the real callbacks.
3714 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3715 (setOk): renamed from setOkay()
3717 2000-08-17 Juergen Vigna <jug@sad.it>
3719 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3720 in the implementation part.
3721 (composeUIInfo): don't show optional menu-items.
3723 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3725 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3727 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3728 text-state when in a text-inset.
3730 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3732 2000-08-17 Marko Vendelin <markov@ioc.ee>
3733 * src/frontends/gnome/FormIndex.C
3734 * src/frontends/gnome/FormIndex.h
3735 * src/frontends/gnome/FormToc.C
3736 * src/frontends/gnome/FormToc.h
3737 * src/frontends/gnome/dialogs
3738 * src/frontends/gnome/diatoc_callbacks.c
3739 * src/frontends/gnome/diatoc_callbacks.h
3740 * src/frontends/gnome/diainsertindex_callbacks.h
3741 * src/frontends/gnome/diainsertindex_callbacks.c
3742 * src/frontends/gnome/diainsertindex_interface.c
3743 * src/frontends/gnome/diainsertindex_interface.h
3744 * src/frontends/gnome/diatoc_interface.h
3745 * src/frontends/gnome/diatoc_interface.c
3746 * src/frontends/gnome/Makefile.am: Table of Contents and
3747 Insert Index dialogs implementation for Gnome frontend
3749 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3751 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3753 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3756 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3758 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3759 destructor. Don't definde if you don't need it
3760 (processEvents): made static, non-blocking events processing for
3762 (runTime): static method. event loop for xforms
3763 * similar as above for kde and gnome.
3765 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3766 new Pimpl is correct
3767 (runTime): new method calss the real frontends runtime func.
3769 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3771 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3773 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3775 2000-08-16 Juergen Vigna <jug@sad.it>
3777 * src/lyx_gui.C (runTime): added GUII RunTime support.
3779 * src/frontends/Makefile.am:
3780 * src/frontends/GUIRunTime.[Ch]:
3781 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3782 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3783 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3785 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3787 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3788 as this is already set in ${FRONTEND_INCLUDE} if needed.
3790 * configure.in (CPPFLAGS): setting the include dir for the frontend
3791 directory and don't set FRONTEND=xforms for now as this is executed
3794 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3796 * src/frontends/kde/Makefile.am:
3797 * src/frontends/kde/FormUrl.C:
3798 * src/frontends/kde/FormUrl.h:
3799 * src/frontends/kde/formurldialog.h:
3800 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3802 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3804 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3806 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3808 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3811 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3813 * src/WorkArea.C (work_area_handler): more work to get te
3814 FL_KEYBOARD to work with xforms 0.88 too, please test.
3816 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3818 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3820 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3823 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3825 * src/Timeout.h: remove Qt::emit hack.
3827 * several files: changes to allo doc++ compilation
3829 * src/lyxfunc.C (processKeySym): new method
3830 (processKeyEvent): comment out if FL_REVISION < 89
3832 * src/WorkArea.C: change some debugging levels.
3833 (WorkArea): set wantkey to FL_KEY_ALL
3834 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3835 clearer code and the use of compose with XForms 0.89. Change to
3836 use signals instead of calling methods in bufferview directly.
3838 * src/Painter.C: change some debugging levels.
3840 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3843 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3844 (workAreaKeyPress): new method
3846 2000-08-14 Juergen Vigna <jug@sad.it>
3848 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3850 * config/kde.m4: addes some features
3852 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3853 include missing xforms dialogs.
3855 * src/Timeout.h: a hack to be able to compile with qt/kde.
3857 * sigc++/.cvsignore: added acinclude.m4
3859 * lib/.cvsignore: added listerros
3861 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3862 xforms tree as objects are needed for other frontends.
3864 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3865 linking with not yet implemented xforms objects.
3867 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3869 2000-08-14 Baruch Even <baruch.even@writeme.com>
3871 * src/frontends/xforms/FormGraphics.h:
3872 * src/frontends/xforms/FormGraphics.C:
3873 * src/frontends/xforms/RadioButtonGroup.h:
3874 * src/frontends/xforms/RadioButtonGroup.C:
3875 * src/insets/insetgraphics.h:
3876 * src/insets/insetgraphics.C:
3877 * src/insets/insetgraphicsParams.h:
3878 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3879 instead of spaces, and various other indentation issues to make the
3880 sources more consistent.
3882 2000-08-14 Marko Vendelin <markov@ioc.ee>
3884 * src/frontends/gnome/dialogs/diaprint.glade
3885 * src/frontends/gnome/FormPrint.C
3886 * src/frontends/gnome/FormPrint.h
3887 * src/frontends/gnome/diaprint_callbacks.c
3888 * src/frontends/gnome/diaprint_callbacks.h
3889 * src/frontends/gnome/diaprint_interface.c
3890 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3893 * src/frontends/gnome/dialogs/diainserturl.glade
3894 * src/frontends/gnome/FormUrl.C
3895 * src/frontends/gnome/FormUrl.h
3896 * src/frontends/gnome/diainserturl_callbacks.c
3897 * src/frontends/gnome/diainserturl_callbacks.h
3898 * src/frontends/gnome/diainserturl_interface.c
3899 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3900 Gnome implementation
3902 * src/frontends/gnome/Dialogs.C
3903 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3904 all other dialogs. Copy all unimplemented dialogs from Xforms
3907 * src/frontends/gnome/support.c
3908 * src/frontends/gnome/support.h: support files generated by Glade
3912 * config/gnome.m4: Gnome configuration scripts
3914 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3915 configure --help message
3917 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3918 only if there are no events pendling in Gnome/Gtk. This enhances
3919 the performance of menus.
3922 2000-08-14 Allan Rae <rae@lyx.org>
3924 * lib/Makefile.am: listerrors cleaning
3926 * lib/listerrors: removed -- generated file
3927 * acinclude.m4: ditto
3928 * sigc++/acinclude.m4: ditto
3930 * src/frontends/xforms/forms/form_citation.fd:
3931 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3934 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3935 `updatesrc` and now we have a `test` target that does what `updatesrc`
3936 used to do. I didn't like having an install target that wasn't related
3939 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3940 on all except FormGraphics. This may yet happen. Followed by a major
3941 cleanup including using FL_TRANSIENT for most of the dialogs. More
3942 changes to come when the ButtonController below is introduced.
3944 * src/frontends/xforms/ButtonController.h: New file for managing up to
3945 four buttons on a dialog according to an externally defined policy.
3946 * src/frontends/xforms/Makefile.am: added above
3948 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3949 Apply and Cancel/Close buttons and everything in between and beyond.
3950 * src/frontends/Makefile.am: added above.
3952 * src/frontends/xforms/forms/form_preferences.fd:
3953 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3954 and removed variable 'status' as a result. Fixed the set_minsize thing.
3955 Use the new screen-font-update after checking screen fonts were changed
3956 Added a "Restore" button to restore the original lyxrc values while
3957 editing. This restores everything not just the last input changed.
3958 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3960 * src/LyXAction.C: screen-font-update added for updating buffers after
3961 screen font settings have been changed.
3962 * src/commandtags.h: ditto
3963 * src/lyxfunc.C: ditto
3965 * forms/lyx.fd: removed screen fonts dialog.
3966 * src/lyx_gui.C: ditto
3967 * src/menus.[Ch]: ditto
3968 * src/lyx.[Ch]: ditto
3969 * src/lyx_cb.C: ditto + code from here moved to make
3970 screen-font-update. And people wonder why progress on GUII is
3971 slow. Look at how scattered this stuff was! It takes forever
3974 * forms/fdfix.sh: Fixup the spacing after commas.
3975 * forms/makefile: Remove date from generated files. Fewer clashes now.
3976 * forms/bullet_forms.C.patch: included someones handwritten changes
3978 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3979 once I've discovered why LyXRC was made noncopyable.
3980 * src/lyx_main.C: ditto
3982 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3984 * src/frontends/xforms/forms/fdfix.sh:
3985 * src/frontends/xforms/forms/fdfixh.sed:
3986 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3987 * src/frontends/xforms/Form*.[hC]:
3988 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3989 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3990 provide a destructor for the struct FD_form_xxxx. Another version of
3991 the set_[max|min]size workaround and a few other cleanups. Actually,
3992 Angus' patch from 20000809.
3994 2000-08-13 Baruch Even <baruch.even@writeme.com>
3996 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3999 2000-08-11 Juergen Vigna <jug@sad.it>
4001 * src/insets/insetgraphics.C (InsetGraphics): changing init
4002 order because of warnings.
4004 * src/frontends/xforms/forms/makefile: adding patching .C with
4007 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
4008 from .C.patch to .c.patch
4010 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
4011 order because of warning.
4013 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
4015 * src/frontends/Liason.C (setMinibuffer): new helper function
4017 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
4019 * src/lyxfunc.C (Dispatch): calling new Document-Layout
4021 * lib/ui/default.ui: commented out PaperLayout entry
4023 * src/frontends/xforms/form_document.[Ch]: new added files
4025 * src/frontends/xforms/FormDocument.[Ch]: ditto
4027 * src/frontends/xforms/forms/form_document.fd: ditto
4029 * src/frontends/xforms/forms/form_document.C.patch: ditto
4031 2000-08-10 Juergen Vigna <jug@sad.it>
4033 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
4034 (InsetGraphics): initialized cacheHandle to 0.
4035 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
4037 2000-08-10 Baruch Even <baruch.even@writeme.com>
4039 * src/graphics/GraphicsCache.h:
4040 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
4041 correctly as a cache.
4043 * src/graphics/GraphicsCacheItem.h:
4044 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4047 * src/graphics/GraphicsCacheItem_pimpl.h:
4048 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4051 * src/insets/insetgraphics.h:
4052 * src/insets/insetgraphics.C: Changed from using a signal notification
4053 to polling when image is not loaded.
4055 2000-08-10 Allan Rae <rae@lyx.org>
4057 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4058 that there are two functions that have to been taken out of line by
4059 hand and aren't taken care of in the script. (Just a reminder note)
4061 * sigc++/macros/*.h.m4: Updated as above.
4063 2000-08-09 Juergen Vigna <jug@sad.it>
4065 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4067 * src/insets/insettabular.C: make drawing of single cell smarter.
4069 2000-08-09 Marko Vendelin <markov@ioc.ee>
4070 * src/frontends/gnome/Menubar_pimpl.C
4071 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4072 implementation: new files
4074 * src/frontends/gnome/mainapp.C
4075 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4078 * src/main.C: create Gnome main window
4080 * src/frontends/xforms/Menubar_pimpl.h
4081 * src/frontends/Menubar.C
4082 * src/frontends/Menubar.h: added method Menubar::update that calls
4083 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4085 * src/LyXView.C: calls Menubar::update to update the state
4088 * src/frontends/gnome/Makefile.am: added new files
4090 * src/frontends/Makefile.am: added frontend compiler options
4092 2000-08-08 Juergen Vigna <jug@sad.it>
4094 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4096 * src/bufferlist.C (close):
4097 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4098 documents if exiting without saving.
4100 * src/buffer.C (save): use removeAutosaveFile()
4102 * src/support/filetools.C (removeAutosaveFile): new function.
4104 * src/lyx_cb.C (MenuWrite): returns a bool now.
4105 (MenuWriteAs): check if file could really be saved and revert to the
4107 (MenuWriteAs): removing old autosavefile if existant.
4109 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4110 before Goto toggle declaration, because of compiler warning.
4112 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4114 * src/lyxfunc.C (MenuNew): small fix.
4116 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4118 * src/bufferlist.C (newFile):
4119 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4121 * src/lyxrc.C: added new_ask_filename tag
4123 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4125 * src/lyx.fd: removed code pertaining to form_ref
4126 * src/lyx.[Ch]: ditto
4127 * src/lyx_cb.C: ditto
4128 * src/lyx_gui.C: ditto
4129 * src/lyx_gui_misc.C: ditto
4131 * src/BufferView_pimpl.C (restorePosition): update buffer only
4134 * src/commandtags.h (LFUN_REFTOGGLE): removed
4135 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4136 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4137 (LFUN_REFBACK): renamed LFUN_REF_BACK
4139 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4140 * src/menus.C: ditto
4141 * src/lyxfunc.C (Dispatch): ditto.
4142 InsertRef dialog is now GUI-independent.
4144 * src/texrow.C: added using std::endl;
4146 * src/insets/insetref.[Ch]: strip out large amounts of code.
4147 The inset is now a container and this functionality is now
4148 managed by a new FormRef dialog
4150 * src/frontends/Dialogs.h (showRef, createRef): new signals
4152 * src/frontends/xforms/FormIndex.[Ch],
4153 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4154 when setting dialog's min/max size
4155 * src/frontends/xforms/FormIndex.[Ch]: ditto
4157 * src/frontends/xforms/FormRef.[Ch],
4158 src/frontends/xforms/forms/form_ref.fd: new xforms
4159 implementation of an InsetRef dialog
4161 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4164 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4165 ios::nocreate is not part of the standard. Removed.
4167 2000-08-07 Baruch Even <baruch.even@writeme.com>
4169 * src/graphics/Renderer.h:
4170 * src/graphics/Renderer.C: Added base class for rendering of different
4171 image formats into Pixmaps.
4173 * src/graphics/XPM_Renderer.h:
4174 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4175 in a different class.
4177 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4178 easily add support for other formats.
4180 * src/insets/figinset.C: plugged a leak of an X resource.
4182 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4184 * src/CutAndPaste.[Ch]: make all metods static.
4186 * development/Code_rules/Rules: more work, added section on
4187 Exceptions, and a References section.
4189 * a lot of header files: work to make doc++ able to generate the
4190 source documentation, some workarounds of doc++ problems. Doc++ is
4191 now able to generate the documentation.
4193 2000-08-07 Juergen Vigna <jug@sad.it>
4195 * src/insets/insettabular.C (recomputeTextInsets): removed function
4197 * src/tabular.C (SetWidthOfMulticolCell):
4199 (calculate_width_of_column_NMC): fixed return value so that it really
4200 only returns true if the column-width has changed (there where
4201 problems with muliticolumn-cells in this column).
4203 2000-08-04 Juergen Vigna <jug@sad.it>
4205 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4206 also on the scrollstatus of the inset.
4207 (workAreaMotionNotify): ditto.
4209 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4211 2000-08-01 Juergen Vigna <jug@sad.it>
4213 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4215 * src/commandtags.h:
4216 * src/LyXAction.C (init):
4217 * src/insets/inset.C (LocalDispatch): added support for
4220 * src/insets/inset.C (scroll): new functions.
4222 * src/insets/insettext.C (removeNewlines): new function.
4223 (SetAutoBreakRows): removes forced newlines in the text of the
4224 paragraph if autoBreakRows is set to false.
4226 * src/tabular.C (Latex): generates a parbox around the cell contents
4229 * src/frontends/xforms/FormTabular.C (local_update): removed
4230 the radio_useparbox button.
4232 * src/tabular.C (UseParbox): new function
4234 2000-08-06 Baruch Even <baruch.even@writeme.com>
4236 * src/graphics/GraphicsCache.h:
4237 * src/graphics/GraphicsCache.C:
4238 * src/graphics/GraphicsCacheItem.h:
4239 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4242 * src/insets/insetgraphics.h:
4243 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4244 and the drawing of the inline image.
4246 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4247 loaded into the wrong position.
4249 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4252 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4254 * src/support/translator.h: move all typedefs to public section
4256 * src/support/filetools.C (MakeLatexName): return string const
4258 (TmpFileName): ditto
4259 (FileOpenSearch): ditto
4261 (LibFileSearch): ditto
4262 (i18nLibFileSearch): ditto
4265 (CreateTmpDir): ditto
4266 (CreateBufferTmpDir): ditto
4267 (CreateLyXTmpDir): ditto
4270 (MakeAbsPath): ditto
4272 (OnlyFilename): ditto
4274 (NormalizePath): ditto
4275 (CleanupPath): ditto
4276 (GetFileContents): ditto
4277 (ReplaceEnvironmentPath): ditto
4278 (MakeRelPath): ditto
4280 (ChangeExtension): ditto
4281 (MakeDisplayPath): ditto
4282 (do_popen): return cmdret const
4283 (findtexfile): return string const
4285 * src/support/DebugStream.h: add some /// to please doc++
4287 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4289 * src/texrow.C (same_rownumber): functor to use with find_if
4290 (getIdFromRow): rewritten to use find_if and to not update the
4291 positions. return true if row is found
4292 (increasePos): new method, use to update positions
4294 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4296 * src/lyxlex_pimpl.C (verifyTable): new method
4299 (GetString): return string const
4300 (pushTable): rewrite to use std::stack
4302 (setFile): better check
4305 * src/lyxlex.h: make LyXLex noncopyable
4307 * src/lyxlex.C (text): return char const * const
4308 (GetString): return string const
4309 (getLongString): return string const
4311 * src/lyx_gui_misc.C (askForText): return pair<...> const
4313 * src/lastfiles.[Ch] (operator): return string const
4315 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4316 istringstream not char const *.
4317 move token.end() out of loop.
4318 (readFile): move initializaton of token
4320 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4321 getIdFromRow is successful.
4323 * lib/bind/emacs.bind: don't include menus bind
4325 * development/Code_rules/Rules: the beginnings of making this
4326 better and covering more of the unwritten rules that we have.
4328 * development/Code_rules/Recommendations: a couple of wording
4331 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4333 * src/support/strerror.c: remove C++ comment.
4335 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4337 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4338 LFUN_INDEX_INSERT_LAST
4340 * src/texrow.C (getIdFromRow): changed from const_iterator to
4341 iterator, allowing code to compile with DEC cxx
4343 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4344 stores part of the class, as suggested by Allan. Will allow
4346 (apply): test to apply uses InsetCommandParams operator!=
4348 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4349 (apply): test to apply uses InsetCommandParams operator!=
4351 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4352 stores part of the class.
4353 (update): removed limits on min/max size.
4355 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4356 (apply): test to apply uses InsetCommandParams operator!=
4358 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4359 (Read, Write, scanCommand, getCommand): moved functionality
4360 into InsetCommandParams.
4362 (getScreenLabel): made pure virtual
4363 new InsetCommandParams operators== and !=
4365 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4366 c-tors based on InsetCommandParams. Removed others.
4367 * src/insets/insetinclude.[Ch]: ditto
4368 * src/insets/insetlabel.[Ch]: ditto
4369 * src/insets/insetparent.[Ch]: ditto
4370 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4372 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4373 insets derived from InsetCommand created using similar c-tors
4374 based on InsetCommandParams
4375 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4376 * src/menus.C (ShowRefsMenu): ditto
4377 * src/paragraph.C (Clone): ditto
4378 * src/text2.C (SetCounter): ditto
4379 * src/lyxfunc.C (Dispatch) ditto
4380 Also recreated old InsetIndex behaviour exactly. Can now
4381 index-insert at the start of a paragraph and index-insert-last
4382 without launching the pop-up.
4384 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4386 * lib/lyxrc.example: mark te pdf options as non functional.
4388 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4389 (isStrDbl): move tmpstr.end() out of loop.
4390 (strToDbl): move intialization of tmpstr
4391 (lowercase): return string const and move tmp.end() out of loop.
4392 (uppercase): return string const and move tmp.edn() out of loop.
4393 (prefixIs): add assertion
4398 (containsOnly): ditto
4399 (containsOnly): ditto
4400 (containsOnly): ditto
4401 (countChar): make last arg char not char const
4402 (token): return string const
4403 (subst): return string const, move tmp.end() out of loop.
4404 (subst): return string const, add assertion
4405 (strip): return string const
4406 (frontStrip): return string const, add assertion
4407 (frontStrip): return string const
4412 * src/support/lstrings.C: add inclde "LAssert.h"
4413 (isStrInt): move tmpstr.end() out of loop.
4415 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4416 toollist.end() out of loop.
4417 (deactivate): move toollist.end() out of loop.
4418 (update): move toollist.end() out of loop.
4419 (updateLayoutList): move tc.end() out of loop.
4420 (add): move toollist.end() out of loop.
4422 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4423 md.end() out of loop.
4425 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4427 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4430 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4431 (Erase): move insetlist.end() out of loop.
4433 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4434 ref to const string as first arg. Move initialization of some
4435 variables, whitespace changes.
4437 * src/kbmap.C (defkey): move table.end() out of loop.
4438 (kb_keymap): move table.end() out of loop.
4439 (findbinding): move table.end() out of loop.
4441 * src/MenuBackend.C (hasMenu): move end() out of loop.
4442 (getMenu): move end() out of loop.
4443 (getMenu): move menulist_.end() out of loop.
4445 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4447 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4450 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4451 (getFromLyXName): move infotab.end() out of loop.
4453 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4454 -fvtable-thunks -ffunction-sections -fdata-sections
4456 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4458 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4461 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4463 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4465 * src/frontends/xforms/FormCitation.[Ch],
4466 src/frontends/xforms/FormIndex.[Ch],
4467 src/frontends/xforms/FormToc.[Ch],
4468 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4470 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4472 * src/commandtags.h: renamed, created some flags for citation
4475 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4477 * src/lyxfunc.C (dispatch): use signals to insert index entry
4479 * src/frontends/Dialogs.h: new signal createIndex
4481 * src/frontends/xforms/FormCommand.[Ch],
4482 src/frontends/xforms/FormCitation.[Ch],
4483 src/frontends/xforms/FormToc.[Ch],
4484 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4486 * src/insets/insetindex.[Ch]: GUI-independent
4488 * src/frontends/xforms/FormIndex.[Ch],
4489 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4492 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4494 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4495 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4497 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4499 * src/insets/insetref.C (Latex): rewrite so that there is now
4500 question that a initialization is requested.
4502 * src/insets/insetcommand.h: reenable the hide signal
4504 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4506 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4507 fix handling of shortcuts (many bugs :)
4508 (add_lastfiles): ditto.
4510 * lib/ui/default.ui: fix a few shortcuts.
4512 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4514 * Makefile.am: Fix ``rpmdist'' target to return the exit
4515 status of the ``rpm'' command, instead of the last command in
4516 the chain (the ``rm lyx.xpm'' command, which always returns
4519 2000-08-02 Allan Rae <rae@lyx.org>
4521 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4522 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4523 * src/frontends/xforms/FormToc.C (FormToc): ditto
4525 * src/frontends/xforms/Makefile.am: A few forgotten files
4527 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4528 Signals-not-copyable-problem Lars' started commenting out.
4530 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4532 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4534 * src/insets/insetcommand.h: Signals is not copyable so anoter
4535 scheme for automatic hiding of forms must be used.
4537 * src/frontends/xforms/FormCitation.h: don't inerit from
4538 noncopyable, FormCommand already does that.
4539 * src/frontends/xforms/FormToc.h: ditto
4540 * src/frontends/xforms/FormUrl.h: ditto
4542 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4544 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4546 * src/insets/insetcommand.h (hide): new SigC::Signal0
4547 (d-tor) new virtual destructor emits hide signal
4549 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4550 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4552 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4553 LOF and LOT. Inset is now GUI-independent
4555 * src/insets/insetloa.[Ch]: redundant
4556 * src/insets/insetlof.[Ch]: ditto
4557 * src/insets/insetlot.[Ch]: ditto
4559 * src/frontends/xforms/forms/form_url.fd: tweaked!
4560 * src/frontends/xforms/forms/form_citation.fd: ditto
4562 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4563 dialogs dealing with InsetCommand insets
4565 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4566 FormCommand base class
4567 * src/frontends/xforms/FormUrl.[Ch]: ditto
4569 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4571 * src/frontends/xforms/FormToc.[Ch]: ditto
4573 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4574 passed a generic InsetCommand pointer
4575 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4577 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4578 and modified InsetTOC class
4579 * src/buffer.C: ditto
4581 * forms/lyx.fd: strip out old FD_form_toc code
4582 * src/lyx_gui_misc.C: ditto
4583 * src/lyx_gui.C: ditto
4584 * src/lyx_cb.C: ditto
4585 * src/lyx.[Ch]: ditto
4587 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4589 * src/support/utility.hpp: tr -d '\r'
4591 2000-08-01 Juergen Vigna <jug@sad.it>
4593 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4595 * src/commandtags.h:
4596 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4597 LFUN_TABULAR_FEATURES.
4599 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4600 LFUN_LAYOUT_TABULAR.
4602 * src/insets/insettabular.C (getStatus): implemented helper function.
4604 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4606 2000-07-31 Juergen Vigna <jug@sad.it>
4608 * src/text.C (draw): fixed screen update problem for text-insets.
4610 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4611 something changed probably this has to be added in various other
4614 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4616 2000-07-31 Baruch Even <baruch.even@writeme.com>
4618 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4619 templates to satisfy compaq cxx.
4622 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4624 * src/support/translator.h (equal_1st_in_pair::operator()): take
4625 const ref pair_type as arg.
4626 (equal_2nd_in_pair::operator()): ditto
4627 (Translator::~Translator): remove empty d-tor.
4629 * src/graphics/GraphicsCache.C: move include config.h to top, also
4630 put initialization of GraphicsCache::singleton here.
4631 (~GraphicsCache): move here
4632 (addFile): take const ref as arg
4635 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4637 * src/BufferView2.C (insertLyXFile): change te with/without header
4640 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4642 * src/frontends/xforms/FormGraphics.C (apply): add some
4643 static_cast. Not very nice, but required by compaq cxx.
4645 * src/frontends/xforms/RadioButtonGroup.h: include header
4646 <utility> instead of <pair.h>
4648 * src/insets/insetgraphicsParams.C: add using directive.
4649 (readResize): change return type to void.
4650 (readOrigin): ditto.
4652 * src/lyxfunc.C (getStatus): add missing break for build-program
4653 function; add test for Literate for export functions.
4655 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4656 entries in Options menu.
4658 2000-07-31 Baruch Even <baruch.even@writeme.com>
4660 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4661 protect against auto-allocation; release icon when needed.
4663 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4665 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4666 on usual typewriter.
4668 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4669 earlier czech.kmap), useful only for programming.
4671 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4673 * src/frontends/xforms/FormCitation.h: fix conditioning around
4676 2000-07-31 Juergen Vigna <jug@sad.it>
4678 * src/frontends/xforms/FormTabular.C (local_update): changed
4679 radio_linebreaks to radio_useparbox and added radio_useminipage.
4681 * src/tabular.C: made support for using minipages/parboxes.
4683 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4685 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4687 (descent): so the cursor is in the middle.
4688 (width): bit smaller box.
4690 * src/insets/insetgraphics.h: added display() function.
4692 2000-07-31 Baruch Even <baruch.even@writeme.com>
4694 * src/frontends/Dialogs.h: Added showGraphics signals.
4696 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4697 xforms form definition of the graphics dialog.
4699 * src/frontends/xforms/FormGraphics.h:
4700 * src/frontends/xforms/FormGraphics.C: Added files, the
4701 GUIndependent code of InsetGraphics
4703 * src/insets/insetgraphics.h:
4704 * src/insets/insetgraphics.C: Major writing to make it work.
4706 * src/insets/insetgraphicsParams.h:
4707 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4708 struct between InsetGraphics and GUI.
4710 * src/LaTeXFeatures.h:
4711 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4712 support for graphicx package.
4714 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4715 for the graphics inset.
4717 * src/support/translator.h: Added file, used in
4718 InsetGraphicsParams. this is a template to translate between two
4721 * src/frontends/xforms/RadioButtonGroup.h:
4722 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4723 way to easily control a radio button group.
4725 2000-07-28 Juergen Vigna <jug@sad.it>
4727 * src/insets/insettabular.C (LocalDispatch):
4728 (TabularFeatures): added support for lyx-functions of tabular features.
4729 (cellstart): refixed this function after someone wrongly changed it.
4731 * src/commandtags.h:
4732 * src/LyXAction.C (init): added support for tabular-features
4734 2000-07-28 Allan Rae <rae@lyx.org>
4736 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4737 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4738 triggers the callback for input checking. As a result we sometimes get
4739 "LyX: This shouldn't happen..." printed to cerr.
4740 (input): Started using status variable since I only free() on
4741 destruction. Some input checking for paths and font sizes.
4743 * src/frontends/xforms/FormPreferences.h: Use status to control
4744 activation of Ok and Apply
4746 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4747 callback. Also resized to stop segfaults with 0.88. The problem is
4748 that xforms-0.88 requires the folder to be wide enough to fit all the
4749 tabs. If it isn't it causes all sorts of problems.
4751 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4753 * src/frontends/xforms/forms/README: Reflect reality.
4755 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4756 * src/frontends/xforms/forms/makefile: ditto.
4758 * src/commandtags.h: Get access to new Preferences dialog
4759 * src/LyXAction.C: ditto
4760 * src/lyxfunc.C: ditto
4761 * lib/ui/default.ui: ditto
4763 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4765 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4767 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4770 * src/frontends/xforms/form_url.[Ch]: added.
4772 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4774 * src/insets/insetbib.h: fixed bug in previous commit
4776 * src/frontends/xforms/FormUrl.h: ditto
4778 * src/frontends/xforms/FormPrint.h: ditto
4780 * src/frontends/xforms/FormPreferences.h: ditto
4782 * src/frontends/xforms/FormCopyright.h: ditto
4784 * src/frontends/xforms/FormCitation.C: ditto
4786 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4787 private copyconstructor and private default contructor
4789 * src/support/Makefile.am: add utility.hpp
4791 * src/support/utility.hpp: new file from boost
4793 * src/insets/insetbib.h: set owner in clone
4795 * src/frontends/xforms/FormCitation.C: added missing include
4798 * src/insets/form_url.[Ch]: removed
4800 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4802 * development/lyx.spec.in
4803 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4804 file/directory re-organization.
4806 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4808 * src/insets/insetcommand.[Ch]: moved the string data and
4809 associated manipulation methods into a new stand-alone class
4810 InsetCommandParams. This class has two additional methods
4811 getAsString() and setFromString() allowing the contents to be
4812 moved around as a single string.
4813 (addContents) method removed.
4814 (setContents) method no longer virtual.
4816 * src/buffer.C (readInset): made use of new InsetCitation,
4817 InsetUrl constructors based on InsetCommandParams.
4819 * src/commandtags.h: add LFUN_INSERT_URL
4821 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4822 independent InsetUrl and use InsetCommandParams to extract
4823 string info and create new Insets.
4825 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4827 * src/frontends/xforms/FormCitation.C (apply): uses
4830 * src/frontends/xforms/form_url.C
4831 * src/frontends/xforms/form_url.h
4832 * src/frontends/xforms/FormUrl.h
4833 * src/frontends/xforms/FormUrl.C
4834 * src/frontends/xforms/forms/form_url.fd: new files
4836 * src/insets/insetcite.[Ch]: removed unused constructors.
4838 * src/insets/insetinclude.[Ch]: no longer store filename
4840 * src/insets/inseturl.[Ch]: GUI-independent.
4842 2000-07-26 Juergen Vigna <jug@sad.it>
4843 * renamed frontend from gtk to gnome as it is that what is realized
4844 and did the necessary changes in the files.
4846 2000-07-26 Marko Vendelin <markov@ioc.ee>
4848 * configure.in: cleaning up gnome configuration scripts
4850 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4852 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4853 shortcuts syndrom by redrawing them explicitely (a better solution
4854 would be appreciated).
4856 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4858 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4861 * src/lyx_cb.C (MenuExport): change html export to do the right
4862 thing depending of the document type (instead of having
4863 html-linuxdoc and html-docbook).
4864 * src/lyxfunc.C (getStatus): update for html
4865 * lib/ui/default.ui: simplify due to the above change.
4866 * src/menus.C (ShowFileMenu): update too (in case we need it).
4868 * src/MenuBackend.C (read): if a menu is defined twice, add the
4869 new entries to the exiting one.
4871 2000-07-26 Juergen Vigna <jug@sad.it>
4873 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4875 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4876 and return a bool if it did actual save the file.
4877 (AutoSave): don't autosave a unnamed doc.
4879 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4880 check if this is an UNNAMED new file and react to it.
4881 (newFile): set buffer to unnamed and change to not mark a new
4882 buffer dirty if I didn't do anything with it.
4884 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4886 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4888 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4889 friend as per Angus's patch posted to lyx-devel.
4891 * src/ext_l10n.h: updated
4893 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4894 gettext on the style string right before inserting them into the
4897 * autogen.sh: add code to extract style strings form layout files,
4898 not good enough yet.
4900 * src/frontends/gtk/.cvsignore: add MAKEFILE
4902 * src/MenuBackend.C (read): run the label strings through gettext
4903 before storing them in the containers.
4905 * src/ext_l10n.h: new file
4907 * autogen.sh : generate the ext_l10n.h file here
4909 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4911 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4914 * lib/ui/default.ui: fix a couple of typos.
4916 * config/gnome/gtk.m4: added (and added to the list of files in
4919 * src/insets/insetinclude.C (unique_id): fix when we are using
4920 lyxstring instead of basic_string<>.
4921 * src/insets/insettext.C (LocalDispatch): ditto.
4922 * src/support/filetools.C: ditto.
4924 * lib/configure.m4: create the ui/ directory if necessary.
4926 * src/LyXView.[Ch] (updateToolbar): new method.
4928 * src/BufferView_pimpl.C (buffer): update the toolbar when
4929 opening/closing buffer.
4931 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4933 * src/LyXAction.C (getActionName): enhance to return also the name
4934 and options of pseudo-actions.
4935 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4937 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4938 as an example of what is possible). Used in File->Build too (more
4939 useful) and in the import/export menus (to mimick the complicated
4940 handling of linuxdoc and friends). Try to update all the entries.
4942 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4945 * src/MenuBackend.C (read): Parse the new OptItem tag.
4947 * src/MenuBackend.h: Add a new optional_ data member (used if the
4948 entry should be omitted when the lyxfunc is disabled).
4950 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4951 function, used as a shortcut.
4952 (create_submenu): align correctly the shortcuts on the widest
4955 * src/MenuBackend.h: MenuItem.label() only returns the label of
4956 the menu without shortcut; new method shortcut().
4958 2000-07-14 Marko Vendelin <markov@ioc.ee>
4960 * src/frontends/gtk/Dialogs.C:
4961 * src/frontends/gtk/FormCopyright.C:
4962 * src/frontends/gtk/FormCopyright.h:
4963 * src/frontends/gtk/Makefile.am: added these source-files for the
4964 Gtk/Gnome support of the Copyright-Dialog.
4966 * src/main.C: added Gnome::Main initialization if using
4967 Gtk/Gnome frontend-GUI.
4969 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4971 * config/gnome/aclocal-include.m4
4972 * config/gnome/compiler-flags.m4
4973 * config/gnome/curses.m4
4974 * config/gnome/gnome--.m4
4975 * config/gnome/gnome-bonobo-check.m4
4976 * config/gnome/gnome-common.m4
4977 * config/gnome/gnome-fileutils.m4
4978 * config/gnome/gnome-ghttp-check.m4
4979 * config/gnome/gnome-gnorba-check.m4
4980 * config/gnome/gnome-guile-checks.m4
4981 * config/gnome/gnome-libgtop-check.m4
4982 * config/gnome/gnome-objc-checks.m4
4983 * config/gnome/gnome-orbit-check.m4
4984 * config/gnome/gnome-print-check.m4
4985 * config/gnome/gnome-pthread-check.m4
4986 * config/gnome/gnome-support.m4
4987 * config/gnome/gnome-undelfs.m4
4988 * config/gnome/gnome-vfs.m4
4989 * config/gnome/gnome-x-checks.m4
4990 * config/gnome/gnome-xml-check.m4
4991 * config/gnome/gnome.m4
4992 * config/gnome/gperf-check.m4
4993 * config/gnome/gtk--.m4
4994 * config/gnome/linger.m4
4995 * config/gnome/need-declaration.m4: added configuration scripts
4996 for Gtk/Gnome frontend-GUI
4998 * configure.in: added support for the --with-frontend=gtk option
5000 * autogen.sh: added config/gnome/* to list of config-files
5002 * acconfig.h: added define for GTKGUI-support
5004 * config/lyxinclude.m4: added --with-frontend[=value] option value
5005 for Gtk/Gnome frontend-GUI support.
5007 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5009 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
5013 * src/paragraph.C (GetChar): remove non-const version
5015 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
5016 (search_kw): use it.
5018 * src/lyx_main.C (init): if "preferences" exist, read that instead
5020 (ReadRcFile): return bool if the file could be read ok.
5021 (ReadUIFile): add a check to see if lex file is set ok.
5023 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
5024 bastring can be used instead of lyxstring (still uses the old code
5025 if std::string is good enough or if lyxstring is used.)
5027 * src/encoding.C: make the arrays static, move ininle functions
5029 * src/encoding.h: from here.
5031 * src/buffer.C: have last_isnet_read as a file scope variable for now.
5032 (parseSingleLyXformat2Token): move inset parsing to separate method
5033 (readInset): new private method
5035 * src/Variables.h: remove virtual from get().
5037 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
5038 access to NEW_INSETS and NEW_TABULAR
5040 * src/MenuBackend.h: remove superfluous forward declaration of
5041 MenuItem. Add documentations tags "///", remove empty MenuItem
5042 destructor, remove private default contructor.
5044 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5046 (read): more string mlabel and mname to where they are used
5047 (read): remove unused variables mlabel and mname
5048 (defaults): unconditional clear, make menusetup take advantage of
5049 add returning Menu &.
5051 * src/LyXView.h: define NEW_MENUBAR as default
5053 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5054 to NEW_INSETS and NEW_TABULAR.
5055 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5056 defined. Change some of the "xxxx-inset-insert" functions names to
5059 * several files: more enahncements to NEW_INSETS and the resulting
5062 * lib/lyxrc.example (\date_insert_format): move to misc section
5064 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5065 bastring and use AC_CACHE_CHECK.
5066 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5067 the system have the newest methods. uses AC_CACHE_CHECK
5068 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5069 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5070 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5072 * configure.in: add LYX_CXX_GOOD_STD_STRING
5074 * acinclude.m4: recreated
5076 2000-07-24 Amir Karger <karger@lyx.org>
5078 * README: add Hebrew, Arabic kmaps
5081 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5083 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5086 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5088 * Lot of files: add pragma interface/implementation.
5090 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5092 * lib/ui/default.ui: new file (ans new directory). Contains the
5093 default menu and toolbar.
5095 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5096 global space. Toolbars are now read (as menus) in ui files.
5098 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5100 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5101 is disabled because the document is read-only. We want to have the
5102 toggle state of the function anyway.
5103 (getStatus): add code for LFUN_VC* functions (mimicking what is
5104 done in old-style menus)
5106 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5107 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5109 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5110 * src/BufferView_pimpl.C: ditto.
5111 * src/lyxfunc.C: ditto.
5113 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5114 default). This replaces old-style menus by new ones.
5116 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5117 MenuItem. Contain the data structure of a menu.
5119 * src/insets/insettext.C: use LyXView::setLayout instead of
5120 accessing directly the toolbar combox.
5121 * src/lyxfunc.C (Dispatch): ditto.
5123 * src/LyXView.C (setLayout): new method, which just calls
5124 Toolbar::setLayout().
5125 (updateLayoutChoice): move part of this method in Toolbar.
5127 * src/toolbar.[Ch]: removed.
5129 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5130 implementation the toolbar.
5132 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5133 the toolbar. It might make sense to merge it with ToolbarDefaults
5135 (setLayout): new function.
5136 (updateLayoutList): ditto.
5137 (openLayoutList): ditto.
5139 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5140 xforms implementation of the toolbar.
5141 (get_toolbar_func): comment out, since I do not
5142 know what it is good for.
5144 * src/ToolbarDefaults.h: Add the ItemType enum.
5146 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5147 for a list of allocated C strings. Used in Menubar xforms
5148 implementation to avoid memory leaks.
5150 * src/support/lstrings.[Ch] (uppercase): new version taking and
5154 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5155 * lib/bind/emacs.bind: ditto.
5157 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5159 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5160 forward decl of LyXView.
5162 * src/toolbar.C (toolbarItem): moved from toolbar.h
5163 (toolbarItem::clean): ditto
5164 (toolbarItem::~toolbarItem): ditto
5165 (toolbarItem::operator): ditto
5167 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5169 * src/paragraph.h: control the NEW_TABULAR define from here
5171 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5172 USE_TABULAR_INSETS to NEW_TABULAR
5174 * src/ToolbarDefaults.C: add include "lyxlex.h"
5176 * files using the old table/tabular: use NEW_TABULAR to control
5177 compilation of old tabular stuff.
5179 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5182 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5183 planemet in reading of old style floats, fix the \end_deeper
5184 problem when reading old style floats.
5186 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5188 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5190 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5192 * lib/bind/sciword.bind: updated.
5194 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5196 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5197 layout write problem
5199 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5201 * src/Makefile.am (INCLUDES): remove image directory from include
5204 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5205 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5207 * src/LyXView.C (create_form_form_main): read the application icon
5210 * lib/images/*.xpm: change the icons to use transparent color for
5213 * src/toolbar.C (update): change the color of the button when it
5216 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5218 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5219 setting explicitely the minibuffer.
5220 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5222 * src/LyXView.C (showState): new function. Shows font information
5223 in minibuffer and update toolbar state.
5224 (LyXView): call Toolbar::update after creating the
5227 * src/toolbar.C: change toollist to be a vector instead of a
5229 (BubbleTimerCB): get help string directly from the callback
5230 argument of the corresponding icon (which is the action)
5231 (set): remove unnecessary ugliness.
5232 (update): new function. update the icons (depressed, disabled)
5233 depending of the status of the corresponding action.
5235 * src/toolbar.h: remove help in toolbarItem
5237 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5239 * src/Painter.C (text): Added code for using symbol glyphs from
5240 iso10646 fonts. Currently diabled.
5242 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5245 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5246 magyar,turkish and usorbian.
5248 * src/paragraph.C (isMultiLingual): Made more efficient.
5250 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5253 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5254 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5255 Also changed the prototype to "bool math_insert_greek(char)".
5257 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5259 * lots of files: apply the NEW_INSETS on all code that will not be
5260 needed when we move to use the new insets. Enable the define in
5261 lyxparagrah.h to try it.
5263 * src/insets/insettabular.C (cellstart): change to be a static
5265 (InsetTabular): initialize buffer in the initializer list.
5267 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5269 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5270 form_print.h out of the header file. Replaced with forward
5271 declarations of the relevant struct.
5273 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5276 * src/commandtags.h: do not include "debug.h" which does not
5277 belong there. #include it in some other places because of this
5280 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5282 * src/insets/insetcaption.C: add a couple "using" directives.
5284 * src/toolbar.C (add): get the help text directly from lyxaction.
5286 (setPixmap): new function. Loads from disk and sets a pixmap on a
5287 botton; the name of the pixmap file is derived from the command
5290 * src/toolbar.h: remove members isBitmap and pixmap from
5293 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5294 * lib/images/: move many files from images/banner.xpm.
5296 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5298 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5299 * src/toolbar.C: ditto.
5300 * configure.in: ditto.
5301 * INSTALL: document.
5303 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5304 the spellchecker popup is closed from the WM.
5306 2000-07-19 Juergen Vigna <jug@sad.it>
5308 * src/insets/insetfloat.C (Write): small fix because we use the
5309 insetname for the type now!
5311 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5313 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5316 * src/frontends/Dialogs.h: removed hideCitation signal
5318 * src/insets/insetcite.h: added hide signal
5320 * src/insets/insetcite.C (~InsetCitation): emits new signal
5321 (getScreenLabel): "intelligent" label should now fit on the screen!
5323 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5325 * src/frontends/xforms/FormCitation.C (showInset): connects
5326 hide() to the inset's hide signal
5327 (show): modified to use fl_set_object_position rather than
5328 fl_set_object_geometry wherever possible
5330 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5332 * src/insets/lyxinset.h: add caption code
5334 * src/insets/insetfloat.C (type): new method
5336 * src/insets/insetcaption.C (Write): new method
5338 (LyxCode): new method
5340 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5341 to get it right together with using the FloatList.
5343 * src/commandtags.h: add LFUN_INSET_CAPTION
5344 * src/lyxfunc.C (Dispatch): handle it
5346 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5349 * src/Variables.[Ch]: make expand take a const reference, remove
5350 the destructor, some whitespace changes.
5352 * src/LyXAction.C (init): add caption-inset-insert
5354 * src/FloatList.C (FloatList): update the default floats a bit.
5356 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5358 * src/Variables.[Ch]: new files. Intended to be used for language
5359 specific strings (like \chaptername) and filename substitution in
5362 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5364 * lib/kbd/american.kmap: update
5366 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5368 * src/bufferparams.[Ch]: remove member allowAccents.
5370 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5372 * src/LaTeXLog.C: use the log_form.h header.
5373 * src/lyx_gui.C: ditto.
5374 * src/lyx_gui_misc.C: ditto.
5375 * src/lyxvc.h: ditto.
5377 * forms/log_form.fd: new file, created from latexoptions.fd. I
5378 kept the log popup and nuked the options form.
5380 * src/{la,}texoptions.[Ch]: removed.
5381 * src/lyx_cb.C (LaTeXOptions): ditto
5383 * src/lyx_gui.C (create_forms): do not handle the
5384 fd_latex_options form.
5386 2000-07-18 Juergen Vigna <jug@sad.it>
5388 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5389 name of the inset so that it can be requested outside (text2.C).
5391 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5394 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5396 * src/mathed/formula.h (ConvertFont): constify
5398 * src/mathed/formula.C (Read): add warning if \end_inset is not
5399 found on expected place.
5401 * src/insets/lyxinset.h (ConvertFont): consify
5403 * src/insets/insetquotes.C (ConvertFont): constify
5404 * src/insets/insetquotes.h: ditto
5406 * src/insets/insetinfo.h: add labelfont
5408 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5409 (ascent): use labelfont
5413 (Write): make .lyx file a bit nicer
5415 * src/insets/insetfloat.C (Write): simplify somewhat...
5416 (Read): add warning if arg is not found
5418 * src/insets/insetcollapsable.C: add using std::max
5419 (Read): move string token and add warning in arg is not found
5420 (draw): use std::max to get the right ty
5421 (getMaxWidth): simplify by using std::max
5423 * src/insets/insetsection.h: new file
5424 * src/insets/insetsection.C: new file
5425 * src/insets/insetcaption.h: new file
5426 * src/insets/insetcaption.C: new file
5428 * src/insets/inset.C (ConvertFont): constify signature
5430 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5431 insetcaption.[Ch] and insetsection.[Ch]
5433 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5434 uses to use LABEL_COUNTER_CHAPTER instead.
5435 * src/text2.C (SetCounter): here
5437 * src/counters.h: new file
5438 * src/counters.C: new file
5439 * src/Sectioning.h: new file
5440 * src/Sectioning.C: new file
5442 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5444 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5446 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5449 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5452 2000-07-17 Juergen Vigna <jug@sad.it>
5454 * src/tabular.C (Validate): check if array-package is needed.
5455 (SetVAlignment): added support for vertical alignment.
5456 (SetLTFoot): better support for longtable header/footers
5457 (Latex): modified to support added features.
5459 * src/LaTeXFeatures.[Ch]: added array-package.
5461 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5463 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5466 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5468 * configure.in: do not forget to put a space after -isystem.
5470 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5472 * lib/kbd/arabic.kmap: a few fixes.
5474 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5476 * some whitespace chagnes to a number of files.
5478 * src/support/DebugStream.h: change to make it easier for
5479 doc++ to parse correctly.
5480 * src/support/lyxstring.h: ditto
5482 * src/mathed/math_utils.C (compara): change to have only one
5484 (MathedLookupBOP): change because of the above.
5486 * src/mathed/math_delim.C (math_deco_compare): change to have only
5488 (search_deco): change becasue of the above.
5490 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5491 instead of manually coded one.
5493 * src/insets/insetquotes.C (Read): read the \end_inset too
5495 * src/insets/insetlatex.h: remove file
5496 * src/insets/insetlatex.C: remove file
5498 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5500 (InsetPrintIndex): remove destructor
5502 * src/insets/insetinclude.h: remove default constructor
5504 * src/insets/insetfloat.C: work to make it work better
5506 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5508 * src/insets/insetcite.h (InsetCitation): remove default constructor
5510 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5512 * src/text.C (GetColumnNearX): comment out some currently unused code.
5514 * src/paragraph.C (writeFile): move some initializations closer to
5516 (CutIntoMinibuffer): small change to use new matchIT operator
5520 (InsertInset): ditto
5523 (InsetIterator): ditto
5524 (Erase): small change to use new matchFT operator
5526 (GetFontSettings): ditto
5527 (HighestFontInRange): ditto
5530 * src/lyxparagraph.h: some chars changed to value_type
5531 (matchIT): because of some stronger checking (perhaps too strong)
5532 in SGI STL, the two operator() unified to one.
5535 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5537 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5538 the last inset read added
5539 (parseSingleLyXformat2Token): some more (future) compability code added
5540 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5541 (parseSingleLyXformat2Token): set last_inset_read
5542 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5543 (parseSingleLyXformat2Token): don't double intializw string next_token
5545 * src/TextCache.C (text_fits::operator()): add const's to the signature
5546 (has_buffer::operator()): ditto
5548 * src/Floating.h: add some comments on the class
5550 * src/FloatList.[Ch] (typeExist): new method
5553 * src/BackStack.h: added default constructor, wanted by Gcc.
5555 2000-07-14 Juergen Vigna <jug@sad.it>
5557 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5559 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5561 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5562 do a redraw when the window is resized!
5563 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5565 * src/insets/insettext.C (resizeLyXText): added function to correctly
5566 being able to resize the LyXWindow.
5568 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5570 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5572 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5573 crashes when closing dialog to a deleted inset.
5575 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5576 method! Now similar to other insets.
5578 2000-07-13 Juergen Vigna <jug@sad.it>
5580 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5582 * lib/examples/Literate.lyx: small patch!
5584 * src/insets/insetbib.C (Read): added this function because of wrong
5585 Write (without [begin|end]_inset).
5587 2000-07-11 Juergen Vigna <jug@sad.it>
5589 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5590 as the insertInset could not be good!
5592 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5593 the bool param should not be last.
5595 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5597 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5598 did submit that to Karl).
5600 * configure.in: use -isystem instead of -I for X headers. This
5601 fixes a problem on solaris with a recent gcc;
5602 put the front-end code after the X detection code;
5603 configure in sigc++ before lib/
5605 * src/lyx_main.C (commandLineHelp): remove -display from command
5608 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5610 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5611 Also put in Makefile rules for building the ``listerrors''
5612 program for parsing errors from literate programs written in LyX.
5614 * lib/build-listerrors: Added small shell script as part of compile
5615 process. This builds a working ``listerrors'' binary if noweb is
5616 installed and either 1) the VNC X server is installed on the machine,
5617 or 2) the user is compiling from within a GUI. The existence of a GUI
5618 is necessary to use the ``lyx --export'' feature for now. This
5619 hack can be removed once ``lyx --export'' no longer requires a GUI to
5622 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5624 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5625 now passed back correctly from gcc and placed "under" error
5626 buttons in a Literate LyX source.
5628 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5630 * src/text.C (GetColumnNearX): Better behavior when a RTL
5631 paragraph is ended by LTR text.
5633 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5636 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5638 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5639 true when clipboard is empty.
5641 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5643 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5644 row of the paragraph.
5645 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5646 to prevent calculation of bidi tables
5648 2000-07-07 Juergen Vigna <jug@sad.it>
5650 * src/screen.C (ToggleSelection): added y_offset and x_offset
5653 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5656 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5658 * src/insets/insettext.C: fixed Layout-Display!
5660 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5662 * configure.in: add check for strings.h header.
5664 * src/spellchecker.C: include <strings.h> in order to have a
5665 definition for bzero().
5667 2000-07-07 Juergen Vigna <jug@sad.it>
5669 * src/insets/insettext.C (draw): set the status of the bv->text to
5670 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5672 * src/screen.C (DrawOneRow):
5673 (DrawFromTo): redraw the actual row if something has changed in it
5676 * src/text.C (draw): call an update of the toplevel-inset if something
5677 has changed inside while drawing.
5679 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5681 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5683 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5684 processing inside class.
5686 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5687 processing inside class.
5689 * src/insets/insetindex.h new struct Holder, consistent with other
5692 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5693 citation dialog from main code and placed it in src/frontends/xforms.
5694 Dialog launched through signals instead of callbacks
5696 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5698 * lyx.man: update the options description.
5700 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5702 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5703 handle neg values, set min width to 590, add doc about -display
5705 2000-07-05 Juergen Vigna <jug@sad.it>
5707 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5708 calls to BufferView *.
5710 * src/insets/insettext.C (checkAndActivateInset): small fix non
5711 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5713 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5714 their \end_inset token!
5716 2000-07-04 edscott <edscott@imp.mx>
5718 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5719 lib/lyxrc.example: added option \wheel_jump
5721 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5723 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5724 remove support for -width,-height,-xpos and -ypos.
5726 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5728 * src/encoding.[Ch]: New files.
5730 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5731 (text): Call to the underline() method only when needed.
5733 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5735 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5736 encoding(s) for the document.
5738 * src/bufferparams.C (BufferParams): Changed default value of
5741 * src/language.C (newLang): Removed.
5742 (items[]): Added encoding information for all defined languages.
5744 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5745 encoding choice button.
5747 * src/lyxrc.h (font_norm_type): New member variable.
5748 (set_font_norm_type): New method.
5750 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5751 paragraphs with different encodings.
5753 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5754 (TransformChar): Changed to work correctly with Arabic points.
5755 (draw): Added support for drawing Arabic points.
5756 (draw): Removed code for drawing underbars (this is done by
5759 * src/support/textutils.h (IsPrintableNonspace): New function.
5761 * src/BufferView_pimpl.h: Added "using SigC::Object".
5762 * src/LyXView.h: ditto.
5764 * src/insets/insetinclude.h (include_label): Changed to mutable.
5766 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5768 * src/mathed/math_iter.h: remove empty destructor
5770 * src/mathed/math_cursor.h: remove empty destructor
5772 * src/insets/lyxinset.h: add THEOREM_CODE
5774 * src/insets/insettheorem.[Ch]: new files
5776 * src/insets/insetminipage.C: (InsertInset): remove
5778 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5780 (InsertInset): remove
5782 * src/insets/insetlist.C: (InsertList): remove
5784 * src/insets/insetfootlike.[Ch]: new files
5786 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5789 (InsertInset): ditto
5791 * src/insets/insetert.C: remove include Painter.h, reindent
5792 (InsertInset): move to header
5794 * src/insets/insetcollapsable.h: remove explicit from default
5795 contructor, remove empty destructor, add InsertInset
5797 * src/insets/insetcollapsable.C (InsertInset): new func
5799 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5801 * src/vspace.h: add explicit to constructor
5803 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5804 \textcompwordmark, please test this.
5806 * src/lyxrc.C: set ascii_linelen to 65 by default
5808 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5810 * src/commandtags.h: add LFUN_INSET_THEOREM
5812 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5813 (makeLinuxDocFile): remove _some_ of the nice logic
5814 (makeDocBookFile): ditto
5816 * src/Painter.[Ch]: (~Painter): removed
5818 * src/LyXAction.C (init): entry for insettheorem added
5820 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5822 (deplog): code to detect files generated by LaTeX, needs testing
5825 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5827 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5829 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5831 * src/LaTeX.C (deplog): Add a check for files that are going to be
5832 created by the first latex run, part of the project to remove the
5835 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5836 contents to the extension list.
5838 2000-07-04 Juergen Vigna <jug@sad.it>
5840 * src/text.C (NextBreakPoint): added support for needFullRow()
5842 * src/insets/lyxinset.h: added needFullRow()
5844 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5847 * src/insets/insettext.C: lots of changes for update!
5849 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5851 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5853 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5855 * src/insets/insetinclude.C (InsetInclude): fixed
5856 initialization of include_label.
5857 (unique_id): now returns a string.
5859 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5861 * src/LaTeXFeatures.h: new member IncludedFiles, for
5862 a map of key, included file name.
5864 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5865 with the included files for inclusion in SGML preamble,
5866 i. e., linuxdoc and docbook.
5869 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5870 nice (is the generated linuxdoc code to be exported?), that
5871 allows to remove column, and only_body that will be true for
5872 slave documents. Insets are allowed inside SGML font type.
5873 New handling of the SGML preamble for included files.
5874 (makeDocBookFile): the same for docbook.
5876 * src/insets/insetinclude.h:
5877 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5879 (DocBook): new export methods.
5881 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5882 and makeDocBookFile.
5884 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5885 formats to export with command line argument -x.
5887 2000-06-29 Juergen Vigna <jug@sad.it>
5889 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5890 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5892 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5893 region could already been cleared by an inset!
5895 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5897 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5900 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5902 (cursorToggle): remove special handling of lyx focus.
5904 2000-06-28 Juergen Vigna <jug@sad.it>
5906 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5909 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5911 * src/insets/insetindex.C (Edit): add a callback when popup is
5914 * src/insets/insettext.C (LocalDispatch):
5915 * src/insets/insetmarginal.h:
5916 * src/insets/insetlist.h:
5917 * src/insets/insetfoot.h:
5918 * src/insets/insetfloat.h:
5919 * src/insets/insetert.h: add a missing std:: qualifier.
5921 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5923 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5926 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5928 * src/insets/insettext.C (Read): remove tmptok unused variable
5929 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5930 (InsertInset): change for new InsetInset code
5932 * src/insets/insettext.h: add TEXT inline method
5934 * src/insets/insettext.C: remove TEXT macro
5936 * src/insets/insetmarginal.C (Write): new method
5937 (Latex): change output slightly
5939 * src/insets/insetfoot.C (Write): new method
5940 (Latex): change output slightly (don't use endl when no need)
5942 * src/insets/insetert.C (Write): new method
5944 * src/insets/insetcollapsable.h: make button_length, button_top_y
5945 and button_bottm_y protected.
5947 * src/insets/insetcollapsable.C (Write): simplify code by using
5948 tostr. Also do not output the float name, the children class
5949 should to that to get control over own arguments
5951 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5952 src/insets/insetminipage.[Ch]:
5955 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5957 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5959 * src/Makefile.am (lyx_SOURCES): add the new files
5961 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5962 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5963 * src/commandtags.h: ditto
5965 * src/LaTeXFeatures.h: add a std::set of used floattypes
5967 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5969 * src/FloatList.[Ch] src/Floating.h: new files
5971 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5973 * src/lyx_cb.C (TableApplyCB): ditto
5975 * src/text2.C: ditto
5976 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5977 (parseSingleLyXformat2Token): ditto + add code for
5978 backwards compability for old float styles + add code for new insets
5980 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5982 (InsertInset(size_type, Inset *, LyXFont)): new method
5983 (InsetChar(size_type, char)): changed to use the other InsetChar
5984 with a LyXFont(ALL_INHERIT).
5985 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5986 insert the META_INSET.
5988 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5990 * sigc++/thread.h (Threads): from here
5992 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5993 definition out of line
5994 * sigc++/scope.h: from here
5996 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5998 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5999 is specified (adapted from a patch from edscott <edscott@imp.mx>).
6001 * Makefile.am (bindist): new target.
6003 * INSTALL: add instructions for doing a binary distribution.
6005 * development/tools/README.bin.example: update a bit.
6007 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
6010 * lib/lyxrc.example: new lyxrc tag \set_color.
6012 * src/lyxfunc.C (Dispatch):
6013 * src/commandtags.h:
6014 * src/LyXAction.C: new lyxfunc "set-color".
6016 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
6017 and an x11name given as strings.
6019 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
6020 cache when a color is changed.
6022 2000-06-26 Juergen Vigna <jug@sad.it>
6024 * src/lyxrow.C (width): added this functions and variable.
6026 * src/insets/insetcite.C (create_form_citation_form): some Gravity
6029 * src/text.C (SetHeightOfRow): fixed calcualting of width.
6031 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6033 * images/undo_bw.xpm: new icon.
6034 * images/redo_bw.xpm: ditto.
6036 * configure.in (INSTALL_SCRIPT): change value to
6037 ${INSTALL} to avoid failures of install-script target.
6038 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
6040 * src/BufferView.h: add a magic "friend" declaration to please
6043 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6045 * forms/cite.fd: modified to allow resizing without messing
6048 * src/insetcite.C: Uses code from cite.fd almost without
6050 User can now resize dialog in the x-direction.
6051 Resizing the dialog in the y-direction is prevented, as the
6052 code does this intelligently already.
6054 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6056 * INSTALL: remove obsolete entry in "problems" section.
6058 * lib/examples/sl_*.lyx: update of the slovenian examples.
6060 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6062 2000-06-23 Juergen Vigna <jug@sad.it>
6064 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6066 * src/buffer.C (resize): delete the LyXText of textinsets.
6068 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6070 * src/insets/lyxinset.h: added another parameter 'cleared' to
6071 the draw() function.
6073 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6074 unlocking inset in inset.
6076 2000-06-22 Juergen Vigna <jug@sad.it>
6078 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6079 of insets and moved first to LyXText.
6081 * src/mathed/formulamacro.[Ch]:
6082 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6084 2000-06-21 Juergen Vigna <jug@sad.it>
6086 * src/text.C (GetVisibleRow): look if I should clear the area or not
6087 using Inset::doClearArea() function.
6089 * src/insets/lyxinset.h: added doClearArea() function and
6090 modified draw(Painter &, ...) to draw(BufferView *, ...)
6092 * src/text2.C (UpdateInset): return bool insted of int
6094 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6096 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6097 combox in the character popup
6099 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6100 BufferParams const & params
6102 2000-06-20 Juergen Vigna <jug@sad.it>
6104 * src/insets/insettext.C (SetParagraphData): set insetowner on
6107 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6109 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6110 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6112 (form_main_): remove
6114 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6115 (create_form_form_main): remove FD_form_main stuff, connect to
6116 autosave_timeout signal
6118 * src/LyXView.[Ch] (getMainForm): remove
6119 (UpdateTimerCB): remove
6120 * src/BufferView_pimpl.h: inherit from SigC::Object
6122 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6123 signal instead of callback
6125 * src/BufferView.[Ch] (cursorToggleCB): remove
6127 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6129 * src/BufferView_pimpl.C: changes because of the one below
6131 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6132 instead of storing a pointer to a LyXText.
6134 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6136 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6138 * src/lyxparagraph.h
6140 * src/paragraph.C: Changed fontlist to a sorted vector.
6142 2000-06-19 Juergen Vigna <jug@sad.it>
6144 * src/BufferView.h: added screen() function.
6146 * src/insets/insettext.C (LocalDispatch): some selection code
6149 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6151 * src/insets/insettext.C (SetParagraphData):
6153 (InsetText): fixes for multiple paragraphs.
6155 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6157 * development/lyx.spec.in: Call configure with ``--without-warnings''
6158 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6159 This should be fine, however, since we generally don't want to be
6160 verbose when making an RPM.
6162 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6164 * lib/scripts/fig2pstex.py: New file
6166 2000-06-16 Juergen Vigna <jug@sad.it>
6168 * src/insets/insettabular.C (UpdateLocal):
6169 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6170 (LocalDispatch): Changed all functions to use LyXText.
6172 2000-06-15 Juergen Vigna <jug@sad.it>
6174 * src/text.C (SetHeightOfRow): call inset::update before requesting
6177 * src/insets/insettext.C (update):
6178 * src/insets/insettabular.C (update): added implementation
6180 * src/insets/lyxinset.h: added update function
6182 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6184 * src/text.C (SelectNextWord): protect against null pointers with
6185 old-style string streams. (fix from Paul Theo Gonciari
6188 * src/cite.[Ch]: remove erroneous files.
6190 * lib/configure.m4: update the list of created directories.
6192 * src/lyxrow.C: include <config.h>
6193 * src/lyxcursor.C: ditto.
6195 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6197 * lib/examples/decimal.lyx: new example file from Mike.
6199 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6200 to find template definitions (from Dekel)
6202 * src/frontends/.cvsignore: add a few things.
6204 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6206 * src/Timeout.C (TimeOut): remove default argument.
6208 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6211 * src/insets/ExternalTemplate.C: add a "using" directive.
6213 * src/lyx_main.h: remove the act_ struct, which seems unused
6216 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6218 * LyX Developers Meeting: All files changed, due to random C++ (by
6219 coincidence) code generator script.
6221 - external inset (cool!)
6222 - initial online editing of preferences
6223 - insettabular breaks insettext(s contents)
6225 - some DocBook fixes
6226 - example files update
6227 - other cool stuff, create a diff and look for yourself.
6229 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6231 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6232 -1 this is a non-line-breaking textinset.
6234 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6235 if there is no width set.
6237 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6239 * Lots of files: Merged the dialogbase branch.
6241 2000-06-09 Allan Rae <rae@lyx.org>
6243 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6244 and the Dispatch methods that used it.
6246 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6247 access to functions formerly kept in Dispatch.
6249 2000-05-19 Allan Rae <rae@lyx.org>
6251 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6252 made to_page and count_copies integers again. from_page remains a
6253 string however because I want to allow entry of a print range like
6254 "1,4,22-25" using this field.
6256 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6257 and printer-params-get. These aren't useful from the minibuffer but
6258 could be used by a script/LyXServer app provided it passes a suitable
6259 auto_mem_buffer. I guess I should take a look at how the LyXServer
6260 works and make it support xtl buffers.
6262 * sigc++/: updated to libsigc++-1.0.1
6264 * src/xtl/: updated to xtl-1.3.pl.11
6266 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6267 those changes done to the files in src/ are actually recreated when
6268 they get regenerated. Please don't ever accept a patch that changes a
6269 dialog unless that patch includes the changes to the corresponding *.fd
6272 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6273 stringOnlyContains, renamed it and generalised it.
6275 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6276 branch. Removed the remaining old form_print code.
6278 2000-04-26 Allan Rae <rae@lyx.org>
6280 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6281 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6283 2000-04-25 Allan Rae <rae@lyx.org>
6285 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6286 against a base of xtl-1.3.pl.4
6288 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6289 filter the Id: entries so they still show the xtl version number
6292 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6293 into the src/xtl code. Patch still pending with José (XTL)
6295 2000-04-24 Allan Rae <rae@lyx.org>
6297 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6298 both more generic and much safer. Use the new template functions.
6299 * src/buffer.[Ch] (Dispatch): ditto.
6301 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6302 and mem buffer more intelligently. Also a little general cleanup.
6305 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6306 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6307 * src/xtl/Makefile.am: ditto.
6308 * src/xtl/.cvsignore: ditto.
6309 * src/Makefile.am: ditto.
6311 * src/PrinterParams.h: Removed the macros member functions. Added a
6312 testInvariant member function. A bit of tidying up and commenting.
6313 Included Angus's idea for fixing operation with egcs-1.1.2.
6315 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6316 cool expansion of XTL's mem_buffer to support automatic memory
6317 management within the buffer itself. Removed the various macros and
6318 replaced them with template functions that use either auto_mem_buffer
6319 or mem_buffer depending on a #define. The mem_buffer support will
6320 disappear as soon as the auto_mem_buffer is confirmed to be good on
6321 other platforms/compilers. That is, it's there so you've got something
6324 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6325 effectively forked XTL. However I expect José will include my code
6326 into the next major release. Also fixed a memory leak.
6327 * src/xtl/text.h: ditto.
6328 * src/xtl/xdr.h: ditto.
6329 * src/xtl/giop.h: ditto.
6331 2000-04-16 Allan Rae <rae@lyx.org>
6333 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6334 by autogen.sh and removed by maintainer-clean anyway.
6335 * .cvsignore, sigc++/.cvsignore: Support the above.
6337 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6339 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6341 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6342 macros, renamed static callback-target member functions to suit new
6343 scheme and made them public.
6344 * src/frontends/xforms/forms/form_print.fd: ditto.
6345 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6347 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6350 * src/xtl/: New directory containing a minimal distribution of XTL.
6351 This is XTL-1.3.pl.4.
6353 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6355 2000-04-15 Allan Rae <rae@lyx.org>
6357 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6359 * sigc++/: Updated to libsigc++-1.0.0
6361 2000-04-14 Allan Rae <rae@lyx.org>
6363 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6364 use the generic ones in future. I'll modify my conversion script.
6366 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6368 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6369 (CloseAllBufferRelatedDialogs): Renamed.
6370 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6372 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6373 of the generic ones. These are the same ones my conversion script
6376 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6377 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6378 * src/buffer.C (Dispatch): ditto
6380 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6381 functions for updating and hiding buffer dependent dialogs.
6382 * src/BufferView.C (buffer): ditto
6383 * src/buffer.C (setReadonly): ditto
6384 * src/lyxfunc.C (CloseBuffer): ditto
6386 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6387 Dialogs.h, and hence all the SigC stuff, into every file that includes
6388 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6390 * src/BufferView2.C: reduce the number of headers included by buffer.h
6392 2000-04-11 Allan Rae <rae@lyx.org>
6394 * src/frontends/xforms/xform_macros.h: A small collection of macros
6395 for building C callbacks.
6397 * src/frontends/xforms/Makefile.am: Added above file.
6399 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6400 scheme again. This time it should work for JMarc. If this is
6401 successful I'll revise my conversion script to automate some of this.
6402 The static member functions in the class also have to be public for
6403 this scheme will work. If the scheme works (it's almost identical to
6404 the way BufferView::cursorToggleCB is handled so it should work) then
6405 FormCopyright and FormPrint will be ready for inclusion into the main
6406 trunk immediately after 1.1.5 is released -- provided we're prepared
6407 for complaints about lame compilers not handling XTL.
6409 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6411 2000-04-07 Allan Rae <rae@lyx.org>
6413 * config/lyxinclude.m4: A bit more tidying up (Angus)
6415 * src/LString.h: JMarc's <string> header fix
6417 * src/PrinterParams.h: Used string for most data to remove some
6418 ugly code in the Print dialog and avoid even uglier code when
6419 appending the ints to a string for output.
6421 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6422 and moved "default:" back to the end of switch statement. Cleaned
6423 up the printing so it uses the right function calls and so the
6424 "print to file" option actually puts the file in the right directory.
6426 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6428 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6429 and Ok+Apply button control into a separate method: input (Angus).
6430 (input) Cleaned it up and improved it to be very thorough now.
6431 (All CB) static_cast used instead of C style cast (Angus). This will
6432 probably change again once we've worked out how to keep gcc-2.8.1 happy
6433 with real C callbacks.
6434 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6435 ignore some of the bool settings and has random numbers instead. Needs
6436 some more investigation. Added other input length checks and checking
6437 of file and printer names.
6439 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6440 would link (Angus). Seems the old code doesn't compile with the pragma
6441 statement either. Separated callback entries from internal methods.
6443 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6445 2000-03-17 Allan Rae <rae@lyx.org>
6447 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6448 need it? Maybe it could go in Dialogs instead? I could make it a
6449 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6450 values to get the bool return value.
6451 (Dispatch): New overloaded method for xtl support.
6453 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6454 extern "C" callback instead of static member functions. Hopefully,
6455 JMarc will be able to compile this. I haven't changed
6456 forms/form_copyright.fd yet. Breaking one of my own rules already.
6458 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6459 because they aren't useful from the minibuffer. Maybe a LyXServer
6460 might want a help message though?
6462 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6464 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6465 xtl which needs both rtti and exceptions.
6467 * src/support/Makefile.am:
6468 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6470 * src/frontends/xforms/input_validators.[ch]: input filters and
6471 validators. These conrol what keys are valid in input boxes.
6472 Use them and write some more. Much better idea than waiting till
6473 after the user has pressed Ok to say that the input fields don't make
6476 * src/frontends/xforms/Makefile.am:
6477 * src/frontends/xforms/forms/form_print.fd:
6478 * src/frontends/xforms/forms/makefile:
6479 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6480 new scheme. Still have to make sure I haven't missed anything from
6481 the current implementation.
6483 * src/Makefile.am, src/PrinterParams.h: New data store.
6485 * other files: Added a couple of copyright notices.
6487 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6489 * src/insets/insetbib.h: move Holder struct in public space.
6491 * src/frontends/include/DialogBase.h: use SigC:: only when
6492 SIGC_CXX_NAMESPACES is defined.
6493 * src/frontends/include/Dialogs.h: ditto.
6495 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6497 * src/frontends/xforms/FormCopyright.[Ch]: do not
6498 mention SigC:: explicitely.
6500 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6502 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6503 deals with testing KDE in main configure.in
6504 * configure.in: ditto.
6506 2000-02-22 Allan Rae <rae@lyx.org>
6508 * Lots of files: Merged from HEAD
6510 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6511 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6513 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6515 * sigc++/: new minidist.
6517 2000-02-14 Allan Rae <rae@lyx.org>
6519 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6521 2000-02-08 Juergen Vigna <jug@sad.it>
6523 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6524 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6526 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6527 for this port and so it is much easier for other people to port
6528 dialogs in a common development environment.
6530 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6531 the QT/KDE implementation.
6533 * src/frontends/kde/Dialogs.C:
6534 * src/frontends/kde/FormCopyright.C:
6535 * src/frontends/kde/FormCopyright.h:
6536 * src/frontends/kde/Makefile.am:
6537 * src/frontends/kde/formcopyrightdialog.C:
6538 * src/frontends/kde/formcopyrightdialog.h:
6539 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6540 for the kde support of the Copyright-Dialog.
6542 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6543 subdir-substitution instead of hardcoded 'xforms' as we now have also
6546 * src/frontends/include/DialogBase.h (Object): just commented the
6547 label after #endif (nasty warning and I don't like warnings ;)
6549 * src/main.C (main): added KApplication initialization if using
6552 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6553 For now only the KDE event-loop is added if frontend==kde.
6555 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6557 * configure.in: added support for the --with-frontend[=value] option
6559 * autogen.sh: added kde.m4 file to list of config-files
6561 * acconfig.h: added define for KDEGUI-support
6563 * config/kde.m4: added configuration functions for KDE-port
6565 * config/lyxinclude.m4: added --with-frontend[=value] option with
6566 support for xforms and KDE.
6568 2000-02-08 Allan Rae <rae@lyx.org>
6570 * all Makefile.am: Fixed up so the make targets dist, distclean,
6571 install and uninstall all work even if builddir != srcdir. Still
6572 have a new sigc++ minidist update to come.
6574 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6576 2000-02-01 Allan Rae <rae@lyx.org>
6578 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6579 Many mods to get builddir != srcdir working.
6581 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6582 for building on NT and so we can do the builddir != srcdir stuff.
6584 2000-01-30 Allan Rae <rae@lyx.org>
6586 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6587 This will stay in "rae" branch. We probably don't really need it in
6588 the main trunk as anyone who wants to help programming it should get
6589 a full library installed also. So they can check both included and
6590 system supplied library compilation.
6592 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6593 Added a 'mini' distribution of libsigc++. If you feel the urge to
6594 change something in these directories - Resist it. If you can't
6595 resist the urge then you should modify the following script and rebuild
6596 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6597 all happen. Still uses a hacked version of libsigc++'s configure.in.
6598 I'm quite happy with the results. I'm not sure the extra work to turn
6599 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6600 worth the trouble and would probably lead to extra maintenance
6602 I haven't tested the following important make targets: install, dist.
6603 Not ready for prime time but very close. Maybe 1.1.5.
6605 * development/tools/makeLyXsigc.sh: A shell script to automatically
6606 generate our mini-dist of libsigc++. It can only be used with a CVS
6607 checkout of libsigc++ not a tarball distribution. It's well commented.
6608 This will end up as part of the libsigc++ distribution so other apps
6609 can easily have an included mini-dist. If someone makes mods to the
6610 sigc++ subpackage without modifying this script to generate those
6611 changes I'll be very upset!
6613 * src/frontends/: Started the gui/system indep structure.
6615 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6616 to access the gui-indep dialogs are in this class. Much improved
6617 design compared to previous revision. Lars, please refrain from
6618 moving this header into src/ like you did with Popups.h last time.
6620 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6622 * src/frontends/xforms/: Started the gui-indep system with a single
6623 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6626 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6627 Here you'll find a very useful makefile and automated fdfix.sh that
6628 makes updating dailogs a no-brainer -- provided you follow the rules
6629 set out in the README. I'm thinking about adding another script to
6630 automatically generate skeleton code for a new dialog given just the
6633 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6634 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6635 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6637 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6639 * src/support/LSubstring.C (operator): simplify
6641 * src/lyxtext.h: removed bparams, use buffer_->params instead
6643 * src/lyxrow.h: make Row a real class, move all variables to
6644 private and use accessors.
6646 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6648 (isRightToLeftPar): ditto
6649 (ChangeLanguage): ditto
6650 (isMultiLingual): ditto
6653 (SimpleTeXOnePar): ditto
6654 (TeXEnvironment): ditto
6655 (GetEndLabel): ditto
6657 (SetOnlyLayout): ditto
6658 (BreakParagraph): ditto
6659 (BreakParagraphConservative): ditto
6660 (GetFontSettings): ditto
6662 (CopyIntoMinibuffer): ditto
6663 (CutIntoMinibuffer): ditto
6664 (PasteParagraph): ditto
6665 (SetPExtraType): ditto
6666 (UnsetPExtraType): ditto
6667 (DocBookContTableRows): ditto
6668 (SimpleDocBookOneTablePar): ditto
6670 (TeXFootnote): ditto
6671 (SimpleTeXOneTablePar): ditto
6672 (TeXContTableRows): ditto
6673 (SimpleTeXSpecialChars): ditto
6676 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6677 to private and use accessors.
6679 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6680 this, we did not use it anymore and has not been for ages. Just a
6681 waste of cpu cycles.
6683 * src/language.h: make Language a real class, move all variables
6684 to private and use accessors.
6686 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6687 (create_view): remove
6688 (update): some changes for new timer
6689 (cursorToggle): use new timer
6690 (beforeChange): change for new timer
6692 * src/BufferView.h (cursorToggleCB): removed last paramter because
6695 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6696 (cursorToggleCB): change because of new timer code
6698 * lib/CREDITS: updated own mailaddress
6700 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6702 * src/support/filetools.C (PutEnv): fix the code in case neither
6703 putenv() nor setenv() have been found.
6705 * INSTALL: mention the install-strip Makefile target.
6707 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6708 read-only documents.
6710 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6712 * lib/reLyX/configure.in (VERSION): avoid using a previously
6713 generated reLyX wrapper to find out $prefix.
6715 * lib/examples/eu_adibide_lyx-atua.lyx:
6716 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6717 translation of the Tutorial (Dooteo)
6719 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6721 * forms/cite.fd: new citation dialog
6723 * src/insetcite.[Ch]: the new citation dialog is moved into
6726 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6729 * src/insets/insetcommand.h: data members made private.
6731 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6733 * LyX 1.1.5 released
6735 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6737 * src/version.h (LYX_RELEASE): to 1.1.5
6739 * src/spellchecker.C (RunSpellChecker): return false if the
6740 spellchecker dies upon creation.
6742 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6744 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6745 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6749 * lib/CREDITS: update entry for Martin Vermeer.
6751 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6753 * src/text.C (draw): Draw foreign language bars at the bottom of
6754 the row instead of at the baseline.
6756 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6758 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6760 * lib/bind/de_menus.bind: updated
6762 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6764 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6766 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6768 * src/menus.C (Limit_string_length): New function
6769 (ShowTocMenu): Limit the number of items/length of items in the
6772 * src/paragraph.C (String): Correct result for a paragraph inside
6775 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6777 * src/bufferlist.C (close): test of buf->getuser() == NULL
6779 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6781 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6782 Do not call to SetCursor when the paragraph is a closed footnote!
6784 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6786 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6789 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6791 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6794 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6795 reference popup, that activates the reference-back action
6797 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6799 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6800 the menus. Also fixed a bug.
6802 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6803 the math panels when switching buffers (unless new buffer is readonly).
6805 * src/BufferView.C (NoSavedPositions)
6806 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6808 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6810 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6811 less of dvi dirty or not.
6813 * src/trans_mgr.[Ch] (insert): change first parameter to string
6816 * src/chset.[Ch] (encodeString): add const to first parameter
6818 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6820 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6824 * src/LaTeX.C (deplog): better searching for dependency files in
6825 the latex log. Uses now regexps.
6827 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6828 instead of the box hack or \hfill.
6830 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6832 * src/lyxfunc.C (doImportHelper): do not create the file before
6833 doing the actual import.
6834 (doImportASCIIasLines): create a new file before doing the insert.
6835 (doImportASCIIasParagraphs): ditto.
6837 * lib/lyxrc.example: remove mention of non-existing commands
6839 * lyx.man: remove mention of color-related switches.
6841 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6843 * src/lyx_gui.C: remove all the color-related ressources, which
6844 are not used anymore.
6846 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6849 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6851 * src/lyxrc.C (read): Add a missing break in the switch
6853 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6855 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6857 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6860 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6862 * src/text.C (draw): draw bars under foreign language words.
6864 * src/LColor.[Ch]: add LColor::language
6866 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6868 * src/lyxcursor.h (boundary): New member variable
6870 * src/text.C (IsBoundary): New methods
6872 * src/text.C: Use the above for currect cursor movement when there
6873 is both RTL & LTR text.
6875 * src/text2.C: ditto
6877 * src/bufferview_funcs.C (ToggleAndShow): ditto
6879 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6881 * src/text.C (DeleteLineForward): set selection to true to avoid
6882 that DeleteEmptyParagraphMechanism does some magic. This is how it
6883 is done in all other functions, and seems reasonable.
6884 (DeleteWordForward): do not jump over non-word stuff, since
6885 CursorRightOneWord() already does it.
6887 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6888 DeleteWordBackward, since they seem safe to me (since selection is
6889 set to "true") DeleteEmptyParagraphMechanism does nothing.
6891 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6893 * src/lyx_main.C (easyParse): simplify the code by factoring the
6894 part that removes parameters from the command line.
6895 (LyX): check wether wrong command line options have been given.
6897 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6899 * src/lyx_main.C : add support for specifying user LyX
6900 directory via command line option -userdir.
6902 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6904 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6905 the number of items per popup.
6906 (Add_to_refs_menu): Ditto.
6908 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6910 * src/lyxparagraph.h: renamed ClearParagraph() to
6911 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6912 textclass as parameter, and do nothing if free_spacing is
6913 true. This fixes part of the line-delete-forward problems.
6915 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6916 (pasteSelection): ditto.
6917 (SwitchLayoutsBetweenClasses): more translatable strings.
6919 * src/text2.C (CutSelection): use StripLeadingSpaces.
6920 (PasteSelection): ditto.
6921 (DeleteEmptyParagraphMechanism): ditto.
6923 2000-05-26 Juergen Vigna <jug@sad.it>
6925 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6926 is not needed in tabular insets.
6928 * src/insets/insettabular.C (TabularFeatures): added missing features.
6930 * src/tabular.C (DeleteColumn):
6932 (AppendRow): implemented this functions
6933 (cellsturct::operator=): clone the inset too;
6935 2000-05-23 Juergen Vigna <jug@sad.it>
6937 * src/insets/insettabular.C (LocalDispatch): better selection support
6938 when having multicolumn-cells.
6940 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6942 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6944 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6946 * src/ColorHandler.C (getGCForeground): put more test into _()
6948 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6951 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6954 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6956 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6957 there are no labels, or when buffer is readonly.
6959 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6960 there are no labels, buffer is SGML, or when buffer is readonly.
6962 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6964 * src/LColor.C (LColor): change a couple of grey40 to grey60
6965 (LColor): rewore initalization to make compiles go some magnitude
6967 (getGUIName): don't use gettext until we need the string.
6969 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6971 * src/Bullet.[Ch]: Fixed a small bug.
6973 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6975 * src/paragraph.C (String): Several fixes/improvements
6977 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6979 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6981 * src/paragraph.C (String): give more correct output.
6983 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6985 * src/lyxfont.C (stateText) Do not output the language if it is
6986 eqaul to the language of the document.
6988 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6989 between two paragraphs with the same language.
6991 * src/paragraph.C (getParLanguage) Return a correct answer for an
6992 empty dummy paragraph.
6994 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6997 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
7000 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
7001 the menus/popup, if requested fonts are unavailable.
7003 2000-05-22 Juergen Vigna <jug@sad.it>
7005 * src/insets/insettabular.C (LocalDispatch): added some more cursor
7006 movement support (Up/Down/Tab/Shift-Tab).
7007 (LocalDispatch): added also preliminari cursor-selection.
7009 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
7011 * src/paragraph.C (PasteParagraph): Hopefully now right!
7013 2000-05-22 Garst R. Reese <reese@isn.net>
7015 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
7016 of list, change all references to Environment to Command
7017 * tex/hollywood.cls : rewrite environments as commands, add
7018 \uppercase to interiorshot and exteriorshot to force uppecase.
7019 * tex/broadway.cls : rewrite environments as commands. Tweak
7022 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7024 * src/menus.C (Add_to_toc_menu): fix the code which limits the
7025 size of items: use a constant intead of the hardcoded 40, and more
7026 importantly do not remove the %m and %x tags added at the end.
7027 (Add_to_refs_menu): use vector::size_type instead of
7028 unsigned int as basic types for the variables. _Please_ do not
7029 assume that size_t is equal to unsigned int. On an alpha, this is
7030 unsigned long, which is _not_ the same.
7032 * src/language.C (initL): remove language "hungarian", since it
7033 seems that "magyar" is better.
7035 2000-05-22 Juergen Vigna <jug@sad.it>
7037 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
7039 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
7042 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
7043 next was deleted but not set to 0.
7045 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7047 * src/language.C (initL): change the initialization of languages
7048 so that compiles goes _fast_.
7050 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7053 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7055 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7059 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7061 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7063 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7067 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7070 * src/insets/insetlo*.[Ch]: Made editable
7072 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7074 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7075 the current selection.
7077 * src/BufferView_pimpl.C (stuffClipboard): new method
7079 * src/BufferView.C (stuffClipboard): new method
7081 * src/paragraph.C (String): new method
7083 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7084 LColor::ignore when lyxname is not found.
7086 * src/BufferView.C (pasteSelection): new method
7088 * src/BufferView_pimpl.C (pasteSelection): new method
7090 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7092 * src/WorkArea.C (request_clipboard_cb): new static function
7093 (getClipboard): new method
7094 (putClipboard): new method
7096 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7098 * LyX 1.1.5pre2 released
7100 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7102 * src/vspace.C (operator=): removed
7103 (operator=): removed
7105 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7107 * src/layout.C (NumberOfClass): manually set the type in make_pair
7108 (NumberOfLayout): ditto
7110 * src/language.C: use the Language constructor for ignore_lang
7112 * src/language.h: add constructors to struct Language
7114 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7116 * src/text2.C (SetCursorIntern): comment out #warning
7118 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7120 * src/mathed/math_iter.h: initialize sx and sw to 0
7122 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7124 * forms/lyx.fd: Redesign of form_ref
7126 * src/LaTeXFeatures.[Ch]
7130 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7133 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7134 and Buffer::inset_iterator.
7136 * src/menus.C: Added new menus: TOC and Refs.
7138 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7140 * src/buffer.C (getTocList): New method.
7142 * src/BufferView2.C (ChangeRefs): New method.
7144 * src/buffer.C (getLabelList): New method. It replaces the old
7145 getReferenceList. The return type is vector<string> instead of
7148 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7149 the old getLabel() and GetNumberOfLabels() methods.
7150 * src/insets/insetlabel.C (getLabelList): ditto
7151 * src/mathed/formula.C (getLabelList): ditto
7153 * src/paragraph.C (String): New method.
7155 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7156 Uses the new getTocList() method.
7157 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7158 which automatically updates the contents of the browser.
7159 (RefUpdateCB): Use the new getLabelList method.
7161 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7163 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7165 * src/spellchecker.C: Added using std::reverse;
7167 2000-05-19 Juergen Vigna <jug@sad.it>
7169 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7171 * src/insets/insettext.C (computeTextRows): small fix for display of
7172 1 character after a newline.
7174 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7177 2000-05-18 Juergen Vigna <jug@sad.it>
7179 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7180 when changing width of column.
7182 * src/tabular.C (set_row_column_number_info): setting of
7183 autobreak rows if necessary.
7185 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7187 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7189 * src/vc-backend.*: renamed stat() to status() and vcstat to
7190 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7191 compilation broke. The new name seems more relevant, anyway.
7193 2000-05-17 Juergen Vigna <jug@sad.it>
7195 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7196 which was wrong if the removing caused removing of rows!
7198 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7199 (pushToken): new function.
7201 * src/text2.C (CutSelection): fix problem discovered with purify
7203 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7205 * src/debug.C (showTags): enlarge the first column, now that we
7206 have 6-digits debug codes.
7208 * lib/layouts/hollywood.layout:
7209 * lib/tex/hollywood.cls:
7210 * lib/tex/brodway.cls:
7211 * lib/layouts/brodway.layout: more commands and fewer
7212 environments. Preambles moved in the .cls files. Broadway now has
7213 more options on scene numbering and less whitespace (from Garst)
7215 * src/insets/insetbib.C (getKeys): make sure that we are in the
7216 document directory, in case the bib file is there.
7218 * src/insets/insetbib.C (Latex): revert bogus change.
7220 2000-05-16 Juergen Vigna <jug@sad.it>
7222 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7223 the TabularLayout on cursor move.
7225 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7227 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7230 (draw): fixed cursor position and drawing so that the cursor is
7231 visible when before the tabular-inset.
7233 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7234 when creating from old insettext.
7236 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7238 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7240 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7241 * lib/tex/brodway.cls: ditto
7243 * lib/layouts/brodway.layout: change alignment of parenthical
7246 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7248 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7249 versions 0.88 and 0.89 are supported.
7251 2000-05-15 Juergen Vigna <jug@sad.it>
7253 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7256 * src/insets/insettext.C (computeTextRows): redone completely this
7257 function in a much cleaner way, because of problems when having a
7259 (draw): added a frame border when the inset is locked.
7260 (SetDrawLockedFrame): this sets if we draw the border or not.
7261 (SetFrameColor): this sets the frame color (default=insetframe).
7263 * src/insets/lyxinset.h: added x() and y() functions which return
7264 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7265 function which is needed to see if we have a locking inset of some
7266 type in this inset (needed for now in insettabular).
7268 * src/vspace.C (inPixels): the same function also without a BufferView
7269 parameter as so it is easier to use it in some ocasions.
7271 * src/lyxfunc.C: changed all places where insertInset was used so
7272 that now if it couldn't be inserted it is deleted!
7274 * src/TabularLayout.C:
7275 * src/TableLayout.C: added support for new tabular-inset!
7277 * src/BufferView2.C (insertInset): this now returns a bool if the
7278 inset was really inserted!!!
7280 * src/tabular.C (GetLastCellInRow):
7281 (GetFirstCellInRow): new helper functions.
7282 (Latex): implemented for new tabular class.
7286 (TeXTopHLine): new Latex() helper functions.
7288 2000-05-12 Juergen Vigna <jug@sad.it>
7290 * src/mathed/formulamacro.C (Read):
7291 * src/mathed/formula.C (Read): read also the \end_inset here!
7293 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7295 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7296 crush when saving formulae with unbalanced parenthesis.
7298 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7300 * src/layout.C: Add new keyword "endlabelstring" to layout file
7302 * src/text.C (GetVisibleRow): Draw endlabel string.
7304 * lib/layouts/broadway.layout
7305 * lib/layouts/hollywood.layout: Added endlabel for the
7306 Parenthetical layout.
7308 * lib/layouts/heb-article.layout: Do not use slanted font shape
7309 for Theorem like environments.
7311 * src/buffer.C (makeLaTeXFile): Always add "american" to
7312 the UsedLanguages list if document language is RTL.
7314 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7316 * add addendum to README.OS2 and small patch (from SMiyata)
7318 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7320 * many files: correct the calls to ChangeExtension().
7322 * src/support/filetools.C (ChangeExtension): remove the no_path
7323 argument, which does not belong there. Use OnlyFileName() instead.
7325 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7326 files when LaTeXing a non-nice latex file.
7328 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7329 a chain of "if". Return false when deadkeys are not handled.
7331 * src/lyx_main.C (LyX): adapted the code for default bindings.
7333 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7334 bindings for basic functionality (except deadkeys).
7335 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7337 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7338 several methods: handle override_x_deadkeys.
7340 * src/lyxrc.h: remove the "bindings" map, which did not make much
7341 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7343 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7345 * src/lyxfont.C (stateText): use a saner method to determine
7346 whether the font is "default". Seems to fix the crash with DEC
7349 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7351 2000-05-08 Juergen Vigna <jug@sad.it>
7353 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7354 TabularLayoutMenu with mouse-button-3
7355 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7357 * src/TabularLayout.C: added this file for having a Layout for
7360 2000-05-05 Juergen Vigna <jug@sad.it>
7362 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7363 recalculating inset-widths.
7364 (TabularFeatures): activated this function so that I can change
7365 tabular-features via menu.
7367 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7368 that I can test some functions with the Table menu.
7370 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7372 * src/lyxfont.C (stateText): guard against stupid c++libs.
7374 * src/tabular.C: add using std::vector
7375 some whitespace changes, + removed som autogenerated code.
7377 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7379 2000-05-05 Juergen Vigna <jug@sad.it>
7381 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7382 row, columns and cellstructures.
7384 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7386 * lib/lyxrc.example: remove obsolete entries.
7388 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7389 reading of protected_separator for free_spacing.
7391 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7393 * src/text.C (draw): do not display an exclamation mark in the
7394 margin for margin notes. This is confusing, ugly and
7397 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7398 AMS math' is checked.
7400 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7401 name to see whether including the amsmath package is needed.
7403 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7405 * src/paragraph.C (validate): Compute UsedLanguages correctly
7406 (don't insert the american language if it doesn't appear in the
7409 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7410 The argument of \thanks{} command is considered moving argument
7412 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7415 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7417 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7418 for appendix/minipage/depth. The lines can be now both in the footnote
7419 frame, and outside the frame.
7421 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7424 2000-05-05 Juergen Vigna <jug@sad.it>
7426 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7427 neede only in tabular.[Ch].
7429 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7431 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7433 (Write): write '~' for PROTECTED_SEPARATOR
7435 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7437 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7440 * src/mathed/formula.C (drawStr): rename size to siz.
7442 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7443 possibly fix a bug by not changing the pflags = flags to piflags =
7446 2000-05-05 Juergen Vigna <jug@sad.it>
7448 * src/insets/insetbib.C: moved using directive
7450 * src/ImportNoweb.C: small fix for being able to compile (missing
7453 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7455 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7456 to use clear, since we don't depend on this in the code. Add test
7459 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7461 * (various *.C files): add using std::foo directives to please dec
7464 * replace calls to string::clear() to string::erase() (Angus)
7466 * src/cheaders/cmath: modified to provide std::abs.
7468 2000-05-04 Juergen Vigna <jug@sad.it>
7470 * src/insets/insettext.C: Prepared all for inserting of multiple
7471 paragraphs. Still display stuff to do (alignment and other things),
7472 but I would like to use LyXText to do this when we cleaned out the
7473 table-support stuff.
7475 * src/insets/insettabular.C: Changed lot of stuff and added lots
7476 of functionality still a lot to do.
7478 * src/tabular.C: Various functions changed name and moved to be
7479 const functions. Added new Read and Write functions and changed
7480 lots of things so it works good with tabular-insets (also removed
7481 some stuff which is not needed anymore * hacks *).
7483 * src/lyxcursor.h: added operators == and != which just look if
7484 par and pos are (not) equal.
7486 * src/buffer.C (latexParagraphs): inserted this function to latex
7487 all paragraphs form par to endpar as then I can use this too for
7490 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7491 so that I can call this to from text insets with their own cursor.
7493 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7494 output off all paragraphs (because of the fix below)!
7496 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7497 the very last paragraph (this could be also the last paragraph of an
7500 * src/texrow.h: added rows() call which returns the count-variable.
7502 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7504 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7506 * lib/configure.m4: better autodetection of DocBook tools.
7508 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7510 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7512 * src/lyx_cb.C: add using std::reverse;
7514 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7517 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7518 selected files. Should fix repeated errors from generated files.
7520 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7522 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7524 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7525 the spellchecker popup.
7527 * lib/lyxrc.example: Removed the \number_inset section
7529 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7531 * src/insets/figinset.C (various): Use IsFileReadable() to make
7532 sure that the file actually exist. Relying on ghostscripts errors
7533 is a bad idea since they can lead to X server crashes.
7535 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7537 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7540 * lib/lyxrc.example: smallish typo in description of
7541 \view_dvi_paper_option
7543 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7546 * src/lyxfunc.C: doImportHelper to factor out common code of the
7547 various import methods. New functions doImportASCIIasLines,
7548 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7549 doImportLinuxDoc for the format specific parts.
7552 * buffer.C: Dispatch returns now a bool to indicate success
7555 * lyx_gui.C: Add getLyXView() for member access
7557 * lyx_main.C: Change logic for batch commands: First try
7558 Buffer::Dispatch (possibly without GUI), if that fails, use
7561 * lyx_main.C: Add support for --import command line switch.
7562 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7563 Available Formats: Everything accepted by 'buffer-import <format>'
7565 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7567 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7570 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7571 documents will be reformatted upon reentry.
7573 2000-04-27 Juergen Vigna <jug@sad.it>
7575 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7576 correctly only last pos this was a bug.
7578 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7580 * release of lyx-1.1.5pre1
7582 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7584 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7586 * src/menus.C: revert the change of naming (Figure->Graphic...)
7587 from 2000-04-11. It was incomplete and bad.
7589 * src/LColor.[Ch]: add LColor::depthbar.
7590 * src/text.C (GetVisibleRow): use it.
7592 * README: update the languages list.
7594 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7596 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7599 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7601 * README: remove sections that were just wrong.
7603 * src/text2.C (GetRowNearY): remove currentrow code
7605 * src/text.C (GetRow): remove currentrow code
7607 * src/screen.C (Update): rewritten a bit.
7608 (SmallUpdate): removed func
7610 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7612 (FullRebreak): return bool
7613 (currentrow): remove var
7614 (currentrow_y): ditto
7616 * src/lyxscreen.h (Draw): change arg to unsigned long
7617 (FitCursor): return bool
7618 (FitManualCursor): ditto
7619 (Smallpdate): remove func
7620 (first): change to unsigned long
7621 (DrawOneRow): change second arg to long (from long &)
7622 (screen_refresh_y): remove var
7623 (scree_refresh_row): ditto
7625 * src/lyxrow.h: change baseline to usigned int from unsigned
7626 short, this brings some implicit/unsigned issues out in the open.
7628 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7630 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7631 instead of smallUpdate.
7633 * src/lyxcursor.h: change y to unsigned long
7635 * src/buffer.h: don't call updateScrollbar after fitcursor
7637 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7638 where they are used. Removed "\\direction", this was not present
7639 in 1.1.4 and is already obsolete. Commented out some code that I
7640 believe to never be called.
7641 (runLiterate): don't call updateScrollbar after fitCursor
7643 (buildProgram): ditto
7646 * src/WorkArea.h (workWidth): change return val to unsigned
7649 (redraw): remove the button redraws
7650 (setScrollbarValue): change for scrollbar
7651 (getScrollbarValue): change for scrollbar
7652 (getScrollbarBounds): change for scrollbar
7654 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7655 (C_WorkArea_down_cb): removed func
7656 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7657 (resize): change for scrollbar
7658 (setScrollbar): ditto
7659 (setScrollbarBounds): ditto
7660 (setScrollbarIncrements): ditto
7661 (up_cb): removed func
7662 (down_cb): removed func
7663 (scroll_cb): change for scrollbar
7664 (work_area_handler): ditto
7666 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7667 when FitCursor did something.
7668 (updateScrollbar): some unsigned changes
7669 (downCB): removed func
7670 (scrollUpOnePage): removed func
7671 (scrollDownOnePage): remvoed func
7672 (workAreaMotionNotify): don't call screen->FitCursor but use
7673 fitCursor instead. and bool return val
7674 (workAreaButtonPress): ditto
7675 (workAreaButtonRelease): some unsigned changes
7676 (checkInsetHit): ditto
7677 (workAreaExpose): ditto
7678 (update): parts rewritten, comments about the signed char arg added
7679 (smallUpdate): removed func
7680 (cursorPrevious): call needed updateScrollbar
7683 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7686 * src/BufferView.[Ch] (upCB): removed func
7687 (downCB): removed func
7688 (smallUpdate): removed func
7690 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7692 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7693 currentrow, currentrow_y optimization. This did not help a lot and
7694 if we want to do this kind of optimization we should rather use
7695 cursor.row instead of the currentrow.
7697 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7698 buffer spacing and klyx spacing support.
7700 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7702 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7705 2000-04-26 Juergen Vigna <jug@sad.it>
7707 * src/insets/figinset.C: fixes to Lars sstream changes!
7709 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7711 * A lot of files: Added Ascii(ostream &) methods to all inset
7712 classes. Used when exporting to ASCII.
7714 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7715 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7718 * src/text2.C (ToggleFree): Disabled implicit word selection when
7719 there is a change in the language
7721 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7722 no output was generated for end-of-sentence inset.
7724 * src/insets/lyxinset.h
7727 * src/paragraph.C: Removed the insetnumber code
7729 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7731 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7733 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7734 no_babel and no_epsfig completely from the file.
7735 (parseSingleLyXformat2Token): add handling for per-paragraph
7736 spacing as written by klyx.
7738 * src/insets/figinset.C: applied patch by Andre. Made it work with
7741 2000-04-20 Juergen Vigna <jug@sad.it>
7743 * src/insets/insettext.C (cutSelection):
7744 (copySelection): Fixed with selection from right to left.
7745 (draw): now the rows are not recalculated at every draw.
7746 (computeTextRows): for now reset the inset-owner here (this is
7747 important for an undo or copy where the inset-owner is not set
7750 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7751 motion to the_locking_inset screen->first was forgotten, this was
7752 not important till we got multiline insets.
7754 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7756 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7757 code seems to be alright (it is code changed by Dekel, and the
7758 intent is indeed that all macros should be defined \protect'ed)
7760 * NEWS: a bit of reorganisation of the new user-visible features.
7762 2000-04-19 Juergen Vigna <jug@sad.it>
7764 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7765 position. Set the inset_owner of the used paragraph so that it knows
7766 that it is inside an inset. Fixed cursor handling with mouse and
7767 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7768 and cleanups to make TextInsets work better.
7770 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7771 Changed parameters of various functions and added LockInsetInInset().
7773 * src/insets/insettext.C:
7775 * src/insets/insetcollapsable.h:
7776 * src/insets/insetcollapsable.C:
7777 * src/insets/insetfoot.h:
7778 * src/insets/insetfoot.C:
7779 * src/insets/insetert.h:
7780 * src/insets/insetert.C: cleaned up the code so that it works now
7781 correctly with insettext.
7783 * src/insets/inset.C:
7784 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7785 that insets in insets are supported right.
7788 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7790 * src/paragraph.C: some small fixes
7792 * src/debug.h: inserted INSETS debug info
7794 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7795 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7797 * src/commandtags.h:
7798 * src/LyXAction.C: insert code for InsetTabular.
7800 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7801 not Button1MotionMask.
7802 (workAreaButtonRelease): send always a InsetButtonRelease event to
7804 (checkInsetHit): some setCursor fixes (always with insets).
7806 * src/BufferView2.C (lockInset): returns a bool now and extended for
7807 locking insets inside insets.
7808 (showLockedInsetCursor): it is important to have the cursor always
7809 before the locked inset.
7810 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7812 * src/BufferView.h: made lockInset return a bool.
7814 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7816 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7817 that is used also internally but can be called as public to have back
7818 a cursor pos which is not set internally.
7819 (SetCursorIntern): Changed to use above function.
7821 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7823 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7828 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7829 patches for things that should be in or should be changed.
7831 * src/* [insetfiles]: change "usigned char fragile" to bool
7832 fragile. There was only one point that could that be questioned
7833 and that is commented in formulamacro.C. Grep for "CHECK".
7835 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7836 (DeleteBuffer): take it out of CutAndPaste and make it static.
7838 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7840 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7841 output the spacing envir commands. Also the new commands used in
7842 the LaTeX output makes the result better.
7844 * src/Spacing.C (writeEnvirBegin): new method
7845 (writeEnvirEnd): new method
7847 2000-04-18 Juergen Vigna <jug@sad.it>
7849 * src/CutAndPaste.C: made textclass a static member of the class
7850 as otherwise it is not accesed right!!!
7852 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7854 * forms/layout_forms.fd
7855 * src/layout_forms.h
7856 * src/layout_forms.C (create_form_form_character)
7857 * src/lyx_cb.C (UserFreeFont)
7858 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7859 documents (in the layout->character popup).
7861 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7863 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7864 \spell_command was in fact not honored (from Kevin Atkinson).
7866 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7869 * src/lyx_gui.h: make lyxViews private (Angus)
7871 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7873 * src/mathed/math_write.C
7874 (MathMatrixInset::Write) Put \protect before \begin{array} and
7875 \end{array} if fragile
7876 (MathParInset::Write): Put \protect before \\ if fragile
7878 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7880 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7881 initialization if the LyXColorHandler must be done after the
7882 connections to the XServer has been established.
7884 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7885 get the background pixel from the lyxColorhandler so that the
7886 figures are rendered with the correct background color.
7887 (NextToken): removed functions.
7888 (GetPSSizes): use ifs >> string instead of NextToken.
7890 * src/Painter.[Ch]: the color cache moved out of this file.
7892 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7895 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7897 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7898 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7900 * src/BufferView.C (enterView): new func
7901 (leaveView): new func
7903 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7905 (leaveView): new func, undefines xterm cursor when approp.
7907 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7908 (AllowInput): delete the Workarea cursor handling from this func.
7910 * src/Painter.C (underline): draw a slimer underline in most cases.
7912 * src/lyx_main.C (error_handler): use extern "C"
7914 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7916 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7917 sent directly to me.
7919 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7920 to the list by Dekel.
7922 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7925 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7926 methods from lyx_cb.here.
7928 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7931 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7933 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7934 instead of using current_view directly.
7936 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7938 * src/LyXAction.C (init): add the paragraph-spacing command.
7940 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7942 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7944 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7945 different from the documents.
7947 * src/text.C (SetHeightOfRow): take paragraph spacing into
7948 account, paragraph spacing takes precedence over buffer spacing
7949 (GetVisibleRow): ditto
7951 * src/paragraph.C (writeFile): output the spacing parameter too.
7952 (validate): set the correct features if spacing is used in the
7954 (Clear): set spacing to default
7955 (MakeSameLayout): spacing too
7956 (HasSameLayout): spacing too
7957 (SetLayout): spacing too
7958 (TeXOnePar): output the spacing commands
7960 * src/lyxparagraph.h: added a spacing variable for use with
7961 per-paragraph spacing.
7963 * src/Spacing.h: add a Default spacing and a method to check if
7964 the current spacing is default. also added an operator==
7966 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7969 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7971 * src/lyxserver.C (callback): fix dispatch of functions
7973 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7974 printf() into lyxerr call.
7976 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7979 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7980 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7981 the "Float" from each of the subitems.
7982 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7984 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7985 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7986 documented the change so that the workaround can be nuked later.
7988 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7991 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7993 * src/buffer.C (getLatexName): ditto
7994 (setReadonly): ditto
7996 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7998 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7999 avoid some uses of current_view. Added also a bufferParams()
8000 method to get at this.
8002 * src/lyxtext.h: changed params->buffer and paramters->bparams.
8004 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8006 * src/lyxparagraph.[Ch]: removed
8007 operator<(LyXParagraph::InsetTable..., added a struct matchIT
8008 with operators used by lower_bound and
8009 upper_bound in InsetTable's
8010 Make struct InsetTable private again. Used matchpos.
8012 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
8014 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
8015 document, the language of existing text is changed (unless the
8016 document is multi-lingual)
8018 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
8020 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
8022 * A lot of files: A rewrite of the Right-to-Left support.
8024 2000-04-10 Juergen Vigna <jug@sad.it>
8026 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
8027 misplaced cursor when inset in inset is locked.
8029 * src/insets/insettext.C (LocalDispatch): small fix so that a
8030 BREAKLINE is not inserted if we don't permit it with autBreakRows.
8032 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
8033 footnote font should be decreased in size twice when displaying.
8035 * src/insets/insettext.C (GetDrawFont): inserted this function as
8036 the drawing-font may differ from the real paragraph font.
8038 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
8039 insets (inset in inset!).
8041 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
8042 function here because we don't want footnotes inside footnotes.
8044 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8046 (init): now set the inset_owner in paragraph.C
8047 (LocalDispatch): added some resetPos() in the right position
8050 (pasteSelection): changed to use the new CutAndPaste-Class.
8052 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8053 which tells if it is allowed to insert another inset inside this one.
8055 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8056 SwitchLayoutsBetweenClasses.
8058 * src/text2.C (InsertInset): checking of the new paragraph-function
8060 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8061 is not needed anymore here!
8064 (PasteSelection): redone (also with #ifdef) so that now this uses
8065 the CutAndPaste-Class.
8066 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8069 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8070 from/to text/insets.
8072 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8073 so that the paragraph knows if it is inside an (text)-inset.
8074 (InsertFromMinibuffer): changed return-value to bool as now it
8075 may happen that an inset is not inserted in the paragraph.
8076 (InsertInsetAllowed): this checks if it is allowed to insert an
8077 inset in this paragraph.
8079 (BreakParagraphConservative):
8080 (BreakParagraph) : small change for the above change of the return
8081 value of InsertFromMinibuffer.
8083 * src/lyxparagraph.h: added inset_owner and the functions to handle
8084 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8086 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8088 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8089 functions from BufferView to BufferView::Pimpl to ease maintence.
8091 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8092 correctly. Also use SetCursorIntern instead of SetCursor.
8094 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8097 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8099 * src/WorkArea.C (belowMouse): manually implement below mouse.
8101 * src/*: Add "explicit" on several constructors, I added probably
8102 some unneeded ones. A couple of changes to code because of this.
8104 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8105 implementation and private parts from the users of BufferView. Not
8108 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8109 implementation and private parts from the users of LyXLex. Not
8112 * src/BufferView_pimpl.[Ch]: new files
8114 * src/lyxlex_pimpl.[Ch]: new files
8116 * src/LyXView.[Ch]: some inline functions move out-of-line
8118 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8120 * src/lyxparagraph.h: make struct InsetTable public.
8122 * src/support/lyxstring.h: change lyxstring::difference_type to be
8123 ptrdiff_t. Add std:: modifiers to streams.
8125 * src/font.C: include the <cctype> header, for islower() and
8128 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8130 * src/font.[Ch]: new files. Contains the metric functions for
8131 fonts, takes a LyXFont as parameter. Better separation of concepts.
8133 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8134 changes because of this.
8136 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8138 * src/*: compile with -Winline and move functions that don't
8141 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8144 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8146 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8147 (various files changed because of this)
8149 * src/Painter.C (text): fixed the drawing of smallcaps.
8151 * src/lyxfont.[Ch] (drawText): removed unused member func.
8154 * src/*.C: added needed "using" statements and "std::" qualifiers.
8156 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8158 * src/*.h: removed all use of "using" from header files use
8159 qualifier std:: instead.
8161 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8163 * src/text.C (Backspace): some additional cleanups (we already
8164 know whether cursor.pos is 0 or not).
8166 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8167 automake does not provide one).
8169 * src/bmtable.h: replace C++ comments with C comments.
8171 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8173 * src/screen.C (ShowCursor): Change the shape of the cursor if
8174 the current language is not equal to the language of the document.
8175 (If the cursor change its shape unexpectedly, then you've found a bug)
8177 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8180 * src/insets/insetnumber.[Ch]: New files.
8182 * src/LyXAction.C (init)
8183 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8186 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8188 * src/lyxparagraph.h
8189 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8190 (the vector is kept sorted).
8192 * src/text.C (GetVisibleRow): Draw selection correctly when there
8193 is both LTR and RTL text.
8195 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8196 which is much faster.
8198 * src/text.C (GetVisibleRow and other): Do not draw the last space
8199 in a row if the direction of the last letter is not equal to the
8200 direction of the paragraph.
8202 * src/lyxfont.C (latexWriteStartChanges):
8203 Check that font language is not equal to basefont language.
8204 (latexWriteEndChanges): ditto
8206 * src/lyx_cb.C (StyleReset): Don't change the language while using
8207 the font-default command.
8209 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8210 empty paragraph before a footnote.
8212 * src/insets/insetcommand.C (draw): Increase x correctly.
8214 * src/screen.C (ShowCursor): Change cursor shape if
8215 current language != document language.
8217 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8219 2000-03-31 Juergen Vigna <jug@sad.it>
8221 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8222 (Clone): changed mode how the paragraph-data is copied to the
8223 new clone-paragraph.
8225 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8226 GetInset(pos) with no inset anymore there (in inset UNDO)
8228 * src/insets/insetcommand.C (draw): small fix as here x is
8229 incremented not as much as width() returns (2 before, 2 behind = 4)
8231 2000-03-30 Juergen Vigna <jug@sad.it>
8233 * src/insets/insettext.C (InsetText): small fix in initialize
8234 widthOffset (should not be done in the init() function)
8236 2000-03-29 Amir Karger <karger@lyx.org>
8238 * lib/examples/it_ItemizeBullets.lyx: translation by
8241 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8243 2000-03-29 Juergen Vigna <jug@sad.it>
8245 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8247 * src/insets/insetfoot.C (Clone): small change as for the below
8248 new init function in the text-inset
8250 * src/insets/insettext.C (init): new function as I've seen that
8251 clone did not copy the Paragraph-Data!
8252 (LocalDispatch): Added code so that now we have some sort of Undo
8253 functionality (well actually we HAVE Undo ;)
8255 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8257 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8259 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8262 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8264 * src/main.C: added a runtime check that verifies that the xforms
8265 header used when building LyX and the library used when running
8266 LyX match. Exit with a message if they don't match. This is a
8267 version number check only.
8269 * src/buffer.C (save): Don't allocate memory on the heap for
8270 struct utimbuf times.
8272 * *: some using changes, use iosfwd instead of the real headers.
8274 * src/lyxfont.C use char const * instead of string for the static
8275 strings. Rewrite some functions to use sstream.
8277 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8279 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8282 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8284 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8285 of Geodesy (from Martin Vermeer)
8287 * lib/layouts/svjour.inc: include file for the Springer svjour
8288 class. It can be used to support journals other than JoG.
8290 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8291 Miskiewicz <misiek@pld.org.pl>)
8292 * lib/reLyX/Makefile.am: ditto.
8294 2000-03-27 Juergen Vigna <jug@sad.it>
8296 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8297 also some modifications with operations on selected text.
8299 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8300 problems with clicking on insets (last famous words ;)
8302 * src/insets/insetcommand.C (draw):
8303 (width): Changed to have a bit of space before and after the inset so
8304 that the blinking cursor can be seen (otherwise it was hidden)
8306 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8308 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8309 would not be added to the link list when an installed gettext (not
8310 part of libc) is found.
8312 2000-03-24 Juergen Vigna <jug@sad.it>
8314 * src/insets/insetcollapsable.C (Edit):
8315 * src/mathed/formula.C (InsetButtonRelease):
8316 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8319 * src/BufferView.C (workAreaButtonPress):
8320 (workAreaButtonRelease):
8321 (checkInsetHit): Finally fixed the clicking on insets be handled
8324 * src/insets/insetert.C (Edit): inserted this call so that ERT
8325 insets work always with LaTeX-font
8327 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8329 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8330 caused lyx to startup with no GUI in place, causing in a crash
8331 upon startup when called with arguments.
8333 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8335 * src/FontLoader.C: better initialization of dummyXFontStruct.
8337 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8339 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8340 for linuxdoc and docbook import and export format options.
8342 * lib/lyxrc.example Example of default values for the previous flags.
8344 * src/lyx_cb.C Use those flags instead of the hardwired values for
8345 linuxdoc and docbook export.
8347 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8350 * src/menus.C Added menus entries for the new import/exports formats.
8352 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8354 * src/lyxrc.*: Added support for running without Gui
8357 * src/FontLoader.C: sensible defaults if no fonts are needed
8359 * src/lyx_cb.C: New function ShowMessage (writes either to the
8360 minibuffer or cout in case of no gui
8361 New function AskOverwrite for common stuff
8362 Consequently various changes to call these functions
8364 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8365 wild guess at sensible screen resolution when having no gui
8367 * src/lyxfont.C: no gui, no fonts... set some defaults
8369 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8371 * src/LColor.C: made the command inset background a bit lighter.
8373 2000-03-20 Hartmut Goebel <goebel@noris.net>
8375 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8376 stdstruct.inc. Koma-Script added some title elements which
8377 otherwise have been listed below "bibliography". This split allows
8378 adding title elements to where they belong.
8380 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8381 define the additional title elements and then include
8384 * many other layout files: changed to include stdtitle.inc just
8385 before stdstruct.inc.
8387 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8389 * src/buffer.C: (save) Added the option to store all backup files
8390 in a single directory
8392 * src/lyxrc.[Ch]: Added variable \backupdir_path
8394 * lib/lyxrc.example: Added descriptions of recently added variables
8396 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8397 bibtex inset, not closing the bibtex popup when deleting the inset)
8399 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8401 * src/lyx_cb.C: add a couple using directives.
8403 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8404 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8405 import based on the filename.
8407 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8408 file would be imported at start, if the filename where of a sgml file.
8410 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8412 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8414 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8415 * src/lyxfont.h Replaced the member variable bits.direction by the
8416 member variable lang. Made many changes in other files.
8417 This allows having a multi-lingual document
8419 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8420 that change the current language to <l>.
8421 Removed the command "font-rtl"
8423 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8424 format for Hebrew documents)
8426 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8427 When auto_mathmode is "true", pressing a digit key in normal mode
8428 will cause entering into mathmode.
8429 If auto_mathmode is "rtl" then this behavior will be active only
8430 when writing right-to-left text.
8432 * src/text2.C (InsertStringA) The string is inserted using the
8435 * src/paragraph.C (GetEndLabel) Gives a correct result for
8436 footnote paragraphs.
8438 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8440 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8442 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8443 front of PasteParagraph. Never insert a ' '. This should at least
8444 fix some cause for the segfaults that we have been experiencing,
8445 it also fixes backspace behaviour slightly. (Phu!)
8447 * src/support/lstrings.C (compare_no_case): some change to make it
8448 compile with gcc 2.95.2 and stdlibc++-v3
8450 * src/text2.C (MeltFootnoteEnvironment): change type o
8451 first_footnote_par_is_not_empty to bool.
8453 * src/lyxparagraph.h: make text private. Changes in other files
8455 (fitToSize): new function
8456 (setContentsFromPar): new function
8457 (clearContents): new function
8458 (SetChar): new function
8460 * src/paragraph.C (readSimpleWholeFile): deleted.
8462 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8463 the file, just use a simple string instead. Also read the file in
8464 a more maintainable manner.
8466 * src/text2.C (InsertStringA): deleted.
8467 (InsertStringB): deleted.
8469 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8471 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8472 RedoParagraphs from the doublespace handling part, just set status
8473 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8474 done, but perhaps not like this.)
8476 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8478 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8479 character when inserting an inset.
8481 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8483 * src/bufferparams.C (readLanguage): now takes "default" into
8486 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8487 also initialize the toplevel_keymap with the default bindings from
8490 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8492 * all files using lyxrc: have lyxrc as a real variable and not a
8493 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8496 * src/lyxrc.C: remove double call to defaultKeyBindings
8498 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8499 toolbar defauls using lyxlex. Remove enums, structs, functions
8502 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8503 toolbar defaults. Also store default keybindings in a map.
8505 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8506 storing the toolbar defaults without any xforms dependencies.
8508 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8509 applied. Changed to use iterators.
8511 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8513 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8514 systems that don't have LINGUAS set to begin with.
8516 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8518 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8519 the list by Dekel Tsur.
8521 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8523 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8524 * src/insets/form_graphics.C: ditto.
8526 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8528 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8530 * src/bufferparams.C (readLanguage): use the new language map
8532 * src/intl.C (InitKeyMapper): use the new language map
8534 * src/lyx_gui.C (create_forms): use the new language map
8536 * src/language.[Ch]: New files. Used for holding the information
8537 about each language. Now! Use this new language map enhance it and
8538 make it really usable for our needs.
8540 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8542 * screen.C (ShowCursor): Removed duplicate code.
8543 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8544 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8546 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8549 * src/text.C Added TransformChar method. Used for rendering Arabic
8550 text correctly (change the glyphs of the letter according to the
8551 position in the word)
8556 * src/lyxrc.C Added lyxrc command {language_command_begin,
8557 language_command_end,language_command_ltr,language_command_rtl,
8558 language_package} which allows the use of either arabtex or Omega
8561 * src/lyx_gui.C (init)
8563 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8564 to use encoding for menu fonts which is different than the encoding
8567 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8568 do not load the babel package.
8569 To write an English document with Hebrew/Arabic, change the document
8570 language to "english".
8572 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8573 (alphaCounter): changed to return char
8574 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8576 * lib/lyxrc.example Added examples for Hebrew/Arabic
8579 * src/layout.C Added layout command endlabeltype
8581 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8583 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8585 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8587 * src/mathed/math_delim.C (search_deco): return a
8588 math_deco_struct* instead of index.
8590 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8592 * All files with a USE_OSTREAM_ONLY within: removed all code that
8593 was unused when USE_OSTREAM_ONLY is defined.
8595 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8596 of any less. Removed header and using.
8598 * src/text.C (GetVisibleRow): draw the string "Page Break
8599 (top/bottom)" on screen when drawing a pagebreak line.
8601 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8603 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8605 * src/mathed/math_macro.C (draw): do some cast magic.
8608 * src/mathed/math_defs.h: change byte* argument to byte const*.
8610 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8612 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8613 know it is right to return InsetFoot* too, but cxx does not like
8616 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8618 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8620 * src/mathed/math_delim.C: change == to proper assignment.
8622 2000-03-09 Juergen Vigna <jug@sad.it>
8624 * src/insets/insettext.C (setPos): fixed various cursor positioning
8625 problems (via mouse and cursor-keys)
8626 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8627 inset (still a small display problem but it works ;)
8629 * src/insets/insetcollapsable.C (draw): added button_top_y and
8630 button_bottom_y to have correct values for clicking on the inset.
8632 * src/support/lyxalgo.h: commented out 'using std::less'
8634 2000-03-08 Juergen Vigna <jug@sad.it>
8636 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8637 Button-Release event closes as it is alos the Release-Event
8640 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8642 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8644 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8645 can add multiple spaces in Scrap (literate programming) styles...
8646 which, by the way, is how I got hooked on LyX to begin with.
8648 * src/mathed/formula.C (Write): Added dummy variable to an
8649 inset::Latex() call.
8650 (Latex): Add free_spacing boolean to inset::Latex()
8652 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8654 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8655 virtual function to include the free_spacing boolean from
8656 the containing paragraph's style.
8658 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8659 Added free_spacing boolean arg to match inset.h
8661 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8662 Added free_spacing boolean arg to match inset.h
8664 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8665 Added free_spacing boolean and made sure that if in a free_spacing
8666 paragraph, that we output normal space if there is a protected space.
8668 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8669 Added free_spacing boolean arg to match inset.h
8671 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8672 Added free_spacing boolean arg to match inset.h
8674 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8675 Added free_spacing boolean arg to match inset.h
8677 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8678 Added free_spacing boolean arg to match inset.h
8680 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8681 Added free_spacing boolean arg to match inset.h
8683 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8684 free_spacing boolean arg to match inset.h
8686 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8687 Added free_spacing boolean arg to match inset.h
8689 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8690 Added free_spacing boolean arg to match inset.h
8692 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8693 Added free_spacing boolean arg to match inset.h
8695 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8696 Added free_spacing boolean arg to match inset.h
8698 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8699 Added free_spacing boolean arg to match inset.h
8701 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8702 free_spacing boolean arg to match inset.h
8704 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8705 free_spacing boolean arg to match inset.h
8707 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8708 ignore free_spacing paragraphs. The user's spaces are left
8711 * src/text.C (InsertChar): Fixed the free_spacing layout
8712 attribute behavior. Now, if free_spacing is set, you can
8713 add multiple spaces in a paragraph with impunity (and they
8714 get output verbatim).
8715 (SelectSelectedWord): Added dummy argument to inset::Latex()
8718 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8721 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8722 paragraph layouts now only input a simple space instead.
8723 Special character insets don't make any sense in free-spacing
8726 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8727 hard-spaces in the *input* file to simple spaces if the layout
8728 is free-spacing. This converts old files which had to have
8729 hard-spaces in free-spacing layouts where a simple space was
8731 (writeFileAscii): Added free_spacing check to pass to the newly
8732 reworked inset::Latex(...) methods. The inset::Latex() code
8733 ensures that hard-spaces in free-spacing paragraphs get output
8734 as spaces (rather than "~").
8736 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8738 * src/mathed/math_delim.C (draw): draw the empty placeholder
8739 delims with a onoffdash line.
8740 (struct math_deco_compare): struct that holds the "functors" used
8741 for the sort and the binary search in math_deco_table.
8742 (class init_deco_table): class used for initial sort of the
8744 (search_deco): use lower_bound to do a binary search in the
8747 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8749 * src/lyxrc.C: a small secret thingie...
8751 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8752 and to not flush the stream as often as it used to.
8754 * src/support/lyxalgo.h: new file
8755 (sorted): template function used for checking if a sequence is
8756 sorted or not. Two versions with and without user supplied
8757 compare. Uses same compare as std::sort.
8759 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8760 it and give warning on lyxerr.
8762 (struct compare_tags): struct with function operators used for
8763 checking if sorted, sorting and lower_bound.
8764 (search_kw): use lower_bound instead of manually implemented
8767 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8769 * src/insets/insetcollapsable.h: fix Clone() declaration.
8770 * src/insets/insetfoot.h: ditto.
8772 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8774 2000-03-08 Juergen Vigna <jug@sad.it>
8776 * src/insets/lyxinset.h: added owner call which tells us if
8777 this inset is inside another inset. Changed also the return-type
8778 of Editable to an enum so it tells clearer what the return-value is.
8780 * src/insets/insettext.C (computeTextRows): fixed computing of
8781 textinsets which split automatically on more rows.
8783 * src/insets/insetert.[Ch]: changed this to be of BaseType
8786 * src/insets/insetfoot.[Ch]: added footnote inset
8788 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8789 collapsable insets (like footnote, ert, ...)
8791 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8793 * src/lyxdraw.h: remvoe file
8795 * src/lyxdraw.C: remove file
8797 * src/insets/insettext.C: added <algorithm>.
8799 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8801 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8802 (matrix_cb): case MM_OK use string stream
8804 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8807 * src/mathed/math_macro.C (draw): use string stream
8808 (Metrics): use string stream
8810 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8811 directly to the ostream.
8813 * src/vspace.C (asString): use string stream.
8814 (asString): use string stream
8815 (asLatexString): use string stream
8817 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8818 setting Spacing::Other.
8820 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8821 sprintf when creating the stretch vale.
8823 * src/text2.C (alphaCounter): changed to return a string and to
8824 not use a static variable internally. Also fixed a one-off bug.
8825 (SetCounter): changed the drawing of the labels to use string
8826 streams instead of sprintf.
8828 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8829 manipulator to use a scheme that does not require library support.
8830 This is also the way it is done in the new GNU libstdc++. Should
8831 work with DEC cxx now.
8833 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8835 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8836 end. This fixes a bug.
8838 * src/mathed (all files concerned with file writing): apply the
8839 USE_OSTREAM_ONLY changes to mathed too.
8841 * src/support/DebugStream.h: make the constructor explicit.
8843 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8844 count and ostream squashed.
8846 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8848 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8850 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8851 ostringstream uses STL strings, and we might not.
8853 * src/insets/insetspecialchar.C: add using directive.
8854 * src/insets/insettext.C: ditto.
8856 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8858 * lib/layouts/seminar.layout: feeble attempt at a layout for
8859 seminar.cls, far from completet and could really use some looking
8860 at from people used to write layout files.
8862 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8863 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8864 a lot nicer and works nicely with ostreams.
8866 * src/mathed/formula.C (draw): a slightly different solution that
8867 the one posted to the list, but I think this one works too. (font
8868 size wrong in headers.)
8870 * src/insets/insettext.C (computeTextRows): some fiddling on
8871 Jürgens turf, added some comments that he should read.
8873 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8874 used and it gave compiler warnings.
8875 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8878 * src/lyx_gui.C (create_forms): do the right thing when
8879 show_banner is true/false.
8881 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8882 show_banner is false.
8884 * most file writing files: Now use iostreams to do almost all of
8885 the writing. Also instead of passing string &, we now use
8886 stringstreams. mathed output is still not adapted to iostreams.
8887 This change can be turned off by commenting out all the occurences
8888 of the "#define USE_OSTREAM_ONLY 1" lines.
8890 * src/WorkArea.C (createPixmap): don't output debug messages.
8891 (WorkArea): don't output debug messages.
8893 * lib/lyxrc.example: added a comment about the new variable
8896 * development/Code_rules/Rules: Added some more commente about how
8897 to build class interfaces and on how better encapsulation can be
8900 2000-03-03 Juergen Vigna <jug@sad.it>
8902 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8903 automatically with the width of the LyX-Window
8905 * src/insets/insettext.C (computeTextRows): fixed update bug in
8906 displaying text-insets (scrollvalues where not initialized!)
8908 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8910 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8911 id in the check of the result from lower_bound is not enough since
8912 lower_bound can return last too, and then res->id will not be a
8915 * all insets and some code that use them: I have conditionalized
8916 removed the Latex(string & out, ...) this means that only the
8917 Latex(ostream &, ...) will be used. This is a work in progress to
8918 move towards using streams for all output of files.
8920 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8923 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8925 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8926 routine (this fixes bug where greek letters were surrounded by too
8929 * src/support/filetools.C (findtexfile): change a bit the search
8930 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8931 no longer passed to kpsewhich, we may have to change that later.
8933 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8934 warning options to avoid problems with X header files (from Angus
8936 * acinclude.m4: regenerated.
8938 2000-03-02 Juergen Vigna <jug@sad.it>
8940 * src/insets/insettext.C (WriteParagraphData): Using the
8941 par->writeFile() function for writing paragraph-data.
8942 (Read): Using buffer->parseSingleLyXformat2Token()-function
8943 for parsing paragraph data!
8945 * src/buffer.C (readLyXformat2): removed all parse data and using
8946 the new parseSingleLyXformat2Token()-function.
8947 (parseSingleLyXformat2Token): added this function to parse (read)
8948 lyx-file-format (this is called also from text-insets now!)
8950 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8952 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8955 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8956 directly instead of going through a func. One very bad thing: a
8957 static LyXFindReplace, but I don't know where to place it.
8959 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8960 string instead of char[]. Also changed to static.
8961 (GetSelectionOrWordAtCursor): changed to static inline
8962 (SetSelectionOverLenChars): ditto.
8964 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8965 current_view and global variables. both classes has changed names
8966 and LyXFindReplace is not inherited from SearchForm.
8968 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8969 fl_form_search form.
8971 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8973 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8975 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8976 bound (from Kayvan).
8978 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8980 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8982 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8984 * some things that I should comment but the local pub says head to
8987 * comment out all code that belongs to the Roff code for Ascii
8988 export of tables. (this is unused)
8990 * src/LyXView.C: use correct type for global variable
8991 current_layout. (LyXTextClass::size_type)
8993 * some code to get the new insetgraphics closer to working I'd be
8994 grateful for any help.
8996 * src/BufferView2.C (insertInset): use the return type of
8997 NumberOfLayout properly. (also changes in other files)
8999 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
9000 this as a test. I want to know what breaks because of this.
9002 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
9004 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9006 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
9007 to use a \makebox in the label, this allows proper justification
9008 with out using protected spaces or multiple hfills. Now it is
9009 "label" for left justified, "\hfill label\hfill" for center, and
9010 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
9011 should be changed accordingly.
9013 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9015 * src/lyxtext.h: change SetLayout() to take a
9016 LyXTextClass::size_type instead of a char (when there is more than
9017 127 layouts in a class); also change type of copylayouttype.
9018 * src/text2.C (SetLayout): ditto.
9019 * src/LyXView.C (updateLayoutChoice): ditto.
9021 * src/LaTeX.C (scanLogFile): errors where the line number was not
9022 given just after the '!'-line were ignored (from Dekel Tsur).
9024 * lib/lyxrc.example: fix description of \date_insert_format
9026 * lib/layouts/llncs.layout: new layout, contributed by Martin
9029 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9031 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
9032 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
9033 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
9034 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
9035 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
9036 paragraph.C, text.C, text2.C)
9038 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9040 * src/insets/insettext.C (LocalDispatch): remove extra break
9043 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9044 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9046 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9047 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9049 * src/insets/insetbib.h: move InsetBibkey::Holder and
9050 InsetCitation::Holder in public space.
9052 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9054 * src/insets/insettext.h: small change to get the new files from
9055 Juergen to compile (use "string", not "class string").
9057 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9058 const & as parameter to LocalDispatch, use LyXFont const & as
9059 paramter to some other func. This also had impacto on lyxinsets.h
9060 and the two mathed insets.
9062 2000-02-24 Juergen Vigna <jug@sad.it>
9065 * src/commandtags.h:
9067 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9071 * src/BufferView2.C: added/updated code for various inset-functions
9073 * src/insets/insetert.[Ch]: added implementation of InsetERT
9075 * src/insets/insettext.[Ch]: added implementation of InsetText
9077 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9078 (draw): added preliminary code for inset scrolling not finshed yet
9080 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9081 as it is in lyxfunc.C now
9083 * src/insets/lyxinset.h: Added functions for text-insets
9085 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9087 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9088 BufferView and reimplement the list as a queue put inside its own
9091 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9093 * several files: use the new interface to the "updateinsetlist"
9095 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9097 (work_area_handler): call BufferView::trippleClick on trippleclick.
9099 * src/BufferView.C (doubleClick): new function, selects word on
9101 (trippleClick): new function, selects line on trippleclick.
9103 2000-02-22 Allan Rae <rae@lyx.org>
9105 * lib/bind/xemacs.bind: buffer-previous not supported
9107 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9109 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9112 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9114 * src/bufferlist.C: get rid of current_view from this file
9116 * src/spellchecker.C: get rid of current_view from this file
9118 * src/vspace.C: get rid of current_view from this file
9119 (inPixels): added BufferView parameter for this func
9120 (asLatexCommand): added a BufferParams for this func
9122 * src/text.C src/text2.C: get rid of current_view from these
9125 * src/lyxfont.C (getFontDirection): move this function here from
9128 * src/bufferparams.C (getDocumentDirection): move this function
9131 * src/paragraph.C (getParDirection): move this function here from
9133 (getLetterDirection): ditto
9135 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9137 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9138 resize due to wrong pixmap beeing used. Also took the opurtunity
9139 to make the LyXScreen stateless on regard to WorkArea and some
9140 general cleanup in the same files.
9142 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9144 * src/Makefile.am: add missing direction.h
9146 * src/PainterBase.h: made the width functions const.
9148 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9151 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9153 * src/insets/insetlatexaccent.C (draw): make the accents draw
9154 better, at present this will only work well with iso8859-1.
9156 * several files: remove the old drawing code, now we use the new
9159 * several files: remove support for mono_video, reverse_video and
9162 2000-02-17 Juergen Vigna <jug@sad.it>
9164 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9165 int ** as we have to return the pointer, otherwise we have only
9166 NULL pointers in the returning function.
9168 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9170 * src/LaTeX.C (operator()): quote file name when running latex.
9172 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9174 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9175 (bubble tip), this removes our special handling of this.
9177 * Remove all code that is unused now that we have the new
9178 workarea. (Code that are not active when NEW_WA is defined.)
9180 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9182 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9184 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9185 nonexisting layout; correctly redirect obsoleted layouts.
9187 * lib/lyxrc.example: document \view_dvi_paper_option
9189 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9192 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9193 (PreviewDVI): handle the view_dvi_paper_option variable.
9194 [Both from Roland Krause]
9196 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9198 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9199 char const *, int, LyXFont)
9200 (text(int, int, string, LyXFont)): ditto
9202 * src/text.C (InsertCharInTable): attempt to fix the double-space
9203 feature in tables too.
9204 (BackspaceInTable): ditto.
9205 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9207 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9209 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9211 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9212 newly found text in textcache to this.
9213 (buffer): set the owner of the text put into the textcache to 0
9215 * src/insets/figinset.C (draw): fixed the drawing of figures with
9218 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9219 drawing of mathframe, hfills, protected space, table lines. I have
9220 now no outstanding drawing problems with the new Painter code.
9222 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9224 * src/PainterBase.C (ellipse, circle): do not specify the default
9227 * src/LColor.h: add using directive.
9229 * src/Painter.[Ch]: change return type of methods from Painter& to
9230 PainterBase&. Add a using directive.
9232 * src/WorkArea.C: wrap xforms callbacks in C functions
9235 * lib/layouts/foils.layout: font fix and simplifications from Carl
9238 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9240 * a lot of files: The Painter, LColor and WorkArea from the old
9241 devel branch has been ported to lyx-devel. Some new files and a
9242 lot of #ifdeffed code. The new workarea is enabled by default, but
9243 if you want to test the new Painter and LColor you have to compile
9244 with USE_PAINTER defined (do this in config.h f.ex.) There are
9245 still some rought edges, and I'd like some help to clear those
9246 out. It looks stable (loads and displays the Userguide very well).
9249 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9251 * src/buffer.C (pop_tag): revert to the previous implementation
9252 (use a global variable for both loops).
9254 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9256 * src/lyxrc.C (LyXRC): change slightly default date format.
9258 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9259 there is an English text with a footnote that starts with a Hebrew
9260 paragraph, or vice versa.
9261 (TeXFootnote): ditto.
9263 * src/text.C (LeftMargin): allow for negative values for
9264 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9267 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9268 for input encoding (cyrillic)
9270 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9272 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9275 * src/toolbar.C (set): ditto
9276 * src/insets/insetbib.C (create_form_citation_form): ditto
9278 * lib/CREDITS: added Dekel Tsur.
9280 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9281 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9282 hebrew supports files from Dekel Tsur.
9284 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9285 <tzafrir@technion.ac.il>
9287 * src/lyxrc.C: put \date_insert_format at the right place.
9289 * src/buffer.C (makeLaTeXFile): fix the handling of
9290 BufferParams::sides when writing out latex files.
9292 * src/BufferView2.C: add a "using" directive.
9294 * src/support/lyxsum.C (sum): when we use lyxstring,
9295 ostringstream::str needs an additional .c_str().
9297 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9299 * src/support/filetools.C (ChangeExtension): patch from Etienne
9302 * src/TextCache.C (show): remove const_cast and make second
9303 parameter non-const LyXText *.
9305 * src/TextCache.h: use non const LyXText in show.
9307 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9310 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9312 * src/support/lyxsum.C: rework to be more flexible.
9314 * several places: don't check if a pointer is 0 if you are going
9317 * src/text.C: remove some dead code.
9319 * src/insets/figinset.C: remove some dead code
9321 * src/buffer.C: move the BufferView funcs to BufferView2.C
9322 remove all support for insetlatexdel
9323 remove support for oldpapersize stuff
9324 made some member funcs const
9326 * src/kbmap.C: use a std::list to store the bindings in.
9328 * src/BufferView2.C: new file
9330 * src/kbsequence.[Ch]: new files
9332 * src/LyXAction.C + others: remove all trace of buffer-previous
9334 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9335 only have one copy in the binary of this table.
9337 * hebrew patch: moved some functions from LyXText to more
9338 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9340 * several files: remove support for XForms older than 0.88
9342 remove some #if 0 #endif code
9344 * src/TextCache.[Ch]: new file. Holds the textcache.
9346 * src/BufferView.C: changes to use the new TextCache interface.
9347 (waitForX): remove the now unused code.
9349 * src/BackStack.h: remove some commented code
9351 * lib/bind/emacs.bind: remove binding for buffer-previous
9353 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9355 * applied the hebrew patch.
9357 * src/lyxrow.h: make sure that all Row variables are initialized.
9359 * src/text2.C (TextHandleUndo): comment out a delete, this might
9360 introduce a memory leak, but should also help us to not try to
9361 read freed memory. We need to look at this one.
9363 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9364 (LyXParagraph): initalize footnotekind.
9366 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9367 forgot this when applying the patch. Please heed the warnings.
9369 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9370 (aka. reformat problem)
9372 * src/bufferlist.C (exists): made const, and use const_iterator
9373 (isLoaded): new func.
9374 (release): use std::find to find the correct buffer.
9376 * src/bufferlist.h: made getState a const func.
9377 made empty a const func.
9378 made exists a const func.
9381 2000-02-01 Juergen Vigna <jug@sad.it>
9383 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9385 * po/it.po: updated a bit the italian po file and also changed the
9386 'file nuovo' for newfile to 'filenuovo' without a space, this did
9389 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9390 for the new insert_date command.
9392 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9393 from jdblair, to insert a date into the current text conforming to
9394 a strftime format (for now only considering the locale-set and not
9395 the document-language).
9397 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9399 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9400 Bounds Read error seen by purify. The problem was that islower is
9401 a macros which takes an unsigned char and uses it as an index for
9402 in array of characters properties (and is thus subject to the
9406 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9407 correctly the paper sides radio buttons.
9408 (UpdateDocumentButtons): ditto.
9410 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9412 * src/kbmap.C (getsym + others): change to return unsigned int,
9413 returning a long can give problems on 64 bit systems. (I assume
9414 that int is 32bit on 64bit systems)
9416 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9418 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9419 LyXLookupString to be zero-terminated. Really fixes problems seen
9422 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9424 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9425 write a (char*)0 to the lyxerr stream.
9427 * src/lastfiles.C: move algorithm before the using statemets.
9429 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9431 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9432 complains otherwise).
9433 * src/table.C: ditto
9435 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9438 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9439 that I removed earlier... It is really needed.
9441 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9443 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9445 * INSTALL: update xforms home page URL.
9447 * lib/configure.m4: fix a bug with unreadable layout files.
9449 * src/table.C (calculate_width_of_column): add "using std::max"
9452 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9454 * several files: marked several lines with "DEL LINE", this is
9455 lines that can be deleted without changing anything.
9456 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9457 checks this anyway */
9460 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9462 * src/DepTable.C (update): add a "+" at the end when the checksum
9463 is different. (debugging string only)
9465 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9466 the next inset to not be displayed. This should also fix the list
9467 of labels in the "Insert Crossreference" dialog.
9469 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9471 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9472 when regex was not found.
9474 * src/support/lstrings.C (lowercase): use handcoded transform always.
9477 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9478 old_cursor.par->prev could be 0.
9480 * several files: changed post inc/dec to pre inc/dec
9482 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9483 write the lastfiles to file.
9485 * src/BufferView.C (buffer): only show TextCache info when debugging
9487 (resizeCurrentBuffer): ditto
9488 (workAreaExpose): ditto
9490 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9492 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9494 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9495 a bit better by removing the special case for \i and \j.
9497 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9499 * src/lyx_main.C (easyParse): remove test for bad comand line
9500 options, since this broke all xforms-related parsing.
9502 * src/kbmap.C (getsym): set return type to unsigned long, as
9503 declared in header. On an alpha, long is _not_ the same as int.
9505 * src/support/LOstream.h: add a "using std::flush;"
9507 * src/insets/figinset.C: ditto.
9509 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9511 * src/bufferlist.C (write): use blinding fast file copy instead of
9512 "a char at a time", now we are doing it the C++ way.
9514 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9515 std::list<int> instead.
9516 (addpidwait): reflect move to std::list<int>
9517 (sigchldchecker): ditto
9519 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9522 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9523 that obviously was wrong...
9525 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9526 c, this avoids warnings with purify and islower.
9528 * src/insets/figinset.C: rename struct queue to struct
9529 queue_element and rewrite to use a std::queue. gsqueue is now a
9530 std::queue<queue_element>
9531 (runqueue): reflect move to std::queue
9534 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9535 we would get "1" "0" instead of "true" "false. Also make the tostr
9538 2000-01-21 Juergen Vigna <jug@sad.it>
9540 * src/buffer.C (writeFileAscii): Disabled code for special groff
9541 handling of tabulars till I fix this in table.C
9543 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9545 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9547 * src/support/lyxlib.h: ditto.
9549 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9551 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9552 and 'j' look better. This might fix the "macron" bug that has been
9555 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9556 functions as one template function. Delete the old versions.
9558 * src/support/lyxsum.C: move using std::ifstream inside
9561 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9564 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9566 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9568 * src/insets/figinset.C (InitFigures): use new instead of malloc
9569 to allocate memory for figures and bitmaps.
9570 (DoneFigures): use delete[] instead of free to deallocate memory
9571 for figures and bitmaps.
9572 (runqueue): use new to allocate
9573 (getfigdata): use new/delete[] instead of malloc/free
9574 (RegisterFigure): ditto
9576 * some files: moved some declarations closer to first use, small
9577 whitespace changes use preincrement instead of postincrement where
9578 it does not make a difference.
9580 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9581 step on the way to use stl::containers for key maps.
9583 * src/bufferlist.h: add a typedef for const_iterator and const
9584 versions of begin and end.
9586 * src/bufferlist.[Ch]: change name of member variable _state to
9587 state_. (avoid reserved names)
9589 (getFileNames): returns the filenames of the buffers in a vector.
9591 * configure.in (ALL_LINGUAS): added ro
9593 * src/support/putenv.C: new file
9595 * src/support/mkdir.C: new file
9597 2000-01-20 Allan Rae <rae@lyx.org>
9599 * lib/layouts/IEEEtran.layout: Added several theorem environments
9601 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9602 couple of minor additions.
9604 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9605 (except for those in footnotes of course)
9607 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9609 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9611 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9612 std::sort and std::lower_bound instead of qsort and handwritten
9614 (struct compara): struct that holds the functors used by std::sort
9615 and std::lower_bound in MathedLookupBOP.
9617 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9619 * src/support/LAssert.h: do not do partial specialization. We do
9622 * src/support/lyxlib.h: note that lyx::getUserName() and
9623 lyx::date() are not in use right now. Should these be suppressed?
9625 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9626 (makeLinuxDocFile): do not put date and user name in linuxdoc
9629 * src/support/lyxlib.h (kill): change first argument to long int,
9630 since that's what solaris uses.
9632 * src/support/kill.C (kill): fix declaration to match prototype.
9634 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9635 actually check whether namespaces are supported. This is not what
9638 * src/support/lyxsum.C: add a using directive.
9640 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9642 * src/support/kill.C: if we have namespace support we don't have
9643 to include lyxlib.h.
9645 * src/support/lyxlib.h: use namespace lyx if supported.
9647 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9649 * src/support/date.C: new file
9651 * src/support/chdir.C: new file
9653 * src/support/getUserName.C: new file
9655 * src/support/getcwd.C: new file
9657 * src/support/abort.C: new file
9659 * src/support/kill.C: new file
9661 * src/support/lyxlib.h: moved all the functions in this file
9662 insede struct lyx. Added also kill and abort to this struct. This
9663 is a way to avoid the "kill is not defined in <csignal>", we make
9664 C++ wrappers for functions that are not ANSI C or ANSI C++.
9666 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9667 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9668 lyx it has been renamed to sum.
9670 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9672 * src/text.C: add using directives for std::min and std::max.
9674 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9676 * src/texrow.C (getIdFromRow): actually return something useful in
9677 id and pos. Hopefully fixes the bug with positionning of errorbox
9680 * src/lyx_main.C (easyParse): output an error and exit if an
9681 incorrect command line option has been given.
9683 * src/spellchecker.C (ispell_check_word): document a memory leak.
9685 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9686 where a "struct utimbuf" is allocated with "new" and deleted with
9689 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9691 * src/text2.C (CutSelection): don't delete double spaces.
9692 (PasteSelection): ditto
9693 (CopySelection): ditto
9695 * src/text.C (Backspace): don't delete double spaces.
9697 * src/lyxlex.C (next): fix a bug that were only present with
9698 conformant std::istream::get to read comment lines, use
9699 std::istream::getline instead. This seems to fix the problem.
9701 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9703 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9704 allowed to insert space before space" editing problem. Please read
9705 commends at the beginning of the function. Comments about usage
9708 * src/text.C (InsertChar): fix for the "not allowed to insert
9709 space before space" editing problem.
9711 * src/text2.C (DeleteEmptyParagraphMechanism): when
9712 IsEmptyTableRow can only return false this last "else if" will
9713 always be a no-op. Commented out.
9715 * src/text.C (RedoParagraph): As far as I can understand tmp
9716 cursor is not really needed.
9718 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9719 present it could only return false anyway.
9720 (several functions): Did something not so smart...added a const
9721 specifier on a lot of methods.
9723 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9724 and add a tmp->text.resize. The LyXParagraph constructor does the
9726 (BreakParagraphConservative): ditto
9728 * src/support/path.h (Path): add a define so that the wrong usage
9729 "Path("/tmp") will be flagged as a compilation error:
9730 "`unnamed_Path' undeclared (first use this function)"
9732 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9734 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9735 which was bogus for several reasons.
9737 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9741 * autogen.sh: do not use "type -path" (what's that anyway?).
9743 * src/support/filetools.C (findtexfile): remove extraneous space
9744 which caused a kpsewhich warning (at least with kpathsea version
9747 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9749 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9751 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9753 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9755 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9757 * src/paragraph.C (BreakParagraph): do not reserve space on text
9758 if we don't need to (otherwise, if pos_end < pos, we end up
9759 reserving huge amounts of memory due to bad unsigned karma).
9760 (BreakParagraphConservative): ditto, although I have not seen
9761 evidence the bug can happen here.
9763 * src/lyxparagraph.h: add a using std::list.
9765 2000-01-11 Juergen Vigna <jug@sad.it>
9767 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9770 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9772 * src/vc-backend.C (doVCCommand): change to be static and take one
9773 more parameter: the path to chdir too be fore executing the command.
9774 (retrive): new function equiv to "co -r"
9776 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9777 file_not_found_hook is true.
9779 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9781 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9782 if a file is readwrite,readonly...anything else.
9784 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9786 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9787 (CreatePostscript): name change from MenuRunDVIPS (or something)
9788 (PreviewPostscript): name change from MenuPreviewPS
9789 (PreviewDVI): name change from MenuPreviewDVI
9791 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9792 \view_pdf_command., \pdf_to_ps_command
9794 * lib/configure.m4: added search for PDF viewer, and search for
9795 PDF to PS converter.
9796 (lyxrc.defaults output): add \pdflatex_command,
9797 \view_pdf_command and \pdf_to_ps_command.
9799 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9801 * src/bufferlist.C (write): we don't use blocksize for anything so
9804 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9806 * src/support/block.h: disable operator T* (), since it causes
9807 problems with both compilers I tried. See comments in the file.
9809 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9812 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9813 variable LYX_DIR_10x to LYX_DIR_11x.
9815 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9817 * INSTALL: document --with-lyxname.
9820 * configure.in: new configure flag --with-lyxname which allows to
9821 choose the name under which lyx is installed. Default is "lyx", of
9822 course. It used to be possible to do this with --program-suffix,
9823 but the later has in fact a different meaning for autoconf.
9825 * src/support/lstrings.h (lstrchr): reformat a bit.
9827 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9828 * src/mathed/math_defs.h: ditto.
9830 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9832 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9833 true, decides if we create a backup file or not when saving. New
9834 tag and variable \pdf_mode, defaults to false. New tag and
9835 variable \pdflatex_command, defaults to pdflatex. New tag and
9836 variable \view_pdf_command, defaults to xpdf. New tag and variable
9837 \pdf_to_ps_command, defaults to pdf2ps.
9839 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9841 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9842 does not have a BufferView.
9843 (unlockInset): ditto + don't access the_locking_inset if the
9844 buffer does not have a BufferView.
9846 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9847 certain circumstances so that we don't continue a keyboard
9848 operation long after the key was released. Try f.ex. to load a
9849 large document, press PageDown for some seconds and then release
9850 it. Before this change the document would contine to scroll for
9851 some time, with this change it stops imidiatly.
9853 * src/support/block.h: don't allocate more space than needed. As
9854 long as we don't try to write to the arr[x] in a array_type arr[x]
9855 it is perfectly ok. (if you write to it you might segfault).
9856 added operator value_type*() so that is possible to pass the array
9857 to functions expecting a C-pointer.
9859 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9862 * intl/*: updated to gettext 0.10.35, tried to add our own
9863 required modifications. Please verify.
9865 * po/*: updated to gettext 0.10.35, tried to add our own required
9866 modifications. Please verify.
9868 * src/support/lstrings.C (tostr): go at fixing the problem with
9869 cxx and stringstream. When stringstream is used return
9870 oss.str().c_str() so that problems with lyxstring and basic_string
9871 are avoided. Note that the best solution would be for cxx to use
9872 basic_string all the way, but it is not conformant yet. (it seems)
9874 * src/lyx_cb.C + other files: moved several global functions to
9875 class BufferView, some have been moved to BufferView.[Ch] others
9876 are still located in lyx_cb.C. Code changes because of this. (part
9877 of "get rid of current_view project".)
9879 * src/buffer.C + other files: moved several Buffer functions to
9880 class BufferView, the functions are still present in buffer.C.
9881 Code changes because of this.
9883 * config/lcmessage.m4: updated to most recent. used when creating
9886 * config/progtest.m4: updated to most recent. used when creating
9889 * config/gettext.m4: updated to most recent. applied patch for
9892 * config/gettext.m4.patch: new file that shows what changes we
9893 have done to the local copy of gettext.m4.
9895 * config/libtool.m4: new file, used in creation of acinclude.m4
9897 * config/lyxinclude.m4: new file, this is the lyx created m4
9898 macros, used in making acinclude.m4.
9900 * autogen.sh: GNU m4 discovered as a separate task not as part of
9901 the lib/configure creation.
9902 Generate acinlucde from files in config. Actually cat
9903 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9904 easier to upgrade .m4 files that really are external.
9906 * src/Spacing.h: moved using std::istringstream to right after
9907 <sstream>. This should fix the problem seen with some compilers.
9909 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9911 * src/lyx_cb.C: began some work to remove the dependency a lot of
9912 functions have on BufferView::text, even if not really needed.
9913 (GetCurrentTextClass): removed this func, it only hid the
9916 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9917 forgot this in last commit.
9919 * src/Bullet.C (bulletEntry): use static char const *[] for the
9920 tables, becuase of this the return arg had to change to string.
9922 (~Bullet): removed unneeded destructor
9924 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9925 (insetSleep): moved from Buffer
9926 (insetWakeup): moved from Buffer
9927 (insetUnlock): moved from Buffer
9929 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9930 from Buffer to BufferView.
9932 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9934 * config/ltmain.sh: updated to version 1.3.4 of libtool
9936 * config/ltconfig: updated to version 1.3.4 of libtool
9938 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9941 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9942 Did I get that right?
9944 * src/lyxlex.h: add a "using" directive or two.
9945 * src/Spacing.h: ditto.
9946 * src/insets/figinset.C: ditto.
9947 * src/support/filetools.C: ditto.
9948 * src/support/lstrings.C: ditto.
9949 * src/BufferView.C: ditto.
9950 * src/bufferlist.C: ditto.
9951 * src/lyx_cb.C: ditto.
9952 * src/lyxlex.C: ditto.
9954 * NEWS: add some changes for 1.1.4.
9956 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9958 * src/BufferView.C: first go at a TextCache to speed up switching
9961 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9963 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9964 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9965 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9966 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9969 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9970 members of the struct are correctly initialized to 0 (detected by
9972 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9973 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9975 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9976 pidwait, since it was allocated with "new". This was potentially
9977 very bad. Thanks to Michael Schmitt for running purify for us.
9980 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9982 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9984 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9986 1999-12-30 Allan Rae <rae@lyx.org>
9988 * lib/templates/IEEEtran.lyx: minor change
9990 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9991 src/mathed/formula.C (LocalDispatch): askForText changes
9993 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9994 know when a user has cancelled input. Fixes annoying problems with
9995 inserting labels and version control.
9997 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9999 * src/support/lstrings.C (tostr): rewritten to use strstream and
10002 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10004 * src/support/filetools.C (IsFileWriteable): use fstream to check
10005 (IsDirWriteable): use fileinfo to check
10007 * src/support/filetools.h (FilePtr): whole class deleted
10009 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
10011 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
10013 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
10015 * src/bufferlist.C (write): use ifstream and ofstream instead of
10018 * src/Spacing.h: use istrstream instead of sscanf
10020 * src/mathed/math_defs.h: change first arg to istream from FILE*
10022 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
10024 * src/mathed/math_parser.C: have yyis to be an istream
10025 (LexGetArg): use istream (yyis)
10027 (mathed_parse): ditto
10028 (mathed_parser_file): first arg istream instead of FILE*, set yyis
10030 * src/mathed/formula.C (Read): rewritten to use istream
10032 * src/mathed/formulamacro.C (Read): rewritten to use istream
10034 * src/lyxlex.h (~LyXLex): deleted desturctor
10035 (getStream): new function, returns an istream
10036 (getFile): deleted funtion
10037 (IsOK): return is.good();
10039 * src/lyxlex.C (LyXLex): delete file and owns_file
10040 (setFile): open an filebuf and assign that to a istream instead of
10042 (setStream): new function, takes an istream as arg.
10043 (setFile): deleted function
10044 (EatLine): rewritten us use istream instead of FILE*
10048 * src/table.C (LyXTable): use istream instead of FILE*
10049 (Read): rewritten to take an istream instead of FILE*
10051 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10053 * src/buffer.C (Dispatch): remove an extraneous break statement.
10055 * src/support/filetools.C (QuoteName): change to do simple
10056 'quoting'. More work is necessary. Also changed to do nothing
10057 under emx (needs fix too).
10058 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10060 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10061 config.h.in to the AC_DEFINE_UNQUOTED() call.
10062 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10063 needs char * as argument (because Solaris 7 declares it like
10066 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10067 remove definition of BZERO.
10069 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10071 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10072 defined, "lyxregex.h" if not.
10074 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10076 (REGEX): new variable that is set to regex.c lyxregex.h when
10077 AM_CONDITIONAL USE_REGEX is set.
10078 (libsupport_la_SOURCES): add $(REGEX)
10080 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10083 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10086 * configure.in: add call to LYX_REGEX
10088 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10089 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10091 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10093 * lib/bind/fi_menus.bind: new file, from
10094 pauli.virtanen@saunalahti.fi.
10096 * src/buffer.C (getBibkeyList): pass the parameter delim to
10097 InsetInclude::getKeys and InsetBibtex::getKeys.
10099 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10100 is passed to Buffer::getBibkeyList
10102 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10103 instead of the hardcoded comma.
10105 * src/insets/insetbib.C (getKeys): make sure that there are not
10106 leading blanks in bibtex keys. Normal latex does not care, but
10107 harvard.sty seems to dislike blanks at the beginning of citation
10108 keys. In particular, the retturn value of the function is
10110 * INSTALL: make it clear that libstdc++ is needed and that gcc
10111 2.7.x probably does not work.
10113 * src/support/filetools.C (findtexfile): make debug message go to
10115 * src/insets/insetbib.C (getKeys): ditto
10117 * src/debug.C (showTags): make sure that the output is correctly
10120 * configure.in: add a comment for TWO_COLOR_ICON define.
10122 * acconfig.h: remove all the entries that already defined in
10123 configure.in or acinclude.m4.
10125 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10126 to avoid user name, date and copyright.
10128 1999-12-21 Juergen Vigna <jug@sad.it>
10130 * src/table.C (Read): Now read bogus row format informations
10131 if the format is < 5 so that afterwards the table can
10132 be read by lyx but without any format-info. Fixed the
10133 crash we experienced when not doing this.
10135 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10137 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10138 (RedoDrawingOfParagraph): ditto
10139 (RedoParagraphs): ditto
10140 (RemoveTableRow): ditto
10142 * src/text.C (Fill): rename arg paperwidth -> paper_width
10144 * src/buffer.C (insertLyXFile): rename var filename -> fname
10145 (writeFile): rename arg filename -> fname
10146 (writeFileAscii): ditto
10147 (makeLaTeXFile): ditto
10148 (makeLinuxDocFile): ditto
10149 (makeDocBookFile): ditto
10151 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10154 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10156 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10159 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10160 compiled by a C compiler not C++.
10162 * src/layout.h (LyXTextClass): added typedef for const_iterator
10163 (LyXTextClassList): added typedef for const_iterator + member
10164 functions begin and end.
10166 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10167 iterators to fill the choice_class.
10168 (updateLayoutChoice): rewritten to use iterators to fill the
10169 layoutlist in the toolbar.
10171 * src/BufferView.h (BufferView::work_area_width): removed unused
10174 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10176 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10177 (sgmlCloseTag): ditto
10179 * src/support/lstrings.h: return type of countChar changed to
10182 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10183 what version of this func to use. Also made to return unsigned int.
10185 * configure.in: call LYX_STD_COUNT
10187 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10188 conforming std::count.
10190 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10192 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10193 and a subscript would give bad display (patch from Dekel Tsur
10194 <dekel@math.tau.ac.il>).
10196 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10198 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10201 * src/chset.h: add a few 'using' directives
10203 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10204 triggered when no buffer is active
10206 * src/layout.C: removed `break' after `return' in switch(), since
10209 * src/lyx_main.C (init): make sure LyX can be ran in place even
10210 when libtool has done its magic with shared libraries. Fix the
10211 test for the case when the system directory has not been found.
10213 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10214 name for the latex file.
10215 (MenuMakeHTML): ditto
10217 * src/buffer.h: add an optional boolean argument, which is passed
10218 to ChangeExtension.
10220 1999-12-20 Allan Rae <rae@lyx.org>
10222 * lib/templates/IEEEtran.lyx: small correction and update.
10224 * configure.in: Attempted to use LYX_PATH_HEADER
10226 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10228 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10229 input from JMarc. Now use preprocessor to find the header.
10230 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10231 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10232 LYX_STL_STRING_FWD. See comments in file.
10234 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10236 * The global MiniBuffer * minibuffer variable is dead.
10238 * The global FD_form_main * fd_form_main variable is dead.
10240 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10242 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10244 * src/table.h: add the LOstream.h header
10245 * src/debug.h: ditto
10247 * src/LyXAction.h: change the explaination of the ReadOnly
10248 attribute: is indicates that the function _can_ be used.
10250 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10253 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10255 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10261 * src/paragraph.C (GetWord): assert on pos>=0
10264 * src/support/lyxstring.C: condition the use of an invariant on
10266 * src/support/lyxstring.h: ditto
10268 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10269 Use LAssert.h instead of plain assert().
10271 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10273 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10274 * src/support/filetools.C: ditto
10276 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10279 * INSTALL: document the new configure flags
10281 * configure.in: suppress --with-debug; add --enable-assertions
10283 * acinclude.m4: various changes in alignment of help strings.
10285 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10287 * src/kbmap.C: commented out the use of the hash map in kb_map,
10288 beginning of movement to a stl::container.
10290 * several files: removed code that was not in effect when
10291 MOVE_TEXT was defined.
10293 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10294 for escaping should not be used. We can discuss if the string
10295 should be enclosed in f.ex. [] instead of "".
10297 * src/trans_mgr.C (insert): use the new returned value from
10298 encodeString to get deadkeys and keymaps done correctly.
10300 * src/chset.C (encodeString): changed to return a pair, to tell
10301 what to use if we know the string.
10303 * src/lyxscreen.h (fillArc): new function.
10305 * src/FontInfo.C (resize): rewritten to use more std::string like
10306 structore, especially string::replace.
10308 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10311 * configure.in (chmod +x some scripts): remove config/gcc-hack
10313 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10315 * src/buffer.C (writeFile): change once again the top comment in a
10316 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10317 instead of an hardcoded version number.
10318 (makeDocBookFile): ditto
10320 * src/version.h: add new define LYX_DOCVERSION
10322 * po/de.po: update from Pit Sütterlin
10323 * lib/bind/de_menus.bind: ditto.
10325 * src/lyxfunc.C (Dispatch): call MenuExport()
10326 * src/buffer.C (Dispatch): ditto
10328 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10329 LyXFunc::Dispatch().
10330 (MenuExport): new function, moved from
10331 LyXFunc::Dispatch().
10333 * src/trans_mgr.C (insert): small cleanup
10334 * src/chset.C (loadFile): ditto
10336 * lib/kbd/iso8859-1.cdef: add missing backslashes
10338 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10340 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10341 help with placing the manually drawn accents better.
10343 (Draw): x2 and hg changed to float to minimize rounding errors and
10344 help place the accents better.
10346 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10347 unsigned short to char is just wrong...cast the char to unsigned
10348 char instead so that the two values can compare sanely. This
10349 should also make the display of insetlatexaccents better and
10350 perhaps also some other insets.
10352 (lbearing): new function
10355 1999-12-15 Allan Rae <rae@lyx.org>
10357 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10358 header that provides a wrapper around the very annoying SGI STL header
10361 * src/support/lyxstring.C, src/LString.h:
10362 removed old SGI-STL-compatability attempts.
10364 * configure.in: Use LYX_STL_STRING_FWD.
10366 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10367 stl_string_fwd.h is around and try to determine it's location.
10368 Major improvement over previous SGI STL 3.2 compatability.
10369 Three small problems remain with this function due to my zero
10370 knowledge of autoconf. JMarc and lgb see the comments in the code.
10372 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10374 * src/broken_const.h, config/hack-gcc, config/README: removed
10376 * configure.in: remove --with-gcc-hack option; do not call
10379 * INSTALL: remove documentation of --with-broken-const and
10382 * acconfig.h: remove all trace of BROKEN_CONST define
10384 * src/buffer.C (makeDocBookFile): update version number in output
10386 (SimpleDocBookOnePar): fix an assert when trying to a character
10387 access beyond string length
10390 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10392 * po/de.po: fix the Export menu
10394 * lyx.man: update the description of -dbg
10396 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10397 (commandLineHelp): updated
10398 (easyParse): show list of available debug levels if -dbg is passed
10401 * src/Makefile.am: add debug.C
10403 * src/debug.h: moved some code to debug.C
10405 * src/debug.C: new file. Contains code to set and show debug
10408 * src/layout.C: remove 'break' after 'continue' in switch
10409 statements, since these cannot be reached.
10411 1999-12-13 Allan Rae <rae@lyx.org>
10413 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10414 (in_word_set): hash() -> math_hash()
10416 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10418 * acconfig.h: Added a test for whether we are using exceptions in the
10419 current compilation run. If so USING_EXCEPTIONS is defined.
10421 * config.in: Check for existance of stl_string_fwd.h
10422 * src/LString.h: If compiling --with-included-string and SGI's
10423 STL version 3.2 is present (see above test) we need to block their
10424 forward declaration of string and supply a __get_c_string().
10425 However, it turns out this is only necessary if compiling with
10426 exceptions enabled so I've a bit more to add yet.
10428 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10429 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10430 src/support/LRegex.h, src/undo.h:
10431 Shuffle the order of the included files a little to ensure that
10432 LString.h gets included before anything that includes stl_string_fwd.h
10434 * src/support/lyxstring.C: We need to #include LString.h instead of
10435 lyxstring.h to get the necessary definition of __get_c_string.
10436 (__get_c_string): New function. This is defined static just like SGI's
10437 although why they need to do this I'm not sure. Perhaps it should be
10438 in lstrings.C instead.
10440 * lib/templates/IEEEtran.lyx: New template file.
10442 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10444 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10445 * intl/Makefile.in (MKINSTALLDIRS): ditto
10447 * src/LyXAction.C (init): changed to hold the LFUN data in a
10448 automatic array in stead of in callso to newFunc, this speeds up
10449 compilation a lot. Also all the memory used by the array is
10450 returned when the init is completed.
10452 * a lot of files: compiled with -Wold-style-cast, changed most of
10453 the reported offenders to C++ style casts. Did not change the
10454 offenders in C files.
10456 * src/trans.h (Match): change argument type to unsigned int.
10458 * src/support/DebugStream.C: fix some types on the streambufs so
10459 that it works on a conforming implementation.
10461 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10463 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10465 * src/support/lyxstring.C: remove the inline added earlier since
10466 they cause a bunch of unsatisfied symbols when linking with dec
10467 cxx. Cxx likes to have the body of inlines at the place where they
10470 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10471 accessing negative bounds in array. This fixes the crash when
10472 inserting accented characters.
10473 * src/trans.h (Match): ditto
10475 * src/buffer.C (Dispatch): since this is a void, it should not try
10476 to return anything...
10478 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10480 * src/buffer.h: removed the two friends from Buffer. Some changes
10481 because of this. Buffer::getFileName and Buffer::setFileName
10482 renamed to Buffer::fileName() and Buffer::fileName(...).
10484 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10486 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10487 and Buffer::update(short) to BufferView. This move is currently
10488 controlled by a define MOVE_TEXT, this will be removed when all
10489 shows to be ok. This move paves the way for better separation
10490 between buffer contents and buffer view. One side effect is that
10491 the BufferView needs a rebreak when swiching buffers, if we want
10492 to avoid this we can add a cache that holds pointers to LyXText's
10493 that is not currently in use.
10495 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10498 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10500 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10502 * lyx_main.C: new command line option -x (or --execute) and
10503 -e (or --export). Now direct conversion from .lyx to .tex
10504 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10505 Unfortunately, X is still needed and the GUI pops up during the
10508 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10510 * src/Spacing.C: add a using directive to bring stream stuff into
10512 * src/paragraph.C: ditto
10513 * src/buffer.C: ditto
10515 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10516 from Lars' announcement).
10518 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10519 example files from Tino Meinen.
10521 1999-12-06 Allan Rae <rae@lyx.org>
10523 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10525 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10527 * src/support/lyxstring.C: added a lot of inline for no good
10530 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10531 latexWriteEndChanges, they were not used.
10533 * src/layout.h (operator<<): output operator for PageSides
10535 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10537 * some example files: loaded in LyX 1.0.4 and saved again to update
10538 certain constructs (table format)
10540 * a lot of files: did the change to use fstream/iostream for all
10541 writing of files. Done with a close look at Andre Poenitz's patch.
10543 * some files: whitespace changes.
10545 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10547 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10548 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10549 architecture, we provide our own. It is used unconditionnally, but
10550 I do not think this is a performance problem. Thanks to Angus
10551 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10552 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10554 (GetInset): use my_memcpy.
10558 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10559 it is easier to understand, but it uses less TeX-only constructs now.
10561 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10562 elements contain spaces
10564 * lib/configure: regenerated
10566 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10567 elements contain spaces; display the list of programs that are
10570 * autogen.sh: make sure lib/configure is executable
10572 * lib/examples/*: rename the tutorial examples to begin with the
10573 two-letters language code.
10575 * src/lyxfunc.C (getStatus): do not query current font if no
10578 * src/lyx_cb.C (RunScript): use QuoteName
10579 (MenuRunDvips): ditto
10580 (PrintApplyCB): ditto
10582 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10583 around argument, so that it works well with the current shell.
10584 Does not work properly with OS/2 shells currently.
10586 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10587 * src/LyXSendto.C (SendtoApplyCB): ditto
10588 * src/lyxfunc.C (Dispatch): ditto
10589 * src/buffer.C (runLaTeX): ditto
10590 (runLiterate): ditto
10591 (buildProgram): ditto
10593 * src/lyx_cb.C (RunScript): ditto
10594 (MenuMakeLaTeX): ditto
10596 * src/buffer.h (getLatexName): new method
10598 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10600 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10602 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10603 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10604 (create_math_panel): ditto
10606 * src/lyxfunc.C (getStatus): re-activate the code which gets
10607 current font and cursor; add test for export to html.
10609 * src/lyxrc.C (read): remove unreachable break statements; add a
10612 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10614 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10616 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10617 introduced by faulty regex.
10618 * src/buffer.C: ditto
10619 * src/lastfiles.C: ditto
10620 * src/paragraph.C: ditto
10621 * src/table.C: ditto
10622 * src/vspace.C: ditto
10623 * src/insets/figinset.C: ditto
10624 Note: most of these is absolutely harmless, except the one in
10625 src/mathed formula.C.
10627 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10629 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10630 operation, yielding correct results for the reLyX command.
10632 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10634 * src/support/filetools.C (ExpandPath): removed an over eager
10636 (ReplaceEnvironmentPath): ditto
10638 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10639 shows that we are doing something fishy in our code...
10640 (BubblePost): ditto
10643 * src/lyxrc.C (read): use a double switch trick to get more help
10644 from the compiler. (the same trick is used in layout.C)
10645 (write): new function. opens a ofstream and pass that to output
10646 (output): new function, takes a ostream and writes the lyxrc
10647 elemts to it. uses a dummy switch to make sure no elements are
10650 * src/lyxlex.h: added a struct pushpophelper for use in functions
10651 with more than one exit point.
10653 * src/lyxlex.[Ch] (GetInteger): made it const
10657 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10659 * src/layout.[hC] : LayoutTags splitted into several enums, new
10660 methods created, better error handling cleaner use of lyxlex. Read
10663 * src/bmtable.[Ch]: change some member prototypes because of the
10664 image const changes.
10666 * commandtags.h, src/LyXAction.C (init): new function:
10667 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10668 This file is not read automatically but you can add \input
10669 preferences to your lyxrc if you want to. We need to discuss how
10672 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10673 in .aux, also remove .bib and .bst files from dependencies when
10676 * src/BufferView.C, src/LyXView.C: add const_cast several places
10677 because of changes to images.
10679 * lib/images/*: same change as for images/*
10681 * lib/lyxrc.example: Default for accept_compound is false not no.
10683 * images/*: changed to be const, however I have som misgivings
10684 about this change so it might be changed back.
10686 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10688 * lib/configure, po/POTFILES.in: regenerated
10690 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10692 * config/lib_configure.m4: removed
10694 * lib/configure.m4: new file (was config/lib_configure.m4)
10696 * configure.in: do not test for rtti, since we do not use it.
10698 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10700 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10701 doubling of allocated space scheme. This makes it faster for large
10702 strings end to use less memory for small strings. xtra rememoved.
10704 * src/insets/figinset.C (waitalarm): commented out.
10705 (GhostscriptMsg): use static_cast
10706 (GhostscriptMsg): use new instead of malloc to allocate memory for
10707 cmap. also delete the memory after use.
10709 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10711 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10712 for changes in bibtex database or style.
10713 (runBibTeX): remove all .bib and .bst files from dep before we
10715 (run): use scanAuc in when dep file already exist.
10717 * src/DepTable.C (remove_files_with_extension): new method
10718 (exist): new method
10720 * src/DepTable.[Ch]: made many of the methods const.
10722 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10724 * src/bufferparams.C: make sure that the default textclass is
10725 "article". It used to be the first one by description order, but
10726 now the first one is "docbook".
10728 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10729 string; call Debug::value.
10730 (easyParse): pass complete argument to setDebuggingLevel().
10732 * src/debug.h (value): fix the code that parses debug levels.
10734 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10737 * src/LyXAction.C: use Debug::ACTION as debug channel.
10739 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10741 * NEWS: updated for the future 1.1.3 release.
10743 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10744 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10745 it should. This is of course a controversial change (since many
10746 people will find that their lyx workscreen is suddenly full of
10747 red), but done for the sake of correctness.
10749 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10750 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10752 * src/insets/inseterror.h, src/insets/inseturl.h,
10753 src/insets/insetinfo.h, src/insets/figinset.h,
10754 src/mathed/formulamacro.h, src/mathed/math_macro.h
10755 (EditMessage): add a missing const and add _() to make sure that
10756 translation happens
10758 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10759 src/insets/insetbib.C, src/support/filetools.C: add `using'
10760 directives for cxx.
10762 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10763 doing 'Insert index of last word' at the beginning of a paragraph.
10765 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10767 * several files: white-space changes.
10769 * src/mathed/formula.C: removed IsAlpha and IsDigit
10771 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10772 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10775 * src/insets/figinset.C (GetPSSizes): don't break when
10776 "EndComments" is seen. But break when a boundingbox is read.
10778 * all classes inherited from Inset: return value of Clone
10779 changed back to Inset *.
10781 * all classes inherited form MathInset: return value of Clone
10782 changed back to MathedInset *.
10784 * src/insets/figinset.C (runqueue): use a ofstream to output the
10785 gs/ps file. Might need some setpresicion or setw. However I can
10786 see no problem with the current code.
10787 (runqueue): use sleep instead of the alarm/signal code. I just
10788 can't see the difference.
10790 * src/paragraph.C (LyXParagraph): reserve space in the new
10791 paragraph and resize the inserted paragraph to just fit.
10793 * src/lyxfunc.h (operator|=): added operator for func_status.
10795 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10796 check for readable file.
10798 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10799 check for readable file.
10800 (MenuMakeLinuxDoc): ditto
10801 (MenuMakeDocBook): ditto
10802 (MenuMakeAscii): ditto
10803 (InsertAsciiFile): split the test for openable and readable
10805 * src/bmtable.C (draw_bitmaptable): use
10806 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10808 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10809 findtexfile from LaTeX to filetools.
10811 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10812 instead of FilePtr. Needs to be verified by a literate user.
10814 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10816 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10817 (EditMessage): likewise.
10819 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10820 respectively as \textasciitilde and \textasciicircum.
10822 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10824 * src/support/lyxstring.h: made the methods that take iterators
10825 use const_iterator.
10827 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10828 (regexMatch): made is use the real regex class.
10830 * src/support/Makefile.am: changed to use libtool
10832 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10834 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10836 (MathIsInset ++): changed several macros to be inline functions
10839 * src/mathed/Makefile.am: changed to use libtool
10841 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10843 * src/insets/inset* : Clone changed to const and return type is
10844 the true insettype not just Inset*.
10846 * src/insets/Makefile.am: changed to use libtool
10848 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10850 * src/undo.[Ch] : added empty() and changed some of the method
10853 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10855 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10856 setID use block<> for the bullets array, added const several places.
10858 * src/lyxfunc.C (getStatus): new function
10860 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10861 LyXAction, added const to several funtions.
10863 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10864 a std::map, and to store the dir items in a vector.
10866 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10869 * src/LyXView.[Ch] + other files : changed currentView to view.
10871 * src/LyXAction.[Ch] : ported from the old devel branch.
10873 * src/.cvsignore: added .libs and a.out
10875 * configure.in : changes to use libtool.
10877 * acinclude.m4 : inserted libtool.m4
10879 * .cvsignore: added libtool
10881 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10883 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10884 file name in insets and mathed directories (otherwise the
10885 dependency is not taken in account under cygwin).
10887 * src/text2.C (InsertString[AB]): make sure that we do not try to
10888 read characters past the string length.
10890 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10892 * lib/doc/LaTeXConfig.lyx.in,
10893 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10895 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10896 file saying who created them and when this heppened; this is
10897 useless and annoys tools like cvs.
10899 * lib/layouts/g-brief-{en,de}.layout,
10900 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10901 from Thomas Hartkens <thomas@hartkens.de>.
10903 * src/{insets,mathed}/Makefile.am: do not declare an empty
10904 LDFLAGS, so that it can be set at configure time (useful on Irix
10907 * lib/reLyX/configure.in: make sure that the prefix is set
10908 correctly in LYX_DIR.
10910 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10912 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10913 be used by 'command-sequence' this allows to bind a key to a
10914 sequence of LyX-commands
10915 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10917 * src/LyXAction.C: add "command-sequence"
10919 * src/LyXFunction.C: handling of "command-sequence"
10921 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10922 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10924 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10926 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10928 * src/buffer.C (writeFile): Do not output a comment giving user
10929 and date at the beginning of a .lyx file. This is useless and
10930 annoys cvs anyway; update version number to 1.1.
10932 * src/Makefile.am (LYX_DIR): add this definition, so that a
10933 default path is hardcoded in LyX.
10935 * configure.in: Use LYX_GNU_GETTEXT.
10937 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10938 AM_GNU_GETTEXT with a bug fixed.
10940 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10942 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10944 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10945 which is used to point to LyX data is now LYX_DIR_11x.
10947 * lyx.man: convert to a unix text file; small updates.
10949 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10951 * src/support/LSubstring.[Ch]: made the second arg of most of the
10952 constructors be a const reference.
10954 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10957 * src/support/lyxstring.[Ch] (swap): added missing member function
10958 and specialization of swap(str, str);
10960 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10962 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10963 trace of the old one.
10965 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10966 put the member definitions in undo.C.
10968 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10969 NEW_TEXT and have now only code that was included when this was
10972 * src/intl.C (LCombo): use static_cast
10974 (DispatchCallback): ditto
10976 * src/definitions.h: removed whole file
10978 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10980 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10981 parsing and stores in a std:map. a regex defines the file format.
10982 removed unneeded members.
10984 * src/bufferparams.h: added several enums from definitions.h here.
10985 Removed unsused destructor. Changed some types to use proper enum
10986 types. use block to have the temp_bullets and user_defined_bullets
10987 and to make the whole class assignable.
10989 * src/bufferparams.C (Copy): removed this functions, use a default
10990 assignment instead.
10992 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10995 * src/buffer.C (readLyXformat2): commend out all that have with
10996 oldpapersize to do. also comment out all that hve to do with
10997 insetlatex and insetlatexdel.
10998 (setOldPaperStuff): commented out
11000 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
11002 * src/LyXAction.C: remove use of inset-latex-insert
11004 * src/mathed/math_panel.C (button_cb): use static_cast
11006 * src/insets/Makefile.am (insets_o_SOURCES): removed
11009 * src/support/lyxstring.C (helper): use the unsigned long
11010 specifier, UL, instead of a static_cast.
11012 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
11014 * src/support/block.h: new file. to be used as a c-style array in
11015 classes, so that the class can be assignable.
11017 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11019 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
11020 NULL, make sure to return an empty string (it is not possible to
11021 set a string to NULL).
11023 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11025 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
11027 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
11029 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
11030 link line, so that Irix users (for example) can set it explicitely to
11033 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
11034 it can be overidden at make time (static or dynamic link, for
11037 * src/vc-backend.C, src/LaTeXFeatures.h,
11038 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
11039 statements to bring templates to global namespace.
11041 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
11043 * src/support/lyxstring.C (operator[] const): make it standard
11046 * src/minibuffer.C (Init): changed to reflect that more
11047 information is given from the lyxvc and need not be provided here.
11049 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11051 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11053 * src/LyXView.C (UpdateTimerCB): use static_cast
11054 (KeyPressMask_raw_callback): ditto
11056 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11057 buffer_, a lot of changes because of this. currentBuffer() ->
11058 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11059 also changes to other files because of this.
11061 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11063 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11064 have no support for RCS and partial support for CVS, will be
11067 * src/insets/ several files: changes because of function name
11068 changes in Bufferview and LyXView.
11070 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11072 * src/support/LSubstring.[Ch]: new files. These implement a
11073 Substring that can be very convenient to use. i.e. is this
11075 string a = "Mary had a little sheep";
11076 Substring(a, "sheep") = "lamb";
11077 a is now "Mary has a little lamb".
11079 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11080 out patterns and subpatterns of strings. It is used by LSubstring
11081 and also by vc-backend.C
11083 * src/support/lyxstring.C: went over all the assertions used and
11084 tried to correct the wrong ones and flag which of them is required
11085 by the standard. some bugs found because of this. Also removed a
11086 couple of assertions.
11088 * src/support/Makefile.am (libsupport_a_SOURCES): added
11089 LSubstring.[Ch] and LRegex.[Ch]
11091 * src/support/FileInfo.h: have struct stat buf as an object and
11092 not a pointer to one, some changes because of this.
11094 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11095 information in layout when adding the layouts preamble to the
11096 textclass preamble.
11098 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11101 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11102 because of bug in OS/2.
11104 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11106 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11107 \verbatim@font instead of \ttfamily, so that it can be redefined.
11109 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11110 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11111 src/layout.h, src/text2.C: add 'using' directive to bring the
11112 STL templates we need from the std:: namespace to the global one.
11113 Needed by DEC cxx in strict ansi mode.
11115 * src/support/LIstream.h,src/support/LOstream.h,
11116 src/support/lyxstring.h,src/table.h,
11117 src/lyxlookup.h: do not include <config.h> in header
11118 files. This should be done in the .C files only.
11120 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11124 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11126 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11127 from Kayvan to fix the tth invokation.
11129 * development/lyx.spec.in: updates from Kayvan to reflect the
11130 changes of file names.
11132 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11134 * src/text2.C (InsertStringB): use std::copy
11135 (InsertStringA): use std::copy
11137 * src/bufferlist.C: use a vector to store the buffers in. This is
11138 an internal change and should not affect any other thing.
11140 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11143 * src/text.C (Fill): fix potential bug, one off bug.
11145 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11147 * src/Makefile.am (lyx_main.o): add more files it depends on.
11149 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11151 * src/support/lyxstring.C: use size_t for the reference count,
11152 size, reserved memory and xtra.
11153 (internal_compare): new private member function. Now the compare
11154 functions should work for std::strings that have embedded '\0'
11156 (compare): all compare functions rewritten to use
11159 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11161 * src/support/lyxstring.C (compare): pass c_str()
11162 (compare): pass c_str
11163 (compare): pass c_str
11165 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11167 * src/support/DebugStream.C: <config.h> was not included correctly.
11169 * lib/configure: forgot to re-generate it :( I'll make this file
11170 auto generated soon.
11172 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11174 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11177 * src/support/lyxstring.C: some changes from length() to rep->sz.
11178 avoids a function call.
11180 * src/support/filetools.C (SpaceLess): yet another version of the
11181 algorithm...now per Jean-Marc's suggestions.
11183 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11185 * src/layout.C (less_textclass_desc): functor for use in sorting
11187 (LyXTextClass::Read): sort the textclasses after reading.
11189 * src/support/filetools.C (SpaceLess): new version of the
11190 SpaceLess functions. What problems does this one give? Please
11193 * images/banner_bw.xbm: made the arrays unsigned char *
11195 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11197 * src/support/lyxstring.C (find): remove bogus assertion in the
11198 two versions of find where this has not been done yet.
11200 * src/support/lyxlib.h: add missing int return type to
11203 * src/menus.C (ShowFileMenu): disable exporting to html if no
11204 html export command is present.
11206 * config/lib_configure.m4: add a test for an HTML converter. The
11207 programs checked for are, in this order: tth, latex2html and
11210 * lib/configure: generated from config/lib_configure.m4.
11212 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11213 html converter. The parameters are now passed through $$FName and
11214 $$OutName, instead of standard input/output.
11216 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11218 * lib/lyxrc.example: update description of \html_command.
11219 add "quotes" around \screen_font_xxx font setting examples to help
11220 people who use fonts with spaces in their names.
11222 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11224 * Distribution files: updates for v1.1.2
11226 * src/support/lyxstring.C (find): remove bogus assert and return
11227 npos for the same condition.
11229 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11231 * added patch for OS/2 from SMiyata.
11233 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11235 * src/text2.C (CutSelection): make space_wrapped a bool
11236 (CutSelection): dont declare int i until we have to.
11237 (alphaCounter): return a char const *.
11239 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11241 * src/support/syscall.C (Systemcalls::kill):
11242 src/support/filetools.C (PutEnv, PutEnvPath):
11243 src/lyx_cb.C (addNewlineAndDepth):
11244 src/FontInfo.C (FontInfo::resize): condition some #warning
11245 directives with WITH_WARNINGS.
11248 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11250 * src/layout.[Ch] + several files: access to class variables
11251 limited and made accessor functions instead a lot of code changed
11252 becuase of this. Also instead of returning pointers often a const
11253 reference is returned instead.
11255 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11257 * src/Makefile.am (dist-hook): added used to remove the CVS from
11258 cheaders upon creating a dist
11259 (EXTRA_DIST): added cheaders
11261 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11262 a character not as a small integer.
11264 * src/support/lyxstring.C (find): removed Assert and added i >=
11265 rep->sz to the first if.
11267 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11269 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11270 src/LyXView.C src/buffer.C src/bufferparams.C
11271 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11272 src/text2.C src/insets/insetinclude.C:
11273 lyxlayout renamed to textclasslist.
11275 * src/layout.C: some lyxerr changes.
11277 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11278 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11279 (LyXLayoutList): removed all traces of this class.
11280 (LyXTextClass::Read): rewrote LT_STYLE
11281 (LyXTextClass::hasLayout): new function
11282 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11283 both const and nonconst version.
11284 (LyXTextClass::delete_layout): new function.
11285 (LyXTextClassList::Style): bug fix. do the right thing if layout
11287 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11288 (LyXTextClassList::NameOfLayout): ditto
11289 (LyXTextClassList::Load): ditto
11291 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11293 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11295 * src/LyXAction.C (LookupFunc): added a workaround for sun
11296 compiler, on the other hand...we don't know if the current code
11297 compiles on sun at all...
11299 * src/support/filetools.C (CleanupPath): subst fix
11301 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11304 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11305 complained about this one?
11307 * src/insets/insetinclude.C (Latex): subst fix
11309 * src/insets/insetbib.C (getKeys): subst fix
11311 * src/LyXSendto.C (SendtoApplyCB): subst fix
11313 * src/lyx_main.C (init): subst fix
11315 * src/layout.C (Read): subst fix
11317 * src/lyx_sendfax_main.C (button_send): subst fix
11319 * src/buffer.C (RoffAsciiTable): subst fix
11321 * src/lyx_cb.C (MenuFax): subst fix
11322 (PrintApplyCB): subst fix
11324 1999-10-26 Juergen Vigna <jug@sad.it>
11326 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11328 (Read): Cleaned up this code so now we read only format vestion >= 5
11330 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11332 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11333 come nobody has complained about this one?
11335 * src/insets/insetinclude.C (Latex): subst fix
11337 * src/insets/insetbib.C (getKeys): subst fix
11339 * src/lyx_main.C (init): subst fix
11341 * src/layout.C (Read): subst fix
11343 * src/buffer.C (RoffAsciiTable): subst fix
11345 * src/lyx_cb.C (MenuFax): subst fix.
11347 * src/layout.[hC] + some other files: rewrote to use
11348 std::container to store textclasses and layouts in.
11349 Simplified, removed a lot of code. Make all classes
11350 assignable. Further simplifications and review of type
11351 use still to be one.
11353 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11354 lastfiles to create the lastfiles partr of the menu.
11356 * src/lastfiles.[Ch]: rewritten to use deque to store the
11357 lastfiles in. Uses fstream for reading and writing. Simplifies
11360 * src/support/syscall.C: remove explicit cast.
11362 * src/BufferView.C (CursorToggleCB): removed code snippets that
11363 were commented out.
11364 use explicat C++ style casts instead of C style casts. also use
11365 u_vdata instea of passing pointers in longs.
11367 * src/PaperLayout.C: removed code snippets that were commented out.
11369 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11371 * src/lyx_main.C: removed code snippets that wer commented out.
11373 * src/paragraph.C: removed code snippets that were commented out.
11375 * src/lyxvc.C (logClose): use static_cast
11377 (viewLog): remove explicit cast to void*
11378 (showLog): removed old commented code
11380 * src/menus.C: use static_cast instead of C style casts. use
11381 u_vdata instead of u_ldata. remove explicit cast to (long) for
11382 pointers. Removed old code that was commented out.
11384 * src/insets/inset.C: removed old commented func
11386 * src/insets/insetref.C (InsetRef): removed old code that had been
11387 commented out for a long time.
11389 (escape): removed C style cast
11391 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11393 * src/insets/insetlatex.C (Draw): removed old commented code
11394 (Read): rewritten to use string
11396 * src/insets/insetlabel.C (escape): removed C style cast
11398 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11400 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11401 old commented code.
11403 * src/insets/insetinclude.h: removed a couple of stupid bools
11405 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11406 (Clone): remove C style cast
11407 (getKeys): changed list to lst because of std::list
11409 * src/insets/inseterror.C (Draw): removed som old commented code.
11411 * src/insets/insetcommand.C (Draw): removed some old commented code.
11413 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11414 commented out forever.
11415 (bibitem_cb): use static_cast instead of C style cast
11416 use of vdata changed to u_vdata.
11418 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11420 (CloseUrlCB): use static_cast instead of C style cast.
11421 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11423 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11424 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11425 (CloseInfoCB): static_cast from ob->u_vdata instead.
11426 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11429 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11430 (C_InsetError_CloseErrorCB): forward the ob parameter
11431 (CloseErrorCB): static_cast from ob->u_vdata instead.
11433 * src/vspace.h: include LString.h since we use string in this class.
11435 * src/vspace.C (lyx_advance): changed name from advance because of
11436 nameclash with stl. And since we cannot use namespaces yet...I
11437 used a lyx_ prefix instead. Expect this to change when we begin
11440 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11442 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11443 and removed now defunct constructor and deconstructor.
11445 * src/BufferView.h: have backstack as a object not as a pointer.
11446 removed initialization from constructor. added include for BackStack
11448 * development/lyx.spec.in (%build): add CFLAGS also.
11450 * src/screen.C (drawFrame): removed another warning.
11452 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11454 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11455 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11456 README and ANNOUNCE a bit for the next release. More work is
11459 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11460 unbreakable if we are in freespacing mode (LyX-Code), but not in
11463 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11465 * src/BackStack.h: fixed initialization order in constructor
11467 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11469 * acinclude.m4 (VERSION): new rules for when a version is
11470 development, added also a variable for prerelease.
11471 (warnings): we set with_warnings=yes for prereleases
11472 (lyx_opt): prereleases compile with same optimization as development
11473 (CXXFLAGS): only use pedantic if we are a development version
11475 * src/BufferView.C (restorePosition): don't do anything if the
11476 backstack is empty.
11478 * src/BackStack.h: added member empty, use this to test if there
11479 is anything to pop...
11481 1999-10-25 Juergen Vigna <jug@sad.it>
11484 * forms/layout_forms.fd +
11485 * forms/latexoptions.fd +
11486 * lyx.fd: changed for various form resize issues
11488 * src/mathed/math_panel.C +
11489 * src/insets/inseterror.C +
11490 * src/insets/insetinfo.C +
11491 * src/insets/inseturl.C +
11492 * src/insets/inseturl.h +
11494 * src/LyXSendto.C +
11495 * src/PaperLayout.C +
11496 * src/ParagraphExtra.C +
11497 * src/TableLayout.C +
11499 * src/layout_forms.C +
11506 * src/menus.C: fixed various resize issues. So now forms can be
11507 resized savely or not be resized at all.
11509 * forms/form_url.fd +
11510 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11513 * src/insets/Makefile.am: added files form_url.[Ch]
11515 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11517 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11518 (and presumably 6.2).
11520 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11521 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11522 remaining static member callbacks.
11524 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11527 * src/support/lyxstring.h: declare struct Srep as friend of
11528 lyxstring, since DEC cxx complains otherwise.
11530 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11532 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11534 * src/LaTeX.C (run): made run_bibtex also depend on files with
11536 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11537 are put into the dependency file.
11539 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11540 the code has shown itself to work
11541 (create_ispell_pipe): removed another warning, added a comment
11544 * src/minibuffer.C (ExecutingCB): removed code that has been
11545 commented out a long time
11547 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11548 out code + a warning.
11550 * src/support/lyxstring.h: comment out the three private
11551 operators, when compiling with string ansi conforming compilers
11552 they make problems.
11554 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11556 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11557 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11560 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11563 * src/mathed/math_panel.C (create_math_panel): remove explicit
11566 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11569 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11570 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11571 to XCreatePixmapFromBitmapData
11572 (fl_set_bmtable_data): change the last argument to be unsigned
11574 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11575 and bh to be unsigned int, remove explicit casts in call to
11576 XReadBitmapFileData.
11578 * images/arrows.xbm: made the arrays unsigned char *
11579 * images/varsz.xbm: ditto
11580 * images/misc.xbm: ditto
11581 * images/greek.xbm: ditto
11582 * images/dots.xbm: ditto
11583 * images/brel.xbm: ditto
11584 * images/bop.xbm: ditto
11586 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11588 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11589 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11590 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11592 (LYX_CXX_CHEADERS): added <clocale> to the test.
11594 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11596 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11598 * src/support/lyxstring.C (append): fixed something that must be a
11599 bug, rep->assign was used instead of rep->append.
11601 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11604 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11605 lyx insert double chars. Fix spotted by Kayvan.
11607 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11609 * Fixed the tth support. I messed up with the Emacs patch apply feature
11610 and omitted the changes in lyxrc.C.
11612 1999-10-22 Juergen Vigna <jug@sad.it>
11614 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11616 * src/lyx_cb.C (MenuInsertRef) +
11617 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11618 the form cannot be resized under it limits (fixes a segfault)
11620 * src/lyx.C (create_form_form_ref) +
11621 * forms/lyx.fd: Changed Gravity on name input field so that it is
11624 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11626 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11627 <ostream> and <istream>.
11629 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11630 whether <fstream> provides the latest standard features, or if we
11631 have an oldstyle library (like in egcs).
11632 (LYX_CXX_STL_STRING): fix the test.
11634 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11635 code on MODERN_STL_STREAM.
11637 * src/support/lyxstring.h: use L{I,O}stream.h.
11639 * src/support/L{I,O}stream.h: new files, designed to setup
11640 correctly streams for our use
11641 - includes the right header depending on STL capabilities
11642 - puts std::ostream and std::endl (for LOStream.h) or
11643 std::istream (LIStream.h) in toplevel namespace.
11645 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11647 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11648 was a bib file that had been changed we ensure that bibtex is run.
11649 (runBibTeX): enhanced to extract the names of the bib files and
11650 getting their absolute path and enter them into the dep file.
11651 (findtexfile): static func that is used to look for tex-files,
11652 checks for absolute patchs and tries also with kpsewhich.
11653 Alternative ways of finding the correct files are wanted. Will
11655 (do_popen): function that runs a command using popen and returns
11656 the whole output of that command in a string. Should be moved to
11659 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11660 file with extension ext has changed.
11662 * src/insets/figinset.C: added ifdef guards around the fl_free
11663 code that jug commented out. Now it is commented out when
11664 compiling with XForms == 0.89.
11666 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11667 to lyxstring.C, and only keep a forward declaration in
11668 lyxstring.h. Simplifies the header file a bit and should help a
11669 bit on compile time too. Also changes to Srep will not mandate a
11670 recompile of code just using string.
11671 (~lyxstring): definition moved here since it uses srep.
11672 (size): definition moved here since it uses srep.
11674 * src/support/lyxstring.h: removed a couple of "inline" that should
11677 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11679 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11682 1999-10-21 Juergen Vigna <jug@sad.it>
11684 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11685 set to left if I just remove the width entry (or it is empty).
11687 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11688 paragraph when having dummy paragraphs.
11690 1999-10-20 Juergen Vigna <jug@sad.it>
11692 * src/insets/figinset.C: just commented some fl_free_form calls
11693 and added warnings so that this calls should be activated later
11694 again. This avoids for now a segfault, but we have a memory leak!
11696 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11697 'const char * argument' to 'string argument', this should
11698 fix some Asserts() in lyxstring.C.
11700 * src/lyxfunc.h: Removed the function argAsString(const char *)
11701 as it is not used anymore.
11703 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11705 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11708 * src/Literate.h: some funcs moved from public to private to make
11709 interface clearer. Unneeded args removed.
11711 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11713 (scanBuildLogFile): ditto
11715 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11716 normal TeX Error. Still room for improvement.
11718 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11720 * src/buffer.C (insertErrors): changes to make the error
11721 desctription show properly.
11723 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11726 * src/support/lyxstring.C (helper): changed to use
11727 sizeof(object->rep->ref).
11728 (operator>>): changed to use a pointer instead.
11730 * src/support/lyxstring.h: changed const reference & to value_type
11731 const & lets see if that helps.
11733 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11735 * Makefile.am (rpmdist): fixed to have non static package and
11738 * src/support/lyxstring.C: removed the compilation guards
11740 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11743 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11744 conditional compile of lyxstring.Ch
11746 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11747 stupid check, but it is a lot better than the bastring hack.
11748 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11750 * several files: changed string::erase into string::clear. Not
11753 * src/chset.C (encodeString): use a char temporary instead
11755 * src/table.C (TexEndOfCell): added tostr around
11756 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11757 (TexEndOfCell): ditto
11758 (TexEndOfCell): ditto
11759 (TexEndOfCell): ditto
11760 (DocBookEndOfCell): ditto
11761 (DocBookEndOfCell): ditto
11762 (DocBookEndOfCell): ditto
11763 (DocBookEndOfCell): ditto
11765 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11767 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11769 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11770 (MenuBuildProg): added tostr around ret
11771 (MenuRunChktex): added tostr around ret
11772 (DocumentApplyCB): added tostr around ret
11774 * src/chset.C (encodeString): added tostr around t->ic
11776 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11777 (makeLaTeXFile): added tostr around tocdepth
11778 (makeLaTeXFile): added tostr around ftcound - 1
11780 * src/insets/insetbib.C (setCounter): added tostr around counter.
11782 * src/support/lyxstring.h: added an operator+=(int) to catch more
11785 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11786 (lyxstring): We DON'T allow NULL pointers.
11788 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11790 * src/mathed/math_macro.C (MathMacroArgument::Write,
11791 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11792 when writing them out.
11794 * src/LString.C: remove, since it is not used anymore.
11796 * src/support/lyxstring.C: condition the content to
11797 USE_INCLUDED_STRING macro.
11799 * src/mathed/math_symbols.C, src/support/lstrings.C,
11800 src/support/lyxstring.C: add `using' directive to specify what
11801 we need in <algorithm>. I do not think that we need to
11802 conditionalize this, but any thought is appreciated.
11804 * many files: change all callback functions to "C" linkage
11805 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11806 strict_ansi. Those who were static are now global.
11807 The case of callbacks which are static class members is
11808 trickier, since we have to make C wrappers around them (see
11809 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11810 did not finish this yet, since it defeats the purpose of
11811 encapsulation, and I am not sure what the best route is.
11813 1999-10-19 Juergen Vigna <jug@sad.it>
11815 * src/support/lyxstring.C (lyxstring): we permit to have a null
11816 pointer as assignment value and just don't assign it.
11818 * src/vspace.C (nextToken): corrected this function substituting
11819 find_first(_not)_of with find_last_of.
11821 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11822 (TableOptCloseCB) (TableSpeCloseCB):
11823 inserted fl_set_focus call for problem with fl_hide_form() in
11826 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11828 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11831 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11833 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11834 LyXLex::next() and not eatline() to get its argument.
11836 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11838 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11839 instead, use fstreams for io of the depfile, removed unneeded
11840 functions and variables.
11842 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11843 vector instead, removed all functions and variables that is not in
11846 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11848 * src/buffer.C (insertErrors): use new interface to TeXError
11850 * Makefile.am (rpmdist): added a rpmdist target
11852 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11853 per Kayvan's instructions.
11855 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11857 * src/Makefile.am: add a definition for localedir, so that locales
11858 are found after installation (Kayvan)
11860 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11862 * development/.cvsignore: new file.
11864 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11866 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11867 C++ compiler provides wrappers for C headers and use our alternate
11870 * configure.in: use LYX_CXX_CHEADERS.
11872 * src/cheader/: new directory, populated with cname headers from
11873 libstdc++-2.8.1. They are a bit old, but probably good enough for
11874 what we want (support compilers who lack them).
11876 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11877 from includes. It turns out is was stupid.
11879 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11881 * lib/Makefile.am (install-data-local): forgot a ';'
11882 (install-data-local): forgot a '\'
11883 (libinstalldirs): needed after all. reintroduced.
11885 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11887 * configure.in (AC_OUTPUT): added lyx.spec
11889 * development/lyx.spec: removed file
11891 * development/lyx.spec.in: new file
11893 * po/*.po: merged with lyx.pot becuase of make distcheck
11895 * lib/Makefile.am (dist-hook): added dist-hook so that
11896 documentation files will be included when doing a make
11897 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11898 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11900 more: tried to make install do the right thing, exclude CVS dirs
11903 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11904 Path would fit in more nicely.
11906 * all files that used to use pathstack: uses now Path instead.
11907 This change was a lot easier than expected.
11909 * src/support/path.h: new file
11911 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11913 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11915 * src/support/lyxstring.C (getline): Default arg was given for
11918 * Configure.cmd: removed file
11920 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11922 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11923 streams classes and types, add the proper 'using' statements when
11924 MODERN_STL is defined.
11926 * src/debug.h: move the << operator definition after the inclusion
11929 * src/support/filetools.C: include "LAssert.h", which is needed
11932 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11935 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11936 include "debug.h" to define a proper ostream.
11938 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11940 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11941 method to the SystemCall class which can kill a process, but it's
11942 not fully implemented yet.
11944 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11946 * src/support/FileInfo.h: Better documentation
11948 * src/lyxfunc.C: Added support for buffer-export html
11950 * src/menus.C: Added Export->As HTML...
11952 * lib/bind/*.bind: Added short-cut for buffer-export html
11954 * src/lyxrc.*: Added support for new \tth_command
11956 * lib/lyxrc.example: Added stuff for new \tth_command
11958 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11960 * lib/Makefile.am (IMAGES): removed images/README
11961 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11962 installes in correct place. Check permisions is installed
11965 * src/LaTeX.C: some no-op changes moved declaration of some
11968 * src/LaTeX.h (LATEX_H): changed include guard name
11970 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11972 * lib/reLyX/Makefile.am: install noweb2lyx.
11974 * lib/Makefile.am: install configure.
11976 * lib/reLyX/configure.in: declare a config aux dir; set package
11977 name to lyx (not sure what the best solution is); generate noweb2lyx.
11979 * lib/layouts/egs.layout: fix the bibliography layout.
11981 1999-10-08 Jürgen Vigna <jug@sad.it>
11983 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11984 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11985 it returned without continuing to search the path.
11987 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11989 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11990 also fixes a bug. It is not allowed to do tricks with std::strings
11991 like: string a("hei"); &a[e]; this will not give what you
11992 think... Any reason for the complexity in this func?
11994 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11996 * Updated README and INSTALL a bit, mostly to check that my
11997 CVS rights are correctly set up.
11999 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
12001 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
12002 does not allow '\0' chars but lyxstring and std::string does.
12004 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
12006 * autogen.sh (AUTOCONF): let the autogen script create the
12007 POTFILES.in file too. POTFILES.in should perhaps now not be
12008 included in the cvs module.
12010 * some more files changed to use C++ includes instead of C ones.
12012 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
12014 (Reread): added tostr to nlink. buggy output otherwise.
12015 (Reread): added a string() around szMode when assigning to Buffer,
12016 without this I got a log of garbled info strings.
12018 * acconfig.h: commented out the PTR_AS_INT macros. They should not
12021 * I have added several ostream & operator<<(ostream &, some_type)
12022 functions. This has been done to avoid casting and warnings when
12023 outputting enums to lyxerr. This as thus eliminated a lot of
12024 explicit casts and has made the code clearer. Among the enums
12025 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
12026 mathed enums, some font enum the Debug::type enum.
12028 * src/support/lyxstring.h (clear): missing method. equivalent of
12031 * all files that contained "stderr": rewrote constructs that used
12032 stderr to use lyxerr instead. (except bmtable)
12034 * src/support/DebugStream.h (level): and the passed t with
12035 Debug::ANY to avoid spurious bits set.
12037 * src/debug.h (Debug::type value): made it accept strings of the
12038 type INFO,INIT,KEY.
12040 * configure.in (Check for programs): Added a check for kpsewhich,
12041 the latex generation will use this later to better the dicovery of
12044 * src/BufferView.C (create_view): we don't need to cast this to
12045 (void*) that is done automatically.
12046 (WorkAreaButtonPress): removed some dead code.
12048 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12050 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12051 is not overwritten when translated (David Sua'rez de Lis).
12053 * lib/CREDITS: Added David Sua'rez de Lis
12055 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12057 * src/bufferparams.C (BufferParams): default input encoding is now
12060 * acinclude.m4 (cross_compiling): comment out macro
12061 LYX_GXX_STRENGTH_REDUCE.
12063 * acconfig.h: make sure that const is not defined (to empty) when
12064 we are compiling C++. Remove commented out code using SIZEOF_xx
12067 * configure.in : move the test for const and inline as late as
12068 possible so that these C tests do not interefere with C++ ones.
12069 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12070 has not been proven.
12072 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12074 * src/table.C (getDocBookAlign): remove bad default value for
12075 isColumn parameter.
12077 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12079 (ShowFileMenu2): ditto.
12081 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12082 of files to ignore.
12084 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12086 * Most files: finished the change from the old error code to use
12087 DebugStream for all lyxerr debugging. Only minor changes remain
12088 (e.g. the setting of debug levels using strings instead of number)
12090 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12092 * src/layout.C (Add): Changed to use compare_no_case instead of
12095 * src/FontInfo.C: changed loop variable type too string::size_type.
12097 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12099 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12100 set ETAGS_ARGS to --c++
12102 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12104 * src/table.C (DocBookEndOfCell): commented out two unused variables
12106 * src/paragraph.C: commented out four unused variables.
12108 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12109 insed a if clause with type string::size_type.
12111 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12114 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12116 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12117 variable, also changed loop to go from 0 to lenght + 1, instead of
12118 -1 to length. This should be correct.
12120 * src/LaTeX.C (scanError): use string::size_type as loop variable
12123 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12124 (l.896) since y_tmp and row was not used anyway.
12126 * src/insets/insetref.C (escape): use string::size_type as loop
12129 * src/insets/insetquotes.C (Width): use string::size_type as loop
12131 (Draw): use string::size_type as loop variable type.
12133 * src/insets/insetlatexaccent.C (checkContents): use
12134 string::size_type as loop variable type.
12136 * src/insets/insetlabel.C (escape): use string::size_type as loop
12139 * src/insets/insetinfo.C: added an extern for current_view.
12141 * src/insets/insetcommand.C (scanCommand): use string::size_type
12142 as loop variable type.
12144 * most files: removed the RCS tags. With them we had to recompile
12145 a lot of files after a simple cvs commit. Also we have never used
12146 them for anything meaningful.
12148 * most files: tags-query-replace NULL 0. As adviced several plases
12149 we now use "0" instead of "NULL" in our code.
12151 * src/support/filetools.C (SpaceLess): use string::size_type as
12152 loop variable type.
12154 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12156 * src/paragraph.C: fixed up some more string stuff.
12158 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12160 * src/support/filetools.h: make modestr a std::string.
12162 * src/filetools.C (GetEnv): made ch really const.
12164 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12165 made code that used these use max/min from <algorithm> instead.
12167 * changed several c library include files to their equivalent c++
12168 library include files. All is not changed yet.
12170 * created a support subdir in src, put lyxstring and lstrings
12171 there + the extra files atexit, fileblock, strerror. Created
12172 Makefile.am. edited configure.in and src/Makefile.am to use this
12173 new subdir. More files moved to support.
12175 * imported som of the functions from repository lyx, filetools
12177 * ran tags-query-replace on LString -> string, corrected the bogus
12178 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12179 is still some errors in there. This is errors where too much or
12180 too litle get deleted from strings (string::erase, string::substr,
12181 string::replace), there can also be some off by one errors, or
12182 just plain wrong use of functions from lstrings. Viewing of quotes
12185 * LyX is now running fairly well with string, but there are
12186 certainly some bugs yet (see above) also string is quite different
12187 from LString among others in that it does not allow null pointers
12188 passed in and will abort if it gets any.
12190 * Added the revtex4 files I forgot when setting up the repository.
12192 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12194 * All over: Tried to clean everything up so that only the files
12195 that we really need are included in the cvs repository.
12196 * Switched to use automake.
12197 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12198 * Install has not been checked.
12200 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12202 * po/pt.po: Three errors:
12203 l.533 and l.538 format specification error
12204 l. 402 duplicate entry, I just deleted it.