1 2000-09-11 Juergen Vigna <jug@sad.it>
3 * src/spellchecker.C (sc_accept_word): change to add_to_session.
5 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
7 2000-09-08 Juergen Vigna <jug@sad.it>
9 * src/lyx_gui.C (create_forms): don't display the "default" entry as
10 we have already "Reset".
12 * src/language.C (initL): inserted "default" language and made this
13 THE default language (and not american!)
15 * src/paragraph.C: inserted handling of "default" language!
17 * src/lyxfont.C: ditto
21 * src/paragraph.C: output the \\par only if we have a following
22 paragraph otherwise it's not needed.
24 2000-09-05 Juergen Vigna <jug@sad.it>
26 * config/pspell.m4: added entry to lyx-flags
28 * src/spellchecker.C: modified version from Kevin for using pspell
30 2000-09-01 Marko Vendelin <markov@ioc.ee>
31 * src/frontends/gnome/Makefile.am
32 * src/frontends/gnome/FormCitation.C
33 * src/frontends/gnome/FormCitation.h
34 * src/frontends/gnome/diainsertcitation_callbacks.c
35 * src/frontends/gnome/diainsertcitation_callbacks.h
36 * src/frontends/gnome/diainsertcitation_interface.c
37 * src/frontends/gnome/diainsertcitation_interface.h
38 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
39 dialog for Gnome frontend
41 * src/main.C: Gnome libraries require keeping application name
42 and its version as strings
44 * src/frontends/gnome/mainapp.C: Change the name of the main window
45 from GnomeLyX to PACKAGE
47 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
49 * src/frontends/Liason.C: add "using: declaration.
51 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
53 * src/mathed/math_macro.C (Metrics): Set the size of the template
55 * src/mathed/formulamacro.C (Latex): Fixed the returned value
57 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
59 * src/converter.C (add_options): New function.
60 (SetViewer): Change $$FName into '$$FName'.
61 (View): Add options when running xdvi
62 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
63 (Convert): The 3rd parameter is now the desired filename. Converts
64 calls to lyx::rename if necessary.
65 Add options when running dvips.
66 (dvi_papersize,dvips_options): New methods.
68 * src/exporter.C (Export): Use getLatexName() instead of fileName().
70 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
71 using a call to Converter::dvips_options.
72 Fixed to work with nex export code.
75 * src/support/rename.C: New files
77 * src/support/syscall.h
78 * src/support/syscall.C: Added Starttype SystemDontWait.
80 * lib/ui/default.ui: Changed to work with new export code
82 * lib/configure.m4: Changed to work with new export code
84 * src/encoding.C: Changed latex name for iso8859_7 encoding.
86 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
88 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
89 so that code compiles with DEC cxx.
91 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
92 to work correctly! Also now supports the additional elements
95 2000-09-01 Allan Rae <rae@lyx.org>
97 * src/frontends/ButtonPolicies.C: renamed all the references to
98 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
100 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
101 since it's a const not a type.
103 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
105 2000-08-31 Juergen Vigna <jug@sad.it>
107 * src/insets/figinset.C: Various changes to look if the filename has
108 an extension and if not add it for inline previewing.
110 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
112 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
113 make buttonStatus and isReadOnly be const methods. (also reflect
114 this in derived classes.)
116 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
117 (nextState): change to be static inline, pass the StateMachine as
119 (PreferencesPolicy): remove casts
120 (OkCancelPolicy): remvoe casts
121 (OkCancelReadOnlyPolicy): remove casts
122 (NoRepeatedApplyReadOnlyPolicy): remove casts
123 (OkApplyCancelReadOnlyPolicy): remove casts
124 (OkApplyCancelPolicy): remove casts
125 (NoRepeatedApplyPolicy): remove casts
127 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
129 * src/converter.C: added some using directives
131 * src/frontends/ButtonPolicies.C: changes to overcome
132 "need lvalue" error with DEC c++
134 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
135 to WMHideCB for DEC c++
137 * src/frontends/xforms/Menubar_pimpl.C: added using directive
139 * src/frontends/xforms/forms/form_document.C.patch: use C callback
140 to BulletBMTableCB for DEC c++
142 2000-08-31 Allan Rae <rae@lyx.org>
144 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
145 character dialog separately from old document dialogs combo_language.
148 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
150 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
151 Removed LFUN_REF_CREATE.
153 * src/MenuBackend.C: Added new tags: toc and references
155 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
156 (add_lastfiles, add_documents, add_formats): Removed the unused smn
158 (add_toc, add_references): New methods.
159 (create_submenu): Handle correctly the case when there is a
160 seperator after optional menu items.
162 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
163 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
164 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
166 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
168 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
170 * src/converter.[Ch]: New file for converting between different
173 * src/export.[Ch]: New file for exporting a LyX file to different
176 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
177 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
178 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
179 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
180 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
181 RunDocBook, MenuExport.
183 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
184 Exporter::Preview methods if NEW_EXPORT is defined.
186 * src/buffer.C (Dispatch): Use Exporter::Export.
188 * src/lyxrc.C: Added new tags: \converter and \viewer.
191 * src/LyXAction.C: Define new lyx-function: buffer-update.
192 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
193 when NEW_EXPORT is defined.
195 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
197 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
199 * lib/ui/default.ui: Added submenus "view" and "update" to the
202 * src/filetools.C (GetExtension): New function.
204 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
206 2000-08-29 Allan Rae <rae@lyx.org>
208 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
210 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
211 (EnableDocumentLayout): removed
212 (DisableDocumentLayout): removed
213 (build): make use of ButtonController's read-only handling to
214 de/activate various objects. Replaces both of the above functions.
216 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
217 (readOnly): was read_only
218 (refresh): fixed dumb mistakes with read_only_ handling
220 * src/frontends/xforms/forms/form_document.fd:
221 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
222 tabbed dialogs so the tabs look more like tabs and so its easier to
223 work out which is the current tab.
225 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
226 segfault with form_table
228 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
230 2000-08-28 Juergen Vigna <jug@sad.it>
232 * acconfig.h: added USE_PSPELL.
234 * src/config.h.in: added USE_PSPELL.
236 * autogen.sh: added pspell.m4
238 * config/pspell.m4: new file.
240 * src/spellchecker.C: implemented support for pspell libary.
242 2000-08-25 Juergen Vigna <jug@sad.it>
244 * src/LyXAction.C (init): renamed LFUN_TABLE to
245 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
247 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
249 * src/lyxscreen.h: add force_clear variable and fuction to force
250 a clear area when redrawing in LyXText.
252 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
254 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
256 * some whitespace and comment changes.
258 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
260 * src/buffer.C: up te LYX_FORMAT to 2.17
262 2000-08-23 Juergen Vigna <jug@sad.it>
264 * src/BufferView_pimpl.C (tripleClick): disable this when in a
267 * src/insets/insettabular.C (pasteSelection): delete the insets
268 LyXText as it is not valid anymore.
269 (copySelection): new function.
270 (pasteSelection): new function.
271 (cutSelection): new function.
272 (LocalDispatch): implemented cut/copy/paste of cell selections.
274 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
275 don't have a LyXText.
277 * src/LyXAction.C (init): a NEW_TABULAR define too much.
279 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
282 2000-08-22 Juergen Vigna <jug@sad.it>
284 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
285 ifdef form_table out if NEW_TABULAR.
287 2000-08-21 Juergen Vigna <jug@sad.it>
289 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
290 (draw): fixed draw position so that the cursor is positioned in the
292 (InsetMotionNotify): hide/show cursor so the position is updated.
293 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
294 using cellstart() function where it should be used.
296 * src/insets/insettext.C (draw): ditto.
298 * src/tabular.C: fixed initialization of some missing variables and
299 made BoxType into an enum.
301 2000-08-22 Marko Vendelin <markov@ioc.ee>
302 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
303 stock menu item using action numerical value, not its string
307 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
309 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
310 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
312 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
314 * src/frontends/xforms/GUIRunTime.C: new file
316 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
317 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
319 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
321 * src/frontends/kde/GUIRunTime.C: new file
323 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
324 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
326 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
328 * src/frontends/gnome/GUIRunTime.C: new file
330 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
333 * src/frontends/GUIRunTime.h: removed constructor and destructor,
334 small change to documetentation.
336 * src/frontends/GUIRunTime.C: removed file
338 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
340 * src/lyxparagraph.h: enable NEW_TABULAR as default
342 * src/lyxfunc.C (processKeySym): remove some commented code
344 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
345 NEW_TABULAR around the fd_form_table_options.
347 * src/lyx_gui.C (runTime): call the static member function as
348 GUIRunTime::runTime().
350 2000-08-21 Allan Rae <rae@lyx.org>
352 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
355 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
357 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
359 2000-08-21 Allan Rae <rae@lyx.org>
361 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
363 * src/frontends/xforms/FormPreferences.C (build): use setOK
364 * src/frontends/xforms/FormDocument.C (build): use setOK
365 (FormDocument): use the appropriate policy.
367 2000-08-21 Allan Rae <rae@lyx.org>
369 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
370 automatic [de]activation of arbitrary objects when in a read-only state.
372 * src/frontends/ButtonPolicies.h: More documentation
373 (isReadOnly): added to support the above.
375 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
377 2000-08-18 Juergen Vigna <jug@sad.it>
379 * src/insets/insettabular.C (getStatus): changed to return func_status.
381 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
382 display toggle menu entries if they are.
384 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
385 new document layout now.
387 * src/lyxfunc.C: ditto
389 * src/lyx_gui_misc.C: ditto
391 * src/lyx_gui.C: ditto
393 * lib/ui/default.ui: removed paper and quotes layout as they are now
394 all in the document layout tabbed folder.
396 * src/frontends/xforms/forms/form_document.fd: added Restore
397 button and callbacks for all inputs for Allan's ButtonPolicy.
399 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
400 (CheckChoiceClass): added missing params setting on class change.
401 (UpdateLayoutDocument): added for updating the layout on params.
402 (build): forgot to RETURN_ALWAYS input_doc_spacing.
403 (FormDocument): Implemented Allan's ButtonPolicy with the
406 2000-08-17 Allan Rae <rae@lyx.org>
408 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
409 so we can at least see the credits again.
411 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
412 controller calls for the appropriate callbacks. Note that since Ok
413 calls apply followed by cancel, and apply isn't a valid input for the
414 APPLIED state, the bc_ calls have to be made in the static callback not
415 within each of the real callbacks.
417 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
418 (setOk): renamed from setOkay()
420 2000-08-17 Juergen Vigna <jug@sad.it>
422 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
423 in the implementation part.
424 (composeUIInfo): don't show optional menu-items.
426 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
428 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
430 * src/bufferview_funcs.C (CurrentState): fixed to show also the
431 text-state when in a text-inset.
433 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
435 2000-08-17 Marko Vendelin <markov@ioc.ee>
436 * src/frontends/gnome/FormIndex.C
437 * src/frontends/gnome/FormIndex.h
438 * src/frontends/gnome/FormToc.C
439 * src/frontends/gnome/FormToc.h
440 * src/frontends/gnome/dialogs
441 * src/frontends/gnome/diatoc_callbacks.c
442 * src/frontends/gnome/diatoc_callbacks.h
443 * src/frontends/gnome/diainsertindex_callbacks.h
444 * src/frontends/gnome/diainsertindex_callbacks.c
445 * src/frontends/gnome/diainsertindex_interface.c
446 * src/frontends/gnome/diainsertindex_interface.h
447 * src/frontends/gnome/diatoc_interface.h
448 * src/frontends/gnome/diatoc_interface.c
449 * src/frontends/gnome/Makefile.am: Table of Contents and
450 Insert Index dialogs implementation for Gnome frontend
452 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
454 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
456 * src/frontends/gnome/diainserturl_interface.c: make the dialog
459 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
461 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
462 destructor. Don't definde if you don't need it
463 (processEvents): made static, non-blocking events processing for
465 (runTime): static method. event loop for xforms
466 * similar as above for kde and gnome.
468 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
470 (runTime): new method calss the real frontends runtime func.
472 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
474 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
476 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
478 2000-08-16 Juergen Vigna <jug@sad.it>
480 * src/lyx_gui.C (runTime): added GUII RunTime support.
482 * src/frontends/Makefile.am:
483 * src/frontends/GUIRunTime.[Ch]:
484 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
485 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
486 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
488 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
490 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
491 as this is already set in ${FRONTEND_INCLUDE} if needed.
493 * configure.in (CPPFLAGS): setting the include dir for the frontend
494 directory and don't set FRONTEND=xforms for now as this is executed
497 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
499 * src/frontends/kde/Makefile.am:
500 * src/frontends/kde/FormUrl.C:
501 * src/frontends/kde/FormUrl.h:
502 * src/frontends/kde/formurldialog.h:
503 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
505 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
507 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
509 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
511 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
514 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
516 * src/WorkArea.C (work_area_handler): more work to get te
517 FL_KEYBOARD to work with xforms 0.88 too, please test.
519 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
521 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
523 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
526 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
528 * src/Timeout.h: remove Qt::emit hack.
530 * several files: changes to allo doc++ compilation
532 * src/lyxfunc.C (processKeySym): new method
533 (processKeyEvent): comment out if FL_REVISION < 89
535 * src/WorkArea.C: change some debugging levels.
536 (WorkArea): set wantkey to FL_KEY_ALL
537 (work_area_handler): enable the FL_KEYBOARD clause, this enables
538 clearer code and the use of compose with XForms 0.89. Change to
539 use signals instead of calling methods in bufferview directly.
541 * src/Painter.C: change some debugging levels.
543 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
546 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
547 (workAreaKeyPress): new method
549 2000-08-14 Juergen Vigna <jug@sad.it>
551 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
553 * config/kde.m4: addes some features
555 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
556 include missing xforms dialogs.
558 * src/Timeout.h: a hack to be able to compile with qt/kde.
560 * sigc++/.cvsignore: added acinclude.m4
562 * lib/.cvsignore: added listerros
564 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
565 xforms tree as objects are needed for other frontends.
567 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
568 linking with not yet implemented xforms objects.
570 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
572 2000-08-14 Baruch Even <baruch.even@writeme.com>
574 * src/frontends/xforms/FormGraphics.h:
575 * src/frontends/xforms/FormGraphics.C:
576 * src/frontends/xforms/RadioButtonGroup.h:
577 * src/frontends/xforms/RadioButtonGroup.C:
578 * src/insets/insetgraphics.h:
579 * src/insets/insetgraphics.C:
580 * src/insets/insetgraphicsParams.h:
581 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
582 instead of spaces, and various other indentation issues to make the
583 sources more consistent.
585 2000-08-14 Marko Vendelin <markov@ioc.ee>
587 * src/frontends/gnome/dialogs/diaprint.glade
588 * src/frontends/gnome/FormPrint.C
589 * src/frontends/gnome/FormPrint.h
590 * src/frontends/gnome/diaprint_callbacks.c
591 * src/frontends/gnome/diaprint_callbacks.h
592 * src/frontends/gnome/diaprint_interface.c
593 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
596 * src/frontends/gnome/dialogs/diainserturl.glade
597 * src/frontends/gnome/FormUrl.C
598 * src/frontends/gnome/FormUrl.h
599 * src/frontends/gnome/diainserturl_callbacks.c
600 * src/frontends/gnome/diainserturl_callbacks.h
601 * src/frontends/gnome/diainserturl_interface.c
602 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
605 * src/frontends/gnome/Dialogs.C
606 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
607 all other dialogs. Copy all unimplemented dialogs from Xforms
610 * src/frontends/gnome/support.c
611 * src/frontends/gnome/support.h: support files generated by Glade
615 * config/gnome.m4: Gnome configuration scripts
617 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
618 configure --help message
620 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
621 only if there are no events pendling in Gnome/Gtk. This enhances
622 the performance of menus.
625 2000-08-14 Allan Rae <rae@lyx.org>
627 * lib/Makefile.am: listerrors cleaning
629 * lib/listerrors: removed -- generated file
630 * acinclude.m4: ditto
631 * sigc++/acinclude.m4: ditto
633 * src/frontends/xforms/forms/form_citation.fd:
634 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
637 * src/frontends/xforms/forms/makefile: I renamed the `install` target
638 `updatesrc` and now we have a `test` target that does what `updatesrc`
639 used to do. I didn't like having an install target that wasn't related
642 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
643 on all except FormGraphics. This may yet happen. Followed by a major
644 cleanup including using FL_TRANSIENT for most of the dialogs. More
645 changes to come when the ButtonController below is introduced.
647 * src/frontends/xforms/ButtonController.h: New file for managing up to
648 four buttons on a dialog according to an externally defined policy.
649 * src/frontends/xforms/Makefile.am: added above
651 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
652 Apply and Cancel/Close buttons and everything in between and beyond.
653 * src/frontends/Makefile.am: added above.
655 * src/frontends/xforms/forms/form_preferences.fd:
656 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
657 and removed variable 'status' as a result. Fixed the set_minsize thing.
658 Use the new screen-font-update after checking screen fonts were changed
659 Added a "Restore" button to restore the original lyxrc values while
660 editing. This restores everything not just the last input changed.
661 That's still a tricky one. As is the "LyX: this shouldn't happen..."
663 * src/LyXAction.C: screen-font-update added for updating buffers after
664 screen font settings have been changed.
665 * src/commandtags.h: ditto
666 * src/lyxfunc.C: ditto
668 * forms/lyx.fd: removed screen fonts dialog.
669 * src/lyx_gui.C: ditto
670 * src/menus.[Ch]: ditto
671 * src/lyx.[Ch]: ditto
672 * src/lyx_cb.C: ditto + code from here moved to make
673 screen-font-update. And people wonder why progress on GUII is
674 slow. Look at how scattered this stuff was! It takes forever
677 * forms/fdfix.sh: Fixup the spacing after commas.
678 * forms/makefile: Remove date from generated files. Fewer clashes now.
679 * forms/bullet_forms.C.patch: included someones handwritten changes
681 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
682 once I've discovered why LyXRC was made noncopyable.
683 * src/lyx_main.C: ditto
685 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
687 * src/frontends/xforms/forms/fdfix.sh:
688 * src/frontends/xforms/forms/fdfixh.sed:
689 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
690 * src/frontends/xforms/Form*.[hC]:
691 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
692 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
693 provide a destructor for the struct FD_form_xxxx. Another version of
694 the set_[max|min]size workaround and a few other cleanups. Actually,
695 Angus' patch from 20000809.
697 2000-08-13 Baruch Even <baruch.even@writeme.com>
699 * src/insets/insetgraphics.C (Clone): Added several fields that needed
702 2000-08-11 Juergen Vigna <jug@sad.it>
704 * src/insets/insetgraphics.C (InsetGraphics): changing init
705 order because of warnings.
707 * src/frontends/xforms/forms/makefile: adding patching .C with
710 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
711 from .C.patch to .c.patch
713 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
714 order because of warning.
716 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
718 * src/frontends/Liason.C (setMinibuffer): new helper function
720 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
722 * src/lyxfunc.C (Dispatch): calling new Document-Layout
724 * lib/ui/default.ui: commented out PaperLayout entry
726 * src/frontends/xforms/form_document.[Ch]: new added files
728 * src/frontends/xforms/FormDocument.[Ch]: ditto
730 * src/frontends/xforms/forms/form_document.fd: ditto
732 * src/frontends/xforms/forms/form_document.C.patch: ditto
734 2000-08-10 Juergen Vigna <jug@sad.it>
736 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
737 (InsetGraphics): initialized cacheHandle to 0.
738 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
740 2000-08-10 Baruch Even <baruch.even@writeme.com>
742 * src/graphics/GraphicsCache.h:
743 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
744 correctly as a cache.
746 * src/graphics/GraphicsCacheItem.h:
747 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
750 * src/graphics/GraphicsCacheItem_pimpl.h:
751 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
754 * src/insets/insetgraphics.h:
755 * src/insets/insetgraphics.C: Changed from using a signal notification
756 to polling when image is not loaded.
758 2000-08-10 Allan Rae <rae@lyx.org>
760 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
761 that there are two functions that have to been taken out of line by
762 hand and aren't taken care of in the script. (Just a reminder note)
764 * sigc++/macros/*.h.m4: Updated as above.
766 2000-08-09 Juergen Vigna <jug@sad.it>
768 * src/insets/insettext.C (draw): small fix for clearing rectangle.
770 * src/insets/insettabular.C: make drawing of single cell smarter.
772 2000-08-09 Marko Vendelin <markov@ioc.ee>
773 * src/frontends/gnome/Menubar_pimpl.C
774 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
775 implementation: new files
777 * src/frontends/gnome/mainapp.C
778 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
781 * src/main.C: create Gnome main window
783 * src/frontends/xforms/Menubar_pimpl.h
784 * src/frontends/Menubar.C
785 * src/frontends/Menubar.h: added method Menubar::update that calls
786 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
788 * src/LyXView.C: calls Menubar::update to update the state
791 * src/frontends/gnome/Makefile.am: added new files
793 * src/frontends/Makefile.am: added frontend compiler options
795 2000-08-08 Juergen Vigna <jug@sad.it>
797 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
799 * src/bufferlist.C (close):
800 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
801 documents if exiting without saving.
803 * src/buffer.C (save): use removeAutosaveFile()
805 * src/support/filetools.C (removeAutosaveFile): new function.
807 * src/lyx_cb.C (MenuWrite): returns a bool now.
808 (MenuWriteAs): check if file could really be saved and revert to the
810 (MenuWriteAs): removing old autosavefile if existant.
812 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
813 before Goto toggle declaration, because of compiler warning.
815 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
817 * src/lyxfunc.C (MenuNew): small fix.
819 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
821 * src/bufferlist.C (newFile):
822 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
824 * src/lyxrc.C: added new_ask_filename tag
826 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
828 * src/lyx.fd: removed code pertaining to form_ref
829 * src/lyx.[Ch]: ditto
830 * src/lyx_cb.C: ditto
831 * src/lyx_gui.C: ditto
832 * src/lyx_gui_misc.C: ditto
834 * src/BufferView_pimpl.C (restorePosition): update buffer only
837 * src/commandtags.h (LFUN_REFTOGGLE): removed
838 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
839 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
840 (LFUN_REFBACK): renamed LFUN_REF_BACK
842 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
844 * src/lyxfunc.C (Dispatch): ditto.
845 InsertRef dialog is now GUI-independent.
847 * src/texrow.C: added using std::endl;
849 * src/insets/insetref.[Ch]: strip out large amounts of code.
850 The inset is now a container and this functionality is now
851 managed by a new FormRef dialog
853 * src/frontends/Dialogs.h (showRef, createRef): new signals
855 * src/frontends/xforms/FormIndex.[Ch],
856 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
857 when setting dialog's min/max size
858 * src/frontends/xforms/FormIndex.[Ch]: ditto
860 * src/frontends/xforms/FormRef.[Ch],
861 src/frontends/xforms/forms/form_ref.fd: new xforms
862 implementation of an InsetRef dialog
864 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
867 * src/graphics/XPM_Renderer.C (isImageFormatOK):
868 ios::nocreate is not part of the standard. Removed.
870 2000-08-07 Baruch Even <baruch.even@writeme.com>
872 * src/graphics/Renderer.h:
873 * src/graphics/Renderer.C: Added base class for rendering of different
874 image formats into Pixmaps.
876 * src/graphics/XPM_Renderer.h:
877 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
878 in a different class.
880 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
881 easily add support for other formats.
883 * src/insets/figinset.C: plugged a leak of an X resource.
885 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
887 * src/CutAndPaste.[Ch]: make all metods static.
889 * development/Code_rules/Rules: more work, added section on
890 Exceptions, and a References section.
892 * a lot of header files: work to make doc++ able to generate the
893 source documentation, some workarounds of doc++ problems. Doc++ is
894 now able to generate the documentation.
896 2000-08-07 Juergen Vigna <jug@sad.it>
898 * src/insets/insettabular.C (recomputeTextInsets): removed function
900 * src/tabular.C (SetWidthOfMulticolCell):
902 (calculate_width_of_column_NMC): fixed return value so that it really
903 only returns true if the column-width has changed (there where
904 problems with muliticolumn-cells in this column).
906 2000-08-04 Juergen Vigna <jug@sad.it>
908 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
909 also on the scrollstatus of the inset.
910 (workAreaMotionNotify): ditto.
912 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
914 2000-08-01 Juergen Vigna <jug@sad.it>
916 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
919 * src/LyXAction.C (init):
920 * src/insets/inset.C (LocalDispatch): added support for
923 * src/insets/inset.C (scroll): new functions.
925 * src/insets/insettext.C (removeNewlines): new function.
926 (SetAutoBreakRows): removes forced newlines in the text of the
927 paragraph if autoBreakRows is set to false.
929 * src/tabular.C (Latex): generates a parbox around the cell contents
932 * src/frontends/xforms/FormTabular.C (local_update): removed
933 the radio_useparbox button.
935 * src/tabular.C (UseParbox): new function
937 2000-08-06 Baruch Even <baruch.even@writeme.com>
939 * src/graphics/GraphicsCache.h:
940 * src/graphics/GraphicsCache.C:
941 * src/graphics/GraphicsCacheItem.h:
942 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
945 * src/insets/insetgraphics.h:
946 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
947 drawing of the inline image.
949 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
950 into the wrong position.
952 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
955 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
957 * src/support/translator.h: move all typedefs to public section
959 * src/support/filetools.C (MakeLatexName): return string const
962 (FileOpenSearch): ditto
964 (LibFileSearch): ditto
965 (i18nLibFileSearch): ditto
968 (CreateTmpDir): ditto
969 (CreateBufferTmpDir): ditto
970 (CreateLyXTmpDir): ditto
975 (OnlyFilename): ditto
977 (NormalizePath): ditto
979 (GetFileContents): ditto
980 (ReplaceEnvironmentPath): ditto
983 (ChangeExtension): ditto
984 (MakeDisplayPath): ditto
985 (do_popen): return cmdret const
986 (findtexfile): return string const
988 * src/support/DebugStream.h: add some /// to please doc++
990 * src/frontends/DialogBase.h (endif): add some /// to please doc++
992 * src/texrow.C (same_rownumber): functor to use with find_if
993 (getIdFromRow): rewritten to use find_if and to not update the
994 positions. return true if row is found
995 (increasePos): new method, use to update positions
997 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
999 * src/lyxlex_pimpl.C (verifyTable): new method
1002 (GetString): return string const
1003 (pushTable): rewrite to use std::stack
1005 (setFile): better check
1008 * src/lyxlex.h: make LyXLex noncopyable
1010 * src/lyxlex.C (text): return char const * const
1011 (GetString): return string const
1012 (getLongString): return string const
1014 * src/lyx_gui_misc.C (askForText): return pair<...> const
1016 * src/lastfiles.[Ch] (operator): return string const
1018 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1019 istringstream not char const *.
1020 move token.end() out of loop.
1021 (readFile): move initializaton of token
1023 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1024 getIdFromRow is successful.
1026 * lib/bind/emacs.bind: don't include menus bind
1028 * development/Code_rules/Rules: the beginnings of making this
1029 better and covering more of the unwritten rules that we have.
1031 * development/Code_rules/Recommendations: a couple of wording
1034 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1036 * src/support/strerror.c: remove C++ comment.
1038 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1040 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1041 LFUN_INDEX_INSERT_LAST
1043 * src/texrow.C (getIdFromRow): changed from const_iterator to
1044 iterator, allowing code to compile with DEC cxx
1046 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1047 stores part of the class, as suggested by Allan. Will allow
1049 (apply): test to apply uses InsetCommandParams operator!=
1051 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1052 (apply): test to apply uses InsetCommandParams operator!=
1054 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1055 stores part of the class.
1056 (update): removed limits on min/max size.
1058 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1059 (apply): test to apply uses InsetCommandParams operator!=
1061 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1062 (Read, Write, scanCommand, getCommand): moved functionality
1063 into InsetCommandParams.
1065 (getScreenLabel): made pure virtual
1066 new InsetCommandParams operators== and !=
1068 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1069 c-tors based on InsetCommandParams. Removed others.
1070 * src/insets/insetinclude.[Ch]: ditto
1071 * src/insets/insetlabel.[Ch]: ditto
1072 * src/insets/insetparent.[Ch]: ditto
1073 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1075 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1076 insets derived from InsetCommand created using similar c-tors
1077 based on InsetCommandParams
1078 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1079 * src/menus.C (ShowRefsMenu): ditto
1080 * src/paragraph.C (Clone): ditto
1081 * src/text2.C (SetCounter): ditto
1082 * src/lyxfunc.C (Dispatch) ditto
1083 Also recreated old InsetIndex behaviour exactly. Can now
1084 index-insert at the start of a paragraph and index-insert-last
1085 without launching the pop-up.
1087 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1089 * lib/lyxrc.example: mark te pdf options as non functional.
1091 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1092 (isStrDbl): move tmpstr.end() out of loop.
1093 (strToDbl): move intialization of tmpstr
1094 (lowercase): return string const and move tmp.end() out of loop.
1095 (uppercase): return string const and move tmp.edn() out of loop.
1096 (prefixIs): add assertion
1101 (containsOnly): ditto
1102 (containsOnly): ditto
1103 (containsOnly): ditto
1104 (countChar): make last arg char not char const
1105 (token): return string const
1106 (subst): return string const, move tmp.end() out of loop.
1107 (subst): return string const, add assertion
1108 (strip): return string const
1109 (frontStrip): return string const, add assertion
1110 (frontStrip): return string const
1115 * src/support/lstrings.C: add inclde "LAssert.h"
1116 (isStrInt): move tmpstr.end() out of loop.
1118 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1119 toollist.end() out of loop.
1120 (deactivate): move toollist.end() out of loop.
1121 (update): move toollist.end() out of loop.
1122 (updateLayoutList): move tc.end() out of loop.
1123 (add): move toollist.end() out of loop.
1125 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1126 md.end() out of loop.
1128 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1130 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1133 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1134 (Erase): move insetlist.end() out of loop.
1136 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1137 ref to const string as first arg. Move initialization of some
1138 variables, whitespace changes.
1140 * src/kbmap.C (defkey): move table.end() out of loop.
1141 (kb_keymap): move table.end() out of loop.
1142 (findbinding): move table.end() out of loop.
1144 * src/MenuBackend.C (hasMenu): move end() out of loop.
1145 (getMenu): move end() out of loop.
1146 (getMenu): move menulist_.end() out of loop.
1148 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1150 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1153 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1154 (getFromLyXName): move infotab.end() out of loop.
1156 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1157 -fvtable-thunks -ffunction-sections -fdata-sections
1159 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1161 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1164 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1166 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1168 * src/frontends/xforms/FormCitation.[Ch],
1169 src/frontends/xforms/FormIndex.[Ch],
1170 src/frontends/xforms/FormToc.[Ch],
1171 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1173 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1175 * src/commandtags.h: renamed, created some flags for citation
1178 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1180 * src/lyxfunc.C (dispatch): use signals to insert index entry
1182 * src/frontends/Dialogs.h: new signal createIndex
1184 * src/frontends/xforms/FormCommand.[Ch],
1185 src/frontends/xforms/FormCitation.[Ch],
1186 src/frontends/xforms/FormToc.[Ch],
1187 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1189 * src/insets/insetindex.[Ch]: GUI-independent
1191 * src/frontends/xforms/FormIndex.[Ch],
1192 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1195 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1197 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1198 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1200 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1202 * src/insets/insetref.C (Latex): rewrite so that there is now
1203 question that a initialization is requested.
1205 * src/insets/insetcommand.h: reenable the hide signal
1207 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1209 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1210 fix handling of shortcuts (many bugs :)
1211 (add_lastfiles): ditto.
1213 * lib/ui/default.ui: fix a few shortcuts.
1215 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1217 * Makefile.am: Fix ``rpmdist'' target to return the exit
1218 status of the ``rpm'' command, instead of the last command in
1219 the chain (the ``rm lyx.xpm'' command, which always returns
1222 2000-08-02 Allan Rae <rae@lyx.org>
1224 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1225 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1226 * src/frontends/xforms/FormToc.C (FormToc): ditto
1228 * src/frontends/xforms/Makefile.am: A few forgotten files
1230 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1231 Signals-not-copyable-problem Lars' started commenting out.
1233 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1235 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1237 * src/insets/insetcommand.h: Signals is not copyable so anoter
1238 scheme for automatic hiding of forms must be used.
1240 * src/frontends/xforms/FormCitation.h: don't inerit from
1241 noncopyable, FormCommand already does that.
1242 * src/frontends/xforms/FormToc.h: ditto
1243 * src/frontends/xforms/FormUrl.h: ditto
1245 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1247 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1249 * src/insets/insetcommand.h (hide): new SigC::Signal0
1250 (d-tor) new virtual destructor emits hide signal
1252 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1253 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1255 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1256 LOF and LOT. Inset is now GUI-independent
1258 * src/insets/insetloa.[Ch]: redundant
1259 * src/insets/insetlof.[Ch]: ditto
1260 * src/insets/insetlot.[Ch]: ditto
1262 * src/frontends/xforms/forms/form_url.fd: tweaked!
1263 * src/frontends/xforms/forms/form_citation.fd: ditto
1265 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1266 dialogs dealing with InsetCommand insets
1268 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1269 FormCommand base class
1270 * src/frontends/xforms/FormUrl.[Ch]: ditto
1272 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1274 * src/frontends/xforms/FormToc.[Ch]: ditto
1276 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1277 passed a generic InsetCommand pointer
1278 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1280 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1281 and modified InsetTOC class
1282 * src/buffer.C: ditto
1284 * forms/lyx.fd: strip out old FD_form_toc code
1285 * src/lyx_gui_misc.C: ditto
1286 * src/lyx_gui.C: ditto
1287 * src/lyx_cb.C: ditto
1288 * src/lyx.[Ch]: ditto
1290 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1292 * src/support/utility.hpp: tr -d '\r'
1294 2000-08-01 Juergen Vigna <jug@sad.it>
1296 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1298 * src/commandtags.h:
1299 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1300 LFUN_TABULAR_FEATURES.
1302 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1303 LFUN_LAYOUT_TABULAR.
1305 * src/insets/insettabular.C (getStatus): implemented helper function.
1307 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1309 2000-07-31 Juergen Vigna <jug@sad.it>
1311 * src/text.C (draw): fixed screen update problem for text-insets.
1313 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1314 something changed probably this has to be added in various other
1317 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1319 2000-07-31 Baruch Even <baruch.even@writeme.com>
1321 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1322 templates to satisfy compaq cxx.
1325 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1327 * src/support/translator.h (equal_1st_in_pair::operator()): take
1328 const ref pair_type as arg.
1329 (equal_2nd_in_pair::operator()): ditto
1330 (Translator::~Translator): remove empty d-tor.
1332 * src/graphics/GraphicsCache.C: move include config.h to top, also
1333 put initialization of GraphicsCache::singleton here.
1334 (~GraphicsCache): move here
1335 (addFile): take const ref as arg
1338 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1340 * src/BufferView2.C (insertLyXFile): change te with/without header
1343 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1345 * src/frontends/xforms/FormGraphics.C (apply): add some
1346 static_cast. Not very nice, but required by compaq cxx.
1348 * src/frontends/xforms/RadioButtonGroup.h: include header
1349 <utility> instead of <pair.h>
1351 * src/insets/insetgraphicsParams.C: add using directive.
1352 (readResize): change return type to void.
1353 (readOrigin): ditto.
1355 * src/lyxfunc.C (getStatus): add missing break for build-program
1356 function; add test for Literate for export functions.
1358 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1359 entries in Options menu.
1361 2000-07-31 Baruch Even <baruch.even@writeme.com>
1363 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1364 protect against auto-allocation; release icon when needed.
1366 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1368 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1369 on usual typewriter.
1371 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1372 earlier czech.kmap), useful only for programming.
1374 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1376 * src/frontends/xforms/FormCitation.h: fix conditioning around
1379 2000-07-31 Juergen Vigna <jug@sad.it>
1381 * src/frontends/xforms/FormTabular.C (local_update): changed
1382 radio_linebreaks to radio_useparbox and added radio_useminipage.
1384 * src/tabular.C: made support for using minipages/parboxes.
1386 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1388 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1390 (descent): so the cursor is in the middle.
1391 (width): bit smaller box.
1393 * src/insets/insetgraphics.h: added display() function.
1395 2000-07-31 Baruch Even <baruch.even@writeme.com>
1397 * src/frontends/Dialogs.h: Added showGraphics signals.
1399 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1400 xforms form definition of the graphics dialog.
1402 * src/frontends/xforms/FormGraphics.h:
1403 * src/frontends/xforms/FormGraphics.C: Added files, the
1404 GUIndependent code of InsetGraphics
1406 * src/insets/insetgraphics.h:
1407 * src/insets/insetgraphics.C: Major writing to make it work.
1409 * src/insets/insetgraphicsParams.h:
1410 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1411 struct between InsetGraphics and GUI.
1413 * src/LaTeXFeatures.h:
1414 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1415 support for graphicx package.
1417 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1418 for the graphics inset.
1420 * src/support/translator.h: Added file, used in
1421 InsetGraphicsParams. this is a template to translate between two
1424 * src/frontends/xforms/RadioButtonGroup.h:
1425 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1426 way to easily control a radio button group.
1428 2000-07-28 Juergen Vigna <jug@sad.it>
1430 * src/insets/insettabular.C (LocalDispatch):
1431 (TabularFeatures): added support for lyx-functions of tabular features.
1432 (cellstart): refixed this function after someone wrongly changed it.
1434 * src/commandtags.h:
1435 * src/LyXAction.C (init): added support for tabular-features
1437 2000-07-28 Allan Rae <rae@lyx.org>
1439 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1440 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1441 triggers the callback for input checking. As a result we sometimes get
1442 "LyX: This shouldn't happen..." printed to cerr.
1443 (input): Started using status variable since I only free() on
1444 destruction. Some input checking for paths and font sizes.
1446 * src/frontends/xforms/FormPreferences.h: Use status to control
1447 activation of Ok and Apply
1449 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1450 callback. Also resized to stop segfaults with 0.88. The problem is
1451 that xforms-0.88 requires the folder to be wide enough to fit all the
1452 tabs. If it isn't it causes all sorts of problems.
1454 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1456 * src/frontends/xforms/forms/README: Reflect reality.
1458 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1459 * src/frontends/xforms/forms/makefile: ditto.
1461 * src/commandtags.h: Get access to new Preferences dialog
1462 * src/LyXAction.C: ditto
1463 * src/lyxfunc.C: ditto
1464 * lib/ui/default.ui: ditto
1466 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1468 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1470 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1473 * src/frontends/xforms/form_url.[Ch]: added.
1475 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1477 * src/insets/insetbib.h: fixed bug in previous commit
1479 * src/frontends/xforms/FormUrl.h: ditto
1481 * src/frontends/xforms/FormPrint.h: ditto
1483 * src/frontends/xforms/FormPreferences.h: ditto
1485 * src/frontends/xforms/FormCopyright.h: ditto
1487 * src/frontends/xforms/FormCitation.C: ditto
1489 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1490 private copyconstructor and private default contructor
1492 * src/support/Makefile.am: add utility.hpp
1494 * src/support/utility.hpp: new file from boost
1496 * src/insets/insetbib.h: set owner in clone
1498 * src/frontends/xforms/FormCitation.C: added missing include
1501 * src/insets/form_url.[Ch]: removed
1503 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1505 * development/lyx.spec.in
1506 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1507 file/directory re-organization.
1509 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1511 * src/insets/insetcommand.[Ch]: moved the string data and
1512 associated manipulation methods into a new stand-alone class
1513 InsetCommandParams. This class has two additional methods
1514 getAsString() and setFromString() allowing the contents to be
1515 moved around as a single string.
1516 (addContents) method removed.
1517 (setContents) method no longer virtual.
1519 * src/buffer.C (readInset): made use of new InsetCitation,
1520 InsetUrl constructors based on InsetCommandParams.
1522 * src/commandtags.h: add LFUN_INSERT_URL
1524 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1525 independent InsetUrl and use InsetCommandParams to extract
1526 string info and create new Insets.
1528 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1530 * src/frontends/xforms/FormCitation.C (apply): uses
1533 * src/frontends/xforms/form_url.C
1534 * src/frontends/xforms/form_url.h
1535 * src/frontends/xforms/FormUrl.h
1536 * src/frontends/xforms/FormUrl.C
1537 * src/frontends/xforms/forms/form_url.fd: new files
1539 * src/insets/insetcite.[Ch]: removed unused constructors.
1541 * src/insets/insetinclude.[Ch]: no longer store filename
1543 * src/insets/inseturl.[Ch]: GUI-independent.
1545 2000-07-26 Juergen Vigna <jug@sad.it>
1546 * renamed frontend from gtk to gnome as it is that what is realized
1547 and did the necessary changes in the files.
1549 2000-07-26 Marko Vendelin <markov@ioc.ee>
1551 * configure.in: cleaning up gnome configuration scripts
1553 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1555 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1556 shortcuts syndrom by redrawing them explicitely (a better solution
1557 would be appreciated).
1559 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1561 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1564 * src/lyx_cb.C (MenuExport): change html export to do the right
1565 thing depending of the document type (instead of having
1566 html-linuxdoc and html-docbook).
1567 * src/lyxfunc.C (getStatus): update for html
1568 * lib/ui/default.ui: simplify due to the above change.
1569 * src/menus.C (ShowFileMenu): update too (in case we need it).
1571 * src/MenuBackend.C (read): if a menu is defined twice, add the
1572 new entries to the exiting one.
1574 2000-07-26 Juergen Vigna <jug@sad.it>
1576 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1578 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1579 and return a bool if it did actual save the file.
1580 (AutoSave): don't autosave a unnamed doc.
1582 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1583 check if this is an UNNAMED new file and react to it.
1584 (newFile): set buffer to unnamed and change to not mark a new
1585 buffer dirty if I didn't do anything with it.
1587 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1589 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1591 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1592 friend as per Angus's patch posted to lyx-devel.
1594 * src/ext_l10n.h: updated
1596 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1597 gettext on the style string right before inserting them into the
1600 * autogen.sh: add code to extract style strings form layout files,
1601 not good enough yet.
1603 * src/frontends/gtk/.cvsignore: add MAKEFILE
1605 * src/MenuBackend.C (read): run the label strings through gettext
1606 before storing them in the containers.
1608 * src/ext_l10n.h: new file
1610 * autogen.sh : generate the ext_l10n.h file here
1612 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1614 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1617 * lib/ui/default.ui: fix a couple of typos.
1619 * config/gnome/gtk.m4: added (and added to the list of files in
1622 * src/insets/insetinclude.C (unique_id): fix when we are using
1623 lyxstring instead of basic_string<>.
1624 * src/insets/insettext.C (LocalDispatch): ditto.
1625 * src/support/filetools.C: ditto.
1627 * lib/configure.m4: create the ui/ directory if necessary.
1629 * src/LyXView.[Ch] (updateToolbar): new method.
1631 * src/BufferView_pimpl.C (buffer): update the toolbar when
1632 opening/closing buffer.
1634 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1636 * src/LyXAction.C (getActionName): enhance to return also the name
1637 and options of pseudo-actions.
1638 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1640 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1641 as an example of what is possible). Used in File->Build too (more
1642 useful) and in the import/export menus (to mimick the complicated
1643 handling of linuxdoc and friends). Try to update all the entries.
1645 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1648 * src/MenuBackend.C (read): Parse the new OptItem tag.
1650 * src/MenuBackend.h: Add a new optional_ data member (used if the
1651 entry should be omitted when the lyxfunc is disabled).
1653 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1654 function, used as a shortcut.
1655 (create_submenu): align correctly the shortcuts on the widest
1658 * src/MenuBackend.h: MenuItem.label() only returns the label of
1659 the menu without shortcut; new method shortcut().
1661 2000-07-14 Marko Vendelin <markov@ioc.ee>
1663 * src/frontends/gtk/Dialogs.C:
1664 * src/frontends/gtk/FormCopyright.C:
1665 * src/frontends/gtk/FormCopyright.h:
1666 * src/frontends/gtk/Makefile.am: added these source-files for the
1667 Gtk/Gnome support of the Copyright-Dialog.
1669 * src/main.C: added Gnome::Main initialization if using
1670 Gtk/Gnome frontend-GUI.
1672 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1674 * config/gnome/aclocal-include.m4
1675 * config/gnome/compiler-flags.m4
1676 * config/gnome/curses.m4
1677 * config/gnome/gnome--.m4
1678 * config/gnome/gnome-bonobo-check.m4
1679 * config/gnome/gnome-common.m4
1680 * config/gnome/gnome-fileutils.m4
1681 * config/gnome/gnome-ghttp-check.m4
1682 * config/gnome/gnome-gnorba-check.m4
1683 * config/gnome/gnome-guile-checks.m4
1684 * config/gnome/gnome-libgtop-check.m4
1685 * config/gnome/gnome-objc-checks.m4
1686 * config/gnome/gnome-orbit-check.m4
1687 * config/gnome/gnome-print-check.m4
1688 * config/gnome/gnome-pthread-check.m4
1689 * config/gnome/gnome-support.m4
1690 * config/gnome/gnome-undelfs.m4
1691 * config/gnome/gnome-vfs.m4
1692 * config/gnome/gnome-x-checks.m4
1693 * config/gnome/gnome-xml-check.m4
1694 * config/gnome/gnome.m4
1695 * config/gnome/gperf-check.m4
1696 * config/gnome/gtk--.m4
1697 * config/gnome/linger.m4
1698 * config/gnome/need-declaration.m4: added configuration scripts
1699 for Gtk/Gnome frontend-GUI
1701 * configure.in: added support for the --with-frontend=gtk option
1703 * autogen.sh: added config/gnome/* to list of config-files
1705 * acconfig.h: added define for GTKGUI-support
1707 * config/lyxinclude.m4: added --with-frontend[=value] option value
1708 for Gtk/Gnome frontend-GUI support.
1710 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1712 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1716 * src/paragraph.C (GetChar): remove non-const version
1718 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1719 (search_kw): use it.
1721 * src/lyx_main.C (init): if "preferences" exist, read that instead
1723 (ReadRcFile): return bool if the file could be read ok.
1724 (ReadUIFile): add a check to see if lex file is set ok.
1726 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1727 bastring can be used instead of lyxstring (still uses the old code
1728 if std::string is good enough or if lyxstring is used.)
1730 * src/encoding.C: make the arrays static, move ininle functions
1732 * src/encoding.h: from here.
1734 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1735 (parseSingleLyXformat2Token): move inset parsing to separate method
1736 (readInset): new private method
1738 * src/Variables.h: remove virtual from get().
1740 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1741 access to NEW_INSETS and NEW_TABULAR
1743 * src/MenuBackend.h: remove superfluous forward declaration of
1744 MenuItem. Add documentations tags "///", remove empty MenuItem
1745 destructor, remove private default contructor.
1747 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1749 (read): more string mlabel and mname to where they are used
1750 (read): remove unused variables mlabel and mname
1751 (defaults): unconditional clear, make menusetup take advantage of
1752 add returning Menu &.
1754 * src/LyXView.h: define NEW_MENUBAR as default
1756 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1757 to NEW_INSETS and NEW_TABULAR.
1758 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1759 defined. Change some of the "xxxx-inset-insert" functions names to
1762 * several files: more enahncements to NEW_INSETS and the resulting
1765 * lib/lyxrc.example (\date_insert_format): move to misc section
1767 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1768 bastring and use AC_CACHE_CHECK.
1769 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1770 the system have the newest methods. uses AC_CACHE_CHECK
1771 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1772 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1773 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1775 * configure.in: add LYX_CXX_GOOD_STD_STRING
1777 * acinclude.m4: recreated
1779 2000-07-24 Amir Karger
1781 * README: add Hebrew, Arabic kmaps
1784 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1786 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1789 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1791 * Lot of files: add pragma interface/implementation.
1793 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1795 * lib/ui/default.ui: new file (ans new directory). Contains the
1796 default menu and toolbar.
1798 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1799 global space. Toolbars are now read (as menus) in ui files.
1801 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1803 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1804 is disabled because the document is read-only. We want to have the
1805 toggle state of the function anyway.
1806 (getStatus): add code for LFUN_VC* functions (mimicking what is
1807 done in old-style menus)
1809 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1810 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1812 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1813 * src/BufferView_pimpl.C: ditto.
1814 * src/lyxfunc.C: ditto.
1816 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1817 default). This replaces old-style menus by new ones.
1819 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1820 MenuItem. Contain the data structure of a menu.
1822 * src/insets/insettext.C: use LyXView::setLayout instead of
1823 accessing directly the toolbar combox.
1824 * src/lyxfunc.C (Dispatch): ditto.
1826 * src/LyXView.C (setLayout): new method, which just calls
1827 Toolbar::setLayout().
1828 (updateLayoutChoice): move part of this method in Toolbar.
1830 * src/toolbar.[Ch]: removed.
1832 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1833 implementation the toolbar.
1835 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1836 the toolbar. It might make sense to merge it with ToolbarDefaults
1838 (setLayout): new function.
1839 (updateLayoutList): ditto.
1840 (openLayoutList): ditto.
1842 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1843 xforms implementation of the toolbar.
1844 (get_toolbar_func): comment out, since I do not
1845 know what it is good for.
1847 * src/ToolbarDefaults.h: Add the ItemType enum.
1849 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1850 for a list of allocated C strings. Used in Menubar xforms
1851 implementation to avoid memory leaks.
1853 * src/support/lstrings.[Ch] (uppercase): new version taking and
1857 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1858 * lib/bind/emacs.bind: ditto.
1860 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1862 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1863 forward decl of LyXView.
1865 * src/toolbar.C (toolbarItem): moved from toolbar.h
1866 (toolbarItem::clean): ditto
1867 (toolbarItem::~toolbarItem): ditto
1868 (toolbarItem::operator): ditto
1870 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1872 * src/paragraph.h: control the NEW_TABULAR define from here
1874 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1875 USE_TABULAR_INSETS to NEW_TABULAR
1877 * src/ToolbarDefaults.C: add include "lyxlex.h"
1879 * files using the old table/tabular: use NEW_TABULAR to control
1880 compilation of old tabular stuff.
1882 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1885 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1886 planemet in reading of old style floats, fix the \end_deeper
1887 problem when reading old style floats.
1889 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1891 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1893 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1895 * lib/bind/sciword.bind: updated.
1897 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1899 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1900 layout write problem
1902 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1904 * src/Makefile.am (INCLUDES): remove image directory from include
1907 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1908 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1910 * src/LyXView.C (create_form_form_main): read the application icon
1913 * lib/images/*.xpm: change the icons to use transparent color for
1916 * src/toolbar.C (update): change the color of the button when it
1919 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1921 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1922 setting explicitely the minibuffer.
1923 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1925 * src/LyXView.C (showState): new function. Shows font information
1926 in minibuffer and update toolbar state.
1927 (LyXView): call Toolbar::update after creating the
1930 * src/toolbar.C: change toollist to be a vector instead of a
1932 (BubbleTimerCB): get help string directly from the callback
1933 argument of the corresponding icon (which is the action)
1934 (set): remove unnecessary ugliness.
1935 (update): new function. update the icons (depressed, disabled)
1936 depending of the status of the corresponding action.
1938 * src/toolbar.h: remove help in toolbarItem
1940 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
1942 * src/Painter.C (text): Added code for using symbol glyphs from
1943 iso10646 fonts. Currently diabled.
1945 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
1948 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
1949 magyar,turkish and usorbian.
1951 * src/paragraph.C (isMultiLingual): Made more efficient.
1953 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
1956 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
1957 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
1958 Also changed the prototype to "bool math_insert_greek(char)".
1960 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1962 * lots of files: apply the NEW_INSETS on all code that will not be
1963 needed when we move to use the new insets. Enable the define in
1964 lyxparagrah.h to try it.
1966 * src/insets/insettabular.C (cellstart): change to be a static
1968 (InsetTabular): initialize buffer in the initializer list.
1970 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
1972 * src/frontends/xforms/FormPrint.[Ch] : moved #include
1973 form_print.h out of the header file. Replaced with forward
1974 declarations of the relevant struct.
1976 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
1979 * src/commandtags.h: do not include "debug.h" which does not
1980 belong there. #include it in some other places because of this
1983 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1985 * src/insets/insetcaption.C: add a couple "using" directives.
1987 * src/toolbar.C (add): get the help text directly from lyxaction.
1989 (setPixmap): new function. Loads from disk and sets a pixmap on a
1990 botton; the name of the pixmap file is derived from the command
1993 * src/toolbar.h: remove members isBitmap and pixmap from
1996 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
1997 * lib/images/: move many files from images/banner.xpm.
1999 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2001 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2002 * src/toolbar.C: ditto.
2003 * configure.in: ditto.
2004 * INSTALL: document.
2006 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2007 the spellchecker popup is closed from the WM.
2009 2000-07-19 Juergen Vigna <jug@sad.it>
2011 * src/insets/insetfloat.C (Write): small fix because we use the
2012 insetname for the type now!
2014 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2016 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2019 * src/frontends/Dialogs.h: removed hideCitation signal
2021 * src/insets/insetcite.h: added hide signal
2023 * src/insets/insetcite.C (~InsetCitation): emits new signal
2024 (getScreenLabel): "intelligent" label should now fit on the screen!
2026 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2028 * src/frontends/xforms/FormCitation.C (showInset): connects
2029 hide() to the inset's hide signal
2030 (show): modified to use fl_set_object_position rather than
2031 fl_set_object_geometry wherever possible
2033 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2035 * src/insets/lyxinset.h: add caption code
2037 * src/insets/insetfloat.C (type): new method
2039 * src/insets/insetcaption.C (Write): new method
2041 (LyxCode): new method
2043 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2044 to get it right together with using the FloatList.
2046 * src/commandtags.h: add LFUN_INSET_CAPTION
2047 * src/lyxfunc.C (Dispatch): handle it
2049 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2052 * src/Variables.[Ch]: make expand take a const reference, remove
2053 the destructor, some whitespace changes.
2055 * src/LyXAction.C (init): add caption-inset-insert
2057 * src/FloatList.C (FloatList): update the default floats a bit.
2059 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2061 * src/Variables.[Ch]: new files. Intended to be used for language
2062 specific strings (like \chaptername) and filename substitution in
2065 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2067 * lib/kbd/american.kmap: update
2069 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2071 * src/bufferparams.[Ch]: remove member allowAccents.
2073 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2075 * src/LaTeXLog.C: use the log_form.h header.
2076 * src/lyx_gui.C: ditto.
2077 * src/lyx_gui_misc.C: ditto.
2078 * src/lyxvc.h: ditto.
2080 * forms/log_form.fd: new file, created from latexoptions.fd. I
2081 kept the log popup and nuked the options form.
2083 * src/{la,}texoptions.[Ch]: removed.
2084 * src/lyx_cb.C (LaTeXOptions): ditto
2086 * src/lyx_gui.C (create_forms): do not handle the
2087 fd_latex_options form.
2089 2000-07-18 Juergen Vigna <jug@sad.it>
2091 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2092 name of the inset so that it can be requested outside (text2.C).
2094 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2097 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2099 * src/mathed/formula.h (ConvertFont): constify
2101 * src/mathed/formula.C (Read): add warning if \end_inset is not
2102 found on expected place.
2104 * src/insets/lyxinset.h (ConvertFont): consify
2106 * src/insets/insetquotes.C (ConvertFont): constify
2107 * src/insets/insetquotes.h: ditto
2109 * src/insets/insetinfo.h: add labelfont
2111 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2112 (ascent): use labelfont
2116 (Write): make .lyx file a bit nicer
2118 * src/insets/insetfloat.C (Write): simplify somewhat...
2119 (Read): add warning if arg is not found
2121 * src/insets/insetcollapsable.C: add using std::max
2122 (Read): move string token and add warning in arg is not found
2123 (draw): use std::max to get the right ty
2124 (getMaxWidth): simplify by using std::max
2126 * src/insets/insetsection.h: new file
2127 * src/insets/insetsection.C: new file
2128 * src/insets/insetcaption.h: new file
2129 * src/insets/insetcaption.C: new file
2131 * src/insets/inset.C (ConvertFont): constify signature
2133 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2134 insetcaption.[Ch] and insetsection.[Ch]
2136 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2137 uses to use LABEL_COUNTER_CHAPTER instead.
2138 * src/text2.C (SetCounter): here
2140 * src/counters.h: new file
2141 * src/counters.C: new file
2142 * src/Sectioning.h: new file
2143 * src/Sectioning.C: new file
2145 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2147 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2149 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2152 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2155 2000-07-17 Juergen Vigna <jug@sad.it>
2157 * src/tabular.C (Validate): check if array-package is needed.
2158 (SetVAlignment): added support for vertical alignment.
2159 (SetLTFoot): better support for longtable header/footers
2160 (Latex): modified to support added features.
2162 * src/LaTeXFeatures.[Ch]: added array-package.
2164 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2166 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2169 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2171 * configure.in: do not forget to put a space after -isystem.
2173 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2175 * lib/kbd/arabic.kmap: a few fixes.
2177 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2179 * some whitespace chagnes to a number of files.
2181 * src/support/DebugStream.h: change to make it easier for
2182 doc++ to parse correctly.
2183 * src/support/lyxstring.h: ditto
2185 * src/mathed/math_utils.C (compara): change to have only one
2187 (MathedLookupBOP): change because of the above.
2189 * src/mathed/math_delim.C (math_deco_compare): change to have only
2191 (search_deco): change becasue of the above.
2193 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2194 instead of manually coded one.
2196 * src/insets/insetquotes.C (Read): read the \end_inset too
2198 * src/insets/insetlatex.h: remove file
2199 * src/insets/insetlatex.C: remove file
2201 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2203 (InsetPrintIndex): remove destructor
2205 * src/insets/insetinclude.h: remove default constructor
2207 * src/insets/insetfloat.C: work to make it work better
2209 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2211 * src/insets/insetcite.h (InsetCitation): remove default constructor
2213 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2215 * src/text.C (GetColumnNearX): comment out some currently unused code.
2217 * src/paragraph.C (writeFile): move some initializations closer to
2219 (CutIntoMinibuffer): small change to use new matchIT operator
2223 (InsertInset): ditto
2226 (InsetIterator): ditto
2227 (Erase): small change to use new matchFT operator
2229 (GetFontSettings): ditto
2230 (HighestFontInRange): ditto
2233 * src/lyxparagraph.h: some chars changed to value_type
2234 (matchIT): because of some stronger checking (perhaps too strong)
2235 in SGI STL, the two operator() unified to one.
2238 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2240 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2241 the last inset read added
2242 (parseSingleLyXformat2Token): some more (future) compability code added
2243 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2244 (parseSingleLyXformat2Token): set last_inset_read
2245 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2246 (parseSingleLyXformat2Token): don't double intializw string next_token
2248 * src/TextCache.C (text_fits::operator()): add const's to the signature
2249 (has_buffer::operator()): ditto
2251 * src/Floating.h: add some comments on the class
2253 * src/FloatList.[Ch] (typeExist): new method
2256 * src/BackStack.h: added default constructor, wanted by Gcc.
2258 2000-07-14 Juergen Vigna <jug@sad.it>
2260 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2262 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2264 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2265 do a redraw when the window is resized!
2266 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2268 * src/insets/insettext.C (resizeLyXText): added function to correctly
2269 being able to resize the LyXWindow.
2271 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2273 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2275 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2276 crashes when closing dialog to a deleted inset.
2278 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2279 method! Now similar to other insets.
2281 2000-07-13 Juergen Vigna <jug@sad.it>
2283 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2285 * lib/examples/Literate.lyx: small patch!
2287 * src/insets/insetbib.C (Read): added this function because of wrong
2288 Write (without [begin|end]_inset).
2290 2000-07-11 Juergen Vigna <jug@sad.it>
2292 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2293 as the insertInset could not be good!
2295 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2296 the bool param should not be last.
2298 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2300 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2301 did submit that to Karl).
2303 * configure.in: use -isystem instead of -I for X headers. This
2304 fixes a problem on solaris with a recent gcc;
2305 put the front-end code after the X detection code;
2306 configure in sigc++ before lib/
2308 * src/lyx_main.C (commandLineHelp): remove -display from command
2311 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2313 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2314 Also put in Makefile rules for building the ``listerrors''
2315 program for parsing errors from literate programs written in LyX.
2317 * lib/build-listerrors: Added small shell script as part of compile
2318 process. This builds a working ``listerrors'' binary if noweb is
2319 installed and either 1) the VNC X server is installed on the machine,
2320 or 2) the user is compiling from within a GUI. The existence of a GUI
2321 is necessary to use the ``lyx --export'' feature for now. This
2322 hack can be removed once ``lyx --export'' no longer requires a GUI to
2325 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2327 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2328 now passed back correctly from gcc and placed "under" error
2329 buttons in a Literate LyX source.
2331 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2333 * src/text.C (GetColumnNearX): Better behavior when a RTL
2334 paragraph is ended by LTR text.
2336 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2339 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2341 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2342 true when clipboard is empty.
2344 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2346 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2347 row of the paragraph.
2348 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2349 to prevent calculation of bidi tables
2351 2000-07-07 Juergen Vigna <jug@sad.it>
2353 * src/screen.C (ToggleSelection): added y_offset and x_offset
2356 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2359 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2361 * src/insets/insettext.C: fixed Layout-Display!
2363 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2365 * configure.in: add check for strings.h header.
2367 * src/spellchecker.C: include <strings.h> in order to have a
2368 definition for bzero().
2370 2000-07-07 Juergen Vigna <jug@sad.it>
2372 * src/insets/insettext.C (draw): set the status of the bv->text to
2373 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2375 * src/screen.C (DrawOneRow):
2376 (DrawFromTo): redraw the actual row if something has changed in it
2379 * src/text.C (draw): call an update of the toplevel-inset if something
2380 has changed inside while drawing.
2382 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2384 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2386 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2387 processing inside class.
2389 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2390 processing inside class.
2392 * src/insets/insetindex.h new struct Holder, consistent with other
2395 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2396 citation dialog from main code and placed it in src/frontends/xforms.
2397 Dialog launched through signals instead of callbacks
2399 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2401 * lyx.man: update the options description.
2403 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2405 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2406 handle neg values, set min width to 590, add doc about -display
2408 2000-07-05 Juergen Vigna <jug@sad.it>
2410 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2411 calls to BufferView *.
2413 * src/insets/insettext.C (checkAndActivateInset): small fix non
2414 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2416 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2417 their \end_inset token!
2419 2000-07-04 edscott <edscott@imp.mx>
2421 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2422 lib/lyxrc.example: added option \wheel_jump
2424 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2426 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2427 remove support for -width,-height,-xpos and -ypos.
2429 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2431 * src/encoding.[Ch]: New files.
2433 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2434 (text): Call to the underline() method only when needed.
2436 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2438 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2439 encoding(s) for the document.
2441 * src/bufferparams.C (BufferParams): Changed default value of
2444 * src/language.C (newLang): Removed.
2445 (items[]): Added encoding information for all defined languages.
2447 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2448 encoding choice button.
2450 * src/lyxrc.h (font_norm_type): New member variable.
2451 (set_font_norm_type): New method.
2453 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2454 paragraphs with different encodings.
2456 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2457 (TransformChar): Changed to work correctly with Arabic points.
2458 (draw): Added support for drawing Arabic points.
2459 (draw): Removed code for drawing underbars (this is done by
2462 * src/support/textutils.h (IsPrintableNonspace): New function.
2464 * src/BufferView_pimpl.h: Added "using SigC::Object".
2465 * src/LyXView.h: ditto.
2467 * src/insets/insetinclude.h (include_label): Changed to mutable.
2469 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2471 * src/mathed/math_iter.h: remove empty destructor
2473 * src/mathed/math_cursor.h: remove empty destructor
2475 * src/insets/lyxinset.h: add THEOREM_CODE
2477 * src/insets/insettheorem.[Ch]: new files
2479 * src/insets/insetminipage.C: (InsertInset): remove
2481 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2483 (InsertInset): remove
2485 * src/insets/insetlist.C: (InsertList): remove
2487 * src/insets/insetfootlike.[Ch]: new files
2489 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2492 (InsertInset): ditto
2494 * src/insets/insetert.C: remove include Painter.h, reindent
2495 (InsertInset): move to header
2497 * src/insets/insetcollapsable.h: remove explicit from default
2498 contructor, remove empty destructor, add InsertInset
2500 * src/insets/insetcollapsable.C (InsertInset): new func
2502 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2504 * src/vspace.h: add explicit to constructor
2506 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2507 \textcompwordmark, please test this.
2509 * src/lyxrc.C: set ascii_linelen to 65 by default
2511 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2513 * src/commandtags.h: add LFUN_INSET_THEOREM
2515 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2516 (makeLinuxDocFile): remove _some_ of the nice logic
2517 (makeDocBookFile): ditto
2519 * src/Painter.[Ch]: (~Painter): removed
2521 * src/LyXAction.C (init): entry for insettheorem added
2523 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2525 (deplog): code to detect files generated by LaTeX, needs testing
2528 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2530 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2532 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2534 * src/LaTeX.C (deplog): Add a check for files that are going to be
2535 created by the first latex run, part of the project to remove the
2538 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2539 contents to the extension list.
2541 2000-07-04 Juergen Vigna <jug@sad.it>
2543 * src/text.C (NextBreakPoint): added support for needFullRow()
2545 * src/insets/lyxinset.h: added needFullRow()
2547 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2550 * src/insets/insettext.C: lots of changes for update!
2552 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2554 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2556 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2558 * src/insets/insetinclude.C (InsetInclude): fixed
2559 initialization of include_label.
2560 (unique_id): now returns a string.
2562 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2564 * src/LaTeXFeatures.h: new member IncludedFiles, for
2565 a map of key, included file name.
2567 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2568 with the included files for inclusion in SGML preamble,
2569 i. e., linuxdoc and docbook.
2572 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2573 nice (is the generated linuxdoc code to be exported?), that
2574 allows to remove column, and only_body that will be true for
2575 slave documents. Insets are allowed inside SGML font type.
2576 New handling of the SGML preamble for included files.
2577 (makeDocBookFile): the same for docbook.
2579 * src/insets/insetinclude.h:
2580 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2582 (DocBook): new export methods.
2584 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2585 and makeDocBookFile.
2587 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2588 formats to export with command line argument -x.
2590 2000-06-29 Juergen Vigna <jug@sad.it>
2592 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2593 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2595 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2596 region could already been cleared by an inset!
2598 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2600 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2603 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2605 (cursorToggle): remove special handling of lyx focus.
2607 2000-06-28 Juergen Vigna <jug@sad.it>
2609 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2612 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2614 * src/insets/insetindex.C (Edit): add a callback when popup is
2617 * src/insets/insettext.C (LocalDispatch):
2618 * src/insets/insetmarginal.h:
2619 * src/insets/insetlist.h:
2620 * src/insets/insetfoot.h:
2621 * src/insets/insetfloat.h:
2622 * src/insets/insetert.h: add a missing std:: qualifier.
2624 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2626 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2629 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2631 * src/insets/insettext.C (Read): remove tmptok unused variable
2632 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2633 (InsertInset): change for new InsetInset code
2635 * src/insets/insettext.h: add TEXT inline method
2637 * src/insets/insettext.C: remove TEXT macro
2639 * src/insets/insetmarginal.C (Write): new method
2640 (Latex): change output slightly
2642 * src/insets/insetfoot.C (Write): new method
2643 (Latex): change output slightly (don't use endl when no need)
2645 * src/insets/insetert.C (Write): new method
2647 * src/insets/insetcollapsable.h: make button_length, button_top_y
2648 and button_bottm_y protected.
2650 * src/insets/insetcollapsable.C (Write): simplify code by using
2651 tostr. Also do not output the float name, the children class
2652 should to that to get control over own arguments
2654 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2655 src/insets/insetminipage.[Ch]:
2658 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2660 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2662 * src/Makefile.am (lyx_SOURCES): add the new files
2664 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2665 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2666 * src/commandtags.h: ditto
2668 * src/LaTeXFeatures.h: add a std::set of used floattypes
2670 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2672 * src/FloatList.[Ch] src/Floating.h: new files
2674 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2676 * src/lyx_cb.C (TableApplyCB): ditto
2678 * src/text2.C: ditto
2679 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2680 (parseSingleLyXformat2Token): ditto + add code for
2681 backwards compability for old float styles + add code for new insets
2683 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2685 (InsertInset(size_type, Inset *, LyXFont)): new method
2686 (InsetChar(size_type, char)): changed to use the other InsetChar
2687 with a LyXFont(ALL_INHERIT).
2688 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2689 insert the META_INSET.
2691 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2693 * sigc++/thread.h (Threads): from here
2695 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2696 definition out of line
2697 * sigc++/scope.h: from here
2699 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2701 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2702 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2704 * Makefile.am (bindist): new target.
2706 * INSTALL: add instructions for doing a binary distribution.
2708 * development/tools/README.bin.example: update a bit.
2710 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2713 * lib/lyxrc.example: new lyxrc tag \set_color.
2715 * src/lyxfunc.C (Dispatch):
2716 * src/commandtags.h:
2717 * src/LyXAction.C: new lyxfunc "set-color".
2719 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2720 and an x11name given as strings.
2722 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2723 cache when a color is changed.
2725 2000-06-26 Juergen Vigna <jug@sad.it>
2727 * src/lyxrow.C (width): added this functions and variable.
2729 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2732 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2734 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2736 * images/undo_bw.xpm: new icon.
2737 * images/redo_bw.xpm: ditto.
2739 * configure.in (INSTALL_SCRIPT): change value to
2740 ${INSTALL} to avoid failures of install-script target.
2741 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2743 * src/BufferView.h: add a magic "friend" declaration to please
2746 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2748 * forms/cite.fd: modified to allow resizing without messing
2751 * src/insetcite.C: Uses code from cite.fd almost without
2753 User can now resize dialog in the x-direction.
2754 Resizing the dialog in the y-direction is prevented, as the
2755 code does this intelligently already.
2757 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2759 * INSTALL: remove obsolete entry in "problems" section.
2761 * lib/examples/sl_*.lyx: update of the slovenian examples.
2763 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2765 2000-06-23 Juergen Vigna <jug@sad.it>
2767 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2769 * src/buffer.C (resize): delete the LyXText of textinsets.
2771 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2773 * src/insets/lyxinset.h: added another parameter 'cleared' to
2774 the draw() function.
2776 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2777 unlocking inset in inset.
2779 2000-06-22 Juergen Vigna <jug@sad.it>
2781 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2782 of insets and moved first to LyXText.
2784 * src/mathed/formulamacro.[Ch]:
2785 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2787 2000-06-21 Juergen Vigna <jug@sad.it>
2789 * src/text.C (GetVisibleRow): look if I should clear the area or not
2790 using Inset::doClearArea() function.
2792 * src/insets/lyxinset.h: added doClearArea() function and
2793 modified draw(Painter &, ...) to draw(BufferView *, ...)
2795 * src/text2.C (UpdateInset): return bool insted of int
2797 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2799 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2800 combox in the character popup
2802 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2803 BufferParams const & params
2805 2000-06-20 Juergen Vigna <jug@sad.it>
2807 * src/insets/insettext.C (SetParagraphData): set insetowner on
2810 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2812 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2813 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2815 (form_main_): remove
2817 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2818 (create_form_form_main): remove FD_form_main stuff, connect to
2819 autosave_timeout signal
2821 * src/LyXView.[Ch] (getMainForm): remove
2822 (UpdateTimerCB): remove
2823 * src/BufferView_pimpl.h: inherit from SigC::Object
2825 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2826 signal instead of callback
2828 * src/BufferView.[Ch] (cursorToggleCB): remove
2830 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2832 * src/BufferView_pimpl.C: changes because of the one below
2834 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2835 instead of storing a pointer to a LyXText.
2837 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2839 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2841 * src/lyxparagraph.h
2843 * src/paragraph.C: Changed fontlist to a sorted vector.
2845 2000-06-19 Juergen Vigna <jug@sad.it>
2847 * src/BufferView.h: added screen() function.
2849 * src/insets/insettext.C (LocalDispatch): some selection code
2852 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2854 * src/insets/insettext.C (SetParagraphData):
2856 (InsetText): fixes for multiple paragraphs.
2858 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2860 * development/lyx.spec.in: Call configure with ``--without-warnings''
2861 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2862 This should be fine, however, since we generally don't want to be
2863 verbose when making an RPM.
2865 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2867 * lib/scripts/fig2pstex.py: New file
2869 2000-06-16 Juergen Vigna <jug@sad.it>
2871 * src/insets/insettabular.C (UpdateLocal):
2872 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2873 (LocalDispatch): Changed all functions to use LyXText.
2875 2000-06-15 Juergen Vigna <jug@sad.it>
2877 * src/text.C (SetHeightOfRow): call inset::update before requesting
2880 * src/insets/insettext.C (update):
2881 * src/insets/insettabular.C (update): added implementation
2883 * src/insets/lyxinset.h: added update function
2885 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2887 * src/text.C (SelectNextWord): protect against null pointers with
2888 old-style string streams. (fix from Paul Theo Gonciari
2891 * src/cite.[Ch]: remove erroneous files.
2893 * lib/configure.m4: update the list of created directories.
2895 * src/lyxrow.C: include <config.h>
2896 * src/lyxcursor.C: ditto.
2898 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2900 * lib/examples/decimal.lyx: new example file from Mike.
2902 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2903 to find template definitions (from Dekel)
2905 * src/frontends/.cvsignore: add a few things.
2907 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2909 * src/Timeout.C (TimeOut): remove default argument.
2911 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2914 * src/insets/ExternalTemplate.C: add a "using" directive.
2916 * src/lyx_main.h: remove the act_ struct, which seems unused
2919 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2921 * LyX Developers Meeting: All files changed, due to random C++ (by
2922 coincidence) code generator script.
2924 - external inset (cool!)
2925 - initial online editing of preferences
2926 - insettabular breaks insettext(s contents)
2928 - some DocBook fixes
2929 - example files update
2930 - other cool stuff, create a diff and look for yourself.
2932 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
2934 * src/insets/insettext.C (computeTextRows): if the maxWidth is
2935 -1 this is a non-line-breaking textinset.
2937 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
2938 if there is no width set.
2940 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
2942 * Lots of files: Merged the dialogbase branch.
2944 2000-06-09 Allan Rae <rae@lyx.org>
2946 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
2947 and the Dispatch methods that used it.
2949 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
2950 access to functions formerly kept in Dispatch.
2952 2000-05-19 Allan Rae <rae@lyx.org>
2954 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
2955 made to_page and count_copies integers again. from_page remains a
2956 string however because I want to allow entry of a print range like
2957 "1,4,22-25" using this field.
2959 * src/LyXAction.C: added action info and commands for buffer-print-xtl
2960 and printer-params-get. These aren't useful from the minibuffer but
2961 could be used by a script/LyXServer app provided it passes a suitable
2962 auto_mem_buffer. I guess I should take a look at how the LyXServer
2963 works and make it support xtl buffers.
2965 * sigc++/: updated to libsigc++-1.0.1
2967 * src/xtl/: updated to xtl-1.3.pl.11
2969 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
2970 those changes done to the files in src/ are actually recreated when
2971 they get regenerated. Please don't ever accept a patch that changes a
2972 dialog unless that patch includes the changes to the corresponding *.fd
2975 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
2976 stringOnlyContains, renamed it and generalised it.
2978 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
2979 branch. Removed the remaining old form_print code.
2981 2000-04-26 Allan Rae <rae@lyx.org>
2983 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
2984 trap I was trying to fix with the ID: fields in src/xtl/ :-)
2986 2000-04-25 Allan Rae <rae@lyx.org>
2988 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
2989 against a base of xtl-1.3.pl.4
2991 * development/tools/lxtl.sh: fixed a couple of silly typos and now
2992 filter the Id: entries so they still show the xtl version number
2995 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
2996 into the src/xtl code. Patch still pending with José (XTL)
2998 2000-04-24 Allan Rae <rae@lyx.org>
3000 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3001 both more generic and much safer. Use the new template functions.
3002 * src/buffer.[Ch] (Dispatch): ditto.
3004 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3005 and mem buffer more intelligently. Also a little general cleanup.
3008 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3009 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3010 * src/xtl/Makefile.am: ditto.
3011 * src/xtl/.cvsignore: ditto.
3012 * src/Makefile.am: ditto.
3014 * src/PrinterParams.h: Removed the macros member functions. Added a
3015 testInvariant member function. A bit of tidying up and commenting.
3016 Included Angus's idea for fixing operation with egcs-1.1.2.
3018 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3019 cool expansion of XTL's mem_buffer to support automatic memory
3020 management within the buffer itself. Removed the various macros and
3021 replaced them with template functions that use either auto_mem_buffer
3022 or mem_buffer depending on a #define. The mem_buffer support will
3023 disappear as soon as the auto_mem_buffer is confirmed to be good on
3024 other platforms/compilers. That is, it's there so you've got something
3027 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3028 effectively forked XTL. However I expect José will include my code
3029 into the next major release. Also fixed a memory leak.
3030 * src/xtl/text.h: ditto.
3031 * src/xtl/xdr.h: ditto.
3032 * src/xtl/giop.h: ditto.
3034 2000-04-16 Allan Rae <rae@lyx.org>
3036 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3037 by autogen.sh and removed by maintainer-clean anyway.
3038 * .cvsignore, sigc++/.cvsignore: Support the above.
3040 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3042 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3044 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3045 macros, renamed static callback-target member functions to suit new
3046 scheme and made them public.
3047 * src/frontends/xforms/forms/form_print.fd: ditto.
3048 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3050 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3053 * src/xtl/: New directory containing a minimal distribution of XTL.
3054 This is XTL-1.3.pl.4.
3056 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3058 2000-04-15 Allan Rae <rae@lyx.org>
3060 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3062 * sigc++/: Updated to libsigc++-1.0.0
3064 2000-04-14 Allan Rae <rae@lyx.org>
3066 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3067 use the generic ones in future. I'll modify my conversion script.
3069 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3071 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3072 (CloseAllBufferRelatedDialogs): Renamed.
3073 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3075 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3076 of the generic ones. These are the same ones my conversion script
3079 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3080 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3081 * src/buffer.C (Dispatch): ditto
3083 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3084 functions for updating and hiding buffer dependent dialogs.
3085 * src/BufferView.C (buffer): ditto
3086 * src/buffer.C (setReadonly): ditto
3087 * src/lyxfunc.C (CloseBuffer): ditto
3089 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3090 Dialogs.h, and hence all the SigC stuff, into every file that includes
3091 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3093 * src/BufferView2.C: reduce the number of headers included by buffer.h
3095 2000-04-11 Allan Rae <rae@lyx.org>
3097 * src/frontends/xforms/xform_macros.h: A small collection of macros
3098 for building C callbacks.
3100 * src/frontends/xforms/Makefile.am: Added above file.
3102 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3103 scheme again. This time it should work for JMarc. If this is
3104 successful I'll revise my conversion script to automate some of this.
3105 The static member functions in the class also have to be public for
3106 this scheme will work. If the scheme works (it's almost identical to
3107 the way BufferView::cursorToggleCB is handled so it should work) then
3108 FormCopyright and FormPrint will be ready for inclusion into the main
3109 trunk immediately after 1.1.5 is released -- provided we're prepared
3110 for complaints about lame compilers not handling XTL.
3112 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3114 2000-04-07 Allan Rae <rae@lyx.org>
3116 * config/lyxinclude.m4: A bit more tidying up (Angus)
3118 * src/LString.h: JMarc's <string> header fix
3120 * src/PrinterParams.h: Used string for most data to remove some
3121 ugly code in the Print dialog and avoid even uglier code when
3122 appending the ints to a string for output.
3124 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3125 and moved "default:" back to the end of switch statement. Cleaned
3126 up the printing so it uses the right function calls and so the
3127 "print to file" option actually puts the file in the right directory.
3129 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3131 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3132 and Ok+Apply button control into a separate method: input (Angus).
3133 (input) Cleaned it up and improved it to be very thorough now.
3134 (All CB) static_cast used instead of C style cast (Angus). This will
3135 probably change again once we've worked out how to keep gcc-2.8.1 happy
3136 with real C callbacks.
3137 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3138 ignore some of the bool settings and has random numbers instead. Needs
3139 some more investigation. Added other input length checks and checking
3140 of file and printer names.
3142 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3143 would link (Angus). Seems the old code doesn't compile with the pragma
3144 statement either. Separated callback entries from internal methods.
3146 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3148 2000-03-17 Allan Rae <rae@lyx.org>
3150 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3151 need it? Maybe it could go in Dialogs instead? I could make it a
3152 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3153 values to get the bool return value.
3154 (Dispatch): New overloaded method for xtl support.
3156 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3157 extern "C" callback instead of static member functions. Hopefully,
3158 JMarc will be able to compile this. I haven't changed
3159 forms/form_copyright.fd yet. Breaking one of my own rules already.
3161 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3162 because they aren't useful from the minibuffer. Maybe a LyXServer
3163 might want a help message though?
3165 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3167 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3168 xtl which needs both rtti and exceptions.
3170 * src/support/Makefile.am:
3171 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3173 * src/frontends/xforms/input_validators.[ch]: input filters and
3174 validators. These conrol what keys are valid in input boxes.
3175 Use them and write some more. Much better idea than waiting till
3176 after the user has pressed Ok to say that the input fields don't make
3179 * src/frontends/xforms/Makefile.am:
3180 * src/frontends/xforms/forms/form_print.fd:
3181 * src/frontends/xforms/forms/makefile:
3182 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3183 new scheme. Still have to make sure I haven't missed anything from
3184 the current implementation.
3186 * src/Makefile.am, src/PrinterParams.h: New data store.
3188 * other files: Added a couple of copyright notices.
3190 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3192 * src/insets/insetbib.h: move Holder struct in public space.
3194 * src/frontends/include/DialogBase.h: use SigC:: only when
3195 SIGC_CXX_NAMESPACES is defined.
3196 * src/frontends/include/Dialogs.h: ditto.
3198 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3200 * src/frontends/xforms/FormCopyright.[Ch]: do not
3201 mention SigC:: explicitely.
3203 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3205 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3206 deals with testing KDE in main configure.in
3207 * configure.in: ditto.
3209 2000-02-22 Allan Rae <rae@lyx.org>
3211 * Lots of files: Merged from HEAD
3213 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3214 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3216 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3218 * sigc++/: new minidist.
3220 2000-02-14 Allan Rae <rae@lyx.org>
3222 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3224 2000-02-08 Juergen Vigna <jug@sad.it>
3226 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3227 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3229 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3230 for this port and so it is much easier for other people to port
3231 dialogs in a common development environment.
3233 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3234 the QT/KDE implementation.
3236 * src/frontends/kde/Dialogs.C:
3237 * src/frontends/kde/FormCopyright.C:
3238 * src/frontends/kde/FormCopyright.h:
3239 * src/frontends/kde/Makefile.am:
3240 * src/frontends/kde/formcopyrightdialog.C:
3241 * src/frontends/kde/formcopyrightdialog.h:
3242 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3243 for the kde support of the Copyright-Dialog.
3245 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3246 subdir-substitution instead of hardcoded 'xforms' as we now have also
3249 * src/frontends/include/DialogBase.h (Object): just commented the
3250 label after #endif (nasty warning and I don't like warnings ;)
3252 * src/main.C (main): added KApplication initialization if using
3255 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3256 For now only the KDE event-loop is added if frontend==kde.
3258 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3260 * configure.in: added support for the --with-frontend[=value] option
3262 * autogen.sh: added kde.m4 file to list of config-files
3264 * acconfig.h: added define for KDEGUI-support
3266 * config/kde.m4: added configuration functions for KDE-port
3268 * config/lyxinclude.m4: added --with-frontend[=value] option with
3269 support for xforms and KDE.
3271 2000-02-08 Allan Rae <rae@lyx.org>
3273 * all Makefile.am: Fixed up so the make targets dist, distclean,
3274 install and uninstall all work even if builddir != srcdir. Still
3275 have a new sigc++ minidist update to come.
3277 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3279 2000-02-01 Allan Rae <rae@lyx.org>
3281 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3282 Many mods to get builddir != srcdir working.
3284 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3285 for building on NT and so we can do the builddir != srcdir stuff.
3287 2000-01-30 Allan Rae <rae@lyx.org>
3289 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3290 This will stay in "rae" branch. We probably don't really need it in
3291 the main trunk as anyone who wants to help programming it should get
3292 a full library installed also. So they can check both included and
3293 system supplied library compilation.
3295 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3296 Added a 'mini' distribution of libsigc++. If you feel the urge to
3297 change something in these directories - Resist it. If you can't
3298 resist the urge then you should modify the following script and rebuild
3299 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3300 all happen. Still uses a hacked version of libsigc++'s configure.in.
3301 I'm quite happy with the results. I'm not sure the extra work to turn
3302 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3303 worth the trouble and would probably lead to extra maintenance
3305 I haven't tested the following important make targets: install, dist.
3306 Not ready for prime time but very close. Maybe 1.1.5.
3308 * development/tools/makeLyXsigc.sh: A shell script to automatically
3309 generate our mini-dist of libsigc++. It can only be used with a CVS
3310 checkout of libsigc++ not a tarball distribution. It's well commented.
3311 This will end up as part of the libsigc++ distribution so other apps
3312 can easily have an included mini-dist. If someone makes mods to the
3313 sigc++ subpackage without modifying this script to generate those
3314 changes I'll be very upset!
3316 * src/frontends/: Started the gui/system indep structure.
3318 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3319 to access the gui-indep dialogs are in this class. Much improved
3320 design compared to previous revision. Lars, please refrain from
3321 moving this header into src/ like you did with Popups.h last time.
3323 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3325 * src/frontends/xforms/: Started the gui-indep system with a single
3326 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3329 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3330 Here you'll find a very useful makefile and automated fdfix.sh that
3331 makes updating dailogs a no-brainer -- provided you follow the rules
3332 set out in the README. I'm thinking about adding another script to
3333 automatically generate skeleton code for a new dialog given just the
3336 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3337 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3338 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3340 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3342 * src/support/LSubstring.C (operator): simplify
3344 * src/lyxtext.h: removed bparams, use buffer_->params instead
3346 * src/lyxrow.h: make Row a real class, move all variables to
3347 private and use accessors.
3349 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3351 (isRightToLeftPar): ditto
3352 (ChangeLanguage): ditto
3353 (isMultiLingual): ditto
3356 (SimpleTeXOnePar): ditto
3357 (TeXEnvironment): ditto
3358 (GetEndLabel): ditto
3360 (SetOnlyLayout): ditto
3361 (BreakParagraph): ditto
3362 (BreakParagraphConservative): ditto
3363 (GetFontSettings): ditto
3365 (CopyIntoMinibuffer): ditto
3366 (CutIntoMinibuffer): ditto
3367 (PasteParagraph): ditto
3368 (SetPExtraType): ditto
3369 (UnsetPExtraType): ditto
3370 (DocBookContTableRows): ditto
3371 (SimpleDocBookOneTablePar): ditto
3373 (TeXFootnote): ditto
3374 (SimpleTeXOneTablePar): ditto
3375 (TeXContTableRows): ditto
3376 (SimpleTeXSpecialChars): ditto
3379 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3380 to private and use accessors.
3382 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3383 this, we did not use it anymore and has not been for ages. Just a
3384 waste of cpu cycles.
3386 * src/language.h: make Language a real class, move all variables
3387 to private and use accessors.
3389 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3390 (create_view): remove
3391 (update): some changes for new timer
3392 (cursorToggle): use new timer
3393 (beforeChange): change for new timer
3395 * src/BufferView.h (cursorToggleCB): removed last paramter because
3398 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3399 (cursorToggleCB): change because of new timer code
3401 * lib/CREDITS: updated own mailaddress
3403 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3405 * src/support/filetools.C (PutEnv): fix the code in case neither
3406 putenv() nor setenv() have been found.
3408 * INSTALL: mention the install-strip Makefile target.
3410 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3411 read-only documents.
3413 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3415 * lib/reLyX/configure.in (VERSION): avoid using a previously
3416 generated reLyX wrapper to find out $prefix.
3418 * lib/examples/eu_adibide_lyx-atua.lyx:
3419 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3420 translation of the Tutorial (Dooteo)
3422 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3424 * forms/cite.fd: new citation dialog
3426 * src/insetcite.[Ch]: the new citation dialog is moved into
3429 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3432 * src/insets/insetcommand.h: data members made private.
3434 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3436 * LyX 1.1.5 released
3438 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3440 * src/version.h (LYX_RELEASE): to 1.1.5
3442 * src/spellchecker.C (RunSpellChecker): return false if the
3443 spellchecker dies upon creation.
3445 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3447 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3448 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3452 * lib/CREDITS: update entry for Martin Vermeer.
3454 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3456 * src/text.C (draw): Draw foreign language bars at the bottom of
3457 the row instead of at the baseline.
3459 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3461 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3463 * lib/bind/de_menus.bind: updated
3465 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3467 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3469 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3471 * src/menus.C (Limit_string_length): New function
3472 (ShowTocMenu): Limit the number of items/length of items in the
3475 * src/paragraph.C (String): Correct result for a paragraph inside
3478 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3480 * src/bufferlist.C (close): test of buf->getuser() == NULL
3482 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3484 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3485 Do not call to SetCursor when the paragraph is a closed footnote!
3487 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3489 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3492 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3494 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3497 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3498 reference popup, that activates the reference-back action
3500 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3502 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3503 the menus. Also fixed a bug.
3505 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3506 the math panels when switching buffers (unless new buffer is readonly).
3508 * src/BufferView.C (NoSavedPositions)
3509 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3511 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3513 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3514 less of dvi dirty or not.
3516 * src/trans_mgr.[Ch] (insert): change first parameter to string
3519 * src/chset.[Ch] (encodeString): add const to first parameter
3521 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3523 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3527 * src/LaTeX.C (deplog): better searching for dependency files in
3528 the latex log. Uses now regexps.
3530 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3531 instead of the box hack or \hfill.
3533 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3535 * src/lyxfunc.C (doImportHelper): do not create the file before
3536 doing the actual import.
3537 (doImportASCIIasLines): create a new file before doing the insert.
3538 (doImportASCIIasParagraphs): ditto.
3540 * lib/lyxrc.example: remove mention of non-existing commands
3542 * lyx.man: remove mention of color-related switches.
3544 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3546 * src/lyx_gui.C: remove all the color-related ressources, which
3547 are not used anymore.
3549 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3552 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3554 * src/lyxrc.C (read): Add a missing break in the switch
3556 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3558 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3560 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3563 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3565 * src/text.C (draw): draw bars under foreign language words.
3567 * src/LColor.[Ch]: add LColor::language
3569 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3571 * src/lyxcursor.h (boundary): New member variable
3573 * src/text.C (IsBoundary): New methods
3575 * src/text.C: Use the above for currect cursor movement when there
3576 is both RTL & LTR text.
3578 * src/text2.C: ditto
3580 * src/bufferview_funcs.C (ToggleAndShow): ditto
3582 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3584 * src/text.C (DeleteLineForward): set selection to true to avoid
3585 that DeleteEmptyParagraphMechanism does some magic. This is how it
3586 is done in all other functions, and seems reasonable.
3587 (DeleteWordForward): do not jump over non-word stuff, since
3588 CursorRightOneWord() already does it.
3590 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3591 DeleteWordBackward, since they seem safe to me (since selection is
3592 set to "true") DeleteEmptyParagraphMechanism does nothing.
3594 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3596 * src/lyx_main.C (easyParse): simplify the code by factoring the
3597 part that removes parameters from the command line.
3598 (LyX): check wether wrong command line options have been given.
3600 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3602 * src/lyx_main.C : add support for specifying user LyX
3603 directory via command line option -userdir.
3605 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3607 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3608 the number of items per popup.
3609 (Add_to_refs_menu): Ditto.
3611 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3613 * src/lyxparagraph.h: renamed ClearParagraph() to
3614 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3615 textclass as parameter, and do nothing if free_spacing is
3616 true. This fixes part of the line-delete-forward problems.
3618 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3619 (pasteSelection): ditto.
3620 (SwitchLayoutsBetweenClasses): more translatable strings.
3622 * src/text2.C (CutSelection): use StripLeadingSpaces.
3623 (PasteSelection): ditto.
3624 (DeleteEmptyParagraphMechanism): ditto.
3626 2000-05-26 Juergen Vigna <jug@sad.it>
3628 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3629 is not needed in tabular insets.
3631 * src/insets/insettabular.C (TabularFeatures): added missing features.
3633 * src/tabular.C (DeleteColumn):
3635 (AppendRow): implemented this functions
3636 (cellsturct::operator=): clone the inset too;
3638 2000-05-23 Juergen Vigna <jug@sad.it>
3640 * src/insets/insettabular.C (LocalDispatch): better selection support
3641 when having multicolumn-cells.
3643 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3645 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3647 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3649 * src/ColorHandler.C (getGCForeground): put more test into _()
3651 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3654 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3657 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3659 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3660 there are no labels, or when buffer is readonly.
3662 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3663 there are no labels, buffer is SGML, or when buffer is readonly.
3665 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3667 * src/LColor.C (LColor): change a couple of grey40 to grey60
3668 (LColor): rewore initalization to make compiles go some magnitude
3670 (getGUIName): don't use gettext until we need the string.
3672 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3674 * src/Bullet.[Ch]: Fixed a small bug.
3676 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3678 * src/paragraph.C (String): Several fixes/improvements
3680 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3682 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3684 * src/paragraph.C (String): give more correct output.
3686 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3688 * src/lyxfont.C (stateText) Do not output the language if it is
3689 eqaul to the language of the document.
3691 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3692 between two paragraphs with the same language.
3694 * src/paragraph.C (getParLanguage) Return a correct answer for an
3695 empty dummy paragraph.
3697 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3700 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3703 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3704 the menus/popup, if requested fonts are unavailable.
3706 2000-05-22 Juergen Vigna <jug@sad.it>
3708 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3709 movement support (Up/Down/Tab/Shift-Tab).
3710 (LocalDispatch): added also preliminari cursor-selection.
3712 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3714 * src/paragraph.C (PasteParagraph): Hopefully now right!
3716 2000-05-22 Garst R. Reese <reese@isn.net>
3718 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3719 of list, change all references to Environment to Command
3720 * tex/hollywood.cls : rewrite environments as commands, add
3721 \uppercase to interiorshot and exteriorshot to force uppecase.
3722 * tex/broadway.cls : rewrite environments as commands. Tweak
3725 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3727 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3728 size of items: use a constant intead of the hardcoded 40, and more
3729 importantly do not remove the %m and %x tags added at the end.
3730 (Add_to_refs_menu): use vector::size_type instead of
3731 unsigned int as basic types for the variables. _Please_ do not
3732 assume that size_t is equal to unsigned int. On an alpha, this is
3733 unsigned long, which is _not_ the same.
3735 * src/language.C (initL): remove language "hungarian", since it
3736 seems that "magyar" is better.
3738 2000-05-22 Juergen Vigna <jug@sad.it>
3740 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3742 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3745 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3746 next was deleted but not set to 0.
3748 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3750 * src/language.C (initL): change the initialization of languages
3751 so that compiles goes _fast_.
3753 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3756 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3758 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3762 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3764 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3766 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3770 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3773 * src/insets/insetlo*.[Ch]: Made editable
3775 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3777 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3778 the current selection.
3780 * src/BufferView_pimpl.C (stuffClipboard): new method
3782 * src/BufferView.C (stuffClipboard): new method
3784 * src/paragraph.C (String): new method
3786 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3787 LColor::ignore when lyxname is not found.
3789 * src/BufferView.C (pasteSelection): new method
3791 * src/BufferView_pimpl.C (pasteSelection): new method
3793 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3795 * src/WorkArea.C (request_clipboard_cb): new static function
3796 (getClipboard): new method
3797 (putClipboard): new method
3799 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3801 * LyX 1.1.5pre2 released
3803 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3805 * src/vspace.C (operator=): removed
3806 (operator=): removed
3808 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3810 * src/layout.C (NumberOfClass): manually set the type in make_pair
3811 (NumberOfLayout): ditto
3813 * src/language.C: use the Language constructor for ignore_lang
3815 * src/language.h: add constructors to struct Language
3817 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3819 * src/text2.C (SetCursorIntern): comment out #warning
3821 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3823 * src/mathed/math_iter.h: initialize sx and sw to 0
3825 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3827 * forms/lyx.fd: Redesign of form_ref
3829 * src/LaTeXFeatures.[Ch]
3833 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3836 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3837 and Buffer::inset_iterator.
3839 * src/menus.C: Added new menus: TOC and Refs.
3841 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3843 * src/buffer.C (getTocList): New method.
3845 * src/BufferView2.C (ChangeRefs): New method.
3847 * src/buffer.C (getLabelList): New method. It replaces the old
3848 getReferenceList. The return type is vector<string> instead of
3851 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3852 the old getLabel() and GetNumberOfLabels() methods.
3853 * src/insets/insetlabel.C (getLabelList): ditto
3854 * src/mathed/formula.C (getLabelList): ditto
3856 * src/paragraph.C (String): New method.
3858 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3859 Uses the new getTocList() method.
3860 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3861 which automatically updates the contents of the browser.
3862 (RefUpdateCB): Use the new getLabelList method.
3864 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3866 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3868 * src/spellchecker.C: Added using std::reverse;
3870 2000-05-19 Juergen Vigna <jug@sad.it>
3872 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3874 * src/insets/insettext.C (computeTextRows): small fix for display of
3875 1 character after a newline.
3877 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3880 2000-05-18 Juergen Vigna <jug@sad.it>
3882 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3883 when changing width of column.
3885 * src/tabular.C (set_row_column_number_info): setting of
3886 autobreak rows if necessary.
3888 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3890 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3892 * src/vc-backend.*: renamed stat() to status() and vcstat to
3893 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3894 compilation broke. The new name seems more relevant, anyway.
3896 2000-05-17 Juergen Vigna <jug@sad.it>
3898 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3899 which was wrong if the removing caused removing of rows!
3901 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3902 (pushToken): new function.
3904 * src/text2.C (CutSelection): fix problem discovered with purify
3906 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3908 * src/debug.C (showTags): enlarge the first column, now that we
3909 have 6-digits debug codes.
3911 * lib/layouts/hollywood.layout:
3912 * lib/tex/hollywood.cls:
3913 * lib/tex/brodway.cls:
3914 * lib/layouts/brodway.layout: more commands and fewer
3915 environments. Preambles moved in the .cls files. Broadway now has
3916 more options on scene numbering and less whitespace (from Garst)
3918 * src/insets/insetbib.C (getKeys): make sure that we are in the
3919 document directory, in case the bib file is there.
3921 * src/insets/insetbib.C (Latex): revert bogus change.
3923 2000-05-16 Juergen Vigna <jug@sad.it>
3925 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3926 the TabularLayout on cursor move.
3928 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
3930 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
3933 (draw): fixed cursor position and drawing so that the cursor is
3934 visible when before the tabular-inset.
3936 * src/insets/insettext.C (init): drawLockedFrame was not initialized
3937 when creating from old insettext.
3939 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
3941 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3943 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
3944 * lib/tex/brodway.cls: ditto
3946 * lib/layouts/brodway.layout: change alignment of parenthical
3949 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3951 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
3952 versions 0.88 and 0.89 are supported.
3954 2000-05-15 Juergen Vigna <jug@sad.it>
3956 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
3959 * src/insets/insettext.C (computeTextRows): redone completely this
3960 function in a much cleaner way, because of problems when having a
3962 (draw): added a frame border when the inset is locked.
3963 (SetDrawLockedFrame): this sets if we draw the border or not.
3964 (SetFrameColor): this sets the frame color (default=insetframe).
3966 * src/insets/lyxinset.h: added x() and y() functions which return
3967 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
3968 function which is needed to see if we have a locking inset of some
3969 type in this inset (needed for now in insettabular).
3971 * src/vspace.C (inPixels): the same function also without a BufferView
3972 parameter as so it is easier to use it in some ocasions.
3974 * src/lyxfunc.C: changed all places where insertInset was used so
3975 that now if it couldn't be inserted it is deleted!
3977 * src/TabularLayout.C:
3978 * src/TableLayout.C: added support for new tabular-inset!
3980 * src/BufferView2.C (insertInset): this now returns a bool if the
3981 inset was really inserted!!!
3983 * src/tabular.C (GetLastCellInRow):
3984 (GetFirstCellInRow): new helper functions.
3985 (Latex): implemented for new tabular class.
3989 (TeXTopHLine): new Latex() helper functions.
3991 2000-05-12 Juergen Vigna <jug@sad.it>
3993 * src/mathed/formulamacro.C (Read):
3994 * src/mathed/formula.C (Read): read also the \end_inset here!
3996 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3998 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
3999 crush when saving formulae with unbalanced parenthesis.
4001 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4003 * src/layout.C: Add new keyword "endlabelstring" to layout file
4005 * src/text.C (GetVisibleRow): Draw endlabel string.
4007 * lib/layouts/broadway.layout
4008 * lib/layouts/hollywood.layout: Added endlabel for the
4009 Parenthetical layout.
4011 * lib/layouts/heb-article.layout: Do not use slanted font shape
4012 for Theorem like environments.
4014 * src/buffer.C (makeLaTeXFile): Always add "american" to
4015 the UsedLanguages list if document language is RTL.
4017 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4019 * add addendum to README.OS2 and small patch (from SMiyata)
4021 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4023 * many files: correct the calls to ChangeExtension().
4025 * src/support/filetools.C (ChangeExtension): remove the no_path
4026 argument, which does not belong there. Use OnlyFileName() instead.
4028 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4029 files when LaTeXing a non-nice latex file.
4031 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4032 a chain of "if". Return false when deadkeys are not handled.
4034 * src/lyx_main.C (LyX): adapted the code for default bindings.
4036 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4037 bindings for basic functionality (except deadkeys).
4038 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4040 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4041 several methods: handle override_x_deadkeys.
4043 * src/lyxrc.h: remove the "bindings" map, which did not make much
4044 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4046 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4048 * src/lyxfont.C (stateText): use a saner method to determine
4049 whether the font is "default". Seems to fix the crash with DEC
4052 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4054 2000-05-08 Juergen Vigna <jug@sad.it>
4056 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4057 TabularLayoutMenu with mouse-button-3
4058 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4060 * src/TabularLayout.C: added this file for having a Layout for
4063 2000-05-05 Juergen Vigna <jug@sad.it>
4065 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4066 recalculating inset-widths.
4067 (TabularFeatures): activated this function so that I can change
4068 tabular-features via menu.
4070 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4071 that I can test some functions with the Table menu.
4073 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4075 * src/lyxfont.C (stateText): guard against stupid c++libs.
4077 * src/tabular.C: add using std::vector
4078 some whitespace changes, + removed som autogenerated code.
4080 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4082 2000-05-05 Juergen Vigna <jug@sad.it>
4084 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4085 row, columns and cellstructures.
4087 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4089 * lib/lyxrc.example: remove obsolete entries.
4091 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4092 reading of protected_separator for free_spacing.
4094 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4096 * src/text.C (draw): do not display an exclamation mark in the
4097 margin for margin notes. This is confusing, ugly and
4100 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4101 AMS math' is checked.
4103 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4104 name to see whether including the amsmath package is needed.
4106 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4108 * src/paragraph.C (validate): Compute UsedLanguages correctly
4109 (don't insert the american language if it doesn't appear in the
4112 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4113 The argument of \thanks{} command is considered moving argument
4115 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4118 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4120 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4121 for appendix/minipage/depth. The lines can be now both in the footnote
4122 frame, and outside the frame.
4124 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4127 2000-05-05 Juergen Vigna <jug@sad.it>
4129 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4130 neede only in tabular.[Ch].
4132 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4134 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4136 (Write): write '~' for PROTECTED_SEPARATOR
4138 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4140 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4143 * src/mathed/formula.C (drawStr): rename size to siz.
4145 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4146 possibly fix a bug by not changing the pflags = flags to piflags =
4149 2000-05-05 Juergen Vigna <jug@sad.it>
4151 * src/insets/insetbib.C: moved using directive
4153 * src/ImportNoweb.C: small fix for being able to compile (missing
4156 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4158 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4159 to use clear, since we don't depend on this in the code. Add test
4162 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4164 * (various *.C files): add using std::foo directives to please dec
4167 * replace calls to string::clear() to string::erase() (Angus)
4169 * src/cheaders/cmath: modified to provide std::abs.
4171 2000-05-04 Juergen Vigna <jug@sad.it>
4173 * src/insets/insettext.C: Prepared all for inserting of multiple
4174 paragraphs. Still display stuff to do (alignment and other things),
4175 but I would like to use LyXText to do this when we cleaned out the
4176 table-support stuff.
4178 * src/insets/insettabular.C: Changed lot of stuff and added lots
4179 of functionality still a lot to do.
4181 * src/tabular.C: Various functions changed name and moved to be
4182 const functions. Added new Read and Write functions and changed
4183 lots of things so it works good with tabular-insets (also removed
4184 some stuff which is not needed anymore * hacks *).
4186 * src/lyxcursor.h: added operators == and != which just look if
4187 par and pos are (not) equal.
4189 * src/buffer.C (latexParagraphs): inserted this function to latex
4190 all paragraphs form par to endpar as then I can use this too for
4193 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4194 so that I can call this to from text insets with their own cursor.
4196 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4197 output off all paragraphs (because of the fix below)!
4199 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4200 the very last paragraph (this could be also the last paragraph of an
4203 * src/texrow.h: added rows() call which returns the count-variable.
4205 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4207 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4209 * lib/configure.m4: better autodetection of DocBook tools.
4211 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4213 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4215 * src/lyx_cb.C: add using std::reverse;
4217 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4220 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4221 selected files. Should fix repeated errors from generated files.
4223 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4225 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4227 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4228 the spellchecker popup.
4230 * lib/lyxrc.example: Removed the \number_inset section
4232 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4234 * src/insets/figinset.C (various): Use IsFileReadable() to make
4235 sure that the file actually exist. Relying on ghostscripts errors
4236 is a bad idea since they can lead to X server crashes.
4238 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4240 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4243 * lib/lyxrc.example: smallish typo in description of
4244 \view_dvi_paper_option
4246 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4249 * src/lyxfunc.C: doImportHelper to factor out common code of the
4250 various import methods. New functions doImportASCIIasLines,
4251 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4252 doImportLinuxDoc for the format specific parts.
4255 * buffer.C: Dispatch returns now a bool to indicate success
4258 * lyx_gui.C: Add getLyXView() for member access
4260 * lyx_main.C: Change logic for batch commands: First try
4261 Buffer::Dispatch (possibly without GUI), if that fails, use
4264 * lyx_main.C: Add support for --import command line switch.
4265 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4266 Available Formats: Everything accepted by 'buffer-import <format>'
4268 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4270 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4273 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4274 documents will be reformatted upon reentry.
4276 2000-04-27 Juergen Vigna <jug@sad.it>
4278 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4279 correctly only last pos this was a bug.
4281 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4283 * release of lyx-1.1.5pre1
4285 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4287 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4289 * src/menus.C: revert the change of naming (Figure->Graphic...)
4290 from 2000-04-11. It was incomplete and bad.
4292 * src/LColor.[Ch]: add LColor::depthbar.
4293 * src/text.C (GetVisibleRow): use it.
4295 * README: update the languages list.
4297 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4299 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4302 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4304 * README: remove sections that were just wrong.
4306 * src/text2.C (GetRowNearY): remove currentrow code
4308 * src/text.C (GetRow): remove currentrow code
4310 * src/screen.C (Update): rewritten a bit.
4311 (SmallUpdate): removed func
4313 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4315 (FullRebreak): return bool
4316 (currentrow): remove var
4317 (currentrow_y): ditto
4319 * src/lyxscreen.h (Draw): change arg to unsigned long
4320 (FitCursor): return bool
4321 (FitManualCursor): ditto
4322 (Smallpdate): remove func
4323 (first): change to unsigned long
4324 (DrawOneRow): change second arg to long (from long &)
4325 (screen_refresh_y): remove var
4326 (scree_refresh_row): ditto
4328 * src/lyxrow.h: change baseline to usigned int from unsigned
4329 short, this brings some implicit/unsigned issues out in the open.
4331 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4333 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4334 instead of smallUpdate.
4336 * src/lyxcursor.h: change y to unsigned long
4338 * src/buffer.h: don't call updateScrollbar after fitcursor
4340 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4341 where they are used. Removed "\\direction", this was not present
4342 in 1.1.4 and is already obsolete. Commented out some code that I
4343 believe to never be called.
4344 (runLiterate): don't call updateScrollbar after fitCursor
4346 (buildProgram): ditto
4349 * src/WorkArea.h (workWidth): change return val to unsigned
4352 (redraw): remove the button redraws
4353 (setScrollbarValue): change for scrollbar
4354 (getScrollbarValue): change for scrollbar
4355 (getScrollbarBounds): change for scrollbar
4357 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4358 (C_WorkArea_down_cb): removed func
4359 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4360 (resize): change for scrollbar
4361 (setScrollbar): ditto
4362 (setScrollbarBounds): ditto
4363 (setScrollbarIncrements): ditto
4364 (up_cb): removed func
4365 (down_cb): removed func
4366 (scroll_cb): change for scrollbar
4367 (work_area_handler): ditto
4369 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4370 when FitCursor did something.
4371 (updateScrollbar): some unsigned changes
4372 (downCB): removed func
4373 (scrollUpOnePage): removed func
4374 (scrollDownOnePage): remvoed func
4375 (workAreaMotionNotify): don't call screen->FitCursor but use
4376 fitCursor instead. and bool return val
4377 (workAreaButtonPress): ditto
4378 (workAreaButtonRelease): some unsigned changes
4379 (checkInsetHit): ditto
4380 (workAreaExpose): ditto
4381 (update): parts rewritten, comments about the signed char arg added
4382 (smallUpdate): removed func
4383 (cursorPrevious): call needed updateScrollbar
4386 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4389 * src/BufferView.[Ch] (upCB): removed func
4390 (downCB): removed func
4391 (smallUpdate): removed func
4393 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4395 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4396 currentrow, currentrow_y optimization. This did not help a lot and
4397 if we want to do this kind of optimization we should rather use
4398 cursor.row instead of the currentrow.
4400 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4401 buffer spacing and klyx spacing support.
4403 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4405 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4408 2000-04-26 Juergen Vigna <jug@sad.it>
4410 * src/insets/figinset.C: fixes to Lars sstream changes!
4412 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4414 * A lot of files: Added Ascii(ostream &) methods to all inset
4415 classes. Used when exporting to ASCII.
4417 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4418 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4421 * src/text2.C (ToggleFree): Disabled implicit word selection when
4422 there is a change in the language
4424 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4425 no output was generated for end-of-sentence inset.
4427 * src/insets/lyxinset.h
4430 * src/paragraph.C: Removed the insetnumber code
4432 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4434 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4436 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4437 no_babel and no_epsfig completely from the file.
4438 (parseSingleLyXformat2Token): add handling for per-paragraph
4439 spacing as written by klyx.
4441 * src/insets/figinset.C: applied patch by Andre. Made it work with
4444 2000-04-20 Juergen Vigna <jug@sad.it>
4446 * src/insets/insettext.C (cutSelection):
4447 (copySelection): Fixed with selection from right to left.
4448 (draw): now the rows are not recalculated at every draw.
4449 (computeTextRows): for now reset the inset-owner here (this is
4450 important for an undo or copy where the inset-owner is not set
4453 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4454 motion to the_locking_inset screen->first was forgotten, this was
4455 not important till we got multiline insets.
4457 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4459 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4460 code seems to be alright (it is code changed by Dekel, and the
4461 intent is indeed that all macros should be defined \protect'ed)
4463 * NEWS: a bit of reorganisation of the new user-visible features.
4465 2000-04-19 Juergen Vigna <jug@sad.it>
4467 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4468 position. Set the inset_owner of the used paragraph so that it knows
4469 that it is inside an inset. Fixed cursor handling with mouse and
4470 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4471 and cleanups to make TextInsets work better.
4473 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4474 Changed parameters of various functions and added LockInsetInInset().
4476 * src/insets/insettext.C:
4478 * src/insets/insetcollapsable.h:
4479 * src/insets/insetcollapsable.C:
4480 * src/insets/insetfoot.h:
4481 * src/insets/insetfoot.C:
4482 * src/insets/insetert.h:
4483 * src/insets/insetert.C: cleaned up the code so that it works now
4484 correctly with insettext.
4486 * src/insets/inset.C:
4487 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4488 that insets in insets are supported right.
4491 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4493 * src/paragraph.C: some small fixes
4495 * src/debug.h: inserted INSETS debug info
4497 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4498 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4500 * src/commandtags.h:
4501 * src/LyXAction.C: insert code for InsetTabular.
4503 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4504 not Button1MotionMask.
4505 (workAreaButtonRelease): send always a InsetButtonRelease event to
4507 (checkInsetHit): some setCursor fixes (always with insets).
4509 * src/BufferView2.C (lockInset): returns a bool now and extended for
4510 locking insets inside insets.
4511 (showLockedInsetCursor): it is important to have the cursor always
4512 before the locked inset.
4513 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4515 * src/BufferView.h: made lockInset return a bool.
4517 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4519 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4520 that is used also internally but can be called as public to have back
4521 a cursor pos which is not set internally.
4522 (SetCursorIntern): Changed to use above function.
4524 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4526 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4531 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4532 patches for things that should be in or should be changed.
4534 * src/* [insetfiles]: change "usigned char fragile" to bool
4535 fragile. There was only one point that could that be questioned
4536 and that is commented in formulamacro.C. Grep for "CHECK".
4538 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4539 (DeleteBuffer): take it out of CutAndPaste and make it static.
4541 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4543 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4544 output the spacing envir commands. Also the new commands used in
4545 the LaTeX output makes the result better.
4547 * src/Spacing.C (writeEnvirBegin): new method
4548 (writeEnvirEnd): new method
4550 2000-04-18 Juergen Vigna <jug@sad.it>
4552 * src/CutAndPaste.C: made textclass a static member of the class
4553 as otherwise it is not accesed right!!!
4555 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4557 * forms/layout_forms.fd
4558 * src/layout_forms.h
4559 * src/layout_forms.C (create_form_form_character)
4560 * src/lyx_cb.C (UserFreeFont)
4561 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4562 documents (in the layout->character popup).
4564 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4566 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4567 \spell_command was in fact not honored (from Kevin Atkinson).
4569 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4572 * src/lyx_gui.h: make lyxViews private (Angus)
4574 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4576 * src/mathed/math_write.C
4577 (MathMatrixInset::Write) Put \protect before \begin{array} and
4578 \end{array} if fragile
4579 (MathParInset::Write): Put \protect before \\ if fragile
4581 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4583 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4584 initialization if the LyXColorHandler must be done after the
4585 connections to the XServer has been established.
4587 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4588 get the background pixel from the lyxColorhandler so that the
4589 figures are rendered with the correct background color.
4590 (NextToken): removed functions.
4591 (GetPSSizes): use ifs >> string instead of NextToken.
4593 * src/Painter.[Ch]: the color cache moved out of this file.
4595 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4598 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4600 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4601 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4603 * src/BufferView.C (enterView): new func
4604 (leaveView): new func
4606 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4608 (leaveView): new func, undefines xterm cursor when approp.
4610 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4611 (AllowInput): delete the Workarea cursor handling from this func.
4613 * src/Painter.C (underline): draw a slimer underline in most cases.
4615 * src/lyx_main.C (error_handler): use extern "C"
4617 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4619 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4620 sent directly to me.
4622 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4623 to the list by Dekel.
4625 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4628 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4629 methods from lyx_cb.here.
4631 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4634 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4636 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4637 instead of using current_view directly.
4639 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4641 * src/LyXAction.C (init): add the paragraph-spacing command.
4643 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4645 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4647 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4648 different from the documents.
4650 * src/text.C (SetHeightOfRow): take paragraph spacing into
4651 account, paragraph spacing takes precedence over buffer spacing
4652 (GetVisibleRow): ditto
4654 * src/paragraph.C (writeFile): output the spacing parameter too.
4655 (validate): set the correct features if spacing is used in the
4657 (Clear): set spacing to default
4658 (MakeSameLayout): spacing too
4659 (HasSameLayout): spacing too
4660 (SetLayout): spacing too
4661 (TeXOnePar): output the spacing commands
4663 * src/lyxparagraph.h: added a spacing variable for use with
4664 per-paragraph spacing.
4666 * src/Spacing.h: add a Default spacing and a method to check if
4667 the current spacing is default. also added an operator==
4669 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4672 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4674 * src/lyxserver.C (callback): fix dispatch of functions
4676 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4677 printf() into lyxerr call.
4679 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4682 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4683 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4684 the "Float" from each of the subitems.
4685 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4687 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4688 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4689 documented the change so that the workaround can be nuked later.
4691 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4694 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4696 * src/buffer.C (getLatexName): ditto
4697 (setReadonly): ditto
4699 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4701 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4702 avoid some uses of current_view. Added also a bufferParams()
4703 method to get at this.
4705 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4707 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4709 * src/lyxparagraph.[Ch]: removed
4710 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4711 with operators used by lower_bound and
4712 upper_bound in InsetTable's
4713 Make struct InsetTable private again. Used matchpos.
4715 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4717 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4718 document, the language of existing text is changed (unless the
4719 document is multi-lingual)
4721 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4723 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4725 * A lot of files: A rewrite of the Right-to-Left support.
4727 2000-04-10 Juergen Vigna <jug@sad.it>
4729 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4730 misplaced cursor when inset in inset is locked.
4732 * src/insets/insettext.C (LocalDispatch): small fix so that a
4733 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4735 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4736 footnote font should be decreased in size twice when displaying.
4738 * src/insets/insettext.C (GetDrawFont): inserted this function as
4739 the drawing-font may differ from the real paragraph font.
4741 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4742 insets (inset in inset!).
4744 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4745 function here because we don't want footnotes inside footnotes.
4747 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4749 (init): now set the inset_owner in paragraph.C
4750 (LocalDispatch): added some resetPos() in the right position
4753 (pasteSelection): changed to use the new CutAndPaste-Class.
4755 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4756 which tells if it is allowed to insert another inset inside this one.
4758 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4759 SwitchLayoutsBetweenClasses.
4761 * src/text2.C (InsertInset): checking of the new paragraph-function
4763 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4764 is not needed anymore here!
4767 (PasteSelection): redone (also with #ifdef) so that now this uses
4768 the CutAndPaste-Class.
4769 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4772 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4773 from/to text/insets.
4775 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4776 so that the paragraph knows if it is inside an (text)-inset.
4777 (InsertFromMinibuffer): changed return-value to bool as now it
4778 may happen that an inset is not inserted in the paragraph.
4779 (InsertInsetAllowed): this checks if it is allowed to insert an
4780 inset in this paragraph.
4782 (BreakParagraphConservative):
4783 (BreakParagraph) : small change for the above change of the return
4784 value of InsertFromMinibuffer.
4786 * src/lyxparagraph.h: added inset_owner and the functions to handle
4787 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4789 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4791 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4792 functions from BufferView to BufferView::Pimpl to ease maintence.
4794 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4795 correctly. Also use SetCursorIntern instead of SetCursor.
4797 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4800 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4802 * src/WorkArea.C (belowMouse): manually implement below mouse.
4804 * src/*: Add "explicit" on several constructors, I added probably
4805 some unneeded ones. A couple of changes to code because of this.
4807 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4808 implementation and private parts from the users of BufferView. Not
4811 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4812 implementation and private parts from the users of LyXLex. Not
4815 * src/BufferView_pimpl.[Ch]: new files
4817 * src/lyxlex_pimpl.[Ch]: new files
4819 * src/LyXView.[Ch]: some inline functions move out-of-line
4821 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4823 * src/lyxparagraph.h: make struct InsetTable public.
4825 * src/support/lyxstring.h: change lyxstring::difference_type to be
4826 ptrdiff_t. Add std:: modifiers to streams.
4828 * src/font.C: include the <cctype> header, for islower() and
4831 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4833 * src/font.[Ch]: new files. Contains the metric functions for
4834 fonts, takes a LyXFont as parameter. Better separation of concepts.
4836 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4837 changes because of this.
4839 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4841 * src/*: compile with -Winline and move functions that don't
4844 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4847 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4849 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4850 (various files changed because of this)
4852 * src/Painter.C (text): fixed the drawing of smallcaps.
4854 * src/lyxfont.[Ch] (drawText): removed unused member func.
4857 * src/*.C: added needed "using" statements and "std::" qualifiers.
4859 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4861 * src/*.h: removed all use of "using" from header files use
4862 qualifier std:: instead.
4864 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4866 * src/text.C (Backspace): some additional cleanups (we already
4867 know whether cursor.pos is 0 or not).
4869 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4870 automake does not provide one).
4872 * src/bmtable.h: replace C++ comments with C comments.
4874 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4876 * src/screen.C (ShowCursor): Change the shape of the cursor if
4877 the current language is not equal to the language of the document.
4878 (If the cursor change its shape unexpectedly, then you've found a bug)
4880 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4883 * src/insets/insetnumber.[Ch]: New files.
4885 * src/LyXAction.C (init)
4886 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4889 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4891 * src/lyxparagraph.h
4892 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4893 (the vector is kept sorted).
4895 * src/text.C (GetVisibleRow): Draw selection correctly when there
4896 is both LTR and RTL text.
4898 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4899 which is much faster.
4901 * src/text.C (GetVisibleRow and other): Do not draw the last space
4902 in a row if the direction of the last letter is not equal to the
4903 direction of the paragraph.
4905 * src/lyxfont.C (latexWriteStartChanges):
4906 Check that font language is not equal to basefont language.
4907 (latexWriteEndChanges): ditto
4909 * src/lyx_cb.C (StyleReset): Don't change the language while using
4910 the font-default command.
4912 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4913 empty paragraph before a footnote.
4915 * src/insets/insetcommand.C (draw): Increase x correctly.
4917 * src/screen.C (ShowCursor): Change cursor shape if
4918 current language != document language.
4920 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4922 2000-03-31 Juergen Vigna <jug@sad.it>
4924 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4925 (Clone): changed mode how the paragraph-data is copied to the
4926 new clone-paragraph.
4928 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4929 GetInset(pos) with no inset anymore there (in inset UNDO)
4931 * src/insets/insetcommand.C (draw): small fix as here x is
4932 incremented not as much as width() returns (2 before, 2 behind = 4)
4934 2000-03-30 Juergen Vigna <jug@sad.it>
4936 * src/insets/insettext.C (InsetText): small fix in initialize
4937 widthOffset (should not be done in the init() function)
4939 2000-03-29 Amir Karger <karger@lyx.org>
4941 * lib/examples/it_ItemizeBullets.lyx: translation by
4944 * Implemented \textasciitilde and fixed a tiny bug in reLyX
4946 2000-03-29 Juergen Vigna <jug@sad.it>
4948 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
4950 * src/insets/insetfoot.C (Clone): small change as for the below
4951 new init function in the text-inset
4953 * src/insets/insettext.C (init): new function as I've seen that
4954 clone did not copy the Paragraph-Data!
4955 (LocalDispatch): Added code so that now we have some sort of Undo
4956 functionality (well actually we HAVE Undo ;)
4958 * src/text.C (Backspace): Small fix for the a | a Backspace problem
4960 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
4962 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
4965 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4967 * src/main.C: added a runtime check that verifies that the xforms
4968 header used when building LyX and the library used when running
4969 LyX match. Exit with a message if they don't match. This is a
4970 version number check only.
4972 * src/buffer.C (save): Don't allocate memory on the heap for
4973 struct utimbuf times.
4975 * *: some using changes, use iosfwd instead of the real headers.
4977 * src/lyxfont.C use char const * instead of string for the static
4978 strings. Rewrite some functions to use sstream.
4980 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4982 * src/text.C (Backspace): hopefully fix the dreaded backaspace
4985 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4987 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
4988 of Geodesy (from Martin Vermeer)
4990 * lib/layouts/svjour.inc: include file for the Springer svjour
4991 class. It can be used to support journals other than JoG.
4993 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
4994 Miskiewicz <misiek@pld.org.pl>)
4995 * lib/reLyX/Makefile.am: ditto.
4997 2000-03-27 Juergen Vigna <jug@sad.it>
4999 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5000 also some modifications with operations on selected text.
5002 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5003 problems with clicking on insets (last famous words ;)
5005 * src/insets/insetcommand.C (draw):
5006 (width): Changed to have a bit of space before and after the inset so
5007 that the blinking cursor can be seen (otherwise it was hidden)
5009 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5011 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5012 would not be added to the link list when an installed gettext (not
5013 part of libc) is found.
5015 2000-03-24 Juergen Vigna <jug@sad.it>
5017 * src/insets/insetcollapsable.C (Edit):
5018 * src/mathed/formula.C (InsetButtonRelease):
5019 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5022 * src/BufferView.C (workAreaButtonPress):
5023 (workAreaButtonRelease):
5024 (checkInsetHit): Finally fixed the clicking on insets be handled
5027 * src/insets/insetert.C (Edit): inserted this call so that ERT
5028 insets work always with LaTeX-font
5030 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5032 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5033 caused lyx to startup with no GUI in place, causing in a crash
5034 upon startup when called with arguments.
5036 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5038 * src/FontLoader.C: better initialization of dummyXFontStruct.
5040 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5042 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5043 for linuxdoc and docbook import and export format options.
5045 * lib/lyxrc.example Example of default values for the previous flags.
5047 * src/lyx_cb.C Use those flags instead of the hardwired values for
5048 linuxdoc and docbook export.
5050 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5053 * src/menus.C Added menus entries for the new import/exports formats.
5055 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5057 * src/lyxrc.*: Added support for running without Gui
5060 * src/FontLoader.C: sensible defaults if no fonts are needed
5062 * src/lyx_cb.C: New function ShowMessage (writes either to the
5063 minibuffer or cout in case of no gui
5064 New function AskOverwrite for common stuff
5065 Consequently various changes to call these functions
5067 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5068 wild guess at sensible screen resolution when having no gui
5070 * src/lyxfont.C: no gui, no fonts... set some defaults
5072 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5074 * src/LColor.C: made the command inset background a bit lighter.
5076 2000-03-20 Hartmut Goebel <goebel@noris.net>
5078 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5079 stdstruct.inc. Koma-Script added some title elements which
5080 otherwise have been listed below "bibliography". This split allows
5081 adding title elements to where they belong.
5083 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5084 define the additional tilte elements and then include
5087 * many other layout files: changed to include stdtitle.inc just
5088 before stdstruct.inc.
5090 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5092 * src/buffer.C: (save) Added the option to store all backup files
5093 in a single directory
5095 * src/lyxrc.[Ch]: Added variable \backupdir_path
5097 * lib/lyxrc.example: Added descriptions of recently added variables
5099 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5100 bibtex inset, not closing the bibtex popup when deleting the inset)
5102 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5104 * src/lyx_cb.C: add a couple using directives.
5106 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5107 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5108 import based on the filename.
5110 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5111 file would be imported at start, if the filename where of a sgml file.
5113 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5115 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5117 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5118 * src/lyxfont.h Replaced the member variable bits.direction by the
5119 member variable lang. Made many changes in other files.
5120 This allows having a multi-lingual document
5122 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5123 that change the current language to <l>.
5124 Removed the command "font-rtl"
5126 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5127 format for Hebrew documents)
5129 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5130 When auto_mathmode is "true", pressing a digit key in normal mode
5131 will cause entering into mathmode.
5132 If auto_mathmode is "rtl" then this behavior will be active only
5133 when writing right-to-left text.
5135 * src/text2.C (InsertStringA) The string is inserted using the
5138 * src/paragraph.C (GetEndLabel) Gives a correct result for
5139 footnote paragraphs.
5141 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5143 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5145 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5146 front of PasteParagraph. Never insert a ' '. This should at least
5147 fix some cause for the segfaults that we have been experiencing,
5148 it also fixes backspace behaviour slightly. (Phu!)
5150 * src/support/lstrings.C (compare_no_case): some change to make it
5151 compile with gcc 2.95.2 and stdlibc++-v3
5153 * src/text2.C (MeltFootnoteEnvironment): change type o
5154 first_footnote_par_is_not_empty to bool.
5156 * src/lyxparagraph.h: make text private. Changes in other files
5158 (fitToSize): new function
5159 (setContentsFromPar): new function
5160 (clearContents): new function
5161 (SetChar): new function
5163 * src/paragraph.C (readSimpleWholeFile): deleted.
5165 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5166 the file, just use a simple string instead. Also read the file in
5167 a more maintainable manner.
5169 * src/text2.C (InsertStringA): deleted.
5170 (InsertStringB): deleted.
5172 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5174 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5175 RedoParagraphs from the doublespace handling part, just set status
5176 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5177 done, but perhaps not like this.)
5179 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5181 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5182 character when inserting an inset.
5184 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5186 * src/bufferparams.C (readLanguage): now takes "default" into
5189 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5190 also initialize the toplevel_keymap with the default bindings from
5193 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5195 * all files using lyxrc: have lyxrc as a real variable and not a
5196 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5199 * src/lyxrc.C: remove double call to defaultKeyBindings
5201 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5202 toolbar defauls using lyxlex. Remove enums, structs, functions
5205 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5206 toolbar defaults. Also store default keybindings in a map.
5208 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5209 storing the toolbar defaults without any xforms dependencies.
5211 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5212 applied. Changed to use iterators.
5214 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5216 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5217 systems that don't have LINGUAS set to begin with.
5219 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5221 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5222 the list by Dekel Tsur.
5224 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5226 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5227 * src/insets/form_graphics.C: ditto.
5229 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5231 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5233 * src/bufferparams.C (readLanguage): use the new language map
5235 * src/intl.C (InitKeyMapper): use the new language map
5237 * src/lyx_gui.C (create_forms): use the new language map
5239 * src/language.[Ch]: New files. Used for holding the information
5240 about each language. Now! Use this new language map enhance it and
5241 make it really usable for our needs.
5243 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5245 * screen.C (ShowCursor): Removed duplicate code.
5246 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5247 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5249 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5252 * src/text.C Added TransformChar method. Used for rendering Arabic
5253 text correctly (change the glyphs of the letter according to the
5254 position in the word)
5259 * src/lyxrc.C Added lyxrc command {language_command_begin,
5260 language_command_end,language_command_ltr,language_command_rtl,
5261 language_package} which allows the use of either arabtex or Omega
5264 * src/lyx_gui.C (init)
5266 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5267 to use encoding for menu fonts which is different than the encoding
5270 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5271 do not load the babel package.
5272 To write an English document with Hebrew/Arabic, change the document
5273 language to "english".
5275 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5276 (alphaCounter): changed to return char
5277 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5279 * lib/lyxrc.example Added examples for Hebrew/Arabic
5282 * src/layout.C Added layout command endlabeltype
5284 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5286 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5288 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5290 * src/mathed/math_delim.C (search_deco): return a
5291 math_deco_struct* instead of index.
5293 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5295 * All files with a USE_OSTREAM_ONLY within: removed all code that
5296 was unused when USE_OSTREAM_ONLY is defined.
5298 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5299 of any less. Removed header and using.
5301 * src/text.C (GetVisibleRow): draw the string "Page Break
5302 (top/bottom)" on screen when drawing a pagebreak line.
5304 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5306 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5308 * src/mathed/math_macro.C (draw): do some cast magic.
5311 * src/mathed/math_defs.h: change byte* argument to byte const*.
5313 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5315 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5316 know it is right to return InsetFoot* too, but cxx does not like
5319 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5321 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5323 * src/mathed/math_delim.C: change == to proper assignment.
5325 2000-03-09 Juergen Vigna <jug@sad.it>
5327 * src/insets/insettext.C (setPos): fixed various cursor positioning
5328 problems (via mouse and cursor-keys)
5329 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5330 inset (still a small display problem but it works ;)
5332 * src/insets/insetcollapsable.C (draw): added button_top_y and
5333 button_bottom_y to have correct values for clicking on the inset.
5335 * src/support/lyxalgo.h: commented out 'using std::less'
5337 2000-03-08 Juergen Vigna <jug@sad.it>
5339 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5340 Button-Release event closes as it is alos the Release-Event
5343 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5345 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5347 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5348 can add multiple spaces in Scrap (literate programming) styles...
5349 which, by the way, is how I got hooked on LyX to begin with.
5351 * src/mathed/formula.C (Write): Added dummy variable to an
5352 inset::Latex() call.
5353 (Latex): Add free_spacing boolean to inset::Latex()
5355 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5357 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5358 virtual function to include the free_spacing boolean from
5359 the containing paragraph's style.
5361 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5362 Added free_spacing boolean arg to match inset.h
5364 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5365 Added free_spacing boolean arg to match inset.h
5367 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5368 Added free_spacing boolean and made sure that if in a free_spacing
5369 paragraph, that we output normal space if there is a protected space.
5371 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5372 Added free_spacing boolean arg to match inset.h
5374 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5375 Added free_spacing boolean arg to match inset.h
5377 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5378 Added free_spacing boolean arg to match inset.h
5380 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5381 Added free_spacing boolean arg to match inset.h
5383 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5384 Added free_spacing boolean arg to match inset.h
5386 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5387 free_spacing boolean arg to match inset.h
5389 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5390 Added free_spacing boolean arg to match inset.h
5392 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5393 Added free_spacing boolean arg to match inset.h
5395 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5396 Added free_spacing boolean arg to match inset.h
5398 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5399 Added free_spacing boolean arg to match inset.h
5401 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5402 Added free_spacing boolean arg to match inset.h
5404 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5405 free_spacing boolean arg to match inset.h
5407 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5408 free_spacing boolean arg to match inset.h
5410 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5411 ignore free_spacing paragraphs. The user's spaces are left
5414 * src/text.C (InsertChar): Fixed the free_spacing layout
5415 attribute behavior. Now, if free_spacing is set, you can
5416 add multiple spaces in a paragraph with impunity (and they
5417 get output verbatim).
5418 (SelectSelectedWord): Added dummy argument to inset::Latex()
5421 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5424 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5425 paragraph layouts now only input a simple space instead.
5426 Special character insets don't make any sense in free-spacing
5429 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5430 hard-spaces in the *input* file to simple spaces if the layout
5431 is free-spacing. This converts old files which had to have
5432 hard-spaces in free-spacing layouts where a simple space was
5434 (writeFileAscii): Added free_spacing check to pass to the newly
5435 reworked inset::Latex(...) methods. The inset::Latex() code
5436 ensures that hard-spaces in free-spacing paragraphs get output
5437 as spaces (rather than "~").
5439 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5441 * src/mathed/math_delim.C (draw): draw the empty placeholder
5442 delims with a onoffdash line.
5443 (struct math_deco_compare): struct that holds the "functors" used
5444 for the sort and the binary search in math_deco_table.
5445 (class init_deco_table): class used for initial sort of the
5447 (search_deco): use lower_bound to do a binary search in the
5450 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5452 * src/lyxrc.C: a small secret thingie...
5454 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5455 and to not flush the stream as often as it used to.
5457 * src/support/lyxalgo.h: new file
5458 (sorted): template function used for checking if a sequence is
5459 sorted or not. Two versions with and without user supplied
5460 compare. Uses same compare as std::sort.
5462 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5463 it and give warning on lyxerr.
5465 (struct compare_tags): struct with function operators used for
5466 checking if sorted, sorting and lower_bound.
5467 (search_kw): use lower_bound instead of manually implemented
5470 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5472 * src/insets/insetcollapsable.h: fix Clone() declaration.
5473 * src/insets/insetfoot.h: ditto.
5475 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5477 2000-03-08 Juergen Vigna <jug@sad.it>
5479 * src/insets/lyxinset.h: added owner call which tells us if
5480 this inset is inside another inset. Changed also the return-type
5481 of Editable to an enum so it tells clearer what the return-value is.
5483 * src/insets/insettext.C (computeTextRows): fixed computing of
5484 textinsets which split automatically on more rows.
5486 * src/insets/insetert.[Ch]: changed this to be of BaseType
5489 * src/insets/insetfoot.[Ch]: added footnote inset
5491 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5492 collapsable insets (like footnote, ert, ...)
5494 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5496 * src/lyxdraw.h: remvoe file
5498 * src/lyxdraw.C: remove file
5500 * src/insets/insettext.C: added <algorithm>.
5502 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5504 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5505 (matrix_cb): case MM_OK use string stream
5507 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5510 * src/mathed/math_macro.C (draw): use string stream
5511 (Metrics): use string stream
5513 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5514 directly to the ostream.
5516 * src/vspace.C (asString): use string stream.
5517 (asString): use string stream
5518 (asLatexString): use string stream
5520 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5521 setting Spacing::Other.
5523 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5524 sprintf when creating the stretch vale.
5526 * src/text2.C (alphaCounter): changed to return a string and to
5527 not use a static variable internally. Also fixed a one-off bug.
5528 (SetCounter): changed the drawing of the labels to use string
5529 streams instead of sprintf.
5531 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5532 manipulator to use a scheme that does not require library support.
5533 This is also the way it is done in the new GNU libstdc++. Should
5534 work with DEC cxx now.
5536 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5538 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5539 end. This fixes a bug.
5541 * src/mathed (all files concerned with file writing): apply the
5542 USE_OSTREAM_ONLY changes to mathed too.
5544 * src/support/DebugStream.h: make the constructor explicit.
5546 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5547 count and ostream squashed.
5549 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5551 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5553 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5554 ostringstream uses STL strings, and we might not.
5556 * src/insets/insetspecialchar.C: add using directive.
5557 * src/insets/insettext.C: ditto.
5559 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5561 * lib/layouts/seminar.layout: feeble attempt at a layout for
5562 seminar.cls, far from completet and could really use some looking
5563 at from people used to write layout files.
5565 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5566 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5567 a lot nicer and works nicely with ostreams.
5569 * src/mathed/formula.C (draw): a slightly different solution that
5570 the one posted to the list, but I think this one works too. (font
5571 size wrong in headers.)
5573 * src/insets/insettext.C (computeTextRows): some fiddling on
5574 Jürgens turf, added some comments that he should read.
5576 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5577 used and it gave compiler warnings.
5578 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5581 * src/lyx_gui.C (create_forms): do the right thing when
5582 show_banner is true/false.
5584 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5585 show_banner is false.
5587 * most file writing files: Now use iostreams to do almost all of
5588 the writing. Also instead of passing string &, we now use
5589 stringstreams. mathed output is still not adapted to iostreams.
5590 This change can be turned off by commenting out all the occurences
5591 of the "#define USE_OSTREAM_ONLY 1" lines.
5593 * src/WorkArea.C (createPixmap): don't output debug messages.
5594 (WorkArea): don't output debug messages.
5596 * lib/lyxrc.example: added a comment about the new variable
5599 * development/Code_rules/Rules: Added some more commente about how
5600 to build class interfaces and on how better encapsulation can be
5603 2000-03-03 Juergen Vigna <jug@sad.it>
5605 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5606 automatically with the width of the LyX-Window
5608 * src/insets/insettext.C (computeTextRows): fixed update bug in
5609 displaying text-insets (scrollvalues where not initialized!)
5611 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5613 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5614 id in the check of the result from lower_bound is not enough since
5615 lower_bound can return last too, and then res->id will not be a
5618 * all insets and some code that use them: I have conditionalized
5619 removed the Latex(string & out, ...) this means that only the
5620 Latex(ostream &, ...) will be used. This is a work in progress to
5621 move towards using streams for all output of files.
5623 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5626 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5628 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5629 routine (this fixes bug where greek letters were surrounded by too
5632 * src/support/filetools.C (findtexfile): change a bit the search
5633 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5634 no longer passed to kpsewhich, we may have to change that later.
5636 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5637 warning options to avoid problems with X header files (from Angus
5639 * acinclude.m4: regenerated.
5641 2000-03-02 Juergen Vigna <jug@sad.it>
5643 * src/insets/insettext.C (WriteParagraphData): Using the
5644 par->writeFile() function for writing paragraph-data.
5645 (Read): Using buffer->parseSingleLyXformat2Token()-function
5646 for parsing paragraph data!
5648 * src/buffer.C (readLyXformat2): removed all parse data and using
5649 the new parseSingleLyXformat2Token()-function.
5650 (parseSingleLyXformat2Token): added this function to parse (read)
5651 lyx-file-format (this is called also from text-insets now!)
5653 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5655 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5658 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5659 directly instead of going through a func. One very bad thing: a
5660 static LyXFindReplace, but I don't know where to place it.
5662 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5663 string instead of char[]. Also changed to static.
5664 (GetSelectionOrWordAtCursor): changed to static inline
5665 (SetSelectionOverLenChars): ditto.
5667 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5668 current_view and global variables. both classes has changed names
5669 and LyXFindReplace is not inherited from SearchForm.
5671 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5672 fl_form_search form.
5674 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5676 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5678 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5679 bound (from Kayvan).
5681 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5683 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5685 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5687 * some things that I should comment but the local pub says head to
5690 * comment out all code that belongs to the Roff code for Ascii
5691 export of tables. (this is unused)
5693 * src/LyXView.C: use correct type for global variable
5694 current_layout. (LyXTextClass::size_type)
5696 * some code to get the new insetgraphics closer to working I'd be
5697 grateful for any help.
5699 * src/BufferView2.C (insertInset): use the return type of
5700 NumberOfLayout properly. (also changes in other files)
5702 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5703 this as a test. I want to know what breaks because of this.
5705 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5707 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5709 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5710 to use a \makebox in the label, this allows proper justification
5711 with out using protected spaces or multiple hfills. Now it is
5712 "label" for left justified, "\hfill label\hfill" for center, and
5713 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5714 should be changed accordingly.
5716 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5718 * src/lyxtext.h: change SetLayout() to take a
5719 LyXTextClass::size_type instead of a char (when there is more than
5720 127 layouts in a class); also change type of copylayouttype.
5721 * src/text2.C (SetLayout): ditto.
5722 * src/LyXView.C (updateLayoutChoice): ditto.
5724 * src/LaTeX.C (scanLogFile): errors where the line number was not
5725 given just after the '!'-line were ignored (from Dekel Tsur).
5727 * lib/lyxrc.example: fix description of \date_insert_format
5729 * lib/layouts/llncs.layout: new layout, contributed by Martin
5732 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5734 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5735 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5736 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5737 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5738 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5739 paragraph.C, text.C, text2.C)
5741 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5743 * src/insets/insettext.C (LocalDispatch): remove extra break
5746 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5747 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5749 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5750 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5752 * src/insets/insetbib.h: move InsetBibkey::Holder and
5753 InsetCitation::Holder in public space.
5755 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5757 * src/insets/insettext.h: small change to get the new files from
5758 Juergen to compile (use "string", not "class string").
5760 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5761 const & as parameter to LocalDispatch, use LyXFont const & as
5762 paramter to some other func. This also had impacto on lyxinsets.h
5763 and the two mathed insets.
5765 2000-02-24 Juergen Vigna <jug@sad.it>
5768 * src/commandtags.h:
5770 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5774 * src/BufferView2.C: added/updated code for various inset-functions
5776 * src/insets/insetert.[Ch]: added implementation of InsetERT
5778 * src/insets/insettext.[Ch]: added implementation of InsetText
5780 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5781 (draw): added preliminary code for inset scrolling not finshed yet
5783 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5784 as it is in lyxfunc.C now
5786 * src/insets/lyxinset.h: Added functions for text-insets
5788 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5790 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5791 BufferView and reimplement the list as a queue put inside its own
5794 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5796 * several files: use the new interface to the "updateinsetlist"
5798 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5800 (work_area_handler): call BufferView::trippleClick on trippleclick.
5802 * src/BufferView.C (doubleClick): new function, selects word on
5804 (trippleClick): new function, selects line on trippleclick.
5806 2000-02-22 Allan Rae <rae@lyx.org>
5808 * lib/bind/xemacs.bind: buffer-previous not supported
5810 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5812 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5815 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5817 * src/bufferlist.C: get rid of current_view from this file
5819 * src/spellchecker.C: get rid of current_view from this file
5821 * src/vspace.C: get rid of current_view from this file
5822 (inPixels): added BufferView parameter for this func
5823 (asLatexCommand): added a BufferParams for this func
5825 * src/text.C src/text2.C: get rid of current_view from these
5828 * src/lyxfont.C (getFontDirection): move this function here from
5831 * src/bufferparams.C (getDocumentDirection): move this function
5834 * src/paragraph.C (getParDirection): move this function here from
5836 (getLetterDirection): ditto
5838 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5840 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5841 resize due to wrong pixmap beeing used. Also took the opurtunity
5842 to make the LyXScreen stateless on regard to WorkArea and some
5843 general cleanup in the same files.
5845 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5847 * src/Makefile.am: add missing direction.h
5849 * src/PainterBase.h: made the width functions const.
5851 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5854 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5856 * src/insets/insetlatexaccent.C (draw): make the accents draw
5857 better, at present this will only work well with iso8859-1.
5859 * several files: remove the old drawing code, now we use the new
5862 * several files: remove support for mono_video, reverse_video and
5865 2000-02-17 Juergen Vigna <jug@sad.it>
5867 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5868 int ** as we have to return the pointer, otherwise we have only
5869 NULL pointers in the returning function.
5871 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5873 * src/LaTeX.C (operator()): quote file name when running latex.
5875 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5877 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5878 (bubble tip), this removes our special handling of this.
5880 * Remove all code that is unused now that we have the new
5881 workarea. (Code that are not active when NEW_WA is defined.)
5883 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5885 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5887 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5888 nonexisting layout; correctly redirect obsoleted layouts.
5890 * lib/lyxrc.example: document \view_dvi_paper_option
5892 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5895 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5896 (PreviewDVI): handle the view_dvi_paper_option variable.
5897 [Both from Roland Krause]
5899 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5901 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5902 char const *, int, LyXFont)
5903 (text(int, int, string, LyXFont)): ditto
5905 * src/text.C (InsertCharInTable): attempt to fix the double-space
5906 feature in tables too.
5907 (BackspaceInTable): ditto.
5908 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5910 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5912 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5914 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5915 newly found text in textcache to this.
5916 (buffer): set the owner of the text put into the textcache to 0
5918 * src/insets/figinset.C (draw): fixed the drawing of figures with
5921 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5922 drawing of mathframe, hfills, protected space, table lines. I have
5923 now no outstanding drawing problems with the new Painter code.
5925 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5927 * src/PainterBase.C (ellipse, circle): do not specify the default
5930 * src/LColor.h: add using directive.
5932 * src/Painter.[Ch]: change return type of methods from Painter& to
5933 PainterBase&. Add a using directive.
5935 * src/WorkArea.C: wrap xforms callbacks in C functions
5938 * lib/layouts/foils.layout: font fix and simplifications from Carl
5941 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5943 * a lot of files: The Painter, LColor and WorkArea from the old
5944 devel branch has been ported to lyx-devel. Some new files and a
5945 lot of #ifdeffed code. The new workarea is enabled by default, but
5946 if you want to test the new Painter and LColor you have to compile
5947 with USE_PAINTER defined (do this in config.h f.ex.) There are
5948 still some rought edges, and I'd like some help to clear those
5949 out. It looks stable (loads and displays the Userguide very well).
5952 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5954 * src/buffer.C (pop_tag): revert to the previous implementation
5955 (use a global variable for both loops).
5957 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
5959 * src/lyxrc.C (LyXRC): change slightly default date format.
5961 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
5962 there is an English text with a footnote that starts with a Hebrew
5963 paragraph, or vice versa.
5964 (TeXFootnote): ditto.
5966 * src/text.C (LeftMargin): allow for negative values for
5967 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
5970 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
5971 for input encoding (cyrillic)
5973 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5975 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
5978 * src/toolbar.C (set): ditto
5979 * src/insets/insetbib.C (create_form_citation_form): ditto
5981 * lib/CREDITS: added Dekel Tsur.
5983 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
5984 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
5985 hebrew supports files from Dekel Tsur.
5987 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
5988 <tzafrir@technion.ac.il>
5990 * src/lyxrc.C: put \date_insert_format at the right place.
5992 * src/buffer.C (makeLaTeXFile): fix the handling of
5993 BufferParams::sides when writing out latex files.
5995 * src/BufferView2.C: add a "using" directive.
5997 * src/support/lyxsum.C (sum): when we use lyxstring,
5998 ostringstream::str needs an additional .c_str().
6000 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6002 * src/support/filetools.C (ChangeExtension): patch from Etienne
6005 * src/TextCache.C (show): remove const_cast and make second
6006 parameter non-const LyXText *.
6008 * src/TextCache.h: use non const LyXText in show.
6010 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6013 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6015 * src/support/lyxsum.C: rework to be more flexible.
6017 * several places: don't check if a pointer is 0 if you are going
6020 * src/text.C: remove some dead code.
6022 * src/insets/figinset.C: remove some dead code
6024 * src/buffer.C: move the BufferView funcs to BufferView2.C
6025 remove all support for insetlatexdel
6026 remove support for oldpapersize stuff
6027 made some member funcs const
6029 * src/kbmap.C: use a std::list to store the bindings in.
6031 * src/BufferView2.C: new file
6033 * src/kbsequence.[Ch]: new files
6035 * src/LyXAction.C + others: remove all trace of buffer-previous
6037 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6038 only have one copy in the binary of this table.
6040 * hebrew patch: moved some functions from LyXText to more
6041 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6043 * several files: remove support for XForms older than 0.88
6045 remove some #if 0 #endif code
6047 * src/TextCache.[Ch]: new file. Holds the textcache.
6049 * src/BufferView.C: changes to use the new TextCache interface.
6050 (waitForX): remove the now unused code.
6052 * src/BackStack.h: remove some commented code
6054 * lib/bind/emacs.bind: remove binding for buffer-previous
6056 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6058 * applied the hebrew patch.
6060 * src/lyxrow.h: make sure that all Row variables are initialized.
6062 * src/text2.C (TextHandleUndo): comment out a delete, this might
6063 introduce a memory leak, but should also help us to not try to
6064 read freed memory. We need to look at this one.
6066 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6067 (LyXParagraph): initalize footnotekind.
6069 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6070 forgot this when applying the patch. Please heed the warnings.
6072 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6073 (aka. reformat problem)
6075 * src/bufferlist.C (exists): made const, and use const_iterator
6076 (isLoaded): new func.
6077 (release): use std::find to find the correct buffer.
6079 * src/bufferlist.h: made getState a const func.
6080 made empty a const func.
6081 made exists a const func.
6084 2000-02-01 Juergen Vigna <jug@sad.it>
6086 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6088 * po/it.po: updated a bit the italian po file and also changed the
6089 'file nuovo' for newfile to 'filenuovo' without a space, this did
6092 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6093 for the new insert_date command.
6095 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6096 from jdblair, to insert a date into the current text conforming to
6097 a strftime format (for now only considering the locale-set and not
6098 the document-language).
6100 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6102 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6103 Bounds Read error seen by purify. The problem was that islower is
6104 a macros which takes an unsigned char and uses it as an index for
6105 in array of characters properties (and is thus subject to the
6109 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6110 correctly the paper sides radio buttons.
6111 (UpdateDocumentButtons): ditto.
6113 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6115 * src/kbmap.C (getsym + others): change to return unsigned int,
6116 returning a long can give problems on 64 bit systems. (I assume
6117 that int is 32bit on 64bit systems)
6119 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6121 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6122 LyXLookupString to be zero-terminated. Really fixes problems seen
6125 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6127 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6128 write a (char*)0 to the lyxerr stream.
6130 * src/lastfiles.C: move algorithm before the using statemets.
6132 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6134 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6135 complains otherwise).
6136 * src/table.C: ditto
6138 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6141 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6142 that I removed earlier... It is really needed.
6144 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6146 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6148 * INSTALL: update xforms home page URL.
6150 * lib/configure.m4: fix a bug with unreadable layout files.
6152 * src/table.C (calculate_width_of_column): add "using std::max"
6155 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6157 * several files: marked several lines with "DEL LINE", this is
6158 lines that can be deleted without changing anything.
6159 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6160 checks this anyway */
6163 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6165 * src/DepTable.C (update): add a "+" at the end when the checksum
6166 is different. (debugging string only)
6168 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6169 the next inset to not be displayed. This should also fix the list
6170 of labels in the "Insert Crossreference" dialog.
6172 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6174 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6175 when regex was not found.
6177 * src/support/lstrings.C (lowercase): use handcoded transform always.
6180 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6181 old_cursor.par->prev could be 0.
6183 * several files: changed post inc/dec to pre inc/dec
6185 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6186 write the lastfiles to file.
6188 * src/BufferView.C (buffer): only show TextCache info when debugging
6190 (resizeCurrentBuffer): ditto
6191 (workAreaExpose): ditto
6193 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6195 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6197 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6198 a bit better by removing the special case for \i and \j.
6200 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6202 * src/lyx_main.C (easyParse): remove test for bad comand line
6203 options, since this broke all xforms-related parsing.
6205 * src/kbmap.C (getsym): set return type to unsigned long, as
6206 declared in header. On an alpha, long is _not_ the same as int.
6208 * src/support/LOstream.h: add a "using std::flush;"
6210 * src/insets/figinset.C: ditto.
6212 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6214 * src/bufferlist.C (write): use blinding fast file copy instead of
6215 "a char at a time", now we are doing it the C++ way.
6217 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6218 std::list<int> instead.
6219 (addpidwait): reflect move to std::list<int>
6220 (sigchldchecker): ditto
6222 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6225 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6226 that obviously was wrong...
6228 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6229 c, this avoids warnings with purify and islower.
6231 * src/insets/figinset.C: rename struct queue to struct
6232 queue_element and rewrite to use a std::queue. gsqueue is now a
6233 std::queue<queue_element>
6234 (runqueue): reflect move to std::queue
6237 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6238 we would get "1" "0" instead of "true" "false. Also make the tostr
6241 2000-01-21 Juergen Vigna <jug@sad.it>
6243 * src/buffer.C (writeFileAscii): Disabled code for special groff
6244 handling of tabulars till I fix this in table.C
6246 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6248 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6250 * src/support/lyxlib.h: ditto.
6252 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6254 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6255 and 'j' look better. This might fix the "macron" bug that has been
6258 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6259 functions as one template function. Delete the old versions.
6261 * src/support/lyxsum.C: move using std::ifstream inside
6264 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6267 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6269 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6271 * src/insets/figinset.C (InitFigures): use new instead of malloc
6272 to allocate memory for figures and bitmaps.
6273 (DoneFigures): use delete[] instead of free to deallocate memory
6274 for figures and bitmaps.
6275 (runqueue): use new to allocate
6276 (getfigdata): use new/delete[] instead of malloc/free
6277 (RegisterFigure): ditto
6279 * some files: moved some declarations closer to first use, small
6280 whitespace changes use preincrement instead of postincrement where
6281 it does not make a difference.
6283 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6284 step on the way to use stl::containers for key maps.
6286 * src/bufferlist.h: add a typedef for const_iterator and const
6287 versions of begin and end.
6289 * src/bufferlist.[Ch]: change name of member variable _state to
6290 state_. (avoid reserved names)
6292 (getFileNames): returns the filenames of the buffers in a vector.
6294 * configure.in (ALL_LINGUAS): added ro
6296 * src/support/putenv.C: new file
6298 * src/support/mkdir.C: new file
6300 2000-01-20 Allan Rae <rae@lyx.org>
6302 * lib/layouts/IEEEtran.layout: Added several theorem environments
6304 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6305 couple of minor additions.
6307 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6308 (except for those in footnotes of course)
6310 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6312 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6314 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6315 std::sort and std::lower_bound instead of qsort and handwritten
6317 (struct compara): struct that holds the functors used by std::sort
6318 and std::lower_bound in MathedLookupBOP.
6320 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6322 * src/support/LAssert.h: do not do partial specialization. We do
6325 * src/support/lyxlib.h: note that lyx::getUserName() and
6326 lyx::date() are not in use right now. Should these be suppressed?
6328 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6329 (makeLinuxDocFile): do not put date and user name in linuxdoc
6332 * src/support/lyxlib.h (kill): change first argument to long int,
6333 since that's what solaris uses.
6335 * src/support/kill.C (kill): fix declaration to match prototype.
6337 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6338 actually check whether namespaces are supported. This is not what
6341 * src/support/lyxsum.C: add a using directive.
6343 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6345 * src/support/kill.C: if we have namespace support we don't have
6346 to include lyxlib.h.
6348 * src/support/lyxlib.h: use namespace lyx if supported.
6350 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6352 * src/support/date.C: new file
6354 * src/support/chdir.C: new file
6356 * src/support/getUserName.C: new file
6358 * src/support/getcwd.C: new file
6360 * src/support/abort.C: new file
6362 * src/support/kill.C: new file
6364 * src/support/lyxlib.h: moved all the functions in this file
6365 insede struct lyx. Added also kill and abort to this struct. This
6366 is a way to avoid the "kill is not defined in <csignal>", we make
6367 C++ wrappers for functions that are not ANSI C or ANSI C++.
6369 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6370 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6371 lyx it has been renamed to sum.
6373 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6375 * src/text.C: add using directives for std::min and std::max.
6377 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6379 * src/texrow.C (getIdFromRow): actually return something useful in
6380 id and pos. Hopefully fixes the bug with positionning of errorbox
6383 * src/lyx_main.C (easyParse): output an error and exit if an
6384 incorrect command line option has been given.
6386 * src/spellchecker.C (ispell_check_word): document a memory leak.
6388 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6389 where a "struct utimbuf" is allocated with "new" and deleted with
6392 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6394 * src/text2.C (CutSelection): don't delete double spaces.
6395 (PasteSelection): ditto
6396 (CopySelection): ditto
6398 * src/text.C (Backspace): don't delete double spaces.
6400 * src/lyxlex.C (next): fix a bug that were only present with
6401 conformant std::istream::get to read comment lines, use
6402 std::istream::getline instead. This seems to fix the problem.
6404 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6406 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6407 allowed to insert space before space" editing problem. Please read
6408 commends at the beginning of the function. Comments about usage
6411 * src/text.C (InsertChar): fix for the "not allowed to insert
6412 space before space" editing problem.
6414 * src/text2.C (DeleteEmptyParagraphMechanism): when
6415 IsEmptyTableRow can only return false this last "else if" will
6416 always be a no-op. Commented out.
6418 * src/text.C (RedoParagraph): As far as I can understand tmp
6419 cursor is not really needed.
6421 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6422 present it could only return false anyway.
6423 (several functions): Did something not so smart...added a const
6424 specifier on a lot of methods.
6426 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6427 and add a tmp->text.resize. The LyXParagraph constructor does the
6429 (BreakParagraphConservative): ditto
6431 * src/support/path.h (Path): add a define so that the wrong usage
6432 "Path("/tmp") will be flagged as a compilation error:
6433 "`unnamed_Path' undeclared (first use this function)"
6435 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6437 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6438 which was bogus for several reasons.
6440 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6444 * autogen.sh: do not use "type -path" (what's that anyway?).
6446 * src/support/filetools.C (findtexfile): remove extraneous space
6447 which caused a kpsewhich warning (at least with kpathsea version
6450 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6452 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6454 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6456 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6458 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6460 * src/paragraph.C (BreakParagraph): do not reserve space on text
6461 if we don't need to (otherwise, if pos_end < pos, we end up
6462 reserving huge amounts of memory due to bad unsigned karma).
6463 (BreakParagraphConservative): ditto, although I have not seen
6464 evidence the bug can happen here.
6466 * src/lyxparagraph.h: add a using std::list.
6468 2000-01-11 Juergen Vigna <jug@sad.it>
6470 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6473 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6475 * src/vc-backend.C (doVCCommand): change to be static and take one
6476 more parameter: the path to chdir too be fore executing the command.
6477 (retrive): new function equiv to "co -r"
6479 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6480 file_not_found_hook is true.
6482 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6484 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6485 if a file is readwrite,readonly...anything else.
6487 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6489 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6490 (CreatePostscript): name change from MenuRunDVIPS (or something)
6491 (PreviewPostscript): name change from MenuPreviewPS
6492 (PreviewDVI): name change from MenuPreviewDVI
6494 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6495 \view_pdf_command., \pdf_to_ps_command
6497 * lib/configure.m4: added search for PDF viewer, and search for
6498 PDF to PS converter.
6499 (lyxrc.defaults output): add \pdflatex_command,
6500 \view_pdf_command and \pdf_to_ps_command.
6502 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6504 * src/bufferlist.C (write): we don't use blocksize for anything so
6507 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6509 * src/support/block.h: disable operator T* (), since it causes
6510 problems with both compilers I tried. See comments in the file.
6512 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6515 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6516 variable LYX_DIR_10x to LYX_DIR_11x.
6518 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6520 * INSTALL: document --with-lyxname.
6523 * configure.in: new configure flag --with-lyxname which allows to
6524 choose the name under which lyx is installed. Default is "lyx", of
6525 course. It used to be possible to do this with --program-suffix,
6526 but the later has in fact a different meaning for autoconf.
6528 * src/support/lstrings.h (lstrchr): reformat a bit.
6530 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6531 * src/mathed/math_defs.h: ditto.
6533 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6535 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6536 true, decides if we create a backup file or not when saving. New
6537 tag and variable \pdf_mode, defaults to false. New tag and
6538 variable \pdflatex_command, defaults to pdflatex. New tag and
6539 variable \view_pdf_command, defaults to xpdf. New tag and variable
6540 \pdf_to_ps_command, defaults to pdf2ps.
6542 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6544 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6545 does not have a BufferView.
6546 (unlockInset): ditto + don't access the_locking_inset if the
6547 buffer does not have a BufferView.
6549 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6550 certain circumstances so that we don't continue a keyboard
6551 operation long after the key was released. Try f.ex. to load a
6552 large document, press PageDown for some seconds and then release
6553 it. Before this change the document would contine to scroll for
6554 some time, with this change it stops imidiatly.
6556 * src/support/block.h: don't allocate more space than needed. As
6557 long as we don't try to write to the arr[x] in a array_type arr[x]
6558 it is perfectly ok. (if you write to it you might segfault).
6559 added operator value_type*() so that is possible to pass the array
6560 to functions expecting a C-pointer.
6562 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6565 * intl/*: updated to gettext 0.10.35, tried to add our own
6566 required modifications. Please verify.
6568 * po/*: updated to gettext 0.10.35, tried to add our own required
6569 modifications. Please verify.
6571 * src/support/lstrings.C (tostr): go at fixing the problem with
6572 cxx and stringstream. When stringstream is used return
6573 oss.str().c_str() so that problems with lyxstring and basic_string
6574 are avoided. Note that the best solution would be for cxx to use
6575 basic_string all the way, but it is not conformant yet. (it seems)
6577 * src/lyx_cb.C + other files: moved several global functions to
6578 class BufferView, some have been moved to BufferView.[Ch] others
6579 are still located in lyx_cb.C. Code changes because of this. (part
6580 of "get rid of current_view project".)
6582 * src/buffer.C + other files: moved several Buffer functions to
6583 class BufferView, the functions are still present in buffer.C.
6584 Code changes because of this.
6586 * config/lcmessage.m4: updated to most recent. used when creating
6589 * config/progtest.m4: updated to most recent. used when creating
6592 * config/gettext.m4: updated to most recent. applied patch for
6595 * config/gettext.m4.patch: new file that shows what changes we
6596 have done to the local copy of gettext.m4.
6598 * config/libtool.m4: new file, used in creation of acinclude.m4
6600 * config/lyxinclude.m4: new file, this is the lyx created m4
6601 macros, used in making acinclude.m4.
6603 * autogen.sh: GNU m4 discovered as a separate task not as part of
6604 the lib/configure creation.
6605 Generate acinlucde from files in config. Actually cat
6606 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6607 easier to upgrade .m4 files that really are external.
6609 * src/Spacing.h: moved using std::istringstream to right after
6610 <sstream>. This should fix the problem seen with some compilers.
6612 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6614 * src/lyx_cb.C: began some work to remove the dependency a lot of
6615 functions have on BufferView::text, even if not really needed.
6616 (GetCurrentTextClass): removed this func, it only hid the
6619 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6620 forgot this in last commit.
6622 * src/Bullet.C (bulletEntry): use static char const *[] for the
6623 tables, becuase of this the return arg had to change to string.
6625 (~Bullet): removed unneeded destructor
6627 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6628 (insetSleep): moved from Buffer
6629 (insetWakeup): moved from Buffer
6630 (insetUnlock): moved from Buffer
6632 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6633 from Buffer to BufferView.
6635 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6637 * config/ltmain.sh: updated to version 1.3.4 of libtool
6639 * config/ltconfig: updated to version 1.3.4 of libtool
6641 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6644 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6645 Did I get that right?
6647 * src/lyxlex.h: add a "using" directive or two.
6648 * src/Spacing.h: ditto.
6649 * src/insets/figinset.C: ditto.
6650 * src/support/filetools.C: ditto.
6651 * src/support/lstrings.C: ditto.
6652 * src/BufferView.C: ditto.
6653 * src/bufferlist.C: ditto.
6654 * src/lyx_cb.C: ditto.
6655 * src/lyxlex.C: ditto.
6657 * NEWS: add some changes for 1.1.4.
6659 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6661 * src/BufferView.C: first go at a TextCache to speed up switching
6664 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6666 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6667 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6668 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6669 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6672 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6673 members of the struct are correctly initialized to 0 (detected by
6675 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6676 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6678 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6679 pidwait, since it was allocated with "new". This was potentially
6680 very bad. Thanks to Michael Schmitt for running purify for us.
6683 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6685 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6687 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6689 1999-12-30 Allan Rae <rae@lyx.org>
6691 * lib/templates/IEEEtran.lyx: minor change
6693 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6694 src/mathed/formula.C (LocalDispatch): askForText changes
6696 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6697 know when a user has cancelled input. Fixes annoying problems with
6698 inserting labels and version control.
6700 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6702 * src/support/lstrings.C (tostr): rewritten to use strstream and
6705 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6707 * src/support/filetools.C (IsFileWriteable): use fstream to check
6708 (IsDirWriteable): use fileinfo to check
6710 * src/support/filetools.h (FilePtr): whole class deleted
6712 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6714 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6716 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6718 * src/bufferlist.C (write): use ifstream and ofstream instead of
6721 * src/Spacing.h: use istrstream instead of sscanf
6723 * src/mathed/math_defs.h: change first arg to istream from FILE*
6725 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6727 * src/mathed/math_parser.C: have yyis to be an istream
6728 (LexGetArg): use istream (yyis)
6730 (mathed_parse): ditto
6731 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6733 * src/mathed/formula.C (Read): rewritten to use istream
6735 * src/mathed/formulamacro.C (Read): rewritten to use istream
6737 * src/lyxlex.h (~LyXLex): deleted desturctor
6738 (getStream): new function, returns an istream
6739 (getFile): deleted funtion
6740 (IsOK): return is.good();
6742 * src/lyxlex.C (LyXLex): delete file and owns_file
6743 (setFile): open an filebuf and assign that to a istream instead of
6745 (setStream): new function, takes an istream as arg.
6746 (setFile): deleted function
6747 (EatLine): rewritten us use istream instead of FILE*
6751 * src/table.C (LyXTable): use istream instead of FILE*
6752 (Read): rewritten to take an istream instead of FILE*
6754 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6756 * src/buffer.C (Dispatch): remove an extraneous break statement.
6758 * src/support/filetools.C (QuoteName): change to do simple
6759 'quoting'. More work is necessary. Also changed to do nothing
6760 under emx (needs fix too).
6761 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6763 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6764 config.h.in to the AC_DEFINE_UNQUOTED() call.
6765 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6766 needs char * as argument (because Solaris 7 declares it like
6769 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6770 remove definition of BZERO.
6772 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6774 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6775 defined, "lyxregex.h" if not.
6777 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6779 (REGEX): new variable that is set to regex.c lyxregex.h when
6780 AM_CONDITIONAL USE_REGEX is set.
6781 (libsupport_la_SOURCES): add $(REGEX)
6783 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6786 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6789 * configure.in: add call to LYX_REGEX
6791 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6792 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6794 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6796 * lib/bind/fi_menus.bind: new file, from
6797 pauli.virtanen@saunalahti.fi.
6799 * src/buffer.C (getBibkeyList): pass the parameter delim to
6800 InsetInclude::getKeys and InsetBibtex::getKeys.
6802 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6803 is passed to Buffer::getBibkeyList
6805 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6806 instead of the hardcoded comma.
6808 * src/insets/insetbib.C (getKeys): make sure that there are not
6809 leading blanks in bibtex keys. Normal latex does not care, but
6810 harvard.sty seems to dislike blanks at the beginning of citation
6811 keys. In particular, the retturn value of the function is
6813 * INSTALL: make it clear that libstdc++ is needed and that gcc
6814 2.7.x probably does not work.
6816 * src/support/filetools.C (findtexfile): make debug message go to
6818 * src/insets/insetbib.C (getKeys): ditto
6820 * src/debug.C (showTags): make sure that the output is correctly
6823 * configure.in: add a comment for TWO_COLOR_ICON define.
6825 * acconfig.h: remove all the entries that already defined in
6826 configure.in or acinclude.m4.
6828 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6829 to avoid user name, date and copyright.
6831 1999-12-21 Juergen Vigna <jug@sad.it>
6833 * src/table.C (Read): Now read bogus row format informations
6834 if the format is < 5 so that afterwards the table can
6835 be read by lyx but without any format-info. Fixed the
6836 crash we experienced when not doing this.
6838 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6840 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6841 (RedoDrawingOfParagraph): ditto
6842 (RedoParagraphs): ditto
6843 (RemoveTableRow): ditto
6845 * src/text.C (Fill): rename arg paperwidth -> paper_width
6847 * src/buffer.C (insertLyXFile): rename var filename -> fname
6848 (writeFile): rename arg filename -> fname
6849 (writeFileAscii): ditto
6850 (makeLaTeXFile): ditto
6851 (makeLinuxDocFile): ditto
6852 (makeDocBookFile): ditto
6854 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6857 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6859 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6862 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6863 compiled by a C compiler not C++.
6865 * src/layout.h (LyXTextClass): added typedef for const_iterator
6866 (LyXTextClassList): added typedef for const_iterator + member
6867 functions begin and end.
6869 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6870 iterators to fill the choice_class.
6871 (updateLayoutChoice): rewritten to use iterators to fill the
6872 layoutlist in the toolbar.
6874 * src/BufferView.h (BufferView::work_area_width): removed unused
6877 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6879 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6880 (sgmlCloseTag): ditto
6882 * src/support/lstrings.h: return type of countChar changed to
6885 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6886 what version of this func to use. Also made to return unsigned int.
6888 * configure.in: call LYX_STD_COUNT
6890 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6891 conforming std::count.
6893 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6895 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6896 and a subscript would give bad display (patch from Dekel Tsur
6897 <dekel@math.tau.ac.il>).
6899 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6901 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6904 * src/chset.h: add a few 'using' directives
6906 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6907 triggered when no buffer is active
6909 * src/layout.C: removed `break' after `return' in switch(), since
6912 * src/lyx_main.C (init): make sure LyX can be ran in place even
6913 when libtool has done its magic with shared libraries. Fix the
6914 test for the case when the system directory has not been found.
6916 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6917 name for the latex file.
6918 (MenuMakeHTML): ditto
6920 * src/buffer.h: add an optional boolean argument, which is passed
6923 1999-12-20 Allan Rae <rae@lyx.org>
6925 * lib/templates/IEEEtran.lyx: small correction and update.
6927 * configure.in: Attempted to use LYX_PATH_HEADER
6929 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
6931 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
6932 input from JMarc. Now use preprocessor to find the header.
6933 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
6934 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
6935 LYX_STL_STRING_FWD. See comments in file.
6937 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
6939 * The global MiniBuffer * minibuffer variable is dead.
6941 * The global FD_form_main * fd_form_main variable is dead.
6943 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6945 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
6947 * src/table.h: add the LOstream.h header
6948 * src/debug.h: ditto
6950 * src/LyXAction.h: change the explaination of the ReadOnly
6951 attribute: is indicates that the function _can_ be used.
6953 * src/LyXAction.C (init): find-replace _can_ be used in read-only
6956 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6958 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
6964 * src/paragraph.C (GetWord): assert on pos>=0
6967 * src/support/lyxstring.C: condition the use of an invariant on
6969 * src/support/lyxstring.h: ditto
6971 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
6972 Use LAssert.h instead of plain assert().
6974 * src/support/lstrings.h: add LAssert.h, in case it is needed.
6976 * src/lyxfunc.C: do not include LAssert.h, it is not used.
6977 * src/support/filetools.C: ditto
6979 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
6982 * INSTALL: document the new configure flags
6984 * configure.in: suppress --with-debug; add --enable-assertions
6986 * acinclude.m4: various changes in alignment of help strings.
6988 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
6990 * src/kbmap.C: commented out the use of the hash map in kb_map,
6991 beginning of movement to a stl::container.
6993 * several files: removed code that was not in effect when
6994 MOVE_TEXT was defined.
6996 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
6997 for escaping should not be used. We can discuss if the string
6998 should be enclosed in f.ex. [] instead of "".
7000 * src/trans_mgr.C (insert): use the new returned value from
7001 encodeString to get deadkeys and keymaps done correctly.
7003 * src/chset.C (encodeString): changed to return a pair, to tell
7004 what to use if we know the string.
7006 * src/lyxscreen.h (fillArc): new function.
7008 * src/FontInfo.C (resize): rewritten to use more std::string like
7009 structore, especially string::replace.
7011 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7014 * configure.in (chmod +x some scripts): remove config/gcc-hack
7016 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7018 * src/buffer.C (writeFile): change once again the top comment in a
7019 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7020 instead of an hardcoded version number.
7021 (makeDocBookFile): ditto
7023 * src/version.h: add new define LYX_DOCVERSION
7025 * po/de.po: update from Pit Sütterlin
7026 * lib/bind/de_menus.bind: ditto.
7028 * src/lyxfunc.C (Dispatch): call MenuExport()
7029 * src/buffer.C (Dispatch): ditto
7031 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7032 LyXFunc::Dispatch().
7033 (MenuExport): new function, moved from
7034 LyXFunc::Dispatch().
7036 * src/trans_mgr.C (insert): small cleanup
7037 * src/chset.C (loadFile): ditto
7039 * lib/kbd/iso8859-1.cdef: add missing backslashes
7041 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7043 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7044 help with placing the manually drawn accents better.
7046 (Draw): x2 and hg changed to float to minimize rounding errors and
7047 help place the accents better.
7049 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7050 unsigned short to char is just wrong...cast the char to unsigned
7051 char instead so that the two values can compare sanely. This
7052 should also make the display of insetlatexaccents better and
7053 perhaps also some other insets.
7055 (lbearing): new function
7058 1999-12-15 Allan Rae <rae@lyx.org>
7060 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7061 header that provides a wrapper around the very annoying SGI STL header
7064 * src/support/lyxstring.C, src/LString.h:
7065 removed old SGI-STL-compatability attempts.
7067 * configure.in: Use LYX_STL_STRING_FWD.
7069 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7070 stl_string_fwd.h is around and try to determine it's location.
7071 Major improvement over previous SGI STL 3.2 compatability.
7072 Three small problems remain with this function due to my zero
7073 knowledge of autoconf. JMarc and lgb see the comments in the code.
7075 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7077 * src/broken_const.h, config/hack-gcc, config/README: removed
7079 * configure.in: remove --with-gcc-hack option; do not call
7082 * INSTALL: remove documentation of --with-broken-const and
7085 * acconfig.h: remove all trace of BROKEN_CONST define
7087 * src/buffer.C (makeDocBookFile): update version number in output
7089 (SimpleDocBookOnePar): fix an assert when trying to a character
7090 access beyond string length
7093 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7095 * po/de.po: fix the Export menu
7097 * lyx.man: update the description of -dbg
7099 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7100 (commandLineHelp): updated
7101 (easyParse): show list of available debug levels if -dbg is passed
7104 * src/Makefile.am: add debug.C
7106 * src/debug.h: moved some code to debug.C
7108 * src/debug.C: new file. Contains code to set and show debug
7111 * src/layout.C: remove 'break' after 'continue' in switch
7112 statements, since these cannot be reached.
7114 1999-12-13 Allan Rae <rae@lyx.org>
7116 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7117 (in_word_set): hash() -> math_hash()
7119 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7121 * acconfig.h: Added a test for whether we are using exceptions in the
7122 current compilation run. If so USING_EXCEPTIONS is defined.
7124 * config.in: Check for existance of stl_string_fwd.h
7125 * src/LString.h: If compiling --with-included-string and SGI's
7126 STL version 3.2 is present (see above test) we need to block their
7127 forward declaration of string and supply a __get_c_string().
7128 However, it turns out this is only necessary if compiling with
7129 exceptions enabled so I've a bit more to add yet.
7131 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7132 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7133 src/support/LRegex.h, src/undo.h:
7134 Shuffle the order of the included files a little to ensure that
7135 LString.h gets included before anything that includes stl_string_fwd.h
7137 * src/support/lyxstring.C: We need to #include LString.h instead of
7138 lyxstring.h to get the necessary definition of __get_c_string.
7139 (__get_c_string): New function. This is defined static just like SGI's
7140 although why they need to do this I'm not sure. Perhaps it should be
7141 in lstrings.C instead.
7143 * lib/templates/IEEEtran.lyx: New template file.
7145 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7147 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7148 * intl/Makefile.in (MKINSTALLDIRS): ditto
7150 * src/LyXAction.C (init): changed to hold the LFUN data in a
7151 automatic array in stead of in callso to newFunc, this speeds up
7152 compilation a lot. Also all the memory used by the array is
7153 returned when the init is completed.
7155 * a lot of files: compiled with -Wold-style-cast, changed most of
7156 the reported offenders to C++ style casts. Did not change the
7157 offenders in C files.
7159 * src/trans.h (Match): change argument type to unsigned int.
7161 * src/support/DebugStream.C: fix some types on the streambufs so
7162 that it works on a conforming implementation.
7164 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7166 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7168 * src/support/lyxstring.C: remove the inline added earlier since
7169 they cause a bunch of unsatisfied symbols when linking with dec
7170 cxx. Cxx likes to have the body of inlines at the place where they
7173 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7174 accessing negative bounds in array. This fixes the crash when
7175 inserting accented characters.
7176 * src/trans.h (Match): ditto
7178 * src/buffer.C (Dispatch): since this is a void, it should not try
7179 to return anything...
7181 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7183 * src/buffer.h: removed the two friends from Buffer. Some changes
7184 because of this. Buffer::getFileName and Buffer::setFileName
7185 renamed to Buffer::fileName() and Buffer::fileName(...).
7187 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7189 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7190 and Buffer::update(short) to BufferView. This move is currently
7191 controlled by a define MOVE_TEXT, this will be removed when all
7192 shows to be ok. This move paves the way for better separation
7193 between buffer contents and buffer view. One side effect is that
7194 the BufferView needs a rebreak when swiching buffers, if we want
7195 to avoid this we can add a cache that holds pointers to LyXText's
7196 that is not currently in use.
7198 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7201 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7203 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7205 * lyx_main.C: new command line option -x (or --execute) and
7206 -e (or --export). Now direct conversion from .lyx to .tex
7207 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7208 Unfortunately, X is still needed and the GUI pops up during the
7211 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7213 * src/Spacing.C: add a using directive to bring stream stuff into
7215 * src/paragraph.C: ditto
7216 * src/buffer.C: ditto
7218 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7219 from Lars' announcement).
7221 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7222 example files from Tino Meinen.
7224 1999-12-06 Allan Rae <rae@lyx.org>
7226 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7228 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7230 * src/support/lyxstring.C: added a lot of inline for no good
7233 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7234 latexWriteEndChanges, they were not used.
7236 * src/layout.h (operator<<): output operator for PageSides
7238 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7240 * some example files: loaded in LyX 1.0.4 and saved again to update
7241 certain constructs (table format)
7243 * a lot of files: did the change to use fstream/iostream for all
7244 writing of files. Done with a close look at Andre Poenitz's patch.
7246 * some files: whitespace changes.
7248 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7250 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7251 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7252 architecture, we provide our own. It is used unconditionnally, but
7253 I do not think this is a performance problem. Thanks to Angus
7254 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7255 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7257 (GetInset): use my_memcpy.
7261 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7262 it is easier to understand, but it uses less TeX-only constructs now.
7264 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7265 elements contain spaces
7267 * lib/configure: regenerated
7269 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7270 elements contain spaces; display the list of programs that are
7273 * autogen.sh: make sure lib/configure is executable
7275 * lib/examples/*: rename the tutorial examples to begin with the
7276 two-letters language code.
7278 * src/lyxfunc.C (getStatus): do not query current font if no
7281 * src/lyx_cb.C (RunScript): use QuoteName
7282 (MenuRunDvips): ditto
7283 (PrintApplyCB): ditto
7285 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7286 around argument, so that it works well with the current shell.
7287 Does not work properly with OS/2 shells currently.
7289 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7290 * src/LyXSendto.C (SendtoApplyCB): ditto
7291 * src/lyxfunc.C (Dispatch): ditto
7292 * src/buffer.C (runLaTeX): ditto
7293 (runLiterate): ditto
7294 (buildProgram): ditto
7296 * src/lyx_cb.C (RunScript): ditto
7297 (MenuMakeLaTeX): ditto
7299 * src/buffer.h (getLatexName): new method
7301 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7303 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7305 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7306 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7307 (create_math_panel): ditto
7309 * src/lyxfunc.C (getStatus): re-activate the code which gets
7310 current font and cursor; add test for export to html.
7312 * src/lyxrc.C (read): remove unreachable break statements; add a
7315 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7317 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7319 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7320 introduced by faulty regex.
7321 * src/buffer.C: ditto
7322 * src/lastfiles.C: ditto
7323 * src/paragraph.C: ditto
7324 * src/table.C: ditto
7325 * src/vspace.C: ditto
7326 * src/insets/figinset.C: ditto
7327 Note: most of these is absolutely harmless, except the one in
7328 src/mathed formula.C.
7330 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7332 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7333 operation, yielding correct results for the reLyX command.
7335 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7337 * src/support/filetools.C (ExpandPath): removed an over eager
7339 (ReplaceEnvironmentPath): ditto
7341 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7342 shows that we are doing something fishy in our code...
7346 * src/lyxrc.C (read): use a double switch trick to get more help
7347 from the compiler. (the same trick is used in layout.C)
7348 (write): new function. opens a ofstream and pass that to output
7349 (output): new function, takes a ostream and writes the lyxrc
7350 elemts to it. uses a dummy switch to make sure no elements are
7353 * src/lyxlex.h: added a struct pushpophelper for use in functions
7354 with more than one exit point.
7356 * src/lyxlex.[Ch] (GetInteger): made it const
7360 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7362 * src/layout.[hC] : LayoutTags splitted into several enums, new
7363 methods created, better error handling cleaner use of lyxlex. Read
7366 * src/bmtable.[Ch]: change some member prototypes because of the
7367 image const changes.
7369 * commandtags.h, src/LyXAction.C (init): new function:
7370 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7371 This file is not read automatically but you can add \input
7372 preferences to your lyxrc if you want to. We need to discuss how
7375 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7376 in .aux, also remove .bib and .bst files from dependencies when
7379 * src/BufferView.C, src/LyXView.C: add const_cast several places
7380 because of changes to images.
7382 * lib/images/*: same change as for images/*
7384 * lib/lyxrc.example: Default for accept_compound is false not no.
7386 * images/*: changed to be const, however I have som misgivings
7387 about this change so it might be changed back.
7389 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7391 * lib/configure, po/POTFILES.in: regenerated
7393 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7395 * config/lib_configure.m4: removed
7397 * lib/configure.m4: new file (was config/lib_configure.m4)
7399 * configure.in: do not test for rtti, since we do not use it.
7401 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7403 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7404 doubling of allocated space scheme. This makes it faster for large
7405 strings end to use less memory for small strings. xtra rememoved.
7407 * src/insets/figinset.C (waitalarm): commented out.
7408 (GhostscriptMsg): use static_cast
7409 (GhostscriptMsg): use new instead of malloc to allocate memory for
7410 cmap. also delete the memory after use.
7412 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7414 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7415 for changes in bibtex database or style.
7416 (runBibTeX): remove all .bib and .bst files from dep before we
7418 (run): use scanAuc in when dep file already exist.
7420 * src/DepTable.C (remove_files_with_extension): new method
7423 * src/DepTable.[Ch]: made many of the methods const.
7425 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7427 * src/bufferparams.C: make sure that the default textclass is
7428 "article". It used to be the first one by description order, but
7429 now the first one is "docbook".
7431 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7432 string; call Debug::value.
7433 (easyParse): pass complete argument to setDebuggingLevel().
7435 * src/debug.h (value): fix the code that parses debug levels.
7437 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7440 * src/LyXAction.C: use Debug::ACTION as debug channel.
7442 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7444 * NEWS: updated for the future 1.1.3 release.
7446 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7447 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7448 it should. This is of course a controversial change (since many
7449 people will find that their lyx workscreen is suddenly full of
7450 red), but done for the sake of correctness.
7452 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7453 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7455 * src/insets/inseterror.h, src/insets/inseturl.h,
7456 src/insets/insetinfo.h, src/insets/figinset.h,
7457 src/mathed/formulamacro.h, src/mathed/math_macro.h
7458 (EditMessage): add a missing const and add _() to make sure that
7461 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7462 src/insets/insetbib.C, src/support/filetools.C: add `using'
7465 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7466 doing 'Insert index of last word' at the beginning of a paragraph.
7468 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7470 * several files: white-space changes.
7472 * src/mathed/formula.C: removed IsAlpha and IsDigit
7474 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7475 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7478 * src/insets/figinset.C (GetPSSizes): don't break when
7479 "EndComments" is seen. But break when a boundingbox is read.
7481 * all classes inherited from Inset: return value of Clone
7482 changed back to Inset *.
7484 * all classes inherited form MathInset: return value of Clone
7485 changed back to MathedInset *.
7487 * src/insets/figinset.C (runqueue): use a ofstream to output the
7488 gs/ps file. Might need some setpresicion or setw. However I can
7489 see no problem with the current code.
7490 (runqueue): use sleep instead of the alarm/signal code. I just
7491 can't see the difference.
7493 * src/paragraph.C (LyXParagraph): reserve space in the new
7494 paragraph and resize the inserted paragraph to just fit.
7496 * src/lyxfunc.h (operator|=): added operator for func_status.
7498 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7499 check for readable file.
7501 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7502 check for readable file.
7503 (MenuMakeLinuxDoc): ditto
7504 (MenuMakeDocBook): ditto
7505 (MenuMakeAscii): ditto
7506 (InsertAsciiFile): split the test for openable and readable
7508 * src/bmtable.C (draw_bitmaptable): use
7509 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7511 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7512 findtexfile from LaTeX to filetools.
7514 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7515 instead of FilePtr. Needs to be verified by a literate user.
7517 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7519 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7520 (EditMessage): likewise.
7522 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7523 respectively as \textasciitilde and \textasciicircum.
7525 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7527 * src/support/lyxstring.h: made the methods that take iterators
7530 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7531 (regexMatch): made is use the real regex class.
7533 * src/support/Makefile.am: changed to use libtool
7535 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7537 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7539 (MathIsInset ++): changed several macros to be inline functions
7542 * src/mathed/Makefile.am: changed to use libtool
7544 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7546 * src/insets/inset* : Clone changed to const and return type is
7547 the true insettype not just Inset*.
7549 * src/insets/Makefile.am: changed to use libtool
7551 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7553 * src/undo.[Ch] : added empty() and changed some of the method
7556 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7558 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7559 setID use block<> for the bullets array, added const several places.
7561 * src/lyxfunc.C (getStatus): new function
7563 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7564 LyXAction, added const to several funtions.
7566 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7567 a std::map, and to store the dir items in a vector.
7569 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7572 * src/LyXView.[Ch] + other files : changed currentView to view.
7574 * src/LyXAction.[Ch] : ported from the old devel branch.
7576 * src/.cvsignore: added .libs and a.out
7578 * configure.in : changes to use libtool.
7580 * acinclude.m4 : inserted libtool.m4
7582 * .cvsignore: added libtool
7584 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7586 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7587 file name in insets and mathed directories (otherwise the
7588 dependency is not taken in account under cygwin).
7590 * src/text2.C (InsertString[AB]): make sure that we do not try to
7591 read characters past the string length.
7593 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7595 * lib/doc/LaTeXConfig.lyx.in,
7596 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7598 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7599 file saying who created them and when this heppened; this is
7600 useless and annoys tools like cvs.
7602 * lib/layouts/g-brief-{en,de}.layout,
7603 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7604 from Thomas Hartkens <thomas@hartkens.de>.
7606 * src/{insets,mathed}/Makefile.am: do not declare an empty
7607 LDFLAGS, so that it can be set at configure time (useful on Irix
7610 * lib/reLyX/configure.in: make sure that the prefix is set
7611 correctly in LYX_DIR.
7613 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7615 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7616 be used by 'command-sequence' this allows to bind a key to a
7617 sequence of LyX-commands
7618 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7620 * src/LyXAction.C: add "command-sequence"
7622 * src/LyXFunction.C: handling of "command-sequence"
7624 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7625 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7627 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7629 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7631 * src/buffer.C (writeFile): Do not output a comment giving user
7632 and date at the beginning of a .lyx file. This is useless and
7633 annoys cvs anyway; update version number to 1.1.
7635 * src/Makefile.am (LYX_DIR): add this definition, so that a
7636 default path is hardcoded in LyX.
7638 * configure.in: Use LYX_GNU_GETTEXT.
7640 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7641 AM_GNU_GETTEXT with a bug fixed.
7643 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7645 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7647 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7648 which is used to point to LyX data is now LYX_DIR_11x.
7650 * lyx.man: convert to a unix text file; small updates.
7652 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7654 * src/support/LSubstring.[Ch]: made the second arg of most of the
7655 constructors be a const reference.
7657 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7660 * src/support/lyxstring.[Ch] (swap): added missing member function
7661 and specialization of swap(str, str);
7663 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7665 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7666 trace of the old one.
7668 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7669 put the member definitions in undo.C.
7671 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7672 NEW_TEXT and have now only code that was included when this was
7675 * src/intl.C (LCombo): use static_cast
7677 (DispatchCallback): ditto
7679 * src/definitions.h: removed whole file
7681 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7683 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7684 parsing and stores in a std:map. a regex defines the file format.
7685 removed unneeded members.
7687 * src/bufferparams.h: added several enums from definitions.h here.
7688 Removed unsused destructor. Changed some types to use proper enum
7689 types. use block to have the temp_bullets and user_defined_bullets
7690 and to make the whole class assignable.
7692 * src/bufferparams.C (Copy): removed this functions, use a default
7695 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7698 * src/buffer.C (readLyXformat2): commend out all that have with
7699 oldpapersize to do. also comment out all that hve to do with
7700 insetlatex and insetlatexdel.
7701 (setOldPaperStuff): commented out
7703 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7705 * src/LyXAction.C: remove use of inset-latex-insert
7707 * src/mathed/math_panel.C (button_cb): use static_cast
7709 * src/insets/Makefile.am (insets_o_SOURCES): removed
7712 * src/support/lyxstring.C (helper): use the unsigned long
7713 specifier, UL, instead of a static_cast.
7715 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7717 * src/support/block.h: new file. to be used as a c-style array in
7718 classes, so that the class can be assignable.
7720 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7722 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7723 NULL, make sure to return an empty string (it is not possible to
7724 set a string to NULL).
7726 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7728 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7730 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7732 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7733 link line, so that Irix users (for example) can set it explicitely to
7736 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7737 it can be overidden at make time (static or dynamic link, for
7740 * src/vc-backend.C, src/LaTeXFeatures.h,
7741 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7742 statements to bring templates to global namespace.
7744 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7746 * src/support/lyxstring.C (operator[] const): make it standard
7749 * src/minibuffer.C (Init): changed to reflect that more
7750 information is given from the lyxvc and need not be provided here.
7752 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7754 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7756 * src/LyXView.C (UpdateTimerCB): use static_cast
7757 (KeyPressMask_raw_callback): ditto
7759 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7760 buffer_, a lot of changes because of this. currentBuffer() ->
7761 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7762 also changes to other files because of this.
7764 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7766 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7767 have no support for RCS and partial support for CVS, will be
7770 * src/insets/ several files: changes because of function name
7771 changes in Bufferview and LyXView.
7773 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7775 * src/support/LSubstring.[Ch]: new files. These implement a
7776 Substring that can be very convenient to use. i.e. is this
7778 string a = "Mary had a little sheep";
7779 Substring(a, "sheep") = "lamb";
7780 a is now "Mary has a little lamb".
7782 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7783 out patterns and subpatterns of strings. It is used by LSubstring
7784 and also by vc-backend.C
7786 * src/support/lyxstring.C: went over all the assertions used and
7787 tried to correct the wrong ones and flag which of them is required
7788 by the standard. some bugs found because of this. Also removed a
7789 couple of assertions.
7791 * src/support/Makefile.am (libsupport_a_SOURCES): added
7792 LSubstring.[Ch] and LRegex.[Ch]
7794 * src/support/FileInfo.h: have struct stat buf as an object and
7795 not a pointer to one, some changes because of this.
7797 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7798 information in layout when adding the layouts preamble to the
7801 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7804 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7805 because of bug in OS/2.
7807 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7809 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7810 \verbatim@font instead of \ttfamily, so that it can be redefined.
7812 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7813 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7814 src/layout.h, src/text2.C: add 'using' directive to bring the
7815 STL templates we need from the std:: namespace to the global one.
7816 Needed by DEC cxx in strict ansi mode.
7818 * src/support/LIstream.h,src/support/LOstream.h,
7819 src/support/lyxstring.h,src/table.h,
7820 src/lyxlookup.h: do not include <config.h> in header
7821 files. This should be done in the .C files only.
7823 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7827 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7829 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7830 from Kayvan to fix the tth invokation.
7832 * development/lyx.spec.in: updates from Kayvan to reflect the
7833 changes of file names.
7835 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7837 * src/text2.C (InsertStringB): use std::copy
7838 (InsertStringA): use std::copy
7840 * src/bufferlist.C: use a vector to store the buffers in. This is
7841 an internal change and should not affect any other thing.
7843 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7846 * src/text.C (Fill): fix potential bug, one off bug.
7848 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7850 * src/Makefile.am (lyx_main.o): add more files it depends on.
7852 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7854 * src/support/lyxstring.C: use size_t for the reference count,
7855 size, reserved memory and xtra.
7856 (internal_compare): new private member function. Now the compare
7857 functions should work for std::strings that have embedded '\0'
7859 (compare): all compare functions rewritten to use
7862 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7864 * src/support/lyxstring.C (compare): pass c_str()
7865 (compare): pass c_str
7866 (compare): pass c_str
7868 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7870 * src/support/DebugStream.C: <config.h> was not included correctly.
7872 * lib/configure: forgot to re-generate it :( I'll make this file
7873 auto generated soon.
7875 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7877 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7880 * src/support/lyxstring.C: some changes from length() to rep->sz.
7881 avoids a function call.
7883 * src/support/filetools.C (SpaceLess): yet another version of the
7884 algorithm...now per Jean-Marc's suggestions.
7886 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7888 * src/layout.C (less_textclass_desc): functor for use in sorting
7890 (LyXTextClass::Read): sort the textclasses after reading.
7892 * src/support/filetools.C (SpaceLess): new version of the
7893 SpaceLess functions. What problems does this one give? Please
7896 * images/banner_bw.xbm: made the arrays unsigned char *
7898 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7900 * src/support/lyxstring.C (find): remove bogus assertion in the
7901 two versions of find where this has not been done yet.
7903 * src/support/lyxlib.h: add missing int return type to
7906 * src/menus.C (ShowFileMenu): disable exporting to html if no
7907 html export command is present.
7909 * config/lib_configure.m4: add a test for an HTML converter. The
7910 programs checked for are, in this order: tth, latex2html and
7913 * lib/configure: generated from config/lib_configure.m4.
7915 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7916 html converter. The parameters are now passed through $$FName and
7917 $$OutName, instead of standard input/output.
7919 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7921 * lib/lyxrc.example: update description of \html_command.
7922 add "quotes" around \screen_font_xxx font setting examples to help
7923 people who use fonts with spaces in their names.
7925 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7927 * Distribution files: updates for v1.1.2
7929 * src/support/lyxstring.C (find): remove bogus assert and return
7930 npos for the same condition.
7932 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7934 * added patch for OS/2 from SMiyata.
7936 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7938 * src/text2.C (CutSelection): make space_wrapped a bool
7939 (CutSelection): dont declare int i until we have to.
7940 (alphaCounter): return a char const *.
7942 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7944 * src/support/syscall.C (Systemcalls::kill):
7945 src/support/filetools.C (PutEnv, PutEnvPath):
7946 src/lyx_cb.C (addNewlineAndDepth):
7947 src/FontInfo.C (FontInfo::resize): condition some #warning
7948 directives with WITH_WARNINGS.
7951 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7953 * src/layout.[Ch] + several files: access to class variables
7954 limited and made accessor functions instead a lot of code changed
7955 becuase of this. Also instead of returning pointers often a const
7956 reference is returned instead.
7958 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
7960 * src/Makefile.am (dist-hook): added used to remove the CVS from
7961 cheaders upon creating a dist
7962 (EXTRA_DIST): added cheaders
7964 * src/support/lstrings.C (tostr(char)): fix it to handle param as
7965 a character not as a small integer.
7967 * src/support/lyxstring.C (find): removed Assert and added i >=
7968 rep->sz to the first if.
7970 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7972 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
7973 src/LyXView.C src/buffer.C src/bufferparams.C
7974 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
7975 src/text2.C src/insets/insetinclude.C:
7976 lyxlayout renamed to textclasslist.
7978 * src/layout.C: some lyxerr changes.
7980 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
7981 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
7982 (LyXLayoutList): removed all traces of this class.
7983 (LyXTextClass::Read): rewrote LT_STYLE
7984 (LyXTextClass::hasLayout): new function
7985 (LyXTextClass::GetLayout): rewritten to return an iterator + has
7986 both const and nonconst version.
7987 (LyXTextClass::delete_layout): new function.
7988 (LyXTextClassList::Style): bug fix. do the right thing if layout
7990 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
7991 (LyXTextClassList::NameOfLayout): ditto
7992 (LyXTextClassList::Load): ditto
7994 * src/buffer.C (makeLaTeXFile): new access to layoutlist
7996 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
7998 * src/LyXAction.C (LookupFunc): added a workaround for sun
7999 compiler, on the other hand...we don't know if the current code
8000 compiles on sun at all...
8002 * src/support/filetools.C (CleanupPath): subst fix
8004 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8007 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8008 complained about this one?
8010 * src/insets/insetinclude.C (Latex): subst fix
8012 * src/insets/insetbib.C (getKeys): subst fix
8014 * src/LyXSendto.C (SendtoApplyCB): subst fix
8016 * src/lyx_main.C (init): subst fix
8018 * src/layout.C (Read): subst fix
8020 * src/lyx_sendfax_main.C (button_send): subst fix
8022 * src/buffer.C (RoffAsciiTable): subst fix
8024 * src/lyx_cb.C (MenuFax): subst fix
8025 (PrintApplyCB): subst fix
8027 1999-10-26 Juergen Vigna <jug@sad.it>
8029 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8031 (Read): Cleaned up this code so now we read only format vestion >= 5
8033 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8035 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8036 come nobody has complained about this one?
8038 * src/insets/insetinclude.C (Latex): subst fix
8040 * src/insets/insetbib.C (getKeys): subst fix
8042 * src/lyx_main.C (init): subst fix
8044 * src/layout.C (Read): subst fix
8046 * src/buffer.C (RoffAsciiTable): subst fix
8048 * src/lyx_cb.C (MenuFax): subst fix.
8050 * src/layout.[hC] + some other files: rewrote to use
8051 std::container to store textclasses and layouts in.
8052 Simplified, removed a lot of code. Make all classes
8053 assignable. Further simplifications and review of type
8054 use still to be one.
8056 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8057 lastfiles to create the lastfiles partr of the menu.
8059 * src/lastfiles.[Ch]: rewritten to use deque to store the
8060 lastfiles in. Uses fstream for reading and writing. Simplifies
8063 * src/support/syscall.C: remove explicit cast.
8065 * src/BufferView.C (CursorToggleCB): removed code snippets that
8067 use explicat C++ style casts instead of C style casts. also use
8068 u_vdata instea of passing pointers in longs.
8070 * src/PaperLayout.C: removed code snippets that were commented out.
8072 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8074 * src/lyx_main.C: removed code snippets that wer commented out.
8076 * src/paragraph.C: removed code snippets that were commented out.
8078 * src/lyxvc.C (logClose): use static_cast
8080 (viewLog): remove explicit cast to void*
8081 (showLog): removed old commented code
8083 * src/menus.C: use static_cast instead of C style casts. use
8084 u_vdata instead of u_ldata. remove explicit cast to (long) for
8085 pointers. Removed old code that was commented out.
8087 * src/insets/inset.C: removed old commented func
8089 * src/insets/insetref.C (InsetRef): removed old code that had been
8090 commented out for a long time.
8092 (escape): removed C style cast
8094 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8096 * src/insets/insetlatex.C (Draw): removed old commented code
8097 (Read): rewritten to use string
8099 * src/insets/insetlabel.C (escape): removed C style cast
8101 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8103 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8106 * src/insets/insetinclude.h: removed a couple of stupid bools
8108 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8109 (Clone): remove C style cast
8110 (getKeys): changed list to lst because of std::list
8112 * src/insets/inseterror.C (Draw): removed som old commented code.
8114 * src/insets/insetcommand.C (Draw): removed some old commented code.
8116 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8117 commented out forever.
8118 (bibitem_cb): use static_cast instead of C style cast
8119 use of vdata changed to u_vdata.
8121 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8123 (CloseUrlCB): use static_cast instead of C style cast.
8124 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8126 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8127 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8128 (CloseInfoCB): static_cast from ob->u_vdata instead.
8129 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8132 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8133 (C_InsetError_CloseErrorCB): forward the ob parameter
8134 (CloseErrorCB): static_cast from ob->u_vdata instead.
8136 * src/vspace.h: include LString.h since we use string in this class.
8138 * src/vspace.C (lyx_advance): changed name from advance because of
8139 nameclash with stl. And since we cannot use namespaces yet...I
8140 used a lyx_ prefix instead. Expect this to change when we begin
8143 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8145 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8146 and removed now defunct constructor and deconstructor.
8148 * src/BufferView.h: have backstack as a object not as a pointer.
8149 removed initialization from constructor. added include for BackStack
8151 * development/lyx.spec.in (%build): add CFLAGS also.
8153 * src/screen.C (drawFrame): removed another warning.
8155 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8157 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8158 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8159 README and ANNOUNCE a bit for the next release. More work is
8162 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8163 unbreakable if we are in freespacing mode (LyX-Code), but not in
8166 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8168 * src/BackStack.h: fixed initialization order in constructor
8170 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8172 * acinclude.m4 (VERSION): new rules for when a version is
8173 development, added also a variable for prerelease.
8174 (warnings): we set with_warnings=yes for prereleases
8175 (lyx_opt): prereleases compile with same optimization as development
8176 (CXXFLAGS): only use pedantic if we are a development version
8178 * src/BufferView.C (restorePosition): don't do anything if the
8181 * src/BackStack.h: added member empty, use this to test if there
8182 is anything to pop...
8184 1999-10-25 Juergen Vigna <jug@sad.it>
8187 * forms/layout_forms.fd +
8188 * forms/latexoptions.fd +
8189 * lyx.fd: changed for various form resize issues
8191 * src/mathed/math_panel.C +
8192 * src/insets/inseterror.C +
8193 * src/insets/insetinfo.C +
8194 * src/insets/inseturl.C +
8195 * src/insets/inseturl.h +
8198 * src/PaperLayout.C +
8199 * src/ParagraphExtra.C +
8200 * src/TableLayout.C +
8202 * src/layout_forms.C +
8209 * src/menus.C: fixed various resize issues. So now forms can be
8210 resized savely or not be resized at all.
8212 * forms/form_url.fd +
8213 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8216 * src/insets/Makefile.am: added files form_url.[Ch]
8218 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8220 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8221 (and presumably 6.2).
8223 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8224 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8225 remaining static member callbacks.
8227 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8230 * src/support/lyxstring.h: declare struct Srep as friend of
8231 lyxstring, since DEC cxx complains otherwise.
8233 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8235 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8237 * src/LaTeX.C (run): made run_bibtex also depend on files with
8239 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8240 are put into the dependency file.
8242 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8243 the code has shown itself to work
8244 (create_ispell_pipe): removed another warning, added a comment
8247 * src/minibuffer.C (ExecutingCB): removed code that has been
8248 commented out a long time
8250 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8251 out code + a warning.
8253 * src/support/lyxstring.h: comment out the three private
8254 operators, when compiling with string ansi conforming compilers
8257 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8259 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8260 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8263 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8266 * src/mathed/math_panel.C (create_math_panel): remove explicit
8269 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8272 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8273 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8274 to XCreatePixmapFromBitmapData
8275 (fl_set_bmtable_data): change the last argument to be unsigned
8277 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8278 and bh to be unsigned int, remove explicit casts in call to
8279 XReadBitmapFileData.
8281 * images/arrows.xbm: made the arrays unsigned char *
8282 * images/varsz.xbm: ditto
8283 * images/misc.xbm: ditto
8284 * images/greek.xbm: ditto
8285 * images/dots.xbm: ditto
8286 * images/brel.xbm: ditto
8287 * images/bop.xbm: ditto
8289 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8291 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8292 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8293 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8295 (LYX_CXX_CHEADERS): added <clocale> to the test.
8297 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8299 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8301 * src/support/lyxstring.C (append): fixed something that must be a
8302 bug, rep->assign was used instead of rep->append.
8304 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8307 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8308 lyx insert double chars. Fix spotted by Kayvan.
8310 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8312 * Fixed the tth support. I messed up with the Emacs patch apply feature
8313 and omitted the changes in lyxrc.C.
8315 1999-10-22 Juergen Vigna <jug@sad.it>
8317 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8319 * src/lyx_cb.C (MenuInsertRef) +
8320 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8321 the form cannot be resized under it limits (fixes a segfault)
8323 * src/lyx.C (create_form_form_ref) +
8324 * forms/lyx.fd: Changed Gravity on name input field so that it is
8327 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8329 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8330 <ostream> and <istream>.
8332 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8333 whether <fstream> provides the latest standard features, or if we
8334 have an oldstyle library (like in egcs).
8335 (LYX_CXX_STL_STRING): fix the test.
8337 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8338 code on MODERN_STL_STREAM.
8340 * src/support/lyxstring.h: use L{I,O}stream.h.
8342 * src/support/L{I,O}stream.h: new files, designed to setup
8343 correctly streams for our use
8344 - includes the right header depending on STL capabilities
8345 - puts std::ostream and std::endl (for LOStream.h) or
8346 std::istream (LIStream.h) in toplevel namespace.
8348 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8350 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8351 was a bib file that had been changed we ensure that bibtex is run.
8352 (runBibTeX): enhanced to extract the names of the bib files and
8353 getting their absolute path and enter them into the dep file.
8354 (findtexfile): static func that is used to look for tex-files,
8355 checks for absolute patchs and tries also with kpsewhich.
8356 Alternative ways of finding the correct files are wanted. Will
8358 (do_popen): function that runs a command using popen and returns
8359 the whole output of that command in a string. Should be moved to
8362 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8363 file with extension ext has changed.
8365 * src/insets/figinset.C: added ifdef guards around the fl_free
8366 code that jug commented out. Now it is commented out when
8367 compiling with XForms == 0.89.
8369 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8370 to lyxstring.C, and only keep a forward declaration in
8371 lyxstring.h. Simplifies the header file a bit and should help a
8372 bit on compile time too. Also changes to Srep will not mandate a
8373 recompile of code just using string.
8374 (~lyxstring): definition moved here since it uses srep.
8375 (size): definition moved here since it uses srep.
8377 * src/support/lyxstring.h: removed a couple of "inline" that should
8380 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8382 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8385 1999-10-21 Juergen Vigna <jug@sad.it>
8387 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8388 set to left if I just remove the width entry (or it is empty).
8390 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8391 paragraph when having dummy paragraphs.
8393 1999-10-20 Juergen Vigna <jug@sad.it>
8395 * src/insets/figinset.C: just commented some fl_free_form calls
8396 and added warnings so that this calls should be activated later
8397 again. This avoids for now a segfault, but we have a memory leak!
8399 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8400 'const char * argument' to 'string argument', this should
8401 fix some Asserts() in lyxstring.C.
8403 * src/lyxfunc.h: Removed the function argAsString(const char *)
8404 as it is not used anymore.
8406 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8408 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8411 * src/Literate.h: some funcs moved from public to private to make
8412 interface clearer. Unneeded args removed.
8414 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8416 (scanBuildLogFile): ditto
8418 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8419 normal TeX Error. Still room for improvement.
8421 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8423 * src/buffer.C (insertErrors): changes to make the error
8424 desctription show properly.
8426 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8429 * src/support/lyxstring.C (helper): changed to use
8430 sizeof(object->rep->ref).
8431 (operator>>): changed to use a pointer instead.
8433 * src/support/lyxstring.h: changed const reference & to value_type
8434 const & lets see if that helps.
8436 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8438 * Makefile.am (rpmdist): fixed to have non static package and
8441 * src/support/lyxstring.C: removed the compilation guards
8443 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8446 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8447 conditional compile of lyxstring.Ch
8449 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8450 stupid check, but it is a lot better than the bastring hack.
8451 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8453 * several files: changed string::erase into string::clear. Not
8456 * src/chset.C (encodeString): use a char temporary instead
8458 * src/table.C (TexEndOfCell): added tostr around
8459 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8460 (TexEndOfCell): ditto
8461 (TexEndOfCell): ditto
8462 (TexEndOfCell): ditto
8463 (DocBookEndOfCell): ditto
8464 (DocBookEndOfCell): ditto
8465 (DocBookEndOfCell): ditto
8466 (DocBookEndOfCell): ditto
8468 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8470 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8472 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8473 (MenuBuildProg): added tostr around ret
8474 (MenuRunChktex): added tostr around ret
8475 (DocumentApplyCB): added tostr around ret
8477 * src/chset.C (encodeString): added tostr around t->ic
8479 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8480 (makeLaTeXFile): added tostr around tocdepth
8481 (makeLaTeXFile): added tostr around ftcound - 1
8483 * src/insets/insetbib.C (setCounter): added tostr around counter.
8485 * src/support/lyxstring.h: added an operator+=(int) to catch more
8488 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8489 (lyxstring): We DON'T allow NULL pointers.
8491 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8493 * src/mathed/math_macro.C (MathMacroArgument::Write,
8494 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8495 when writing them out.
8497 * src/LString.C: remove, since it is not used anymore.
8499 * src/support/lyxstring.C: condition the content to
8500 USE_INCLUDED_STRING macro.
8502 * src/mathed/math_symbols.C, src/support/lstrings.C,
8503 src/support/lyxstring.C: add `using' directive to specify what
8504 we need in <algorithm>. I do not think that we need to
8505 conditionalize this, but any thought is appreciated.
8507 * many files: change all callback functions to "C" linkage
8508 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8509 strict_ansi. Those who were static are now global.
8510 The case of callbacks which are static class members is
8511 trickier, since we have to make C wrappers around them (see
8512 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8513 did not finish this yet, since it defeats the purpose of
8514 encapsulation, and I am not sure what the best route is.
8516 1999-10-19 Juergen Vigna <jug@sad.it>
8518 * src/support/lyxstring.C (lyxstring): we permit to have a null
8519 pointer as assignment value and just don't assign it.
8521 * src/vspace.C (nextToken): corrected this function substituting
8522 find_first(_not)_of with find_last_of.
8524 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8525 (TableOptCloseCB) (TableSpeCloseCB):
8526 inserted fl_set_focus call for problem with fl_hide_form() in
8529 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8531 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8534 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8536 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8537 LyXLex::next() and not eatline() to get its argument.
8539 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8541 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8542 instead, use fstreams for io of the depfile, removed unneeded
8543 functions and variables.
8545 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8546 vector instead, removed all functions and variables that is not in
8549 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8551 * src/buffer.C (insertErrors): use new interface to TeXError
8553 * Makefile.am (rpmdist): added a rpmdist target
8555 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8556 per Kayvan's instructions.
8558 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8560 * src/Makefile.am: add a definition for localedir, so that locales
8561 are found after installation (Kayvan)
8563 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8565 * development/.cvsignore: new file.
8567 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8569 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8570 C++ compiler provides wrappers for C headers and use our alternate
8573 * configure.in: use LYX_CXX_CHEADERS.
8575 * src/cheader/: new directory, populated with cname headers from
8576 libstdc++-2.8.1. They are a bit old, but probably good enough for
8577 what we want (support compilers who lack them).
8579 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8580 from includes. It turns out is was stupid.
8582 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8584 * lib/Makefile.am (install-data-local): forgot a ';'
8585 (install-data-local): forgot a '\'
8586 (libinstalldirs): needed after all. reintroduced.
8588 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8590 * configure.in (AC_OUTPUT): added lyx.spec
8592 * development/lyx.spec: removed file
8594 * development/lyx.spec.in: new file
8596 * po/*.po: merged with lyx.pot becuase of make distcheck
8598 * lib/Makefile.am (dist-hook): added dist-hook so that
8599 documentation files will be included when doing a make
8600 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8601 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8603 more: tried to make install do the right thing, exclude CVS dirs
8606 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8607 Path would fit in more nicely.
8609 * all files that used to use pathstack: uses now Path instead.
8610 This change was a lot easier than expected.
8612 * src/support/path.h: new file
8614 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8616 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8618 * src/support/lyxstring.C (getline): Default arg was given for
8621 * Configure.cmd: removed file
8623 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8625 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8626 streams classes and types, add the proper 'using' statements when
8627 MODERN_STL is defined.
8629 * src/debug.h: move the << operator definition after the inclusion
8632 * src/support/filetools.C: include "LAssert.h", which is needed
8635 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8638 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8639 include "debug.h" to define a proper ostream.
8641 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8643 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8644 method to the SystemCall class which can kill a process, but it's
8645 not fully implemented yet.
8647 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8649 * src/support/FileInfo.h: Better documentation
8651 * src/lyxfunc.C: Added support for buffer-export html
8653 * src/menus.C: Added Export->As HTML...
8655 * lib/bind/*.bind: Added short-cut for buffer-export html
8657 * src/lyxrc.*: Added support for new \tth_command
8659 * lib/lyxrc.example: Added stuff for new \tth_command
8661 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8663 * lib/Makefile.am (IMAGES): removed images/README
8664 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8665 installes in correct place. Check permisions is installed
8668 * src/LaTeX.C: some no-op changes moved declaration of some
8671 * src/LaTeX.h (LATEX_H): changed include guard name
8673 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8675 * lib/reLyX/Makefile.am: install noweb2lyx.
8677 * lib/Makefile.am: install configure.
8679 * lib/reLyX/configure.in: declare a config aux dir; set package
8680 name to lyx (not sure what the best solution is); generate noweb2lyx.
8682 * lib/layouts/egs.layout: fix the bibliography layout.
8684 1999-10-08 Jürgen Vigna <jug@sad.it>
8686 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8687 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8688 it returned without continuing to search the path.
8690 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8692 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8693 also fixes a bug. It is not allowed to do tricks with std::strings
8694 like: string a("hei"); &a[e]; this will not give what you
8695 think... Any reason for the complexity in this func?
8697 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8699 * Updated README and INSTALL a bit, mostly to check that my
8700 CVS rights are correctly set up.
8702 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8704 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8705 does not allow '\0' chars but lyxstring and std::string does.
8707 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8709 * autogen.sh (AUTOCONF): let the autogen script create the
8710 POTFILES.in file too. POTFILES.in should perhaps now not be
8711 included in the cvs module.
8713 * some more files changed to use C++ includes instead of C ones.
8715 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8717 (Reread): added tostr to nlink. buggy output otherwise.
8718 (Reread): added a string() around szMode when assigning to Buffer,
8719 without this I got a log of garbled info strings.
8721 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8724 * I have added several ostream & operator<<(ostream &, some_type)
8725 functions. This has been done to avoid casting and warnings when
8726 outputting enums to lyxerr. This as thus eliminated a lot of
8727 explicit casts and has made the code clearer. Among the enums
8728 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8729 mathed enums, some font enum the Debug::type enum.
8731 * src/support/lyxstring.h (clear): missing method. equivalent of
8734 * all files that contained "stderr": rewrote constructs that used
8735 stderr to use lyxerr instead. (except bmtable)
8737 * src/support/DebugStream.h (level): and the passed t with
8738 Debug::ANY to avoid spurious bits set.
8740 * src/debug.h (Debug::type value): made it accept strings of the
8743 * configure.in (Check for programs): Added a check for kpsewhich,
8744 the latex generation will use this later to better the dicovery of
8747 * src/BufferView.C (create_view): we don't need to cast this to
8748 (void*) that is done automatically.
8749 (WorkAreaButtonPress): removed some dead code.
8751 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8753 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8754 is not overwritten when translated (David Sua'rez de Lis).
8756 * lib/CREDITS: Added David Sua'rez de Lis
8758 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8760 * src/bufferparams.C (BufferParams): default input encoding is now
8763 * acinclude.m4 (cross_compiling): comment out macro
8764 LYX_GXX_STRENGTH_REDUCE.
8766 * acconfig.h: make sure that const is not defined (to empty) when
8767 we are compiling C++. Remove commented out code using SIZEOF_xx
8770 * configure.in : move the test for const and inline as late as
8771 possible so that these C tests do not interefere with C++ ones.
8772 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8773 has not been proven.
8775 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8777 * src/table.C (getDocBookAlign): remove bad default value for
8780 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8782 (ShowFileMenu2): ditto.
8784 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8787 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8789 * Most files: finished the change from the old error code to use
8790 DebugStream for all lyxerr debugging. Only minor changes remain
8791 (e.g. the setting of debug levels using strings instead of number)
8793 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8795 * src/layout.C (Add): Changed to use compare_no_case instead of
8798 * src/FontInfo.C: changed loop variable type too string::size_type.
8800 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8802 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8803 set ETAGS_ARGS to --c++
8805 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8807 * src/table.C (DocBookEndOfCell): commented out two unused variables
8809 * src/paragraph.C: commented out four unused variables.
8811 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8812 insed a if clause with type string::size_type.
8814 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8817 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8819 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8820 variable, also changed loop to go from 0 to lenght + 1, instead of
8821 -1 to length. This should be correct.
8823 * src/LaTeX.C (scanError): use string::size_type as loop variable
8826 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8827 (l.896) since y_tmp and row was not used anyway.
8829 * src/insets/insetref.C (escape): use string::size_type as loop
8832 * src/insets/insetquotes.C (Width): use string::size_type as loop
8834 (Draw): use string::size_type as loop variable type.
8836 * src/insets/insetlatexaccent.C (checkContents): use
8837 string::size_type as loop variable type.
8839 * src/insets/insetlabel.C (escape): use string::size_type as loop
8842 * src/insets/insetinfo.C: added an extern for current_view.
8844 * src/insets/insetcommand.C (scanCommand): use string::size_type
8845 as loop variable type.
8847 * most files: removed the RCS tags. With them we had to recompile
8848 a lot of files after a simple cvs commit. Also we have never used
8849 them for anything meaningful.
8851 * most files: tags-query-replace NULL 0. As adviced several plases
8852 we now use "0" instead of "NULL" in our code.
8854 * src/support/filetools.C (SpaceLess): use string::size_type as
8857 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8859 * src/paragraph.C: fixed up some more string stuff.
8861 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8863 * src/support/filetools.h: make modestr a std::string.
8865 * src/filetools.C (GetEnv): made ch really const.
8867 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8868 made code that used these use max/min from <algorithm> instead.
8870 * changed several c library include files to their equivalent c++
8871 library include files. All is not changed yet.
8873 * created a support subdir in src, put lyxstring and lstrings
8874 there + the extra files atexit, fileblock, strerror. Created
8875 Makefile.am. edited configure.in and src/Makefile.am to use this
8876 new subdir. More files moved to support.
8878 * imported som of the functions from repository lyx, filetools
8880 * ran tags-query-replace on LString -> string, corrected the bogus
8881 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8882 is still some errors in there. This is errors where too much or
8883 too litle get deleted from strings (string::erase, string::substr,
8884 string::replace), there can also be some off by one errors, or
8885 just plain wrong use of functions from lstrings. Viewing of quotes
8888 * LyX is now running fairly well with string, but there are
8889 certainly some bugs yet (see above) also string is quite different
8890 from LString among others in that it does not allow null pointers
8891 passed in and will abort if it gets any.
8893 * Added the revtex4 files I forgot when setting up the repository.
8895 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8897 * All over: Tried to clean everything up so that only the files
8898 that we really need are included in the cvs repository.
8899 * Switched to use automake.
8900 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8901 * Install has not been checked.
8903 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8905 * po/pt.po: Three errors:
8906 l.533 and l.538 format specification error
8907 l. 402 duplicate entry, I just deleted it.