1 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3 * src/frontends/kde/FormCitation.C: fix thinko
4 where we didn't always display the reference text
7 * src/frontends/kde/formurldialog.C
8 * src/frontends/kde/formurldialog.h
9 * src/frontends/kde/FormUrl.C
10 * src/frontends/kde/FormUrl.h: minor cleanups
12 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
14 * src/frontends/kde/Makefile.am
15 * src/frontends/kde/FormToc.C
16 * src/frontends/kde/FormToc.h
17 * src/frontends/kde/FormCitation.C
18 * src/frontends/kde/FormCitation.h
19 * src/frontends/kde/FormIndex.C
20 * src/frontends/kde/FormIndex.h
21 * src/frontends/kde/formtocdialog.C
22 * src/frontends/kde/formtocdialog.h
23 * src/frontends/kde/formcitationdialog.C
24 * src/frontends/kde/formcitationdialog.h
25 * src/frontends/kde/formindexdialog.C
26 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
28 2000-09-12 Juergen Vigna <jug@sad.it>
30 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
33 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
35 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
38 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
40 * src/converter.C (Add, Convert): Added support for converter flags:
41 needaux, resultdir, resultfile.
42 (Convert): Added new parameter view_file.
43 (dvips_options): Fixed letter paper option.
45 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
46 (Export, GetExportableFormats, GetViewableFormats): Added support
49 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
51 (easyParse): Fixed to work with new export code.
53 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
56 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
58 * lib/bind/*.bind: Replaced
59 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
60 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
62 2000-09-11 Juergen Vigna <jug@sad.it>
64 * src/lyx_gui.C (runTime): uses global guiruntime variable.
66 * src/main.C (main): now GUII defines global guiruntime!
68 * src/frontends/gnome/GUIRunTime.C (initApplication):
69 * src/frontends/kde/GUIRunTime.C (initApplication):
70 * src/frontends/xforms/GUIRunTime.C (initApplication):
71 * src/frontends/GUIRunTime.h: added new function initApplication.
73 * src/spellchecker.C (sc_accept_word): change to add_to_session.
75 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
77 2000-09-08 Juergen Vigna <jug@sad.it>
79 * src/lyx_gui.C (create_forms): don't display the "default" entry as
80 we have already "Reset".
82 * src/language.C (initL): inserted "default" language and made this
83 THE default language (and not american!)
85 * src/paragraph.C: inserted handling of "default" language!
87 * src/lyxfont.C: ditto
91 * src/paragraph.C: output the \\par only if we have a following
92 paragraph otherwise it's not needed.
94 2000-09-05 Juergen Vigna <jug@sad.it>
96 * config/pspell.m4: added entry to lyx-flags
98 * src/spellchecker.C: modified version from Kevin for using pspell
100 2000-09-01 Marko Vendelin <markov@ioc.ee>
101 * src/frontends/gnome/Makefile.am
102 * src/frontends/gnome/FormCitation.C
103 * src/frontends/gnome/FormCitation.h
104 * src/frontends/gnome/diainsertcitation_callbacks.c
105 * src/frontends/gnome/diainsertcitation_callbacks.h
106 * src/frontends/gnome/diainsertcitation_interface.c
107 * src/frontends/gnome/diainsertcitation_interface.h
108 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
109 dialog for Gnome frontend
111 * src/main.C: Gnome libraries require keeping application name
112 and its version as strings
114 * src/frontends/gnome/mainapp.C: Change the name of the main window
115 from GnomeLyX to PACKAGE
117 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
119 * src/frontends/Liason.C: add "using: declaration.
121 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
123 * src/mathed/math_macro.C (Metrics): Set the size of the template
125 * src/mathed/formulamacro.C (Latex): Fixed the returned value
127 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
129 * src/converter.C (add_options): New function.
130 (SetViewer): Change $$FName into '$$FName'.
131 (View): Add options when running xdvi
132 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
133 (Convert): The 3rd parameter is now the desired filename. Converts
134 calls to lyx::rename if necessary.
135 Add options when running dvips.
136 (dvi_papersize,dvips_options): New methods.
138 * src/exporter.C (Export): Use getLatexName() instead of fileName().
140 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
141 using a call to Converter::dvips_options.
142 Fixed to work with nex export code.
145 * src/support/rename.C: New files
147 * src/support/syscall.h
148 * src/support/syscall.C: Added Starttype SystemDontWait.
150 * lib/ui/default.ui: Changed to work with new export code
152 * lib/configure.m4: Changed to work with new export code
154 * src/encoding.C: Changed latex name for iso8859_7 encoding.
156 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
158 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
159 so that code compiles with DEC cxx.
161 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
162 to work correctly! Also now supports the additional elements
165 2000-09-01 Allan Rae <rae@lyx.org>
167 * src/frontends/ButtonPolicies.C: renamed all the references to
168 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
170 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
171 since it's a const not a type.
173 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
175 2000-08-31 Juergen Vigna <jug@sad.it>
177 * src/insets/figinset.C: Various changes to look if the filename has
178 an extension and if not add it for inline previewing.
180 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
182 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
183 make buttonStatus and isReadOnly be const methods. (also reflect
184 this in derived classes.)
186 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
187 (nextState): change to be static inline, pass the StateMachine as
189 (PreferencesPolicy): remove casts
190 (OkCancelPolicy): remvoe casts
191 (OkCancelReadOnlyPolicy): remove casts
192 (NoRepeatedApplyReadOnlyPolicy): remove casts
193 (OkApplyCancelReadOnlyPolicy): remove casts
194 (OkApplyCancelPolicy): remove casts
195 (NoRepeatedApplyPolicy): remove casts
197 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
199 * src/converter.C: added some using directives
201 * src/frontends/ButtonPolicies.C: changes to overcome
202 "need lvalue" error with DEC c++
204 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
205 to WMHideCB for DEC c++
207 * src/frontends/xforms/Menubar_pimpl.C: added using directive
209 * src/frontends/xforms/forms/form_document.C.patch: use C callback
210 to BulletBMTableCB for DEC c++
212 2000-08-31 Allan Rae <rae@lyx.org>
214 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
215 character dialog separately from old document dialogs combo_language.
218 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
220 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
221 Removed LFUN_REF_CREATE.
223 * src/MenuBackend.C: Added new tags: toc and references
225 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
226 (add_lastfiles, add_documents, add_formats): Removed the unused smn
228 (add_toc, add_references): New methods.
229 (create_submenu): Handle correctly the case when there is a
230 seperator after optional menu items.
232 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
233 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
234 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
236 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
238 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
240 * src/converter.[Ch]: New file for converting between different
243 * src/export.[Ch]: New file for exporting a LyX file to different
246 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
247 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
248 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
249 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
250 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
251 RunDocBook, MenuExport.
253 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
254 Exporter::Preview methods if NEW_EXPORT is defined.
256 * src/buffer.C (Dispatch): Use Exporter::Export.
258 * src/lyxrc.C: Added new tags: \converter and \viewer.
261 * src/LyXAction.C: Define new lyx-function: buffer-update.
262 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
263 when NEW_EXPORT is defined.
265 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
267 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
269 * lib/ui/default.ui: Added submenus "view" and "update" to the
272 * src/filetools.C (GetExtension): New function.
274 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
276 2000-08-29 Allan Rae <rae@lyx.org>
278 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
280 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
281 (EnableDocumentLayout): removed
282 (DisableDocumentLayout): removed
283 (build): make use of ButtonController's read-only handling to
284 de/activate various objects. Replaces both of the above functions.
286 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
287 (readOnly): was read_only
288 (refresh): fixed dumb mistakes with read_only_ handling
290 * src/frontends/xforms/forms/form_document.fd:
291 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
292 tabbed dialogs so the tabs look more like tabs and so its easier to
293 work out which is the current tab.
295 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
296 segfault with form_table
298 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
300 2000-08-28 Juergen Vigna <jug@sad.it>
302 * acconfig.h: added USE_PSPELL.
304 * src/config.h.in: added USE_PSPELL.
306 * autogen.sh: added pspell.m4
308 * config/pspell.m4: new file.
310 * src/spellchecker.C: implemented support for pspell libary.
312 2000-08-25 Juergen Vigna <jug@sad.it>
314 * src/LyXAction.C (init): renamed LFUN_TABLE to
315 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
317 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
319 * src/lyxscreen.h: add force_clear variable and fuction to force
320 a clear area when redrawing in LyXText.
322 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
324 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
326 * some whitespace and comment changes.
328 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
330 * src/buffer.C: up te LYX_FORMAT to 2.17
332 2000-08-23 Juergen Vigna <jug@sad.it>
334 * src/BufferView_pimpl.C (tripleClick): disable this when in a
337 * src/insets/insettabular.C (pasteSelection): delete the insets
338 LyXText as it is not valid anymore.
339 (copySelection): new function.
340 (pasteSelection): new function.
341 (cutSelection): new function.
342 (LocalDispatch): implemented cut/copy/paste of cell selections.
344 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
345 don't have a LyXText.
347 * src/LyXAction.C (init): a NEW_TABULAR define too much.
349 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
352 2000-08-22 Juergen Vigna <jug@sad.it>
354 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
355 ifdef form_table out if NEW_TABULAR.
357 2000-08-21 Juergen Vigna <jug@sad.it>
359 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
360 (draw): fixed draw position so that the cursor is positioned in the
362 (InsetMotionNotify): hide/show cursor so the position is updated.
363 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
364 using cellstart() function where it should be used.
366 * src/insets/insettext.C (draw): ditto.
368 * src/tabular.C: fixed initialization of some missing variables and
369 made BoxType into an enum.
371 2000-08-22 Marko Vendelin <markov@ioc.ee>
372 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
373 stock menu item using action numerical value, not its string
377 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
379 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
380 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
382 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
384 * src/frontends/xforms/GUIRunTime.C: new file
386 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
387 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
389 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
391 * src/frontends/kde/GUIRunTime.C: new file
393 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
394 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
396 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
398 * src/frontends/gnome/GUIRunTime.C: new file
400 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
403 * src/frontends/GUIRunTime.h: removed constructor and destructor,
404 small change to documetentation.
406 * src/frontends/GUIRunTime.C: removed file
408 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
410 * src/lyxparagraph.h: enable NEW_TABULAR as default
412 * src/lyxfunc.C (processKeySym): remove some commented code
414 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
415 NEW_TABULAR around the fd_form_table_options.
417 * src/lyx_gui.C (runTime): call the static member function as
418 GUIRunTime::runTime().
420 2000-08-21 Allan Rae <rae@lyx.org>
422 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
425 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
427 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
429 2000-08-21 Allan Rae <rae@lyx.org>
431 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
433 * src/frontends/xforms/FormPreferences.C (build): use setOK
434 * src/frontends/xforms/FormDocument.C (build): use setOK
435 (FormDocument): use the appropriate policy.
437 2000-08-21 Allan Rae <rae@lyx.org>
439 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
440 automatic [de]activation of arbitrary objects when in a read-only state.
442 * src/frontends/ButtonPolicies.h: More documentation
443 (isReadOnly): added to support the above.
445 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
447 2000-08-18 Juergen Vigna <jug@sad.it>
449 * src/insets/insettabular.C (getStatus): changed to return func_status.
451 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
452 display toggle menu entries if they are.
454 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
455 new document layout now.
457 * src/lyxfunc.C: ditto
459 * src/lyx_gui_misc.C: ditto
461 * src/lyx_gui.C: ditto
463 * lib/ui/default.ui: removed paper and quotes layout as they are now
464 all in the document layout tabbed folder.
466 * src/frontends/xforms/forms/form_document.fd: added Restore
467 button and callbacks for all inputs for Allan's ButtonPolicy.
469 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
470 (CheckChoiceClass): added missing params setting on class change.
471 (UpdateLayoutDocument): added for updating the layout on params.
472 (build): forgot to RETURN_ALWAYS input_doc_spacing.
473 (FormDocument): Implemented Allan's ButtonPolicy with the
476 2000-08-17 Allan Rae <rae@lyx.org>
478 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
479 so we can at least see the credits again.
481 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
482 controller calls for the appropriate callbacks. Note that since Ok
483 calls apply followed by cancel, and apply isn't a valid input for the
484 APPLIED state, the bc_ calls have to be made in the static callback not
485 within each of the real callbacks.
487 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
488 (setOk): renamed from setOkay()
490 2000-08-17 Juergen Vigna <jug@sad.it>
492 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
493 in the implementation part.
494 (composeUIInfo): don't show optional menu-items.
496 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
498 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
500 * src/bufferview_funcs.C (CurrentState): fixed to show also the
501 text-state when in a text-inset.
503 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
505 2000-08-17 Marko Vendelin <markov@ioc.ee>
506 * src/frontends/gnome/FormIndex.C
507 * src/frontends/gnome/FormIndex.h
508 * src/frontends/gnome/FormToc.C
509 * src/frontends/gnome/FormToc.h
510 * src/frontends/gnome/dialogs
511 * src/frontends/gnome/diatoc_callbacks.c
512 * src/frontends/gnome/diatoc_callbacks.h
513 * src/frontends/gnome/diainsertindex_callbacks.h
514 * src/frontends/gnome/diainsertindex_callbacks.c
515 * src/frontends/gnome/diainsertindex_interface.c
516 * src/frontends/gnome/diainsertindex_interface.h
517 * src/frontends/gnome/diatoc_interface.h
518 * src/frontends/gnome/diatoc_interface.c
519 * src/frontends/gnome/Makefile.am: Table of Contents and
520 Insert Index dialogs implementation for Gnome frontend
522 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
524 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
526 * src/frontends/gnome/diainserturl_interface.c: make the dialog
529 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
531 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
532 destructor. Don't definde if you don't need it
533 (processEvents): made static, non-blocking events processing for
535 (runTime): static method. event loop for xforms
536 * similar as above for kde and gnome.
538 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
540 (runTime): new method calss the real frontends runtime func.
542 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
544 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
546 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
548 2000-08-16 Juergen Vigna <jug@sad.it>
550 * src/lyx_gui.C (runTime): added GUII RunTime support.
552 * src/frontends/Makefile.am:
553 * src/frontends/GUIRunTime.[Ch]:
554 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
555 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
556 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
558 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
560 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
561 as this is already set in ${FRONTEND_INCLUDE} if needed.
563 * configure.in (CPPFLAGS): setting the include dir for the frontend
564 directory and don't set FRONTEND=xforms for now as this is executed
567 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
569 * src/frontends/kde/Makefile.am:
570 * src/frontends/kde/FormUrl.C:
571 * src/frontends/kde/FormUrl.h:
572 * src/frontends/kde/formurldialog.h:
573 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
575 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
577 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
579 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
581 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
584 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
586 * src/WorkArea.C (work_area_handler): more work to get te
587 FL_KEYBOARD to work with xforms 0.88 too, please test.
589 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
591 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
593 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
596 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
598 * src/Timeout.h: remove Qt::emit hack.
600 * several files: changes to allo doc++ compilation
602 * src/lyxfunc.C (processKeySym): new method
603 (processKeyEvent): comment out if FL_REVISION < 89
605 * src/WorkArea.C: change some debugging levels.
606 (WorkArea): set wantkey to FL_KEY_ALL
607 (work_area_handler): enable the FL_KEYBOARD clause, this enables
608 clearer code and the use of compose with XForms 0.89. Change to
609 use signals instead of calling methods in bufferview directly.
611 * src/Painter.C: change some debugging levels.
613 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
616 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
617 (workAreaKeyPress): new method
619 2000-08-14 Juergen Vigna <jug@sad.it>
621 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
623 * config/kde.m4: addes some features
625 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
626 include missing xforms dialogs.
628 * src/Timeout.h: a hack to be able to compile with qt/kde.
630 * sigc++/.cvsignore: added acinclude.m4
632 * lib/.cvsignore: added listerros
634 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
635 xforms tree as objects are needed for other frontends.
637 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
638 linking with not yet implemented xforms objects.
640 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
642 2000-08-14 Baruch Even <baruch.even@writeme.com>
644 * src/frontends/xforms/FormGraphics.h:
645 * src/frontends/xforms/FormGraphics.C:
646 * src/frontends/xforms/RadioButtonGroup.h:
647 * src/frontends/xforms/RadioButtonGroup.C:
648 * src/insets/insetgraphics.h:
649 * src/insets/insetgraphics.C:
650 * src/insets/insetgraphicsParams.h:
651 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
652 instead of spaces, and various other indentation issues to make the
653 sources more consistent.
655 2000-08-14 Marko Vendelin <markov@ioc.ee>
657 * src/frontends/gnome/dialogs/diaprint.glade
658 * src/frontends/gnome/FormPrint.C
659 * src/frontends/gnome/FormPrint.h
660 * src/frontends/gnome/diaprint_callbacks.c
661 * src/frontends/gnome/diaprint_callbacks.h
662 * src/frontends/gnome/diaprint_interface.c
663 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
666 * src/frontends/gnome/dialogs/diainserturl.glade
667 * src/frontends/gnome/FormUrl.C
668 * src/frontends/gnome/FormUrl.h
669 * src/frontends/gnome/diainserturl_callbacks.c
670 * src/frontends/gnome/diainserturl_callbacks.h
671 * src/frontends/gnome/diainserturl_interface.c
672 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
675 * src/frontends/gnome/Dialogs.C
676 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
677 all other dialogs. Copy all unimplemented dialogs from Xforms
680 * src/frontends/gnome/support.c
681 * src/frontends/gnome/support.h: support files generated by Glade
685 * config/gnome.m4: Gnome configuration scripts
687 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
688 configure --help message
690 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
691 only if there are no events pendling in Gnome/Gtk. This enhances
692 the performance of menus.
695 2000-08-14 Allan Rae <rae@lyx.org>
697 * lib/Makefile.am: listerrors cleaning
699 * lib/listerrors: removed -- generated file
700 * acinclude.m4: ditto
701 * sigc++/acinclude.m4: ditto
703 * src/frontends/xforms/forms/form_citation.fd:
704 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
707 * src/frontends/xforms/forms/makefile: I renamed the `install` target
708 `updatesrc` and now we have a `test` target that does what `updatesrc`
709 used to do. I didn't like having an install target that wasn't related
712 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
713 on all except FormGraphics. This may yet happen. Followed by a major
714 cleanup including using FL_TRANSIENT for most of the dialogs. More
715 changes to come when the ButtonController below is introduced.
717 * src/frontends/xforms/ButtonController.h: New file for managing up to
718 four buttons on a dialog according to an externally defined policy.
719 * src/frontends/xforms/Makefile.am: added above
721 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
722 Apply and Cancel/Close buttons and everything in between and beyond.
723 * src/frontends/Makefile.am: added above.
725 * src/frontends/xforms/forms/form_preferences.fd:
726 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
727 and removed variable 'status' as a result. Fixed the set_minsize thing.
728 Use the new screen-font-update after checking screen fonts were changed
729 Added a "Restore" button to restore the original lyxrc values while
730 editing. This restores everything not just the last input changed.
731 That's still a tricky one. As is the "LyX: this shouldn't happen..."
733 * src/LyXAction.C: screen-font-update added for updating buffers after
734 screen font settings have been changed.
735 * src/commandtags.h: ditto
736 * src/lyxfunc.C: ditto
738 * forms/lyx.fd: removed screen fonts dialog.
739 * src/lyx_gui.C: ditto
740 * src/menus.[Ch]: ditto
741 * src/lyx.[Ch]: ditto
742 * src/lyx_cb.C: ditto + code from here moved to make
743 screen-font-update. And people wonder why progress on GUII is
744 slow. Look at how scattered this stuff was! It takes forever
747 * forms/fdfix.sh: Fixup the spacing after commas.
748 * forms/makefile: Remove date from generated files. Fewer clashes now.
749 * forms/bullet_forms.C.patch: included someones handwritten changes
751 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
752 once I've discovered why LyXRC was made noncopyable.
753 * src/lyx_main.C: ditto
755 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
757 * src/frontends/xforms/forms/fdfix.sh:
758 * src/frontends/xforms/forms/fdfixh.sed:
759 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
760 * src/frontends/xforms/Form*.[hC]:
761 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
762 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
763 provide a destructor for the struct FD_form_xxxx. Another version of
764 the set_[max|min]size workaround and a few other cleanups. Actually,
765 Angus' patch from 20000809.
767 2000-08-13 Baruch Even <baruch.even@writeme.com>
769 * src/insets/insetgraphics.C (Clone): Added several fields that needed
772 2000-08-11 Juergen Vigna <jug@sad.it>
774 * src/insets/insetgraphics.C (InsetGraphics): changing init
775 order because of warnings.
777 * src/frontends/xforms/forms/makefile: adding patching .C with
780 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
781 from .C.patch to .c.patch
783 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
784 order because of warning.
786 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
788 * src/frontends/Liason.C (setMinibuffer): new helper function
790 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
792 * src/lyxfunc.C (Dispatch): calling new Document-Layout
794 * lib/ui/default.ui: commented out PaperLayout entry
796 * src/frontends/xforms/form_document.[Ch]: new added files
798 * src/frontends/xforms/FormDocument.[Ch]: ditto
800 * src/frontends/xforms/forms/form_document.fd: ditto
802 * src/frontends/xforms/forms/form_document.C.patch: ditto
804 2000-08-10 Juergen Vigna <jug@sad.it>
806 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
807 (InsetGraphics): initialized cacheHandle to 0.
808 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
810 2000-08-10 Baruch Even <baruch.even@writeme.com>
812 * src/graphics/GraphicsCache.h:
813 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
814 correctly as a cache.
816 * src/graphics/GraphicsCacheItem.h:
817 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
820 * src/graphics/GraphicsCacheItem_pimpl.h:
821 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
824 * src/insets/insetgraphics.h:
825 * src/insets/insetgraphics.C: Changed from using a signal notification
826 to polling when image is not loaded.
828 2000-08-10 Allan Rae <rae@lyx.org>
830 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
831 that there are two functions that have to been taken out of line by
832 hand and aren't taken care of in the script. (Just a reminder note)
834 * sigc++/macros/*.h.m4: Updated as above.
836 2000-08-09 Juergen Vigna <jug@sad.it>
838 * src/insets/insettext.C (draw): small fix for clearing rectangle.
840 * src/insets/insettabular.C: make drawing of single cell smarter.
842 2000-08-09 Marko Vendelin <markov@ioc.ee>
843 * src/frontends/gnome/Menubar_pimpl.C
844 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
845 implementation: new files
847 * src/frontends/gnome/mainapp.C
848 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
851 * src/main.C: create Gnome main window
853 * src/frontends/xforms/Menubar_pimpl.h
854 * src/frontends/Menubar.C
855 * src/frontends/Menubar.h: added method Menubar::update that calls
856 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
858 * src/LyXView.C: calls Menubar::update to update the state
861 * src/frontends/gnome/Makefile.am: added new files
863 * src/frontends/Makefile.am: added frontend compiler options
865 2000-08-08 Juergen Vigna <jug@sad.it>
867 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
869 * src/bufferlist.C (close):
870 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
871 documents if exiting without saving.
873 * src/buffer.C (save): use removeAutosaveFile()
875 * src/support/filetools.C (removeAutosaveFile): new function.
877 * src/lyx_cb.C (MenuWrite): returns a bool now.
878 (MenuWriteAs): check if file could really be saved and revert to the
880 (MenuWriteAs): removing old autosavefile if existant.
882 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
883 before Goto toggle declaration, because of compiler warning.
885 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
887 * src/lyxfunc.C (MenuNew): small fix.
889 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
891 * src/bufferlist.C (newFile):
892 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
894 * src/lyxrc.C: added new_ask_filename tag
896 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
898 * src/lyx.fd: removed code pertaining to form_ref
899 * src/lyx.[Ch]: ditto
900 * src/lyx_cb.C: ditto
901 * src/lyx_gui.C: ditto
902 * src/lyx_gui_misc.C: ditto
904 * src/BufferView_pimpl.C (restorePosition): update buffer only
907 * src/commandtags.h (LFUN_REFTOGGLE): removed
908 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
909 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
910 (LFUN_REFBACK): renamed LFUN_REF_BACK
912 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
914 * src/lyxfunc.C (Dispatch): ditto.
915 InsertRef dialog is now GUI-independent.
917 * src/texrow.C: added using std::endl;
919 * src/insets/insetref.[Ch]: strip out large amounts of code.
920 The inset is now a container and this functionality is now
921 managed by a new FormRef dialog
923 * src/frontends/Dialogs.h (showRef, createRef): new signals
925 * src/frontends/xforms/FormIndex.[Ch],
926 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
927 when setting dialog's min/max size
928 * src/frontends/xforms/FormIndex.[Ch]: ditto
930 * src/frontends/xforms/FormRef.[Ch],
931 src/frontends/xforms/forms/form_ref.fd: new xforms
932 implementation of an InsetRef dialog
934 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
937 * src/graphics/XPM_Renderer.C (isImageFormatOK):
938 ios::nocreate is not part of the standard. Removed.
940 2000-08-07 Baruch Even <baruch.even@writeme.com>
942 * src/graphics/Renderer.h:
943 * src/graphics/Renderer.C: Added base class for rendering of different
944 image formats into Pixmaps.
946 * src/graphics/XPM_Renderer.h:
947 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
948 in a different class.
950 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
951 easily add support for other formats.
953 * src/insets/figinset.C: plugged a leak of an X resource.
955 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
957 * src/CutAndPaste.[Ch]: make all metods static.
959 * development/Code_rules/Rules: more work, added section on
960 Exceptions, and a References section.
962 * a lot of header files: work to make doc++ able to generate the
963 source documentation, some workarounds of doc++ problems. Doc++ is
964 now able to generate the documentation.
966 2000-08-07 Juergen Vigna <jug@sad.it>
968 * src/insets/insettabular.C (recomputeTextInsets): removed function
970 * src/tabular.C (SetWidthOfMulticolCell):
972 (calculate_width_of_column_NMC): fixed return value so that it really
973 only returns true if the column-width has changed (there where
974 problems with muliticolumn-cells in this column).
976 2000-08-04 Juergen Vigna <jug@sad.it>
978 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
979 also on the scrollstatus of the inset.
980 (workAreaMotionNotify): ditto.
982 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
984 2000-08-01 Juergen Vigna <jug@sad.it>
986 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
989 * src/LyXAction.C (init):
990 * src/insets/inset.C (LocalDispatch): added support for
993 * src/insets/inset.C (scroll): new functions.
995 * src/insets/insettext.C (removeNewlines): new function.
996 (SetAutoBreakRows): removes forced newlines in the text of the
997 paragraph if autoBreakRows is set to false.
999 * src/tabular.C (Latex): generates a parbox around the cell contents
1002 * src/frontends/xforms/FormTabular.C (local_update): removed
1003 the radio_useparbox button.
1005 * src/tabular.C (UseParbox): new function
1007 2000-08-06 Baruch Even <baruch.even@writeme.com>
1009 * src/graphics/GraphicsCache.h:
1010 * src/graphics/GraphicsCache.C:
1011 * src/graphics/GraphicsCacheItem.h:
1012 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1015 * src/insets/insetgraphics.h:
1016 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1017 drawing of the inline image.
1019 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1020 into the wrong position.
1022 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1025 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1027 * src/support/translator.h: move all typedefs to public section
1029 * src/support/filetools.C (MakeLatexName): return string const
1031 (TmpFileName): ditto
1032 (FileOpenSearch): ditto
1034 (LibFileSearch): ditto
1035 (i18nLibFileSearch): ditto
1038 (CreateTmpDir): ditto
1039 (CreateBufferTmpDir): ditto
1040 (CreateLyXTmpDir): ditto
1043 (MakeAbsPath): ditto
1045 (OnlyFilename): ditto
1047 (NormalizePath): ditto
1048 (CleanupPath): ditto
1049 (GetFileContents): ditto
1050 (ReplaceEnvironmentPath): ditto
1051 (MakeRelPath): ditto
1053 (ChangeExtension): ditto
1054 (MakeDisplayPath): ditto
1055 (do_popen): return cmdret const
1056 (findtexfile): return string const
1058 * src/support/DebugStream.h: add some /// to please doc++
1060 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1062 * src/texrow.C (same_rownumber): functor to use with find_if
1063 (getIdFromRow): rewritten to use find_if and to not update the
1064 positions. return true if row is found
1065 (increasePos): new method, use to update positions
1067 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1069 * src/lyxlex_pimpl.C (verifyTable): new method
1072 (GetString): return string const
1073 (pushTable): rewrite to use std::stack
1075 (setFile): better check
1078 * src/lyxlex.h: make LyXLex noncopyable
1080 * src/lyxlex.C (text): return char const * const
1081 (GetString): return string const
1082 (getLongString): return string const
1084 * src/lyx_gui_misc.C (askForText): return pair<...> const
1086 * src/lastfiles.[Ch] (operator): return string const
1088 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1089 istringstream not char const *.
1090 move token.end() out of loop.
1091 (readFile): move initializaton of token
1093 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1094 getIdFromRow is successful.
1096 * lib/bind/emacs.bind: don't include menus bind
1098 * development/Code_rules/Rules: the beginnings of making this
1099 better and covering more of the unwritten rules that we have.
1101 * development/Code_rules/Recommendations: a couple of wording
1104 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1106 * src/support/strerror.c: remove C++ comment.
1108 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1110 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1111 LFUN_INDEX_INSERT_LAST
1113 * src/texrow.C (getIdFromRow): changed from const_iterator to
1114 iterator, allowing code to compile with DEC cxx
1116 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1117 stores part of the class, as suggested by Allan. Will allow
1119 (apply): test to apply uses InsetCommandParams operator!=
1121 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1122 (apply): test to apply uses InsetCommandParams operator!=
1124 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1125 stores part of the class.
1126 (update): removed limits on min/max size.
1128 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1129 (apply): test to apply uses InsetCommandParams operator!=
1131 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1132 (Read, Write, scanCommand, getCommand): moved functionality
1133 into InsetCommandParams.
1135 (getScreenLabel): made pure virtual
1136 new InsetCommandParams operators== and !=
1138 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1139 c-tors based on InsetCommandParams. Removed others.
1140 * src/insets/insetinclude.[Ch]: ditto
1141 * src/insets/insetlabel.[Ch]: ditto
1142 * src/insets/insetparent.[Ch]: ditto
1143 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1145 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1146 insets derived from InsetCommand created using similar c-tors
1147 based on InsetCommandParams
1148 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1149 * src/menus.C (ShowRefsMenu): ditto
1150 * src/paragraph.C (Clone): ditto
1151 * src/text2.C (SetCounter): ditto
1152 * src/lyxfunc.C (Dispatch) ditto
1153 Also recreated old InsetIndex behaviour exactly. Can now
1154 index-insert at the start of a paragraph and index-insert-last
1155 without launching the pop-up.
1157 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1159 * lib/lyxrc.example: mark te pdf options as non functional.
1161 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1162 (isStrDbl): move tmpstr.end() out of loop.
1163 (strToDbl): move intialization of tmpstr
1164 (lowercase): return string const and move tmp.end() out of loop.
1165 (uppercase): return string const and move tmp.edn() out of loop.
1166 (prefixIs): add assertion
1171 (containsOnly): ditto
1172 (containsOnly): ditto
1173 (containsOnly): ditto
1174 (countChar): make last arg char not char const
1175 (token): return string const
1176 (subst): return string const, move tmp.end() out of loop.
1177 (subst): return string const, add assertion
1178 (strip): return string const
1179 (frontStrip): return string const, add assertion
1180 (frontStrip): return string const
1185 * src/support/lstrings.C: add inclde "LAssert.h"
1186 (isStrInt): move tmpstr.end() out of loop.
1188 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1189 toollist.end() out of loop.
1190 (deactivate): move toollist.end() out of loop.
1191 (update): move toollist.end() out of loop.
1192 (updateLayoutList): move tc.end() out of loop.
1193 (add): move toollist.end() out of loop.
1195 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1196 md.end() out of loop.
1198 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1200 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1203 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1204 (Erase): move insetlist.end() out of loop.
1206 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1207 ref to const string as first arg. Move initialization of some
1208 variables, whitespace changes.
1210 * src/kbmap.C (defkey): move table.end() out of loop.
1211 (kb_keymap): move table.end() out of loop.
1212 (findbinding): move table.end() out of loop.
1214 * src/MenuBackend.C (hasMenu): move end() out of loop.
1215 (getMenu): move end() out of loop.
1216 (getMenu): move menulist_.end() out of loop.
1218 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1220 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1223 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1224 (getFromLyXName): move infotab.end() out of loop.
1226 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1227 -fvtable-thunks -ffunction-sections -fdata-sections
1229 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1231 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1234 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1236 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1238 * src/frontends/xforms/FormCitation.[Ch],
1239 src/frontends/xforms/FormIndex.[Ch],
1240 src/frontends/xforms/FormToc.[Ch],
1241 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1243 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1245 * src/commandtags.h: renamed, created some flags for citation
1248 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1250 * src/lyxfunc.C (dispatch): use signals to insert index entry
1252 * src/frontends/Dialogs.h: new signal createIndex
1254 * src/frontends/xforms/FormCommand.[Ch],
1255 src/frontends/xforms/FormCitation.[Ch],
1256 src/frontends/xforms/FormToc.[Ch],
1257 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1259 * src/insets/insetindex.[Ch]: GUI-independent
1261 * src/frontends/xforms/FormIndex.[Ch],
1262 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1265 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1267 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1268 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1270 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1272 * src/insets/insetref.C (Latex): rewrite so that there is now
1273 question that a initialization is requested.
1275 * src/insets/insetcommand.h: reenable the hide signal
1277 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1279 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1280 fix handling of shortcuts (many bugs :)
1281 (add_lastfiles): ditto.
1283 * lib/ui/default.ui: fix a few shortcuts.
1285 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1287 * Makefile.am: Fix ``rpmdist'' target to return the exit
1288 status of the ``rpm'' command, instead of the last command in
1289 the chain (the ``rm lyx.xpm'' command, which always returns
1292 2000-08-02 Allan Rae <rae@lyx.org>
1294 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1295 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1296 * src/frontends/xforms/FormToc.C (FormToc): ditto
1298 * src/frontends/xforms/Makefile.am: A few forgotten files
1300 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1301 Signals-not-copyable-problem Lars' started commenting out.
1303 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1305 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1307 * src/insets/insetcommand.h: Signals is not copyable so anoter
1308 scheme for automatic hiding of forms must be used.
1310 * src/frontends/xforms/FormCitation.h: don't inerit from
1311 noncopyable, FormCommand already does that.
1312 * src/frontends/xforms/FormToc.h: ditto
1313 * src/frontends/xforms/FormUrl.h: ditto
1315 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1317 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1319 * src/insets/insetcommand.h (hide): new SigC::Signal0
1320 (d-tor) new virtual destructor emits hide signal
1322 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1323 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1325 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1326 LOF and LOT. Inset is now GUI-independent
1328 * src/insets/insetloa.[Ch]: redundant
1329 * src/insets/insetlof.[Ch]: ditto
1330 * src/insets/insetlot.[Ch]: ditto
1332 * src/frontends/xforms/forms/form_url.fd: tweaked!
1333 * src/frontends/xforms/forms/form_citation.fd: ditto
1335 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1336 dialogs dealing with InsetCommand insets
1338 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1339 FormCommand base class
1340 * src/frontends/xforms/FormUrl.[Ch]: ditto
1342 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1344 * src/frontends/xforms/FormToc.[Ch]: ditto
1346 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1347 passed a generic InsetCommand pointer
1348 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1350 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1351 and modified InsetTOC class
1352 * src/buffer.C: ditto
1354 * forms/lyx.fd: strip out old FD_form_toc code
1355 * src/lyx_gui_misc.C: ditto
1356 * src/lyx_gui.C: ditto
1357 * src/lyx_cb.C: ditto
1358 * src/lyx.[Ch]: ditto
1360 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1362 * src/support/utility.hpp: tr -d '\r'
1364 2000-08-01 Juergen Vigna <jug@sad.it>
1366 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1368 * src/commandtags.h:
1369 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1370 LFUN_TABULAR_FEATURES.
1372 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1373 LFUN_LAYOUT_TABULAR.
1375 * src/insets/insettabular.C (getStatus): implemented helper function.
1377 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1379 2000-07-31 Juergen Vigna <jug@sad.it>
1381 * src/text.C (draw): fixed screen update problem for text-insets.
1383 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1384 something changed probably this has to be added in various other
1387 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1389 2000-07-31 Baruch Even <baruch.even@writeme.com>
1391 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1392 templates to satisfy compaq cxx.
1395 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1397 * src/support/translator.h (equal_1st_in_pair::operator()): take
1398 const ref pair_type as arg.
1399 (equal_2nd_in_pair::operator()): ditto
1400 (Translator::~Translator): remove empty d-tor.
1402 * src/graphics/GraphicsCache.C: move include config.h to top, also
1403 put initialization of GraphicsCache::singleton here.
1404 (~GraphicsCache): move here
1405 (addFile): take const ref as arg
1408 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1410 * src/BufferView2.C (insertLyXFile): change te with/without header
1413 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1415 * src/frontends/xforms/FormGraphics.C (apply): add some
1416 static_cast. Not very nice, but required by compaq cxx.
1418 * src/frontends/xforms/RadioButtonGroup.h: include header
1419 <utility> instead of <pair.h>
1421 * src/insets/insetgraphicsParams.C: add using directive.
1422 (readResize): change return type to void.
1423 (readOrigin): ditto.
1425 * src/lyxfunc.C (getStatus): add missing break for build-program
1426 function; add test for Literate for export functions.
1428 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1429 entries in Options menu.
1431 2000-07-31 Baruch Even <baruch.even@writeme.com>
1433 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1434 protect against auto-allocation; release icon when needed.
1436 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1438 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1439 on usual typewriter.
1441 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1442 earlier czech.kmap), useful only for programming.
1444 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1446 * src/frontends/xforms/FormCitation.h: fix conditioning around
1449 2000-07-31 Juergen Vigna <jug@sad.it>
1451 * src/frontends/xforms/FormTabular.C (local_update): changed
1452 radio_linebreaks to radio_useparbox and added radio_useminipage.
1454 * src/tabular.C: made support for using minipages/parboxes.
1456 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1458 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1460 (descent): so the cursor is in the middle.
1461 (width): bit smaller box.
1463 * src/insets/insetgraphics.h: added display() function.
1465 2000-07-31 Baruch Even <baruch.even@writeme.com>
1467 * src/frontends/Dialogs.h: Added showGraphics signals.
1469 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1470 xforms form definition of the graphics dialog.
1472 * src/frontends/xforms/FormGraphics.h:
1473 * src/frontends/xforms/FormGraphics.C: Added files, the
1474 GUIndependent code of InsetGraphics
1476 * src/insets/insetgraphics.h:
1477 * src/insets/insetgraphics.C: Major writing to make it work.
1479 * src/insets/insetgraphicsParams.h:
1480 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1481 struct between InsetGraphics and GUI.
1483 * src/LaTeXFeatures.h:
1484 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1485 support for graphicx package.
1487 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1488 for the graphics inset.
1490 * src/support/translator.h: Added file, used in
1491 InsetGraphicsParams. this is a template to translate between two
1494 * src/frontends/xforms/RadioButtonGroup.h:
1495 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
1496 way to easily control a radio button group.
1498 2000-07-28 Juergen Vigna <jug@sad.it>
1500 * src/insets/insettabular.C (LocalDispatch):
1501 (TabularFeatures): added support for lyx-functions of tabular features.
1502 (cellstart): refixed this function after someone wrongly changed it.
1504 * src/commandtags.h:
1505 * src/LyXAction.C (init): added support for tabular-features
1507 2000-07-28 Allan Rae <rae@lyx.org>
1509 * src/frontends/xforms/FormPreferences.C (build): Setup input return
1510 checking. NOTE: It seems that pressing ESC to cancel the dialog also
1511 triggers the callback for input checking. As a result we sometimes get
1512 "LyX: This shouldn't happen..." printed to cerr.
1513 (input): Started using status variable since I only free() on
1514 destruction. Some input checking for paths and font sizes.
1516 * src/frontends/xforms/FormPreferences.h: Use status to control
1517 activation of Ok and Apply
1519 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
1520 callback. Also resized to stop segfaults with 0.88. The problem is
1521 that xforms-0.88 requires the folder to be wide enough to fit all the
1522 tabs. If it isn't it causes all sorts of problems.
1524 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
1526 * src/frontends/xforms/forms/README: Reflect reality.
1528 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
1529 * src/frontends/xforms/forms/makefile: ditto.
1531 * src/commandtags.h: Get access to new Preferences dialog
1532 * src/LyXAction.C: ditto
1533 * src/lyxfunc.C: ditto
1534 * lib/ui/default.ui: ditto
1536 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1538 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
1540 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
1543 * src/frontends/xforms/form_url.[Ch]: added.
1545 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1547 * src/insets/insetbib.h: fixed bug in previous commit
1549 * src/frontends/xforms/FormUrl.h: ditto
1551 * src/frontends/xforms/FormPrint.h: ditto
1553 * src/frontends/xforms/FormPreferences.h: ditto
1555 * src/frontends/xforms/FormCopyright.h: ditto
1557 * src/frontends/xforms/FormCitation.C: ditto
1559 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
1560 private copyconstructor and private default contructor
1562 * src/support/Makefile.am: add utility.hpp
1564 * src/support/utility.hpp: new file from boost
1566 * src/insets/insetbib.h: set owner in clone
1568 * src/frontends/xforms/FormCitation.C: added missing include
1571 * src/insets/form_url.[Ch]: removed
1573 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
1575 * development/lyx.spec.in
1576 * Makefile.am: Fix buglet for LyX RPM generation resulting from
1577 file/directory re-organization.
1579 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
1581 * src/insets/insetcommand.[Ch]: moved the string data and
1582 associated manipulation methods into a new stand-alone class
1583 InsetCommandParams. This class has two additional methods
1584 getAsString() and setFromString() allowing the contents to be
1585 moved around as a single string.
1586 (addContents) method removed.
1587 (setContents) method no longer virtual.
1589 * src/buffer.C (readInset): made use of new InsetCitation,
1590 InsetUrl constructors based on InsetCommandParams.
1592 * src/commandtags.h: add LFUN_INSERT_URL
1594 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
1595 independent InsetUrl and use InsetCommandParams to extract
1596 string info and create new Insets.
1598 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
1600 * src/frontends/xforms/FormCitation.C (apply): uses
1603 * src/frontends/xforms/form_url.C
1604 * src/frontends/xforms/form_url.h
1605 * src/frontends/xforms/FormUrl.h
1606 * src/frontends/xforms/FormUrl.C
1607 * src/frontends/xforms/forms/form_url.fd: new files
1609 * src/insets/insetcite.[Ch]: removed unused constructors.
1611 * src/insets/insetinclude.[Ch]: no longer store filename
1613 * src/insets/inseturl.[Ch]: GUI-independent.
1615 2000-07-26 Juergen Vigna <jug@sad.it>
1616 * renamed frontend from gtk to gnome as it is that what is realized
1617 and did the necessary changes in the files.
1619 2000-07-26 Marko Vendelin <markov@ioc.ee>
1621 * configure.in: cleaning up gnome configuration scripts
1623 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1625 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
1626 shortcuts syndrom by redrawing them explicitely (a better solution
1627 would be appreciated).
1629 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
1631 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
1634 * src/lyx_cb.C (MenuExport): change html export to do the right
1635 thing depending of the document type (instead of having
1636 html-linuxdoc and html-docbook).
1637 * src/lyxfunc.C (getStatus): update for html
1638 * lib/ui/default.ui: simplify due to the above change.
1639 * src/menus.C (ShowFileMenu): update too (in case we need it).
1641 * src/MenuBackend.C (read): if a menu is defined twice, add the
1642 new entries to the exiting one.
1644 2000-07-26 Juergen Vigna <jug@sad.it>
1646 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
1648 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
1649 and return a bool if it did actual save the file.
1650 (AutoSave): don't autosave a unnamed doc.
1652 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
1653 check if this is an UNNAMED new file and react to it.
1654 (newFile): set buffer to unnamed and change to not mark a new
1655 buffer dirty if I didn't do anything with it.
1657 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
1659 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1661 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
1662 friend as per Angus's patch posted to lyx-devel.
1664 * src/ext_l10n.h: updated
1666 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
1667 gettext on the style string right before inserting them into the
1670 * autogen.sh: add code to extract style strings form layout files,
1671 not good enough yet.
1673 * src/frontends/gtk/.cvsignore: add MAKEFILE
1675 * src/MenuBackend.C (read): run the label strings through gettext
1676 before storing them in the containers.
1678 * src/ext_l10n.h: new file
1680 * autogen.sh : generate the ext_l10n.h file here
1682 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1684 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
1687 * lib/ui/default.ui: fix a couple of typos.
1689 * config/gnome/gtk.m4: added (and added to the list of files in
1692 * src/insets/insetinclude.C (unique_id): fix when we are using
1693 lyxstring instead of basic_string<>.
1694 * src/insets/insettext.C (LocalDispatch): ditto.
1695 * src/support/filetools.C: ditto.
1697 * lib/configure.m4: create the ui/ directory if necessary.
1699 * src/LyXView.[Ch] (updateToolbar): new method.
1701 * src/BufferView_pimpl.C (buffer): update the toolbar when
1702 opening/closing buffer.
1704 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1706 * src/LyXAction.C (getActionName): enhance to return also the name
1707 and options of pseudo-actions.
1708 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
1710 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
1711 as an example of what is possible). Used in File->Build too (more
1712 useful) and in the import/export menus (to mimick the complicated
1713 handling of linuxdoc and friends). Try to update all the entries.
1715 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
1718 * src/MenuBackend.C (read): Parse the new OptItem tag.
1720 * src/MenuBackend.h: Add a new optional_ data member (used if the
1721 entry should be omitted when the lyxfunc is disabled).
1723 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
1724 function, used as a shortcut.
1725 (create_submenu): align correctly the shortcuts on the widest
1728 * src/MenuBackend.h: MenuItem.label() only returns the label of
1729 the menu without shortcut; new method shortcut().
1731 2000-07-14 Marko Vendelin <markov@ioc.ee>
1733 * src/frontends/gtk/Dialogs.C:
1734 * src/frontends/gtk/FormCopyright.C:
1735 * src/frontends/gtk/FormCopyright.h:
1736 * src/frontends/gtk/Makefile.am: added these source-files for the
1737 Gtk/Gnome support of the Copyright-Dialog.
1739 * src/main.C: added Gnome::Main initialization if using
1740 Gtk/Gnome frontend-GUI.
1742 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
1744 * config/gnome/aclocal-include.m4
1745 * config/gnome/compiler-flags.m4
1746 * config/gnome/curses.m4
1747 * config/gnome/gnome--.m4
1748 * config/gnome/gnome-bonobo-check.m4
1749 * config/gnome/gnome-common.m4
1750 * config/gnome/gnome-fileutils.m4
1751 * config/gnome/gnome-ghttp-check.m4
1752 * config/gnome/gnome-gnorba-check.m4
1753 * config/gnome/gnome-guile-checks.m4
1754 * config/gnome/gnome-libgtop-check.m4
1755 * config/gnome/gnome-objc-checks.m4
1756 * config/gnome/gnome-orbit-check.m4
1757 * config/gnome/gnome-print-check.m4
1758 * config/gnome/gnome-pthread-check.m4
1759 * config/gnome/gnome-support.m4
1760 * config/gnome/gnome-undelfs.m4
1761 * config/gnome/gnome-vfs.m4
1762 * config/gnome/gnome-x-checks.m4
1763 * config/gnome/gnome-xml-check.m4
1764 * config/gnome/gnome.m4
1765 * config/gnome/gperf-check.m4
1766 * config/gnome/gtk--.m4
1767 * config/gnome/linger.m4
1768 * config/gnome/need-declaration.m4: added configuration scripts
1769 for Gtk/Gnome frontend-GUI
1771 * configure.in: added support for the --with-frontend=gtk option
1773 * autogen.sh: added config/gnome/* to list of config-files
1775 * acconfig.h: added define for GTKGUI-support
1777 * config/lyxinclude.m4: added --with-frontend[=value] option value
1778 for Gtk/Gnome frontend-GUI support.
1780 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
1782 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
1786 * src/paragraph.C (GetChar): remove non-const version
1788 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
1789 (search_kw): use it.
1791 * src/lyx_main.C (init): if "preferences" exist, read that instead
1793 (ReadRcFile): return bool if the file could be read ok.
1794 (ReadUIFile): add a check to see if lex file is set ok.
1796 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
1797 bastring can be used instead of lyxstring (still uses the old code
1798 if std::string is good enough or if lyxstring is used.)
1800 * src/encoding.C: make the arrays static, move ininle functions
1802 * src/encoding.h: from here.
1804 * src/buffer.C: have last_isnet_read as a file scope variable for now.
1805 (parseSingleLyXformat2Token): move inset parsing to separate method
1806 (readInset): new private method
1808 * src/Variables.h: remove virtual from get().
1810 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
1811 access to NEW_INSETS and NEW_TABULAR
1813 * src/MenuBackend.h: remove superfluous forward declaration of
1814 MenuItem. Add documentations tags "///", remove empty MenuItem
1815 destructor, remove private default contructor.
1817 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
1819 (read): more string mlabel and mname to where they are used
1820 (read): remove unused variables mlabel and mname
1821 (defaults): unconditional clear, make menusetup take advantage of
1822 add returning Menu &.
1824 * src/LyXView.h: define NEW_MENUBAR as default
1826 * src/LyXAction.C: include lyxparagraph.h temporary to get access
1827 to NEW_INSETS and NEW_TABULAR.
1828 (init): commetn out some funcs that is obsolete when NEW_INSETS is
1829 defined. Change some of the "xxxx-inset-insert" functions names to
1832 * several files: more enahncements to NEW_INSETS and the resulting
1835 * lib/lyxrc.example (\date_insert_format): move to misc section
1837 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
1838 bastring and use AC_CACHE_CHECK.
1839 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
1840 the system have the newest methods. uses AC_CACHE_CHECK
1841 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
1842 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
1843 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
1845 * configure.in: add LYX_CXX_GOOD_STD_STRING
1847 * acinclude.m4: recreated
1849 2000-07-24 Amir Karger
1851 * README: add Hebrew, Arabic kmaps
1854 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1856 * src/buffer.C (writeFileAscii): Define actcell as an int instead
1859 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1861 * Lot of files: add pragma interface/implementation.
1863 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
1865 * lib/ui/default.ui: new file (ans new directory). Contains the
1866 default menu and toolbar.
1868 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
1869 global space. Toolbars are now read (as menus) in ui files.
1871 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
1873 * src/lyxfunc.C (getStatus): do not exit immediately if a command
1874 is disabled because the document is read-only. We want to have the
1875 toggle state of the function anyway.
1876 (getStatus): add code for LFUN_VC* functions (mimicking what is
1877 done in old-style menus)
1879 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
1880 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
1882 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
1883 * src/BufferView_pimpl.C: ditto.
1884 * src/lyxfunc.C: ditto.
1886 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
1887 default). This replaces old-style menus by new ones.
1889 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
1890 MenuItem. Contain the data structure of a menu.
1892 * src/insets/insettext.C: use LyXView::setLayout instead of
1893 accessing directly the toolbar combox.
1894 * src/lyxfunc.C (Dispatch): ditto.
1896 * src/LyXView.C (setLayout): new method, which just calls
1897 Toolbar::setLayout().
1898 (updateLayoutChoice): move part of this method in Toolbar.
1900 * src/toolbar.[Ch]: removed.
1902 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
1903 implementation the toolbar.
1905 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
1906 the toolbar. It might make sense to merge it with ToolbarDefaults
1908 (setLayout): new function.
1909 (updateLayoutList): ditto.
1910 (openLayoutList): ditto.
1912 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
1913 xforms implementation of the toolbar.
1914 (get_toolbar_func): comment out, since I do not
1915 know what it is good for.
1917 * src/ToolbarDefaults.h: Add the ItemType enum.
1919 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
1920 for a list of allocated C strings. Used in Menubar xforms
1921 implementation to avoid memory leaks.
1923 * src/support/lstrings.[Ch] (uppercase): new version taking and
1927 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
1928 * lib/bind/emacs.bind: ditto.
1930 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
1932 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
1933 forward decl of LyXView.
1935 * src/toolbar.C (toolbarItem): moved from toolbar.h
1936 (toolbarItem::clean): ditto
1937 (toolbarItem::~toolbarItem): ditto
1938 (toolbarItem::operator): ditto
1940 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
1942 * src/paragraph.h: control the NEW_TABULAR define from here
1944 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
1945 USE_TABULAR_INSETS to NEW_TABULAR
1947 * src/ToolbarDefaults.C: add include "lyxlex.h"
1949 * files using the old table/tabular: use NEW_TABULAR to control
1950 compilation of old tabular stuff.
1952 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
1955 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
1956 planemet in reading of old style floats, fix the \end_deeper
1957 problem when reading old style floats.
1959 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1961 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
1963 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
1965 * lib/bind/sciword.bind: updated.
1967 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1969 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
1970 layout write problem
1972 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1974 * src/Makefile.am (INCLUDES): remove image directory from include
1977 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
1978 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
1980 * src/LyXView.C (create_form_form_main): read the application icon
1983 * lib/images/*.xpm: change the icons to use transparent color for
1986 * src/toolbar.C (update): change the color of the button when it
1989 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1991 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
1992 setting explicitely the minibuffer.
1993 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
1995 * src/LyXView.C (showState): new function. Shows font information
1996 in minibuffer and update toolbar state.
1997 (LyXView): call Toolbar::update after creating the
2000 * src/toolbar.C: change toollist to be a vector instead of a
2002 (BubbleTimerCB): get help string directly from the callback
2003 argument of the corresponding icon (which is the action)
2004 (set): remove unnecessary ugliness.
2005 (update): new function. update the icons (depressed, disabled)
2006 depending of the status of the corresponding action.
2008 * src/toolbar.h: remove help in toolbarItem
2010 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2012 * src/Painter.C (text): Added code for using symbol glyphs from
2013 iso10646 fonts. Currently diabled.
2015 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2018 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2019 magyar,turkish and usorbian.
2021 * src/paragraph.C (isMultiLingual): Made more efficient.
2023 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2026 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2027 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2028 Also changed the prototype to "bool math_insert_greek(char)".
2030 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2032 * lots of files: apply the NEW_INSETS on all code that will not be
2033 needed when we move to use the new insets. Enable the define in
2034 lyxparagrah.h to try it.
2036 * src/insets/insettabular.C (cellstart): change to be a static
2038 (InsetTabular): initialize buffer in the initializer list.
2040 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2042 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2043 form_print.h out of the header file. Replaced with forward
2044 declarations of the relevant struct.
2046 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2049 * src/commandtags.h: do not include "debug.h" which does not
2050 belong there. #include it in some other places because of this
2053 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2055 * src/insets/insetcaption.C: add a couple "using" directives.
2057 * src/toolbar.C (add): get the help text directly from lyxaction.
2059 (setPixmap): new function. Loads from disk and sets a pixmap on a
2060 botton; the name of the pixmap file is derived from the command
2063 * src/toolbar.h: remove members isBitmap and pixmap from
2066 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2067 * lib/images/: move many files from images/banner.xpm.
2069 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2071 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2072 * src/toolbar.C: ditto.
2073 * configure.in: ditto.
2074 * INSTALL: document.
2076 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2077 the spellchecker popup is closed from the WM.
2079 2000-07-19 Juergen Vigna <jug@sad.it>
2081 * src/insets/insetfloat.C (Write): small fix because we use the
2082 insetname for the type now!
2084 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2086 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2089 * src/frontends/Dialogs.h: removed hideCitation signal
2091 * src/insets/insetcite.h: added hide signal
2093 * src/insets/insetcite.C (~InsetCitation): emits new signal
2094 (getScreenLabel): "intelligent" label should now fit on the screen!
2096 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2098 * src/frontends/xforms/FormCitation.C (showInset): connects
2099 hide() to the inset's hide signal
2100 (show): modified to use fl_set_object_position rather than
2101 fl_set_object_geometry wherever possible
2103 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2105 * src/insets/lyxinset.h: add caption code
2107 * src/insets/insetfloat.C (type): new method
2109 * src/insets/insetcaption.C (Write): new method
2111 (LyxCode): new method
2113 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2114 to get it right together with using the FloatList.
2116 * src/commandtags.h: add LFUN_INSET_CAPTION
2117 * src/lyxfunc.C (Dispatch): handle it
2119 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2122 * src/Variables.[Ch]: make expand take a const reference, remove
2123 the destructor, some whitespace changes.
2125 * src/LyXAction.C (init): add caption-inset-insert
2127 * src/FloatList.C (FloatList): update the default floats a bit.
2129 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2131 * src/Variables.[Ch]: new files. Intended to be used for language
2132 specific strings (like \chaptername) and filename substitution in
2135 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2137 * lib/kbd/american.kmap: update
2139 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2141 * src/bufferparams.[Ch]: remove member allowAccents.
2143 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2145 * src/LaTeXLog.C: use the log_form.h header.
2146 * src/lyx_gui.C: ditto.
2147 * src/lyx_gui_misc.C: ditto.
2148 * src/lyxvc.h: ditto.
2150 * forms/log_form.fd: new file, created from latexoptions.fd. I
2151 kept the log popup and nuked the options form.
2153 * src/{la,}texoptions.[Ch]: removed.
2154 * src/lyx_cb.C (LaTeXOptions): ditto
2156 * src/lyx_gui.C (create_forms): do not handle the
2157 fd_latex_options form.
2159 2000-07-18 Juergen Vigna <jug@sad.it>
2161 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2162 name of the inset so that it can be requested outside (text2.C).
2164 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2167 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2169 * src/mathed/formula.h (ConvertFont): constify
2171 * src/mathed/formula.C (Read): add warning if \end_inset is not
2172 found on expected place.
2174 * src/insets/lyxinset.h (ConvertFont): consify
2176 * src/insets/insetquotes.C (ConvertFont): constify
2177 * src/insets/insetquotes.h: ditto
2179 * src/insets/insetinfo.h: add labelfont
2181 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2182 (ascent): use labelfont
2186 (Write): make .lyx file a bit nicer
2188 * src/insets/insetfloat.C (Write): simplify somewhat...
2189 (Read): add warning if arg is not found
2191 * src/insets/insetcollapsable.C: add using std::max
2192 (Read): move string token and add warning in arg is not found
2193 (draw): use std::max to get the right ty
2194 (getMaxWidth): simplify by using std::max
2196 * src/insets/insetsection.h: new file
2197 * src/insets/insetsection.C: new file
2198 * src/insets/insetcaption.h: new file
2199 * src/insets/insetcaption.C: new file
2201 * src/insets/inset.C (ConvertFont): constify signature
2203 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2204 insetcaption.[Ch] and insetsection.[Ch]
2206 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2207 uses to use LABEL_COUNTER_CHAPTER instead.
2208 * src/text2.C (SetCounter): here
2210 * src/counters.h: new file
2211 * src/counters.C: new file
2212 * src/Sectioning.h: new file
2213 * src/Sectioning.C: new file
2215 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2217 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2219 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2222 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2225 2000-07-17 Juergen Vigna <jug@sad.it>
2227 * src/tabular.C (Validate): check if array-package is needed.
2228 (SetVAlignment): added support for vertical alignment.
2229 (SetLTFoot): better support for longtable header/footers
2230 (Latex): modified to support added features.
2232 * src/LaTeXFeatures.[Ch]: added array-package.
2234 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2236 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2239 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2241 * configure.in: do not forget to put a space after -isystem.
2243 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2245 * lib/kbd/arabic.kmap: a few fixes.
2247 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2249 * some whitespace chagnes to a number of files.
2251 * src/support/DebugStream.h: change to make it easier for
2252 doc++ to parse correctly.
2253 * src/support/lyxstring.h: ditto
2255 * src/mathed/math_utils.C (compara): change to have only one
2257 (MathedLookupBOP): change because of the above.
2259 * src/mathed/math_delim.C (math_deco_compare): change to have only
2261 (search_deco): change becasue of the above.
2263 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2264 instead of manually coded one.
2266 * src/insets/insetquotes.C (Read): read the \end_inset too
2268 * src/insets/insetlatex.h: remove file
2269 * src/insets/insetlatex.C: remove file
2271 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2273 (InsetPrintIndex): remove destructor
2275 * src/insets/insetinclude.h: remove default constructor
2277 * src/insets/insetfloat.C: work to make it work better
2279 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2281 * src/insets/insetcite.h (InsetCitation): remove default constructor
2283 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2285 * src/text.C (GetColumnNearX): comment out some currently unused code.
2287 * src/paragraph.C (writeFile): move some initializations closer to
2289 (CutIntoMinibuffer): small change to use new matchIT operator
2293 (InsertInset): ditto
2296 (InsetIterator): ditto
2297 (Erase): small change to use new matchFT operator
2299 (GetFontSettings): ditto
2300 (HighestFontInRange): ditto
2303 * src/lyxparagraph.h: some chars changed to value_type
2304 (matchIT): because of some stronger checking (perhaps too strong)
2305 in SGI STL, the two operator() unified to one.
2308 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2310 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2311 the last inset read added
2312 (parseSingleLyXformat2Token): some more (future) compability code added
2313 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2314 (parseSingleLyXformat2Token): set last_inset_read
2315 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2316 (parseSingleLyXformat2Token): don't double intializw string next_token
2318 * src/TextCache.C (text_fits::operator()): add const's to the signature
2319 (has_buffer::operator()): ditto
2321 * src/Floating.h: add some comments on the class
2323 * src/FloatList.[Ch] (typeExist): new method
2326 * src/BackStack.h: added default constructor, wanted by Gcc.
2328 2000-07-14 Juergen Vigna <jug@sad.it>
2330 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2332 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2334 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2335 do a redraw when the window is resized!
2336 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2338 * src/insets/insettext.C (resizeLyXText): added function to correctly
2339 being able to resize the LyXWindow.
2341 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2343 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2345 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2346 crashes when closing dialog to a deleted inset.
2348 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2349 method! Now similar to other insets.
2351 2000-07-13 Juergen Vigna <jug@sad.it>
2353 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2355 * lib/examples/Literate.lyx: small patch!
2357 * src/insets/insetbib.C (Read): added this function because of wrong
2358 Write (without [begin|end]_inset).
2360 2000-07-11 Juergen Vigna <jug@sad.it>
2362 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2363 as the insertInset could not be good!
2365 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2366 the bool param should not be last.
2368 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2370 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2371 did submit that to Karl).
2373 * configure.in: use -isystem instead of -I for X headers. This
2374 fixes a problem on solaris with a recent gcc;
2375 put the front-end code after the X detection code;
2376 configure in sigc++ before lib/
2378 * src/lyx_main.C (commandLineHelp): remove -display from command
2381 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2383 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2384 Also put in Makefile rules for building the ``listerrors''
2385 program for parsing errors from literate programs written in LyX.
2387 * lib/build-listerrors: Added small shell script as part of compile
2388 process. This builds a working ``listerrors'' binary if noweb is
2389 installed and either 1) the VNC X server is installed on the machine,
2390 or 2) the user is compiling from within a GUI. The existence of a GUI
2391 is necessary to use the ``lyx --export'' feature for now. This
2392 hack can be removed once ``lyx --export'' no longer requires a GUI to
2395 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2397 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2398 now passed back correctly from gcc and placed "under" error
2399 buttons in a Literate LyX source.
2401 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2403 * src/text.C (GetColumnNearX): Better behavior when a RTL
2404 paragraph is ended by LTR text.
2406 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2409 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2411 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2412 true when clipboard is empty.
2414 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2416 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2417 row of the paragraph.
2418 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2419 to prevent calculation of bidi tables
2421 2000-07-07 Juergen Vigna <jug@sad.it>
2423 * src/screen.C (ToggleSelection): added y_offset and x_offset
2426 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2429 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2431 * src/insets/insettext.C: fixed Layout-Display!
2433 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2435 * configure.in: add check for strings.h header.
2437 * src/spellchecker.C: include <strings.h> in order to have a
2438 definition for bzero().
2440 2000-07-07 Juergen Vigna <jug@sad.it>
2442 * src/insets/insettext.C (draw): set the status of the bv->text to
2443 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2445 * src/screen.C (DrawOneRow):
2446 (DrawFromTo): redraw the actual row if something has changed in it
2449 * src/text.C (draw): call an update of the toplevel-inset if something
2450 has changed inside while drawing.
2452 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2454 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2456 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2457 processing inside class.
2459 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2460 processing inside class.
2462 * src/insets/insetindex.h new struct Holder, consistent with other
2465 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2466 citation dialog from main code and placed it in src/frontends/xforms.
2467 Dialog launched through signals instead of callbacks
2469 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2471 * lyx.man: update the options description.
2473 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2475 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2476 handle neg values, set min width to 590, add doc about -display
2478 2000-07-05 Juergen Vigna <jug@sad.it>
2480 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2481 calls to BufferView *.
2483 * src/insets/insettext.C (checkAndActivateInset): small fix non
2484 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2486 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2487 their \end_inset token!
2489 2000-07-04 edscott <edscott@imp.mx>
2491 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
2492 lib/lyxrc.example: added option \wheel_jump
2494 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
2496 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
2497 remove support for -width,-height,-xpos and -ypos.
2499 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
2501 * src/encoding.[Ch]: New files.
2503 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
2504 (text): Call to the underline() method only when needed.
2506 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
2508 * src/buffer.C (makeLaTeXFile): Compute automatically the input
2509 encoding(s) for the document.
2511 * src/bufferparams.C (BufferParams): Changed default value of
2514 * src/language.C (newLang): Removed.
2515 (items[]): Added encoding information for all defined languages.
2517 * src/lyx_gui.C (create_forms): Added "auto" option to the input
2518 encoding choice button.
2520 * src/lyxrc.h (font_norm_type): New member variable.
2521 (set_font_norm_type): New method.
2523 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
2524 paragraphs with different encodings.
2526 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
2527 (TransformChar): Changed to work correctly with Arabic points.
2528 (draw): Added support for drawing Arabic points.
2529 (draw): Removed code for drawing underbars (this is done by
2532 * src/support/textutils.h (IsPrintableNonspace): New function.
2534 * src/BufferView_pimpl.h: Added "using SigC::Object".
2535 * src/LyXView.h: ditto.
2537 * src/insets/insetinclude.h (include_label): Changed to mutable.
2539 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
2541 * src/mathed/math_iter.h: remove empty destructor
2543 * src/mathed/math_cursor.h: remove empty destructor
2545 * src/insets/lyxinset.h: add THEOREM_CODE
2547 * src/insets/insettheorem.[Ch]: new files
2549 * src/insets/insetminipage.C: (InsertInset): remove
2551 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
2553 (InsertInset): remove
2555 * src/insets/insetlist.C: (InsertList): remove
2557 * src/insets/insetfootlike.[Ch]: new files
2559 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
2562 (InsertInset): ditto
2564 * src/insets/insetert.C: remove include Painter.h, reindent
2565 (InsertInset): move to header
2567 * src/insets/insetcollapsable.h: remove explicit from default
2568 contructor, remove empty destructor, add InsertInset
2570 * src/insets/insetcollapsable.C (InsertInset): new func
2572 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2574 * src/vspace.h: add explicit to constructor
2576 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
2577 \textcompwordmark, please test this.
2579 * src/lyxrc.C: set ascii_linelen to 65 by default
2581 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
2583 * src/commandtags.h: add LFUN_INSET_THEOREM
2585 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
2586 (makeLinuxDocFile): remove _some_ of the nice logic
2587 (makeDocBookFile): ditto
2589 * src/Painter.[Ch]: (~Painter): removed
2591 * src/LyXAction.C (init): entry for insettheorem added
2593 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
2595 (deplog): code to detect files generated by LaTeX, needs testing
2598 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2600 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
2602 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2604 * src/LaTeX.C (deplog): Add a check for files that are going to be
2605 created by the first latex run, part of the project to remove the
2608 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
2609 contents to the extension list.
2611 2000-07-04 Juergen Vigna <jug@sad.it>
2613 * src/text.C (NextBreakPoint): added support for needFullRow()
2615 * src/insets/lyxinset.h: added needFullRow()
2617 * src/insets/insetcollapsable.C: redone now this uses a text-inset
2620 * src/insets/insettext.C: lots of changes for update!
2622 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
2624 * src/LaTeXFeatures.h: add a missing std:: qualifier.
2626 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
2628 * src/insets/insetinclude.C (InsetInclude): fixed
2629 initialization of include_label.
2630 (unique_id): now returns a string.
2632 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
2634 * src/LaTeXFeatures.h: new member IncludedFiles, for
2635 a map of key, included file name.
2637 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
2638 with the included files for inclusion in SGML preamble,
2639 i. e., linuxdoc and docbook.
2642 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
2643 nice (is the generated linuxdoc code to be exported?), that
2644 allows to remove column, and only_body that will be true for
2645 slave documents. Insets are allowed inside SGML font type.
2646 New handling of the SGML preamble for included files.
2647 (makeDocBookFile): the same for docbook.
2649 * src/insets/insetinclude.h:
2650 * src/insets/insetinclude.C (Validate): keeps a list of included files.
2652 (DocBook): new export methods.
2654 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
2655 and makeDocBookFile.
2657 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
2658 formats to export with command line argument -x.
2660 2000-06-29 Juergen Vigna <jug@sad.it>
2662 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
2663 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
2665 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
2666 region could already been cleared by an inset!
2668 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2670 * src/BufferView_pimpl.h: remove member variables lyx_focus and
2673 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
2675 (cursorToggle): remove special handling of lyx focus.
2677 2000-06-28 Juergen Vigna <jug@sad.it>
2679 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
2682 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2684 * src/insets/insetindex.C (Edit): add a callback when popup is
2687 * src/insets/insettext.C (LocalDispatch):
2688 * src/insets/insetmarginal.h:
2689 * src/insets/insetlist.h:
2690 * src/insets/insetfoot.h:
2691 * src/insets/insetfloat.h:
2692 * src/insets/insetert.h: add a missing std:: qualifier.
2694 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
2696 * src/support/lyxsum.C (sum): '\0' teminate file read when using
2699 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
2701 * src/insets/insettext.C (Read): remove tmptok unused variable
2702 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
2703 (InsertInset): change for new InsetInset code
2705 * src/insets/insettext.h: add TEXT inline method
2707 * src/insets/insettext.C: remove TEXT macro
2709 * src/insets/insetmarginal.C (Write): new method
2710 (Latex): change output slightly
2712 * src/insets/insetfoot.C (Write): new method
2713 (Latex): change output slightly (don't use endl when no need)
2715 * src/insets/insetert.C (Write): new method
2717 * src/insets/insetcollapsable.h: make button_length, button_top_y
2718 and button_bottm_y protected.
2720 * src/insets/insetcollapsable.C (Write): simplify code by using
2721 tostr. Also do not output the float name, the children class
2722 should to that to get control over own arguments
2724 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
2725 src/insets/insetminipage.[Ch]:
2728 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
2730 * src/lyxfunc.C (Dispatch): cases for new insets/commands
2732 * src/Makefile.am (lyx_SOURCES): add the new files
2734 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
2735 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
2736 * src/commandtags.h: ditto
2738 * src/LaTeXFeatures.h: add a std::set of used floattypes
2740 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
2742 * src/FloatList.[Ch] src/Floating.h: new files
2744 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
2746 * src/lyx_cb.C (TableApplyCB): ditto
2748 * src/text2.C: ditto
2749 * src/buffer.C (SimpleLinuxDocOnePar): ditto
2750 (parseSingleLyXformat2Token): ditto + add code for
2751 backwards compability for old float styles + add code for new insets
2753 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
2755 (InsertInset(size_type, Inset *, LyXFont)): new method
2756 (InsetChar(size_type, char)): changed to use the other InsetChar
2757 with a LyXFont(ALL_INHERIT).
2758 (InsetInset(size_type, Inset*)): changed to use InsetChar to
2759 insert the META_INSET.
2761 * sigc++/thread.cc (Privete<int>::operator int&): move definition
2763 * sigc++/thread.h (Threads): from here
2765 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
2766 definition out of line
2767 * sigc++/scope.h: from here
2769 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2771 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
2772 is specified (adapted from a patch from edscott <edscott@imp.mx>).
2774 * Makefile.am (bindist): new target.
2776 * INSTALL: add instructions for doing a binary distribution.
2778 * development/tools/README.bin.example: update a bit.
2780 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
2783 * lib/lyxrc.example: new lyxrc tag \set_color.
2785 * src/lyxfunc.C (Dispatch):
2786 * src/commandtags.h:
2787 * src/LyXAction.C: new lyxfunc "set-color".
2789 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
2790 and an x11name given as strings.
2792 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
2793 cache when a color is changed.
2795 2000-06-26 Juergen Vigna <jug@sad.it>
2797 * src/lyxrow.C (width): added this functions and variable.
2799 * src/insets/insetcite.C (create_form_citation_form): some Gravity
2802 * src/text.C (SetHeightOfRow): fixed calcualting of width.
2804 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2806 * images/undo_bw.xpm: new icon.
2807 * images/redo_bw.xpm: ditto.
2809 * configure.in (INSTALL_SCRIPT): change value to
2810 ${INSTALL} to avoid failures of install-script target.
2811 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
2813 * src/BufferView.h: add a magic "friend" declaration to please
2816 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
2818 * forms/cite.fd: modified to allow resizing without messing
2821 * src/insetcite.C: Uses code from cite.fd almost without
2823 User can now resize dialog in the x-direction.
2824 Resizing the dialog in the y-direction is prevented, as the
2825 code does this intelligently already.
2827 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2829 * INSTALL: remove obsolete entry in "problems" section.
2831 * lib/examples/sl_*.lyx: update of the slovenian examples.
2833 * src/support/FileInfo.[Ch] (getBlockSize): remove.
2835 2000-06-23 Juergen Vigna <jug@sad.it>
2837 * src/lyxtext.h: added a 'cleared' flag to draw() function.
2839 * src/buffer.C (resize): delete the LyXText of textinsets.
2841 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
2843 * src/insets/lyxinset.h: added another parameter 'cleared' to
2844 the draw() function.
2846 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
2847 unlocking inset in inset.
2849 2000-06-22 Juergen Vigna <jug@sad.it>
2851 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
2852 of insets and moved first to LyXText.
2854 * src/mathed/formulamacro.[Ch]:
2855 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
2857 2000-06-21 Juergen Vigna <jug@sad.it>
2859 * src/text.C (GetVisibleRow): look if I should clear the area or not
2860 using Inset::doClearArea() function.
2862 * src/insets/lyxinset.h: added doClearArea() function and
2863 modified draw(Painter &, ...) to draw(BufferView *, ...)
2865 * src/text2.C (UpdateInset): return bool insted of int
2867 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
2869 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
2870 combox in the character popup
2872 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
2873 BufferParams const & params
2875 2000-06-20 Juergen Vigna <jug@sad.it>
2877 * src/insets/insettext.C (SetParagraphData): set insetowner on
2880 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2882 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
2883 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
2885 (form_main_): remove
2887 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
2888 (create_form_form_main): remove FD_form_main stuff, connect to
2889 autosave_timeout signal
2891 * src/LyXView.[Ch] (getMainForm): remove
2892 (UpdateTimerCB): remove
2893 * src/BufferView_pimpl.h: inherit from SigC::Object
2895 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
2896 signal instead of callback
2898 * src/BufferView.[Ch] (cursorToggleCB): remove
2900 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2902 * src/BufferView_pimpl.C: changes because of the one below
2904 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
2905 instead of storing a pointer to a LyXText.
2907 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
2909 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
2911 * src/lyxparagraph.h
2913 * src/paragraph.C: Changed fontlist to a sorted vector.
2915 2000-06-19 Juergen Vigna <jug@sad.it>
2917 * src/BufferView.h: added screen() function.
2919 * src/insets/insettext.C (LocalDispatch): some selection code
2922 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
2924 * src/insets/insettext.C (SetParagraphData):
2926 (InsetText): fixes for multiple paragraphs.
2928 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
2930 * development/lyx.spec.in: Call configure with ``--without-warnings''
2931 to work around a bug with the Makefiles when doing ``make lyxrpm''.
2932 This should be fine, however, since we generally don't want to be
2933 verbose when making an RPM.
2935 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
2937 * lib/scripts/fig2pstex.py: New file
2939 2000-06-16 Juergen Vigna <jug@sad.it>
2941 * src/insets/insettabular.C (UpdateLocal):
2942 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
2943 (LocalDispatch): Changed all functions to use LyXText.
2945 2000-06-15 Juergen Vigna <jug@sad.it>
2947 * src/text.C (SetHeightOfRow): call inset::update before requesting
2950 * src/insets/insettext.C (update):
2951 * src/insets/insettabular.C (update): added implementation
2953 * src/insets/lyxinset.h: added update function
2955 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2957 * src/text.C (SelectNextWord): protect against null pointers with
2958 old-style string streams. (fix from Paul Theo Gonciari
2961 * src/cite.[Ch]: remove erroneous files.
2963 * lib/configure.m4: update the list of created directories.
2965 * src/lyxrow.C: include <config.h>
2966 * src/lyxcursor.C: ditto.
2968 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2970 * lib/examples/decimal.lyx: new example file from Mike.
2972 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
2973 to find template definitions (from Dekel)
2975 * src/frontends/.cvsignore: add a few things.
2977 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
2979 * src/Timeout.C (TimeOut): remove default argument.
2981 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
2984 * src/insets/ExternalTemplate.C: add a "using" directive.
2986 * src/lyx_main.h: remove the act_ struct, which seems unused
2989 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
2991 * LyX Developers Meeting: All files changed, due to random C++ (by
2992 coincidence) code generator script.
2994 - external inset (cool!)
2995 - initial online editing of preferences
2996 - insettabular breaks insettext(s contents)
2998 - some DocBook fixes
2999 - example files update
3000 - other cool stuff, create a diff and look for yourself.
3002 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3004 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3005 -1 this is a non-line-breaking textinset.
3007 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3008 if there is no width set.
3010 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3012 * Lots of files: Merged the dialogbase branch.
3014 2000-06-09 Allan Rae <rae@lyx.org>
3016 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3017 and the Dispatch methods that used it.
3019 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3020 access to functions formerly kept in Dispatch.
3022 2000-05-19 Allan Rae <rae@lyx.org>
3024 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3025 made to_page and count_copies integers again. from_page remains a
3026 string however because I want to allow entry of a print range like
3027 "1,4,22-25" using this field.
3029 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3030 and printer-params-get. These aren't useful from the minibuffer but
3031 could be used by a script/LyXServer app provided it passes a suitable
3032 auto_mem_buffer. I guess I should take a look at how the LyXServer
3033 works and make it support xtl buffers.
3035 * sigc++/: updated to libsigc++-1.0.1
3037 * src/xtl/: updated to xtl-1.3.pl.11
3039 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3040 those changes done to the files in src/ are actually recreated when
3041 they get regenerated. Please don't ever accept a patch that changes a
3042 dialog unless that patch includes the changes to the corresponding *.fd
3045 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3046 stringOnlyContains, renamed it and generalised it.
3048 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3049 branch. Removed the remaining old form_print code.
3051 2000-04-26 Allan Rae <rae@lyx.org>
3053 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3054 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3056 2000-04-25 Allan Rae <rae@lyx.org>
3058 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3059 against a base of xtl-1.3.pl.4
3061 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3062 filter the Id: entries so they still show the xtl version number
3065 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3066 into the src/xtl code. Patch still pending with José (XTL)
3068 2000-04-24 Allan Rae <rae@lyx.org>
3070 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3071 both more generic and much safer. Use the new template functions.
3072 * src/buffer.[Ch] (Dispatch): ditto.
3074 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3075 and mem buffer more intelligently. Also a little general cleanup.
3078 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3079 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3080 * src/xtl/Makefile.am: ditto.
3081 * src/xtl/.cvsignore: ditto.
3082 * src/Makefile.am: ditto.
3084 * src/PrinterParams.h: Removed the macros member functions. Added a
3085 testInvariant member function. A bit of tidying up and commenting.
3086 Included Angus's idea for fixing operation with egcs-1.1.2.
3088 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3089 cool expansion of XTL's mem_buffer to support automatic memory
3090 management within the buffer itself. Removed the various macros and
3091 replaced them with template functions that use either auto_mem_buffer
3092 or mem_buffer depending on a #define. The mem_buffer support will
3093 disappear as soon as the auto_mem_buffer is confirmed to be good on
3094 other platforms/compilers. That is, it's there so you've got something
3097 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3098 effectively forked XTL. However I expect José will include my code
3099 into the next major release. Also fixed a memory leak.
3100 * src/xtl/text.h: ditto.
3101 * src/xtl/xdr.h: ditto.
3102 * src/xtl/giop.h: ditto.
3104 2000-04-16 Allan Rae <rae@lyx.org>
3106 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3107 by autogen.sh and removed by maintainer-clean anyway.
3108 * .cvsignore, sigc++/.cvsignore: Support the above.
3110 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3112 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3114 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3115 macros, renamed static callback-target member functions to suit new
3116 scheme and made them public.
3117 * src/frontends/xforms/forms/form_print.fd: ditto.
3118 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3120 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3123 * src/xtl/: New directory containing a minimal distribution of XTL.
3124 This is XTL-1.3.pl.4.
3126 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3128 2000-04-15 Allan Rae <rae@lyx.org>
3130 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3132 * sigc++/: Updated to libsigc++-1.0.0
3134 2000-04-14 Allan Rae <rae@lyx.org>
3136 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3137 use the generic ones in future. I'll modify my conversion script.
3139 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3141 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3142 (CloseAllBufferRelatedDialogs): Renamed.
3143 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3145 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3146 of the generic ones. These are the same ones my conversion script
3149 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3150 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3151 * src/buffer.C (Dispatch): ditto
3153 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3154 functions for updating and hiding buffer dependent dialogs.
3155 * src/BufferView.C (buffer): ditto
3156 * src/buffer.C (setReadonly): ditto
3157 * src/lyxfunc.C (CloseBuffer): ditto
3159 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3160 Dialogs.h, and hence all the SigC stuff, into every file that includes
3161 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3163 * src/BufferView2.C: reduce the number of headers included by buffer.h
3165 2000-04-11 Allan Rae <rae@lyx.org>
3167 * src/frontends/xforms/xform_macros.h: A small collection of macros
3168 for building C callbacks.
3170 * src/frontends/xforms/Makefile.am: Added above file.
3172 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3173 scheme again. This time it should work for JMarc. If this is
3174 successful I'll revise my conversion script to automate some of this.
3175 The static member functions in the class also have to be public for
3176 this scheme will work. If the scheme works (it's almost identical to
3177 the way BufferView::cursorToggleCB is handled so it should work) then
3178 FormCopyright and FormPrint will be ready for inclusion into the main
3179 trunk immediately after 1.1.5 is released -- provided we're prepared
3180 for complaints about lame compilers not handling XTL.
3182 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3184 2000-04-07 Allan Rae <rae@lyx.org>
3186 * config/lyxinclude.m4: A bit more tidying up (Angus)
3188 * src/LString.h: JMarc's <string> header fix
3190 * src/PrinterParams.h: Used string for most data to remove some
3191 ugly code in the Print dialog and avoid even uglier code when
3192 appending the ints to a string for output.
3194 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3195 and moved "default:" back to the end of switch statement. Cleaned
3196 up the printing so it uses the right function calls and so the
3197 "print to file" option actually puts the file in the right directory.
3199 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3201 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3202 and Ok+Apply button control into a separate method: input (Angus).
3203 (input) Cleaned it up and improved it to be very thorough now.
3204 (All CB) static_cast used instead of C style cast (Angus). This will
3205 probably change again once we've worked out how to keep gcc-2.8.1 happy
3206 with real C callbacks.
3207 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3208 ignore some of the bool settings and has random numbers instead. Needs
3209 some more investigation. Added other input length checks and checking
3210 of file and printer names.
3212 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3213 would link (Angus). Seems the old code doesn't compile with the pragma
3214 statement either. Separated callback entries from internal methods.
3216 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3218 2000-03-17 Allan Rae <rae@lyx.org>
3220 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3221 need it? Maybe it could go in Dialogs instead? I could make it a
3222 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3223 values to get the bool return value.
3224 (Dispatch): New overloaded method for xtl support.
3226 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3227 extern "C" callback instead of static member functions. Hopefully,
3228 JMarc will be able to compile this. I haven't changed
3229 forms/form_copyright.fd yet. Breaking one of my own rules already.
3231 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3232 because they aren't useful from the minibuffer. Maybe a LyXServer
3233 might want a help message though?
3235 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3237 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3238 xtl which needs both rtti and exceptions.
3240 * src/support/Makefile.am:
3241 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3243 * src/frontends/xforms/input_validators.[ch]: input filters and
3244 validators. These conrol what keys are valid in input boxes.
3245 Use them and write some more. Much better idea than waiting till
3246 after the user has pressed Ok to say that the input fields don't make
3249 * src/frontends/xforms/Makefile.am:
3250 * src/frontends/xforms/forms/form_print.fd:
3251 * src/frontends/xforms/forms/makefile:
3252 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3253 new scheme. Still have to make sure I haven't missed anything from
3254 the current implementation.
3256 * src/Makefile.am, src/PrinterParams.h: New data store.
3258 * other files: Added a couple of copyright notices.
3260 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3262 * src/insets/insetbib.h: move Holder struct in public space.
3264 * src/frontends/include/DialogBase.h: use SigC:: only when
3265 SIGC_CXX_NAMESPACES is defined.
3266 * src/frontends/include/Dialogs.h: ditto.
3268 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3270 * src/frontends/xforms/FormCopyright.[Ch]: do not
3271 mention SigC:: explicitely.
3273 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3275 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3276 deals with testing KDE in main configure.in
3277 * configure.in: ditto.
3279 2000-02-22 Allan Rae <rae@lyx.org>
3281 * Lots of files: Merged from HEAD
3283 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3284 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3286 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3288 * sigc++/: new minidist.
3290 2000-02-14 Allan Rae <rae@lyx.org>
3292 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3294 2000-02-08 Juergen Vigna <jug@sad.it>
3296 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3297 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3299 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3300 for this port and so it is much easier for other people to port
3301 dialogs in a common development environment.
3303 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3304 the QT/KDE implementation.
3306 * src/frontends/kde/Dialogs.C:
3307 * src/frontends/kde/FormCopyright.C:
3308 * src/frontends/kde/FormCopyright.h:
3309 * src/frontends/kde/Makefile.am:
3310 * src/frontends/kde/formcopyrightdialog.C:
3311 * src/frontends/kde/formcopyrightdialog.h:
3312 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3313 for the kde support of the Copyright-Dialog.
3315 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3316 subdir-substitution instead of hardcoded 'xforms' as we now have also
3319 * src/frontends/include/DialogBase.h (Object): just commented the
3320 label after #endif (nasty warning and I don't like warnings ;)
3322 * src/main.C (main): added KApplication initialization if using
3325 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3326 For now only the KDE event-loop is added if frontend==kde.
3328 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3330 * configure.in: added support for the --with-frontend[=value] option
3332 * autogen.sh: added kde.m4 file to list of config-files
3334 * acconfig.h: added define for KDEGUI-support
3336 * config/kde.m4: added configuration functions for KDE-port
3338 * config/lyxinclude.m4: added --with-frontend[=value] option with
3339 support for xforms and KDE.
3341 2000-02-08 Allan Rae <rae@lyx.org>
3343 * all Makefile.am: Fixed up so the make targets dist, distclean,
3344 install and uninstall all work even if builddir != srcdir. Still
3345 have a new sigc++ minidist update to come.
3347 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3349 2000-02-01 Allan Rae <rae@lyx.org>
3351 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3352 Many mods to get builddir != srcdir working.
3354 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3355 for building on NT and so we can do the builddir != srcdir stuff.
3357 2000-01-30 Allan Rae <rae@lyx.org>
3359 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3360 This will stay in "rae" branch. We probably don't really need it in
3361 the main trunk as anyone who wants to help programming it should get
3362 a full library installed also. So they can check both included and
3363 system supplied library compilation.
3365 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3366 Added a 'mini' distribution of libsigc++. If you feel the urge to
3367 change something in these directories - Resist it. If you can't
3368 resist the urge then you should modify the following script and rebuild
3369 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3370 all happen. Still uses a hacked version of libsigc++'s configure.in.
3371 I'm quite happy with the results. I'm not sure the extra work to turn
3372 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3373 worth the trouble and would probably lead to extra maintenance
3375 I haven't tested the following important make targets: install, dist.
3376 Not ready for prime time but very close. Maybe 1.1.5.
3378 * development/tools/makeLyXsigc.sh: A shell script to automatically
3379 generate our mini-dist of libsigc++. It can only be used with a CVS
3380 checkout of libsigc++ not a tarball distribution. It's well commented.
3381 This will end up as part of the libsigc++ distribution so other apps
3382 can easily have an included mini-dist. If someone makes mods to the
3383 sigc++ subpackage without modifying this script to generate those
3384 changes I'll be very upset!
3386 * src/frontends/: Started the gui/system indep structure.
3388 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3389 to access the gui-indep dialogs are in this class. Much improved
3390 design compared to previous revision. Lars, please refrain from
3391 moving this header into src/ like you did with Popups.h last time.
3393 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3395 * src/frontends/xforms/: Started the gui-indep system with a single
3396 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3399 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3400 Here you'll find a very useful makefile and automated fdfix.sh that
3401 makes updating dailogs a no-brainer -- provided you follow the rules
3402 set out in the README. I'm thinking about adding another script to
3403 automatically generate skeleton code for a new dialog given just the
3406 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3407 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3408 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3410 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3412 * src/support/LSubstring.C (operator): simplify
3414 * src/lyxtext.h: removed bparams, use buffer_->params instead
3416 * src/lyxrow.h: make Row a real class, move all variables to
3417 private and use accessors.
3419 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3421 (isRightToLeftPar): ditto
3422 (ChangeLanguage): ditto
3423 (isMultiLingual): ditto
3426 (SimpleTeXOnePar): ditto
3427 (TeXEnvironment): ditto
3428 (GetEndLabel): ditto
3430 (SetOnlyLayout): ditto
3431 (BreakParagraph): ditto
3432 (BreakParagraphConservative): ditto
3433 (GetFontSettings): ditto
3435 (CopyIntoMinibuffer): ditto
3436 (CutIntoMinibuffer): ditto
3437 (PasteParagraph): ditto
3438 (SetPExtraType): ditto
3439 (UnsetPExtraType): ditto
3440 (DocBookContTableRows): ditto
3441 (SimpleDocBookOneTablePar): ditto
3443 (TeXFootnote): ditto
3444 (SimpleTeXOneTablePar): ditto
3445 (TeXContTableRows): ditto
3446 (SimpleTeXSpecialChars): ditto
3449 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3450 to private and use accessors.
3452 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3453 this, we did not use it anymore and has not been for ages. Just a
3454 waste of cpu cycles.
3456 * src/language.h: make Language a real class, move all variables
3457 to private and use accessors.
3459 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3460 (create_view): remove
3461 (update): some changes for new timer
3462 (cursorToggle): use new timer
3463 (beforeChange): change for new timer
3465 * src/BufferView.h (cursorToggleCB): removed last paramter because
3468 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3469 (cursorToggleCB): change because of new timer code
3471 * lib/CREDITS: updated own mailaddress
3473 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3475 * src/support/filetools.C (PutEnv): fix the code in case neither
3476 putenv() nor setenv() have been found.
3478 * INSTALL: mention the install-strip Makefile target.
3480 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3481 read-only documents.
3483 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3485 * lib/reLyX/configure.in (VERSION): avoid using a previously
3486 generated reLyX wrapper to find out $prefix.
3488 * lib/examples/eu_adibide_lyx-atua.lyx:
3489 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
3490 translation of the Tutorial (Dooteo)
3492 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
3494 * forms/cite.fd: new citation dialog
3496 * src/insetcite.[Ch]: the new citation dialog is moved into
3499 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
3502 * src/insets/insetcommand.h: data members made private.
3504 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3506 * LyX 1.1.5 released
3508 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3510 * src/version.h (LYX_RELEASE): to 1.1.5
3512 * src/spellchecker.C (RunSpellChecker): return false if the
3513 spellchecker dies upon creation.
3515 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3517 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
3518 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
3522 * lib/CREDITS: update entry for Martin Vermeer.
3524 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
3526 * src/text.C (draw): Draw foreign language bars at the bottom of
3527 the row instead of at the baseline.
3529 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
3531 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
3533 * lib/bind/de_menus.bind: updated
3535 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3537 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
3539 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
3541 * src/menus.C (Limit_string_length): New function
3542 (ShowTocMenu): Limit the number of items/length of items in the
3545 * src/paragraph.C (String): Correct result for a paragraph inside
3548 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3550 * src/bufferlist.C (close): test of buf->getuser() == NULL
3552 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
3554 * src/BufferView2.C (removeAutoInsets): Fix a bug:
3555 Do not call to SetCursor when the paragraph is a closed footnote!
3557 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
3559 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
3562 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
3564 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3567 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
3568 reference popup, that activates the reference-back action
3570 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
3572 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
3573 the menus. Also fixed a bug.
3575 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
3576 the math panels when switching buffers (unless new buffer is readonly).
3578 * src/BufferView.C (NoSavedPositions)
3579 * src/BufferView_pimpl.C (NoSavedPositions): New methods
3581 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3583 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
3584 less of dvi dirty or not.
3586 * src/trans_mgr.[Ch] (insert): change first parameter to string
3589 * src/chset.[Ch] (encodeString): add const to first parameter
3591 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3593 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
3597 * src/LaTeX.C (deplog): better searching for dependency files in
3598 the latex log. Uses now regexps.
3600 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
3601 instead of the box hack or \hfill.
3603 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3605 * src/lyxfunc.C (doImportHelper): do not create the file before
3606 doing the actual import.
3607 (doImportASCIIasLines): create a new file before doing the insert.
3608 (doImportASCIIasParagraphs): ditto.
3610 * lib/lyxrc.example: remove mention of non-existing commands
3612 * lyx.man: remove mention of color-related switches.
3614 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
3616 * src/lyx_gui.C: remove all the color-related ressources, which
3617 are not used anymore.
3619 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
3622 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
3624 * src/lyxrc.C (read): Add a missing break in the switch
3626 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
3628 * src/text2.C (InsertStringA): Fix a bug with insertion into table
3630 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
3633 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3635 * src/text.C (draw): draw bars under foreign language words.
3637 * src/LColor.[Ch]: add LColor::language
3639 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
3641 * src/lyxcursor.h (boundary): New member variable
3643 * src/text.C (IsBoundary): New methods
3645 * src/text.C: Use the above for currect cursor movement when there
3646 is both RTL & LTR text.
3648 * src/text2.C: ditto
3650 * src/bufferview_funcs.C (ToggleAndShow): ditto
3652 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3654 * src/text.C (DeleteLineForward): set selection to true to avoid
3655 that DeleteEmptyParagraphMechanism does some magic. This is how it
3656 is done in all other functions, and seems reasonable.
3657 (DeleteWordForward): do not jump over non-word stuff, since
3658 CursorRightOneWord() already does it.
3660 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
3661 DeleteWordBackward, since they seem safe to me (since selection is
3662 set to "true") DeleteEmptyParagraphMechanism does nothing.
3664 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3666 * src/lyx_main.C (easyParse): simplify the code by factoring the
3667 part that removes parameters from the command line.
3668 (LyX): check wether wrong command line options have been given.
3670 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
3672 * src/lyx_main.C : add support for specifying user LyX
3673 directory via command line option -userdir.
3675 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
3677 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
3678 the number of items per popup.
3679 (Add_to_refs_menu): Ditto.
3681 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3683 * src/lyxparagraph.h: renamed ClearParagraph() to
3684 StripLeadingSpaces() and moved it to paragraph.C. We pass the
3685 textclass as parameter, and do nothing if free_spacing is
3686 true. This fixes part of the line-delete-forward problems.
3688 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
3689 (pasteSelection): ditto.
3690 (SwitchLayoutsBetweenClasses): more translatable strings.
3692 * src/text2.C (CutSelection): use StripLeadingSpaces.
3693 (PasteSelection): ditto.
3694 (DeleteEmptyParagraphMechanism): ditto.
3696 2000-05-26 Juergen Vigna <jug@sad.it>
3698 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
3699 is not needed in tabular insets.
3701 * src/insets/insettabular.C (TabularFeatures): added missing features.
3703 * src/tabular.C (DeleteColumn):
3705 (AppendRow): implemented this functions
3706 (cellsturct::operator=): clone the inset too;
3708 2000-05-23 Juergen Vigna <jug@sad.it>
3710 * src/insets/insettabular.C (LocalDispatch): better selection support
3711 when having multicolumn-cells.
3713 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
3715 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
3717 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3719 * src/ColorHandler.C (getGCForeground): put more test into _()
3721 * lib/examples/eu_splash.lyx: new file (Basque translation) from
3724 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
3727 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
3729 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
3730 there are no labels, or when buffer is readonly.
3732 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
3733 there are no labels, buffer is SGML, or when buffer is readonly.
3735 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3737 * src/LColor.C (LColor): change a couple of grey40 to grey60
3738 (LColor): rewore initalization to make compiles go some magnitude
3740 (getGUIName): don't use gettext until we need the string.
3742 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
3744 * src/Bullet.[Ch]: Fixed a small bug.
3746 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
3748 * src/paragraph.C (String): Several fixes/improvements
3750 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
3752 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3754 * src/paragraph.C (String): give more correct output.
3756 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
3758 * src/lyxfont.C (stateText) Do not output the language if it is
3759 eqaul to the language of the document.
3761 * src/paragraph.C (TeXOnePar): Do not put language switch commands
3762 between two paragraphs with the same language.
3764 * src/paragraph.C (getParLanguage) Return a correct answer for an
3765 empty dummy paragraph.
3767 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
3770 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
3773 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
3774 the menus/popup, if requested fonts are unavailable.
3776 2000-05-22 Juergen Vigna <jug@sad.it>
3778 * src/insets/insettabular.C (LocalDispatch): added some more cursor
3779 movement support (Up/Down/Tab/Shift-Tab).
3780 (LocalDispatch): added also preliminari cursor-selection.
3782 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
3784 * src/paragraph.C (PasteParagraph): Hopefully now right!
3786 2000-05-22 Garst R. Reese <reese@isn.net>
3788 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
3789 of list, change all references to Environment to Command
3790 * tex/hollywood.cls : rewrite environments as commands, add
3791 \uppercase to interiorshot and exteriorshot to force uppecase.
3792 * tex/broadway.cls : rewrite environments as commands. Tweak
3795 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3797 * src/menus.C (Add_to_toc_menu): fix the code which limits the
3798 size of items: use a constant intead of the hardcoded 40, and more
3799 importantly do not remove the %m and %x tags added at the end.
3800 (Add_to_refs_menu): use vector::size_type instead of
3801 unsigned int as basic types for the variables. _Please_ do not
3802 assume that size_t is equal to unsigned int. On an alpha, this is
3803 unsigned long, which is _not_ the same.
3805 * src/language.C (initL): remove language "hungarian", since it
3806 seems that "magyar" is better.
3808 2000-05-22 Juergen Vigna <jug@sad.it>
3810 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
3812 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
3815 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
3816 next was deleted but not set to 0.
3818 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3820 * src/language.C (initL): change the initialization of languages
3821 so that compiles goes _fast_.
3823 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
3826 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
3828 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3832 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3834 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
3836 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
3840 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
3843 * src/insets/insetlo*.[Ch]: Made editable
3845 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3847 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
3848 the current selection.
3850 * src/BufferView_pimpl.C (stuffClipboard): new method
3852 * src/BufferView.C (stuffClipboard): new method
3854 * src/paragraph.C (String): new method
3856 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
3857 LColor::ignore when lyxname is not found.
3859 * src/BufferView.C (pasteSelection): new method
3861 * src/BufferView_pimpl.C (pasteSelection): new method
3863 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
3865 * src/WorkArea.C (request_clipboard_cb): new static function
3866 (getClipboard): new method
3867 (putClipboard): new method
3869 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3871 * LyX 1.1.5pre2 released
3873 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3875 * src/vspace.C (operator=): removed
3876 (operator=): removed
3878 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
3880 * src/layout.C (NumberOfClass): manually set the type in make_pair
3881 (NumberOfLayout): ditto
3883 * src/language.C: use the Language constructor for ignore_lang
3885 * src/language.h: add constructors to struct Language
3887 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
3889 * src/text2.C (SetCursorIntern): comment out #warning
3891 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
3893 * src/mathed/math_iter.h: initialize sx and sw to 0
3895 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
3897 * forms/lyx.fd: Redesign of form_ref
3899 * src/LaTeXFeatures.[Ch]
3903 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
3906 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
3907 and Buffer::inset_iterator.
3909 * src/menus.C: Added new menus: TOC and Refs.
3911 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
3913 * src/buffer.C (getTocList): New method.
3915 * src/BufferView2.C (ChangeRefs): New method.
3917 * src/buffer.C (getLabelList): New method. It replaces the old
3918 getReferenceList. The return type is vector<string> instead of
3921 * src/insets/insetinclude.C (getLabelList): New method. Replaces
3922 the old getLabel() and GetNumberOfLabels() methods.
3923 * src/insets/insetlabel.C (getLabelList): ditto
3924 * src/mathed/formula.C (getLabelList): ditto
3926 * src/paragraph.C (String): New method.
3928 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
3929 Uses the new getTocList() method.
3930 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
3931 which automatically updates the contents of the browser.
3932 (RefUpdateCB): Use the new getLabelList method.
3934 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
3936 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
3938 * src/spellchecker.C: Added using std::reverse;
3940 2000-05-19 Juergen Vigna <jug@sad.it>
3942 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
3944 * src/insets/insettext.C (computeTextRows): small fix for display of
3945 1 character after a newline.
3947 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
3950 2000-05-18 Juergen Vigna <jug@sad.it>
3952 * src/insets/insettabular.C (TabularFeatures): fixed update of display
3953 when changing width of column.
3955 * src/tabular.C (set_row_column_number_info): setting of
3956 autobreak rows if necessary.
3958 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3960 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
3962 * src/vc-backend.*: renamed stat() to status() and vcstat to
3963 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
3964 compilation broke. The new name seems more relevant, anyway.
3966 2000-05-17 Juergen Vigna <jug@sad.it>
3968 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
3969 which was wrong if the removing caused removing of rows!
3971 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
3972 (pushToken): new function.
3974 * src/text2.C (CutSelection): fix problem discovered with purify
3976 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3978 * src/debug.C (showTags): enlarge the first column, now that we
3979 have 6-digits debug codes.
3981 * lib/layouts/hollywood.layout:
3982 * lib/tex/hollywood.cls:
3983 * lib/tex/brodway.cls:
3984 * lib/layouts/brodway.layout: more commands and fewer
3985 environments. Preambles moved in the .cls files. Broadway now has
3986 more options on scene numbering and less whitespace (from Garst)
3988 * src/insets/insetbib.C (getKeys): make sure that we are in the
3989 document directory, in case the bib file is there.
3991 * src/insets/insetbib.C (Latex): revert bogus change.
3993 2000-05-16 Juergen Vigna <jug@sad.it>
3995 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
3996 the TabularLayout on cursor move.
3998 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4000 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4003 (draw): fixed cursor position and drawing so that the cursor is
4004 visible when before the tabular-inset.
4006 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4007 when creating from old insettext.
4009 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4011 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4013 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4014 * lib/tex/brodway.cls: ditto
4016 * lib/layouts/brodway.layout: change alignment of parenthical
4019 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4021 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4022 versions 0.88 and 0.89 are supported.
4024 2000-05-15 Juergen Vigna <jug@sad.it>
4026 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4029 * src/insets/insettext.C (computeTextRows): redone completely this
4030 function in a much cleaner way, because of problems when having a
4032 (draw): added a frame border when the inset is locked.
4033 (SetDrawLockedFrame): this sets if we draw the border or not.
4034 (SetFrameColor): this sets the frame color (default=insetframe).
4036 * src/insets/lyxinset.h: added x() and y() functions which return
4037 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4038 function which is needed to see if we have a locking inset of some
4039 type in this inset (needed for now in insettabular).
4041 * src/vspace.C (inPixels): the same function also without a BufferView
4042 parameter as so it is easier to use it in some ocasions.
4044 * src/lyxfunc.C: changed all places where insertInset was used so
4045 that now if it couldn't be inserted it is deleted!
4047 * src/TabularLayout.C:
4048 * src/TableLayout.C: added support for new tabular-inset!
4050 * src/BufferView2.C (insertInset): this now returns a bool if the
4051 inset was really inserted!!!
4053 * src/tabular.C (GetLastCellInRow):
4054 (GetFirstCellInRow): new helper functions.
4055 (Latex): implemented for new tabular class.
4059 (TeXTopHLine): new Latex() helper functions.
4061 2000-05-12 Juergen Vigna <jug@sad.it>
4063 * src/mathed/formulamacro.C (Read):
4064 * src/mathed/formula.C (Read): read also the \end_inset here!
4066 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4068 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4069 crush when saving formulae with unbalanced parenthesis.
4071 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4073 * src/layout.C: Add new keyword "endlabelstring" to layout file
4075 * src/text.C (GetVisibleRow): Draw endlabel string.
4077 * lib/layouts/broadway.layout
4078 * lib/layouts/hollywood.layout: Added endlabel for the
4079 Parenthetical layout.
4081 * lib/layouts/heb-article.layout: Do not use slanted font shape
4082 for Theorem like environments.
4084 * src/buffer.C (makeLaTeXFile): Always add "american" to
4085 the UsedLanguages list if document language is RTL.
4087 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4089 * add addendum to README.OS2 and small patch (from SMiyata)
4091 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4093 * many files: correct the calls to ChangeExtension().
4095 * src/support/filetools.C (ChangeExtension): remove the no_path
4096 argument, which does not belong there. Use OnlyFileName() instead.
4098 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4099 files when LaTeXing a non-nice latex file.
4101 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4102 a chain of "if". Return false when deadkeys are not handled.
4104 * src/lyx_main.C (LyX): adapted the code for default bindings.
4106 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4107 bindings for basic functionality (except deadkeys).
4108 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4110 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4111 several methods: handle override_x_deadkeys.
4113 * src/lyxrc.h: remove the "bindings" map, which did not make much
4114 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4116 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4118 * src/lyxfont.C (stateText): use a saner method to determine
4119 whether the font is "default". Seems to fix the crash with DEC
4122 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4124 2000-05-08 Juergen Vigna <jug@sad.it>
4126 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4127 TabularLayoutMenu with mouse-button-3
4128 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4130 * src/TabularLayout.C: added this file for having a Layout for
4133 2000-05-05 Juergen Vigna <jug@sad.it>
4135 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4136 recalculating inset-widths.
4137 (TabularFeatures): activated this function so that I can change
4138 tabular-features via menu.
4140 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4141 that I can test some functions with the Table menu.
4143 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4145 * src/lyxfont.C (stateText): guard against stupid c++libs.
4147 * src/tabular.C: add using std::vector
4148 some whitespace changes, + removed som autogenerated code.
4150 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4152 2000-05-05 Juergen Vigna <jug@sad.it>
4154 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4155 row, columns and cellstructures.
4157 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4159 * lib/lyxrc.example: remove obsolete entries.
4161 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4162 reading of protected_separator for free_spacing.
4164 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4166 * src/text.C (draw): do not display an exclamation mark in the
4167 margin for margin notes. This is confusing, ugly and
4170 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4171 AMS math' is checked.
4173 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4174 name to see whether including the amsmath package is needed.
4176 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4178 * src/paragraph.C (validate): Compute UsedLanguages correctly
4179 (don't insert the american language if it doesn't appear in the
4182 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4183 The argument of \thanks{} command is considered moving argument
4185 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4188 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4190 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4191 for appendix/minipage/depth. The lines can be now both in the footnote
4192 frame, and outside the frame.
4194 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4197 2000-05-05 Juergen Vigna <jug@sad.it>
4199 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4200 neede only in tabular.[Ch].
4202 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4204 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4206 (Write): write '~' for PROTECTED_SEPARATOR
4208 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4210 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4213 * src/mathed/formula.C (drawStr): rename size to siz.
4215 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4216 possibly fix a bug by not changing the pflags = flags to piflags =
4219 2000-05-05 Juergen Vigna <jug@sad.it>
4221 * src/insets/insetbib.C: moved using directive
4223 * src/ImportNoweb.C: small fix for being able to compile (missing
4226 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4228 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4229 to use clear, since we don't depend on this in the code. Add test
4232 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4234 * (various *.C files): add using std::foo directives to please dec
4237 * replace calls to string::clear() to string::erase() (Angus)
4239 * src/cheaders/cmath: modified to provide std::abs.
4241 2000-05-04 Juergen Vigna <jug@sad.it>
4243 * src/insets/insettext.C: Prepared all for inserting of multiple
4244 paragraphs. Still display stuff to do (alignment and other things),
4245 but I would like to use LyXText to do this when we cleaned out the
4246 table-support stuff.
4248 * src/insets/insettabular.C: Changed lot of stuff and added lots
4249 of functionality still a lot to do.
4251 * src/tabular.C: Various functions changed name and moved to be
4252 const functions. Added new Read and Write functions and changed
4253 lots of things so it works good with tabular-insets (also removed
4254 some stuff which is not needed anymore * hacks *).
4256 * src/lyxcursor.h: added operators == and != which just look if
4257 par and pos are (not) equal.
4259 * src/buffer.C (latexParagraphs): inserted this function to latex
4260 all paragraphs form par to endpar as then I can use this too for
4263 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4264 so that I can call this to from text insets with their own cursor.
4266 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4267 output off all paragraphs (because of the fix below)!
4269 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4270 the very last paragraph (this could be also the last paragraph of an
4273 * src/texrow.h: added rows() call which returns the count-variable.
4275 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4277 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4279 * lib/configure.m4: better autodetection of DocBook tools.
4281 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4283 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4285 * src/lyx_cb.C: add using std::reverse;
4287 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4290 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4291 selected files. Should fix repeated errors from generated files.
4293 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4295 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4297 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4298 the spellchecker popup.
4300 * lib/lyxrc.example: Removed the \number_inset section
4302 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4304 * src/insets/figinset.C (various): Use IsFileReadable() to make
4305 sure that the file actually exist. Relying on ghostscripts errors
4306 is a bad idea since they can lead to X server crashes.
4308 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4310 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4313 * lib/lyxrc.example: smallish typo in description of
4314 \view_dvi_paper_option
4316 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4319 * src/lyxfunc.C: doImportHelper to factor out common code of the
4320 various import methods. New functions doImportASCIIasLines,
4321 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4322 doImportLinuxDoc for the format specific parts.
4325 * buffer.C: Dispatch returns now a bool to indicate success
4328 * lyx_gui.C: Add getLyXView() for member access
4330 * lyx_main.C: Change logic for batch commands: First try
4331 Buffer::Dispatch (possibly without GUI), if that fails, use
4334 * lyx_main.C: Add support for --import command line switch.
4335 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4336 Available Formats: Everything accepted by 'buffer-import <format>'
4338 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4340 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4343 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4344 documents will be reformatted upon reentry.
4346 2000-04-27 Juergen Vigna <jug@sad.it>
4348 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4349 correctly only last pos this was a bug.
4351 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4353 * release of lyx-1.1.5pre1
4355 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4357 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4359 * src/menus.C: revert the change of naming (Figure->Graphic...)
4360 from 2000-04-11. It was incomplete and bad.
4362 * src/LColor.[Ch]: add LColor::depthbar.
4363 * src/text.C (GetVisibleRow): use it.
4365 * README: update the languages list.
4367 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4369 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4372 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4374 * README: remove sections that were just wrong.
4376 * src/text2.C (GetRowNearY): remove currentrow code
4378 * src/text.C (GetRow): remove currentrow code
4380 * src/screen.C (Update): rewritten a bit.
4381 (SmallUpdate): removed func
4383 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4385 (FullRebreak): return bool
4386 (currentrow): remove var
4387 (currentrow_y): ditto
4389 * src/lyxscreen.h (Draw): change arg to unsigned long
4390 (FitCursor): return bool
4391 (FitManualCursor): ditto
4392 (Smallpdate): remove func
4393 (first): change to unsigned long
4394 (DrawOneRow): change second arg to long (from long &)
4395 (screen_refresh_y): remove var
4396 (scree_refresh_row): ditto
4398 * src/lyxrow.h: change baseline to usigned int from unsigned
4399 short, this brings some implicit/unsigned issues out in the open.
4401 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4403 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4404 instead of smallUpdate.
4406 * src/lyxcursor.h: change y to unsigned long
4408 * src/buffer.h: don't call updateScrollbar after fitcursor
4410 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4411 where they are used. Removed "\\direction", this was not present
4412 in 1.1.4 and is already obsolete. Commented out some code that I
4413 believe to never be called.
4414 (runLiterate): don't call updateScrollbar after fitCursor
4416 (buildProgram): ditto
4419 * src/WorkArea.h (workWidth): change return val to unsigned
4422 (redraw): remove the button redraws
4423 (setScrollbarValue): change for scrollbar
4424 (getScrollbarValue): change for scrollbar
4425 (getScrollbarBounds): change for scrollbar
4427 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4428 (C_WorkArea_down_cb): removed func
4429 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4430 (resize): change for scrollbar
4431 (setScrollbar): ditto
4432 (setScrollbarBounds): ditto
4433 (setScrollbarIncrements): ditto
4434 (up_cb): removed func
4435 (down_cb): removed func
4436 (scroll_cb): change for scrollbar
4437 (work_area_handler): ditto
4439 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4440 when FitCursor did something.
4441 (updateScrollbar): some unsigned changes
4442 (downCB): removed func
4443 (scrollUpOnePage): removed func
4444 (scrollDownOnePage): remvoed func
4445 (workAreaMotionNotify): don't call screen->FitCursor but use
4446 fitCursor instead. and bool return val
4447 (workAreaButtonPress): ditto
4448 (workAreaButtonRelease): some unsigned changes
4449 (checkInsetHit): ditto
4450 (workAreaExpose): ditto
4451 (update): parts rewritten, comments about the signed char arg added
4452 (smallUpdate): removed func
4453 (cursorPrevious): call needed updateScrollbar
4456 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4459 * src/BufferView.[Ch] (upCB): removed func
4460 (downCB): removed func
4461 (smallUpdate): removed func
4463 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4465 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4466 currentrow, currentrow_y optimization. This did not help a lot and
4467 if we want to do this kind of optimization we should rather use
4468 cursor.row instead of the currentrow.
4470 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4471 buffer spacing and klyx spacing support.
4473 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4475 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4478 2000-04-26 Juergen Vigna <jug@sad.it>
4480 * src/insets/figinset.C: fixes to Lars sstream changes!
4482 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4484 * A lot of files: Added Ascii(ostream &) methods to all inset
4485 classes. Used when exporting to ASCII.
4487 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4488 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
4491 * src/text2.C (ToggleFree): Disabled implicit word selection when
4492 there is a change in the language
4494 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
4495 no output was generated for end-of-sentence inset.
4497 * src/insets/lyxinset.h
4500 * src/paragraph.C: Removed the insetnumber code
4502 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
4504 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4506 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
4507 no_babel and no_epsfig completely from the file.
4508 (parseSingleLyXformat2Token): add handling for per-paragraph
4509 spacing as written by klyx.
4511 * src/insets/figinset.C: applied patch by Andre. Made it work with
4514 2000-04-20 Juergen Vigna <jug@sad.it>
4516 * src/insets/insettext.C (cutSelection):
4517 (copySelection): Fixed with selection from right to left.
4518 (draw): now the rows are not recalculated at every draw.
4519 (computeTextRows): for now reset the inset-owner here (this is
4520 important for an undo or copy where the inset-owner is not set
4523 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
4524 motion to the_locking_inset screen->first was forgotten, this was
4525 not important till we got multiline insets.
4527 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4529 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
4530 code seems to be alright (it is code changed by Dekel, and the
4531 intent is indeed that all macros should be defined \protect'ed)
4533 * NEWS: a bit of reorganisation of the new user-visible features.
4535 2000-04-19 Juergen Vigna <jug@sad.it>
4537 * src/insets/insettext.C (init): using a LyXCursor now for cursor
4538 position. Set the inset_owner of the used paragraph so that it knows
4539 that it is inside an inset. Fixed cursor handling with mouse and
4540 cursor keys. Fixed wrong timed inset redraws and lots of other changes
4541 and cleanups to make TextInsets work better.
4543 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
4544 Changed parameters of various functions and added LockInsetInInset().
4546 * src/insets/insettext.C:
4548 * src/insets/insetcollapsable.h:
4549 * src/insets/insetcollapsable.C:
4550 * src/insets/insetfoot.h:
4551 * src/insets/insetfoot.C:
4552 * src/insets/insetert.h:
4553 * src/insets/insetert.C: cleaned up the code so that it works now
4554 correctly with insettext.
4556 * src/insets/inset.C:
4557 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
4558 that insets in insets are supported right.
4561 * src/table.C: lots of changes for use with inset tabular (and cleanup)
4563 * src/paragraph.C: some small fixes
4565 * src/debug.h: inserted INSETS debug info
4567 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
4568 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
4570 * src/commandtags.h:
4571 * src/LyXAction.C: insert code for InsetTabular.
4573 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
4574 not Button1MotionMask.
4575 (workAreaButtonRelease): send always a InsetButtonRelease event to
4577 (checkInsetHit): some setCursor fixes (always with insets).
4579 * src/BufferView2.C (lockInset): returns a bool now and extended for
4580 locking insets inside insets.
4581 (showLockedInsetCursor): it is important to have the cursor always
4582 before the locked inset.
4583 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
4585 * src/BufferView.h: made lockInset return a bool.
4587 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
4589 * src/text2.C (SetCursor): This now has a version with a LyXCursor
4590 that is used also internally but can be called as public to have back
4591 a cursor pos which is not set internally.
4592 (SetCursorIntern): Changed to use above function.
4594 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
4596 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4601 * NEWS: updated for prerelease of 1.1.5. Please comment and send
4602 patches for things that should be in or should be changed.
4604 * src/* [insetfiles]: change "usigned char fragile" to bool
4605 fragile. There was only one point that could that be questioned
4606 and that is commented in formulamacro.C. Grep for "CHECK".
4608 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
4609 (DeleteBuffer): take it out of CutAndPaste and make it static.
4611 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4613 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
4614 output the spacing envir commands. Also the new commands used in
4615 the LaTeX output makes the result better.
4617 * src/Spacing.C (writeEnvirBegin): new method
4618 (writeEnvirEnd): new method
4620 2000-04-18 Juergen Vigna <jug@sad.it>
4622 * src/CutAndPaste.C: made textclass a static member of the class
4623 as otherwise it is not accesed right!!!
4625 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
4627 * forms/layout_forms.fd
4628 * src/layout_forms.h
4629 * src/layout_forms.C (create_form_form_character)
4630 * src/lyx_cb.C (UserFreeFont)
4631 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
4632 documents (in the layout->character popup).
4634 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4636 * src/spellchecker.C (create_ispell_pipe): fix a bug where
4637 \spell_command was in fact not honored (from Kevin Atkinson).
4639 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
4642 * src/lyx_gui.h: make lyxViews private (Angus)
4644 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
4646 * src/mathed/math_write.C
4647 (MathMatrixInset::Write) Put \protect before \begin{array} and
4648 \end{array} if fragile
4649 (MathParInset::Write): Put \protect before \\ if fragile
4651 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
4653 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
4654 initialization if the LyXColorHandler must be done after the
4655 connections to the XServer has been established.
4657 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
4658 get the background pixel from the lyxColorhandler so that the
4659 figures are rendered with the correct background color.
4660 (NextToken): removed functions.
4661 (GetPSSizes): use ifs >> string instead of NextToken.
4663 * src/Painter.[Ch]: the color cache moved out of this file.
4665 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
4668 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
4670 * src/WorkArea.C (work_area_handler): call BufferView::enterView
4671 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
4673 * src/BufferView.C (enterView): new func
4674 (leaveView): new func
4676 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
4678 (leaveView): new func, undefines xterm cursor when approp.
4680 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
4681 (AllowInput): delete the Workarea cursor handling from this func.
4683 * src/Painter.C (underline): draw a slimer underline in most cases.
4685 * src/lyx_main.C (error_handler): use extern "C"
4687 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4689 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
4690 sent directly to me.
4692 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
4693 to the list by Dekel.
4695 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
4698 * src/bufferview_funcs.[Ch]: two new files, moved several of the
4699 methods from lyx_cb.here.
4701 * src/lyx_cb.C: in addition to the above; removed input_prohibited
4704 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4706 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
4707 instead of using current_view directly.
4709 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
4711 * src/LyXAction.C (init): add the paragraph-spacing command.
4713 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
4715 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
4717 * src/lyx_cb.C (CurrentState): output a string when the spacing is
4718 different from the documents.
4720 * src/text.C (SetHeightOfRow): take paragraph spacing into
4721 account, paragraph spacing takes precedence over buffer spacing
4722 (GetVisibleRow): ditto
4724 * src/paragraph.C (writeFile): output the spacing parameter too.
4725 (validate): set the correct features if spacing is used in the
4727 (Clear): set spacing to default
4728 (MakeSameLayout): spacing too
4729 (HasSameLayout): spacing too
4730 (SetLayout): spacing too
4731 (TeXOnePar): output the spacing commands
4733 * src/lyxparagraph.h: added a spacing variable for use with
4734 per-paragraph spacing.
4736 * src/Spacing.h: add a Default spacing and a method to check if
4737 the current spacing is default. also added an operator==
4739 * src/text2.C (DeleteEmptyParagraphMechanism): added a
4742 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4744 * src/lyxserver.C (callback): fix dispatch of functions
4746 * src/insets/insetlatexaccent.C (checkContents): turn bogus
4747 printf() into lyxerr call.
4749 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
4752 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
4753 "Table" to "Table Box", "Float" to "Floating Material"; deletes
4754 the "Float" from each of the subitems.
4755 (ShowHelpMenu): add entry for "FAQ" and "TOC".
4757 * src/support/DebugStream.h: add an #ifdef to work around a gcc
4758 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
4759 documented the change so that the workaround can be nuked later.
4761 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
4764 * src/lyxlex_pimpl.C (next): do not re-declare the default value
4766 * src/buffer.C (getLatexName): ditto
4767 (setReadonly): ditto
4769 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
4771 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
4772 avoid some uses of current_view. Added also a bufferParams()
4773 method to get at this.
4775 * src/lyxtext.h: changed params->buffer and paramters->bparams.
4777 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4779 * src/lyxparagraph.[Ch]: removed
4780 operator<(LyXParagraph::InsetTable..., added a struct matchIT
4781 with operators used by lower_bound and
4782 upper_bound in InsetTable's
4783 Make struct InsetTable private again. Used matchpos.
4785 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
4787 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
4788 document, the language of existing text is changed (unless the
4789 document is multi-lingual)
4791 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
4793 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
4795 * A lot of files: A rewrite of the Right-to-Left support.
4797 2000-04-10 Juergen Vigna <jug@sad.it>
4799 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
4800 misplaced cursor when inset in inset is locked.
4802 * src/insets/insettext.C (LocalDispatch): small fix so that a
4803 BREAKLINE is not inserted if we don't permit it with autBreakRows.
4805 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
4806 footnote font should be decreased in size twice when displaying.
4808 * src/insets/insettext.C (GetDrawFont): inserted this function as
4809 the drawing-font may differ from the real paragraph font.
4811 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
4812 insets (inset in inset!).
4814 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
4815 function here because we don't want footnotes inside footnotes.
4817 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
4819 (init): now set the inset_owner in paragraph.C
4820 (LocalDispatch): added some resetPos() in the right position
4823 (pasteSelection): changed to use the new CutAndPaste-Class.
4825 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
4826 which tells if it is allowed to insert another inset inside this one.
4828 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
4829 SwitchLayoutsBetweenClasses.
4831 * src/text2.C (InsertInset): checking of the new paragraph-function
4833 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
4834 is not needed anymore here!
4837 (PasteSelection): redone (also with #ifdef) so that now this uses
4838 the CutAndPaste-Class.
4839 (SwitchLayoutsBetweenClasses): removed here and implemented in the
4842 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
4843 from/to text/insets.
4845 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
4846 so that the paragraph knows if it is inside an (text)-inset.
4847 (InsertFromMinibuffer): changed return-value to bool as now it
4848 may happen that an inset is not inserted in the paragraph.
4849 (InsertInsetAllowed): this checks if it is allowed to insert an
4850 inset in this paragraph.
4852 (BreakParagraphConservative):
4853 (BreakParagraph) : small change for the above change of the return
4854 value of InsertFromMinibuffer.
4856 * src/lyxparagraph.h: added inset_owner and the functions to handle
4857 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
4859 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
4861 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
4862 functions from BufferView to BufferView::Pimpl to ease maintence.
4864 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
4865 correctly. Also use SetCursorIntern instead of SetCursor.
4867 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
4870 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
4872 * src/WorkArea.C (belowMouse): manually implement below mouse.
4874 * src/*: Add "explicit" on several constructors, I added probably
4875 some unneeded ones. A couple of changes to code because of this.
4877 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
4878 implementation and private parts from the users of BufferView. Not
4881 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
4882 implementation and private parts from the users of LyXLex. Not
4885 * src/BufferView_pimpl.[Ch]: new files
4887 * src/lyxlex_pimpl.[Ch]: new files
4889 * src/LyXView.[Ch]: some inline functions move out-of-line
4891 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4893 * src/lyxparagraph.h: make struct InsetTable public.
4895 * src/support/lyxstring.h: change lyxstring::difference_type to be
4896 ptrdiff_t. Add std:: modifiers to streams.
4898 * src/font.C: include the <cctype> header, for islower() and
4901 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4903 * src/font.[Ch]: new files. Contains the metric functions for
4904 fonts, takes a LyXFont as parameter. Better separation of concepts.
4906 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
4907 changes because of this.
4909 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
4911 * src/*: compile with -Winline and move functions that don't
4914 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
4917 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4919 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
4920 (various files changed because of this)
4922 * src/Painter.C (text): fixed the drawing of smallcaps.
4924 * src/lyxfont.[Ch] (drawText): removed unused member func.
4927 * src/*.C: added needed "using" statements and "std::" qualifiers.
4929 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4931 * src/*.h: removed all use of "using" from header files use
4932 qualifier std:: instead.
4934 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4936 * src/text.C (Backspace): some additional cleanups (we already
4937 know whether cursor.pos is 0 or not).
4939 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
4940 automake does not provide one).
4942 * src/bmtable.h: replace C++ comments with C comments.
4944 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
4946 * src/screen.C (ShowCursor): Change the shape of the cursor if
4947 the current language is not equal to the language of the document.
4948 (If the cursor change its shape unexpectedly, then you've found a bug)
4950 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
4953 * src/insets/insetnumber.[Ch]: New files.
4955 * src/LyXAction.C (init)
4956 * src/lyxfunc.C (dispatch): Add command number-inset-insert
4959 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
4961 * src/lyxparagraph.h
4962 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
4963 (the vector is kept sorted).
4965 * src/text.C (GetVisibleRow): Draw selection correctly when there
4966 is both LTR and RTL text.
4968 * src/paragraph.C (Clone): Use the assignment operator for cloning,
4969 which is much faster.
4971 * src/text.C (GetVisibleRow and other): Do not draw the last space
4972 in a row if the direction of the last letter is not equal to the
4973 direction of the paragraph.
4975 * src/lyxfont.C (latexWriteStartChanges):
4976 Check that font language is not equal to basefont language.
4977 (latexWriteEndChanges): ditto
4979 * src/lyx_cb.C (StyleReset): Don't change the language while using
4980 the font-default command.
4982 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
4983 empty paragraph before a footnote.
4985 * src/insets/insetcommand.C (draw): Increase x correctly.
4987 * src/screen.C (ShowCursor): Change cursor shape if
4988 current language != document language.
4990 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
4992 2000-03-31 Juergen Vigna <jug@sad.it>
4994 * src/paragraph.C (GetInset): commented out text[pos] = ' '
4995 (Clone): changed mode how the paragraph-data is copied to the
4996 new clone-paragraph.
4998 * src/lyxfunc.C (Dispatch): fixed small problem when calling
4999 GetInset(pos) with no inset anymore there (in inset UNDO)
5001 * src/insets/insetcommand.C (draw): small fix as here x is
5002 incremented not as much as width() returns (2 before, 2 behind = 4)
5004 2000-03-30 Juergen Vigna <jug@sad.it>
5006 * src/insets/insettext.C (InsetText): small fix in initialize
5007 widthOffset (should not be done in the init() function)
5009 2000-03-29 Amir Karger <karger@lyx.org>
5011 * lib/examples/it_ItemizeBullets.lyx: translation by
5014 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5016 2000-03-29 Juergen Vigna <jug@sad.it>
5018 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5020 * src/insets/insetfoot.C (Clone): small change as for the below
5021 new init function in the text-inset
5023 * src/insets/insettext.C (init): new function as I've seen that
5024 clone did not copy the Paragraph-Data!
5025 (LocalDispatch): Added code so that now we have some sort of Undo
5026 functionality (well actually we HAVE Undo ;)
5028 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5030 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5032 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5035 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5037 * src/main.C: added a runtime check that verifies that the xforms
5038 header used when building LyX and the library used when running
5039 LyX match. Exit with a message if they don't match. This is a
5040 version number check only.
5042 * src/buffer.C (save): Don't allocate memory on the heap for
5043 struct utimbuf times.
5045 * *: some using changes, use iosfwd instead of the real headers.
5047 * src/lyxfont.C use char const * instead of string for the static
5048 strings. Rewrite some functions to use sstream.
5050 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5052 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5055 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5057 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5058 of Geodesy (from Martin Vermeer)
5060 * lib/layouts/svjour.inc: include file for the Springer svjour
5061 class. It can be used to support journals other than JoG.
5063 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5064 Miskiewicz <misiek@pld.org.pl>)
5065 * lib/reLyX/Makefile.am: ditto.
5067 2000-03-27 Juergen Vigna <jug@sad.it>
5069 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5070 also some modifications with operations on selected text.
5072 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5073 problems with clicking on insets (last famous words ;)
5075 * src/insets/insetcommand.C (draw):
5076 (width): Changed to have a bit of space before and after the inset so
5077 that the blinking cursor can be seen (otherwise it was hidden)
5079 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5081 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5082 would not be added to the link list when an installed gettext (not
5083 part of libc) is found.
5085 2000-03-24 Juergen Vigna <jug@sad.it>
5087 * src/insets/insetcollapsable.C (Edit):
5088 * src/mathed/formula.C (InsetButtonRelease):
5089 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5092 * src/BufferView.C (workAreaButtonPress):
5093 (workAreaButtonRelease):
5094 (checkInsetHit): Finally fixed the clicking on insets be handled
5097 * src/insets/insetert.C (Edit): inserted this call so that ERT
5098 insets work always with LaTeX-font
5100 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5102 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5103 caused lyx to startup with no GUI in place, causing in a crash
5104 upon startup when called with arguments.
5106 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5108 * src/FontLoader.C: better initialization of dummyXFontStruct.
5110 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5112 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5113 for linuxdoc and docbook import and export format options.
5115 * lib/lyxrc.example Example of default values for the previous flags.
5117 * src/lyx_cb.C Use those flags instead of the hardwired values for
5118 linuxdoc and docbook export.
5120 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5123 * src/menus.C Added menus entries for the new import/exports formats.
5125 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5127 * src/lyxrc.*: Added support for running without Gui
5130 * src/FontLoader.C: sensible defaults if no fonts are needed
5132 * src/lyx_cb.C: New function ShowMessage (writes either to the
5133 minibuffer or cout in case of no gui
5134 New function AskOverwrite for common stuff
5135 Consequently various changes to call these functions
5137 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5138 wild guess at sensible screen resolution when having no gui
5140 * src/lyxfont.C: no gui, no fonts... set some defaults
5142 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5144 * src/LColor.C: made the command inset background a bit lighter.
5146 2000-03-20 Hartmut Goebel <goebel@noris.net>
5148 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5149 stdstruct.inc. Koma-Script added some title elements which
5150 otherwise have been listed below "bibliography". This split allows
5151 adding title elements to where they belong.
5153 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5154 define the additional tilte elements and then include
5157 * many other layout files: changed to include stdtitle.inc just
5158 before stdstruct.inc.
5160 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5162 * src/buffer.C: (save) Added the option to store all backup files
5163 in a single directory
5165 * src/lyxrc.[Ch]: Added variable \backupdir_path
5167 * lib/lyxrc.example: Added descriptions of recently added variables
5169 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5170 bibtex inset, not closing the bibtex popup when deleting the inset)
5172 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5174 * src/lyx_cb.C: add a couple using directives.
5176 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5177 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5178 import based on the filename.
5180 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5181 file would be imported at start, if the filename where of a sgml file.
5183 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5185 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5187 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5188 * src/lyxfont.h Replaced the member variable bits.direction by the
5189 member variable lang. Made many changes in other files.
5190 This allows having a multi-lingual document
5192 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5193 that change the current language to <l>.
5194 Removed the command "font-rtl"
5196 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5197 format for Hebrew documents)
5199 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5200 When auto_mathmode is "true", pressing a digit key in normal mode
5201 will cause entering into mathmode.
5202 If auto_mathmode is "rtl" then this behavior will be active only
5203 when writing right-to-left text.
5205 * src/text2.C (InsertStringA) The string is inserted using the
5208 * src/paragraph.C (GetEndLabel) Gives a correct result for
5209 footnote paragraphs.
5211 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5213 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5215 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5216 front of PasteParagraph. Never insert a ' '. This should at least
5217 fix some cause for the segfaults that we have been experiencing,
5218 it also fixes backspace behaviour slightly. (Phu!)
5220 * src/support/lstrings.C (compare_no_case): some change to make it
5221 compile with gcc 2.95.2 and stdlibc++-v3
5223 * src/text2.C (MeltFootnoteEnvironment): change type o
5224 first_footnote_par_is_not_empty to bool.
5226 * src/lyxparagraph.h: make text private. Changes in other files
5228 (fitToSize): new function
5229 (setContentsFromPar): new function
5230 (clearContents): new function
5231 (SetChar): new function
5233 * src/paragraph.C (readSimpleWholeFile): deleted.
5235 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5236 the file, just use a simple string instead. Also read the file in
5237 a more maintainable manner.
5239 * src/text2.C (InsertStringA): deleted.
5240 (InsertStringB): deleted.
5242 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5244 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5245 RedoParagraphs from the doublespace handling part, just set status
5246 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5247 done, but perhaps not like this.)
5249 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5251 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5252 character when inserting an inset.
5254 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5256 * src/bufferparams.C (readLanguage): now takes "default" into
5259 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5260 also initialize the toplevel_keymap with the default bindings from
5263 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5265 * all files using lyxrc: have lyxrc as a real variable and not a
5266 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5269 * src/lyxrc.C: remove double call to defaultKeyBindings
5271 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5272 toolbar defauls using lyxlex. Remove enums, structs, functions
5275 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5276 toolbar defaults. Also store default keybindings in a map.
5278 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5279 storing the toolbar defaults without any xforms dependencies.
5281 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5282 applied. Changed to use iterators.
5284 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5286 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5287 systems that don't have LINGUAS set to begin with.
5289 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5291 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5292 the list by Dekel Tsur.
5294 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5296 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5297 * src/insets/form_graphics.C: ditto.
5299 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5301 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5303 * src/bufferparams.C (readLanguage): use the new language map
5305 * src/intl.C (InitKeyMapper): use the new language map
5307 * src/lyx_gui.C (create_forms): use the new language map
5309 * src/language.[Ch]: New files. Used for holding the information
5310 about each language. Now! Use this new language map enhance it and
5311 make it really usable for our needs.
5313 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5315 * screen.C (ShowCursor): Removed duplicate code.
5316 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5317 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5319 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5322 * src/text.C Added TransformChar method. Used for rendering Arabic
5323 text correctly (change the glyphs of the letter according to the
5324 position in the word)
5329 * src/lyxrc.C Added lyxrc command {language_command_begin,
5330 language_command_end,language_command_ltr,language_command_rtl,
5331 language_package} which allows the use of either arabtex or Omega
5334 * src/lyx_gui.C (init)
5336 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5337 to use encoding for menu fonts which is different than the encoding
5340 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5341 do not load the babel package.
5342 To write an English document with Hebrew/Arabic, change the document
5343 language to "english".
5345 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5346 (alphaCounter): changed to return char
5347 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5349 * lib/lyxrc.example Added examples for Hebrew/Arabic
5352 * src/layout.C Added layout command endlabeltype
5354 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5356 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5358 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5360 * src/mathed/math_delim.C (search_deco): return a
5361 math_deco_struct* instead of index.
5363 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5365 * All files with a USE_OSTREAM_ONLY within: removed all code that
5366 was unused when USE_OSTREAM_ONLY is defined.
5368 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5369 of any less. Removed header and using.
5371 * src/text.C (GetVisibleRow): draw the string "Page Break
5372 (top/bottom)" on screen when drawing a pagebreak line.
5374 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5376 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5378 * src/mathed/math_macro.C (draw): do some cast magic.
5381 * src/mathed/math_defs.h: change byte* argument to byte const*.
5383 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5385 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5386 know it is right to return InsetFoot* too, but cxx does not like
5389 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5391 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5393 * src/mathed/math_delim.C: change == to proper assignment.
5395 2000-03-09 Juergen Vigna <jug@sad.it>
5397 * src/insets/insettext.C (setPos): fixed various cursor positioning
5398 problems (via mouse and cursor-keys)
5399 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5400 inset (still a small display problem but it works ;)
5402 * src/insets/insetcollapsable.C (draw): added button_top_y and
5403 button_bottom_y to have correct values for clicking on the inset.
5405 * src/support/lyxalgo.h: commented out 'using std::less'
5407 2000-03-08 Juergen Vigna <jug@sad.it>
5409 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5410 Button-Release event closes as it is alos the Release-Event
5413 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5415 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5417 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5418 can add multiple spaces in Scrap (literate programming) styles...
5419 which, by the way, is how I got hooked on LyX to begin with.
5421 * src/mathed/formula.C (Write): Added dummy variable to an
5422 inset::Latex() call.
5423 (Latex): Add free_spacing boolean to inset::Latex()
5425 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5427 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5428 virtual function to include the free_spacing boolean from
5429 the containing paragraph's style.
5431 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5432 Added free_spacing boolean arg to match inset.h
5434 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5435 Added free_spacing boolean arg to match inset.h
5437 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5438 Added free_spacing boolean and made sure that if in a free_spacing
5439 paragraph, that we output normal space if there is a protected space.
5441 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5442 Added free_spacing boolean arg to match inset.h
5444 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5445 Added free_spacing boolean arg to match inset.h
5447 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5448 Added free_spacing boolean arg to match inset.h
5450 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5451 Added free_spacing boolean arg to match inset.h
5453 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5454 Added free_spacing boolean arg to match inset.h
5456 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5457 free_spacing boolean arg to match inset.h
5459 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5460 Added free_spacing boolean arg to match inset.h
5462 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5463 Added free_spacing boolean arg to match inset.h
5465 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5466 Added free_spacing boolean arg to match inset.h
5468 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5469 Added free_spacing boolean arg to match inset.h
5471 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5472 Added free_spacing boolean arg to match inset.h
5474 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5475 free_spacing boolean arg to match inset.h
5477 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5478 free_spacing boolean arg to match inset.h
5480 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5481 ignore free_spacing paragraphs. The user's spaces are left
5484 * src/text.C (InsertChar): Fixed the free_spacing layout
5485 attribute behavior. Now, if free_spacing is set, you can
5486 add multiple spaces in a paragraph with impunity (and they
5487 get output verbatim).
5488 (SelectSelectedWord): Added dummy argument to inset::Latex()
5491 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
5494 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
5495 paragraph layouts now only input a simple space instead.
5496 Special character insets don't make any sense in free-spacing
5499 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
5500 hard-spaces in the *input* file to simple spaces if the layout
5501 is free-spacing. This converts old files which had to have
5502 hard-spaces in free-spacing layouts where a simple space was
5504 (writeFileAscii): Added free_spacing check to pass to the newly
5505 reworked inset::Latex(...) methods. The inset::Latex() code
5506 ensures that hard-spaces in free-spacing paragraphs get output
5507 as spaces (rather than "~").
5509 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5511 * src/mathed/math_delim.C (draw): draw the empty placeholder
5512 delims with a onoffdash line.
5513 (struct math_deco_compare): struct that holds the "functors" used
5514 for the sort and the binary search in math_deco_table.
5515 (class init_deco_table): class used for initial sort of the
5517 (search_deco): use lower_bound to do a binary search in the
5520 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5522 * src/lyxrc.C: a small secret thingie...
5524 * src/lyxlex.C (printTable): changed to take a ostream as paramter
5525 and to not flush the stream as often as it used to.
5527 * src/support/lyxalgo.h: new file
5528 (sorted): template function used for checking if a sequence is
5529 sorted or not. Two versions with and without user supplied
5530 compare. Uses same compare as std::sort.
5532 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
5533 it and give warning on lyxerr.
5535 (struct compare_tags): struct with function operators used for
5536 checking if sorted, sorting and lower_bound.
5537 (search_kw): use lower_bound instead of manually implemented
5540 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5542 * src/insets/insetcollapsable.h: fix Clone() declaration.
5543 * src/insets/insetfoot.h: ditto.
5545 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
5547 2000-03-08 Juergen Vigna <jug@sad.it>
5549 * src/insets/lyxinset.h: added owner call which tells us if
5550 this inset is inside another inset. Changed also the return-type
5551 of Editable to an enum so it tells clearer what the return-value is.
5553 * src/insets/insettext.C (computeTextRows): fixed computing of
5554 textinsets which split automatically on more rows.
5556 * src/insets/insetert.[Ch]: changed this to be of BaseType
5559 * src/insets/insetfoot.[Ch]: added footnote inset
5561 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
5562 collapsable insets (like footnote, ert, ...)
5564 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5566 * src/lyxdraw.h: remvoe file
5568 * src/lyxdraw.C: remove file
5570 * src/insets/insettext.C: added <algorithm>.
5572 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
5574 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
5575 (matrix_cb): case MM_OK use string stream
5577 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
5580 * src/mathed/math_macro.C (draw): use string stream
5581 (Metrics): use string stream
5583 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
5584 directly to the ostream.
5586 * src/vspace.C (asString): use string stream.
5587 (asString): use string stream
5588 (asLatexString): use string stream
5590 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
5591 setting Spacing::Other.
5593 * src/LaTeXFeatures.C (getPackages): use string stream instead of
5594 sprintf when creating the stretch vale.
5596 * src/text2.C (alphaCounter): changed to return a string and to
5597 not use a static variable internally. Also fixed a one-off bug.
5598 (SetCounter): changed the drawing of the labels to use string
5599 streams instead of sprintf.
5601 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
5602 manipulator to use a scheme that does not require library support.
5603 This is also the way it is done in the new GNU libstdc++. Should
5604 work with DEC cxx now.
5606 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5608 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
5609 end. This fixes a bug.
5611 * src/mathed (all files concerned with file writing): apply the
5612 USE_OSTREAM_ONLY changes to mathed too.
5614 * src/support/DebugStream.h: make the constructor explicit.
5616 * src/lyxfont.C (latexWriteStartChanges): small bug related to
5617 count and ostream squashed.
5619 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5621 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
5623 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
5624 ostringstream uses STL strings, and we might not.
5626 * src/insets/insetspecialchar.C: add using directive.
5627 * src/insets/insettext.C: ditto.
5629 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5631 * lib/layouts/seminar.layout: feeble attempt at a layout for
5632 seminar.cls, far from completet and could really use some looking
5633 at from people used to write layout files.
5635 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
5636 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
5637 a lot nicer and works nicely with ostreams.
5639 * src/mathed/formula.C (draw): a slightly different solution that
5640 the one posted to the list, but I think this one works too. (font
5641 size wrong in headers.)
5643 * src/insets/insettext.C (computeTextRows): some fiddling on
5644 Jürgens turf, added some comments that he should read.
5646 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
5647 used and it gave compiler warnings.
5648 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
5651 * src/lyx_gui.C (create_forms): do the right thing when
5652 show_banner is true/false.
5654 * src/lyx_cb.C (TimerCB): no need to close or do anything if
5655 show_banner is false.
5657 * most file writing files: Now use iostreams to do almost all of
5658 the writing. Also instead of passing string &, we now use
5659 stringstreams. mathed output is still not adapted to iostreams.
5660 This change can be turned off by commenting out all the occurences
5661 of the "#define USE_OSTREAM_ONLY 1" lines.
5663 * src/WorkArea.C (createPixmap): don't output debug messages.
5664 (WorkArea): don't output debug messages.
5666 * lib/lyxrc.example: added a comment about the new variable
5669 * development/Code_rules/Rules: Added some more commente about how
5670 to build class interfaces and on how better encapsulation can be
5673 2000-03-03 Juergen Vigna <jug@sad.it>
5675 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
5676 automatically with the width of the LyX-Window
5678 * src/insets/insettext.C (computeTextRows): fixed update bug in
5679 displaying text-insets (scrollvalues where not initialized!)
5681 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5683 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
5684 id in the check of the result from lower_bound is not enough since
5685 lower_bound can return last too, and then res->id will not be a
5688 * all insets and some code that use them: I have conditionalized
5689 removed the Latex(string & out, ...) this means that only the
5690 Latex(ostream &, ...) will be used. This is a work in progress to
5691 move towards using streams for all output of files.
5693 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
5696 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5698 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
5699 routine (this fixes bug where greek letters were surrounded by too
5702 * src/support/filetools.C (findtexfile): change a bit the search
5703 algorithm, to fix bug introduced in 1.1.4. Note that --format is
5704 no longer passed to kpsewhich, we may have to change that later.
5706 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
5707 warning options to avoid problems with X header files (from Angus
5709 * acinclude.m4: regenerated.
5711 2000-03-02 Juergen Vigna <jug@sad.it>
5713 * src/insets/insettext.C (WriteParagraphData): Using the
5714 par->writeFile() function for writing paragraph-data.
5715 (Read): Using buffer->parseSingleLyXformat2Token()-function
5716 for parsing paragraph data!
5718 * src/buffer.C (readLyXformat2): removed all parse data and using
5719 the new parseSingleLyXformat2Token()-function.
5720 (parseSingleLyXformat2Token): added this function to parse (read)
5721 lyx-file-format (this is called also from text-insets now!)
5723 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5725 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
5728 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
5729 directly instead of going through a func. One very bad thing: a
5730 static LyXFindReplace, but I don't know where to place it.
5732 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
5733 string instead of char[]. Also changed to static.
5734 (GetSelectionOrWordAtCursor): changed to static inline
5735 (SetSelectionOverLenChars): ditto.
5737 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
5738 current_view and global variables. both classes has changed names
5739 and LyXFindReplace is not inherited from SearchForm.
5741 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
5742 fl_form_search form.
5744 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
5746 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5748 * lib/bind/*.bind: make sure 'buffer-previous' function is not
5749 bound (from Kayvan).
5751 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
5753 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
5755 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5757 * some things that I should comment but the local pub says head to
5760 * comment out all code that belongs to the Roff code for Ascii
5761 export of tables. (this is unused)
5763 * src/LyXView.C: use correct type for global variable
5764 current_layout. (LyXTextClass::size_type)
5766 * some code to get the new insetgraphics closer to working I'd be
5767 grateful for any help.
5769 * src/BufferView2.C (insertInset): use the return type of
5770 NumberOfLayout properly. (also changes in other files)
5772 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
5773 this as a test. I want to know what breaks because of this.
5775 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
5777 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
5779 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
5780 to use a \makebox in the label, this allows proper justification
5781 with out using protected spaces or multiple hfills. Now it is
5782 "label" for left justified, "\hfill label\hfill" for center, and
5783 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
5784 should be changed accordingly.
5786 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5788 * src/lyxtext.h: change SetLayout() to take a
5789 LyXTextClass::size_type instead of a char (when there is more than
5790 127 layouts in a class); also change type of copylayouttype.
5791 * src/text2.C (SetLayout): ditto.
5792 * src/LyXView.C (updateLayoutChoice): ditto.
5794 * src/LaTeX.C (scanLogFile): errors where the line number was not
5795 given just after the '!'-line were ignored (from Dekel Tsur).
5797 * lib/lyxrc.example: fix description of \date_insert_format
5799 * lib/layouts/llncs.layout: new layout, contributed by Martin
5802 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5804 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
5805 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
5806 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
5807 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
5808 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
5809 paragraph.C, text.C, text2.C)
5811 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5813 * src/insets/insettext.C (LocalDispatch): remove extra break
5816 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
5817 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
5819 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
5820 * src/insets/insettext.[Ch] (GetCursorPos): ditto
5822 * src/insets/insetbib.h: move InsetBibkey::Holder and
5823 InsetCitation::Holder in public space.
5825 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5827 * src/insets/insettext.h: small change to get the new files from
5828 Juergen to compile (use "string", not "class string").
5830 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
5831 const & as parameter to LocalDispatch, use LyXFont const & as
5832 paramter to some other func. This also had impacto on lyxinsets.h
5833 and the two mathed insets.
5835 2000-02-24 Juergen Vigna <jug@sad.it>
5838 * src/commandtags.h:
5840 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
5844 * src/BufferView2.C: added/updated code for various inset-functions
5846 * src/insets/insetert.[Ch]: added implementation of InsetERT
5848 * src/insets/insettext.[Ch]: added implementation of InsetText
5850 * src/insets/inset.C (Edit): added "unsigned int button" parameter
5851 (draw): added preliminary code for inset scrolling not finshed yet
5853 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
5854 as it is in lyxfunc.C now
5856 * src/insets/lyxinset.h: Added functions for text-insets
5858 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5860 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
5861 BufferView and reimplement the list as a queue put inside its own
5864 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
5866 * several files: use the new interface to the "updateinsetlist"
5868 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
5870 (work_area_handler): call BufferView::trippleClick on trippleclick.
5872 * src/BufferView.C (doubleClick): new function, selects word on
5874 (trippleClick): new function, selects line on trippleclick.
5876 2000-02-22 Allan Rae <rae@lyx.org>
5878 * lib/bind/xemacs.bind: buffer-previous not supported
5880 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5882 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
5885 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5887 * src/bufferlist.C: get rid of current_view from this file
5889 * src/spellchecker.C: get rid of current_view from this file
5891 * src/vspace.C: get rid of current_view from this file
5892 (inPixels): added BufferView parameter for this func
5893 (asLatexCommand): added a BufferParams for this func
5895 * src/text.C src/text2.C: get rid of current_view from these
5898 * src/lyxfont.C (getFontDirection): move this function here from
5901 * src/bufferparams.C (getDocumentDirection): move this function
5904 * src/paragraph.C (getParDirection): move this function here from
5906 (getLetterDirection): ditto
5908 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5910 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
5911 resize due to wrong pixmap beeing used. Also took the opurtunity
5912 to make the LyXScreen stateless on regard to WorkArea and some
5913 general cleanup in the same files.
5915 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5917 * src/Makefile.am: add missing direction.h
5919 * src/PainterBase.h: made the width functions const.
5921 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
5924 * src/insets/insetcommand.C (draw): draw Editable as buttons.
5926 * src/insets/insetlatexaccent.C (draw): make the accents draw
5927 better, at present this will only work well with iso8859-1.
5929 * several files: remove the old drawing code, now we use the new
5932 * several files: remove support for mono_video, reverse_video and
5935 2000-02-17 Juergen Vigna <jug@sad.it>
5937 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
5938 int ** as we have to return the pointer, otherwise we have only
5939 NULL pointers in the returning function.
5941 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5943 * src/LaTeX.C (operator()): quote file name when running latex.
5945 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5947 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
5948 (bubble tip), this removes our special handling of this.
5950 * Remove all code that is unused now that we have the new
5951 workarea. (Code that are not active when NEW_WA is defined.)
5953 * Make the uses of XSync not conditionalized on define USE_XSYNC.
5955 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5957 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
5958 nonexisting layout; correctly redirect obsoleted layouts.
5960 * lib/lyxrc.example: document \view_dvi_paper_option
5962 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
5965 * src/lyx_cb.C (RunScript): handle $$FName for command names.
5966 (PreviewDVI): handle the view_dvi_paper_option variable.
5967 [Both from Roland Krause]
5969 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5971 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
5972 char const *, int, LyXFont)
5973 (text(int, int, string, LyXFont)): ditto
5975 * src/text.C (InsertCharInTable): attempt to fix the double-space
5976 feature in tables too.
5977 (BackspaceInTable): ditto.
5978 (GetVisibleRow): make bottom pagebreak line be a onoff line.
5980 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5982 * src/text2.C (owner): only complain if owner_ is set and bv != 0
5984 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
5985 newly found text in textcache to this.
5986 (buffer): set the owner of the text put into the textcache to 0
5988 * src/insets/figinset.C (draw): fixed the drawing of figures with
5991 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
5992 drawing of mathframe, hfills, protected space, table lines. I have
5993 now no outstanding drawing problems with the new Painter code.
5995 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5997 * src/PainterBase.C (ellipse, circle): do not specify the default
6000 * src/LColor.h: add using directive.
6002 * src/Painter.[Ch]: change return type of methods from Painter& to
6003 PainterBase&. Add a using directive.
6005 * src/WorkArea.C: wrap xforms callbacks in C functions
6008 * lib/layouts/foils.layout: font fix and simplifications from Carl
6011 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6013 * a lot of files: The Painter, LColor and WorkArea from the old
6014 devel branch has been ported to lyx-devel. Some new files and a
6015 lot of #ifdeffed code. The new workarea is enabled by default, but
6016 if you want to test the new Painter and LColor you have to compile
6017 with USE_PAINTER defined (do this in config.h f.ex.) There are
6018 still some rought edges, and I'd like some help to clear those
6019 out. It looks stable (loads and displays the Userguide very well).
6022 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6024 * src/buffer.C (pop_tag): revert to the previous implementation
6025 (use a global variable for both loops).
6027 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6029 * src/lyxrc.C (LyXRC): change slightly default date format.
6031 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6032 there is an English text with a footnote that starts with a Hebrew
6033 paragraph, or vice versa.
6034 (TeXFootnote): ditto.
6036 * src/text.C (LeftMargin): allow for negative values for
6037 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6040 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6041 for input encoding (cyrillic)
6043 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6045 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6048 * src/toolbar.C (set): ditto
6049 * src/insets/insetbib.C (create_form_citation_form): ditto
6051 * lib/CREDITS: added Dekel Tsur.
6053 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6054 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6055 hebrew supports files from Dekel Tsur.
6057 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6058 <tzafrir@technion.ac.il>
6060 * src/lyxrc.C: put \date_insert_format at the right place.
6062 * src/buffer.C (makeLaTeXFile): fix the handling of
6063 BufferParams::sides when writing out latex files.
6065 * src/BufferView2.C: add a "using" directive.
6067 * src/support/lyxsum.C (sum): when we use lyxstring,
6068 ostringstream::str needs an additional .c_str().
6070 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6072 * src/support/filetools.C (ChangeExtension): patch from Etienne
6075 * src/TextCache.C (show): remove const_cast and make second
6076 parameter non-const LyXText *.
6078 * src/TextCache.h: use non const LyXText in show.
6080 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6083 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6085 * src/support/lyxsum.C: rework to be more flexible.
6087 * several places: don't check if a pointer is 0 if you are going
6090 * src/text.C: remove some dead code.
6092 * src/insets/figinset.C: remove some dead code
6094 * src/buffer.C: move the BufferView funcs to BufferView2.C
6095 remove all support for insetlatexdel
6096 remove support for oldpapersize stuff
6097 made some member funcs const
6099 * src/kbmap.C: use a std::list to store the bindings in.
6101 * src/BufferView2.C: new file
6103 * src/kbsequence.[Ch]: new files
6105 * src/LyXAction.C + others: remove all trace of buffer-previous
6107 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6108 only have one copy in the binary of this table.
6110 * hebrew patch: moved some functions from LyXText to more
6111 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6113 * several files: remove support for XForms older than 0.88
6115 remove some #if 0 #endif code
6117 * src/TextCache.[Ch]: new file. Holds the textcache.
6119 * src/BufferView.C: changes to use the new TextCache interface.
6120 (waitForX): remove the now unused code.
6122 * src/BackStack.h: remove some commented code
6124 * lib/bind/emacs.bind: remove binding for buffer-previous
6126 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6128 * applied the hebrew patch.
6130 * src/lyxrow.h: make sure that all Row variables are initialized.
6132 * src/text2.C (TextHandleUndo): comment out a delete, this might
6133 introduce a memory leak, but should also help us to not try to
6134 read freed memory. We need to look at this one.
6136 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6137 (LyXParagraph): initalize footnotekind.
6139 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6140 forgot this when applying the patch. Please heed the warnings.
6142 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6143 (aka. reformat problem)
6145 * src/bufferlist.C (exists): made const, and use const_iterator
6146 (isLoaded): new func.
6147 (release): use std::find to find the correct buffer.
6149 * src/bufferlist.h: made getState a const func.
6150 made empty a const func.
6151 made exists a const func.
6154 2000-02-01 Juergen Vigna <jug@sad.it>
6156 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6158 * po/it.po: updated a bit the italian po file and also changed the
6159 'file nuovo' for newfile to 'filenuovo' without a space, this did
6162 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6163 for the new insert_date command.
6165 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6166 from jdblair, to insert a date into the current text conforming to
6167 a strftime format (for now only considering the locale-set and not
6168 the document-language).
6170 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6172 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6173 Bounds Read error seen by purify. The problem was that islower is
6174 a macros which takes an unsigned char and uses it as an index for
6175 in array of characters properties (and is thus subject to the
6179 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6180 correctly the paper sides radio buttons.
6181 (UpdateDocumentButtons): ditto.
6183 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6185 * src/kbmap.C (getsym + others): change to return unsigned int,
6186 returning a long can give problems on 64 bit systems. (I assume
6187 that int is 32bit on 64bit systems)
6189 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6191 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6192 LyXLookupString to be zero-terminated. Really fixes problems seen
6195 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6197 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6198 write a (char*)0 to the lyxerr stream.
6200 * src/lastfiles.C: move algorithm before the using statemets.
6202 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6204 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6205 complains otherwise).
6206 * src/table.C: ditto
6208 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6211 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6212 that I removed earlier... It is really needed.
6214 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6216 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6218 * INSTALL: update xforms home page URL.
6220 * lib/configure.m4: fix a bug with unreadable layout files.
6222 * src/table.C (calculate_width_of_column): add "using std::max"
6225 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6227 * several files: marked several lines with "DEL LINE", this is
6228 lines that can be deleted without changing anything.
6229 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6230 checks this anyway */
6233 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6235 * src/DepTable.C (update): add a "+" at the end when the checksum
6236 is different. (debugging string only)
6238 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6239 the next inset to not be displayed. This should also fix the list
6240 of labels in the "Insert Crossreference" dialog.
6242 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6244 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6245 when regex was not found.
6247 * src/support/lstrings.C (lowercase): use handcoded transform always.
6250 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6251 old_cursor.par->prev could be 0.
6253 * several files: changed post inc/dec to pre inc/dec
6255 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6256 write the lastfiles to file.
6258 * src/BufferView.C (buffer): only show TextCache info when debugging
6260 (resizeCurrentBuffer): ditto
6261 (workAreaExpose): ditto
6263 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6265 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6267 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6268 a bit better by removing the special case for \i and \j.
6270 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6272 * src/lyx_main.C (easyParse): remove test for bad comand line
6273 options, since this broke all xforms-related parsing.
6275 * src/kbmap.C (getsym): set return type to unsigned long, as
6276 declared in header. On an alpha, long is _not_ the same as int.
6278 * src/support/LOstream.h: add a "using std::flush;"
6280 * src/insets/figinset.C: ditto.
6282 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6284 * src/bufferlist.C (write): use blinding fast file copy instead of
6285 "a char at a time", now we are doing it the C++ way.
6287 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6288 std::list<int> instead.
6289 (addpidwait): reflect move to std::list<int>
6290 (sigchldchecker): ditto
6292 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6295 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6296 that obviously was wrong...
6298 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6299 c, this avoids warnings with purify and islower.
6301 * src/insets/figinset.C: rename struct queue to struct
6302 queue_element and rewrite to use a std::queue. gsqueue is now a
6303 std::queue<queue_element>
6304 (runqueue): reflect move to std::queue
6307 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6308 we would get "1" "0" instead of "true" "false. Also make the tostr
6311 2000-01-21 Juergen Vigna <jug@sad.it>
6313 * src/buffer.C (writeFileAscii): Disabled code for special groff
6314 handling of tabulars till I fix this in table.C
6316 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6318 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6320 * src/support/lyxlib.h: ditto.
6322 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6324 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6325 and 'j' look better. This might fix the "macron" bug that has been
6328 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6329 functions as one template function. Delete the old versions.
6331 * src/support/lyxsum.C: move using std::ifstream inside
6334 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6337 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6339 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6341 * src/insets/figinset.C (InitFigures): use new instead of malloc
6342 to allocate memory for figures and bitmaps.
6343 (DoneFigures): use delete[] instead of free to deallocate memory
6344 for figures and bitmaps.
6345 (runqueue): use new to allocate
6346 (getfigdata): use new/delete[] instead of malloc/free
6347 (RegisterFigure): ditto
6349 * some files: moved some declarations closer to first use, small
6350 whitespace changes use preincrement instead of postincrement where
6351 it does not make a difference.
6353 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6354 step on the way to use stl::containers for key maps.
6356 * src/bufferlist.h: add a typedef for const_iterator and const
6357 versions of begin and end.
6359 * src/bufferlist.[Ch]: change name of member variable _state to
6360 state_. (avoid reserved names)
6362 (getFileNames): returns the filenames of the buffers in a vector.
6364 * configure.in (ALL_LINGUAS): added ro
6366 * src/support/putenv.C: new file
6368 * src/support/mkdir.C: new file
6370 2000-01-20 Allan Rae <rae@lyx.org>
6372 * lib/layouts/IEEEtran.layout: Added several theorem environments
6374 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6375 couple of minor additions.
6377 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6378 (except for those in footnotes of course)
6380 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6382 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6384 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6385 std::sort and std::lower_bound instead of qsort and handwritten
6387 (struct compara): struct that holds the functors used by std::sort
6388 and std::lower_bound in MathedLookupBOP.
6390 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6392 * src/support/LAssert.h: do not do partial specialization. We do
6395 * src/support/lyxlib.h: note that lyx::getUserName() and
6396 lyx::date() are not in use right now. Should these be suppressed?
6398 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6399 (makeLinuxDocFile): do not put date and user name in linuxdoc
6402 * src/support/lyxlib.h (kill): change first argument to long int,
6403 since that's what solaris uses.
6405 * src/support/kill.C (kill): fix declaration to match prototype.
6407 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6408 actually check whether namespaces are supported. This is not what
6411 * src/support/lyxsum.C: add a using directive.
6413 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6415 * src/support/kill.C: if we have namespace support we don't have
6416 to include lyxlib.h.
6418 * src/support/lyxlib.h: use namespace lyx if supported.
6420 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6422 * src/support/date.C: new file
6424 * src/support/chdir.C: new file
6426 * src/support/getUserName.C: new file
6428 * src/support/getcwd.C: new file
6430 * src/support/abort.C: new file
6432 * src/support/kill.C: new file
6434 * src/support/lyxlib.h: moved all the functions in this file
6435 insede struct lyx. Added also kill and abort to this struct. This
6436 is a way to avoid the "kill is not defined in <csignal>", we make
6437 C++ wrappers for functions that are not ANSI C or ANSI C++.
6439 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6440 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6441 lyx it has been renamed to sum.
6443 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6445 * src/text.C: add using directives for std::min and std::max.
6447 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6449 * src/texrow.C (getIdFromRow): actually return something useful in
6450 id and pos. Hopefully fixes the bug with positionning of errorbox
6453 * src/lyx_main.C (easyParse): output an error and exit if an
6454 incorrect command line option has been given.
6456 * src/spellchecker.C (ispell_check_word): document a memory leak.
6458 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6459 where a "struct utimbuf" is allocated with "new" and deleted with
6462 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6464 * src/text2.C (CutSelection): don't delete double spaces.
6465 (PasteSelection): ditto
6466 (CopySelection): ditto
6468 * src/text.C (Backspace): don't delete double spaces.
6470 * src/lyxlex.C (next): fix a bug that were only present with
6471 conformant std::istream::get to read comment lines, use
6472 std::istream::getline instead. This seems to fix the problem.
6474 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6476 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6477 allowed to insert space before space" editing problem. Please read
6478 commends at the beginning of the function. Comments about usage
6481 * src/text.C (InsertChar): fix for the "not allowed to insert
6482 space before space" editing problem.
6484 * src/text2.C (DeleteEmptyParagraphMechanism): when
6485 IsEmptyTableRow can only return false this last "else if" will
6486 always be a no-op. Commented out.
6488 * src/text.C (RedoParagraph): As far as I can understand tmp
6489 cursor is not really needed.
6491 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
6492 present it could only return false anyway.
6493 (several functions): Did something not so smart...added a const
6494 specifier on a lot of methods.
6496 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
6497 and add a tmp->text.resize. The LyXParagraph constructor does the
6499 (BreakParagraphConservative): ditto
6501 * src/support/path.h (Path): add a define so that the wrong usage
6502 "Path("/tmp") will be flagged as a compilation error:
6503 "`unnamed_Path' undeclared (first use this function)"
6505 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6507 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
6508 which was bogus for several reasons.
6510 * src/LaTeX.C (scanAux): fix the regular expression used to scan
6514 * autogen.sh: do not use "type -path" (what's that anyway?).
6516 * src/support/filetools.C (findtexfile): remove extraneous space
6517 which caused a kpsewhich warning (at least with kpathsea version
6520 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6522 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
6524 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
6526 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
6528 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6530 * src/paragraph.C (BreakParagraph): do not reserve space on text
6531 if we don't need to (otherwise, if pos_end < pos, we end up
6532 reserving huge amounts of memory due to bad unsigned karma).
6533 (BreakParagraphConservative): ditto, although I have not seen
6534 evidence the bug can happen here.
6536 * src/lyxparagraph.h: add a using std::list.
6538 2000-01-11 Juergen Vigna <jug@sad.it>
6540 * src/menus.C (MenuDocu): output an Alert if the documentation-file
6543 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6545 * src/vc-backend.C (doVCCommand): change to be static and take one
6546 more parameter: the path to chdir too be fore executing the command.
6547 (retrive): new function equiv to "co -r"
6549 * src/bufferlist.C (loadLyXFile): implement the missing parts if
6550 file_not_found_hook is true.
6552 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
6554 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
6555 if a file is readwrite,readonly...anything else.
6557 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6559 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
6560 (CreatePostscript): name change from MenuRunDVIPS (or something)
6561 (PreviewPostscript): name change from MenuPreviewPS
6562 (PreviewDVI): name change from MenuPreviewDVI
6564 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
6565 \view_pdf_command., \pdf_to_ps_command
6567 * lib/configure.m4: added search for PDF viewer, and search for
6568 PDF to PS converter.
6569 (lyxrc.defaults output): add \pdflatex_command,
6570 \view_pdf_command and \pdf_to_ps_command.
6572 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
6574 * src/bufferlist.C (write): we don't use blocksize for anything so
6577 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6579 * src/support/block.h: disable operator T* (), since it causes
6580 problems with both compilers I tried. See comments in the file.
6582 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
6585 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
6586 variable LYX_DIR_10x to LYX_DIR_11x.
6588 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
6590 * INSTALL: document --with-lyxname.
6593 * configure.in: new configure flag --with-lyxname which allows to
6594 choose the name under which lyx is installed. Default is "lyx", of
6595 course. It used to be possible to do this with --program-suffix,
6596 but the later has in fact a different meaning for autoconf.
6598 * src/support/lstrings.h (lstrchr): reformat a bit.
6600 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
6601 * src/mathed/math_defs.h: ditto.
6603 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6605 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
6606 true, decides if we create a backup file or not when saving. New
6607 tag and variable \pdf_mode, defaults to false. New tag and
6608 variable \pdflatex_command, defaults to pdflatex. New tag and
6609 variable \view_pdf_command, defaults to xpdf. New tag and variable
6610 \pdf_to_ps_command, defaults to pdf2ps.
6612 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6614 * src/bufferlist.C (close): don't call insetUnlock if the buffer
6615 does not have a BufferView.
6616 (unlockInset): ditto + don't access the_locking_inset if the
6617 buffer does not have a BufferView.
6619 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
6620 certain circumstances so that we don't continue a keyboard
6621 operation long after the key was released. Try f.ex. to load a
6622 large document, press PageDown for some seconds and then release
6623 it. Before this change the document would contine to scroll for
6624 some time, with this change it stops imidiatly.
6626 * src/support/block.h: don't allocate more space than needed. As
6627 long as we don't try to write to the arr[x] in a array_type arr[x]
6628 it is perfectly ok. (if you write to it you might segfault).
6629 added operator value_type*() so that is possible to pass the array
6630 to functions expecting a C-pointer.
6632 * lib/Makefile.am (dist-hook): don't fail completely if unable to
6635 * intl/*: updated to gettext 0.10.35, tried to add our own
6636 required modifications. Please verify.
6638 * po/*: updated to gettext 0.10.35, tried to add our own required
6639 modifications. Please verify.
6641 * src/support/lstrings.C (tostr): go at fixing the problem with
6642 cxx and stringstream. When stringstream is used return
6643 oss.str().c_str() so that problems with lyxstring and basic_string
6644 are avoided. Note that the best solution would be for cxx to use
6645 basic_string all the way, but it is not conformant yet. (it seems)
6647 * src/lyx_cb.C + other files: moved several global functions to
6648 class BufferView, some have been moved to BufferView.[Ch] others
6649 are still located in lyx_cb.C. Code changes because of this. (part
6650 of "get rid of current_view project".)
6652 * src/buffer.C + other files: moved several Buffer functions to
6653 class BufferView, the functions are still present in buffer.C.
6654 Code changes because of this.
6656 * config/lcmessage.m4: updated to most recent. used when creating
6659 * config/progtest.m4: updated to most recent. used when creating
6662 * config/gettext.m4: updated to most recent. applied patch for
6665 * config/gettext.m4.patch: new file that shows what changes we
6666 have done to the local copy of gettext.m4.
6668 * config/libtool.m4: new file, used in creation of acinclude.m4
6670 * config/lyxinclude.m4: new file, this is the lyx created m4
6671 macros, used in making acinclude.m4.
6673 * autogen.sh: GNU m4 discovered as a separate task not as part of
6674 the lib/configure creation.
6675 Generate acinlucde from files in config. Actually cat
6676 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
6677 easier to upgrade .m4 files that really are external.
6679 * src/Spacing.h: moved using std::istringstream to right after
6680 <sstream>. This should fix the problem seen with some compilers.
6682 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6684 * src/lyx_cb.C: began some work to remove the dependency a lot of
6685 functions have on BufferView::text, even if not really needed.
6686 (GetCurrentTextClass): removed this func, it only hid the
6689 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
6690 forgot this in last commit.
6692 * src/Bullet.C (bulletEntry): use static char const *[] for the
6693 tables, becuase of this the return arg had to change to string.
6695 (~Bullet): removed unneeded destructor
6697 * src/BufferView.C (beforeChange): moved from lyx_cb.C
6698 (insetSleep): moved from Buffer
6699 (insetWakeup): moved from Buffer
6700 (insetUnlock): moved from Buffer
6702 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
6703 from Buffer to BufferView.
6705 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
6707 * config/ltmain.sh: updated to version 1.3.4 of libtool
6709 * config/ltconfig: updated to version 1.3.4 of libtool
6711 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6714 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
6715 Did I get that right?
6717 * src/lyxlex.h: add a "using" directive or two.
6718 * src/Spacing.h: ditto.
6719 * src/insets/figinset.C: ditto.
6720 * src/support/filetools.C: ditto.
6721 * src/support/lstrings.C: ditto.
6722 * src/BufferView.C: ditto.
6723 * src/bufferlist.C: ditto.
6724 * src/lyx_cb.C: ditto.
6725 * src/lyxlex.C: ditto.
6727 * NEWS: add some changes for 1.1.4.
6729 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6731 * src/BufferView.C: first go at a TextCache to speed up switching
6734 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6736 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
6737 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
6738 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
6739 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
6742 * src/mathed/math_defs.h (MathedRowSt): make sure that all
6743 members of the struct are correctly initialized to 0 (detected by
6745 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
6746 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
6748 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
6749 pidwait, since it was allocated with "new". This was potentially
6750 very bad. Thanks to Michael Schmitt for running purify for us.
6753 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6755 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
6757 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
6759 1999-12-30 Allan Rae <rae@lyx.org>
6761 * lib/templates/IEEEtran.lyx: minor change
6763 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
6764 src/mathed/formula.C (LocalDispatch): askForText changes
6766 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
6767 know when a user has cancelled input. Fixes annoying problems with
6768 inserting labels and version control.
6770 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6772 * src/support/lstrings.C (tostr): rewritten to use strstream and
6775 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6777 * src/support/filetools.C (IsFileWriteable): use fstream to check
6778 (IsDirWriteable): use fileinfo to check
6780 * src/support/filetools.h (FilePtr): whole class deleted
6782 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
6784 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
6786 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
6788 * src/bufferlist.C (write): use ifstream and ofstream instead of
6791 * src/Spacing.h: use istrstream instead of sscanf
6793 * src/mathed/math_defs.h: change first arg to istream from FILE*
6795 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
6797 * src/mathed/math_parser.C: have yyis to be an istream
6798 (LexGetArg): use istream (yyis)
6800 (mathed_parse): ditto
6801 (mathed_parser_file): first arg istream instead of FILE*, set yyis
6803 * src/mathed/formula.C (Read): rewritten to use istream
6805 * src/mathed/formulamacro.C (Read): rewritten to use istream
6807 * src/lyxlex.h (~LyXLex): deleted desturctor
6808 (getStream): new function, returns an istream
6809 (getFile): deleted funtion
6810 (IsOK): return is.good();
6812 * src/lyxlex.C (LyXLex): delete file and owns_file
6813 (setFile): open an filebuf and assign that to a istream instead of
6815 (setStream): new function, takes an istream as arg.
6816 (setFile): deleted function
6817 (EatLine): rewritten us use istream instead of FILE*
6821 * src/table.C (LyXTable): use istream instead of FILE*
6822 (Read): rewritten to take an istream instead of FILE*
6824 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6826 * src/buffer.C (Dispatch): remove an extraneous break statement.
6828 * src/support/filetools.C (QuoteName): change to do simple
6829 'quoting'. More work is necessary. Also changed to do nothing
6830 under emx (needs fix too).
6831 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
6833 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
6834 config.h.in to the AC_DEFINE_UNQUOTED() call.
6835 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
6836 needs char * as argument (because Solaris 7 declares it like
6839 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
6840 remove definition of BZERO.
6842 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6844 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
6845 defined, "lyxregex.h" if not.
6847 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
6849 (REGEX): new variable that is set to regex.c lyxregex.h when
6850 AM_CONDITIONAL USE_REGEX is set.
6851 (libsupport_la_SOURCES): add $(REGEX)
6853 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
6856 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
6859 * configure.in: add call to LYX_REGEX
6861 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
6862 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
6864 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6866 * lib/bind/fi_menus.bind: new file, from
6867 pauli.virtanen@saunalahti.fi.
6869 * src/buffer.C (getBibkeyList): pass the parameter delim to
6870 InsetInclude::getKeys and InsetBibtex::getKeys.
6872 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
6873 is passed to Buffer::getBibkeyList
6875 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
6876 instead of the hardcoded comma.
6878 * src/insets/insetbib.C (getKeys): make sure that there are not
6879 leading blanks in bibtex keys. Normal latex does not care, but
6880 harvard.sty seems to dislike blanks at the beginning of citation
6881 keys. In particular, the retturn value of the function is
6883 * INSTALL: make it clear that libstdc++ is needed and that gcc
6884 2.7.x probably does not work.
6886 * src/support/filetools.C (findtexfile): make debug message go to
6888 * src/insets/insetbib.C (getKeys): ditto
6890 * src/debug.C (showTags): make sure that the output is correctly
6893 * configure.in: add a comment for TWO_COLOR_ICON define.
6895 * acconfig.h: remove all the entries that already defined in
6896 configure.in or acinclude.m4.
6898 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
6899 to avoid user name, date and copyright.
6901 1999-12-21 Juergen Vigna <jug@sad.it>
6903 * src/table.C (Read): Now read bogus row format informations
6904 if the format is < 5 so that afterwards the table can
6905 be read by lyx but without any format-info. Fixed the
6906 crash we experienced when not doing this.
6908 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6910 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
6911 (RedoDrawingOfParagraph): ditto
6912 (RedoParagraphs): ditto
6913 (RemoveTableRow): ditto
6915 * src/text.C (Fill): rename arg paperwidth -> paper_width
6917 * src/buffer.C (insertLyXFile): rename var filename -> fname
6918 (writeFile): rename arg filename -> fname
6919 (writeFileAscii): ditto
6920 (makeLaTeXFile): ditto
6921 (makeLinuxDocFile): ditto
6922 (makeDocBookFile): ditto
6924 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
6927 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
6929 * src/bmtable.h: add extern "C" on this file when __cplusplus is
6932 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
6933 compiled by a C compiler not C++.
6935 * src/layout.h (LyXTextClass): added typedef for const_iterator
6936 (LyXTextClassList): added typedef for const_iterator + member
6937 functions begin and end.
6939 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
6940 iterators to fill the choice_class.
6941 (updateLayoutChoice): rewritten to use iterators to fill the
6942 layoutlist in the toolbar.
6944 * src/BufferView.h (BufferView::work_area_width): removed unused
6947 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
6949 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
6950 (sgmlCloseTag): ditto
6952 * src/support/lstrings.h: return type of countChar changed to
6955 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
6956 what version of this func to use. Also made to return unsigned int.
6958 * configure.in: call LYX_STD_COUNT
6960 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
6961 conforming std::count.
6963 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6965 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
6966 and a subscript would give bad display (patch from Dekel Tsur
6967 <dekel@math.tau.ac.il>).
6969 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
6971 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
6974 * src/chset.h: add a few 'using' directives
6976 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
6977 triggered when no buffer is active
6979 * src/layout.C: removed `break' after `return' in switch(), since
6982 * src/lyx_main.C (init): make sure LyX can be ran in place even
6983 when libtool has done its magic with shared libraries. Fix the
6984 test for the case when the system directory has not been found.
6986 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
6987 name for the latex file.
6988 (MenuMakeHTML): ditto
6990 * src/buffer.h: add an optional boolean argument, which is passed
6993 1999-12-20 Allan Rae <rae@lyx.org>
6995 * lib/templates/IEEEtran.lyx: small correction and update.
6997 * configure.in: Attempted to use LYX_PATH_HEADER
6999 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7001 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7002 input from JMarc. Now use preprocessor to find the header.
7003 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7004 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7005 LYX_STL_STRING_FWD. See comments in file.
7007 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7009 * The global MiniBuffer * minibuffer variable is dead.
7011 * The global FD_form_main * fd_form_main variable is dead.
7013 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7015 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7017 * src/table.h: add the LOstream.h header
7018 * src/debug.h: ditto
7020 * src/LyXAction.h: change the explaination of the ReadOnly
7021 attribute: is indicates that the function _can_ be used.
7023 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7026 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7028 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7034 * src/paragraph.C (GetWord): assert on pos>=0
7037 * src/support/lyxstring.C: condition the use of an invariant on
7039 * src/support/lyxstring.h: ditto
7041 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7042 Use LAssert.h instead of plain assert().
7044 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7046 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7047 * src/support/filetools.C: ditto
7049 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7052 * INSTALL: document the new configure flags
7054 * configure.in: suppress --with-debug; add --enable-assertions
7056 * acinclude.m4: various changes in alignment of help strings.
7058 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7060 * src/kbmap.C: commented out the use of the hash map in kb_map,
7061 beginning of movement to a stl::container.
7063 * several files: removed code that was not in effect when
7064 MOVE_TEXT was defined.
7066 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7067 for escaping should not be used. We can discuss if the string
7068 should be enclosed in f.ex. [] instead of "".
7070 * src/trans_mgr.C (insert): use the new returned value from
7071 encodeString to get deadkeys and keymaps done correctly.
7073 * src/chset.C (encodeString): changed to return a pair, to tell
7074 what to use if we know the string.
7076 * src/lyxscreen.h (fillArc): new function.
7078 * src/FontInfo.C (resize): rewritten to use more std::string like
7079 structore, especially string::replace.
7081 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7084 * configure.in (chmod +x some scripts): remove config/gcc-hack
7086 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7088 * src/buffer.C (writeFile): change once again the top comment in a
7089 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7090 instead of an hardcoded version number.
7091 (makeDocBookFile): ditto
7093 * src/version.h: add new define LYX_DOCVERSION
7095 * po/de.po: update from Pit Sütterlin
7096 * lib/bind/de_menus.bind: ditto.
7098 * src/lyxfunc.C (Dispatch): call MenuExport()
7099 * src/buffer.C (Dispatch): ditto
7101 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7102 LyXFunc::Dispatch().
7103 (MenuExport): new function, moved from
7104 LyXFunc::Dispatch().
7106 * src/trans_mgr.C (insert): small cleanup
7107 * src/chset.C (loadFile): ditto
7109 * lib/kbd/iso8859-1.cdef: add missing backslashes
7111 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7113 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7114 help with placing the manually drawn accents better.
7116 (Draw): x2 and hg changed to float to minimize rounding errors and
7117 help place the accents better.
7119 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7120 unsigned short to char is just wrong...cast the char to unsigned
7121 char instead so that the two values can compare sanely. This
7122 should also make the display of insetlatexaccents better and
7123 perhaps also some other insets.
7125 (lbearing): new function
7128 1999-12-15 Allan Rae <rae@lyx.org>
7130 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7131 header that provides a wrapper around the very annoying SGI STL header
7134 * src/support/lyxstring.C, src/LString.h:
7135 removed old SGI-STL-compatability attempts.
7137 * configure.in: Use LYX_STL_STRING_FWD.
7139 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7140 stl_string_fwd.h is around and try to determine it's location.
7141 Major improvement over previous SGI STL 3.2 compatability.
7142 Three small problems remain with this function due to my zero
7143 knowledge of autoconf. JMarc and lgb see the comments in the code.
7145 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7147 * src/broken_const.h, config/hack-gcc, config/README: removed
7149 * configure.in: remove --with-gcc-hack option; do not call
7152 * INSTALL: remove documentation of --with-broken-const and
7155 * acconfig.h: remove all trace of BROKEN_CONST define
7157 * src/buffer.C (makeDocBookFile): update version number in output
7159 (SimpleDocBookOnePar): fix an assert when trying to a character
7160 access beyond string length
7163 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7165 * po/de.po: fix the Export menu
7167 * lyx.man: update the description of -dbg
7169 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7170 (commandLineHelp): updated
7171 (easyParse): show list of available debug levels if -dbg is passed
7174 * src/Makefile.am: add debug.C
7176 * src/debug.h: moved some code to debug.C
7178 * src/debug.C: new file. Contains code to set and show debug
7181 * src/layout.C: remove 'break' after 'continue' in switch
7182 statements, since these cannot be reached.
7184 1999-12-13 Allan Rae <rae@lyx.org>
7186 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7187 (in_word_set): hash() -> math_hash()
7189 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7191 * acconfig.h: Added a test for whether we are using exceptions in the
7192 current compilation run. If so USING_EXCEPTIONS is defined.
7194 * config.in: Check for existance of stl_string_fwd.h
7195 * src/LString.h: If compiling --with-included-string and SGI's
7196 STL version 3.2 is present (see above test) we need to block their
7197 forward declaration of string and supply a __get_c_string().
7198 However, it turns out this is only necessary if compiling with
7199 exceptions enabled so I've a bit more to add yet.
7201 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7202 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7203 src/support/LRegex.h, src/undo.h:
7204 Shuffle the order of the included files a little to ensure that
7205 LString.h gets included before anything that includes stl_string_fwd.h
7207 * src/support/lyxstring.C: We need to #include LString.h instead of
7208 lyxstring.h to get the necessary definition of __get_c_string.
7209 (__get_c_string): New function. This is defined static just like SGI's
7210 although why they need to do this I'm not sure. Perhaps it should be
7211 in lstrings.C instead.
7213 * lib/templates/IEEEtran.lyx: New template file.
7215 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7217 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7218 * intl/Makefile.in (MKINSTALLDIRS): ditto
7220 * src/LyXAction.C (init): changed to hold the LFUN data in a
7221 automatic array in stead of in callso to newFunc, this speeds up
7222 compilation a lot. Also all the memory used by the array is
7223 returned when the init is completed.
7225 * a lot of files: compiled with -Wold-style-cast, changed most of
7226 the reported offenders to C++ style casts. Did not change the
7227 offenders in C files.
7229 * src/trans.h (Match): change argument type to unsigned int.
7231 * src/support/DebugStream.C: fix some types on the streambufs so
7232 that it works on a conforming implementation.
7234 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7236 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7238 * src/support/lyxstring.C: remove the inline added earlier since
7239 they cause a bunch of unsatisfied symbols when linking with dec
7240 cxx. Cxx likes to have the body of inlines at the place where they
7243 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7244 accessing negative bounds in array. This fixes the crash when
7245 inserting accented characters.
7246 * src/trans.h (Match): ditto
7248 * src/buffer.C (Dispatch): since this is a void, it should not try
7249 to return anything...
7251 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7253 * src/buffer.h: removed the two friends from Buffer. Some changes
7254 because of this. Buffer::getFileName and Buffer::setFileName
7255 renamed to Buffer::fileName() and Buffer::fileName(...).
7257 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7259 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7260 and Buffer::update(short) to BufferView. This move is currently
7261 controlled by a define MOVE_TEXT, this will be removed when all
7262 shows to be ok. This move paves the way for better separation
7263 between buffer contents and buffer view. One side effect is that
7264 the BufferView needs a rebreak when swiching buffers, if we want
7265 to avoid this we can add a cache that holds pointers to LyXText's
7266 that is not currently in use.
7268 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7271 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7273 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7275 * lyx_main.C: new command line option -x (or --execute) and
7276 -e (or --export). Now direct conversion from .lyx to .tex
7277 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7278 Unfortunately, X is still needed and the GUI pops up during the
7281 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7283 * src/Spacing.C: add a using directive to bring stream stuff into
7285 * src/paragraph.C: ditto
7286 * src/buffer.C: ditto
7288 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7289 from Lars' announcement).
7291 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7292 example files from Tino Meinen.
7294 1999-12-06 Allan Rae <rae@lyx.org>
7296 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7298 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7300 * src/support/lyxstring.C: added a lot of inline for no good
7303 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7304 latexWriteEndChanges, they were not used.
7306 * src/layout.h (operator<<): output operator for PageSides
7308 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7310 * some example files: loaded in LyX 1.0.4 and saved again to update
7311 certain constructs (table format)
7313 * a lot of files: did the change to use fstream/iostream for all
7314 writing of files. Done with a close look at Andre Poenitz's patch.
7316 * some files: whitespace changes.
7318 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7320 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7321 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7322 architecture, we provide our own. It is used unconditionnally, but
7323 I do not think this is a performance problem. Thanks to Angus
7324 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7325 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7327 (GetInset): use my_memcpy.
7331 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7332 it is easier to understand, but it uses less TeX-only constructs now.
7334 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7335 elements contain spaces
7337 * lib/configure: regenerated
7339 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7340 elements contain spaces; display the list of programs that are
7343 * autogen.sh: make sure lib/configure is executable
7345 * lib/examples/*: rename the tutorial examples to begin with the
7346 two-letters language code.
7348 * src/lyxfunc.C (getStatus): do not query current font if no
7351 * src/lyx_cb.C (RunScript): use QuoteName
7352 (MenuRunDvips): ditto
7353 (PrintApplyCB): ditto
7355 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7356 around argument, so that it works well with the current shell.
7357 Does not work properly with OS/2 shells currently.
7359 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7360 * src/LyXSendto.C (SendtoApplyCB): ditto
7361 * src/lyxfunc.C (Dispatch): ditto
7362 * src/buffer.C (runLaTeX): ditto
7363 (runLiterate): ditto
7364 (buildProgram): ditto
7366 * src/lyx_cb.C (RunScript): ditto
7367 (MenuMakeLaTeX): ditto
7369 * src/buffer.h (getLatexName): new method
7371 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7373 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7375 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7376 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7377 (create_math_panel): ditto
7379 * src/lyxfunc.C (getStatus): re-activate the code which gets
7380 current font and cursor; add test for export to html.
7382 * src/lyxrc.C (read): remove unreachable break statements; add a
7385 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7387 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7389 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7390 introduced by faulty regex.
7391 * src/buffer.C: ditto
7392 * src/lastfiles.C: ditto
7393 * src/paragraph.C: ditto
7394 * src/table.C: ditto
7395 * src/vspace.C: ditto
7396 * src/insets/figinset.C: ditto
7397 Note: most of these is absolutely harmless, except the one in
7398 src/mathed formula.C.
7400 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7402 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7403 operation, yielding correct results for the reLyX command.
7405 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7407 * src/support/filetools.C (ExpandPath): removed an over eager
7409 (ReplaceEnvironmentPath): ditto
7411 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7412 shows that we are doing something fishy in our code...
7416 * src/lyxrc.C (read): use a double switch trick to get more help
7417 from the compiler. (the same trick is used in layout.C)
7418 (write): new function. opens a ofstream and pass that to output
7419 (output): new function, takes a ostream and writes the lyxrc
7420 elemts to it. uses a dummy switch to make sure no elements are
7423 * src/lyxlex.h: added a struct pushpophelper for use in functions
7424 with more than one exit point.
7426 * src/lyxlex.[Ch] (GetInteger): made it const
7430 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7432 * src/layout.[hC] : LayoutTags splitted into several enums, new
7433 methods created, better error handling cleaner use of lyxlex. Read
7436 * src/bmtable.[Ch]: change some member prototypes because of the
7437 image const changes.
7439 * commandtags.h, src/LyXAction.C (init): new function:
7440 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7441 This file is not read automatically but you can add \input
7442 preferences to your lyxrc if you want to. We need to discuss how
7445 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7446 in .aux, also remove .bib and .bst files from dependencies when
7449 * src/BufferView.C, src/LyXView.C: add const_cast several places
7450 because of changes to images.
7452 * lib/images/*: same change as for images/*
7454 * lib/lyxrc.example: Default for accept_compound is false not no.
7456 * images/*: changed to be const, however I have som misgivings
7457 about this change so it might be changed back.
7459 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7461 * lib/configure, po/POTFILES.in: regenerated
7463 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7465 * config/lib_configure.m4: removed
7467 * lib/configure.m4: new file (was config/lib_configure.m4)
7469 * configure.in: do not test for rtti, since we do not use it.
7471 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7473 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7474 doubling of allocated space scheme. This makes it faster for large
7475 strings end to use less memory for small strings. xtra rememoved.
7477 * src/insets/figinset.C (waitalarm): commented out.
7478 (GhostscriptMsg): use static_cast
7479 (GhostscriptMsg): use new instead of malloc to allocate memory for
7480 cmap. also delete the memory after use.
7482 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7484 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7485 for changes in bibtex database or style.
7486 (runBibTeX): remove all .bib and .bst files from dep before we
7488 (run): use scanAuc in when dep file already exist.
7490 * src/DepTable.C (remove_files_with_extension): new method
7493 * src/DepTable.[Ch]: made many of the methods const.
7495 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7497 * src/bufferparams.C: make sure that the default textclass is
7498 "article". It used to be the first one by description order, but
7499 now the first one is "docbook".
7501 * src/lyx_main.C (setDebuggingLevel): change type of argument to
7502 string; call Debug::value.
7503 (easyParse): pass complete argument to setDebuggingLevel().
7505 * src/debug.h (value): fix the code that parses debug levels.
7507 * src/debug.h: add new debug type ACTION, reserved for LyXAction
7510 * src/LyXAction.C: use Debug::ACTION as debug channel.
7512 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
7514 * NEWS: updated for the future 1.1.3 release.
7516 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
7517 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
7518 it should. This is of course a controversial change (since many
7519 people will find that their lyx workscreen is suddenly full of
7520 red), but done for the sake of correctness.
7522 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
7523 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
7525 * src/insets/inseterror.h, src/insets/inseturl.h,
7526 src/insets/insetinfo.h, src/insets/figinset.h,
7527 src/mathed/formulamacro.h, src/mathed/math_macro.h
7528 (EditMessage): add a missing const and add _() to make sure that
7531 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
7532 src/insets/insetbib.C, src/support/filetools.C: add `using'
7535 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
7536 doing 'Insert index of last word' at the beginning of a paragraph.
7538 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7540 * several files: white-space changes.
7542 * src/mathed/formula.C: removed IsAlpha and IsDigit
7544 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
7545 .bib file. use a ifstream instead of FilePtr when parsing the .bib
7548 * src/insets/figinset.C (GetPSSizes): don't break when
7549 "EndComments" is seen. But break when a boundingbox is read.
7551 * all classes inherited from Inset: return value of Clone
7552 changed back to Inset *.
7554 * all classes inherited form MathInset: return value of Clone
7555 changed back to MathedInset *.
7557 * src/insets/figinset.C (runqueue): use a ofstream to output the
7558 gs/ps file. Might need some setpresicion or setw. However I can
7559 see no problem with the current code.
7560 (runqueue): use sleep instead of the alarm/signal code. I just
7561 can't see the difference.
7563 * src/paragraph.C (LyXParagraph): reserve space in the new
7564 paragraph and resize the inserted paragraph to just fit.
7566 * src/lyxfunc.h (operator|=): added operator for func_status.
7568 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
7569 check for readable file.
7571 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
7572 check for readable file.
7573 (MenuMakeLinuxDoc): ditto
7574 (MenuMakeDocBook): ditto
7575 (MenuMakeAscii): ditto
7576 (InsertAsciiFile): split the test for openable and readable
7578 * src/bmtable.C (draw_bitmaptable): use
7579 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
7581 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
7582 findtexfile from LaTeX to filetools.
7584 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
7585 instead of FilePtr. Needs to be verified by a literate user.
7587 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7589 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
7590 (EditMessage): likewise.
7592 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
7593 respectively as \textasciitilde and \textasciicircum.
7595 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7597 * src/support/lyxstring.h: made the methods that take iterators
7600 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
7601 (regexMatch): made is use the real regex class.
7603 * src/support/Makefile.am: changed to use libtool
7605 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
7607 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
7609 (MathIsInset ++): changed several macros to be inline functions
7612 * src/mathed/Makefile.am: changed to use libtool
7614 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
7616 * src/insets/inset* : Clone changed to const and return type is
7617 the true insettype not just Inset*.
7619 * src/insets/Makefile.am: changed to use libtool
7621 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
7623 * src/undo.[Ch] : added empty() and changed some of the method
7626 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
7628 * src/lyxparagraph.h: use id() and id(...) instead of getID and
7629 setID use block<> for the bullets array, added const several places.
7631 * src/lyxfunc.C (getStatus): new function
7633 * src/lyxfunc.[Ch] : small changes to take advantage of the new
7634 LyXAction, added const to several funtions.
7636 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
7637 a std::map, and to store the dir items in a vector.
7639 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
7642 * src/LyXView.[Ch] + other files : changed currentView to view.
7644 * src/LyXAction.[Ch] : ported from the old devel branch.
7646 * src/.cvsignore: added .libs and a.out
7648 * configure.in : changes to use libtool.
7650 * acinclude.m4 : inserted libtool.m4
7652 * .cvsignore: added libtool
7654 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7656 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
7657 file name in insets and mathed directories (otherwise the
7658 dependency is not taken in account under cygwin).
7660 * src/text2.C (InsertString[AB]): make sure that we do not try to
7661 read characters past the string length.
7663 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7665 * lib/doc/LaTeXConfig.lyx.in,
7666 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
7668 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
7669 file saying who created them and when this heppened; this is
7670 useless and annoys tools like cvs.
7672 * lib/layouts/g-brief-{en,de}.layout,
7673 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
7674 from Thomas Hartkens <thomas@hartkens.de>.
7676 * src/{insets,mathed}/Makefile.am: do not declare an empty
7677 LDFLAGS, so that it can be set at configure time (useful on Irix
7680 * lib/reLyX/configure.in: make sure that the prefix is set
7681 correctly in LYX_DIR.
7683 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7685 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
7686 be used by 'command-sequence' this allows to bind a key to a
7687 sequence of LyX-commands
7688 (Example: 'command-sequence math-insert alpha; math-insert beta;")
7690 * src/LyXAction.C: add "command-sequence"
7692 * src/LyXFunction.C: handling of "command-sequence"
7694 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
7695 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
7697 * src/lyxserver.C, src/minibuffer.C: Use this new interface
7699 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7701 * src/buffer.C (writeFile): Do not output a comment giving user
7702 and date at the beginning of a .lyx file. This is useless and
7703 annoys cvs anyway; update version number to 1.1.
7705 * src/Makefile.am (LYX_DIR): add this definition, so that a
7706 default path is hardcoded in LyX.
7708 * configure.in: Use LYX_GNU_GETTEXT.
7710 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
7711 AM_GNU_GETTEXT with a bug fixed.
7713 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
7715 * src/chset.C: add "using std::ifstream;" to please dec cxx.
7717 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
7718 which is used to point to LyX data is now LYX_DIR_11x.
7720 * lyx.man: convert to a unix text file; small updates.
7722 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7724 * src/support/LSubstring.[Ch]: made the second arg of most of the
7725 constructors be a const reference.
7727 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
7730 * src/support/lyxstring.[Ch] (swap): added missing member function
7731 and specialization of swap(str, str);
7733 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
7735 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
7736 trace of the old one.
7738 * src/undo.[Ch]: made the undostack use std::list to store undo's in
7739 put the member definitions in undo.C.
7741 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
7742 NEW_TEXT and have now only code that was included when this was
7745 * src/intl.C (LCombo): use static_cast
7747 (DispatchCallback): ditto
7749 * src/definitions.h: removed whole file
7751 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
7753 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
7754 parsing and stores in a std:map. a regex defines the file format.
7755 removed unneeded members.
7757 * src/bufferparams.h: added several enums from definitions.h here.
7758 Removed unsused destructor. Changed some types to use proper enum
7759 types. use block to have the temp_bullets and user_defined_bullets
7760 and to make the whole class assignable.
7762 * src/bufferparams.C (Copy): removed this functions, use a default
7765 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
7768 * src/buffer.C (readLyXformat2): commend out all that have with
7769 oldpapersize to do. also comment out all that hve to do with
7770 insetlatex and insetlatexdel.
7771 (setOldPaperStuff): commented out
7773 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
7775 * src/LyXAction.C: remove use of inset-latex-insert
7777 * src/mathed/math_panel.C (button_cb): use static_cast
7779 * src/insets/Makefile.am (insets_o_SOURCES): removed
7782 * src/support/lyxstring.C (helper): use the unsigned long
7783 specifier, UL, instead of a static_cast.
7785 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
7787 * src/support/block.h: new file. to be used as a c-style array in
7788 classes, so that the class can be assignable.
7790 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7792 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
7793 NULL, make sure to return an empty string (it is not possible to
7794 set a string to NULL).
7796 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7798 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
7800 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
7802 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
7803 link line, so that Irix users (for example) can set it explicitely to
7806 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
7807 it can be overidden at make time (static or dynamic link, for
7810 * src/vc-backend.C, src/LaTeXFeatures.h,
7811 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
7812 statements to bring templates to global namespace.
7814 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7816 * src/support/lyxstring.C (operator[] const): make it standard
7819 * src/minibuffer.C (Init): changed to reflect that more
7820 information is given from the lyxvc and need not be provided here.
7822 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
7824 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
7826 * src/LyXView.C (UpdateTimerCB): use static_cast
7827 (KeyPressMask_raw_callback): ditto
7829 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
7830 buffer_, a lot of changes because of this. currentBuffer() ->
7831 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
7832 also changes to other files because of this.
7834 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7836 * src/vc-backend.[Ch]: new files. The backends for vc handling,
7837 have no support for RCS and partial support for CVS, will be
7840 * src/insets/ several files: changes because of function name
7841 changes in Bufferview and LyXView.
7843 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
7845 * src/support/LSubstring.[Ch]: new files. These implement a
7846 Substring that can be very convenient to use. i.e. is this
7848 string a = "Mary had a little sheep";
7849 Substring(a, "sheep") = "lamb";
7850 a is now "Mary has a little lamb".
7852 * src/support/LRegex.[Ch]: a regex class that can be used to pick
7853 out patterns and subpatterns of strings. It is used by LSubstring
7854 and also by vc-backend.C
7856 * src/support/lyxstring.C: went over all the assertions used and
7857 tried to correct the wrong ones and flag which of them is required
7858 by the standard. some bugs found because of this. Also removed a
7859 couple of assertions.
7861 * src/support/Makefile.am (libsupport_a_SOURCES): added
7862 LSubstring.[Ch] and LRegex.[Ch]
7864 * src/support/FileInfo.h: have struct stat buf as an object and
7865 not a pointer to one, some changes because of this.
7867 * src/LaTeXFeatures.C (getTClassPreamble): also use the
7868 information in layout when adding the layouts preamble to the
7871 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
7874 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
7875 because of bug in OS/2.
7877 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7879 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
7880 \verbatim@font instead of \ttfamily, so that it can be redefined.
7882 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
7883 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
7884 src/layout.h, src/text2.C: add 'using' directive to bring the
7885 STL templates we need from the std:: namespace to the global one.
7886 Needed by DEC cxx in strict ansi mode.
7888 * src/support/LIstream.h,src/support/LOstream.h,
7889 src/support/lyxstring.h,src/table.h,
7890 src/lyxlookup.h: do not include <config.h> in header
7891 files. This should be done in the .C files only.
7893 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
7897 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7899 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
7900 from Kayvan to fix the tth invokation.
7902 * development/lyx.spec.in: updates from Kayvan to reflect the
7903 changes of file names.
7905 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7907 * src/text2.C (InsertStringB): use std::copy
7908 (InsertStringA): use std::copy
7910 * src/bufferlist.C: use a vector to store the buffers in. This is
7911 an internal change and should not affect any other thing.
7913 * src/BufferView.C (waitForX): use XSync instead of the lengthy
7916 * src/text.C (Fill): fix potential bug, one off bug.
7918 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7920 * src/Makefile.am (lyx_main.o): add more files it depends on.
7922 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
7924 * src/support/lyxstring.C: use size_t for the reference count,
7925 size, reserved memory and xtra.
7926 (internal_compare): new private member function. Now the compare
7927 functions should work for std::strings that have embedded '\0'
7929 (compare): all compare functions rewritten to use
7932 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7934 * src/support/lyxstring.C (compare): pass c_str()
7935 (compare): pass c_str
7936 (compare): pass c_str
7938 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7940 * src/support/DebugStream.C: <config.h> was not included correctly.
7942 * lib/configure: forgot to re-generate it :( I'll make this file
7943 auto generated soon.
7945 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
7947 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
7950 * src/support/lyxstring.C: some changes from length() to rep->sz.
7951 avoids a function call.
7953 * src/support/filetools.C (SpaceLess): yet another version of the
7954 algorithm...now per Jean-Marc's suggestions.
7956 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7958 * src/layout.C (less_textclass_desc): functor for use in sorting
7960 (LyXTextClass::Read): sort the textclasses after reading.
7962 * src/support/filetools.C (SpaceLess): new version of the
7963 SpaceLess functions. What problems does this one give? Please
7966 * images/banner_bw.xbm: made the arrays unsigned char *
7968 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7970 * src/support/lyxstring.C (find): remove bogus assertion in the
7971 two versions of find where this has not been done yet.
7973 * src/support/lyxlib.h: add missing int return type to
7976 * src/menus.C (ShowFileMenu): disable exporting to html if no
7977 html export command is present.
7979 * config/lib_configure.m4: add a test for an HTML converter. The
7980 programs checked for are, in this order: tth, latex2html and
7983 * lib/configure: generated from config/lib_configure.m4.
7985 * src/lyxfunc.C (Dispatch): update and improve the execution of an
7986 html converter. The parameters are now passed through $$FName and
7987 $$OutName, instead of standard input/output.
7989 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
7991 * lib/lyxrc.example: update description of \html_command.
7992 add "quotes" around \screen_font_xxx font setting examples to help
7993 people who use fonts with spaces in their names.
7995 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7997 * Distribution files: updates for v1.1.2
7999 * src/support/lyxstring.C (find): remove bogus assert and return
8000 npos for the same condition.
8002 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8004 * added patch for OS/2 from SMiyata.
8006 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8008 * src/text2.C (CutSelection): make space_wrapped a bool
8009 (CutSelection): dont declare int i until we have to.
8010 (alphaCounter): return a char const *.
8012 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8014 * src/support/syscall.C (Systemcalls::kill):
8015 src/support/filetools.C (PutEnv, PutEnvPath):
8016 src/lyx_cb.C (addNewlineAndDepth):
8017 src/FontInfo.C (FontInfo::resize): condition some #warning
8018 directives with WITH_WARNINGS.
8021 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8023 * src/layout.[Ch] + several files: access to class variables
8024 limited and made accessor functions instead a lot of code changed
8025 becuase of this. Also instead of returning pointers often a const
8026 reference is returned instead.
8028 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8030 * src/Makefile.am (dist-hook): added used to remove the CVS from
8031 cheaders upon creating a dist
8032 (EXTRA_DIST): added cheaders
8034 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8035 a character not as a small integer.
8037 * src/support/lyxstring.C (find): removed Assert and added i >=
8038 rep->sz to the first if.
8040 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8042 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8043 src/LyXView.C src/buffer.C src/bufferparams.C
8044 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8045 src/text2.C src/insets/insetinclude.C:
8046 lyxlayout renamed to textclasslist.
8048 * src/layout.C: some lyxerr changes.
8050 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8051 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8052 (LyXLayoutList): removed all traces of this class.
8053 (LyXTextClass::Read): rewrote LT_STYLE
8054 (LyXTextClass::hasLayout): new function
8055 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8056 both const and nonconst version.
8057 (LyXTextClass::delete_layout): new function.
8058 (LyXTextClassList::Style): bug fix. do the right thing if layout
8060 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8061 (LyXTextClassList::NameOfLayout): ditto
8062 (LyXTextClassList::Load): ditto
8064 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8066 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8068 * src/LyXAction.C (LookupFunc): added a workaround for sun
8069 compiler, on the other hand...we don't know if the current code
8070 compiles on sun at all...
8072 * src/support/filetools.C (CleanupPath): subst fix
8074 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8077 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8078 complained about this one?
8080 * src/insets/insetinclude.C (Latex): subst fix
8082 * src/insets/insetbib.C (getKeys): subst fix
8084 * src/LyXSendto.C (SendtoApplyCB): subst fix
8086 * src/lyx_main.C (init): subst fix
8088 * src/layout.C (Read): subst fix
8090 * src/lyx_sendfax_main.C (button_send): subst fix
8092 * src/buffer.C (RoffAsciiTable): subst fix
8094 * src/lyx_cb.C (MenuFax): subst fix
8095 (PrintApplyCB): subst fix
8097 1999-10-26 Juergen Vigna <jug@sad.it>
8099 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8101 (Read): Cleaned up this code so now we read only format vestion >= 5
8103 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8105 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8106 come nobody has complained about this one?
8108 * src/insets/insetinclude.C (Latex): subst fix
8110 * src/insets/insetbib.C (getKeys): subst fix
8112 * src/lyx_main.C (init): subst fix
8114 * src/layout.C (Read): subst fix
8116 * src/buffer.C (RoffAsciiTable): subst fix
8118 * src/lyx_cb.C (MenuFax): subst fix.
8120 * src/layout.[hC] + some other files: rewrote to use
8121 std::container to store textclasses and layouts in.
8122 Simplified, removed a lot of code. Make all classes
8123 assignable. Further simplifications and review of type
8124 use still to be one.
8126 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8127 lastfiles to create the lastfiles partr of the menu.
8129 * src/lastfiles.[Ch]: rewritten to use deque to store the
8130 lastfiles in. Uses fstream for reading and writing. Simplifies
8133 * src/support/syscall.C: remove explicit cast.
8135 * src/BufferView.C (CursorToggleCB): removed code snippets that
8137 use explicat C++ style casts instead of C style casts. also use
8138 u_vdata instea of passing pointers in longs.
8140 * src/PaperLayout.C: removed code snippets that were commented out.
8142 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8144 * src/lyx_main.C: removed code snippets that wer commented out.
8146 * src/paragraph.C: removed code snippets that were commented out.
8148 * src/lyxvc.C (logClose): use static_cast
8150 (viewLog): remove explicit cast to void*
8151 (showLog): removed old commented code
8153 * src/menus.C: use static_cast instead of C style casts. use
8154 u_vdata instead of u_ldata. remove explicit cast to (long) for
8155 pointers. Removed old code that was commented out.
8157 * src/insets/inset.C: removed old commented func
8159 * src/insets/insetref.C (InsetRef): removed old code that had been
8160 commented out for a long time.
8162 (escape): removed C style cast
8164 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8166 * src/insets/insetlatex.C (Draw): removed old commented code
8167 (Read): rewritten to use string
8169 * src/insets/insetlabel.C (escape): removed C style cast
8171 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8173 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8176 * src/insets/insetinclude.h: removed a couple of stupid bools
8178 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8179 (Clone): remove C style cast
8180 (getKeys): changed list to lst because of std::list
8182 * src/insets/inseterror.C (Draw): removed som old commented code.
8184 * src/insets/insetcommand.C (Draw): removed some old commented code.
8186 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8187 commented out forever.
8188 (bibitem_cb): use static_cast instead of C style cast
8189 use of vdata changed to u_vdata.
8191 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8193 (CloseUrlCB): use static_cast instead of C style cast.
8194 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8196 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8197 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8198 (CloseInfoCB): static_cast from ob->u_vdata instead.
8199 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8202 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8203 (C_InsetError_CloseErrorCB): forward the ob parameter
8204 (CloseErrorCB): static_cast from ob->u_vdata instead.
8206 * src/vspace.h: include LString.h since we use string in this class.
8208 * src/vspace.C (lyx_advance): changed name from advance because of
8209 nameclash with stl. And since we cannot use namespaces yet...I
8210 used a lyx_ prefix instead. Expect this to change when we begin
8213 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8215 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8216 and removed now defunct constructor and deconstructor.
8218 * src/BufferView.h: have backstack as a object not as a pointer.
8219 removed initialization from constructor. added include for BackStack
8221 * development/lyx.spec.in (%build): add CFLAGS also.
8223 * src/screen.C (drawFrame): removed another warning.
8225 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8227 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8228 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8229 README and ANNOUNCE a bit for the next release. More work is
8232 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8233 unbreakable if we are in freespacing mode (LyX-Code), but not in
8236 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8238 * src/BackStack.h: fixed initialization order in constructor
8240 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8242 * acinclude.m4 (VERSION): new rules for when a version is
8243 development, added also a variable for prerelease.
8244 (warnings): we set with_warnings=yes for prereleases
8245 (lyx_opt): prereleases compile with same optimization as development
8246 (CXXFLAGS): only use pedantic if we are a development version
8248 * src/BufferView.C (restorePosition): don't do anything if the
8251 * src/BackStack.h: added member empty, use this to test if there
8252 is anything to pop...
8254 1999-10-25 Juergen Vigna <jug@sad.it>
8257 * forms/layout_forms.fd +
8258 * forms/latexoptions.fd +
8259 * lyx.fd: changed for various form resize issues
8261 * src/mathed/math_panel.C +
8262 * src/insets/inseterror.C +
8263 * src/insets/insetinfo.C +
8264 * src/insets/inseturl.C +
8265 * src/insets/inseturl.h +
8268 * src/PaperLayout.C +
8269 * src/ParagraphExtra.C +
8270 * src/TableLayout.C +
8272 * src/layout_forms.C +
8279 * src/menus.C: fixed various resize issues. So now forms can be
8280 resized savely or not be resized at all.
8282 * forms/form_url.fd +
8283 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8286 * src/insets/Makefile.am: added files form_url.[Ch]
8288 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8290 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8291 (and presumably 6.2).
8293 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8294 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8295 remaining static member callbacks.
8297 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8300 * src/support/lyxstring.h: declare struct Srep as friend of
8301 lyxstring, since DEC cxx complains otherwise.
8303 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8305 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8307 * src/LaTeX.C (run): made run_bibtex also depend on files with
8309 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8310 are put into the dependency file.
8312 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8313 the code has shown itself to work
8314 (create_ispell_pipe): removed another warning, added a comment
8317 * src/minibuffer.C (ExecutingCB): removed code that has been
8318 commented out a long time
8320 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8321 out code + a warning.
8323 * src/support/lyxstring.h: comment out the three private
8324 operators, when compiling with string ansi conforming compilers
8327 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8329 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8330 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8333 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8336 * src/mathed/math_panel.C (create_math_panel): remove explicit
8339 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8342 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8343 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8344 to XCreatePixmapFromBitmapData
8345 (fl_set_bmtable_data): change the last argument to be unsigned
8347 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8348 and bh to be unsigned int, remove explicit casts in call to
8349 XReadBitmapFileData.
8351 * images/arrows.xbm: made the arrays unsigned char *
8352 * images/varsz.xbm: ditto
8353 * images/misc.xbm: ditto
8354 * images/greek.xbm: ditto
8355 * images/dots.xbm: ditto
8356 * images/brel.xbm: ditto
8357 * images/bop.xbm: ditto
8359 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8361 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8362 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8363 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8365 (LYX_CXX_CHEADERS): added <clocale> to the test.
8367 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8369 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8371 * src/support/lyxstring.C (append): fixed something that must be a
8372 bug, rep->assign was used instead of rep->append.
8374 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8377 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8378 lyx insert double chars. Fix spotted by Kayvan.
8380 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8382 * Fixed the tth support. I messed up with the Emacs patch apply feature
8383 and omitted the changes in lyxrc.C.
8385 1999-10-22 Juergen Vigna <jug@sad.it>
8387 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8389 * src/lyx_cb.C (MenuInsertRef) +
8390 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8391 the form cannot be resized under it limits (fixes a segfault)
8393 * src/lyx.C (create_form_form_ref) +
8394 * forms/lyx.fd: Changed Gravity on name input field so that it is
8397 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8399 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8400 <ostream> and <istream>.
8402 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8403 whether <fstream> provides the latest standard features, or if we
8404 have an oldstyle library (like in egcs).
8405 (LYX_CXX_STL_STRING): fix the test.
8407 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8408 code on MODERN_STL_STREAM.
8410 * src/support/lyxstring.h: use L{I,O}stream.h.
8412 * src/support/L{I,O}stream.h: new files, designed to setup
8413 correctly streams for our use
8414 - includes the right header depending on STL capabilities
8415 - puts std::ostream and std::endl (for LOStream.h) or
8416 std::istream (LIStream.h) in toplevel namespace.
8418 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8420 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8421 was a bib file that had been changed we ensure that bibtex is run.
8422 (runBibTeX): enhanced to extract the names of the bib files and
8423 getting their absolute path and enter them into the dep file.
8424 (findtexfile): static func that is used to look for tex-files,
8425 checks for absolute patchs and tries also with kpsewhich.
8426 Alternative ways of finding the correct files are wanted. Will
8428 (do_popen): function that runs a command using popen and returns
8429 the whole output of that command in a string. Should be moved to
8432 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8433 file with extension ext has changed.
8435 * src/insets/figinset.C: added ifdef guards around the fl_free
8436 code that jug commented out. Now it is commented out when
8437 compiling with XForms == 0.89.
8439 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8440 to lyxstring.C, and only keep a forward declaration in
8441 lyxstring.h. Simplifies the header file a bit and should help a
8442 bit on compile time too. Also changes to Srep will not mandate a
8443 recompile of code just using string.
8444 (~lyxstring): definition moved here since it uses srep.
8445 (size): definition moved here since it uses srep.
8447 * src/support/lyxstring.h: removed a couple of "inline" that should
8450 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8452 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8455 1999-10-21 Juergen Vigna <jug@sad.it>
8457 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8458 set to left if I just remove the width entry (or it is empty).
8460 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8461 paragraph when having dummy paragraphs.
8463 1999-10-20 Juergen Vigna <jug@sad.it>
8465 * src/insets/figinset.C: just commented some fl_free_form calls
8466 and added warnings so that this calls should be activated later
8467 again. This avoids for now a segfault, but we have a memory leak!
8469 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8470 'const char * argument' to 'string argument', this should
8471 fix some Asserts() in lyxstring.C.
8473 * src/lyxfunc.h: Removed the function argAsString(const char *)
8474 as it is not used anymore.
8476 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8478 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8481 * src/Literate.h: some funcs moved from public to private to make
8482 interface clearer. Unneeded args removed.
8484 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8486 (scanBuildLogFile): ditto
8488 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
8489 normal TeX Error. Still room for improvement.
8491 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
8493 * src/buffer.C (insertErrors): changes to make the error
8494 desctription show properly.
8496 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
8499 * src/support/lyxstring.C (helper): changed to use
8500 sizeof(object->rep->ref).
8501 (operator>>): changed to use a pointer instead.
8503 * src/support/lyxstring.h: changed const reference & to value_type
8504 const & lets see if that helps.
8506 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8508 * Makefile.am (rpmdist): fixed to have non static package and
8511 * src/support/lyxstring.C: removed the compilation guards
8513 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
8516 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
8517 conditional compile of lyxstring.Ch
8519 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
8520 stupid check, but it is a lot better than the bastring hack.
8521 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
8523 * several files: changed string::erase into string::clear. Not
8526 * src/chset.C (encodeString): use a char temporary instead
8528 * src/table.C (TexEndOfCell): added tostr around
8529 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
8530 (TexEndOfCell): ditto
8531 (TexEndOfCell): ditto
8532 (TexEndOfCell): ditto
8533 (DocBookEndOfCell): ditto
8534 (DocBookEndOfCell): ditto
8535 (DocBookEndOfCell): ditto
8536 (DocBookEndOfCell): ditto
8538 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
8540 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
8542 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
8543 (MenuBuildProg): added tostr around ret
8544 (MenuRunChktex): added tostr around ret
8545 (DocumentApplyCB): added tostr around ret
8547 * src/chset.C (encodeString): added tostr around t->ic
8549 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
8550 (makeLaTeXFile): added tostr around tocdepth
8551 (makeLaTeXFile): added tostr around ftcound - 1
8553 * src/insets/insetbib.C (setCounter): added tostr around counter.
8555 * src/support/lyxstring.h: added an operator+=(int) to catch more
8558 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
8559 (lyxstring): We DON'T allow NULL pointers.
8561 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8563 * src/mathed/math_macro.C (MathMacroArgument::Write,
8564 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
8565 when writing them out.
8567 * src/LString.C: remove, since it is not used anymore.
8569 * src/support/lyxstring.C: condition the content to
8570 USE_INCLUDED_STRING macro.
8572 * src/mathed/math_symbols.C, src/support/lstrings.C,
8573 src/support/lyxstring.C: add `using' directive to specify what
8574 we need in <algorithm>. I do not think that we need to
8575 conditionalize this, but any thought is appreciated.
8577 * many files: change all callback functions to "C" linkage
8578 functions to please strict C++ compilers like DEC cxx 6.1 in mode
8579 strict_ansi. Those who were static are now global.
8580 The case of callbacks which are static class members is
8581 trickier, since we have to make C wrappers around them (see
8582 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
8583 did not finish this yet, since it defeats the purpose of
8584 encapsulation, and I am not sure what the best route is.
8586 1999-10-19 Juergen Vigna <jug@sad.it>
8588 * src/support/lyxstring.C (lyxstring): we permit to have a null
8589 pointer as assignment value and just don't assign it.
8591 * src/vspace.C (nextToken): corrected this function substituting
8592 find_first(_not)_of with find_last_of.
8594 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
8595 (TableOptCloseCB) (TableSpeCloseCB):
8596 inserted fl_set_focus call for problem with fl_hide_form() in
8599 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8601 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
8604 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8606 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
8607 LyXLex::next() and not eatline() to get its argument.
8609 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8611 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
8612 instead, use fstreams for io of the depfile, removed unneeded
8613 functions and variables.
8615 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
8616 vector instead, removed all functions and variables that is not in
8619 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8621 * src/buffer.C (insertErrors): use new interface to TeXError
8623 * Makefile.am (rpmdist): added a rpmdist target
8625 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
8626 per Kayvan's instructions.
8628 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8630 * src/Makefile.am: add a definition for localedir, so that locales
8631 are found after installation (Kayvan)
8633 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8635 * development/.cvsignore: new file.
8637 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8639 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
8640 C++ compiler provides wrappers for C headers and use our alternate
8643 * configure.in: use LYX_CXX_CHEADERS.
8645 * src/cheader/: new directory, populated with cname headers from
8646 libstdc++-2.8.1. They are a bit old, but probably good enough for
8647 what we want (support compilers who lack them).
8649 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
8650 from includes. It turns out is was stupid.
8652 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8654 * lib/Makefile.am (install-data-local): forgot a ';'
8655 (install-data-local): forgot a '\'
8656 (libinstalldirs): needed after all. reintroduced.
8658 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8660 * configure.in (AC_OUTPUT): added lyx.spec
8662 * development/lyx.spec: removed file
8664 * development/lyx.spec.in: new file
8666 * po/*.po: merged with lyx.pot becuase of make distcheck
8668 * lib/Makefile.am (dist-hook): added dist-hook so that
8669 documentation files will be included when doing a make
8670 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
8671 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
8673 more: tried to make install do the right thing, exclude CVS dirs
8676 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
8677 Path would fit in more nicely.
8679 * all files that used to use pathstack: uses now Path instead.
8680 This change was a lot easier than expected.
8682 * src/support/path.h: new file
8684 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
8686 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
8688 * src/support/lyxstring.C (getline): Default arg was given for
8691 * Configure.cmd: removed file
8693 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8695 * src/support/DebugStream.[Ch]: remove the explicit std:: before
8696 streams classes and types, add the proper 'using' statements when
8697 MODERN_STL is defined.
8699 * src/debug.h: move the << operator definition after the inclusion
8702 * src/support/filetools.C: include "LAssert.h", which is needed
8705 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
8708 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
8709 include "debug.h" to define a proper ostream.
8711 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8713 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
8714 method to the SystemCall class which can kill a process, but it's
8715 not fully implemented yet.
8717 * src/*.C: Changed Systemcalls::Startscript() to startscript()
8719 * src/support/FileInfo.h: Better documentation
8721 * src/lyxfunc.C: Added support for buffer-export html
8723 * src/menus.C: Added Export->As HTML...
8725 * lib/bind/*.bind: Added short-cut for buffer-export html
8727 * src/lyxrc.*: Added support for new \tth_command
8729 * lib/lyxrc.example: Added stuff for new \tth_command
8731 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8733 * lib/Makefile.am (IMAGES): removed images/README
8734 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
8735 installes in correct place. Check permisions is installed
8738 * src/LaTeX.C: some no-op changes moved declaration of some
8741 * src/LaTeX.h (LATEX_H): changed include guard name
8743 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8745 * lib/reLyX/Makefile.am: install noweb2lyx.
8747 * lib/Makefile.am: install configure.
8749 * lib/reLyX/configure.in: declare a config aux dir; set package
8750 name to lyx (not sure what the best solution is); generate noweb2lyx.
8752 * lib/layouts/egs.layout: fix the bibliography layout.
8754 1999-10-08 Jürgen Vigna <jug@sad.it>
8756 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
8757 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
8758 it returned without continuing to search the path.
8760 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8762 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
8763 also fixes a bug. It is not allowed to do tricks with std::strings
8764 like: string a("hei"); &a[e]; this will not give what you
8765 think... Any reason for the complexity in this func?
8767 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
8769 * Updated README and INSTALL a bit, mostly to check that my
8770 CVS rights are correctly set up.
8772 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8774 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
8775 does not allow '\0' chars but lyxstring and std::string does.
8777 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8779 * autogen.sh (AUTOCONF): let the autogen script create the
8780 POTFILES.in file too. POTFILES.in should perhaps now not be
8781 included in the cvs module.
8783 * some more files changed to use C++ includes instead of C ones.
8785 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
8787 (Reread): added tostr to nlink. buggy output otherwise.
8788 (Reread): added a string() around szMode when assigning to Buffer,
8789 without this I got a log of garbled info strings.
8791 * acconfig.h: commented out the PTR_AS_INT macros. They should not
8794 * I have added several ostream & operator<<(ostream &, some_type)
8795 functions. This has been done to avoid casting and warnings when
8796 outputting enums to lyxerr. This as thus eliminated a lot of
8797 explicit casts and has made the code clearer. Among the enums
8798 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
8799 mathed enums, some font enum the Debug::type enum.
8801 * src/support/lyxstring.h (clear): missing method. equivalent of
8804 * all files that contained "stderr": rewrote constructs that used
8805 stderr to use lyxerr instead. (except bmtable)
8807 * src/support/DebugStream.h (level): and the passed t with
8808 Debug::ANY to avoid spurious bits set.
8810 * src/debug.h (Debug::type value): made it accept strings of the
8813 * configure.in (Check for programs): Added a check for kpsewhich,
8814 the latex generation will use this later to better the dicovery of
8817 * src/BufferView.C (create_view): we don't need to cast this to
8818 (void*) that is done automatically.
8819 (WorkAreaButtonPress): removed some dead code.
8821 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8823 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
8824 is not overwritten when translated (David Sua'rez de Lis).
8826 * lib/CREDITS: Added David Sua'rez de Lis
8828 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
8830 * src/bufferparams.C (BufferParams): default input encoding is now
8833 * acinclude.m4 (cross_compiling): comment out macro
8834 LYX_GXX_STRENGTH_REDUCE.
8836 * acconfig.h: make sure that const is not defined (to empty) when
8837 we are compiling C++. Remove commented out code using SIZEOF_xx
8840 * configure.in : move the test for const and inline as late as
8841 possible so that these C tests do not interefere with C++ ones.
8842 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
8843 has not been proven.
8845 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8847 * src/table.C (getDocBookAlign): remove bad default value for
8850 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
8852 (ShowFileMenu2): ditto.
8854 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
8857 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8859 * Most files: finished the change from the old error code to use
8860 DebugStream for all lyxerr debugging. Only minor changes remain
8861 (e.g. the setting of debug levels using strings instead of number)
8863 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8865 * src/layout.C (Add): Changed to use compare_no_case instead of
8868 * src/FontInfo.C: changed loop variable type too string::size_type.
8870 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8872 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
8873 set ETAGS_ARGS to --c++
8875 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
8877 * src/table.C (DocBookEndOfCell): commented out two unused variables
8879 * src/paragraph.C: commented out four unused variables.
8881 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
8882 insed a if clause with type string::size_type.
8884 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
8887 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
8889 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
8890 variable, also changed loop to go from 0 to lenght + 1, instead of
8891 -1 to length. This should be correct.
8893 * src/LaTeX.C (scanError): use string::size_type as loop variable
8896 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
8897 (l.896) since y_tmp and row was not used anyway.
8899 * src/insets/insetref.C (escape): use string::size_type as loop
8902 * src/insets/insetquotes.C (Width): use string::size_type as loop
8904 (Draw): use string::size_type as loop variable type.
8906 * src/insets/insetlatexaccent.C (checkContents): use
8907 string::size_type as loop variable type.
8909 * src/insets/insetlabel.C (escape): use string::size_type as loop
8912 * src/insets/insetinfo.C: added an extern for current_view.
8914 * src/insets/insetcommand.C (scanCommand): use string::size_type
8915 as loop variable type.
8917 * most files: removed the RCS tags. With them we had to recompile
8918 a lot of files after a simple cvs commit. Also we have never used
8919 them for anything meaningful.
8921 * most files: tags-query-replace NULL 0. As adviced several plases
8922 we now use "0" instead of "NULL" in our code.
8924 * src/support/filetools.C (SpaceLess): use string::size_type as
8927 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8929 * src/paragraph.C: fixed up some more string stuff.
8931 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8933 * src/support/filetools.h: make modestr a std::string.
8935 * src/filetools.C (GetEnv): made ch really const.
8937 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
8938 made code that used these use max/min from <algorithm> instead.
8940 * changed several c library include files to their equivalent c++
8941 library include files. All is not changed yet.
8943 * created a support subdir in src, put lyxstring and lstrings
8944 there + the extra files atexit, fileblock, strerror. Created
8945 Makefile.am. edited configure.in and src/Makefile.am to use this
8946 new subdir. More files moved to support.
8948 * imported som of the functions from repository lyx, filetools
8950 * ran tags-query-replace on LString -> string, corrected the bogus
8951 cases. Tried to make use of lstrings.[hC], debugged a lot. There
8952 is still some errors in there. This is errors where too much or
8953 too litle get deleted from strings (string::erase, string::substr,
8954 string::replace), there can also be some off by one errors, or
8955 just plain wrong use of functions from lstrings. Viewing of quotes
8958 * LyX is now running fairly well with string, but there are
8959 certainly some bugs yet (see above) also string is quite different
8960 from LString among others in that it does not allow null pointers
8961 passed in and will abort if it gets any.
8963 * Added the revtex4 files I forgot when setting up the repository.
8965 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8967 * All over: Tried to clean everything up so that only the files
8968 that we really need are included in the cvs repository.
8969 * Switched to use automake.
8970 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
8971 * Install has not been checked.
8973 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8975 * po/pt.po: Three errors:
8976 l.533 and l.538 format specification error
8977 l. 402 duplicate entry, I just deleted it.