1 2000-11-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * src/frontends/xforms/FormPreferences.C (ok): use AddName().
5 * src/frontends/xforms/Dialogs.C: add "using" directive.
7 2000-11-13 Angus Leeming <a.leeming@ic.ac.uk>
9 * src/filedlg.C (Select): highlight suggested file in browser, if
12 * src/frontends/xforms/FormPreferences.[Ch]: re-written so that
13 each tab folder is encapsulated in its own class.
14 The Language keymaps are now chosen using a text input and a
15 browser button, rather than a Combox.
16 All the browser buttons are now functional, although LyXFileDlg
17 still needs to be modified to make it straighhtforward to return a
18 directory if that is what is desired.
20 * src/frontends/xforms/forms/form_preferences.fd: use text input
21 and browse button to input the Language keymaps. Add a few
22 callbacks for the browse buttons.
24 2000-11-14 Lars Gullik Bjønnes <larsbj@lyx.org>
26 * src/support/tempname.C (tempName): small changes to make it
27 safer. remove the '.' before XXXXXX
29 * src/support/filetools.C (TmpFileName): remove func
32 * src/frontends/xforms/FormRef.C (FormRef): explicit call the bp
33 * src/frontends/xforms/FormUrl.C (FormUrl): ditto
34 * src/frontends/xforms/FormTabularCreate.C (FormTabularCreate): ditto
35 * src/frontends/xforms/FormTabular.C (FormTabular): ditto
37 * src/frontends/xforms/FormInset.h (FormInset): remove default for bp
40 * src/frontends/xforms/FormGraphics.C (FormGraphics): explicit
43 * src/frontends/xforms/FormError.C (FormError): use IgnorantPolicy
44 for bp (this fixes a reproducible hard crash)
46 * src/frontends/xforms/FormCopyright.C (FormCopyright): explicit
49 * src/frontends/xforms/FormBase.h: make bp_ private
50 (FormBaseBI): remove default for bp
53 * src/frontends/xforms/Dialogs.C (Dialogs): use the old method it
56 * src/frontends/xforms/Color.C (RGBColor): made several vars
57 const, changed initialization of j to allow it to be const
60 * several files: added const to local variables.
62 * src/lyx_cb.C: removed several function prototypes and moved them
66 (UpdateLayoutPreamble):
68 (MenuInsertLabel): add BufferView as arguemnt
69 (LayoutsCB): make tmp const
71 * src/layout_forms.h: regenerated
73 * src/debug.C: add Debug::FILES
74 (showLevel) (showTags): translate the desc
76 * src/debug.h: add FILES as debug target
78 * src/bufferlist.C: use current_view as an interim measure becuase
79 of added arguments to MenuWrite and MenuWriteAs
81 * forms/layout_forms.h.patch: make the patch more correct and more appalyable
83 * config/lyxinclude.m4 (LYX_STD_COUNT): change test to not involve
85 (LYX_PROG_CXX): change 2.97 rules to include the -f.. that
86 libstdc++ is compiled with.
88 2000-11-13 José Abílio Matos <jamatos@fep.up.pt>
90 * lib/layouts/docbook-book.layout
91 * lib/layouts/docbook.layout
92 * lib/layouts/linuxdoc.layout: No need for "dummy" paragraphs, now
93 those paragraphs are expresse as SGML comments <!-- -->.
96 * src/LaTeXFeatures.C (getIncludedFiles): takes a filename as
97 parameter, this allows to express all the include files as relative
98 paths to the master buffer. The verbatim insert works as the other
101 * src/buffer.C (sgmlOpenTag) (sgmlCloseTag): don't write if latexname
103 (MakeLinuxdocFile) (MakeDocBookFile): included files are relative
105 (MakeDocBookFile): top_element is always written. Some clean up, as
106 sgmlOpenTag() and sgmlCloseTag() take care of the SGML comment case.
108 * src/insets/insetinclude.C (Linuxdoc): Added verbatim file fix.
109 (DocBook) added close tag to inlinegraphics trick for verbatim. Now
110 a reference is written instead of the name.
111 (Validate): use the relative path for the filename.
113 * src/insets/insetlabel.C (DocBook): write end tag, for XML
116 * src/support/filetools.h
117 * src/support/filetools.C (IsSGMLFilename): added.
120 2000-11-13 Miyata Shigeru <miyata@kusm.kyoto-u.ac.jp>
122 * development/OS2/quick_fix.patch:
124 * README.OS2: quick update to the OS/2 port.
126 2000-11-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
128 * src/converter.C: add "using" directive.
130 * src/frontends/xforms/FormPreferences.C: add "using" directive.
131 (compare_converter): add "int" as return type.
133 * src/frontends/xforms/Color.C: comment out FL_LIGHTER_COL1 here
136 2000-11-11 Angus Leeming <a.leeming@ic.ac.uk>
138 * src/lyx_gui.C (create_forms): map the xform colours, should a
139 mapping exist. Ie, call XformColor::read().
141 * src/frontends/xforms/Color.[Ch] renamed struct RGB as RGBColor
142 and struct HSV as HSVColor.
143 (XformColor::read, XformColor::write) : new methods that
144 input/output any changes to the cform GUI colors.
146 * src/frontends/xforms/Dialogs.C: FORMS_H_LOCATION no longer
149 * src/frontends/xforms/FormPreferences.C Lots of little changes
150 associated with the changed name of the RGB and HSV structs. Can
151 now save changes to xforms GUI to file. Commented out
152 FL_LIGHTER_COL1 to allow compilation with xforms 0.88. It isn't
153 used currently anyway.
155 2000-11-11 Dekel Tsur <dekelts@tau.ac.il>
157 * src/converter.C: A lot of changes:
158 - It is no longer possible to choose between two or more ways to
159 export to some format (the new code uses only the shortest path).
160 However, it is still possible to choose between pdflatex/ps2pdf
161 for creating a PDF file, by defining two PDF formats: pdf & pdf2.
162 - Added several methods that makes the FormPreferences code simpler.
163 - Changed the tokens $$FName and $$OutName to $$i and $$o.
165 * src/exporter.C (Export): lyxrc.use_pdf is set before
166 makeLaTeXFile is called. This works but not very nice.
168 * src/frontends/xforms/FormPreferences.C: The formats/converters
169 tabs are now fully functional.
171 * src/buffer.C (getTocList): Add numbers to the captions.
173 * lib/lyxrc.example: Removed fax section
175 * src/support/rename.C (rename): Delete the old file if lyx::copy
178 2000-11-13 Rob Lahaye <lahaye@postech.edu>
180 * lib/ui/default.ui: minor polishing.
182 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
184 * src/frontends/xforms/Color.C: include <algorithm> and <cmath>
187 * lib/Makefile.am (DOCINST): do not install everything in the
188 documentation directory.
190 2000-11-10 John Levon <moz@compsoc.man.ac.uk>
192 * src/bufferlist.C (newFile): set the filename to the constructed
195 * src/lyx_cb.C (MenuWriteAs): if a buffer is "unnamed", pass the
196 constructed "newfileXX.lyx" name to the dialog
198 * src/frontends/DialogBase.h: make update() non-abstract so
199 KDE doesn't need to implement two update methods for every form
201 * src/frontends/kde/Makefile.am: add missing xforms objects
204 * src/frontends/kde/Dialogs.C: Add FormTabularCreate dialog
206 2000-11-09 Angus Leeming <a.leeming@ic.ac.uk>
208 * src/frontends/xforms/Color.[Ch]: new files, defining the color
209 structs RGB and HSV. May not be the best place for these files.
210 Perhaps move them into src ?
212 * src/frontends/xforms/Makefile.am: added new files.
214 * src/frontends/xforms/forms/form_preferences.fd:
215 * src/frontends/xforms/FormPreferences.[Ch]: bowed to reality and
216 replaced all instances of "colour" with "color"!
218 * src/frontends/xforms/forms/form_preferences.fd: modified Colors tab
221 * src/frontends/xforms/FormPreferences.[Ch]: functioning Colors
222 tab. Can now alter the colors of the xform's GUI on the fly. With
223 the aid of a single static Signal (see below), can "Apply" these
224 changes to all currently open dialogs. (Well, to all of the NEW
225 dialogs and to LyXView. The OLD dialogs are not yet redrawn.) ALL
226 subsequently opened dialogs will, of course, also have the new
227 color scheme. Cannot yet save (or load) the choices to file, so
228 they are lost when exiting LyX.
230 * src/frontends/Dialogs.h:
231 * src/frontends/xforms/Dialogs.C (redrawGUI): new static Signal.
232 Used to trigger a redraw of any dialogs connected to it because,
233 for example, the GUI colours have been re-mapped.
235 * src/frontends/xforms/FormBase.[Ch]:
236 * src/frontends/xforms/FormDocument.[Ch]:
237 * src/frontends/xforms/FormParagraph.[Ch]:
238 * src/frontends/xforms/FormPreferences.[Ch]:
239 * src/frontends/xforms/FormTabular.[Ch]: (redraw): new virtual
240 method, to be connected to Dialogs::redrawGUI. Method must be
241 virtual, because dialogs with tabbed folders need to redraw the
242 forms of each tab folder.
244 * src/LyXView.C (d-tor):
245 * src/frontends/xforms/FormBase.C (d-tor): connected
246 Dialogs::redrawGUI signal to redraw().
248 * src/frontends/xforms/FormBase.C (~FormBaseBI, ~FormBaseBD):
249 removed Assert, because it is identical to that in FormBase.
251 2000-11-10 Rob Lahaye <lahaye@postech.edu>
253 * lib/ui/default.ui: minor polishing.
255 2000-11-10 Juergen Vigna <jug@sad.it>
257 * src/insets/insettext.C (resizeLyXText): check !cache[bv]
258 (deleteLyXText): ditto
260 * src/insets/insettabular.C (InsetButtonPress): don't clear the
261 selection on mouse-button-3.
263 * src/insets/insettabular.h: new function clearSelection(), use this
264 functions inside insettabular.C.
266 * src/insets/insettabular.C (TabularFeatures): clear the selection
267 on remove_row/column.
269 * src/insets/inset.C (scroll): fixed some scroll stuff.
271 * src/insets/insettabular.C (draw): fixed another minor draw problem.
273 2000-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
275 * lib/CREDITS: add Yves Bastide
277 2000-11-03 Yves Bastide <stid@libd-pc11.univ-bpclermont.fr>
279 * config/lyxinclude.m4 (LYX_CXX_GLOBAL_CSTD): new function to
280 check whether C library functions are in the global namespace.
282 * configure.in: calls it.
284 * src/support/lstrings.C: #ifndef CXX_GLOBAL_CSTD instead of
287 2000-11-08 Dekel Tsur <dekelts@tau.ac.il>
289 * src/frontends/xforms/FormPreferences.C (updateLanguage): Check
290 iterators to prevent crash.
292 2000-11-08 Angus Leeming <a.leeming@ic.ac.uk>
294 * src/converter.h (getprettyname, getFromToPrettyname): new methods.
296 * src/frontends/xforms/xform_macros.h (C_PREPOSTHANDLER): new macro
297 shortcut for xforms CB to the preemptive or post-handler function.
299 * src/frontends/xforms/forms/form_preferences.fd (form_preferences):
300 removed the HIDDEN_TIMER as it's no longer used.
301 Various other small changes.
303 * src/frontends/xforms/FormPreferences.[Ch]: removed timer. Use a
304 preemptive handler to obtain feedback, rather than the post-handler.
305 (ColoursLoadBrowser): find "black" and "white" based on RGB values
307 Formats tab is now complete. Converters tab is nearly so.
309 2000-11-09 Juergen Vigna <jug@sad.it>
311 * src/insets/insettext.C (~InsetText):
314 (SetParagraphData): set cache.second to 0 after deleting it!
315 (getLyXText): check if cache.second is not 0 if finding it.
317 2000-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
319 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): use
320 lyxlex to parse the rgb.txt file.
323 * src/lyxlex_pimpl.[Ch]: implement setCommentChar method, to
324 replace the default '#' comment character.
326 * src/support/tempname.C: add "using" directive
327 * src/frontends/ButtonPolicies.C: ditto.
329 * src/support/filetools.C (DirList): add an explicit cast to avoid
330 a compile error (probably not the right fix)
332 2000-11-08 Lars Gullik Bjønnes <larsbj@lyx.org>
334 * src/support/filetools.C (DirList): implement using system functions
336 * src/support/tempname.C: new file
338 * src/support/Makefile.am (libsupport_la_SOURCES): add tempname.C
340 * src/insets/insetexternal.C (InsetExternal): use lyx::tempName
342 * src/graphics/GraphicsCacheItem_pimpl.C (renderXPM): use
345 * src/frontends/xforms/ButtonController.C: new file
347 * src/os2_defines.h: remove getcwd define
349 * src/lyxvc.C: include support/lyxlib.h
350 (showLog): use lyx::tempName
352 * src/lyx_cb.C: comment out includes that we don't need
353 (AutoSave): use lyx::tempName
355 * src/filedlg.C: include support/lyxlib.h
356 (Reread): use lyx::getcwd
358 * src/converter.C: include support/filetools.h
359 (add_options): change to static inline, make tail const
360 (Add): make old_viewer const
361 (GetAllFormats): make it a const method, use const_iterator
362 (enable): make static inline
363 (SplitFormat): make using_format const
365 * src/LaTeX.C (run): use lyx::getcwd
367 * configure.in: check for mkstemp as well
369 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
371 * src/converter.[Ch] (GetAllCommands): new method.
373 * src/support/filetools.[Ch] (DirList): new method.
375 * src/frontends/xforms/FormPreferences.C: started (just!) adding
376 functionality to the converters tab.
377 The formats tab is now nearly complete.
378 The kbmap choices in Languages tab now display the contents of
379 system_lyxdir/kbd/*.kmap in readable form.
381 * src/frontends/xforms/FormPreferences.h: made struct RGB private.
382 Moved some variables into the class.
384 * src/frontends/xforms/forms/form_preferences.fd: Revert colour of
385 inactive tab folder to FL_COL1. Haven't yet worked out how to change
386 colour of active folder to lighter grey instead. Any takers?
387 (form_colours): added an "Apply" button.
388 (form_converters): added a "Flags" input field.
389 (form_formats): added a "Shortcut" input field. Note that we can't use
390 names such as "input_shortcut" as this buggers up the sed script stuff.
392 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
400 * src/lyx_sendfax_main.C:
403 * src/spellchecker.C:
404 * src/insets/figinset.C:
405 * src/insets/insetbib.C:
406 * src/insets/insetexternal.C:
407 * src/insets/insetinclude.C:
408 * src/insets/insetinfo.C:
409 * src/mathed/math_panel.C:
410 use FL_PLACE_MOUSE | FL_FREE_SIZE, FL_TRANSIENT in fl_show_form(), so
411 all "daughter" dialogs now have identical "feel".
413 2000-11-07 Angus Leeming <a.leeming@ic.ac.uk>
415 * src/lyx_gui_misc.[Ch] (IgnoreCloseBoxCB): removed as it's no longer
416 used (and was only used in one place prior to this patch. Incorrectly!)
418 * src/frontends/xforms/FormDocument.C: changed some instances of
419 FL_RETURN_ALWAYS to FL_RETURN_CHANGED as I think that this makes more
420 sense. Also added fl_set_input_return() for class_->input_doc_extra and
421 for options_->input_float_placement. This fixes a bug reported by
424 * src/frontends/xforms/FormGraphics.[Ch] (free): removed. Placed
425 functionality into d-tor.
427 * src/frontends/xforms/input_validators.c (fl_lowercase_filter): allow
428 input of numerals also.
430 * src/insets/insetinclude.C (Edit): use CancelCloseBoxCB in
431 fl_set_form_atclose(). Can now close dialog from window manager,
432 fixing a bug reported by Rob Lahaye.
434 2000-11-06 Angus Leeming <a.leeming@ic.ac.uk>
436 * src/frontends/xforms/forms/form_preferences.fd: Inactive tab folders
437 are no longer dark. Haven't yet worked out how to lighten the colour of
438 the active tabfolder. Any ideas anybody?
439 Adjusted Colours tab a little.
440 Added Shortcut field to converters tab. Note that we can't create an
441 fdesign label like "input_shortcut" as this buggers up the sed-script
444 * src/frontends/xforms/FormPreferences.[Ch]:
445 (feedback): fixed crash due to to ob=0.
446 (LanguagesXXX): the kbmap choices now contain the files
447 sytem_lyxdir/kbd/*.kmap. I think that these choices should eventually
448 be replaced by an input with a file browse button, but since the browse
449 buttons don'y yet work, this'll do for the moment.
450 (FormatsXXX): think that this is now nearly fully functional.
451 Some points/questions though:
452 1. Does "Apply" remove formats if no longer present?
453 2. I think that the browser should list the GUI names rather than the
455 3. Must ensure that we can't delete Formats used by an existing
458 * src/support/filetools.[Ch] (DirList): new function. Not at all sure
459 if this is the best way to do this.
461 2000-11-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
463 * lib/reLyX/acinclude.m4 (RELYX_CHECK_ERRORS): remove useless message.
465 * lib/configure.m4 (latex_to_html_command): avoid spaces around =
466 for variable assignment.
468 2000-11-07 Rob Lahaye <lahaye@postech.edu>
470 * src/lib/ui/default.ui: added sub/superscripts to menu as
471 Insert->Special characters and cleaned-up the file a bit
473 2000-11-07 Allan Rae <rae@lyx.org>
475 * src/frontends/xforms/FormPreferences.C (feedback): make sure
476 ob isn't 0 before using it. See comments in function.
478 * src/frontends/xforms/forms/fdfixc.sed: tiny spacing fix.
480 * src/frontends/xforms/form_*.C: regenerated
482 2000-11-07 Lars Gullik Bjønnes <larsbj@lyx.org>
484 * src/LaTeX.C (deplog): change reg1 to handle (/.../.../fil.sty)
486 * config/lyxinclude.m4 (LYX_PROG_CXX): remove -fno-rtti when
487 compiling with gcc-2.96
489 2000-11-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
491 * src/support/lyxstring.C: add a couple "using" directives.
493 * src/frontends/xforms/FormPreferences.C (ColoursLoadBrowser): add
494 a .c_str() here too for good measure.
495 * src/Spacing.C (set): ditto.
496 * src/lyxfunc.C (Dispatch): ditto.
498 * src/insets/insettabular.C (copySelection): change .str() to
499 .str().c_str() to fix problems with lyxstring.
500 * src/support/filetools.C (GetFileContents): ditto.
501 * src/buffer.C (asciiParagraph): ditto.
502 * src/paragraph.C (String): ditto.
504 * lib/bind/fi_menus.bind: change symbol-insert to math-insert.
505 * lib/bind/sciword.bind: ditto.
507 * src/LyXAction.C (init): remove "symbol-insert" function, which
508 shared LFUN_INSERT_MATH with "math-insert".
510 * lib/configure.m4: == is not a valid operator for command test.
512 * src/lyxrc.C: add using directive.
514 * src/converter.h: add std:: qualifier.
516 2000-11-03 Dekel Tsur <dekelts@tau.ac.il>
518 * src/converter.[Ch] and other files: Change the Format class to a
519 real class, and create two instances: formats and system_format.
521 * src/lyxrc.C (output): Output the difference between formats and
524 * src/frontends/xforms/FormPreferences.C (input): Simplify.
525 (buildFormats): Insert formats into browser.
526 (inputFormats): Made the browser and add button functional.
527 (applyFormats): Update formats from format_vec.
529 * src/converter.C: Changed all (*it). to it->
530 (Format::dummy): New method.
531 (Format::importer): New format flag.
532 (Formats::GetAllFormats): New method.
533 (Formats::Add): Delete format from the map if prettyname is empty.
534 (Converter::Convert): Print an error message if moving the file fails.
535 (Converter::GetReachableTo): New method
537 * src/MenuBackend.[Ch]: Add support for importformats tag.
539 * src/support/rename.C (rename): Call to lyx::copy if ::rename fails.
541 * lib/configure.m4: Add word->tex and ps->fax converters.
543 * lib/ui/default.ui: Use ImportFormats on file->import menu.
544 Return fax to file menu.
548 2000-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
550 * src/frontends/xforms/FormPreferences.h (operator=): move out of RGB
553 * src/frontends/xforms/FormPreferences.C (WriteableFile): simplify
556 * src/lyxfunc.C (processKeyEvent): removed
558 * src/bufferlist.C (emergencyWrite): removed the out commented
559 emergency write code.
561 * src/Makefile.am (lyx_main.o): add dep for commandtags.h
563 * src/LyXView.[Ch]: remove the outcommented raw_callback code
565 * many files: change formatting to be a bit more uniform for
566 if,while,for,switch statements, remove some parantesis not needed.
569 2000-11-03 John Levon <moz@compsoc.man.ac.uk>
571 * config/kde.m4: make config more robust when KDEDIR is set
573 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
575 * src/frontends/xforms/Toolbar_pimpl.C: do not crash if mathed has
576 not returned a pixmap for "math-insert".
578 * src/LyXAction.C (init): sort the entries a bit.
580 2000-11-03 Juergen Vigna <jug@sad.it>
582 * src/insets/insettabular.h: added fixed number to update codes so
583 that update is only in one direction.
585 * src/insets/insettabular.C (UpdateLocal): modified a bit don't think
588 * src/insets/insettext.C (InsetButtonPress): set the_locking_inset
589 before call to edit because of redraw.
591 * src/insets/insetcollapsable.C (draw): fixed clearing too much.
593 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
595 * lib/ui/default.ui: Populate "edit_float" menu
597 * src/lyxfunc.C (Dispatch): implement LFUN_FLOATSOPERATE.
599 * src/LyXAction.C (init): add new entry LFUN_FLOATSOPERATE, name
600 "floats-operate". The name is ugly (and the func also), but this
601 is just a band-aid until we switch to new insets.
603 2000-11-03 Rob Lahaye <lahaye@postech.edu>
605 * lib/ui/default.ui: update again the menu layout (fix some
608 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
610 * src/MenuBackend.h (fulllabel): new method.
612 * src/MenuBackend.C (checkShortcuts): new method. Checks whether
613 the menu shortcuts of a menu are unique and whether they
614 correspond to a letter of the label.
615 (expand): call checkShortcuts when debugging.
617 2000-11-03 Andre Poenitz <poenitz@HTWM.De>
619 * src/insets/insettext.C (InsetButtonPress): shut off warning.
621 2000-11-02 Lior Silberman <lior@Princeton.EDU>
623 * lib/examples/*.lyx : '\language default' => '\language english'
625 * lib/examples/it_splash.lyx : except where it should be italian
627 * lib/templates/*.lyx : the same
629 * doc/*.lyx* : the same
631 2000-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
633 * lib/bind/menus.bind: remove the Layout menu entries, which I
634 somehow forgot earlier.
636 2000-11-03 Rob Lahaye <lahaye@postech.edu>
638 * lib/ui/old-default.ui: keep the old one here for reference (to
641 * lib/ui/default.ui: update the menu layout
643 2000-11-02 Angus Leeming <a.leeming@ic.ac.uk>
645 * src/frontends/xforms/FormCitation.C: made use of ButtonController.
646 Can now Apply to different insets without closing the dialog.
648 * src/frontends/xforms/FormPreferences.C: new Colour and Format tabs.
649 Can't actually DO anything with them yet, but I'd like a little
652 * src/frontends/xforms/input_validators.[ch]
653 (fl_lowercase_filter): new.
655 2000-10-27 Dekel Tsur <dekelts@tau.ac.il>
657 * src/mathed/formulamacro.h (LyxCode) Return MATHMACRO_CODE instead
658 of MATH_CODE. This fixes a bug with math-macros in RTL text.
660 * src/text.C (PrepareToPrint): Show math-macros block aligned.
662 2000-11-02 Juergen Vigna <jug@sad.it>
664 * src/insets/insettext.C (LocalDispatch): return a DISPATCHED_NOUPDATE
665 on char insertion as it has already be updated by bv->updateInset().
667 * src/insets/insettabular.C (UpdateInsetInInset): update the inset
668 if an inset inside was updated.
670 * lib/configure.cmd: commented out fax-search code
672 2000-11-01 Yves Bastide <stid@acm.org>
674 * src/tabular.C (OldFormatRead): set tabular language to the
677 2000-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
679 * lib/reLyX/MakePreamble.pm (translate_preamble): fix reading of
680 class names with non-letter characters (from Yves Bastide).
682 * lib/ui/default.ui: change Item to OptItem in import menu.
683 Comment out fax stuff.
685 * lib/configure.m4: comment out fax-related stuff.
687 2000-10-31 Angus Leeming <a.leeming@ic.ac.uk>
689 * src/frontends/xforms/xform_helpers.[Ch]: new files. Repository for
690 useful xforms helper functions. At present contains only formatted().
691 Input a string and it returns it with line breaks so that in fits
694 * src/frontends/xforms/Makefile.am: add new files.
696 * src/lyxrc.[Ch] (getDescription): new name for getFeedback.
697 * src/lyxrc.C (getDescription): Removed '\n's from strings. Corrected
700 * src/frontends/xforms/FormPreferences.[Ch]:
701 * src/frontends/xforms/forms/form_preferences.fd: No new functionality
702 but lots of little clean ups. Removed enum State. Make use of
703 formatted(). Constify lots of methods. Perhaps best of all: removed
704 requirement for that horrible reinterpret_cast from pointer to long in
707 2000-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
709 * src/lyxlookup.C: include FORMS_H_LOCATION to get at FL_REVISION,
710 conditionalize build on xforms < 0.89
712 * src/lyx_gui.C (LyXGUI): only close lyxlookup if not xforms 0.89
714 * src/lyxfunc.C (getStatus): commenout LFUN_FAX
716 * src/LyXAction.C (init): comment out fax
718 * src/lyxrc.h: comment out the fax enums
719 comment out the fax variables
721 * src/commandtags.h: comment out LFUN_FAX
723 * src/lyxrc.C: disable fax variables.
724 (read): disable parsing of fax variables
725 (output): disable writing of fax variables
726 (getFeedback): now description for fax variables
728 * src/lyxfunc.C: comment out MenuFax
729 (Dispatch): disable LFUN_FAX
731 * src/lyx_cb.C (MenuFax): comment out
733 * src/WorkArea.C: add <cctype>
734 (work_area_handler): better key handling, should be ok now.
735 for accented chars + etc
737 * src/Makefile.am (lyx_SOURCES): remove lyx_sendfax.C
738 lyx_sendfax.h and lyx_sendfax_man.C
740 * src/LyXView.C: don't include lyxlookup.h when using xforms 0.89
741 (show): don't call InitLyXLookup when using xforms 0.89
743 2000-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
745 * src/trans.C (AddDeadkey): better fix, the other one could crash...
747 * src/support/filetools.C (GetFileContents): close to dummy change
749 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
751 * src/trans.C (AddDeadkey): workaround stupid compilers.
753 2000-10-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
755 * src/frontends/xforms/FormDocument.C (class_update): fix setting
756 of two-sided document.
758 2000-10-31 Juergen Vigna <jug@sad.it>
760 * src/WorkArea.C (work_area_handler): honor xforms 0.88 defines.
762 * src/insets/insettabular.C (ActivateCellInset): passed the wrong
763 xposition to the Edit call.
765 2000-10-31 Lars Gullik Bjønnes <larsbj@lyx.org>
767 * src/trans.C (AddDeadkey): cast explicitly to char.
769 2000-10-30 Lars Gullik Bjønnes <larsbj@lyx.org>
771 * src/tabular.C (AsciiBottomHLine): simplify?
772 (AsciiTopHLine): simplify?
773 (print_n_chars): simplify
774 (DocBook): remove most of the << endl; we should flush the stream
775 as seldom as possible.
777 (TeXBottomHLine): ditto
780 (write_attribute): try a templified version.
781 (set_row_column_number_info): lesson scope of variables
783 * src/support/lstrings.h (tostr): new specialization of tostr
785 * src/trans.C (AddDeadkey): slightly cleaner fix.
787 2000-10-28 Dekel Tsur <dekelts@tau.ac.il>
789 * src/frontends/xforms/Menubar_pimpl.C (add_toc): Replace '%' by
790 '%%' in Toc menu labels.
793 * src/insets/insetlatexaccent.C (draw): Correct rendering when
794 font_norm is iso10646-1.
796 * src/font.C (ascent): Fixed for 16bit fonts
797 (descent,lbearing,rbearing): ditto
799 2000-10-30 Angus Leeming <a.leeming@ic.ac.uk>
801 * src/lyxrc.C.[Ch]: moved LyXRCTags into public part of header file.
802 (getFeedback): new static method.
804 * src/frontends/xforms/FormPreferences.[Ch]: one or two new inputs.
805 Now use combox rather than choice to display languages.
806 Feedback is now output using a new timer callback mechanism, identical
807 to that in Toolbar_pimpl. Individual messages obtained from lyxrc.
809 2000-10-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
811 * src/minibuffer.C: fix for older compilers
813 2000-10-30 Juergen Vigna <jug@sad.it>
815 * src/insets/insettext.C (InsertInset): fixed this as the cursor
816 has to be Left of the inset otherwise LyXText won't find it!
818 * src/BufferView2.C (open_new_inset): delete the inset if it can
821 2000-10-30 Rob Lahaye <lahaye@postech.edu>
825 2000-10-29 Marko Vendelin <markov@ioc.ee>
826 * src/frontends/gnome/FormCitation.C
827 * src/frontends/gnome/FormCitation.h
828 * src/frontends/gnome/FormCopyright.C
829 * src/frontends/gnome/FormCopyright.h
830 * src/frontends/gnome/FormError.C
831 * src/frontends/gnome/FormError.h
832 * src/frontends/gnome/FormIndex.C
833 * src/frontends/gnome/FormIndex.h
834 * src/frontends/gnome/FormPrint.C
835 * src/frontends/gnome/FormPrint.h
836 * src/frontends/gnome/FormRef.C
837 * src/frontends/gnome/FormRef.h
838 * src/frontends/gnome/FormToc.C
839 * src/frontends/gnome/FormToc.h
840 * src/frontends/gnome/FormUrl.C
841 * src/frontends/gnome/FormUrl.h
842 * src/frontends/gnome/Menubar_pimpl.C
843 * src/frontends/gnome/mainapp.C
844 * src/frontends/gnome/mainapp.h
845 * src/frontends/gnome/pixbutton.h: replacing NULL with 0 and
846 changing update() to updateSlot() where appropriate
848 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
850 * src/frontends/xforms/FormPreferences.[Ch]:
851 * src/frontends/xforms/forms/form_preferences.fd: added a Languagues
854 2000-10-28 Juergen Vigna <jug@sad.it>
856 * src/insets/insettabular.C (draw): fixed drawing bug.
858 * src/insets/insettext.C (clear):
860 (SetParagraphData): clearing the TEXT buffers when deleting the
861 paragraphs used by it.
863 * src/BufferView_pimpl.C (cursorNext): fixed PageDown problem.
865 * src/trans.C (AddDeadkey): fixed bug in inizializing keymap array.
867 2000-10-27 Juergen Vigna <jug@sad.it>
869 * src/tabular.C (~LyXTabular): removed not needed anymore.
871 * src/tabular.h: changed rowofcell and columnofcell to vector<int>
874 2000-10-27 Angus Leeming <a.leeming@ic.ac.uk>
876 * src/frontends/Dialogs.h: remove hideTabular signal as it is no
879 * src/frontends/xforms/FormRef.[Ch]: fix bug when setting the min
882 * src/frontends/xforms/FormPreferences.[Ch]:
883 * src/frontends/xforms/forms/form_preferences.fd: lots and lots!
884 Reorganised as modules based on tabs. Much easier to follow the
885 flow and to add new tabs. Added warning and feedback messages.
888 2000-10-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
890 * src/tabular.h (DocBook): add std:: qualifier.
892 2000-10-26 José Abílio Matos <jamatos@fep.up.pt>
894 * src/buffer.h (SimpleDocBookOnePar): becomes public and const.
895 * src/buffer.C (SimpleDocBookOnePar): this method goes const.
898 * insettabular.C (DocBook): uses the tabular methods to export
901 * src/insets/insettext.h
902 * src/insets/insettext.C (DocBook): Implemented export for docbooc.
904 2000-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
906 * src/frontends/ButtonPolicies.h (operator<<): reinsert for State
909 * src/lyxfunc.C (MenuNew): lessen the scope of fname
910 moved misplaced AllowInput two lines up.
912 * src/buffer.C (readFile): compare float with float, not with int
914 2000-10-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
916 * src/minibuffer.C: add "using SigC::slot" statement.
918 2000-10-25 Angus Leeming <a.leeming@ic.ac.uk>
920 * src/frontends/xforms/forms/README: updated section about make.
922 * src/frontends/xforms/forms/form_*.fd: lots and lots of shortcuts.
923 Tidied some forms up, made two of form_tabular's tabs more
924 self-consistent, fixed Jean-Marc's size problem in form_preferences,
925 fixed translation problem with "Column".
927 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
929 * src/minibuffer.h: use Timeout instead of the xforms timer
931 (setTimer) rewrite for the Timeout, change to unsigned arg
932 (set): change to unsigned timer arg
935 * src/minibuffer.C (TimerCB): removed func
936 (C_MiniBuffer_TimerCB): removed func
937 (C_MiniBuffer_ExecutingCB): rewrite to not depend on TimerCB
938 (peek_event): use a switch statement
939 (add): don't use fl_add_timer.
940 (Set): rewrite to use the Timeout
943 * src/Timeout.[Ch] (setType): return a Timeout &
944 (setTimeout): ditto, change to unsigned arg for timeout
946 2000-10-25 Dekel Tsur <dekelts@tau.ac.il>
948 * src/mathed/formula.C (mathed_string_width): Use string instead
949 of a constant size char array.
951 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
953 * src/frontends/ButtonPolicies.h: remove the LOstream and remove
954 the two recently added operator<< for SMInput and State.
956 * src/frontends/ButtonPolicies.C (PreferencesPolicy): cast
958 (OkCancelPolicy): ditto
959 (OkCancelReadOnlyPolicy): ditto
960 (NoRepeatedApplyReadOnlyPolicy): ditto
961 (OkApplyCancelReadOnlyPolicy): ditto
962 (OkApplyCancelPolicy): ditto
963 (NoRepeatedApplyPolicy): ditto
965 2000-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
967 * src/frontends/ButtonPolicies.h: include "support/LOstream.h" and
968 add the usual std:: qualifiers.
970 2000-10-25 Juergen Vigna <jug@sad.it>
972 * src/screen.C (ShowManualCursor): fixed another uint -> int problem.
974 2000-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
976 * src/support/filetools.C (MakeRelPath): change some types to
979 * src/frontends/ButtonPolicies.h (operator<<): new operator for
980 ButtonPolicy::SMInput and ButtonPolicy::State.
982 * src/FontLoader.C (reset): small cleanup
983 (unload): small cleanup
985 * src/FontInfo.C (getFontname): initialize error to 10000.0
987 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
989 * src/frontends/xforms/FormPreferences.[Ch]:
990 * src/frontends/xforms/forms/form_preferences.fd: added spell checker,
991 TeX encoding and default paper size sections.
993 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
995 * src/frontends/xforms/FormTabularCreate.C: add missing #pragma
998 * src/frontends/xforms/FormError.C (disconnect): use erase() to
999 make the message_ empty.
1000 (FormError): don't initialize message_ in initializer list.
1002 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1004 * src/frontends/xforms/FormInset.[Ch]: Aieeeeee! Ok, I'm an idiot.
1006 2000-10-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1008 * lib/kbd/latvian.kmap: new file from Janne Pänkälä (epa@iki.fi)
1010 2000-10-24 John Levon <moz@compsoc.man.ac.uk>
1012 * src/frontends/kde/*data.[Ch]: _("") is not
1015 2000-10-24 Angus Leeming <a.leeming@ic.ac.uk>
1017 * src/buffer.C: removed redundant using directive.
1019 * src/frontends/DialogBase.h: revert to original definition of
1022 * src/frontends/xforms/Dialogs.C (c-tor): splitting the tabular
1023 stuff into two classes, one for each dialog, requires a new
1024 element in the dialogs vector, FormTabularCreate.
1026 * src/frontends/xforms/FormXXX.[Ch] (update): revert to original
1029 * src/frontends/xforms/FormBase.[Ch] (FormBaseBD::updateSlot): new
1030 method. Continues Allan's idea, but means that derived classes
1031 don't need to worry about "update or hide?".
1033 * src/frontends/xforms/FormError.C (showInset): add connection
1036 * src/frontends/xforms/FormTabular.[Ch]: split into two classes,
1037 one for each dialog. FormTabular now contains main tabular dialog
1040 * src/frontends/xforms/FormTabularCreate.[Ch]:
1041 * src/frontends/xforms/forms/form_tabular_create.fd: the create
1044 * src/frontends/xforms/FormGraphics.[Ch]:
1045 * src/frontends/xforms/forms/form_graphics.fd
1046 * src/frontends/xforms/FormTabular.[Ch]:
1047 * src/frontends/xforms/forms/form_tabular.fd: made daughter
1048 classes of FormInset.
1050 * src/frontends/xforms/forms/fdfix.sh: small fix. Can now create
1051 class names properly. Eg, form_my_new_dialog -> FormMyNewDialog.
1053 * src/frontends/xforms/Makefile.am:
1054 * src/frontends/xforms/forms/makefile: added new files.
1056 * src/insets/insettabular.[Ch]: removed (Dialogs *) member
1057 variable. added Signal0 hide signal, in keeping with other GUI-I
1060 * src/support/lstrings.h: removed redundant std:: qualifier as
1061 it's already declared in Lsstream.h.
1063 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1065 * src/insets/figinset.C (GhostscriptMsg): use DisplayString() to
1069 2000-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
1071 * src/tabular.C (Ascii): minimize scope of cell.
1073 * src/BufferView2.C (nextWord): return string() instead of 0;
1075 2000-10-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1077 * src/converter.h: add a std:: qualifier
1079 2000-10-21 Dekel Tsur <dekelts@tau.ac.il>
1081 * src/importer.[Ch]: New files. Used for importing files into LyX.
1083 * src/lyxfunc.C (doImport): Use the new Importer class.
1085 * src/converter.h: Add shortcut member to the Format class.
1086 Used for holding the menu shortcut.
1088 * src/converter.C and other files: Made a distinction between
1089 format name and format extension. New formats can be defined using
1090 the \format lyxrc tag.
1091 Added two new converter flags: latex and disable.
1093 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1095 * src/support/lyxlib.h: unify namespace/struct implementation.
1096 Remove extra declarations.
1098 * src/support/chdir.C (chdir): remove version taking char const *
1100 * src/support/rename.C: ditto.
1101 * src/support/lyxsum.C: ditto.
1103 2000-10-19 Angus Leeming <a.leeming@ic.ac.uk>
1105 * src/frontends/xforms/FormBase.[Ch]:
1106 * src/frontends/xforms/FormXXX.[Ch] where XXX is a FormBase daughter:
1107 read the xforms manual to discover that fl_set_form_minsize()/maxsize()
1108 work only for the next call to fl_show_form(). The correct place to set
1109 them, therefore is in connect() immediately BEFORE fl_show_form(). Now
1110 done. FormBase also stores minw_, minh_ itself. All dialogs derived
1111 from FormBase have the minimum size set; no more stupid crashes with
1114 2000-10-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1116 * lib/ui/default.ui: fix shortcut for Insert->Include File.
1118 2000-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1120 * lib/CREDITS: add Andre' Poenitz and Kornelia Pietsch
1122 * src/support/lyxlib.h: changed second argument of mkdir to
1123 unsigned long int (unsigned int would probably have been enough,
1124 but...). Removed <sys/types.h> header.
1125 * src/support/mkdir.C (mkdir): ditto.
1129 2000-10-19 Juergen Vigna <jug@sad.it>
1131 * src/lyxfunc.C (MenuNew): small fix (form John)
1133 * src/screen.C (Update): removed unneeded code.
1135 * src/tabular.C (Ascii): refixed int != uint bug!
1137 * src/support/lyxlib.h: added sys/types.h include for now permits
1138 compiling, but I don't like this!
1140 2000-10-18 Juergen Vigna <jug@sad.it>
1142 * src/text2.C (ClearSelection): if we clear the selection we need
1143 more refresh so set the status apropriately
1145 * src/insets/insettext.C (draw): hopefully finally fixed draw
1148 2000-10-12 Juergen Vigna <jug@sad.it>
1150 * src/insets/insettext.C (draw): another small fix and make a block
1151 so that variables are localized.
1153 2000-10-18 Angus Leeming <a.leeming@ic.ac.uk>
1155 * src/support/lstrings.C (lowercase, uppercase):
1156 use explicit casts to remove compiler warnings.
1158 * src/support/LRegex.C (Impl):
1159 * src/support/StrPool.C (add):
1160 * src/support/filetools.C (MakeAbsPath, NormalizePath, MakeRelPath)
1161 (AddPath, MakeDisplayPath):
1162 * src/support/lstrings.C (prefixIs, subst):
1163 use correct type to remove compiler warnings.
1165 * src/support/lstrings.[Ch] (countChar): returns string::size_type.
1167 * src/support/lyxlib.h:
1168 * src/support/mkdir.C (mkdir): change parameter to mode_t for
1169 portability and to remove compiler warning with DEC cxx.
1171 * src/support/FileInfo.[Ch] (flagRWX): ditto.
1173 2000-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1175 * src/minibuffer.C (peek_event): retun 1 when there has been a
1176 mouseclick in the minibuffer.
1180 2000-10-17 John Levon <moz@compsoc.man.ac.uk>
1182 * src/frontends/xforms/FormParagraph.C: more space above/below
1185 2000-10-17 Dekel Tsur <dekelts@tau.ac.il>
1187 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1188 a char only if real_current_font was changed.
1190 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1192 * NEWS: update somewhat for 1.1.6
1194 * lib/ui/default.ui: clean up.
1196 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
1198 * lib/CREDITS: clean up
1200 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1202 * src/combox.[Ch] (select): changed argument back to int
1203 * src/combox.C (peek_event): removed num_bytes as it is declared but
1206 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
1207 modified calls to Combox::select() to remove warnings about type
1210 * src/insets/insetbutton.C (width): explicit cast to remove warning
1211 about type conversion.
1213 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
1216 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
1217 sel_pos_end, refering to cursor position are changed to
1218 LyXParagraph::size_type.
1220 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
1221 consistent with LyXCursor::pos().
1222 (inset_pos): changed to LyXParagraph::size_type for same reason.
1224 * src/insets/insettext.C (resizeLyXText): changed some temporary
1225 variables refing to cursor position to LyXParagraph::size_type.
1227 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
1229 * src/frontends/kde/<various>: The Great Renaming,
1232 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1234 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
1236 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1238 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
1239 0 when there are no arguments.
1241 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1243 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
1244 to segfaults when pressing Ok in InsetBibtex dialog.
1246 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
1248 * forms/layout_forms.fd:
1249 * src/layout_forms.C (create_form_form_character): small change to use
1250 labelframe rather than engraved frame + text
1252 * src/lyx_gui.C (create_forms): initialise choice_language with some
1253 arbitrary value to prevent segfault when dialog is shown.
1255 2000-10-16 Baruch Even <baruch.even@writeme.com>
1257 * src/converter.C (runLaTeX, scanLog): Added a warning when there
1258 is no resulting file. This pertains only to LaTeX output.
1260 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
1262 * src/text.C (Backspace): Make sure that the row of the cursor is
1265 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
1268 * src/lyx_gui.C (init): Prevent a crash when only one font from
1269 menu/popup fonts is not found.
1271 * lib/lyxrc.example: Add an example for binding a key for language
1274 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
1276 * src/converter.C (GetReachable): Changed the returned type to
1278 (IsReachable): New method
1280 * src/MenuBackend.C (expand): Handle formats that appear more
1283 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1285 * src/frontends/support/Makefile.am
1286 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
1289 * lib/CREDITS: add Garst Reese.
1291 * src/support/snprintf.h: add extern "C" {} around the definitions.
1293 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
1295 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1298 * src/frontends/xforms/FormDocument.C:
1299 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
1300 compile without "conversion to integral type of smaller size"
1303 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1305 * src/text.C (GetColumnNearX): Fixed disabled code.
1307 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1309 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
1312 * src/support/snprintf.[ch]: new files
1314 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1316 * src/frontends/kde/formprintdialog.C: add
1317 file browser for selecting postscript output
1319 * src/frontends/kde/formprintdialogdata.C:
1320 * src/frontends/kde/formprintdialogdata.h: re-generate
1323 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
1325 * src/frontends/gnome/Makefile.am:
1326 * src/frontends/kde/Makefile.am: FormCommand.C
1327 disappeared from xforms
1329 * src/frontends/kde/FormCitation.C:
1330 * src/frontends/kde/FormIndex.C: read-only
1333 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1335 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
1338 * src/bufferlist.C: add using directive.
1340 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
1342 * src/support/lyxfunctional.h: version of class_fun for void
1343 returns added, const versions of back_inseter_fun and compare_fun
1346 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
1348 * src/frontends/xforms/FormInset.C (showInset): fix typo.
1350 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1352 * ChangeLog: cleanup.
1354 * lib/CREDITS: update to add all the contributors we've forgotten.
1355 I have obviously missed some, so tell me whether there were
1358 2000-10-13 Marko Vendelin <markov@ioc.ee>
1360 * src/frontends/gnome/FormCitation.C
1361 * src/frontends/gnome/FormCitation.h
1362 * src/frontends/gnome/FormError.C
1363 * src/frontends/gnome/FormIndex.C
1364 * src/frontends/gnome/FormRef.C
1365 * src/frontends/gnome/FormRef.h
1366 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
1368 * src/frontends/gnome/FormCitation.C
1369 * src/frontends/gnome/FormCopyright.C
1370 * src/frontends/gnome/FormError.C
1371 * src/frontends/gnome/FormIndex.C
1372 * src/frontends/gnome/FormRef.C
1373 * src/frontends/gnome/FormToc.C
1374 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
1377 * src/frontends/gnome/Menubar_pimpl.C
1378 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
1381 2000-10-11 Baruch Even <baruch.even@writeme.com>
1384 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
1385 to convey its real action.
1387 * src/minibuffer.C (peek_event): Added action when mouse clicks to
1388 clear the minibuffer and prepare to enter a command.
1390 * src/mathed/formula.C (LocalDispatch): Changed to conform with
1391 the rename from ExecCommand to PrepareForCommand.
1392 * src/lyxfunc.C (Dispatch): ditto.
1394 2000-10-11 Baruch Even <baruch.even@writeme.com>
1396 * src/buffer.C (writeFile): Added test for errors on writing, this
1397 catches all errors and not only file system full errors as intended.
1399 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
1401 * src/lyx_gui.C (create_forms): better fix for crash with
1402 translated interface.
1404 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
1406 * src/frontends/kde/Makefile.am:
1407 * src/frontends/kde/FormCopyright.C:
1408 * src/frontends/kde/formcopyrightdialog.C:
1409 * src/frontends/kde/formcopyrightdialog.h:
1410 * src/frontends/kde/formcopyrightdialogdata.C:
1411 * src/frontends/kde/formcopyrightdialogdata.h:
1412 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
1413 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
1414 copyright to use qtarch
1416 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
1418 * src/encoding.C (read): Fixed bug that caused an error message at
1419 the end of the file.
1421 * po/Makefile.in.in: Fixed rule for ext_l10n.h
1423 * lib/lyxrc.example: Fixed hebrew example.
1425 2000-10-13 Allan Rae <rae@lyx.org>
1427 * src/frontends/xforms/FormPreferences.C (input): reworking the
1429 (build, update, apply): New inputs in various tabfolders
1431 * src/frontends/xforms/FormToc.C: use new button policy.
1432 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
1433 dialogs that either can't use any existing policy or where it just
1436 * src/frontends/xforms/FormTabular.h: removed copyright notice that
1439 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
1440 added a bool parameter which is ignored.
1442 * src/buffer.C (setReadonly):
1443 * src/BufferView_pimpl.C (buffer):
1444 * src/frontends/kde/FormCopyright.h (update):
1445 * src/frontends/kde/FormCitation.[Ch] (update):
1446 * src/frontends/kde/FormIndex.[Ch] (update):
1447 * src/frontends/kde/FormPrint.[Ch] (update):
1448 * src/frontends/kde/FormRef.[Ch] (update):
1449 * src/frontends/kde/FormToc.[Ch] (update):
1450 * src/frontends/kde/FormUrl.[Ch] (update):
1451 * src/frontends/gnome/FormCopyright.h (update):
1452 * src/frontends/gnome/FormCitation.[Ch] (update):
1453 * src/frontends/gnome/FormError.[Ch] (update):
1454 * src/frontends/gnome/FormIndex.[Ch] (update):
1455 * src/frontends/gnome/FormPrint.[Ch] (update):
1456 * src/frontends/gnome/FormRef.h (update):
1457 * src/frontends/gnome/FormToc.[Ch] (update):
1458 * src/frontends/gnome/FormUrl.[Ch] (update):
1459 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
1460 to updateBufferDependent and DialogBase
1462 * src/frontends/xforms/FormCitation.[hC]:
1463 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
1464 * src/frontends/xforms/FormError.[Ch]:
1465 * src/frontends/xforms/FormGraphics.[Ch]:
1466 * src/frontends/xforms/FormIndex.[Ch]:
1467 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
1468 and fixed readOnly handling.
1469 * src/frontends/xforms/FormPrint.[Ch]:
1470 * src/frontends/xforms/FormRef.[Ch]:
1471 * src/frontends/xforms/FormTabular.[Ch]:
1472 * src/frontends/xforms/FormToc.[Ch]:
1473 * src/frontends/xforms/FormUrl.[Ch]:
1474 * src/frontends/xforms/FormInset.[Ch]:
1475 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
1476 form of updateBufferDependent.
1478 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
1479 if form()->visible just in case someone does stuff to the form in a
1482 * src/frontends/DialogBase.h (enum): removed enum since we can now use
1483 the buttoncontroller for everything the enum used to be used for.
1484 (update) It would seem we need to force all dialogs to use a bool
1485 parameter or have two update functions. I chose to go with one.
1486 I did try removing update() from here and FormBase and defining the
1487 appropriate update signatures in FormBaseB[DI] but then ran into the
1488 problem of the update() call in FormBase::show(). Whatever I did
1489 to get around that would require another function and that just
1490 got more confusing. Hence the decision to make everyone have an
1491 update(bool). An alternative might have been to override show() in
1492 FormBaseB[DI] and that would allow the different and appropriate
1495 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
1496 true == buffer change occurred. I decided against using a default
1497 template parameter since not all compilers support that at present.
1499 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
1501 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
1502 army knife" by removing functionality.
1503 (clearStore): removed. All such housekeeping on hide()ing the dialog
1504 is to be carried out by overloaded disconnect() methods.
1505 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
1506 superceded by Baruch's neat test (FormGraphics) to update an existing
1507 dialog if a new signal is recieved rather than block all new signals
1509 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
1510 only to Inset dialogs.
1511 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
1512 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
1514 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
1516 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
1517 as a base class to all inset dialogs. Used solely to connect/disconnect
1518 the Inset::hide signal and to define what action to take on receipt of
1519 a UpdateBufferDependent signal.
1520 (FormCommand): now derived from FormInset.
1522 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
1525 * src/frontends/xforms/FormCopyright.[Ch]:
1526 * src/frontends/xforms/FormPreferences.[Ch]:
1527 now derived from FormBaseBI.
1529 * src/frontends/xforms/FormDocument.[Ch]:
1530 * src/frontends/xforms/FormParagraph.[Ch]:
1531 * src/frontends/xforms/FormPrint.[Ch]:
1532 now derived from FormBaseBD.
1534 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
1536 * src/frontends/xforms/FormCitation.[Ch]:
1537 * src/frontends/xforms/FormError.[Ch]:
1538 * src/frontends/xforms/FormRef.[Ch]:
1539 * src/frontends/xforms/FormToc.[Ch]:
1540 (clearStore): reworked as disconnect().
1542 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
1545 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1547 * src/converter.C (runLaTeX): constify buffer argument
1550 * src/frontends/support/Makefile.am (INCLUDES): fix.
1552 * src/buffer.h: add std:: qualifier
1553 * src/insets/figinset.C (addpidwait): ditto
1554 * src/MenuBackend.C: ditto
1555 * src/buffer.C: ditto
1556 * src/bufferlist.C: ditto
1557 * src/layout.C: ditto
1558 * src/lyxfunc.C: ditto
1560 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1562 * src/lyxtext.h (bidi_level): change return type to
1563 LyXParagraph::size_type.
1565 * src/lyxparagraph.h: change size_type to
1566 TextContainer::difference_type. This should really be
1567 TextContainer::size_type, but we need currently to support signed
1570 2000-10-11 Marko Vendelin <markov@ioc.ee>
1571 * src/frontends/gnome/FormError.h
1572 * src/frontends/gnome/FormRef.C
1573 * src/frontends/gnome/FormRef.h
1574 * src/frontends/gnome/FormError.C
1575 * src/frontends/gnome/Makefile.am
1576 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
1577 to Gnome frontend. Both dialogs use "action" area.
1579 2000-10-12 Baruch Even <baruch.even@writeme.com>
1581 * src/graphics/GraphicsCacheItem_pimpl.C:
1582 * src/graphics/Renderer.C:
1583 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
1586 2000-10-12 Juergen Vigna <jug@sad.it>
1588 * src/insets/insettext.C (draw): fixed drawing bug (specifically
1589 visible when selecting).
1591 * development/Code_rules/Rules: fixed some typos.
1593 2000-10-09 Baruch Even <baruch.even@writeme.com>
1595 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
1596 compiling on egcs 1.1.2 possible.
1598 * src/filedlg.C (comp_direntry::operator() ): ditto.
1600 2000-08-31 Baruch Even <baruch.even@writeme.com>
1602 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
1605 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
1606 transient it now only gets freed when the object is destructed.
1608 2000-08-24 Baruch Even <baruch.even@writeme.com>
1610 * src/frontends/FormGraphics.h:
1611 * src/frontends/FormGraphics.C: Changed to use ButtonController and
1614 2000-08-20 Baruch Even <baruch.even@writeme.com>
1616 * src/insets/insetgraphics.C:
1617 (draw): Added messages to the drawn rectangle to report status.
1618 (updateInset): Disabled the use of the inline graphics,
1621 2000-08-17 Baruch Even <baruch.even@writeme.com>
1623 * src/frontends/support: Directory added for the support of GUII LyX.
1625 * src/frontends/support/LyXImage.h:
1626 * src/frontends/support/LyXImage.C: Base class for GUII holding of
1629 * src/frontends/support/LyXImage_X.h:
1630 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
1631 version of LyXImage, this uses the Xlib Pixmap.
1633 * src/PainterBase.h:
1634 * src/PainterBase.C:
1636 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
1637 replacement to Pixmap.
1639 * src/insets/insetgraphics.h:
1640 * src/insets/insetgraphics.C:
1641 * src/graphics/GraphicsCacheItem.h:
1642 * src/graphics/GraphicsCacheItem.C:
1643 * src/graphics/GraphicsCacheItem_pimpl.h:
1644 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
1647 * src/graphics/GraphicsCacheItem.h:
1648 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
1649 another copy of the object.
1651 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
1652 of cacheHandle, this fixed a bug that sent LyX crashing.
1654 * src/graphics/XPM_Renderer.h:
1655 * src/graphics/XPM_Renderer.C:
1656 * src/graphics/EPS_Renderer.h:
1657 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
1659 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1661 * src/lyxfunc.C (processKeySym): only handle the
1662 lockinginset/inset stuff if we have a buffer and text loaded...
1664 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
1666 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
1668 * src/support/lyxfunctional.h: add operator= that takes a reference
1670 * src/lyxserver.C (mkfifo): make first arg const
1672 * src/layout.h: renamed name(...) to setName(...) to work around
1675 * src/buffer.C (setFileName): had to change name of function to
1676 work around bugs in egcs. (renamed from fileName)
1678 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
1680 * src/support/translator.h: move helper template classes to
1681 lyxfunctional.h, include "support/lyxfunctional.h"
1683 * src/support/lyxmanip.h: add delaration of fmt
1685 * src/support/lyxfunctional.h: new file
1686 (class_fun_t): new template class
1687 (class_fun): helper template function
1688 (back_insert_fun_iterator): new template class
1689 (back_inserter_fun): helper template function
1690 (compare_memfun_t): new template class
1691 (compare_memfun): helper template function
1692 (equal_1st_in_pair): moved here from translator
1693 (equal_2nd_in_pair): moved here from translator
1695 * src/support/fmt.C: new file
1696 (fmt): new func, can be used for a printf substitute when still
1697 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
1699 * src/support/StrPool.C: add some comments
1701 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
1704 * src/insets/figinset.C (addpidwait): use std::copy with
1705 ostream_iterator to fill the pidwaitlist
1707 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
1709 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
1712 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
1715 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
1717 * src/frontends/xforms/FormDocument.C (build): remove c_str()
1718 (class_update): ditto
1719 (BulletPanel): ditto
1720 (CheckChoiceClass): move initialization of tc and tct
1722 * src/tabular.C: remove current_view
1723 (OldFormatRead): similar to right below [istream::ignore]
1725 * src/lyxlex_pimpl.C (next): add code for faster skipping of
1726 chars, unfortunately this is buggy on gcc 2.95.2, so currently
1727 unused [istream::ignore]
1729 * src/lyxfunc.C: include "support/lyxfunctional.h"
1730 (getInsetByCode): use std::find_if and compare_memfun
1732 * src/lyxfont.C (stateText): remove c_str()
1734 * src/lyx_main.C (setDebuggingLevel): make static
1735 (commandLineHelp): make static
1737 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
1738 Screen* together with fl_get_display() and fl_screen
1740 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
1741 togheter with fl_get_display() and fl_screen
1742 (create_forms): remove c_str()
1744 * src/layout.C: include "support/lyxfunctional.h"
1745 (hasLayout): use std::find_if and compare_memfun
1746 (GetLayout): use std::find_if and comapre_memfun
1747 (delete_layout): use std::remove_if and compare_memfun
1748 (NumberOfClass): use std:.find_if and compare_memfun
1750 * src/gettext.h: change for the new functions
1752 * src/gettext.C: new file, make _(char const * str) and _(string
1753 const & str) real functions.
1755 * src/font.C (width): rewrite slightly to avoid one extra variable
1757 * src/debug.C: initialize Debug::ANY here
1759 * src/commandtags.h: update number comments
1761 * src/combox.h (get): make const func
1763 (getline): make const
1765 * src/combox.C (input_cb): handle case where fl_get_input can
1768 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
1769 "support/lyxfunctional.h", remove current_view variable.
1770 (resize): use std::for_each with std::mem_fun
1771 (getFileNames): use std::copy with back_inserter_fun
1772 (getBuffer): change arg type to unsigned int
1773 (emergencyWriteAll): call emergencyWrite with std::for_each and
1775 (emergencyWrite): new method, the for loop in emergencyWriteAll
1777 (exists): use std::find_if with compare_memfun
1778 (getBuffer): use std::find_if and compare_memfun
1780 * src/buffer.h: add typedefs for iterator_category, value_type
1781 difference_type, pointer and reference for inset_iterator
1782 add postfix ++ for inset_iterator
1783 make inset_iterator::getPos() const
1785 * src/buffer.C: added support/lyxmanip.h
1786 (readFile): use lyxerr << fmt instead of printf
1787 (makeLaTeXFile): use std::copy to write out encodings
1789 * src/Painter.C (text): rewrite slightly to avoid extra font variable
1791 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
1792 free and the char * temp.
1793 (hasMenu): use std::find_if and compare_memfun
1796 * src/Makefile.am (lyx_SOURCES): added gettext.C
1798 * src/LyXAction.C (retrieveActionArg): clear the arg, use
1799 string::insert small change to avoid temporary
1801 * src/LColor.C (getGUIName): remove c_str()
1803 * several files: change all occurrences of fl_display to
1806 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
1807 that -pedantic is not used for gcc 2.97 (cvs gcc)
1809 * boost/Makefile.am: begin slowly to prepare for a real boost lib
1811 2000-10-11 Allan Rae <rae@lyx.org>
1813 * src/frontends/xforms/FormPreferences.C (input): template path must be
1814 a readable directory. It doesn't need to be writeable.
1815 (build, delete, update, apply): New inputs in the various tabfolders
1817 * src/frontends/xforms/forms/form_preferences.fd:
1818 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
1819 several new entries to existing folders. Shuffled some existing stuff
1822 * src/frontends/xforms/forms/form_print.fd:
1823 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
1824 Should probably rework PrinterParams as well. Note that the switch to
1825 collated is effectively the same as !unsorted so changing PrinterParams
1826 will require a lot of fiddly changes to reverse the existing logic.
1828 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
1830 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1832 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
1834 2000-10-10 Allan Rae <rae@lyx.org>
1837 * src/lyxfunc.C (Dispatch):
1839 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
1842 * src/lyxrc.C (output): Only write the differences between system lyxrc
1843 and the users settings.
1846 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
1848 I'll rewrite this later, after 1.1.6 probably, to keep a single
1849 LyXRC but two instances of a LyXRCStruct.
1851 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1853 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
1855 * src/tabular.h: add a few std:: qualifiers.
1857 * src/encoding.C: add using directive.
1858 * src/language.C: ditto.
1860 * src/insets/insetquotes.C (Validate): use languages->lang()
1861 instead of only language.
1863 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
1865 * lib/languages: New file.
1867 * lib/encodings: New file.
1869 * src/language.C (Languages): New class.
1870 (read): New method. Reads the languages from the 'languages' file.
1872 * src/encoding.C (Encodings): New class.
1873 (read): New method. Reads the encodings from the 'encodings' file.
1875 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
1878 * src/bufferparams.h and a lot of files: Deleted the member language,
1879 and renamed language_info to language
1881 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
1882 * src/lyxfont.C (latexWriteStartChanges): ditto.
1883 * src/paragraph.C (validate,TeXOnePar): ditto.
1885 * src/lyxfont.C (update): Restored deleted code.
1887 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
1889 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
1891 * src/BufferView_pimpl.C (buffer): cleaned up a little.
1893 * src/insets/figinset.[Ch]:
1894 * src/insets/insetinclude.[Ch]:
1895 * src/insets/insetinclude.[Ch]:
1896 * src/insets/insetparent.[Ch]:
1897 * src/insets/insetref.[Ch]:
1898 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
1900 * src/insets/*.[Ch]:
1901 * src/mathed/formula.[Ch]:
1902 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
1904 * src/buffer.C (parseSingleLyXformat2Token, readInset):
1905 * src/lyx_cb.C (FigureApplyCB):
1906 * src/lyxfunc.C (getStatus, Dispatch):
1907 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
1910 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
1912 * src/converter.[Ch] (Formats::View):
1913 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
1915 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
1916 *current_view->buffer(). This will change later, but this patch is way
1919 2000-10-09 Juergen Vigna <jug@sad.it>
1921 * src/text.C (GetRow): small fix.
1923 * src/BufferView_pimpl.C (cursorPrevious):
1924 (cursorNext): added LyXText parameter to function.
1926 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
1927 keypress depending on cursor position.
1929 2000-10-06 Juergen Vigna <jug@sad.it>
1931 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
1932 (copySelection): redone this function and also copy ascii representa-
1935 * src/tabular.C (Ascii):
1939 (print_n_chars): new functions to realize the ascii export of tabulars.
1941 2000-10-05 Juergen Vigna <jug@sad.it>
1943 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
1944 if we don't have a buffer.
1946 2000-10-10 Allan Rae <rae@lyx.org>
1948 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
1949 with closing dialog. It seems that nested tabfolders require hiding
1950 of inner tabfolders before hiding the dialog itself. Actually all I
1951 did was hide the active outer folder.
1953 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
1954 unless there really is a buffer. hideBufferDependent is called
1957 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
1958 POTFILES.in stays in $(srcdir).
1960 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
1962 * lib/lyxrc.example: Few changes.
1964 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
1966 * src/BufferView_pimpl.C (buffer): only need one the
1967 updateBufferDependent signal to be emitted once! Moved to the end of
1968 the method to allow bv_->text to be updated first.
1970 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
1971 and hSignal_ with Dialogs * and BufferDependency variables.
1972 New Buffer * parent_, initialised when the dialog is launched. Used to
1973 check whether to update() or hide() dialog in the new, private
1974 updateOrHide() method that is connected to the updateBufferDependent
1975 signal. Daughter classes dictate what to do using the
1976 ChangedBufferAction enum, passed to the c-tor.
1978 * src/frontends/xforms/FormCitation.C:
1979 * src/frontends/xforms/FormCommand.C:
1980 * src/frontends/xforms/FormCopyright.C:
1981 * src/frontends/xforms/FormDocument.C:
1982 * src/frontends/xforms/FormError.C:
1983 * src/frontends/xforms/FormIndex.C:
1984 * src/frontends/xforms/FormPreferences.C:
1985 * src/frontends/xforms/FormPrint.C:
1986 * src/frontends/xforms/FormRef.C:
1987 * src/frontends/xforms/FormToc.C:
1988 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
1991 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
1992 ChangedBufferAction enum.
1994 * src/frontends/xforms/FormParagraph.[Ch]
1995 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
1998 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2000 * lib/bind/cua.bind: fix a bit.
2001 * lib/bind/emacs.bind: ditto.
2003 * lib/bind/menus.bind: remove real menu entries from there.
2005 * src/spellchecker.C: make sure we only include strings.h when
2008 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2010 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
2011 function. It enlarges the maximum number of pup when needed.
2012 (add_toc2): Open a new menu if maximum number of items per menu has
2015 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
2017 * src/frontends/kde/FormPrint.C: fix error reporting
2019 * src/frontends/xforms/FormDocument.C: fix compiler
2022 * lib/.cvsignore: add Literate.nw
2024 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
2027 * bufferview_funcs.[Ch]
2030 * text2.C: Add support for numbers in RTL text.
2032 2000-10-06 Allan Rae <rae@lyx.org>
2034 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
2035 to be gettext.m4 friendly again. ext_l10n.h is now
2036 generated into $top_srcdir instead of $top_builddir
2037 so that lyx.pot will be built correctly -- without
2038 duplicate parsing of ext_l10n.h.
2040 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2042 * src/frontends/kde/FormCitation.C: make the dialog
2043 behave more sensibly
2045 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
2047 * config/kde.m4: fix consecutive ./configure runs,
2048 look for qtarch, fix library order
2050 * src/frontends/kde/Makefile.am: tidy up,
2051 add Print dialog, add .dlg dependencies
2053 * src/frontends/kde/FormPrint.C:
2054 * src/frontends/kde/FormPrint.h:
2055 * src/frontends/kde/formprintdialog.C:
2056 * src/frontends/kde/formprintdialog.h:
2057 * src/frontends/kde/formprintdialogdata.C:
2058 * src/frontends/kde/formprintdialogdata.h:
2059 * src/frontends/kde/dlg/formprintdialog.dlg: add
2062 * src/frontends/kde/dlg/README: Added explanatory readme
2064 * src/frontends/kde/dlg/checkinitorder.pl: small perl
2065 script to double-check qtarch's output
2067 * src/frontends/kde/formindexdialog.C:
2068 * src/frontends/kde/formindexdialogdata.C:
2069 * src/frontends/kde/formindexdialogdata.h:
2070 * src/frontends/kde/dlg/formindexdialog.dlg: update
2071 for qtarch, minor fixes
2073 2000-10-05 Allan Rae <rae@lyx.org>
2075 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
2076 dialogs when switching buffers update them instead. It's up to each
2077 dialog to decide if it should still be visible or not.
2078 update() should return a bool to control visiblity within show().
2079 Or perhaps better to set a member variable and use that to control
2082 * lib/build-listerrors: create an empty "listerrors" file just to stop
2083 make trying to regenerate it all the time if you don't have noweb
2086 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
2088 * po/Makefile.in.in (ext_l10n.h): added a rule to build
2089 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
2090 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
2091 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
2092 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
2094 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
2096 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
2098 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
2099 deleting buffer. Closes all buffer-dependent dialogs.
2101 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
2103 * src/frontends/xforms/FormCitation.[Ch]:
2104 * src/frontends/xforms/FormPreferences.[Ch]:
2105 * src/frontends/xforms/FormPrint.[Ch]:
2106 * src/frontends/xforms/FormRef.[Ch]:
2107 * src/frontends/xforms/FormUrl.[Ch]: ditto
2109 * src/frontends/xforms/FormDocument.[Ch]:
2110 * src/frontends/xforms/forms/form_document.C.patch:
2111 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
2112 pass through a single input() function.
2114 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
2116 * lib/build-listerrors: return status as OK
2118 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
2120 * lib/lyxrc.example: Updated to new export code
2122 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2124 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
2127 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
2130 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
2131 LyX-Code is defined.
2132 * lib/layouts/amsbook.layout: ditto.
2134 * boost/Makefile.am: fix typo.
2136 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
2138 (add_lastfiles): removed.
2139 (add_documents): removed.
2140 (add_formats): removed.
2142 * src/frontends/Menubar.C: remove useless "using" directive.
2144 * src/MenuBackend.h: add a new MenuItem constructor.
2146 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
2149 2000-10-04 Allan Rae <rae@lyx.org>
2151 * lib/Makefile.am (listerrors):
2152 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
2153 I haven't got notangle installed so Kayvan please test. The output
2154 should end up in $builddir. This also allows people who don't have
2155 noweb installed to complete the make process without error.
2157 * src/frontends/xforms/FormCommand.[Ch] (showInset):
2158 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
2159 by JMarc's picky compiler.
2161 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
2164 * src/insets/insettabular.C (setPos): change for loop to not use
2165 sequencing operator. Please check this Jürgen.
2167 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
2169 * src/insets/insetcite.C (getScreenLabel): ditto
2170 * src/support/filetools.C (QuoteName): ditto
2171 (ChangeExtension): ditto
2173 * src/BufferView_pimpl.C (scrollCB): make heigt int
2175 * src/BufferView2.C (insertInset): comment out unused arg
2177 * boost/Makefile.am (EXTRADIST): new variable
2179 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2181 * src/exporter.C (IsExportable): Fixed
2183 * lib/configure.m4: Small fix
2185 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
2187 * src/insets/insetbutton.C (width): Changed to work with no GUI.
2188 * src/insets/insetbib.C (bibitemWidest): ditto.
2189 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
2191 2000-10-03 Juergen Vigna <jug@sad.it>
2193 * src/BufferView2.C (theLockingInset): removed const because of
2194 Agnus's compile problems.
2196 * src/insets/insettext.C (LocalDispatch): set the language of the
2197 surronding paragraph on inserting the first character.
2199 * various files: changed use of BufferView::the_locking_inset.
2201 * src/BufferView2.C (theLockingInset):
2202 (theLockingInset): new functions.
2204 * src/BufferView.h: removed the_locking_inset.
2206 * src/lyxtext.h: added the_locking_inset
2208 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
2210 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
2212 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2214 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
2215 * src/mathed/math_cursor.C (IsAlpha): ditto.
2216 * src/mathed/math_inset.C (strnew): ditto.
2217 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
2218 (IMetrics): cxp set but never used; removed.
2219 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
2220 that the variable in question has been removed also!
2223 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
2224 using the Buffer * passed to Latex(), using the BufferView * passed to
2225 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
2227 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
2228 Linuxdoc() and DocBook() rather than the stored Buffer * master.
2230 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
2231 * src/buffer.C (readInset): used new InsetBibtex c-tor
2232 * (getBibkeyList): used new InsetBibtex::getKeys
2234 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2237 * lib/build-listerrors
2239 * src/exporter.C: Add literate programming support to the export code
2242 * src/lyx_cb.C: Remove old literate code.
2244 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
2247 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
2248 * src/converter.C (View, Convert): Use QuoteName.
2250 * src/insets/figinset.C (Preview): Use Formats::View.
2252 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
2254 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2256 * src/lyxfunc.C (Dispatch): move declaration of text variable at
2257 the top of the function, because compaq cxx complains that the
2258 "goto exit_with_message" when the function is disabled bypasses
2260 (MenuNew): try a better fix for the generation of new file names.
2261 This time, I used AddName() instead of AddPath(), hoping Juergen
2264 2000-10-03 Allan Rae <rae@lyx.org>
2266 * src/frontends/xforms/forms/form_preferences.fd:
2267 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
2268 nested tabfolders has begun. The old "Miscellaneous" was renamed as
2269 "Look and Feel"->"General" but will need to be split up further into
2270 general output and general input tabs. Current plan is for four outer
2271 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
2272 stuff; "Inputs" for input and import configuration; "Outputs" for
2273 output and export configuration; and one more whatever is left over
2274 called "General". The leftovers at present look like being which
2275 viewers to use, spellchecker, language support and might be better
2276 named "Support". I've put "Paths" in "Inputs" for the moment as this
2277 seems reasonable for now at least.
2278 One problem remains: X error kills LyX when you close Preferences.
2280 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
2282 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
2283 qualifier from form()
2284 * src/frontends/xforms/FormCitation.[Ch]:
2285 * src/frontends/xforms/FormCopyright.[Ch]:
2286 * src/frontends/xforms/FormDocument.[Ch]:
2287 * src/frontends/xforms/FormError.[Ch]:
2288 * src/frontends/xforms/FormIndex.[Ch]:
2289 * src/frontends/xforms/FormPreferences.[Ch]:
2290 * src/frontends/xforms/FormPrint.[Ch]:
2291 * src/frontends/xforms/FormRef.[Ch]:
2292 * src/frontends/xforms/FormToc.[Ch]:
2293 * src/frontends/xforms/FormUrl.[Ch]: ditto.
2295 * src/frontends/xforms/FormCitation.[Ch]:
2296 * src/frontends/xforms/FormIndex.[Ch]:
2297 * src/frontends/xforms/FormRef.[Ch]:
2298 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
2299 with Allan's naming policy
2301 * src/frontends/xforms/FormCitation.C: some static casts to remove
2304 2000-10-02 Juergen Vigna <jug@sad.it>
2306 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
2307 now you can type or do stuff inside the table-cell also when in dummy
2308 position, fixed visible cursor.
2310 * src/insets/insettext.C (Edit): fixing cursor-view position.
2312 * src/lyxfunc.C (Dispatch): use * text variable so that it can
2313 be used for equal functions in lyxfunc and insettext.
2315 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
2317 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
2319 * src/frontends/gnome/FormCitation.h:
2320 * src/frontends/gnome/FormCopyright.h:
2321 * src/frontends/gnome/FormIndex.h:
2322 * src/frontends/gnome/FormPrint.h:
2323 * src/frontends/gnome/FormToc.h:
2324 * src/frontends/gnome/FormUrl.h:
2325 * src/frontends/kde/FormCitation.h:
2326 * src/frontends/kde/FormCopyright.h:
2327 * src/frontends/kde/FormIndex.h:
2328 * src/frontends/kde/FormRef.h:
2329 * src/frontends/kde/FormToc.h:
2330 * src/frontends/kde/FormUrl.h: fix remaining users of
2333 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2335 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
2336 from depth argument.
2337 (DocBookHandleCaption): ditto.
2338 (DocBookHandleFootnote): ditto.
2339 (SimpleDocBookOnePar): ditto.
2341 * src/frontends/xforms/FormDocument.h (form): remove extra
2342 FormDocument:: qualifier.
2344 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
2346 * sigc++/handle.h: ditto.
2348 * src/lyx_gui_misc.C: add "using" directive.
2350 * src/cheaders/cstddef: new file, needed by the boost library (for
2353 2000-10-02 Juergen Vigna <jug@sad.it>
2355 * src/insets/insettext.C (SetFont): better support.
2357 * src/insets/insettabular.C (draw): fixed drawing of single cell.
2359 * src/screen.C (DrawOneRow): some uint refixes!
2361 2000-10-02 Allan Rae <rae@lyx.org>
2363 * boost/.cvsignore: ignore Makefile as well
2365 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
2366 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
2368 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
2369 Left this one out by accident.
2371 * src/frontends/xforms/FormBase.h (restore): default to calling
2372 update() since that will restore the original/currently-applied values.
2373 Any input() triggered error messages will require the derived classes
2374 to redefine restore().
2376 * src/frontends/xforms/FormDocument.C: initialize a few variables to
2377 avoid a segfault. combo_doc_class is the main concern.
2379 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
2381 * Simplify build-listerrors in view of GUI-less export ability!
2383 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2385 * src/lyx_main.C (easyParse): Disable gui when exporting
2387 * src/insets/figinset.C:
2390 * src/lyx_gui_misc.C
2391 * src/tabular.C: Changes to allow no-gui.
2393 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
2395 * src/support/utility.hpp: removed file
2396 * src/support/block.h: removed file
2398 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
2401 * src/mathed/formula.C: add support/lyxlib.h
2402 * src/mathed/formulamacro.C: ditto
2404 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
2405 * src/lyxparagraph.h: ditto
2407 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
2408 * src/frontends/Makefile.am (INCLUDES): ditto
2409 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
2410 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
2411 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
2412 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
2413 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
2414 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
2416 * src/BufferView.h: use boost/utility.hpp
2417 * src/LColor.h: ditto
2418 * src/LaTeX.h: ditto
2419 * src/LyXAction.h: ditto
2420 * src/LyXView.h: ditto
2421 * src/bufferlist.h: ditto
2422 * src/lastfiles.h: ditto
2423 * src/layout.h: ditto
2424 * src/lyx_gui.h: ditto
2425 * src/lyx_main.h: ditto
2426 * src/lyxlex.h: ditto
2427 * src/lyxrc.h: ditto
2428 * src/frontends/ButtonPolicies.h: ditto
2429 * src/frontends/Dialogs.h: ditto
2430 * src/frontends/xforms/FormBase.h: ditto
2431 * src/frontends/xforms/FormGraphics.h: ditto
2432 * src/frontends/xforms/FormParagraph.h: ditto
2433 * src/frontends/xforms/FormTabular.h: ditto
2434 * src/graphics/GraphicsCache.h: ditto
2435 * src/graphics/Renderer.h: ditto
2436 * src/insets/ExternalTemplate.h: ditto
2437 * src/insets/insetcommand.h: ditto
2438 * src/support/path.h: ditto
2440 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
2441 and introduce clause for 2.97.
2443 * boost/libs/README: new file
2445 * boost/boost/utility.hpp: new file
2447 * boost/boost/config.hpp: new file
2449 * boost/boost/array.hpp: new file
2451 * boost/Makefile.am: new file
2453 * boost/.cvsignore: new file
2455 * configure.in (AC_OUTPUT): add boost/Makefile
2457 * Makefile.am (SUBDIRS): add boost
2459 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
2461 * src/support/lstrings.C (suffixIs): Fixed.
2463 2000-10-01 Allan Rae <rae@lyx.org>
2465 * src/PrinterParams.h: moved things around to avoid the "can't
2466 inline call" warning.
2468 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
2469 into doc++ documentation.
2471 * src/frontends/xforms/FormCommand.[Ch]: support button policy
2473 * src/frontends/xforms/FormRef.C: make use of button controller
2474 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
2475 cleaned up button controller usage.
2476 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
2477 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
2478 use the button controller
2480 * src/frontends/xforms/forms/*.fd: and associated generated files
2481 updated to reflect changes to FormBase. Some other FormXxxx files
2482 also got minor updates to reflect changes to FormBase.
2484 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
2485 (hide): made virtual.
2486 (input): return a bool. true == valid input
2487 (RestoreCB, restore): new
2488 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
2489 Changes to allow derived dialogs to use a ButtonController and
2490 make sense when doing so: OK button calls ok() and so on.
2492 * src/frontends/xforms/ButtonController.h (class ButtonController):
2493 Switch from template implementation to taking Policy parameter.
2494 Allows FormBase to provide a ButtonController for any dialog.
2496 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
2497 Probably should rename connect and disconnect.
2498 (apply): use the radio button groups
2499 (form): needed by FormBase
2500 (build): setup the radio button groups
2502 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
2504 * several files: type changes to reduce the number of warnings and
2505 to unify type hangling a bit. Still much to do.
2507 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2509 * lib/images/*: rename a bunch of icons to match Dekel converter
2512 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
2515 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
2517 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
2519 * sigc++/handle.h: ditto for class Handle.
2521 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
2523 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
2525 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
2527 * src/intl.C (InitKeyMapper): Correct the value of n due to the
2528 removal of the "default" language.
2530 * src/combox.h (getline): Check that sel > 0
2532 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
2534 * lib/examples/docbook_example.lyx
2535 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
2537 * lib/layouts/docbook-book.layout: new docbook book layout.
2539 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
2541 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
2543 * src/insets/figinset.C (DocBook):fixed small typo.
2545 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
2547 * src/insets/insetinclude.h: string include_label doesn't need to be
2550 2000-09-29 Allan Rae <rae@lyx.org>
2552 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
2553 Allow derived type to control connection and disconnection from signals
2554 of its choice if desired.
2556 2000-09-28 Juergen Vigna <jug@sad.it>
2558 * src/insets/insettabular.C (update): fixed cursor setting when
2559 the_locking_inset changed.
2560 (draw): made this a bit cleaner.
2561 (InsetButtonPress): fixed!
2563 * various files: added LyXText Parameter to fitCursor call.
2565 * src/BufferView.C (fitCursor): added LyXText parameter.
2567 * src/insets/insettabular.C (draw): small draw fix.
2569 * src/tabular.C: right setting of left/right celllines.
2571 * src/tabular.[Ch]: fixed various types in funcions and structures.
2572 * src/insets/insettabular.C: ditto
2573 * src/frontends/xforms/FormTabular.C: ditto
2575 2000-09-28 Allan Rae <rae@lyx.org>
2577 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
2578 that the #ifdef's had been applied to part of what should have been
2579 a complete condition. It's possible there are other tests that
2580 were specific to tables that are also wrong now that InsetTabular is
2581 being used. Now we need to fix the output of '\n' after a table in a
2582 float for the same reason as the original condition:
2583 "don't insert this if we would be adding it before or after a table
2584 in a float. This little trick is needed in order to allow use of
2585 tables in \subfigures or \subtables."
2586 Juergen can you check this?
2588 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2590 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
2591 output to the ostream.
2593 * several files: fixed types based on warnings from cxx
2595 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
2597 * src/frontends/kde/Makefile.am: fix rule for
2598 formindexdialogdata_moc.C
2600 * src/.cvsignore: add ext_l10n.h to ignore
2602 * acconfig.h: stop messing with __STRICT_ANSI__
2603 * config/gnome.m4: remove option to set -ansi
2604 * config/kde.m4: remove option to set -ansi
2605 * config/lyxinclude.m4: don't set -ansi
2607 2000-09-27 Juergen Vigna <jug@sad.it>
2609 * various files: remove "default" language check.
2611 * src/insets/insetquotes.C: removed use of current_view.
2613 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
2614 the one should have red ears by now!
2616 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
2617 in more then one paragraph. Fixed cursor-movement/selection.
2619 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
2620 paragraphs inside a text inset.
2622 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
2623 text-inset if this owner is an inset.
2625 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2627 * src/Bullet.h: changed type of font, character and size to int
2629 * src/buffer.C (asciiParagraph): remove actcell and fname1.
2631 * src/insets/inseturl.[Ch]:
2632 * src/insets/insetref.[Ch]:
2633 * src/insets/insetlabel.[Ch]: add linelen to Ascii
2635 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
2637 * src/buffer.C (readFile): block-if statement rearranged to minimise
2638 bloat. Patch does not reverse Jean-Marc's change ;-)
2640 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
2641 Class rewritten to store pointers to hide/update signals directly,
2642 rather than Dialogs *. Also defined an enum to ease use. All xforms
2643 forms can now be derived from this class.
2645 * src/frontends/xforms/FormCommand.[Ch]
2646 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
2648 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
2651 * src/frontends/xforms/forms/form_citation.fd
2652 * src/frontends/xforms/forms/form_copyright.fd
2653 * src/frontends/xforms/forms/form_error.fd
2654 * src/frontends/xforms/forms/form_index.fd
2655 * src/frontends/xforms/forms/form_ref.fd
2656 * src/frontends/xforms/forms/form_toc.fd
2657 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
2659 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
2661 * src/insets/insetfoot.C: removed redundent using directive.
2663 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2665 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
2666 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
2668 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
2669 created in the constructors in different groups. Then set() just
2670 have to show the groups as needed. This fixes the redraw problems
2671 (and is how the old menu code worked).
2673 * src/support/lyxlib.h: declare the methods as static when we do
2674 not have namespaces.
2676 2000-09-26 Juergen Vigna <jug@sad.it>
2678 * src/buffer.C (asciiParagraph): new function.
2679 (writeFileAscii): new function with parameter ostream.
2680 (writeFileAscii): use now asciiParagraph.
2682 * various inset files: added the linelen parameter to the Ascii-func.
2684 * src/tabular.C (Write): fixed error in writing file introduced by
2685 the last changes from Lars.
2687 * lib/bind/menus.bind: removed not supported functions.
2689 * src/insets/insettext.C (Ascii): implemented this function.
2691 * src/insets/lyxinset.h (Ascii): added linelen parameter.
2693 * src/tabular.C (write_attribute[int,string,bool]): new functions.
2694 (Write): use of the write_attribute functions.
2696 * src/bufferlist.C (close): fixed reasking question!
2698 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2700 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
2701 new files use the everwhere possible.
2704 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
2705 src/log_form.C src/lyx.C:
2708 * src/buffer.C (runLaTeX): remove func
2710 * src/PaperLayout.C: removed file
2711 * src/ParagraphExtra.C: likewise
2712 * src/bullet_forms.C: likewise
2713 * src/bullet_forms.h: likewise
2714 * src/bullet_forms_cb.C: likewise
2716 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
2717 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
2720 * several files: remove all traces of the old fd_form_paragraph,
2721 and functions belonging to that.
2723 * several files: remove all traces of the old fd_form_document,
2724 and functions belonging to that.
2726 * several files: constify local variables were possible.
2728 * several files: remove all code that was dead when NEW_EXPORT was
2731 * several files: removed string::c_str in as many places as
2734 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
2735 (e): be a bit more outspoken when patching
2736 (updatesrc): only move files if changed.
2738 * forms/layout_forms.h.patch: regenerated
2740 * forms/layout_forms.fd: remove form_document and form_paragraph
2741 and form_quotes and form_paper and form_table_options and
2742 form_paragraph_extra
2744 * forms/form1.fd: remove form_table
2746 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
2747 the fdui->... rewrite. Update some comments to xforms 0.88
2749 * forms/bullet_forms.C.patch: removed file
2750 * forms/bullet_forms.fd: likewise
2751 * forms/bullet_forms.h.patch: likewise
2753 * development/Code_rules/Rules: added a section on switch
2754 statements. Updated some comment to xforms 0.88.
2756 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2758 * src/buffer.C (readFile): make sure that the whole version number
2759 is read after \lyxformat (even when it contains a comma)
2761 * lib/ui/default.ui: change shortcut of math menu to M-a.
2763 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2765 * src/vspace.C (nextToken): use isStrDbl() to check for proper
2768 * src/LyXView.C (updateWindowTitle): show the full files name in
2769 window title, limited to 30 characters.
2771 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
2772 When a number of characters has been given, we should not assume
2773 that the string is 0-terminated.
2775 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
2776 calls (fixes some memory leaks)
2778 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
2779 trans member on exit.
2781 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2783 * src/converter.C (GetReachable): fix typo.
2785 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
2786 understand ',' instead of '.'.
2787 (GetInteger): rewrite to use strToInt().
2789 2000-09-26 Juergen Vigna <jug@sad.it>
2791 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
2792 better visibility and error-message on wrong VSpace input.
2794 * src/language.C (initL): added english again.
2796 2000-09-25 Juergen Vigna <jug@sad.it>
2798 * src/frontends/kde/Dialogs.C (Dialogs):
2799 * src/frontends/gnome/Dialogs.C (Dialogs):
2800 * src/frontends/kde/Makefile.am:
2801 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
2803 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
2805 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
2807 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
2809 * src/frontends/xforms/FormParagraph.C:
2810 * src/frontends/xforms/FormParagraph.h:
2811 * src/frontends/xforms/form_paragraph.C:
2812 * src/frontends/xforms/form_paragraph.h:
2813 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
2816 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
2818 * src/tabular.C (OldFormatRead): forgot to delete the temporary
2819 Paragraph-Data after use.
2821 * src/insets/insettext.C (LocalDispatch): don't set the layout on
2822 non breakable paragraphs.
2824 2000-09-25 Garst R. Reese <reese@isn.net>
2826 * src/language.C (initL): added missing language_country codes.
2828 2000-09-25 Juergen Vigna <jug@sad.it>
2830 * src/insets/insettext.C (InsetText):
2831 (deleteLyXText): remove the not released LyXText structure!
2833 2000-09-24 Marko Vendelin <markov@ioc.ee>
2835 * src/frontends/gnome/mainapp.C
2836 * src/frontends/gnome/mainapp.h: added support for keyboard
2839 * src/frontends/gnome/FormCitation.C
2840 * src/frontends/gnome/FormCitation.h
2841 * src/frontends/gnome/Makefile.am
2842 * src/frontends/gnome/pixbutton.h: completed the rewrite of
2843 FormCitation to use "action area" in mainapp window
2845 * src/frontends/gnome/Menubar_pimpl.C
2846 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
2849 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
2851 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
2852 width/descent/ascent values if name is empty.
2853 (mathed_string_height): Use std::max.
2855 2000-09-25 Allan Rae <rae@lyx.org>
2857 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
2858 segfault. This will be completely redesigned soon.
2860 * sigc++: updated libsigc++. Fixes struct timespec bug.
2862 * development/tools/makeLyXsigc.sh: .cvsignore addition
2864 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
2866 * several files: removed almost all traces of the old table
2869 * src/TableLayout.C: removed file
2871 2000-09-22 Juergen Vigna <jug@sad.it>
2873 * src/frontends/kde/Dialogs.C: added credits forms.
2875 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
2877 * src/frontends/gnome/Dialogs.C: added some forms.
2879 * src/spellchecker.C (init_spell_checker): set language in pspell code
2880 (RunSpellChecker): some modifications for setting language string.
2882 * src/language.[Ch]: added language_country code.
2884 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
2886 * src/frontends/Dialogs.h: added new signal showError.
2887 Rearranged existing signals in some sort of alphabetical order.
2889 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
2890 FormError.[Ch], form_error.[Ch]
2891 * src/frontends/xforms/forms/makefile: added new file form_error.fd
2892 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
2894 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
2895 dialogs. I think that this can be used as the base to all these
2898 * src/frontends/xforms/FormError.[Ch]
2899 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
2900 implementation of InsetError dialog.
2902 * src/insets/inseterror.[Ch]: rendered GUI-independent.
2904 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
2905 * src/frontends/kde/Makefile.am: ditto
2907 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
2909 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
2910 macrobf. This fixes a bug of invisible text.
2912 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2914 * lib/doc/LaTeXConfig.lyx.in: updated.
2916 * src/language.C (initL): remove language "francais" and change a
2917 bit the names of the two other french variations.
2919 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
2920 string that may not be 0-terminated.
2922 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2924 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
2926 2000-09-20 Marko Vendelin <markov@ioc.ee>
2928 * src/frontends/gnome/FormCitation.C
2929 * src/frontends/gnome/FormIndex.C
2930 * src/frontends/gnome/FormToc.C
2931 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
2932 the variable initialization to shut up the warnings
2934 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2936 * src/table.[Ch]: deleted files
2938 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
2941 2000-09-18 Juergen Vigna <jug@sad.it>
2943 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
2944 problems with selection. Inserted new LFUN_PASTESELECTION.
2945 (InsetButtonPress): inserted handling of middle mouse-button paste.
2947 * src/spellchecker.C: changed word to word.c_str().
2949 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
2951 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
2952 included in the ``make dist'' tarball.
2954 2000-09-15 Juergen Vigna <jug@sad.it>
2956 * src/CutAndPaste.C (cutSelection): small fix return the right
2957 end position after cut inside one paragraph only.
2959 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
2960 we are locked as otherwise we don't have a valid cursor position!
2962 * src/insets/figinset.C (draw): small bugfix but why is this needed???
2964 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
2966 * src/frontends/kde/FormRef.C: added using directive.
2967 * src/frontends/kde/FormToc.C: ditto
2969 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
2971 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
2973 2000-09-19 Marko Vendelin <markov@ioc.ee>
2975 * src/frontends/gnome/Menubar_pimpl.C
2976 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
2977 Toc, ViewFormats, UpdateFormats, and ExportFormats.
2979 * src/frontends/gnome/mainapp.C
2980 * src/frontends/gnome/mainapp.h: support for menu update used
2983 * src/frontends/gnome/mainapp.C
2984 * src/frontends/gnome/mainapp.h: support for "action" area in the
2985 main window. This area is used by small simple dialogs, such as
2988 * src/frontends/gnome/FormIndex.C
2989 * src/frontends/gnome/FormIndex.h
2990 * src/frontends/gnome/FormUrl.C
2991 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
2994 * src/frontends/gnome/FormCitation.C
2995 * src/frontends/gnome/FormCitation.h: rewrite to use main window
2996 action area. Only "Insert new citation" is implemented.
2998 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
3000 * src/buffer.C (Dispatch): fix call to Dispatch
3001 * src/insets/insetref.C (Edit): likewise
3002 * src/insets/insetparent.C (Edit): likewise
3003 * src/insets/insetinclude.C (include_cb): likewise
3004 * src/frontends/xforms/FormUrl.C (apply): likewise
3005 * src/frontends/xforms/FormToc.C (apply): likewise
3006 * src/frontends/xforms/FormRef.C (apply): likewise
3007 * src/frontends/xforms/FormIndex.C (apply): likewise
3008 * src/frontends/xforms/FormCitation.C (apply): likewise
3009 * src/lyxserver.C (callback): likewise
3010 * src/lyxfunc.C (processKeySym): likewise
3011 (Dispatch): likewise
3012 (Dispatch): likewise
3013 * src/lyx_cb.C (LayoutsCB): likewise
3015 * Makefile.am (sourcedoc): small change
3017 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
3019 * src/main.C (main): Don't make an empty GUIRunTime object. all
3020 methods are static. constify a bit remove unneded using + headers.
3022 * src/tabular.C: some more const to local vars move some loop vars
3024 * src/spellchecker.C: added some c_str after some word for pspell
3026 * src/frontends/GUIRunTime.h: add new static method setDefaults
3027 * src/frontends/xforms/GUIRunTime.C (setDefaults):
3028 * src/frontends/kde/GUIRunTime.C (setDefaults):
3029 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
3031 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
3032 with strnew in arg, use correct emptystring when calling SetName.
3034 * several files: remove all commented code with relation to
3035 HAVE_SSTREAM beeing false. We now only support stringstream and
3038 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3040 * src/lyxfunc.C: construct correctly the automatic new file
3043 * src/text2.C (IsStringInText): change type of variable i to shut
3046 * src/support/sstream.h: do not use namespaces if the compiler
3047 does not support them.
3049 2000-09-15 Marko Vendelin <markov@ioc.ee>
3050 * src/frontends/gnome/FormCitation.C
3051 * src/frontends/gnome/FormCitation.h
3052 * src/frontends/gnome/diainsertcitation_interface.c
3053 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
3054 regexp support to FormCitation [Gnome].
3056 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
3059 * configure.in: remove unused KDE/GTKGUI define
3061 * src/frontends/kde/FormRef.C
3062 * src/frontends/kde/FormRef.h
3063 * src/frontends/kde/formrefdialog.C
3064 * src/frontends/kde/formrefdialog.h: double click will
3065 go to reference, now it is possible to change a cross-ref
3068 * src/frontends/kde/FormToc.C
3069 * src/frontends/kde/FormToc.h
3070 * src/frontends/kde/formtocdialog.C
3071 * src/frontends/kde/formtocdialog.h: add a depth
3074 * src/frontends/kde/Makefile.am: add QtLyXView.h
3077 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
3079 * src/frontends/kde/FormCitation.h: added some using directives.
3081 * src/frontends/kde/FormToc.h: corrected definition of doTree.
3083 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
3086 * src/mathed/math_defs.h: redefine SetAlign to use string rather
3089 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3091 * src/buffer.C (pop_tag): revert for the second time a change by
3092 Lars, who seems to really hate having non-local loop variables :)
3094 * src/Lsstream.h: add "using" statements.
3096 * src/support/copy.C (copy): add a bunch of std:: qualifiers
3097 * src/buffer.C (writeFile): ditto
3099 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3101 * src/buffer.C (writeFile): try to fix the locale modified format
3102 number to always be as we want it.
3104 * src/WorkArea.C (work_area_handler): try to workaround the bugs
3105 in XForms 0.89. C-space is now working again.
3107 * src/Lsstream.h src/support/sstream.h: new files.
3109 * also commented out all cases where strstream were used.
3111 * src/Bullet.h (c_str): remove method.
3113 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
3115 * a lot of files: get rid of "char const *" and "char *" is as
3116 many places as possible. We only want to use them in interaction
3117 with system of other libraries, not inside lyx.
3119 * a lot of files: return const object is not of pod type. This
3120 helps ensure that temporary objects is not modified. And fits well
3121 with "programming by contract".
3123 * configure.in: check for the locale header too
3125 * Makefile.am (sourcedoc): new tag for generation of doc++
3128 2000-09-14 Juergen Vigna <jug@sad.it>
3130 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
3131 callback to check which combo called it and do the right action.
3133 * src/combox.C (combo_cb): added combo * to the callbacks.
3134 (Hide): moved call of callback after Ungrab of the pointer.
3136 * src/intl.h: removed LCombo2 function.
3138 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
3139 function as this can now be handled in one function.
3141 * src/combox.h: added Combox * to callback prototype.
3143 * src/frontends/xforms/Toolbar_pimpl.C:
3144 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
3146 2000-09-14 Garst Reese <reese@isn.net>
3148 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
3149 moved usepackage{xxx}'s to beginning of file. Changed left margin
3150 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
3151 underlining from title. Thanks to John Culleton for useful suggestions.
3153 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3155 * src/lyxlex_pimpl.C (setFile): change error message to debug
3158 2000-09-13 Juergen Vigna <jug@sad.it>
3160 * src/frontends/xforms/FormDocument.C: implemented choice_class
3161 as combox and give callback to combo_language so OK/Apply is activated
3164 * src/bufferlist.C (newFile): small fix so already named files
3165 (via an open call) are not requested to be named again on the
3168 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3170 * src/frontends/kde/Makefile.am
3171 * src/frontends/kde/FormRef.C
3172 * src/frontends/kde/FormRef.h
3173 * src/frontends/kde/formrefdialog.C
3174 * src/frontends/kde/formrefdialog.h: implement
3177 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
3179 * src/frontends/kde/formtocdialog.C
3180 * src/frontends/kde/formtocdialog.h
3181 * src/frontends/kde/FormToc.C
3182 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
3184 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
3186 * src/frontends/kde/FormCitation.C: fix thinko
3187 where we didn't always display the reference text
3190 * src/frontends/kde/formurldialog.C
3191 * src/frontends/kde/formurldialog.h
3192 * src/frontends/kde/FormUrl.C
3193 * src/frontends/kde/FormUrl.h: minor cleanups
3195 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
3197 * src/frontends/kde/Makefile.am
3198 * src/frontends/kde/FormToc.C
3199 * src/frontends/kde/FormToc.h
3200 * src/frontends/kde/FormCitation.C
3201 * src/frontends/kde/FormCitation.h
3202 * src/frontends/kde/FormIndex.C
3203 * src/frontends/kde/FormIndex.h
3204 * src/frontends/kde/formtocdialog.C
3205 * src/frontends/kde/formtocdialog.h
3206 * src/frontends/kde/formcitationdialog.C
3207 * src/frontends/kde/formcitationdialog.h
3208 * src/frontends/kde/formindexdialog.C
3209 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
3211 2000-09-12 Juergen Vigna <jug@sad.it>
3213 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
3216 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3218 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
3221 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
3223 * src/converter.C (Add, Convert): Added support for converter flags:
3224 needaux, resultdir, resultfile.
3225 (Convert): Added new parameter view_file.
3226 (dvips_options): Fixed letter paper option.
3228 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
3229 (Export, GetExportableFormats, GetViewableFormats): Added support
3232 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
3234 (easyParse): Fixed to work with new export code.
3236 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
3239 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
3241 * lib/bind/*.bind: Replaced
3242 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
3243 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
3245 2000-09-11 Juergen Vigna <jug@sad.it>
3247 * src/lyx_gui.C (runTime): uses global guiruntime variable.
3249 * src/main.C (main): now GUII defines global guiruntime!
3251 * src/frontends/gnome/GUIRunTime.C (initApplication):
3252 * src/frontends/kde/GUIRunTime.C (initApplication):
3253 * src/frontends/xforms/GUIRunTime.C (initApplication):
3254 * src/frontends/GUIRunTime.h: added new function initApplication.
3256 * src/spellchecker.C (sc_accept_word): change to add_to_session.
3258 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
3260 2000-09-08 Juergen Vigna <jug@sad.it>
3262 * src/lyx_gui.C (create_forms): don't display the "default" entry as
3263 we have already "Reset".
3265 * src/language.C (initL): inserted "default" language and made this
3266 THE default language (and not american!)
3268 * src/paragraph.C: inserted handling of "default" language!
3270 * src/lyxfont.C: ditto
3274 * src/paragraph.C: output the \\par only if we have a following
3275 paragraph otherwise it's not needed.
3277 2000-09-05 Juergen Vigna <jug@sad.it>
3279 * config/pspell.m4: added entry to lyx-flags
3281 * src/spellchecker.C: modified version from Kevin for using pspell
3283 2000-09-01 Marko Vendelin <markov@ioc.ee>
3284 * src/frontends/gnome/Makefile.am
3285 * src/frontends/gnome/FormCitation.C
3286 * src/frontends/gnome/FormCitation.h
3287 * src/frontends/gnome/diainsertcitation_callbacks.c
3288 * src/frontends/gnome/diainsertcitation_callbacks.h
3289 * src/frontends/gnome/diainsertcitation_interface.c
3290 * src/frontends/gnome/diainsertcitation_interface.h
3291 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
3292 dialog for Gnome frontend
3294 * src/main.C: Gnome libraries require keeping application name
3295 and its version as strings
3297 * src/frontends/gnome/mainapp.C: Change the name of the main window
3298 from GnomeLyX to PACKAGE
3300 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3302 * src/frontends/Liason.C: add "using: declaration.
3304 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
3306 * src/mathed/math_macro.C (Metrics): Set the size of the template
3308 * src/mathed/formulamacro.C (Latex): Fixed the returned value
3310 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
3312 * src/converter.C (add_options): New function.
3313 (SetViewer): Change $$FName into '$$FName'.
3314 (View): Add options when running xdvi
3315 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
3316 (Convert): The 3rd parameter is now the desired filename. Converts
3317 calls to lyx::rename if necessary.
3318 Add options when running dvips.
3319 (dvi_papersize,dvips_options): New methods.
3321 * src/exporter.C (Export): Use getLatexName() instead of fileName().
3323 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
3324 using a call to Converter::dvips_options.
3325 Fixed to work with nex export code.
3327 * src/support/copy.C
3328 * src/support/rename.C: New files
3330 * src/support/syscall.h
3331 * src/support/syscall.C: Added Starttype SystemDontWait.
3333 * lib/ui/default.ui: Changed to work with new export code
3335 * lib/configure.m4: Changed to work with new export code
3337 * src/encoding.C: Changed latex name for iso8859_7 encoding.
3339 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
3341 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
3342 so that code compiles with DEC cxx.
3344 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
3345 to work correctly! Also now supports the additional elements
3348 2000-09-01 Allan Rae <rae@lyx.org>
3350 * src/frontends/ButtonPolicies.C: renamed all the references to
3351 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
3353 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
3354 since it's a const not a type.
3356 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
3358 2000-08-31 Juergen Vigna <jug@sad.it>
3360 * src/insets/figinset.C: Various changes to look if the filename has
3361 an extension and if not add it for inline previewing.
3363 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3365 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
3366 make buttonStatus and isReadOnly be const methods. (also reflect
3367 this in derived classes.)
3369 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
3370 (nextState): change to be static inline, pass the StateMachine as
3372 (PreferencesPolicy): remove casts
3373 (OkCancelPolicy): remvoe casts
3374 (OkCancelReadOnlyPolicy): remove casts
3375 (NoRepeatedApplyReadOnlyPolicy): remove casts
3376 (OkApplyCancelReadOnlyPolicy): remove casts
3377 (OkApplyCancelPolicy): remove casts
3378 (NoRepeatedApplyPolicy): remove casts
3380 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
3382 * src/converter.C: added some using directives
3384 * src/frontends/ButtonPolicies.C: changes to overcome
3385 "need lvalue" error with DEC c++
3387 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
3388 to WMHideCB for DEC c++
3390 * src/frontends/xforms/Menubar_pimpl.C: added using directive
3392 * src/frontends/xforms/forms/form_document.C.patch: use C callback
3393 to BulletBMTableCB for DEC c++
3395 2000-08-31 Allan Rae <rae@lyx.org>
3397 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
3398 character dialog separately from old document dialogs combo_language.
3401 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3403 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
3404 Removed LFUN_REF_CREATE.
3406 * src/MenuBackend.C: Added new tags: toc and references
3408 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
3409 (add_lastfiles, add_documents, add_formats): Removed the unused smn
3411 (add_toc, add_references): New methods.
3412 (create_submenu): Handle correctly the case when there is a
3413 seperator after optional menu items.
3415 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
3416 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
3417 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
3419 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
3421 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
3423 * src/converter.[Ch]: New file for converting between different
3426 * src/export.[Ch]: New file for exporting a LyX file to different
3429 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
3430 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
3431 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
3432 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
3433 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
3434 RunDocBook, MenuExport.
3436 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
3437 Exporter::Preview methods if NEW_EXPORT is defined.
3439 * src/buffer.C (Dispatch): Use Exporter::Export.
3441 * src/lyxrc.C: Added new tags: \converter and \viewer.
3444 * src/LyXAction.C: Define new lyx-function: buffer-update.
3445 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
3446 when NEW_EXPORT is defined.
3448 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
3450 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
3452 * lib/ui/default.ui: Added submenus "view" and "update" to the
3455 * src/filetools.C (GetExtension): New function.
3457 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
3459 2000-08-29 Allan Rae <rae@lyx.org>
3461 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
3463 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
3464 (EnableDocumentLayout): removed
3465 (DisableDocumentLayout): removed
3466 (build): make use of ButtonController's read-only handling to
3467 de/activate various objects. Replaces both of the above functions.
3469 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
3470 (readOnly): was read_only
3471 (refresh): fixed dumb mistakes with read_only_ handling
3473 * src/frontends/xforms/forms/form_document.fd:
3474 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
3475 tabbed dialogs so the tabs look more like tabs and so its easier to
3476 work out which is the current tab.
3478 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
3479 segfault with form_table
3481 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
3483 2000-08-28 Juergen Vigna <jug@sad.it>
3485 * acconfig.h: added USE_PSPELL.
3487 * src/config.h.in: added USE_PSPELL.
3489 * autogen.sh: added pspell.m4
3491 * config/pspell.m4: new file.
3493 * src/spellchecker.C: implemented support for pspell libary.
3495 2000-08-25 Juergen Vigna <jug@sad.it>
3497 * src/LyXAction.C (init): renamed LFUN_TABLE to
3498 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
3500 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
3502 * src/lyxscreen.h: add force_clear variable and fuction to force
3503 a clear area when redrawing in LyXText.
3505 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
3507 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3509 * some whitespace and comment changes.
3511 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
3513 * src/buffer.C: up te LYX_FORMAT to 2.17
3515 2000-08-23 Juergen Vigna <jug@sad.it>
3517 * src/BufferView_pimpl.C (tripleClick): disable this when in a
3520 * src/insets/insettabular.C (pasteSelection): delete the insets
3521 LyXText as it is not valid anymore.
3522 (copySelection): new function.
3523 (pasteSelection): new function.
3524 (cutSelection): new function.
3525 (LocalDispatch): implemented cut/copy/paste of cell selections.
3527 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
3528 don't have a LyXText.
3530 * src/LyXAction.C (init): a NEW_TABULAR define too much.
3532 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
3535 2000-08-22 Juergen Vigna <jug@sad.it>
3537 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
3538 ifdef form_table out if NEW_TABULAR.
3540 2000-08-21 Juergen Vigna <jug@sad.it>
3542 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
3543 (draw): fixed draw position so that the cursor is positioned in the
3545 (InsetMotionNotify): hide/show cursor so the position is updated.
3546 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
3547 using cellstart() function where it should be used.
3549 * src/insets/insettext.C (draw): ditto.
3551 * src/tabular.C: fixed initialization of some missing variables and
3552 made BoxType into an enum.
3554 2000-08-22 Marko Vendelin <markov@ioc.ee>
3555 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
3556 stock menu item using action numerical value, not its string
3560 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
3562 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
3563 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
3565 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
3567 * src/frontends/xforms/GUIRunTime.C: new file
3569 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
3570 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3572 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
3574 * src/frontends/kde/GUIRunTime.C: new file
3576 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
3577 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
3579 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
3581 * src/frontends/gnome/GUIRunTime.C: new file
3583 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
3586 * src/frontends/GUIRunTime.h: removed constructor and destructor,
3587 small change to documetentation.
3589 * src/frontends/GUIRunTime.C: removed file
3591 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
3593 * src/lyxparagraph.h: enable NEW_TABULAR as default
3595 * src/lyxfunc.C (processKeySym): remove some commented code
3597 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
3598 NEW_TABULAR around the fd_form_table_options.
3600 * src/lyx_gui.C (runTime): call the static member function as
3601 GUIRunTime::runTime().
3603 2000-08-21 Allan Rae <rae@lyx.org>
3605 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
3608 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
3610 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
3612 2000-08-21 Allan Rae <rae@lyx.org>
3614 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
3615 keep Garst happy ;-)
3616 * src/frontends/xforms/FormPreferences.C (build): use setOK
3617 * src/frontends/xforms/FormDocument.C (build): use setOK
3618 (FormDocument): use the appropriate policy.
3620 2000-08-21 Allan Rae <rae@lyx.org>
3622 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
3623 automatic [de]activation of arbitrary objects when in a read-only state.
3625 * src/frontends/ButtonPolicies.h: More documentation
3626 (isReadOnly): added to support the above.
3628 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
3630 2000-08-18 Juergen Vigna <jug@sad.it>
3632 * src/insets/insettabular.C (getStatus): changed to return func_status.
3634 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
3635 display toggle menu entries if they are.
3637 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
3638 new document layout now.
3640 * src/lyxfunc.C: ditto
3642 * src/lyx_gui_misc.C: ditto
3644 * src/lyx_gui.C: ditto
3646 * lib/ui/default.ui: removed paper and quotes layout as they are now
3647 all in the document layout tabbed folder.
3649 * src/frontends/xforms/forms/form_document.fd: added Restore
3650 button and callbacks for all inputs for Allan's ButtonPolicy.
3652 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
3653 (CheckChoiceClass): added missing params setting on class change.
3654 (UpdateLayoutDocument): added for updating the layout on params.
3655 (build): forgot to RETURN_ALWAYS input_doc_spacing.
3656 (FormDocument): Implemented Allan's ButtonPolicy with the
3659 2000-08-17 Allan Rae <rae@lyx.org>
3661 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
3662 so we can at least see the credits again.
3664 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
3665 controller calls for the appropriate callbacks. Note that since Ok
3666 calls apply followed by cancel, and apply isn't a valid input for the
3667 APPLIED state, the bc_ calls have to be made in the static callback not
3668 within each of the real callbacks.
3670 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
3671 (setOk): renamed from setOkay()
3673 2000-08-17 Juergen Vigna <jug@sad.it>
3675 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
3676 in the implementation part.
3677 (composeUIInfo): don't show optional menu-items.
3679 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
3681 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
3683 * src/bufferview_funcs.C (CurrentState): fixed to show also the
3684 text-state when in a text-inset.
3686 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
3688 2000-08-17 Marko Vendelin <markov@ioc.ee>
3689 * src/frontends/gnome/FormIndex.C
3690 * src/frontends/gnome/FormIndex.h
3691 * src/frontends/gnome/FormToc.C
3692 * src/frontends/gnome/FormToc.h
3693 * src/frontends/gnome/dialogs
3694 * src/frontends/gnome/diatoc_callbacks.c
3695 * src/frontends/gnome/diatoc_callbacks.h
3696 * src/frontends/gnome/diainsertindex_callbacks.h
3697 * src/frontends/gnome/diainsertindex_callbacks.c
3698 * src/frontends/gnome/diainsertindex_interface.c
3699 * src/frontends/gnome/diainsertindex_interface.h
3700 * src/frontends/gnome/diatoc_interface.h
3701 * src/frontends/gnome/diatoc_interface.c
3702 * src/frontends/gnome/Makefile.am: Table of Contents and
3703 Insert Index dialogs implementation for Gnome frontend
3705 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
3707 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
3709 * src/frontends/gnome/diainserturl_interface.c: make the dialog
3712 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
3714 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
3715 destructor. Don't definde if you don't need it
3716 (processEvents): made static, non-blocking events processing for
3718 (runTime): static method. event loop for xforms
3719 * similar as above for kde and gnome.
3721 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
3722 new Pimpl is correct
3723 (runTime): new method calss the real frontends runtime func.
3725 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
3727 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3729 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
3731 2000-08-16 Juergen Vigna <jug@sad.it>
3733 * src/lyx_gui.C (runTime): added GUII RunTime support.
3735 * src/frontends/Makefile.am:
3736 * src/frontends/GUIRunTime.[Ch]:
3737 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
3738 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
3739 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
3741 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
3743 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
3744 as this is already set in ${FRONTEND_INCLUDE} if needed.
3746 * configure.in (CPPFLAGS): setting the include dir for the frontend
3747 directory and don't set FRONTEND=xforms for now as this is executed
3750 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
3752 * src/frontends/kde/Makefile.am:
3753 * src/frontends/kde/FormUrl.C:
3754 * src/frontends/kde/FormUrl.h:
3755 * src/frontends/kde/formurldialog.h:
3756 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
3758 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
3760 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
3762 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
3764 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
3767 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
3769 * src/WorkArea.C (work_area_handler): more work to get te
3770 FL_KEYBOARD to work with xforms 0.88 too, please test.
3772 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
3774 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
3776 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
3779 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
3781 * src/Timeout.h: remove Qt::emit hack.
3783 * several files: changes to allo doc++ compilation
3785 * src/lyxfunc.C (processKeySym): new method
3786 (processKeyEvent): comment out if FL_REVISION < 89
3788 * src/WorkArea.C: change some debugging levels.
3789 (WorkArea): set wantkey to FL_KEY_ALL
3790 (work_area_handler): enable the FL_KEYBOARD clause, this enables
3791 clearer code and the use of compose with XForms 0.89. Change to
3792 use signals instead of calling methods in bufferview directly.
3794 * src/Painter.C: change some debugging levels.
3796 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
3799 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
3800 (workAreaKeyPress): new method
3802 2000-08-14 Juergen Vigna <jug@sad.it>
3804 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
3806 * config/kde.m4: addes some features
3808 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
3809 include missing xforms dialogs.
3811 * src/Timeout.h: a hack to be able to compile with qt/kde.
3813 * sigc++/.cvsignore: added acinclude.m4
3815 * lib/.cvsignore: added listerros
3817 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
3818 xforms tree as objects are needed for other frontends.
3820 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
3821 linking with not yet implemented xforms objects.
3823 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
3825 2000-08-14 Baruch Even <baruch.even@writeme.com>
3827 * src/frontends/xforms/FormGraphics.h:
3828 * src/frontends/xforms/FormGraphics.C:
3829 * src/frontends/xforms/RadioButtonGroup.h:
3830 * src/frontends/xforms/RadioButtonGroup.C:
3831 * src/insets/insetgraphics.h:
3832 * src/insets/insetgraphics.C:
3833 * src/insets/insetgraphicsParams.h:
3834 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
3835 instead of spaces, and various other indentation issues to make the
3836 sources more consistent.
3838 2000-08-14 Marko Vendelin <markov@ioc.ee>
3840 * src/frontends/gnome/dialogs/diaprint.glade
3841 * src/frontends/gnome/FormPrint.C
3842 * src/frontends/gnome/FormPrint.h
3843 * src/frontends/gnome/diaprint_callbacks.c
3844 * src/frontends/gnome/diaprint_callbacks.h
3845 * src/frontends/gnome/diaprint_interface.c
3846 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
3849 * src/frontends/gnome/dialogs/diainserturl.glade
3850 * src/frontends/gnome/FormUrl.C
3851 * src/frontends/gnome/FormUrl.h
3852 * src/frontends/gnome/diainserturl_callbacks.c
3853 * src/frontends/gnome/diainserturl_callbacks.h
3854 * src/frontends/gnome/diainserturl_interface.c
3855 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
3856 Gnome implementation
3858 * src/frontends/gnome/Dialogs.C
3859 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
3860 all other dialogs. Copy all unimplemented dialogs from Xforms
3863 * src/frontends/gnome/support.c
3864 * src/frontends/gnome/support.h: support files generated by Glade
3868 * config/gnome.m4: Gnome configuration scripts
3870 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
3871 configure --help message
3873 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
3874 only if there are no events pendling in Gnome/Gtk. This enhances
3875 the performance of menus.
3878 2000-08-14 Allan Rae <rae@lyx.org>
3880 * lib/Makefile.am: listerrors cleaning
3882 * lib/listerrors: removed -- generated file
3883 * acinclude.m4: ditto
3884 * sigc++/acinclude.m4: ditto
3886 * src/frontends/xforms/forms/form_citation.fd:
3887 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
3890 * src/frontends/xforms/forms/makefile: I renamed the `install` target
3891 `updatesrc` and now we have a `test` target that does what `updatesrc`
3892 used to do. I didn't like having an install target that wasn't related
3895 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
3896 on all except FormGraphics. This may yet happen. Followed by a major
3897 cleanup including using FL_TRANSIENT for most of the dialogs. More
3898 changes to come when the ButtonController below is introduced.
3900 * src/frontends/xforms/ButtonController.h: New file for managing up to
3901 four buttons on a dialog according to an externally defined policy.
3902 * src/frontends/xforms/Makefile.am: added above
3904 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
3905 Apply and Cancel/Close buttons and everything in between and beyond.
3906 * src/frontends/Makefile.am: added above.
3908 * src/frontends/xforms/forms/form_preferences.fd:
3909 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
3910 and removed variable 'status' as a result. Fixed the set_minsize thing.
3911 Use the new screen-font-update after checking screen fonts were changed
3912 Added a "Restore" button to restore the original lyxrc values while
3913 editing. This restores everything not just the last input changed.
3914 That's still a tricky one. As is the "LyX: this shouldn't happen..."
3916 * src/LyXAction.C: screen-font-update added for updating buffers after
3917 screen font settings have been changed.
3918 * src/commandtags.h: ditto
3919 * src/lyxfunc.C: ditto
3921 * forms/lyx.fd: removed screen fonts dialog.
3922 * src/lyx_gui.C: ditto
3923 * src/menus.[Ch]: ditto
3924 * src/lyx.[Ch]: ditto
3925 * src/lyx_cb.C: ditto + code from here moved to make
3926 screen-font-update. And people wonder why progress on GUII is
3927 slow. Look at how scattered this stuff was! It takes forever
3930 * forms/fdfix.sh: Fixup the spacing after commas.
3931 * forms/makefile: Remove date from generated files. Fewer clashes now.
3932 * forms/bullet_forms.C.patch: included someones handwritten changes
3934 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
3935 once I've discovered why LyXRC was made noncopyable.
3936 * src/lyx_main.C: ditto
3938 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
3940 * src/frontends/xforms/forms/fdfix.sh:
3941 * src/frontends/xforms/forms/fdfixh.sed:
3942 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
3943 * src/frontends/xforms/Form*.[hC]:
3944 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
3945 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
3946 provide a destructor for the struct FD_form_xxxx. Another version of
3947 the set_[max|min]size workaround and a few other cleanups. Actually,
3948 Angus' patch from 20000809.
3950 2000-08-13 Baruch Even <baruch.even@writeme.com>
3952 * src/insets/insetgraphics.C (Clone): Added several fields that needed
3955 2000-08-11 Juergen Vigna <jug@sad.it>
3957 * src/insets/insetgraphics.C (InsetGraphics): changing init
3958 order because of warnings.
3960 * src/frontends/xforms/forms/makefile: adding patching .C with
3963 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
3964 from .C.patch to .c.patch
3966 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
3967 order because of warning.
3969 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
3971 * src/frontends/Liason.C (setMinibuffer): new helper function
3973 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
3975 * src/lyxfunc.C (Dispatch): calling new Document-Layout
3977 * lib/ui/default.ui: commented out PaperLayout entry
3979 * src/frontends/xforms/form_document.[Ch]: new added files
3981 * src/frontends/xforms/FormDocument.[Ch]: ditto
3983 * src/frontends/xforms/forms/form_document.fd: ditto
3985 * src/frontends/xforms/forms/form_document.C.patch: ditto
3987 2000-08-10 Juergen Vigna <jug@sad.it>
3989 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
3990 (InsetGraphics): initialized cacheHandle to 0.
3991 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
3993 2000-08-10 Baruch Even <baruch.even@writeme.com>
3995 * src/graphics/GraphicsCache.h:
3996 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
3997 correctly as a cache.
3999 * src/graphics/GraphicsCacheItem.h:
4000 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
4003 * src/graphics/GraphicsCacheItem_pimpl.h:
4004 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
4007 * src/insets/insetgraphics.h:
4008 * src/insets/insetgraphics.C: Changed from using a signal notification
4009 to polling when image is not loaded.
4011 2000-08-10 Allan Rae <rae@lyx.org>
4013 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
4014 that there are two functions that have to been taken out of line by
4015 hand and aren't taken care of in the script. (Just a reminder note)
4017 * sigc++/macros/*.h.m4: Updated as above.
4019 2000-08-09 Juergen Vigna <jug@sad.it>
4021 * src/insets/insettext.C (draw): small fix for clearing rectangle.
4023 * src/insets/insettabular.C: make drawing of single cell smarter.
4025 2000-08-09 Marko Vendelin <markov@ioc.ee>
4026 * src/frontends/gnome/Menubar_pimpl.C
4027 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
4028 implementation: new files
4030 * src/frontends/gnome/mainapp.C
4031 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
4034 * src/main.C: create Gnome main window
4036 * src/frontends/xforms/Menubar_pimpl.h
4037 * src/frontends/Menubar.C
4038 * src/frontends/Menubar.h: added method Menubar::update that calls
4039 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
4041 * src/LyXView.C: calls Menubar::update to update the state
4044 * src/frontends/gnome/Makefile.am: added new files
4046 * src/frontends/Makefile.am: added frontend compiler options
4048 2000-08-08 Juergen Vigna <jug@sad.it>
4050 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
4052 * src/bufferlist.C (close):
4053 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
4054 documents if exiting without saving.
4056 * src/buffer.C (save): use removeAutosaveFile()
4058 * src/support/filetools.C (removeAutosaveFile): new function.
4060 * src/lyx_cb.C (MenuWrite): returns a bool now.
4061 (MenuWriteAs): check if file could really be saved and revert to the
4063 (MenuWriteAs): removing old autosavefile if existant.
4065 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
4066 before Goto toggle declaration, because of compiler warning.
4068 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
4070 * src/lyxfunc.C (MenuNew): small fix.
4072 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
4074 * src/bufferlist.C (newFile):
4075 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
4077 * src/lyxrc.C: added new_ask_filename tag
4079 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
4081 * src/lyx.fd: removed code pertaining to form_ref
4082 * src/lyx.[Ch]: ditto
4083 * src/lyx_cb.C: ditto
4084 * src/lyx_gui.C: ditto
4085 * src/lyx_gui_misc.C: ditto
4087 * src/BufferView_pimpl.C (restorePosition): update buffer only
4090 * src/commandtags.h (LFUN_REFTOGGLE): removed
4091 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
4092 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
4093 (LFUN_REFBACK): renamed LFUN_REF_BACK
4095 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
4096 * src/menus.C: ditto
4097 * src/lyxfunc.C (Dispatch): ditto.
4098 InsertRef dialog is now GUI-independent.
4100 * src/texrow.C: added using std::endl;
4102 * src/insets/insetref.[Ch]: strip out large amounts of code.
4103 The inset is now a container and this functionality is now
4104 managed by a new FormRef dialog
4106 * src/frontends/Dialogs.h (showRef, createRef): new signals
4108 * src/frontends/xforms/FormIndex.[Ch],
4109 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
4110 when setting dialog's min/max size
4111 * src/frontends/xforms/FormIndex.[Ch]: ditto
4113 * src/frontends/xforms/FormRef.[Ch],
4114 src/frontends/xforms/forms/form_ref.fd: new xforms
4115 implementation of an InsetRef dialog
4117 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
4120 * src/graphics/XPM_Renderer.C (isImageFormatOK):
4121 ios::nocreate is not part of the standard. Removed.
4123 2000-08-07 Baruch Even <baruch.even@writeme.com>
4125 * src/graphics/Renderer.h:
4126 * src/graphics/Renderer.C: Added base class for rendering of different
4127 image formats into Pixmaps.
4129 * src/graphics/XPM_Renderer.h:
4130 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
4131 in a different class.
4133 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
4134 easily add support for other formats.
4136 * src/insets/figinset.C: plugged a leak of an X resource.
4138 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
4140 * src/CutAndPaste.[Ch]: make all metods static.
4142 * development/Code_rules/Rules: more work, added section on
4143 Exceptions, and a References section.
4145 * a lot of header files: work to make doc++ able to generate the
4146 source documentation, some workarounds of doc++ problems. Doc++ is
4147 now able to generate the documentation.
4149 2000-08-07 Juergen Vigna <jug@sad.it>
4151 * src/insets/insettabular.C (recomputeTextInsets): removed function
4153 * src/tabular.C (SetWidthOfMulticolCell):
4155 (calculate_width_of_column_NMC): fixed return value so that it really
4156 only returns true if the column-width has changed (there where
4157 problems with muliticolumn-cells in this column).
4159 2000-08-04 Juergen Vigna <jug@sad.it>
4161 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
4162 also on the scrollstatus of the inset.
4163 (workAreaMotionNotify): ditto.
4165 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
4167 2000-08-01 Juergen Vigna <jug@sad.it>
4169 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
4171 * src/commandtags.h:
4172 * src/LyXAction.C (init):
4173 * src/insets/inset.C (LocalDispatch): added support for
4176 * src/insets/inset.C (scroll): new functions.
4178 * src/insets/insettext.C (removeNewlines): new function.
4179 (SetAutoBreakRows): removes forced newlines in the text of the
4180 paragraph if autoBreakRows is set to false.
4182 * src/tabular.C (Latex): generates a parbox around the cell contents
4185 * src/frontends/xforms/FormTabular.C (local_update): removed
4186 the radio_useparbox button.
4188 * src/tabular.C (UseParbox): new function
4190 2000-08-06 Baruch Even <baruch.even@writeme.com>
4192 * src/graphics/GraphicsCache.h:
4193 * src/graphics/GraphicsCache.C:
4194 * src/graphics/GraphicsCacheItem.h:
4195 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
4198 * src/insets/insetgraphics.h:
4199 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
4200 and the drawing of the inline image.
4202 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
4203 loaded into the wrong position.
4205 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
4208 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4210 * src/support/translator.h: move all typedefs to public section
4212 * src/support/filetools.C (MakeLatexName): return string const
4214 (TmpFileName): ditto
4215 (FileOpenSearch): ditto
4217 (LibFileSearch): ditto
4218 (i18nLibFileSearch): ditto
4221 (CreateTmpDir): ditto
4222 (CreateBufferTmpDir): ditto
4223 (CreateLyXTmpDir): ditto
4226 (MakeAbsPath): ditto
4228 (OnlyFilename): ditto
4230 (NormalizePath): ditto
4231 (CleanupPath): ditto
4232 (GetFileContents): ditto
4233 (ReplaceEnvironmentPath): ditto
4234 (MakeRelPath): ditto
4236 (ChangeExtension): ditto
4237 (MakeDisplayPath): ditto
4238 (do_popen): return cmdret const
4239 (findtexfile): return string const
4241 * src/support/DebugStream.h: add some /// to please doc++
4243 * src/frontends/DialogBase.h (endif): add some /// to please doc++
4245 * src/texrow.C (same_rownumber): functor to use with find_if
4246 (getIdFromRow): rewritten to use find_if and to not update the
4247 positions. return true if row is found
4248 (increasePos): new method, use to update positions
4250 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
4252 * src/lyxlex_pimpl.C (verifyTable): new method
4255 (GetString): return string const
4256 (pushTable): rewrite to use std::stack
4258 (setFile): better check
4261 * src/lyxlex.h: make LyXLex noncopyable
4263 * src/lyxlex.C (text): return char const * const
4264 (GetString): return string const
4265 (getLongString): return string const
4267 * src/lyx_gui_misc.C (askForText): return pair<...> const
4269 * src/lastfiles.[Ch] (operator): return string const
4271 * src/buffer.C (parseSingleLyXformat2Token): pass string to
4272 istringstream not char const *.
4273 move token.end() out of loop.
4274 (readFile): move initializaton of token
4276 * src/BufferView2.C (insertErrors): run texrow.increasePos if
4277 getIdFromRow is successful.
4279 * lib/bind/emacs.bind: don't include menus bind
4281 * development/Code_rules/Rules: the beginnings of making this
4282 better and covering more of the unwritten rules that we have.
4284 * development/Code_rules/Recommendations: a couple of wording
4287 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4289 * src/support/strerror.c: remove C++ comment.
4291 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
4293 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
4294 LFUN_INDEX_INSERT_LAST
4296 * src/texrow.C (getIdFromRow): changed from const_iterator to
4297 iterator, allowing code to compile with DEC cxx
4299 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
4300 stores part of the class, as suggested by Allan. Will allow
4302 (apply): test to apply uses InsetCommandParams operator!=
4304 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
4305 (apply): test to apply uses InsetCommandParams operator!=
4307 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
4308 stores part of the class.
4309 (update): removed limits on min/max size.
4311 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
4312 (apply): test to apply uses InsetCommandParams operator!=
4314 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
4315 (Read, Write, scanCommand, getCommand): moved functionality
4316 into InsetCommandParams.
4318 (getScreenLabel): made pure virtual
4319 new InsetCommandParams operators== and !=
4321 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
4322 c-tors based on InsetCommandParams. Removed others.
4323 * src/insets/insetinclude.[Ch]: ditto
4324 * src/insets/insetlabel.[Ch]: ditto
4325 * src/insets/insetparent.[Ch]: ditto
4326 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
4328 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
4329 insets derived from InsetCommand created using similar c-tors
4330 based on InsetCommandParams
4331 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
4332 * src/menus.C (ShowRefsMenu): ditto
4333 * src/paragraph.C (Clone): ditto
4334 * src/text2.C (SetCounter): ditto
4335 * src/lyxfunc.C (Dispatch) ditto
4336 Also recreated old InsetIndex behaviour exactly. Can now
4337 index-insert at the start of a paragraph and index-insert-last
4338 without launching the pop-up.
4340 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4342 * lib/lyxrc.example: mark te pdf options as non functional.
4344 * src/support/lstrings.C (strToInt): move initalization of tmpstr
4345 (isStrDbl): move tmpstr.end() out of loop.
4346 (strToDbl): move intialization of tmpstr
4347 (lowercase): return string const and move tmp.end() out of loop.
4348 (uppercase): return string const and move tmp.edn() out of loop.
4349 (prefixIs): add assertion
4354 (containsOnly): ditto
4355 (containsOnly): ditto
4356 (containsOnly): ditto
4357 (countChar): make last arg char not char const
4358 (token): return string const
4359 (subst): return string const, move tmp.end() out of loop.
4360 (subst): return string const, add assertion
4361 (strip): return string const
4362 (frontStrip): return string const, add assertion
4363 (frontStrip): return string const
4368 * src/support/lstrings.C: add inclde "LAssert.h"
4369 (isStrInt): move tmpstr.end() out of loop.
4371 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
4372 toollist.end() out of loop.
4373 (deactivate): move toollist.end() out of loop.
4374 (update): move toollist.end() out of loop.
4375 (updateLayoutList): move tc.end() out of loop.
4376 (add): move toollist.end() out of loop.
4378 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
4379 md.end() out of loop.
4381 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
4383 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
4386 * src/paragraph.C (Erase): move fontlist.end() out of loop.
4387 (Erase): move insetlist.end() out of loop.
4389 * src/lyx_sendfax_main.C: make show_logfile static and to take a
4390 ref to const string as first arg. Move initialization of some
4391 variables, whitespace changes.
4393 * src/kbmap.C (defkey): move table.end() out of loop.
4394 (kb_keymap): move table.end() out of loop.
4395 (findbinding): move table.end() out of loop.
4397 * src/MenuBackend.C (hasMenu): move end() out of loop.
4398 (getMenu): move end() out of loop.
4399 (getMenu): move menulist_.end() out of loop.
4401 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
4403 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
4406 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
4407 (getFromLyXName): move infotab.end() out of loop.
4409 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
4410 -fvtable-thunks -ffunction-sections -fdata-sections
4412 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
4414 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
4417 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4419 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
4421 * src/frontends/xforms/FormCitation.[Ch],
4422 src/frontends/xforms/FormIndex.[Ch],
4423 src/frontends/xforms/FormToc.[Ch],
4424 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
4426 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
4428 * src/commandtags.h: renamed, created some flags for citation
4431 * src/lyx_gui_misc.C: stripped out old FD_index_form code
4433 * src/lyxfunc.C (dispatch): use signals to insert index entry
4435 * src/frontends/Dialogs.h: new signal createIndex
4437 * src/frontends/xforms/FormCommand.[Ch],
4438 src/frontends/xforms/FormCitation.[Ch],
4439 src/frontends/xforms/FormToc.[Ch],
4440 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
4442 * src/insets/insetindex.[Ch]: GUI-independent
4444 * src/frontends/xforms/FormIndex.[Ch],
4445 * src/frontends/xforms/forms/form_index.fd: xforms implementation
4448 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
4450 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
4451 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
4453 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4455 * src/insets/insetref.C (Latex): rewrite so that there is now
4456 question that a initialization is requested.
4458 * src/insets/insetcommand.h: reenable the hide signal
4460 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4462 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
4463 fix handling of shortcuts (many bugs :)
4464 (add_lastfiles): ditto.
4466 * lib/ui/default.ui: fix a few shortcuts.
4468 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
4470 * Makefile.am: Fix ``rpmdist'' target to return the exit
4471 status of the ``rpm'' command, instead of the last command in
4472 the chain (the ``rm lyx.xpm'' command, which always returns
4475 2000-08-02 Allan Rae <rae@lyx.org>
4477 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
4478 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
4479 * src/frontends/xforms/FormToc.C (FormToc): ditto
4481 * src/frontends/xforms/Makefile.am: A few forgotten files
4483 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
4484 Signals-not-copyable-problem Lars' started commenting out.
4486 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
4488 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4490 * src/insets/insetcommand.h: Signals is not copyable so anoter
4491 scheme for automatic hiding of forms must be used.
4493 * src/frontends/xforms/FormCitation.h: don't inerit from
4494 noncopyable, FormCommand already does that.
4495 * src/frontends/xforms/FormToc.h: ditto
4496 * src/frontends/xforms/FormUrl.h: ditto
4498 * src/frontends/xforms/FormCitation.C: add include <algorithm>
4500 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
4502 * src/insets/insetcommand.h (hide): new SigC::Signal0
4503 (d-tor) new virtual destructor emits hide signal
4505 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
4506 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
4508 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
4509 LOF and LOT. Inset is now GUI-independent
4511 * src/insets/insetloa.[Ch]: redundant
4512 * src/insets/insetlof.[Ch]: ditto
4513 * src/insets/insetlot.[Ch]: ditto
4515 * src/frontends/xforms/forms/form_url.fd: tweaked!
4516 * src/frontends/xforms/forms/form_citation.fd: ditto
4518 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
4519 dialogs dealing with InsetCommand insets
4521 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
4522 FormCommand base class
4523 * src/frontends/xforms/FormUrl.[Ch]: ditto
4525 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
4527 * src/frontends/xforms/FormToc.[Ch]: ditto
4529 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
4530 passed a generic InsetCommand pointer
4531 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
4533 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
4534 and modified InsetTOC class
4535 * src/buffer.C: ditto
4537 * forms/lyx.fd: strip out old FD_form_toc code
4538 * src/lyx_gui_misc.C: ditto
4539 * src/lyx_gui.C: ditto
4540 * src/lyx_cb.C: ditto
4541 * src/lyx.[Ch]: ditto
4543 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4545 * src/support/utility.hpp: tr -d '\r'
4547 2000-08-01 Juergen Vigna <jug@sad.it>
4549 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
4551 * src/commandtags.h:
4552 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
4553 LFUN_TABULAR_FEATURES.
4555 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
4556 LFUN_LAYOUT_TABULAR.
4558 * src/insets/insettabular.C (getStatus): implemented helper function.
4560 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
4562 2000-07-31 Juergen Vigna <jug@sad.it>
4564 * src/text.C (draw): fixed screen update problem for text-insets.
4566 * src/text2.C (SetParagrpah): call an update of the inset-owner when
4567 something changed probably this has to be added in various other
4570 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
4572 2000-07-31 Baruch Even <baruch.even@writeme.com>
4574 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
4575 templates to satisfy compaq cxx.
4578 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4580 * src/support/translator.h (equal_1st_in_pair::operator()): take
4581 const ref pair_type as arg.
4582 (equal_2nd_in_pair::operator()): ditto
4583 (Translator::~Translator): remove empty d-tor.
4585 * src/graphics/GraphicsCache.C: move include config.h to top, also
4586 put initialization of GraphicsCache::singleton here.
4587 (~GraphicsCache): move here
4588 (addFile): take const ref as arg
4591 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
4593 * src/BufferView2.C (insertLyXFile): change te with/without header
4596 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4598 * src/frontends/xforms/FormGraphics.C (apply): add some
4599 static_cast. Not very nice, but required by compaq cxx.
4601 * src/frontends/xforms/RadioButtonGroup.h: include header
4602 <utility> instead of <pair.h>
4604 * src/insets/insetgraphicsParams.C: add using directive.
4605 (readResize): change return type to void.
4606 (readOrigin): ditto.
4608 * src/lyxfunc.C (getStatus): add missing break for build-program
4609 function; add test for Literate for export functions.
4611 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
4612 entries in Options menu.
4614 2000-07-31 Baruch Even <baruch.even@writeme.com>
4616 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
4617 protect against auto-allocation; release icon when needed.
4619 2000-07-31 Matej Cepl <CeplM@seznam.cz>
4621 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
4622 on usual typewriter.
4624 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
4625 earlier czech.kmap), useful only for programming.
4627 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4629 * src/frontends/xforms/FormCitation.h: fix conditioning around
4632 2000-07-31 Juergen Vigna <jug@sad.it>
4634 * src/frontends/xforms/FormTabular.C (local_update): changed
4635 radio_linebreaks to radio_useparbox and added radio_useminipage.
4637 * src/tabular.C: made support for using minipages/parboxes.
4639 * src/bufferlist.C (QwriteAll): small fix for asking for save.
4641 * src/insets/insetgraphics.C (draw): just draw the inset so that the
4643 (descent): so the cursor is in the middle.
4644 (width): bit smaller box.
4646 * src/insets/insetgraphics.h: added display() function.
4648 2000-07-31 Baruch Even <baruch.even@writeme.com>
4650 * src/frontends/Dialogs.h: Added showGraphics signals.
4652 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
4653 xforms form definition of the graphics dialog.
4655 * src/frontends/xforms/FormGraphics.h:
4656 * src/frontends/xforms/FormGraphics.C: Added files, the
4657 GUIndependent code of InsetGraphics
4659 * src/insets/insetgraphics.h:
4660 * src/insets/insetgraphics.C: Major writing to make it work.
4662 * src/insets/insetgraphicsParams.h:
4663 * src/insets/insetgraphicsParams.C: Added files, parameter passing
4664 struct between InsetGraphics and GUI.
4666 * src/LaTeXFeatures.h:
4667 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
4668 support for graphicx package.
4670 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
4671 for the graphics inset.
4673 * src/support/translator.h: Added file, used in
4674 InsetGraphicsParams. this is a template to translate between two
4677 * src/frontends/xforms/RadioButtonGroup.h:
4678 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
4679 way to easily control a radio button group.
4681 2000-07-28 Juergen Vigna <jug@sad.it>
4683 * src/insets/insettabular.C (LocalDispatch):
4684 (TabularFeatures): added support for lyx-functions of tabular features.
4685 (cellstart): refixed this function after someone wrongly changed it.
4687 * src/commandtags.h:
4688 * src/LyXAction.C (init): added support for tabular-features
4690 2000-07-28 Allan Rae <rae@lyx.org>
4692 * src/frontends/xforms/FormPreferences.C (build): Setup input return
4693 checking. NOTE: It seems that pressing ESC to cancel the dialog also
4694 triggers the callback for input checking. As a result we sometimes get
4695 "LyX: This shouldn't happen..." printed to cerr.
4696 (input): Started using status variable since I only free() on
4697 destruction. Some input checking for paths and font sizes.
4699 * src/frontends/xforms/FormPreferences.h: Use status to control
4700 activation of Ok and Apply
4702 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
4703 callback. Also resized to stop segfaults with 0.88. The problem is
4704 that xforms-0.88 requires the folder to be wide enough to fit all the
4705 tabs. If it isn't it causes all sorts of problems.
4707 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
4709 * src/frontends/xforms/forms/README: Reflect reality.
4711 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
4712 * src/frontends/xforms/forms/makefile: ditto.
4714 * src/commandtags.h: Get access to new Preferences dialog
4715 * src/LyXAction.C: ditto
4716 * src/lyxfunc.C: ditto
4717 * lib/ui/default.ui: ditto
4719 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4721 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
4723 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
4726 * src/frontends/xforms/form_url.[Ch]: added.
4728 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4730 * src/insets/insetbib.h: fixed bug in previous commit
4732 * src/frontends/xforms/FormUrl.h: ditto
4734 * src/frontends/xforms/FormPrint.h: ditto
4736 * src/frontends/xforms/FormPreferences.h: ditto
4738 * src/frontends/xforms/FormCopyright.h: ditto
4740 * src/frontends/xforms/FormCitation.C: ditto
4742 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
4743 private copyconstructor and private default contructor
4745 * src/support/Makefile.am: add utility.hpp
4747 * src/support/utility.hpp: new file from boost
4749 * src/insets/insetbib.h: set owner in clone
4751 * src/frontends/xforms/FormCitation.C: added missing include
4754 * src/insets/form_url.[Ch]: removed
4756 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
4758 * development/lyx.spec.in
4759 * Makefile.am: Fix buglet for LyX RPM generation resulting from
4760 file/directory re-organization.
4762 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
4764 * src/insets/insetcommand.[Ch]: moved the string data and
4765 associated manipulation methods into a new stand-alone class
4766 InsetCommandParams. This class has two additional methods
4767 getAsString() and setFromString() allowing the contents to be
4768 moved around as a single string.
4769 (addContents) method removed.
4770 (setContents) method no longer virtual.
4772 * src/buffer.C (readInset): made use of new InsetCitation,
4773 InsetUrl constructors based on InsetCommandParams.
4775 * src/commandtags.h: add LFUN_INSERT_URL
4777 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
4778 independent InsetUrl and use InsetCommandParams to extract
4779 string info and create new Insets.
4781 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
4783 * src/frontends/xforms/FormCitation.C (apply): uses
4786 * src/frontends/xforms/form_url.C
4787 * src/frontends/xforms/form_url.h
4788 * src/frontends/xforms/FormUrl.h
4789 * src/frontends/xforms/FormUrl.C
4790 * src/frontends/xforms/forms/form_url.fd: new files
4792 * src/insets/insetcite.[Ch]: removed unused constructors.
4794 * src/insets/insetinclude.[Ch]: no longer store filename
4796 * src/insets/inseturl.[Ch]: GUI-independent.
4798 2000-07-26 Juergen Vigna <jug@sad.it>
4799 * renamed frontend from gtk to gnome as it is that what is realized
4800 and did the necessary changes in the files.
4802 2000-07-26 Marko Vendelin <markov@ioc.ee>
4804 * configure.in: cleaning up gnome configuration scripts
4806 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4808 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
4809 shortcuts syndrom by redrawing them explicitely (a better solution
4810 would be appreciated).
4812 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
4814 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
4817 * src/lyx_cb.C (MenuExport): change html export to do the right
4818 thing depending of the document type (instead of having
4819 html-linuxdoc and html-docbook).
4820 * src/lyxfunc.C (getStatus): update for html
4821 * lib/ui/default.ui: simplify due to the above change.
4822 * src/menus.C (ShowFileMenu): update too (in case we need it).
4824 * src/MenuBackend.C (read): if a menu is defined twice, add the
4825 new entries to the exiting one.
4827 2000-07-26 Juergen Vigna <jug@sad.it>
4829 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
4831 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
4832 and return a bool if it did actual save the file.
4833 (AutoSave): don't autosave a unnamed doc.
4835 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
4836 check if this is an UNNAMED new file and react to it.
4837 (newFile): set buffer to unnamed and change to not mark a new
4838 buffer dirty if I didn't do anything with it.
4840 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
4842 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4844 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
4845 friend as per Angus's patch posted to lyx-devel.
4847 * src/ext_l10n.h: updated
4849 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
4850 gettext on the style string right before inserting them into the
4853 * autogen.sh: add code to extract style strings form layout files,
4854 not good enough yet.
4856 * src/frontends/gtk/.cvsignore: add MAKEFILE
4858 * src/MenuBackend.C (read): run the label strings through gettext
4859 before storing them in the containers.
4861 * src/ext_l10n.h: new file
4863 * autogen.sh : generate the ext_l10n.h file here
4865 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4867 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
4870 * lib/ui/default.ui: fix a couple of typos.
4872 * config/gnome/gtk.m4: added (and added to the list of files in
4875 * src/insets/insetinclude.C (unique_id): fix when we are using
4876 lyxstring instead of basic_string<>.
4877 * src/insets/insettext.C (LocalDispatch): ditto.
4878 * src/support/filetools.C: ditto.
4880 * lib/configure.m4: create the ui/ directory if necessary.
4882 * src/LyXView.[Ch] (updateToolbar): new method.
4884 * src/BufferView_pimpl.C (buffer): update the toolbar when
4885 opening/closing buffer.
4887 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4889 * src/LyXAction.C (getActionName): enhance to return also the name
4890 and options of pseudo-actions.
4891 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
4893 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
4894 as an example of what is possible). Used in File->Build too (more
4895 useful) and in the import/export menus (to mimick the complicated
4896 handling of linuxdoc and friends). Try to update all the entries.
4898 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
4901 * src/MenuBackend.C (read): Parse the new OptItem tag.
4903 * src/MenuBackend.h: Add a new optional_ data member (used if the
4904 entry should be omitted when the lyxfunc is disabled).
4906 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
4907 function, used as a shortcut.
4908 (create_submenu): align correctly the shortcuts on the widest
4911 * src/MenuBackend.h: MenuItem.label() only returns the label of
4912 the menu without shortcut; new method shortcut().
4914 2000-07-14 Marko Vendelin <markov@ioc.ee>
4916 * src/frontends/gtk/Dialogs.C:
4917 * src/frontends/gtk/FormCopyright.C:
4918 * src/frontends/gtk/FormCopyright.h:
4919 * src/frontends/gtk/Makefile.am: added these source-files for the
4920 Gtk/Gnome support of the Copyright-Dialog.
4922 * src/main.C: added Gnome::Main initialization if using
4923 Gtk/Gnome frontend-GUI.
4925 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
4927 * config/gnome/aclocal-include.m4
4928 * config/gnome/compiler-flags.m4
4929 * config/gnome/curses.m4
4930 * config/gnome/gnome--.m4
4931 * config/gnome/gnome-bonobo-check.m4
4932 * config/gnome/gnome-common.m4
4933 * config/gnome/gnome-fileutils.m4
4934 * config/gnome/gnome-ghttp-check.m4
4935 * config/gnome/gnome-gnorba-check.m4
4936 * config/gnome/gnome-guile-checks.m4
4937 * config/gnome/gnome-libgtop-check.m4
4938 * config/gnome/gnome-objc-checks.m4
4939 * config/gnome/gnome-orbit-check.m4
4940 * config/gnome/gnome-print-check.m4
4941 * config/gnome/gnome-pthread-check.m4
4942 * config/gnome/gnome-support.m4
4943 * config/gnome/gnome-undelfs.m4
4944 * config/gnome/gnome-vfs.m4
4945 * config/gnome/gnome-x-checks.m4
4946 * config/gnome/gnome-xml-check.m4
4947 * config/gnome/gnome.m4
4948 * config/gnome/gperf-check.m4
4949 * config/gnome/gtk--.m4
4950 * config/gnome/linger.m4
4951 * config/gnome/need-declaration.m4: added configuration scripts
4952 for Gtk/Gnome frontend-GUI
4954 * configure.in: added support for the --with-frontend=gtk option
4956 * autogen.sh: added config/gnome/* to list of config-files
4958 * acconfig.h: added define for GTKGUI-support
4960 * config/lyxinclude.m4: added --with-frontend[=value] option value
4961 for Gtk/Gnome frontend-GUI support.
4963 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4965 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
4969 * src/paragraph.C (GetChar): remove non-const version
4971 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
4972 (search_kw): use it.
4974 * src/lyx_main.C (init): if "preferences" exist, read that instead
4976 (ReadRcFile): return bool if the file could be read ok.
4977 (ReadUIFile): add a check to see if lex file is set ok.
4979 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
4980 bastring can be used instead of lyxstring (still uses the old code
4981 if std::string is good enough or if lyxstring is used.)
4983 * src/encoding.C: make the arrays static, move ininle functions
4985 * src/encoding.h: from here.
4987 * src/buffer.C: have last_isnet_read as a file scope variable for now.
4988 (parseSingleLyXformat2Token): move inset parsing to separate method
4989 (readInset): new private method
4991 * src/Variables.h: remove virtual from get().
4993 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
4994 access to NEW_INSETS and NEW_TABULAR
4996 * src/MenuBackend.h: remove superfluous forward declaration of
4997 MenuItem. Add documentations tags "///", remove empty MenuItem
4998 destructor, remove private default contructor.
5000 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
5002 (read): more string mlabel and mname to where they are used
5003 (read): remove unused variables mlabel and mname
5004 (defaults): unconditional clear, make menusetup take advantage of
5005 add returning Menu &.
5007 * src/LyXView.h: define NEW_MENUBAR as default
5009 * src/LyXAction.C: include lyxparagraph.h temporary to get access
5010 to NEW_INSETS and NEW_TABULAR.
5011 (init): commetn out some funcs that is obsolete when NEW_INSETS is
5012 defined. Change some of the "xxxx-inset-insert" functions names to
5015 * several files: more enahncements to NEW_INSETS and the resulting
5018 * lib/lyxrc.example (\date_insert_format): move to misc section
5020 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
5021 bastring and use AC_CACHE_CHECK.
5022 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
5023 the system have the newest methods. uses AC_CACHE_CHECK
5024 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
5025 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
5026 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
5028 * configure.in: add LYX_CXX_GOOD_STD_STRING
5030 * acinclude.m4: recreated
5032 2000-07-24 Amir Karger <karger@lyx.org>
5034 * README: add Hebrew, Arabic kmaps
5037 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5039 * src/buffer.C (writeFileAscii): Define actcell as an int instead
5042 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5044 * Lot of files: add pragma interface/implementation.
5046 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
5048 * lib/ui/default.ui: new file (ans new directory). Contains the
5049 default menu and toolbar.
5051 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
5052 global space. Toolbars are now read (as menus) in ui files.
5054 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
5056 * src/lyxfunc.C (getStatus): do not exit immediately if a command
5057 is disabled because the document is read-only. We want to have the
5058 toggle state of the function anyway.
5059 (getStatus): add code for LFUN_VC* functions (mimicking what is
5060 done in old-style menus)
5062 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
5063 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
5065 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
5066 * src/BufferView_pimpl.C: ditto.
5067 * src/lyxfunc.C: ditto.
5069 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
5070 default). This replaces old-style menus by new ones.
5072 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
5073 MenuItem. Contain the data structure of a menu.
5075 * src/insets/insettext.C: use LyXView::setLayout instead of
5076 accessing directly the toolbar combox.
5077 * src/lyxfunc.C (Dispatch): ditto.
5079 * src/LyXView.C (setLayout): new method, which just calls
5080 Toolbar::setLayout().
5081 (updateLayoutChoice): move part of this method in Toolbar.
5083 * src/toolbar.[Ch]: removed.
5085 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
5086 implementation the toolbar.
5088 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
5089 the toolbar. It might make sense to merge it with ToolbarDefaults
5091 (setLayout): new function.
5092 (updateLayoutList): ditto.
5093 (openLayoutList): ditto.
5095 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
5096 xforms implementation of the toolbar.
5097 (get_toolbar_func): comment out, since I do not
5098 know what it is good for.
5100 * src/ToolbarDefaults.h: Add the ItemType enum.
5102 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
5103 for a list of allocated C strings. Used in Menubar xforms
5104 implementation to avoid memory leaks.
5106 * src/support/lstrings.[Ch] (uppercase): new version taking and
5110 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
5111 * lib/bind/emacs.bind: ditto.
5113 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5115 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
5116 forward decl of LyXView.
5118 * src/toolbar.C (toolbarItem): moved from toolbar.h
5119 (toolbarItem::clean): ditto
5120 (toolbarItem::~toolbarItem): ditto
5121 (toolbarItem::operator): ditto
5123 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
5125 * src/paragraph.h: control the NEW_TABULAR define from here
5127 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
5128 USE_TABULAR_INSETS to NEW_TABULAR
5130 * src/ToolbarDefaults.C: add include "lyxlex.h"
5132 * files using the old table/tabular: use NEW_TABULAR to control
5133 compilation of old tabular stuff.
5135 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
5138 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
5139 planemet in reading of old style floats, fix the \end_deeper
5140 problem when reading old style floats.
5142 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5144 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
5146 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
5148 * lib/bind/sciword.bind: updated.
5150 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5152 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
5153 layout write problem
5155 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5157 * src/Makefile.am (INCLUDES): remove image directory from include
5160 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
5161 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
5163 * src/LyXView.C (create_form_form_main): read the application icon
5166 * lib/images/*.xpm: change the icons to use transparent color for
5169 * src/toolbar.C (update): change the color of the button when it
5172 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5174 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
5175 setting explicitely the minibuffer.
5176 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
5178 * src/LyXView.C (showState): new function. Shows font information
5179 in minibuffer and update toolbar state.
5180 (LyXView): call Toolbar::update after creating the
5183 * src/toolbar.C: change toollist to be a vector instead of a
5185 (BubbleTimerCB): get help string directly from the callback
5186 argument of the corresponding icon (which is the action)
5187 (set): remove unnecessary ugliness.
5188 (update): new function. update the icons (depressed, disabled)
5189 depending of the status of the corresponding action.
5191 * src/toolbar.h: remove help in toolbarItem
5193 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
5195 * src/Painter.C (text): Added code for using symbol glyphs from
5196 iso10646 fonts. Currently diabled.
5198 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
5201 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
5202 magyar,turkish and usorbian.
5204 * src/paragraph.C (isMultiLingual): Made more efficient.
5206 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
5209 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
5210 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
5211 Also changed the prototype to "bool math_insert_greek(char)".
5213 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5215 * lots of files: apply the NEW_INSETS on all code that will not be
5216 needed when we move to use the new insets. Enable the define in
5217 lyxparagrah.h to try it.
5219 * src/insets/insettabular.C (cellstart): change to be a static
5221 (InsetTabular): initialize buffer in the initializer list.
5223 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
5225 * src/frontends/xforms/FormPrint.[Ch] : moved #include
5226 form_print.h out of the header file. Replaced with forward
5227 declarations of the relevant struct.
5229 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
5232 * src/commandtags.h: do not include "debug.h" which does not
5233 belong there. #include it in some other places because of this
5236 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5238 * src/insets/insetcaption.C: add a couple "using" directives.
5240 * src/toolbar.C (add): get the help text directly from lyxaction.
5242 (setPixmap): new function. Loads from disk and sets a pixmap on a
5243 botton; the name of the pixmap file is derived from the command
5246 * src/toolbar.h: remove members isBitmap and pixmap from
5249 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
5250 * lib/images/: move many files from images/banner.xpm.
5252 * src/lyx_gui.C (create_forms): read banner pixmap from file.
5254 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
5255 * src/toolbar.C: ditto.
5256 * configure.in: ditto.
5257 * INSTALL: document.
5259 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
5260 the spellchecker popup is closed from the WM.
5262 2000-07-19 Juergen Vigna <jug@sad.it>
5264 * src/insets/insetfloat.C (Write): small fix because we use the
5265 insetname for the type now!
5267 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
5269 * src/frontends/xforms/forms/form_citation.fd: object sizes are
5272 * src/frontends/Dialogs.h: removed hideCitation signal
5274 * src/insets/insetcite.h: added hide signal
5276 * src/insets/insetcite.C (~InsetCitation): emits new signal
5277 (getScreenLabel): "intelligent" label should now fit on the screen!
5279 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
5281 * src/frontends/xforms/FormCitation.C (showInset): connects
5282 hide() to the inset's hide signal
5283 (show): modified to use fl_set_object_position rather than
5284 fl_set_object_geometry wherever possible
5286 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
5288 * src/insets/lyxinset.h: add caption code
5290 * src/insets/insetfloat.C (type): new method
5292 * src/insets/insetcaption.C (Write): new method
5294 (LyxCode): new method
5296 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
5297 to get it right together with using the FloatList.
5299 * src/commandtags.h: add LFUN_INSET_CAPTION
5300 * src/lyxfunc.C (Dispatch): handle it
5302 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
5305 * src/Variables.[Ch]: make expand take a const reference, remove
5306 the destructor, some whitespace changes.
5308 * src/LyXAction.C (init): add caption-inset-insert
5310 * src/FloatList.C (FloatList): update the default floats a bit.
5312 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5314 * src/Variables.[Ch]: new files. Intended to be used for language
5315 specific strings (like \chaptername) and filename substitution in
5318 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
5320 * lib/kbd/american.kmap: update
5322 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
5324 * src/bufferparams.[Ch]: remove member allowAccents.
5326 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
5328 * src/LaTeXLog.C: use the log_form.h header.
5329 * src/lyx_gui.C: ditto.
5330 * src/lyx_gui_misc.C: ditto.
5331 * src/lyxvc.h: ditto.
5333 * forms/log_form.fd: new file, created from latexoptions.fd. I
5334 kept the log popup and nuked the options form.
5336 * src/{la,}texoptions.[Ch]: removed.
5337 * src/lyx_cb.C (LaTeXOptions): ditto
5339 * src/lyx_gui.C (create_forms): do not handle the
5340 fd_latex_options form.
5342 2000-07-18 Juergen Vigna <jug@sad.it>
5344 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
5345 name of the inset so that it can be requested outside (text2.C).
5347 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
5350 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5352 * src/mathed/formula.h (ConvertFont): constify
5354 * src/mathed/formula.C (Read): add warning if \end_inset is not
5355 found on expected place.
5357 * src/insets/lyxinset.h (ConvertFont): consify
5359 * src/insets/insetquotes.C (ConvertFont): constify
5360 * src/insets/insetquotes.h: ditto
5362 * src/insets/insetinfo.h: add labelfont
5364 * src/insets/insetinfo.C (InsetInfo): set the labelfont
5365 (ascent): use labelfont
5369 (Write): make .lyx file a bit nicer
5371 * src/insets/insetfloat.C (Write): simplify somewhat...
5372 (Read): add warning if arg is not found
5374 * src/insets/insetcollapsable.C: add using std::max
5375 (Read): move string token and add warning in arg is not found
5376 (draw): use std::max to get the right ty
5377 (getMaxWidth): simplify by using std::max
5379 * src/insets/insetsection.h: new file
5380 * src/insets/insetsection.C: new file
5381 * src/insets/insetcaption.h: new file
5382 * src/insets/insetcaption.C: new file
5384 * src/insets/inset.C (ConvertFont): constify signature
5386 * src/insets/Makefile.am (libinsets_la_SOURCES): add
5387 insetcaption.[Ch] and insetsection.[Ch]
5389 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
5390 uses to use LABEL_COUNTER_CHAPTER instead.
5391 * src/text2.C (SetCounter): here
5393 * src/counters.h: new file
5394 * src/counters.C: new file
5395 * src/Sectioning.h: new file
5396 * src/Sectioning.C: new file
5398 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
5400 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5402 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
5405 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
5408 2000-07-17 Juergen Vigna <jug@sad.it>
5410 * src/tabular.C (Validate): check if array-package is needed.
5411 (SetVAlignment): added support for vertical alignment.
5412 (SetLTFoot): better support for longtable header/footers
5413 (Latex): modified to support added features.
5415 * src/LaTeXFeatures.[Ch]: added array-package.
5417 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
5419 * src/lyx_gui.C (LyXGUI): make sure that the height is large
5422 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
5424 * configure.in: do not forget to put a space after -isystem.
5426 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
5428 * lib/kbd/arabic.kmap: a few fixes.
5430 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5432 * some whitespace chagnes to a number of files.
5434 * src/support/DebugStream.h: change to make it easier for
5435 doc++ to parse correctly.
5436 * src/support/lyxstring.h: ditto
5438 * src/mathed/math_utils.C (compara): change to have only one
5440 (MathedLookupBOP): change because of the above.
5442 * src/mathed/math_delim.C (math_deco_compare): change to have only
5444 (search_deco): change becasue of the above.
5446 * src/insets/insettabular.C (DrawCellSelection): use std::swap
5447 instead of manually coded one.
5449 * src/insets/insetquotes.C (Read): read the \end_inset too
5451 * src/insets/insetlatex.h: remove file
5452 * src/insets/insetlatex.C: remove file
5454 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
5456 (InsetPrintIndex): remove destructor
5458 * src/insets/insetinclude.h: remove default constructor
5460 * src/insets/insetfloat.C: work to make it work better
5462 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
5464 * src/insets/insetcite.h (InsetCitation): remove default constructor
5466 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
5468 * src/text.C (GetColumnNearX): comment out some currently unused code.
5470 * src/paragraph.C (writeFile): move some initializations closer to
5472 (CutIntoMinibuffer): small change to use new matchIT operator
5476 (InsertInset): ditto
5479 (InsetIterator): ditto
5480 (Erase): small change to use new matchFT operator
5482 (GetFontSettings): ditto
5483 (HighestFontInRange): ditto
5486 * src/lyxparagraph.h: some chars changed to value_type
5487 (matchIT): because of some stronger checking (perhaps too strong)
5488 in SGI STL, the two operator() unified to one.
5491 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
5493 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
5494 the last inset read added
5495 (parseSingleLyXformat2Token): some more (future) compability code added
5496 (parseSingleLyXformat2Token): warning about solitary \end_inset added
5497 (parseSingleLyXformat2Token): set last_inset_read
5498 (parseSingleLyXformat2Token): more code to read new "Float" correctly
5499 (parseSingleLyXformat2Token): don't double intializw string next_token
5501 * src/TextCache.C (text_fits::operator()): add const's to the signature
5502 (has_buffer::operator()): ditto
5504 * src/Floating.h: add some comments on the class
5506 * src/FloatList.[Ch] (typeExist): new method
5509 * src/BackStack.h: added default constructor, wanted by Gcc.
5511 2000-07-14 Juergen Vigna <jug@sad.it>
5513 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
5515 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
5517 * src/insets/insettabular.C (resizeLyXText): need this to be able to
5518 do a redraw when the window is resized!
5519 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
5521 * src/insets/insettext.C (resizeLyXText): added function to correctly
5522 being able to resize the LyXWindow.
5524 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
5526 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
5528 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
5529 crashes when closing dialog to a deleted inset.
5531 * src/insets/insetcite.[Ch] (Edit) : the return of this former
5532 method! Now similar to other insets.
5534 2000-07-13 Juergen Vigna <jug@sad.it>
5536 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
5538 * lib/examples/Literate.lyx: small patch!
5540 * src/insets/insetbib.C (Read): added this function because of wrong
5541 Write (without [begin|end]_inset).
5543 2000-07-11 Juergen Vigna <jug@sad.it>
5545 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
5546 as the insertInset could not be good!
5548 * src/screen.C (ToggleSelection): fixed toggle selection bug as
5549 the bool param should not be last.
5551 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5553 * sigc++/configure.in: fix bug in threading-related code (Yes, I
5554 did submit that to Karl).
5556 * configure.in: use -isystem instead of -I for X headers. This
5557 fixes a problem on solaris with a recent gcc;
5558 put the front-end code after the X detection code;
5559 configure in sigc++ before lib/
5561 * src/lyx_main.C (commandLineHelp): remove -display from command
5564 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
5566 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
5567 Also put in Makefile rules for building the ``listerrors''
5568 program for parsing errors from literate programs written in LyX.
5570 * lib/build-listerrors: Added small shell script as part of compile
5571 process. This builds a working ``listerrors'' binary if noweb is
5572 installed and either 1) the VNC X server is installed on the machine,
5573 or 2) the user is compiling from within a GUI. The existence of a GUI
5574 is necessary to use the ``lyx --export'' feature for now. This
5575 hack can be removed once ``lyx --export'' no longer requires a GUI to
5578 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
5580 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
5581 now passed back correctly from gcc and placed "under" error
5582 buttons in a Literate LyX source.
5584 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5586 * src/text.C (GetColumnNearX): Better behavior when a RTL
5587 paragraph is ended by LTR text.
5589 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
5592 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5594 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
5595 true when clipboard is empty.
5597 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
5599 * text.C (Backspace): Prevent rebreaking of a row if it is the last
5600 row of the paragraph.
5601 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
5602 to prevent calculation of bidi tables
5604 2000-07-07 Juergen Vigna <jug@sad.it>
5606 * src/screen.C (ToggleSelection): added y_offset and x_offset
5609 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
5612 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
5614 * src/insets/insettext.C: fixed Layout-Display!
5616 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5618 * configure.in: add check for strings.h header.
5620 * src/spellchecker.C: include <strings.h> in order to have a
5621 definition for bzero().
5623 2000-07-07 Juergen Vigna <jug@sad.it>
5625 * src/insets/insettext.C (draw): set the status of the bv->text to
5626 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
5628 * src/screen.C (DrawOneRow):
5629 (DrawFromTo): redraw the actual row if something has changed in it
5632 * src/text.C (draw): call an update of the toplevel-inset if something
5633 has changed inside while drawing.
5635 * src/lyxtext.h: added CHANGED_IN_DRAW status.
5637 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
5639 * src/insets/insetbib.[Ch] (callback) new method, moving callback
5640 processing inside class.
5642 * src/insets/insetindex.[Ch] (callback) new method, moving callback
5643 processing inside class.
5645 * src/insets/insetindex.h new struct Holder, consistent with other
5648 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
5649 citation dialog from main code and placed it in src/frontends/xforms.
5650 Dialog launched through signals instead of callbacks
5652 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
5654 * lyx.man: update the options description.
5656 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
5658 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
5659 handle neg values, set min width to 590, add doc about -display
5661 2000-07-05 Juergen Vigna <jug@sad.it>
5663 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
5664 calls to BufferView *.
5666 * src/insets/insettext.C (checkAndActivateInset): small fix non
5667 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
5669 * src/insets/insetcommand.C (Read): Fixed as insets should read till
5670 their \end_inset token!
5672 2000-07-04 edscott <edscott@imp.mx>
5674 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
5675 lib/lyxrc.example: added option \wheel_jump
5677 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
5679 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
5680 remove support for -width,-height,-xpos and -ypos.
5682 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
5684 * src/encoding.[Ch]: New files.
5686 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
5687 (text): Call to the underline() method only when needed.
5689 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
5691 * src/buffer.C (makeLaTeXFile): Compute automatically the input
5692 encoding(s) for the document.
5694 * src/bufferparams.C (BufferParams): Changed default value of
5697 * src/language.C (newLang): Removed.
5698 (items[]): Added encoding information for all defined languages.
5700 * src/lyx_gui.C (create_forms): Added "auto" option to the input
5701 encoding choice button.
5703 * src/lyxrc.h (font_norm_type): New member variable.
5704 (set_font_norm_type): New method.
5706 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
5707 paragraphs with different encodings.
5709 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
5710 (TransformChar): Changed to work correctly with Arabic points.
5711 (draw): Added support for drawing Arabic points.
5712 (draw): Removed code for drawing underbars (this is done by
5715 * src/support/textutils.h (IsPrintableNonspace): New function.
5717 * src/BufferView_pimpl.h: Added "using SigC::Object".
5718 * src/LyXView.h: ditto.
5720 * src/insets/insetinclude.h (include_label): Changed to mutable.
5722 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
5724 * src/mathed/math_iter.h: remove empty destructor
5726 * src/mathed/math_cursor.h: remove empty destructor
5728 * src/insets/lyxinset.h: add THEOREM_CODE
5730 * src/insets/insettheorem.[Ch]: new files
5732 * src/insets/insetminipage.C: (InsertInset): remove
5734 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
5736 (InsertInset): remove
5738 * src/insets/insetlist.C: (InsertList): remove
5740 * src/insets/insetfootlike.[Ch]: new files
5742 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
5745 (InsertInset): ditto
5747 * src/insets/insetert.C: remove include Painter.h, reindent
5748 (InsertInset): move to header
5750 * src/insets/insetcollapsable.h: remove explicit from default
5751 contructor, remove empty destructor, add InsertInset
5753 * src/insets/insetcollapsable.C (InsertInset): new func
5755 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5757 * src/vspace.h: add explicit to constructor
5759 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
5760 \textcompwordmark, please test this.
5762 * src/lyxrc.C: set ascii_linelen to 65 by default
5764 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
5766 * src/commandtags.h: add LFUN_INSET_THEOREM
5768 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
5769 (makeLinuxDocFile): remove _some_ of the nice logic
5770 (makeDocBookFile): ditto
5772 * src/Painter.[Ch]: (~Painter): removed
5774 * src/LyXAction.C (init): entry for insettheorem added
5776 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
5778 (deplog): code to detect files generated by LaTeX, needs testing
5781 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5783 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
5785 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5787 * src/LaTeX.C (deplog): Add a check for files that are going to be
5788 created by the first latex run, part of the project to remove the
5791 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
5792 contents to the extension list.
5794 2000-07-04 Juergen Vigna <jug@sad.it>
5796 * src/text.C (NextBreakPoint): added support for needFullRow()
5798 * src/insets/lyxinset.h: added needFullRow()
5800 * src/insets/insetcollapsable.C: redone now this uses a text-inset
5803 * src/insets/insettext.C: lots of changes for update!
5805 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
5807 * src/LaTeXFeatures.h: add a missing std:: qualifier.
5809 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
5811 * src/insets/insetinclude.C (InsetInclude): fixed
5812 initialization of include_label.
5813 (unique_id): now returns a string.
5815 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
5817 * src/LaTeXFeatures.h: new member IncludedFiles, for
5818 a map of key, included file name.
5820 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
5821 with the included files for inclusion in SGML preamble,
5822 i. e., linuxdoc and docbook.
5825 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
5826 nice (is the generated linuxdoc code to be exported?), that
5827 allows to remove column, and only_body that will be true for
5828 slave documents. Insets are allowed inside SGML font type.
5829 New handling of the SGML preamble for included files.
5830 (makeDocBookFile): the same for docbook.
5832 * src/insets/insetinclude.h:
5833 * src/insets/insetinclude.C (Validate): keeps a list of included files.
5835 (DocBook): new export methods.
5837 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
5838 and makeDocBookFile.
5840 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
5841 formats to export with command line argument -x.
5843 2000-06-29 Juergen Vigna <jug@sad.it>
5845 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
5846 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
5848 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
5849 region could already been cleared by an inset!
5851 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5853 * src/BufferView_pimpl.h: remove member variables lyx_focus and
5856 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
5858 (cursorToggle): remove special handling of lyx focus.
5860 2000-06-28 Juergen Vigna <jug@sad.it>
5862 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
5865 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5867 * src/insets/insetindex.C (Edit): add a callback when popup is
5870 * src/insets/insettext.C (LocalDispatch):
5871 * src/insets/insetmarginal.h:
5872 * src/insets/insetlist.h:
5873 * src/insets/insetfoot.h:
5874 * src/insets/insetfloat.h:
5875 * src/insets/insetert.h: add a missing std:: qualifier.
5877 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
5879 * src/support/lyxsum.C (sum): '\0' teminate file read when using
5882 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
5884 * src/insets/insettext.C (Read): remove tmptok unused variable
5885 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
5886 (InsertInset): change for new InsetInset code
5888 * src/insets/insettext.h: add TEXT inline method
5890 * src/insets/insettext.C: remove TEXT macro
5892 * src/insets/insetmarginal.C (Write): new method
5893 (Latex): change output slightly
5895 * src/insets/insetfoot.C (Write): new method
5896 (Latex): change output slightly (don't use endl when no need)
5898 * src/insets/insetert.C (Write): new method
5900 * src/insets/insetcollapsable.h: make button_length, button_top_y
5901 and button_bottm_y protected.
5903 * src/insets/insetcollapsable.C (Write): simplify code by using
5904 tostr. Also do not output the float name, the children class
5905 should to that to get control over own arguments
5907 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
5908 src/insets/insetminipage.[Ch]:
5911 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
5913 * src/lyxfunc.C (Dispatch): cases for new insets/commands
5915 * src/Makefile.am (lyx_SOURCES): add the new files
5917 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
5918 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
5919 * src/commandtags.h: ditto
5921 * src/LaTeXFeatures.h: add a std::set of used floattypes
5923 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
5925 * src/FloatList.[Ch] src/Floating.h: new files
5927 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
5929 * src/lyx_cb.C (TableApplyCB): ditto
5931 * src/text2.C: ditto
5932 * src/buffer.C (SimpleLinuxDocOnePar): ditto
5933 (parseSingleLyXformat2Token): ditto + add code for
5934 backwards compability for old float styles + add code for new insets
5936 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
5938 (InsertInset(size_type, Inset *, LyXFont)): new method
5939 (InsetChar(size_type, char)): changed to use the other InsetChar
5940 with a LyXFont(ALL_INHERIT).
5941 (InsetInset(size_type, Inset*)): changed to use InsetChar to
5942 insert the META_INSET.
5944 * sigc++/thread.cc (Privete<int>::operator int&): move definition
5946 * sigc++/thread.h (Threads): from here
5948 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
5949 definition out of line
5950 * sigc++/scope.h: from here
5952 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5954 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
5955 is specified (adapted from a patch from edscott <edscott@imp.mx>).
5957 * Makefile.am (bindist): new target.
5959 * INSTALL: add instructions for doing a binary distribution.
5961 * development/tools/README.bin.example: update a bit.
5963 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
5966 * lib/lyxrc.example: new lyxrc tag \set_color.
5968 * src/lyxfunc.C (Dispatch):
5969 * src/commandtags.h:
5970 * src/LyXAction.C: new lyxfunc "set-color".
5972 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
5973 and an x11name given as strings.
5975 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
5976 cache when a color is changed.
5978 2000-06-26 Juergen Vigna <jug@sad.it>
5980 * src/lyxrow.C (width): added this functions and variable.
5982 * src/insets/insetcite.C (create_form_citation_form): some Gravity
5985 * src/text.C (SetHeightOfRow): fixed calcualting of width.
5987 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5989 * images/undo_bw.xpm: new icon.
5990 * images/redo_bw.xpm: ditto.
5992 * configure.in (INSTALL_SCRIPT): change value to
5993 ${INSTALL} to avoid failures of install-script target.
5994 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
5996 * src/BufferView.h: add a magic "friend" declaration to please
5999 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
6001 * forms/cite.fd: modified to allow resizing without messing
6004 * src/insetcite.C: Uses code from cite.fd almost without
6006 User can now resize dialog in the x-direction.
6007 Resizing the dialog in the y-direction is prevented, as the
6008 code does this intelligently already.
6010 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6012 * INSTALL: remove obsolete entry in "problems" section.
6014 * lib/examples/sl_*.lyx: update of the slovenian examples.
6016 * src/support/FileInfo.[Ch] (getBlockSize): remove.
6018 2000-06-23 Juergen Vigna <jug@sad.it>
6020 * src/lyxtext.h: added a 'cleared' flag to draw() function.
6022 * src/buffer.C (resize): delete the LyXText of textinsets.
6024 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
6026 * src/insets/lyxinset.h: added another parameter 'cleared' to
6027 the draw() function.
6029 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
6030 unlocking inset in inset.
6032 2000-06-22 Juergen Vigna <jug@sad.it>
6034 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
6035 of insets and moved first to LyXText.
6037 * src/mathed/formulamacro.[Ch]:
6038 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
6040 2000-06-21 Juergen Vigna <jug@sad.it>
6042 * src/text.C (GetVisibleRow): look if I should clear the area or not
6043 using Inset::doClearArea() function.
6045 * src/insets/lyxinset.h: added doClearArea() function and
6046 modified draw(Painter &, ...) to draw(BufferView *, ...)
6048 * src/text2.C (UpdateInset): return bool insted of int
6050 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
6052 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
6053 combox in the character popup
6055 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
6056 BufferParams const & params
6058 2000-06-20 Juergen Vigna <jug@sad.it>
6060 * src/insets/insettext.C (SetParagraphData): set insetowner on
6063 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6065 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
6066 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
6068 (form_main_): remove
6070 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
6071 (create_form_form_main): remove FD_form_main stuff, connect to
6072 autosave_timeout signal
6074 * src/LyXView.[Ch] (getMainForm): remove
6075 (UpdateTimerCB): remove
6076 * src/BufferView_pimpl.h: inherit from SigC::Object
6078 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
6079 signal instead of callback
6081 * src/BufferView.[Ch] (cursorToggleCB): remove
6083 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6085 * src/BufferView_pimpl.C: changes because of the one below
6087 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
6088 instead of storing a pointer to a LyXText.
6090 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
6092 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
6094 * src/lyxparagraph.h
6096 * src/paragraph.C: Changed fontlist to a sorted vector.
6098 2000-06-19 Juergen Vigna <jug@sad.it>
6100 * src/BufferView.h: added screen() function.
6102 * src/insets/insettext.C (LocalDispatch): some selection code
6105 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
6107 * src/insets/insettext.C (SetParagraphData):
6109 (InsetText): fixes for multiple paragraphs.
6111 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
6113 * development/lyx.spec.in: Call configure with ``--without-warnings''
6114 to work around a bug with the Makefiles when doing ``make lyxrpm''.
6115 This should be fine, however, since we generally don't want to be
6116 verbose when making an RPM.
6118 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
6120 * lib/scripts/fig2pstex.py: New file
6122 2000-06-16 Juergen Vigna <jug@sad.it>
6124 * src/insets/insettabular.C (UpdateLocal):
6125 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
6126 (LocalDispatch): Changed all functions to use LyXText.
6128 2000-06-15 Juergen Vigna <jug@sad.it>
6130 * src/text.C (SetHeightOfRow): call inset::update before requesting
6133 * src/insets/insettext.C (update):
6134 * src/insets/insettabular.C (update): added implementation
6136 * src/insets/lyxinset.h: added update function
6138 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6140 * src/text.C (SelectNextWord): protect against null pointers with
6141 old-style string streams. (fix from Paul Theo Gonciari
6144 * src/cite.[Ch]: remove erroneous files.
6146 * lib/configure.m4: update the list of created directories.
6148 * src/lyxrow.C: include <config.h>
6149 * src/lyxcursor.C: ditto.
6151 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6153 * lib/examples/decimal.lyx: new example file from Mike.
6155 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
6156 to find template definitions (from Dekel)
6158 * src/frontends/.cvsignore: add a few things.
6160 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
6162 * src/Timeout.C (TimeOut): remove default argument.
6164 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
6167 * src/insets/ExternalTemplate.C: add a "using" directive.
6169 * src/lyx_main.h: remove the act_ struct, which seems unused
6172 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6174 * LyX Developers Meeting: All files changed, due to random C++ (by
6175 coincidence) code generator script.
6177 - external inset (cool!)
6178 - initial online editing of preferences
6179 - insettabular breaks insettext(s contents)
6181 - some DocBook fixes
6182 - example files update
6183 - other cool stuff, create a diff and look for yourself.
6185 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
6187 * src/insets/insettext.C (computeTextRows): if the maxWidth is
6188 -1 this is a non-line-breaking textinset.
6190 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
6191 if there is no width set.
6193 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6195 * Lots of files: Merged the dialogbase branch.
6197 2000-06-09 Allan Rae <rae@lyx.org>
6199 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
6200 and the Dispatch methods that used it.
6202 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
6203 access to functions formerly kept in Dispatch.
6205 2000-05-19 Allan Rae <rae@lyx.org>
6207 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
6208 made to_page and count_copies integers again. from_page remains a
6209 string however because I want to allow entry of a print range like
6210 "1,4,22-25" using this field.
6212 * src/LyXAction.C: added action info and commands for buffer-print-xtl
6213 and printer-params-get. These aren't useful from the minibuffer but
6214 could be used by a script/LyXServer app provided it passes a suitable
6215 auto_mem_buffer. I guess I should take a look at how the LyXServer
6216 works and make it support xtl buffers.
6218 * sigc++/: updated to libsigc++-1.0.1
6220 * src/xtl/: updated to xtl-1.3.pl.11
6222 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
6223 those changes done to the files in src/ are actually recreated when
6224 they get regenerated. Please don't ever accept a patch that changes a
6225 dialog unless that patch includes the changes to the corresponding *.fd
6228 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
6229 stringOnlyContains, renamed it and generalised it.
6231 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
6232 branch. Removed the remaining old form_print code.
6234 2000-04-26 Allan Rae <rae@lyx.org>
6236 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
6237 trap I was trying to fix with the ID: fields in src/xtl/ :-)
6239 2000-04-25 Allan Rae <rae@lyx.org>
6241 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
6242 against a base of xtl-1.3.pl.4
6244 * development/tools/lxtl.sh: fixed a couple of silly typos and now
6245 filter the Id: entries so they still show the xtl version number
6248 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
6249 into the src/xtl code. Patch still pending with José (XTL)
6251 2000-04-24 Allan Rae <rae@lyx.org>
6253 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
6254 both more generic and much safer. Use the new template functions.
6255 * src/buffer.[Ch] (Dispatch): ditto.
6257 * src/frontends/xforms/FormPrint.C (update): Use new template functions
6258 and mem buffer more intelligently. Also a little general cleanup.
6261 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
6262 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
6263 * src/xtl/Makefile.am: ditto.
6264 * src/xtl/.cvsignore: ditto.
6265 * src/Makefile.am: ditto.
6267 * src/PrinterParams.h: Removed the macros member functions. Added a
6268 testInvariant member function. A bit of tidying up and commenting.
6269 Included Angus's idea for fixing operation with egcs-1.1.2.
6271 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
6272 cool expansion of XTL's mem_buffer to support automatic memory
6273 management within the buffer itself. Removed the various macros and
6274 replaced them with template functions that use either auto_mem_buffer
6275 or mem_buffer depending on a #define. The mem_buffer support will
6276 disappear as soon as the auto_mem_buffer is confirmed to be good on
6277 other platforms/compilers. That is, it's there so you've got something
6280 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
6281 effectively forked XTL. However I expect José will include my code
6282 into the next major release. Also fixed a memory leak.
6283 * src/xtl/text.h: ditto.
6284 * src/xtl/xdr.h: ditto.
6285 * src/xtl/giop.h: ditto.
6287 2000-04-16 Allan Rae <rae@lyx.org>
6289 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
6290 by autogen.sh and removed by maintainer-clean anyway.
6291 * .cvsignore, sigc++/.cvsignore: Support the above.
6293 * sigc++/.cvsignore: Forgot that retbind.h was generated.
6295 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
6297 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
6298 macros, renamed static callback-target member functions to suit new
6299 scheme and made them public.
6300 * src/frontends/xforms/forms/form_print.fd: ditto.
6301 * src/frontends/xforms/forms/form_copyright.fd: ditto.
6303 * src/support/lxtl.h: small cleanup to use typedef instead of #define
6306 * src/xtl/: New directory containing a minimal distribution of XTL.
6307 This is XTL-1.3.pl.4.
6309 * development/tools/lxtl.sh: A script to generate the above mini-dist.
6311 2000-04-15 Allan Rae <rae@lyx.org>
6313 * development/tools/makeLyXsigc.sh: Remove the library version numbers
6315 * sigc++/: Updated to libsigc++-1.0.0
6317 2000-04-14 Allan Rae <rae@lyx.org>
6319 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
6320 use the generic ones in future. I'll modify my conversion script.
6322 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
6324 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
6325 (CloseAllBufferRelatedDialogs): Renamed.
6326 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
6328 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
6329 of the generic ones. These are the same ones my conversion script
6332 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
6333 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
6334 * src/buffer.C (Dispatch): ditto
6336 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
6337 functions for updating and hiding buffer dependent dialogs.
6338 * src/BufferView.C (buffer): ditto
6339 * src/buffer.C (setReadonly): ditto
6340 * src/lyxfunc.C (CloseBuffer): ditto
6342 * src/buffer.h: Take setReadonly() out of line so I don't have to include
6343 Dialogs.h, and hence all the SigC stuff, into every file that includes
6344 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
6346 * src/BufferView2.C: reduce the number of headers included by buffer.h
6348 2000-04-11 Allan Rae <rae@lyx.org>
6350 * src/frontends/xforms/xform_macros.h: A small collection of macros
6351 for building C callbacks.
6353 * src/frontends/xforms/Makefile.am: Added above file.
6355 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
6356 scheme again. This time it should work for JMarc. If this is
6357 successful I'll revise my conversion script to automate some of this.
6358 The static member functions in the class also have to be public for
6359 this scheme will work. If the scheme works (it's almost identical to
6360 the way BufferView::cursorToggleCB is handled so it should work) then
6361 FormCopyright and FormPrint will be ready for inclusion into the main
6362 trunk immediately after 1.1.5 is released -- provided we're prepared
6363 for complaints about lame compilers not handling XTL.
6365 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
6367 2000-04-07 Allan Rae <rae@lyx.org>
6369 * config/lyxinclude.m4: A bit more tidying up (Angus)
6371 * src/LString.h: JMarc's <string> header fix
6373 * src/PrinterParams.h: Used string for most data to remove some
6374 ugly code in the Print dialog and avoid even uglier code when
6375 appending the ints to a string for output.
6377 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
6378 and moved "default:" back to the end of switch statement. Cleaned
6379 up the printing so it uses the right function calls and so the
6380 "print to file" option actually puts the file in the right directory.
6382 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
6384 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
6385 and Ok+Apply button control into a separate method: input (Angus).
6386 (input) Cleaned it up and improved it to be very thorough now.
6387 (All CB) static_cast used instead of C style cast (Angus). This will
6388 probably change again once we've worked out how to keep gcc-2.8.1 happy
6389 with real C callbacks.
6390 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
6391 ignore some of the bool settings and has random numbers instead. Needs
6392 some more investigation. Added other input length checks and checking
6393 of file and printer names.
6395 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
6396 would link (Angus). Seems the old code doesn't compile with the pragma
6397 statement either. Separated callback entries from internal methods.
6399 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
6401 2000-03-17 Allan Rae <rae@lyx.org>
6403 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
6404 need it? Maybe it could go in Dialogs instead? I could make it a
6405 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
6406 values to get the bool return value.
6407 (Dispatch): New overloaded method for xtl support.
6409 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
6410 extern "C" callback instead of static member functions. Hopefully,
6411 JMarc will be able to compile this. I haven't changed
6412 forms/form_copyright.fd yet. Breaking one of my own rules already.
6414 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
6415 because they aren't useful from the minibuffer. Maybe a LyXServer
6416 might want a help message though?
6418 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
6420 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
6421 xtl which needs both rtti and exceptions.
6423 * src/support/Makefile.am:
6424 * src/support/lxtl.h: New file. Some helper macros for using XTL.
6426 * src/frontends/xforms/input_validators.[ch]: input filters and
6427 validators. These conrol what keys are valid in input boxes.
6428 Use them and write some more. Much better idea than waiting till
6429 after the user has pressed Ok to say that the input fields don't make
6432 * src/frontends/xforms/Makefile.am:
6433 * src/frontends/xforms/forms/form_print.fd:
6434 * src/frontends/xforms/forms/makefile:
6435 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
6436 new scheme. Still have to make sure I haven't missed anything from
6437 the current implementation.
6439 * src/Makefile.am, src/PrinterParams.h: New data store.
6441 * other files: Added a couple of copyright notices.
6443 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6445 * src/insets/insetbib.h: move Holder struct in public space.
6447 * src/frontends/include/DialogBase.h: use SigC:: only when
6448 SIGC_CXX_NAMESPACES is defined.
6449 * src/frontends/include/Dialogs.h: ditto.
6451 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
6453 * src/frontends/xforms/FormCopyright.[Ch]: do not
6454 mention SigC:: explicitely.
6456 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6458 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
6459 deals with testing KDE in main configure.in
6460 * configure.in: ditto.
6462 2000-02-22 Allan Rae <rae@lyx.org>
6464 * Lots of files: Merged from HEAD
6466 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
6467 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
6469 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
6471 * sigc++/: new minidist.
6473 2000-02-14 Allan Rae <rae@lyx.org>
6475 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
6477 2000-02-08 Juergen Vigna <jug@sad.it>
6479 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
6480 file for the buildin GUI builder of KDevelop of the copyright-dialog.
6482 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
6483 for this port and so it is much easier for other people to port
6484 dialogs in a common development environment.
6486 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
6487 the QT/KDE implementation.
6489 * src/frontends/kde/Dialogs.C:
6490 * src/frontends/kde/FormCopyright.C:
6491 * src/frontends/kde/FormCopyright.h:
6492 * src/frontends/kde/Makefile.am:
6493 * src/frontends/kde/formcopyrightdialog.C:
6494 * src/frontends/kde/formcopyrightdialog.h:
6495 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
6496 for the kde support of the Copyright-Dialog.
6498 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
6499 subdir-substitution instead of hardcoded 'xforms' as we now have also
6502 * src/frontends/include/DialogBase.h (Object): just commented the
6503 label after #endif (nasty warning and I don't like warnings ;)
6505 * src/main.C (main): added KApplication initialization if using
6508 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
6509 For now only the KDE event-loop is added if frontend==kde.
6511 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
6513 * configure.in: added support for the --with-frontend[=value] option
6515 * autogen.sh: added kde.m4 file to list of config-files
6517 * acconfig.h: added define for KDEGUI-support
6519 * config/kde.m4: added configuration functions for KDE-port
6521 * config/lyxinclude.m4: added --with-frontend[=value] option with
6522 support for xforms and KDE.
6524 2000-02-08 Allan Rae <rae@lyx.org>
6526 * all Makefile.am: Fixed up so the make targets dist, distclean,
6527 install and uninstall all work even if builddir != srcdir. Still
6528 have a new sigc++ minidist update to come.
6530 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
6532 2000-02-01 Allan Rae <rae@lyx.org>
6534 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
6535 Many mods to get builddir != srcdir working.
6537 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
6538 for building on NT and so we can do the builddir != srcdir stuff.
6540 2000-01-30 Allan Rae <rae@lyx.org>
6542 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
6543 This will stay in "rae" branch. We probably don't really need it in
6544 the main trunk as anyone who wants to help programming it should get
6545 a full library installed also. So they can check both included and
6546 system supplied library compilation.
6548 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
6549 Added a 'mini' distribution of libsigc++. If you feel the urge to
6550 change something in these directories - Resist it. If you can't
6551 resist the urge then you should modify the following script and rebuild
6552 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
6553 all happen. Still uses a hacked version of libsigc++'s configure.in.
6554 I'm quite happy with the results. I'm not sure the extra work to turn
6555 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
6556 worth the trouble and would probably lead to extra maintenance
6558 I haven't tested the following important make targets: install, dist.
6559 Not ready for prime time but very close. Maybe 1.1.5.
6561 * development/tools/makeLyXsigc.sh: A shell script to automatically
6562 generate our mini-dist of libsigc++. It can only be used with a CVS
6563 checkout of libsigc++ not a tarball distribution. It's well commented.
6564 This will end up as part of the libsigc++ distribution so other apps
6565 can easily have an included mini-dist. If someone makes mods to the
6566 sigc++ subpackage without modifying this script to generate those
6567 changes I'll be very upset!
6569 * src/frontends/: Started the gui/system indep structure.
6571 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
6572 to access the gui-indep dialogs are in this class. Much improved
6573 design compared to previous revision. Lars, please refrain from
6574 moving this header into src/ like you did with Popups.h last time.
6576 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
6578 * src/frontends/xforms/: Started the gui-indep system with a single
6579 dialog: FormCopyright. Initial testing of use of libsigc++ was very
6582 * src/frontends/xforms/forms: Repository for the xforms .fd files.
6583 Here you'll find a very useful makefile and automated fdfix.sh that
6584 makes updating dailogs a no-brainer -- provided you follow the rules
6585 set out in the README. I'm thinking about adding another script to
6586 automatically generate skeleton code for a new dialog given just the
6589 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
6590 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
6591 Made FormCopyright gui-indep and added a lyxfunc to get to it.
6593 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6595 * src/support/LSubstring.C (operator): simplify
6597 * src/lyxtext.h: removed bparams, use buffer_->params instead
6599 * src/lyxrow.h: make Row a real class, move all variables to
6600 private and use accessors.
6602 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
6604 (isRightToLeftPar): ditto
6605 (ChangeLanguage): ditto
6606 (isMultiLingual): ditto
6609 (SimpleTeXOnePar): ditto
6610 (TeXEnvironment): ditto
6611 (GetEndLabel): ditto
6613 (SetOnlyLayout): ditto
6614 (BreakParagraph): ditto
6615 (BreakParagraphConservative): ditto
6616 (GetFontSettings): ditto
6618 (CopyIntoMinibuffer): ditto
6619 (CutIntoMinibuffer): ditto
6620 (PasteParagraph): ditto
6621 (SetPExtraType): ditto
6622 (UnsetPExtraType): ditto
6623 (DocBookContTableRows): ditto
6624 (SimpleDocBookOneTablePar): ditto
6626 (TeXFootnote): ditto
6627 (SimpleTeXOneTablePar): ditto
6628 (TeXContTableRows): ditto
6629 (SimpleTeXSpecialChars): ditto
6632 * src/lyxcursor.h: make LyXCursor a real class, move all variables
6633 to private and use accessors.
6635 * src/lyx_cb.C: remove char updatetimer, and all code that uses
6636 this, we did not use it anymore and has not been for ages. Just a
6637 waste of cpu cycles.
6639 * src/language.h: make Language a real class, move all variables
6640 to private and use accessors.
6642 * src/BufferView_pimpl.C (Pimpl): use new timer code.
6643 (create_view): remove
6644 (update): some changes for new timer
6645 (cursorToggle): use new timer
6646 (beforeChange): change for new timer
6648 * src/BufferView.h (cursorToggleCB): removed last paramter because
6651 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
6652 (cursorToggleCB): change because of new timer code
6654 * lib/CREDITS: updated own mailaddress
6656 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6658 * src/support/filetools.C (PutEnv): fix the code in case neither
6659 putenv() nor setenv() have been found.
6661 * INSTALL: mention the install-strip Makefile target.
6663 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
6664 read-only documents.
6666 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6668 * lib/reLyX/configure.in (VERSION): avoid using a previously
6669 generated reLyX wrapper to find out $prefix.
6671 * lib/examples/eu_adibide_lyx-atua.lyx:
6672 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
6673 translation of the Tutorial (Dooteo)
6675 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
6677 * forms/cite.fd: new citation dialog
6679 * src/insetcite.[Ch]: the new citation dialog is moved into
6682 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
6685 * src/insets/insetcommand.h: data members made private.
6687 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6689 * LyX 1.1.5 released
6691 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6693 * src/version.h (LYX_RELEASE): to 1.1.5
6695 * src/spellchecker.C (RunSpellChecker): return false if the
6696 spellchecker dies upon creation.
6698 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6700 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
6701 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
6705 * lib/CREDITS: update entry for Martin Vermeer.
6707 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
6709 * src/text.C (draw): Draw foreign language bars at the bottom of
6710 the row instead of at the baseline.
6712 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
6714 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6716 * lib/bind/de_menus.bind: updated
6718 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6720 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
6722 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
6724 * src/menus.C (Limit_string_length): New function
6725 (ShowTocMenu): Limit the number of items/length of items in the
6728 * src/paragraph.C (String): Correct result for a paragraph inside
6731 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6733 * src/bufferlist.C (close): test of buf->getuser() == NULL
6735 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
6737 * src/BufferView2.C (removeAutoInsets): Fix a bug:
6738 Do not call to SetCursor when the paragraph is a closed footnote!
6740 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
6742 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
6745 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
6747 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6750 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
6751 reference popup, that activates the reference-back action
6753 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
6755 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
6756 the menus. Also fixed a bug.
6758 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
6759 the math panels when switching buffers (unless new buffer is readonly).
6761 * src/BufferView.C (NoSavedPositions)
6762 * src/BufferView_pimpl.C (NoSavedPositions): New methods
6764 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6766 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
6767 less of dvi dirty or not.
6769 * src/trans_mgr.[Ch] (insert): change first parameter to string
6772 * src/chset.[Ch] (encodeString): add const to first parameter
6774 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6776 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
6780 * src/LaTeX.C (deplog): better searching for dependency files in
6781 the latex log. Uses now regexps.
6783 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
6784 instead of the box hack or \hfill.
6786 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6788 * src/lyxfunc.C (doImportHelper): do not create the file before
6789 doing the actual import.
6790 (doImportASCIIasLines): create a new file before doing the insert.
6791 (doImportASCIIasParagraphs): ditto.
6793 * lib/lyxrc.example: remove mention of non-existing commands
6795 * lyx.man: remove mention of color-related switches.
6797 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
6799 * src/lyx_gui.C: remove all the color-related ressources, which
6800 are not used anymore.
6802 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
6805 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
6807 * src/lyxrc.C (read): Add a missing break in the switch
6809 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
6811 * src/text2.C (InsertStringA): Fix a bug with insertion into table
6813 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
6816 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6818 * src/text.C (draw): draw bars under foreign language words.
6820 * src/LColor.[Ch]: add LColor::language
6822 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
6824 * src/lyxcursor.h (boundary): New member variable
6826 * src/text.C (IsBoundary): New methods
6828 * src/text.C: Use the above for currect cursor movement when there
6829 is both RTL & LTR text.
6831 * src/text2.C: ditto
6833 * src/bufferview_funcs.C (ToggleAndShow): ditto
6835 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6837 * src/text.C (DeleteLineForward): set selection to true to avoid
6838 that DeleteEmptyParagraphMechanism does some magic. This is how it
6839 is done in all other functions, and seems reasonable.
6840 (DeleteWordForward): do not jump over non-word stuff, since
6841 CursorRightOneWord() already does it.
6843 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
6844 DeleteWordBackward, since they seem safe to me (since selection is
6845 set to "true") DeleteEmptyParagraphMechanism does nothing.
6847 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6849 * src/lyx_main.C (easyParse): simplify the code by factoring the
6850 part that removes parameters from the command line.
6851 (LyX): check wether wrong command line options have been given.
6853 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
6855 * src/lyx_main.C : add support for specifying user LyX
6856 directory via command line option -userdir.
6858 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
6860 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
6861 the number of items per popup.
6862 (Add_to_refs_menu): Ditto.
6864 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6866 * src/lyxparagraph.h: renamed ClearParagraph() to
6867 StripLeadingSpaces() and moved it to paragraph.C. We pass the
6868 textclass as parameter, and do nothing if free_spacing is
6869 true. This fixes part of the line-delete-forward problems.
6871 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
6872 (pasteSelection): ditto.
6873 (SwitchLayoutsBetweenClasses): more translatable strings.
6875 * src/text2.C (CutSelection): use StripLeadingSpaces.
6876 (PasteSelection): ditto.
6877 (DeleteEmptyParagraphMechanism): ditto.
6879 2000-05-26 Juergen Vigna <jug@sad.it>
6881 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
6882 is not needed in tabular insets.
6884 * src/insets/insettabular.C (TabularFeatures): added missing features.
6886 * src/tabular.C (DeleteColumn):
6888 (AppendRow): implemented this functions
6889 (cellsturct::operator=): clone the inset too;
6891 2000-05-23 Juergen Vigna <jug@sad.it>
6893 * src/insets/insettabular.C (LocalDispatch): better selection support
6894 when having multicolumn-cells.
6896 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6898 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
6900 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6902 * src/ColorHandler.C (getGCForeground): put more test into _()
6904 * lib/examples/eu_splash.lyx: new file (Basque translation) from
6907 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
6910 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
6912 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
6913 there are no labels, or when buffer is readonly.
6915 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
6916 there are no labels, buffer is SGML, or when buffer is readonly.
6918 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6920 * src/LColor.C (LColor): change a couple of grey40 to grey60
6921 (LColor): rewore initalization to make compiles go some magnitude
6923 (getGUIName): don't use gettext until we need the string.
6925 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
6927 * src/Bullet.[Ch]: Fixed a small bug.
6929 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
6931 * src/paragraph.C (String): Several fixes/improvements
6933 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
6935 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6937 * src/paragraph.C (String): give more correct output.
6939 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
6941 * src/lyxfont.C (stateText) Do not output the language if it is
6942 eqaul to the language of the document.
6944 * src/paragraph.C (TeXOnePar): Do not put language switch commands
6945 between two paragraphs with the same language.
6947 * src/paragraph.C (getParLanguage) Return a correct answer for an
6948 empty dummy paragraph.
6950 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
6953 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
6956 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
6957 the menus/popup, if requested fonts are unavailable.
6959 2000-05-22 Juergen Vigna <jug@sad.it>
6961 * src/insets/insettabular.C (LocalDispatch): added some more cursor
6962 movement support (Up/Down/Tab/Shift-Tab).
6963 (LocalDispatch): added also preliminari cursor-selection.
6965 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
6967 * src/paragraph.C (PasteParagraph): Hopefully now right!
6969 2000-05-22 Garst R. Reese <reese@isn.net>
6971 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
6972 of list, change all references to Environment to Command
6973 * tex/hollywood.cls : rewrite environments as commands, add
6974 \uppercase to interiorshot and exteriorshot to force uppecase.
6975 * tex/broadway.cls : rewrite environments as commands. Tweak
6978 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6980 * src/menus.C (Add_to_toc_menu): fix the code which limits the
6981 size of items: use a constant intead of the hardcoded 40, and more
6982 importantly do not remove the %m and %x tags added at the end.
6983 (Add_to_refs_menu): use vector::size_type instead of
6984 unsigned int as basic types for the variables. _Please_ do not
6985 assume that size_t is equal to unsigned int. On an alpha, this is
6986 unsigned long, which is _not_ the same.
6988 * src/language.C (initL): remove language "hungarian", since it
6989 seems that "magyar" is better.
6991 2000-05-22 Juergen Vigna <jug@sad.it>
6993 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
6995 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
6998 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
6999 next was deleted but not set to 0.
7001 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7003 * src/language.C (initL): change the initialization of languages
7004 so that compiles goes _fast_.
7006 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
7009 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
7011 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7015 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7017 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
7019 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
7023 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
7026 * src/insets/insetlo*.[Ch]: Made editable
7028 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7030 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
7031 the current selection.
7033 * src/BufferView_pimpl.C (stuffClipboard): new method
7035 * src/BufferView.C (stuffClipboard): new method
7037 * src/paragraph.C (String): new method
7039 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
7040 LColor::ignore when lyxname is not found.
7042 * src/BufferView.C (pasteSelection): new method
7044 * src/BufferView_pimpl.C (pasteSelection): new method
7046 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
7048 * src/WorkArea.C (request_clipboard_cb): new static function
7049 (getClipboard): new method
7050 (putClipboard): new method
7052 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7054 * LyX 1.1.5pre2 released
7056 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7058 * src/vspace.C (operator=): removed
7059 (operator=): removed
7061 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
7063 * src/layout.C (NumberOfClass): manually set the type in make_pair
7064 (NumberOfLayout): ditto
7066 * src/language.C: use the Language constructor for ignore_lang
7068 * src/language.h: add constructors to struct Language
7070 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
7072 * src/text2.C (SetCursorIntern): comment out #warning
7074 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
7076 * src/mathed/math_iter.h: initialize sx and sw to 0
7078 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7080 * forms/lyx.fd: Redesign of form_ref
7082 * src/LaTeXFeatures.[Ch]
7086 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
7089 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
7090 and Buffer::inset_iterator.
7092 * src/menus.C: Added new menus: TOC and Refs.
7094 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
7096 * src/buffer.C (getTocList): New method.
7098 * src/BufferView2.C (ChangeRefs): New method.
7100 * src/buffer.C (getLabelList): New method. It replaces the old
7101 getReferenceList. The return type is vector<string> instead of
7104 * src/insets/insetinclude.C (getLabelList): New method. Replaces
7105 the old getLabel() and GetNumberOfLabels() methods.
7106 * src/insets/insetlabel.C (getLabelList): ditto
7107 * src/mathed/formula.C (getLabelList): ditto
7109 * src/paragraph.C (String): New method.
7111 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
7112 Uses the new getTocList() method.
7113 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
7114 which automatically updates the contents of the browser.
7115 (RefUpdateCB): Use the new getLabelList method.
7117 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
7119 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
7121 * src/spellchecker.C: Added using std::reverse;
7123 2000-05-19 Juergen Vigna <jug@sad.it>
7125 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
7127 * src/insets/insettext.C (computeTextRows): small fix for display of
7128 1 character after a newline.
7130 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
7133 2000-05-18 Juergen Vigna <jug@sad.it>
7135 * src/insets/insettabular.C (TabularFeatures): fixed update of display
7136 when changing width of column.
7138 * src/tabular.C (set_row_column_number_info): setting of
7139 autobreak rows if necessary.
7141 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7143 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
7145 * src/vc-backend.*: renamed stat() to status() and vcstat to
7146 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
7147 compilation broke. The new name seems more relevant, anyway.
7149 2000-05-17 Juergen Vigna <jug@sad.it>
7151 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
7152 which was wrong if the removing caused removing of rows!
7154 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
7155 (pushToken): new function.
7157 * src/text2.C (CutSelection): fix problem discovered with purify
7159 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7161 * src/debug.C (showTags): enlarge the first column, now that we
7162 have 6-digits debug codes.
7164 * lib/layouts/hollywood.layout:
7165 * lib/tex/hollywood.cls:
7166 * lib/tex/brodway.cls:
7167 * lib/layouts/brodway.layout: more commands and fewer
7168 environments. Preambles moved in the .cls files. Broadway now has
7169 more options on scene numbering and less whitespace (from Garst)
7171 * src/insets/insetbib.C (getKeys): make sure that we are in the
7172 document directory, in case the bib file is there.
7174 * src/insets/insetbib.C (Latex): revert bogus change.
7176 2000-05-16 Juergen Vigna <jug@sad.it>
7178 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
7179 the TabularLayout on cursor move.
7181 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
7183 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
7186 (draw): fixed cursor position and drawing so that the cursor is
7187 visible when before the tabular-inset.
7189 * src/insets/insettext.C (init): drawLockedFrame was not initialized
7190 when creating from old insettext.
7192 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
7194 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7196 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
7197 * lib/tex/brodway.cls: ditto
7199 * lib/layouts/brodway.layout: change alignment of parenthical
7202 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7204 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
7205 versions 0.88 and 0.89 are supported.
7207 2000-05-15 Juergen Vigna <jug@sad.it>
7209 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
7212 * src/insets/insettext.C (computeTextRows): redone completely this
7213 function in a much cleaner way, because of problems when having a
7215 (draw): added a frame border when the inset is locked.
7216 (SetDrawLockedFrame): this sets if we draw the border or not.
7217 (SetFrameColor): this sets the frame color (default=insetframe).
7219 * src/insets/lyxinset.h: added x() and y() functions which return
7220 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
7221 function which is needed to see if we have a locking inset of some
7222 type in this inset (needed for now in insettabular).
7224 * src/vspace.C (inPixels): the same function also without a BufferView
7225 parameter as so it is easier to use it in some ocasions.
7227 * src/lyxfunc.C: changed all places where insertInset was used so
7228 that now if it couldn't be inserted it is deleted!
7230 * src/TabularLayout.C:
7231 * src/TableLayout.C: added support for new tabular-inset!
7233 * src/BufferView2.C (insertInset): this now returns a bool if the
7234 inset was really inserted!!!
7236 * src/tabular.C (GetLastCellInRow):
7237 (GetFirstCellInRow): new helper functions.
7238 (Latex): implemented for new tabular class.
7242 (TeXTopHLine): new Latex() helper functions.
7244 2000-05-12 Juergen Vigna <jug@sad.it>
7246 * src/mathed/formulamacro.C (Read):
7247 * src/mathed/formula.C (Read): read also the \end_inset here!
7249 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
7251 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
7252 crush when saving formulae with unbalanced parenthesis.
7254 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
7256 * src/layout.C: Add new keyword "endlabelstring" to layout file
7258 * src/text.C (GetVisibleRow): Draw endlabel string.
7260 * lib/layouts/broadway.layout
7261 * lib/layouts/hollywood.layout: Added endlabel for the
7262 Parenthetical layout.
7264 * lib/layouts/heb-article.layout: Do not use slanted font shape
7265 for Theorem like environments.
7267 * src/buffer.C (makeLaTeXFile): Always add "american" to
7268 the UsedLanguages list if document language is RTL.
7270 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7272 * add addendum to README.OS2 and small patch (from SMiyata)
7274 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7276 * many files: correct the calls to ChangeExtension().
7278 * src/support/filetools.C (ChangeExtension): remove the no_path
7279 argument, which does not belong there. Use OnlyFileName() instead.
7281 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
7282 files when LaTeXing a non-nice latex file.
7284 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
7285 a chain of "if". Return false when deadkeys are not handled.
7287 * src/lyx_main.C (LyX): adapted the code for default bindings.
7289 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
7290 bindings for basic functionality (except deadkeys).
7291 (deadKeyBindings): new method. Performs the bindings of deadkeys.
7293 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
7294 several methods: handle override_x_deadkeys.
7296 * src/lyxrc.h: remove the "bindings" map, which did not make much
7297 sense anyway. New variable override_x_deadkeys, defaulting to "true".
7299 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7301 * src/lyxfont.C (stateText): use a saner method to determine
7302 whether the font is "default". Seems to fix the crash with DEC
7305 * src/Bullet.[Ch] (Bullet): remove const on parameters.
7307 2000-05-08 Juergen Vigna <jug@sad.it>
7309 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
7310 TabularLayoutMenu with mouse-button-3
7311 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
7313 * src/TabularLayout.C: added this file for having a Layout for
7316 2000-05-05 Juergen Vigna <jug@sad.it>
7318 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
7319 recalculating inset-widths.
7320 (TabularFeatures): activated this function so that I can change
7321 tabular-features via menu.
7323 * src/menus.C (ShowEditMenu): inserted support for insettabular so
7324 that I can test some functions with the Table menu.
7326 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7328 * src/lyxfont.C (stateText): guard against stupid c++libs.
7330 * src/tabular.C: add using std::vector
7331 some whitespace changes, + removed som autogenerated code.
7333 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
7335 2000-05-05 Juergen Vigna <jug@sad.it>
7337 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
7338 row, columns and cellstructures.
7340 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7342 * lib/lyxrc.example: remove obsolete entries.
7344 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
7345 reading of protected_separator for free_spacing.
7347 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7349 * src/text.C (draw): do not display an exclamation mark in the
7350 margin for margin notes. This is confusing, ugly and
7353 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
7354 AMS math' is checked.
7356 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
7357 name to see whether including the amsmath package is needed.
7359 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
7361 * src/paragraph.C (validate): Compute UsedLanguages correctly
7362 (don't insert the american language if it doesn't appear in the
7365 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
7366 The argument of \thanks{} command is considered moving argument
7368 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
7371 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
7373 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
7374 for appendix/minipage/depth. The lines can be now both in the footnote
7375 frame, and outside the frame.
7377 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
7380 2000-05-05 Juergen Vigna <jug@sad.it>
7382 * src/table.[Ch]: removed the inset and buffer stuff as this is now
7383 neede only in tabular.[Ch].
7385 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
7387 * src/insets/insetspecialchar.C (Read): allow command == '~' for
7389 (Write): write '~' for PROTECTED_SEPARATOR
7391 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7393 * src/lyxparagraph.h: add a friend struct matchIT after the struct
7396 * src/mathed/formula.C (drawStr): rename size to siz.
7398 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
7399 possibly fix a bug by not changing the pflags = flags to piflags =
7402 2000-05-05 Juergen Vigna <jug@sad.it>
7404 * src/insets/insetbib.C: moved using directive
7406 * src/ImportNoweb.C: small fix for being able to compile (missing
7409 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
7411 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
7412 to use clear, since we don't depend on this in the code. Add test
7415 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7417 * (various *.C files): add using std::foo directives to please dec
7420 * replace calls to string::clear() to string::erase() (Angus)
7422 * src/cheaders/cmath: modified to provide std::abs.
7424 2000-05-04 Juergen Vigna <jug@sad.it>
7426 * src/insets/insettext.C: Prepared all for inserting of multiple
7427 paragraphs. Still display stuff to do (alignment and other things),
7428 but I would like to use LyXText to do this when we cleaned out the
7429 table-support stuff.
7431 * src/insets/insettabular.C: Changed lot of stuff and added lots
7432 of functionality still a lot to do.
7434 * src/tabular.C: Various functions changed name and moved to be
7435 const functions. Added new Read and Write functions and changed
7436 lots of things so it works good with tabular-insets (also removed
7437 some stuff which is not needed anymore * hacks *).
7439 * src/lyxcursor.h: added operators == and != which just look if
7440 par and pos are (not) equal.
7442 * src/buffer.C (latexParagraphs): inserted this function to latex
7443 all paragraphs form par to endpar as then I can use this too for
7446 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
7447 so that I can call this to from text insets with their own cursor.
7449 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
7450 output off all paragraphs (because of the fix below)!
7452 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
7453 the very last paragraph (this could be also the last paragraph of an
7456 * src/texrow.h: added rows() call which returns the count-variable.
7458 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
7460 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
7462 * lib/configure.m4: better autodetection of DocBook tools.
7464 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7466 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
7468 * src/lyx_cb.C: add using std::reverse;
7470 * src/LaTeX.C (run): on error always run deleteFilesOnError before
7473 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
7474 selected files. Should fix repeated errors from generated files.
7476 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
7478 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
7480 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
7481 the spellchecker popup.
7483 * lib/lyxrc.example: Removed the \number_inset section
7485 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7487 * src/insets/figinset.C (various): Use IsFileReadable() to make
7488 sure that the file actually exist. Relying on ghostscripts errors
7489 is a bad idea since they can lead to X server crashes.
7491 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
7493 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
7496 * lib/lyxrc.example: smallish typo in description of
7497 \view_dvi_paper_option
7499 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7502 * src/lyxfunc.C: doImportHelper to factor out common code of the
7503 various import methods. New functions doImportASCIIasLines,
7504 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
7505 doImportLinuxDoc for the format specific parts.
7508 * buffer.C: Dispatch returns now a bool to indicate success
7511 * lyx_gui.C: Add getLyXView() for member access
7513 * lyx_main.C: Change logic for batch commands: First try
7514 Buffer::Dispatch (possibly without GUI), if that fails, use
7517 * lyx_main.C: Add support for --import command line switch.
7518 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
7519 Available Formats: Everything accepted by 'buffer-import <format>'
7521 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
7523 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
7526 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
7527 documents will be reformatted upon reentry.
7529 2000-04-27 Juergen Vigna <jug@sad.it>
7531 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
7532 correctly only last pos this was a bug.
7534 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7536 * release of lyx-1.1.5pre1
7538 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7540 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
7542 * src/menus.C: revert the change of naming (Figure->Graphic...)
7543 from 2000-04-11. It was incomplete and bad.
7545 * src/LColor.[Ch]: add LColor::depthbar.
7546 * src/text.C (GetVisibleRow): use it.
7548 * README: update the languages list.
7550 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7552 * src/text.C (GetVisibleRow): show the depth of paragraphs using
7555 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7557 * README: remove sections that were just wrong.
7559 * src/text2.C (GetRowNearY): remove currentrow code
7561 * src/text.C (GetRow): remove currentrow code
7563 * src/screen.C (Update): rewritten a bit.
7564 (SmallUpdate): removed func
7566 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
7568 (FullRebreak): return bool
7569 (currentrow): remove var
7570 (currentrow_y): ditto
7572 * src/lyxscreen.h (Draw): change arg to unsigned long
7573 (FitCursor): return bool
7574 (FitManualCursor): ditto
7575 (Smallpdate): remove func
7576 (first): change to unsigned long
7577 (DrawOneRow): change second arg to long (from long &)
7578 (screen_refresh_y): remove var
7579 (scree_refresh_row): ditto
7581 * src/lyxrow.h: change baseline to usigned int from unsigned
7582 short, this brings some implicit/unsigned issues out in the open.
7584 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
7586 (Dispatch): don't call updateScrollbar after fitCursor. Use update
7587 instead of smallUpdate.
7589 * src/lyxcursor.h: change y to unsigned long
7591 * src/buffer.h: don't call updateScrollbar after fitcursor
7593 * src/buffer.C (parseSingleLyXformat2Token): move variables to
7594 where they are used. Removed "\\direction", this was not present
7595 in 1.1.4 and is already obsolete. Commented out some code that I
7596 believe to never be called.
7597 (runLiterate): don't call updateScrollbar after fitCursor
7599 (buildProgram): ditto
7602 * src/WorkArea.h (workWidth): change return val to unsigned
7605 (redraw): remove the button redraws
7606 (setScrollbarValue): change for scrollbar
7607 (getScrollbarValue): change for scrollbar
7608 (getScrollbarBounds): change for scrollbar
7610 * src/WorkArea.C (C_WorkArea_up_cb): removed func
7611 (C_WorkArea_down_cb): removed func
7612 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
7613 (resize): change for scrollbar
7614 (setScrollbar): ditto
7615 (setScrollbarBounds): ditto
7616 (setScrollbarIncrements): ditto
7617 (up_cb): removed func
7618 (down_cb): removed func
7619 (scroll_cb): change for scrollbar
7620 (work_area_handler): ditto
7622 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
7623 when FitCursor did something.
7624 (updateScrollbar): some unsigned changes
7625 (downCB): removed func
7626 (scrollUpOnePage): removed func
7627 (scrollDownOnePage): remvoed func
7628 (workAreaMotionNotify): don't call screen->FitCursor but use
7629 fitCursor instead. and bool return val
7630 (workAreaButtonPress): ditto
7631 (workAreaButtonRelease): some unsigned changes
7632 (checkInsetHit): ditto
7633 (workAreaExpose): ditto
7634 (update): parts rewritten, comments about the signed char arg added
7635 (smallUpdate): removed func
7636 (cursorPrevious): call needed updateScrollbar
7639 * src/BufferView2.C (allFloats): don't call updateScrollbar after
7642 * src/BufferView.[Ch] (upCB): removed func
7643 (downCB): removed func
7644 (smallUpdate): removed func
7646 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7648 * src/lyxtext.h src/text.C src/text2.C: removed support for the
7649 currentrow, currentrow_y optimization. This did not help a lot and
7650 if we want to do this kind of optimization we should rather use
7651 cursor.row instead of the currentrow.
7653 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
7654 buffer spacing and klyx spacing support.
7656 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
7658 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
7661 2000-04-26 Juergen Vigna <jug@sad.it>
7663 * src/insets/figinset.C: fixes to Lars sstream changes!
7665 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
7667 * A lot of files: Added Ascii(ostream &) methods to all inset
7668 classes. Used when exporting to ASCII.
7670 * src/buffer.C (writeFileAscii,RoffAsciiTable)
7671 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
7674 * src/text2.C (ToggleFree): Disabled implicit word selection when
7675 there is a change in the language
7677 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
7678 no output was generated for end-of-sentence inset.
7680 * src/insets/lyxinset.h
7683 * src/paragraph.C: Removed the insetnumber code
7685 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
7687 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7689 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
7690 no_babel and no_epsfig completely from the file.
7691 (parseSingleLyXformat2Token): add handling for per-paragraph
7692 spacing as written by klyx.
7694 * src/insets/figinset.C: applied patch by Andre. Made it work with
7697 2000-04-20 Juergen Vigna <jug@sad.it>
7699 * src/insets/insettext.C (cutSelection):
7700 (copySelection): Fixed with selection from right to left.
7701 (draw): now the rows are not recalculated at every draw.
7702 (computeTextRows): for now reset the inset-owner here (this is
7703 important for an undo or copy where the inset-owner is not set
7706 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
7707 motion to the_locking_inset screen->first was forgotten, this was
7708 not important till we got multiline insets.
7710 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7712 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
7713 code seems to be alright (it is code changed by Dekel, and the
7714 intent is indeed that all macros should be defined \protect'ed)
7716 * NEWS: a bit of reorganisation of the new user-visible features.
7718 2000-04-19 Juergen Vigna <jug@sad.it>
7720 * src/insets/insettext.C (init): using a LyXCursor now for cursor
7721 position. Set the inset_owner of the used paragraph so that it knows
7722 that it is inside an inset. Fixed cursor handling with mouse and
7723 cursor keys. Fixed wrong timed inset redraws and lots of other changes
7724 and cleanups to make TextInsets work better.
7726 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
7727 Changed parameters of various functions and added LockInsetInInset().
7729 * src/insets/insettext.C:
7731 * src/insets/insetcollapsable.h:
7732 * src/insets/insetcollapsable.C:
7733 * src/insets/insetfoot.h:
7734 * src/insets/insetfoot.C:
7735 * src/insets/insetert.h:
7736 * src/insets/insetert.C: cleaned up the code so that it works now
7737 correctly with insettext.
7739 * src/insets/inset.C:
7740 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
7741 that insets in insets are supported right.
7744 * src/table.C: lots of changes for use with inset tabular (and cleanup)
7746 * src/paragraph.C: some small fixes
7748 * src/debug.h: inserted INSETS debug info
7750 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
7751 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
7753 * src/commandtags.h:
7754 * src/LyXAction.C: insert code for InsetTabular.
7756 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
7757 not Button1MotionMask.
7758 (workAreaButtonRelease): send always a InsetButtonRelease event to
7760 (checkInsetHit): some setCursor fixes (always with insets).
7762 * src/BufferView2.C (lockInset): returns a bool now and extended for
7763 locking insets inside insets.
7764 (showLockedInsetCursor): it is important to have the cursor always
7765 before the locked inset.
7766 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
7768 * src/BufferView.h: made lockInset return a bool.
7770 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
7772 * src/text2.C (SetCursor): This now has a version with a LyXCursor
7773 that is used also internally but can be called as public to have back
7774 a cursor pos which is not set internally.
7775 (SetCursorIntern): Changed to use above function.
7777 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
7779 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
7784 * NEWS: updated for prerelease of 1.1.5. Please comment and send
7785 patches for things that should be in or should be changed.
7787 * src/* [insetfiles]: change "usigned char fragile" to bool
7788 fragile. There was only one point that could that be questioned
7789 and that is commented in formulamacro.C. Grep for "CHECK".
7791 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
7792 (DeleteBuffer): take it out of CutAndPaste and make it static.
7794 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7796 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
7797 output the spacing envir commands. Also the new commands used in
7798 the LaTeX output makes the result better.
7800 * src/Spacing.C (writeEnvirBegin): new method
7801 (writeEnvirEnd): new method
7803 2000-04-18 Juergen Vigna <jug@sad.it>
7805 * src/CutAndPaste.C: made textclass a static member of the class
7806 as otherwise it is not accesed right!!!
7808 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
7810 * forms/layout_forms.fd
7811 * src/layout_forms.h
7812 * src/layout_forms.C (create_form_form_character)
7813 * src/lyx_cb.C (UserFreeFont)
7814 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
7815 documents (in the layout->character popup).
7817 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7819 * src/spellchecker.C (create_ispell_pipe): fix a bug where
7820 \spell_command was in fact not honored (from Kevin Atkinson).
7822 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
7825 * src/lyx_gui.h: make lyxViews private (Angus)
7827 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
7829 * src/mathed/math_write.C
7830 (MathMatrixInset::Write) Put \protect before \begin{array} and
7831 \end{array} if fragile
7832 (MathParInset::Write): Put \protect before \\ if fragile
7834 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7836 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
7837 initialization if the LyXColorHandler must be done after the
7838 connections to the XServer has been established.
7840 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
7841 get the background pixel from the lyxColorhandler so that the
7842 figures are rendered with the correct background color.
7843 (NextToken): removed functions.
7844 (GetPSSizes): use ifs >> string instead of NextToken.
7846 * src/Painter.[Ch]: the color cache moved out of this file.
7848 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
7851 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7853 * src/WorkArea.C (work_area_handler): call BufferView::enterView
7854 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
7856 * src/BufferView.C (enterView): new func
7857 (leaveView): new func
7859 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
7861 (leaveView): new func, undefines xterm cursor when approp.
7863 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
7864 (AllowInput): delete the Workarea cursor handling from this func.
7866 * src/Painter.C (underline): draw a slimer underline in most cases.
7868 * src/lyx_main.C (error_handler): use extern "C"
7870 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7872 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
7873 sent directly to me.
7875 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
7876 to the list by Dekel.
7878 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
7881 * src/bufferview_funcs.[Ch]: two new files, moved several of the
7882 methods from lyx_cb.here.
7884 * src/lyx_cb.C: in addition to the above; removed input_prohibited
7887 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7889 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
7890 instead of using current_view directly.
7892 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
7894 * src/LyXAction.C (init): add the paragraph-spacing command.
7896 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
7898 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
7900 * src/lyx_cb.C (CurrentState): output a string when the spacing is
7901 different from the documents.
7903 * src/text.C (SetHeightOfRow): take paragraph spacing into
7904 account, paragraph spacing takes precedence over buffer spacing
7905 (GetVisibleRow): ditto
7907 * src/paragraph.C (writeFile): output the spacing parameter too.
7908 (validate): set the correct features if spacing is used in the
7910 (Clear): set spacing to default
7911 (MakeSameLayout): spacing too
7912 (HasSameLayout): spacing too
7913 (SetLayout): spacing too
7914 (TeXOnePar): output the spacing commands
7916 * src/lyxparagraph.h: added a spacing variable for use with
7917 per-paragraph spacing.
7919 * src/Spacing.h: add a Default spacing and a method to check if
7920 the current spacing is default. also added an operator==
7922 * src/text2.C (DeleteEmptyParagraphMechanism): added a
7925 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7927 * src/lyxserver.C (callback): fix dispatch of functions
7929 * src/insets/insetlatexaccent.C (checkContents): turn bogus
7930 printf() into lyxerr call.
7932 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
7935 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
7936 "Table" to "Table Box", "Float" to "Floating Material"; deletes
7937 the "Float" from each of the subitems.
7938 (ShowHelpMenu): add entry for "FAQ" and "TOC".
7940 * src/support/DebugStream.h: add an #ifdef to work around a gcc
7941 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
7942 documented the change so that the workaround can be nuked later.
7944 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
7947 * src/lyxlex_pimpl.C (next): do not re-declare the default value
7949 * src/buffer.C (getLatexName): ditto
7950 (setReadonly): ditto
7952 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7954 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
7955 avoid some uses of current_view. Added also a bufferParams()
7956 method to get at this.
7958 * src/lyxtext.h: changed params->buffer and paramters->bparams.
7960 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7962 * src/lyxparagraph.[Ch]: removed
7963 operator<(LyXParagraph::InsetTable..., added a struct matchIT
7964 with operators used by lower_bound and
7965 upper_bound in InsetTable's
7966 Make struct InsetTable private again. Used matchpos.
7968 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
7970 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
7971 document, the language of existing text is changed (unless the
7972 document is multi-lingual)
7974 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
7976 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
7978 * A lot of files: A rewrite of the Right-to-Left support.
7980 2000-04-10 Juergen Vigna <jug@sad.it>
7982 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
7983 misplaced cursor when inset in inset is locked.
7985 * src/insets/insettext.C (LocalDispatch): small fix so that a
7986 BREAKLINE is not inserted if we don't permit it with autBreakRows.
7988 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
7989 footnote font should be decreased in size twice when displaying.
7991 * src/insets/insettext.C (GetDrawFont): inserted this function as
7992 the drawing-font may differ from the real paragraph font.
7994 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
7995 insets (inset in inset!).
7997 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
7998 function here because we don't want footnotes inside footnotes.
8000 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
8002 (init): now set the inset_owner in paragraph.C
8003 (LocalDispatch): added some resetPos() in the right position
8006 (pasteSelection): changed to use the new CutAndPaste-Class.
8008 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
8009 which tells if it is allowed to insert another inset inside this one.
8011 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
8012 SwitchLayoutsBetweenClasses.
8014 * src/text2.C (InsertInset): checking of the new paragraph-function
8016 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
8017 is not needed anymore here!
8020 (PasteSelection): redone (also with #ifdef) so that now this uses
8021 the CutAndPaste-Class.
8022 (SwitchLayoutsBetweenClasses): removed here and implemented in the
8025 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
8026 from/to text/insets.
8028 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
8029 so that the paragraph knows if it is inside an (text)-inset.
8030 (InsertFromMinibuffer): changed return-value to bool as now it
8031 may happen that an inset is not inserted in the paragraph.
8032 (InsertInsetAllowed): this checks if it is allowed to insert an
8033 inset in this paragraph.
8035 (BreakParagraphConservative):
8036 (BreakParagraph) : small change for the above change of the return
8037 value of InsertFromMinibuffer.
8039 * src/lyxparagraph.h: added inset_owner and the functions to handle
8040 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
8042 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8044 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
8045 functions from BufferView to BufferView::Pimpl to ease maintence.
8047 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
8048 correctly. Also use SetCursorIntern instead of SetCursor.
8050 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
8053 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8055 * src/WorkArea.C (belowMouse): manually implement below mouse.
8057 * src/*: Add "explicit" on several constructors, I added probably
8058 some unneeded ones. A couple of changes to code because of this.
8060 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
8061 implementation and private parts from the users of BufferView. Not
8064 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
8065 implementation and private parts from the users of LyXLex. Not
8068 * src/BufferView_pimpl.[Ch]: new files
8070 * src/lyxlex_pimpl.[Ch]: new files
8072 * src/LyXView.[Ch]: some inline functions move out-of-line
8074 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8076 * src/lyxparagraph.h: make struct InsetTable public.
8078 * src/support/lyxstring.h: change lyxstring::difference_type to be
8079 ptrdiff_t. Add std:: modifiers to streams.
8081 * src/font.C: include the <cctype> header, for islower() and
8084 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8086 * src/font.[Ch]: new files. Contains the metric functions for
8087 fonts, takes a LyXFont as parameter. Better separation of concepts.
8089 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
8090 changes because of this.
8092 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
8094 * src/*: compile with -Winline and move functions that don't
8097 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
8100 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8102 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
8103 (various files changed because of this)
8105 * src/Painter.C (text): fixed the drawing of smallcaps.
8107 * src/lyxfont.[Ch] (drawText): removed unused member func.
8110 * src/*.C: added needed "using" statements and "std::" qualifiers.
8112 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
8114 * src/*.h: removed all use of "using" from header files use
8115 qualifier std:: instead.
8117 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8119 * src/text.C (Backspace): some additional cleanups (we already
8120 know whether cursor.pos is 0 or not).
8122 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
8123 automake does not provide one).
8125 * src/bmtable.h: replace C++ comments with C comments.
8127 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
8129 * src/screen.C (ShowCursor): Change the shape of the cursor if
8130 the current language is not equal to the language of the document.
8131 (If the cursor change its shape unexpectedly, then you've found a bug)
8133 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
8136 * src/insets/insetnumber.[Ch]: New files.
8138 * src/LyXAction.C (init)
8139 * src/lyxfunc.C (dispatch): Add command number-inset-insert
8142 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
8144 * src/lyxparagraph.h
8145 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
8146 (the vector is kept sorted).
8148 * src/text.C (GetVisibleRow): Draw selection correctly when there
8149 is both LTR and RTL text.
8151 * src/paragraph.C (Clone): Use the assignment operator for cloning,
8152 which is much faster.
8154 * src/text.C (GetVisibleRow and other): Do not draw the last space
8155 in a row if the direction of the last letter is not equal to the
8156 direction of the paragraph.
8158 * src/lyxfont.C (latexWriteStartChanges):
8159 Check that font language is not equal to basefont language.
8160 (latexWriteEndChanges): ditto
8162 * src/lyx_cb.C (StyleReset): Don't change the language while using
8163 the font-default command.
8165 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
8166 empty paragraph before a footnote.
8168 * src/insets/insetcommand.C (draw): Increase x correctly.
8170 * src/screen.C (ShowCursor): Change cursor shape if
8171 current language != document language.
8173 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
8175 2000-03-31 Juergen Vigna <jug@sad.it>
8177 * src/paragraph.C (GetInset): commented out text[pos] = ' '
8178 (Clone): changed mode how the paragraph-data is copied to the
8179 new clone-paragraph.
8181 * src/lyxfunc.C (Dispatch): fixed small problem when calling
8182 GetInset(pos) with no inset anymore there (in inset UNDO)
8184 * src/insets/insetcommand.C (draw): small fix as here x is
8185 incremented not as much as width() returns (2 before, 2 behind = 4)
8187 2000-03-30 Juergen Vigna <jug@sad.it>
8189 * src/insets/insettext.C (InsetText): small fix in initialize
8190 widthOffset (should not be done in the init() function)
8192 2000-03-29 Amir Karger <karger@lyx.org>
8194 * lib/examples/it_ItemizeBullets.lyx: translation by
8197 * Implemented \textasciitilde and fixed a tiny bug in reLyX
8199 2000-03-29 Juergen Vigna <jug@sad.it>
8201 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
8203 * src/insets/insetfoot.C (Clone): small change as for the below
8204 new init function in the text-inset
8206 * src/insets/insettext.C (init): new function as I've seen that
8207 clone did not copy the Paragraph-Data!
8208 (LocalDispatch): Added code so that now we have some sort of Undo
8209 functionality (well actually we HAVE Undo ;)
8211 * src/text.C (Backspace): Small fix for the a | a Backspace problem
8213 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
8215 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
8218 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8220 * src/main.C: added a runtime check that verifies that the xforms
8221 header used when building LyX and the library used when running
8222 LyX match. Exit with a message if they don't match. This is a
8223 version number check only.
8225 * src/buffer.C (save): Don't allocate memory on the heap for
8226 struct utimbuf times.
8228 * *: some using changes, use iosfwd instead of the real headers.
8230 * src/lyxfont.C use char const * instead of string for the static
8231 strings. Rewrite some functions to use sstream.
8233 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8235 * src/text.C (Backspace): hopefully fix the dreaded backaspace
8238 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8240 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
8241 of Geodesy (from Martin Vermeer)
8243 * lib/layouts/svjour.inc: include file for the Springer svjour
8244 class. It can be used to support journals other than JoG.
8246 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
8247 Miskiewicz <misiek@pld.org.pl>)
8248 * lib/reLyX/Makefile.am: ditto.
8250 2000-03-27 Juergen Vigna <jug@sad.it>
8252 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
8253 also some modifications with operations on selected text.
8255 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
8256 problems with clicking on insets (last famous words ;)
8258 * src/insets/insetcommand.C (draw):
8259 (width): Changed to have a bit of space before and after the inset so
8260 that the blinking cursor can be seen (otherwise it was hidden)
8262 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8264 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
8265 would not be added to the link list when an installed gettext (not
8266 part of libc) is found.
8268 2000-03-24 Juergen Vigna <jug@sad.it>
8270 * src/insets/insetcollapsable.C (Edit):
8271 * src/mathed/formula.C (InsetButtonRelease):
8272 (InsetButtonPress): fixed for new handling of ButtonPress/Release
8275 * src/BufferView.C (workAreaButtonPress):
8276 (workAreaButtonRelease):
8277 (checkInsetHit): Finally fixed the clicking on insets be handled
8280 * src/insets/insetert.C (Edit): inserted this call so that ERT
8281 insets work always with LaTeX-font
8283 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8285 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
8286 caused lyx to startup with no GUI in place, causing in a crash
8287 upon startup when called with arguments.
8289 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8291 * src/FontLoader.C: better initialization of dummyXFontStruct.
8293 2000-03-20 José Abílio Matos <jamatos@lyx.org>
8295 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
8296 for linuxdoc and docbook import and export format options.
8298 * lib/lyxrc.example Example of default values for the previous flags.
8300 * src/lyx_cb.C Use those flags instead of the hardwired values for
8301 linuxdoc and docbook export.
8303 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
8306 * src/menus.C Added menus entries for the new import/exports formats.
8308 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8310 * src/lyxrc.*: Added support for running without Gui
8313 * src/FontLoader.C: sensible defaults if no fonts are needed
8315 * src/lyx_cb.C: New function ShowMessage (writes either to the
8316 minibuffer or cout in case of no gui
8317 New function AskOverwrite for common stuff
8318 Consequently various changes to call these functions
8320 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
8321 wild guess at sensible screen resolution when having no gui
8323 * src/lyxfont.C: no gui, no fonts... set some defaults
8325 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8327 * src/LColor.C: made the command inset background a bit lighter.
8329 2000-03-20 Hartmut Goebel <goebel@noris.net>
8331 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
8332 stdstruct.inc. Koma-Script added some title elements which
8333 otherwise have been listed below "bibliography". This split allows
8334 adding title elements to where they belong.
8336 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
8337 define the additional title elements and then include
8340 * many other layout files: changed to include stdtitle.inc just
8341 before stdstruct.inc.
8343 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
8345 * src/buffer.C: (save) Added the option to store all backup files
8346 in a single directory
8348 * src/lyxrc.[Ch]: Added variable \backupdir_path
8350 * lib/lyxrc.example: Added descriptions of recently added variables
8352 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
8353 bibtex inset, not closing the bibtex popup when deleting the inset)
8355 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8357 * src/lyx_cb.C: add a couple using directives.
8359 2000-03-17 José Abílio Matos <jamatos@lyx.org>
8360 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
8361 import based on the filename.
8363 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
8364 file would be imported at start, if the filename where of a sgml file.
8366 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
8368 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
8370 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
8371 * src/lyxfont.h Replaced the member variable bits.direction by the
8372 member variable lang. Made many changes in other files.
8373 This allows having a multi-lingual document
8375 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
8376 that change the current language to <l>.
8377 Removed the command "font-rtl"
8379 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
8380 format for Hebrew documents)
8382 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
8383 When auto_mathmode is "true", pressing a digit key in normal mode
8384 will cause entering into mathmode.
8385 If auto_mathmode is "rtl" then this behavior will be active only
8386 when writing right-to-left text.
8388 * src/text2.C (InsertStringA) The string is inserted using the
8391 * src/paragraph.C (GetEndLabel) Gives a correct result for
8392 footnote paragraphs.
8394 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
8396 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
8398 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
8399 front of PasteParagraph. Never insert a ' '. This should at least
8400 fix some cause for the segfaults that we have been experiencing,
8401 it also fixes backspace behaviour slightly. (Phu!)
8403 * src/support/lstrings.C (compare_no_case): some change to make it
8404 compile with gcc 2.95.2 and stdlibc++-v3
8406 * src/text2.C (MeltFootnoteEnvironment): change type o
8407 first_footnote_par_is_not_empty to bool.
8409 * src/lyxparagraph.h: make text private. Changes in other files
8411 (fitToSize): new function
8412 (setContentsFromPar): new function
8413 (clearContents): new function
8414 (SetChar): new function
8416 * src/paragraph.C (readSimpleWholeFile): deleted.
8418 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
8419 the file, just use a simple string instead. Also read the file in
8420 a more maintainable manner.
8422 * src/text2.C (InsertStringA): deleted.
8423 (InsertStringB): deleted.
8425 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8427 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
8428 RedoParagraphs from the doublespace handling part, just set status
8429 to NEED_MORE_REFRESH. Also don't update cursor position (should be
8430 done, but perhaps not like this.)
8432 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8434 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
8435 character when inserting an inset.
8437 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8439 * src/bufferparams.C (readLanguage): now takes "default" into
8442 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
8443 also initialize the toplevel_keymap with the default bindings from
8446 * src/buffer.C (Buffer): remove lyxrc from the parameters.
8448 * all files using lyxrc: have lyxrc as a real variable and not a
8449 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
8452 * src/lyxrc.C: remove double call to defaultKeyBindings
8454 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
8455 toolbar defauls using lyxlex. Remove enums, structs, functions
8458 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
8459 toolbar defaults. Also store default keybindings in a map.
8461 * src/ToolbarDefaults.[Ch]: New file. This class is used for
8462 storing the toolbar defaults without any xforms dependencies.
8464 * src/insets/figinset.C: patch posted to list by Andre Poenitz
8465 applied. Changed to use iterators.
8467 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
8469 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
8470 systems that don't have LINGUAS set to begin with.
8472 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8474 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
8475 the list by Dekel Tsur.
8477 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8479 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
8480 * src/insets/form_graphics.C: ditto.
8482 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
8484 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8486 * src/bufferparams.C (readLanguage): use the new language map
8488 * src/intl.C (InitKeyMapper): use the new language map
8490 * src/lyx_gui.C (create_forms): use the new language map
8492 * src/language.[Ch]: New files. Used for holding the information
8493 about each language. Now! Use this new language map enhance it and
8494 make it really usable for our needs.
8496 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
8498 * screen.C (ShowCursor): Removed duplicate code.
8499 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
8500 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
8502 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
8505 * src/text.C Added TransformChar method. Used for rendering Arabic
8506 text correctly (change the glyphs of the letter according to the
8507 position in the word)
8512 * src/lyxrc.C Added lyxrc command {language_command_begin,
8513 language_command_end,language_command_ltr,language_command_rtl,
8514 language_package} which allows the use of either arabtex or Omega
8517 * src/lyx_gui.C (init)
8519 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
8520 to use encoding for menu fonts which is different than the encoding
8523 * src/buffer.C (makeLaTeXFile): If params.language = "default",
8524 do not load the babel package.
8525 To write an English document with Hebrew/Arabic, change the document
8526 language to "english".
8528 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
8529 (alphaCounter): changed to return char
8530 (loweralphaCounter, hebrewCounter, romanCounter): New functions
8532 * lib/lyxrc.example Added examples for Hebrew/Arabic
8535 * src/layout.C Added layout command endlabeltype
8537 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
8539 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
8541 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8543 * src/mathed/math_delim.C (search_deco): return a
8544 math_deco_struct* instead of index.
8546 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8548 * All files with a USE_OSTREAM_ONLY within: removed all code that
8549 was unused when USE_OSTREAM_ONLY is defined.
8551 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
8552 of any less. Removed header and using.
8554 * src/text.C (GetVisibleRow): draw the string "Page Break
8555 (top/bottom)" on screen when drawing a pagebreak line.
8557 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8559 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
8561 * src/mathed/math_macro.C (draw): do some cast magic.
8564 * src/mathed/math_defs.h: change byte* argument to byte const*.
8566 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
8568 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
8569 know it is right to return InsetFoot* too, but cxx does not like
8572 * src/insets/insetcollapsable.[Ch] (Clone): make const.
8574 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
8576 * src/mathed/math_delim.C: change == to proper assignment.
8578 2000-03-09 Juergen Vigna <jug@sad.it>
8580 * src/insets/insettext.C (setPos): fixed various cursor positioning
8581 problems (via mouse and cursor-keys)
8582 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
8583 inset (still a small display problem but it works ;)
8585 * src/insets/insetcollapsable.C (draw): added button_top_y and
8586 button_bottom_y to have correct values for clicking on the inset.
8588 * src/support/lyxalgo.h: commented out 'using std::less'
8590 2000-03-08 Juergen Vigna <jug@sad.it>
8592 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
8593 Button-Release event closes as it is alos the Release-Event
8596 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
8598 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
8600 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
8601 can add multiple spaces in Scrap (literate programming) styles...
8602 which, by the way, is how I got hooked on LyX to begin with.
8604 * src/mathed/formula.C (Write): Added dummy variable to an
8605 inset::Latex() call.
8606 (Latex): Add free_spacing boolean to inset::Latex()
8608 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
8610 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
8611 virtual function to include the free_spacing boolean from
8612 the containing paragraph's style.
8614 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
8615 Added free_spacing boolean arg to match inset.h
8617 * src/insets/insettext.C, src/insets/insettext.h (Latex):
8618 Added free_spacing boolean arg to match inset.h
8620 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
8621 Added free_spacing boolean and made sure that if in a free_spacing
8622 paragraph, that we output normal space if there is a protected space.
8624 * src/insets/insetref.C, src/insets/insetref.h (Latex):
8625 Added free_spacing boolean arg to match inset.h
8627 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
8628 Added free_spacing boolean arg to match inset.h
8630 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
8631 Added free_spacing boolean arg to match inset.h
8633 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
8634 Added free_spacing boolean arg to match inset.h
8636 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
8637 Added free_spacing boolean arg to match inset.h
8639 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
8640 free_spacing boolean arg to match inset.h
8642 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
8643 Added free_spacing boolean arg to match inset.h
8645 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
8646 Added free_spacing boolean arg to match inset.h
8648 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
8649 Added free_spacing boolean arg to match inset.h
8651 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
8652 Added free_spacing boolean arg to match inset.h
8654 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
8655 Added free_spacing boolean arg to match inset.h
8657 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
8658 free_spacing boolean arg to match inset.h
8660 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
8661 free_spacing boolean arg to match inset.h
8663 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
8664 ignore free_spacing paragraphs. The user's spaces are left
8667 * src/text.C (InsertChar): Fixed the free_spacing layout
8668 attribute behavior. Now, if free_spacing is set, you can
8669 add multiple spaces in a paragraph with impunity (and they
8670 get output verbatim).
8671 (SelectSelectedWord): Added dummy argument to inset::Latex()
8674 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
8677 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
8678 paragraph layouts now only input a simple space instead.
8679 Special character insets don't make any sense in free-spacing
8682 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
8683 hard-spaces in the *input* file to simple spaces if the layout
8684 is free-spacing. This converts old files which had to have
8685 hard-spaces in free-spacing layouts where a simple space was
8687 (writeFileAscii): Added free_spacing check to pass to the newly
8688 reworked inset::Latex(...) methods. The inset::Latex() code
8689 ensures that hard-spaces in free-spacing paragraphs get output
8690 as spaces (rather than "~").
8692 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8694 * src/mathed/math_delim.C (draw): draw the empty placeholder
8695 delims with a onoffdash line.
8696 (struct math_deco_compare): struct that holds the "functors" used
8697 for the sort and the binary search in math_deco_table.
8698 (class init_deco_table): class used for initial sort of the
8700 (search_deco): use lower_bound to do a binary search in the
8703 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8705 * src/lyxrc.C: a small secret thingie...
8707 * src/lyxlex.C (printTable): changed to take a ostream as paramter
8708 and to not flush the stream as often as it used to.
8710 * src/support/lyxalgo.h: new file
8711 (sorted): template function used for checking if a sequence is
8712 sorted or not. Two versions with and without user supplied
8713 compare. Uses same compare as std::sort.
8715 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
8716 it and give warning on lyxerr.
8718 (struct compare_tags): struct with function operators used for
8719 checking if sorted, sorting and lower_bound.
8720 (search_kw): use lower_bound instead of manually implemented
8723 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8725 * src/insets/insetcollapsable.h: fix Clone() declaration.
8726 * src/insets/insetfoot.h: ditto.
8728 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
8730 2000-03-08 Juergen Vigna <jug@sad.it>
8732 * src/insets/lyxinset.h: added owner call which tells us if
8733 this inset is inside another inset. Changed also the return-type
8734 of Editable to an enum so it tells clearer what the return-value is.
8736 * src/insets/insettext.C (computeTextRows): fixed computing of
8737 textinsets which split automatically on more rows.
8739 * src/insets/insetert.[Ch]: changed this to be of BaseType
8742 * src/insets/insetfoot.[Ch]: added footnote inset
8744 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
8745 collapsable insets (like footnote, ert, ...)
8747 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8749 * src/lyxdraw.h: remvoe file
8751 * src/lyxdraw.C: remove file
8753 * src/insets/insettext.C: added <algorithm>.
8755 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8757 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
8758 (matrix_cb): case MM_OK use string stream
8760 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
8763 * src/mathed/math_macro.C (draw): use string stream
8764 (Metrics): use string stream
8766 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
8767 directly to the ostream.
8769 * src/vspace.C (asString): use string stream.
8770 (asString): use string stream
8771 (asLatexString): use string stream
8773 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
8774 setting Spacing::Other.
8776 * src/LaTeXFeatures.C (getPackages): use string stream instead of
8777 sprintf when creating the stretch vale.
8779 * src/text2.C (alphaCounter): changed to return a string and to
8780 not use a static variable internally. Also fixed a one-off bug.
8781 (SetCounter): changed the drawing of the labels to use string
8782 streams instead of sprintf.
8784 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
8785 manipulator to use a scheme that does not require library support.
8786 This is also the way it is done in the new GNU libstdc++. Should
8787 work with DEC cxx now.
8789 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8791 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
8792 end. This fixes a bug.
8794 * src/mathed (all files concerned with file writing): apply the
8795 USE_OSTREAM_ONLY changes to mathed too.
8797 * src/support/DebugStream.h: make the constructor explicit.
8799 * src/lyxfont.C (latexWriteStartChanges): small bug related to
8800 count and ostream squashed.
8802 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8804 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
8806 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
8807 ostringstream uses STL strings, and we might not.
8809 * src/insets/insetspecialchar.C: add using directive.
8810 * src/insets/insettext.C: ditto.
8812 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8814 * lib/layouts/seminar.layout: feeble attempt at a layout for
8815 seminar.cls, far from completet and could really use some looking
8816 at from people used to write layout files.
8818 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
8819 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
8820 a lot nicer and works nicely with ostreams.
8822 * src/mathed/formula.C (draw): a slightly different solution that
8823 the one posted to the list, but I think this one works too. (font
8824 size wrong in headers.)
8826 * src/insets/insettext.C (computeTextRows): some fiddling on
8827 Jürgens turf, added some comments that he should read.
8829 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
8830 used and it gave compiler warnings.
8831 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
8834 * src/lyx_gui.C (create_forms): do the right thing when
8835 show_banner is true/false.
8837 * src/lyx_cb.C (TimerCB): no need to close or do anything if
8838 show_banner is false.
8840 * most file writing files: Now use iostreams to do almost all of
8841 the writing. Also instead of passing string &, we now use
8842 stringstreams. mathed output is still not adapted to iostreams.
8843 This change can be turned off by commenting out all the occurences
8844 of the "#define USE_OSTREAM_ONLY 1" lines.
8846 * src/WorkArea.C (createPixmap): don't output debug messages.
8847 (WorkArea): don't output debug messages.
8849 * lib/lyxrc.example: added a comment about the new variable
8852 * development/Code_rules/Rules: Added some more commente about how
8853 to build class interfaces and on how better encapsulation can be
8856 2000-03-03 Juergen Vigna <jug@sad.it>
8858 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
8859 automatically with the width of the LyX-Window
8861 * src/insets/insettext.C (computeTextRows): fixed update bug in
8862 displaying text-insets (scrollvalues where not initialized!)
8864 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8866 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
8867 id in the check of the result from lower_bound is not enough since
8868 lower_bound can return last too, and then res->id will not be a
8871 * all insets and some code that use them: I have conditionalized
8872 removed the Latex(string & out, ...) this means that only the
8873 Latex(ostream &, ...) will be used. This is a work in progress to
8874 move towards using streams for all output of files.
8876 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
8879 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8881 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
8882 routine (this fixes bug where greek letters were surrounded by too
8885 * src/support/filetools.C (findtexfile): change a bit the search
8886 algorithm, to fix bug introduced in 1.1.4. Note that --format is
8887 no longer passed to kpsewhich, we may have to change that later.
8889 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
8890 warning options to avoid problems with X header files (from Angus
8892 * acinclude.m4: regenerated.
8894 2000-03-02 Juergen Vigna <jug@sad.it>
8896 * src/insets/insettext.C (WriteParagraphData): Using the
8897 par->writeFile() function for writing paragraph-data.
8898 (Read): Using buffer->parseSingleLyXformat2Token()-function
8899 for parsing paragraph data!
8901 * src/buffer.C (readLyXformat2): removed all parse data and using
8902 the new parseSingleLyXformat2Token()-function.
8903 (parseSingleLyXformat2Token): added this function to parse (read)
8904 lyx-file-format (this is called also from text-insets now!)
8906 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8908 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
8911 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
8912 directly instead of going through a func. One very bad thing: a
8913 static LyXFindReplace, but I don't know where to place it.
8915 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
8916 string instead of char[]. Also changed to static.
8917 (GetSelectionOrWordAtCursor): changed to static inline
8918 (SetSelectionOverLenChars): ditto.
8920 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
8921 current_view and global variables. both classes has changed names
8922 and LyXFindReplace is not inherited from SearchForm.
8924 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
8925 fl_form_search form.
8927 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
8929 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8931 * lib/bind/*.bind: make sure 'buffer-previous' function is not
8932 bound (from Kayvan).
8934 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
8936 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
8938 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8940 * some things that I should comment but the local pub says head to
8943 * comment out all code that belongs to the Roff code for Ascii
8944 export of tables. (this is unused)
8946 * src/LyXView.C: use correct type for global variable
8947 current_layout. (LyXTextClass::size_type)
8949 * some code to get the new insetgraphics closer to working I'd be
8950 grateful for any help.
8952 * src/BufferView2.C (insertInset): use the return type of
8953 NumberOfLayout properly. (also changes in other files)
8955 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
8956 this as a test. I want to know what breaks because of this.
8958 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
8960 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8962 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
8963 to use a \makebox in the label, this allows proper justification
8964 with out using protected spaces or multiple hfills. Now it is
8965 "label" for left justified, "\hfill label\hfill" for center, and
8966 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
8967 should be changed accordingly.
8969 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8971 * src/lyxtext.h: change SetLayout() to take a
8972 LyXTextClass::size_type instead of a char (when there is more than
8973 127 layouts in a class); also change type of copylayouttype.
8974 * src/text2.C (SetLayout): ditto.
8975 * src/LyXView.C (updateLayoutChoice): ditto.
8977 * src/LaTeX.C (scanLogFile): errors where the line number was not
8978 given just after the '!'-line were ignored (from Dekel Tsur).
8980 * lib/lyxrc.example: fix description of \date_insert_format
8982 * lib/layouts/llncs.layout: new layout, contributed by Martin
8985 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8987 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
8988 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
8989 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
8990 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
8991 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
8992 paragraph.C, text.C, text2.C)
8994 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8996 * src/insets/insettext.C (LocalDispatch): remove extra break
8999 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
9000 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
9002 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
9003 * src/insets/insettext.[Ch] (GetCursorPos): ditto
9005 * src/insets/insetbib.h: move InsetBibkey::Holder and
9006 InsetCitation::Holder in public space.
9008 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9010 * src/insets/insettext.h: small change to get the new files from
9011 Juergen to compile (use "string", not "class string").
9013 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
9014 const & as parameter to LocalDispatch, use LyXFont const & as
9015 paramter to some other func. This also had impacto on lyxinsets.h
9016 and the two mathed insets.
9018 2000-02-24 Juergen Vigna <jug@sad.it>
9021 * src/commandtags.h:
9023 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
9027 * src/BufferView2.C: added/updated code for various inset-functions
9029 * src/insets/insetert.[Ch]: added implementation of InsetERT
9031 * src/insets/insettext.[Ch]: added implementation of InsetText
9033 * src/insets/inset.C (Edit): added "unsigned int button" parameter
9034 (draw): added preliminary code for inset scrolling not finshed yet
9036 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
9037 as it is in lyxfunc.C now
9039 * src/insets/lyxinset.h: Added functions for text-insets
9041 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9043 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
9044 BufferView and reimplement the list as a queue put inside its own
9047 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
9049 * several files: use the new interface to the "updateinsetlist"
9051 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
9053 (work_area_handler): call BufferView::trippleClick on trippleclick.
9055 * src/BufferView.C (doubleClick): new function, selects word on
9057 (trippleClick): new function, selects line on trippleclick.
9059 2000-02-22 Allan Rae <rae@lyx.org>
9061 * lib/bind/xemacs.bind: buffer-previous not supported
9063 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9065 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
9068 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9070 * src/bufferlist.C: get rid of current_view from this file
9072 * src/spellchecker.C: get rid of current_view from this file
9074 * src/vspace.C: get rid of current_view from this file
9075 (inPixels): added BufferView parameter for this func
9076 (asLatexCommand): added a BufferParams for this func
9078 * src/text.C src/text2.C: get rid of current_view from these
9081 * src/lyxfont.C (getFontDirection): move this function here from
9084 * src/bufferparams.C (getDocumentDirection): move this function
9087 * src/paragraph.C (getParDirection): move this function here from
9089 (getLetterDirection): ditto
9091 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
9093 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
9094 resize due to wrong pixmap beeing used. Also took the opurtunity
9095 to make the LyXScreen stateless on regard to WorkArea and some
9096 general cleanup in the same files.
9098 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9100 * src/Makefile.am: add missing direction.h
9102 * src/PainterBase.h: made the width functions const.
9104 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
9107 * src/insets/insetcommand.C (draw): draw Editable as buttons.
9109 * src/insets/insetlatexaccent.C (draw): make the accents draw
9110 better, at present this will only work well with iso8859-1.
9112 * several files: remove the old drawing code, now we use the new
9115 * several files: remove support for mono_video, reverse_video and
9118 2000-02-17 Juergen Vigna <jug@sad.it>
9120 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
9121 int ** as we have to return the pointer, otherwise we have only
9122 NULL pointers in the returning function.
9124 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9126 * src/LaTeX.C (operator()): quote file name when running latex.
9128 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9130 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
9131 (bubble tip), this removes our special handling of this.
9133 * Remove all code that is unused now that we have the new
9134 workarea. (Code that are not active when NEW_WA is defined.)
9136 * Make the uses of XSync not conditionalized on define USE_XSYNC.
9138 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9140 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
9141 nonexisting layout; correctly redirect obsoleted layouts.
9143 * lib/lyxrc.example: document \view_dvi_paper_option
9145 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
9148 * src/lyx_cb.C (RunScript): handle $$FName for command names.
9149 (PreviewDVI): handle the view_dvi_paper_option variable.
9150 [Both from Roland Krause]
9152 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9154 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
9155 char const *, int, LyXFont)
9156 (text(int, int, string, LyXFont)): ditto
9158 * src/text.C (InsertCharInTable): attempt to fix the double-space
9159 feature in tables too.
9160 (BackspaceInTable): ditto.
9161 (GetVisibleRow): make bottom pagebreak line be a onoff line.
9163 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9165 * src/text2.C (owner): only complain if owner_ is set and bv != 0
9167 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
9168 newly found text in textcache to this.
9169 (buffer): set the owner of the text put into the textcache to 0
9171 * src/insets/figinset.C (draw): fixed the drawing of figures with
9174 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
9175 drawing of mathframe, hfills, protected space, table lines. I have
9176 now no outstanding drawing problems with the new Painter code.
9178 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9180 * src/PainterBase.C (ellipse, circle): do not specify the default
9183 * src/LColor.h: add using directive.
9185 * src/Painter.[Ch]: change return type of methods from Painter& to
9186 PainterBase&. Add a using directive.
9188 * src/WorkArea.C: wrap xforms callbacks in C functions
9191 * lib/layouts/foils.layout: font fix and simplifications from Carl
9194 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9196 * a lot of files: The Painter, LColor and WorkArea from the old
9197 devel branch has been ported to lyx-devel. Some new files and a
9198 lot of #ifdeffed code. The new workarea is enabled by default, but
9199 if you want to test the new Painter and LColor you have to compile
9200 with USE_PAINTER defined (do this in config.h f.ex.) There are
9201 still some rought edges, and I'd like some help to clear those
9202 out. It looks stable (loads and displays the Userguide very well).
9205 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9207 * src/buffer.C (pop_tag): revert to the previous implementation
9208 (use a global variable for both loops).
9210 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
9212 * src/lyxrc.C (LyXRC): change slightly default date format.
9214 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
9215 there is an English text with a footnote that starts with a Hebrew
9216 paragraph, or vice versa.
9217 (TeXFootnote): ditto.
9219 * src/text.C (LeftMargin): allow for negative values for
9220 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
9223 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
9224 for input encoding (cyrillic)
9226 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9228 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
9231 * src/toolbar.C (set): ditto
9232 * src/insets/insetbib.C (create_form_citation_form): ditto
9234 * lib/CREDITS: added Dekel Tsur.
9236 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
9237 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
9238 hebrew supports files from Dekel Tsur.
9240 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
9241 <tzafrir@technion.ac.il>
9243 * src/lyxrc.C: put \date_insert_format at the right place.
9245 * src/buffer.C (makeLaTeXFile): fix the handling of
9246 BufferParams::sides when writing out latex files.
9248 * src/BufferView2.C: add a "using" directive.
9250 * src/support/lyxsum.C (sum): when we use lyxstring,
9251 ostringstream::str needs an additional .c_str().
9253 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9255 * src/support/filetools.C (ChangeExtension): patch from Etienne
9258 * src/TextCache.C (show): remove const_cast and make second
9259 parameter non-const LyXText *.
9261 * src/TextCache.h: use non const LyXText in show.
9263 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
9266 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9268 * src/support/lyxsum.C: rework to be more flexible.
9270 * several places: don't check if a pointer is 0 if you are going
9273 * src/text.C: remove some dead code.
9275 * src/insets/figinset.C: remove some dead code
9277 * src/buffer.C: move the BufferView funcs to BufferView2.C
9278 remove all support for insetlatexdel
9279 remove support for oldpapersize stuff
9280 made some member funcs const
9282 * src/kbmap.C: use a std::list to store the bindings in.
9284 * src/BufferView2.C: new file
9286 * src/kbsequence.[Ch]: new files
9288 * src/LyXAction.C + others: remove all trace of buffer-previous
9290 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
9291 only have one copy in the binary of this table.
9293 * hebrew patch: moved some functions from LyXText to more
9294 appropriate places. (LyXParagraph, BufferParams, LyXFont)
9296 * several files: remove support for XForms older than 0.88
9298 remove some #if 0 #endif code
9300 * src/TextCache.[Ch]: new file. Holds the textcache.
9302 * src/BufferView.C: changes to use the new TextCache interface.
9303 (waitForX): remove the now unused code.
9305 * src/BackStack.h: remove some commented code
9307 * lib/bind/emacs.bind: remove binding for buffer-previous
9309 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9311 * applied the hebrew patch.
9313 * src/lyxrow.h: make sure that all Row variables are initialized.
9315 * src/text2.C (TextHandleUndo): comment out a delete, this might
9316 introduce a memory leak, but should also help us to not try to
9317 read freed memory. We need to look at this one.
9319 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
9320 (LyXParagraph): initalize footnotekind.
9322 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
9323 forgot this when applying the patch. Please heed the warnings.
9325 * src/BufferView.C (buffer): a fix for the buffer-reload problem
9326 (aka. reformat problem)
9328 * src/bufferlist.C (exists): made const, and use const_iterator
9329 (isLoaded): new func.
9330 (release): use std::find to find the correct buffer.
9332 * src/bufferlist.h: made getState a const func.
9333 made empty a const func.
9334 made exists a const func.
9337 2000-02-01 Juergen Vigna <jug@sad.it>
9339 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
9341 * po/it.po: updated a bit the italian po file and also changed the
9342 'file nuovo' for newfile to 'filenuovo' without a space, this did
9345 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
9346 for the new insert_date command.
9348 * src/lyxfunc.C (Dispatch): added support for a insert_date function
9349 from jdblair, to insert a date into the current text conforming to
9350 a strftime format (for now only considering the locale-set and not
9351 the document-language).
9353 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9355 * src/lyxfont.C (textWidth): hopefully better fix for the Array
9356 Bounds Read error seen by purify. The problem was that islower is
9357 a macros which takes an unsigned char and uses it as an index for
9358 in array of characters properties (and is thus subject to the
9362 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
9363 correctly the paper sides radio buttons.
9364 (UpdateDocumentButtons): ditto.
9366 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9368 * src/kbmap.C (getsym + others): change to return unsigned int,
9369 returning a long can give problems on 64 bit systems. (I assume
9370 that int is 32bit on 64bit systems)
9372 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9374 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
9375 LyXLookupString to be zero-terminated. Really fixes problems seen
9378 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9380 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
9381 write a (char*)0 to the lyxerr stream.
9383 * src/lastfiles.C: move algorithm before the using statemets.
9385 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9387 * src/lastfiles.C: move using directives in global scope (egcs 1.x
9388 complains otherwise).
9389 * src/table.C: ditto
9391 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
9394 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
9395 that I removed earlier... It is really needed.
9397 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
9399 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9401 * INSTALL: update xforms home page URL.
9403 * lib/configure.m4: fix a bug with unreadable layout files.
9405 * src/table.C (calculate_width_of_column): add "using std::max"
9408 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
9410 * several files: marked several lines with "DEL LINE", this is
9411 lines that can be deleted without changing anything.
9412 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
9413 checks this anyway */
9416 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
9418 * src/DepTable.C (update): add a "+" at the end when the checksum
9419 is different. (debugging string only)
9421 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
9422 the next inset to not be displayed. This should also fix the list
9423 of labels in the "Insert Crossreference" dialog.
9425 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9427 * src/support/LSubstring.C (LSubstring): set pos to string::npos
9428 when regex was not found.
9430 * src/support/lstrings.C (lowercase): use handcoded transform always.
9433 * src/text.C (Delete): fixed the crash. cursor.par->prev and
9434 old_cursor.par->prev could be 0.
9436 * several files: changed post inc/dec to pre inc/dec
9438 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
9439 write the lastfiles to file.
9441 * src/BufferView.C (buffer): only show TextCache info when debugging
9443 (resizeCurrentBuffer): ditto
9444 (workAreaExpose): ditto
9446 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
9448 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
9450 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
9451 a bit better by removing the special case for \i and \j.
9453 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9455 * src/lyx_main.C (easyParse): remove test for bad comand line
9456 options, since this broke all xforms-related parsing.
9458 * src/kbmap.C (getsym): set return type to unsigned long, as
9459 declared in header. On an alpha, long is _not_ the same as int.
9461 * src/support/LOstream.h: add a "using std::flush;"
9463 * src/insets/figinset.C: ditto.
9465 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
9467 * src/bufferlist.C (write): use blinding fast file copy instead of
9468 "a char at a time", now we are doing it the C++ way.
9470 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
9471 std::list<int> instead.
9472 (addpidwait): reflect move to std::list<int>
9473 (sigchldchecker): ditto
9475 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
9478 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
9479 that obviously was wrong...
9481 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
9482 c, this avoids warnings with purify and islower.
9484 * src/insets/figinset.C: rename struct queue to struct
9485 queue_element and rewrite to use a std::queue. gsqueue is now a
9486 std::queue<queue_element>
9487 (runqueue): reflect move to std::queue
9490 * src/support/lstrings.h (tostr): specialize for bool, otherwise
9491 we would get "1" "0" instead of "true" "false. Also make the tostr
9494 2000-01-21 Juergen Vigna <jug@sad.it>
9496 * src/buffer.C (writeFileAscii): Disabled code for special groff
9497 handling of tabulars till I fix this in table.C
9499 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9501 * src/support/mkdir.C (mkdir): change second argument of mkdir to
9503 * src/support/lyxlib.h: ditto.
9505 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
9507 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
9508 and 'j' look better. This might fix the "macron" bug that has been
9511 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
9512 functions as one template function. Delete the old versions.
9514 * src/support/lyxsum.C: move using std::ifstream inside
9517 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
9520 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
9522 * src/mathed/formula.C: delete #include "bufferlist.h" never used
9524 * src/insets/figinset.C (InitFigures): use new instead of malloc
9525 to allocate memory for figures and bitmaps.
9526 (DoneFigures): use delete[] instead of free to deallocate memory
9527 for figures and bitmaps.
9528 (runqueue): use new to allocate
9529 (getfigdata): use new/delete[] instead of malloc/free
9530 (RegisterFigure): ditto
9532 * some files: moved some declarations closer to first use, small
9533 whitespace changes use preincrement instead of postincrement where
9534 it does not make a difference.
9536 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
9537 step on the way to use stl::containers for key maps.
9539 * src/bufferlist.h: add a typedef for const_iterator and const
9540 versions of begin and end.
9542 * src/bufferlist.[Ch]: change name of member variable _state to
9543 state_. (avoid reserved names)
9545 (getFileNames): returns the filenames of the buffers in a vector.
9547 * configure.in (ALL_LINGUAS): added ro
9549 * src/support/putenv.C: new file
9551 * src/support/mkdir.C: new file
9553 2000-01-20 Allan Rae <rae@lyx.org>
9555 * lib/layouts/IEEEtran.layout: Added several theorem environments
9557 * lib/templates/IEEEtran.lyx: Example theorem environments and a
9558 couple of minor additions.
9560 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
9561 (except for those in footnotes of course)
9563 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9565 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
9567 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
9568 std::sort and std::lower_bound instead of qsort and handwritten
9570 (struct compara): struct that holds the functors used by std::sort
9571 and std::lower_bound in MathedLookupBOP.
9573 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9575 * src/support/LAssert.h: do not do partial specialization. We do
9578 * src/support/lyxlib.h: note that lyx::getUserName() and
9579 lyx::date() are not in use right now. Should these be suppressed?
9581 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
9582 (makeLinuxDocFile): do not put date and user name in linuxdoc
9585 * src/support/lyxlib.h (kill): change first argument to long int,
9586 since that's what solaris uses.
9588 * src/support/kill.C (kill): fix declaration to match prototype.
9590 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
9591 actually check whether namespaces are supported. This is not what
9594 * src/support/lyxsum.C: add a using directive.
9596 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9598 * src/support/kill.C: if we have namespace support we don't have
9599 to include lyxlib.h.
9601 * src/support/lyxlib.h: use namespace lyx if supported.
9603 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9605 * src/support/date.C: new file
9607 * src/support/chdir.C: new file
9609 * src/support/getUserName.C: new file
9611 * src/support/getcwd.C: new file
9613 * src/support/abort.C: new file
9615 * src/support/kill.C: new file
9617 * src/support/lyxlib.h: moved all the functions in this file
9618 insede struct lyx. Added also kill and abort to this struct. This
9619 is a way to avoid the "kill is not defined in <csignal>", we make
9620 C++ wrappers for functions that are not ANSI C or ANSI C++.
9622 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
9623 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
9624 lyx it has been renamed to sum.
9626 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9628 * src/text.C: add using directives for std::min and std::max.
9630 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9632 * src/texrow.C (getIdFromRow): actually return something useful in
9633 id and pos. Hopefully fixes the bug with positionning of errorbox
9636 * src/lyx_main.C (easyParse): output an error and exit if an
9637 incorrect command line option has been given.
9639 * src/spellchecker.C (ispell_check_word): document a memory leak.
9641 * src/bufferlist.C (write): fix mismatched allocation/deletion,
9642 where a "struct utimbuf" is allocated with "new" and deleted with
9645 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9647 * src/text2.C (CutSelection): don't delete double spaces.
9648 (PasteSelection): ditto
9649 (CopySelection): ditto
9651 * src/text.C (Backspace): don't delete double spaces.
9653 * src/lyxlex.C (next): fix a bug that were only present with
9654 conformant std::istream::get to read comment lines, use
9655 std::istream::getline instead. This seems to fix the problem.
9657 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9659 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
9660 allowed to insert space before space" editing problem. Please read
9661 commends at the beginning of the function. Comments about usage
9664 * src/text.C (InsertChar): fix for the "not allowed to insert
9665 space before space" editing problem.
9667 * src/text2.C (DeleteEmptyParagraphMechanism): when
9668 IsEmptyTableRow can only return false this last "else if" will
9669 always be a no-op. Commented out.
9671 * src/text.C (RedoParagraph): As far as I can understand tmp
9672 cursor is not really needed.
9674 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
9675 present it could only return false anyway.
9676 (several functions): Did something not so smart...added a const
9677 specifier on a lot of methods.
9679 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
9680 and add a tmp->text.resize. The LyXParagraph constructor does the
9682 (BreakParagraphConservative): ditto
9684 * src/support/path.h (Path): add a define so that the wrong usage
9685 "Path("/tmp") will be flagged as a compilation error:
9686 "`unnamed_Path' undeclared (first use this function)"
9688 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9690 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
9691 which was bogus for several reasons.
9693 * src/LaTeX.C (scanAux): fix the regular expression used to scan
9697 * autogen.sh: do not use "type -path" (what's that anyway?).
9699 * src/support/filetools.C (findtexfile): remove extraneous space
9700 which caused a kpsewhich warning (at least with kpathsea version
9703 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9705 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
9707 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
9709 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
9711 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9713 * src/paragraph.C (BreakParagraph): do not reserve space on text
9714 if we don't need to (otherwise, if pos_end < pos, we end up
9715 reserving huge amounts of memory due to bad unsigned karma).
9716 (BreakParagraphConservative): ditto, although I have not seen
9717 evidence the bug can happen here.
9719 * src/lyxparagraph.h: add a using std::list.
9721 2000-01-11 Juergen Vigna <jug@sad.it>
9723 * src/menus.C (MenuDocu): output an Alert if the documentation-file
9726 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
9728 * src/vc-backend.C (doVCCommand): change to be static and take one
9729 more parameter: the path to chdir too be fore executing the command.
9730 (retrive): new function equiv to "co -r"
9732 * src/bufferlist.C (loadLyXFile): implement the missing parts if
9733 file_not_found_hook is true.
9735 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
9737 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
9738 if a file is readwrite,readonly...anything else.
9740 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9742 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
9743 (CreatePostscript): name change from MenuRunDVIPS (or something)
9744 (PreviewPostscript): name change from MenuPreviewPS
9745 (PreviewDVI): name change from MenuPreviewDVI
9747 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
9748 \view_pdf_command., \pdf_to_ps_command
9750 * lib/configure.m4: added search for PDF viewer, and search for
9751 PDF to PS converter.
9752 (lyxrc.defaults output): add \pdflatex_command,
9753 \view_pdf_command and \pdf_to_ps_command.
9755 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
9757 * src/bufferlist.C (write): we don't use blocksize for anything so
9760 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9762 * src/support/block.h: disable operator T* (), since it causes
9763 problems with both compilers I tried. See comments in the file.
9765 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
9768 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
9769 variable LYX_DIR_10x to LYX_DIR_11x.
9771 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
9773 * INSTALL: document --with-lyxname.
9776 * configure.in: new configure flag --with-lyxname which allows to
9777 choose the name under which lyx is installed. Default is "lyx", of
9778 course. It used to be possible to do this with --program-suffix,
9779 but the later has in fact a different meaning for autoconf.
9781 * src/support/lstrings.h (lstrchr): reformat a bit.
9783 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
9784 * src/mathed/math_defs.h: ditto.
9786 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9788 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
9789 true, decides if we create a backup file or not when saving. New
9790 tag and variable \pdf_mode, defaults to false. New tag and
9791 variable \pdflatex_command, defaults to pdflatex. New tag and
9792 variable \view_pdf_command, defaults to xpdf. New tag and variable
9793 \pdf_to_ps_command, defaults to pdf2ps.
9795 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
9797 * src/bufferlist.C (close): don't call insetUnlock if the buffer
9798 does not have a BufferView.
9799 (unlockInset): ditto + don't access the_locking_inset if the
9800 buffer does not have a BufferView.
9802 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
9803 certain circumstances so that we don't continue a keyboard
9804 operation long after the key was released. Try f.ex. to load a
9805 large document, press PageDown for some seconds and then release
9806 it. Before this change the document would contine to scroll for
9807 some time, with this change it stops imidiatly.
9809 * src/support/block.h: don't allocate more space than needed. As
9810 long as we don't try to write to the arr[x] in a array_type arr[x]
9811 it is perfectly ok. (if you write to it you might segfault).
9812 added operator value_type*() so that is possible to pass the array
9813 to functions expecting a C-pointer.
9815 * lib/Makefile.am (dist-hook): don't fail completely if unable to
9818 * intl/*: updated to gettext 0.10.35, tried to add our own
9819 required modifications. Please verify.
9821 * po/*: updated to gettext 0.10.35, tried to add our own required
9822 modifications. Please verify.
9824 * src/support/lstrings.C (tostr): go at fixing the problem with
9825 cxx and stringstream. When stringstream is used return
9826 oss.str().c_str() so that problems with lyxstring and basic_string
9827 are avoided. Note that the best solution would be for cxx to use
9828 basic_string all the way, but it is not conformant yet. (it seems)
9830 * src/lyx_cb.C + other files: moved several global functions to
9831 class BufferView, some have been moved to BufferView.[Ch] others
9832 are still located in lyx_cb.C. Code changes because of this. (part
9833 of "get rid of current_view project".)
9835 * src/buffer.C + other files: moved several Buffer functions to
9836 class BufferView, the functions are still present in buffer.C.
9837 Code changes because of this.
9839 * config/lcmessage.m4: updated to most recent. used when creating
9842 * config/progtest.m4: updated to most recent. used when creating
9845 * config/gettext.m4: updated to most recent. applied patch for
9848 * config/gettext.m4.patch: new file that shows what changes we
9849 have done to the local copy of gettext.m4.
9851 * config/libtool.m4: new file, used in creation of acinclude.m4
9853 * config/lyxinclude.m4: new file, this is the lyx created m4
9854 macros, used in making acinclude.m4.
9856 * autogen.sh: GNU m4 discovered as a separate task not as part of
9857 the lib/configure creation.
9858 Generate acinlucde from files in config. Actually cat
9859 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
9860 easier to upgrade .m4 files that really are external.
9862 * src/Spacing.h: moved using std::istringstream to right after
9863 <sstream>. This should fix the problem seen with some compilers.
9865 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9867 * src/lyx_cb.C: began some work to remove the dependency a lot of
9868 functions have on BufferView::text, even if not really needed.
9869 (GetCurrentTextClass): removed this func, it only hid the
9872 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
9873 forgot this in last commit.
9875 * src/Bullet.C (bulletEntry): use static char const *[] for the
9876 tables, becuase of this the return arg had to change to string.
9878 (~Bullet): removed unneeded destructor
9880 * src/BufferView.C (beforeChange): moved from lyx_cb.C
9881 (insetSleep): moved from Buffer
9882 (insetWakeup): moved from Buffer
9883 (insetUnlock): moved from Buffer
9885 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
9886 from Buffer to BufferView.
9888 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
9890 * config/ltmain.sh: updated to version 1.3.4 of libtool
9892 * config/ltconfig: updated to version 1.3.4 of libtool
9894 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9897 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
9898 Did I get that right?
9900 * src/lyxlex.h: add a "using" directive or two.
9901 * src/Spacing.h: ditto.
9902 * src/insets/figinset.C: ditto.
9903 * src/support/filetools.C: ditto.
9904 * src/support/lstrings.C: ditto.
9905 * src/BufferView.C: ditto.
9906 * src/bufferlist.C: ditto.
9907 * src/lyx_cb.C: ditto.
9908 * src/lyxlex.C: ditto.
9910 * NEWS: add some changes for 1.1.4.
9912 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9914 * src/BufferView.C: first go at a TextCache to speed up switching
9917 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9919 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
9920 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
9921 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
9922 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
9925 * src/mathed/math_defs.h (MathedRowSt): make sure that all
9926 members of the struct are correctly initialized to 0 (detected by
9928 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
9929 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
9931 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
9932 pidwait, since it was allocated with "new". This was potentially
9933 very bad. Thanks to Michael Schmitt for running purify for us.
9936 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9938 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
9940 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
9942 1999-12-30 Allan Rae <rae@lyx.org>
9944 * lib/templates/IEEEtran.lyx: minor change
9946 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
9947 src/mathed/formula.C (LocalDispatch): askForText changes
9949 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
9950 know when a user has cancelled input. Fixes annoying problems with
9951 inserting labels and version control.
9953 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9955 * src/support/lstrings.C (tostr): rewritten to use strstream and
9958 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9960 * src/support/filetools.C (IsFileWriteable): use fstream to check
9961 (IsDirWriteable): use fileinfo to check
9963 * src/support/filetools.h (FilePtr): whole class deleted
9965 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
9967 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
9969 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
9971 * src/bufferlist.C (write): use ifstream and ofstream instead of
9974 * src/Spacing.h: use istrstream instead of sscanf
9976 * src/mathed/math_defs.h: change first arg to istream from FILE*
9978 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
9980 * src/mathed/math_parser.C: have yyis to be an istream
9981 (LexGetArg): use istream (yyis)
9983 (mathed_parse): ditto
9984 (mathed_parser_file): first arg istream instead of FILE*, set yyis
9986 * src/mathed/formula.C (Read): rewritten to use istream
9988 * src/mathed/formulamacro.C (Read): rewritten to use istream
9990 * src/lyxlex.h (~LyXLex): deleted desturctor
9991 (getStream): new function, returns an istream
9992 (getFile): deleted funtion
9993 (IsOK): return is.good();
9995 * src/lyxlex.C (LyXLex): delete file and owns_file
9996 (setFile): open an filebuf and assign that to a istream instead of
9998 (setStream): new function, takes an istream as arg.
9999 (setFile): deleted function
10000 (EatLine): rewritten us use istream instead of FILE*
10004 * src/table.C (LyXTable): use istream instead of FILE*
10005 (Read): rewritten to take an istream instead of FILE*
10007 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10009 * src/buffer.C (Dispatch): remove an extraneous break statement.
10011 * src/support/filetools.C (QuoteName): change to do simple
10012 'quoting'. More work is necessary. Also changed to do nothing
10013 under emx (needs fix too).
10014 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
10016 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
10017 config.h.in to the AC_DEFINE_UNQUOTED() call.
10018 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
10019 needs char * as argument (because Solaris 7 declares it like
10022 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
10023 remove definition of BZERO.
10025 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10027 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
10028 defined, "lyxregex.h" if not.
10030 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
10032 (REGEX): new variable that is set to regex.c lyxregex.h when
10033 AM_CONDITIONAL USE_REGEX is set.
10034 (libsupport_la_SOURCES): add $(REGEX)
10036 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
10039 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
10042 * configure.in: add call to LYX_REGEX
10044 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
10045 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
10047 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10049 * lib/bind/fi_menus.bind: new file, from
10050 pauli.virtanen@saunalahti.fi.
10052 * src/buffer.C (getBibkeyList): pass the parameter delim to
10053 InsetInclude::getKeys and InsetBibtex::getKeys.
10055 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
10056 is passed to Buffer::getBibkeyList
10058 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
10059 instead of the hardcoded comma.
10061 * src/insets/insetbib.C (getKeys): make sure that there are not
10062 leading blanks in bibtex keys. Normal latex does not care, but
10063 harvard.sty seems to dislike blanks at the beginning of citation
10064 keys. In particular, the retturn value of the function is
10066 * INSTALL: make it clear that libstdc++ is needed and that gcc
10067 2.7.x probably does not work.
10069 * src/support/filetools.C (findtexfile): make debug message go to
10071 * src/insets/insetbib.C (getKeys): ditto
10073 * src/debug.C (showTags): make sure that the output is correctly
10076 * configure.in: add a comment for TWO_COLOR_ICON define.
10078 * acconfig.h: remove all the entries that already defined in
10079 configure.in or acinclude.m4.
10081 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
10082 to avoid user name, date and copyright.
10084 1999-12-21 Juergen Vigna <jug@sad.it>
10086 * src/table.C (Read): Now read bogus row format informations
10087 if the format is < 5 so that afterwards the table can
10088 be read by lyx but without any format-info. Fixed the
10089 crash we experienced when not doing this.
10091 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
10093 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
10094 (RedoDrawingOfParagraph): ditto
10095 (RedoParagraphs): ditto
10096 (RemoveTableRow): ditto
10098 * src/text.C (Fill): rename arg paperwidth -> paper_width
10100 * src/buffer.C (insertLyXFile): rename var filename -> fname
10101 (writeFile): rename arg filename -> fname
10102 (writeFileAscii): ditto
10103 (makeLaTeXFile): ditto
10104 (makeLinuxDocFile): ditto
10105 (makeDocBookFile): ditto
10107 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
10110 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
10112 * src/bmtable.h: add extern "C" on this file when __cplusplus is
10115 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
10116 compiled by a C compiler not C++.
10118 * src/layout.h (LyXTextClass): added typedef for const_iterator
10119 (LyXTextClassList): added typedef for const_iterator + member
10120 functions begin and end.
10122 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
10123 iterators to fill the choice_class.
10124 (updateLayoutChoice): rewritten to use iterators to fill the
10125 layoutlist in the toolbar.
10127 * src/BufferView.h (BufferView::work_area_width): removed unused
10130 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
10132 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
10133 (sgmlCloseTag): ditto
10135 * src/support/lstrings.h: return type of countChar changed to
10138 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
10139 what version of this func to use. Also made to return unsigned int.
10141 * configure.in: call LYX_STD_COUNT
10143 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
10144 conforming std::count.
10146 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10148 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
10149 and a subscript would give bad display (patch from Dekel Tsur
10150 <dekel@math.tau.ac.il>).
10152 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
10154 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
10157 * src/chset.h: add a few 'using' directives
10159 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
10160 triggered when no buffer is active
10162 * src/layout.C: removed `break' after `return' in switch(), since
10165 * src/lyx_main.C (init): make sure LyX can be ran in place even
10166 when libtool has done its magic with shared libraries. Fix the
10167 test for the case when the system directory has not been found.
10169 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
10170 name for the latex file.
10171 (MenuMakeHTML): ditto
10173 * src/buffer.h: add an optional boolean argument, which is passed
10174 to ChangeExtension.
10176 1999-12-20 Allan Rae <rae@lyx.org>
10178 * lib/templates/IEEEtran.lyx: small correction and update.
10180 * configure.in: Attempted to use LYX_PATH_HEADER
10182 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
10184 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
10185 input from JMarc. Now use preprocessor to find the header.
10186 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
10187 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
10188 LYX_STL_STRING_FWD. See comments in file.
10190 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
10192 * The global MiniBuffer * minibuffer variable is dead.
10194 * The global FD_form_main * fd_form_main variable is dead.
10196 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10198 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
10200 * src/table.h: add the LOstream.h header
10201 * src/debug.h: ditto
10203 * src/LyXAction.h: change the explaination of the ReadOnly
10204 attribute: is indicates that the function _can_ be used.
10206 * src/LyXAction.C (init): find-replace _can_ be used in read-only
10209 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10211 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
10217 * src/paragraph.C (GetWord): assert on pos>=0
10220 * src/support/lyxstring.C: condition the use of an invariant on
10222 * src/support/lyxstring.h: ditto
10224 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
10225 Use LAssert.h instead of plain assert().
10227 * src/support/lstrings.h: add LAssert.h, in case it is needed.
10229 * src/lyxfunc.C: do not include LAssert.h, it is not used.
10230 * src/support/filetools.C: ditto
10232 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
10235 * INSTALL: document the new configure flags
10237 * configure.in: suppress --with-debug; add --enable-assertions
10239 * acinclude.m4: various changes in alignment of help strings.
10241 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10243 * src/kbmap.C: commented out the use of the hash map in kb_map,
10244 beginning of movement to a stl::container.
10246 * several files: removed code that was not in effect when
10247 MOVE_TEXT was defined.
10249 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
10250 for escaping should not be used. We can discuss if the string
10251 should be enclosed in f.ex. [] instead of "".
10253 * src/trans_mgr.C (insert): use the new returned value from
10254 encodeString to get deadkeys and keymaps done correctly.
10256 * src/chset.C (encodeString): changed to return a pair, to tell
10257 what to use if we know the string.
10259 * src/lyxscreen.h (fillArc): new function.
10261 * src/FontInfo.C (resize): rewritten to use more std::string like
10262 structore, especially string::replace.
10264 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
10267 * configure.in (chmod +x some scripts): remove config/gcc-hack
10269 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10271 * src/buffer.C (writeFile): change once again the top comment in a
10272 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
10273 instead of an hardcoded version number.
10274 (makeDocBookFile): ditto
10276 * src/version.h: add new define LYX_DOCVERSION
10278 * po/de.po: update from Pit Sütterlin
10279 * lib/bind/de_menus.bind: ditto.
10281 * src/lyxfunc.C (Dispatch): call MenuExport()
10282 * src/buffer.C (Dispatch): ditto
10284 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
10285 LyXFunc::Dispatch().
10286 (MenuExport): new function, moved from
10287 LyXFunc::Dispatch().
10289 * src/trans_mgr.C (insert): small cleanup
10290 * src/chset.C (loadFile): ditto
10292 * lib/kbd/iso8859-1.cdef: add missing backslashes
10294 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10296 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
10297 help with placing the manually drawn accents better.
10299 (Draw): x2 and hg changed to float to minimize rounding errors and
10300 help place the accents better.
10302 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
10303 unsigned short to char is just wrong...cast the char to unsigned
10304 char instead so that the two values can compare sanely. This
10305 should also make the display of insetlatexaccents better and
10306 perhaps also some other insets.
10308 (lbearing): new function
10311 1999-12-15 Allan Rae <rae@lyx.org>
10313 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
10314 header that provides a wrapper around the very annoying SGI STL header
10317 * src/support/lyxstring.C, src/LString.h:
10318 removed old SGI-STL-compatability attempts.
10320 * configure.in: Use LYX_STL_STRING_FWD.
10322 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
10323 stl_string_fwd.h is around and try to determine it's location.
10324 Major improvement over previous SGI STL 3.2 compatability.
10325 Three small problems remain with this function due to my zero
10326 knowledge of autoconf. JMarc and lgb see the comments in the code.
10328 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10330 * src/broken_const.h, config/hack-gcc, config/README: removed
10332 * configure.in: remove --with-gcc-hack option; do not call
10335 * INSTALL: remove documentation of --with-broken-const and
10338 * acconfig.h: remove all trace of BROKEN_CONST define
10340 * src/buffer.C (makeDocBookFile): update version number in output
10342 (SimpleDocBookOnePar): fix an assert when trying to a character
10343 access beyond string length
10346 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10348 * po/de.po: fix the Export menu
10350 * lyx.man: update the description of -dbg
10352 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
10353 (commandLineHelp): updated
10354 (easyParse): show list of available debug levels if -dbg is passed
10357 * src/Makefile.am: add debug.C
10359 * src/debug.h: moved some code to debug.C
10361 * src/debug.C: new file. Contains code to set and show debug
10364 * src/layout.C: remove 'break' after 'continue' in switch
10365 statements, since these cannot be reached.
10367 1999-12-13 Allan Rae <rae@lyx.org>
10369 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
10370 (in_word_set): hash() -> math_hash()
10372 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
10374 * acconfig.h: Added a test for whether we are using exceptions in the
10375 current compilation run. If so USING_EXCEPTIONS is defined.
10377 * config.in: Check for existance of stl_string_fwd.h
10378 * src/LString.h: If compiling --with-included-string and SGI's
10379 STL version 3.2 is present (see above test) we need to block their
10380 forward declaration of string and supply a __get_c_string().
10381 However, it turns out this is only necessary if compiling with
10382 exceptions enabled so I've a bit more to add yet.
10384 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
10385 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
10386 src/support/LRegex.h, src/undo.h:
10387 Shuffle the order of the included files a little to ensure that
10388 LString.h gets included before anything that includes stl_string_fwd.h
10390 * src/support/lyxstring.C: We need to #include LString.h instead of
10391 lyxstring.h to get the necessary definition of __get_c_string.
10392 (__get_c_string): New function. This is defined static just like SGI's
10393 although why they need to do this I'm not sure. Perhaps it should be
10394 in lstrings.C instead.
10396 * lib/templates/IEEEtran.lyx: New template file.
10398 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10400 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
10401 * intl/Makefile.in (MKINSTALLDIRS): ditto
10403 * src/LyXAction.C (init): changed to hold the LFUN data in a
10404 automatic array in stead of in callso to newFunc, this speeds up
10405 compilation a lot. Also all the memory used by the array is
10406 returned when the init is completed.
10408 * a lot of files: compiled with -Wold-style-cast, changed most of
10409 the reported offenders to C++ style casts. Did not change the
10410 offenders in C files.
10412 * src/trans.h (Match): change argument type to unsigned int.
10414 * src/support/DebugStream.C: fix some types on the streambufs so
10415 that it works on a conforming implementation.
10417 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10419 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
10421 * src/support/lyxstring.C: remove the inline added earlier since
10422 they cause a bunch of unsatisfied symbols when linking with dec
10423 cxx. Cxx likes to have the body of inlines at the place where they
10426 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
10427 accessing negative bounds in array. This fixes the crash when
10428 inserting accented characters.
10429 * src/trans.h (Match): ditto
10431 * src/buffer.C (Dispatch): since this is a void, it should not try
10432 to return anything...
10434 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10436 * src/buffer.h: removed the two friends from Buffer. Some changes
10437 because of this. Buffer::getFileName and Buffer::setFileName
10438 renamed to Buffer::fileName() and Buffer::fileName(...).
10440 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
10442 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
10443 and Buffer::update(short) to BufferView. This move is currently
10444 controlled by a define MOVE_TEXT, this will be removed when all
10445 shows to be ok. This move paves the way for better separation
10446 between buffer contents and buffer view. One side effect is that
10447 the BufferView needs a rebreak when swiching buffers, if we want
10448 to avoid this we can add a cache that holds pointers to LyXText's
10449 that is not currently in use.
10451 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
10454 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10456 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
10458 * lyx_main.C: new command line option -x (or --execute) and
10459 -e (or --export). Now direct conversion from .lyx to .tex
10460 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
10461 Unfortunately, X is still needed and the GUI pops up during the
10464 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10466 * src/Spacing.C: add a using directive to bring stream stuff into
10468 * src/paragraph.C: ditto
10469 * src/buffer.C: ditto
10471 * NEWS: updated a bit the new features of 1.1.3 (took a few things
10472 from Lars' announcement).
10474 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
10475 example files from Tino Meinen.
10477 1999-12-06 Allan Rae <rae@lyx.org>
10479 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
10481 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10483 * src/support/lyxstring.C: added a lot of inline for no good
10486 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
10487 latexWriteEndChanges, they were not used.
10489 * src/layout.h (operator<<): output operator for PageSides
10491 * src/mathed/math_iter.C (my_memcpy): slightly changed.
10493 * some example files: loaded in LyX 1.0.4 and saved again to update
10494 certain constructs (table format)
10496 * a lot of files: did the change to use fstream/iostream for all
10497 writing of files. Done with a close look at Andre Poenitz's patch.
10499 * some files: whitespace changes.
10501 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10503 * src/mathed/math_iter.C (my_memcpy): new function. Since the
10504 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
10505 architecture, we provide our own. It is used unconditionnally, but
10506 I do not think this is a performance problem. Thanks to Angus
10507 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
10508 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
10510 (GetInset): use my_memcpy.
10514 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
10515 it is easier to understand, but it uses less TeX-only constructs now.
10517 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
10518 elements contain spaces
10520 * lib/configure: regenerated
10522 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
10523 elements contain spaces; display the list of programs that are
10526 * autogen.sh: make sure lib/configure is executable
10528 * lib/examples/*: rename the tutorial examples to begin with the
10529 two-letters language code.
10531 * src/lyxfunc.C (getStatus): do not query current font if no
10534 * src/lyx_cb.C (RunScript): use QuoteName
10535 (MenuRunDvips): ditto
10536 (PrintApplyCB): ditto
10538 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
10539 around argument, so that it works well with the current shell.
10540 Does not work properly with OS/2 shells currently.
10542 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
10543 * src/LyXSendto.C (SendtoApplyCB): ditto
10544 * src/lyxfunc.C (Dispatch): ditto
10545 * src/buffer.C (runLaTeX): ditto
10546 (runLiterate): ditto
10547 (buildProgram): ditto
10549 * src/lyx_cb.C (RunScript): ditto
10550 (MenuMakeLaTeX): ditto
10552 * src/buffer.h (getLatexName): new method
10554 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
10556 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10558 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
10559 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
10560 (create_math_panel): ditto
10562 * src/lyxfunc.C (getStatus): re-activate the code which gets
10563 current font and cursor; add test for export to html.
10565 * src/lyxrc.C (read): remove unreachable break statements; add a
10568 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
10570 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10572 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
10573 introduced by faulty regex.
10574 * src/buffer.C: ditto
10575 * src/lastfiles.C: ditto
10576 * src/paragraph.C: ditto
10577 * src/table.C: ditto
10578 * src/vspace.C: ditto
10579 * src/insets/figinset.C: ditto
10580 Note: most of these is absolutely harmless, except the one in
10581 src/mathed formula.C.
10583 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
10585 * src/ImportNoweb.C (documentclass): fixed bounds for substr
10586 operation, yielding correct results for the reLyX command.
10588 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10590 * src/support/filetools.C (ExpandPath): removed an over eager
10592 (ReplaceEnvironmentPath): ditto
10594 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
10595 shows that we are doing something fishy in our code...
10596 (BubblePost): ditto
10599 * src/lyxrc.C (read): use a double switch trick to get more help
10600 from the compiler. (the same trick is used in layout.C)
10601 (write): new function. opens a ofstream and pass that to output
10602 (output): new function, takes a ostream and writes the lyxrc
10603 elemts to it. uses a dummy switch to make sure no elements are
10606 * src/lyxlex.h: added a struct pushpophelper for use in functions
10607 with more than one exit point.
10609 * src/lyxlex.[Ch] (GetInteger): made it const
10613 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
10615 * src/layout.[hC] : LayoutTags splitted into several enums, new
10616 methods created, better error handling cleaner use of lyxlex. Read
10619 * src/bmtable.[Ch]: change some member prototypes because of the
10620 image const changes.
10622 * commandtags.h, src/LyXAction.C (init): new function:
10623 "preferences-save", saves the lyxrc entries into .lyx/preferences.
10624 This file is not read automatically but you can add \input
10625 preferences to your lyxrc if you want to. We need to discuss how
10628 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
10629 in .aux, also remove .bib and .bst files from dependencies when
10632 * src/BufferView.C, src/LyXView.C: add const_cast several places
10633 because of changes to images.
10635 * lib/images/*: same change as for images/*
10637 * lib/lyxrc.example: Default for accept_compound is false not no.
10639 * images/*: changed to be const, however I have som misgivings
10640 about this change so it might be changed back.
10642 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10644 * lib/configure, po/POTFILES.in: regenerated
10646 * autogen.sh: autogenerate lib/configure from lib/configure.m4
10648 * config/lib_configure.m4: removed
10650 * lib/configure.m4: new file (was config/lib_configure.m4)
10652 * configure.in: do not test for rtti, since we do not use it.
10654 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10656 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
10657 doubling of allocated space scheme. This makes it faster for large
10658 strings end to use less memory for small strings. xtra rememoved.
10660 * src/insets/figinset.C (waitalarm): commented out.
10661 (GhostscriptMsg): use static_cast
10662 (GhostscriptMsg): use new instead of malloc to allocate memory for
10663 cmap. also delete the memory after use.
10665 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
10667 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
10668 for changes in bibtex database or style.
10669 (runBibTeX): remove all .bib and .bst files from dep before we
10671 (run): use scanAuc in when dep file already exist.
10673 * src/DepTable.C (remove_files_with_extension): new method
10674 (exist): new method
10676 * src/DepTable.[Ch]: made many of the methods const.
10678 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10680 * src/bufferparams.C: make sure that the default textclass is
10681 "article". It used to be the first one by description order, but
10682 now the first one is "docbook".
10684 * src/lyx_main.C (setDebuggingLevel): change type of argument to
10685 string; call Debug::value.
10686 (easyParse): pass complete argument to setDebuggingLevel().
10688 * src/debug.h (value): fix the code that parses debug levels.
10690 * src/debug.h: add new debug type ACTION, reserved for LyXAction
10693 * src/LyXAction.C: use Debug::ACTION as debug channel.
10695 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
10697 * NEWS: updated for the future 1.1.3 release.
10699 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
10700 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
10701 it should. This is of course a controversial change (since many
10702 people will find that their lyx workscreen is suddenly full of
10703 red), but done for the sake of correctness.
10705 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
10706 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
10708 * src/insets/inseterror.h, src/insets/inseturl.h,
10709 src/insets/insetinfo.h, src/insets/figinset.h,
10710 src/mathed/formulamacro.h, src/mathed/math_macro.h
10711 (EditMessage): add a missing const and add _() to make sure that
10712 translation happens
10714 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
10715 src/insets/insetbib.C, src/support/filetools.C: add `using'
10716 directives for cxx.
10718 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
10719 doing 'Insert index of last word' at the beginning of a paragraph.
10721 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10723 * several files: white-space changes.
10725 * src/mathed/formula.C: removed IsAlpha and IsDigit
10727 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
10728 .bib file. use a ifstream instead of FilePtr when parsing the .bib
10731 * src/insets/figinset.C (GetPSSizes): don't break when
10732 "EndComments" is seen. But break when a boundingbox is read.
10734 * all classes inherited from Inset: return value of Clone
10735 changed back to Inset *.
10737 * all classes inherited form MathInset: return value of Clone
10738 changed back to MathedInset *.
10740 * src/insets/figinset.C (runqueue): use a ofstream to output the
10741 gs/ps file. Might need some setpresicion or setw. However I can
10742 see no problem with the current code.
10743 (runqueue): use sleep instead of the alarm/signal code. I just
10744 can't see the difference.
10746 * src/paragraph.C (LyXParagraph): reserve space in the new
10747 paragraph and resize the inserted paragraph to just fit.
10749 * src/lyxfunc.h (operator|=): added operator for func_status.
10751 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
10752 check for readable file.
10754 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
10755 check for readable file.
10756 (MenuMakeLinuxDoc): ditto
10757 (MenuMakeDocBook): ditto
10758 (MenuMakeAscii): ditto
10759 (InsertAsciiFile): split the test for openable and readable
10761 * src/bmtable.C (draw_bitmaptable): use
10762 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
10764 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
10765 findtexfile from LaTeX to filetools.
10767 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
10768 instead of FilePtr. Needs to be verified by a literate user.
10770 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10772 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
10773 (EditMessage): likewise.
10775 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
10776 respectively as \textasciitilde and \textasciicircum.
10778 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10780 * src/support/lyxstring.h: made the methods that take iterators
10781 use const_iterator.
10783 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
10784 (regexMatch): made is use the real regex class.
10786 * src/support/Makefile.am: changed to use libtool
10788 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
10790 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
10792 (MathIsInset ++): changed several macros to be inline functions
10795 * src/mathed/Makefile.am: changed to use libtool
10797 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
10799 * src/insets/inset* : Clone changed to const and return type is
10800 the true insettype not just Inset*.
10802 * src/insets/Makefile.am: changed to use libtool
10804 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
10806 * src/undo.[Ch] : added empty() and changed some of the method
10809 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
10811 * src/lyxparagraph.h: use id() and id(...) instead of getID and
10812 setID use block<> for the bullets array, added const several places.
10814 * src/lyxfunc.C (getStatus): new function
10816 * src/lyxfunc.[Ch] : small changes to take advantage of the new
10817 LyXAction, added const to several funtions.
10819 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
10820 a std::map, and to store the dir items in a vector.
10822 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
10825 * src/LyXView.[Ch] + other files : changed currentView to view.
10827 * src/LyXAction.[Ch] : ported from the old devel branch.
10829 * src/.cvsignore: added .libs and a.out
10831 * configure.in : changes to use libtool.
10833 * acinclude.m4 : inserted libtool.m4
10835 * .cvsignore: added libtool
10837 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10839 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
10840 file name in insets and mathed directories (otherwise the
10841 dependency is not taken in account under cygwin).
10843 * src/text2.C (InsertString[AB]): make sure that we do not try to
10844 read characters past the string length.
10846 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10848 * lib/doc/LaTeXConfig.lyx.in,
10849 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
10851 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
10852 file saying who created them and when this heppened; this is
10853 useless and annoys tools like cvs.
10855 * lib/layouts/g-brief-{en,de}.layout,
10856 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
10857 from Thomas Hartkens <thomas@hartkens.de>.
10859 * src/{insets,mathed}/Makefile.am: do not declare an empty
10860 LDFLAGS, so that it can be set at configure time (useful on Irix
10863 * lib/reLyX/configure.in: make sure that the prefix is set
10864 correctly in LYX_DIR.
10866 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
10868 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
10869 be used by 'command-sequence' this allows to bind a key to a
10870 sequence of LyX-commands
10871 (Example: 'command-sequence math-insert alpha; math-insert beta;")
10873 * src/LyXAction.C: add "command-sequence"
10875 * src/LyXFunction.C: handling of "command-sequence"
10877 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
10878 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
10880 * src/lyxserver.C, src/minibuffer.C: Use this new interface
10882 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10884 * src/buffer.C (writeFile): Do not output a comment giving user
10885 and date at the beginning of a .lyx file. This is useless and
10886 annoys cvs anyway; update version number to 1.1.
10888 * src/Makefile.am (LYX_DIR): add this definition, so that a
10889 default path is hardcoded in LyX.
10891 * configure.in: Use LYX_GNU_GETTEXT.
10893 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
10894 AM_GNU_GETTEXT with a bug fixed.
10896 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
10898 * src/chset.C: add "using std::ifstream;" to please dec cxx.
10900 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
10901 which is used to point to LyX data is now LYX_DIR_11x.
10903 * lyx.man: convert to a unix text file; small updates.
10905 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
10907 * src/support/LSubstring.[Ch]: made the second arg of most of the
10908 constructors be a const reference.
10910 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
10913 * src/support/lyxstring.[Ch] (swap): added missing member function
10914 and specialization of swap(str, str);
10916 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
10918 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
10919 trace of the old one.
10921 * src/undo.[Ch]: made the undostack use std::list to store undo's in
10922 put the member definitions in undo.C.
10924 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
10925 NEW_TEXT and have now only code that was included when this was
10928 * src/intl.C (LCombo): use static_cast
10930 (DispatchCallback): ditto
10932 * src/definitions.h: removed whole file
10934 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
10936 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
10937 parsing and stores in a std:map. a regex defines the file format.
10938 removed unneeded members.
10940 * src/bufferparams.h: added several enums from definitions.h here.
10941 Removed unsused destructor. Changed some types to use proper enum
10942 types. use block to have the temp_bullets and user_defined_bullets
10943 and to make the whole class assignable.
10945 * src/bufferparams.C (Copy): removed this functions, use a default
10946 assignment instead.
10948 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
10951 * src/buffer.C (readLyXformat2): commend out all that have with
10952 oldpapersize to do. also comment out all that hve to do with
10953 insetlatex and insetlatexdel.
10954 (setOldPaperStuff): commented out
10956 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
10958 * src/LyXAction.C: remove use of inset-latex-insert
10960 * src/mathed/math_panel.C (button_cb): use static_cast
10962 * src/insets/Makefile.am (insets_o_SOURCES): removed
10965 * src/support/lyxstring.C (helper): use the unsigned long
10966 specifier, UL, instead of a static_cast.
10968 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
10970 * src/support/block.h: new file. to be used as a c-style array in
10971 classes, so that the class can be assignable.
10973 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10975 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
10976 NULL, make sure to return an empty string (it is not possible to
10977 set a string to NULL).
10979 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10981 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
10983 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
10985 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
10986 link line, so that Irix users (for example) can set it explicitely to
10989 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
10990 it can be overidden at make time (static or dynamic link, for
10993 * src/vc-backend.C, src/LaTeXFeatures.h,
10994 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
10995 statements to bring templates to global namespace.
10997 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
10999 * src/support/lyxstring.C (operator[] const): make it standard
11002 * src/minibuffer.C (Init): changed to reflect that more
11003 information is given from the lyxvc and need not be provided here.
11005 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
11007 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
11009 * src/LyXView.C (UpdateTimerCB): use static_cast
11010 (KeyPressMask_raw_callback): ditto
11012 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
11013 buffer_, a lot of changes because of this. currentBuffer() ->
11014 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
11015 also changes to other files because of this.
11017 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
11019 * src/vc-backend.[Ch]: new files. The backends for vc handling,
11020 have no support for RCS and partial support for CVS, will be
11023 * src/insets/ several files: changes because of function name
11024 changes in Bufferview and LyXView.
11026 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
11028 * src/support/LSubstring.[Ch]: new files. These implement a
11029 Substring that can be very convenient to use. i.e. is this
11031 string a = "Mary had a little sheep";
11032 Substring(a, "sheep") = "lamb";
11033 a is now "Mary has a little lamb".
11035 * src/support/LRegex.[Ch]: a regex class that can be used to pick
11036 out patterns and subpatterns of strings. It is used by LSubstring
11037 and also by vc-backend.C
11039 * src/support/lyxstring.C: went over all the assertions used and
11040 tried to correct the wrong ones and flag which of them is required
11041 by the standard. some bugs found because of this. Also removed a
11042 couple of assertions.
11044 * src/support/Makefile.am (libsupport_a_SOURCES): added
11045 LSubstring.[Ch] and LRegex.[Ch]
11047 * src/support/FileInfo.h: have struct stat buf as an object and
11048 not a pointer to one, some changes because of this.
11050 * src/LaTeXFeatures.C (getTClassPreamble): also use the
11051 information in layout when adding the layouts preamble to the
11052 textclass preamble.
11054 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
11057 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
11058 because of bug in OS/2.
11060 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11062 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
11063 \verbatim@font instead of \ttfamily, so that it can be redefined.
11065 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
11066 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
11067 src/layout.h, src/text2.C: add 'using' directive to bring the
11068 STL templates we need from the std:: namespace to the global one.
11069 Needed by DEC cxx in strict ansi mode.
11071 * src/support/LIstream.h,src/support/LOstream.h,
11072 src/support/lyxstring.h,src/table.h,
11073 src/lyxlookup.h: do not include <config.h> in header
11074 files. This should be done in the .C files only.
11076 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
11080 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11082 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
11083 from Kayvan to fix the tth invokation.
11085 * development/lyx.spec.in: updates from Kayvan to reflect the
11086 changes of file names.
11088 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11090 * src/text2.C (InsertStringB): use std::copy
11091 (InsertStringA): use std::copy
11093 * src/bufferlist.C: use a vector to store the buffers in. This is
11094 an internal change and should not affect any other thing.
11096 * src/BufferView.C (waitForX): use XSync instead of the lengthy
11099 * src/text.C (Fill): fix potential bug, one off bug.
11101 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
11103 * src/Makefile.am (lyx_main.o): add more files it depends on.
11105 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
11107 * src/support/lyxstring.C: use size_t for the reference count,
11108 size, reserved memory and xtra.
11109 (internal_compare): new private member function. Now the compare
11110 functions should work for std::strings that have embedded '\0'
11112 (compare): all compare functions rewritten to use
11115 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11117 * src/support/lyxstring.C (compare): pass c_str()
11118 (compare): pass c_str
11119 (compare): pass c_str
11121 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11123 * src/support/DebugStream.C: <config.h> was not included correctly.
11125 * lib/configure: forgot to re-generate it :( I'll make this file
11126 auto generated soon.
11128 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
11130 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
11133 * src/support/lyxstring.C: some changes from length() to rep->sz.
11134 avoids a function call.
11136 * src/support/filetools.C (SpaceLess): yet another version of the
11137 algorithm...now per Jean-Marc's suggestions.
11139 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11141 * src/layout.C (less_textclass_desc): functor for use in sorting
11143 (LyXTextClass::Read): sort the textclasses after reading.
11145 * src/support/filetools.C (SpaceLess): new version of the
11146 SpaceLess functions. What problems does this one give? Please
11149 * images/banner_bw.xbm: made the arrays unsigned char *
11151 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11153 * src/support/lyxstring.C (find): remove bogus assertion in the
11154 two versions of find where this has not been done yet.
11156 * src/support/lyxlib.h: add missing int return type to
11159 * src/menus.C (ShowFileMenu): disable exporting to html if no
11160 html export command is present.
11162 * config/lib_configure.m4: add a test for an HTML converter. The
11163 programs checked for are, in this order: tth, latex2html and
11166 * lib/configure: generated from config/lib_configure.m4.
11168 * src/lyxfunc.C (Dispatch): update and improve the execution of an
11169 html converter. The parameters are now passed through $$FName and
11170 $$OutName, instead of standard input/output.
11172 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
11174 * lib/lyxrc.example: update description of \html_command.
11175 add "quotes" around \screen_font_xxx font setting examples to help
11176 people who use fonts with spaces in their names.
11178 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
11180 * Distribution files: updates for v1.1.2
11182 * src/support/lyxstring.C (find): remove bogus assert and return
11183 npos for the same condition.
11185 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
11187 * added patch for OS/2 from SMiyata.
11189 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
11191 * src/text2.C (CutSelection): make space_wrapped a bool
11192 (CutSelection): dont declare int i until we have to.
11193 (alphaCounter): return a char const *.
11195 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11197 * src/support/syscall.C (Systemcalls::kill):
11198 src/support/filetools.C (PutEnv, PutEnvPath):
11199 src/lyx_cb.C (addNewlineAndDepth):
11200 src/FontInfo.C (FontInfo::resize): condition some #warning
11201 directives with WITH_WARNINGS.
11204 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
11206 * src/layout.[Ch] + several files: access to class variables
11207 limited and made accessor functions instead a lot of code changed
11208 becuase of this. Also instead of returning pointers often a const
11209 reference is returned instead.
11211 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
11213 * src/Makefile.am (dist-hook): added used to remove the CVS from
11214 cheaders upon creating a dist
11215 (EXTRA_DIST): added cheaders
11217 * src/support/lstrings.C (tostr(char)): fix it to handle param as
11218 a character not as a small integer.
11220 * src/support/lyxstring.C (find): removed Assert and added i >=
11221 rep->sz to the first if.
11223 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
11225 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
11226 src/LyXView.C src/buffer.C src/bufferparams.C
11227 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
11228 src/text2.C src/insets/insetinclude.C:
11229 lyxlayout renamed to textclasslist.
11231 * src/layout.C: some lyxerr changes.
11233 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
11234 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
11235 (LyXLayoutList): removed all traces of this class.
11236 (LyXTextClass::Read): rewrote LT_STYLE
11237 (LyXTextClass::hasLayout): new function
11238 (LyXTextClass::GetLayout): rewritten to return an iterator + has
11239 both const and nonconst version.
11240 (LyXTextClass::delete_layout): new function.
11241 (LyXTextClassList::Style): bug fix. do the right thing if layout
11243 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
11244 (LyXTextClassList::NameOfLayout): ditto
11245 (LyXTextClassList::Load): ditto
11247 * src/buffer.C (makeLaTeXFile): new access to layoutlist
11249 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
11251 * src/LyXAction.C (LookupFunc): added a workaround for sun
11252 compiler, on the other hand...we don't know if the current code
11253 compiles on sun at all...
11255 * src/support/filetools.C (CleanupPath): subst fix
11257 * src/insets/insetbib.C (delDatabase): subst fix, this looks
11260 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
11261 complained about this one?
11263 * src/insets/insetinclude.C (Latex): subst fix
11265 * src/insets/insetbib.C (getKeys): subst fix
11267 * src/LyXSendto.C (SendtoApplyCB): subst fix
11269 * src/lyx_main.C (init): subst fix
11271 * src/layout.C (Read): subst fix
11273 * src/lyx_sendfax_main.C (button_send): subst fix
11275 * src/buffer.C (RoffAsciiTable): subst fix
11277 * src/lyx_cb.C (MenuFax): subst fix
11278 (PrintApplyCB): subst fix
11280 1999-10-26 Juergen Vigna <jug@sad.it>
11282 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
11284 (Read): Cleaned up this code so now we read only format vestion >= 5
11286 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
11288 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
11289 come nobody has complained about this one?
11291 * src/insets/insetinclude.C (Latex): subst fix
11293 * src/insets/insetbib.C (getKeys): subst fix
11295 * src/lyx_main.C (init): subst fix
11297 * src/layout.C (Read): subst fix
11299 * src/buffer.C (RoffAsciiTable): subst fix
11301 * src/lyx_cb.C (MenuFax): subst fix.
11303 * src/layout.[hC] + some other files: rewrote to use
11304 std::container to store textclasses and layouts in.
11305 Simplified, removed a lot of code. Make all classes
11306 assignable. Further simplifications and review of type
11307 use still to be one.
11309 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
11310 lastfiles to create the lastfiles partr of the menu.
11312 * src/lastfiles.[Ch]: rewritten to use deque to store the
11313 lastfiles in. Uses fstream for reading and writing. Simplifies
11316 * src/support/syscall.C: remove explicit cast.
11318 * src/BufferView.C (CursorToggleCB): removed code snippets that
11319 were commented out.
11320 use explicat C++ style casts instead of C style casts. also use
11321 u_vdata instea of passing pointers in longs.
11323 * src/PaperLayout.C: removed code snippets that were commented out.
11325 * src/lyx_gui_misc.C: removed code snippets that were commented out.
11327 * src/lyx_main.C: removed code snippets that wer commented out.
11329 * src/paragraph.C: removed code snippets that were commented out.
11331 * src/lyxvc.C (logClose): use static_cast
11333 (viewLog): remove explicit cast to void*
11334 (showLog): removed old commented code
11336 * src/menus.C: use static_cast instead of C style casts. use
11337 u_vdata instead of u_ldata. remove explicit cast to (long) for
11338 pointers. Removed old code that was commented out.
11340 * src/insets/inset.C: removed old commented func
11342 * src/insets/insetref.C (InsetRef): removed old code that had been
11343 commented out for a long time.
11345 (escape): removed C style cast
11347 * src/insets/insetlatexaccent.C (Draw): removed old commented code
11349 * src/insets/insetlatex.C (Draw): removed old commented code
11350 (Read): rewritten to use string
11352 * src/insets/insetlabel.C (escape): removed C style cast
11354 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
11356 * src/insets/insetindex.C: use static_cast and u_vdata, removed
11357 old commented code.
11359 * src/insets/insetinclude.h: removed a couple of stupid bools
11361 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
11362 (Clone): remove C style cast
11363 (getKeys): changed list to lst because of std::list
11365 * src/insets/inseterror.C (Draw): removed som old commented code.
11367 * src/insets/insetcommand.C (Draw): removed some old commented code.
11369 * src/insets/insetbib.C (bibitem_cb): removed code that has been
11370 commented out forever.
11371 (bibitem_cb): use static_cast instead of C style cast
11372 use of vdata changed to u_vdata.
11374 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
11376 (CloseUrlCB): use static_cast instead of C style cast.
11377 (CloseUrlCB): added a fl_free form...it seemed to be missing.
11379 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
11380 (C_InsetInfo_CloseInfoCB): forward the ob parameter
11381 (CloseInfoCB): static_cast from ob->u_vdata instead.
11382 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
11385 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
11386 (C_InsetError_CloseErrorCB): forward the ob parameter
11387 (CloseErrorCB): static_cast from ob->u_vdata instead.
11389 * src/vspace.h: include LString.h since we use string in this class.
11391 * src/vspace.C (lyx_advance): changed name from advance because of
11392 nameclash with stl. And since we cannot use namespaces yet...I
11393 used a lyx_ prefix instead. Expect this to change when we begin
11396 * src/BufferView.[Ch] (BufferView::~BufferView): removed
11398 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
11399 and removed now defunct constructor and deconstructor.
11401 * src/BufferView.h: have backstack as a object not as a pointer.
11402 removed initialization from constructor. added include for BackStack
11404 * development/lyx.spec.in (%build): add CFLAGS also.
11406 * src/screen.C (drawFrame): removed another warning.
11408 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11410 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
11411 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
11412 README and ANNOUNCE a bit for the next release. More work is
11415 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
11416 unbreakable if we are in freespacing mode (LyX-Code), but not in
11419 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
11421 * src/BackStack.h: fixed initialization order in constructor
11423 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
11425 * acinclude.m4 (VERSION): new rules for when a version is
11426 development, added also a variable for prerelease.
11427 (warnings): we set with_warnings=yes for prereleases
11428 (lyx_opt): prereleases compile with same optimization as development
11429 (CXXFLAGS): only use pedantic if we are a development version
11431 * src/BufferView.C (restorePosition): don't do anything if the
11432 backstack is empty.
11434 * src/BackStack.h: added member empty, use this to test if there
11435 is anything to pop...
11437 1999-10-25 Juergen Vigna <jug@sad.it>
11440 * forms/layout_forms.fd +
11441 * forms/latexoptions.fd +
11442 * lyx.fd: changed for various form resize issues
11444 * src/mathed/math_panel.C +
11445 * src/insets/inseterror.C +
11446 * src/insets/insetinfo.C +
11447 * src/insets/inseturl.C +
11448 * src/insets/inseturl.h +
11450 * src/LyXSendto.C +
11451 * src/PaperLayout.C +
11452 * src/ParagraphExtra.C +
11453 * src/TableLayout.C +
11455 * src/layout_forms.C +
11462 * src/menus.C: fixed various resize issues. So now forms can be
11463 resized savely or not be resized at all.
11465 * forms/form_url.fd +
11466 * src/insets/form_url.[Ch]: added because it's cleaner and easier
11469 * src/insets/Makefile.am: added files form_url.[Ch]
11471 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11473 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
11474 (and presumably 6.2).
11476 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
11477 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
11478 remaining static member callbacks.
11480 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
11483 * src/support/lyxstring.h: declare struct Srep as friend of
11484 lyxstring, since DEC cxx complains otherwise.
11486 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11488 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
11490 * src/LaTeX.C (run): made run_bibtex also depend on files with
11492 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
11493 are put into the dependency file.
11495 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
11496 the code has shown itself to work
11497 (create_ispell_pipe): removed another warning, added a comment
11500 * src/minibuffer.C (ExecutingCB): removed code that has been
11501 commented out a long time
11503 * src/lyxfunc.C (processKeyEvent): removed some very old commented
11504 out code + a warning.
11506 * src/support/lyxstring.h: comment out the three private
11507 operators, when compiling with string ansi conforming compilers
11508 they make problems.
11510 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
11512 (pixmapFromBitmapData): change type of bdata to be unsigned char *
11513 (pixmapFromBitmapData): add a reinterpret_cast in the call to
11516 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
11519 * src/mathed/math_panel.C (create_math_panel): remove explicit
11522 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
11525 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
11526 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
11527 to XCreatePixmapFromBitmapData
11528 (fl_set_bmtable_data): change the last argument to be unsigned
11530 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
11531 and bh to be unsigned int, remove explicit casts in call to
11532 XReadBitmapFileData.
11534 * images/arrows.xbm: made the arrays unsigned char *
11535 * images/varsz.xbm: ditto
11536 * images/misc.xbm: ditto
11537 * images/greek.xbm: ditto
11538 * images/dots.xbm: ditto
11539 * images/brel.xbm: ditto
11540 * images/bop.xbm: ditto
11542 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
11544 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
11545 (LYX_PROG_CXX): added -pedantic to g++ compile options when
11546 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
11548 (LYX_CXX_CHEADERS): added <clocale> to the test.
11550 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
11552 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
11554 * src/support/lyxstring.C (append): fixed something that must be a
11555 bug, rep->assign was used instead of rep->append.
11557 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
11560 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
11561 lyx insert double chars. Fix spotted by Kayvan.
11563 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11565 * Fixed the tth support. I messed up with the Emacs patch apply feature
11566 and omitted the changes in lyxrc.C.
11568 1999-10-22 Juergen Vigna <jug@sad.it>
11570 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
11572 * src/lyx_cb.C (MenuInsertRef) +
11573 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
11574 the form cannot be resized under it limits (fixes a segfault)
11576 * src/lyx.C (create_form_form_ref) +
11577 * forms/lyx.fd: Changed Gravity on name input field so that it is
11580 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11582 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
11583 <ostream> and <istream>.
11585 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
11586 whether <fstream> provides the latest standard features, or if we
11587 have an oldstyle library (like in egcs).
11588 (LYX_CXX_STL_STRING): fix the test.
11590 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
11591 code on MODERN_STL_STREAM.
11593 * src/support/lyxstring.h: use L{I,O}stream.h.
11595 * src/support/L{I,O}stream.h: new files, designed to setup
11596 correctly streams for our use
11597 - includes the right header depending on STL capabilities
11598 - puts std::ostream and std::endl (for LOStream.h) or
11599 std::istream (LIStream.h) in toplevel namespace.
11601 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
11603 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
11604 was a bib file that had been changed we ensure that bibtex is run.
11605 (runBibTeX): enhanced to extract the names of the bib files and
11606 getting their absolute path and enter them into the dep file.
11607 (findtexfile): static func that is used to look for tex-files,
11608 checks for absolute patchs and tries also with kpsewhich.
11609 Alternative ways of finding the correct files are wanted. Will
11611 (do_popen): function that runs a command using popen and returns
11612 the whole output of that command in a string. Should be moved to
11615 * src/DepTable.[Ch] (extchanged): new function that returns true if a
11616 file with extension ext has changed.
11618 * src/insets/figinset.C: added ifdef guards around the fl_free
11619 code that jug commented out. Now it is commented out when
11620 compiling with XForms == 0.89.
11622 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
11623 to lyxstring.C, and only keep a forward declaration in
11624 lyxstring.h. Simplifies the header file a bit and should help a
11625 bit on compile time too. Also changes to Srep will not mandate a
11626 recompile of code just using string.
11627 (~lyxstring): definition moved here since it uses srep.
11628 (size): definition moved here since it uses srep.
11630 * src/support/lyxstring.h: removed a couple of "inline" that should
11633 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11635 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
11638 1999-10-21 Juergen Vigna <jug@sad.it>
11640 * src/table.C (SetPWidth): Just a small fix so the alignment is not
11641 set to left if I just remove the width entry (or it is empty).
11643 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
11644 paragraph when having dummy paragraphs.
11646 1999-10-20 Juergen Vigna <jug@sad.it>
11648 * src/insets/figinset.C: just commented some fl_free_form calls
11649 and added warnings so that this calls should be activated later
11650 again. This avoids for now a segfault, but we have a memory leak!
11652 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
11653 'const char * argument' to 'string argument', this should
11654 fix some Asserts() in lyxstring.C.
11656 * src/lyxfunc.h: Removed the function argAsString(const char *)
11657 as it is not used anymore.
11659 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
11661 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
11664 * src/Literate.h: some funcs moved from public to private to make
11665 interface clearer. Unneeded args removed.
11667 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
11669 (scanBuildLogFile): ditto
11671 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
11672 normal TeX Error. Still room for improvement.
11674 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
11676 * src/buffer.C (insertErrors): changes to make the error
11677 desctription show properly.
11679 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
11682 * src/support/lyxstring.C (helper): changed to use
11683 sizeof(object->rep->ref).
11684 (operator>>): changed to use a pointer instead.
11686 * src/support/lyxstring.h: changed const reference & to value_type
11687 const & lets see if that helps.
11689 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
11691 * Makefile.am (rpmdist): fixed to have non static package and
11694 * src/support/lyxstring.C: removed the compilation guards
11696 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
11699 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
11700 conditional compile of lyxstring.Ch
11702 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
11703 stupid check, but it is a lot better than the bastring hack.
11704 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
11706 * several files: changed string::erase into string::clear. Not
11709 * src/chset.C (encodeString): use a char temporary instead
11711 * src/table.C (TexEndOfCell): added tostr around
11712 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
11713 (TexEndOfCell): ditto
11714 (TexEndOfCell): ditto
11715 (TexEndOfCell): ditto
11716 (DocBookEndOfCell): ditto
11717 (DocBookEndOfCell): ditto
11718 (DocBookEndOfCell): ditto
11719 (DocBookEndOfCell): ditto
11721 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
11723 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
11725 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
11726 (MenuBuildProg): added tostr around ret
11727 (MenuRunChktex): added tostr around ret
11728 (DocumentApplyCB): added tostr around ret
11730 * src/chset.C (encodeString): added tostr around t->ic
11732 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
11733 (makeLaTeXFile): added tostr around tocdepth
11734 (makeLaTeXFile): added tostr around ftcound - 1
11736 * src/insets/insetbib.C (setCounter): added tostr around counter.
11738 * src/support/lyxstring.h: added an operator+=(int) to catch more
11741 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
11742 (lyxstring): We DON'T allow NULL pointers.
11744 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11746 * src/mathed/math_macro.C (MathMacroArgument::Write,
11747 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
11748 when writing them out.
11750 * src/LString.C: remove, since it is not used anymore.
11752 * src/support/lyxstring.C: condition the content to
11753 USE_INCLUDED_STRING macro.
11755 * src/mathed/math_symbols.C, src/support/lstrings.C,
11756 src/support/lyxstring.C: add `using' directive to specify what
11757 we need in <algorithm>. I do not think that we need to
11758 conditionalize this, but any thought is appreciated.
11760 * many files: change all callback functions to "C" linkage
11761 functions to please strict C++ compilers like DEC cxx 6.1 in mode
11762 strict_ansi. Those who were static are now global.
11763 The case of callbacks which are static class members is
11764 trickier, since we have to make C wrappers around them (see
11765 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
11766 did not finish this yet, since it defeats the purpose of
11767 encapsulation, and I am not sure what the best route is.
11769 1999-10-19 Juergen Vigna <jug@sad.it>
11771 * src/support/lyxstring.C (lyxstring): we permit to have a null
11772 pointer as assignment value and just don't assign it.
11774 * src/vspace.C (nextToken): corrected this function substituting
11775 find_first(_not)_of with find_last_of.
11777 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
11778 (TableOptCloseCB) (TableSpeCloseCB):
11779 inserted fl_set_focus call for problem with fl_hide_form() in
11782 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11784 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
11787 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11789 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
11790 LyXLex::next() and not eatline() to get its argument.
11792 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
11794 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
11795 instead, use fstreams for io of the depfile, removed unneeded
11796 functions and variables.
11798 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
11799 vector instead, removed all functions and variables that is not in
11802 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
11804 * src/buffer.C (insertErrors): use new interface to TeXError
11806 * Makefile.am (rpmdist): added a rpmdist target
11808 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
11809 per Kayvan's instructions.
11811 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11813 * src/Makefile.am: add a definition for localedir, so that locales
11814 are found after installation (Kayvan)
11816 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11818 * development/.cvsignore: new file.
11820 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11822 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
11823 C++ compiler provides wrappers for C headers and use our alternate
11826 * configure.in: use LYX_CXX_CHEADERS.
11828 * src/cheader/: new directory, populated with cname headers from
11829 libstdc++-2.8.1. They are a bit old, but probably good enough for
11830 what we want (support compilers who lack them).
11832 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
11833 from includes. It turns out is was stupid.
11835 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
11837 * lib/Makefile.am (install-data-local): forgot a ';'
11838 (install-data-local): forgot a '\'
11839 (libinstalldirs): needed after all. reintroduced.
11841 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
11843 * configure.in (AC_OUTPUT): added lyx.spec
11845 * development/lyx.spec: removed file
11847 * development/lyx.spec.in: new file
11849 * po/*.po: merged with lyx.pot becuase of make distcheck
11851 * lib/Makefile.am (dist-hook): added dist-hook so that
11852 documentation files will be included when doing a make
11853 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
11854 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
11856 more: tried to make install do the right thing, exclude CVS dirs
11859 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
11860 Path would fit in more nicely.
11862 * all files that used to use pathstack: uses now Path instead.
11863 This change was a lot easier than expected.
11865 * src/support/path.h: new file
11867 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
11869 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
11871 * src/support/lyxstring.C (getline): Default arg was given for
11874 * Configure.cmd: removed file
11876 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11878 * src/support/DebugStream.[Ch]: remove the explicit std:: before
11879 streams classes and types, add the proper 'using' statements when
11880 MODERN_STL is defined.
11882 * src/debug.h: move the << operator definition after the inclusion
11885 * src/support/filetools.C: include "LAssert.h", which is needed
11888 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
11891 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
11892 include "debug.h" to define a proper ostream.
11894 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
11896 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
11897 method to the SystemCall class which can kill a process, but it's
11898 not fully implemented yet.
11900 * src/*.C: Changed Systemcalls::Startscript() to startscript()
11902 * src/support/FileInfo.h: Better documentation
11904 * src/lyxfunc.C: Added support for buffer-export html
11906 * src/menus.C: Added Export->As HTML...
11908 * lib/bind/*.bind: Added short-cut for buffer-export html
11910 * src/lyxrc.*: Added support for new \tth_command
11912 * lib/lyxrc.example: Added stuff for new \tth_command
11914 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
11916 * lib/Makefile.am (IMAGES): removed images/README
11917 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
11918 installes in correct place. Check permisions is installed
11921 * src/LaTeX.C: some no-op changes moved declaration of some
11924 * src/LaTeX.h (LATEX_H): changed include guard name
11926 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
11928 * lib/reLyX/Makefile.am: install noweb2lyx.
11930 * lib/Makefile.am: install configure.
11932 * lib/reLyX/configure.in: declare a config aux dir; set package
11933 name to lyx (not sure what the best solution is); generate noweb2lyx.
11935 * lib/layouts/egs.layout: fix the bibliography layout.
11937 1999-10-08 Jürgen Vigna <jug@sad.it>
11939 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
11940 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
11941 it returned without continuing to search the path.
11943 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
11945 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
11946 also fixes a bug. It is not allowed to do tricks with std::strings
11947 like: string a("hei"); &a[e]; this will not give what you
11948 think... Any reason for the complexity in this func?
11950 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
11952 * Updated README and INSTALL a bit, mostly to check that my
11953 CVS rights are correctly set up.
11955 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
11957 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
11958 does not allow '\0' chars but lyxstring and std::string does.
11960 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
11962 * autogen.sh (AUTOCONF): let the autogen script create the
11963 POTFILES.in file too. POTFILES.in should perhaps now not be
11964 included in the cvs module.
11966 * some more files changed to use C++ includes instead of C ones.
11968 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
11970 (Reread): added tostr to nlink. buggy output otherwise.
11971 (Reread): added a string() around szMode when assigning to Buffer,
11972 without this I got a log of garbled info strings.
11974 * acconfig.h: commented out the PTR_AS_INT macros. They should not
11977 * I have added several ostream & operator<<(ostream &, some_type)
11978 functions. This has been done to avoid casting and warnings when
11979 outputting enums to lyxerr. This as thus eliminated a lot of
11980 explicit casts and has made the code clearer. Among the enums
11981 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
11982 mathed enums, some font enum the Debug::type enum.
11984 * src/support/lyxstring.h (clear): missing method. equivalent of
11987 * all files that contained "stderr": rewrote constructs that used
11988 stderr to use lyxerr instead. (except bmtable)
11990 * src/support/DebugStream.h (level): and the passed t with
11991 Debug::ANY to avoid spurious bits set.
11993 * src/debug.h (Debug::type value): made it accept strings of the
11994 type INFO,INIT,KEY.
11996 * configure.in (Check for programs): Added a check for kpsewhich,
11997 the latex generation will use this later to better the dicovery of
12000 * src/BufferView.C (create_view): we don't need to cast this to
12001 (void*) that is done automatically.
12002 (WorkAreaButtonPress): removed some dead code.
12004 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12006 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
12007 is not overwritten when translated (David Sua'rez de Lis).
12009 * lib/CREDITS: Added David Sua'rez de Lis
12011 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
12013 * src/bufferparams.C (BufferParams): default input encoding is now
12016 * acinclude.m4 (cross_compiling): comment out macro
12017 LYX_GXX_STRENGTH_REDUCE.
12019 * acconfig.h: make sure that const is not defined (to empty) when
12020 we are compiling C++. Remove commented out code using SIZEOF_xx
12023 * configure.in : move the test for const and inline as late as
12024 possible so that these C tests do not interefere with C++ ones.
12025 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
12026 has not been proven.
12028 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
12030 * src/table.C (getDocBookAlign): remove bad default value for
12031 isColumn parameter.
12033 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
12035 (ShowFileMenu2): ditto.
12037 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
12038 of files to ignore.
12040 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
12042 * Most files: finished the change from the old error code to use
12043 DebugStream for all lyxerr debugging. Only minor changes remain
12044 (e.g. the setting of debug levels using strings instead of number)
12046 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
12048 * src/layout.C (Add): Changed to use compare_no_case instead of
12051 * src/FontInfo.C: changed loop variable type too string::size_type.
12053 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
12055 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
12056 set ETAGS_ARGS to --c++
12058 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
12060 * src/table.C (DocBookEndOfCell): commented out two unused variables
12062 * src/paragraph.C: commented out four unused variables.
12064 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
12065 insed a if clause with type string::size_type.
12067 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
12070 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
12072 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
12073 variable, also changed loop to go from 0 to lenght + 1, instead of
12074 -1 to length. This should be correct.
12076 * src/LaTeX.C (scanError): use string::size_type as loop variable
12079 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
12080 (l.896) since y_tmp and row was not used anyway.
12082 * src/insets/insetref.C (escape): use string::size_type as loop
12085 * src/insets/insetquotes.C (Width): use string::size_type as loop
12087 (Draw): use string::size_type as loop variable type.
12089 * src/insets/insetlatexaccent.C (checkContents): use
12090 string::size_type as loop variable type.
12092 * src/insets/insetlabel.C (escape): use string::size_type as loop
12095 * src/insets/insetinfo.C: added an extern for current_view.
12097 * src/insets/insetcommand.C (scanCommand): use string::size_type
12098 as loop variable type.
12100 * most files: removed the RCS tags. With them we had to recompile
12101 a lot of files after a simple cvs commit. Also we have never used
12102 them for anything meaningful.
12104 * most files: tags-query-replace NULL 0. As adviced several plases
12105 we now use "0" instead of "NULL" in our code.
12107 * src/support/filetools.C (SpaceLess): use string::size_type as
12108 loop variable type.
12110 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
12112 * src/paragraph.C: fixed up some more string stuff.
12114 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
12116 * src/support/filetools.h: make modestr a std::string.
12118 * src/filetools.C (GetEnv): made ch really const.
12120 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
12121 made code that used these use max/min from <algorithm> instead.
12123 * changed several c library include files to their equivalent c++
12124 library include files. All is not changed yet.
12126 * created a support subdir in src, put lyxstring and lstrings
12127 there + the extra files atexit, fileblock, strerror. Created
12128 Makefile.am. edited configure.in and src/Makefile.am to use this
12129 new subdir. More files moved to support.
12131 * imported som of the functions from repository lyx, filetools
12133 * ran tags-query-replace on LString -> string, corrected the bogus
12134 cases. Tried to make use of lstrings.[hC], debugged a lot. There
12135 is still some errors in there. This is errors where too much or
12136 too litle get deleted from strings (string::erase, string::substr,
12137 string::replace), there can also be some off by one errors, or
12138 just plain wrong use of functions from lstrings. Viewing of quotes
12141 * LyX is now running fairly well with string, but there are
12142 certainly some bugs yet (see above) also string is quite different
12143 from LString among others in that it does not allow null pointers
12144 passed in and will abort if it gets any.
12146 * Added the revtex4 files I forgot when setting up the repository.
12148 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
12150 * All over: Tried to clean everything up so that only the files
12151 that we really need are included in the cvs repository.
12152 * Switched to use automake.
12153 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
12154 * Install has not been checked.
12156 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
12158 * po/pt.po: Three errors:
12159 l.533 and l.538 format specification error
12160 l. 402 duplicate entry, I just deleted it.