1 2000-09-26 Juergen Vigna <jug@sad.it>
3 * src/buffer.C (asciiParagraph): new function.
4 (writeFileAscii): new function with parameter ostream.
5 (writeFileAscii): use now asciiParagraph.
7 * various inset files: added the linelen parameter to the Ascii-func.
9 * src/tabular.C (Write): fixed error in writing file introduced by
10 the last changes from Lars.
12 * lib/bind/menus.bind: removed not supported functions.
14 * src/insets/insettext.C (Ascii): implemented this function.
16 * src/insets/lyxinset.h (Ascii): added linelen parameter.
18 * src/tabular.C (write_attribute[int,string,bool]): new functions.
19 (Write): use of the write_attribute functions.
21 * src/bufferlist.C (close): fixed reasking question!
23 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
25 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
26 new files use the everwhere possible.
29 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
30 src/log_form.C src/lyx.C:
33 * src/buffer.C (runLaTeX): remove func
35 * src/PaperLayout.C: removed file
36 * src/ParagraphExtra.C: likewise
37 * src/bullet_forms.C: likewise
38 * src/bullet_forms.h: likewise
39 * src/bullet_forms_cb.C: likewise
41 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
42 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
45 * several files: remove all traces of the old fd_form_paragraph,
46 and functions belonging to that.
48 * several files: remove all traces of the old fd_form_document,
49 and functions belonging to that.
51 * several files: constify local variables were possible.
53 * several files: remove all code that was dead when NEW_EXPORT was
56 * several files: removed string::c_str in as many places as
59 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
60 (e): be a bit more outspoken when patching
61 (updatesrc): only move files if changed.
63 * forms/layout_forms.h.patch: regenerated
65 * forms/layout_forms.fd: remove form_document and form_paragraph
66 and form_quotes and form_paper and form_table_options and
69 * forms/form1.fd: remove form_table
71 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
72 the fdui->... rewrite. Update some comments to xforms 0.88
74 * forms/bullet_forms.C.patch: removed file
75 * forms/bullet_forms.fd: likewise
76 * forms/bullet_forms.h.patch: likewise
78 * development/Code_rules/Rules: added a section on switch
79 statements. Updated some comment to xforms 0.88.
81 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
83 * src/buffer.C (readFile): make sure that the whole version number
84 is read after \lyxformat (even when it contains a comma)
86 * lib/ui/default.ui: change shortcut of math menu to M-a.
88 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
90 * src/vspace.C (nextToken): use isStrDbl() to check for proper
93 * src/LyXView.C (updateWindowTitle): show the full files name in
94 window title, limited to 30 characters.
96 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
97 When a number of characters has been given, we should not assume
98 that the string is 0-terminated.
100 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
101 calls (fixes some memory leaks)
103 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
104 trans member on exit.
106 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
108 * src/converter.C (GetReachable): fix typo.
110 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
111 understand ',' instead of '.'.
112 (GetInteger): rewrite to use strToInt().
114 2000-09-26 Juergen Vigna <jug@sad.it>
116 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
117 better visibility and error-message on wrong VSpace input.
119 * src/language.C (initL): added english again.
121 2000-09-25 Juergen Vigna <jug@sad.it>
123 * src/frontends/kde/Dialogs.C (Dialogs):
124 * src/frontends/gnome/Dialogs.C (Dialogs):
125 * src/frontends/kde/Makefile.am:
126 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
128 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
130 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
132 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
134 * src/frontends/xforms/FormParagraph.C:
135 * src/frontends/xforms/FormParagraph.h:
136 * src/frontends/xforms/form_paragraph.C:
137 * src/frontends/xforms/form_paragraph.h:
138 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
141 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
143 * src/tabular.C (OldFormatRead): forgot to delete the temporary
144 Paragraph-Data after use.
146 * src/insets/insettext.C (LocalDispatch): don't set the layout on
147 non breakable paragraphs.
149 2000-09-25 Garst R. Reese <reese@isn.net>
151 * src/language.C (initL): added missing language_country codes.
153 2000-09-25 Juergen Vigna <jug@sad.it>
155 * src/insets/insettext.C (InsetText):
156 (deleteLyXText): remove the not released LyXText structure!
158 2000-09-24 Marko Vendelin <markov@ioc.ee>
160 * src/frontends/gnome/mainapp.C
161 * src/frontends/gnome/mainapp.h: added support for keyboard
164 * src/frontends/gnome/FormCitation.C
165 * src/frontends/gnome/FormCitation.h
166 * src/frontends/gnome/Makefile.am
167 * src/frontends/gnome/pixbutton.h: completed the rewrite of
168 FormCitation to use "action area" in mainapp window
170 * src/frontends/gnome/Menubar_pimpl.C
171 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
174 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
176 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
177 width/descent/ascent values if name is empty.
178 (mathed_string_height): Use std::max.
180 2000-09-25 Allan Rae <rae@lyx.org>
182 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
183 segfault. This will be completely redesigned soon.
185 * sigc++: updated libsigc++. Fixes struct timespec bug.
187 * development/tools/makeLyXsigc.sh: .cvsignore addition
189 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
191 * several files: removed almost all traces of the old table
194 * src/TableLayout.C: removed file
196 2000-09-22 Juergen Vigna <jug@sad.it>
198 * src/frontends/kde/Dialogs.C: added credits forms.
200 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
202 * src/frontends/gnome/Dialogs.C: added some forms.
204 * src/spellchecker.C (init_spell_checker): set language in pspell code
205 (RunSpellChecker): some modifications for setting language string.
207 * src/language.[Ch]: added language_country code.
209 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
211 * src/frontends/Dialogs.h: added new signal showError.
212 Rearranged existing signals in some sort of alphabetical order.
214 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
215 FormError.[Ch], form_error.[Ch]
216 * src/frontends/xforms/forms/makefile: added new file form_error.fd
217 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
219 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
220 dialogs. I think that this can be used as the base to all these
223 * src/frontends/xforms/FormError.[Ch]
224 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
225 implementation of InsetError dialog.
227 * src/insets/inseterror.[Ch]: rendered GUI-independent.
229 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
230 * src/frontends/kde/Makefile.am: ditto
232 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
234 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
235 macrobf. This fixes a bug of invisible text.
237 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
239 * lib/doc/LaTeXConfig.lyx.in: updated.
241 * src/language.C (initL): remove language "francais" and change a
242 bit the names of the two other french variations.
244 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
245 string that may not be 0-terminated.
247 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
249 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
251 2000-09-20 Marko Vendelin <markov@ioc.ee>
253 * src/frontends/gnome/FormCitation.C
254 * src/frontends/gnome/FormIndex.C
255 * src/frontends/gnome/FormToc.C
256 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
257 the variable initialization to shut up the warnings
259 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
261 * src/table.[Ch]: deleted files
263 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
266 2000-09-18 Juergen Vigna <jug@sad.it>
268 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
269 problems with selection. Inserted new LFUN_PASTESELECTION.
270 (InsetButtonPress): inserted handling of middle mouse-button paste.
272 * src/spellchecker.C: changed word to word.c_str().
274 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
276 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
277 included in the ``make dist'' tarball.
279 2000-09-15 Juergen Vigna <jug@sad.it>
281 * src/CutAndPaste.C (cutSelection): small fix return the right
282 end position after cut inside one paragraph only.
284 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
285 we are locked as otherwise we don't have a valid cursor position!
287 * src/insets/figinset.C (draw): small bugfix but why is this needed???
289 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
291 * src/frontends/kde/FormRef.C: added using directive.
292 * src/frontends/kde/FormToc.C: ditto
294 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
296 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
299 2000-09-19 Marko Vendelin <markov@ioc.ee>
301 * src/frontends/gnome/Menubar_pimpl.C
302 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
303 Toc, ViewFormats, UpdateFormats, and ExportFormats.
305 * src/frontends/gnome/mainapp.C
306 * src/frontends/gnome/mainapp.h: support for menu update used
309 * src/frontends/gnome/mainapp.C
310 * src/frontends/gnome/mainapp.h: support for "action" area in the
311 main window. This area is used by small simple dialogs, such as
314 * src/frontends/gnome/FormIndex.C
315 * src/frontends/gnome/FormIndex.h
316 * src/frontends/gnome/FormUrl.C
317 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
320 * src/frontends/gnome/FormCitation.C
321 * src/frontends/gnome/FormCitation.h: rewrite to use main window
322 action area. Only "Insert new citation" is implemented.
326 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
328 * src/buffer.C (Dispatch): fix call to Dispatch
329 * src/insets/insetref.C (Edit): likewise
330 * src/insets/insetparent.C (Edit): likewise
331 * src/insets/insetinclude.C (include_cb): likewise
332 * src/frontends/xforms/FormUrl.C (apply): likewise
333 * src/frontends/xforms/FormToc.C (apply): likewise
334 * src/frontends/xforms/FormRef.C (apply): likewise
335 * src/frontends/xforms/FormIndex.C (apply): likewise
336 * src/frontends/xforms/FormCitation.C (apply): likewise
337 * src/lyxserver.C (callback): likewise
338 * src/lyxfunc.C (processKeySym): likewise
341 * src/lyx_cb.C (LayoutsCB): likewise
343 * Makefile.am (sourcedoc): small change
345 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
347 * src/main.C (main): Don't make an empty GUIRunTime object. all
348 methods are static. constify a bit remove unneded using + headers.
350 * src/tabular.C: some more const to local vars move some loop vars
352 * src/spellchecker.C: added some c_str after some word for pspell
354 * src/frontends/GUIRunTime.h: add new static method setDefaults
355 * src/frontends/xforms/GUIRunTime.C (setDefaults):
356 * src/frontends/kde/GUIRunTime.C (setDefaults):
357 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
359 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
360 with strnew in arg, use correct emptystring when calling SetName.
362 * several files: remove all commented code with relation to
363 HAVE_SSTREAM beeing false. We now only support stringstream and
366 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
368 * src/lyxfunc.C: construct correctly the automatic new file
371 * src/text2.C (IsStringInText): change type of variable i to shut
374 * src/support/sstream.h: do not use namespaces if the compiler
375 does not support them.
377 2000-09-15 Marko Vendelin <markov@ioc.ee>
378 * src/frontends/gnome/FormCitation.C
379 * src/frontends/gnome/FormCitation.h
380 * src/frontends/gnome/diainsertcitation_interface.c
381 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
382 regexp support to FormCitation [Gnome].
384 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
387 * configure.in: remove unused KDE/GTKGUI define
389 * src/frontends/kde/FormRef.C
390 * src/frontends/kde/FormRef.h
391 * src/frontends/kde/formrefdialog.C
392 * src/frontends/kde/formrefdialog.h: double click will
393 go to reference, now it is possible to change a cross-ref
396 * src/frontends/kde/FormToc.C
397 * src/frontends/kde/FormToc.h
398 * src/frontends/kde/formtocdialog.C
399 * src/frontends/kde/formtocdialog.h: add a depth
402 * src/frontends/kde/Makefile.am: add QtLyXView.h
405 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
407 * src/frontends/kde/FormCitation.h: added some using directives.
409 * src/frontends/kde/FormToc.h: corrected definition of doTree.
411 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
414 * src/mathed/math_defs.h: redefine SetAlign to use string rather
417 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
419 * src/buffer.C (pop_tag): revert for the second time a change by
420 Lars, who seems to really hate having non-local loop variables :)
422 * src/Lsstream.h: add "using" statements.
424 * src/support/copy.C (copy): add a bunch of std:: qualifiers
425 * src/buffer.C (writeFile): ditto
427 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
429 * src/buffer.C (writeFile): try to fix the locale modified format
430 number to always be as we want it.
432 * src/WorkArea.C (work_area_handler): try to workaround the bugs
433 in XForms 0.89. C-space is now working again.
435 * src/Lsstream.h src/support/sstream.h: new files.
437 * also commented out all cases where strstream were used.
439 * src/Bullet.h (c_str): remove method.
441 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
443 * a lot of files: get rid of "char const *" and "char *" is as
444 many places as possible. We only want to use them in interaction
445 with system of other libraries, not inside lyx.
447 * a lot of files: return const object is not of pod type. This
448 helps ensure that temporary objects is not modified. And fits well
449 with "programming by contract".
451 * configure.in: check for the locale header too
453 * Makefile.am (sourcedoc): new tag for generation of doc++
456 2000-09-14 Juergen Vigna <jug@sad.it>
458 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
459 callback to check which combo called it and do the right action.
461 * src/combox.C (combo_cb): added combo * to the callbacks.
462 (Hide): moved call of callback after Ungrab of the pointer.
464 * src/intl.h: removed LCombo2 function.
466 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
467 function as this can now be handled in one function.
469 * src/combox.h: added Combox * to callback prototype.
471 * src/frontends/xforms/Toolbar_pimpl.C:
472 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
474 2000-09-14 Garst Reese <reese@isn.net>
476 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
477 moved usepackage{xxx}'s to beginning of file. Changed left margin
478 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
479 underlining from title. Thanks to John Culleton for useful suggestions.
481 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
483 * src/lyxlex_pimpl.C (setFile): change error message to debug
486 2000-09-13 Juergen Vigna <jug@sad.it>
488 * src/frontends/xforms/FormDocument.C: implemented choice_class
489 as combox and give callback to combo_language so OK/Apply is activated
492 * src/bufferlist.C (newFile): small fix so already named files
493 (via an open call) are not requested to be named again on the
496 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
498 * src/frontends/kde/Makefile.am
499 * src/frontends/kde/FormRef.C
500 * src/frontends/kde/FormRef.h
501 * src/frontends/kde/formrefdialog.C
502 * src/frontends/kde/formrefdialog.h: implement
505 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
507 * src/frontends/kde/formtocdialog.C
508 * src/frontends/kde/formtocdialog.h
509 * src/frontends/kde/FormToc.C
510 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
512 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
514 * src/frontends/kde/FormCitation.C: fix thinko
515 where we didn't always display the reference text
518 * src/frontends/kde/formurldialog.C
519 * src/frontends/kde/formurldialog.h
520 * src/frontends/kde/FormUrl.C
521 * src/frontends/kde/FormUrl.h: minor cleanups
523 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
525 * src/frontends/kde/Makefile.am
526 * src/frontends/kde/FormToc.C
527 * src/frontends/kde/FormToc.h
528 * src/frontends/kde/FormCitation.C
529 * src/frontends/kde/FormCitation.h
530 * src/frontends/kde/FormIndex.C
531 * src/frontends/kde/FormIndex.h
532 * src/frontends/kde/formtocdialog.C
533 * src/frontends/kde/formtocdialog.h
534 * src/frontends/kde/formcitationdialog.C
535 * src/frontends/kde/formcitationdialog.h
536 * src/frontends/kde/formindexdialog.C
537 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
539 2000-09-12 Juergen Vigna <jug@sad.it>
541 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
544 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
546 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
549 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
551 * src/converter.C (Add, Convert): Added support for converter flags:
552 needaux, resultdir, resultfile.
553 (Convert): Added new parameter view_file.
554 (dvips_options): Fixed letter paper option.
556 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
557 (Export, GetExportableFormats, GetViewableFormats): Added support
560 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
562 (easyParse): Fixed to work with new export code.
564 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
567 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
569 * lib/bind/*.bind: Replaced
570 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
571 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
573 2000-09-11 Juergen Vigna <jug@sad.it>
575 * src/lyx_gui.C (runTime): uses global guiruntime variable.
577 * src/main.C (main): now GUII defines global guiruntime!
579 * src/frontends/gnome/GUIRunTime.C (initApplication):
580 * src/frontends/kde/GUIRunTime.C (initApplication):
581 * src/frontends/xforms/GUIRunTime.C (initApplication):
582 * src/frontends/GUIRunTime.h: added new function initApplication.
584 * src/spellchecker.C (sc_accept_word): change to add_to_session.
586 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
588 2000-09-08 Juergen Vigna <jug@sad.it>
590 * src/lyx_gui.C (create_forms): don't display the "default" entry as
591 we have already "Reset".
593 * src/language.C (initL): inserted "default" language and made this
594 THE default language (and not american!)
596 * src/paragraph.C: inserted handling of "default" language!
598 * src/lyxfont.C: ditto
602 * src/paragraph.C: output the \\par only if we have a following
603 paragraph otherwise it's not needed.
605 2000-09-05 Juergen Vigna <jug@sad.it>
607 * config/pspell.m4: added entry to lyx-flags
609 * src/spellchecker.C: modified version from Kevin for using pspell
611 2000-09-01 Marko Vendelin <markov@ioc.ee>
612 * src/frontends/gnome/Makefile.am
613 * src/frontends/gnome/FormCitation.C
614 * src/frontends/gnome/FormCitation.h
615 * src/frontends/gnome/diainsertcitation_callbacks.c
616 * src/frontends/gnome/diainsertcitation_callbacks.h
617 * src/frontends/gnome/diainsertcitation_interface.c
618 * src/frontends/gnome/diainsertcitation_interface.h
619 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
620 dialog for Gnome frontend
622 * src/main.C: Gnome libraries require keeping application name
623 and its version as strings
625 * src/frontends/gnome/mainapp.C: Change the name of the main window
626 from GnomeLyX to PACKAGE
628 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
630 * src/frontends/Liason.C: add "using: declaration.
632 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
634 * src/mathed/math_macro.C (Metrics): Set the size of the template
636 * src/mathed/formulamacro.C (Latex): Fixed the returned value
638 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
640 * src/converter.C (add_options): New function.
641 (SetViewer): Change $$FName into '$$FName'.
642 (View): Add options when running xdvi
643 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
644 (Convert): The 3rd parameter is now the desired filename. Converts
645 calls to lyx::rename if necessary.
646 Add options when running dvips.
647 (dvi_papersize,dvips_options): New methods.
649 * src/exporter.C (Export): Use getLatexName() instead of fileName().
651 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
652 using a call to Converter::dvips_options.
653 Fixed to work with nex export code.
656 * src/support/rename.C: New files
658 * src/support/syscall.h
659 * src/support/syscall.C: Added Starttype SystemDontWait.
661 * lib/ui/default.ui: Changed to work with new export code
663 * lib/configure.m4: Changed to work with new export code
665 * src/encoding.C: Changed latex name for iso8859_7 encoding.
667 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
669 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
670 so that code compiles with DEC cxx.
672 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
673 to work correctly! Also now supports the additional elements
676 2000-09-01 Allan Rae <rae@lyx.org>
678 * src/frontends/ButtonPolicies.C: renamed all the references to
679 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
681 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
682 since it's a const not a type.
684 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
686 2000-08-31 Juergen Vigna <jug@sad.it>
688 * src/insets/figinset.C: Various changes to look if the filename has
689 an extension and if not add it for inline previewing.
691 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
693 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
694 make buttonStatus and isReadOnly be const methods. (also reflect
695 this in derived classes.)
697 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
698 (nextState): change to be static inline, pass the StateMachine as
700 (PreferencesPolicy): remove casts
701 (OkCancelPolicy): remvoe casts
702 (OkCancelReadOnlyPolicy): remove casts
703 (NoRepeatedApplyReadOnlyPolicy): remove casts
704 (OkApplyCancelReadOnlyPolicy): remove casts
705 (OkApplyCancelPolicy): remove casts
706 (NoRepeatedApplyPolicy): remove casts
708 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
710 * src/converter.C: added some using directives
712 * src/frontends/ButtonPolicies.C: changes to overcome
713 "need lvalue" error with DEC c++
715 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
716 to WMHideCB for DEC c++
718 * src/frontends/xforms/Menubar_pimpl.C: added using directive
720 * src/frontends/xforms/forms/form_document.C.patch: use C callback
721 to BulletBMTableCB for DEC c++
723 2000-08-31 Allan Rae <rae@lyx.org>
725 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
726 character dialog separately from old document dialogs combo_language.
729 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
731 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
732 Removed LFUN_REF_CREATE.
734 * src/MenuBackend.C: Added new tags: toc and references
736 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
737 (add_lastfiles, add_documents, add_formats): Removed the unused smn
739 (add_toc, add_references): New methods.
740 (create_submenu): Handle correctly the case when there is a
741 seperator after optional menu items.
743 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
744 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
745 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
747 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
749 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
751 * src/converter.[Ch]: New file for converting between different
754 * src/export.[Ch]: New file for exporting a LyX file to different
757 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
758 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
759 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
760 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
761 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
762 RunDocBook, MenuExport.
764 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
765 Exporter::Preview methods if NEW_EXPORT is defined.
767 * src/buffer.C (Dispatch): Use Exporter::Export.
769 * src/lyxrc.C: Added new tags: \converter and \viewer.
772 * src/LyXAction.C: Define new lyx-function: buffer-update.
773 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
774 when NEW_EXPORT is defined.
776 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
778 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
780 * lib/ui/default.ui: Added submenus "view" and "update" to the
783 * src/filetools.C (GetExtension): New function.
785 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
787 2000-08-29 Allan Rae <rae@lyx.org>
789 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
791 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
792 (EnableDocumentLayout): removed
793 (DisableDocumentLayout): removed
794 (build): make use of ButtonController's read-only handling to
795 de/activate various objects. Replaces both of the above functions.
797 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
798 (readOnly): was read_only
799 (refresh): fixed dumb mistakes with read_only_ handling
801 * src/frontends/xforms/forms/form_document.fd:
802 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
803 tabbed dialogs so the tabs look more like tabs and so its easier to
804 work out which is the current tab.
806 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
807 segfault with form_table
809 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
811 2000-08-28 Juergen Vigna <jug@sad.it>
813 * acconfig.h: added USE_PSPELL.
815 * src/config.h.in: added USE_PSPELL.
817 * autogen.sh: added pspell.m4
819 * config/pspell.m4: new file.
821 * src/spellchecker.C: implemented support for pspell libary.
823 2000-08-25 Juergen Vigna <jug@sad.it>
825 * src/LyXAction.C (init): renamed LFUN_TABLE to
826 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
828 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
830 * src/lyxscreen.h: add force_clear variable and fuction to force
831 a clear area when redrawing in LyXText.
833 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
835 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
837 * some whitespace and comment changes.
839 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
841 * src/buffer.C: up te LYX_FORMAT to 2.17
843 2000-08-23 Juergen Vigna <jug@sad.it>
845 * src/BufferView_pimpl.C (tripleClick): disable this when in a
848 * src/insets/insettabular.C (pasteSelection): delete the insets
849 LyXText as it is not valid anymore.
850 (copySelection): new function.
851 (pasteSelection): new function.
852 (cutSelection): new function.
853 (LocalDispatch): implemented cut/copy/paste of cell selections.
855 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
856 don't have a LyXText.
858 * src/LyXAction.C (init): a NEW_TABULAR define too much.
860 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
863 2000-08-22 Juergen Vigna <jug@sad.it>
865 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
866 ifdef form_table out if NEW_TABULAR.
868 2000-08-21 Juergen Vigna <jug@sad.it>
870 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
871 (draw): fixed draw position so that the cursor is positioned in the
873 (InsetMotionNotify): hide/show cursor so the position is updated.
874 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
875 using cellstart() function where it should be used.
877 * src/insets/insettext.C (draw): ditto.
879 * src/tabular.C: fixed initialization of some missing variables and
880 made BoxType into an enum.
882 2000-08-22 Marko Vendelin <markov@ioc.ee>
883 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
884 stock menu item using action numerical value, not its string
888 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
890 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
891 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
893 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
895 * src/frontends/xforms/GUIRunTime.C: new file
897 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
898 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
900 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
902 * src/frontends/kde/GUIRunTime.C: new file
904 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
905 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
907 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
909 * src/frontends/gnome/GUIRunTime.C: new file
911 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
914 * src/frontends/GUIRunTime.h: removed constructor and destructor,
915 small change to documetentation.
917 * src/frontends/GUIRunTime.C: removed file
919 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
921 * src/lyxparagraph.h: enable NEW_TABULAR as default
923 * src/lyxfunc.C (processKeySym): remove some commented code
925 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
926 NEW_TABULAR around the fd_form_table_options.
928 * src/lyx_gui.C (runTime): call the static member function as
929 GUIRunTime::runTime().
931 2000-08-21 Allan Rae <rae@lyx.org>
933 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
936 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
938 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
940 2000-08-21 Allan Rae <rae@lyx.org>
942 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
944 * src/frontends/xforms/FormPreferences.C (build): use setOK
945 * src/frontends/xforms/FormDocument.C (build): use setOK
946 (FormDocument): use the appropriate policy.
948 2000-08-21 Allan Rae <rae@lyx.org>
950 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
951 automatic [de]activation of arbitrary objects when in a read-only state.
953 * src/frontends/ButtonPolicies.h: More documentation
954 (isReadOnly): added to support the above.
956 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
958 2000-08-18 Juergen Vigna <jug@sad.it>
960 * src/insets/insettabular.C (getStatus): changed to return func_status.
962 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
963 display toggle menu entries if they are.
965 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
966 new document layout now.
968 * src/lyxfunc.C: ditto
970 * src/lyx_gui_misc.C: ditto
972 * src/lyx_gui.C: ditto
974 * lib/ui/default.ui: removed paper and quotes layout as they are now
975 all in the document layout tabbed folder.
977 * src/frontends/xforms/forms/form_document.fd: added Restore
978 button and callbacks for all inputs for Allan's ButtonPolicy.
980 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
981 (CheckChoiceClass): added missing params setting on class change.
982 (UpdateLayoutDocument): added for updating the layout on params.
983 (build): forgot to RETURN_ALWAYS input_doc_spacing.
984 (FormDocument): Implemented Allan's ButtonPolicy with the
987 2000-08-17 Allan Rae <rae@lyx.org>
989 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
990 so we can at least see the credits again.
992 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
993 controller calls for the appropriate callbacks. Note that since Ok
994 calls apply followed by cancel, and apply isn't a valid input for the
995 APPLIED state, the bc_ calls have to be made in the static callback not
996 within each of the real callbacks.
998 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
999 (setOk): renamed from setOkay()
1001 2000-08-17 Juergen Vigna <jug@sad.it>
1003 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
1004 in the implementation part.
1005 (composeUIInfo): don't show optional menu-items.
1007 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
1009 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
1011 * src/bufferview_funcs.C (CurrentState): fixed to show also the
1012 text-state when in a text-inset.
1014 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
1016 2000-08-17 Marko Vendelin <markov@ioc.ee>
1017 * src/frontends/gnome/FormIndex.C
1018 * src/frontends/gnome/FormIndex.h
1019 * src/frontends/gnome/FormToc.C
1020 * src/frontends/gnome/FormToc.h
1021 * src/frontends/gnome/dialogs
1022 * src/frontends/gnome/diatoc_callbacks.c
1023 * src/frontends/gnome/diatoc_callbacks.h
1024 * src/frontends/gnome/diainsertindex_callbacks.h
1025 * src/frontends/gnome/diainsertindex_callbacks.c
1026 * src/frontends/gnome/diainsertindex_interface.c
1027 * src/frontends/gnome/diainsertindex_interface.h
1028 * src/frontends/gnome/diatoc_interface.h
1029 * src/frontends/gnome/diatoc_interface.c
1030 * src/frontends/gnome/Makefile.am: Table of Contents and
1031 Insert Index dialogs implementation for Gnome frontend
1033 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
1035 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
1037 * src/frontends/gnome/diainserturl_interface.c: make the dialog
1040 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
1042 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
1043 destructor. Don't definde if you don't need it
1044 (processEvents): made static, non-blocking events processing for
1046 (runTime): static method. event loop for xforms
1047 * similar as above for kde and gnome.
1049 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
1050 new Pimpl is correct
1051 (runTime): new method calss the real frontends runtime func.
1053 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
1055 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1057 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
1059 2000-08-16 Juergen Vigna <jug@sad.it>
1061 * src/lyx_gui.C (runTime): added GUII RunTime support.
1063 * src/frontends/Makefile.am:
1064 * src/frontends/GUIRunTime.[Ch]:
1065 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
1066 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
1067 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
1069 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
1071 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
1072 as this is already set in ${FRONTEND_INCLUDE} if needed.
1074 * configure.in (CPPFLAGS): setting the include dir for the frontend
1075 directory and don't set FRONTEND=xforms for now as this is executed
1078 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
1080 * src/frontends/kde/Makefile.am:
1081 * src/frontends/kde/FormUrl.C:
1082 * src/frontends/kde/FormUrl.h:
1083 * src/frontends/kde/formurldialog.h:
1084 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
1086 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
1088 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
1090 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
1092 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
1095 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
1097 * src/WorkArea.C (work_area_handler): more work to get te
1098 FL_KEYBOARD to work with xforms 0.88 too, please test.
1100 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
1102 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
1104 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
1107 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1109 * src/Timeout.h: remove Qt::emit hack.
1111 * several files: changes to allo doc++ compilation
1113 * src/lyxfunc.C (processKeySym): new method
1114 (processKeyEvent): comment out if FL_REVISION < 89
1116 * src/WorkArea.C: change some debugging levels.
1117 (WorkArea): set wantkey to FL_KEY_ALL
1118 (work_area_handler): enable the FL_KEYBOARD clause, this enables
1119 clearer code and the use of compose with XForms 0.89. Change to
1120 use signals instead of calling methods in bufferview directly.
1122 * src/Painter.C: change some debugging levels.
1124 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
1127 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
1128 (workAreaKeyPress): new method
1130 2000-08-14 Juergen Vigna <jug@sad.it>
1132 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
1134 * config/kde.m4: addes some features
1136 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
1137 include missing xforms dialogs.
1139 * src/Timeout.h: a hack to be able to compile with qt/kde.
1141 * sigc++/.cvsignore: added acinclude.m4
1143 * lib/.cvsignore: added listerros
1145 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
1146 xforms tree as objects are needed for other frontends.
1148 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
1149 linking with not yet implemented xforms objects.
1151 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
1153 2000-08-14 Baruch Even <baruch.even@writeme.com>
1155 * src/frontends/xforms/FormGraphics.h:
1156 * src/frontends/xforms/FormGraphics.C:
1157 * src/frontends/xforms/RadioButtonGroup.h:
1158 * src/frontends/xforms/RadioButtonGroup.C:
1159 * src/insets/insetgraphics.h:
1160 * src/insets/insetgraphics.C:
1161 * src/insets/insetgraphicsParams.h:
1162 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
1163 instead of spaces, and various other indentation issues to make the
1164 sources more consistent.
1166 2000-08-14 Marko Vendelin <markov@ioc.ee>
1168 * src/frontends/gnome/dialogs/diaprint.glade
1169 * src/frontends/gnome/FormPrint.C
1170 * src/frontends/gnome/FormPrint.h
1171 * src/frontends/gnome/diaprint_callbacks.c
1172 * src/frontends/gnome/diaprint_callbacks.h
1173 * src/frontends/gnome/diaprint_interface.c
1174 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
1177 * src/frontends/gnome/dialogs/diainserturl.glade
1178 * src/frontends/gnome/FormUrl.C
1179 * src/frontends/gnome/FormUrl.h
1180 * src/frontends/gnome/diainserturl_callbacks.c
1181 * src/frontends/gnome/diainserturl_callbacks.h
1182 * src/frontends/gnome/diainserturl_interface.c
1183 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
1184 Gnome implementation
1186 * src/frontends/gnome/Dialogs.C
1187 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
1188 all other dialogs. Copy all unimplemented dialogs from Xforms
1191 * src/frontends/gnome/support.c
1192 * src/frontends/gnome/support.h: support files generated by Glade
1196 * config/gnome.m4: Gnome configuration scripts
1198 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
1199 configure --help message
1201 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
1202 only if there are no events pendling in Gnome/Gtk. This enhances
1203 the performance of menus.
1206 2000-08-14 Allan Rae <rae@lyx.org>
1208 * lib/Makefile.am: listerrors cleaning
1210 * lib/listerrors: removed -- generated file
1211 * acinclude.m4: ditto
1212 * sigc++/acinclude.m4: ditto
1214 * src/frontends/xforms/forms/form_citation.fd:
1215 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
1218 * src/frontends/xforms/forms/makefile: I renamed the `install` target
1219 `updatesrc` and now we have a `test` target that does what `updatesrc`
1220 used to do. I didn't like having an install target that wasn't related
1223 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
1224 on all except FormGraphics. This may yet happen. Followed by a major
1225 cleanup including using FL_TRANSIENT for most of the dialogs. More
1226 changes to come when the ButtonController below is introduced.
1228 * src/frontends/xforms/ButtonController.h: New file for managing up to
1229 four buttons on a dialog according to an externally defined policy.
1230 * src/frontends/xforms/Makefile.am: added above
1232 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
1233 Apply and Cancel/Close buttons and everything in between and beyond.
1234 * src/frontends/Makefile.am: added above.
1236 * src/frontends/xforms/forms/form_preferences.fd:
1237 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
1238 and removed variable 'status' as a result. Fixed the set_minsize thing.
1239 Use the new screen-font-update after checking screen fonts were changed
1240 Added a "Restore" button to restore the original lyxrc values while
1241 editing. This restores everything not just the last input changed.
1242 That's still a tricky one. As is the "LyX: this shouldn't happen..."
1244 * src/LyXAction.C: screen-font-update added for updating buffers after
1245 screen font settings have been changed.
1246 * src/commandtags.h: ditto
1247 * src/lyxfunc.C: ditto
1249 * forms/lyx.fd: removed screen fonts dialog.
1250 * src/lyx_gui.C: ditto
1251 * src/menus.[Ch]: ditto
1252 * src/lyx.[Ch]: ditto
1253 * src/lyx_cb.C: ditto + code from here moved to make
1254 screen-font-update. And people wonder why progress on GUII is
1255 slow. Look at how scattered this stuff was! It takes forever
1258 * forms/fdfix.sh: Fixup the spacing after commas.
1259 * forms/makefile: Remove date from generated files. Fewer clashes now.
1260 * forms/bullet_forms.C.patch: included someones handwritten changes
1262 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
1263 once I've discovered why LyXRC was made noncopyable.
1264 * src/lyx_main.C: ditto
1266 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
1268 * src/frontends/xforms/forms/fdfix.sh:
1269 * src/frontends/xforms/forms/fdfixh.sed:
1270 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
1271 * src/frontends/xforms/Form*.[hC]:
1272 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
1273 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
1274 provide a destructor for the struct FD_form_xxxx. Another version of
1275 the set_[max|min]size workaround and a few other cleanups. Actually,
1276 Angus' patch from 20000809.
1278 2000-08-13 Baruch Even <baruch.even@writeme.com>
1280 * src/insets/insetgraphics.C (Clone): Added several fields that needed
1283 2000-08-11 Juergen Vigna <jug@sad.it>
1285 * src/insets/insetgraphics.C (InsetGraphics): changing init
1286 order because of warnings.
1288 * src/frontends/xforms/forms/makefile: adding patching .C with
1291 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
1292 from .C.patch to .c.patch
1294 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
1295 order because of warning.
1297 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
1299 * src/frontends/Liason.C (setMinibuffer): new helper function
1301 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
1303 * src/lyxfunc.C (Dispatch): calling new Document-Layout
1305 * lib/ui/default.ui: commented out PaperLayout entry
1307 * src/frontends/xforms/form_document.[Ch]: new added files
1309 * src/frontends/xforms/FormDocument.[Ch]: ditto
1311 * src/frontends/xforms/forms/form_document.fd: ditto
1313 * src/frontends/xforms/forms/form_document.C.patch: ditto
1315 2000-08-10 Juergen Vigna <jug@sad.it>
1317 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
1318 (InsetGraphics): initialized cacheHandle to 0.
1319 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
1321 2000-08-10 Baruch Even <baruch.even@writeme.com>
1323 * src/graphics/GraphicsCache.h:
1324 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
1325 correctly as a cache.
1327 * src/graphics/GraphicsCacheItem.h:
1328 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
1331 * src/graphics/GraphicsCacheItem_pimpl.h:
1332 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
1335 * src/insets/insetgraphics.h:
1336 * src/insets/insetgraphics.C: Changed from using a signal notification
1337 to polling when image is not loaded.
1339 2000-08-10 Allan Rae <rae@lyx.org>
1341 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
1342 that there are two functions that have to been taken out of line by
1343 hand and aren't taken care of in the script. (Just a reminder note)
1345 * sigc++/macros/*.h.m4: Updated as above.
1347 2000-08-09 Juergen Vigna <jug@sad.it>
1349 * src/insets/insettext.C (draw): small fix for clearing rectangle.
1351 * src/insets/insettabular.C: make drawing of single cell smarter.
1353 2000-08-09 Marko Vendelin <markov@ioc.ee>
1354 * src/frontends/gnome/Menubar_pimpl.C
1355 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
1356 implementation: new files
1358 * src/frontends/gnome/mainapp.C
1359 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
1362 * src/main.C: create Gnome main window
1364 * src/frontends/xforms/Menubar_pimpl.h
1365 * src/frontends/Menubar.C
1366 * src/frontends/Menubar.h: added method Menubar::update that calls
1367 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
1369 * src/LyXView.C: calls Menubar::update to update the state
1372 * src/frontends/gnome/Makefile.am: added new files
1374 * src/frontends/Makefile.am: added frontend compiler options
1376 2000-08-08 Juergen Vigna <jug@sad.it>
1378 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
1380 * src/bufferlist.C (close):
1381 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
1382 documents if exiting without saving.
1384 * src/buffer.C (save): use removeAutosaveFile()
1386 * src/support/filetools.C (removeAutosaveFile): new function.
1388 * src/lyx_cb.C (MenuWrite): returns a bool now.
1389 (MenuWriteAs): check if file could really be saved and revert to the
1391 (MenuWriteAs): removing old autosavefile if existant.
1393 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
1394 before Goto toggle declaration, because of compiler warning.
1396 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
1398 * src/lyxfunc.C (MenuNew): small fix.
1400 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
1402 * src/bufferlist.C (newFile):
1403 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
1405 * src/lyxrc.C: added new_ask_filename tag
1407 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
1409 * src/lyx.fd: removed code pertaining to form_ref
1410 * src/lyx.[Ch]: ditto
1411 * src/lyx_cb.C: ditto
1412 * src/lyx_gui.C: ditto
1413 * src/lyx_gui_misc.C: ditto
1415 * src/BufferView_pimpl.C (restorePosition): update buffer only
1418 * src/commandtags.h (LFUN_REFTOGGLE): removed
1419 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
1420 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
1421 (LFUN_REFBACK): renamed LFUN_REF_BACK
1423 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
1424 * src/menus.C: ditto
1425 * src/lyxfunc.C (Dispatch): ditto.
1426 InsertRef dialog is now GUI-independent.
1428 * src/texrow.C: added using std::endl;
1430 * src/insets/insetref.[Ch]: strip out large amounts of code.
1431 The inset is now a container and this functionality is now
1432 managed by a new FormRef dialog
1434 * src/frontends/Dialogs.h (showRef, createRef): new signals
1436 * src/frontends/xforms/FormIndex.[Ch],
1437 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
1438 when setting dialog's min/max size
1439 * src/frontends/xforms/FormIndex.[Ch]: ditto
1441 * src/frontends/xforms/FormRef.[Ch],
1442 src/frontends/xforms/forms/form_ref.fd: new xforms
1443 implementation of an InsetRef dialog
1445 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
1448 * src/graphics/XPM_Renderer.C (isImageFormatOK):
1449 ios::nocreate is not part of the standard. Removed.
1451 2000-08-07 Baruch Even <baruch.even@writeme.com>
1453 * src/graphics/Renderer.h:
1454 * src/graphics/Renderer.C: Added base class for rendering of different
1455 image formats into Pixmaps.
1457 * src/graphics/XPM_Renderer.h:
1458 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
1459 in a different class.
1461 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
1462 easily add support for other formats.
1464 * src/insets/figinset.C: plugged a leak of an X resource.
1466 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
1468 * src/CutAndPaste.[Ch]: make all metods static.
1470 * development/Code_rules/Rules: more work, added section on
1471 Exceptions, and a References section.
1473 * a lot of header files: work to make doc++ able to generate the
1474 source documentation, some workarounds of doc++ problems. Doc++ is
1475 now able to generate the documentation.
1477 2000-08-07 Juergen Vigna <jug@sad.it>
1479 * src/insets/insettabular.C (recomputeTextInsets): removed function
1481 * src/tabular.C (SetWidthOfMulticolCell):
1483 (calculate_width_of_column_NMC): fixed return value so that it really
1484 only returns true if the column-width has changed (there where
1485 problems with muliticolumn-cells in this column).
1487 2000-08-04 Juergen Vigna <jug@sad.it>
1489 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
1490 also on the scrollstatus of the inset.
1491 (workAreaMotionNotify): ditto.
1493 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
1495 2000-08-01 Juergen Vigna <jug@sad.it>
1497 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
1499 * src/commandtags.h:
1500 * src/LyXAction.C (init):
1501 * src/insets/inset.C (LocalDispatch): added support for
1504 * src/insets/inset.C (scroll): new functions.
1506 * src/insets/insettext.C (removeNewlines): new function.
1507 (SetAutoBreakRows): removes forced newlines in the text of the
1508 paragraph if autoBreakRows is set to false.
1510 * src/tabular.C (Latex): generates a parbox around the cell contents
1513 * src/frontends/xforms/FormTabular.C (local_update): removed
1514 the radio_useparbox button.
1516 * src/tabular.C (UseParbox): new function
1518 2000-08-06 Baruch Even <baruch.even@writeme.com>
1520 * src/graphics/GraphicsCache.h:
1521 * src/graphics/GraphicsCache.C:
1522 * src/graphics/GraphicsCacheItem.h:
1523 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
1526 * src/insets/insetgraphics.h:
1527 * src/insets/insetgraphics.C: Added the use of the GraphicsCache and the
1528 drawing of the inline image.
1530 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be loaded
1531 into the wrong position.
1533 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
1536 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
1538 * src/support/translator.h: move all typedefs to public section
1540 * src/support/filetools.C (MakeLatexName): return string const
1542 (TmpFileName): ditto
1543 (FileOpenSearch): ditto
1545 (LibFileSearch): ditto
1546 (i18nLibFileSearch): ditto
1549 (CreateTmpDir): ditto
1550 (CreateBufferTmpDir): ditto
1551 (CreateLyXTmpDir): ditto
1554 (MakeAbsPath): ditto
1556 (OnlyFilename): ditto
1558 (NormalizePath): ditto
1559 (CleanupPath): ditto
1560 (GetFileContents): ditto
1561 (ReplaceEnvironmentPath): ditto
1562 (MakeRelPath): ditto
1564 (ChangeExtension): ditto
1565 (MakeDisplayPath): ditto
1566 (do_popen): return cmdret const
1567 (findtexfile): return string const
1569 * src/support/DebugStream.h: add some /// to please doc++
1571 * src/frontends/DialogBase.h (endif): add some /// to please doc++
1573 * src/texrow.C (same_rownumber): functor to use with find_if
1574 (getIdFromRow): rewritten to use find_if and to not update the
1575 positions. return true if row is found
1576 (increasePos): new method, use to update positions
1578 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
1580 * src/lyxlex_pimpl.C (verifyTable): new method
1583 (GetString): return string const
1584 (pushTable): rewrite to use std::stack
1586 (setFile): better check
1589 * src/lyxlex.h: make LyXLex noncopyable
1591 * src/lyxlex.C (text): return char const * const
1592 (GetString): return string const
1593 (getLongString): return string const
1595 * src/lyx_gui_misc.C (askForText): return pair<...> const
1597 * src/lastfiles.[Ch] (operator): return string const
1599 * src/buffer.C (parseSingleLyXformat2Token): pass string to
1600 istringstream not char const *.
1601 move token.end() out of loop.
1602 (readFile): move initializaton of token
1604 * src/BufferView2.C (insertErrors): run texrow.increasePos if
1605 getIdFromRow is successful.
1607 * lib/bind/emacs.bind: don't include menus bind
1609 * development/Code_rules/Rules: the beginnings of making this
1610 better and covering more of the unwritten rules that we have.
1612 * development/Code_rules/Recommendations: a couple of wording
1615 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1617 * src/support/strerror.c: remove C++ comment.
1619 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
1621 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
1622 LFUN_INDEX_INSERT_LAST
1624 * src/texrow.C (getIdFromRow): changed from const_iterator to
1625 iterator, allowing code to compile with DEC cxx
1627 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
1628 stores part of the class, as suggested by Allan. Will allow
1630 (apply): test to apply uses InsetCommandParams operator!=
1632 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
1633 (apply): test to apply uses InsetCommandParams operator!=
1635 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
1636 stores part of the class.
1637 (update): removed limits on min/max size.
1639 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
1640 (apply): test to apply uses InsetCommandParams operator!=
1642 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
1643 (Read, Write, scanCommand, getCommand): moved functionality
1644 into InsetCommandParams.
1646 (getScreenLabel): made pure virtual
1647 new InsetCommandParams operators== and !=
1649 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
1650 c-tors based on InsetCommandParams. Removed others.
1651 * src/insets/insetinclude.[Ch]: ditto
1652 * src/insets/insetlabel.[Ch]: ditto
1653 * src/insets/insetparent.[Ch]: ditto
1654 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
1656 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
1657 insets derived from InsetCommand created using similar c-tors
1658 based on InsetCommandParams
1659 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
1660 * src/menus.C (ShowRefsMenu): ditto
1661 * src/paragraph.C (Clone): ditto
1662 * src/text2.C (SetCounter): ditto
1663 * src/lyxfunc.C (Dispatch) ditto
1664 Also recreated old InsetIndex behaviour exactly. Can now
1665 index-insert at the start of a paragraph and index-insert-last
1666 without launching the pop-up.
1668 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
1670 * lib/lyxrc.example: mark te pdf options as non functional.
1672 * src/support/lstrings.C (strToInt): move initalization of tmpstr
1673 (isStrDbl): move tmpstr.end() out of loop.
1674 (strToDbl): move intialization of tmpstr
1675 (lowercase): return string const and move tmp.end() out of loop.
1676 (uppercase): return string const and move tmp.edn() out of loop.
1677 (prefixIs): add assertion
1682 (containsOnly): ditto
1683 (containsOnly): ditto
1684 (containsOnly): ditto
1685 (countChar): make last arg char not char const
1686 (token): return string const
1687 (subst): return string const, move tmp.end() out of loop.
1688 (subst): return string const, add assertion
1689 (strip): return string const
1690 (frontStrip): return string const, add assertion
1691 (frontStrip): return string const
1696 * src/support/lstrings.C: add inclde "LAssert.h"
1697 (isStrInt): move tmpstr.end() out of loop.
1699 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
1700 toollist.end() out of loop.
1701 (deactivate): move toollist.end() out of loop.
1702 (update): move toollist.end() out of loop.
1703 (updateLayoutList): move tc.end() out of loop.
1704 (add): move toollist.end() out of loop.
1706 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
1707 md.end() out of loop.
1709 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
1711 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
1714 * src/paragraph.C (Erase): move fontlist.end() out of loop.
1715 (Erase): move insetlist.end() out of loop.
1717 * src/lyx_sendfax_main.C: make show_logfile static and to take a
1718 ref to const string as first arg. Move initialization of some
1719 variables, whitespace changes.
1721 * src/kbmap.C (defkey): move table.end() out of loop.
1722 (kb_keymap): move table.end() out of loop.
1723 (findbinding): move table.end() out of loop.
1725 * src/MenuBackend.C (hasMenu): move end() out of loop.
1726 (getMenu): move end() out of loop.
1727 (getMenu): move menulist_.end() out of loop.
1729 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
1731 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
1734 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
1735 (getFromLyXName): move infotab.end() out of loop.
1737 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
1738 -fvtable-thunks -ffunction-sections -fdata-sections
1740 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
1742 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
1745 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1747 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
1749 * src/frontends/xforms/FormCitation.[Ch],
1750 src/frontends/xforms/FormIndex.[Ch],
1751 src/frontends/xforms/FormToc.[Ch],
1752 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
1754 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
1756 * src/commandtags.h: renamed, created some flags for citation
1759 * src/lyx_gui_misc.C: stripped out old FD_index_form code
1761 * src/lyxfunc.C (dispatch): use signals to insert index entry
1763 * src/frontends/Dialogs.h: new signal createIndex
1765 * src/frontends/xforms/FormCommand.[Ch],
1766 src/frontends/xforms/FormCitation.[Ch],
1767 src/frontends/xforms/FormToc.[Ch],
1768 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
1770 * src/insets/insetindex.[Ch]: GUI-independent
1772 * src/frontends/xforms/FormIndex.[Ch],
1773 * src/frontends/xforms/forms/form_index.fd: xforms implementation
1776 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
1778 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
1779 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
1781 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1783 * src/insets/insetref.C (Latex): rewrite so that there is now
1784 question that a initialization is requested.
1786 * src/insets/insetcommand.h: reenable the hide signal
1788 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1790 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
1791 fix handling of shortcuts (many bugs :)
1792 (add_lastfiles): ditto.
1794 * lib/ui/default.ui: fix a few shortcuts.
1796 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
1798 * Makefile.am: Fix ``rpmdist'' target to return the exit
1799 status of the ``rpm'' command, instead of the last command in
1800 the chain (the ``rm lyx.xpm'' command, which always returns
1803 2000-08-02 Allan Rae <rae@lyx.org>
1805 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
1806 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
1807 * src/frontends/xforms/FormToc.C (FormToc): ditto
1809 * src/frontends/xforms/Makefile.am: A few forgotten files
1811 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
1812 Signals-not-copyable-problem Lars' started commenting out.
1814 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
1816 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1818 * src/insets/insetcommand.h: Signals is not copyable so anoter
1819 scheme for automatic hiding of forms must be used.
1821 * src/frontends/xforms/FormCitation.h: don't inerit from
1822 noncopyable, FormCommand already does that.
1823 * src/frontends/xforms/FormToc.h: ditto
1824 * src/frontends/xforms/FormUrl.h: ditto
1826 * src/frontends/xforms/FormCitation.C: add include <algorithm>
1828 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
1830 * src/insets/insetcommand.h (hide): new SigC::Signal0
1831 (d-tor) new virtual destructor emits hide signal
1833 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
1834 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
1836 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
1837 LOF and LOT. Inset is now GUI-independent
1839 * src/insets/insetloa.[Ch]: redundant
1840 * src/insets/insetlof.[Ch]: ditto
1841 * src/insets/insetlot.[Ch]: ditto
1843 * src/frontends/xforms/forms/form_url.fd: tweaked!
1844 * src/frontends/xforms/forms/form_citation.fd: ditto
1846 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
1847 dialogs dealing with InsetCommand insets
1849 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
1850 FormCommand base class
1851 * src/frontends/xforms/FormUrl.[Ch]: ditto
1853 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
1855 * src/frontends/xforms/FormToc.[Ch]: ditto
1857 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
1858 passed a generic InsetCommand pointer
1859 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
1861 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
1862 and modified InsetTOC class
1863 * src/buffer.C: ditto
1865 * forms/lyx.fd: strip out old FD_form_toc code
1866 * src/lyx_gui_misc.C: ditto
1867 * src/lyx_gui.C: ditto
1868 * src/lyx_cb.C: ditto
1869 * src/lyx.[Ch]: ditto
1871 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
1873 * src/support/utility.hpp: tr -d '\r'
1875 2000-08-01 Juergen Vigna <jug@sad.it>
1877 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
1879 * src/commandtags.h:
1880 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
1881 LFUN_TABULAR_FEATURES.
1883 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
1884 LFUN_LAYOUT_TABULAR.
1886 * src/insets/insettabular.C (getStatus): implemented helper function.
1888 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
1890 2000-07-31 Juergen Vigna <jug@sad.it>
1892 * src/text.C (draw): fixed screen update problem for text-insets.
1894 * src/text2.C (SetParagrpah): call an update of the inset-owner when
1895 something changed probably this has to be added in various other
1898 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
1900 2000-07-31 Baruch Even <baruch.even@writeme.com>
1902 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
1903 templates to satisfy compaq cxx.
1906 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
1908 * src/support/translator.h (equal_1st_in_pair::operator()): take
1909 const ref pair_type as arg.
1910 (equal_2nd_in_pair::operator()): ditto
1911 (Translator::~Translator): remove empty d-tor.
1913 * src/graphics/GraphicsCache.C: move include config.h to top, also
1914 put initialization of GraphicsCache::singleton here.
1915 (~GraphicsCache): move here
1916 (addFile): take const ref as arg
1919 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
1921 * src/BufferView2.C (insertLyXFile): change te with/without header
1924 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1926 * src/frontends/xforms/FormGraphics.C (apply): add some
1927 static_cast. Not very nice, but required by compaq cxx.
1929 * src/frontends/xforms/RadioButtonGroup.h: include header
1930 <utility> instead of <pair.h>
1932 * src/insets/insetgraphicsParams.C: add using directive.
1933 (readResize): change return type to void.
1934 (readOrigin): ditto.
1936 * src/lyxfunc.C (getStatus): add missing break for build-program
1937 function; add test for Literate for export functions.
1939 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
1940 entries in Options menu.
1942 2000-07-31 Baruch Even <baruch.even@writeme.com>
1944 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
1945 protect against auto-allocation; release icon when needed.
1947 2000-07-31 Matej Cepl <CeplM@seznam.cz>
1949 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
1950 on usual typewriter.
1952 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
1953 earlier czech.kmap), useful only for programming.
1955 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1957 * src/frontends/xforms/FormCitation.h: fix conditioning around
1960 2000-07-31 Juergen Vigna <jug@sad.it>
1962 * src/frontends/xforms/FormTabular.C (local_update): changed
1963 radio_linebreaks to radio_useparbox and added radio_useminipage.
1965 * src/tabular.C: made support for using minipages/parboxes.
1967 * src/bufferlist.C (QwriteAll): small fix for asking for save.
1969 * src/insets/insetgraphics.C (draw): just draw the inset so that the
1971 (descent): so the cursor is in the middle.
1972 (width): bit smaller box.
1974 * src/insets/insetgraphics.h: added display() function.
1976 2000-07-31 Baruch Even <baruch.even@writeme.com>
1978 * src/frontends/Dialogs.h: Added showGraphics signals.
1980 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
1981 xforms form definition of the graphics dialog.
1983 * src/frontends/xforms/FormGraphics.h:
1984 * src/frontends/xforms/FormGraphics.C: Added files, the
1985 GUIndependent code of InsetGraphics
1987 * src/insets/insetgraphics.h:
1988 * src/insets/insetgraphics.C: Major writing to make it work.
1990 * src/insets/insetgraphicsParams.h:
1991 * src/insets/insetgraphicsParams.C: Added files, parameter passing
1992 struct between InsetGraphics and GUI.
1994 * src/LaTeXFeatures.h:
1995 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
1996 support for graphicx package.
1998 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
1999 for the graphics inset.
2001 * src/support/translator.h: Added file, used in
2002 InsetGraphicsParams. this is a template to translate between two
2005 * src/frontends/xforms/RadioButtonGroup.h:
2006 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
2007 way to easily control a radio button group.
2009 2000-07-28 Juergen Vigna <jug@sad.it>
2011 * src/insets/insettabular.C (LocalDispatch):
2012 (TabularFeatures): added support for lyx-functions of tabular features.
2013 (cellstart): refixed this function after someone wrongly changed it.
2015 * src/commandtags.h:
2016 * src/LyXAction.C (init): added support for tabular-features
2018 2000-07-28 Allan Rae <rae@lyx.org>
2020 * src/frontends/xforms/FormPreferences.C (build): Setup input return
2021 checking. NOTE: It seems that pressing ESC to cancel the dialog also
2022 triggers the callback for input checking. As a result we sometimes get
2023 "LyX: This shouldn't happen..." printed to cerr.
2024 (input): Started using status variable since I only free() on
2025 destruction. Some input checking for paths and font sizes.
2027 * src/frontends/xforms/FormPreferences.h: Use status to control
2028 activation of Ok and Apply
2030 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
2031 callback. Also resized to stop segfaults with 0.88. The problem is
2032 that xforms-0.88 requires the folder to be wide enough to fit all the
2033 tabs. If it isn't it causes all sorts of problems.
2035 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
2037 * src/frontends/xforms/forms/README: Reflect reality.
2039 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
2040 * src/frontends/xforms/forms/makefile: ditto.
2042 * src/commandtags.h: Get access to new Preferences dialog
2043 * src/LyXAction.C: ditto
2044 * src/lyxfunc.C: ditto
2045 * lib/ui/default.ui: ditto
2047 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2049 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
2051 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
2054 * src/frontends/xforms/form_url.[Ch]: added.
2056 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
2058 * src/insets/insetbib.h: fixed bug in previous commit
2060 * src/frontends/xforms/FormUrl.h: ditto
2062 * src/frontends/xforms/FormPrint.h: ditto
2064 * src/frontends/xforms/FormPreferences.h: ditto
2066 * src/frontends/xforms/FormCopyright.h: ditto
2068 * src/frontends/xforms/FormCitation.C: ditto
2070 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
2071 private copyconstructor and private default contructor
2073 * src/support/Makefile.am: add utility.hpp
2075 * src/support/utility.hpp: new file from boost
2077 * src/insets/insetbib.h: set owner in clone
2079 * src/frontends/xforms/FormCitation.C: added missing include
2082 * src/insets/form_url.[Ch]: removed
2084 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
2086 * development/lyx.spec.in
2087 * Makefile.am: Fix buglet for LyX RPM generation resulting from
2088 file/directory re-organization.
2090 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
2092 * src/insets/insetcommand.[Ch]: moved the string data and
2093 associated manipulation methods into a new stand-alone class
2094 InsetCommandParams. This class has two additional methods
2095 getAsString() and setFromString() allowing the contents to be
2096 moved around as a single string.
2097 (addContents) method removed.
2098 (setContents) method no longer virtual.
2100 * src/buffer.C (readInset): made use of new InsetCitation,
2101 InsetUrl constructors based on InsetCommandParams.
2103 * src/commandtags.h: add LFUN_INSERT_URL
2105 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
2106 independent InsetUrl and use InsetCommandParams to extract
2107 string info and create new Insets.
2109 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
2111 * src/frontends/xforms/FormCitation.C (apply): uses
2114 * src/frontends/xforms/form_url.C
2115 * src/frontends/xforms/form_url.h
2116 * src/frontends/xforms/FormUrl.h
2117 * src/frontends/xforms/FormUrl.C
2118 * src/frontends/xforms/forms/form_url.fd: new files
2120 * src/insets/insetcite.[Ch]: removed unused constructors.
2122 * src/insets/insetinclude.[Ch]: no longer store filename
2124 * src/insets/inseturl.[Ch]: GUI-independent.
2126 2000-07-26 Juergen Vigna <jug@sad.it>
2127 * renamed frontend from gtk to gnome as it is that what is realized
2128 and did the necessary changes in the files.
2130 2000-07-26 Marko Vendelin <markov@ioc.ee>
2132 * configure.in: cleaning up gnome configuration scripts
2134 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2136 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
2137 shortcuts syndrom by redrawing them explicitely (a better solution
2138 would be appreciated).
2140 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
2142 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
2145 * src/lyx_cb.C (MenuExport): change html export to do the right
2146 thing depending of the document type (instead of having
2147 html-linuxdoc and html-docbook).
2148 * src/lyxfunc.C (getStatus): update for html
2149 * lib/ui/default.ui: simplify due to the above change.
2150 * src/menus.C (ShowFileMenu): update too (in case we need it).
2152 * src/MenuBackend.C (read): if a menu is defined twice, add the
2153 new entries to the exiting one.
2155 2000-07-26 Juergen Vigna <jug@sad.it>
2157 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
2159 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
2160 and return a bool if it did actual save the file.
2161 (AutoSave): don't autosave a unnamed doc.
2163 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
2164 check if this is an UNNAMED new file and react to it.
2165 (newFile): set buffer to unnamed and change to not mark a new
2166 buffer dirty if I didn't do anything with it.
2168 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
2170 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
2172 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
2173 friend as per Angus's patch posted to lyx-devel.
2175 * src/ext_l10n.h: updated
2177 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
2178 gettext on the style string right before inserting them into the
2181 * autogen.sh: add code to extract style strings form layout files,
2182 not good enough yet.
2184 * src/frontends/gtk/.cvsignore: add MAKEFILE
2186 * src/MenuBackend.C (read): run the label strings through gettext
2187 before storing them in the containers.
2189 * src/ext_l10n.h: new file
2191 * autogen.sh : generate the ext_l10n.h file here
2193 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2195 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
2198 * lib/ui/default.ui: fix a couple of typos.
2200 * config/gnome/gtk.m4: added (and added to the list of files in
2203 * src/insets/insetinclude.C (unique_id): fix when we are using
2204 lyxstring instead of basic_string<>.
2205 * src/insets/insettext.C (LocalDispatch): ditto.
2206 * src/support/filetools.C: ditto.
2208 * lib/configure.m4: create the ui/ directory if necessary.
2210 * src/LyXView.[Ch] (updateToolbar): new method.
2212 * src/BufferView_pimpl.C (buffer): update the toolbar when
2213 opening/closing buffer.
2215 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2217 * src/LyXAction.C (getActionName): enhance to return also the name
2218 and options of pseudo-actions.
2219 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
2221 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
2222 as an example of what is possible). Used in File->Build too (more
2223 useful) and in the import/export menus (to mimick the complicated
2224 handling of linuxdoc and friends). Try to update all the entries.
2226 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
2229 * src/MenuBackend.C (read): Parse the new OptItem tag.
2231 * src/MenuBackend.h: Add a new optional_ data member (used if the
2232 entry should be omitted when the lyxfunc is disabled).
2234 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
2235 function, used as a shortcut.
2236 (create_submenu): align correctly the shortcuts on the widest
2239 * src/MenuBackend.h: MenuItem.label() only returns the label of
2240 the menu without shortcut; new method shortcut().
2242 2000-07-14 Marko Vendelin <markov@ioc.ee>
2244 * src/frontends/gtk/Dialogs.C:
2245 * src/frontends/gtk/FormCopyright.C:
2246 * src/frontends/gtk/FormCopyright.h:
2247 * src/frontends/gtk/Makefile.am: added these source-files for the
2248 Gtk/Gnome support of the Copyright-Dialog.
2250 * src/main.C: added Gnome::Main initialization if using
2251 Gtk/Gnome frontend-GUI.
2253 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
2255 * config/gnome/aclocal-include.m4
2256 * config/gnome/compiler-flags.m4
2257 * config/gnome/curses.m4
2258 * config/gnome/gnome--.m4
2259 * config/gnome/gnome-bonobo-check.m4
2260 * config/gnome/gnome-common.m4
2261 * config/gnome/gnome-fileutils.m4
2262 * config/gnome/gnome-ghttp-check.m4
2263 * config/gnome/gnome-gnorba-check.m4
2264 * config/gnome/gnome-guile-checks.m4
2265 * config/gnome/gnome-libgtop-check.m4
2266 * config/gnome/gnome-objc-checks.m4
2267 * config/gnome/gnome-orbit-check.m4
2268 * config/gnome/gnome-print-check.m4
2269 * config/gnome/gnome-pthread-check.m4
2270 * config/gnome/gnome-support.m4
2271 * config/gnome/gnome-undelfs.m4
2272 * config/gnome/gnome-vfs.m4
2273 * config/gnome/gnome-x-checks.m4
2274 * config/gnome/gnome-xml-check.m4
2275 * config/gnome/gnome.m4
2276 * config/gnome/gperf-check.m4
2277 * config/gnome/gtk--.m4
2278 * config/gnome/linger.m4
2279 * config/gnome/need-declaration.m4: added configuration scripts
2280 for Gtk/Gnome frontend-GUI
2282 * configure.in: added support for the --with-frontend=gtk option
2284 * autogen.sh: added config/gnome/* to list of config-files
2286 * acconfig.h: added define for GTKGUI-support
2288 * config/lyxinclude.m4: added --with-frontend[=value] option value
2289 for Gtk/Gnome frontend-GUI support.
2291 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2293 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
2297 * src/paragraph.C (GetChar): remove non-const version
2299 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
2300 (search_kw): use it.
2302 * src/lyx_main.C (init): if "preferences" exist, read that instead
2304 (ReadRcFile): return bool if the file could be read ok.
2305 (ReadUIFile): add a check to see if lex file is set ok.
2307 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
2308 bastring can be used instead of lyxstring (still uses the old code
2309 if std::string is good enough or if lyxstring is used.)
2311 * src/encoding.C: make the arrays static, move ininle functions
2313 * src/encoding.h: from here.
2315 * src/buffer.C: have last_isnet_read as a file scope variable for now.
2316 (parseSingleLyXformat2Token): move inset parsing to separate method
2317 (readInset): new private method
2319 * src/Variables.h: remove virtual from get().
2321 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
2322 access to NEW_INSETS and NEW_TABULAR
2324 * src/MenuBackend.h: remove superfluous forward declaration of
2325 MenuItem. Add documentations tags "///", remove empty MenuItem
2326 destructor, remove private default contructor.
2328 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
2330 (read): more string mlabel and mname to where they are used
2331 (read): remove unused variables mlabel and mname
2332 (defaults): unconditional clear, make menusetup take advantage of
2333 add returning Menu &.
2335 * src/LyXView.h: define NEW_MENUBAR as default
2337 * src/LyXAction.C: include lyxparagraph.h temporary to get access
2338 to NEW_INSETS and NEW_TABULAR.
2339 (init): commetn out some funcs that is obsolete when NEW_INSETS is
2340 defined. Change some of the "xxxx-inset-insert" functions names to
2343 * several files: more enahncements to NEW_INSETS and the resulting
2346 * lib/lyxrc.example (\date_insert_format): move to misc section
2348 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
2349 bastring and use AC_CACHE_CHECK.
2350 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
2351 the system have the newest methods. uses AC_CACHE_CHECK
2352 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
2353 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
2354 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
2356 * configure.in: add LYX_CXX_GOOD_STD_STRING
2358 * acinclude.m4: recreated
2360 2000-07-24 Amir Karger
2362 * README: add Hebrew, Arabic kmaps
2365 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2367 * src/buffer.C (writeFileAscii): Define actcell as an int instead
2370 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2372 * Lot of files: add pragma interface/implementation.
2374 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
2376 * lib/ui/default.ui: new file (ans new directory). Contains the
2377 default menu and toolbar.
2379 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
2380 global space. Toolbars are now read (as menus) in ui files.
2382 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
2384 * src/lyxfunc.C (getStatus): do not exit immediately if a command
2385 is disabled because the document is read-only. We want to have the
2386 toggle state of the function anyway.
2387 (getStatus): add code for LFUN_VC* functions (mimicking what is
2388 done in old-style menus)
2390 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
2391 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
2393 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
2394 * src/BufferView_pimpl.C: ditto.
2395 * src/lyxfunc.C: ditto.
2397 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
2398 default). This replaces old-style menus by new ones.
2400 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
2401 MenuItem. Contain the data structure of a menu.
2403 * src/insets/insettext.C: use LyXView::setLayout instead of
2404 accessing directly the toolbar combox.
2405 * src/lyxfunc.C (Dispatch): ditto.
2407 * src/LyXView.C (setLayout): new method, which just calls
2408 Toolbar::setLayout().
2409 (updateLayoutChoice): move part of this method in Toolbar.
2411 * src/toolbar.[Ch]: removed.
2413 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
2414 implementation the toolbar.
2416 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
2417 the toolbar. It might make sense to merge it with ToolbarDefaults
2419 (setLayout): new function.
2420 (updateLayoutList): ditto.
2421 (openLayoutList): ditto.
2423 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
2424 xforms implementation of the toolbar.
2425 (get_toolbar_func): comment out, since I do not
2426 know what it is good for.
2428 * src/ToolbarDefaults.h: Add the ItemType enum.
2430 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
2431 for a list of allocated C strings. Used in Menubar xforms
2432 implementation to avoid memory leaks.
2434 * src/support/lstrings.[Ch] (uppercase): new version taking and
2438 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
2439 * lib/bind/emacs.bind: ditto.
2441 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
2443 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
2444 forward decl of LyXView.
2446 * src/toolbar.C (toolbarItem): moved from toolbar.h
2447 (toolbarItem::clean): ditto
2448 (toolbarItem::~toolbarItem): ditto
2449 (toolbarItem::operator): ditto
2451 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
2453 * src/paragraph.h: control the NEW_TABULAR define from here
2455 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
2456 USE_TABULAR_INSETS to NEW_TABULAR
2458 * src/ToolbarDefaults.C: add include "lyxlex.h"
2460 * files using the old table/tabular: use NEW_TABULAR to control
2461 compilation of old tabular stuff.
2463 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
2466 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
2467 planemet in reading of old style floats, fix the \end_deeper
2468 problem when reading old style floats.
2470 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2472 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
2474 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
2476 * lib/bind/sciword.bind: updated.
2478 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
2480 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
2481 layout write problem
2483 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2485 * src/Makefile.am (INCLUDES): remove image directory from include
2488 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
2489 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
2491 * src/LyXView.C (create_form_form_main): read the application icon
2494 * lib/images/*.xpm: change the icons to use transparent color for
2497 * src/toolbar.C (update): change the color of the button when it
2500 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2502 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
2503 setting explicitely the minibuffer.
2504 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
2506 * src/LyXView.C (showState): new function. Shows font information
2507 in minibuffer and update toolbar state.
2508 (LyXView): call Toolbar::update after creating the
2511 * src/toolbar.C: change toollist to be a vector instead of a
2513 (BubbleTimerCB): get help string directly from the callback
2514 argument of the corresponding icon (which is the action)
2515 (set): remove unnecessary ugliness.
2516 (update): new function. update the icons (depressed, disabled)
2517 depending of the status of the corresponding action.
2519 * src/toolbar.h: remove help in toolbarItem
2521 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
2523 * src/Painter.C (text): Added code for using symbol glyphs from
2524 iso10646 fonts. Currently diabled.
2526 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
2529 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
2530 magyar,turkish and usorbian.
2532 * src/paragraph.C (isMultiLingual): Made more efficient.
2534 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
2537 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
2538 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
2539 Also changed the prototype to "bool math_insert_greek(char)".
2541 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
2543 * lots of files: apply the NEW_INSETS on all code that will not be
2544 needed when we move to use the new insets. Enable the define in
2545 lyxparagrah.h to try it.
2547 * src/insets/insettabular.C (cellstart): change to be a static
2549 (InsetTabular): initialize buffer in the initializer list.
2551 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
2553 * src/frontends/xforms/FormPrint.[Ch] : moved #include
2554 form_print.h out of the header file. Replaced with forward
2555 declarations of the relevant struct.
2557 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
2560 * src/commandtags.h: do not include "debug.h" which does not
2561 belong there. #include it in some other places because of this
2564 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2566 * src/insets/insetcaption.C: add a couple "using" directives.
2568 * src/toolbar.C (add): get the help text directly from lyxaction.
2570 (setPixmap): new function. Loads from disk and sets a pixmap on a
2571 botton; the name of the pixmap file is derived from the command
2574 * src/toolbar.h: remove members isBitmap and pixmap from
2577 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
2578 * lib/images/: move many files from images/banner.xpm.
2580 * src/lyx_gui.C (create_forms): read banner pixmap from file.
2582 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
2583 * src/toolbar.C: ditto.
2584 * configure.in: ditto.
2585 * INSTALL: document.
2587 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
2588 the spellchecker popup is closed from the WM.
2590 2000-07-19 Juergen Vigna <jug@sad.it>
2592 * src/insets/insetfloat.C (Write): small fix because we use the
2593 insetname for the type now!
2595 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
2597 * src/frontends/xforms/forms/form_citation.fd: object sizes are
2600 * src/frontends/Dialogs.h: removed hideCitation signal
2602 * src/insets/insetcite.h: added hide signal
2604 * src/insets/insetcite.C (~InsetCitation): emits new signal
2605 (getScreenLabel): "intelligent" label should now fit on the screen!
2607 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
2609 * src/frontends/xforms/FormCitation.C (showInset): connects
2610 hide() to the inset's hide signal
2611 (show): modified to use fl_set_object_position rather than
2612 fl_set_object_geometry wherever possible
2614 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
2616 * src/insets/lyxinset.h: add caption code
2618 * src/insets/insetfloat.C (type): new method
2620 * src/insets/insetcaption.C (Write): new method
2622 (LyxCode): new method
2624 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
2625 to get it right together with using the FloatList.
2627 * src/commandtags.h: add LFUN_INSET_CAPTION
2628 * src/lyxfunc.C (Dispatch): handle it
2630 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
2633 * src/Variables.[Ch]: make expand take a const reference, remove
2634 the destructor, some whitespace changes.
2636 * src/LyXAction.C (init): add caption-inset-insert
2638 * src/FloatList.C (FloatList): update the default floats a bit.
2640 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2642 * src/Variables.[Ch]: new files. Intended to be used for language
2643 specific strings (like \chaptername) and filename substitution in
2646 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
2648 * lib/kbd/american.kmap: update
2650 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
2652 * src/bufferparams.[Ch]: remove member allowAccents.
2654 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
2656 * src/LaTeXLog.C: use the log_form.h header.
2657 * src/lyx_gui.C: ditto.
2658 * src/lyx_gui_misc.C: ditto.
2659 * src/lyxvc.h: ditto.
2661 * forms/log_form.fd: new file, created from latexoptions.fd. I
2662 kept the log popup and nuked the options form.
2664 * src/{la,}texoptions.[Ch]: removed.
2665 * src/lyx_cb.C (LaTeXOptions): ditto
2667 * src/lyx_gui.C (create_forms): do not handle the
2668 fd_latex_options form.
2670 2000-07-18 Juergen Vigna <jug@sad.it>
2672 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
2673 name of the inset so that it can be requested outside (text2.C).
2675 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
2678 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2680 * src/mathed/formula.h (ConvertFont): constify
2682 * src/mathed/formula.C (Read): add warning if \end_inset is not
2683 found on expected place.
2685 * src/insets/lyxinset.h (ConvertFont): consify
2687 * src/insets/insetquotes.C (ConvertFont): constify
2688 * src/insets/insetquotes.h: ditto
2690 * src/insets/insetinfo.h: add labelfont
2692 * src/insets/insetinfo.C (InsetInfo): set the labelfont
2693 (ascent): use labelfont
2697 (Write): make .lyx file a bit nicer
2699 * src/insets/insetfloat.C (Write): simplify somewhat...
2700 (Read): add warning if arg is not found
2702 * src/insets/insetcollapsable.C: add using std::max
2703 (Read): move string token and add warning in arg is not found
2704 (draw): use std::max to get the right ty
2705 (getMaxWidth): simplify by using std::max
2707 * src/insets/insetsection.h: new file
2708 * src/insets/insetsection.C: new file
2709 * src/insets/insetcaption.h: new file
2710 * src/insets/insetcaption.C: new file
2712 * src/insets/inset.C (ConvertFont): constify signature
2714 * src/insets/Makefile.am (libinsets_la_SOURCES): add
2715 insetcaption.[Ch] and insetsection.[Ch]
2717 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
2718 uses to use LABEL_COUNTER_CHAPTER instead.
2719 * src/text2.C (SetCounter): here
2721 * src/counters.h: new file
2722 * src/counters.C: new file
2723 * src/Sectioning.h: new file
2724 * src/Sectioning.C: new file
2726 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
2728 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2730 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
2733 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
2736 2000-07-17 Juergen Vigna <jug@sad.it>
2738 * src/tabular.C (Validate): check if array-package is needed.
2739 (SetVAlignment): added support for vertical alignment.
2740 (SetLTFoot): better support for longtable header/footers
2741 (Latex): modified to support added features.
2743 * src/LaTeXFeatures.[Ch]: added array-package.
2745 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
2747 * src/lyx_gui.C (LyXGUI): make sure that the height is large
2750 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
2752 * configure.in: do not forget to put a space after -isystem.
2754 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
2756 * lib/kbd/arabic.kmap: a few fixes.
2758 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2760 * some whitespace chagnes to a number of files.
2762 * src/support/DebugStream.h: change to make it easier for
2763 doc++ to parse correctly.
2764 * src/support/lyxstring.h: ditto
2766 * src/mathed/math_utils.C (compara): change to have only one
2768 (MathedLookupBOP): change because of the above.
2770 * src/mathed/math_delim.C (math_deco_compare): change to have only
2772 (search_deco): change becasue of the above.
2774 * src/insets/insettabular.C (DrawCellSelection): use std::swap
2775 instead of manually coded one.
2777 * src/insets/insetquotes.C (Read): read the \end_inset too
2779 * src/insets/insetlatex.h: remove file
2780 * src/insets/insetlatex.C: remove file
2782 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
2784 (InsetPrintIndex): remove destructor
2786 * src/insets/insetinclude.h: remove default constructor
2788 * src/insets/insetfloat.C: work to make it work better
2790 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
2792 * src/insets/insetcite.h (InsetCitation): remove default constructor
2794 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
2796 * src/text.C (GetColumnNearX): comment out some currently unused code.
2798 * src/paragraph.C (writeFile): move some initializations closer to
2800 (CutIntoMinibuffer): small change to use new matchIT operator
2804 (InsertInset): ditto
2807 (InsetIterator): ditto
2808 (Erase): small change to use new matchFT operator
2810 (GetFontSettings): ditto
2811 (HighestFontInRange): ditto
2814 * src/lyxparagraph.h: some chars changed to value_type
2815 (matchIT): because of some stronger checking (perhaps too strong)
2816 in SGI STL, the two operator() unified to one.
2819 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
2821 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
2822 the last inset read added
2823 (parseSingleLyXformat2Token): some more (future) compability code added
2824 (parseSingleLyXformat2Token): warning about solitary \end_inset added
2825 (parseSingleLyXformat2Token): set last_inset_read
2826 (parseSingleLyXformat2Token): more code to read new "Float" correctly
2827 (parseSingleLyXformat2Token): don't double intializw string next_token
2829 * src/TextCache.C (text_fits::operator()): add const's to the signature
2830 (has_buffer::operator()): ditto
2832 * src/Floating.h: add some comments on the class
2834 * src/FloatList.[Ch] (typeExist): new method
2837 * src/BackStack.h: added default constructor, wanted by Gcc.
2839 2000-07-14 Juergen Vigna <jug@sad.it>
2841 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
2843 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
2845 * src/insets/insettabular.C (resizeLyXText): need this to be able to
2846 do a redraw when the window is resized!
2847 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
2849 * src/insets/insettext.C (resizeLyXText): added function to correctly
2850 being able to resize the LyXWindow.
2852 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
2854 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
2856 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
2857 crashes when closing dialog to a deleted inset.
2859 * src/insets/insetcite.[Ch] (Edit) : the return of this former
2860 method! Now similar to other insets.
2862 2000-07-13 Juergen Vigna <jug@sad.it>
2864 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
2866 * lib/examples/Literate.lyx: small patch!
2868 * src/insets/insetbib.C (Read): added this function because of wrong
2869 Write (without [begin|end]_inset).
2871 2000-07-11 Juergen Vigna <jug@sad.it>
2873 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
2874 as the insertInset could not be good!
2876 * src/screen.C (ToggleSelection): fixed toggle selection bug as
2877 the bool param should not be last.
2879 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2881 * sigc++/configure.in: fix bug in threading-related code (Yes, I
2882 did submit that to Karl).
2884 * configure.in: use -isystem instead of -I for X headers. This
2885 fixes a problem on solaris with a recent gcc;
2886 put the front-end code after the X detection code;
2887 configure in sigc++ before lib/
2889 * src/lyx_main.C (commandLineHelp): remove -display from command
2892 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
2894 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
2895 Also put in Makefile rules for building the ``listerrors''
2896 program for parsing errors from literate programs written in LyX.
2898 * lib/build-listerrors: Added small shell script as part of compile
2899 process. This builds a working ``listerrors'' binary if noweb is
2900 installed and either 1) the VNC X server is installed on the machine,
2901 or 2) the user is compiling from within a GUI. The existence of a GUI
2902 is necessary to use the ``lyx --export'' feature for now. This
2903 hack can be removed once ``lyx --export'' no longer requires a GUI to
2906 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
2908 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
2909 now passed back correctly from gcc and placed "under" error
2910 buttons in a Literate LyX source.
2912 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2914 * src/text.C (GetColumnNearX): Better behavior when a RTL
2915 paragraph is ended by LTR text.
2917 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
2920 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2922 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
2923 true when clipboard is empty.
2925 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
2927 * text.C (Backspace): Prevent rebreaking of a row if it is the last
2928 row of the paragraph.
2929 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
2930 to prevent calculation of bidi tables
2932 2000-07-07 Juergen Vigna <jug@sad.it>
2934 * src/screen.C (ToggleSelection): added y_offset and x_offset
2937 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
2940 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
2942 * src/insets/insettext.C: fixed Layout-Display!
2944 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2946 * configure.in: add check for strings.h header.
2948 * src/spellchecker.C: include <strings.h> in order to have a
2949 definition for bzero().
2951 2000-07-07 Juergen Vigna <jug@sad.it>
2953 * src/insets/insettext.C (draw): set the status of the bv->text to
2954 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
2956 * src/screen.C (DrawOneRow):
2957 (DrawFromTo): redraw the actual row if something has changed in it
2960 * src/text.C (draw): call an update of the toplevel-inset if something
2961 has changed inside while drawing.
2963 * src/lyxtext.h: added CHANGED_IN_DRAW status.
2965 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
2967 * src/insets/insetbib.[Ch] (callback) new method, moving callback
2968 processing inside class.
2970 * src/insets/insetindex.[Ch] (callback) new method, moving callback
2971 processing inside class.
2973 * src/insets/insetindex.h new struct Holder, consistent with other
2976 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
2977 citation dialog from main code and placed it in src/frontends/xforms.
2978 Dialog launched through signals instead of callbacks
2980 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
2982 * lyx.man: update the options description.
2984 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
2986 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
2987 handle neg values, set min width to 590, add doc about -display
2989 2000-07-05 Juergen Vigna <jug@sad.it>
2991 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
2992 calls to BufferView *.
2994 * src/insets/insettext.C (checkAndActivateInset): small fix non
2995 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
2997 * src/insets/insetcommand.C (Read): Fixed as insets should read till
2998 their \end_inset token!
3000 2000-07-04 edscott <edscott@imp.mx>
3002 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
3003 lib/lyxrc.example: added option \wheel_jump
3005 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
3007 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
3008 remove support for -width,-height,-xpos and -ypos.
3010 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
3012 * src/encoding.[Ch]: New files.
3014 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
3015 (text): Call to the underline() method only when needed.
3017 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
3019 * src/buffer.C (makeLaTeXFile): Compute automatically the input
3020 encoding(s) for the document.
3022 * src/bufferparams.C (BufferParams): Changed default value of
3025 * src/language.C (newLang): Removed.
3026 (items[]): Added encoding information for all defined languages.
3028 * src/lyx_gui.C (create_forms): Added "auto" option to the input
3029 encoding choice button.
3031 * src/lyxrc.h (font_norm_type): New member variable.
3032 (set_font_norm_type): New method.
3034 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
3035 paragraphs with different encodings.
3037 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
3038 (TransformChar): Changed to work correctly with Arabic points.
3039 (draw): Added support for drawing Arabic points.
3040 (draw): Removed code for drawing underbars (this is done by
3043 * src/support/textutils.h (IsPrintableNonspace): New function.
3045 * src/BufferView_pimpl.h: Added "using SigC::Object".
3046 * src/LyXView.h: ditto.
3048 * src/insets/insetinclude.h (include_label): Changed to mutable.
3050 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
3052 * src/mathed/math_iter.h: remove empty destructor
3054 * src/mathed/math_cursor.h: remove empty destructor
3056 * src/insets/lyxinset.h: add THEOREM_CODE
3058 * src/insets/insettheorem.[Ch]: new files
3060 * src/insets/insetminipage.C: (InsertInset): remove
3062 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
3064 (InsertInset): remove
3066 * src/insets/insetlist.C: (InsertList): remove
3068 * src/insets/insetfootlike.[Ch]: new files
3070 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
3073 (InsertInset): ditto
3075 * src/insets/insetert.C: remove include Painter.h, reindent
3076 (InsertInset): move to header
3078 * src/insets/insetcollapsable.h: remove explicit from default
3079 contructor, remove empty destructor, add InsertInset
3081 * src/insets/insetcollapsable.C (InsertInset): new func
3083 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3085 * src/vspace.h: add explicit to constructor
3087 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
3088 \textcompwordmark, please test this.
3090 * src/lyxrc.C: set ascii_linelen to 65 by default
3092 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
3094 * src/commandtags.h: add LFUN_INSET_THEOREM
3096 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
3097 (makeLinuxDocFile): remove _some_ of the nice logic
3098 (makeDocBookFile): ditto
3100 * src/Painter.[Ch]: (~Painter): removed
3102 * src/LyXAction.C (init): entry for insettheorem added
3104 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
3106 (deplog): code to detect files generated by LaTeX, needs testing
3109 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3111 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
3113 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3115 * src/LaTeX.C (deplog): Add a check for files that are going to be
3116 created by the first latex run, part of the project to remove the
3119 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
3120 contents to the extension list.
3122 2000-07-04 Juergen Vigna <jug@sad.it>
3124 * src/text.C (NextBreakPoint): added support for needFullRow()
3126 * src/insets/lyxinset.h: added needFullRow()
3128 * src/insets/insetcollapsable.C: redone now this uses a text-inset
3131 * src/insets/insettext.C: lots of changes for update!
3133 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
3135 * src/LaTeXFeatures.h: add a missing std:: qualifier.
3137 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
3139 * src/insets/insetinclude.C (InsetInclude): fixed
3140 initialization of include_label.
3141 (unique_id): now returns a string.
3143 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
3145 * src/LaTeXFeatures.h: new member IncludedFiles, for
3146 a map of key, included file name.
3148 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
3149 with the included files for inclusion in SGML preamble,
3150 i. e., linuxdoc and docbook.
3153 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
3154 nice (is the generated linuxdoc code to be exported?), that
3155 allows to remove column, and only_body that will be true for
3156 slave documents. Insets are allowed inside SGML font type.
3157 New handling of the SGML preamble for included files.
3158 (makeDocBookFile): the same for docbook.
3160 * src/insets/insetinclude.h:
3161 * src/insets/insetinclude.C (Validate): keeps a list of included files.
3163 (DocBook): new export methods.
3165 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
3166 and makeDocBookFile.
3168 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
3169 formats to export with command line argument -x.
3171 2000-06-29 Juergen Vigna <jug@sad.it>
3173 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
3174 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
3176 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
3177 region could already been cleared by an inset!
3179 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3181 * src/BufferView_pimpl.h: remove member variables lyx_focus and
3184 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
3186 (cursorToggle): remove special handling of lyx focus.
3188 2000-06-28 Juergen Vigna <jug@sad.it>
3190 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
3193 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3195 * src/insets/insetindex.C (Edit): add a callback when popup is
3198 * src/insets/insettext.C (LocalDispatch):
3199 * src/insets/insetmarginal.h:
3200 * src/insets/insetlist.h:
3201 * src/insets/insetfoot.h:
3202 * src/insets/insetfloat.h:
3203 * src/insets/insetert.h: add a missing std:: qualifier.
3205 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
3207 * src/support/lyxsum.C (sum): '\0' teminate file read when using
3210 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
3212 * src/insets/insettext.C (Read): remove tmptok unused variable
3213 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
3214 (InsertInset): change for new InsetInset code
3216 * src/insets/insettext.h: add TEXT inline method
3218 * src/insets/insettext.C: remove TEXT macro
3220 * src/insets/insetmarginal.C (Write): new method
3221 (Latex): change output slightly
3223 * src/insets/insetfoot.C (Write): new method
3224 (Latex): change output slightly (don't use endl when no need)
3226 * src/insets/insetert.C (Write): new method
3228 * src/insets/insetcollapsable.h: make button_length, button_top_y
3229 and button_bottm_y protected.
3231 * src/insets/insetcollapsable.C (Write): simplify code by using
3232 tostr. Also do not output the float name, the children class
3233 should to that to get control over own arguments
3235 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
3236 src/insets/insetminipage.[Ch]:
3239 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
3241 * src/lyxfunc.C (Dispatch): cases for new insets/commands
3243 * src/Makefile.am (lyx_SOURCES): add the new files
3245 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
3246 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
3247 * src/commandtags.h: ditto
3249 * src/LaTeXFeatures.h: add a std::set of used floattypes
3251 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
3253 * src/FloatList.[Ch] src/Floating.h: new files
3255 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
3257 * src/lyx_cb.C (TableApplyCB): ditto
3259 * src/text2.C: ditto
3260 * src/buffer.C (SimpleLinuxDocOnePar): ditto
3261 (parseSingleLyXformat2Token): ditto + add code for
3262 backwards compability for old float styles + add code for new insets
3264 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
3266 (InsertInset(size_type, Inset *, LyXFont)): new method
3267 (InsetChar(size_type, char)): changed to use the other InsetChar
3268 with a LyXFont(ALL_INHERIT).
3269 (InsetInset(size_type, Inset*)): changed to use InsetChar to
3270 insert the META_INSET.
3272 * sigc++/thread.cc (Privete<int>::operator int&): move definition
3274 * sigc++/thread.h (Threads): from here
3276 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
3277 definition out of line
3278 * sigc++/scope.h: from here
3280 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3282 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
3283 is specified (adapted from a patch from edscott <edscott@imp.mx>).
3285 * Makefile.am (bindist): new target.
3287 * INSTALL: add instructions for doing a binary distribution.
3289 * development/tools/README.bin.example: update a bit.
3291 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
3294 * lib/lyxrc.example: new lyxrc tag \set_color.
3296 * src/lyxfunc.C (Dispatch):
3297 * src/commandtags.h:
3298 * src/LyXAction.C: new lyxfunc "set-color".
3300 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
3301 and an x11name given as strings.
3303 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
3304 cache when a color is changed.
3306 2000-06-26 Juergen Vigna <jug@sad.it>
3308 * src/lyxrow.C (width): added this functions and variable.
3310 * src/insets/insetcite.C (create_form_citation_form): some Gravity
3313 * src/text.C (SetHeightOfRow): fixed calcualting of width.
3315 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3317 * images/undo_bw.xpm: new icon.
3318 * images/redo_bw.xpm: ditto.
3320 * configure.in (INSTALL_SCRIPT): change value to
3321 ${INSTALL} to avoid failures of install-script target.
3322 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
3324 * src/BufferView.h: add a magic "friend" declaration to please
3327 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
3329 * forms/cite.fd: modified to allow resizing without messing
3332 * src/insetcite.C: Uses code from cite.fd almost without
3334 User can now resize dialog in the x-direction.
3335 Resizing the dialog in the y-direction is prevented, as the
3336 code does this intelligently already.
3338 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3340 * INSTALL: remove obsolete entry in "problems" section.
3342 * lib/examples/sl_*.lyx: update of the slovenian examples.
3344 * src/support/FileInfo.[Ch] (getBlockSize): remove.
3346 2000-06-23 Juergen Vigna <jug@sad.it>
3348 * src/lyxtext.h: added a 'cleared' flag to draw() function.
3350 * src/buffer.C (resize): delete the LyXText of textinsets.
3352 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
3354 * src/insets/lyxinset.h: added another parameter 'cleared' to
3355 the draw() function.
3357 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
3358 unlocking inset in inset.
3360 2000-06-22 Juergen Vigna <jug@sad.it>
3362 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
3363 of insets and moved first to LyXText.
3365 * src/mathed/formulamacro.[Ch]:
3366 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
3368 2000-06-21 Juergen Vigna <jug@sad.it>
3370 * src/text.C (GetVisibleRow): look if I should clear the area or not
3371 using Inset::doClearArea() function.
3373 * src/insets/lyxinset.h: added doClearArea() function and
3374 modified draw(Painter &, ...) to draw(BufferView *, ...)
3376 * src/text2.C (UpdateInset): return bool insted of int
3378 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
3380 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
3381 combox in the character popup
3383 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
3384 BufferParams const & params
3386 2000-06-20 Juergen Vigna <jug@sad.it>
3388 * src/insets/insettext.C (SetParagraphData): set insetowner on
3391 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3393 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
3394 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
3396 (form_main_): remove
3398 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
3399 (create_form_form_main): remove FD_form_main stuff, connect to
3400 autosave_timeout signal
3402 * src/LyXView.[Ch] (getMainForm): remove
3403 (UpdateTimerCB): remove
3404 * src/BufferView_pimpl.h: inherit from SigC::Object
3406 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
3407 signal instead of callback
3409 * src/BufferView.[Ch] (cursorToggleCB): remove
3411 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3413 * src/BufferView_pimpl.C: changes because of the one below
3415 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
3416 instead of storing a pointer to a LyXText.
3418 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
3420 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
3422 * src/lyxparagraph.h
3424 * src/paragraph.C: Changed fontlist to a sorted vector.
3426 2000-06-19 Juergen Vigna <jug@sad.it>
3428 * src/BufferView.h: added screen() function.
3430 * src/insets/insettext.C (LocalDispatch): some selection code
3433 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
3435 * src/insets/insettext.C (SetParagraphData):
3437 (InsetText): fixes for multiple paragraphs.
3439 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
3441 * development/lyx.spec.in: Call configure with ``--without-warnings''
3442 to work around a bug with the Makefiles when doing ``make lyxrpm''.
3443 This should be fine, however, since we generally don't want to be
3444 verbose when making an RPM.
3446 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
3448 * lib/scripts/fig2pstex.py: New file
3450 2000-06-16 Juergen Vigna <jug@sad.it>
3452 * src/insets/insettabular.C (UpdateLocal):
3453 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
3454 (LocalDispatch): Changed all functions to use LyXText.
3456 2000-06-15 Juergen Vigna <jug@sad.it>
3458 * src/text.C (SetHeightOfRow): call inset::update before requesting
3461 * src/insets/insettext.C (update):
3462 * src/insets/insettabular.C (update): added implementation
3464 * src/insets/lyxinset.h: added update function
3466 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3468 * src/text.C (SelectNextWord): protect against null pointers with
3469 old-style string streams. (fix from Paul Theo Gonciari
3472 * src/cite.[Ch]: remove erroneous files.
3474 * lib/configure.m4: update the list of created directories.
3476 * src/lyxrow.C: include <config.h>
3477 * src/lyxcursor.C: ditto.
3479 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3481 * lib/examples/decimal.lyx: new example file from Mike.
3483 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
3484 to find template definitions (from Dekel)
3486 * src/frontends/.cvsignore: add a few things.
3488 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
3490 * src/Timeout.C (TimeOut): remove default argument.
3492 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
3495 * src/insets/ExternalTemplate.C: add a "using" directive.
3497 * src/lyx_main.h: remove the act_ struct, which seems unused
3500 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
3502 * LyX Developers Meeting: All files changed, due to random C++ (by
3503 coincidence) code generator script.
3505 - external inset (cool!)
3506 - initial online editing of preferences
3507 - insettabular breaks insettext(s contents)
3509 - some DocBook fixes
3510 - example files update
3511 - other cool stuff, create a diff and look for yourself.
3513 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
3515 * src/insets/insettext.C (computeTextRows): if the maxWidth is
3516 -1 this is a non-line-breaking textinset.
3518 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
3519 if there is no width set.
3521 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
3523 * Lots of files: Merged the dialogbase branch.
3525 2000-06-09 Allan Rae <rae@lyx.org>
3527 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
3528 and the Dispatch methods that used it.
3530 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
3531 access to functions formerly kept in Dispatch.
3533 2000-05-19 Allan Rae <rae@lyx.org>
3535 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
3536 made to_page and count_copies integers again. from_page remains a
3537 string however because I want to allow entry of a print range like
3538 "1,4,22-25" using this field.
3540 * src/LyXAction.C: added action info and commands for buffer-print-xtl
3541 and printer-params-get. These aren't useful from the minibuffer but
3542 could be used by a script/LyXServer app provided it passes a suitable
3543 auto_mem_buffer. I guess I should take a look at how the LyXServer
3544 works and make it support xtl buffers.
3546 * sigc++/: updated to libsigc++-1.0.1
3548 * src/xtl/: updated to xtl-1.3.pl.11
3550 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
3551 those changes done to the files in src/ are actually recreated when
3552 they get regenerated. Please don't ever accept a patch that changes a
3553 dialog unless that patch includes the changes to the corresponding *.fd
3556 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
3557 stringOnlyContains, renamed it and generalised it.
3559 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
3560 branch. Removed the remaining old form_print code.
3562 2000-04-26 Allan Rae <rae@lyx.org>
3564 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
3565 trap I was trying to fix with the ID: fields in src/xtl/ :-)
3567 2000-04-25 Allan Rae <rae@lyx.org>
3569 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
3570 against a base of xtl-1.3.pl.4
3572 * development/tools/lxtl.sh: fixed a couple of silly typos and now
3573 filter the Id: entries so they still show the xtl version number
3576 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
3577 into the src/xtl code. Patch still pending with José (XTL)
3579 2000-04-24 Allan Rae <rae@lyx.org>
3581 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
3582 both more generic and much safer. Use the new template functions.
3583 * src/buffer.[Ch] (Dispatch): ditto.
3585 * src/frontends/xforms/FormPrint.C (update): Use new template functions
3586 and mem buffer more intelligently. Also a little general cleanup.
3589 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
3590 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
3591 * src/xtl/Makefile.am: ditto.
3592 * src/xtl/.cvsignore: ditto.
3593 * src/Makefile.am: ditto.
3595 * src/PrinterParams.h: Removed the macros member functions. Added a
3596 testInvariant member function. A bit of tidying up and commenting.
3597 Included Angus's idea for fixing operation with egcs-1.1.2.
3599 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
3600 cool expansion of XTL's mem_buffer to support automatic memory
3601 management within the buffer itself. Removed the various macros and
3602 replaced them with template functions that use either auto_mem_buffer
3603 or mem_buffer depending on a #define. The mem_buffer support will
3604 disappear as soon as the auto_mem_buffer is confirmed to be good on
3605 other platforms/compilers. That is, it's there so you've got something
3608 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
3609 effectively forked XTL. However I expect José will include my code
3610 into the next major release. Also fixed a memory leak.
3611 * src/xtl/text.h: ditto.
3612 * src/xtl/xdr.h: ditto.
3613 * src/xtl/giop.h: ditto.
3615 2000-04-16 Allan Rae <rae@lyx.org>
3617 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
3618 by autogen.sh and removed by maintainer-clean anyway.
3619 * .cvsignore, sigc++/.cvsignore: Support the above.
3621 * sigc++/.cvsignore: Forgot that retbind.h was generated.
3623 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
3625 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
3626 macros, renamed static callback-target member functions to suit new
3627 scheme and made them public.
3628 * src/frontends/xforms/forms/form_print.fd: ditto.
3629 * src/frontends/xforms/forms/form_copyright.fd: ditto.
3631 * src/support/lxtl.h: small cleanup to use typedef instead of #define
3634 * src/xtl/: New directory containing a minimal distribution of XTL.
3635 This is XTL-1.3.pl.4.
3637 * development/tools/lxtl.sh: A script to generate the above mini-dist.
3639 2000-04-15 Allan Rae <rae@lyx.org>
3641 * development/tools/makeLyXsigc.sh: Remove the library version numbers
3643 * sigc++/: Updated to libsigc++-1.0.0
3645 2000-04-14 Allan Rae <rae@lyx.org>
3647 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
3648 use the generic ones in future. I'll modify my conversion script.
3650 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
3652 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
3653 (CloseAllBufferRelatedDialogs): Renamed.
3654 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
3656 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
3657 of the generic ones. These are the same ones my conversion script
3660 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
3661 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
3662 * src/buffer.C (Dispatch): ditto
3664 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
3665 functions for updating and hiding buffer dependent dialogs.
3666 * src/BufferView.C (buffer): ditto
3667 * src/buffer.C (setReadonly): ditto
3668 * src/lyxfunc.C (CloseBuffer): ditto
3670 * src/buffer.h: Take setReadonly() out of line so I don't have to include
3671 Dialogs.h, and hence all the SigC stuff, into every file that includes
3672 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
3674 * src/BufferView2.C: reduce the number of headers included by buffer.h
3676 2000-04-11 Allan Rae <rae@lyx.org>
3678 * src/frontends/xforms/xform_macros.h: A small collection of macros
3679 for building C callbacks.
3681 * src/frontends/xforms/Makefile.am: Added above file.
3683 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
3684 scheme again. This time it should work for JMarc. If this is
3685 successful I'll revise my conversion script to automate some of this.
3686 The static member functions in the class also have to be public for
3687 this scheme will work. If the scheme works (it's almost identical to
3688 the way BufferView::cursorToggleCB is handled so it should work) then
3689 FormCopyright and FormPrint will be ready for inclusion into the main
3690 trunk immediately after 1.1.5 is released -- provided we're prepared
3691 for complaints about lame compilers not handling XTL.
3693 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
3695 2000-04-07 Allan Rae <rae@lyx.org>
3697 * config/lyxinclude.m4: A bit more tidying up (Angus)
3699 * src/LString.h: JMarc's <string> header fix
3701 * src/PrinterParams.h: Used string for most data to remove some
3702 ugly code in the Print dialog and avoid even uglier code when
3703 appending the ints to a string for output.
3705 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
3706 and moved "default:" back to the end of switch statement. Cleaned
3707 up the printing so it uses the right function calls and so the
3708 "print to file" option actually puts the file in the right directory.
3710 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
3712 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
3713 and Ok+Apply button control into a separate method: input (Angus).
3714 (input) Cleaned it up and improved it to be very thorough now.
3715 (All CB) static_cast used instead of C style cast (Angus). This will
3716 probably change again once we've worked out how to keep gcc-2.8.1 happy
3717 with real C callbacks.
3718 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
3719 ignore some of the bool settings and has random numbers instead. Needs
3720 some more investigation. Added other input length checks and checking
3721 of file and printer names.
3723 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
3724 would link (Angus). Seems the old code doesn't compile with the pragma
3725 statement either. Separated callback entries from internal methods.
3727 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
3729 2000-03-17 Allan Rae <rae@lyx.org>
3731 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
3732 need it? Maybe it could go in Dialogs instead? I could make it a
3733 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
3734 values to get the bool return value.
3735 (Dispatch): New overloaded method for xtl support.
3737 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
3738 extern "C" callback instead of static member functions. Hopefully,
3739 JMarc will be able to compile this. I haven't changed
3740 forms/form_copyright.fd yet. Breaking one of my own rules already.
3742 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
3743 because they aren't useful from the minibuffer. Maybe a LyXServer
3744 might want a help message though?
3746 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
3748 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
3749 xtl which needs both rtti and exceptions.
3751 * src/support/Makefile.am:
3752 * src/support/lxtl.h: New file. Some helper macros for using XTL.
3754 * src/frontends/xforms/input_validators.[ch]: input filters and
3755 validators. These conrol what keys are valid in input boxes.
3756 Use them and write some more. Much better idea than waiting till
3757 after the user has pressed Ok to say that the input fields don't make
3760 * src/frontends/xforms/Makefile.am:
3761 * src/frontends/xforms/forms/form_print.fd:
3762 * src/frontends/xforms/forms/makefile:
3763 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
3764 new scheme. Still have to make sure I haven't missed anything from
3765 the current implementation.
3767 * src/Makefile.am, src/PrinterParams.h: New data store.
3769 * other files: Added a couple of copyright notices.
3771 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3773 * src/insets/insetbib.h: move Holder struct in public space.
3775 * src/frontends/include/DialogBase.h: use SigC:: only when
3776 SIGC_CXX_NAMESPACES is defined.
3777 * src/frontends/include/Dialogs.h: ditto.
3779 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
3781 * src/frontends/xforms/FormCopyright.[Ch]: do not
3782 mention SigC:: explicitely.
3784 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3786 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
3787 deals with testing KDE in main configure.in
3788 * configure.in: ditto.
3790 2000-02-22 Allan Rae <rae@lyx.org>
3792 * Lots of files: Merged from HEAD
3794 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
3795 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
3797 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
3799 * sigc++/: new minidist.
3801 2000-02-14 Allan Rae <rae@lyx.org>
3803 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
3805 2000-02-08 Juergen Vigna <jug@sad.it>
3807 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
3808 file for the buildin GUI builder of KDevelop of the copyright-dialog.
3810 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
3811 for this port and so it is much easier for other people to port
3812 dialogs in a common development environment.
3814 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
3815 the QT/KDE implementation.
3817 * src/frontends/kde/Dialogs.C:
3818 * src/frontends/kde/FormCopyright.C:
3819 * src/frontends/kde/FormCopyright.h:
3820 * src/frontends/kde/Makefile.am:
3821 * src/frontends/kde/formcopyrightdialog.C:
3822 * src/frontends/kde/formcopyrightdialog.h:
3823 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
3824 for the kde support of the Copyright-Dialog.
3826 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
3827 subdir-substitution instead of hardcoded 'xforms' as we now have also
3830 * src/frontends/include/DialogBase.h (Object): just commented the
3831 label after #endif (nasty warning and I don't like warnings ;)
3833 * src/main.C (main): added KApplication initialization if using
3836 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
3837 For now only the KDE event-loop is added if frontend==kde.
3839 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
3841 * configure.in: added support for the --with-frontend[=value] option
3843 * autogen.sh: added kde.m4 file to list of config-files
3845 * acconfig.h: added define for KDEGUI-support
3847 * config/kde.m4: added configuration functions for KDE-port
3849 * config/lyxinclude.m4: added --with-frontend[=value] option with
3850 support for xforms and KDE.
3852 2000-02-08 Allan Rae <rae@lyx.org>
3854 * all Makefile.am: Fixed up so the make targets dist, distclean,
3855 install and uninstall all work even if builddir != srcdir. Still
3856 have a new sigc++ minidist update to come.
3858 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
3860 2000-02-01 Allan Rae <rae@lyx.org>
3862 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
3863 Many mods to get builddir != srcdir working.
3865 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
3866 for building on NT and so we can do the builddir != srcdir stuff.
3868 2000-01-30 Allan Rae <rae@lyx.org>
3870 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
3871 This will stay in "rae" branch. We probably don't really need it in
3872 the main trunk as anyone who wants to help programming it should get
3873 a full library installed also. So they can check both included and
3874 system supplied library compilation.
3876 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
3877 Added a 'mini' distribution of libsigc++. If you feel the urge to
3878 change something in these directories - Resist it. If you can't
3879 resist the urge then you should modify the following script and rebuild
3880 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
3881 all happen. Still uses a hacked version of libsigc++'s configure.in.
3882 I'm quite happy with the results. I'm not sure the extra work to turn
3883 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
3884 worth the trouble and would probably lead to extra maintenance
3886 I haven't tested the following important make targets: install, dist.
3887 Not ready for prime time but very close. Maybe 1.1.5.
3889 * development/tools/makeLyXsigc.sh: A shell script to automatically
3890 generate our mini-dist of libsigc++. It can only be used with a CVS
3891 checkout of libsigc++ not a tarball distribution. It's well commented.
3892 This will end up as part of the libsigc++ distribution so other apps
3893 can easily have an included mini-dist. If someone makes mods to the
3894 sigc++ subpackage without modifying this script to generate those
3895 changes I'll be very upset!
3897 * src/frontends/: Started the gui/system indep structure.
3899 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
3900 to access the gui-indep dialogs are in this class. Much improved
3901 design compared to previous revision. Lars, please refrain from
3902 moving this header into src/ like you did with Popups.h last time.
3904 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
3906 * src/frontends/xforms/: Started the gui-indep system with a single
3907 dialog: FormCopyright. Initial testing of use of libsigc++ was very
3910 * src/frontends/xforms/forms: Repository for the xforms .fd files.
3911 Here you'll find a very useful makefile and automated fdfix.sh that
3912 makes updating dailogs a no-brainer -- provided you follow the rules
3913 set out in the README. I'm thinking about adding another script to
3914 automatically generate skeleton code for a new dialog given just the
3917 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
3918 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
3919 Made FormCopyright gui-indep and added a lyxfunc to get to it.
3921 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
3923 * src/support/LSubstring.C (operator): simplify
3925 * src/lyxtext.h: removed bparams, use buffer_->params instead
3927 * src/lyxrow.h: make Row a real class, move all variables to
3928 private and use accessors.
3930 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
3932 (isRightToLeftPar): ditto
3933 (ChangeLanguage): ditto
3934 (isMultiLingual): ditto
3937 (SimpleTeXOnePar): ditto
3938 (TeXEnvironment): ditto
3939 (GetEndLabel): ditto
3941 (SetOnlyLayout): ditto
3942 (BreakParagraph): ditto
3943 (BreakParagraphConservative): ditto
3944 (GetFontSettings): ditto
3946 (CopyIntoMinibuffer): ditto
3947 (CutIntoMinibuffer): ditto
3948 (PasteParagraph): ditto
3949 (SetPExtraType): ditto
3950 (UnsetPExtraType): ditto
3951 (DocBookContTableRows): ditto
3952 (SimpleDocBookOneTablePar): ditto
3954 (TeXFootnote): ditto
3955 (SimpleTeXOneTablePar): ditto
3956 (TeXContTableRows): ditto
3957 (SimpleTeXSpecialChars): ditto
3960 * src/lyxcursor.h: make LyXCursor a real class, move all variables
3961 to private and use accessors.
3963 * src/lyx_cb.C: remove char updatetimer, and all code that uses
3964 this, we did not use it anymore and has not been for ages. Just a
3965 waste of cpu cycles.
3967 * src/language.h: make Language a real class, move all variables
3968 to private and use accessors.
3970 * src/BufferView_pimpl.C (Pimpl): use new timer code.
3971 (create_view): remove
3972 (update): some changes for new timer
3973 (cursorToggle): use new timer
3974 (beforeChange): change for new timer
3976 * src/BufferView.h (cursorToggleCB): removed last paramter because
3979 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
3980 (cursorToggleCB): change because of new timer code
3982 * lib/CREDITS: updated own mailaddress
3984 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3986 * src/support/filetools.C (PutEnv): fix the code in case neither
3987 putenv() nor setenv() have been found.
3989 * INSTALL: mention the install-strip Makefile target.
3991 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
3992 read-only documents.
3994 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3996 * lib/reLyX/configure.in (VERSION): avoid using a previously
3997 generated reLyX wrapper to find out $prefix.
3999 * lib/examples/eu_adibide_lyx-atua.lyx:
4000 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
4001 translation of the Tutorial (Dooteo)
4003 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
4005 * forms/cite.fd: new citation dialog
4007 * src/insetcite.[Ch]: the new citation dialog is moved into
4010 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
4013 * src/insets/insetcommand.h: data members made private.
4015 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4017 * LyX 1.1.5 released
4019 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4021 * src/version.h (LYX_RELEASE): to 1.1.5
4023 * src/spellchecker.C (RunSpellChecker): return false if the
4024 spellchecker dies upon creation.
4026 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4028 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
4029 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
4033 * lib/CREDITS: update entry for Martin Vermeer.
4035 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
4037 * src/text.C (draw): Draw foreign language bars at the bottom of
4038 the row instead of at the baseline.
4040 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
4042 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
4044 * lib/bind/de_menus.bind: updated
4046 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4048 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
4050 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
4052 * src/menus.C (Limit_string_length): New function
4053 (ShowTocMenu): Limit the number of items/length of items in the
4056 * src/paragraph.C (String): Correct result for a paragraph inside
4059 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4061 * src/bufferlist.C (close): test of buf->getuser() == NULL
4063 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
4065 * src/BufferView2.C (removeAutoInsets): Fix a bug:
4066 Do not call to SetCursor when the paragraph is a closed footnote!
4068 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
4070 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
4073 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
4075 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4078 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
4079 reference popup, that activates the reference-back action
4081 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
4083 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
4084 the menus. Also fixed a bug.
4086 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
4087 the math panels when switching buffers (unless new buffer is readonly).
4089 * src/BufferView.C (NoSavedPositions)
4090 * src/BufferView_pimpl.C (NoSavedPositions): New methods
4092 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
4094 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
4095 less of dvi dirty or not.
4097 * src/trans_mgr.[Ch] (insert): change first parameter to string
4100 * src/chset.[Ch] (encodeString): add const to first parameter
4102 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
4104 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
4108 * src/LaTeX.C (deplog): better searching for dependency files in
4109 the latex log. Uses now regexps.
4111 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
4112 instead of the box hack or \hfill.
4114 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4116 * src/lyxfunc.C (doImportHelper): do not create the file before
4117 doing the actual import.
4118 (doImportASCIIasLines): create a new file before doing the insert.
4119 (doImportASCIIasParagraphs): ditto.
4121 * lib/lyxrc.example: remove mention of non-existing commands
4123 * lyx.man: remove mention of color-related switches.
4125 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
4127 * src/lyx_gui.C: remove all the color-related ressources, which
4128 are not used anymore.
4130 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
4133 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
4135 * src/lyxrc.C (read): Add a missing break in the switch
4137 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
4139 * src/text2.C (InsertStringA): Fix a bug with insertion into table
4141 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
4144 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4146 * src/text.C (draw): draw bars under foreign language words.
4148 * src/LColor.[Ch]: add LColor::language
4150 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
4152 * src/lyxcursor.h (boundary): New member variable
4154 * src/text.C (IsBoundary): New methods
4156 * src/text.C: Use the above for currect cursor movement when there
4157 is both RTL & LTR text.
4159 * src/text2.C: ditto
4161 * src/bufferview_funcs.C (ToggleAndShow): ditto
4163 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4165 * src/text.C (DeleteLineForward): set selection to true to avoid
4166 that DeleteEmptyParagraphMechanism does some magic. This is how it
4167 is done in all other functions, and seems reasonable.
4168 (DeleteWordForward): do not jump over non-word stuff, since
4169 CursorRightOneWord() already does it.
4171 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
4172 DeleteWordBackward, since they seem safe to me (since selection is
4173 set to "true") DeleteEmptyParagraphMechanism does nothing.
4175 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4177 * src/lyx_main.C (easyParse): simplify the code by factoring the
4178 part that removes parameters from the command line.
4179 (LyX): check wether wrong command line options have been given.
4181 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
4183 * src/lyx_main.C : add support for specifying user LyX
4184 directory via command line option -userdir.
4186 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
4188 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
4189 the number of items per popup.
4190 (Add_to_refs_menu): Ditto.
4192 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4194 * src/lyxparagraph.h: renamed ClearParagraph() to
4195 StripLeadingSpaces() and moved it to paragraph.C. We pass the
4196 textclass as parameter, and do nothing if free_spacing is
4197 true. This fixes part of the line-delete-forward problems.
4199 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
4200 (pasteSelection): ditto.
4201 (SwitchLayoutsBetweenClasses): more translatable strings.
4203 * src/text2.C (CutSelection): use StripLeadingSpaces.
4204 (PasteSelection): ditto.
4205 (DeleteEmptyParagraphMechanism): ditto.
4207 2000-05-26 Juergen Vigna <jug@sad.it>
4209 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
4210 is not needed in tabular insets.
4212 * src/insets/insettabular.C (TabularFeatures): added missing features.
4214 * src/tabular.C (DeleteColumn):
4216 (AppendRow): implemented this functions
4217 (cellsturct::operator=): clone the inset too;
4219 2000-05-23 Juergen Vigna <jug@sad.it>
4221 * src/insets/insettabular.C (LocalDispatch): better selection support
4222 when having multicolumn-cells.
4224 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4226 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
4228 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4230 * src/ColorHandler.C (getGCForeground): put more test into _()
4232 * lib/examples/eu_splash.lyx: new file (Basque translation) from
4235 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
4238 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
4240 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
4241 there are no labels, or when buffer is readonly.
4243 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
4244 there are no labels, buffer is SGML, or when buffer is readonly.
4246 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4248 * src/LColor.C (LColor): change a couple of grey40 to grey60
4249 (LColor): rewore initalization to make compiles go some magnitude
4251 (getGUIName): don't use gettext until we need the string.
4253 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
4255 * src/Bullet.[Ch]: Fixed a small bug.
4257 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
4259 * src/paragraph.C (String): Several fixes/improvements
4261 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
4263 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
4265 * src/paragraph.C (String): give more correct output.
4267 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
4269 * src/lyxfont.C (stateText) Do not output the language if it is
4270 eqaul to the language of the document.
4272 * src/paragraph.C (TeXOnePar): Do not put language switch commands
4273 between two paragraphs with the same language.
4275 * src/paragraph.C (getParLanguage) Return a correct answer for an
4276 empty dummy paragraph.
4278 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
4281 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
4284 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
4285 the menus/popup, if requested fonts are unavailable.
4287 2000-05-22 Juergen Vigna <jug@sad.it>
4289 * src/insets/insettabular.C (LocalDispatch): added some more cursor
4290 movement support (Up/Down/Tab/Shift-Tab).
4291 (LocalDispatch): added also preliminari cursor-selection.
4293 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
4295 * src/paragraph.C (PasteParagraph): Hopefully now right!
4297 2000-05-22 Garst R. Reese <reese@isn.net>
4299 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
4300 of list, change all references to Environment to Command
4301 * tex/hollywood.cls : rewrite environments as commands, add
4302 \uppercase to interiorshot and exteriorshot to force uppecase.
4303 * tex/broadway.cls : rewrite environments as commands. Tweak
4306 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4308 * src/menus.C (Add_to_toc_menu): fix the code which limits the
4309 size of items: use a constant intead of the hardcoded 40, and more
4310 importantly do not remove the %m and %x tags added at the end.
4311 (Add_to_refs_menu): use vector::size_type instead of
4312 unsigned int as basic types for the variables. _Please_ do not
4313 assume that size_t is equal to unsigned int. On an alpha, this is
4314 unsigned long, which is _not_ the same.
4316 * src/language.C (initL): remove language "hungarian", since it
4317 seems that "magyar" is better.
4319 2000-05-22 Juergen Vigna <jug@sad.it>
4321 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
4323 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
4326 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
4327 next was deleted but not set to 0.
4329 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4331 * src/language.C (initL): change the initialization of languages
4332 so that compiles goes _fast_.
4334 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
4337 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
4339 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4343 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4345 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
4347 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
4351 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
4354 * src/insets/insetlo*.[Ch]: Made editable
4356 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4358 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
4359 the current selection.
4361 * src/BufferView_pimpl.C (stuffClipboard): new method
4363 * src/BufferView.C (stuffClipboard): new method
4365 * src/paragraph.C (String): new method
4367 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
4368 LColor::ignore when lyxname is not found.
4370 * src/BufferView.C (pasteSelection): new method
4372 * src/BufferView_pimpl.C (pasteSelection): new method
4374 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
4376 * src/WorkArea.C (request_clipboard_cb): new static function
4377 (getClipboard): new method
4378 (putClipboard): new method
4380 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4382 * LyX 1.1.5pre2 released
4384 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4386 * src/vspace.C (operator=): removed
4387 (operator=): removed
4389 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
4391 * src/layout.C (NumberOfClass): manually set the type in make_pair
4392 (NumberOfLayout): ditto
4394 * src/language.C: use the Language constructor for ignore_lang
4396 * src/language.h: add constructors to struct Language
4398 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
4400 * src/text2.C (SetCursorIntern): comment out #warning
4402 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
4404 * src/mathed/math_iter.h: initialize sx and sw to 0
4406 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4408 * forms/lyx.fd: Redesign of form_ref
4410 * src/LaTeXFeatures.[Ch]
4414 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
4417 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
4418 and Buffer::inset_iterator.
4420 * src/menus.C: Added new menus: TOC and Refs.
4422 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
4424 * src/buffer.C (getTocList): New method.
4426 * src/BufferView2.C (ChangeRefs): New method.
4428 * src/buffer.C (getLabelList): New method. It replaces the old
4429 getReferenceList. The return type is vector<string> instead of
4432 * src/insets/insetinclude.C (getLabelList): New method. Replaces
4433 the old getLabel() and GetNumberOfLabels() methods.
4434 * src/insets/insetlabel.C (getLabelList): ditto
4435 * src/mathed/formula.C (getLabelList): ditto
4437 * src/paragraph.C (String): New method.
4439 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
4440 Uses the new getTocList() method.
4441 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
4442 which automatically updates the contents of the browser.
4443 (RefUpdateCB): Use the new getLabelList method.
4445 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
4447 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
4449 * src/spellchecker.C: Added using std::reverse;
4451 2000-05-19 Juergen Vigna <jug@sad.it>
4453 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
4455 * src/insets/insettext.C (computeTextRows): small fix for display of
4456 1 character after a newline.
4458 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
4461 2000-05-18 Juergen Vigna <jug@sad.it>
4463 * src/insets/insettabular.C (TabularFeatures): fixed update of display
4464 when changing width of column.
4466 * src/tabular.C (set_row_column_number_info): setting of
4467 autobreak rows if necessary.
4469 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4471 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
4473 * src/vc-backend.*: renamed stat() to status() and vcstat to
4474 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
4475 compilation broke. The new name seems more relevant, anyway.
4477 2000-05-17 Juergen Vigna <jug@sad.it>
4479 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
4480 which was wrong if the removing caused removing of rows!
4482 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
4483 (pushToken): new function.
4485 * src/text2.C (CutSelection): fix problem discovered with purify
4487 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4489 * src/debug.C (showTags): enlarge the first column, now that we
4490 have 6-digits debug codes.
4492 * lib/layouts/hollywood.layout:
4493 * lib/tex/hollywood.cls:
4494 * lib/tex/brodway.cls:
4495 * lib/layouts/brodway.layout: more commands and fewer
4496 environments. Preambles moved in the .cls files. Broadway now has
4497 more options on scene numbering and less whitespace (from Garst)
4499 * src/insets/insetbib.C (getKeys): make sure that we are in the
4500 document directory, in case the bib file is there.
4502 * src/insets/insetbib.C (Latex): revert bogus change.
4504 2000-05-16 Juergen Vigna <jug@sad.it>
4506 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
4507 the TabularLayout on cursor move.
4509 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
4511 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
4514 (draw): fixed cursor position and drawing so that the cursor is
4515 visible when before the tabular-inset.
4517 * src/insets/insettext.C (init): drawLockedFrame was not initialized
4518 when creating from old insettext.
4520 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
4522 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4524 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
4525 * lib/tex/brodway.cls: ditto
4527 * lib/layouts/brodway.layout: change alignment of parenthical
4530 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4532 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
4533 versions 0.88 and 0.89 are supported.
4535 2000-05-15 Juergen Vigna <jug@sad.it>
4537 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
4540 * src/insets/insettext.C (computeTextRows): redone completely this
4541 function in a much cleaner way, because of problems when having a
4543 (draw): added a frame border when the inset is locked.
4544 (SetDrawLockedFrame): this sets if we draw the border or not.
4545 (SetFrameColor): this sets the frame color (default=insetframe).
4547 * src/insets/lyxinset.h: added x() and y() functions which return
4548 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
4549 function which is needed to see if we have a locking inset of some
4550 type in this inset (needed for now in insettabular).
4552 * src/vspace.C (inPixels): the same function also without a BufferView
4553 parameter as so it is easier to use it in some ocasions.
4555 * src/lyxfunc.C: changed all places where insertInset was used so
4556 that now if it couldn't be inserted it is deleted!
4558 * src/TabularLayout.C:
4559 * src/TableLayout.C: added support for new tabular-inset!
4561 * src/BufferView2.C (insertInset): this now returns a bool if the
4562 inset was really inserted!!!
4564 * src/tabular.C (GetLastCellInRow):
4565 (GetFirstCellInRow): new helper functions.
4566 (Latex): implemented for new tabular class.
4570 (TeXTopHLine): new Latex() helper functions.
4572 2000-05-12 Juergen Vigna <jug@sad.it>
4574 * src/mathed/formulamacro.C (Read):
4575 * src/mathed/formula.C (Read): read also the \end_inset here!
4577 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
4579 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
4580 crush when saving formulae with unbalanced parenthesis.
4582 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
4584 * src/layout.C: Add new keyword "endlabelstring" to layout file
4586 * src/text.C (GetVisibleRow): Draw endlabel string.
4588 * lib/layouts/broadway.layout
4589 * lib/layouts/hollywood.layout: Added endlabel for the
4590 Parenthetical layout.
4592 * lib/layouts/heb-article.layout: Do not use slanted font shape
4593 for Theorem like environments.
4595 * src/buffer.C (makeLaTeXFile): Always add "american" to
4596 the UsedLanguages list if document language is RTL.
4598 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4600 * add addendum to README.OS2 and small patch (from SMiyata)
4602 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4604 * many files: correct the calls to ChangeExtension().
4606 * src/support/filetools.C (ChangeExtension): remove the no_path
4607 argument, which does not belong there. Use OnlyFileName() instead.
4609 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
4610 files when LaTeXing a non-nice latex file.
4612 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
4613 a chain of "if". Return false when deadkeys are not handled.
4615 * src/lyx_main.C (LyX): adapted the code for default bindings.
4617 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
4618 bindings for basic functionality (except deadkeys).
4619 (deadKeyBindings): new method. Performs the bindings of deadkeys.
4621 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
4622 several methods: handle override_x_deadkeys.
4624 * src/lyxrc.h: remove the "bindings" map, which did not make much
4625 sense anyway. New variable override_x_deadkeys, defaulting to "true".
4627 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4629 * src/lyxfont.C (stateText): use a saner method to determine
4630 whether the font is "default". Seems to fix the crash with DEC
4633 * src/Bullet.[Ch] (Bullet): remove const on parameters.
4635 2000-05-08 Juergen Vigna <jug@sad.it>
4637 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
4638 TabularLayoutMenu with mouse-button-3
4639 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
4641 * src/TabularLayout.C: added this file for having a Layout for
4644 2000-05-05 Juergen Vigna <jug@sad.it>
4646 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
4647 recalculating inset-widths.
4648 (TabularFeatures): activated this function so that I can change
4649 tabular-features via menu.
4651 * src/menus.C (ShowEditMenu): inserted support for insettabular so
4652 that I can test some functions with the Table menu.
4654 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4656 * src/lyxfont.C (stateText): guard against stupid c++libs.
4658 * src/tabular.C: add using std::vector
4659 some whitespace changes, + removed som autogenerated code.
4661 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
4663 2000-05-05 Juergen Vigna <jug@sad.it>
4665 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
4666 row, columns and cellstructures.
4668 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4670 * lib/lyxrc.example: remove obsolete entries.
4672 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
4673 reading of protected_separator for free_spacing.
4675 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4677 * src/text.C (draw): do not display an exclamation mark in the
4678 margin for margin notes. This is confusing, ugly and
4681 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
4682 AMS math' is checked.
4684 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
4685 name to see whether including the amsmath package is needed.
4687 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
4689 * src/paragraph.C (validate): Compute UsedLanguages correctly
4690 (don't insert the american language if it doesn't appear in the
4693 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
4694 The argument of \thanks{} command is considered moving argument
4696 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
4699 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
4701 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
4702 for appendix/minipage/depth. The lines can be now both in the footnote
4703 frame, and outside the frame.
4705 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
4708 2000-05-05 Juergen Vigna <jug@sad.it>
4710 * src/table.[Ch]: removed the inset and buffer stuff as this is now
4711 neede only in tabular.[Ch].
4713 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
4715 * src/insets/insetspecialchar.C (Read): allow command == '~' for
4717 (Write): write '~' for PROTECTED_SEPARATOR
4719 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4721 * src/lyxparagraph.h: add a friend struct matchIT after the struct
4724 * src/mathed/formula.C (drawStr): rename size to siz.
4726 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
4727 possibly fix a bug by not changing the pflags = flags to piflags =
4730 2000-05-05 Juergen Vigna <jug@sad.it>
4732 * src/insets/insetbib.C: moved using directive
4734 * src/ImportNoweb.C: small fix for being able to compile (missing
4737 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4739 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
4740 to use clear, since we don't depend on this in the code. Add test
4743 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4745 * (various *.C files): add using std::foo directives to please dec
4748 * replace calls to string::clear() to string::erase() (Angus)
4750 * src/cheaders/cmath: modified to provide std::abs.
4752 2000-05-04 Juergen Vigna <jug@sad.it>
4754 * src/insets/insettext.C: Prepared all for inserting of multiple
4755 paragraphs. Still display stuff to do (alignment and other things),
4756 but I would like to use LyXText to do this when we cleaned out the
4757 table-support stuff.
4759 * src/insets/insettabular.C: Changed lot of stuff and added lots
4760 of functionality still a lot to do.
4762 * src/tabular.C: Various functions changed name and moved to be
4763 const functions. Added new Read and Write functions and changed
4764 lots of things so it works good with tabular-insets (also removed
4765 some stuff which is not needed anymore * hacks *).
4767 * src/lyxcursor.h: added operators == and != which just look if
4768 par and pos are (not) equal.
4770 * src/buffer.C (latexParagraphs): inserted this function to latex
4771 all paragraphs form par to endpar as then I can use this too for
4774 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
4775 so that I can call this to from text insets with their own cursor.
4777 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
4778 output off all paragraphs (because of the fix below)!
4780 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
4781 the very last paragraph (this could be also the last paragraph of an
4784 * src/texrow.h: added rows() call which returns the count-variable.
4786 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
4788 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
4790 * lib/configure.m4: better autodetection of DocBook tools.
4792 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4794 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
4796 * src/lyx_cb.C: add using std::reverse;
4798 * src/LaTeX.C (run): on error always run deleteFilesOnError before
4801 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
4802 selected files. Should fix repeated errors from generated files.
4804 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
4806 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
4808 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
4809 the spellchecker popup.
4811 * lib/lyxrc.example: Removed the \number_inset section
4813 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4815 * src/insets/figinset.C (various): Use IsFileReadable() to make
4816 sure that the file actually exist. Relying on ghostscripts errors
4817 is a bad idea since they can lead to X server crashes.
4819 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
4821 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
4824 * lib/lyxrc.example: smallish typo in description of
4825 \view_dvi_paper_option
4827 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
4830 * src/lyxfunc.C: doImportHelper to factor out common code of the
4831 various import methods. New functions doImportASCIIasLines,
4832 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
4833 doImportLinuxDoc for the format specific parts.
4836 * buffer.C: Dispatch returns now a bool to indicate success
4839 * lyx_gui.C: Add getLyXView() for member access
4841 * lyx_main.C: Change logic for batch commands: First try
4842 Buffer::Dispatch (possibly without GUI), if that fails, use
4845 * lyx_main.C: Add support for --import command line switch.
4846 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
4847 Available Formats: Everything accepted by 'buffer-import <format>'
4849 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
4851 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
4854 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
4855 documents will be reformatted upon reentry.
4857 2000-04-27 Juergen Vigna <jug@sad.it>
4859 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
4860 correctly only last pos this was a bug.
4862 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4864 * release of lyx-1.1.5pre1
4866 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4868 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
4870 * src/menus.C: revert the change of naming (Figure->Graphic...)
4871 from 2000-04-11. It was incomplete and bad.
4873 * src/LColor.[Ch]: add LColor::depthbar.
4874 * src/text.C (GetVisibleRow): use it.
4876 * README: update the languages list.
4878 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4880 * src/text.C (GetVisibleRow): show the depth of paragraphs using
4883 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
4885 * README: remove sections that were just wrong.
4887 * src/text2.C (GetRowNearY): remove currentrow code
4889 * src/text.C (GetRow): remove currentrow code
4891 * src/screen.C (Update): rewritten a bit.
4892 (SmallUpdate): removed func
4894 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
4896 (FullRebreak): return bool
4897 (currentrow): remove var
4898 (currentrow_y): ditto
4900 * src/lyxscreen.h (Draw): change arg to unsigned long
4901 (FitCursor): return bool
4902 (FitManualCursor): ditto
4903 (Smallpdate): remove func
4904 (first): change to unsigned long
4905 (DrawOneRow): change second arg to long (from long &)
4906 (screen_refresh_y): remove var
4907 (scree_refresh_row): ditto
4909 * src/lyxrow.h: change baseline to usigned int from unsigned
4910 short, this brings some implicit/unsigned issues out in the open.
4912 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
4914 (Dispatch): don't call updateScrollbar after fitCursor. Use update
4915 instead of smallUpdate.
4917 * src/lyxcursor.h: change y to unsigned long
4919 * src/buffer.h: don't call updateScrollbar after fitcursor
4921 * src/buffer.C (parseSingleLyXformat2Token): move variables to
4922 where they are used. Removed "\\direction", this was not present
4923 in 1.1.4 and is already obsolete. Commented out some code that I
4924 believe to never be called.
4925 (runLiterate): don't call updateScrollbar after fitCursor
4927 (buildProgram): ditto
4930 * src/WorkArea.h (workWidth): change return val to unsigned
4933 (redraw): remove the button redraws
4934 (setScrollbarValue): change for scrollbar
4935 (getScrollbarValue): change for scrollbar
4936 (getScrollbarBounds): change for scrollbar
4938 * src/WorkArea.C (C_WorkArea_up_cb): removed func
4939 (C_WorkArea_down_cb): removed func
4940 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
4941 (resize): change for scrollbar
4942 (setScrollbar): ditto
4943 (setScrollbarBounds): ditto
4944 (setScrollbarIncrements): ditto
4945 (up_cb): removed func
4946 (down_cb): removed func
4947 (scroll_cb): change for scrollbar
4948 (work_area_handler): ditto
4950 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
4951 when FitCursor did something.
4952 (updateScrollbar): some unsigned changes
4953 (downCB): removed func
4954 (scrollUpOnePage): removed func
4955 (scrollDownOnePage): remvoed func
4956 (workAreaMotionNotify): don't call screen->FitCursor but use
4957 fitCursor instead. and bool return val
4958 (workAreaButtonPress): ditto
4959 (workAreaButtonRelease): some unsigned changes
4960 (checkInsetHit): ditto
4961 (workAreaExpose): ditto
4962 (update): parts rewritten, comments about the signed char arg added
4963 (smallUpdate): removed func
4964 (cursorPrevious): call needed updateScrollbar
4967 * src/BufferView2.C (allFloats): don't call updateScrollbar after
4970 * src/BufferView.[Ch] (upCB): removed func
4971 (downCB): removed func
4972 (smallUpdate): removed func
4974 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
4976 * src/lyxtext.h src/text.C src/text2.C: removed support for the
4977 currentrow, currentrow_y optimization. This did not help a lot and
4978 if we want to do this kind of optimization we should rather use
4979 cursor.row instead of the currentrow.
4981 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
4982 buffer spacing and klyx spacing support.
4984 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
4986 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
4989 2000-04-26 Juergen Vigna <jug@sad.it>
4991 * src/insets/figinset.C: fixes to Lars sstream changes!
4993 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
4995 * A lot of files: Added Ascii(ostream &) methods to all inset
4996 classes. Used when exporting to ASCII.
4998 * src/buffer.C (writeFileAscii,RoffAsciiTable)
4999 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
5002 * src/text2.C (ToggleFree): Disabled implicit word selection when
5003 there is a change in the language
5005 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
5006 no output was generated for end-of-sentence inset.
5008 * src/insets/lyxinset.h
5011 * src/paragraph.C: Removed the insetnumber code
5013 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
5015 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5017 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
5018 no_babel and no_epsfig completely from the file.
5019 (parseSingleLyXformat2Token): add handling for per-paragraph
5020 spacing as written by klyx.
5022 * src/insets/figinset.C: applied patch by Andre. Made it work with
5025 2000-04-20 Juergen Vigna <jug@sad.it>
5027 * src/insets/insettext.C (cutSelection):
5028 (copySelection): Fixed with selection from right to left.
5029 (draw): now the rows are not recalculated at every draw.
5030 (computeTextRows): for now reset the inset-owner here (this is
5031 important for an undo or copy where the inset-owner is not set
5034 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
5035 motion to the_locking_inset screen->first was forgotten, this was
5036 not important till we got multiline insets.
5038 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5040 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
5041 code seems to be alright (it is code changed by Dekel, and the
5042 intent is indeed that all macros should be defined \protect'ed)
5044 * NEWS: a bit of reorganisation of the new user-visible features.
5046 2000-04-19 Juergen Vigna <jug@sad.it>
5048 * src/insets/insettext.C (init): using a LyXCursor now for cursor
5049 position. Set the inset_owner of the used paragraph so that it knows
5050 that it is inside an inset. Fixed cursor handling with mouse and
5051 cursor keys. Fixed wrong timed inset redraws and lots of other changes
5052 and cleanups to make TextInsets work better.
5054 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
5055 Changed parameters of various functions and added LockInsetInInset().
5057 * src/insets/insettext.C:
5059 * src/insets/insetcollapsable.h:
5060 * src/insets/insetcollapsable.C:
5061 * src/insets/insetfoot.h:
5062 * src/insets/insetfoot.C:
5063 * src/insets/insetert.h:
5064 * src/insets/insetert.C: cleaned up the code so that it works now
5065 correctly with insettext.
5067 * src/insets/inset.C:
5068 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
5069 that insets in insets are supported right.
5072 * src/table.C: lots of changes for use with inset tabular (and cleanup)
5074 * src/paragraph.C: some small fixes
5076 * src/debug.h: inserted INSETS debug info
5078 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
5079 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
5081 * src/commandtags.h:
5082 * src/LyXAction.C: insert code for InsetTabular.
5084 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
5085 not Button1MotionMask.
5086 (workAreaButtonRelease): send always a InsetButtonRelease event to
5088 (checkInsetHit): some setCursor fixes (always with insets).
5090 * src/BufferView2.C (lockInset): returns a bool now and extended for
5091 locking insets inside insets.
5092 (showLockedInsetCursor): it is important to have the cursor always
5093 before the locked inset.
5094 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
5096 * src/BufferView.h: made lockInset return a bool.
5098 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
5100 * src/text2.C (SetCursor): This now has a version with a LyXCursor
5101 that is used also internally but can be called as public to have back
5102 a cursor pos which is not set internally.
5103 (SetCursorIntern): Changed to use above function.
5105 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
5107 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5112 * NEWS: updated for prerelease of 1.1.5. Please comment and send
5113 patches for things that should be in or should be changed.
5115 * src/* [insetfiles]: change "usigned char fragile" to bool
5116 fragile. There was only one point that could that be questioned
5117 and that is commented in formulamacro.C. Grep for "CHECK".
5119 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
5120 (DeleteBuffer): take it out of CutAndPaste and make it static.
5122 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
5124 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
5125 output the spacing envir commands. Also the new commands used in
5126 the LaTeX output makes the result better.
5128 * src/Spacing.C (writeEnvirBegin): new method
5129 (writeEnvirEnd): new method
5131 2000-04-18 Juergen Vigna <jug@sad.it>
5133 * src/CutAndPaste.C: made textclass a static member of the class
5134 as otherwise it is not accesed right!!!
5136 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
5138 * forms/layout_forms.fd
5139 * src/layout_forms.h
5140 * src/layout_forms.C (create_form_form_character)
5141 * src/lyx_cb.C (UserFreeFont)
5142 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
5143 documents (in the layout->character popup).
5145 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5147 * src/spellchecker.C (create_ispell_pipe): fix a bug where
5148 \spell_command was in fact not honored (from Kevin Atkinson).
5150 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
5153 * src/lyx_gui.h: make lyxViews private (Angus)
5155 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
5157 * src/mathed/math_write.C
5158 (MathMatrixInset::Write) Put \protect before \begin{array} and
5159 \end{array} if fragile
5160 (MathParInset::Write): Put \protect before \\ if fragile
5162 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5164 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
5165 initialization if the LyXColorHandler must be done after the
5166 connections to the XServer has been established.
5168 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
5169 get the background pixel from the lyxColorhandler so that the
5170 figures are rendered with the correct background color.
5171 (NextToken): removed functions.
5172 (GetPSSizes): use ifs >> string instead of NextToken.
5174 * src/Painter.[Ch]: the color cache moved out of this file.
5176 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
5179 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
5181 * src/WorkArea.C (work_area_handler): call BufferView::enterView
5182 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
5184 * src/BufferView.C (enterView): new func
5185 (leaveView): new func
5187 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
5189 (leaveView): new func, undefines xterm cursor when approp.
5191 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
5192 (AllowInput): delete the Workarea cursor handling from this func.
5194 * src/Painter.C (underline): draw a slimer underline in most cases.
5196 * src/lyx_main.C (error_handler): use extern "C"
5198 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5200 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
5201 sent directly to me.
5203 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
5204 to the list by Dekel.
5206 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
5209 * src/bufferview_funcs.[Ch]: two new files, moved several of the
5210 methods from lyx_cb.here.
5212 * src/lyx_cb.C: in addition to the above; removed input_prohibited
5215 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5217 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
5218 instead of using current_view directly.
5220 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
5222 * src/LyXAction.C (init): add the paragraph-spacing command.
5224 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
5226 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
5228 * src/lyx_cb.C (CurrentState): output a string when the spacing is
5229 different from the documents.
5231 * src/text.C (SetHeightOfRow): take paragraph spacing into
5232 account, paragraph spacing takes precedence over buffer spacing
5233 (GetVisibleRow): ditto
5235 * src/paragraph.C (writeFile): output the spacing parameter too.
5236 (validate): set the correct features if spacing is used in the
5238 (Clear): set spacing to default
5239 (MakeSameLayout): spacing too
5240 (HasSameLayout): spacing too
5241 (SetLayout): spacing too
5242 (TeXOnePar): output the spacing commands
5244 * src/lyxparagraph.h: added a spacing variable for use with
5245 per-paragraph spacing.
5247 * src/Spacing.h: add a Default spacing and a method to check if
5248 the current spacing is default. also added an operator==
5250 * src/text2.C (DeleteEmptyParagraphMechanism): added a
5253 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5255 * src/lyxserver.C (callback): fix dispatch of functions
5257 * src/insets/insetlatexaccent.C (checkContents): turn bogus
5258 printf() into lyxerr call.
5260 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
5263 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
5264 "Table" to "Table Box", "Float" to "Floating Material"; deletes
5265 the "Float" from each of the subitems.
5266 (ShowHelpMenu): add entry for "FAQ" and "TOC".
5268 * src/support/DebugStream.h: add an #ifdef to work around a gcc
5269 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
5270 documented the change so that the workaround can be nuked later.
5272 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
5275 * src/lyxlex_pimpl.C (next): do not re-declare the default value
5277 * src/buffer.C (getLatexName): ditto
5278 (setReadonly): ditto
5280 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
5282 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
5283 avoid some uses of current_view. Added also a bufferParams()
5284 method to get at this.
5286 * src/lyxtext.h: changed params->buffer and paramters->bparams.
5288 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5290 * src/lyxparagraph.[Ch]: removed
5291 operator<(LyXParagraph::InsetTable..., added a struct matchIT
5292 with operators used by lower_bound and
5293 upper_bound in InsetTable's
5294 Make struct InsetTable private again. Used matchpos.
5296 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
5298 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
5299 document, the language of existing text is changed (unless the
5300 document is multi-lingual)
5302 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
5304 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
5306 * A lot of files: A rewrite of the Right-to-Left support.
5308 2000-04-10 Juergen Vigna <jug@sad.it>
5310 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
5311 misplaced cursor when inset in inset is locked.
5313 * src/insets/insettext.C (LocalDispatch): small fix so that a
5314 BREAKLINE is not inserted if we don't permit it with autBreakRows.
5316 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
5317 footnote font should be decreased in size twice when displaying.
5319 * src/insets/insettext.C (GetDrawFont): inserted this function as
5320 the drawing-font may differ from the real paragraph font.
5322 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
5323 insets (inset in inset!).
5325 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
5326 function here because we don't want footnotes inside footnotes.
5328 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
5330 (init): now set the inset_owner in paragraph.C
5331 (LocalDispatch): added some resetPos() in the right position
5334 (pasteSelection): changed to use the new CutAndPaste-Class.
5336 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
5337 which tells if it is allowed to insert another inset inside this one.
5339 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
5340 SwitchLayoutsBetweenClasses.
5342 * src/text2.C (InsertInset): checking of the new paragraph-function
5344 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
5345 is not needed anymore here!
5348 (PasteSelection): redone (also with #ifdef) so that now this uses
5349 the CutAndPaste-Class.
5350 (SwitchLayoutsBetweenClasses): removed here and implemented in the
5353 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
5354 from/to text/insets.
5356 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
5357 so that the paragraph knows if it is inside an (text)-inset.
5358 (InsertFromMinibuffer): changed return-value to bool as now it
5359 may happen that an inset is not inserted in the paragraph.
5360 (InsertInsetAllowed): this checks if it is allowed to insert an
5361 inset in this paragraph.
5363 (BreakParagraphConservative):
5364 (BreakParagraph) : small change for the above change of the return
5365 value of InsertFromMinibuffer.
5367 * src/lyxparagraph.h: added inset_owner and the functions to handle
5368 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
5370 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5372 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
5373 functions from BufferView to BufferView::Pimpl to ease maintence.
5375 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
5376 correctly. Also use SetCursorIntern instead of SetCursor.
5378 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
5381 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
5383 * src/WorkArea.C (belowMouse): manually implement below mouse.
5385 * src/*: Add "explicit" on several constructors, I added probably
5386 some unneeded ones. A couple of changes to code because of this.
5388 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
5389 implementation and private parts from the users of BufferView. Not
5392 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
5393 implementation and private parts from the users of LyXLex. Not
5396 * src/BufferView_pimpl.[Ch]: new files
5398 * src/lyxlex_pimpl.[Ch]: new files
5400 * src/LyXView.[Ch]: some inline functions move out-of-line
5402 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5404 * src/lyxparagraph.h: make struct InsetTable public.
5406 * src/support/lyxstring.h: change lyxstring::difference_type to be
5407 ptrdiff_t. Add std:: modifiers to streams.
5409 * src/font.C: include the <cctype> header, for islower() and
5412 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
5414 * src/font.[Ch]: new files. Contains the metric functions for
5415 fonts, takes a LyXFont as parameter. Better separation of concepts.
5417 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
5418 changes because of this.
5420 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
5422 * src/*: compile with -Winline and move functions that don't
5425 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
5428 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
5430 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
5431 (various files changed because of this)
5433 * src/Painter.C (text): fixed the drawing of smallcaps.
5435 * src/lyxfont.[Ch] (drawText): removed unused member func.
5438 * src/*.C: added needed "using" statements and "std::" qualifiers.
5440 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5442 * src/*.h: removed all use of "using" from header files use
5443 qualifier std:: instead.
5445 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5447 * src/text.C (Backspace): some additional cleanups (we already
5448 know whether cursor.pos is 0 or not).
5450 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
5451 automake does not provide one).
5453 * src/bmtable.h: replace C++ comments with C comments.
5455 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
5457 * src/screen.C (ShowCursor): Change the shape of the cursor if
5458 the current language is not equal to the language of the document.
5459 (If the cursor change its shape unexpectedly, then you've found a bug)
5461 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
5464 * src/insets/insetnumber.[Ch]: New files.
5466 * src/LyXAction.C (init)
5467 * src/lyxfunc.C (dispatch): Add command number-inset-insert
5470 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
5472 * src/lyxparagraph.h
5473 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
5474 (the vector is kept sorted).
5476 * src/text.C (GetVisibleRow): Draw selection correctly when there
5477 is both LTR and RTL text.
5479 * src/paragraph.C (Clone): Use the assignment operator for cloning,
5480 which is much faster.
5482 * src/text.C (GetVisibleRow and other): Do not draw the last space
5483 in a row if the direction of the last letter is not equal to the
5484 direction of the paragraph.
5486 * src/lyxfont.C (latexWriteStartChanges):
5487 Check that font language is not equal to basefont language.
5488 (latexWriteEndChanges): ditto
5490 * src/lyx_cb.C (StyleReset): Don't change the language while using
5491 the font-default command.
5493 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
5494 empty paragraph before a footnote.
5496 * src/insets/insetcommand.C (draw): Increase x correctly.
5498 * src/screen.C (ShowCursor): Change cursor shape if
5499 current language != document language.
5501 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
5503 2000-03-31 Juergen Vigna <jug@sad.it>
5505 * src/paragraph.C (GetInset): commented out text[pos] = ' '
5506 (Clone): changed mode how the paragraph-data is copied to the
5507 new clone-paragraph.
5509 * src/lyxfunc.C (Dispatch): fixed small problem when calling
5510 GetInset(pos) with no inset anymore there (in inset UNDO)
5512 * src/insets/insetcommand.C (draw): small fix as here x is
5513 incremented not as much as width() returns (2 before, 2 behind = 4)
5515 2000-03-30 Juergen Vigna <jug@sad.it>
5517 * src/insets/insettext.C (InsetText): small fix in initialize
5518 widthOffset (should not be done in the init() function)
5520 2000-03-29 Amir Karger <karger@lyx.org>
5522 * lib/examples/it_ItemizeBullets.lyx: translation by
5525 * Implemented \textasciitilde and fixed a tiny bug in reLyX
5527 2000-03-29 Juergen Vigna <jug@sad.it>
5529 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
5531 * src/insets/insetfoot.C (Clone): small change as for the below
5532 new init function in the text-inset
5534 * src/insets/insettext.C (init): new function as I've seen that
5535 clone did not copy the Paragraph-Data!
5536 (LocalDispatch): Added code so that now we have some sort of Undo
5537 functionality (well actually we HAVE Undo ;)
5539 * src/text.C (Backspace): Small fix for the a | a Backspace problem
5541 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
5543 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
5546 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5548 * src/main.C: added a runtime check that verifies that the xforms
5549 header used when building LyX and the library used when running
5550 LyX match. Exit with a message if they don't match. This is a
5551 version number check only.
5553 * src/buffer.C (save): Don't allocate memory on the heap for
5554 struct utimbuf times.
5556 * *: some using changes, use iosfwd instead of the real headers.
5558 * src/lyxfont.C use char const * instead of string for the static
5559 strings. Rewrite some functions to use sstream.
5561 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5563 * src/text.C (Backspace): hopefully fix the dreaded backaspace
5566 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5568 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
5569 of Geodesy (from Martin Vermeer)
5571 * lib/layouts/svjour.inc: include file for the Springer svjour
5572 class. It can be used to support journals other than JoG.
5574 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
5575 Miskiewicz <misiek@pld.org.pl>)
5576 * lib/reLyX/Makefile.am: ditto.
5578 2000-03-27 Juergen Vigna <jug@sad.it>
5580 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
5581 also some modifications with operations on selected text.
5583 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
5584 problems with clicking on insets (last famous words ;)
5586 * src/insets/insetcommand.C (draw):
5587 (width): Changed to have a bit of space before and after the inset so
5588 that the blinking cursor can be seen (otherwise it was hidden)
5590 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5592 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
5593 would not be added to the link list when an installed gettext (not
5594 part of libc) is found.
5596 2000-03-24 Juergen Vigna <jug@sad.it>
5598 * src/insets/insetcollapsable.C (Edit):
5599 * src/mathed/formula.C (InsetButtonRelease):
5600 (InsetButtonPress): fixed for new handling of ButtonPress/Release
5603 * src/BufferView.C (workAreaButtonPress):
5604 (workAreaButtonRelease):
5605 (checkInsetHit): Finally fixed the clicking on insets be handled
5608 * src/insets/insetert.C (Edit): inserted this call so that ERT
5609 insets work always with LaTeX-font
5611 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5613 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
5614 caused lyx to startup with no GUI in place, causing in a crash
5615 upon startup when called with arguments.
5617 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5619 * src/FontLoader.C: better initialization of dummyXFontStruct.
5621 2000-03-20 José Abílio Matos <jamatos@lyx.org>
5623 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
5624 for linuxdoc and docbook import and export format options.
5626 * lib/lyxrc.example Example of default values for the previous flags.
5628 * src/lyx_cb.C Use those flags instead of the hardwired values for
5629 linuxdoc and docbook export.
5631 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
5634 * src/menus.C Added menus entries for the new import/exports formats.
5636 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
5638 * src/lyxrc.*: Added support for running without Gui
5641 * src/FontLoader.C: sensible defaults if no fonts are needed
5643 * src/lyx_cb.C: New function ShowMessage (writes either to the
5644 minibuffer or cout in case of no gui
5645 New function AskOverwrite for common stuff
5646 Consequently various changes to call these functions
5648 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
5649 wild guess at sensible screen resolution when having no gui
5651 * src/lyxfont.C: no gui, no fonts... set some defaults
5653 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5655 * src/LColor.C: made the command inset background a bit lighter.
5657 2000-03-20 Hartmut Goebel <goebel@noris.net>
5659 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
5660 stdstruct.inc. Koma-Script added some title elements which
5661 otherwise have been listed below "bibliography". This split allows
5662 adding title elements to where they belong.
5664 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
5665 define the additional tilte elements and then include
5668 * many other layout files: changed to include stdtitle.inc just
5669 before stdstruct.inc.
5671 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
5673 * src/buffer.C: (save) Added the option to store all backup files
5674 in a single directory
5676 * src/lyxrc.[Ch]: Added variable \backupdir_path
5678 * lib/lyxrc.example: Added descriptions of recently added variables
5680 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
5681 bibtex inset, not closing the bibtex popup when deleting the inset)
5683 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5685 * src/lyx_cb.C: add a couple using directives.
5687 2000-03-17 José Abílio Matos <jamatos@lyx.org>
5688 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
5689 import based on the filename.
5691 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
5692 file would be imported at start, if the filename where of a sgml file.
5694 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
5696 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
5698 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
5699 * src/lyxfont.h Replaced the member variable bits.direction by the
5700 member variable lang. Made many changes in other files.
5701 This allows having a multi-lingual document
5703 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
5704 that change the current language to <l>.
5705 Removed the command "font-rtl"
5707 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
5708 format for Hebrew documents)
5710 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
5711 When auto_mathmode is "true", pressing a digit key in normal mode
5712 will cause entering into mathmode.
5713 If auto_mathmode is "rtl" then this behavior will be active only
5714 when writing right-to-left text.
5716 * src/text2.C (InsertStringA) The string is inserted using the
5719 * src/paragraph.C (GetEndLabel) Gives a correct result for
5720 footnote paragraphs.
5722 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
5724 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
5726 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
5727 front of PasteParagraph. Never insert a ' '. This should at least
5728 fix some cause for the segfaults that we have been experiencing,
5729 it also fixes backspace behaviour slightly. (Phu!)
5731 * src/support/lstrings.C (compare_no_case): some change to make it
5732 compile with gcc 2.95.2 and stdlibc++-v3
5734 * src/text2.C (MeltFootnoteEnvironment): change type o
5735 first_footnote_par_is_not_empty to bool.
5737 * src/lyxparagraph.h: make text private. Changes in other files
5739 (fitToSize): new function
5740 (setContentsFromPar): new function
5741 (clearContents): new function
5742 (SetChar): new function
5744 * src/paragraph.C (readSimpleWholeFile): deleted.
5746 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
5747 the file, just use a simple string instead. Also read the file in
5748 a more maintainable manner.
5750 * src/text2.C (InsertStringA): deleted.
5751 (InsertStringB): deleted.
5753 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
5755 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
5756 RedoParagraphs from the doublespace handling part, just set status
5757 to NEED_MORE_REFRESH. Also don't update cursor position (should be
5758 done, but perhaps not like this.)
5760 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5762 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
5763 character when inserting an inset.
5765 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
5767 * src/bufferparams.C (readLanguage): now takes "default" into
5770 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
5771 also initialize the toplevel_keymap with the default bindings from
5774 * src/buffer.C (Buffer): remove lyxrc from the parameters.
5776 * all files using lyxrc: have lyxrc as a real variable and not a
5777 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
5780 * src/lyxrc.C: remove double call to defaultKeyBindings
5782 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
5783 toolbar defauls using lyxlex. Remove enums, structs, functions
5786 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
5787 toolbar defaults. Also store default keybindings in a map.
5789 * src/ToolbarDefaults.[Ch]: New file. This class is used for
5790 storing the toolbar defaults without any xforms dependencies.
5792 * src/insets/figinset.C: patch posted to list by Andre Poenitz
5793 applied. Changed to use iterators.
5795 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
5797 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
5798 systems that don't have LINGUAS set to begin with.
5800 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5802 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
5803 the list by Dekel Tsur.
5805 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5807 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
5808 * src/insets/form_graphics.C: ditto.
5810 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
5812 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5814 * src/bufferparams.C (readLanguage): use the new language map
5816 * src/intl.C (InitKeyMapper): use the new language map
5818 * src/lyx_gui.C (create_forms): use the new language map
5820 * src/language.[Ch]: New files. Used for holding the information
5821 about each language. Now! Use this new language map enhance it and
5822 make it really usable for our needs.
5824 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
5826 * screen.C (ShowCursor): Removed duplicate code.
5827 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
5828 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
5830 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
5833 * src/text.C Added TransformChar method. Used for rendering Arabic
5834 text correctly (change the glyphs of the letter according to the
5835 position in the word)
5840 * src/lyxrc.C Added lyxrc command {language_command_begin,
5841 language_command_end,language_command_ltr,language_command_rtl,
5842 language_package} which allows the use of either arabtex or Omega
5845 * src/lyx_gui.C (init)
5847 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
5848 to use encoding for menu fonts which is different than the encoding
5851 * src/buffer.C (makeLaTeXFile): If params.language = "default",
5852 do not load the babel package.
5853 To write an English document with Hebrew/Arabic, change the document
5854 language to "english".
5856 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
5857 (alphaCounter): changed to return char
5858 (loweralphaCounter, hebrewCounter, romanCounter): New functions
5860 * lib/lyxrc.example Added examples for Hebrew/Arabic
5863 * src/layout.C Added layout command endlabeltype
5865 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
5867 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
5869 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5871 * src/mathed/math_delim.C (search_deco): return a
5872 math_deco_struct* instead of index.
5874 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5876 * All files with a USE_OSTREAM_ONLY within: removed all code that
5877 was unused when USE_OSTREAM_ONLY is defined.
5879 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
5880 of any less. Removed header and using.
5882 * src/text.C (GetVisibleRow): draw the string "Page Break
5883 (top/bottom)" on screen when drawing a pagebreak line.
5885 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5887 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
5889 * src/mathed/math_macro.C (draw): do some cast magic.
5892 * src/mathed/math_defs.h: change byte* argument to byte const*.
5894 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
5896 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
5897 know it is right to return InsetFoot* too, but cxx does not like
5900 * src/insets/insetcollapsable.[Ch] (Clone): make const.
5902 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
5904 * src/mathed/math_delim.C: change == to proper assignment.
5906 2000-03-09 Juergen Vigna <jug@sad.it>
5908 * src/insets/insettext.C (setPos): fixed various cursor positioning
5909 problems (via mouse and cursor-keys)
5910 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
5911 inset (still a small display problem but it works ;)
5913 * src/insets/insetcollapsable.C (draw): added button_top_y and
5914 button_bottom_y to have correct values for clicking on the inset.
5916 * src/support/lyxalgo.h: commented out 'using std::less'
5918 2000-03-08 Juergen Vigna <jug@sad.it>
5920 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
5921 Button-Release event closes as it is alos the Release-Event
5924 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
5926 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
5928 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
5929 can add multiple spaces in Scrap (literate programming) styles...
5930 which, by the way, is how I got hooked on LyX to begin with.
5932 * src/mathed/formula.C (Write): Added dummy variable to an
5933 inset::Latex() call.
5934 (Latex): Add free_spacing boolean to inset::Latex()
5936 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
5938 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
5939 virtual function to include the free_spacing boolean from
5940 the containing paragraph's style.
5942 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
5943 Added free_spacing boolean arg to match inset.h
5945 * src/insets/insettext.C, src/insets/insettext.h (Latex):
5946 Added free_spacing boolean arg to match inset.h
5948 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
5949 Added free_spacing boolean and made sure that if in a free_spacing
5950 paragraph, that we output normal space if there is a protected space.
5952 * src/insets/insetref.C, src/insets/insetref.h (Latex):
5953 Added free_spacing boolean arg to match inset.h
5955 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
5956 Added free_spacing boolean arg to match inset.h
5958 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
5959 Added free_spacing boolean arg to match inset.h
5961 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
5962 Added free_spacing boolean arg to match inset.h
5964 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
5965 Added free_spacing boolean arg to match inset.h
5967 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
5968 free_spacing boolean arg to match inset.h
5970 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
5971 Added free_spacing boolean arg to match inset.h
5973 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
5974 Added free_spacing boolean arg to match inset.h
5976 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
5977 Added free_spacing boolean arg to match inset.h
5979 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
5980 Added free_spacing boolean arg to match inset.h
5982 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
5983 Added free_spacing boolean arg to match inset.h
5985 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
5986 free_spacing boolean arg to match inset.h
5988 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
5989 free_spacing boolean arg to match inset.h
5991 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
5992 ignore free_spacing paragraphs. The user's spaces are left
5995 * src/text.C (InsertChar): Fixed the free_spacing layout
5996 attribute behavior. Now, if free_spacing is set, you can
5997 add multiple spaces in a paragraph with impunity (and they
5998 get output verbatim).
5999 (SelectSelectedWord): Added dummy argument to inset::Latex()
6002 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
6005 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
6006 paragraph layouts now only input a simple space instead.
6007 Special character insets don't make any sense in free-spacing
6010 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
6011 hard-spaces in the *input* file to simple spaces if the layout
6012 is free-spacing. This converts old files which had to have
6013 hard-spaces in free-spacing layouts where a simple space was
6015 (writeFileAscii): Added free_spacing check to pass to the newly
6016 reworked inset::Latex(...) methods. The inset::Latex() code
6017 ensures that hard-spaces in free-spacing paragraphs get output
6018 as spaces (rather than "~").
6020 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
6022 * src/mathed/math_delim.C (draw): draw the empty placeholder
6023 delims with a onoffdash line.
6024 (struct math_deco_compare): struct that holds the "functors" used
6025 for the sort and the binary search in math_deco_table.
6026 (class init_deco_table): class used for initial sort of the
6028 (search_deco): use lower_bound to do a binary search in the
6031 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6033 * src/lyxrc.C: a small secret thingie...
6035 * src/lyxlex.C (printTable): changed to take a ostream as paramter
6036 and to not flush the stream as often as it used to.
6038 * src/support/lyxalgo.h: new file
6039 (sorted): template function used for checking if a sequence is
6040 sorted or not. Two versions with and without user supplied
6041 compare. Uses same compare as std::sort.
6043 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
6044 it and give warning on lyxerr.
6046 (struct compare_tags): struct with function operators used for
6047 checking if sorted, sorting and lower_bound.
6048 (search_kw): use lower_bound instead of manually implemented
6051 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6053 * src/insets/insetcollapsable.h: fix Clone() declaration.
6054 * src/insets/insetfoot.h: ditto.
6056 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
6058 2000-03-08 Juergen Vigna <jug@sad.it>
6060 * src/insets/lyxinset.h: added owner call which tells us if
6061 this inset is inside another inset. Changed also the return-type
6062 of Editable to an enum so it tells clearer what the return-value is.
6064 * src/insets/insettext.C (computeTextRows): fixed computing of
6065 textinsets which split automatically on more rows.
6067 * src/insets/insetert.[Ch]: changed this to be of BaseType
6070 * src/insets/insetfoot.[Ch]: added footnote inset
6072 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
6073 collapsable insets (like footnote, ert, ...)
6075 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6077 * src/lyxdraw.h: remvoe file
6079 * src/lyxdraw.C: remove file
6081 * src/insets/insettext.C: added <algorithm>.
6083 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6085 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
6086 (matrix_cb): case MM_OK use string stream
6088 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
6091 * src/mathed/math_macro.C (draw): use string stream
6092 (Metrics): use string stream
6094 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
6095 directly to the ostream.
6097 * src/vspace.C (asString): use string stream.
6098 (asString): use string stream
6099 (asLatexString): use string stream
6101 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
6102 setting Spacing::Other.
6104 * src/LaTeXFeatures.C (getPackages): use string stream instead of
6105 sprintf when creating the stretch vale.
6107 * src/text2.C (alphaCounter): changed to return a string and to
6108 not use a static variable internally. Also fixed a one-off bug.
6109 (SetCounter): changed the drawing of the labels to use string
6110 streams instead of sprintf.
6112 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
6113 manipulator to use a scheme that does not require library support.
6114 This is also the way it is done in the new GNU libstdc++. Should
6115 work with DEC cxx now.
6117 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6119 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
6120 end. This fixes a bug.
6122 * src/mathed (all files concerned with file writing): apply the
6123 USE_OSTREAM_ONLY changes to mathed too.
6125 * src/support/DebugStream.h: make the constructor explicit.
6127 * src/lyxfont.C (latexWriteStartChanges): small bug related to
6128 count and ostream squashed.
6130 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6132 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
6134 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
6135 ostringstream uses STL strings, and we might not.
6137 * src/insets/insetspecialchar.C: add using directive.
6138 * src/insets/insettext.C: ditto.
6140 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
6142 * lib/layouts/seminar.layout: feeble attempt at a layout for
6143 seminar.cls, far from completet and could really use some looking
6144 at from people used to write layout files.
6146 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
6147 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
6148 a lot nicer and works nicely with ostreams.
6150 * src/mathed/formula.C (draw): a slightly different solution that
6151 the one posted to the list, but I think this one works too. (font
6152 size wrong in headers.)
6154 * src/insets/insettext.C (computeTextRows): some fiddling on
6155 Jürgens turf, added some comments that he should read.
6157 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
6158 used and it gave compiler warnings.
6159 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
6162 * src/lyx_gui.C (create_forms): do the right thing when
6163 show_banner is true/false.
6165 * src/lyx_cb.C (TimerCB): no need to close or do anything if
6166 show_banner is false.
6168 * most file writing files: Now use iostreams to do almost all of
6169 the writing. Also instead of passing string &, we now use
6170 stringstreams. mathed output is still not adapted to iostreams.
6171 This change can be turned off by commenting out all the occurences
6172 of the "#define USE_OSTREAM_ONLY 1" lines.
6174 * src/WorkArea.C (createPixmap): don't output debug messages.
6175 (WorkArea): don't output debug messages.
6177 * lib/lyxrc.example: added a comment about the new variable
6180 * development/Code_rules/Rules: Added some more commente about how
6181 to build class interfaces and on how better encapsulation can be
6184 2000-03-03 Juergen Vigna <jug@sad.it>
6186 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
6187 automatically with the width of the LyX-Window
6189 * src/insets/insettext.C (computeTextRows): fixed update bug in
6190 displaying text-insets (scrollvalues where not initialized!)
6192 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6194 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
6195 id in the check of the result from lower_bound is not enough since
6196 lower_bound can return last too, and then res->id will not be a
6199 * all insets and some code that use them: I have conditionalized
6200 removed the Latex(string & out, ...) this means that only the
6201 Latex(ostream &, ...) will be used. This is a work in progress to
6202 move towards using streams for all output of files.
6204 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
6207 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6209 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
6210 routine (this fixes bug where greek letters were surrounded by too
6213 * src/support/filetools.C (findtexfile): change a bit the search
6214 algorithm, to fix bug introduced in 1.1.4. Note that --format is
6215 no longer passed to kpsewhich, we may have to change that later.
6217 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
6218 warning options to avoid problems with X header files (from Angus
6220 * acinclude.m4: regenerated.
6222 2000-03-02 Juergen Vigna <jug@sad.it>
6224 * src/insets/insettext.C (WriteParagraphData): Using the
6225 par->writeFile() function for writing paragraph-data.
6226 (Read): Using buffer->parseSingleLyXformat2Token()-function
6227 for parsing paragraph data!
6229 * src/buffer.C (readLyXformat2): removed all parse data and using
6230 the new parseSingleLyXformat2Token()-function.
6231 (parseSingleLyXformat2Token): added this function to parse (read)
6232 lyx-file-format (this is called also from text-insets now!)
6234 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6236 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
6239 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
6240 directly instead of going through a func. One very bad thing: a
6241 static LyXFindReplace, but I don't know where to place it.
6243 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
6244 string instead of char[]. Also changed to static.
6245 (GetSelectionOrWordAtCursor): changed to static inline
6246 (SetSelectionOverLenChars): ditto.
6248 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
6249 current_view and global variables. both classes has changed names
6250 and LyXFindReplace is not inherited from SearchForm.
6252 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
6253 fl_form_search form.
6255 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
6257 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6259 * lib/bind/*.bind: make sure 'buffer-previous' function is not
6260 bound (from Kayvan).
6262 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
6264 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
6266 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
6268 * some things that I should comment but the local pub says head to
6271 * comment out all code that belongs to the Roff code for Ascii
6272 export of tables. (this is unused)
6274 * src/LyXView.C: use correct type for global variable
6275 current_layout. (LyXTextClass::size_type)
6277 * some code to get the new insetgraphics closer to working I'd be
6278 grateful for any help.
6280 * src/BufferView2.C (insertInset): use the return type of
6281 NumberOfLayout properly. (also changes in other files)
6283 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
6284 this as a test. I want to know what breaks because of this.
6286 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
6288 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
6290 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
6291 to use a \makebox in the label, this allows proper justification
6292 with out using protected spaces or multiple hfills. Now it is
6293 "label" for left justified, "\hfill label\hfill" for center, and
6294 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
6295 should be changed accordingly.
6297 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6299 * src/lyxtext.h: change SetLayout() to take a
6300 LyXTextClass::size_type instead of a char (when there is more than
6301 127 layouts in a class); also change type of copylayouttype.
6302 * src/text2.C (SetLayout): ditto.
6303 * src/LyXView.C (updateLayoutChoice): ditto.
6305 * src/LaTeX.C (scanLogFile): errors where the line number was not
6306 given just after the '!'-line were ignored (from Dekel Tsur).
6308 * lib/lyxrc.example: fix description of \date_insert_format
6310 * lib/layouts/llncs.layout: new layout, contributed by Martin
6313 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6315 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
6316 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
6317 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
6318 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
6319 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
6320 paragraph.C, text.C, text2.C)
6322 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6324 * src/insets/insettext.C (LocalDispatch): remove extra break
6327 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
6328 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
6330 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
6331 * src/insets/insettext.[Ch] (GetCursorPos): ditto
6333 * src/insets/insetbib.h: move InsetBibkey::Holder and
6334 InsetCitation::Holder in public space.
6336 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6338 * src/insets/insettext.h: small change to get the new files from
6339 Juergen to compile (use "string", not "class string").
6341 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
6342 const & as parameter to LocalDispatch, use LyXFont const & as
6343 paramter to some other func. This also had impacto on lyxinsets.h
6344 and the two mathed insets.
6346 2000-02-24 Juergen Vigna <jug@sad.it>
6349 * src/commandtags.h:
6351 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
6355 * src/BufferView2.C: added/updated code for various inset-functions
6357 * src/insets/insetert.[Ch]: added implementation of InsetERT
6359 * src/insets/insettext.[Ch]: added implementation of InsetText
6361 * src/insets/inset.C (Edit): added "unsigned int button" parameter
6362 (draw): added preliminary code for inset scrolling not finshed yet
6364 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
6365 as it is in lyxfunc.C now
6367 * src/insets/lyxinset.h: Added functions for text-insets
6369 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6371 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
6372 BufferView and reimplement the list as a queue put inside its own
6375 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
6377 * several files: use the new interface to the "updateinsetlist"
6379 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
6381 (work_area_handler): call BufferView::trippleClick on trippleclick.
6383 * src/BufferView.C (doubleClick): new function, selects word on
6385 (trippleClick): new function, selects line on trippleclick.
6387 2000-02-22 Allan Rae <rae@lyx.org>
6389 * lib/bind/xemacs.bind: buffer-previous not supported
6391 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6393 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
6396 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6398 * src/bufferlist.C: get rid of current_view from this file
6400 * src/spellchecker.C: get rid of current_view from this file
6402 * src/vspace.C: get rid of current_view from this file
6403 (inPixels): added BufferView parameter for this func
6404 (asLatexCommand): added a BufferParams for this func
6406 * src/text.C src/text2.C: get rid of current_view from these
6409 * src/lyxfont.C (getFontDirection): move this function here from
6412 * src/bufferparams.C (getDocumentDirection): move this function
6415 * src/paragraph.C (getParDirection): move this function here from
6417 (getLetterDirection): ditto
6419 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
6421 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
6422 resize due to wrong pixmap beeing used. Also took the opurtunity
6423 to make the LyXScreen stateless on regard to WorkArea and some
6424 general cleanup in the same files.
6426 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6428 * src/Makefile.am: add missing direction.h
6430 * src/PainterBase.h: made the width functions const.
6432 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
6435 * src/insets/insetcommand.C (draw): draw Editable as buttons.
6437 * src/insets/insetlatexaccent.C (draw): make the accents draw
6438 better, at present this will only work well with iso8859-1.
6440 * several files: remove the old drawing code, now we use the new
6443 * several files: remove support for mono_video, reverse_video and
6446 2000-02-17 Juergen Vigna <jug@sad.it>
6448 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
6449 int ** as we have to return the pointer, otherwise we have only
6450 NULL pointers in the returning function.
6452 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6454 * src/LaTeX.C (operator()): quote file name when running latex.
6456 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6458 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
6459 (bubble tip), this removes our special handling of this.
6461 * Remove all code that is unused now that we have the new
6462 workarea. (Code that are not active when NEW_WA is defined.)
6464 * Make the uses of XSync not conditionalized on define USE_XSYNC.
6466 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6468 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
6469 nonexisting layout; correctly redirect obsoleted layouts.
6471 * lib/lyxrc.example: document \view_dvi_paper_option
6473 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
6476 * src/lyx_cb.C (RunScript): handle $$FName for command names.
6477 (PreviewDVI): handle the view_dvi_paper_option variable.
6478 [Both from Roland Krause]
6480 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6482 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
6483 char const *, int, LyXFont)
6484 (text(int, int, string, LyXFont)): ditto
6486 * src/text.C (InsertCharInTable): attempt to fix the double-space
6487 feature in tables too.
6488 (BackspaceInTable): ditto.
6489 (GetVisibleRow): make bottom pagebreak line be a onoff line.
6491 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6493 * src/text2.C (owner): only complain if owner_ is set and bv != 0
6495 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
6496 newly found text in textcache to this.
6497 (buffer): set the owner of the text put into the textcache to 0
6499 * src/insets/figinset.C (draw): fixed the drawing of figures with
6502 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
6503 drawing of mathframe, hfills, protected space, table lines. I have
6504 now no outstanding drawing problems with the new Painter code.
6506 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6508 * src/PainterBase.C (ellipse, circle): do not specify the default
6511 * src/LColor.h: add using directive.
6513 * src/Painter.[Ch]: change return type of methods from Painter& to
6514 PainterBase&. Add a using directive.
6516 * src/WorkArea.C: wrap xforms callbacks in C functions
6519 * lib/layouts/foils.layout: font fix and simplifications from Carl
6522 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6524 * a lot of files: The Painter, LColor and WorkArea from the old
6525 devel branch has been ported to lyx-devel. Some new files and a
6526 lot of #ifdeffed code. The new workarea is enabled by default, but
6527 if you want to test the new Painter and LColor you have to compile
6528 with USE_PAINTER defined (do this in config.h f.ex.) There are
6529 still some rought edges, and I'd like some help to clear those
6530 out. It looks stable (loads and displays the Userguide very well).
6533 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6535 * src/buffer.C (pop_tag): revert to the previous implementation
6536 (use a global variable for both loops).
6538 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
6540 * src/lyxrc.C (LyXRC): change slightly default date format.
6542 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
6543 there is an English text with a footnote that starts with a Hebrew
6544 paragraph, or vice versa.
6545 (TeXFootnote): ditto.
6547 * src/text.C (LeftMargin): allow for negative values for
6548 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
6551 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
6552 for input encoding (cyrillic)
6554 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6556 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
6559 * src/toolbar.C (set): ditto
6560 * src/insets/insetbib.C (create_form_citation_form): ditto
6562 * lib/CREDITS: added Dekel Tsur.
6564 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
6565 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
6566 hebrew supports files from Dekel Tsur.
6568 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
6569 <tzafrir@technion.ac.il>
6571 * src/lyxrc.C: put \date_insert_format at the right place.
6573 * src/buffer.C (makeLaTeXFile): fix the handling of
6574 BufferParams::sides when writing out latex files.
6576 * src/BufferView2.C: add a "using" directive.
6578 * src/support/lyxsum.C (sum): when we use lyxstring,
6579 ostringstream::str needs an additional .c_str().
6581 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
6583 * src/support/filetools.C (ChangeExtension): patch from Etienne
6586 * src/TextCache.C (show): remove const_cast and make second
6587 parameter non-const LyXText *.
6589 * src/TextCache.h: use non const LyXText in show.
6591 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
6594 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6596 * src/support/lyxsum.C: rework to be more flexible.
6598 * several places: don't check if a pointer is 0 if you are going
6601 * src/text.C: remove some dead code.
6603 * src/insets/figinset.C: remove some dead code
6605 * src/buffer.C: move the BufferView funcs to BufferView2.C
6606 remove all support for insetlatexdel
6607 remove support for oldpapersize stuff
6608 made some member funcs const
6610 * src/kbmap.C: use a std::list to store the bindings in.
6612 * src/BufferView2.C: new file
6614 * src/kbsequence.[Ch]: new files
6616 * src/LyXAction.C + others: remove all trace of buffer-previous
6618 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
6619 only have one copy in the binary of this table.
6621 * hebrew patch: moved some functions from LyXText to more
6622 appropriate places. (LyXParagraph, BufferParams, LyXFont)
6624 * several files: remove support for XForms older than 0.88
6626 remove some #if 0 #endif code
6628 * src/TextCache.[Ch]: new file. Holds the textcache.
6630 * src/BufferView.C: changes to use the new TextCache interface.
6631 (waitForX): remove the now unused code.
6633 * src/BackStack.h: remove some commented code
6635 * lib/bind/emacs.bind: remove binding for buffer-previous
6637 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6639 * applied the hebrew patch.
6641 * src/lyxrow.h: make sure that all Row variables are initialized.
6643 * src/text2.C (TextHandleUndo): comment out a delete, this might
6644 introduce a memory leak, but should also help us to not try to
6645 read freed memory. We need to look at this one.
6647 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
6648 (LyXParagraph): initalize footnotekind.
6650 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
6651 forgot this when applying the patch. Please heed the warnings.
6653 * src/BufferView.C (buffer): a fix for the buffer-reload problem
6654 (aka. reformat problem)
6656 * src/bufferlist.C (exists): made const, and use const_iterator
6657 (isLoaded): new func.
6658 (release): use std::find to find the correct buffer.
6660 * src/bufferlist.h: made getState a const func.
6661 made empty a const func.
6662 made exists a const func.
6665 2000-02-01 Juergen Vigna <jug@sad.it>
6667 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
6669 * po/it.po: updated a bit the italian po file and also changed the
6670 'file nuovo' for newfile to 'filenuovo' without a space, this did
6673 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
6674 for the new insert_date command.
6676 * src/lyxfunc.C (Dispatch): added support for a insert_date function
6677 from jdblair, to insert a date into the current text conforming to
6678 a strftime format (for now only considering the locale-set and not
6679 the document-language).
6681 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6683 * src/lyxfont.C (textWidth): hopefully better fix for the Array
6684 Bounds Read error seen by purify. The problem was that islower is
6685 a macros which takes an unsigned char and uses it as an index for
6686 in array of characters properties (and is thus subject to the
6690 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
6691 correctly the paper sides radio buttons.
6692 (UpdateDocumentButtons): ditto.
6694 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6696 * src/kbmap.C (getsym + others): change to return unsigned int,
6697 returning a long can give problems on 64 bit systems. (I assume
6698 that int is 32bit on 64bit systems)
6700 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6702 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
6703 LyXLookupString to be zero-terminated. Really fixes problems seen
6706 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6708 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
6709 write a (char*)0 to the lyxerr stream.
6711 * src/lastfiles.C: move algorithm before the using statemets.
6713 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6715 * src/lastfiles.C: move using directives in global scope (egcs 1.x
6716 complains otherwise).
6717 * src/table.C: ditto
6719 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
6722 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
6723 that I removed earlier... It is really needed.
6725 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
6727 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6729 * INSTALL: update xforms home page URL.
6731 * lib/configure.m4: fix a bug with unreadable layout files.
6733 * src/table.C (calculate_width_of_column): add "using std::max"
6736 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6738 * several files: marked several lines with "DEL LINE", this is
6739 lines that can be deleted without changing anything.
6740 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
6741 checks this anyway */
6744 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
6746 * src/DepTable.C (update): add a "+" at the end when the checksum
6747 is different. (debugging string only)
6749 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
6750 the next inset to not be displayed. This should also fix the list
6751 of labels in the "Insert Crossreference" dialog.
6753 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
6755 * src/support/LSubstring.C (LSubstring): set pos to string::npos
6756 when regex was not found.
6758 * src/support/lstrings.C (lowercase): use handcoded transform always.
6761 * src/text.C (Delete): fixed the crash. cursor.par->prev and
6762 old_cursor.par->prev could be 0.
6764 * several files: changed post inc/dec to pre inc/dec
6766 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
6767 write the lastfiles to file.
6769 * src/BufferView.C (buffer): only show TextCache info when debugging
6771 (resizeCurrentBuffer): ditto
6772 (workAreaExpose): ditto
6774 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
6776 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
6778 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
6779 a bit better by removing the special case for \i and \j.
6781 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6783 * src/lyx_main.C (easyParse): remove test for bad comand line
6784 options, since this broke all xforms-related parsing.
6786 * src/kbmap.C (getsym): set return type to unsigned long, as
6787 declared in header. On an alpha, long is _not_ the same as int.
6789 * src/support/LOstream.h: add a "using std::flush;"
6791 * src/insets/figinset.C: ditto.
6793 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
6795 * src/bufferlist.C (write): use blinding fast file copy instead of
6796 "a char at a time", now we are doing it the C++ way.
6798 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
6799 std::list<int> instead.
6800 (addpidwait): reflect move to std::list<int>
6801 (sigchldchecker): ditto
6803 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
6806 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
6807 that obviously was wrong...
6809 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
6810 c, this avoids warnings with purify and islower.
6812 * src/insets/figinset.C: rename struct queue to struct
6813 queue_element and rewrite to use a std::queue. gsqueue is now a
6814 std::queue<queue_element>
6815 (runqueue): reflect move to std::queue
6818 * src/support/lstrings.h (tostr): specialize for bool, otherwise
6819 we would get "1" "0" instead of "true" "false. Also make the tostr
6822 2000-01-21 Juergen Vigna <jug@sad.it>
6824 * src/buffer.C (writeFileAscii): Disabled code for special groff
6825 handling of tabulars till I fix this in table.C
6827 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6829 * src/support/mkdir.C (mkdir): change second argument of mkdir to
6831 * src/support/lyxlib.h: ditto.
6833 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
6835 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
6836 and 'j' look better. This might fix the "macron" bug that has been
6839 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
6840 functions as one template function. Delete the old versions.
6842 * src/support/lyxsum.C: move using std::ifstream inside
6845 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
6848 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
6850 * src/mathed/formula.C: delete #include "bufferlist.h" never used
6852 * src/insets/figinset.C (InitFigures): use new instead of malloc
6853 to allocate memory for figures and bitmaps.
6854 (DoneFigures): use delete[] instead of free to deallocate memory
6855 for figures and bitmaps.
6856 (runqueue): use new to allocate
6857 (getfigdata): use new/delete[] instead of malloc/free
6858 (RegisterFigure): ditto
6860 * some files: moved some declarations closer to first use, small
6861 whitespace changes use preincrement instead of postincrement where
6862 it does not make a difference.
6864 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
6865 step on the way to use stl::containers for key maps.
6867 * src/bufferlist.h: add a typedef for const_iterator and const
6868 versions of begin and end.
6870 * src/bufferlist.[Ch]: change name of member variable _state to
6871 state_. (avoid reserved names)
6873 (getFileNames): returns the filenames of the buffers in a vector.
6875 * configure.in (ALL_LINGUAS): added ro
6877 * src/support/putenv.C: new file
6879 * src/support/mkdir.C: new file
6881 2000-01-20 Allan Rae <rae@lyx.org>
6883 * lib/layouts/IEEEtran.layout: Added several theorem environments
6885 * lib/templates/IEEEtran.lyx: Example theorem environments and a
6886 couple of minor additions.
6888 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
6889 (except for those in footnotes of course)
6891 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6893 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
6895 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
6896 std::sort and std::lower_bound instead of qsort and handwritten
6898 (struct compara): struct that holds the functors used by std::sort
6899 and std::lower_bound in MathedLookupBOP.
6901 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6903 * src/support/LAssert.h: do not do partial specialization. We do
6906 * src/support/lyxlib.h: note that lyx::getUserName() and
6907 lyx::date() are not in use right now. Should these be suppressed?
6909 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
6910 (makeLinuxDocFile): do not put date and user name in linuxdoc
6913 * src/support/lyxlib.h (kill): change first argument to long int,
6914 since that's what solaris uses.
6916 * src/support/kill.C (kill): fix declaration to match prototype.
6918 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
6919 actually check whether namespaces are supported. This is not what
6922 * src/support/lyxsum.C: add a using directive.
6924 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6926 * src/support/kill.C: if we have namespace support we don't have
6927 to include lyxlib.h.
6929 * src/support/lyxlib.h: use namespace lyx if supported.
6931 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6933 * src/support/date.C: new file
6935 * src/support/chdir.C: new file
6937 * src/support/getUserName.C: new file
6939 * src/support/getcwd.C: new file
6941 * src/support/abort.C: new file
6943 * src/support/kill.C: new file
6945 * src/support/lyxlib.h: moved all the functions in this file
6946 insede struct lyx. Added also kill and abort to this struct. This
6947 is a way to avoid the "kill is not defined in <csignal>", we make
6948 C++ wrappers for functions that are not ANSI C or ANSI C++.
6950 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
6951 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
6952 lyx it has been renamed to sum.
6954 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6956 * src/text.C: add using directives for std::min and std::max.
6958 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6960 * src/texrow.C (getIdFromRow): actually return something useful in
6961 id and pos. Hopefully fixes the bug with positionning of errorbox
6964 * src/lyx_main.C (easyParse): output an error and exit if an
6965 incorrect command line option has been given.
6967 * src/spellchecker.C (ispell_check_word): document a memory leak.
6969 * src/bufferlist.C (write): fix mismatched allocation/deletion,
6970 where a "struct utimbuf" is allocated with "new" and deleted with
6973 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
6975 * src/text2.C (CutSelection): don't delete double spaces.
6976 (PasteSelection): ditto
6977 (CopySelection): ditto
6979 * src/text.C (Backspace): don't delete double spaces.
6981 * src/lyxlex.C (next): fix a bug that were only present with
6982 conformant std::istream::get to read comment lines, use
6983 std::istream::getline instead. This seems to fix the problem.
6985 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6987 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
6988 allowed to insert space before space" editing problem. Please read
6989 commends at the beginning of the function. Comments about usage
6992 * src/text.C (InsertChar): fix for the "not allowed to insert
6993 space before space" editing problem.
6995 * src/text2.C (DeleteEmptyParagraphMechanism): when
6996 IsEmptyTableRow can only return false this last "else if" will
6997 always be a no-op. Commented out.
6999 * src/text.C (RedoParagraph): As far as I can understand tmp
7000 cursor is not really needed.
7002 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
7003 present it could only return false anyway.
7004 (several functions): Did something not so smart...added a const
7005 specifier on a lot of methods.
7007 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
7008 and add a tmp->text.resize. The LyXParagraph constructor does the
7010 (BreakParagraphConservative): ditto
7012 * src/support/path.h (Path): add a define so that the wrong usage
7013 "Path("/tmp") will be flagged as a compilation error:
7014 "`unnamed_Path' undeclared (first use this function)"
7016 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7018 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
7019 which was bogus for several reasons.
7021 * src/LaTeX.C (scanAux): fix the regular expression used to scan
7025 * autogen.sh: do not use "type -path" (what's that anyway?).
7027 * src/support/filetools.C (findtexfile): remove extraneous space
7028 which caused a kpsewhich warning (at least with kpathsea version
7031 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7033 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
7035 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
7037 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
7039 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7041 * src/paragraph.C (BreakParagraph): do not reserve space on text
7042 if we don't need to (otherwise, if pos_end < pos, we end up
7043 reserving huge amounts of memory due to bad unsigned karma).
7044 (BreakParagraphConservative): ditto, although I have not seen
7045 evidence the bug can happen here.
7047 * src/lyxparagraph.h: add a using std::list.
7049 2000-01-11 Juergen Vigna <jug@sad.it>
7051 * src/menus.C (MenuDocu): output an Alert if the documentation-file
7054 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7056 * src/vc-backend.C (doVCCommand): change to be static and take one
7057 more parameter: the path to chdir too be fore executing the command.
7058 (retrive): new function equiv to "co -r"
7060 * src/bufferlist.C (loadLyXFile): implement the missing parts if
7061 file_not_found_hook is true.
7063 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
7065 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
7066 if a file is readwrite,readonly...anything else.
7068 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7070 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
7071 (CreatePostscript): name change from MenuRunDVIPS (or something)
7072 (PreviewPostscript): name change from MenuPreviewPS
7073 (PreviewDVI): name change from MenuPreviewDVI
7075 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
7076 \view_pdf_command., \pdf_to_ps_command
7078 * lib/configure.m4: added search for PDF viewer, and search for
7079 PDF to PS converter.
7080 (lyxrc.defaults output): add \pdflatex_command,
7081 \view_pdf_command and \pdf_to_ps_command.
7083 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
7085 * src/bufferlist.C (write): we don't use blocksize for anything so
7088 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7090 * src/support/block.h: disable operator T* (), since it causes
7091 problems with both compilers I tried. See comments in the file.
7093 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
7096 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
7097 variable LYX_DIR_10x to LYX_DIR_11x.
7099 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
7101 * INSTALL: document --with-lyxname.
7104 * configure.in: new configure flag --with-lyxname which allows to
7105 choose the name under which lyx is installed. Default is "lyx", of
7106 course. It used to be possible to do this with --program-suffix,
7107 but the later has in fact a different meaning for autoconf.
7109 * src/support/lstrings.h (lstrchr): reformat a bit.
7111 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
7112 * src/mathed/math_defs.h: ditto.
7114 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7116 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
7117 true, decides if we create a backup file or not when saving. New
7118 tag and variable \pdf_mode, defaults to false. New tag and
7119 variable \pdflatex_command, defaults to pdflatex. New tag and
7120 variable \view_pdf_command, defaults to xpdf. New tag and variable
7121 \pdf_to_ps_command, defaults to pdf2ps.
7123 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7125 * src/bufferlist.C (close): don't call insetUnlock if the buffer
7126 does not have a BufferView.
7127 (unlockInset): ditto + don't access the_locking_inset if the
7128 buffer does not have a BufferView.
7130 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
7131 certain circumstances so that we don't continue a keyboard
7132 operation long after the key was released. Try f.ex. to load a
7133 large document, press PageDown for some seconds and then release
7134 it. Before this change the document would contine to scroll for
7135 some time, with this change it stops imidiatly.
7137 * src/support/block.h: don't allocate more space than needed. As
7138 long as we don't try to write to the arr[x] in a array_type arr[x]
7139 it is perfectly ok. (if you write to it you might segfault).
7140 added operator value_type*() so that is possible to pass the array
7141 to functions expecting a C-pointer.
7143 * lib/Makefile.am (dist-hook): don't fail completely if unable to
7146 * intl/*: updated to gettext 0.10.35, tried to add our own
7147 required modifications. Please verify.
7149 * po/*: updated to gettext 0.10.35, tried to add our own required
7150 modifications. Please verify.
7152 * src/support/lstrings.C (tostr): go at fixing the problem with
7153 cxx and stringstream. When stringstream is used return
7154 oss.str().c_str() so that problems with lyxstring and basic_string
7155 are avoided. Note that the best solution would be for cxx to use
7156 basic_string all the way, but it is not conformant yet. (it seems)
7158 * src/lyx_cb.C + other files: moved several global functions to
7159 class BufferView, some have been moved to BufferView.[Ch] others
7160 are still located in lyx_cb.C. Code changes because of this. (part
7161 of "get rid of current_view project".)
7163 * src/buffer.C + other files: moved several Buffer functions to
7164 class BufferView, the functions are still present in buffer.C.
7165 Code changes because of this.
7167 * config/lcmessage.m4: updated to most recent. used when creating
7170 * config/progtest.m4: updated to most recent. used when creating
7173 * config/gettext.m4: updated to most recent. applied patch for
7176 * config/gettext.m4.patch: new file that shows what changes we
7177 have done to the local copy of gettext.m4.
7179 * config/libtool.m4: new file, used in creation of acinclude.m4
7181 * config/lyxinclude.m4: new file, this is the lyx created m4
7182 macros, used in making acinclude.m4.
7184 * autogen.sh: GNU m4 discovered as a separate task not as part of
7185 the lib/configure creation.
7186 Generate acinlucde from files in config. Actually cat
7187 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
7188 easier to upgrade .m4 files that really are external.
7190 * src/Spacing.h: moved using std::istringstream to right after
7191 <sstream>. This should fix the problem seen with some compilers.
7193 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7195 * src/lyx_cb.C: began some work to remove the dependency a lot of
7196 functions have on BufferView::text, even if not really needed.
7197 (GetCurrentTextClass): removed this func, it only hid the
7200 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
7201 forgot this in last commit.
7203 * src/Bullet.C (bulletEntry): use static char const *[] for the
7204 tables, becuase of this the return arg had to change to string.
7206 (~Bullet): removed unneeded destructor
7208 * src/BufferView.C (beforeChange): moved from lyx_cb.C
7209 (insetSleep): moved from Buffer
7210 (insetWakeup): moved from Buffer
7211 (insetUnlock): moved from Buffer
7213 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
7214 from Buffer to BufferView.
7216 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
7218 * config/ltmain.sh: updated to version 1.3.4 of libtool
7220 * config/ltconfig: updated to version 1.3.4 of libtool
7222 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7225 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
7226 Did I get that right?
7228 * src/lyxlex.h: add a "using" directive or two.
7229 * src/Spacing.h: ditto.
7230 * src/insets/figinset.C: ditto.
7231 * src/support/filetools.C: ditto.
7232 * src/support/lstrings.C: ditto.
7233 * src/BufferView.C: ditto.
7234 * src/bufferlist.C: ditto.
7235 * src/lyx_cb.C: ditto.
7236 * src/lyxlex.C: ditto.
7238 * NEWS: add some changes for 1.1.4.
7240 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7242 * src/BufferView.C: first go at a TextCache to speed up switching
7245 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7247 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
7248 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
7249 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
7250 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
7253 * src/mathed/math_defs.h (MathedRowSt): make sure that all
7254 members of the struct are correctly initialized to 0 (detected by
7256 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
7257 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
7259 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
7260 pidwait, since it was allocated with "new". This was potentially
7261 very bad. Thanks to Michael Schmitt for running purify for us.
7264 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7266 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
7268 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
7270 1999-12-30 Allan Rae <rae@lyx.org>
7272 * lib/templates/IEEEtran.lyx: minor change
7274 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
7275 src/mathed/formula.C (LocalDispatch): askForText changes
7277 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
7278 know when a user has cancelled input. Fixes annoying problems with
7279 inserting labels and version control.
7281 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7283 * src/support/lstrings.C (tostr): rewritten to use strstream and
7286 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
7288 * src/support/filetools.C (IsFileWriteable): use fstream to check
7289 (IsDirWriteable): use fileinfo to check
7291 * src/support/filetools.h (FilePtr): whole class deleted
7293 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
7295 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
7297 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
7299 * src/bufferlist.C (write): use ifstream and ofstream instead of
7302 * src/Spacing.h: use istrstream instead of sscanf
7304 * src/mathed/math_defs.h: change first arg to istream from FILE*
7306 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
7308 * src/mathed/math_parser.C: have yyis to be an istream
7309 (LexGetArg): use istream (yyis)
7311 (mathed_parse): ditto
7312 (mathed_parser_file): first arg istream instead of FILE*, set yyis
7314 * src/mathed/formula.C (Read): rewritten to use istream
7316 * src/mathed/formulamacro.C (Read): rewritten to use istream
7318 * src/lyxlex.h (~LyXLex): deleted desturctor
7319 (getStream): new function, returns an istream
7320 (getFile): deleted funtion
7321 (IsOK): return is.good();
7323 * src/lyxlex.C (LyXLex): delete file and owns_file
7324 (setFile): open an filebuf and assign that to a istream instead of
7326 (setStream): new function, takes an istream as arg.
7327 (setFile): deleted function
7328 (EatLine): rewritten us use istream instead of FILE*
7332 * src/table.C (LyXTable): use istream instead of FILE*
7333 (Read): rewritten to take an istream instead of FILE*
7335 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7337 * src/buffer.C (Dispatch): remove an extraneous break statement.
7339 * src/support/filetools.C (QuoteName): change to do simple
7340 'quoting'. More work is necessary. Also changed to do nothing
7341 under emx (needs fix too).
7342 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
7344 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
7345 config.h.in to the AC_DEFINE_UNQUOTED() call.
7346 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
7347 needs char * as argument (because Solaris 7 declares it like
7350 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
7351 remove definition of BZERO.
7353 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
7355 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
7356 defined, "lyxregex.h" if not.
7358 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
7360 (REGEX): new variable that is set to regex.c lyxregex.h when
7361 AM_CONDITIONAL USE_REGEX is set.
7362 (libsupport_la_SOURCES): add $(REGEX)
7364 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
7367 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
7370 * configure.in: add call to LYX_REGEX
7372 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
7373 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
7375 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7377 * lib/bind/fi_menus.bind: new file, from
7378 pauli.virtanen@saunalahti.fi.
7380 * src/buffer.C (getBibkeyList): pass the parameter delim to
7381 InsetInclude::getKeys and InsetBibtex::getKeys.
7383 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
7384 is passed to Buffer::getBibkeyList
7386 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
7387 instead of the hardcoded comma.
7389 * src/insets/insetbib.C (getKeys): make sure that there are not
7390 leading blanks in bibtex keys. Normal latex does not care, but
7391 harvard.sty seems to dislike blanks at the beginning of citation
7392 keys. In particular, the retturn value of the function is
7394 * INSTALL: make it clear that libstdc++ is needed and that gcc
7395 2.7.x probably does not work.
7397 * src/support/filetools.C (findtexfile): make debug message go to
7399 * src/insets/insetbib.C (getKeys): ditto
7401 * src/debug.C (showTags): make sure that the output is correctly
7404 * configure.in: add a comment for TWO_COLOR_ICON define.
7406 * acconfig.h: remove all the entries that already defined in
7407 configure.in or acinclude.m4.
7409 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
7410 to avoid user name, date and copyright.
7412 1999-12-21 Juergen Vigna <jug@sad.it>
7414 * src/table.C (Read): Now read bogus row format informations
7415 if the format is < 5 so that afterwards the table can
7416 be read by lyx but without any format-info. Fixed the
7417 crash we experienced when not doing this.
7419 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
7421 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
7422 (RedoDrawingOfParagraph): ditto
7423 (RedoParagraphs): ditto
7424 (RemoveTableRow): ditto
7426 * src/text.C (Fill): rename arg paperwidth -> paper_width
7428 * src/buffer.C (insertLyXFile): rename var filename -> fname
7429 (writeFile): rename arg filename -> fname
7430 (writeFileAscii): ditto
7431 (makeLaTeXFile): ditto
7432 (makeLinuxDocFile): ditto
7433 (makeDocBookFile): ditto
7435 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
7438 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
7440 * src/bmtable.h: add extern "C" on this file when __cplusplus is
7443 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
7444 compiled by a C compiler not C++.
7446 * src/layout.h (LyXTextClass): added typedef for const_iterator
7447 (LyXTextClassList): added typedef for const_iterator + member
7448 functions begin and end.
7450 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
7451 iterators to fill the choice_class.
7452 (updateLayoutChoice): rewritten to use iterators to fill the
7453 layoutlist in the toolbar.
7455 * src/BufferView.h (BufferView::work_area_width): removed unused
7458 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
7460 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
7461 (sgmlCloseTag): ditto
7463 * src/support/lstrings.h: return type of countChar changed to
7466 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
7467 what version of this func to use. Also made to return unsigned int.
7469 * configure.in: call LYX_STD_COUNT
7471 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
7472 conforming std::count.
7474 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7476 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
7477 and a subscript would give bad display (patch from Dekel Tsur
7478 <dekel@math.tau.ac.il>).
7480 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
7482 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
7485 * src/chset.h: add a few 'using' directives
7487 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
7488 triggered when no buffer is active
7490 * src/layout.C: removed `break' after `return' in switch(), since
7493 * src/lyx_main.C (init): make sure LyX can be ran in place even
7494 when libtool has done its magic with shared libraries. Fix the
7495 test for the case when the system directory has not been found.
7497 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
7498 name for the latex file.
7499 (MenuMakeHTML): ditto
7501 * src/buffer.h: add an optional boolean argument, which is passed
7504 1999-12-20 Allan Rae <rae@lyx.org>
7506 * lib/templates/IEEEtran.lyx: small correction and update.
7508 * configure.in: Attempted to use LYX_PATH_HEADER
7510 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
7512 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
7513 input from JMarc. Now use preprocessor to find the header.
7514 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
7515 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
7516 LYX_STL_STRING_FWD. See comments in file.
7518 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
7520 * The global MiniBuffer * minibuffer variable is dead.
7522 * The global FD_form_main * fd_form_main variable is dead.
7524 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7526 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
7528 * src/table.h: add the LOstream.h header
7529 * src/debug.h: ditto
7531 * src/LyXAction.h: change the explaination of the ReadOnly
7532 attribute: is indicates that the function _can_ be used.
7534 * src/LyXAction.C (init): find-replace _can_ be used in read-only
7537 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7539 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
7545 * src/paragraph.C (GetWord): assert on pos>=0
7548 * src/support/lyxstring.C: condition the use of an invariant on
7550 * src/support/lyxstring.h: ditto
7552 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
7553 Use LAssert.h instead of plain assert().
7555 * src/support/lstrings.h: add LAssert.h, in case it is needed.
7557 * src/lyxfunc.C: do not include LAssert.h, it is not used.
7558 * src/support/filetools.C: ditto
7560 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
7563 * INSTALL: document the new configure flags
7565 * configure.in: suppress --with-debug; add --enable-assertions
7567 * acinclude.m4: various changes in alignment of help strings.
7569 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7571 * src/kbmap.C: commented out the use of the hash map in kb_map,
7572 beginning of movement to a stl::container.
7574 * several files: removed code that was not in effect when
7575 MOVE_TEXT was defined.
7577 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
7578 for escaping should not be used. We can discuss if the string
7579 should be enclosed in f.ex. [] instead of "".
7581 * src/trans_mgr.C (insert): use the new returned value from
7582 encodeString to get deadkeys and keymaps done correctly.
7584 * src/chset.C (encodeString): changed to return a pair, to tell
7585 what to use if we know the string.
7587 * src/lyxscreen.h (fillArc): new function.
7589 * src/FontInfo.C (resize): rewritten to use more std::string like
7590 structore, especially string::replace.
7592 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
7595 * configure.in (chmod +x some scripts): remove config/gcc-hack
7597 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7599 * src/buffer.C (writeFile): change once again the top comment in a
7600 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
7601 instead of an hardcoded version number.
7602 (makeDocBookFile): ditto
7604 * src/version.h: add new define LYX_DOCVERSION
7606 * po/de.po: update from Pit Sütterlin
7607 * lib/bind/de_menus.bind: ditto.
7609 * src/lyxfunc.C (Dispatch): call MenuExport()
7610 * src/buffer.C (Dispatch): ditto
7612 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
7613 LyXFunc::Dispatch().
7614 (MenuExport): new function, moved from
7615 LyXFunc::Dispatch().
7617 * src/trans_mgr.C (insert): small cleanup
7618 * src/chset.C (loadFile): ditto
7620 * lib/kbd/iso8859-1.cdef: add missing backslashes
7622 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7624 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
7625 help with placing the manually drawn accents better.
7627 (Draw): x2 and hg changed to float to minimize rounding errors and
7628 help place the accents better.
7630 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
7631 unsigned short to char is just wrong...cast the char to unsigned
7632 char instead so that the two values can compare sanely. This
7633 should also make the display of insetlatexaccents better and
7634 perhaps also some other insets.
7636 (lbearing): new function
7639 1999-12-15 Allan Rae <rae@lyx.org>
7641 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
7642 header that provides a wrapper around the very annoying SGI STL header
7645 * src/support/lyxstring.C, src/LString.h:
7646 removed old SGI-STL-compatability attempts.
7648 * configure.in: Use LYX_STL_STRING_FWD.
7650 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
7651 stl_string_fwd.h is around and try to determine it's location.
7652 Major improvement over previous SGI STL 3.2 compatability.
7653 Three small problems remain with this function due to my zero
7654 knowledge of autoconf. JMarc and lgb see the comments in the code.
7656 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7658 * src/broken_const.h, config/hack-gcc, config/README: removed
7660 * configure.in: remove --with-gcc-hack option; do not call
7663 * INSTALL: remove documentation of --with-broken-const and
7666 * acconfig.h: remove all trace of BROKEN_CONST define
7668 * src/buffer.C (makeDocBookFile): update version number in output
7670 (SimpleDocBookOnePar): fix an assert when trying to a character
7671 access beyond string length
7674 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7676 * po/de.po: fix the Export menu
7678 * lyx.man: update the description of -dbg
7680 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
7681 (commandLineHelp): updated
7682 (easyParse): show list of available debug levels if -dbg is passed
7685 * src/Makefile.am: add debug.C
7687 * src/debug.h: moved some code to debug.C
7689 * src/debug.C: new file. Contains code to set and show debug
7692 * src/layout.C: remove 'break' after 'continue' in switch
7693 statements, since these cannot be reached.
7695 1999-12-13 Allan Rae <rae@lyx.org>
7697 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
7698 (in_word_set): hash() -> math_hash()
7700 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
7702 * acconfig.h: Added a test for whether we are using exceptions in the
7703 current compilation run. If so USING_EXCEPTIONS is defined.
7705 * config.in: Check for existance of stl_string_fwd.h
7706 * src/LString.h: If compiling --with-included-string and SGI's
7707 STL version 3.2 is present (see above test) we need to block their
7708 forward declaration of string and supply a __get_c_string().
7709 However, it turns out this is only necessary if compiling with
7710 exceptions enabled so I've a bit more to add yet.
7712 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
7713 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
7714 src/support/LRegex.h, src/undo.h:
7715 Shuffle the order of the included files a little to ensure that
7716 LString.h gets included before anything that includes stl_string_fwd.h
7718 * src/support/lyxstring.C: We need to #include LString.h instead of
7719 lyxstring.h to get the necessary definition of __get_c_string.
7720 (__get_c_string): New function. This is defined static just like SGI's
7721 although why they need to do this I'm not sure. Perhaps it should be
7722 in lstrings.C instead.
7724 * lib/templates/IEEEtran.lyx: New template file.
7726 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7728 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
7729 * intl/Makefile.in (MKINSTALLDIRS): ditto
7731 * src/LyXAction.C (init): changed to hold the LFUN data in a
7732 automatic array in stead of in callso to newFunc, this speeds up
7733 compilation a lot. Also all the memory used by the array is
7734 returned when the init is completed.
7736 * a lot of files: compiled with -Wold-style-cast, changed most of
7737 the reported offenders to C++ style casts. Did not change the
7738 offenders in C files.
7740 * src/trans.h (Match): change argument type to unsigned int.
7742 * src/support/DebugStream.C: fix some types on the streambufs so
7743 that it works on a conforming implementation.
7745 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7747 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
7749 * src/support/lyxstring.C: remove the inline added earlier since
7750 they cause a bunch of unsatisfied symbols when linking with dec
7751 cxx. Cxx likes to have the body of inlines at the place where they
7754 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
7755 accessing negative bounds in array. This fixes the crash when
7756 inserting accented characters.
7757 * src/trans.h (Match): ditto
7759 * src/buffer.C (Dispatch): since this is a void, it should not try
7760 to return anything...
7762 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7764 * src/buffer.h: removed the two friends from Buffer. Some changes
7765 because of this. Buffer::getFileName and Buffer::setFileName
7766 renamed to Buffer::fileName() and Buffer::fileName(...).
7768 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7770 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
7771 and Buffer::update(short) to BufferView. This move is currently
7772 controlled by a define MOVE_TEXT, this will be removed when all
7773 shows to be ok. This move paves the way for better separation
7774 between buffer contents and buffer view. One side effect is that
7775 the BufferView needs a rebreak when swiching buffers, if we want
7776 to avoid this we can add a cache that holds pointers to LyXText's
7777 that is not currently in use.
7779 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
7782 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7784 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
7786 * lyx_main.C: new command line option -x (or --execute) and
7787 -e (or --export). Now direct conversion from .lyx to .tex
7788 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
7789 Unfortunately, X is still needed and the GUI pops up during the
7792 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7794 * src/Spacing.C: add a using directive to bring stream stuff into
7796 * src/paragraph.C: ditto
7797 * src/buffer.C: ditto
7799 * NEWS: updated a bit the new features of 1.1.3 (took a few things
7800 from Lars' announcement).
7802 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
7803 example files from Tino Meinen.
7805 1999-12-06 Allan Rae <rae@lyx.org>
7807 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
7809 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7811 * src/support/lyxstring.C: added a lot of inline for no good
7814 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
7815 latexWriteEndChanges, they were not used.
7817 * src/layout.h (operator<<): output operator for PageSides
7819 * src/mathed/math_iter.C (my_memcpy): slightly changed.
7821 * some example files: loaded in LyX 1.0.4 and saved again to update
7822 certain constructs (table format)
7824 * a lot of files: did the change to use fstream/iostream for all
7825 writing of files. Done with a close look at Andre Poenitz's patch.
7827 * some files: whitespace changes.
7829 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7831 * src/mathed/math_iter.C (my_memcpy): new function. Since the
7832 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
7833 architecture, we provide our own. It is used unconditionnally, but
7834 I do not think this is a performance problem. Thanks to Angus
7835 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
7836 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
7838 (GetInset): use my_memcpy.
7842 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
7843 it is easier to understand, but it uses less TeX-only constructs now.
7845 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
7846 elements contain spaces
7848 * lib/configure: regenerated
7850 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
7851 elements contain spaces; display the list of programs that are
7854 * autogen.sh: make sure lib/configure is executable
7856 * lib/examples/*: rename the tutorial examples to begin with the
7857 two-letters language code.
7859 * src/lyxfunc.C (getStatus): do not query current font if no
7862 * src/lyx_cb.C (RunScript): use QuoteName
7863 (MenuRunDvips): ditto
7864 (PrintApplyCB): ditto
7866 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
7867 around argument, so that it works well with the current shell.
7868 Does not work properly with OS/2 shells currently.
7870 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
7871 * src/LyXSendto.C (SendtoApplyCB): ditto
7872 * src/lyxfunc.C (Dispatch): ditto
7873 * src/buffer.C (runLaTeX): ditto
7874 (runLiterate): ditto
7875 (buildProgram): ditto
7877 * src/lyx_cb.C (RunScript): ditto
7878 (MenuMakeLaTeX): ditto
7880 * src/buffer.h (getLatexName): new method
7882 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
7884 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7886 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
7887 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
7888 (create_math_panel): ditto
7890 * src/lyxfunc.C (getStatus): re-activate the code which gets
7891 current font and cursor; add test for export to html.
7893 * src/lyxrc.C (read): remove unreachable break statements; add a
7896 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
7898 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7900 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
7901 introduced by faulty regex.
7902 * src/buffer.C: ditto
7903 * src/lastfiles.C: ditto
7904 * src/paragraph.C: ditto
7905 * src/table.C: ditto
7906 * src/vspace.C: ditto
7907 * src/insets/figinset.C: ditto
7908 Note: most of these is absolutely harmless, except the one in
7909 src/mathed formula.C.
7911 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7913 * src/ImportNoweb.C (documentclass): fixed bounds for substr
7914 operation, yielding correct results for the reLyX command.
7916 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7918 * src/support/filetools.C (ExpandPath): removed an over eager
7920 (ReplaceEnvironmentPath): ditto
7922 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
7923 shows that we are doing something fishy in our code...
7927 * src/lyxrc.C (read): use a double switch trick to get more help
7928 from the compiler. (the same trick is used in layout.C)
7929 (write): new function. opens a ofstream and pass that to output
7930 (output): new function, takes a ostream and writes the lyxrc
7931 elemts to it. uses a dummy switch to make sure no elements are
7934 * src/lyxlex.h: added a struct pushpophelper for use in functions
7935 with more than one exit point.
7937 * src/lyxlex.[Ch] (GetInteger): made it const
7941 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
7943 * src/layout.[hC] : LayoutTags splitted into several enums, new
7944 methods created, better error handling cleaner use of lyxlex. Read
7947 * src/bmtable.[Ch]: change some member prototypes because of the
7948 image const changes.
7950 * commandtags.h, src/LyXAction.C (init): new function:
7951 "preferences-save", saves the lyxrc entries into .lyx/preferences.
7952 This file is not read automatically but you can add \input
7953 preferences to your lyxrc if you want to. We need to discuss how
7956 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
7957 in .aux, also remove .bib and .bst files from dependencies when
7960 * src/BufferView.C, src/LyXView.C: add const_cast several places
7961 because of changes to images.
7963 * lib/images/*: same change as for images/*
7965 * lib/lyxrc.example: Default for accept_compound is false not no.
7967 * images/*: changed to be const, however I have som misgivings
7968 about this change so it might be changed back.
7970 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7972 * lib/configure, po/POTFILES.in: regenerated
7974 * autogen.sh: autogenerate lib/configure from lib/configure.m4
7976 * config/lib_configure.m4: removed
7978 * lib/configure.m4: new file (was config/lib_configure.m4)
7980 * configure.in: do not test for rtti, since we do not use it.
7982 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
7984 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
7985 doubling of allocated space scheme. This makes it faster for large
7986 strings end to use less memory for small strings. xtra rememoved.
7988 * src/insets/figinset.C (waitalarm): commented out.
7989 (GhostscriptMsg): use static_cast
7990 (GhostscriptMsg): use new instead of malloc to allocate memory for
7991 cmap. also delete the memory after use.
7993 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
7995 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
7996 for changes in bibtex database or style.
7997 (runBibTeX): remove all .bib and .bst files from dep before we
7999 (run): use scanAuc in when dep file already exist.
8001 * src/DepTable.C (remove_files_with_extension): new method
8004 * src/DepTable.[Ch]: made many of the methods const.
8006 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8008 * src/bufferparams.C: make sure that the default textclass is
8009 "article". It used to be the first one by description order, but
8010 now the first one is "docbook".
8012 * src/lyx_main.C (setDebuggingLevel): change type of argument to
8013 string; call Debug::value.
8014 (easyParse): pass complete argument to setDebuggingLevel().
8016 * src/debug.h (value): fix the code that parses debug levels.
8018 * src/debug.h: add new debug type ACTION, reserved for LyXAction
8021 * src/LyXAction.C: use Debug::ACTION as debug channel.
8023 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
8025 * NEWS: updated for the future 1.1.3 release.
8027 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
8028 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
8029 it should. This is of course a controversial change (since many
8030 people will find that their lyx workscreen is suddenly full of
8031 red), but done for the sake of correctness.
8033 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
8034 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
8036 * src/insets/inseterror.h, src/insets/inseturl.h,
8037 src/insets/insetinfo.h, src/insets/figinset.h,
8038 src/mathed/formulamacro.h, src/mathed/math_macro.h
8039 (EditMessage): add a missing const and add _() to make sure that
8042 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
8043 src/insets/insetbib.C, src/support/filetools.C: add `using'
8046 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
8047 doing 'Insert index of last word' at the beginning of a paragraph.
8049 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8051 * several files: white-space changes.
8053 * src/mathed/formula.C: removed IsAlpha and IsDigit
8055 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
8056 .bib file. use a ifstream instead of FilePtr when parsing the .bib
8059 * src/insets/figinset.C (GetPSSizes): don't break when
8060 "EndComments" is seen. But break when a boundingbox is read.
8062 * all classes inherited from Inset: return value of Clone
8063 changed back to Inset *.
8065 * all classes inherited form MathInset: return value of Clone
8066 changed back to MathedInset *.
8068 * src/insets/figinset.C (runqueue): use a ofstream to output the
8069 gs/ps file. Might need some setpresicion or setw. However I can
8070 see no problem with the current code.
8071 (runqueue): use sleep instead of the alarm/signal code. I just
8072 can't see the difference.
8074 * src/paragraph.C (LyXParagraph): reserve space in the new
8075 paragraph and resize the inserted paragraph to just fit.
8077 * src/lyxfunc.h (operator|=): added operator for func_status.
8079 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
8080 check for readable file.
8082 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
8083 check for readable file.
8084 (MenuMakeLinuxDoc): ditto
8085 (MenuMakeDocBook): ditto
8086 (MenuMakeAscii): ditto
8087 (InsertAsciiFile): split the test for openable and readable
8089 * src/bmtable.C (draw_bitmaptable): use
8090 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
8092 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
8093 findtexfile from LaTeX to filetools.
8095 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
8096 instead of FilePtr. Needs to be verified by a literate user.
8098 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8100 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
8101 (EditMessage): likewise.
8103 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
8104 respectively as \textasciitilde and \textasciicircum.
8106 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8108 * src/support/lyxstring.h: made the methods that take iterators
8111 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
8112 (regexMatch): made is use the real regex class.
8114 * src/support/Makefile.am: changed to use libtool
8116 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
8118 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
8120 (MathIsInset ++): changed several macros to be inline functions
8123 * src/mathed/Makefile.am: changed to use libtool
8125 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
8127 * src/insets/inset* : Clone changed to const and return type is
8128 the true insettype not just Inset*.
8130 * src/insets/Makefile.am: changed to use libtool
8132 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
8134 * src/undo.[Ch] : added empty() and changed some of the method
8137 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
8139 * src/lyxparagraph.h: use id() and id(...) instead of getID and
8140 setID use block<> for the bullets array, added const several places.
8142 * src/lyxfunc.C (getStatus): new function
8144 * src/lyxfunc.[Ch] : small changes to take advantage of the new
8145 LyXAction, added const to several funtions.
8147 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
8148 a std::map, and to store the dir items in a vector.
8150 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
8153 * src/LyXView.[Ch] + other files : changed currentView to view.
8155 * src/LyXAction.[Ch] : ported from the old devel branch.
8157 * src/.cvsignore: added .libs and a.out
8159 * configure.in : changes to use libtool.
8161 * acinclude.m4 : inserted libtool.m4
8163 * .cvsignore: added libtool
8165 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8167 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
8168 file name in insets and mathed directories (otherwise the
8169 dependency is not taken in account under cygwin).
8171 * src/text2.C (InsertString[AB]): make sure that we do not try to
8172 read characters past the string length.
8174 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8176 * lib/doc/LaTeXConfig.lyx.in,
8177 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
8179 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
8180 file saying who created them and when this heppened; this is
8181 useless and annoys tools like cvs.
8183 * lib/layouts/g-brief-{en,de}.layout,
8184 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
8185 from Thomas Hartkens <thomas@hartkens.de>.
8187 * src/{insets,mathed}/Makefile.am: do not declare an empty
8188 LDFLAGS, so that it can be set at configure time (useful on Irix
8191 * lib/reLyX/configure.in: make sure that the prefix is set
8192 correctly in LYX_DIR.
8194 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
8196 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
8197 be used by 'command-sequence' this allows to bind a key to a
8198 sequence of LyX-commands
8199 (Example: 'command-sequence math-insert alpha; math-insert beta;")
8201 * src/LyXAction.C: add "command-sequence"
8203 * src/LyXFunction.C: handling of "command-sequence"
8205 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
8206 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
8208 * src/lyxserver.C, src/minibuffer.C: Use this new interface
8210 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8212 * src/buffer.C (writeFile): Do not output a comment giving user
8213 and date at the beginning of a .lyx file. This is useless and
8214 annoys cvs anyway; update version number to 1.1.
8216 * src/Makefile.am (LYX_DIR): add this definition, so that a
8217 default path is hardcoded in LyX.
8219 * configure.in: Use LYX_GNU_GETTEXT.
8221 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
8222 AM_GNU_GETTEXT with a bug fixed.
8224 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
8226 * src/chset.C: add "using std::ifstream;" to please dec cxx.
8228 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
8229 which is used to point to LyX data is now LYX_DIR_11x.
8231 * lyx.man: convert to a unix text file; small updates.
8233 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
8235 * src/support/LSubstring.[Ch]: made the second arg of most of the
8236 constructors be a const reference.
8238 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
8241 * src/support/lyxstring.[Ch] (swap): added missing member function
8242 and specialization of swap(str, str);
8244 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
8246 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
8247 trace of the old one.
8249 * src/undo.[Ch]: made the undostack use std::list to store undo's in
8250 put the member definitions in undo.C.
8252 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
8253 NEW_TEXT and have now only code that was included when this was
8256 * src/intl.C (LCombo): use static_cast
8258 (DispatchCallback): ditto
8260 * src/definitions.h: removed whole file
8262 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
8264 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
8265 parsing and stores in a std:map. a regex defines the file format.
8266 removed unneeded members.
8268 * src/bufferparams.h: added several enums from definitions.h here.
8269 Removed unsused destructor. Changed some types to use proper enum
8270 types. use block to have the temp_bullets and user_defined_bullets
8271 and to make the whole class assignable.
8273 * src/bufferparams.C (Copy): removed this functions, use a default
8276 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
8279 * src/buffer.C (readLyXformat2): commend out all that have with
8280 oldpapersize to do. also comment out all that hve to do with
8281 insetlatex and insetlatexdel.
8282 (setOldPaperStuff): commented out
8284 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
8286 * src/LyXAction.C: remove use of inset-latex-insert
8288 * src/mathed/math_panel.C (button_cb): use static_cast
8290 * src/insets/Makefile.am (insets_o_SOURCES): removed
8293 * src/support/lyxstring.C (helper): use the unsigned long
8294 specifier, UL, instead of a static_cast.
8296 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
8298 * src/support/block.h: new file. to be used as a c-style array in
8299 classes, so that the class can be assignable.
8301 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8303 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
8304 NULL, make sure to return an empty string (it is not possible to
8305 set a string to NULL).
8307 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8309 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
8311 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
8313 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
8314 link line, so that Irix users (for example) can set it explicitely to
8317 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
8318 it can be overidden at make time (static or dynamic link, for
8321 * src/vc-backend.C, src/LaTeXFeatures.h,
8322 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
8323 statements to bring templates to global namespace.
8325 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8327 * src/support/lyxstring.C (operator[] const): make it standard
8330 * src/minibuffer.C (Init): changed to reflect that more
8331 information is given from the lyxvc and need not be provided here.
8333 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
8335 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
8337 * src/LyXView.C (UpdateTimerCB): use static_cast
8338 (KeyPressMask_raw_callback): ditto
8340 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
8341 buffer_, a lot of changes because of this. currentBuffer() ->
8342 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
8343 also changes to other files because of this.
8345 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8347 * src/vc-backend.[Ch]: new files. The backends for vc handling,
8348 have no support for RCS and partial support for CVS, will be
8351 * src/insets/ several files: changes because of function name
8352 changes in Bufferview and LyXView.
8354 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
8356 * src/support/LSubstring.[Ch]: new files. These implement a
8357 Substring that can be very convenient to use. i.e. is this
8359 string a = "Mary had a little sheep";
8360 Substring(a, "sheep") = "lamb";
8361 a is now "Mary has a little lamb".
8363 * src/support/LRegex.[Ch]: a regex class that can be used to pick
8364 out patterns and subpatterns of strings. It is used by LSubstring
8365 and also by vc-backend.C
8367 * src/support/lyxstring.C: went over all the assertions used and
8368 tried to correct the wrong ones and flag which of them is required
8369 by the standard. some bugs found because of this. Also removed a
8370 couple of assertions.
8372 * src/support/Makefile.am (libsupport_a_SOURCES): added
8373 LSubstring.[Ch] and LRegex.[Ch]
8375 * src/support/FileInfo.h: have struct stat buf as an object and
8376 not a pointer to one, some changes because of this.
8378 * src/LaTeXFeatures.C (getTClassPreamble): also use the
8379 information in layout when adding the layouts preamble to the
8382 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
8385 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
8386 because of bug in OS/2.
8388 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8390 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
8391 \verbatim@font instead of \ttfamily, so that it can be redefined.
8393 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
8394 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
8395 src/layout.h, src/text2.C: add 'using' directive to bring the
8396 STL templates we need from the std:: namespace to the global one.
8397 Needed by DEC cxx in strict ansi mode.
8399 * src/support/LIstream.h,src/support/LOstream.h,
8400 src/support/lyxstring.h,src/table.h,
8401 src/lyxlookup.h: do not include <config.h> in header
8402 files. This should be done in the .C files only.
8404 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
8408 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8410 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
8411 from Kayvan to fix the tth invokation.
8413 * development/lyx.spec.in: updates from Kayvan to reflect the
8414 changes of file names.
8416 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
8418 * src/text2.C (InsertStringB): use std::copy
8419 (InsertStringA): use std::copy
8421 * src/bufferlist.C: use a vector to store the buffers in. This is
8422 an internal change and should not affect any other thing.
8424 * src/BufferView.C (waitForX): use XSync instead of the lengthy
8427 * src/text.C (Fill): fix potential bug, one off bug.
8429 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8431 * src/Makefile.am (lyx_main.o): add more files it depends on.
8433 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
8435 * src/support/lyxstring.C: use size_t for the reference count,
8436 size, reserved memory and xtra.
8437 (internal_compare): new private member function. Now the compare
8438 functions should work for std::strings that have embedded '\0'
8440 (compare): all compare functions rewritten to use
8443 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8445 * src/support/lyxstring.C (compare): pass c_str()
8446 (compare): pass c_str
8447 (compare): pass c_str
8449 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8451 * src/support/DebugStream.C: <config.h> was not included correctly.
8453 * lib/configure: forgot to re-generate it :( I'll make this file
8454 auto generated soon.
8456 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8458 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
8461 * src/support/lyxstring.C: some changes from length() to rep->sz.
8462 avoids a function call.
8464 * src/support/filetools.C (SpaceLess): yet another version of the
8465 algorithm...now per Jean-Marc's suggestions.
8467 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8469 * src/layout.C (less_textclass_desc): functor for use in sorting
8471 (LyXTextClass::Read): sort the textclasses after reading.
8473 * src/support/filetools.C (SpaceLess): new version of the
8474 SpaceLess functions. What problems does this one give? Please
8477 * images/banner_bw.xbm: made the arrays unsigned char *
8479 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8481 * src/support/lyxstring.C (find): remove bogus assertion in the
8482 two versions of find where this has not been done yet.
8484 * src/support/lyxlib.h: add missing int return type to
8487 * src/menus.C (ShowFileMenu): disable exporting to html if no
8488 html export command is present.
8490 * config/lib_configure.m4: add a test for an HTML converter. The
8491 programs checked for are, in this order: tth, latex2html and
8494 * lib/configure: generated from config/lib_configure.m4.
8496 * src/lyxfunc.C (Dispatch): update and improve the execution of an
8497 html converter. The parameters are now passed through $$FName and
8498 $$OutName, instead of standard input/output.
8500 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
8502 * lib/lyxrc.example: update description of \html_command.
8503 add "quotes" around \screen_font_xxx font setting examples to help
8504 people who use fonts with spaces in their names.
8506 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
8508 * Distribution files: updates for v1.1.2
8510 * src/support/lyxstring.C (find): remove bogus assert and return
8511 npos for the same condition.
8513 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
8515 * added patch for OS/2 from SMiyata.
8517 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8519 * src/text2.C (CutSelection): make space_wrapped a bool
8520 (CutSelection): dont declare int i until we have to.
8521 (alphaCounter): return a char const *.
8523 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8525 * src/support/syscall.C (Systemcalls::kill):
8526 src/support/filetools.C (PutEnv, PutEnvPath):
8527 src/lyx_cb.C (addNewlineAndDepth):
8528 src/FontInfo.C (FontInfo::resize): condition some #warning
8529 directives with WITH_WARNINGS.
8532 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8534 * src/layout.[Ch] + several files: access to class variables
8535 limited and made accessor functions instead a lot of code changed
8536 becuase of this. Also instead of returning pointers often a const
8537 reference is returned instead.
8539 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
8541 * src/Makefile.am (dist-hook): added used to remove the CVS from
8542 cheaders upon creating a dist
8543 (EXTRA_DIST): added cheaders
8545 * src/support/lstrings.C (tostr(char)): fix it to handle param as
8546 a character not as a small integer.
8548 * src/support/lyxstring.C (find): removed Assert and added i >=
8549 rep->sz to the first if.
8551 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8553 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
8554 src/LyXView.C src/buffer.C src/bufferparams.C
8555 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
8556 src/text2.C src/insets/insetinclude.C:
8557 lyxlayout renamed to textclasslist.
8559 * src/layout.C: some lyxerr changes.
8561 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
8562 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
8563 (LyXLayoutList): removed all traces of this class.
8564 (LyXTextClass::Read): rewrote LT_STYLE
8565 (LyXTextClass::hasLayout): new function
8566 (LyXTextClass::GetLayout): rewritten to return an iterator + has
8567 both const and nonconst version.
8568 (LyXTextClass::delete_layout): new function.
8569 (LyXTextClassList::Style): bug fix. do the right thing if layout
8571 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
8572 (LyXTextClassList::NameOfLayout): ditto
8573 (LyXTextClassList::Load): ditto
8575 * src/buffer.C (makeLaTeXFile): new access to layoutlist
8577 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
8579 * src/LyXAction.C (LookupFunc): added a workaround for sun
8580 compiler, on the other hand...we don't know if the current code
8581 compiles on sun at all...
8583 * src/support/filetools.C (CleanupPath): subst fix
8585 * src/insets/insetbib.C (delDatabase): subst fix, this looks
8588 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
8589 complained about this one?
8591 * src/insets/insetinclude.C (Latex): subst fix
8593 * src/insets/insetbib.C (getKeys): subst fix
8595 * src/LyXSendto.C (SendtoApplyCB): subst fix
8597 * src/lyx_main.C (init): subst fix
8599 * src/layout.C (Read): subst fix
8601 * src/lyx_sendfax_main.C (button_send): subst fix
8603 * src/buffer.C (RoffAsciiTable): subst fix
8605 * src/lyx_cb.C (MenuFax): subst fix
8606 (PrintApplyCB): subst fix
8608 1999-10-26 Juergen Vigna <jug@sad.it>
8610 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
8612 (Read): Cleaned up this code so now we read only format vestion >= 5
8614 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
8616 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
8617 come nobody has complained about this one?
8619 * src/insets/insetinclude.C (Latex): subst fix
8621 * src/insets/insetbib.C (getKeys): subst fix
8623 * src/lyx_main.C (init): subst fix
8625 * src/layout.C (Read): subst fix
8627 * src/buffer.C (RoffAsciiTable): subst fix
8629 * src/lyx_cb.C (MenuFax): subst fix.
8631 * src/layout.[hC] + some other files: rewrote to use
8632 std::container to store textclasses and layouts in.
8633 Simplified, removed a lot of code. Make all classes
8634 assignable. Further simplifications and review of type
8635 use still to be one.
8637 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
8638 lastfiles to create the lastfiles partr of the menu.
8640 * src/lastfiles.[Ch]: rewritten to use deque to store the
8641 lastfiles in. Uses fstream for reading and writing. Simplifies
8644 * src/support/syscall.C: remove explicit cast.
8646 * src/BufferView.C (CursorToggleCB): removed code snippets that
8648 use explicat C++ style casts instead of C style casts. also use
8649 u_vdata instea of passing pointers in longs.
8651 * src/PaperLayout.C: removed code snippets that were commented out.
8653 * src/lyx_gui_misc.C: removed code snippets that were commented out.
8655 * src/lyx_main.C: removed code snippets that wer commented out.
8657 * src/paragraph.C: removed code snippets that were commented out.
8659 * src/lyxvc.C (logClose): use static_cast
8661 (viewLog): remove explicit cast to void*
8662 (showLog): removed old commented code
8664 * src/menus.C: use static_cast instead of C style casts. use
8665 u_vdata instead of u_ldata. remove explicit cast to (long) for
8666 pointers. Removed old code that was commented out.
8668 * src/insets/inset.C: removed old commented func
8670 * src/insets/insetref.C (InsetRef): removed old code that had been
8671 commented out for a long time.
8673 (escape): removed C style cast
8675 * src/insets/insetlatexaccent.C (Draw): removed old commented code
8677 * src/insets/insetlatex.C (Draw): removed old commented code
8678 (Read): rewritten to use string
8680 * src/insets/insetlabel.C (escape): removed C style cast
8682 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
8684 * src/insets/insetindex.C: use static_cast and u_vdata, removed
8687 * src/insets/insetinclude.h: removed a couple of stupid bools
8689 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
8690 (Clone): remove C style cast
8691 (getKeys): changed list to lst because of std::list
8693 * src/insets/inseterror.C (Draw): removed som old commented code.
8695 * src/insets/insetcommand.C (Draw): removed some old commented code.
8697 * src/insets/insetbib.C (bibitem_cb): removed code that has been
8698 commented out forever.
8699 (bibitem_cb): use static_cast instead of C style cast
8700 use of vdata changed to u_vdata.
8702 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
8704 (CloseUrlCB): use static_cast instead of C style cast.
8705 (CloseUrlCB): added a fl_free form...it seemed to be missing.
8707 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
8708 (C_InsetInfo_CloseInfoCB): forward the ob parameter
8709 (CloseInfoCB): static_cast from ob->u_vdata instead.
8710 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
8713 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
8714 (C_InsetError_CloseErrorCB): forward the ob parameter
8715 (CloseErrorCB): static_cast from ob->u_vdata instead.
8717 * src/vspace.h: include LString.h since we use string in this class.
8719 * src/vspace.C (lyx_advance): changed name from advance because of
8720 nameclash with stl. And since we cannot use namespaces yet...I
8721 used a lyx_ prefix instead. Expect this to change when we begin
8724 * src/BufferView.[Ch] (BufferView::~BufferView): removed
8726 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
8727 and removed now defunct constructor and deconstructor.
8729 * src/BufferView.h: have backstack as a object not as a pointer.
8730 removed initialization from constructor. added include for BackStack
8732 * development/lyx.spec.in (%build): add CFLAGS also.
8734 * src/screen.C (drawFrame): removed another warning.
8736 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8738 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
8739 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
8740 README and ANNOUNCE a bit for the next release. More work is
8743 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
8744 unbreakable if we are in freespacing mode (LyX-Code), but not in
8747 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8749 * src/BackStack.h: fixed initialization order in constructor
8751 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
8753 * acinclude.m4 (VERSION): new rules for when a version is
8754 development, added also a variable for prerelease.
8755 (warnings): we set with_warnings=yes for prereleases
8756 (lyx_opt): prereleases compile with same optimization as development
8757 (CXXFLAGS): only use pedantic if we are a development version
8759 * src/BufferView.C (restorePosition): don't do anything if the
8762 * src/BackStack.h: added member empty, use this to test if there
8763 is anything to pop...
8765 1999-10-25 Juergen Vigna <jug@sad.it>
8768 * forms/layout_forms.fd +
8769 * forms/latexoptions.fd +
8770 * lyx.fd: changed for various form resize issues
8772 * src/mathed/math_panel.C +
8773 * src/insets/inseterror.C +
8774 * src/insets/insetinfo.C +
8775 * src/insets/inseturl.C +
8776 * src/insets/inseturl.h +
8779 * src/PaperLayout.C +
8780 * src/ParagraphExtra.C +
8781 * src/TableLayout.C +
8783 * src/layout_forms.C +
8790 * src/menus.C: fixed various resize issues. So now forms can be
8791 resized savely or not be resized at all.
8793 * forms/form_url.fd +
8794 * src/insets/form_url.[Ch]: added because it's cleaner and easier
8797 * src/insets/Makefile.am: added files form_url.[Ch]
8799 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8801 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
8802 (and presumably 6.2).
8804 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
8805 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
8806 remaining static member callbacks.
8808 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
8811 * src/support/lyxstring.h: declare struct Srep as friend of
8812 lyxstring, since DEC cxx complains otherwise.
8814 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8816 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8818 * src/LaTeX.C (run): made run_bibtex also depend on files with
8820 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
8821 are put into the dependency file.
8823 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
8824 the code has shown itself to work
8825 (create_ispell_pipe): removed another warning, added a comment
8828 * src/minibuffer.C (ExecutingCB): removed code that has been
8829 commented out a long time
8831 * src/lyxfunc.C (processKeyEvent): removed some very old commented
8832 out code + a warning.
8834 * src/support/lyxstring.h: comment out the three private
8835 operators, when compiling with string ansi conforming compilers
8838 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
8840 (pixmapFromBitmapData): change type of bdata to be unsigned char *
8841 (pixmapFromBitmapData): add a reinterpret_cast in the call to
8844 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
8847 * src/mathed/math_panel.C (create_math_panel): remove explicit
8850 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
8853 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
8854 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
8855 to XCreatePixmapFromBitmapData
8856 (fl_set_bmtable_data): change the last argument to be unsigned
8858 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
8859 and bh to be unsigned int, remove explicit casts in call to
8860 XReadBitmapFileData.
8862 * images/arrows.xbm: made the arrays unsigned char *
8863 * images/varsz.xbm: ditto
8864 * images/misc.xbm: ditto
8865 * images/greek.xbm: ditto
8866 * images/dots.xbm: ditto
8867 * images/brel.xbm: ditto
8868 * images/bop.xbm: ditto
8870 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
8872 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
8873 (LYX_PROG_CXX): added -pedantic to g++ compile options when
8874 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
8876 (LYX_CXX_CHEADERS): added <clocale> to the test.
8878 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
8880 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
8882 * src/support/lyxstring.C (append): fixed something that must be a
8883 bug, rep->assign was used instead of rep->append.
8885 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
8888 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
8889 lyx insert double chars. Fix spotted by Kayvan.
8891 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
8893 * Fixed the tth support. I messed up with the Emacs patch apply feature
8894 and omitted the changes in lyxrc.C.
8896 1999-10-22 Juergen Vigna <jug@sad.it>
8898 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
8900 * src/lyx_cb.C (MenuInsertRef) +
8901 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
8902 the form cannot be resized under it limits (fixes a segfault)
8904 * src/lyx.C (create_form_form_ref) +
8905 * forms/lyx.fd: Changed Gravity on name input field so that it is
8908 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8910 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
8911 <ostream> and <istream>.
8913 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
8914 whether <fstream> provides the latest standard features, or if we
8915 have an oldstyle library (like in egcs).
8916 (LYX_CXX_STL_STRING): fix the test.
8918 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
8919 code on MODERN_STL_STREAM.
8921 * src/support/lyxstring.h: use L{I,O}stream.h.
8923 * src/support/L{I,O}stream.h: new files, designed to setup
8924 correctly streams for our use
8925 - includes the right header depending on STL capabilities
8926 - puts std::ostream and std::endl (for LOStream.h) or
8927 std::istream (LIStream.h) in toplevel namespace.
8929 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
8931 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
8932 was a bib file that had been changed we ensure that bibtex is run.
8933 (runBibTeX): enhanced to extract the names of the bib files and
8934 getting their absolute path and enter them into the dep file.
8935 (findtexfile): static func that is used to look for tex-files,
8936 checks for absolute patchs and tries also with kpsewhich.
8937 Alternative ways of finding the correct files are wanted. Will
8939 (do_popen): function that runs a command using popen and returns
8940 the whole output of that command in a string. Should be moved to
8943 * src/DepTable.[Ch] (extchanged): new function that returns true if a
8944 file with extension ext has changed.
8946 * src/insets/figinset.C: added ifdef guards around the fl_free
8947 code that jug commented out. Now it is commented out when
8948 compiling with XForms == 0.89.
8950 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
8951 to lyxstring.C, and only keep a forward declaration in
8952 lyxstring.h. Simplifies the header file a bit and should help a
8953 bit on compile time too. Also changes to Srep will not mandate a
8954 recompile of code just using string.
8955 (~lyxstring): definition moved here since it uses srep.
8956 (size): definition moved here since it uses srep.
8958 * src/support/lyxstring.h: removed a couple of "inline" that should
8961 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8963 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
8966 1999-10-21 Juergen Vigna <jug@sad.it>
8968 * src/table.C (SetPWidth): Just a small fix so the alignment is not
8969 set to left if I just remove the width entry (or it is empty).
8971 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
8972 paragraph when having dummy paragraphs.
8974 1999-10-20 Juergen Vigna <jug@sad.it>
8976 * src/insets/figinset.C: just commented some fl_free_form calls
8977 and added warnings so that this calls should be activated later
8978 again. This avoids for now a segfault, but we have a memory leak!
8980 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
8981 'const char * argument' to 'string argument', this should
8982 fix some Asserts() in lyxstring.C.
8984 * src/lyxfunc.h: Removed the function argAsString(const char *)
8985 as it is not used anymore.
8987 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8989 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
8992 * src/Literate.h: some funcs moved from public to private to make
8993 interface clearer. Unneeded args removed.
8995 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
8997 (scanBuildLogFile): ditto
8999 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
9000 normal TeX Error. Still room for improvement.
9002 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
9004 * src/buffer.C (insertErrors): changes to make the error
9005 desctription show properly.
9007 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
9010 * src/support/lyxstring.C (helper): changed to use
9011 sizeof(object->rep->ref).
9012 (operator>>): changed to use a pointer instead.
9014 * src/support/lyxstring.h: changed const reference & to value_type
9015 const & lets see if that helps.
9017 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
9019 * Makefile.am (rpmdist): fixed to have non static package and
9022 * src/support/lyxstring.C: removed the compilation guards
9024 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
9027 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
9028 conditional compile of lyxstring.Ch
9030 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
9031 stupid check, but it is a lot better than the bastring hack.
9032 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
9034 * several files: changed string::erase into string::clear. Not
9037 * src/chset.C (encodeString): use a char temporary instead
9039 * src/table.C (TexEndOfCell): added tostr around
9040 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
9041 (TexEndOfCell): ditto
9042 (TexEndOfCell): ditto
9043 (TexEndOfCell): ditto
9044 (DocBookEndOfCell): ditto
9045 (DocBookEndOfCell): ditto
9046 (DocBookEndOfCell): ditto
9047 (DocBookEndOfCell): ditto
9049 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
9051 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
9053 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
9054 (MenuBuildProg): added tostr around ret
9055 (MenuRunChktex): added tostr around ret
9056 (DocumentApplyCB): added tostr around ret
9058 * src/chset.C (encodeString): added tostr around t->ic
9060 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
9061 (makeLaTeXFile): added tostr around tocdepth
9062 (makeLaTeXFile): added tostr around ftcound - 1
9064 * src/insets/insetbib.C (setCounter): added tostr around counter.
9066 * src/support/lyxstring.h: added an operator+=(int) to catch more
9069 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
9070 (lyxstring): We DON'T allow NULL pointers.
9072 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9074 * src/mathed/math_macro.C (MathMacroArgument::Write,
9075 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
9076 when writing them out.
9078 * src/LString.C: remove, since it is not used anymore.
9080 * src/support/lyxstring.C: condition the content to
9081 USE_INCLUDED_STRING macro.
9083 * src/mathed/math_symbols.C, src/support/lstrings.C,
9084 src/support/lyxstring.C: add `using' directive to specify what
9085 we need in <algorithm>. I do not think that we need to
9086 conditionalize this, but any thought is appreciated.
9088 * many files: change all callback functions to "C" linkage
9089 functions to please strict C++ compilers like DEC cxx 6.1 in mode
9090 strict_ansi. Those who were static are now global.
9091 The case of callbacks which are static class members is
9092 trickier, since we have to make C wrappers around them (see
9093 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
9094 did not finish this yet, since it defeats the purpose of
9095 encapsulation, and I am not sure what the best route is.
9097 1999-10-19 Juergen Vigna <jug@sad.it>
9099 * src/support/lyxstring.C (lyxstring): we permit to have a null
9100 pointer as assignment value and just don't assign it.
9102 * src/vspace.C (nextToken): corrected this function substituting
9103 find_first(_not)_of with find_last_of.
9105 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
9106 (TableOptCloseCB) (TableSpeCloseCB):
9107 inserted fl_set_focus call for problem with fl_hide_form() in
9110 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9112 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
9115 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9117 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
9118 LyXLex::next() and not eatline() to get its argument.
9120 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
9122 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
9123 instead, use fstreams for io of the depfile, removed unneeded
9124 functions and variables.
9126 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
9127 vector instead, removed all functions and variables that is not in
9130 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9132 * src/buffer.C (insertErrors): use new interface to TeXError
9134 * Makefile.am (rpmdist): added a rpmdist target
9136 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
9137 per Kayvan's instructions.
9139 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9141 * src/Makefile.am: add a definition for localedir, so that locales
9142 are found after installation (Kayvan)
9144 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9146 * development/.cvsignore: new file.
9148 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9150 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
9151 C++ compiler provides wrappers for C headers and use our alternate
9154 * configure.in: use LYX_CXX_CHEADERS.
9156 * src/cheader/: new directory, populated with cname headers from
9157 libstdc++-2.8.1. They are a bit old, but probably good enough for
9158 what we want (support compilers who lack them).
9160 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
9161 from includes. It turns out is was stupid.
9163 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
9165 * lib/Makefile.am (install-data-local): forgot a ';'
9166 (install-data-local): forgot a '\'
9167 (libinstalldirs): needed after all. reintroduced.
9169 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
9171 * configure.in (AC_OUTPUT): added lyx.spec
9173 * development/lyx.spec: removed file
9175 * development/lyx.spec.in: new file
9177 * po/*.po: merged with lyx.pot becuase of make distcheck
9179 * lib/Makefile.am (dist-hook): added dist-hook so that
9180 documentation files will be included when doing a make
9181 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
9182 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
9184 more: tried to make install do the right thing, exclude CVS dirs
9187 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
9188 Path would fit in more nicely.
9190 * all files that used to use pathstack: uses now Path instead.
9191 This change was a lot easier than expected.
9193 * src/support/path.h: new file
9195 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
9197 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
9199 * src/support/lyxstring.C (getline): Default arg was given for
9202 * Configure.cmd: removed file
9204 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9206 * src/support/DebugStream.[Ch]: remove the explicit std:: before
9207 streams classes and types, add the proper 'using' statements when
9208 MODERN_STL is defined.
9210 * src/debug.h: move the << operator definition after the inclusion
9213 * src/support/filetools.C: include "LAssert.h", which is needed
9216 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
9219 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
9220 include "debug.h" to define a proper ostream.
9222 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
9224 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
9225 method to the SystemCall class which can kill a process, but it's
9226 not fully implemented yet.
9228 * src/*.C: Changed Systemcalls::Startscript() to startscript()
9230 * src/support/FileInfo.h: Better documentation
9232 * src/lyxfunc.C: Added support for buffer-export html
9234 * src/menus.C: Added Export->As HTML...
9236 * lib/bind/*.bind: Added short-cut for buffer-export html
9238 * src/lyxrc.*: Added support for new \tth_command
9240 * lib/lyxrc.example: Added stuff for new \tth_command
9242 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9244 * lib/Makefile.am (IMAGES): removed images/README
9245 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
9246 installes in correct place. Check permisions is installed
9249 * src/LaTeX.C: some no-op changes moved declaration of some
9252 * src/LaTeX.h (LATEX_H): changed include guard name
9254 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9256 * lib/reLyX/Makefile.am: install noweb2lyx.
9258 * lib/Makefile.am: install configure.
9260 * lib/reLyX/configure.in: declare a config aux dir; set package
9261 name to lyx (not sure what the best solution is); generate noweb2lyx.
9263 * lib/layouts/egs.layout: fix the bibliography layout.
9265 1999-10-08 Jürgen Vigna <jug@sad.it>
9267 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
9268 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
9269 it returned without continuing to search the path.
9271 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9273 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
9274 also fixes a bug. It is not allowed to do tricks with std::strings
9275 like: string a("hei"); &a[e]; this will not give what you
9276 think... Any reason for the complexity in this func?
9278 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
9280 * Updated README and INSTALL a bit, mostly to check that my
9281 CVS rights are correctly set up.
9283 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
9285 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
9286 does not allow '\0' chars but lyxstring and std::string does.
9288 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9290 * autogen.sh (AUTOCONF): let the autogen script create the
9291 POTFILES.in file too. POTFILES.in should perhaps now not be
9292 included in the cvs module.
9294 * some more files changed to use C++ includes instead of C ones.
9296 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
9298 (Reread): added tostr to nlink. buggy output otherwise.
9299 (Reread): added a string() around szMode when assigning to Buffer,
9300 without this I got a log of garbled info strings.
9302 * acconfig.h: commented out the PTR_AS_INT macros. They should not
9305 * I have added several ostream & operator<<(ostream &, some_type)
9306 functions. This has been done to avoid casting and warnings when
9307 outputting enums to lyxerr. This as thus eliminated a lot of
9308 explicit casts and has made the code clearer. Among the enums
9309 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
9310 mathed enums, some font enum the Debug::type enum.
9312 * src/support/lyxstring.h (clear): missing method. equivalent of
9315 * all files that contained "stderr": rewrote constructs that used
9316 stderr to use lyxerr instead. (except bmtable)
9318 * src/support/DebugStream.h (level): and the passed t with
9319 Debug::ANY to avoid spurious bits set.
9321 * src/debug.h (Debug::type value): made it accept strings of the
9324 * configure.in (Check for programs): Added a check for kpsewhich,
9325 the latex generation will use this later to better the dicovery of
9328 * src/BufferView.C (create_view): we don't need to cast this to
9329 (void*) that is done automatically.
9330 (WorkAreaButtonPress): removed some dead code.
9332 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9334 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
9335 is not overwritten when translated (David Sua'rez de Lis).
9337 * lib/CREDITS: Added David Sua'rez de Lis
9339 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
9341 * src/bufferparams.C (BufferParams): default input encoding is now
9344 * acinclude.m4 (cross_compiling): comment out macro
9345 LYX_GXX_STRENGTH_REDUCE.
9347 * acconfig.h: make sure that const is not defined (to empty) when
9348 we are compiling C++. Remove commented out code using SIZEOF_xx
9351 * configure.in : move the test for const and inline as late as
9352 possible so that these C tests do not interefere with C++ ones.
9353 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
9354 has not been proven.
9356 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9358 * src/table.C (getDocBookAlign): remove bad default value for
9361 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
9363 (ShowFileMenu2): ditto.
9365 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
9368 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9370 * Most files: finished the change from the old error code to use
9371 DebugStream for all lyxerr debugging. Only minor changes remain
9372 (e.g. the setting of debug levels using strings instead of number)
9374 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9376 * src/layout.C (Add): Changed to use compare_no_case instead of
9379 * src/FontInfo.C: changed loop variable type too string::size_type.
9381 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9383 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
9384 set ETAGS_ARGS to --c++
9386 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
9388 * src/table.C (DocBookEndOfCell): commented out two unused variables
9390 * src/paragraph.C: commented out four unused variables.
9392 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
9393 insed a if clause with type string::size_type.
9395 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
9398 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
9400 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
9401 variable, also changed loop to go from 0 to lenght + 1, instead of
9402 -1 to length. This should be correct.
9404 * src/LaTeX.C (scanError): use string::size_type as loop variable
9407 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
9408 (l.896) since y_tmp and row was not used anyway.
9410 * src/insets/insetref.C (escape): use string::size_type as loop
9413 * src/insets/insetquotes.C (Width): use string::size_type as loop
9415 (Draw): use string::size_type as loop variable type.
9417 * src/insets/insetlatexaccent.C (checkContents): use
9418 string::size_type as loop variable type.
9420 * src/insets/insetlabel.C (escape): use string::size_type as loop
9423 * src/insets/insetinfo.C: added an extern for current_view.
9425 * src/insets/insetcommand.C (scanCommand): use string::size_type
9426 as loop variable type.
9428 * most files: removed the RCS tags. With them we had to recompile
9429 a lot of files after a simple cvs commit. Also we have never used
9430 them for anything meaningful.
9432 * most files: tags-query-replace NULL 0. As adviced several plases
9433 we now use "0" instead of "NULL" in our code.
9435 * src/support/filetools.C (SpaceLess): use string::size_type as
9438 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
9440 * src/paragraph.C: fixed up some more string stuff.
9442 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
9444 * src/support/filetools.h: make modestr a std::string.
9446 * src/filetools.C (GetEnv): made ch really const.
9448 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
9449 made code that used these use max/min from <algorithm> instead.
9451 * changed several c library include files to their equivalent c++
9452 library include files. All is not changed yet.
9454 * created a support subdir in src, put lyxstring and lstrings
9455 there + the extra files atexit, fileblock, strerror. Created
9456 Makefile.am. edited configure.in and src/Makefile.am to use this
9457 new subdir. More files moved to support.
9459 * imported som of the functions from repository lyx, filetools
9461 * ran tags-query-replace on LString -> string, corrected the bogus
9462 cases. Tried to make use of lstrings.[hC], debugged a lot. There
9463 is still some errors in there. This is errors where too much or
9464 too litle get deleted from strings (string::erase, string::substr,
9465 string::replace), there can also be some off by one errors, or
9466 just plain wrong use of functions from lstrings. Viewing of quotes
9469 * LyX is now running fairly well with string, but there are
9470 certainly some bugs yet (see above) also string is quite different
9471 from LString among others in that it does not allow null pointers
9472 passed in and will abort if it gets any.
9474 * Added the revtex4 files I forgot when setting up the repository.
9476 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
9478 * All over: Tried to clean everything up so that only the files
9479 that we really need are included in the cvs repository.
9480 * Switched to use automake.
9481 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
9482 * Install has not been checked.
9484 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9486 * po/pt.po: Three errors:
9487 l.533 and l.538 format specification error
9488 l. 402 duplicate entry, I just deleted it.