1 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3 * NEWS: update somehow for 1.1.6
5 * lib/ui/default.ui: clean up.
7 2000-10-17 Angus Leeming <a.leeming@ic.ac.uk>
9 * lib/CREDITS: clean up
11 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
13 * src/combox.[Ch] (select): changed argument back to int
14 * src/combox.C (peek_event): removed num_bytes as it is declared but
17 * src/frontends/xforms/FormDocument.C (class_apply, bullets_apply):
18 modified calls to Combox::select() to remove warnings about type
21 * src/insets/insetbutton.C (width): explicit cast to remove warning
22 about type conversion.
24 * src/insets/insetcite.C (getScreenLabel): use string::size_type not
27 * src/insets/insettabular.[Ch]: variables inset_pos, sel_pos_start and
28 sel_pos_end, refering to cursor position are changed to
29 LyXParagraph::size_type.
31 * src/insets/insettext.h (cpos): returns LyXParagraph::size_type,
32 consistent with LyXCursor::pos().
33 (inset_pos): changed to LyXParagraph::size_type for same reason.
35 * src/insets/insettext.C (resizeLyXText): changed some temporary
36 variables refing to cursor position to LyXParagraph::size_type.
38 2000-10-16 John Levon <moz@compsoc.man.ac.uk>
40 * src/frontends/kde/<various>: The Great Renaming,
43 2000-10-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
45 * src/frontends/support/Makefile.am (EXTRA_DIST): re-fix.
47 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
49 * src/mathed/math_macro.C (MathMacroTemplate): initialize args to
50 0 when there are no arguments.
52 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
54 * src/insets/insetbib.C: re-introduce current_view as a temporary fix
55 to segfaults when pressing Ok in InsetBibtex dialog.
57 2000-10-16 Angus Leeming <a.leeming@ic.ac.uk>
59 * forms/layout_forms.fd:
60 * src/layout_forms.C (create_form_form_character): small change to use
61 labelframe rather than engraved frame + text
63 * src/lyx_gui.C (create_forms): initialise choice_language with some
64 arbitrary value to prevent segfault when dialog is shown.
66 2000-10-16 Baruch Even <baruch.even@writeme.com>
68 * src/converter.C (runLaTeX, scanLog): Added a warning when there
69 is no resulting file. This pertains only to LaTeX output.
71 2000-10-14 Dekel Tsur <dekelts@tau.ac.il>
73 * src/text.C (Backspace): Make sure that the row of the cursor is
76 * src/lyxfunc.C (Dispatch): Call to showState() after insertion of
79 * src/lyx_gui.C (init): Prevent a crash when only one font from
80 menu/popup fonts is not found.
82 * lib/lyxrc.example: Add an example for binding a key for language
85 2000-10-15 Dekel Tsur <dekelts@tau.ac.il>
87 * src/converter.C (GetReachable): Changed the returned type to
89 (IsReachable): New method
91 * src/MenuBackend.C (expand): Handle formats that appear more
94 2000-10-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
96 * src/frontends/support/Makefile.am
97 (libfrontendsupport_la_EXTRA_DIST): add LyXImage_X.[Ch] here and
100 * lib/CREDITS: add Garst Reese.
102 * src/support/snprintf.h: add extern "C" {} around the definitions.
104 * src/cheaders/cstdarg: new header file, taken from GNU libstdc++.
106 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
109 * src/frontends/xforms/FormDocument.C:
110 * src/frontends/xforms/Menubar_pimpl.C: small changes so that they
111 compile without "conversion to integral type of smaller size"
114 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
116 * src/text.C (GetColumnNearX): Fixed disabled code.
118 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
120 * configure.in (CPPFLAGS): add snprintf and vsnprintf to
123 * src/support/snprintf.[ch]: new files
125 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
127 * src/frontends/kde/formprintdialog.C: add
128 file browser for selecting postscript output
130 * src/frontends/kde/formprintdialogdata.C:
131 * src/frontends/kde/formprintdialogdata.h: re-generate
134 2000-10-13 John Levon <moz@compsoc.man.ac.uk>
136 * src/frontends/gnome/Makefile.am:
137 * src/frontends/kde/Makefile.am: FormCommand.C
138 disappeared from xforms
140 * src/frontends/kde/FormCitation.C:
141 * src/frontends/kde/FormIndex.C: read-only
144 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
146 * src/support/lyxfunctional.h (void_class_fun_t): fix name of
149 * src/bufferlist.C: add using directive.
151 2000-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
153 * src/support/lyxfunctional.h: version of class_fun for void
154 returns added, const versions of back_inseter_fun and compare_fun
157 2000-10-13 Angus Leeming <a.leeming@ic.ac.uk>
159 * src/frontends/xforms/FormInset.C (showInset): fix typo.
161 2000-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
163 * ChangeLog: cleanup.
165 * lib/CREDITS: update to add all the contributors we've forgotten.
166 I have obviously missed some, so tell me whether there were
169 2000-10-13 Marko Vendelin <markov@ioc.ee>
171 * src/frontends/gnome/FormCitation.C
172 * src/frontends/gnome/FormCitation.h
173 * src/frontends/gnome/FormError.C
174 * src/frontends/gnome/FormIndex.C
175 * src/frontends/gnome/FormRef.C
176 * src/frontends/gnome/FormRef.h
177 * src/frontends/gnome/FormUrl.C: hide dialogs on "update" signal
179 * src/frontends/gnome/FormCitation.C
180 * src/frontends/gnome/FormCopyright.C
181 * src/frontends/gnome/FormError.C
182 * src/frontends/gnome/FormIndex.C
183 * src/frontends/gnome/FormRef.C
184 * src/frontends/gnome/FormToc.C
185 * src/frontends/gnome/FormUrl.C: replacing gettext N_() with _() where
188 * src/frontends/gnome/Menubar_pimpl.C
189 * src/frontends/gnome/Menubar_pimpl.h: using new Menu::expand method to
192 2000-10-11 Baruch Even <baruch.even@writeme.com>
195 * src/minibuffer.C: Changed the method ExecCommand to PrepareForCommand
196 to convey its real action.
198 * src/minibuffer.C (peek_event): Added action when mouse clicks to
199 clear the minibuffer and prepare to enter a command.
201 * src/mathed/formula.C (LocalDispatch): Changed to conform with
202 the rename from ExecCommand to PrepareForCommand.
203 * src/lyxfunc.C (Dispatch): ditto.
205 2000-10-11 Baruch Even <baruch.even@writeme.com>
207 * src/buffer.C (writeFile): Added test for errors on writing, this
208 catches all errors and not only file system full errors as intended.
210 2000-10-13 Dekel Tsur <dekelts@tau.ac.il>
212 * src/lyx_gui.C (create_forms): better fix for crash with
213 translated interface.
215 2000-10-12 John Levon <moz@compsoc.man.ac.uk>
217 * src/frontends/kde/Makefile.am:
218 * src/frontends/kde/FormCopyright.C:
219 * src/frontends/kde/formcopyrightdialog.C:
220 * src/frontends/kde/formcopyrightdialog.h:
221 * src/frontends/kde/formcopyrightdialogdata.C:
222 * src/frontends/kde/formcopyrightdialogdata.h:
223 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg:
224 * src/frontends/kde/dlg/formcopyrightdialog.dlg: convert
225 copyright to use qtarch
227 2000-10-12 Dekel Tsur <dekelts@tau.ac.il>
229 * src/encoding.C (read): Fixed bug that caused an error message at
232 * po/Makefile.in.in: Fixed rule for ext_l10n.h
234 * lib/lyxrc.example: Fixed hebrew example.
236 2000-10-13 Allan Rae <rae@lyx.org>
238 * src/frontends/xforms/FormPreferences.C (input): reworking the
240 (build, update, apply): New inputs in various tabfolders
242 * src/frontends/xforms/FormToc.C: use new button policy.
243 * src/frontends/ButtonPolicies.h (class IgnorantPolicy): for
244 dialogs that either can't use any existing policy or where it just
247 * src/frontends/xforms/FormTabular.h: removed copyright notice that
250 * src/lyx_gui_misc.[Ch] (updateAllVisibleBufferRelatedDialogs):
251 added a bool parameter which is ignored.
253 * src/buffer.C (setReadonly):
254 * src/BufferView_pimpl.C (buffer):
255 * src/frontends/kde/FormCopyright.h (update):
256 * src/frontends/kde/FormCitation.[Ch] (update):
257 * src/frontends/kde/FormIndex.[Ch] (update):
258 * src/frontends/kde/FormPrint.[Ch] (update):
259 * src/frontends/kde/FormRef.[Ch] (update):
260 * src/frontends/kde/FormToc.[Ch] (update):
261 * src/frontends/kde/FormUrl.[Ch] (update):
262 * src/frontends/gnome/FormCopyright.h (update):
263 * src/frontends/gnome/FormCitation.[Ch] (update):
264 * src/frontends/gnome/FormError.[Ch] (update):
265 * src/frontends/gnome/FormIndex.[Ch] (update):
266 * src/frontends/gnome/FormPrint.[Ch] (update):
267 * src/frontends/gnome/FormRef.h (update):
268 * src/frontends/gnome/FormToc.[Ch] (update):
269 * src/frontends/gnome/FormUrl.[Ch] (update):
270 * src/frontends/xforms/FormGraphics.[Ch] (update): reflect new changes
271 to updateBufferDependent and DialogBase
273 * src/frontends/xforms/FormCitation.[hC]:
274 * src/frontends/xforms/FormDocument.[hC]: also removed restore()
275 * src/frontends/xforms/FormError.[Ch]:
276 * src/frontends/xforms/FormGraphics.[Ch]:
277 * src/frontends/xforms/FormIndex.[Ch]:
278 * src/frontends/xforms/FormParagraph.[Ch]: also added missing "virtual"s
279 and fixed readOnly handling.
280 * src/frontends/xforms/FormPrint.[Ch]:
281 * src/frontends/xforms/FormRef.[Ch]:
282 * src/frontends/xforms/FormTabular.[Ch]:
283 * src/frontends/xforms/FormToc.[Ch]:
284 * src/frontends/xforms/FormUrl.[Ch]:
285 * src/frontends/xforms/FormInset.[Ch]:
286 * src/frontends/xforms/FormBase.[hC]: modifications to use the new
287 form of updateBufferDependent.
289 * src/frontends/xforms/FormBase.C (hide): only call disconnect()
290 if form()->visible just in case someone does stuff to the form in a
293 * src/frontends/DialogBase.h (enum): removed enum since we can now use
294 the buttoncontroller for everything the enum used to be used for.
295 (update) It would seem we need to force all dialogs to use a bool
296 parameter or have two update functions. I chose to go with one.
297 I did try removing update() from here and FormBase and defining the
298 appropriate update signatures in FormBaseB[DI] but then ran into the
299 problem of the update() call in FormBase::show(). Whatever I did
300 to get around that would require another function and that just
301 got more confusing. Hence the decision to make everyone have an
302 update(bool). An alternative might have been to override show() in
303 FormBaseB[DI] and that would allow the different and appropriate
306 * src/frontends/Dialogs.h (updateBufferDependent): now takes a bool.
307 true == buffer change occurred. I decided against using a default
308 template parameter since not all compilers support that at present.
310 2000-10-11 Angus Leeming <a.leeming@ic.ac.uk>
312 * src/frontends/xforms/FormBase.[Ch] (FormBase) : made less of a "swiss
313 army knife" by removing functionality.
314 (clearStore): removed. All such housekeeping on hide()ing the dialog
315 is to be carried out by overloaded disconnect() methods.
316 (dialogIsOpen): removed. Relevant only to Inset dialogs anyway, but
317 superceded by Baruch's neat test (FormGraphics) to update an existing
318 dialog if a new signal is recieved rather than block all new signals
320 (cba_, parent_, updateOrHide): removed to new FormInset class. Relevant
321 only to Inset dialogs.
322 (FormBaseBI, FormBaseBD): new classes derived from FormBase for
323 "Buffer Independent" and "Buffer Dependent" dialogs respectively.
325 * src/frontends/xforms/FormCommand.[Ch]: renamed as FormInset.[Ch]
327 * src/frontends/xforms/FormInset.[Ch] (FormInset): New class, defined
328 as a base class to all inset dialogs. Used solely to connect/disconnect
329 the Inset::hide signal and to define what action to take on receipt of
330 a UpdateBufferDependent signal.
331 (FormCommand): now derived from FormInset.
333 * src/frontends/xforms/FormCitation.[Ch] (clearStore): reworked as
336 * src/frontends/xforms/FormCopyright.[Ch]:
337 * src/frontends/xforms/FormPreferences.[Ch]:
338 now derived from FormBaseBI.
340 * src/frontends/xforms/FormDocument.[Ch]:
341 * src/frontends/xforms/FormParagraph.[Ch]:
342 * src/frontends/xforms/FormPrint.[Ch]:
343 now derived from FormBaseBD.
345 * src/frontends/xforms/FormError.[Ch]: now derived from FormInset.
347 * src/frontends/xforms/FormCitation.[Ch]:
348 * src/frontends/xforms/FormError.[Ch]:
349 * src/frontends/xforms/FormRef.[Ch]:
350 * src/frontends/xforms/FormToc.[Ch]:
351 (clearStore): reworked as disconnect().
353 * src/frontends/xforms/Makefile.am: removed FormCommand.[Ch], adding
356 2000-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
358 * src/converter.C (runLaTeX): constify buffer argument
361 * src/frontends/support/Makefile.am (INCLUDES): fix.
363 * src/buffer.h: add std:: qualifier
364 * src/insets/figinset.C (addpidwait): ditto
365 * src/MenuBackend.C: ditto
366 * src/buffer.C: ditto
367 * src/bufferlist.C: ditto
368 * src/layout.C: ditto
369 * src/lyxfunc.C: ditto
371 2000-10-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
373 * src/lyxtext.h (bidi_level): change return type to
374 LyXParagraph::size_type.
376 * src/lyxparagraph.h: change size_type to
377 TextContainer::difference_type. This should really be
378 TextContainer::size_type, but we need currently to support signed
381 2000-10-11 Marko Vendelin <markov@ioc.ee>
382 * src/frontends/gnome/FormError.h
383 * src/frontends/gnome/FormRef.C
384 * src/frontends/gnome/FormRef.h
385 * src/frontends/gnome/FormError.C
386 * src/frontends/gnome/Makefile.am
387 * src/frontends/gnome/pixbutton.h: FormError and FormRef are ported
388 to Gnome frontend. Both dialogs use "action" area.
390 2000-10-12 Baruch Even <baruch.even@writeme.com>
392 * src/graphics/GraphicsCacheItem_pimpl.C:
393 * src/graphics/Renderer.C:
394 * src/graphics/XPM_Renderer.C: Corrected resolution of conflicts.
397 2000-10-12 Juergen Vigna <jug@sad.it>
399 * src/insets/insettext.C (draw): fixed drawing bug (specifically
400 visible when selecting).
402 * development/Code_rules/Rules: fixed some typos.
404 2000-10-09 Baruch Even <baruch.even@writeme.com>
406 * src/filedlg.C (GroupCache::find): de-inlined the function, makes
407 compiling on egcs 1.1.2 possible.
409 * src/filedlg.C (comp_direntry::operator() ): ditto.
411 2000-08-31 Baruch Even <baruch.even@writeme.com>
413 * src/lyx_cb.[hC] (ShowMessage): Result of the const-ificiation of the
416 * src/frontends/xforms/FormGraphics.C: Changed the dialog to be
417 transient it now only gets freed when the object is destructed.
419 2000-08-24 Baruch Even <baruch.even@writeme.com>
421 * src/frontends/FormGraphics.h:
422 * src/frontends/FormGraphics.C: Changed to use ButtonController and
425 2000-08-20 Baruch Even <baruch.even@writeme.com>
427 * src/insets/insetgraphics.C:
428 (draw): Added messages to the drawn rectangle to report status.
429 (updateInset): Disabled the use of the inline graphics,
432 2000-08-17 Baruch Even <baruch.even@writeme.com>
434 * src/frontends/support: Directory added for the support of GUII LyX.
436 * src/frontends/support/LyXImage.h:
437 * src/frontends/support/LyXImage.C: Base class for GUII holding of
440 * src/frontends/support/LyXImage_X.h:
441 * src/frontends/support/LyXImage_X.C: Implementation of the Xlib
442 version of LyXImage, this uses the Xlib Pixmap.
447 * src/Painter.C: Added a new method image() to draw LyXImage-s, a GUII
448 replacement to Pixmap.
450 * src/insets/insetgraphics.h:
451 * src/insets/insetgraphics.C:
452 * src/graphics/GraphicsCacheItem.h:
453 * src/graphics/GraphicsCacheItem.C:
454 * src/graphics/GraphicsCacheItem_pimpl.h:
455 * src/graphics/GraphicsCacheItem_pimpl.C: Changed to use LyXImage
458 * src/graphics/GraphicsCacheItem.h:
459 * src/graphics/GraphicsCacheItem.C: Added the Clone() method to create
460 another copy of the object.
462 * src/insets/insetgraphics.C (Clone): Changed to create a second copy
463 of cacheHandle, this fixed a bug that sent LyX crashing.
465 * src/graphics/XPM_Renderer.h:
466 * src/graphics/XPM_Renderer.C:
467 * src/graphics/EPS_Renderer.h:
468 * src/graphics/EPS_Renderer.C: Changed to Unix LF from DOS CRLF.
470 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
472 * src/lyxfunc.C (processKeySym): only handle the
473 lockinginset/inset stuff if we have a buffer and text loaded...
475 * lib/Makefile.am (EXTRA_DIST): add encodings and languages
477 2000-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
479 * src/support/lyxfunctional.h: add operator= that takes a reference
481 * src/lyxserver.C (mkfifo): make first arg const
483 * src/layout.h: renamed name(...) to setName(...) to work around
486 * src/buffer.C (setFileName): had to change name of function to
487 work around bugs in egcs. (renamed from fileName)
489 2000-10-11 Lars Gullik Bjønnes <larsbj@lyx.org>
491 * src/support/translator.h: move helper template classes to
492 lyxfunctional.h, include "support/lyxfunctional.h"
494 * src/support/lyxmanip.h: add delaration of fmt
496 * src/support/lyxfunctional.h: new file
497 (class_fun_t): new template class
498 (class_fun): helper template function
499 (back_insert_fun_iterator): new template class
500 (back_inserter_fun): helper template function
501 (compare_memfun_t): new template class
502 (compare_memfun): helper template function
503 (equal_1st_in_pair): moved here from translator
504 (equal_2nd_in_pair): moved here from translator
506 * src/support/fmt.C: new file
507 (fmt): new func, can be used for a printf substitute when still
508 using iostreams ex. lyxerr << fmt("Hello %s", "Jürgen") << endl;
510 * src/support/StrPool.C: add some comments
512 * src/support/Makefile.am (libsupport_la_SOURCES): add fmt.C and
515 * src/insets/figinset.C (addpidwait): use std::copy with
516 ostream_iterator to fill the pidwaitlist
518 * src/graphics/XPM_Renderer.C (renderImage): use ScreenOfDisplay
520 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): remove
523 * src/frontends/xforms/Menubar_pimpl.C: make several file scope
526 * src/frontends/xforms/FormParagraph.C (input): use lyx::atoi
528 * src/frontends/xforms/FormDocument.C (build): remove c_str()
529 (class_update): ditto
531 (CheckChoiceClass): move initialization of tc and tct
533 * src/tabular.C: remove current_view
534 (OldFormatRead): similar to right below [istream::ignore]
536 * src/lyxlex_pimpl.C (next): add code for faster skipping of
537 chars, unfortunately this is buggy on gcc 2.95.2, so currently
538 unused [istream::ignore]
540 * src/lyxfunc.C: include "support/lyxfunctional.h"
541 (getInsetByCode): use std::find_if and compare_memfun
543 * src/lyxfont.C (stateText): remove c_str()
545 * src/lyx_main.C (setDebuggingLevel): make static
546 (commandLineHelp): make static
548 * src/lyx_gui_misc.C (getScreenDPI): use ScreenOfDisplay to get
549 Screen* together with fl_get_display() and fl_screen
551 * src/lyx_gui.C (LyXGUI): use ScreenOfDisplay to get Screen*
552 togheter with fl_get_display() and fl_screen
553 (create_forms): remove c_str()
555 * src/layout.C: include "support/lyxfunctional.h"
556 (hasLayout): use std::find_if and compare_memfun
557 (GetLayout): use std::find_if and comapre_memfun
558 (delete_layout): use std::remove_if and compare_memfun
559 (NumberOfClass): use std:.find_if and compare_memfun
561 * src/gettext.h: change for the new functions
563 * src/gettext.C: new file, make _(char const * str) and _(string
564 const & str) real functions.
566 * src/font.C (width): rewrite slightly to avoid one extra variable
568 * src/debug.C: initialize Debug::ANY here
570 * src/commandtags.h: update number comments
572 * src/combox.h (get): make const func
574 (getline): make const
576 * src/combox.C (input_cb): handle case where fl_get_input can
579 * src/bufferlist.C: add <functional>, "support/lyxmanip.h",
580 "support/lyxfunctional.h", remove current_view variable.
581 (resize): use std::for_each with std::mem_fun
582 (getFileNames): use std::copy with back_inserter_fun
583 (getBuffer): change arg type to unsigned int
584 (emergencyWriteAll): call emergencyWrite with std::for_each and
586 (emergencyWrite): new method, the for loop in emergencyWriteAll
588 (exists): use std::find_if with compare_memfun
589 (getBuffer): use std::find_if and compare_memfun
591 * src/buffer.h: add typedefs for iterator_category, value_type
592 difference_type, pointer and reference for inset_iterator
593 add postfix ++ for inset_iterator
594 make inset_iterator::getPos() const
596 * src/buffer.C: added support/lyxmanip.h
597 (readFile): use lyxerr << fmt instead of printf
598 (makeLaTeXFile): use std::copy to write out encodings
600 * src/Painter.C (text): rewrite slightly to avoid extra font variable
602 * src/MenuBackend.C (read): remove c_str(), as well as strdup and
603 free and the char * temp.
604 (hasMenu): use std::find_if and compare_memfun
607 * src/Makefile.am (lyx_SOURCES): added gettext.C
609 * src/LyXAction.C (retrieveActionArg): clear the arg, use
610 string::insert small change to avoid temporary
612 * src/LColor.C (getGUIName): remove c_str()
614 * several files: change all occurrences of fl_display to
617 * config/lyxinclude.m4 (LYX_PROG_CXX): add a 2.97 clause so
618 that -pedantic is not used for gcc 2.97 (cvs gcc)
620 * boost/Makefile.am: begin slowly to prepare for a real boost lib
622 2000-10-11 Allan Rae <rae@lyx.org>
624 * src/frontends/xforms/FormPreferences.C (input): template path must be
625 a readable directory. It doesn't need to be writeable.
626 (build, delete, update, apply): New inputs in the various tabfolders
628 * src/frontends/xforms/forms/form_preferences.fd:
629 * src/frontends/xforms/FormPreferences.h: New tabfolder and added
630 several new entries to existing folders. Shuffled some existing stuff
633 * src/frontends/xforms/forms/form_print.fd:
634 * src/frontends/xforms/FormPrint.C (apply): rename unsorted to collated.
635 Should probably rework PrinterParams as well. Note that the switch to
636 collated is effectively the same as !unsorted so changing PrinterParams
637 will require a lot of fiddly changes to reverse the existing logic.
639 * src/lyx_cb.C (TimerCB): cleaned up Angus's patch.
641 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
643 * src/lyx_cb.C (TimerCB): fix crash when fd_form_title doesn't exist.
645 2000-10-10 Allan Rae <rae@lyx.org>
648 * src/lyxfunc.C (Dispatch):
650 * src/BufferView_pimpl.C (scrollCB): cursor_follows_scrollbar made a
653 * src/lyxrc.C (output): Only write the differences between system lyxrc
654 and the users settings.
657 * src/lyxrc.[Ch]: commented out noncopyable so I can keep a
659 I'll rewrite this later, after 1.1.6 probably, to keep a single
660 LyXRC but two instances of a LyXRCStruct.
662 2000-10-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
664 * lib/Makefile.am (pkgdata_DATA): add encoding and languages
666 * src/tabular.h: add a few std:: qualifiers.
668 * src/encoding.C: add using directive.
669 * src/language.C: ditto.
671 * src/insets/insetquotes.C (Validate): use languages->lang()
672 instead of only language.
674 2000-10-07 Dekel Tsur <dekelts@tau.ac.il>
676 * lib/languages: New file.
678 * lib/encodings: New file.
680 * src/language.C (Languages): New class.
681 (read): New method. Reads the languages from the 'languages' file.
683 * src/encoding.C (Encodings): New class.
684 (read): New method. Reads the encodings from the 'encodings' file.
686 * src/lyx_main.C (init): Call to LyXSetStyle() after languages
689 * src/bufferparams.h and a lot of files: Deleted the member language,
690 and renamed language_info to language
692 * src/buffer.C (makeLaTeXFile): Use babel() instead of lang()
693 * src/lyxfont.C (latexWriteStartChanges): ditto.
694 * src/paragraph.C (validate,TeXOnePar): ditto.
696 * src/lyxfont.C (update): Restored deleted code.
698 * src/frontends/xforms/FormDocument.C (build): Made the combox taller
700 2000-10-10 Angus Leeming <a.leeming@ic.ac.uk>
702 * src/BufferView_pimpl.C (buffer): cleaned up a little.
704 * src/insets/figinset.[Ch]:
705 * src/insets/insetinclude.[Ch]:
706 * src/insets/insetinclude.[Ch]:
707 * src/insets/insetparent.[Ch]:
708 * src/insets/insetref.[Ch]:
709 * src/insets/insettabular.[Ch] (c-tor): Buffer passed as const &.
712 * src/mathed/formula.[Ch]:
713 * src/mathed/formulamacro.C (Clone): passed Buffer const &.
715 * src/buffer.C (parseSingleLyXformat2Token, readInset):
716 * src/lyx_cb.C (FigureApplyCB):
717 * src/lyxfunc.C (getStatus, Dispatch):
718 * src/frontends/xforms/FormTabular.C: use modified c-tors to some
721 * src/lyxfunc.C (Dispatch): string "ref" not used. Removed.
723 * src/converter.[Ch] (Formats::View):
724 * src/lyx_cb.[Ch] (ShowMessage): constify Buffer * parameter.
726 * src/paragraph.C (CopyIntoMinibuffer, Clone): Insets::Clone() passed
727 *current_view->buffer(). This will change later, but this patch is way
730 2000-10-09 Juergen Vigna <jug@sad.it>
732 * src/text.C (GetRow): small fix.
734 * src/BufferView_pimpl.C (cursorPrevious):
735 (cursorNext): added LyXText parameter to function.
737 * src/insets/insettabular.C (LocalDispatch): activate cell inset on
738 keypress depending on cursor position.
740 2000-10-06 Juergen Vigna <jug@sad.it>
742 * src/insets/insettabular.C (Ascii): finally call right ascii-function.
743 (copySelection): redone this function and also copy ascii representa-
746 * src/tabular.C (Ascii):
750 (print_n_chars): new functions to realize the ascii export of tabulars.
752 2000-10-05 Juergen Vigna <jug@sad.it>
754 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): small fix
755 if we don't have a buffer.
757 2000-10-10 Allan Rae <rae@lyx.org>
759 * src/frontends/xforms/FormPreferences.[Ch] (hide): Fix the problem
760 with closing dialog. It seems that nested tabfolders require hiding
761 of inner tabfolders before hiding the dialog itself. Actually all I
762 did was hide the active outer folder.
764 * src/BufferView_pimpl.C (buffer): don't call updateBufferDependent
765 unless there really is a buffer. hideBufferDependent is called
768 * po/Makefile.in.in (POTFILES.in): one little tweak to ensure
769 POTFILES.in stays in $(srcdir).
771 2000-10-09 Dekel Tsur <dekelts@tau.ac.il>
773 * lib/lyxrc.example: Few changes.
775 2000-10-05 Angus Leeming <a.leeming@ic.ac.uk>
777 * src/BufferView_pimpl.C (buffer): only need one the
778 updateBufferDependent signal to be emitted once! Moved to the end of
779 the method to allow bv_->text to be updated first.
781 * src/frontends/xforms/FormBase.[Ch]: replaced the two signals uSignal_
782 and hSignal_ with Dialogs * and BufferDependency variables.
783 New Buffer * parent_, initialised when the dialog is launched. Used to
784 check whether to update() or hide() dialog in the new, private
785 updateOrHide() method that is connected to the updateBufferDependent
786 signal. Daughter classes dictate what to do using the
787 ChangedBufferAction enum, passed to the c-tor.
789 * src/frontends/xforms/FormCitation.C:
790 * src/frontends/xforms/FormCommand.C:
791 * src/frontends/xforms/FormCopyright.C:
792 * src/frontends/xforms/FormDocument.C:
793 * src/frontends/xforms/FormError.C:
794 * src/frontends/xforms/FormIndex.C:
795 * src/frontends/xforms/FormPreferences.C:
796 * src/frontends/xforms/FormPrint.C:
797 * src/frontends/xforms/FormRef.C:
798 * src/frontends/xforms/FormToc.C:
799 * src/frontends/xforms/FormUrl.C (c-tor): modified call to FormBase
802 * src/frontends/xforms/FormCommand.[Ch] (c-tor) passed a
803 ChangedBufferAction enum.
805 * src/frontends/xforms/FormParagraph.[Ch]
806 * src/frontends/xforms/forms/form_paragraph.fd: now derived from
809 2000-10-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
811 * lib/bind/cua.bind: fix a bit.
812 * lib/bind/emacs.bind: ditto.
814 * lib/bind/menus.bind: remove real menu entries from there.
816 * src/spellchecker.C: make sure we only include strings.h when
819 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
821 * src/frontends/xforms/Menubar_pimpl.C (get_new_submenu): New
822 function. It enlarges the maximum number of pup when needed.
823 (add_toc2): Open a new menu if maximum number of items per menu has
826 2000-10-05 John Levon <moz@compsoc.man.ac.uk>
828 * src/frontends/kde/FormPrint.C: fix error reporting
830 * src/frontends/xforms/FormDocument.C: fix compiler
833 * lib/.cvsignore: add Literate.nw
835 2000-10-05 Dekel Tsur <dekelts@tau.ac.il>
838 * bufferview_funcs.[Ch]
841 * text2.C: Add support for numbers in RTL text.
843 2000-10-06 Allan Rae <rae@lyx.org>
845 * po/Makefile.in.in (POTFILES.in, POTFILES): Fixed
846 to be gettext.m4 friendly again. ext_l10n.h is now
847 generated into $top_srcdir instead of $top_builddir
848 so that lyx.pot will be built correctly -- without
849 duplicate parsing of ext_l10n.h.
851 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
853 * src/frontends/kde/FormCitation.C: make the dialog
856 2000-10-03 John Levon <moz@compsoc.man.ac.uk>
858 * config/kde.m4: fix consecutive ./configure runs,
859 look for qtarch, fix library order
861 * src/frontends/kde/Makefile.am: tidy up,
862 add Print dialog, add .dlg dependencies
864 * src/frontends/kde/FormPrint.C:
865 * src/frontends/kde/FormPrint.h:
866 * src/frontends/kde/formprintdialog.C:
867 * src/frontends/kde/formprintdialog.h:
868 * src/frontends/kde/formprintdialogdata.C:
869 * src/frontends/kde/formprintdialogdata.h:
870 * src/frontends/kde/dlg/formprintdialog.dlg: add
873 * src/frontends/kde/dlg/README: Added explanatory readme
875 * src/frontends/kde/dlg/checkinitorder.pl: small perl
876 script to double-check qtarch's output
878 * src/frontends/kde/formindexdialog.C:
879 * src/frontends/kde/formindexdialogdata.C:
880 * src/frontends/kde/formindexdialogdata.h:
881 * src/frontends/kde/dlg/formindexdialog.dlg: update
882 for qtarch, minor fixes
884 2000-10-05 Allan Rae <rae@lyx.org>
886 * src/BufferView_pimpl.C (buffer): don't hide all buffer dependent
887 dialogs when switching buffers update them instead. It's up to each
888 dialog to decide if it should still be visible or not.
889 update() should return a bool to control visiblity within show().
890 Or perhaps better to set a member variable and use that to control
893 * lib/build-listerrors: create an empty "listerrors" file just to stop
894 make trying to regenerate it all the time if you don't have noweb
897 * .cvsignore: ignore distdir and dist.tar.gz using rule lyx-*
899 * po/Makefile.in.in (ext_l10n.h): added a rule to build
900 $(top_builddir)/src/ext_l10n.h. The rule has to go here because po/
901 is built before src/ and ext_l10n.h isn't actually needed to build lyx.
902 (POTFILES.in): added a rule to build POTFILES.in. It is also now safe
903 to rebuild POTFILES.in with scrap *.[hC] files in xforms/forms/.
905 * autogen.sh: po/POTFILES.in and src/ext_l10n.h now generated by make.
907 2000-10-04 Angus Leeming <a.leeming@ic.ac.uk>
909 * src/BufferView_pimpl.C (buffer): emit hideBufferDependent when
910 deleting buffer. Closes all buffer-dependent dialogs.
912 * src/frontends/xforms/FormBase.[Ch] (input): modified to pass
914 * src/frontends/xforms/FormCitation.[Ch]:
915 * src/frontends/xforms/FormPreferences.[Ch]:
916 * src/frontends/xforms/FormPrint.[Ch]:
917 * src/frontends/xforms/FormRef.[Ch]:
918 * src/frontends/xforms/FormUrl.[Ch]: ditto
920 * src/frontends/xforms/FormDocument.[Ch]:
921 * src/frontends/xforms/forms/form_document.C.patch:
922 * src/frontends/xforms/forms/form_document.fd: all input callbacks now
923 pass through a single input() function.
925 2000-10-04 John Levon <moz@compsoc.man.ac.uk>
927 * lib/build-listerrors: return status as OK
929 2000-10-04 Dekel Tsur <dekelts@tau.ac.il>
931 * lib/lyxrc.example: Updated to new export code
933 2000-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
935 * src/mathed/math_parser.C (LexInitCodes): set lexcode of "@" to
938 * src/mathed/formula.C (LocalDispatch): add '@' as an LM_TC_VAR
941 * lib/layouts/amsart.layout: include lyxmacros.inc, so that
943 * lib/layouts/amsbook.layout: ditto.
945 * boost/Makefile.am: fix typo.
947 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): use
949 (add_lastfiles): removed.
950 (add_documents): removed.
951 (add_formats): removed.
953 * src/frontends/Menubar.C: remove useless "using" directive.
955 * src/MenuBackend.h: add a new MenuItem constructor.
957 * src/MenuBackend.[Ch] (Menu::expand): new method. Used in the
960 2000-10-04 Allan Rae <rae@lyx.org>
962 * lib/Makefile.am (listerrors):
963 * lib/build-listerrors: make $builddir != $srcdir compiles work again.
964 I haven't got notangle installed so Kayvan please test. The output
965 should end up in $builddir. This also allows people who don't have
966 noweb installed to complete the make process without error.
968 * src/frontends/xforms/FormCommand.[Ch] (showInset):
969 * src/frontends/xforms/FormError.[Ch] (showInset): fix warnings found
970 by JMarc's picky compiler.
972 2000-10-03 Lars Gullik Bjønnes <larsbj@lyx.org>
975 * src/insets/insettabular.C (setPos): change for loop to not use
976 sequencing operator. Please check this Jürgen.
978 * src/frontends/xforms/Menubar_pimpl.C (makeMenubar): use "c"
980 * src/insets/insetcite.C (getScreenLabel): ditto
981 * src/support/filetools.C (QuoteName): ditto
982 (ChangeExtension): ditto
984 * src/BufferView_pimpl.C (scrollCB): make heigt int
986 * src/BufferView2.C (insertInset): comment out unused arg
988 * boost/Makefile.am (EXTRADIST): new variable
990 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
992 * src/exporter.C (IsExportable): Fixed
994 * lib/configure.m4: Small fix
996 2000-10-03 Dekel Tsur <dekelts@tau.ac.il>
998 * src/insets/insetbutton.C (width): Changed to work with no GUI.
999 * src/insets/insetbib.C (bibitemWidest): ditto.
1000 * src/lyx_gui_misc.C (AskQuestion,AskConfirmation,askForText): ditto.
1002 2000-10-03 Juergen Vigna <jug@sad.it>
1004 * src/BufferView2.C (theLockingInset): removed const because of
1005 Agnus's compile problems.
1007 * src/insets/insettext.C (LocalDispatch): set the language of the
1008 surronding paragraph on inserting the first character.
1010 * various files: changed use of BufferView::the_locking_inset.
1012 * src/BufferView2.C (theLockingInset):
1013 (theLockingInset): new functions.
1015 * src/BufferView.h: removed the_locking_inset.
1017 * src/lyxtext.h: added the_locking_inset
1019 * src/BufferView_pimpl.C (checkInsetHit): y_tmp form uint to int.
1021 * src/insets/lyxinset.h: added bool to ShowInsetCursor definition.
1023 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1025 * src/mathed/formula.C (IsMacro): declared but not referenced; removed.
1026 * src/mathed/math_cursor.C (IsAlpha): ditto.
1027 * src/mathed/math_inset.C (strnew): ditto.
1028 * src/mathed/math_iter.C: SizeFont declared but not referenced;removed.
1029 (IMetrics): cxp set but never used; removed.
1030 * src/insets/figinset.C (InitFigures): removed redundant for loop, now
1031 that the variable in question has been removed also!
1034 * src/insets/insetbib.[Ch]: remove need to store Buffer * owner by
1035 using the Buffer * passed to Latex(), using the BufferView * passed to
1036 bibitemMaxWidth() bibitemWidest() and by passing a Buffer* to getKeys()
1038 * src/insets/insetinclude.C: use the Buffer * passed to Latex(),
1039 Linuxdoc() and DocBook() rather than the stored Buffer * master.
1041 * src/lyxfunc.C (Dispatch): used new InsetBibtex c-tor
1042 * src/buffer.C (readInset): used new InsetBibtex c-tor
1043 * (getBibkeyList): used new InsetBibtex::getKeys
1045 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1048 * lib/build-listerrors
1050 * src/exporter.C: Add literate programming support to the export code
1053 * src/lyx_cb.C: Remove old literate code.
1055 * src/lyxrc.[Ch]: Remove many obsolete (due to new export code)
1058 * src/lyxfunc.C (getStatus): Use Exporter::IsExportable
1059 * src/converter.C (View, Convert): Use QuoteName.
1061 * src/insets/figinset.C (Preview): Use Formats::View.
1063 * lib/configure.m4: Add sgml->dvi converter to lyxrc.default
1065 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1067 * src/lyxfunc.C (Dispatch): move declaration of text variable at
1068 the top of the function, because compaq cxx complains that the
1069 "goto exit_with_message" when the function is disabled bypasses
1071 (MenuNew): try a better fix for the generation of new file names.
1072 This time, I used AddName() instead of AddPath(), hoping Juergen
1075 2000-10-03 Allan Rae <rae@lyx.org>
1077 * src/frontends/xforms/forms/form_preferences.fd:
1078 * src/frontends/xforms/FormPreferences.[Ch]: redesign of dialog using
1079 nested tabfolders has begun. The old "Miscellaneous" was renamed as
1080 "Look and Feel"->"General" but will need to be split up further into
1081 general output and general input tabs. Current plan is for four outer
1082 tabfolders: "Look and Feel" for colours, bindings, fonts and other HCI
1083 stuff; "Inputs" for input and import configuration; "Outputs" for
1084 output and export configuration; and one more whatever is left over
1085 called "General". The leftovers at present look like being which
1086 viewers to use, spellchecker, language support and might be better
1087 named "Support". I've put "Paths" in "Inputs" for the moment as this
1088 seems reasonable for now at least.
1089 One problem remains: X error kills LyX when you close Preferences.
1091 2000-10-02 Angus Leeming <a.leeming@ic.ac.uk>
1093 * src/frontends/xforms/FormBase.[Ch]: removed "meaningless" const.
1094 qualifier from form()
1095 * src/frontends/xforms/FormCitation.[Ch]:
1096 * src/frontends/xforms/FormCopyright.[Ch]:
1097 * src/frontends/xforms/FormDocument.[Ch]:
1098 * src/frontends/xforms/FormError.[Ch]:
1099 * src/frontends/xforms/FormIndex.[Ch]:
1100 * src/frontends/xforms/FormPreferences.[Ch]:
1101 * src/frontends/xforms/FormPrint.[Ch]:
1102 * src/frontends/xforms/FormRef.[Ch]:
1103 * src/frontends/xforms/FormToc.[Ch]:
1104 * src/frontends/xforms/FormUrl.[Ch]: ditto.
1106 * src/frontends/xforms/FormCitation.[Ch]:
1107 * src/frontends/xforms/FormIndex.[Ch]:
1108 * src/frontends/xforms/FormRef.[Ch]:
1109 * src/frontends/xforms/FormUrl.[Ch]: Renamed a few buttons, consistent
1110 with Allan's naming policy
1112 * src/frontends/xforms/FormCitation.C: some static casts to remove
1115 2000-10-02 Juergen Vigna <jug@sad.it>
1117 * src/insets/insettabular.C (LocalDispatch): fixed selection code,
1118 now you can type or do stuff inside the table-cell also when in dummy
1119 position, fixed visible cursor.
1121 * src/insets/insettext.C (Edit): fixing cursor-view position.
1123 * src/lyxfunc.C (Dispatch): use * text variable so that it can
1124 be used for equal functions in lyxfunc and insettext.
1126 * src/text.C (GetVisibleRow): fixed a small clear_area bug.
1128 2000-10-02 John Levon <moz@compsoc.man.ac.uk>
1130 * src/frontends/gnome/FormCitation.h:
1131 * src/frontends/gnome/FormCopyright.h:
1132 * src/frontends/gnome/FormIndex.h:
1133 * src/frontends/gnome/FormPrint.h:
1134 * src/frontends/gnome/FormToc.h:
1135 * src/frontends/gnome/FormUrl.h:
1136 * src/frontends/kde/FormCitation.h:
1137 * src/frontends/kde/FormCopyright.h:
1138 * src/frontends/kde/FormIndex.h:
1139 * src/frontends/kde/FormRef.h:
1140 * src/frontends/kde/FormToc.h:
1141 * src/frontends/kde/FormUrl.h: fix remaining users of
1144 2000-10-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1146 * src/buffer.C (linuxDocHandleFootnote): remove const modifier
1147 from depth argument.
1148 (DocBookHandleCaption): ditto.
1149 (DocBookHandleFootnote): ditto.
1150 (SimpleDocBookOnePar): ditto.
1152 * src/frontends/xforms/FormDocument.h (form): remove extra
1153 FormDocument:: qualifier.
1155 * sigc++/macros/basic_signal.h.m4: remove erroneous virtual
1157 * sigc++/handle.h: ditto.
1159 * src/lyx_gui_misc.C: add "using" directive.
1161 * src/cheaders/cstddef: new file, needed by the boost library (for
1164 2000-10-02 Juergen Vigna <jug@sad.it>
1166 * src/insets/insettext.C (SetFont): better support.
1168 * src/insets/insettabular.C (draw): fixed drawing of single cell.
1170 * src/screen.C (DrawOneRow): some uint refixes!
1172 2000-10-02 Allan Rae <rae@lyx.org>
1174 * boost/.cvsignore: ignore Makefile as well
1176 * src/lyxfunc.C (Dispatch): missing break; and moved the '}' for
1177 LFUN_UNKNOWN_ACTION: so it doesn't wrap around default:.
1179 * src/frontends/xforms/FormPreferences.[Ch] (restore): D'oh.
1180 Left this one out by accident.
1182 * src/frontends/xforms/FormBase.h (restore): default to calling
1183 update() since that will restore the original/currently-applied values.
1184 Any input() triggered error messages will require the derived classes
1185 to redefine restore().
1187 * src/frontends/xforms/FormDocument.C: initialize a few variables to
1188 avoid a segfault. combo_doc_class is the main concern.
1190 2000-10-01 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
1192 * Simplify build-listerrors in view of GUI-less export ability!
1194 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1196 * src/lyx_main.C (easyParse): Disable gui when exporting
1198 * src/insets/figinset.C:
1201 * src/lyx_gui_misc.C
1202 * src/tabular.C: Changes to allow no-gui.
1204 2000-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
1206 * src/support/utility.hpp: removed file
1207 * src/support/block.h: removed file
1209 * src/support/Makefile.am (libsupport_la_SOURCES): remove block.h
1212 * src/mathed/formula.C: add support/lyxlib.h
1213 * src/mathed/formulamacro.C: ditto
1215 * src/bufferparams.h: use boost/array.hpp instead of support/block.h
1216 * src/lyxparagraph.h: ditto
1218 * src/Makefile.am (BOOST_INCLUDES): the boost include dir
1219 * src/frontends/Makefile.am (INCLUDES): ditto
1220 * src/frontends/gnome/Makefile.am (BOOST_INCLUDES): ditto
1221 * src/frontends/kde/Makefile.am (BOOST_INCLUDES): ditto
1222 * src/frontends/xforms/Makefile.am (BOOST_INCLUDES): ditto
1223 * src/graphics/Makefile.am (BOOST_INCLUDES): ditto
1224 * src/insets/Makefile.am (BOOST_INCLUDES): ditto
1225 * src/mathed/Makefile.am (BOOST_INCLUDES): ditto
1227 * src/BufferView.h: use boost/utility.hpp
1228 * src/LColor.h: ditto
1229 * src/LaTeX.h: ditto
1230 * src/LyXAction.h: ditto
1231 * src/LyXView.h: ditto
1232 * src/bufferlist.h: ditto
1233 * src/lastfiles.h: ditto
1234 * src/layout.h: ditto
1235 * src/lyx_gui.h: ditto
1236 * src/lyx_main.h: ditto
1237 * src/lyxlex.h: ditto
1238 * src/lyxrc.h: ditto
1239 * src/frontends/ButtonPolicies.h: ditto
1240 * src/frontends/Dialogs.h: ditto
1241 * src/frontends/xforms/FormBase.h: ditto
1242 * src/frontends/xforms/FormGraphics.h: ditto
1243 * src/frontends/xforms/FormParagraph.h: ditto
1244 * src/frontends/xforms/FormTabular.h: ditto
1245 * src/graphics/GraphicsCache.h: ditto
1246 * src/graphics/Renderer.h: ditto
1247 * src/insets/ExternalTemplate.h: ditto
1248 * src/insets/insetcommand.h: ditto
1249 * src/support/path.h: ditto
1251 * config/lyxinclude.m4 (LYX_PROG_CXX): change clause for 2.96
1252 and introduce clause for 2.97.
1254 * boost/libs/README: new file
1256 * boost/boost/utility.hpp: new file
1258 * boost/boost/config.hpp: new file
1260 * boost/boost/array.hpp: new file
1262 * boost/Makefile.am: new file
1264 * boost/.cvsignore: new file
1266 * configure.in (AC_OUTPUT): add boost/Makefile
1268 * Makefile.am (SUBDIRS): add boost
1270 2000-10-01 Dekel Tsur <dekelts@tau.ac.il>
1272 * src/support/lstrings.C (suffixIs): Fixed.
1274 2000-10-01 Allan Rae <rae@lyx.org>
1276 * src/PrinterParams.h: moved things around to avoid the "can't
1277 inline call" warning.
1279 * src/frontends/xforms/RadioButtonGroup.h: turned a comment
1280 into doc++ documentation.
1282 * src/frontends/xforms/FormCommand.[Ch]: support button policy
1284 * src/frontends/xforms/FormRef.C: make use of button controller
1285 * src/frontends/xforms/FormDocument.[Ch]: convert to use FormBase
1286 cleaned up button controller usage.
1287 * src/frontends/xforms/FormPreferences.[Ch]: convert to use FormBase
1288 * src/frontends/xforms/FormPrint.[Ch]: convert to use FormBase and
1289 use the button controller
1291 * src/frontends/xforms/forms/*.fd: and associated generated files
1292 updated to reflect changes to FormBase. Some other FormXxxx files
1293 also got minor updates to reflect changes to FormBase.
1295 * src/frontends/xforms/FormBase.[Ch]: (ok, cancel): new
1296 (hide): made virtual.
1297 (input): return a bool. true == valid input
1298 (RestoreCB, restore): new
1299 (CancelCB, OKCB): renamed from HideCB and ApplyHideCB.
1300 Changes to allow derived dialogs to use a ButtonController and
1301 make sense when doing so: OK button calls ok() and so on.
1303 * src/frontends/xforms/ButtonController.h (class ButtonController):
1304 Switch from template implementation to taking Policy parameter.
1305 Allows FormBase to provide a ButtonController for any dialog.
1307 * src/frontends/xforms/FormPrint.C (connect): setup sizing at show-time
1308 Probably should rename connect and disconnect.
1309 (apply): use the radio button groups
1310 (form): needed by FormBase
1311 (build): setup the radio button groups
1313 2000-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
1315 * several files: type changes to reduce the number of warnings and
1316 to unify type hangling a bit. Still much to do.
1318 2000-09-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1320 * lib/images/*: rename a bunch of icons to match Dekel converter
1323 * src/buffer.h (SimpleLinuxDocOnePar): remove const qualifier to
1326 * src/frontends/xforms/FormBase.C (disconnect): remove bogus test.
1328 * sigc++/macros/basic_signal.h.m4: fix class Signal_ to have a
1330 * sigc++/handle.h: ditto for class Handle.
1332 2000-09-27 John Levon <moz@compsoc.man.ac.uk>
1334 * config/kde.m4: make Qt fail immediately if Qt2 is picked up
1336 2000-09-28 Dekel Tsur <dekelts@tau.ac.il>
1338 * src/intl.C (InitKeyMapper): Correct the value of n due to the
1339 removal of the "default" language.
1341 * src/combox.h (getline): Check that sel > 0
1343 2000-09-29 José Abílio Matos <jamatos@fep.up.pt>
1345 * lib/examples/docbook_example.lyx
1346 * lib/examples/docbook_article.lyx: file renamed to avoid confusion.
1348 * lib/layouts/docbook-book.layout: new docbook book layout.
1350 * lib/layouts/linuxdoc.layout: LatexName of Style SGML is now dummy.
1352 * lib/layouts/manpage.layout: Same as above. Style SubSection removed.
1354 * src/insets/figinset.C (DocBook):fixed small typo.
1356 * src/insets/insetinclude.C (DocBook): new export for verbatim type.
1358 * src/insets/insetinclude.h: string include_label doesn't need to be
1361 2000-09-29 Allan Rae <rae@lyx.org>
1363 * src/frontends/xforms/FormBase.[Ch] (connect, disconnect): new.
1364 Allow derived type to control connection and disconnection from signals
1365 of its choice if desired.
1367 2000-09-28 Juergen Vigna <jug@sad.it>
1369 * src/insets/insettabular.C (update): fixed cursor setting when
1370 the_locking_inset changed.
1371 (draw): made this a bit cleaner.
1372 (InsetButtonPress): fixed!
1374 * various files: added LyXText Parameter to fitCursor call.
1376 * src/BufferView.C (fitCursor): added LyXText parameter.
1378 * src/insets/insettabular.C (draw): small draw fix.
1380 * src/tabular.C: right setting of left/right celllines.
1382 * src/tabular.[Ch]: fixed various types in funcions and structures.
1383 * src/insets/insettabular.C: ditto
1384 * src/frontends/xforms/FormTabular.C: ditto
1386 2000-09-28 Allan Rae <rae@lyx.org>
1388 * src/paragraph.C (TeXOnePar): fixed output of '\n'. The problem was
1389 that the #ifdef's had been applied to part of what should have been
1390 a complete condition. It's possible there are other tests that
1391 were specific to tables that are also wrong now that InsetTabular is
1392 being used. Now we need to fix the output of '\n' after a table in a
1393 float for the same reason as the original condition:
1394 "don't insert this if we would be adding it before or after a table
1395 in a float. This little trick is needed in order to allow use of
1396 tables in \subfigures or \subtables."
1397 Juergen can you check this?
1399 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1401 * src/insets/insettext.C (Ascii): return numer of '\n' in the text
1402 outputed to the ostream.
1404 * several files: fixed types based on warnings from cxx
1406 2000-09-26 John Levon <moz@compsoc.man.ac.uk>
1408 * src/frontends/kde/Makefile.am: fix rule for
1409 formindexdialogdata_moc.C
1411 * src/.cvsignore: add ext_l10n.h to ignore
1413 * acconfig.h: stop messing with __STRICT_ANSI__
1414 * config/gnome.m4: remove option to set -ansi
1415 * config/kde.m4: remove option to set -ansi
1416 * config/lyxinclude.m4: don't set -ansi
1418 2000-09-27 Juergen Vigna <jug@sad.it>
1420 * various files: remove "default" language check.
1422 * src/insets/insetquotes.C: removed use of current_view.
1424 * src/lyxfunc.C (MenuNew): I don't know how put the AddPath here but
1425 the one should have red ears by now!
1427 * src/insets/insettext.C (LocalDispatch): fixed setting of same layouts
1428 in more then one paragraph. Fixed cursor-movement/selection.
1430 * src/frontends/xforms/FormParagraph.C: disable pagebreaks for
1431 paragraphs inside a text inset.
1433 * src/text.C (GetVisibleRow): paint top/bottom line only as wide as the
1434 text-inset if this owner is an inset.
1436 2000-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
1438 * src/Bullet.h: changed type of font, character and size to int
1440 * src/buffer.C (asciiParagraph): remove actcell and fname1.
1442 * src/insets/inseturl.[Ch]:
1443 * src/insets/insetref.[Ch]:
1444 * src/insets/insetlabel.[Ch]: add linelen to Ascii
1446 2000-09-26 Angus Leeming <a.leeming@ic.ac.uk>
1448 * src/buffer.C (readFile): block-if statement rearranged to minimise
1449 bloat. Patch does not reverse Jean-Marc's change ;-)
1451 * src/frontends/xforms/FormBase.[Ch]: Renamed some of the callbacks.
1452 Class rewritten to store pointers to hide/update signals directly,
1453 rather than Dialogs *. Also defined an enum to ease use. All xforms
1454 forms can now be derived from this class.
1456 * src/frontends/xforms/FormCommand.[Ch]
1457 * src/frontends/xforms/FormCopyright.[Ch]: now derived from FormBase.
1459 * src/frontends/xforms/FormError.[Ch]: moved inclusion of inseterror.h
1462 * src/frontends/xforms/forms/form_citation.fd
1463 * src/frontends/xforms/forms/form_copyright.fd
1464 * src/frontends/xforms/forms/form_error.fd
1465 * src/frontends/xforms/forms/form_index.fd
1466 * src/frontends/xforms/forms/form_ref.fd
1467 * src/frontends/xforms/forms/form_toc.fd
1468 * src/frontends/xforms/forms/form_url.fd: remamed callbacks
1470 * src/frontends/xforms/forms/makefile: small change to work with DEC sh.
1472 * src/insets/insetfoot.C: removed redundent using directive.
1474 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1476 * lib/layouts/siamltex.layout: new textclass for SIAM journals,
1477 from Kornelia Pietsch <pietsch@mathematik.tu-chemnitz.de>
1479 * src/frontends/xforms/Menubar_pimpl.C: menu buttons are now
1480 created in the constructors in different groups. Then set() just
1481 have to show the groups as needed. This fixes the redraw problems
1482 (and is how the old menu code worked).
1484 * src/support/lyxlib.h: declare the methods as static when we do
1485 not have namespaces.
1487 2000-09-26 Juergen Vigna <jug@sad.it>
1489 * src/buffer.C (asciiParagraph): new function.
1490 (writeFileAscii): new function with parameter ostream.
1491 (writeFileAscii): use now asciiParagraph.
1493 * various inset files: added the linelen parameter to the Ascii-func.
1495 * src/tabular.C (Write): fixed error in writing file introduced by
1496 the last changes from Lars.
1498 * lib/bind/menus.bind: removed not supported functions.
1500 * src/insets/insettext.C (Ascii): implemented this function.
1502 * src/insets/lyxinset.h (Ascii): added linelen parameter.
1504 * src/tabular.C (write_attribute[int,string,bool]): new functions.
1505 (Write): use of the write_attribute functions.
1507 * src/bufferlist.C (close): fixed reasking question!
1509 2000-09-26 Lars Gullik Bjønnes <larsbj@lyx.org>
1511 * src/support/unlink.C src/support/remove.C src/support/mkdir.C:
1512 new files use the everwhere possible.
1515 * src/form1.C src/form1.h src/layout_forms.C src/layout_forms.h
1516 src/log_form.C src/lyx.C:
1519 * src/buffer.C (runLaTeX): remove func
1521 * src/PaperLayout.C: removed file
1522 * src/ParagraphExtra.C: likewise
1523 * src/bullet_forms.C: likewise
1524 * src/bullet_forms.h: likewise
1525 * src/bullet_forms_cb.C: likewise
1527 * src/Makefile.am (lyx_SOURCES): remove PaperLayout.C,
1528 ParagraphExtra.C, bullet_forms.C, bullet_forms.h and
1531 * several files: remove all traces of the old fd_form_paragraph,
1532 and functions belonging to that.
1534 * several files: remove all traces of the old fd_form_document,
1535 and functions belonging to that.
1537 * several files: constify local variables were possible.
1539 * several files: remove all code that was dead when NEW_EXPORT was
1542 * several files: removed string::c_str in as many places as
1545 * forms/makefile (SRCS,OBJS,COBJS): removed bullet_forms.[fd,c,C]
1546 (e): be a bit more outspoken when patching
1547 (updatesrc): only move files if changed.
1549 * forms/layout_forms.h.patch: regenerated
1551 * forms/layout_forms.fd: remove form_document and form_paragraph
1552 and form_quotes and form_paper and form_table_options and
1553 form_paragraph_extra
1555 * forms/form1.fd: remove form_table
1557 * forms/fdfix.sh: remove sed rules for fl_set_object_lcolor and
1558 the fdui->... rewrite. Update some comments to xforms 0.88
1560 * forms/bullet_forms.C.patch: removed file
1561 * forms/bullet_forms.fd: likewise
1562 * forms/bullet_forms.h.patch: likewise
1564 * development/Code_rules/Rules: added a section on switch
1565 statements. Updated some comment to xforms 0.88.
1567 2000-09-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1569 * src/buffer.C (readFile): make sure that the whole version number
1570 is read after \lyxformat (even when it contains a comma)
1572 * lib/ui/default.ui: change shortcut of math menu to M-a.
1574 2000-09-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1576 * src/vspace.C (nextToken): use isStrDbl() to check for proper
1579 * src/LyXView.C (updateWindowTitle): show the full files name in
1580 window title, limited to 30 characters.
1582 * src/support/lyxstring.C (lyxstring): fix it correctly this time.
1583 When a number of characters has been given, we should not assume
1584 that the string is 0-terminated.
1586 * src/intl.C (InitKeyMapper): remove a bunch of string::c_str()
1587 calls (fixes some memory leaks)
1589 * src/intl.[Ch]: add a destructor for Intl, in order to delete the
1590 trans member on exit.
1592 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1594 * src/converter.C (GetReachable): fix typo.
1596 * src/lyxlex.C (GetFloat): rewrite to use strToDbl() and
1597 understand ',' instead of '.'.
1598 (GetInteger): rewrite to use strToInt().
1600 2000-09-26 Juergen Vigna <jug@sad.it>
1602 * src/frontends/xforms/FormParagraph.C: fixed de/activation of fields,
1603 better visibility and error-message on wrong VSpace input.
1605 * src/language.C (initL): added english again.
1607 2000-09-25 Juergen Vigna <jug@sad.it>
1609 * src/frontends/kde/Dialogs.C (Dialogs):
1610 * src/frontends/gnome/Dialogs.C (Dialogs):
1611 * src/frontends/kde/Makefile.am:
1612 * src/frontends/gnome/Makefile.am: added FormParagraph from xforms.
1614 * src/frontends/xforms/forms/makefile: added form_paragraph.fd.
1616 * src/frontends/xforms/Dialogs.C (Dialogs): added FormParagraph.
1618 * src/frontends/xforms/Makefile.am: added files for FormParagraph.
1620 * src/frontends/xforms/FormParagraph.C:
1621 * src/frontends/xforms/FormParagraph.h:
1622 * src/frontends/xforms/form_paragraph.C:
1623 * src/frontends/xforms/form_paragraph.h:
1624 * src/frontends/xforms/forms/form_paragraph.fd: new files for the new
1627 * src/lyxfunc.C (Dispatch): call the new layout paragraph.
1629 * src/tabular.C (OldFormatRead): forgot to delete the temporary
1630 Paragraph-Data after use.
1632 * src/insets/insettext.C (LocalDispatch): don't set the layout on
1633 non breakable paragraphs.
1635 2000-09-25 Garst R. Reese <reese@isn.net>
1637 * src/language.C (initL): added missing language_country codes.
1639 2000-09-25 Juergen Vigna <jug@sad.it>
1641 * src/insets/insettext.C (InsetText):
1642 (deleteLyXText): remove the not released LyXText structure!
1644 2000-09-24 Marko Vendelin <markov@ioc.ee>
1646 * src/frontends/gnome/mainapp.C
1647 * src/frontends/gnome/mainapp.h: added support for keyboard
1650 * src/frontends/gnome/FormCitation.C
1651 * src/frontends/gnome/FormCitation.h
1652 * src/frontends/gnome/Makefile.am
1653 * src/frontends/gnome/pixbutton.h: completed the rewrite of
1654 FormCitation to use "action area" in mainapp window
1656 * src/frontends/gnome/Menubar_pimpl.C
1657 * src/frontends/gnome/Menubar_pimpl.h: Gnome menu can handle
1660 2000-09-23 Dekel Tsur <dekel@math.tau.ac.il>
1662 * src/mathed/formula.C (MathFuncInset::Metrics): Use default
1663 width/descent/ascent values if name is empty.
1664 (mathed_string_height): Use std::max.
1666 2000-09-25 Allan Rae <rae@lyx.org>
1668 * src/frontends/xforms/forms/form_preferences.fd: resize to stop
1669 segfault. This will be completely redesigned soon.
1671 * sigc++: updated libsigc++. Fixes struct timespec bug.
1673 * development/tools/makeLyXsigc.sh: .cvsignore addition
1675 2000-09-23 Lars Gullik Bjønnes <larsbj@lyx.org>
1677 * several files: removed almost all traces of the old table
1680 * src/TableLayout.C: removed file
1682 2000-09-22 Juergen Vigna <jug@sad.it>
1684 * src/frontends/kde/Dialogs.C: added credits forms.
1686 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added forms.
1688 * src/frontends/gnome/Dialogs.C: added some forms.
1690 * src/spellchecker.C (init_spell_checker): set language in pspell code
1691 (RunSpellChecker): some modifications for setting language string.
1693 * src/language.[Ch]: added language_country code.
1695 2000-09-21 Angus Leeming <a.leeming@ic.ac.uk>
1697 * src/frontends/Dialogs.h: added new signal showError.
1698 Rearranged existing signals in some sort of alphabetical order.
1700 * src/frontends/xforms/Makefile.am: added new files, FormBase.[Ch],
1701 FormError.[Ch], form_error.[Ch]
1702 * src/frontends/xforms/forms/makefile: added new file form_error.fd
1703 * src/frontends/xforms/Dialogs.C: added new xforms dialog FormError.
1705 * src/frontends/xforms/FormBase.[Ch]: new base class for xforms
1706 dialogs. I think that this can be used as the base to all these
1709 * src/frontends/xforms/FormError.[Ch]
1710 * src/frontends/xforms/forms/form_error.fd: new files. Xforms
1711 implementation of InsetError dialog.
1713 * src/insets/inseterror.[Ch]: rendered GUI-independent.
1715 * src/frontends/kde/Dialogs.C: added new xforms dialog FormError.
1716 * src/frontends/kde/Makefile.am: ditto
1718 2000-09-21 Dekel Tsur <dekel@math.tau.ac.il>
1720 * src/mathed/math_cursor.[Ch]: Removed class members macroln and
1721 macrobf. This fixes a bug of invisible text.
1723 2000-09-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1725 * lib/doc/LaTeXConfig.lyx.in: updated.
1727 * src/language.C (initL): remove language "francais" and change a
1728 bit the names of the two other french variations.
1730 * src/support/lyxstring.C (lyxstring): do not apply strlen() on a
1731 string that may not be 0-terminated.
1733 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1735 * src/Makefile.am (lyx_SOURCES): remove table.C and Table.h
1737 2000-09-20 Marko Vendelin <markov@ioc.ee>
1739 * src/frontends/gnome/FormCitation.C
1740 * src/frontends/gnome/FormIndex.C
1741 * src/frontends/gnome/FormToc.C
1742 * src/frontends/gnome/FormUrl.C: cleanup the loops, reordering
1743 the variable initialization to shut up the warnings
1745 2000-09-20 Lars Gullik Bjønnes <larsbj@lyx.org>
1747 * src/table.[Ch]: deleted files
1749 * src/lyxfunc.C (Dispatch): Don't pass 0 as argument to Dispatch
1752 2000-09-18 Juergen Vigna <jug@sad.it>
1754 * src/insets/insettext.C (LocalDispatch): fixed Backspace/Delete
1755 problems with selection. Inserted new LFUN_PASTESELECTION.
1756 (InsetButtonPress): inserted handling of middle mouse-button paste.
1758 * src/spellchecker.C: changed word to word.c_str().
1760 2000-09-16 Kayvan A. Sylvan <kayvan@sylvan.com>
1762 * src/Makefile.am: Add sources to lyx_SOURCES so they will be
1763 included in the ``make dist'' tarball.
1765 2000-09-15 Juergen Vigna <jug@sad.it>
1767 * src/CutAndPaste.C (cutSelection): small fix return the right
1768 end position after cut inside one paragraph only.
1770 * src/insets/insettext.C (resizeLyXText): only reset the cursor if
1771 we are locked as otherwise we don't have a valid cursor position!
1773 * src/insets/figinset.C (draw): small bugfix but why is this needed???
1775 2000-09-19 Angus Leeming <a.leeming@ic.ac.uk>
1777 * src/frontends/kde/FormRef.C: added using directive.
1778 * src/frontends/kde/FormToc.C: ditto
1780 * src/frontends/kde/formtocdialog.h: changed endl to std::endl.
1782 * src/frontends/kde/FormRef.h: removed trailing comma from enums.
1784 2000-09-19 Marko Vendelin <markov@ioc.ee>
1786 * src/frontends/gnome/Menubar_pimpl.C
1787 * src/frontends/gnome/Menubar_pimpl.h: Gnome menus show now
1788 Toc, ViewFormats, UpdateFormats, and ExportFormats.
1790 * src/frontends/gnome/mainapp.C
1791 * src/frontends/gnome/mainapp.h: support for menu update used
1794 * src/frontends/gnome/mainapp.C
1795 * src/frontends/gnome/mainapp.h: support for "action" area in the
1796 main window. This area is used by small simple dialogs, such as
1799 * src/frontends/gnome/FormIndex.C
1800 * src/frontends/gnome/FormIndex.h
1801 * src/frontends/gnome/FormUrl.C
1802 * src/frontends/gnome/FormUrl.h: rewrite to use main window action
1805 * src/frontends/gnome/FormCitation.C
1806 * src/frontends/gnome/FormCitation.h: rewrite to use main window
1807 action area. Only "Insert new citation" is implemented.
1809 2000-09-19 Lars Gullik Bjønnes <larsbj@lyx.org>
1811 * src/buffer.C (Dispatch): fix call to Dispatch
1812 * src/insets/insetref.C (Edit): likewise
1813 * src/insets/insetparent.C (Edit): likewise
1814 * src/insets/insetinclude.C (include_cb): likewise
1815 * src/frontends/xforms/FormUrl.C (apply): likewise
1816 * src/frontends/xforms/FormToc.C (apply): likewise
1817 * src/frontends/xforms/FormRef.C (apply): likewise
1818 * src/frontends/xforms/FormIndex.C (apply): likewise
1819 * src/frontends/xforms/FormCitation.C (apply): likewise
1820 * src/lyxserver.C (callback): likewise
1821 * src/lyxfunc.C (processKeySym): likewise
1822 (Dispatch): likewise
1823 (Dispatch): likewise
1824 * src/lyx_cb.C (LayoutsCB): likewise
1826 * Makefile.am (sourcedoc): small change
1828 2000-09-18 Lars Gullik Bjønnes <larsbj@lyx.org>
1830 * src/main.C (main): Don't make an empty GUIRunTime object. all
1831 methods are static. constify a bit remove unneded using + headers.
1833 * src/tabular.C: some more const to local vars move some loop vars
1835 * src/spellchecker.C: added some c_str after some word for pspell
1837 * src/frontends/GUIRunTime.h: add new static method setDefaults
1838 * src/frontends/xforms/GUIRunTime.C (setDefaults):
1839 * src/frontends/kde/GUIRunTime.C (setDefaults):
1840 * src/frontends/gnome/GUIRunTime.C (setDefaults): new method
1842 * src/mathed/math_cursor.C (MacroModeClose): don't call SetName
1843 with strnew in arg, use correct emptystring when calling SetName.
1845 * several files: remove all commented code with relation to
1846 HAVE_SSTREAM beeing false. We now only support stringstream and
1849 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1851 * src/lyxfunc.C: construct correctly the automatic new file
1854 * src/text2.C (IsStringInText): change type of variable i to shut
1857 * src/support/sstream.h: do not use namespaces if the compiler
1858 does not support them.
1860 2000-09-15 Marko Vendelin <markov@ioc.ee>
1861 * src/frontends/gnome/FormCitation.C
1862 * src/frontends/gnome/FormCitation.h
1863 * src/frontends/gnome/diainsertcitation_interface.c
1864 * src/frontends/gnome/dialogs/diainsertcitation.glade: adds
1865 regexp support to FormCitation [Gnome].
1867 2000-09-15 John Levon <moz@compsoc.man.ac.uk>
1870 * configure.in: remove unused KDE/GTKGUI define
1872 * src/frontends/kde/FormRef.C
1873 * src/frontends/kde/FormRef.h
1874 * src/frontends/kde/formrefdialog.C
1875 * src/frontends/kde/formrefdialog.h: double click will
1876 go to reference, now it is possible to change a cross-ref
1879 * src/frontends/kde/FormToc.C
1880 * src/frontends/kde/FormToc.h
1881 * src/frontends/kde/formtocdialog.C
1882 * src/frontends/kde/formtocdialog.h: add a depth
1885 * src/frontends/kde/Makefile.am: add QtLyXView.h
1888 2000-09-15 Angus Leeming <a.leeming@ic.ac.uk>
1890 * src/frontends/kde/FormCitation.h: added some using directives.
1892 * src/frontends/kde/FormToc.h: corrected definition of doTree.
1894 * src/frontends/kde/GUIRunTime.C (initApplication): use lyxerr not
1897 * src/mathed/math_defs.h: redefine SetAlign to use string rather
1900 2000-09-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1902 * src/buffer.C (pop_tag): revert for the second time a change by
1903 Lars, who seems to really hate having non-local loop variables :)
1905 * src/Lsstream.h: add "using" statements.
1907 * src/support/copy.C (copy): add a bunch of std:: qualifiers
1908 * src/buffer.C (writeFile): ditto
1910 2000-09-14 Lars Gullik Bjønnes <larsbj@lyx.org>
1912 * src/buffer.C (writeFile): try to fix the locale modified format
1913 number to always be as we want it.
1915 * src/WorkArea.C (work_area_handler): try to workaround the bugs
1916 in XForms 0.89. C-space is now working again.
1918 * src/Lsstream.h src/support/sstream.h: new files.
1920 * also commented out all cases where strstream were used.
1922 * src/Bullet.h (c_str): remove method.
1924 * remove all stuff that is irrelevant when NEW_MENUBAR is defined
1926 * a lot of files: get rid of "char const *" and "char *" is as
1927 many places as possible. We only want to use them in interaction
1928 with system of other libraries, not inside lyx.
1930 * a lot of files: return const object is not of pod type. This
1931 helps ensure that temporary objects is not modified. And fits well
1932 with "programming by contract".
1934 * configure.in: check for the locale header too
1936 * Makefile.am (sourcedoc): new tag for generation of doc++
1939 2000-09-14 Juergen Vigna <jug@sad.it>
1941 * src/frontends/xforms/FormDocument.C (ComboInputCB): fixed the
1942 callback to check which combo called it and do the right action.
1944 * src/combox.C (combo_cb): added combo * to the callbacks.
1945 (Hide): moved call of callback after Ungrab of the pointer.
1947 * src/intl.h: removed LCombo2 function.
1949 * src/intl.C (LCombo): added Combox * to call and removed LCombo2
1950 function as this can now be handled in one function.
1952 * src/combox.h: added Combox * to callback prototype.
1954 * src/frontends/xforms/Toolbar_pimpl.C:
1955 * src/lyx_cb.C (LayoutsCB): added Combox * to function call.
1957 2000-09-14 Garst Reese <reese@isn.net>
1959 * lib/tex/hollywood.cls changed length of parenthicals to 1.5in
1960 moved usepackage{xxx}'s to beginning of file. Changed left margin
1961 to 1.5in, right margin to 1in. Forced headrulewidth to 0, removed
1962 underlining from title. Thanks to John Culleton for useful suggestions.
1964 2000-09-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
1966 * src/lyxlex_pimpl.C (setFile): change error message to debug
1969 2000-09-13 Juergen Vigna <jug@sad.it>
1971 * src/frontends/xforms/FormDocument.C: implemented choice_class
1972 as combox and give callback to combo_language so OK/Apply is activated
1975 * src/bufferlist.C (newFile): small fix so already named files
1976 (via an open call) are not requested to be named again on the
1979 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1981 * src/frontends/kde/Makefile.am
1982 * src/frontends/kde/FormRef.C
1983 * src/frontends/kde/FormRef.h
1984 * src/frontends/kde/formrefdialog.C
1985 * src/frontends/kde/formrefdialog.h: implement
1988 2000-09-13 John Levon <moz@compsoc.man.ac.uk>
1990 * src/frontends/kde/formtocdialog.C
1991 * src/frontends/kde/formtocdialog.h
1992 * src/frontends/kde/FormToc.C
1993 * src/frontends/kde/FormToc.h: change to make TOC hierarchical properly
1995 2000-09-11 John Levon <moz@compsoc.man.ac.uk>
1997 * src/frontends/kde/FormCitation.C: fix thinko
1998 where we didn't always display the reference text
2001 * src/frontends/kde/formurldialog.C
2002 * src/frontends/kde/formurldialog.h
2003 * src/frontends/kde/FormUrl.C
2004 * src/frontends/kde/FormUrl.h: minor cleanups
2006 * src/frontends/kde/QtLyXView: wrapper to avoid Qt namespace mangling
2008 * src/frontends/kde/Makefile.am
2009 * src/frontends/kde/FormToc.C
2010 * src/frontends/kde/FormToc.h
2011 * src/frontends/kde/FormCitation.C
2012 * src/frontends/kde/FormCitation.h
2013 * src/frontends/kde/FormIndex.C
2014 * src/frontends/kde/FormIndex.h
2015 * src/frontends/kde/formtocdialog.C
2016 * src/frontends/kde/formtocdialog.h
2017 * src/frontends/kde/formcitationdialog.C
2018 * src/frontends/kde/formcitationdialog.h
2019 * src/frontends/kde/formindexdialog.C
2020 * src/frontends/kde/formindexdialog.h: new Toc,Citation,Index dialogs
2022 2000-09-12 Juergen Vigna <jug@sad.it>
2024 * src/frontends/gnome/GUIRunTime.C (initApplication): make id + version
2027 2000-09-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2029 * src/frontends/xforms/GUIRunTime.C (initApplication): use lyxerr,
2032 2000-09-09 Dekel Tsur <dekel@math.tau.ac.il>
2034 * src/converter.C (Add, Convert): Added support for converter flags:
2035 needaux, resultdir, resultfile.
2036 (Convert): Added new parameter view_file.
2037 (dvips_options): Fixed letter paper option.
2039 * src/exporter.C (Export, BufferExtension): Added support for Docbook.
2040 (Export, GetExportableFormats, GetViewableFormats): Added support
2043 * src/lyx_main.C (LyX): Call to QuitLyX() to remove temporary
2045 (easyParse): Fixed to work with new export code.
2047 * src/support/filetools.C (DeleteAllFilesInDir) Fixed to delete
2050 * lyx-devel-export/lib/configure.m4: Changed flags of tth.
2052 * lib/bind/*.bind: Replaced
2053 buffer-view,buffer-view-ps,buffer-typeset,buffer-typeset-ps by
2054 buffer-view dvi,buffer-view ps,buffer-update dvi,buffer-update ps
2056 2000-09-11 Juergen Vigna <jug@sad.it>
2058 * src/lyx_gui.C (runTime): uses global guiruntime variable.
2060 * src/main.C (main): now GUII defines global guiruntime!
2062 * src/frontends/gnome/GUIRunTime.C (initApplication):
2063 * src/frontends/kde/GUIRunTime.C (initApplication):
2064 * src/frontends/xforms/GUIRunTime.C (initApplication):
2065 * src/frontends/GUIRunTime.h: added new function initApplication.
2067 * src/spellchecker.C (sc_accept_word): change to add_to_session.
2069 * src/vspace.C (nextToken): fixed error with number 0cm as unvalid.
2071 2000-09-08 Juergen Vigna <jug@sad.it>
2073 * src/lyx_gui.C (create_forms): don't display the "default" entry as
2074 we have already "Reset".
2076 * src/language.C (initL): inserted "default" language and made this
2077 THE default language (and not american!)
2079 * src/paragraph.C: inserted handling of "default" language!
2081 * src/lyxfont.C: ditto
2085 * src/paragraph.C: output the \\par only if we have a following
2086 paragraph otherwise it's not needed.
2088 2000-09-05 Juergen Vigna <jug@sad.it>
2090 * config/pspell.m4: added entry to lyx-flags
2092 * src/spellchecker.C: modified version from Kevin for using pspell
2094 2000-09-01 Marko Vendelin <markov@ioc.ee>
2095 * src/frontends/gnome/Makefile.am
2096 * src/frontends/gnome/FormCitation.C
2097 * src/frontends/gnome/FormCitation.h
2098 * src/frontends/gnome/diainsertcitation_callbacks.c
2099 * src/frontends/gnome/diainsertcitation_callbacks.h
2100 * src/frontends/gnome/diainsertcitation_interface.c
2101 * src/frontends/gnome/diainsertcitation_interface.h
2102 * src/frontends/gnome/dialogs/diainsertcitation.glade: Insert Citation
2103 dialog for Gnome frontend
2105 * src/main.C: Gnome libraries require keeping application name
2106 and its version as strings
2108 * src/frontends/gnome/mainapp.C: Change the name of the main window
2109 from GnomeLyX to PACKAGE
2111 2000-09-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
2113 * src/frontends/Liason.C: add "using: declaration.
2115 2000-08-31 Dekel Tsur <dekel@math.tau.ac.il>
2117 * src/mathed/math_macro.C (Metrics): Set the size of the template
2119 * src/mathed/formulamacro.C (Latex): Fixed the returned value
2121 2000-09-04 Dekel Tsur <dekel@math.tau.ac.il>
2123 * src/converter.C (add_options): New function.
2124 (SetViewer): Change $$FName into '$$FName'.
2125 (View): Add options when running xdvi
2126 (Add): Change $$FName into '$$FName'. Same for $$BaseName/$$OutName.
2127 (Convert): The 3rd parameter is now the desired filename. Converts
2128 calls to lyx::rename if necessary.
2129 Add options when running dvips.
2130 (dvi_papersize,dvips_options): New methods.
2132 * src/exporter.C (Export): Use getLatexName() instead of fileName().
2134 * src/frontends/Liason.C (printBuffer): Removed duplicate code by
2135 using a call to Converter::dvips_options.
2136 Fixed to work with nex export code.
2138 * src/support/copy.C
2139 * src/support/rename.C: New files
2141 * src/support/syscall.h
2142 * src/support/syscall.C: Added Starttype SystemDontWait.
2144 * lib/ui/default.ui: Changed to work with new export code
2146 * lib/configure.m4: Changed to work with new export code
2148 * src/encoding.C: Changed latex name for iso8859_7 encoding.
2150 2000-09-04 Angus Leeming <a.leeming@ic.ac.uk> +
2152 * src/frontends/xforms/Menubar_pimpl.C: added two using directives
2153 so that code compiles with DEC cxx.
2155 * src/frontends/xforms/FormCitation.C (setSize): code re-writtenn
2156 to work correctly! Also now supports the additional elements
2159 2000-09-01 Allan Rae <rae@lyx.org>
2161 * src/frontends/ButtonPolicies.C: renamed all the references to
2162 PreferencesPolicy::{AllButtons,BOGUS} to be ButtonPolicy.
2164 * src/frontends/ButtonPolicies.h: rename AllButtons to ALL_BUTTONS
2165 since it's a const not a type.
2167 * src/frontends/xforms/ButtonController.h: cleanup before Lars does.
2169 2000-08-31 Juergen Vigna <jug@sad.it>
2171 * src/insets/figinset.C: Various changes to look if the filename has
2172 an extension and if not add it for inline previewing.
2174 2000-08-31 Lars Gullik Bjønnes <larsbj@lyx.org>
2176 * src/frontends/ButtonPolicies.h: add a Button AllButtons.
2177 make buttonStatus and isReadOnly be const methods. (also reflect
2178 this in derived classes.)
2180 * src/frontends/ButtonPolicies.C: remove sum_ and bogus_
2181 (nextState): change to be static inline, pass the StateMachine as
2183 (PreferencesPolicy): remove casts
2184 (OkCancelPolicy): remvoe casts
2185 (OkCancelReadOnlyPolicy): remove casts
2186 (NoRepeatedApplyReadOnlyPolicy): remove casts
2187 (OkApplyCancelReadOnlyPolicy): remove casts
2188 (OkApplyCancelPolicy): remove casts
2189 (NoRepeatedApplyPolicy): remove casts
2191 2000-08-31 Angus Leeming <a.leeming@ic.ac.uk>
2193 * src/converter.C: added some using directives
2195 * src/frontends/ButtonPolicies.C: changes to overcome
2196 "need lvalue" error with DEC c++
2198 * src/frontends/xforms/FormDocument.C (c-tor): use C callback
2199 to WMHideCB for DEC c++
2201 * src/frontends/xforms/Menubar_pimpl.C: added using directive
2203 * src/frontends/xforms/forms/form_document.C.patch: use C callback
2204 to BulletBMTableCB for DEC c++
2206 2000-08-31 Allan Rae <rae@lyx.org>
2208 * src/lyx_gui.C (create_forms): build combo_language2 which is part of
2209 character dialog separately from old document dialogs combo_language.
2212 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2214 * src/commandtags.h: Added LFUN_GOTO_PARAGRAPH.
2215 Removed LFUN_REF_CREATE.
2217 * src/MenuBackend.C: Added new tags: toc and references
2219 * src/frontends/xforms/Menubar_pimpl.C: Removed the use of StrPool
2220 (add_lastfiles, add_documents, add_formats): Removed the unused smn
2222 (add_toc, add_references): New methods.
2223 (create_submenu): Handle correctly the case when there is a
2224 seperator after optional menu items.
2226 * src/lyxfunc.C (getStatus): Handle LFUN_REF_BACK.
2227 (dispatch): Combined the code for LFUN_REF_CREATE and LFUN_REF_INSERT.
2228 (dispatch): New code for LFUN_GOTO_PARAGRAPH.
2230 * src/frontends/xforms/FormToc.C (apply): Use Dispatch.
2232 2000-08-30 Dekel Tsur <dekel@math.tau.ac.il>
2234 * src/converter.[Ch]: New file for converting between different
2237 * src/export.[Ch]: New file for exporting a LyX file to different
2240 * src/lyx_cb.C: Remove many functions when NEW_EXPORT is defined:
2241 MenuRunLaTeX, MakeLaTeXOutput, RunScript, CreatePostscript,
2242 PreviewPostscript, PreviewDVI, AskOverwrite, MenuMakeLaTeX,
2243 MenuMakeLinuxDoc, MenuMakeDocBook, MenuMakeHTML,
2244 MenuMakeHTML_LinuxDoc, MenuMakeHTML_DocBook, RunLinuxDoc,
2245 RunDocBook, MenuExport.
2247 * src/lyxfunc.C (Dispatch): Use the Exporter::Export and
2248 Exporter::Preview methods if NEW_EXPORT is defined.
2250 * src/buffer.C (Dispatch): Use Exporter::Export.
2252 * src/lyxrc.C: Added new tags: \converter and \viewer.
2255 * src/LyXAction.C: Define new lyx-function: buffer-update.
2256 Remove obsolete buffer-typeset,buffer-typeset-ps & buffer-view-ps
2257 when NEW_EXPORT is defined.
2259 * src/MenuBackend.C: Added new tags: updateformats and viewformats.
2261 * src/frontends/xforms/Menubar_pimpl.C (add_formats) New method.
2263 * lib/ui/default.ui: Added submenus "view" and "update" to the
2266 * src/filetools.C (GetExtension): New function.
2268 * src/LaTeX.C (LaTeX): Add "-pdf" to depfile if pdflatex is used.
2270 2000-08-29 Allan Rae <rae@lyx.org>
2272 * lib/bind/xemacs.bind: update a binding due to Juergen's recent work
2274 * src/frontends/xforms/FormDocument.C (checkReadOnly): new function
2275 (EnableDocumentLayout): removed
2276 (DisableDocumentLayout): removed
2277 (build): make use of ButtonController's read-only handling to
2278 de/activate various objects. Replaces both of the above functions.
2280 * src/frontends/xforms/ButtonController.h (readWrite): was read_write
2281 (readOnly): was read_only
2282 (refresh): fixed dumb mistakes with read_only_ handling
2284 * src/frontends/xforms/forms/form_document.fd:
2285 * src/frontends/xforms/forms/form_tabular.fd: Use FL_FLAT_BOX for the
2286 tabbed dialogs so the tabs look more like tabs and so its easier to
2287 work out which is the current tab.
2289 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): fix
2290 segfault with form_table
2292 * src/frontends/ButtonPolicies.C: All policies now support UNDO_ALL.
2294 2000-08-28 Juergen Vigna <jug@sad.it>
2296 * acconfig.h: added USE_PSPELL.
2298 * src/config.h.in: added USE_PSPELL.
2300 * autogen.sh: added pspell.m4
2302 * config/pspell.m4: new file.
2304 * src/spellchecker.C: implemented support for pspell libary.
2306 2000-08-25 Juergen Vigna <jug@sad.it>
2308 * src/LyXAction.C (init): renamed LFUN_TABLE to
2309 LFUN_DIALOG_TABULAR_INSERT and fixed all it's occurences.
2311 * src/lyxfunc.C (getStatus): fix for disabled Edit->Table entries.
2313 * src/lyxscreen.h: add force_clear variable and fuction to force
2314 a clear area when redrawing in LyXText.
2316 * src/text.C (GetVisibleRow): look if the screen forces a redraw.
2318 2000-08-25 Lars Gullik Bjønnes <larsbj@lyx.org>
2320 * some whitespace and comment changes.
2322 * src/lyx_gui.C (LyXGUI): use C++ style casts instead of C ones.
2324 * src/buffer.C: up te LYX_FORMAT to 2.17
2326 2000-08-23 Juergen Vigna <jug@sad.it>
2328 * src/BufferView_pimpl.C (tripleClick): disable this when in a
2331 * src/insets/insettabular.C (pasteSelection): delete the insets
2332 LyXText as it is not valid anymore.
2333 (copySelection): new function.
2334 (pasteSelection): new function.
2335 (cutSelection): new function.
2336 (LocalDispatch): implemented cut/copy/paste of cell selections.
2338 * src/insets/insettext.C (resizeLyXText): don't need resize if I still
2339 don't have a LyXText.
2341 * src/LyXAction.C (init): a NEW_TABULAR define too much.
2343 * src/lyx_gui_misc.C (CloseAllBufferRelatedDialogs): another missing
2346 2000-08-22 Juergen Vigna <jug@sad.it>
2348 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs):
2349 ifdef form_table out if NEW_TABULAR.
2351 2000-08-21 Juergen Vigna <jug@sad.it>
2353 * src/insets/insettabular.C (TabularFeatures): BoxType is enum now.
2354 (draw): fixed draw position so that the cursor is positioned in the
2356 (InsetMotionNotify): hide/show cursor so the position is updated.
2357 (GENERAL): fixed cursor_pos to show only 0/1 (begin/end of cell),
2358 using cellstart() function where it should be used.
2360 * src/insets/insettext.C (draw): ditto.
2362 * src/tabular.C: fixed initialization of some missing variables and
2363 made BoxType into an enum.
2365 2000-08-22 Marko Vendelin <markov@ioc.ee>
2366 * src/frontends/gnome/Menubar_pimpl.C: Mathces LyX action with Gnome
2367 stock menu item using action numerical value, not its string
2371 2000-08-22 Lars Gullik Bjønnes <larsbj@lyx.org>
2373 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add
2374 GUIRunTime.C remove GUIRunTime_pimpl.[Ch]
2376 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]: removed file
2378 * src/frontends/xforms/GUIRunTime.C: new file
2380 * src/frontends/kde/Makefile.am (libkde_la_SOURCES): add
2381 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2383 * src/frontends/kde/GUIRunTime_pimpl.[Ch]: removed file
2385 * src/frontends/kde/GUIRunTime.C: new file
2387 * src/frontends/gnome/Makefile.am (libgnome_la_SOURCES): add
2388 GUIRunTime.C and remove GUIRunTime_pimpl.[Ch]
2390 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: removed file
2392 * src/frontends/gnome/GUIRunTime.C: new file
2394 * src/frontends/Makefile.am (libfrontends_la_SOURCES): removed
2397 * src/frontends/GUIRunTime.h: removed constructor and destructor,
2398 small change to documetentation.
2400 * src/frontends/GUIRunTime.C: removed file
2402 * src/text2.C (MeltFootnoteEnvironment): add some NEW_TABULAR
2404 * src/lyxparagraph.h: enable NEW_TABULAR as default
2406 * src/lyxfunc.C (processKeySym): remove some commented code
2408 * src/lyx_gui_misc.C (updateAllVisibleBufferRelatedDialogs): add
2409 NEW_TABULAR around the fd_form_table_options.
2411 * src/lyx_gui.C (runTime): call the static member function as
2412 GUIRunTime::runTime().
2414 2000-08-21 Allan Rae <rae@lyx.org>
2416 * src/frontends/xforms/FormDocument.h: D'oh. Forgot to change the
2419 2000-08-21 Dekel Tsur <dekel@math.tau.ac.il>
2421 * src/Spacing.C (writeEnvirBegin): Small fix when sstream not present
2423 2000-08-21 Allan Rae <rae@lyx.org>
2425 * src/frontends/xforms/ButtonController.h (setOK): renamed from setOk to
2426 keep Garst happy ;-)
2427 * src/frontends/xforms/FormPreferences.C (build): use setOK
2428 * src/frontends/xforms/FormDocument.C (build): use setOK
2429 (FormDocument): use the appropriate policy.
2431 2000-08-21 Allan Rae <rae@lyx.org>
2433 * src/frontends/xforms/ButtonController.h (class ButtonController): Allow
2434 automatic [de]activation of arbitrary objects when in a read-only state.
2436 * src/frontends/ButtonPolicies.h: More documentation
2437 (isReadOnly): added to support the above.
2439 * src/frontends/xforms/forms/form_preferences.fd: Changed Ok -> Save
2441 2000-08-18 Juergen Vigna <jug@sad.it>
2443 * src/insets/insettabular.C (getStatus): changed to return func_status.
2445 * src/lyxfunc.C (getStatus): fixed TabularFeatures menu to always
2446 display toggle menu entries if they are.
2448 * src/lyx_cb.C: #ifdef'ed out layout stuff which is in the
2449 new document layout now.
2451 * src/lyxfunc.C: ditto
2453 * src/lyx_gui_misc.C: ditto
2455 * src/lyx_gui.C: ditto
2457 * lib/ui/default.ui: removed paper and quotes layout as they are now
2458 all in the document layout tabbed folder.
2460 * src/frontends/xforms/forms/form_document.fd: added Restore
2461 button and callbacks for all inputs for Allan's ButtonPolicy.
2463 * src/frontends/xforms/FormDocument.C (ChoiceClassCB): added.
2464 (CheckChoiceClass): added missing params setting on class change.
2465 (UpdateLayoutDocument): added for updating the layout on params.
2466 (build): forgot to RETURN_ALWAYS input_doc_spacing.
2467 (FormDocument): Implemented Allan's ButtonPolicy with the
2470 2000-08-17 Allan Rae <rae@lyx.org>
2472 * src/frontends/xforms/Dialogs.C (Dialogs): Make a temporary connection
2473 so we can at least see the credits again.
2475 * src/frontends/xforms/FormPreferences.C: Used the appropriate button
2476 controller calls for the appropriate callbacks. Note that since Ok
2477 calls apply followed by cancel, and apply isn't a valid input for the
2478 APPLIED state, the bc_ calls have to be made in the static callback not
2479 within each of the real callbacks.
2481 * src/frontends/xforms/ButtonController.h (Ok): renamed from Okay()
2482 (setOk): renamed from setOkay()
2484 2000-08-17 Juergen Vigna <jug@sad.it>
2486 * src/frontends/gnome/Menubar_pimpl.C (openByName): put this function
2487 in the implementation part.
2488 (composeUIInfo): don't show optional menu-items.
2490 * src/lyxfunc.C (getStatus): use insets LyXText if the_locking_inset.
2492 * src/insets/insettext.C (UpdateLocal): call to LyXView::showState()
2494 * src/bufferview_funcs.C (CurrentState): fixed to show also the
2495 text-state when in a text-inset.
2497 * src/frontends/kde/GUIRunTime_pimpl.C: include xforms for now.
2499 2000-08-17 Marko Vendelin <markov@ioc.ee>
2500 * src/frontends/gnome/FormIndex.C
2501 * src/frontends/gnome/FormIndex.h
2502 * src/frontends/gnome/FormToc.C
2503 * src/frontends/gnome/FormToc.h
2504 * src/frontends/gnome/dialogs
2505 * src/frontends/gnome/diatoc_callbacks.c
2506 * src/frontends/gnome/diatoc_callbacks.h
2507 * src/frontends/gnome/diainsertindex_callbacks.h
2508 * src/frontends/gnome/diainsertindex_callbacks.c
2509 * src/frontends/gnome/diainsertindex_interface.c
2510 * src/frontends/gnome/diainsertindex_interface.h
2511 * src/frontends/gnome/diatoc_interface.h
2512 * src/frontends/gnome/diatoc_interface.c
2513 * src/frontends/gnome/Makefile.am: Table of Contents and
2514 Insert Index dialogs implementation for Gnome frontend
2516 * src/frontends/gnome/GUIRunTime_pimpl.C: fix some small bugs
2518 * src/frontends/gnome/Menubar_pimpl.C: remove historical comments
2520 * src/frontends/gnome/diainserturl_interface.c: make the dialog
2523 2000-08-17 Lars Gullik Bjønnes <larsbj@lyx.org>
2525 * src/frontends/xforms/GUIRunTime_pimpl.C: constructor and
2526 destructor. Don't definde if you don't need it
2527 (processEvents): made static, non-blocking events processing for
2529 (runTime): static method. event loop for xforms
2530 * similar as above for kde and gnome.
2532 * src/frontends/GUIRunTime.C (GUIRunTime): new Pimpl() is wrong
2533 new Pimpl is correct
2534 (runTime): new method calss the real frontends runtime func.
2536 * src/lyx_gui.C (runTime): change to use the GUIRunTime::runTime
2538 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2540 * src/lyx_gui.C (create_forms): fix the "No change" gettext missing
2542 2000-08-16 Juergen Vigna <jug@sad.it>
2544 * src/lyx_gui.C (runTime): added GUII RunTime support.
2546 * src/frontends/Makefile.am:
2547 * src/frontends/GUIRunTime.[Ch]:
2548 * src/frontends/xforms/GUIRunTime_pimpl.[Ch]:
2549 * src/frontends/kde/GUIRunTime_pimpl.[Ch]:
2550 * src/frontends/gnome/GUIRunTime_pimpl.[Ch]: added GUII runtime support
2552 * src/LyXAction.C (init): added dummy LFUN_INSERT_URL.
2554 * src/frontends/Makefile.am (INCLUDES): don't set the FRONTENDS include
2555 as this is already set in ${FRONTEND_INCLUDE} if needed.
2557 * configure.in (CPPFLAGS): setting the include dir for the frontend
2558 directory and don't set FRONTEND=xforms for now as this is executed
2561 2000-08-16 John Levon (moz@compsoc.man.ac.uk)
2563 * src/frontends/kde/Makefile.am:
2564 * src/frontends/kde/FormUrl.C:
2565 * src/frontends/kde/FormUrl.h:
2566 * src/frontends/kde/formurldialog.h:
2567 * src/frontends/kde/formurldialog.C: Add KDE URL dialog
2569 2000-08-15 Kayvan A. Sylvan <kayvan@sylvan.com>
2571 * src/frontend/Makefile.am: Add gnome and kde to dist tar file.
2573 2000-08-16 Lars Gullik Bjønnes <larsbj@lyx.org>
2575 * src/BufferView_pimpl.C (workAreaKeyPress): enable the
2578 2000-08-15 Lars Gullik Bjønnes <larsbj@lyx.org>
2580 * src/WorkArea.C (work_area_handler): more work to get te
2581 FL_KEYBOARD to work with xforms 0.88 too, please test.
2583 * src/BufferView_pimpl.C (workAreaKeyPress): add XForms 0.88 guard.
2585 2000-08-15 Dekel Tsur <dekel@math.tau.ac.il>
2587 * src/frontends/ButtonPolicies.C: make gcc happy when compiling with
2590 2000-08-14 Lars Gullik Bjønnes <larsbj@lyx.org>
2592 * src/Timeout.h: remove Qt::emit hack.
2594 * several files: changes to allo doc++ compilation
2596 * src/lyxfunc.C (processKeySym): new method
2597 (processKeyEvent): comment out if FL_REVISION < 89
2599 * src/WorkArea.C: change some debugging levels.
2600 (WorkArea): set wantkey to FL_KEY_ALL
2601 (work_area_handler): enable the FL_KEYBOARD clause, this enables
2602 clearer code and the use of compose with XForms 0.89. Change to
2603 use signals instead of calling methods in bufferview directly.
2605 * src/Painter.C: change some debugging levels.
2607 * src/LyXView.C: don't setup of use the KeyPressMask_raw_callback
2610 * src/BufferView_pimpl.C (Pimpl): Connect to the WorkArea signals.
2611 (workAreaKeyPress): new method
2613 2000-08-14 Juergen Vigna <jug@sad.it>
2615 * src/frontends/kde/Dialogs.C (Dialogs): added missing dialogs.
2617 * config/kde.m4: addes some features
2619 * src/frontends/kde/Makefile.am (libkde_la_OBJADD): modified to
2620 include missing xforms dialogs.
2622 * src/Timeout.h: a hack to be able to compile with qt/kde.
2624 * sigc++/.cvsignore: added acinclude.m4
2626 * lib/.cvsignore: added listerros
2628 * src/frontends/Makefile.am: modified for now to ALWAYS compile the
2629 xforms tree as objects are needed for other frontends.
2631 * src/frontends/gnome/Makefile.am (libgnome_la_OBJADD): added for
2632 linking with not yet implemented xforms objects.
2634 * src/frontends/gnome/Dialogs.C (Dialogs): added FormDocument.
2636 2000-08-14 Baruch Even <baruch.even@writeme.com>
2638 * src/frontends/xforms/FormGraphics.h:
2639 * src/frontends/xforms/FormGraphics.C:
2640 * src/frontends/xforms/RadioButtonGroup.h:
2641 * src/frontends/xforms/RadioButtonGroup.C:
2642 * src/insets/insetgraphics.h:
2643 * src/insets/insetgraphics.C:
2644 * src/insets/insetgraphicsParams.h:
2645 * src/insets/insetgraphicsParams.C: Changed indentation to use tabs
2646 instead of spaces, and various other indentation issues to make the
2647 sources more consistent.
2649 2000-08-14 Marko Vendelin <markov@ioc.ee>
2651 * src/frontends/gnome/dialogs/diaprint.glade
2652 * src/frontends/gnome/FormPrint.C
2653 * src/frontends/gnome/FormPrint.h
2654 * src/frontends/gnome/diaprint_callbacks.c
2655 * src/frontends/gnome/diaprint_callbacks.h
2656 * src/frontends/gnome/diaprint_interface.c
2657 * src/frontends/gnome/diaprint_interface.h: Print dialog Gnome
2660 * src/frontends/gnome/dialogs/diainserturl.glade
2661 * src/frontends/gnome/FormUrl.C
2662 * src/frontends/gnome/FormUrl.h
2663 * src/frontends/gnome/diainserturl_callbacks.c
2664 * src/frontends/gnome/diainserturl_callbacks.h
2665 * src/frontends/gnome/diainserturl_interface.c
2666 * src/frontends/gnome/diainserturl_interface.h: Insert Url dialog
2667 Gnome implementation
2669 * src/frontends/gnome/Dialogs.C
2670 * src/frontends/gnome/Makefile.am: added Print, Insert Url and
2671 all other dialogs. Copy all unimplemented dialogs from Xforms
2674 * src/frontends/gnome/support.c
2675 * src/frontends/gnome/support.h: support files generated by Glade
2679 * config/gnome.m4: Gnome configuration scripts
2681 * config/lyxinclude.m4: cleanup: frontend renamed from gtk to gnome in
2682 configure --help message
2684 * src/lyx_gui.C: Gnome/Gtk releases control in LyXGUI::runTime()
2685 only if there are no events pendling in Gnome/Gtk. This enhances
2686 the performance of menus.
2689 2000-08-14 Allan Rae <rae@lyx.org>
2691 * lib/Makefile.am: listerrors cleaning
2693 * lib/listerrors: removed -- generated file
2694 * acinclude.m4: ditto
2695 * sigc++/acinclude.m4: ditto
2697 * src/frontends/xforms/forms/form_citation.fd:
2698 * src/frontends/xforms/FormCitation.C (setSize): Made the form a more
2701 * src/frontends/xforms/forms/makefile: I renamed the `install` target
2702 `updatesrc` and now we have a `test` target that does what `updatesrc`
2703 used to do. I didn't like having an install target that wasn't related
2706 * src/frontends/xforms/Form*.[hC]: Removed the free() member functions
2707 on all except FormGraphics. This may yet happen. Followed by a major
2708 cleanup including using FL_TRANSIENT for most of the dialogs. More
2709 changes to come when the ButtonController below is introduced.
2711 * src/frontends/xforms/ButtonController.h: New file for managing up to
2712 four buttons on a dialog according to an externally defined policy.
2713 * src/frontends/xforms/Makefile.am: added above
2715 * src/frontends/ButtonPolicies.[hC]: New files full of policies for Ok,
2716 Apply and Cancel/Close buttons and everything in between and beyond.
2717 * src/frontends/Makefile.am: added above.
2719 * src/frontends/xforms/forms/form_preferences.fd:
2720 * src/frontends/xforms/FormPreferences.[hC]: Uses the ButtonController
2721 and removed variable 'status' as a result. Fixed the set_minsize thing.
2722 Use the new screen-font-update after checking screen fonts were changed
2723 Added a "Restore" button to restore the original lyxrc values while
2724 editing. This restores everything not just the last input changed.
2725 That's still a tricky one. As is the "LyX: this shouldn't happen..."
2727 * src/LyXAction.C: screen-font-update added for updating buffers after
2728 screen font settings have been changed.
2729 * src/commandtags.h: ditto
2730 * src/lyxfunc.C: ditto
2732 * forms/lyx.fd: removed screen fonts dialog.
2733 * src/lyx_gui.C: ditto
2734 * src/menus.[Ch]: ditto
2735 * src/lyx.[Ch]: ditto
2736 * src/lyx_cb.C: ditto + code from here moved to make
2737 screen-font-update. And people wonder why progress on GUII is
2738 slow. Look at how scattered this stuff was! It takes forever
2741 * forms/fdfix.sh: Fixup the spacing after commas.
2742 * forms/makefile: Remove date from generated files. Fewer clashes now.
2743 * forms/bullet_forms.C.patch: included someones handwritten changes
2745 * src/lyxrc.[Ch]: Added a commented out system_lyxrc. Will use it RSN
2746 once I've discovered why LyXRC was made noncopyable.
2747 * src/lyx_main.C: ditto
2749 2000-08-14 Angus Leeming <a.leeming@ic.ac.uk>
2751 * src/frontends/xforms/forms/fdfix.sh:
2752 * src/frontends/xforms/forms/fdfixh.sed:
2753 * src/frontends/xforms/forms/fdfixc.sed: New file from Angus
2754 * src/frontends/xforms/Form*.[hC]:
2755 * src/frontends/xforms/form_*.[hC]: Massive rewrite of the generation
2756 scripts to rename all the "FL_OBJECT * form_xxxx" to "form" and to
2757 provide a destructor for the struct FD_form_xxxx. Another version of
2758 the set_[max|min]size workaround and a few other cleanups. Actually,
2759 Angus' patch from 20000809.
2761 2000-08-13 Baruch Even <baruch.even@writeme.com>
2763 * src/insets/insetgraphics.C (Clone): Added several fields that needed
2766 2000-08-11 Juergen Vigna <jug@sad.it>
2768 * src/insets/insetgraphics.C (InsetGraphics): changing init
2769 order because of warnings.
2771 * src/frontends/xforms/forms/makefile: adding patching .C with
2774 * src/frontends/xforms/forms/fdfix.sh: changing patching file .c
2775 from .C.patch to .c.patch
2777 * src/frontends/xforms/FormCommand.C (FormCommand): changing init
2778 order because of warning.
2780 * src/frontends/xforms/Dialogs.C (Dialogs): added FormDialog
2782 * src/frontends/Liason.C (setMinibuffer): new helper function
2784 * src/frontends/Dialogs.h (class Dialogs): inserting showLayoutDocument
2786 * src/lyxfunc.C (Dispatch): calling new Document-Layout
2788 * lib/ui/default.ui: commented out PaperLayout entry
2790 * src/frontends/xforms/form_document.[Ch]: new added files
2792 * src/frontends/xforms/FormDocument.[Ch]: ditto
2794 * src/frontends/xforms/forms/form_document.fd: ditto
2796 * src/frontends/xforms/forms/form_document.C.patch: ditto
2798 2000-08-10 Juergen Vigna <jug@sad.it>
2800 * src/insets/insetgraphics.C (draw): fixed access to 0 cacheHandle.
2801 (InsetGraphics): initialized cacheHandle to 0.
2802 (draw): changed call to updateInset to status=CHANGE_IN_DRAW.
2804 2000-08-10 Baruch Even <baruch.even@writeme.com>
2806 * src/graphics/GraphicsCache.h:
2807 * src/graphics/GraphicsCache.C (addFile, removeFile): Changed to work
2808 correctly as a cache.
2810 * src/graphics/GraphicsCacheItem.h:
2811 * src/graphics/GraphicsCacheItem.C: Changed to the pimpl idiom to allow
2814 * src/graphics/GraphicsCacheItem_pimpl.h:
2815 * src/graphics/GraphicsCacheItem_pimpl.C: The implementation of the
2818 * src/insets/insetgraphics.h:
2819 * src/insets/insetgraphics.C: Changed from using a signal notification
2820 to polling when image is not loaded.
2822 2000-08-10 Allan Rae <rae@lyx.org>
2824 * development/tools/makeLyXsigc.sh: Updated to allow Signal3. Note
2825 that there are two functions that have to been taken out of line by
2826 hand and aren't taken care of in the script. (Just a reminder note)
2828 * sigc++/macros/*.h.m4: Updated as above.
2830 2000-08-09 Juergen Vigna <jug@sad.it>
2832 * src/insets/insettext.C (draw): small fix for clearing rectangle.
2834 * src/insets/insettabular.C: make drawing of single cell smarter.
2836 2000-08-09 Marko Vendelin <markov@ioc.ee>
2837 * src/frontends/gnome/Menubar_pimpl.C
2838 * src/frontends/gnome/Menubar_pimpl.h: Gnome frontend Menubar
2839 implementation: new files
2841 * src/frontends/gnome/mainapp.C
2842 * src/frontends/gnome/mainapp.h: Gnome main window (temporary
2845 * src/main.C: create Gnome main window
2847 * src/frontends/xforms/Menubar_pimpl.h
2848 * src/frontends/Menubar.C
2849 * src/frontends/Menubar.h: added method Menubar::update that calls
2850 Menubar_pimpl::update and xforms/Menubar_pimpl::update (empty one)
2852 * src/LyXView.C: calls Menubar::update to update the state
2855 * src/frontends/gnome/Makefile.am: added new files
2857 * src/frontends/Makefile.am: added frontend compiler options
2859 2000-08-08 Juergen Vigna <jug@sad.it>
2861 * src/lyx_cb.C (AutoSave): autosave for unnamed files enabled!
2863 * src/bufferlist.C (close):
2864 * src/bufferlist.C (QwriteAll): remove Autosave-files for Unnamed()
2865 documents if exiting without saving.
2867 * src/buffer.C (save): use removeAutosaveFile()
2869 * src/support/filetools.C (removeAutosaveFile): new function.
2871 * src/lyx_cb.C (MenuWrite): returns a bool now.
2872 (MenuWriteAs): check if file could really be saved and revert to the
2874 (MenuWriteAs): removing old autosavefile if existant.
2876 * src/frontends/xforms/FormRef.h: puting FD_form_ref declaration
2877 before Goto toggle declaration, because of compiler warning.
2879 * src/frontends/xforms/FormRef.C: forgot include of <algorithm>
2881 * src/lyxfunc.C (MenuNew): small fix.
2883 * src/lyxrc.C (output): added RC_NEW_ASK_FILENAME tag.
2885 * src/bufferlist.C (newFile):
2886 * src/lyxfunc.C (MenuNew): use the new_ask_filename tag from lyxrc.
2888 * src/lyxrc.C: added new_ask_filename tag
2890 2000-08-07 Angus Leeming <a.leeming@ic.ac.uk>
2892 * src/lyx.fd: removed code pertaining to form_ref
2893 * src/lyx.[Ch]: ditto
2894 * src/lyx_cb.C: ditto
2895 * src/lyx_gui.C: ditto
2896 * src/lyx_gui_misc.C: ditto
2898 * src/BufferView_pimpl.C (restorePosition): update buffer only
2901 * src/commandtags.h (LFUN_REFTOGGLE): removed
2902 (LFUN_INSERT_REF): renamed LFUN_REF_INSERT
2903 (LFUN_REFGOTO): renamed LFUN_REF_GOTO
2904 (LFUN_REFBACK): renamed LFUN_REF_BACK
2906 * src/LyXAction.C: removed code pertaining to LFUN_REFTOGGLE
2907 * src/menus.C: ditto
2908 * src/lyxfunc.C (Dispatch): ditto.
2909 InsertRef dialog is now GUI-independent.
2911 * src/texrow.C: added using std::endl;
2913 * src/insets/insetref.[Ch]: strip out large amounts of code.
2914 The inset is now a container and this functionality is now
2915 managed by a new FormRef dialog
2917 * src/frontends/Dialogs.h (showRef, createRef): new signals
2919 * src/frontends/xforms/FormIndex.[Ch],
2920 src/frontends/xforms/FormUrl.[Ch]: workaround an xforms bug
2921 when setting dialog's min/max size
2922 * src/frontends/xforms/FormIndex.[Ch]: ditto
2924 * src/frontends/xforms/FormRef.[Ch],
2925 src/frontends/xforms/forms/form_ref.fd: new xforms
2926 implementation of an InsetRef dialog
2928 * src/graphics/GraphicsCache.[Ch]: small changes to compile with
2931 * src/graphics/XPM_Renderer.C (isImageFormatOK):
2932 ios::nocreate is not part of the standard. Removed.
2934 2000-08-07 Baruch Even <baruch.even@writeme.com>
2936 * src/graphics/Renderer.h:
2937 * src/graphics/Renderer.C: Added base class for rendering of different
2938 image formats into Pixmaps.
2940 * src/graphics/XPM_Renderer.h:
2941 * src/graphics/XPM_Renderer.C: Taken from GraphicsCacheItem and placed
2942 in a different class.
2944 * src/graphics/GraphicsCacheItem.C: factored out the rendering in order to
2945 easily add support for other formats.
2947 * src/insets/figinset.C: plugged a leak of an X resource.
2949 2000-08-07 Lars Gullik Bjønnes <larsbj@lyx.org>
2951 * src/CutAndPaste.[Ch]: make all metods static.
2953 * development/Code_rules/Rules: more work, added section on
2954 Exceptions, and a References section.
2956 * a lot of header files: work to make doc++ able to generate the
2957 source documentation, some workarounds of doc++ problems. Doc++ is
2958 now able to generate the documentation.
2960 2000-08-07 Juergen Vigna <jug@sad.it>
2962 * src/insets/insettabular.C (recomputeTextInsets): removed function
2964 * src/tabular.C (SetWidthOfMulticolCell):
2966 (calculate_width_of_column_NMC): fixed return value so that it really
2967 only returns true if the column-width has changed (there where
2968 problems with muliticolumn-cells in this column).
2970 2000-08-04 Juergen Vigna <jug@sad.it>
2972 * src/BufferView_pimpl.C (checkInsetHit): changed so that it looks
2973 also on the scrollstatus of the inset.
2974 (workAreaMotionNotify): ditto.
2976 * src/texrow.C (getIdFromRow): fixed compile problem on egcs-1.1.2.
2978 2000-08-01 Juergen Vigna <jug@sad.it>
2980 * src/insets/insettabular.C (resetPos): scroll tabular automatically.
2982 * src/commandtags.h:
2983 * src/LyXAction.C (init):
2984 * src/insets/inset.C (LocalDispatch): added support for
2987 * src/insets/inset.C (scroll): new functions.
2989 * src/insets/insettext.C (removeNewlines): new function.
2990 (SetAutoBreakRows): removes forced newlines in the text of the
2991 paragraph if autoBreakRows is set to false.
2993 * src/tabular.C (Latex): generates a parbox around the cell contents
2996 * src/frontends/xforms/FormTabular.C (local_update): removed
2997 the radio_useparbox button.
2999 * src/tabular.C (UseParbox): new function
3001 2000-08-06 Baruch Even <baruch.even@writeme.com>
3003 * src/graphics/GraphicsCache.h:
3004 * src/graphics/GraphicsCache.C:
3005 * src/graphics/GraphicsCacheItem.h:
3006 * src/graphics/GraphicsCacheItem.C: Made them to actually do something
3009 * src/insets/insetgraphics.h:
3010 * src/insets/insetgraphics.C: Added the use of the GraphicsCache
3011 and the drawing of the inline image.
3013 * src/buffer.C: Fixed a bug where a loaded InsetGraphics would be
3014 loaded into the wrong position.
3016 * src/lyxfunc.C: When adding an InsetGraphics the edit dialog is now
3019 2000-08-05 Lars Gullik Bjønnes <larsbj@lyx.org>
3021 * src/support/translator.h: move all typedefs to public section
3023 * src/support/filetools.C (MakeLatexName): return string const
3025 (TmpFileName): ditto
3026 (FileOpenSearch): ditto
3028 (LibFileSearch): ditto
3029 (i18nLibFileSearch): ditto
3032 (CreateTmpDir): ditto
3033 (CreateBufferTmpDir): ditto
3034 (CreateLyXTmpDir): ditto
3037 (MakeAbsPath): ditto
3039 (OnlyFilename): ditto
3041 (NormalizePath): ditto
3042 (CleanupPath): ditto
3043 (GetFileContents): ditto
3044 (ReplaceEnvironmentPath): ditto
3045 (MakeRelPath): ditto
3047 (ChangeExtension): ditto
3048 (MakeDisplayPath): ditto
3049 (do_popen): return cmdret const
3050 (findtexfile): return string const
3052 * src/support/DebugStream.h: add some /// to please doc++
3054 * src/frontends/DialogBase.h (endif): add some /// to please doc++
3056 * src/texrow.C (same_rownumber): functor to use with find_if
3057 (getIdFromRow): rewritten to use find_if and to not update the
3058 positions. return true if row is found
3059 (increasePos): new method, use to update positions
3061 * src/lyxlex_pimpl.h: make LyXLex::Pimpl noncopyable
3063 * src/lyxlex_pimpl.C (verifyTable): new method
3066 (GetString): return string const
3067 (pushTable): rewrite to use std::stack
3069 (setFile): better check
3072 * src/lyxlex.h: make LyXLex noncopyable
3074 * src/lyxlex.C (text): return char const * const
3075 (GetString): return string const
3076 (getLongString): return string const
3078 * src/lyx_gui_misc.C (askForText): return pair<...> const
3080 * src/lastfiles.[Ch] (operator): return string const
3082 * src/buffer.C (parseSingleLyXformat2Token): pass string to
3083 istringstream not char const *.
3084 move token.end() out of loop.
3085 (readFile): move initializaton of token
3087 * src/BufferView2.C (insertErrors): run texrow.increasePos if
3088 getIdFromRow is successful.
3090 * lib/bind/emacs.bind: don't include menus bind
3092 * development/Code_rules/Rules: the beginnings of making this
3093 better and covering more of the unwritten rules that we have.
3095 * development/Code_rules/Recommendations: a couple of wording
3098 2000-08-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3100 * src/support/strerror.c: remove C++ comment.
3102 2000-08-04 Angus Leeming <a.leeming@ic.ac.uk>
3104 * src/commandtags.h: LFUN_INDEX_CREATE_LAST reverts to
3105 LFUN_INDEX_INSERT_LAST
3107 * src/texrow.C (getIdFromRow): changed from const_iterator to
3108 iterator, allowing code to compile with DEC cxx
3110 * src/frontends/xforms/FormCitation.[Ch]: made vector<string>
3111 stores part of the class, as suggested by Allan. Will allow
3113 (apply): test to apply uses InsetCommandParams operator!=
3115 * src/frontends/xforms/FormIndex.C: moved set_minsize into build
3116 (apply): test to apply uses InsetCommandParams operator!=
3118 * src/frontends/xforms/FormToc.[Ch]: made vector<string>
3119 stores part of the class.
3120 (update): removed limits on min/max size.
3122 * src/frontends/xforms/FormUrl.C: moved set_minsize into build
3123 (apply): test to apply uses InsetCommandParams operator!=
3125 * src/insets/insetcommand.[Ch] InsetCommand made noncopyable
3126 (Read, Write, scanCommand, getCommand): moved functionality
3127 into InsetCommandParams.
3129 (getScreenLabel): made pure virtual
3130 new InsetCommandParams operators== and !=
3132 * src/insets/insetbib.[Ch] (InsetBibKey, InsetBibtex): new
3133 c-tors based on InsetCommandParams. Removed others.
3134 * src/insets/insetinclude.[Ch]: ditto
3135 * src/insets/insetlabel.[Ch]: ditto
3136 * src/insets/insetparent.[Ch]: ditto
3137 * src/insets/insetref.[Ch]: ditto. Also moved gotoLabel into .C
3139 * src/buffer.C (parseSingleLyXformat2Token, readInset): all
3140 insets derived from InsetCommand created using similar c-tors
3141 based on InsetCommandParams
3142 * src/lyx_cb.C (MenuInsertLabel, RefSelectCB): ditto
3143 * src/menus.C (ShowRefsMenu): ditto
3144 * src/paragraph.C (Clone): ditto
3145 * src/text2.C (SetCounter): ditto
3146 * src/lyxfunc.C (Dispatch) ditto
3147 Also recreated old InsetIndex behaviour exactly. Can now
3148 index-insert at the start of a paragraph and index-insert-last
3149 without launching the pop-up.
3151 2000-08-03 Lars Gullik Bjønnes <larsbj@lyx.org>
3153 * lib/lyxrc.example: mark te pdf options as non functional.
3155 * src/support/lstrings.C (strToInt): move initalization of tmpstr
3156 (isStrDbl): move tmpstr.end() out of loop.
3157 (strToDbl): move intialization of tmpstr
3158 (lowercase): return string const and move tmp.end() out of loop.
3159 (uppercase): return string const and move tmp.edn() out of loop.
3160 (prefixIs): add assertion
3165 (containsOnly): ditto
3166 (containsOnly): ditto
3167 (containsOnly): ditto
3168 (countChar): make last arg char not char const
3169 (token): return string const
3170 (subst): return string const, move tmp.end() out of loop.
3171 (subst): return string const, add assertion
3172 (strip): return string const
3173 (frontStrip): return string const, add assertion
3174 (frontStrip): return string const
3179 * src/support/lstrings.C: add inclde "LAssert.h"
3180 (isStrInt): move tmpstr.end() out of loop.
3182 * src/frontends/xforms/Toolbar_pimpl.C (activate): move
3183 toollist.end() out of loop.
3184 (deactivate): move toollist.end() out of loop.
3185 (update): move toollist.end() out of loop.
3186 (updateLayoutList): move tc.end() out of loop.
3187 (add): move toollist.end() out of loop.
3189 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): move
3190 md.end() out of loop.
3192 * src/texrow.h: make getIdFromRow const, make rowlist mutable.
3194 * src/texrow.C (getIdFromRow): make const, more rowlist.end() out
3197 * src/paragraph.C (Erase): move fontlist.end() out of loop.
3198 (Erase): move insetlist.end() out of loop.
3200 * src/lyx_sendfax_main.C: make show_logfile static and to take a
3201 ref to const string as first arg. Move initialization of some
3202 variables, whitespace changes.
3204 * src/kbmap.C (defkey): move table.end() out of loop.
3205 (kb_keymap): move table.end() out of loop.
3206 (findbinding): move table.end() out of loop.
3208 * src/MenuBackend.C (hasMenu): move end() out of loop.
3209 (getMenu): move end() out of loop.
3210 (getMenu): move menulist_.end() out of loop.
3212 * src/Makefile.am (#lyx_LDFLAGS): interesting option commented out.
3214 * src/LaTeXFeatures.C (getIncludedFiles): move IncludedFiles.end()
3217 * src/LColor.C (getFromGUIName): move infotab.end() out of loop.
3218 (getFromLyXName): move infotab.end() out of loop.
3220 * config/lyxinclude.m4 (CXXFLAGS): change for 2.96 add
3221 -fvtable-thunks -ffunction-sections -fdata-sections
3223 2000-08-03 Dekel Tsur <dekel@math.tau.ac.il>
3225 * src/frontends/xforms/RadioButtonGroup.h: Changed <forms.h> to
3228 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3230 * src/frontends/xforms/FormCommand.[Ch] (d-tor): removed
3232 * src/frontends/xforms/FormCitation.[Ch],
3233 src/frontends/xforms/FormIndex.[Ch],
3234 src/frontends/xforms/FormToc.[Ch],
3235 src/frontends/xforms/FormUrl.[Ch] (d-tors): call free()
3237 2000-08-03 Angus Leeming <a.leeming@ic.ac.uk>
3239 * src/commandtags.h: renamed, created some flags for citation
3242 * src/lyx_gui_misc.C: stripped out old FD_index_form code
3244 * src/lyxfunc.C (dispatch): use signals to insert index entry
3246 * src/frontends/Dialogs.h: new signal createIndex
3248 * src/frontends/xforms/FormCommand.[Ch],
3249 src/frontends/xforms/FormCitation.[Ch],
3250 src/frontends/xforms/FormToc.[Ch],
3251 src/frontends/xforms/FormUrl.[Ch]: clean up and comment better
3253 * src/insets/insetindex.[Ch]: GUI-independent
3255 * src/frontends/xforms/FormIndex.[Ch],
3256 * src/frontends/xforms/forms/form_index.fd: xforms implementation
3259 2000-08-01 Dekel Tsur <dekel@math.tau.ac.il>
3261 * src/mathed/math_write.C (MathDecorationInset::Write) Put \protect
3262 before \overbrace, \underbrace, \overleftarrow, or \overrightarrow.
3264 2000-08-02 Lars Gullik Bjønnes <larsbj@lyx.org>
3266 * src/insets/insetref.C (Latex): rewrite so that there is now
3267 question that a initialization is requested.
3269 * src/insets/insetcommand.h: reenable the hide signal
3271 2000-08-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3273 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): try to
3274 fix handling of shortcuts (many bugs :)
3275 (add_lastfiles): ditto.
3277 * lib/ui/default.ui: fix a few shortcuts.
3279 2000-07-27 Kayvan A. Sylvan <kayvan@sylvan.com>
3281 * Makefile.am: Fix ``rpmdist'' target to return the exit
3282 status of the ``rpm'' command, instead of the last command in
3283 the chain (the ``rm lyx.xpm'' command, which always returns
3286 2000-08-02 Allan Rae <rae@lyx.org>
3288 * src/frontends/xforms/FormUrl.C (FormUrl): Initialise ALL variables.
3289 * src/frontends/xforms/FormCitation.C (FormCitation): ditto
3290 * src/frontends/xforms/FormToc.C (FormToc): ditto
3292 * src/frontends/xforms/Makefile.am: A few forgotten files
3294 * src/frontends/xforms/FormCommand.C (showInset): The rest of the
3295 Signals-not-copyable-problem Lars' started commenting out.
3297 * src/frontends/xforms/form_toc.[hC]: new files. TOC crashes lyx.
3299 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3301 * src/insets/insetcommand.h: Signals is not copyable so anoter
3302 scheme for automatic hiding of forms must be used.
3304 * src/frontends/xforms/FormCitation.h: don't inerit from
3305 noncopyable, FormCommand already does that.
3306 * src/frontends/xforms/FormToc.h: ditto
3307 * src/frontends/xforms/FormUrl.h: ditto
3309 * src/frontends/xforms/FormCitation.C: add include <algorithm>
3311 2000-08-01 Angus Leeming <a.leeming@ic.ac.uk>
3313 * src/insets/insetcommand.h (hide): new SigC::Signal0
3314 (d-tor) new virtual destructor emits hide signal
3316 * src/insets/insetcite.[Ch] (hide, d-tor, EditMessage): removed
3317 * src/insets/inseturl.[Ch] (hide, d-tor): ditto
3319 * src/insets/insettoc.[Ch]: one inset now deals with TOC, LOA,
3320 LOF and LOT. Inset is now GUI-independent
3322 * src/insets/insetloa.[Ch]: redundant
3323 * src/insets/insetlof.[Ch]: ditto
3324 * src/insets/insetlot.[Ch]: ditto
3326 * src/frontends/xforms/forms/form_url.fd: tweaked!
3327 * src/frontends/xforms/forms/form_citation.fd: ditto
3329 * src/frontends/xforms/FormCommand.[Ch]: new base class to those
3330 dialogs dealing with InsetCommand insets
3332 * src/frontends/xforms/FormCitation.[Ch]: now makes use of
3333 FormCommand base class
3334 * src/frontends/xforms/FormUrl.[Ch]: ditto
3336 * src/frontends/xforms/forms/form_toc.fd: Xforms implementation
3338 * src/frontends/xforms/FormToc.[Ch]: ditto
3340 * src/frontends/Dialogs.h (showCitation, showTOC, showUrl): all
3341 passed a generic InsetCommand pointer
3342 * src/frontends/xforms/Dialogs.C (c-tor): create instance of FormToc
3344 * src/lyxfunc.C (Dispatch) : modified to accomodate new FormToc class
3345 and modified InsetTOC class
3346 * src/buffer.C: ditto
3348 * forms/lyx.fd: strip out old FD_form_toc code
3349 * src/lyx_gui_misc.C: ditto
3350 * src/lyx_gui.C: ditto
3351 * src/lyx_cb.C: ditto
3352 * src/lyx.[Ch]: ditto
3354 2000-08-01 Lars Gullik Bjønnes <larsbj@lyx.org>
3356 * src/support/utility.hpp: tr -d '\r'
3358 2000-08-01 Juergen Vigna <jug@sad.it>
3360 * src/insets/insettabular.h: removed initFeatures() as it's not needed.
3362 * src/commandtags.h:
3363 * src/LyXAction.C (init): added LFUN_LAYOUT_TABULAR and
3364 LFUN_TABULAR_FEATURES.
3366 * src/lyxfunc.C (getStatus): implemented LFUN_TABULAR_FEATURES and
3367 LFUN_LAYOUT_TABULAR.
3369 * src/insets/insettabular.C (getStatus): implemented helper function.
3371 * lib/ui/default.ui: implemented edit-table-menu and layout-tabular.
3373 2000-07-31 Juergen Vigna <jug@sad.it>
3375 * src/text.C (draw): fixed screen update problem for text-insets.
3377 * src/text2.C (SetParagrpah): call an update of the inset-owner when
3378 something changed probably this has to be added in various other
3381 * src/insets/insettext.C (cy): fixed to give back the right cursor.y().
3383 2000-07-31 Baruch Even <baruch.even@writeme.com>
3385 * src/frontends/xforms/RadioButtonGroup.C: Changed to use home-brew
3386 templates to satisfy compaq cxx.
3389 2000-07-31 Lars Gullik Bjønnes <larsbj@lyx.org>
3391 * src/support/translator.h (equal_1st_in_pair::operator()): take
3392 const ref pair_type as arg.
3393 (equal_2nd_in_pair::operator()): ditto
3394 (Translator::~Translator): remove empty d-tor.
3396 * src/graphics/GraphicsCache.C: move include config.h to top, also
3397 put initialization of GraphicsCache::singleton here.
3398 (~GraphicsCache): move here
3399 (addFile): take const ref as arg
3402 * src/lyxlex_pimpl.C (setFile): comment in old behaviour
3404 * src/BufferView2.C (insertLyXFile): change te with/without header
3407 2000-07-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3409 * src/frontends/xforms/FormGraphics.C (apply): add some
3410 static_cast. Not very nice, but required by compaq cxx.
3412 * src/frontends/xforms/RadioButtonGroup.h: include header
3413 <utility> instead of <pair.h>
3415 * src/insets/insetgraphicsParams.C: add using directive.
3416 (readResize): change return type to void.
3417 (readOrigin): ditto.
3419 * src/lyxfunc.C (getStatus): add missing break for build-program
3420 function; add test for Literate for export functions.
3422 * lib/ui/default.ui: fix Insert->TOC->TOC; comment out invalid
3423 entries in Options menu.
3425 2000-07-31 Baruch Even <baruch.even@writeme.com>
3427 * src/frontends/xforms/Toolbar_pimpl.C (toolbarItem::operator=):
3428 protect against auto-allocation; release icon when needed.
3430 2000-07-31 Matej Cepl <CeplM@seznam.cz>
3432 * lib/kbd/czech.kmap: new file. standard Czech keyboard as found
3433 on usual typewriter.
3435 * lib/kbd/czech-prg.kmap: simpler czech kmap (which was the
3436 earlier czech.kmap), useful only for programming.
3438 2000-07-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3440 * src/frontends/xforms/FormCitation.h: fix conditioning around
3443 2000-07-31 Juergen Vigna <jug@sad.it>
3445 * src/frontends/xforms/FormTabular.C (local_update): changed
3446 radio_linebreaks to radio_useparbox and added radio_useminipage.
3448 * src/tabular.C: made support for using minipages/parboxes.
3450 * src/bufferlist.C (QwriteAll): small fix for asking for save.
3452 * src/insets/insetgraphics.C (draw): just draw the inset so that the
3454 (descent): so the cursor is in the middle.
3455 (width): bit smaller box.
3457 * src/insets/insetgraphics.h: added display() function.
3459 2000-07-31 Baruch Even <baruch.even@writeme.com>
3461 * src/frontends/Dialogs.h: Added showGraphics signals.
3463 * src/frontends/xforms/forms/form_graphics.fd: Added file, the
3464 xforms form definition of the graphics dialog.
3466 * src/frontends/xforms/FormGraphics.h:
3467 * src/frontends/xforms/FormGraphics.C: Added files, the
3468 GUIndependent code of InsetGraphics
3470 * src/insets/insetgraphics.h:
3471 * src/insets/insetgraphics.C: Major writing to make it work.
3473 * src/insets/insetgraphicsParams.h:
3474 * src/insets/insetgraphicsParams.C: Added files, parameter passing
3475 struct between InsetGraphics and GUI.
3477 * src/LaTeXFeatures.h:
3478 * src/LaTeXFeatures.C (c-tor, require, getPackages): Enabled
3479 support for graphicx package.
3481 * src/buffer.C (parseSingleLyXformat2Token): Fixed read support
3482 for the graphics inset.
3484 * src/support/translator.h: Added file, used in
3485 InsetGraphicsParams. this is a template to translate between two
3488 * src/frontends/xforms/RadioButtonGroup.h:
3489 * src/frontends/xforms/RadioButtonGroup.C: Added files, Comprise a
3490 way to easily control a radio button group.
3492 2000-07-28 Juergen Vigna <jug@sad.it>
3494 * src/insets/insettabular.C (LocalDispatch):
3495 (TabularFeatures): added support for lyx-functions of tabular features.
3496 (cellstart): refixed this function after someone wrongly changed it.
3498 * src/commandtags.h:
3499 * src/LyXAction.C (init): added support for tabular-features
3501 2000-07-28 Allan Rae <rae@lyx.org>
3503 * src/frontends/xforms/FormPreferences.C (build): Setup input return
3504 checking. NOTE: It seems that pressing ESC to cancel the dialog also
3505 triggers the callback for input checking. As a result we sometimes get
3506 "LyX: This shouldn't happen..." printed to cerr.
3507 (input): Started using status variable since I only free() on
3508 destruction. Some input checking for paths and font sizes.
3510 * src/frontends/xforms/FormPreferences.h: Use status to control
3511 activation of Ok and Apply
3513 * src/frontends/xforms/forms/form_preferences.fd: Setup input return
3514 callback. Also resized to stop segfaults with 0.88. The problem is
3515 that xforms-0.88 requires the folder to be wide enough to fit all the
3516 tabs. If it isn't it causes all sorts of problems.
3518 * src/frontends/xforms/FormCopyright.[hC]: forward declare FD_form...
3520 * src/frontends/xforms/forms/README: Reflect reality.
3522 * src/frontends/xforms/forms/fdfix.sh: Clean up comments
3523 * src/frontends/xforms/forms/makefile: ditto.
3525 * src/commandtags.h: Get access to new Preferences dialog
3526 * src/LyXAction.C: ditto
3527 * src/lyxfunc.C: ditto
3528 * lib/ui/default.ui: ditto
3530 2000-07-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3532 * src/frontends/xforms/forms/makefile (.c.C): change call to fdfix.sh.
3534 * src/frontends/xforms/Makefile.am (libxforms_la_SOURCES): add a
3537 * src/frontends/xforms/form_url.[Ch]: added.
3539 2000-07-27 Lars Gullik Bjønnes <larsbj@lyx.org>
3541 * src/insets/insetbib.h: fixed bug in previous commit
3543 * src/frontends/xforms/FormUrl.h: ditto
3545 * src/frontends/xforms/FormPrint.h: ditto
3547 * src/frontends/xforms/FormPreferences.h: ditto
3549 * src/frontends/xforms/FormCopyright.h: ditto
3551 * src/frontends/xforms/FormCitation.C: ditto
3553 * src/frontends/Dialogs.h (class Dialogs): use noncopyable, remove
3554 private copyconstructor and private default contructor
3556 * src/support/Makefile.am: add utility.hpp
3558 * src/support/utility.hpp: new file from boost
3560 * src/insets/insetbib.h: set owner in clone
3562 * src/frontends/xforms/FormCitation.C: added missing include
3565 * src/insets/form_url.[Ch]: removed
3567 2000-07-26 Kayvan A. Sylvan <kayvan@sylvan.com>
3569 * development/lyx.spec.in
3570 * Makefile.am: Fix buglet for LyX RPM generation resulting from
3571 file/directory re-organization.
3573 2000-07-26 Angus Leeming <a.leeming@ic.ac.uk>
3575 * src/insets/insetcommand.[Ch]: moved the string data and
3576 associated manipulation methods into a new stand-alone class
3577 InsetCommandParams. This class has two additional methods
3578 getAsString() and setFromString() allowing the contents to be
3579 moved around as a single string.
3580 (addContents) method removed.
3581 (setContents) method no longer virtual.
3583 * src/buffer.C (readInset): made use of new InsetCitation,
3584 InsetUrl constructors based on InsetCommandParams.
3586 * src/commandtags.h: add LFUN_INSERT_URL
3588 * src/lyxfunc.C (Dispatch): changed to accomadate GUI-
3589 independent InsetUrl and use InsetCommandParams to extract
3590 string info and create new Insets.
3592 * src/frontends/Dialogs.h: add signals showUrl, createUrl.
3594 * src/frontends/xforms/FormCitation.C (apply): uses
3597 * src/frontends/xforms/form_url.C
3598 * src/frontends/xforms/form_url.h
3599 * src/frontends/xforms/FormUrl.h
3600 * src/frontends/xforms/FormUrl.C
3601 * src/frontends/xforms/forms/form_url.fd: new files
3603 * src/insets/insetcite.[Ch]: removed unused constructors.
3605 * src/insets/insetinclude.[Ch]: no longer store filename
3607 * src/insets/inseturl.[Ch]: GUI-independent.
3609 2000-07-26 Juergen Vigna <jug@sad.it>
3610 * renamed frontend from gtk to gnome as it is that what is realized
3611 and did the necessary changes in the files.
3613 2000-07-26 Marko Vendelin <markov@ioc.ee>
3615 * configure.in: cleaning up gnome configuration scripts
3617 2000-07-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3619 * src/frontends/xforms/Menubar_pimpl.C (set): fix the disappearing
3620 shortcuts syndrom by redrawing them explicitely (a better solution
3621 would be appreciated).
3623 * src/lyxfunc.C (getStatus): fix crash when functions are disabled.
3625 * src/frontends/xforms/Menubar_pimpl.C (set): fix the shortcut of
3628 * src/lyx_cb.C (MenuExport): change html export to do the right
3629 thing depending of the document type (instead of having
3630 html-linuxdoc and html-docbook).
3631 * src/lyxfunc.C (getStatus): update for html
3632 * lib/ui/default.ui: simplify due to the above change.
3633 * src/menus.C (ShowFileMenu): update too (in case we need it).
3635 * src/MenuBackend.C (read): if a menu is defined twice, add the
3636 new entries to the exiting one.
3638 2000-07-26 Juergen Vigna <jug@sad.it>
3640 * src/buffer.h: added functions setUnnamed(bool) and isUnnamed().
3642 * src/lyx_cb.C (MenuWriteAs): Changed to react right for unnamed docs
3643 and return a bool if it did actual save the file.
3644 (AutoSave): don't autosave a unnamed doc.
3646 * src/bufferlist.C (close) (QwriteAll) (emergencyWriteAll):
3647 check if this is an UNNAMED new file and react to it.
3648 (newFile): set buffer to unnamed and change to not mark a new
3649 buffer dirty if I didn't do anything with it.
3651 * src/lyxfunc.C (MenuNew): Changed to not ask for filename on new.
3653 2000-07-26 Lars Gullik Bjønnes <larsbj@lyx.org>
3655 * src/frontends/Menubar.h: make "struct Pimpl;" public + the
3656 friend as per Angus's patch posted to lyx-devel.
3658 * src/ext_l10n.h: updated
3660 * src/frontends/xforms/Toolbar_pimpl.C (updateLayoutList): run
3661 gettext on the style string right before inserting them into the
3664 * autogen.sh: add code to extract style strings form layout files,
3665 not good enough yet.
3667 * src/frontends/gtk/.cvsignore: add MAKEFILE
3669 * src/MenuBackend.C (read): run the label strings through gettext
3670 before storing them in the containers.
3672 * src/ext_l10n.h: new file
3674 * autogen.sh : generate the ext_l10n.h file here
3676 2000-07-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3678 * src/lyxrc.C (read): do not use LyXLex::lex() to parse set_color
3681 * lib/ui/default.ui: fix a couple of typos.
3683 * config/gnome/gtk.m4: added (and added to the list of files in
3686 * src/insets/insetinclude.C (unique_id): fix when we are using
3687 lyxstring instead of basic_string<>.
3688 * src/insets/insettext.C (LocalDispatch): ditto.
3689 * src/support/filetools.C: ditto.
3691 * lib/configure.m4: create the ui/ directory if necessary.
3693 * src/LyXView.[Ch] (updateToolbar): new method.
3695 * src/BufferView_pimpl.C (buffer): update the toolbar when
3696 opening/closing buffer.
3698 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3700 * src/LyXAction.C (getActionName): enhance to return also the name
3701 and options of pseudo-actions.
3702 (init): New lyxfunc LFUN_MATH_PANEL=="math-panel".
3704 * lib/ui/default.ui: use OptItem in the vc submenu (intented just
3705 as an example of what is possible). Used in File->Build too (more
3706 useful) and in the import/export menus (to mimick the complicated
3707 handling of linuxdoc and friends). Try to update all the entries.
3709 * src/frontends/xforms/Menubar_pimpl.C (create_submenu): handle
3712 * src/MenuBackend.C (read): Parse the new OptItem tag.
3714 * src/MenuBackend.h: Add a new optional_ data member (used if the
3715 entry should be omitted when the lyxfunc is disabled).
3717 * src/frontends/xforms/Menubar_pimpl.C (string_width): new
3718 function, used as a shortcut.
3719 (create_submenu): align correctly the shortcuts on the widest
3722 * src/MenuBackend.h: MenuItem.label() only returns the label of
3723 the menu without shortcut; new method shortcut().
3725 2000-07-14 Marko Vendelin <markov@ioc.ee>
3727 * src/frontends/gtk/Dialogs.C:
3728 * src/frontends/gtk/FormCopyright.C:
3729 * src/frontends/gtk/FormCopyright.h:
3730 * src/frontends/gtk/Makefile.am: added these source-files for the
3731 Gtk/Gnome support of the Copyright-Dialog.
3733 * src/main.C: added Gnome::Main initialization if using
3734 Gtk/Gnome frontend-GUI.
3736 * src/lyx_gui.C: added Gnome event loop if using Gtk/Gnome
3738 * config/gnome/aclocal-include.m4
3739 * config/gnome/compiler-flags.m4
3740 * config/gnome/curses.m4
3741 * config/gnome/gnome--.m4
3742 * config/gnome/gnome-bonobo-check.m4
3743 * config/gnome/gnome-common.m4
3744 * config/gnome/gnome-fileutils.m4
3745 * config/gnome/gnome-ghttp-check.m4
3746 * config/gnome/gnome-gnorba-check.m4
3747 * config/gnome/gnome-guile-checks.m4
3748 * config/gnome/gnome-libgtop-check.m4
3749 * config/gnome/gnome-objc-checks.m4
3750 * config/gnome/gnome-orbit-check.m4
3751 * config/gnome/gnome-print-check.m4
3752 * config/gnome/gnome-pthread-check.m4
3753 * config/gnome/gnome-support.m4
3754 * config/gnome/gnome-undelfs.m4
3755 * config/gnome/gnome-vfs.m4
3756 * config/gnome/gnome-x-checks.m4
3757 * config/gnome/gnome-xml-check.m4
3758 * config/gnome/gnome.m4
3759 * config/gnome/gperf-check.m4
3760 * config/gnome/gtk--.m4
3761 * config/gnome/linger.m4
3762 * config/gnome/need-declaration.m4: added configuration scripts
3763 for Gtk/Gnome frontend-GUI
3765 * configure.in: added support for the --with-frontend=gtk option
3767 * autogen.sh: added config/gnome/* to list of config-files
3769 * acconfig.h: added define for GTKGUI-support
3771 * config/lyxinclude.m4: added --with-frontend[=value] option value
3772 for Gtk/Gnome frontend-GUI support.
3774 2000-07-25 Lars Gullik Bjønnes <larsbj@lyx.org>
3776 * src/support/lstrings.C (prefixIs): rewrite so that gcc bastring
3780 * src/paragraph.C (GetChar): remove non-const version
3782 * src/lyxlex_pimpl.C (compare_tags): rewritten to suit cvs gcc 2.96
3783 (search_kw): use it.
3785 * src/lyx_main.C (init): if "preferences" exist, read that instead
3787 (ReadRcFile): return bool if the file could be read ok.
3788 (ReadUIFile): add a check to see if lex file is set ok.
3790 * src/lyx_cb.C (InsertAsciiFile): rewrite a bit so that gcc
3791 bastring can be used instead of lyxstring (still uses the old code
3792 if std::string is good enough or if lyxstring is used.)
3794 * src/encoding.C: make the arrays static, move ininle functions
3796 * src/encoding.h: from here.
3798 * src/buffer.C: have last_isnet_read as a file scope variable for now.
3799 (parseSingleLyXformat2Token): move inset parsing to separate method
3800 (readInset): new private method
3802 * src/Variables.h: remove virtual from get().
3804 * src/ToolbarDefaults.C: include lyxparagraph.h temporary to get
3805 access to NEW_INSETS and NEW_TABULAR
3807 * src/MenuBackend.h: remove superfluous forward declaration of
3808 MenuItem. Add documentations tags "///", remove empty MenuItem
3809 destructor, remove private default contructor.
3811 * src/MenuBackend.C (MenuItem): remove unneeded copy contructor
3813 (read): more string mlabel and mname to where they are used
3814 (read): remove unused variables mlabel and mname
3815 (defaults): unconditional clear, make menusetup take advantage of
3816 add returning Menu &.
3818 * src/LyXView.h: define NEW_MENUBAR as default
3820 * src/LyXAction.C: include lyxparagraph.h temporary to get access
3821 to NEW_INSETS and NEW_TABULAR.
3822 (init): commetn out some funcs that is obsolete when NEW_INSETS is
3823 defined. Change some of the "xxxx-inset-insert" functions names to
3826 * several files: more enahncements to NEW_INSETS and the resulting
3829 * lib/lyxrc.example (\date_insert_format): move to misc section
3831 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): allow to use the gcc
3832 bastring and use AC_CACHE_CHECK.
3833 (LYX_CXX_GOOD_STD_STRING): new check. Checks if the std::string of
3834 the system have the newest methods. uses AC_CACHE_CHECK
3835 (LYX_CXX_MUTABLE): use AC_CACHE_CHECK
3836 (LYX_CXX_PARTIAL): use AC_CACHE_CHECK
3837 (LYX_CXX_NAMESPACES): use AC_CACHE_CHECK
3839 * configure.in: add LYX_CXX_GOOD_STD_STRING
3841 * acinclude.m4: recreated
3843 2000-07-24 Amir Karger <karger@lyx.org>
3845 * README: add Hebrew, Arabic kmaps
3848 2000-07-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3850 * src/buffer.C (writeFileAscii): Define actcell as an int instead
3853 2000-07-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3855 * Lot of files: add pragma interface/implementation.
3857 * src/lyx_main.C (ReadUFile): new method. Read the UI file.
3859 * lib/ui/default.ui: new file (ans new directory). Contains the
3860 default menu and toolbar.
3862 * src/lyxrc.[Ch]: new variable ui_file. Move toolbardefaults to
3863 global space. Toolbars are now read (as menus) in ui files.
3865 * src/debug.C: change Debug::TOOLBAR to Debug::GUI.
3867 * src/lyxfunc.C (getStatus): do not exit immediately if a command
3868 is disabled because the document is read-only. We want to have the
3869 toggle state of the function anyway.
3870 (getStatus): add code for LFUN_VC* functions (mimicking what is
3871 done in old-style menus)
3873 * src/lyxfunc.C (Dispatch): news functions LFUN_SWITCHBUFFER,
3874 LFUN_HELP_CREDITS, LFUN_HELP_VERSION, LFUN_HELP_OPEN.
3876 * src/LyXView.[Ch]: add code for the NEW_MENUBAR define.
3877 * src/BufferView_pimpl.C: ditto.
3878 * src/lyxfunc.C: ditto.
3880 * src/LyXView.h: add a define NEW_MENUBAR (commented out by
3881 default). This replaces old-style menus by new ones.
3883 * src/MenuBackend.[Ch]: new classes MenuBackend, Menu and
3884 MenuItem. Contain the data structure of a menu.
3886 * src/insets/insettext.C: use LyXView::setLayout instead of
3887 accessing directly the toolbar combox.
3888 * src/lyxfunc.C (Dispatch): ditto.
3890 * src/LyXView.C (setLayout): new method, which just calls
3891 Toolbar::setLayout().
3892 (updateLayoutChoice): move part of this method in Toolbar.
3894 * src/toolbar.[Ch]: removed.
3896 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. The xforms
3897 implementation the toolbar.
3899 * src/frontend/Toolbar.[Ch]: new files. The abstract interface of
3900 the toolbar. It might make sense to merge it with ToolbarDefaults
3902 (setLayout): new function.
3903 (updateLayoutList): ditto.
3904 (openLayoutList): ditto.
3906 * src/frontend/xforms/Toolbar_pimpl.[Ch]: new files. Contain the
3907 xforms implementation of the toolbar.
3908 (get_toolbar_func): comment out, since I do not
3909 know what it is good for.
3911 * src/ToolbarDefaults.h: Add the ItemType enum.
3913 * src/support/StrPool.[Ch]: new class. Acts as a reference holder
3914 for a list of allocated C strings. Used in Menubar xforms
3915 implementation to avoid memory leaks.
3917 * src/support/lstrings.[Ch] (uppercase): new version taking and
3921 * lib/bind/xemacs.bind: remove bogus binding for lyx-quit.
3922 * lib/bind/emacs.bind: ditto.
3924 2000-07-21 Lars Gullik Bjønnes <larsbj@lyx.org>
3926 * src/toolbar.h: include commandtags.h instead of lyxfunc.h,
3927 forward decl of LyXView.
3929 * src/toolbar.C (toolbarItem): moved from toolbar.h
3930 (toolbarItem::clean): ditto
3931 (toolbarItem::~toolbarItem): ditto
3932 (toolbarItem::operator): ditto
3934 * src/text2.C (SetLayout): commetn out USE_OLD_SETUP_LAYOUT stuff
3936 * src/paragraph.h: control the NEW_TABULAR define from here
3938 * src/buffer.C: remove define USE_PARSE_FUNCTION, change
3939 USE_TABULAR_INSETS to NEW_TABULAR
3941 * src/ToolbarDefaults.C: add include "lyxlex.h"
3943 * files using the old table/tabular: use NEW_TABULAR to control
3944 compilation of old tabular stuff.
3946 * src/paragraph.C (SimpleTeXOnePar): NEW_INSETS: move some #ifdef
3949 * src/buffer.C (parseSingleLyXformat2Token): NEW_INSETS: fix the
3950 planemet in reading of old style floats, fix the \end_deeper
3951 problem when reading old style floats.
3953 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3955 * src/paragraph.C (writeFile): NEW_INSETS: move a misplaced #endif
3957 2000-07-20 Serge Winitzki <winitzki@erebus.phys.cwru.edu>
3959 * lib/bind/sciword.bind: updated.
3961 2000-07-20 Lars Gullik Bjønnes <larsbj@lyx.org>
3963 * src/paragraph.C (writeFile): NEW_INSETS: possible fix to the
3964 layout write problem
3966 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3968 * src/Makefile.am (INCLUDES): remove image directory from include
3971 * src/bullet_forms.C (create_form_form_bullet): small cleanup.
3972 * src/bullet_forms_cb.C (BulletPanelCB): ditto.
3974 * src/LyXView.C (create_form_form_main): read the application icon
3977 * lib/images/*.xpm: change the icons to use transparent color for
3980 * src/toolbar.C (update): change the color of the button when it
3983 2000-07-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
3985 * src/lyxfunc.C (Dispatch): use LyXView::ShowState instead of
3986 setting explicitely the minibuffer.
3987 * src/BufferView_pimpl.C (workAreaButtonRelease): ditto.
3989 * src/LyXView.C (showState): new function. Shows font information
3990 in minibuffer and update toolbar state.
3991 (LyXView): call Toolbar::update after creating the
3994 * src/toolbar.C: change toollist to be a vector instead of a
3996 (BubbleTimerCB): get help string directly from the callback
3997 argument of the corresponding icon (which is the action)
3998 (set): remove unnecessary ugliness.
3999 (update): new function. update the icons (depressed, disabled)
4000 depending of the status of the corresponding action.
4002 * src/toolbar.h: remove help in toolbarItem
4004 2000-07-19 Dekel Tsur <dekel@math.tau.ac.il>
4006 * src/Painter.C (text): Added code for using symbol glyphs from
4007 iso10646 fonts. Currently diabled.
4009 * src/encoding.C: Added new encodings: iso8859_3,iso8859_9 and
4012 * src/language.C (initL): Fixed encodings for esperanto,lsorbian,
4013 magyar,turkish and usorbian.
4015 * src/paragraph.C (isMultiLingual): Made more efficient.
4017 * src/mathed/formula.C (LocalDispatch): Fixed behavior of greek
4020 * src/mathed/math_symbols.C (math_insert_greek): Changed to use
4021 LocalDispatch(..,LFUN_SELFINSERT,..) instead of math_insert_symbol().
4022 Also changed the prototype to "bool math_insert_greek(char)".
4024 2000-07-19 Lars Gullik Bjønnes <larsbj@lyx.org>
4026 * lots of files: apply the NEW_INSETS on all code that will not be
4027 needed when we move to use the new insets. Enable the define in
4028 lyxparagrah.h to try it.
4030 * src/insets/insettabular.C (cellstart): change to be a static
4032 (InsetTabular): initialize buffer in the initializer list.
4034 2000-07-19 Angus Leeming <a.leeming@ic.ac.uk>
4036 * src/frontends/xforms/FormPrint.[Ch] : moved #include
4037 form_print.h out of the header file. Replaced with forward
4038 declarations of the relevant struct.
4040 * src/frontends/xforms/FormPreferences.[Ch] : ditto for
4043 * src/commandtags.h: do not include "debug.h" which does not
4044 belong there. #include it in some other places because of this
4047 2000-07-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4049 * src/insets/insetcaption.C: add a couple "using" directives.
4051 * src/toolbar.C (add): get the help text directly from lyxaction.
4053 (setPixmap): new function. Loads from disk and sets a pixmap on a
4054 botton; the name of the pixmap file is derived from the command
4057 * src/toolbar.h: remove members isBitmap and pixmap from
4060 * lib/images/*.xbm *_bw.xpm: remove (not used any more).
4061 * lib/images/: move many files from images/banner.xpm.
4063 * src/lyx_gui.C (create_forms): read banner pixmap from file.
4065 * src/lyx_gui.C (create_forms): remove TWO_COLORS_ICONS support.
4066 * src/toolbar.C: ditto.
4067 * configure.in: ditto.
4068 * INSTALL: document.
4070 * src/spellchecker.C (ShowSpellChecker): use CancelCloseCB when
4071 the spellchecker popup is closed from the WM.
4073 2000-07-19 Juergen Vigna <jug@sad.it>
4075 * src/insets/insetfloat.C (Write): small fix because we use the
4076 insetname for the type now!
4078 2000-07-18 Angus Leeming <a.leeming@ic.ac.uk>
4080 * src/frontends/xforms/forms/form_citation.fd: object sizes are
4083 * src/frontends/Dialogs.h: removed hideCitation signal
4085 * src/insets/insetcite.h: added hide signal
4087 * src/insets/insetcite.C (~InsetCitation): emits new signal
4088 (getScreenLabel): "intelligent" label should now fit on the screen!
4090 * src/frontends/xforms/FormCitation.[Ch] (hideInset): removed
4092 * src/frontends/xforms/FormCitation.C (showInset): connects
4093 hide() to the inset's hide signal
4094 (show): modified to use fl_set_object_position rather than
4095 fl_set_object_geometry wherever possible
4097 2000-07-18 Lars Gullik Bjønnes <larsbj@lyx.org>
4099 * src/insets/lyxinset.h: add caption code
4101 * src/insets/insetfloat.C (type): new method
4103 * src/insets/insetcaption.C (Write): new method
4105 (LyxCode): new method
4107 * src/text2.C (SetCounter): revert Jürgens code, but use his idea
4108 to get it right together with using the FloatList.
4110 * src/commandtags.h: add LFUN_INSET_CAPTION
4111 * src/lyxfunc.C (Dispatch): handle it
4113 * src/buffer.C (parseSingleLyXformat2Token): add code to read a
4116 * src/Variables.[Ch]: make expand take a const reference, remove
4117 the destructor, some whitespace changes.
4119 * src/LyXAction.C (init): add caption-inset-insert
4121 * src/FloatList.C (FloatList): update the default floats a bit.
4123 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4125 * src/Variables.[Ch]: new files. Intended to be used for language
4126 specific strings (like \chaptername) and filename substitution in
4129 * src/trans.C (AddDeadkey): replace keyword "all" with "native" in
4131 * lib/kbd/american.kmap: update
4133 * src/trans_mgr.C (normalkey): do not test allowAccent anymore.
4135 * src/bufferparams.[Ch]: remove member allowAccents.
4137 * src/menus.C (ShowOptionsMenu): remove the LaTeX entry.
4139 * src/LaTeXLog.C: use the log_form.h header.
4140 * src/lyx_gui.C: ditto.
4141 * src/lyx_gui_misc.C: ditto.
4142 * src/lyxvc.h: ditto.
4144 * forms/log_form.fd: new file, created from latexoptions.fd. I
4145 kept the log popup and nuked the options form.
4147 * src/{la,}texoptions.[Ch]: removed.
4148 * src/lyx_cb.C (LaTeXOptions): ditto
4150 * src/lyx_gui.C (create_forms): do not handle the
4151 fd_latex_options form.
4153 2000-07-18 Juergen Vigna <jug@sad.it>
4155 * src/insets/insetfloat.C (InsetFloat): use setInsetName to set the
4156 name of the inset so that it can be requested outside (text2.C).
4158 * src/text2.C (SetCounter): modified so it sees insetfloat for caption
4161 2000-07-17 Lars Gullik Bjønnes <larsbj@lyx.org>
4163 * src/mathed/formula.h (ConvertFont): constify
4165 * src/mathed/formula.C (Read): add warning if \end_inset is not
4166 found on expected place.
4168 * src/insets/lyxinset.h (ConvertFont): consify
4170 * src/insets/insetquotes.C (ConvertFont): constify
4171 * src/insets/insetquotes.h: ditto
4173 * src/insets/insetinfo.h: add labelfont
4175 * src/insets/insetinfo.C (InsetInfo): set the labelfont
4176 (ascent): use labelfont
4180 (Write): make .lyx file a bit nicer
4182 * src/insets/insetfloat.C (Write): simplify somewhat...
4183 (Read): add warning if arg is not found
4185 * src/insets/insetcollapsable.C: add using std::max
4186 (Read): move string token and add warning in arg is not found
4187 (draw): use std::max to get the right ty
4188 (getMaxWidth): simplify by using std::max
4190 * src/insets/insetsection.h: new file
4191 * src/insets/insetsection.C: new file
4192 * src/insets/insetcaption.h: new file
4193 * src/insets/insetcaption.C: new file
4195 * src/insets/inset.C (ConvertFont): constify signature
4197 * src/insets/Makefile.am (libinsets_la_SOURCES): add
4198 insetcaption.[Ch] and insetsection.[Ch]
4200 * src/layout.h: remove LABEL_FIRST_COUNTER from enum, change all
4201 uses to use LABEL_COUNTER_CHAPTER instead.
4202 * src/text2.C (SetCounter): here
4204 * src/counters.h: new file
4205 * src/counters.C: new file
4206 * src/Sectioning.h: new file
4207 * src/Sectioning.C: new file
4209 * src/Makefile.am (lyx_SOURCES): add Sectioning.[hC] and counters.[Ch]
4211 2000-07-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4213 * lib/Makefile.am (listerrors): build-listerrors is in ${srcdir},
4216 * src/paragraph.[Ch] (SimpleTeXSpecialChars): fix the definition of
4219 2000-07-17 Juergen Vigna <jug@sad.it>
4221 * src/tabular.C (Validate): check if array-package is needed.
4222 (SetVAlignment): added support for vertical alignment.
4223 (SetLTFoot): better support for longtable header/footers
4224 (Latex): modified to support added features.
4226 * src/LaTeXFeatures.[Ch]: added array-package.
4228 2000-07-17 R. Lahaye <lahaye@postech.ac.kr>
4230 * src/lyx_gui.C (LyXGUI): make sure that the height is large
4233 2000-07-17 Kayvan Sylvan <ksylvan@synopsys.com>
4235 * configure.in: do not forget to put a space after -isystem.
4237 2000-07-10 Dekel Tsur <dekel@math.tau.ac.il>
4239 * lib/kbd/arabic.kmap: a few fixes.
4241 2000-07-16 Lars Gullik Bjønnes <larsbj@lyx.org>
4243 * some whitespace chagnes to a number of files.
4245 * src/support/DebugStream.h: change to make it easier for
4246 doc++ to parse correctly.
4247 * src/support/lyxstring.h: ditto
4249 * src/mathed/math_utils.C (compara): change to have only one
4251 (MathedLookupBOP): change because of the above.
4253 * src/mathed/math_delim.C (math_deco_compare): change to have only
4255 (search_deco): change becasue of the above.
4257 * src/insets/insettabular.C (DrawCellSelection): use std::swap
4258 instead of manually coded one.
4260 * src/insets/insetquotes.C (Read): read the \end_inset too
4262 * src/insets/insetlatex.h: remove file
4263 * src/insets/insetlatex.C: remove file
4265 * src/insets/insetindex.[Ch] (InsetPrintIndex): remove default
4267 (InsetPrintIndex): remove destructor
4269 * src/insets/insetinclude.h: remove default constructor
4271 * src/insets/insetfloat.C: work to make it work better
4273 * src/insets/inseterror.[Ch] (InsetError): remove default constructor
4275 * src/insets/insetcite.h (InsetCitation): remove default constructor
4277 * src/insets/insetbutton.[Ch] (InsetButton): remove default constructor
4279 * src/text.C (GetColumnNearX): comment out some currently unused code.
4281 * src/paragraph.C (writeFile): move some initializations closer to
4283 (CutIntoMinibuffer): small change to use new matchIT operator
4287 (InsertInset): ditto
4290 (InsetIterator): ditto
4291 (Erase): small change to use new matchFT operator
4293 (GetFontSettings): ditto
4294 (HighestFontInRange): ditto
4297 * src/lyxparagraph.h: some chars changed to value_type
4298 (matchIT): because of some stronger checking (perhaps too strong)
4299 in SGI STL, the two operator() unified to one.
4302 * src/lyxfunc.C (Dispatch): code to insert InsetFloat improved
4304 * src/buffer.C (parseSingleLyXformat2Token): static string to hold
4305 the last inset read added
4306 (parseSingleLyXformat2Token): some more (future) compability code added
4307 (parseSingleLyXformat2Token): warning about solitary \end_inset added
4308 (parseSingleLyXformat2Token): set last_inset_read
4309 (parseSingleLyXformat2Token): more code to read new "Float" correctly
4310 (parseSingleLyXformat2Token): don't double intializw string next_token
4312 * src/TextCache.C (text_fits::operator()): add const's to the signature
4313 (has_buffer::operator()): ditto
4315 * src/Floating.h: add some comments on the class
4317 * src/FloatList.[Ch] (typeExist): new method
4320 * src/BackStack.h: added default constructor, wanted by Gcc.
4322 2000-07-14 Juergen Vigna <jug@sad.it>
4324 * src/insets/insettext.C (clear): fixed for multiple paragraps/layouts.
4326 * src/frontends/xforms/forms/form_tabular.fd: updated a bit.
4328 * src/insets/insettabular.C (resizeLyXText): need this to be able to
4329 do a redraw when the window is resized!
4330 (LocalDispatch): small fix so LFUN_TAB works only with locked_inset.
4332 * src/insets/insettext.C (resizeLyXText): added function to correctly
4333 being able to resize the LyXWindow.
4335 * src/table.C (Read): fixed read on DOS-lyx-file (lf-lr)
4337 2000-07-13 Angus Leeming <a.leeming@ic.ac.uk>
4339 * src/frontends/Dialogs.h (hideCitation) : new signal to prevent
4340 crashes when closing dialog to a deleted inset.
4342 * src/insets/insetcite.[Ch] (Edit) : the return of this former
4343 method! Now similar to other insets.
4345 2000-07-13 Juergen Vigna <jug@sad.it>
4347 * src/text.C (GetVisibleRow): fixed clearing of rows with insets!
4349 * lib/examples/Literate.lyx: small patch!
4351 * src/insets/insetbib.C (Read): added this function because of wrong
4352 Write (without [begin|end]_inset).
4354 2000-07-11 Juergen Vigna <jug@sad.it>
4356 * src/BufferView2.C (open_new_inset): changed to a bool returnvalue
4357 as the insertInset could not be good!
4359 * src/screen.C (ToggleSelection): fixed toggle selection bug as
4360 the bool param should not be last.
4362 2000-07-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4364 * sigc++/configure.in: fix bug in threading-related code (Yes, I
4365 did submit that to Karl).
4367 * configure.in: use -isystem instead of -I for X headers. This
4368 fixes a problem on solaris with a recent gcc;
4369 put the front-end code after the X detection code;
4370 configure in sigc++ before lib/
4372 * src/lyx_main.C (commandLineHelp): remove -display from command
4375 2000-07-09 Kayvan A. Sylvan <kayvan@sylvan.com>
4377 * lib/Makefile.am: added lib/build-listerrors to DIST tarfile.
4378 Also put in Makefile rules for building the ``listerrors''
4379 program for parsing errors from literate programs written in LyX.
4381 * lib/build-listerrors: Added small shell script as part of compile
4382 process. This builds a working ``listerrors'' binary if noweb is
4383 installed and either 1) the VNC X server is installed on the machine,
4384 or 2) the user is compiling from within a GUI. The existence of a GUI
4385 is necessary to use the ``lyx --export'' feature for now. This
4386 hack can be removed once ``lyx --export'' no longer requires a GUI to
4389 2000-07-09 Bernard Michael Hurley <bernardh@westherts.ac.uk>
4391 * lib/examples/Literate.lyx, src/Literate.[Ch]: Error messages are
4392 now passed back correctly from gcc and placed "under" error
4393 buttons in a Literate LyX source.
4395 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4397 * src/text.C (GetColumnNearX): Better behavior when a RTL
4398 paragraph is ended by LTR text.
4400 * src/text2.C (SetCurrentFont,CursorLeftIntern,CursorRightIntern):
4403 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4405 * src/WorkArea.C (request_clipboard_cb): Set clipboard_read to
4406 true when clipboard is empty.
4408 2000-07-08 Dekel Tsur <dekel@math.tau.ac.il>
4410 * text.C (Backspace): Prevent rebreaking of a row if it is the last
4411 row of the paragraph.
4412 (SetHeightOfRow): Call to PrepareToPrint with 7th argument = false
4413 to prevent calculation of bidi tables
4415 2000-07-07 Juergen Vigna <jug@sad.it>
4417 * src/screen.C (ToggleSelection): added y_offset and x_offset
4420 * src/insets/insettext.C (InsetMotionNotify): fixed selection with
4423 * src/text.C (GetVisibleRow): fixed selection drawing in insets.
4425 * src/insets/insettext.C: fixed Layout-Display!
4427 2000-07-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4429 * configure.in: add check for strings.h header.
4431 * src/spellchecker.C: include <strings.h> in order to have a
4432 definition for bzero().
4434 2000-07-07 Juergen Vigna <jug@sad.it>
4436 * src/insets/insettext.C (draw): set the status of the bv->text to
4437 CHANGED_IN_DRAW if top_x changed and so a reinit is necessary.
4439 * src/screen.C (DrawOneRow):
4440 (DrawFromTo): redraw the actual row if something has changed in it
4443 * src/text.C (draw): call an update of the toplevel-inset if something
4444 has changed inside while drawing.
4446 * src/lyxtext.h: added CHANGED_IN_DRAW status.
4448 2000-07-06 Angus Leeming <a.leeming@ic.ac.uk>
4450 * src/insets/insetbib.[Ch] (callback) new method, moving callback
4451 processing inside class.
4453 * src/insets/insetindex.[Ch] (callback) new method, moving callback
4454 processing inside class.
4456 * src/insets/insetindex.h new struct Holder, consistent with other
4459 * src/insets/insetcite.[Ch] and elsewhere: stripped out xforms
4460 citation dialog from main code and placed it in src/frontends/xforms.
4461 Dialog launched through signals instead of callbacks
4463 2000-07-06 R. Lahaye <lahaye@postech.ac.kr>
4465 * lyx.man: update the options description.
4467 2000-07-05 R. Lahaye <lahaye@postech.ac.kr>
4469 * src/lyx_gui.C src/lyx_main.C: improve the -geometry support,
4470 handle neg values, set min width to 590, add doc about -display
4472 2000-07-05 Juergen Vigna <jug@sad.it>
4474 * src/insets/lyxinset.h: changed Painter & in ascent(), descent()
4475 calls to BufferView *.
4477 * src/insets/insettext.C (checkAndActivateInset): small fix non
4478 HIGHLY_EDITABLE insets should not be entered by cursor-move-over!
4480 * src/insets/insetcommand.C (Read): Fixed as insets should read till
4481 their \end_inset token!
4483 2000-07-04 edscott <edscott@imp.mx>
4485 * src/lyxrc.C, src/lyxrc.h, src/BufferView_pimpl.C,
4486 lib/lyxrc.example: added option \wheel_jump
4488 2000-07-04 R. Lahaye <lahaye@postech.ac.kr>
4490 * src/lyx_gui.C src/lyx_main.C: add support for -geometry, and
4491 remove support for -width,-height,-xpos and -ypos.
4493 2000-07-01 Dekel Tsur <dekel@math.tau.ac.il>
4495 * src/encoding.[Ch]: New files.
4497 * src/painter.C (text(int,int,XChar2b const *,...)): New method.
4498 (text): Call to the underline() method only when needed.
4500 * src/font.C (XTextWidth16,width(XChar2b const *,...)): New methods.
4502 * src/buffer.C (makeLaTeXFile): Compute automatically the input
4503 encoding(s) for the document.
4505 * src/bufferparams.C (BufferParams): Changed default value of
4508 * src/language.C (newLang): Removed.
4509 (items[]): Added encoding information for all defined languages.
4511 * src/lyx_gui.C (create_forms): Added "auto" option to the input
4512 encoding choice button.
4514 * src/lyxrc.h (font_norm_type): New member variable.
4515 (set_font_norm_type): New method.
4517 * src/paragraph.C (TeXOnePar): Put "\inputencoding{}" between
4518 paragraphs with different encodings.
4520 * src/text.C (is_arabic, is_nikud, TransformChar): Moved to encoding.C
4521 (TransformChar): Changed to work correctly with Arabic points.
4522 (draw): Added support for drawing Arabic points.
4523 (draw): Removed code for drawing underbars (this is done by
4526 * src/support/textutils.h (IsPrintableNonspace): New function.
4528 * src/BufferView_pimpl.h: Added "using SigC::Object".
4529 * src/LyXView.h: ditto.
4531 * src/insets/insetinclude.h (include_label): Changed to mutable.
4533 2000-07-04 Lars Gullik Bjønnes <larsbj@lyx.org>
4535 * src/mathed/math_iter.h: remove empty destructor
4537 * src/mathed/math_cursor.h: remove empty destructor
4539 * src/insets/lyxinset.h: add THEOREM_CODE
4541 * src/insets/insettheorem.[Ch]: new files
4543 * src/insets/insetminipage.C: (InsertInset): remove
4545 * src/insets/insetmarginal.C: inherit from InsetFootLike instead
4547 (InsertInset): remove
4549 * src/insets/insetlist.C: (InsertList): remove
4551 * src/insets/insetfootlike.[Ch]: new files
4553 * src/insets/insetfoot.C: inherit from InsetFootLike instead of
4556 (InsertInset): ditto
4558 * src/insets/insetert.C: remove include Painter.h, reindent
4559 (InsertInset): move to header
4561 * src/insets/insetcollapsable.h: remove explicit from default
4562 contructor, remove empty destructor, add InsertInset
4564 * src/insets/insetcollapsable.C (InsertInset): new func
4566 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4568 * src/vspace.h: add explicit to constructor
4570 * src/paragraph.C (SimpleTeXSpecialChars): use \, instead of
4571 \textcompwordmark, please test this.
4573 * src/lyxrc.C: set ascii_linelen to 65 by default
4575 * src/lyxfunc.C (Dispatch): handle LFUN_INSET_THEOREM
4577 * src/commandtags.h: add LFUN_INSET_THEOREM
4579 * src/buffer.C (parseSingleLyXformat2Token): handle insettheorem
4580 (makeLinuxDocFile): remove _some_ of the nice logic
4581 (makeDocBookFile): ditto
4583 * src/Painter.[Ch]: (~Painter): removed
4585 * src/LyXAction.C (init): entry for insettheorem added
4587 * src/LaTeX.C: get rid of the all_files array, and the TEX_FILES
4589 (deplog): code to detect files generated by LaTeX, needs testing
4592 2000-07-03 Lars Gullik Bjønnes <larsbj@lyx.org>
4594 * src/FloatList.[Ch]: moved inlines out of line to FloatList.C
4596 2000-07-02 Lars Gullik Bjønnes <larsbj@lyx.org>
4598 * src/LaTeX.C (deplog): Add a check for files that are going to be
4599 created by the first latex run, part of the project to remove the
4602 * src/LaTeX.[Ch]: Patch from Baruch to add hebrew table of
4603 contents to the extension list.
4605 2000-07-04 Juergen Vigna <jug@sad.it>
4607 * src/text.C (NextBreakPoint): added support for needFullRow()
4609 * src/insets/lyxinset.h: added needFullRow()
4611 * src/insets/insetcollapsable.C: redone now this uses a text-inset
4614 * src/insets/insettext.C: lots of changes for update!
4616 2000-07-03 Angus Leeming <a.leeming@ic.ac.uk>
4618 * src/LaTeXFeatures.h: add a missing std:: qualifier.
4620 2000-07-02 José Abílio Matos <jamatos@fep.up.pt>
4622 * src/insets/insetinclude.C (InsetInclude): fixed
4623 initialization of include_label.
4624 (unique_id): now returns a string.
4626 2000-07-01 José Abílio Matos <jamatos@fep.up.pt>
4628 * src/LaTeXFeatures.h: new member IncludedFiles, for
4629 a map of key, included file name.
4631 * src/LaTeXFeatures.C (getIncludedFiles): returns a string
4632 with the included files for inclusion in SGML preamble,
4633 i. e., linuxdoc and docbook.
4636 * src/buffer.C (makeLinuxDocFile): takes two new arguments,
4637 nice (is the generated linuxdoc code to be exported?), that
4638 allows to remove column, and only_body that will be true for
4639 slave documents. Insets are allowed inside SGML font type.
4640 New handling of the SGML preamble for included files.
4641 (makeDocBookFile): the same for docbook.
4643 * src/insets/insetinclude.h:
4644 * src/insets/insetinclude.C (Validate): keeps a list of included files.
4646 (DocBook): new export methods.
4648 * src/lyx_cb.C: adjust to the new calling sequence for makeLinuxDocFile
4649 and makeDocBookFile.
4651 * src/lyx_main.C (easyParse): accept linuxdoc and docbook as
4652 formats to export with command line argument -x.
4654 2000-06-29 Juergen Vigna <jug@sad.it>
4656 * src/mathed/formula.C (LocalDispatch): changed only-cursor-movements
4657 to return DISPATCHED_NOUPDATE so that a it does not redraw the inset!
4659 * src/text.C (GetVisibleRow): added 'bool cleared' parameter as the
4660 region could already been cleared by an inset!
4662 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4664 * src/BufferView_pimpl.h: remove member variables lyx_focus and
4667 * src/BufferView_pimpl.C (Pimpl): delete init of work_area_focus
4669 (cursorToggle): remove special handling of lyx focus.
4671 2000-06-28 Juergen Vigna <jug@sad.it>
4673 * src/text.C (GetVisibleRow): fixed clearing of text if rowHeight >
4676 2000-06-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4678 * src/insets/insetindex.C (Edit): add a callback when popup is
4681 * src/insets/insettext.C (LocalDispatch):
4682 * src/insets/insetmarginal.h:
4683 * src/insets/insetlist.h:
4684 * src/insets/insetfoot.h:
4685 * src/insets/insetfloat.h:
4686 * src/insets/insetert.h: add a missing std:: qualifier.
4688 2000-06-28 Lars Gullik Bjønnes <larsbj@lyx.org>
4690 * src/support/lyxsum.C (sum): '\0' teminate file read when using
4693 * src/insets/lyxinset.h: add FLOAT_CODE and MINIPAGE_CODE
4695 * src/insets/insettext.C (Read): remove tmptok unused variable
4696 (LocalDispatch): add not working LFUN_PARAGRAPH_SPACING
4697 (InsertInset): change for new InsetInset code
4699 * src/insets/insettext.h: add TEXT inline method
4701 * src/insets/insettext.C: remove TEXT macro
4703 * src/insets/insetmarginal.C (Write): new method
4704 (Latex): change output slightly
4706 * src/insets/insetfoot.C (Write): new method
4707 (Latex): change output slightly (don't use endl when no need)
4709 * src/insets/insetert.C (Write): new method
4711 * src/insets/insetcollapsable.h: make button_length, button_top_y
4712 and button_bottm_y protected.
4714 * src/insets/insetcollapsable.C (Write): simplify code by using
4715 tostr. Also do not output the float name, the children class
4716 should to that to get control over own arguments
4718 * src/insets/insetfloat.[Ch] src/insets/insetlist.[Ch]
4719 src/insets/insetminipage.[Ch]:
4722 * src/insets/Makefile.am (libinsets_la_SOURCES): add new files
4724 * src/lyxfunc.C (Dispatch): cases for new insets/commands
4726 * src/Makefile.am (lyx_SOURCES): add the new files
4728 * src/LyXAction.C (init): add LFUN_INSET_MARGINAL,
4729 LFUN_INSET_MINIPAGE, LFUN_INSET_FLOAT, LFUN_INSET_LIST
4730 * src/commandtags.h: ditto
4732 * src/LaTeXFeatures.h: add a std::set of used floattypes
4734 * src/LaTeXFeatures.C (getPackages): add basic support for float.sty
4736 * src/FloatList.[Ch] src/Floating.h: new files
4738 * src/CutAndPaste.C (SwitchLayoutsBetweenClasses): change call to
4740 * src/lyx_cb.C (TableApplyCB): ditto
4742 * src/text2.C: ditto
4743 * src/buffer.C (SimpleLinuxDocOnePar): ditto
4744 (parseSingleLyXformat2Token): ditto + add code for
4745 backwards compability for old float styles + add code for new insets
4747 * src/lyxparagraph.[Ch] (InsertChar(size_type, char, LyXFont)): new
4749 (InsertInset(size_type, Inset *, LyXFont)): new method
4750 (InsetChar(size_type, char)): changed to use the other InsetChar
4751 with a LyXFont(ALL_INHERIT).
4752 (InsetInset(size_type, Inset*)): changed to use InsetChar to
4753 insert the META_INSET.
4755 * sigc++/thread.cc (Privete<int>::operator int&): move definition
4757 * sigc++/thread.h (Threads): from here
4759 * sigc++/scope.cc (ScopeIterator_::ScopeIterator_): move
4760 definition out of line
4761 * sigc++/scope.h: from here
4763 2000-06-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4765 * src/lyxrc.C (read): make sure the .kmap files exist when a keymap
4766 is specified (adapted from a patch from edscott <edscott@imp.mx>).
4768 * Makefile.am (bindist): new target.
4770 * INSTALL: add instructions for doing a binary distribution.
4772 * development/tools/README.bin.example: update a bit.
4774 2000-06-26 Lior Silberman <slior@math.huji.ac.il>
4777 * lib/lyxrc.example: new lyxrc tag \set_color.
4779 * src/lyxfunc.C (Dispatch):
4780 * src/commandtags.h:
4781 * src/LyXAction.C: new lyxfunc "set-color".
4783 * src/LColor.[Ch] (setColor): new method to set colors from a lyxname
4784 and an x11name given as strings.
4786 * src/ColorHandler.[Ch] (updateColor): new method. Updates the GC
4787 cache when a color is changed.
4789 2000-06-26 Juergen Vigna <jug@sad.it>
4791 * src/lyxrow.C (width): added this functions and variable.
4793 * src/insets/insetcite.C (create_form_citation_form): some Gravity
4796 * src/text.C (SetHeightOfRow): fixed calcualting of width.
4798 2000-06-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4800 * images/undo_bw.xpm: new icon.
4801 * images/redo_bw.xpm: ditto.
4803 * configure.in (INSTALL_SCRIPT): change value to
4804 ${INSTALL} to avoid failures of install-script target.
4805 * lib/reLyX/configure.in (INSTALL_SCRIPT): ditto
4807 * src/BufferView.h: add a magic "friend" declaration to please
4810 2000-06-23 Angus Leeming <a.leeming@ic.ac.uk>
4812 * forms/cite.fd: modified to allow resizing without messing
4815 * src/insetcite.C: Uses code from cite.fd almost without
4817 User can now resize dialog in the x-direction.
4818 Resizing the dialog in the y-direction is prevented, as the
4819 code does this intelligently already.
4821 2000-06-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4823 * INSTALL: remove obsolete entry in "problems" section.
4825 * lib/examples/sl_*.lyx: update of the slovenian examples.
4827 * src/support/FileInfo.[Ch] (getBlockSize): remove.
4829 2000-06-23 Juergen Vigna <jug@sad.it>
4831 * src/lyxtext.h: added a 'cleared' flag to draw() function.
4833 * src/buffer.C (resize): delete the LyXText of textinsets.
4835 * src/paragraph.C (SetInsetOwner): set the owner in the insets too.
4837 * src/insets/lyxinset.h: added another parameter 'cleared' to
4838 the draw() function.
4840 * src/lyxfunc.C (processKeyEvent): move cursor to the right of the
4841 unlocking inset in inset.
4843 2000-06-22 Juergen Vigna <jug@sad.it>
4845 * src/lyxscreen.h: added some y_offset/x_offset parameters for drawings
4846 of insets and moved first to LyXText.
4848 * src/mathed/formulamacro.[Ch]:
4849 * src/mathed/formula.[Ch]: changed prototype of draw() and GetCursorPos
4851 2000-06-21 Juergen Vigna <jug@sad.it>
4853 * src/text.C (GetVisibleRow): look if I should clear the area or not
4854 using Inset::doClearArea() function.
4856 * src/insets/lyxinset.h: added doClearArea() function and
4857 modified draw(Painter &, ...) to draw(BufferView *, ...)
4859 * src/text2.C (UpdateInset): return bool insted of int
4861 2000-06-20 Dekel Tsur <dekel@math.tau.ac.il>
4863 * src/lyx_gui.C (create_forms): Add "Reset" option to the language
4864 combox in the character popup
4866 * src/lyx_cb.C (UserFreeFont): Add argument to the method:
4867 BufferParams const & params
4869 2000-06-20 Juergen Vigna <jug@sad.it>
4871 * src/insets/insettext.C (SetParagraphData): set insetowner on
4874 2000-06-21 Lars Gullik Bjønnes <larsbj@lyx.org>
4876 * src/Timeout.[Ch]: Change to use signals instead of callbacks.
4877 * src/LyXView.h (struct FD_form_main): remove, LyXView inherits
4879 (form_main_): remove
4881 * src/LyXView.C (LyXView_AutosaveTimerCB): remove
4882 (create_form_form_main): remove FD_form_main stuff, connect to
4883 autosave_timeout signal
4885 * src/LyXView.[Ch] (getMainForm): remove
4886 (UpdateTimerCB): remove
4887 * src/BufferView_pimpl.h: inherit from SigC::Object
4889 * src/BufferView_pimpl.C (Pimpl): connect to cursor_timeout with
4890 signal instead of callback
4892 * src/BufferView.[Ch] (cursorToggleCB): remove
4894 2000-06-20 Lars Gullik Bjønnes <larsbj@lyx.org>
4896 * src/BufferView_pimpl.C: changes because of the one below
4898 * src/screen.[Ch]: Made the lyxscreen take LyXText as argument
4899 instead of storing a pointer to a LyXText.
4901 * src/buffer.[Ch]: apply Baruch's remove isdviclean patch.
4903 2000-06-10 Dekel Tsur <dekel@math.tau.ac.il>
4905 * src/lyxparagraph.h
4907 * src/paragraph.C: Changed fontlist to a sorted vector.
4909 2000-06-19 Juergen Vigna <jug@sad.it>
4911 * src/BufferView.h: added screen() function.
4913 * src/insets/insettext.C (LocalDispatch): some selection code
4916 * src/vspace.C (nextToken): use stringfunctions instead of sscanf.
4918 * src/insets/insettext.C (SetParagraphData):
4920 (InsetText): fixes for multiple paragraphs.
4922 2000-06-17 Kayvan A. Sylvan <kayvan@sylvan.com>
4924 * development/lyx.spec.in: Call configure with ``--without-warnings''
4925 to work around a bug with the Makefiles when doing ``make lyxrpm''.
4926 This should be fine, however, since we generally don't want to be
4927 verbose when making an RPM.
4929 2000-06-16 Dekel Tsur <dekel@math.tau.ac.il>
4931 * lib/scripts/fig2pstex.py: New file
4933 2000-06-16 Juergen Vigna <jug@sad.it>
4935 * src/insets/insettabular.C (UpdateLocal):
4936 * src/insets/insettext.C (UpdateLocal): fixed mark_dirty problem.
4937 (LocalDispatch): Changed all functions to use LyXText.
4939 2000-06-15 Juergen Vigna <jug@sad.it>
4941 * src/text.C (SetHeightOfRow): call inset::update before requesting
4944 * src/insets/insettext.C (update):
4945 * src/insets/insettabular.C (update): added implementation
4947 * src/insets/lyxinset.h: added update function
4949 2000-06-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4951 * src/text.C (SelectNextWord): protect against null pointers with
4952 old-style string streams. (fix from Paul Theo Gonciari
4955 * src/cite.[Ch]: remove erroneous files.
4957 * lib/configure.m4: update the list of created directories.
4959 * src/lyxrow.C: include <config.h>
4960 * src/lyxcursor.C: ditto.
4962 2000-06-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
4964 * lib/examples/decimal.lyx: new example file from Mike.
4966 * src/insets/ExternalTemplate.C (readTemplates): Use LibFileSearch()
4967 to find template definitions (from Dekel)
4969 * src/frontends/.cvsignore: add a few things.
4971 * src/frontends/xforms/input_validators.[ch]: remove C++ comments.
4973 * src/Timeout.C (TimeOut): remove default argument.
4975 * src/LyXView.C (LyXView_AutosaveTimerCB): this should not have
4978 * src/insets/ExternalTemplate.C: add a "using" directive.
4980 * src/lyx_main.h: remove the act_ struct, which seems unused
4983 2000-06-12 Lars Gullik Bjønnes <larsbj@lyx.org>
4985 * LyX Developers Meeting: All files changed, due to random C++ (by
4986 coincidence) code generator script.
4988 - external inset (cool!)
4989 - initial online editing of preferences
4990 - insettabular breaks insettext(s contents)
4992 - some DocBook fixes
4993 - example files update
4994 - other cool stuff, create a diff and look for yourself.
4996 2000-06-09 The Great LyX Application <lyx@localhost.localdomain>
4998 * src/insets/insettext.C (computeTextRows): if the maxWidth is
4999 -1 this is a non-line-breaking textinset.
5001 * src/insets/insettabular.C (GetMaxWidthOfCell): returns now -1
5002 if there is no width set.
5004 2000-06-10 Lars Gullik Bjønnes <larsbj@lyx.org>
5006 * Lots of files: Merged the dialogbase branch.
5008 2000-06-09 Allan Rae <rae@lyx.org>
5010 * src/xtl/, src/lyxfunc.[Ch], src/buffer.[Ch]: Removed XTL and
5011 and the Dispatch methods that used it.
5013 * src/frontends/Liason.[Ch]: replaced with a Liason namespace for
5014 access to functions formerly kept in Dispatch.
5016 2000-05-19 Allan Rae <rae@lyx.org>
5018 * src/PrinterParams.h, src/buffer.C, src/frontends/xforms/FormPrint.C:
5019 made to_page and count_copies integers again. from_page remains a
5020 string however because I want to allow entry of a print range like
5021 "1,4,22-25" using this field.
5023 * src/LyXAction.C: added action info and commands for buffer-print-xtl
5024 and printer-params-get. These aren't useful from the minibuffer but
5025 could be used by a script/LyXServer app provided it passes a suitable
5026 auto_mem_buffer. I guess I should take a look at how the LyXServer
5027 works and make it support xtl buffers.
5029 * sigc++/: updated to libsigc++-1.0.1
5031 * src/xtl/: updated to xtl-1.3.pl.11
5033 * forms/makefile, forms/fdfix.sh, forms/layout_forms.fd: Made sure
5034 those changes done to the files in src/ are actually recreated when
5035 they get regenerated. Please don't ever accept a patch that changes a
5036 dialog unless that patch includes the changes to the corresponding *.fd
5039 * src/lyx_cb.C, src/support/lstrings.[hC]: Moved Stephen Witt's
5040 stringOnlyContains, renamed it and generalised it.
5042 * lots-of-files: Rolled the "rae" branch over into the "dialogbase"
5043 branch. Removed the remaining old form_print code.
5045 2000-04-26 Allan Rae <rae@lyx.org>
5047 * ChangeLog, development/tools/lxtl.sh: D'oh! Got caught in the same
5048 trap I was trying to fix with the ID: fields in src/xtl/ :-)
5050 2000-04-25 Allan Rae <rae@lyx.org>
5052 * src/xtl/: Updated to incorporate Angus's two patches as well as mine
5053 against a base of xtl-1.3.pl.4
5055 * development/tools/lxtl.sh: fixed a couple of silly typos and now
5056 filter the Id: entries so they still show the xtl version number
5059 * src/support/lxtl.h: removed auto_mem_buffer which is now incorporated
5060 into the src/xtl code. Patch still pending with José (XTL)
5062 2000-04-24 Allan Rae <rae@lyx.org>
5064 * src/lyxfunc.[Ch] (Dispatch): Use a mem buffer as a parameter. This is
5065 both more generic and much safer. Use the new template functions.
5066 * src/buffer.[Ch] (Dispatch): ditto.
5068 * src/frontends/xforms/FormPrint.C (update): Use new template functions
5069 and mem buffer more intelligently. Also a little general cleanup.
5072 * configure.in (AC_OUTPUT): Extra stuff for xtl that I forgot.
5073 * development/tools/lxtl.sh: Ditto. Makefile.am + .cvsignore
5074 * src/xtl/Makefile.am: ditto.
5075 * src/xtl/.cvsignore: ditto.
5076 * src/Makefile.am: ditto.
5078 * src/PrinterParams.h: Removed the macros member functions. Added a
5079 testInvariant member function. A bit of tidying up and commenting.
5080 Included Angus's idea for fixing operation with egcs-1.1.2.
5082 * src/support/lxtl.h: Many changes. Added auto_mem_buffer -- a really
5083 cool expansion of XTL's mem_buffer to support automatic memory
5084 management within the buffer itself. Removed the various macros and
5085 replaced them with template functions that use either auto_mem_buffer
5086 or mem_buffer depending on a #define. The mem_buffer support will
5087 disappear as soon as the auto_mem_buffer is confirmed to be good on
5088 other platforms/compilers. That is, it's there so you've got something
5091 * src/xtl/objio.h: Changes to support auto_mem_buffer. This has
5092 effectively forked XTL. However I expect José will include my code
5093 into the next major release. Also fixed a memory leak.
5094 * src/xtl/text.h: ditto.
5095 * src/xtl/xdr.h: ditto.
5096 * src/xtl/giop.h: ditto.
5098 2000-04-16 Allan Rae <rae@lyx.org>
5100 * acinclude.m4, sigc++/acinclude.m4: Removed -- they're generated
5101 by autogen.sh and removed by maintainer-clean anyway.
5102 * .cvsignore, sigc++/.cvsignore: Support the above.
5104 * sigc++/.cvsignore: Forgot that retbind.h was generated.
5106 * src/buffer.C (Dispatch): Couldn't print a single page. Fixed.
5108 * src/frontends/xforms/FormPrint.[Ch]: Switched to C callbacks using
5109 macros, renamed static callback-target member functions to suit new
5110 scheme and made them public.
5111 * src/frontends/xforms/forms/form_print.fd: ditto.
5112 * src/frontends/xforms/forms/form_copyright.fd: ditto.
5114 * src/support/lxtl.h: small cleanup to use typedef instead of #define
5117 * src/xtl/: New directory containing a minimal distribution of XTL.
5118 This is XTL-1.3.pl.4.
5120 * development/tools/lxtl.sh: A script to generate the above mini-dist.
5122 2000-04-15 Allan Rae <rae@lyx.org>
5124 * development/tools/makeLyXsigc.sh: Remove the library version numbers
5126 * sigc++/: Updated to libsigc++-1.0.0
5128 2000-04-14 Allan Rae <rae@lyx.org>
5130 * src/frontends/xforms/xform_macros.h: Remove specific macros and just
5131 use the generic ones in future. I'll modify my conversion script.
5133 * src/frontends/xforms/FormCopyright.C: Reverse the earlier change.
5135 * src/lyx_gui_misc.[Ch]: Removed references to form_print.
5136 (CloseAllBufferRelatedDialogs): Renamed.
5137 (updateAllVisibleBufferRelatedDialogs): ditto. Added LaTeXLog
5139 * src/frontends/xforms/FormCopyright.C: Use the specific macros instead
5140 of the generic ones. These are the same ones my conversion script
5143 * src/PrinterParams.h: Allow you to print a range of odd or even pages.
5144 * src/frontends/xforms/FormPrint.C (apply, update): ditto+small cleanup
5145 * src/buffer.C (Dispatch): ditto
5147 * src/LyXView.C (LyXView): Use new signals instead of old hard coded
5148 functions for updating and hiding buffer dependent dialogs.
5149 * src/BufferView.C (buffer): ditto
5150 * src/buffer.C (setReadonly): ditto
5151 * src/lyxfunc.C (CloseBuffer): ditto
5153 * src/buffer.h: Take setReadonly() out of line so I don't have to include
5154 Dialogs.h, and hence all the SigC stuff, into every file that includes
5155 buffer.h. We also don't need to include lyx_gui_misc.h in everything.
5157 * src/BufferView2.C: reduce the number of headers included by buffer.h
5159 2000-04-11 Allan Rae <rae@lyx.org>
5161 * src/frontends/xforms/xform_macros.h: A small collection of macros
5162 for building C callbacks.
5164 * src/frontends/xforms/Makefile.am: Added above file.
5166 * src/frontends/xforms/FormCopyright.[Ch]: Revised the C callback
5167 scheme again. This time it should work for JMarc. If this is
5168 successful I'll revise my conversion script to automate some of this.
5169 The static member functions in the class also have to be public for
5170 this scheme will work. If the scheme works (it's almost identical to
5171 the way BufferView::cursorToggleCB is handled so it should work) then
5172 FormCopyright and FormPrint will be ready for inclusion into the main
5173 trunk immediately after 1.1.5 is released -- provided we're prepared
5174 for complaints about lame compilers not handling XTL.
5176 * src/support/lxtl.h: Switched to XDR_format instead of raw_format.
5178 2000-04-07 Allan Rae <rae@lyx.org>
5180 * config/lyxinclude.m4: A bit more tidying up (Angus)
5182 * src/LString.h: JMarc's <string> header fix
5184 * src/PrinterParams.h: Used string for most data to remove some
5185 ugly code in the Print dialog and avoid even uglier code when
5186 appending the ints to a string for output.
5188 * src/buffer.C (Dispatch): Added a couple of braces to fix an error
5189 and moved "default:" back to the end of switch statement. Cleaned
5190 up the printing so it uses the right function calls and so the
5191 "print to file" option actually puts the file in the right directory.
5193 * src/frontends/xforms/Dialogs.C: Added FormPrint (Angus).
5195 * src/frontends/xforms/FormPrint.C (PrintInputCB): moved input checking
5196 and Ok+Apply button control into a separate method: input (Angus).
5197 (input) Cleaned it up and improved it to be very thorough now.
5198 (All CB) static_cast used instead of C style cast (Angus). This will
5199 probably change again once we've worked out how to keep gcc-2.8.1 happy
5200 with real C callbacks.
5201 (update) add a few "default:" labels to switches. Egcs-1.1.2 seems to
5202 ignore some of the bool settings and has random numbers instead. Needs
5203 some more investigation. Added other input length checks and checking
5204 of file and printer names.
5206 * src/frontends/xforms/FormPrint.h: Removed pragma statement so it
5207 would link (Angus). Seems the old code doesn't compile with the pragma
5208 statement either. Separated callback entries from internal methods.
5210 * src/lyxfunc.C (Dispatch): LFUN_MENUPRINT calls new dialog (Angus).
5212 2000-03-17 Allan Rae <rae@lyx.org>
5214 * src/lyxfunc.[Ch] (isAvailable): This is only temporary. Do we really
5215 need it? Maybe it could go in Dialogs instead? I could make it a
5216 LFUN but you'd have to call Dispatch(int, int, char*) with dummy
5217 values to get the bool return value.
5218 (Dispatch): New overloaded method for xtl support.
5220 * src/frontends/xforms/FormCopyright.[Ch]: Modified to use a friendly
5221 extern "C" callback instead of static member functions. Hopefully,
5222 JMarc will be able to compile this. I haven't changed
5223 forms/form_copyright.fd yet. Breaking one of my own rules already.
5225 * src/commandtags.h: New xtl-based LFUN's no description in LyXAction
5226 because they aren't useful from the minibuffer. Maybe a LyXServer
5227 might want a help message though?
5229 * src/buffer.[Ch] (Dispatch): New overloaded method for xtl support.
5231 * config/lyxinclude.m4: Changes to g++ flags to suit compiling with
5232 xtl which needs both rtti and exceptions.
5234 * src/support/Makefile.am:
5235 * src/support/lxtl.h: New file. Some helper macros for using XTL.
5237 * src/frontends/xforms/input_validators.[ch]: input filters and
5238 validators. These conrol what keys are valid in input boxes.
5239 Use them and write some more. Much better idea than waiting till
5240 after the user has pressed Ok to say that the input fields don't make
5243 * src/frontends/xforms/Makefile.am:
5244 * src/frontends/xforms/forms/form_print.fd:
5245 * src/frontends/xforms/forms/makefile:
5246 * src/frontends/xforms/FormPrint.[Ch]: Ported previous print form to
5247 new scheme. Still have to make sure I haven't missed anything from
5248 the current implementation.
5250 * src/Makefile.am, src/PrinterParams.h: New data store.
5252 * other files: Added a couple of copyright notices.
5254 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5256 * src/insets/insetbib.h: move Holder struct in public space.
5258 * src/frontends/include/DialogBase.h: use SigC:: only when
5259 SIGC_CXX_NAMESPACES is defined.
5260 * src/frontends/include/Dialogs.h: ditto.
5262 * sigc++/Makefile.am (%.h): use the autodected GNU m4.
5264 * src/frontends/xforms/FormCopyright.[Ch]: do not
5265 mention SigC:: explicitely.
5267 2000-03-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5269 * config/lyxinclude.m4 (LYX_USE_FRONTEND): move the code which
5270 deals with testing KDE in main configure.in
5271 * configure.in: ditto.
5273 2000-02-22 Allan Rae <rae@lyx.org>
5275 * Lots of files: Merged from HEAD
5277 * All Makefile.am (ETAGS_ARGS): use parameter that is also compatible
5278 with the etags shipped with SuSE-6.3 (fancier than gnu-etags).
5280 * autogen.sh: Fix JMarcs complaints by building a sigc++/acinclude.m4
5282 * sigc++/: new minidist.
5284 2000-02-14 Allan Rae <rae@lyx.org>
5286 * development/tools/makeLyXsigc.sh: Small fix for Makefile.am
5288 2000-02-08 Juergen Vigna <jug@sad.it>
5290 * src/frontends/kde/dlg/formcopyrightdialog.kdevdlg: the dialog data
5291 file for the buildin GUI builder of KDevelop of the copyright-dialog.
5293 * src/frontends/kde/lyxgui.kdevprj: I added this as I use KDevelop
5294 for this port and so it is much easier for other people to port
5295 dialogs in a common development environment.
5297 * src/frontends/kde/formcopyrightdialog_moc.C: needed MOC file for
5298 the QT/KDE implementation.
5300 * src/frontends/kde/Dialogs.C:
5301 * src/frontends/kde/FormCopyright.C:
5302 * src/frontends/kde/FormCopyright.h:
5303 * src/frontends/kde/Makefile.am:
5304 * src/frontends/kde/formcopyrightdialog.C:
5305 * src/frontends/kde/formcopyrightdialog.h:
5306 * src/frontends/kde/formcopyrightdialogdata.C: added this source-files
5307 for the kde support of the Copyright-Dialog.
5309 * src/frontends/Makefile.am (AUTOMAKE_OPTIONS): now uses @FRONTEND@
5310 subdir-substitution instead of hardcoded 'xforms' as we now have also
5313 * src/frontends/include/DialogBase.h (Object): just commented the
5314 label after #endif (nasty warning and I don't like warnings ;)
5316 * src/main.C (main): added KApplication initialization if using
5319 * src/lyx_gui.C (runTime): added support for multiple toolkit support.
5320 For now only the KDE event-loop is added if frontend==kde.
5322 * src/Makefile.am (lyx_DEPENDENCIES): added @FRONTEND_xxx@ support
5324 * configure.in: added support for the --with-frontend[=value] option
5326 * autogen.sh: added kde.m4 file to list of config-files
5328 * acconfig.h: added define for KDEGUI-support
5330 * config/kde.m4: added configuration functions for KDE-port
5332 * config/lyxinclude.m4: added --with-frontend[=value] option with
5333 support for xforms and KDE.
5335 2000-02-08 Allan Rae <rae@lyx.org>
5337 * all Makefile.am: Fixed up so the make targets dist, distclean,
5338 install and uninstall all work even if builddir != srcdir. Still
5339 have a new sigc++ minidist update to come.
5341 * config/lyxinclude.m4: Some more builddir!=srcdir fixes.
5343 2000-02-01 Allan Rae <rae@lyx.org>
5345 * config/lyxinclude.m4, development/tools/makeLyXsigc.sh:
5346 Many mods to get builddir != srcdir working.
5348 * sigc++/: Upgraded to 0.8.7. This includes many needed fixes both
5349 for building on NT and so we can do the builddir != srcdir stuff.
5351 2000-01-30 Allan Rae <rae@lyx.org>
5353 * sigc++/doc/*: Selected documentation for the libsigc++ mini dist.
5354 This will stay in "rae" branch. We probably don't really need it in
5355 the main trunk as anyone who wants to help programming it should get
5356 a full library installed also. So they can check both included and
5357 system supplied library compilation.
5359 * sigc++/*, sigc++/macros/*, config/sigc++.m4, config/lyxinclude.m4:
5360 Added a 'mini' distribution of libsigc++. If you feel the urge to
5361 change something in these directories - Resist it. If you can't
5362 resist the urge then you should modify the following script and rebuild
5363 the dist. LYX_WITH_SIGC in lyxinclude.m4 is the wrapper to make it
5364 all happen. Still uses a hacked version of libsigc++'s configure.in.
5365 I'm quite happy with the results. I'm not sure the extra work to turn
5366 the sigc++/configure.in into a few extra AC_DEFUNs in sigc++.m4 is
5367 worth the trouble and would probably lead to extra maintenance
5369 I haven't tested the following important make targets: install, dist.
5370 Not ready for prime time but very close. Maybe 1.1.5.
5372 * development/tools/makeLyXsigc.sh: A shell script to automatically
5373 generate our mini-dist of libsigc++. It can only be used with a CVS
5374 checkout of libsigc++ not a tarball distribution. It's well commented.
5375 This will end up as part of the libsigc++ distribution so other apps
5376 can easily have an included mini-dist. If someone makes mods to the
5377 sigc++ subpackage without modifying this script to generate those
5378 changes I'll be very upset!
5380 * src/frontends/: Started the gui/system indep structure.
5382 * src/frontends/include/Dialogs.h: Dialog container. All the Signal<>s
5383 to access the gui-indep dialogs are in this class. Much improved
5384 design compared to previous revision. Lars, please refrain from
5385 moving this header into src/ like you did with Popups.h last time.
5387 * src/frontends/include/DialogBase.h: Abstract base class for dialogs.
5389 * src/frontends/xforms/: Started the gui-indep system with a single
5390 dialog: FormCopyright. Initial testing of use of libsigc++ was very
5393 * src/frontends/xforms/forms: Repository for the xforms .fd files.
5394 Here you'll find a very useful makefile and automated fdfix.sh that
5395 makes updating dailogs a no-brainer -- provided you follow the rules
5396 set out in the README. I'm thinking about adding another script to
5397 automatically generate skeleton code for a new dialog given just the
5400 * src/commandtags.h, src/lyxfunc.C, src/menus.C:
5401 * src/credits.{Ch}, src/credits_form.{Ch}, forms/credits_form.fd:
5402 Made FormCopyright gui-indep and added a lyxfunc to get to it.
5404 2000-06-09 Lars Gullik Bjønnes <larsbj@lyx.org>
5406 * src/support/LSubstring.C (operator): simplify
5408 * src/lyxtext.h: removed bparams, use buffer_->params instead
5410 * src/lyxrow.h: make Row a real class, move all variables to
5411 private and use accessors.
5413 * src/lyxparagraph.h (getParLanguage): add BufferParamas as
5415 (isRightToLeftPar): ditto
5416 (ChangeLanguage): ditto
5417 (isMultiLingual): ditto
5420 (SimpleTeXOnePar): ditto
5421 (TeXEnvironment): ditto
5422 (GetEndLabel): ditto
5424 (SetOnlyLayout): ditto
5425 (BreakParagraph): ditto
5426 (BreakParagraphConservative): ditto
5427 (GetFontSettings): ditto
5429 (CopyIntoMinibuffer): ditto
5430 (CutIntoMinibuffer): ditto
5431 (PasteParagraph): ditto
5432 (SetPExtraType): ditto
5433 (UnsetPExtraType): ditto
5434 (DocBookContTableRows): ditto
5435 (SimpleDocBookOneTablePar): ditto
5437 (TeXFootnote): ditto
5438 (SimpleTeXOneTablePar): ditto
5439 (TeXContTableRows): ditto
5440 (SimpleTeXSpecialChars): ditto
5443 * src/lyxcursor.h: make LyXCursor a real class, move all variables
5444 to private and use accessors.
5446 * src/lyx_cb.C: remove char updatetimer, and all code that uses
5447 this, we did not use it anymore and has not been for ages. Just a
5448 waste of cpu cycles.
5450 * src/language.h: make Language a real class, move all variables
5451 to private and use accessors.
5453 * src/BufferView_pimpl.C (Pimpl): use new timer code.
5454 (create_view): remove
5455 (update): some changes for new timer
5456 (cursorToggle): use new timer
5457 (beforeChange): change for new timer
5459 * src/BufferView.h (cursorToggleCB): removed last paramter because
5462 * src/BufferView.C (C_BufferView_CursorToggleCB): removed
5463 (cursorToggleCB): change because of new timer code
5465 * lib/CREDITS: updated own mailaddress
5467 2000-06-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5469 * src/support/filetools.C (PutEnv): fix the code in case neither
5470 putenv() nor setenv() have been found.
5472 * INSTALL: mention the install-strip Makefile target.
5474 * src/LyXAction.C (init): make LFUN_BUILDPROG available in
5475 read-only documents.
5477 2000-06-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5479 * lib/reLyX/configure.in (VERSION): avoid using a previously
5480 generated reLyX wrapper to find out $prefix.
5482 * lib/examples/eu_adibide_lyx-atua.lyx:
5483 * lib/examples/eu_adibide_gordina.lyx: new examples for the Basque
5484 translation of the Tutorial (Dooteo)
5486 2000-06-06 Angus Leeming <a.leeming@ic.ac.uk>
5488 * forms/cite.fd: new citation dialog
5490 * src/insetcite.[Ch]: the new citation dialog is moved into
5493 * src/insetbib.C: InsetBibtex::getKeys() uses STL containers
5496 * src/insets/insetcommand.h: data members made private.
5498 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5500 * LyX 1.1.5 released
5502 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5504 * src/version.h (LYX_RELEASE): to 1.1.5
5506 * src/spellchecker.C (RunSpellChecker): return false if the
5507 spellchecker dies upon creation.
5509 2000-06-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5511 * lib/reLyX/reLyXmain.pl, lib/reLyX/LastLyX.pm: fix suffix of file
5512 in \include{} (from Tomasz Motylewski <motyl@stan.chemie.unibas.ch>)
5516 * lib/CREDITS: update entry for Martin Vermeer.
5518 2000-06-06 Dekel Tsur <dekel@math.tau.ac.il>
5520 * src/text.C (draw): Draw foreign language bars at the bottom of
5521 the row instead of at the baseline.
5523 * lib/examples/Minipage.lyx: Use the new multi-lingual support.
5525 2000-06-06 Lars Gullik Bjønnes <larsbj@lyx.org>
5527 * lib/bind/de_menus.bind: updated
5529 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5531 * forms/lyx.fd: Correct gravity for objects in form_toc and form_ref
5533 2000-06-05 Dekel Tsur <dekel@math.tau.ac.il>
5535 * src/menus.C (Limit_string_length): New function
5536 (ShowTocMenu): Limit the number of items/length of items in the
5539 * src/paragraph.C (String): Correct result for a paragraph inside
5542 2000-06-05 Lars Gullik Bjønnes <larsbj@lyx.org>
5544 * src/bufferlist.C (close): test of buf->getuser() == NULL
5546 2000-06-02 Dekel Tsur <dekel@math.tau.ac.il>
5548 * src/BufferView2.C (removeAutoInsets): Fix a bug:
5549 Do not call to SetCursor when the paragraph is a closed footnote!
5551 2000-06-01 Dekel Tsur <dekel@math.tau.ac.il>
5553 * src/insets/insetlabel.C (Edit): Mark buffer as dirty when a
5556 * src/text.C (SetCursor): Made the computation of cursor_vpos safer.
5558 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5561 * src/lyx_cb.C (RefSelectCB): Added "Go Back" button in the insert
5562 reference popup, that activates the reference-back action
5564 * src/menus.C (ShowRefsMenu): Added "Go Back" menu item.
5566 * src/menus.C (Add_to_refs_menu): Limit the size of each item in
5567 the menus. Also fixed a bug.
5569 * src/lyx_cb.C (updateAllVisibleBufferRelatedPopups): Do not close
5570 the math panels when switching buffers (unless new buffer is readonly).
5572 * src/BufferView.C (NoSavedPositions)
5573 * src/BufferView_pimpl.C (NoSavedPositions): New methods
5575 2000-06-01 Lars Gullik Bjønnes <larsbj@lyx.org>
5577 * src/lyx_cb.C (MakeLaTeXOutput): we run MakeLaTeXOutput regard
5578 less of dvi dirty or not.
5580 * src/trans_mgr.[Ch] (insert): change first parameter to string
5583 * src/chset.[Ch] (encodeString): add const to first parameter
5585 2000-05-31 Lars Gullik Bjønnes <larsbj@lyx.org>
5587 * src/support/lyxstring.C (begin): fix a "shared" string bug. use
5591 * src/LaTeX.C (deplog): better searching for dependency files in
5592 the latex log. Uses now regexps.
5594 * lib/layouts/stdlists.inc (lyxlist): fix the label to use \hfil
5595 instead of the box hack or \hfill.
5597 2000-05-31 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5599 * src/lyxfunc.C (doImportHelper): do not create the file before
5600 doing the actual import.
5601 (doImportASCIIasLines): create a new file before doing the insert.
5602 (doImportASCIIasParagraphs): ditto.
5604 * lib/lyxrc.example: remove mention of non-existing commands
5606 * lyx.man: remove mention of color-related switches.
5608 * src/lyxrc.C: remove RC_SELECTIONCOLOR and RC_BACKGROUNDCOLOR.
5610 * src/lyx_gui.C: remove all the color-related ressources, which
5611 are not used anymore.
5613 * src/lyx_gui_misc.C (WarnReadonly): use MakeDisplayPath on file
5616 2000-05-31 Dekel Tsur <dekel@math.tau.ac.il>
5618 * src/lyxrc.C (read): Add a missing break in the switch
5620 2000-05-30 Dekel Tsur <dekel@math.tau.ac.il>
5622 * src/text2.C (InsertStringA): Fix a bug with insertion into table
5624 * src/trans_mgr.C (insertVerbatim): Do not use insetquote when the
5627 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5629 * src/text.C (draw): draw bars under foreign language words.
5631 * src/LColor.[Ch]: add LColor::language
5633 2000-05-27 Dekel Tsur <dekel@math.tau.ac.il>
5635 * src/lyxcursor.h (boundary): New member variable
5637 * src/text.C (IsBoundary): New methods
5639 * src/text.C: Use the above for currect cursor movement when there
5640 is both RTL & LTR text.
5642 * src/text2.C: ditto
5644 * src/bufferview_funcs.C (ToggleAndShow): ditto
5646 2000-05-30 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5648 * src/text.C (DeleteLineForward): set selection to true to avoid
5649 that DeleteEmptyParagraphMechanism does some magic. This is how it
5650 is done in all other functions, and seems reasonable.
5651 (DeleteWordForward): do not jump over non-word stuff, since
5652 CursorRightOneWord() already does it.
5654 Remove the CHECK tag from DeleteLineForward, DeleteWordForward and
5655 DeleteWordBackward, since they seem safe to me (since selection is
5656 set to "true") DeleteEmptyParagraphMechanism does nothing.
5658 2000-05-29 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5660 * src/lyx_main.C (easyParse): simplify the code by factoring the
5661 part that removes parameters from the command line.
5662 (LyX): check wether wrong command line options have been given.
5664 2000-05-29 Lior Silberman <slior@math.huji.ac.il>
5666 * src/lyx_main.C : add support for specifying user LyX
5667 directory via command line option -userdir.
5669 2000-05-26 Dekel Tsur <dekel@math.tau.ac.il>
5671 * src/menus.C (Add_to_toc_menu): Limit the number of popups, and
5672 the number of items per popup.
5673 (Add_to_refs_menu): Ditto.
5675 2000-05-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5677 * src/lyxparagraph.h: renamed ClearParagraph() to
5678 StripLeadingSpaces() and moved it to paragraph.C. We pass the
5679 textclass as parameter, and do nothing if free_spacing is
5680 true. This fixes part of the line-delete-forward problems.
5682 * src/CutAndPaste.C (cutSelection): use StripLeadingSpaces.
5683 (pasteSelection): ditto.
5684 (SwitchLayoutsBetweenClasses): more translatable strings.
5686 * src/text2.C (CutSelection): use StripLeadingSpaces.
5687 (PasteSelection): ditto.
5688 (DeleteEmptyParagraphMechanism): ditto.
5690 2000-05-26 Juergen Vigna <jug@sad.it>
5692 * src/TabularLayout.C (TabularOptionsCB): removed delete-table as this
5693 is not needed in tabular insets.
5695 * src/insets/insettabular.C (TabularFeatures): added missing features.
5697 * src/tabular.C (DeleteColumn):
5699 (AppendRow): implemented this functions
5700 (cellsturct::operator=): clone the inset too;
5702 2000-05-23 Juergen Vigna <jug@sad.it>
5704 * src/insets/insettabular.C (LocalDispatch): better selection support
5705 when having multicolumn-cells.
5707 2000-05-26 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
5709 * lib/layouts/linuxdoc.layout: fix indentation of paragraphs.
5711 2000-05-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5713 * src/ColorHandler.C (getGCForeground): put more test into _()
5715 * lib/examples/eu_splash.lyx: new file (Basque translation) from
5718 * config/lyxinclude.m4 (LYX_PROG_CXX): use ${CXX} and not g++ to
5721 2000-05-25 Dekel Tsur <dekel@math.tau.ac.il>
5723 * src/lyx_cb.C (RefUpdateCB): disable appropriate buttons when
5724 there are no labels, or when buffer is readonly.
5726 * src/menus.C (ShowRefsMenu) disable appropriate menu items when
5727 there are no labels, buffer is SGML, or when buffer is readonly.
5729 2000-05-25 Lars Gullik Bjønnes <larsbj@lyx.org>
5731 * src/LColor.C (LColor): change a couple of grey40 to grey60
5732 (LColor): rewore initalization to make compiles go some magnitude
5734 (getGUIName): don't use gettext until we need the string.
5736 2000-05-09 Dekel Tsur <dekel@math.tau.ac.il>
5738 * src/Bullet.[Ch]: Fixed a small bug.
5740 2000-05-21 Dekel Tsur <dekel@math.tau.ac.il>
5742 * src/paragraph.C (String): Several fixes/improvements
5744 * src/insets/insetbib.[Ch] (InsetCitation::Ascii) New method
5746 2000-05-22 Lars Gullik Bjønnes <larsbj@lyx.org>
5748 * src/paragraph.C (String): give more correct output.
5750 2000-05-20 Dekel Tsur <dekel@math.tau.ac.il>
5752 * src/lyxfont.C (stateText) Do not output the language if it is
5753 eqaul to the language of the document.
5755 * src/paragraph.C (TeXOnePar): Do not put language switch commands
5756 between two paragraphs with the same language.
5758 * src/paragraph.C (getParLanguage) Return a correct answer for an
5759 empty dummy paragraph.
5761 * src/menus.C (ShowTocMenu): Do not draw lines between LOF/LOT/LOA
5764 * src/menus.C (ShowLayoutMenu) Add "Start of Appendix" item to the
5767 * src/lyx_gui.C (init): Try to use helvetica (or fixed) fonts for
5768 the menus/popup, if requested fonts are unavailable.
5770 2000-05-22 Juergen Vigna <jug@sad.it>
5772 * src/insets/insettabular.C (LocalDispatch): added some more cursor
5773 movement support (Up/Down/Tab/Shift-Tab).
5774 (LocalDispatch): added also preliminari cursor-selection.
5776 * src/LyXAction.C (init): added SHIFT-Tab as tab-backward.
5778 * src/paragraph.C (PasteParagraph): Hopefully now right!
5780 2000-05-22 Garst R. Reese <reese@isn.net>
5782 * layouts/hollywood.layout, broadway.layout : move Dialogue to top
5783 of list, change all references to Environment to Command
5784 * tex/hollywood.cls : rewrite environments as commands, add
5785 \uppercase to interiorshot and exteriorshot to force uppecase.
5786 * tex/broadway.cls : rewrite environments as commands. Tweak
5789 2000-05-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5791 * src/menus.C (Add_to_toc_menu): fix the code which limits the
5792 size of items: use a constant intead of the hardcoded 40, and more
5793 importantly do not remove the %m and %x tags added at the end.
5794 (Add_to_refs_menu): use vector::size_type instead of
5795 unsigned int as basic types for the variables. _Please_ do not
5796 assume that size_t is equal to unsigned int. On an alpha, this is
5797 unsigned long, which is _not_ the same.
5799 * src/language.C (initL): remove language "hungarian", since it
5800 seems that "magyar" is better.
5802 2000-05-22 Juergen Vigna <jug@sad.it>
5804 * src/CutAndPaste.C: hopefully fixed memory the problem defenitively!
5806 * src/tabular.C (OldFormatRead): added \end_deeper to the end LyXTable
5809 * src/paragraph.C (PasteParagraph): Possibly a memory leak as
5810 next was deleted but not set to 0.
5812 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5814 * src/language.C (initL): change the initialization of languages
5815 so that compiles goes _fast_.
5817 * src/menus.C (Add_to_toc_menu): limit the line length in TOC to
5820 * src/lyxfunc.C (processKeyEvent): initalize keysym_return to 0.
5822 2000-05-21 Lars Gullik Bjønnes <larsbj@lyx.org>
5826 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5828 * src/WorkArea.C (request_clipboard_cb): give "C" linkage.
5830 2000-05-19 Dekel Tsur <dekel@math.tau.ac.il>
5834 * src/lyxfunc.C (Dispatch): Added LFUN_LOFVIEW, LFUN_LOTVIEW
5837 * src/insets/insetlo*.[Ch]: Made editable
5839 2000-05-20 Lars Gullik Bjønnes <larsbj@lyx.org>
5841 * src/text2.C (SetSelection): call BufferView::stuffClipboard with
5842 the current selection.
5844 * src/BufferView_pimpl.C (stuffClipboard): new method
5846 * src/BufferView.C (stuffClipboard): new method
5848 * src/paragraph.C (String): new method
5850 * src/LColor.C (getFromLyXName): return LColor::inherit instead of
5851 LColor::ignore when lyxname is not found.
5853 * src/BufferView.C (pasteSelection): new method
5855 * src/BufferView_pimpl.C (pasteSelection): new method
5857 * src/lyxfunc.C (Dispatch): use the new clipboard functions.
5859 * src/WorkArea.C (request_clipboard_cb): new static function
5860 (getClipboard): new method
5861 (putClipboard): new method
5863 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5865 * LyX 1.1.5pre2 released
5867 2000-05-19 Lars Gullik Bjønnes <larsbj@lyx.org>
5869 * src/vspace.C (operator=): removed
5870 (operator=): removed
5872 * src/lyx_gui_misc.C (askForText): manually set the type in make_pair
5874 * src/layout.C (NumberOfClass): manually set the type in make_pair
5875 (NumberOfLayout): ditto
5877 * src/language.C: use the Language constructor for ignore_lang
5879 * src/language.h: add constructors to struct Language
5881 * src/BufferView_pimpl.C (scrollDown): change to pair<float, float>
5883 * src/text2.C (SetCursorIntern): comment out #warning
5885 * src/mathed/math_symbols.C (pixmapFromBitmapData): add const_cast
5887 * src/mathed/math_iter.h: initialize sx and sw to 0
5889 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
5891 * forms/lyx.fd: Redesign of form_ref
5893 * src/LaTeXFeatures.[Ch]
5897 * src/insets/insetref.[Ch]: Added support for varioref and prettyref.
5900 * src/lyxparagraph.h: Added new classes: LyXParagraph::inset_iterator
5901 and Buffer::inset_iterator.
5903 * src/menus.C: Added new menus: TOC and Refs.
5905 * src/insets/insetlabel.C (Edit) Made InsetLabel editable.
5907 * src/buffer.C (getTocList): New method.
5909 * src/BufferView2.C (ChangeRefs): New method.
5911 * src/buffer.C (getLabelList): New method. It replaces the old
5912 getReferenceList. The return type is vector<string> instead of
5915 * src/insets/insetinclude.C (getLabelList): New method. Replaces
5916 the old getLabel() and GetNumberOfLabels() methods.
5917 * src/insets/insetlabel.C (getLabelList): ditto
5918 * src/mathed/formula.C (getLabelList): ditto
5920 * src/paragraph.C (String): New method.
5922 * src/lyx_cb.C (TocSelectCB,TocUpdateCB): Rewritten.
5923 Uses the new getTocList() method.
5924 TocSelectCB() now calls to TocUpdateCB() before moving the cursor,
5925 which automatically updates the contents of the browser.
5926 (RefUpdateCB): Use the new getLabelList method.
5928 * src/lyxfunc.C (Dispatch): Give an error if the label is not found.
5930 * src/BufferView2.C (gotoLabel) Use the new getLabelList method.
5932 * src/spellchecker.C: Added using std::reverse;
5934 2000-05-19 Juergen Vigna <jug@sad.it>
5936 * src/tabular.C (Validate): fixed/added validating of LaTeXFeatures.
5938 * src/insets/insettext.C (computeTextRows): small fix for display of
5939 1 character after a newline.
5941 * src/tabular.C (OldFormatRead): fixed the OldFormatRead with regard
5944 2000-05-18 Juergen Vigna <jug@sad.it>
5946 * src/insets/insettabular.C (TabularFeatures): fixed update of display
5947 when changing width of column.
5949 * src/tabular.C (set_row_column_number_info): setting of
5950 autobreak rows if necessary.
5952 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5954 * src/lyxvc.C (toggleReadOnly): use VCS::status() instead of stat()
5956 * src/vc-backend.*: renamed stat() to status() and vcstat to
5957 vcstatus. It happens that Tru64 Unix 5.0 has stat() as a macro and
5958 compilation broke. The new name seems more relevant, anyway.
5960 2000-05-17 Juergen Vigna <jug@sad.it>
5962 * src/BufferView2.C (removeAutoInsets): fixed use of AutoDeleteInsets
5963 which was wrong if the removing caused removing of rows!
5965 * src/lyxlex_pimpl.C (next, nextToken): insert support for pushToken.
5966 (pushToken): new function.
5968 * src/text2.C (CutSelection): fix problem discovered with purify
5970 2000-05-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
5972 * src/debug.C (showTags): enlarge the first column, now that we
5973 have 6-digits debug codes.
5975 * lib/layouts/hollywood.layout:
5976 * lib/tex/hollywood.cls:
5977 * lib/tex/brodway.cls:
5978 * lib/layouts/brodway.layout: more commands and fewer
5979 environments. Preambles moved in the .cls files. Broadway now has
5980 more options on scene numbering and less whitespace (from Garst)
5982 * src/insets/insetbib.C (getKeys): make sure that we are in the
5983 document directory, in case the bib file is there.
5985 * src/insets/insetbib.C (Latex): revert bogus change.
5987 2000-05-16 Juergen Vigna <jug@sad.it>
5989 * src/insets/insettabular.C (UnlockInsetInInset): Changes to update
5990 the TabularLayout on cursor move.
5992 * src/TabularLayout.C (TabularOptionsCB): Wrong call to MenuLayoutTable
5994 * src/insets/insettabular.C (Clone): Clone the LyXTabular for
5997 (draw): fixed cursor position and drawing so that the cursor is
5998 visible when before the tabular-inset.
6000 * src/insets/insettext.C (init): drawLockedFrame was not initialized
6001 when creating from old insettext.
6003 * src/tabular.C (Clone): added Clone of text-inset for undo-handling.
6005 2000-05-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6007 * lib/tex/hollywood.cls: better algorithm for page breaks (Garst)
6008 * lib/tex/brodway.cls: ditto
6010 * lib/layouts/brodway.layout: change alignment of parenthical
6013 2000-05-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6015 * config/lyxinclude.m4 (LYX_PATH_XFORMS): make it clear that only
6016 versions 0.88 and 0.89 are supported.
6018 2000-05-15 Juergen Vigna <jug@sad.it>
6020 * src/insets/insetcollapsable.C (draw): enhancements in drawing and
6023 * src/insets/insettext.C (computeTextRows): redone completely this
6024 function in a much cleaner way, because of problems when having a
6026 (draw): added a frame border when the inset is locked.
6027 (SetDrawLockedFrame): this sets if we draw the border or not.
6028 (SetFrameColor): this sets the frame color (default=insetframe).
6030 * src/insets/lyxinset.h: added x() and y() functions which return
6031 the top_x and top_baseline values. Added a GetFirstLockingInsetOfType
6032 function which is needed to see if we have a locking inset of some
6033 type in this inset (needed for now in insettabular).
6035 * src/vspace.C (inPixels): the same function also without a BufferView
6036 parameter as so it is easier to use it in some ocasions.
6038 * src/lyxfunc.C: changed all places where insertInset was used so
6039 that now if it couldn't be inserted it is deleted!
6041 * src/TabularLayout.C:
6042 * src/TableLayout.C: added support for new tabular-inset!
6044 * src/BufferView2.C (insertInset): this now returns a bool if the
6045 inset was really inserted!!!
6047 * src/tabular.C (GetLastCellInRow):
6048 (GetFirstCellInRow): new helper functions.
6049 (Latex): implemented for new tabular class.
6053 (TeXTopHLine): new Latex() helper functions.
6055 2000-05-12 Juergen Vigna <jug@sad.it>
6057 * src/mathed/formulamacro.C (Read):
6058 * src/mathed/formula.C (Read): read also the \end_inset here!
6060 2000-05-10 Dekel Tsur <dekel@math.tau.ac.il>
6062 * src/mathed/math_write.C (MathParInset::Write): Fixed a bug:
6063 crush when saving formulae with unbalanced parenthesis.
6065 20000-05-11 Dekel Tsur <dekel@math.tau.ac.il>
6067 * src/layout.C: Add new keyword "endlabelstring" to layout file
6069 * src/text.C (GetVisibleRow): Draw endlabel string.
6071 * lib/layouts/broadway.layout
6072 * lib/layouts/hollywood.layout: Added endlabel for the
6073 Parenthetical layout.
6075 * lib/layouts/heb-article.layout: Do not use slanted font shape
6076 for Theorem like environments.
6078 * src/buffer.C (makeLaTeXFile): Always add "american" to
6079 the UsedLanguages list if document language is RTL.
6081 2000-05-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6083 * add addendum to README.OS2 and small patch (from SMiyata)
6085 2000-05-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6087 * many files: correct the calls to ChangeExtension().
6089 * src/support/filetools.C (ChangeExtension): remove the no_path
6090 argument, which does not belong there. Use OnlyFileName() instead.
6092 * src/insets/insetbib.C (Latex): use absolute paths for bibtex
6093 files when LaTeXing a non-nice latex file.
6095 * src/lyxlookup.C (isDeadEvent): use a switch statement instead of
6096 a chain of "if". Return false when deadkeys are not handled.
6098 * src/lyx_main.C (LyX): adapted the code for default bindings.
6100 * src/kbmap.C (defaultKeyBindings): new method. Performs the default
6101 bindings for basic functionality (except deadkeys).
6102 (deadKeyBindings): new method. Performs the bindings of deadkeys.
6104 * src/lyxrc.C (defaultKeyBindings): moved to lyx_main.C
6105 several methods: handle override_x_deadkeys.
6107 * src/lyxrc.h: remove the "bindings" map, which did not make much
6108 sense anyway. New variable override_x_deadkeys, defaulting to "true".
6110 2000-05-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6112 * src/lyxfont.C (stateText): use a saner method to determine
6113 whether the font is "default". Seems to fix the crash with DEC
6116 * src/Bullet.[Ch] (Bullet): remove const on parameters.
6118 2000-05-08 Juergen Vigna <jug@sad.it>
6120 * src/insets/insettabular.C (InsetButtonRelease): Now opens the
6121 TabularLayoutMenu with mouse-button-3
6122 (LocalDispatch): added LFUN_MENU_LAYOUT to open the Tabular-Layout.
6124 * src/TabularLayout.C: added this file for having a Layout for
6127 2000-05-05 Juergen Vigna <jug@sad.it>
6129 * src/insets/insettabular.C (UpdateLocal): resetCursorPos when
6130 recalculating inset-widths.
6131 (TabularFeatures): activated this function so that I can change
6132 tabular-features via menu.
6134 * src/menus.C (ShowEditMenu): inserted support for insettabular so
6135 that I can test some functions with the Table menu.
6137 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6139 * src/lyxfont.C (stateText): guard against stupid c++libs.
6141 * src/tabular.C: add using std::vector
6142 some whitespace changes, + removed som autogenerated code.
6144 * src/buffer.C (parseSingleLyXformat2Token): stupid bug.
6146 2000-05-05 Juergen Vigna <jug@sad.it>
6148 * src/tabular.[Ch]: now using std:vector instead of arrays for all the
6149 row, columns and cellstructures.
6151 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6153 * lib/lyxrc.example: remove obsolete entries.
6155 * src/buffer.C (parseSingleLyXformat2Token): patch from dekel, fix
6156 reading of protected_separator for free_spacing.
6158 2000-05-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6160 * src/text.C (draw): do not display an exclamation mark in the
6161 margin for margin notes. This is confusing, ugly and
6164 * src/LaTeXFeatures.C (getPackages): load amssymb also when 'Use
6165 AMS math' is checked.
6167 * src/buffer.C (makeLaTeXFile): do not depend on the textclass
6168 name to see whether including the amsmath package is needed.
6170 2000-05-05 Dekel Tsur <dekel@math.tau.ac.il>
6172 * src/paragraph.C (validate): Compute UsedLanguages correctly
6173 (don't insert the american language if it doesn't appear in the
6176 * src/paragraph.C (TeXOnePar,SimpleTeXOnePar,SimpleTeXSpecialChars)
6177 The argument of \thanks{} command is considered moving argument
6179 * src/paragraph.C (SimpleTeXOnePar): Put \protect before \\ if in
6182 2000-05-04 Dekel Tsur <dekel@math.tau.ac.il>
6184 * src/text.C (GetVisibleRow): Improved drawing of vertical lines
6185 for appendix/minipage/depth. The lines can be now both in the footnote
6186 frame, and outside the frame.
6188 * src/text.C (SingleWidth,draw): Correct rendering of Hebrew vowels
6191 2000-05-05 Juergen Vigna <jug@sad.it>
6193 * src/table.[Ch]: removed the inset and buffer stuff as this is now
6194 neede only in tabular.[Ch].
6196 2000-05-05 Lars Gullik Bjønnes <larsbj@lyx.org>
6198 * src/insets/insetspecialchar.C (Read): allow command == '~' for
6200 (Write): write '~' for PROTECTED_SEPARATOR
6202 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6204 * src/lyxparagraph.h: add a friend struct matchIT after the struct
6207 * src/mathed/formula.C (drawStr): rename size to siz.
6209 * src/insets/figinset.C (RestoreForm): rename pflags to piflags,
6210 possibly fix a bug by not changing the pflags = flags to piflags =
6213 2000-05-05 Juergen Vigna <jug@sad.it>
6215 * src/insets/insetbib.C: moved using directive
6217 * src/ImportNoweb.C: small fix for being able to compile (missing
6220 2000-05-04 Lars Gullik Bjønnes <larsbj@lyx.org>
6222 * config/lyxinclude.m4 (LYX_CXX_STL_STRING): change the test not
6223 to use clear, since we don't depend on this in the code. Add test
6226 2000-05-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6228 * (various *.C files): add using std::foo directives to please dec
6231 * replace calls to string::clear() to string::erase() (Angus)
6233 * src/cheaders/cmath: modified to provide std::abs.
6235 2000-05-04 Juergen Vigna <jug@sad.it>
6237 * src/insets/insettext.C: Prepared all for inserting of multiple
6238 paragraphs. Still display stuff to do (alignment and other things),
6239 but I would like to use LyXText to do this when we cleaned out the
6240 table-support stuff.
6242 * src/insets/insettabular.C: Changed lot of stuff and added lots
6243 of functionality still a lot to do.
6245 * src/tabular.C: Various functions changed name and moved to be
6246 const functions. Added new Read and Write functions and changed
6247 lots of things so it works good with tabular-insets (also removed
6248 some stuff which is not needed anymore * hacks *).
6250 * src/lyxcursor.h: added operators == and != which just look if
6251 par and pos are (not) equal.
6253 * src/buffer.C (latexParagraphs): inserted this function to latex
6254 all paragraphs form par to endpar as then I can use this too for
6257 * src/text2.C (SetLayout): Changed this to use a cursor this is needed
6258 so that I can call this to from text insets with their own cursor.
6260 * src/buffer.C (makeLaTeXFile): added the output of one \n after the
6261 output off all paragraphs (because of the fix below)!
6263 * src/paragraph.C (TeXOnePar): removed output of \n when we are in
6264 the very last paragraph (this could be also the last paragraph of an
6267 * src/texrow.h: added rows() call which returns the count-variable.
6269 2000-05-03 Jose Abilio Oliveira Matos <jamatos@novalis.fc.up.pt>
6271 * lib/lyxrc.example: fix examples for exporting SGML to HTML.
6273 * lib/configure.m4: better autodetection of DocBook tools.
6275 2000-04-28 Lars Gullik Bjønnes <larsbj@lyx.org>
6277 * src/lyx_main.C (easyParse): use lyxerr instead of cerr.
6279 * src/lyx_cb.C: add using std::reverse;
6281 * src/LaTeX.C (run): on error always run deleteFilesOnError before
6284 * src/LaTeX.[Ch] (deleteFilesOnError): new method. unlinks some
6285 selected files. Should fix repeated errors from generated files.
6287 2000-04-27 Dekel Tsur <dekel@math.tau.ac.il>
6289 * src/lyx_cb.C (TocUpdateCB): Reverse strings for Hebrew paragraphs
6291 * src/spellchecker.C (RunSpellChecker): Reverse Hebrew strings in
6292 the spellchecker popup.
6294 * lib/lyxrc.example: Removed the \number_inset section
6296 2000-04-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6298 * src/insets/figinset.C (various): Use IsFileReadable() to make
6299 sure that the file actually exist. Relying on ghostscripts errors
6300 is a bad idea since they can lead to X server crashes.
6302 2000-04-27 Claus Hentschel <claus.hentschel@mbau.fh-hannover.de>
6304 * intl/loadmsgcat.c (_nl_load_domain): pass O_BINARY as flag to
6307 * lib/lyxrc.example: smallish typo in description of
6308 \view_dvi_paper_option
6310 2000-04-26 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
6313 * src/lyxfunc.C: doImportHelper to factor out common code of the
6314 various import methods. New functions doImportASCIIasLines,
6315 doImportASCIIasParagraphs, doImportLaTeX, doImportNoWeb,
6316 doImportLinuxDoc for the format specific parts.
6319 * buffer.C: Dispatch returns now a bool to indicate success
6322 * lyx_gui.C: Add getLyXView() for member access
6324 * lyx_main.C: Change logic for batch commands: First try
6325 Buffer::Dispatch (possibly without GUI), if that fails, use
6328 * lyx_main.C: Add support for --import command line switch.
6329 Now 'lyx --import ascii file.txt' opens the GUI with file.txt loaded.
6330 Available Formats: Everything accepted by 'buffer-import <format>'
6332 2000-04-27 Lars Gullik Bjønnes <larsbj@lyx.org>
6334 * src/lyx_gui.C (create_forms): small oneliner from Garst to have
6337 * src/lyx_cb.C (ScreenApplyCB): clear the textcache so that the
6338 documents will be reformatted upon reentry.
6340 2000-04-27 Juergen Vigna <jug@sad.it>
6342 * src/CutAndPaste.C (pasteSelection): last paragraph was not returned
6343 correctly only last pos this was a bug.
6345 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6347 * release of lyx-1.1.5pre1
6349 2000-04-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6351 * src/insets/insettabular.[Ch]: fix the Clone() declaration.
6353 * src/menus.C: revert the change of naming (Figure->Graphic...)
6354 from 2000-04-11. It was incomplete and bad.
6356 * src/LColor.[Ch]: add LColor::depthbar.
6357 * src/text.C (GetVisibleRow): use it.
6359 * README: update the languages list.
6361 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6363 * src/text.C (GetVisibleRow): show the depth of paragraphs using
6366 2000-04-26 Lars Gullik Bjønnes <larsbj@lyx.org>
6368 * README: remove sections that were just wrong.
6370 * src/text2.C (GetRowNearY): remove currentrow code
6372 * src/text.C (GetRow): remove currentrow code
6374 * src/screen.C (Update): rewritten a bit.
6375 (SmallUpdate): removed func
6377 * src/lyxtext.h (text_status): removed NEED_LITTLE_REFRESH, never
6379 (FullRebreak): return bool
6380 (currentrow): remove var
6381 (currentrow_y): ditto
6383 * src/lyxscreen.h (Draw): change arg to unsigned long
6384 (FitCursor): return bool
6385 (FitManualCursor): ditto
6386 (Smallpdate): remove func
6387 (first): change to unsigned long
6388 (DrawOneRow): change second arg to long (from long &)
6389 (screen_refresh_y): remove var
6390 (scree_refresh_row): ditto
6392 * src/lyxrow.h: change baseline to usigned int from unsigned
6393 short, this brings some implicit/unsigned issues out in the open.
6395 * src/lyxfunc.C (moveCursorUpdate): update(0) == update(-2) change
6397 (Dispatch): don't call updateScrollbar after fitCursor. Use update
6398 instead of smallUpdate.
6400 * src/lyxcursor.h: change y to unsigned long
6402 * src/buffer.h: don't call updateScrollbar after fitcursor
6404 * src/buffer.C (parseSingleLyXformat2Token): move variables to
6405 where they are used. Removed "\\direction", this was not present
6406 in 1.1.4 and is already obsolete. Commented out some code that I
6407 believe to never be called.
6408 (runLiterate): don't call updateScrollbar after fitCursor
6410 (buildProgram): ditto
6413 * src/WorkArea.h (workWidth): change return val to unsigned
6416 (redraw): remove the button redraws
6417 (setScrollbarValue): change for scrollbar
6418 (getScrollbarValue): change for scrollbar
6419 (getScrollbarBounds): change for scrollbar
6421 * src/WorkArea.C (C_WorkArea_up_cb): removed func
6422 (C_WorkArea_down_cb): removed func
6423 (WorkArea): use fl_add_scrollbar instead of two buttons and a slider.
6424 (resize): change for scrollbar
6425 (setScrollbar): ditto
6426 (setScrollbarBounds): ditto
6427 (setScrollbarIncrements): ditto
6428 (up_cb): removed func
6429 (down_cb): removed func
6430 (scroll_cb): change for scrollbar
6431 (work_area_handler): ditto
6433 * src/BufferView_pimpl.C (fitCursor): only call updateScrollbar
6434 when FitCursor did something.
6435 (updateScrollbar): some unsigned changes
6436 (downCB): removed func
6437 (scrollUpOnePage): removed func
6438 (scrollDownOnePage): remvoed func
6439 (workAreaMotionNotify): don't call screen->FitCursor but use
6440 fitCursor instead. and bool return val
6441 (workAreaButtonPress): ditto
6442 (workAreaButtonRelease): some unsigned changes
6443 (checkInsetHit): ditto
6444 (workAreaExpose): ditto
6445 (update): parts rewritten, comments about the signed char arg added
6446 (smallUpdate): removed func
6447 (cursorPrevious): call needed updateScrollbar
6450 * src/BufferView2.C (allFloats): don't call updateScrollbar after
6453 * src/BufferView.[Ch] (upCB): removed func
6454 (downCB): removed func
6455 (smallUpdate): removed func
6457 2000-04-25 Lars Gullik Bjønnes <larsbj@lyx.org>
6459 * src/lyxtext.h src/text.C src/text2.C: removed support for the
6460 currentrow, currentrow_y optimization. This did not help a lot and
6461 if we want to do this kind of optimization we should rather use
6462 cursor.row instead of the currentrow.
6464 * src/buffer.C (parseSingleLyXformat2Token): fixed mistake in
6465 buffer spacing and klyx spacing support.
6467 2000-04-25 Dekel Tsur <dekel@math.tau.ac.il>
6469 * src/spellchecker.C (RunSpellChecker): Speedup spellchecking by
6472 2000-04-26 Juergen Vigna <jug@sad.it>
6474 * src/insets/figinset.C: fixes to Lars sstream changes!
6476 2000-04-23 Dekel Tsur <dekel@math.tau.ac.il>
6478 * A lot of files: Added Ascii(ostream &) methods to all inset
6479 classes. Used when exporting to ASCII.
6481 * src/buffer.C (writeFileAscii,RoffAsciiTable)
6482 * src/paragraph.C (RoffContTableRows): Use the Ascii() methods
6485 * src/text2.C (ToggleFree): Disabled implicit word selection when
6486 there is a change in the language
6488 * src/insets/insetspecialchar.C (Linuxdoc,DocBook): Fixed a bug:
6489 no output was generated for end-of-sentence inset.
6491 * src/insets/lyxinset.h
6494 * src/paragraph.C: Removed the insetnumber code
6496 * src/text.C (SelectWordWhenUnderCursor): Cleaned the code.
6498 2000-04-22 Lars Gullik Bjønnes <larsbj@lyx.org>
6500 * src/buffer.C (parseSingleLyXformat2Token): remove no_isolatin1,
6501 no_babel and no_epsfig completely from the file.
6502 (parseSingleLyXformat2Token): add handling for per-paragraph
6503 spacing as written by klyx.
6505 * src/insets/figinset.C: applied patch by Andre. Made it work with
6508 2000-04-20 Juergen Vigna <jug@sad.it>
6510 * src/insets/insettext.C (cutSelection):
6511 (copySelection): Fixed with selection from right to left.
6512 (draw): now the rows are not recalculated at every draw.
6513 (computeTextRows): for now reset the inset-owner here (this is
6514 important for an undo or copy where the inset-owner is not set
6517 * src/BufferView_pimpl.C (workAreaMotionNotify): when passing the
6518 motion to the_locking_inset screen->first was forgotten, this was
6519 not important till we got multiline insets.
6521 2000-04-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6523 * src/mathed/formulamacro.C (Latex): remove CHECK comment, since
6524 code seems to be alright (it is code changed by Dekel, and the
6525 intent is indeed that all macros should be defined \protect'ed)
6527 * NEWS: a bit of reorganisation of the new user-visible features.
6529 2000-04-19 Juergen Vigna <jug@sad.it>
6531 * src/insets/insettext.C (init): using a LyXCursor now for cursor
6532 position. Set the inset_owner of the used paragraph so that it knows
6533 that it is inside an inset. Fixed cursor handling with mouse and
6534 cursor keys. Fixed wrong timed inset redraws and lots of other changes
6535 and cleanups to make TextInsets work better.
6537 * src/insets/insettext.h: Using a LyXCursor now. Added a clear() call.
6538 Changed parameters of various functions and added LockInsetInInset().
6540 * src/insets/insettext.C:
6542 * src/insets/insetcollapsable.h:
6543 * src/insets/insetcollapsable.C:
6544 * src/insets/insetfoot.h:
6545 * src/insets/insetfoot.C:
6546 * src/insets/insetert.h:
6547 * src/insets/insetert.C: cleaned up the code so that it works now
6548 correctly with insettext.
6550 * src/insets/inset.C:
6551 * src/insets/lyxinset.h: inserted inset_owner and some more changes so
6552 that insets in insets are supported right.
6555 * src/table.C: lots of changes for use with inset tabular (and cleanup)
6557 * src/paragraph.C: some small fixes
6559 * src/debug.h: inserted INSETS debug info
6561 * src/lyxfunc.C (Dispatch): added code for InsetTabular and some inset
6562 fixes (f.ex. calling LFUN_DOWN if exiting inset with LFUN_DOWN).
6564 * src/commandtags.h:
6565 * src/LyXAction.C: insert code for InsetTabular.
6567 * src/BufferView_pimpl.C (workAreaMotionNotify): do return always if
6568 not Button1MotionMask.
6569 (workAreaButtonRelease): send always a InsetButtonRelease event to
6571 (checkInsetHit): some setCursor fixes (always with insets).
6573 * src/BufferView2.C (lockInset): returns a bool now and extended for
6574 locking insets inside insets.
6575 (showLockedInsetCursor): it is important to have the cursor always
6576 before the locked inset.
6577 (fitLockedInsetCursor): forgot adding of InsetInInsetY()-offset.
6579 * src/BufferView.h: made lockInset return a bool.
6581 * src/lyxtext.h: inserted function SetCursor(LyXCursor, ...).
6583 * src/text2.C (SetCursor): This now has a version with a LyXCursor
6584 that is used also internally but can be called as public to have back
6585 a cursor pos which is not set internally.
6586 (SetCursorIntern): Changed to use above function.
6588 * src/CutAndPaste.C (DeleteBuffer): forgot to inizialize textclass
6590 2000-04-19 Lars Gullik Bjønnes <larsbj@lyx.org>
6595 * NEWS: updated for prerelease of 1.1.5. Please comment and send
6596 patches for things that should be in or should be changed.
6598 * src/* [insetfiles]: change "usigned char fragile" to bool
6599 fragile. There was only one point that could that be questioned
6600 and that is commented in formulamacro.C. Grep for "CHECK".
6602 * src/CutAndPaste.C (getBufferTextClass): unused func, removed.
6603 (DeleteBuffer): take it out of CutAndPaste and make it static.
6605 2000-04-17 Lars Gullik Bjønnes <larsbj@lyx.org>
6607 * src/paragraph.C (TeXOnePar): use the new method in Spacing to
6608 output the spacing envir commands. Also the new commands used in
6609 the LaTeX output makes the result better.
6611 * src/Spacing.C (writeEnvirBegin): new method
6612 (writeEnvirEnd): new method
6614 2000-04-18 Juergen Vigna <jug@sad.it>
6616 * src/CutAndPaste.C: made textclass a static member of the class
6617 as otherwise it is not accesed right!!!
6619 2000-04-17 Dekel Tsur <dekel@math.tau.ac.il>
6621 * forms/layout_forms.fd
6622 * src/layout_forms.h
6623 * src/layout_forms.C (create_form_form_character)
6624 * src/lyx_cb.C (UserFreeFont)
6625 * src/lyx_gui.C (create_forms): Added GUI support for multi-lingual
6626 documents (in the layout->character popup).
6628 2000-04-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6630 * src/spellchecker.C (create_ispell_pipe): fix a bug where
6631 \spell_command was in fact not honored (from Kevin Atkinson).
6633 * src/lyx_gui.C (~LyXGUI): make sure lyxViews is deleted when
6636 * src/lyx_gui.h: make lyxViews private (Angus)
6638 2000-04-15 Dekel Tsur <dekel@math.tau.ac.il>
6640 * src/mathed/math_write.C
6641 (MathMatrixInset::Write) Put \protect before \begin{array} and
6642 \end{array} if fragile
6643 (MathParInset::Write): Put \protect before \\ if fragile
6645 2000-04-15 Lars Gullik Bjønnes <larsbj@lyx.org>
6647 * src/lyx_gui.C (LyXGUI): initialize the LyXColorHandler. The
6648 initialization if the LyXColorHandler must be done after the
6649 connections to the XServer has been established.
6651 * src/insets/figinset.C (runqueue): change the grabing a bit. Also
6652 get the background pixel from the lyxColorhandler so that the
6653 figures are rendered with the correct background color.
6654 (NextToken): removed functions.
6655 (GetPSSizes): use ifs >> string instead of NextToken.
6657 * src/Painter.[Ch]: the color cache moved out of this file.
6659 * src/ColorHandler.[Ch]: new files. Holds the gc cache for color
6662 2000-04-14 Lars Gullik Bjønnes <larsbj@lyx.org>
6664 * src/WorkArea.C (work_area_handler): call BufferView::enterView
6665 and Buffer::leaveView when FL_ENTER and FL_LEAVE.
6667 * src/BufferView.C (enterView): new func
6668 (leaveView): new func
6670 * src/BufferView_pimpl.C (enterView): new func, sets xterm cursor
6672 (leaveView): new func, undefines xterm cursor when approp.
6674 * src/bufferview_funcs.C: moved SetXCursor to BufferView_pimp.C
6675 (AllowInput): delete the Workarea cursor handling from this func.
6677 * src/Painter.C (underline): draw a slimer underline in most cases.
6679 * src/lyx_main.C (error_handler): use extern "C"
6681 2000-04-12 Lars Gullik Bjønnes <larsbj@lyx.org>
6683 * src/insets/figinset.C (DocBook): small patch from Jose (jamatos)
6684 sent directly to me.
6686 * src/text2.C (DeleteEmptyParagraphMechanism): small patch posted
6687 to the list by Dekel.
6689 * src/lyxfunc.C (Dispatch): make PARAGRAPH_SPACING compile with
6692 * src/bufferview_funcs.[Ch]: two new files, moved several of the
6693 methods from lyx_cb.here.
6695 * src/lyx_cb.C: in addition to the above; removed input_prohibited
6698 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6700 * src/lyx_cb.[Ch]: made several functions take a BufferView* arg
6701 instead of using current_view directly.
6703 * src/lyxfunc.C (Dispatch): the paragraph-spacing implementation
6705 * src/LyXAction.C (init): add the paragraph-spacing command.
6707 * src/commandtags.h: add enum for LFUN_PARAGRAPH_SPACING
6709 * src/buffer.C (parseSingleLyXformat2Token): read the paragraph spacing
6711 * src/lyx_cb.C (CurrentState): output a string when the spacing is
6712 different from the documents.
6714 * src/text.C (SetHeightOfRow): take paragraph spacing into
6715 account, paragraph spacing takes precedence over buffer spacing
6716 (GetVisibleRow): ditto
6718 * src/paragraph.C (writeFile): output the spacing parameter too.
6719 (validate): set the correct features if spacing is used in the
6721 (Clear): set spacing to default
6722 (MakeSameLayout): spacing too
6723 (HasSameLayout): spacing too
6724 (SetLayout): spacing too
6725 (TeXOnePar): output the spacing commands
6727 * src/lyxparagraph.h: added a spacing variable for use with
6728 per-paragraph spacing.
6730 * src/Spacing.h: add a Default spacing and a method to check if
6731 the current spacing is default. also added an operator==
6733 * src/text2.C (DeleteEmptyParagraphMechanism): added a
6736 2000-04-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6738 * src/lyxserver.C (callback): fix dispatch of functions
6740 * src/insets/insetlatexaccent.C (checkContents): turn bogus
6741 printf() into lyxerr call.
6743 * src/tex-strings.C (tex_fonts): add "pslatex" to the choice of
6746 * src/menus.C (ShowInsertMenu): rename "Figure" to "Graphic",
6747 "Table" to "Table Box", "Float" to "Floating Material"; deletes
6748 the "Float" from each of the subitems.
6749 (ShowHelpMenu): add entry for "FAQ" and "TOC".
6751 * src/support/DebugStream.h: add an #ifdef to work around a gcc
6752 2.8.x compiler error. Yes, I know, gcc 2.8.1 is bad, but I
6753 documented the change so that the workaround can be nuked later.
6755 * src/lyx_gui_misc.C (getScreenDPI): new function. Code moved from
6758 * src/lyxlex_pimpl.C (next): do not re-declare the default value
6760 * src/buffer.C (getLatexName): ditto
6761 (setReadonly): ditto
6763 2000-04-11 Lars Gullik Bjønnes <larsbj@lyx.org>
6765 * src/LaTeXFeatures.h: add a const reference to BufferParams, to
6766 avoid some uses of current_view. Added also a bufferParams()
6767 method to get at this.
6769 * src/lyxtext.h: changed params->buffer and paramters->bparams.
6771 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6773 * src/lyxparagraph.[Ch]: removed
6774 operator<(LyXParagraph::InsetTable..., added a struct matchIT
6775 with operators used by lower_bound and
6776 upper_bound in InsetTable's
6777 Make struct InsetTable private again. Used matchpos.
6779 2000-04-08 Dekel Tsur <dekel@math.tau.ac.il>
6781 * src/lyx_cb.C (DocumentApplyCB): When changing the language of the
6782 document, the language of existing text is changed (unless the
6783 document is multi-lingual)
6785 * src/buffer.C (ChangeLanguage,isMultiLingual) New methods.
6787 * src/paragraph.C (ChangeLanguage,isMultiLingual) New methods.
6789 * A lot of files: A rewrite of the Right-to-Left support.
6791 2000-04-10 Juergen Vigna <jug@sad.it>
6793 * src/BufferView2.C (showLockedInsetCursor): small bugfix for
6794 misplaced cursor when inset in inset is locked.
6796 * src/insets/insettext.C (LocalDispatch): small fix so that a
6797 BREAKLINE is not inserted if we don't permit it with autBreakRows.
6799 * src/insets/insetfoot.C (GetDrawFont): implemented this as the
6800 footnote font should be decreased in size twice when displaying.
6802 * src/insets/insettext.C (GetDrawFont): inserted this function as
6803 the drawing-font may differ from the real paragraph font.
6805 * src/lyxfunc.C (processKeyEvent): fixed Esc-handling when unlocking
6806 insets (inset in inset!).
6808 * src/insets/insetfoot.C (InsertInsetAllowed): implemented the below
6809 function here because we don't want footnotes inside footnotes.
6811 * src/insets/insettext.C (InsetText): forgot to set autoBreakRows for
6813 (init): now set the inset_owner in paragraph.C
6814 (LocalDispatch): added some resetPos() in the right position
6817 (pasteSelection): changed to use the new CutAndPaste-Class.
6819 * src/insets/lyxinset.h: inserted new function InsertInsetAllowed
6820 which tells if it is allowed to insert another inset inside this one.
6822 * src/lyx_cb.C (DocumentApplyCB): Using CutAndPaste-Class for
6823 SwitchLayoutsBetweenClasses.
6825 * src/text2.C (InsertInset): checking of the new paragraph-function
6827 (DeleteSimpleCutBuffer): removed (for now only with #ifdef) as this
6828 is not needed anymore here!
6831 (PasteSelection): redone (also with #ifdef) so that now this uses
6832 the CutAndPaste-Class.
6833 (SwitchLayoutsBetweenClasses): removed here and implemented in the
6836 * src/CutAndPaste.[Ch]: added this for clean handling of CutAndPaste
6837 from/to text/insets.
6839 * src/paragraph.C (LyXParagraph): inserted new inset_owner pointer
6840 so that the paragraph knows if it is inside an (text)-inset.
6841 (InsertFromMinibuffer): changed return-value to bool as now it
6842 may happen that an inset is not inserted in the paragraph.
6843 (InsertInsetAllowed): this checks if it is allowed to insert an
6844 inset in this paragraph.
6846 (BreakParagraphConservative):
6847 (BreakParagraph) : small change for the above change of the return
6848 value of InsertFromMinibuffer.
6850 * src/lyxparagraph.h: added inset_owner and the functions to handle
6851 this (SetInsetOwner(), InInset() and InsertInsetAllowed()).
6853 2000-04-10 Lars Gullik Bjønnes <larsbj@lyx.org>
6855 * src/BufferView.[Ch], src/BufferView_pimpl.[Ch]: move more
6856 functions from BufferView to BufferView::Pimpl to ease maintence.
6858 * src/text2.C (DeleteEmptyParagraphMechanism): update the cursor
6859 correctly. Also use SetCursorIntern instead of SetCursor.
6861 * src/insets/insetinfo.C (draw): draw InsetInfo notes with the
6864 2000-04-08 Lars Gullik Bjønnes <larsbj@lyx.org>
6866 * src/WorkArea.C (belowMouse): manually implement below mouse.
6868 * src/*: Add "explicit" on several constructors, I added probably
6869 some unneeded ones. A couple of changes to code because of this.
6871 * src/BufferView.[Ch]: Used the "pimpl" idiom to hide more of the
6872 implementation and private parts from the users of BufferView. Not
6875 * src/lyxlex.[Ch]: Used the "pimpl" idiom to hide more of the
6876 implementation and private parts from the users of LyXLex. Not
6879 * src/BufferView_pimpl.[Ch]: new files
6881 * src/lyxlex_pimpl.[Ch]: new files
6883 * src/LyXView.[Ch]: some inline functions move out-of-line
6885 2000-04-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6887 * src/lyxparagraph.h: make struct InsetTable public.
6889 * src/support/lyxstring.h: change lyxstring::difference_type to be
6890 ptrdiff_t. Add std:: modifiers to streams.
6892 * src/font.C: include the <cctype> header, for islower() and
6895 2000-04-03 Lars Gullik Bjønnes <larsbj@lyx.org>
6897 * src/font.[Ch]: new files. Contains the metric functions for
6898 fonts, takes a LyXFont as parameter. Better separation of concepts.
6900 * src/lyxfont.[Ch]: move the metric functions to font.[Ch] several
6901 changes because of this.
6903 * src/PainterBase.[Ch] (width): remove, use the ones in font.C instead
6905 * src/*: compile with -Winline and move functions that don't
6908 * src/lyx_cb.C (stringOnlyContains): use string::find_first_not_of
6911 2000-04-02 Lars Gullik Bjønnes <larsbj@lyx.org>
6913 * src/paragraph.C (GetLabelstring): renamed from GetLabestring.
6914 (various files changed because of this)
6916 * src/Painter.C (text): fixed the drawing of smallcaps.
6918 * src/lyxfont.[Ch] (drawText): removed unused member func.
6921 * src/*.C: added needed "using" statements and "std::" qualifiers.
6923 2000-03-31 Lars Gullik Bjønnes <larsbj@lyx.org>
6925 * src/*.h: removed all use of "using" from header files use
6926 qualifier std:: instead.
6928 2000-04-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
6930 * src/text.C (Backspace): some additional cleanups (we already
6931 know whether cursor.pos is 0 or not).
6933 * lib/reLyX/Makefile.am (DESTDIR): add an empty value (since
6934 automake does not provide one).
6936 * src/bmtable.h: replace C++ comments with C comments.
6938 2000-04-02 Dekel Tsur <dekel@math.tau.ac.il>
6940 * src/screen.C (ShowCursor): Change the shape of the cursor if
6941 the current language is not equal to the language of the document.
6942 (If the cursor change its shape unexpectedly, then you've found a bug)
6944 * src/insets/insettext.C (LocalDispatch, UpdateLocal) Fixed some
6947 * src/insets/insetnumber.[Ch]: New files.
6949 * src/LyXAction.C (init)
6950 * src/lyxfunc.C (dispatch): Add command number-inset-insert
6953 * src/lyxrc.C: Renamed command \auto_mathmode to \number_inset
6955 * src/lyxparagraph.h
6956 * src/paragraph.C: Changed insetlist to Vector<InsetTable>.
6957 (the vector is kept sorted).
6959 * src/text.C (GetVisibleRow): Draw selection correctly when there
6960 is both LTR and RTL text.
6962 * src/paragraph.C (Clone): Use the assignment operator for cloning,
6963 which is much faster.
6965 * src/text.C (GetVisibleRow and other): Do not draw the last space
6966 in a row if the direction of the last letter is not equal to the
6967 direction of the paragraph.
6969 * src/lyxfont.C (latexWriteStartChanges):
6970 Check that font language is not equal to basefont language.
6971 (latexWriteEndChanges): ditto
6973 * src/lyx_cb.C (StyleReset): Don't change the language while using
6974 the font-default command.
6976 * src/paragraph.C (GetFirstFontSettings): Handle correctly an
6977 empty paragraph before a footnote.
6979 * src/insets/insetcommand.C (draw): Increase x correctly.
6981 * src/screen.C (ShowCursor): Change cursor shape if
6982 current language != document language.
6984 * src/lyxfunc.C (dispatch): Added calls to owner->view()->setState()
6986 2000-03-31 Juergen Vigna <jug@sad.it>
6988 * src/paragraph.C (GetInset): commented out text[pos] = ' '
6989 (Clone): changed mode how the paragraph-data is copied to the
6990 new clone-paragraph.
6992 * src/lyxfunc.C (Dispatch): fixed small problem when calling
6993 GetInset(pos) with no inset anymore there (in inset UNDO)
6995 * src/insets/insetcommand.C (draw): small fix as here x is
6996 incremented not as much as width() returns (2 before, 2 behind = 4)
6998 2000-03-30 Juergen Vigna <jug@sad.it>
7000 * src/insets/insettext.C (InsetText): small fix in initialize
7001 widthOffset (should not be done in the init() function)
7003 2000-03-29 Amir Karger <karger@lyx.org>
7005 * lib/examples/it_ItemizeBullets.lyx: translation by
7008 * Implemented \textasciitilde and fixed a tiny bug in reLyX
7010 2000-03-29 Juergen Vigna <jug@sad.it>
7012 * src/insets/insetcollapsable.C (Clone): same as in InsetFoot
7014 * src/insets/insetfoot.C (Clone): small change as for the below
7015 new init function in the text-inset
7017 * src/insets/insettext.C (init): new function as I've seen that
7018 clone did not copy the Paragraph-Data!
7019 (LocalDispatch): Added code so that now we have some sort of Undo
7020 functionality (well actually we HAVE Undo ;)
7022 * src/text.C (Backspace): Small fix for the a | a Backspace problem
7024 2000-03-24 Dekel Tsur <dekel@math.tau.ac.il>
7026 * src/paragraph.C (AutoDeleteInsets) Fixed a bug (wrong positions
7029 2000-03-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7031 * src/main.C: added a runtime check that verifies that the xforms
7032 header used when building LyX and the library used when running
7033 LyX match. Exit with a message if they don't match. This is a
7034 version number check only.
7036 * src/buffer.C (save): Don't allocate memory on the heap for
7037 struct utimbuf times.
7039 * *: some using changes, use iosfwd instead of the real headers.
7041 * src/lyxfont.C use char const * instead of string for the static
7042 strings. Rewrite some functions to use sstream.
7044 2000-03-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7046 * src/text.C (Backspace): hopefully fix the dreaded backaspace
7049 2000-03-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7051 * lib/layouts/svjog.layout: new file, for Springer-Verlag Journal
7052 of Geodesy (from Martin Vermeer)
7054 * lib/layouts/svjour.inc: include file for the Springer svjour
7055 class. It can be used to support journals other than JoG.
7057 * lib/Makefile.am: use $(DESTDIR) make variable (from Arkadiusz
7058 Miskiewicz <misiek@pld.org.pl>)
7059 * lib/reLyX/Makefile.am: ditto.
7061 2000-03-27 Juergen Vigna <jug@sad.it>
7063 * src/insets/insettext.C: added Cut/Copy/Paste inside insets,
7064 also some modifications with operations on selected text.
7066 * src/BufferView.C (checkInsetHit): Now hopefully fixed all the
7067 problems with clicking on insets (last famous words ;)
7069 * src/insets/insetcommand.C (draw):
7070 (width): Changed to have a bit of space before and after the inset so
7071 that the blinking cursor can be seen (otherwise it was hidden)
7073 2000-03-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7075 * config/gettext.m4 (AM_WITH_NLS): fix a gettext bug where -lintl
7076 would not be added to the link list when an installed gettext (not
7077 part of libc) is found.
7079 2000-03-24 Juergen Vigna <jug@sad.it>
7081 * src/insets/insetcollapsable.C (Edit):
7082 * src/mathed/formula.C (InsetButtonRelease):
7083 (InsetButtonPress): fixed for new handling of ButtonPress/Release
7086 * src/BufferView.C (workAreaButtonPress):
7087 (workAreaButtonRelease):
7088 (checkInsetHit): Finally fixed the clicking on insets be handled
7091 * src/insets/insetert.C (Edit): inserted this call so that ERT
7092 insets work always with LaTeX-font
7094 2000-03-21 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7096 * src/lyx_main.C (easyParse): Removed misplaced gui=false which
7097 caused lyx to startup with no GUI in place, causing in a crash
7098 upon startup when called with arguments.
7100 2000-03-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7102 * src/FontLoader.C: better initialization of dummyXFontStruct.
7104 2000-03-20 José Abílio Matos <jamatos@lyx.org>
7106 * src/lyxrc.[Ch] Removed \sgml_extra_options, added 6 other flags
7107 for linuxdoc and docbook import and export format options.
7109 * lib/lyxrc.example Example of default values for the previous flags.
7111 * src/lyx_cb.C Use those flags instead of the hardwired values for
7112 linuxdoc and docbook export.
7114 * src/lyxfunc.[Ch] Added HTML export for linuxdoc and docbook, added
7117 * src/menus.C Added menus entries for the new import/exports formats.
7119 2000-03-09 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
7121 * src/lyxrc.*: Added support for running without Gui
7124 * src/FontLoader.C: sensible defaults if no fonts are needed
7126 * src/lyx_cb.C: New function ShowMessage (writes either to the
7127 minibuffer or cout in case of no gui
7128 New function AskOverwrite for common stuff
7129 Consequently various changes to call these functions
7131 * src/lyx_main.C: allow gui = false and handle lyxrc \use_gui false
7132 wild guess at sensible screen resolution when having no gui
7134 * src/lyxfont.C: no gui, no fonts... set some defaults
7136 2000-03-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7138 * src/LColor.C: made the command inset background a bit lighter.
7140 2000-03-20 Hartmut Goebel <goebel@noris.net>
7142 * lib/layouts/stdstruct.inc: split into stdtitle.inc and
7143 stdstruct.inc. Koma-Script added some title elements which
7144 otherwise have been listed below "bibliography". This split allows
7145 adding title elements to where they belong.
7147 * lib/layouts/scrclass.inc: changed to include stdtitle.inc, then
7148 define the additional title elements and then include
7151 * many other layout files: changed to include stdtitle.inc just
7152 before stdstruct.inc.
7154 2000-03-18 Dekel Tsur <dekel@math.tau.ac.il>
7156 * src/buffer.C: (save) Added the option to store all backup files
7157 in a single directory
7159 * src/lyxrc.[Ch]: Added variable \backupdir_path
7161 * lib/lyxrc.example: Added descriptions of recently added variables
7163 * src/insets/insetbib.[Ch]: Fixed few bugs (crash when editing a
7164 bibtex inset, not closing the bibtex popup when deleting the inset)
7166 2000-03-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7168 * src/lyx_cb.C: add a couple using directives.
7170 2000-03-17 José Abílio Matos <jamatos@lyx.org>
7171 * src/lyx_cb.C (RunLinuxDoc) Removed the flag==-1 option for linuxdoc
7172 import based on the filename.
7174 * src/bufferlist.C () Removed the call to RunLinuxDoc where a linuxdoc
7175 file would be imported at start, if the filename where of a sgml file.
7177 * src/support/filetools.C (IsSGMLfilename) Removed, no longer needed.
7179 * src/support/filetools.h (IsSGMLfilename) Removed, no longer needed.
7181 2000-03-16 Dekel Tsur <dekel@math.tau.ac.il>
7182 * src/lyxfont.h Replaced the member variable bits.direction by the
7183 member variable lang. Made many changes in other files.
7184 This allows having a multi-lingual document
7186 * src/lyxfunc.C, src/lyx_cb.C Added a new command "language <l>"
7187 that change the current language to <l>.
7188 Removed the command "font-rtl"
7190 * src/buffer.C Changed LYX_FORMAT to 2.16 (as I changed the file
7191 format for Hebrew documents)
7193 * src/lyxrc.C, src/lyxfunc.C Added a new lyxrc command "auto_mathmode"
7194 When auto_mathmode is "true", pressing a digit key in normal mode
7195 will cause entering into mathmode.
7196 If auto_mathmode is "rtl" then this behavior will be active only
7197 when writing right-to-left text.
7199 * src/text2.C (InsertStringA) The string is inserted using the
7202 * src/paragraph.C (GetEndLabel) Gives a correct result for
7203 footnote paragraphs.
7205 * src/paragraph.C (PreviousBeforeFootnote) Fixed a small bug
7207 2000-03-16 Lars Gullik Bjønnes <larsbj@lyx.org>
7209 * src/text.C (Backspace): move RemoveParagraph and RemoveRow in
7210 front of PasteParagraph. Never insert a ' '. This should at least
7211 fix some cause for the segfaults that we have been experiencing,
7212 it also fixes backspace behaviour slightly. (Phu!)
7214 * src/support/lstrings.C (compare_no_case): some change to make it
7215 compile with gcc 2.95.2 and stdlibc++-v3
7217 * src/text2.C (MeltFootnoteEnvironment): change type o
7218 first_footnote_par_is_not_empty to bool.
7220 * src/lyxparagraph.h: make text private. Changes in other files
7222 (fitToSize): new function
7223 (setContentsFromPar): new function
7224 (clearContents): new function
7225 (SetChar): new function
7227 * src/paragraph.C (readSimpleWholeFile): deleted.
7229 * src/lyx_cb.C (InsertAsciiFile): don't use a LyXParagraph to hold
7230 the file, just use a simple string instead. Also read the file in
7231 a more maintainable manner.
7233 * src/text2.C (InsertStringA): deleted.
7234 (InsertStringB): deleted.
7236 2000-03-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7238 * src/text2.C (DeleteEmptyParagraphMechanism): don't run,
7239 RedoParagraphs from the doublespace handling part, just set status
7240 to NEED_MORE_REFRESH. Also don't update cursor position (should be
7241 done, but perhaps not like this.)
7243 2000-03-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7245 * src/text2.C (InsertStringA): don't forget to insert a META_INSET
7246 character when inserting an inset.
7248 2000-03-12 Lars Gullik Bjønnes <larsbj@lyx.org>
7250 * src/bufferparams.C (readLanguage): now takes "default" into
7253 * src/lyx_main.C (LyX): remove the setup of lyxrc. (new)
7254 also initialize the toplevel_keymap with the default bindings from
7257 * src/buffer.C (Buffer): remove lyxrc from the parameters.
7259 * all files using lyxrc: have lyxrc as a real variable and not a
7260 pointer. remove all extern LyXRC * lyxrc. The equiv to this is
7263 * src/lyxrc.C: remove double call to defaultKeyBindings
7265 * src/toolbar.[Ch]: Let the ToolbarDefaults handle the reading of
7266 toolbar defauls using lyxlex. Remove enums, structs, functions
7269 * src/lyxrc.h: use ToolbarDefaults instead of Toolbar for storing
7270 toolbar defaults. Also store default keybindings in a map.
7272 * src/ToolbarDefaults.[Ch]: New file. This class is used for
7273 storing the toolbar defaults without any xforms dependencies.
7275 * src/insets/figinset.C: patch posted to list by Andre Poenitz
7276 applied. Changed to use iterators.
7278 2000-03-11 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
7280 * development/lyx.spec.in: Fix to ``unset LINGUAS'' line for
7281 systems that don't have LINGUAS set to begin with.
7283 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7285 * src/text2.C (DeleteEmptyParagraphMechanism): small fix posted to
7286 the list by Dekel Tsur.
7288 2000-03-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7290 * src/insets/insetgraphics.C (GraphicxCB): declare with "C" linkage.
7291 * src/insets/form_graphics.C: ditto.
7293 * src/insets/inseturl.C (Latex): the free_spc argument is not used.
7295 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7297 * src/bufferparams.C (readLanguage): use the new language map
7299 * src/intl.C (InitKeyMapper): use the new language map
7301 * src/lyx_gui.C (create_forms): use the new language map
7303 * src/language.[Ch]: New files. Used for holding the information
7304 about each language. Now! Use this new language map enhance it and
7305 make it really usable for our needs.
7307 2000-03-09 Dekel Tsur <dekel@math.tau.ac.il>
7309 * screen.C (ShowCursor): Removed duplicate code.
7310 (ShowManualCursor): Support for 3 cursor shapes: Bar (default),
7311 L (LTR text in RTL document), and reversed-L (RTL text in LTR document)
7313 * src/text.C (NextBreakPoint,Fill): Moved declaration of left_margin
7316 * src/text.C Added TransformChar method. Used for rendering Arabic
7317 text correctly (change the glyphs of the letter according to the
7318 position in the word)
7323 * src/lyxrc.C Added lyxrc command {language_command_begin,
7324 language_command_end,language_command_ltr,language_command_rtl,
7325 language_package} which allows the use of either arabtex or Omega
7328 * src/lyx_gui.C (init)
7330 * src/lyxrc.C Added lyxrc command screen_font_encoding_menu. Allows
7331 to use encoding for menu fonts which is different than the encoding
7334 * src/buffer.C (makeLaTeXFile): If params.language = "default",
7335 do not load the babel package.
7336 To write an English document with Hebrew/Arabic, change the document
7337 language to "english".
7339 * src/text2.C (SetCounter): Fixed appendix labels for Hebrew document
7340 (alphaCounter): changed to return char
7341 (loweralphaCounter, hebrewCounter, romanCounter): New functions
7343 * lib/lyxrc.example Added examples for Hebrew/Arabic
7346 * src/layout.C Added layout command endlabeltype
7348 * src/paragraph.C Added GetEndLabel(),LastPhysicalPar() const
7350 * src/text.C (GetVisibleRow): Draw a box at the end of proof layout
7352 2000-03-10 Lars Gullik Bjønnes <larsbj@lyx.org>
7354 * src/mathed/math_delim.C (search_deco): return a
7355 math_deco_struct* instead of index.
7357 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7359 * All files with a USE_OSTREAM_ONLY within: removed all code that
7360 was unused when USE_OSTREAM_ONLY is defined.
7362 * src/support/lyxalgo.h (sorted): rewrote to use plain '<' instead
7363 of any less. Removed header and using.
7365 * src/text.C (GetVisibleRow): draw the string "Page Break
7366 (top/bottom)" on screen when drawing a pagebreak line.
7368 2000-03-09 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7370 * lib/doc/LaTeXConfig.lyx.in: add description of textclass llncs.
7372 * src/mathed/math_macro.C (draw): do some cast magic.
7375 * src/mathed/math_defs.h: change byte* argument to byte const*.
7377 * src/mathed/formulamacro.[Ch]: add free_spc to Latex() method.
7379 * src/insets/insetfoot.[Ch]: Clone() always returns an Inset* (well I
7380 know it is right to return InsetFoot* too, but cxx does not like
7383 * src/insets/insetcollapsable.[Ch] (Clone): make const.
7385 * development/lyx.spec.in: unset LINGUAS to avoid i18n problems.
7387 * src/mathed/math_delim.C: change == to proper assignment.
7389 2000-03-09 Juergen Vigna <jug@sad.it>
7391 * src/insets/insettext.C (setPos): fixed various cursor positioning
7392 problems (via mouse and cursor-keys)
7393 (LocalDispatch): added posibility to add a Ctrl-Enter inside a text
7394 inset (still a small display problem but it works ;)
7396 * src/insets/insetcollapsable.C (draw): added button_top_y and
7397 button_bottom_y to have correct values for clicking on the inset.
7399 * src/support/lyxalgo.h: commented out 'using std::less'
7401 2000-03-08 Juergen Vigna <jug@sad.it>
7403 * src/insets/insetcollapsable.C (InsetButtonRelease): Now a
7404 Button-Release event closes as it is alos the Release-Event
7407 * src/lyxfunc.C (Dispatch): forgot a break in the LFUN_INSET_ERT
7409 2000-03-07 Kayvan A. Sylvan <kayvan@camel.internal.sylvan.com>
7411 * lib/layouts/literate-scrap.inc: Fixed initial comment. Now we
7412 can add multiple spaces in Scrap (literate programming) styles...
7413 which, by the way, is how I got hooked on LyX to begin with.
7415 * src/mathed/formula.C (Write): Added dummy variable to an
7416 inset::Latex() call.
7417 (Latex): Add free_spacing boolean to inset::Latex()
7419 * src/mathed/formula.h (Latex): Added free_spacing boolean arg.
7421 * src/insets/lyxinset.h: Changed definition of the inset::Latex()
7422 virtual function to include the free_spacing boolean from
7423 the containing paragraph's style.
7425 * src/insets/inseturl.C, src/insets/inseturl.h (Latex):
7426 Added free_spacing boolean arg to match inset.h
7428 * src/insets/insettext.C, src/insets/insettext.h (Latex):
7429 Added free_spacing boolean arg to match inset.h
7431 * src/insets/insetspecialchar.C, src/insets/insetspecialchar.h (Latex):
7432 Added free_spacing boolean and made sure that if in a free_spacing
7433 paragraph, that we output normal space if there is a protected space.
7435 * src/insets/insetref.C, src/insets/insetref.h (Latex):
7436 Added free_spacing boolean arg to match inset.h
7438 * src/insets/insetquotes.C, src/insets/insetquotes.h (Latex):
7439 Added free_spacing boolean arg to match inset.h
7441 * src/insets/insetparent.C, src/insets/insetparent.h (Latex):
7442 Added free_spacing boolean arg to match inset.h
7444 * src/insets/insetlatexaccent.C, src/insets/insetlatexaccent.h (Latex):
7445 Added free_spacing boolean arg to match inset.h
7447 * src/insets/insetlatex.C, src/insets/insetlatex.h (Latex):
7448 Added free_spacing boolean arg to match inset.h
7450 * src/insets/insetlabel.C, src/insets/insetlabel.h (Latex): Added
7451 free_spacing boolean arg to match inset.h
7453 * src/insets/insetinfo.C, src/insets/insetinfo.h (Latex):
7454 Added free_spacing boolean arg to match inset.h
7456 * src/insets/insetinclude.C, src/insets/insetinclude.h (Latex):
7457 Added free_spacing boolean arg to match inset.h
7459 * src/insets/insetgraphics.C, src/insets/insetgraphics.h (Latex):
7460 Added free_spacing boolean arg to match inset.h
7462 * src/insets/inseterror.C, src/insets/inseterror.h (Latex):
7463 Added free_spacing boolean arg to match inset.h
7465 * src/insets/insetcommand.C, src/insets/insetcommand.h (Latex):
7466 Added free_spacing boolean arg to match inset.h
7468 * src/insets/insetbib.C, src/insets/insetbib.h (Latex): Added
7469 free_spacing boolean arg to match inset.h
7471 * src/insets/figinset.C, src/insets/figinset.h (Latex): Added
7472 free_spacing boolean arg to match inset.h
7474 * src/text2.C (DeleteEmptyParagraphMechanism): Fix this to
7475 ignore free_spacing paragraphs. The user's spaces are left
7478 * src/text.C (InsertChar): Fixed the free_spacing layout
7479 attribute behavior. Now, if free_spacing is set, you can
7480 add multiple spaces in a paragraph with impunity (and they
7481 get output verbatim).
7482 (SelectSelectedWord): Added dummy argument to inset::Latex()
7485 * src/paragraph.C (TeXOnePar): Added dummy args to inset::Latex(...)
7488 * src/lyxfunc.C (Dispatch): Hard-spaces input in free_spacing
7489 paragraph layouts now only input a simple space instead.
7490 Special character insets don't make any sense in free-spacing
7493 * src/buffer.C (parseSingleLyXformat2Token): Code to convert
7494 hard-spaces in the *input* file to simple spaces if the layout
7495 is free-spacing. This converts old files which had to have
7496 hard-spaces in free-spacing layouts where a simple space was
7498 (writeFileAscii): Added free_spacing check to pass to the newly
7499 reworked inset::Latex(...) methods. The inset::Latex() code
7500 ensures that hard-spaces in free-spacing paragraphs get output
7501 as spaces (rather than "~").
7503 2000-03-09 Lars Gullik Bjønnes <larsbj@lyx.org>
7505 * src/mathed/math_delim.C (draw): draw the empty placeholder
7506 delims with a onoffdash line.
7507 (struct math_deco_compare): struct that holds the "functors" used
7508 for the sort and the binary search in math_deco_table.
7509 (class init_deco_table): class used for initial sort of the
7511 (search_deco): use lower_bound to do a binary search in the
7514 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7516 * src/lyxrc.C: a small secret thingie...
7518 * src/lyxlex.C (printTable): changed to take a ostream as paramter
7519 and to not flush the stream as often as it used to.
7521 * src/support/lyxalgo.h: new file
7522 (sorted): template function used for checking if a sequence is
7523 sorted or not. Two versions with and without user supplied
7524 compare. Uses same compare as std::sort.
7526 * src/lyxlex.C (LyXLex): check if the table is sorted, if not sort
7527 it and give warning on lyxerr.
7529 (struct compare_tags): struct with function operators used for
7530 checking if sorted, sorting and lower_bound.
7531 (search_kw): use lower_bound instead of manually implemented
7534 2000-03-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7536 * src/insets/insetcollapsable.h: fix Clone() declaration.
7537 * src/insets/insetfoot.h: ditto.
7539 * src/insets/lyxinset.h: remove an extra comma at the end of enum.
7541 2000-03-08 Juergen Vigna <jug@sad.it>
7543 * src/insets/lyxinset.h: added owner call which tells us if
7544 this inset is inside another inset. Changed also the return-type
7545 of Editable to an enum so it tells clearer what the return-value is.
7547 * src/insets/insettext.C (computeTextRows): fixed computing of
7548 textinsets which split automatically on more rows.
7550 * src/insets/insetert.[Ch]: changed this to be of BaseType
7553 * src/insets/insetfoot.[Ch]: added footnote inset
7555 * src/insets/insetcollapsable.[Ch]: added this BaseClass for
7556 collapsable insets (like footnote, ert, ...)
7558 2000-03-08 Lars Gullik Bjønnes <larsbj@lyx.org>
7560 * src/lyxdraw.h: remvoe file
7562 * src/lyxdraw.C: remove file
7564 * src/insets/insettext.C: added <algorithm>.
7566 2000-03-07 Lars Gullik Bjønnes <larsbj@lyx.org>
7568 * src/mathed/math_panel.C (delim_cb): case MM_OK use string stream
7569 (matrix_cb): case MM_OK use string stream
7571 * src/mathed/formula.C (LocalDispatch): case LFUN_SETXY use string
7574 * src/mathed/math_macro.C (draw): use string stream
7575 (Metrics): use string stream
7577 * src/paragraph.C (TeXFootnote): for case LyXParagraph::FIG, write
7578 directly to the ostream.
7580 * src/vspace.C (asString): use string stream.
7581 (asString): use string stream
7582 (asLatexString): use string stream
7584 * src/lyx_cb.C (UpdateLayoutDocument): use string stream for
7585 setting Spacing::Other.
7587 * src/LaTeXFeatures.C (getPackages): use string stream instead of
7588 sprintf when creating the stretch vale.
7590 * src/text2.C (alphaCounter): changed to return a string and to
7591 not use a static variable internally. Also fixed a one-off bug.
7592 (SetCounter): changed the drawing of the labels to use string
7593 streams instead of sprintf.
7595 * src/support/lyxmanip.h: rewrite the newlineanDepth ostream
7596 manipulator to use a scheme that does not require library support.
7597 This is also the way it is done in the new GNU libstdc++. Should
7598 work with DEC cxx now.
7600 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7602 * src/mathed/math_inset.h (Write(ostream & os): add a space at the
7603 end. This fixes a bug.
7605 * src/mathed (all files concerned with file writing): apply the
7606 USE_OSTREAM_ONLY changes to mathed too.
7608 * src/support/DebugStream.h: make the constructor explicit.
7610 * src/lyxfont.C (latexWriteStartChanges): small bug related to
7611 count and ostream squashed.
7613 2000-03-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7615 * src/support/Makefile.am (libsupport_la_SOURCES): add lyxmanip.h.
7617 * src/buffer.C (makeLaTeXFile): add a .c_str(), since
7618 ostringstream uses STL strings, and we might not.
7620 * src/insets/insetspecialchar.C: add using directive.
7621 * src/insets/insettext.C: ditto.
7623 2000-03-06 Lars Gullik Bjønnes <larsbj@lyx.org>
7625 * lib/layouts/seminar.layout: feeble attempt at a layout for
7626 seminar.cls, far from completet and could really use some looking
7627 at from people used to write layout files.
7629 * src/support/lyxmanip.h (newlineAndDepth): ostream manipulator to
7630 use instead of the AddNewlineAndDepth funtion in lyx_cb.C. This is
7631 a lot nicer and works nicely with ostreams.
7633 * src/mathed/formula.C (draw): a slightly different solution that
7634 the one posted to the list, but I think this one works too. (font
7635 size wrong in headers.)
7637 * src/insets/insettext.C (computeTextRows): some fiddling on
7638 Jürgens turf, added some comments that he should read.
7640 * src/lyxrc.C: remove all traces of RC_NOMENUACCELERATORS, never
7641 used and it gave compiler warnings.
7642 RC_SHOW_BANNER + "\\show_banner" added, also to reading and
7645 * src/lyx_gui.C (create_forms): do the right thing when
7646 show_banner is true/false.
7648 * src/lyx_cb.C (TimerCB): no need to close or do anything if
7649 show_banner is false.
7651 * most file writing files: Now use iostreams to do almost all of
7652 the writing. Also instead of passing string &, we now use
7653 stringstreams. mathed output is still not adapted to iostreams.
7654 This change can be turned off by commenting out all the occurences
7655 of the "#define USE_OSTREAM_ONLY 1" lines.
7657 * src/WorkArea.C (createPixmap): don't output debug messages.
7658 (WorkArea): don't output debug messages.
7660 * lib/lyxrc.example: added a comment about the new variable
7663 * development/Code_rules/Rules: Added some more commente about how
7664 to build class interfaces and on how better encapsulation can be
7667 2000-03-03 Juergen Vigna <jug@sad.it>
7669 * src/insets/insetert.C (InsetERT): Now ERT-insets break row
7670 automatically with the width of the LyX-Window
7672 * src/insets/insettext.C (computeTextRows): fixed update bug in
7673 displaying text-insets (scrollvalues where not initialized!)
7675 2000-03-02 Lars Gullik Bjønnes <larsbj@lyx.org>
7677 * src/mathed/math_utils.C (MathedLookupBOP): using only res->id ==
7678 id in the check of the result from lower_bound is not enough since
7679 lower_bound can return last too, and then res->id will not be a
7682 * all insets and some code that use them: I have conditionalized
7683 removed the Latex(string & out, ...) this means that only the
7684 Latex(ostream &, ...) will be used. This is a work in progress to
7685 move towards using streams for all output of files.
7687 * src/text.C (GetColumnNearX): initialize LyXParagraph::size_type
7690 2000-03-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7692 * src/mathed/math_utils.C (MathedLookupBOP): fix the search
7693 routine (this fixes bug where greek letters were surrounded by too
7696 * src/support/filetools.C (findtexfile): change a bit the search
7697 algorithm, to fix bug introduced in 1.1.4. Note that --format is
7698 no longer passed to kpsewhich, we may have to change that later.
7700 * config/lyxinclude.m4 (LYX_PROG_CXX): better version-dependent
7701 warning options to avoid problems with X header files (from Angus
7703 * acinclude.m4: regenerated.
7705 2000-03-02 Juergen Vigna <jug@sad.it>
7707 * src/insets/insettext.C (WriteParagraphData): Using the
7708 par->writeFile() function for writing paragraph-data.
7709 (Read): Using buffer->parseSingleLyXformat2Token()-function
7710 for parsing paragraph data!
7712 * src/buffer.C (readLyXformat2): removed all parse data and using
7713 the new parseSingleLyXformat2Token()-function.
7714 (parseSingleLyXformat2Token): added this function to parse (read)
7715 lyx-file-format (this is called also from text-insets now!)
7717 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7719 * src/paragraph.C (BeginningOfMainBody): initialize previous_char
7722 * src/lyxfunc.C (Dispatch(LFUN_MENUSEARCH)): Do the Search dialog
7723 directly instead of going through a func. One very bad thing: a
7724 static LyXFindReplace, but I don't know where to place it.
7726 * src/lyxfr1.C (GetCurrentSelectionAsString): rewritten to use a
7727 string instead of char[]. Also changed to static.
7728 (GetSelectionOrWordAtCursor): changed to static inline
7729 (SetSelectionOverLenChars): ditto.
7731 * src/lyxfr0.[Ch] src/lyxfr1.[Ch]: rewrite to get rid of
7732 current_view and global variables. both classes has changed names
7733 and LyXFindReplace is not inherited from SearchForm.
7735 * src/lyx_gui_misc.C (CloseAllBufferRelatedPopups): remove the
7736 fl_form_search form.
7738 * src/lyx_gui.C (create_forms): removed the fl_form_search form.
7740 2000-03-01 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7742 * lib/bind/*.bind: make sure 'buffer-previous' function is not
7743 bound (from Kayvan).
7745 * src/insets/Makefile.am (libinsets_la_SOURCES): add BoundingBox.h.
7747 * lib/layouts/stdletter.inc: fix line spacing in Send_To_Address.
7749 2000-03-01 Lars Gullik Bjønnes <larsbj@lyx.org>
7751 * some things that I should comment but the local pub says head to
7754 * comment out all code that belongs to the Roff code for Ascii
7755 export of tables. (this is unused)
7757 * src/LyXView.C: use correct type for global variable
7758 current_layout. (LyXTextClass::size_type)
7760 * some code to get the new insetgraphics closer to working I'd be
7761 grateful for any help.
7763 * src/BufferView2.C (insertInset): use the return type of
7764 NumberOfLayout properly. (also changes in other files)
7766 * src/insets/insetspecialchar.[Ch]: add the PROTECTED SEPARATOR to
7767 this as a test. I want to know what breaks because of this.
7769 * src/BufferView.[Ch] (tripleClick): name change from trippleClick.
7771 2000-02-29 Lars Gullik Bjønnes <larsbj@lyx.org>
7773 * lib/layouts/stdlists.inc: changed the lyxlist latex definition
7774 to use a \makebox in the label, this allows proper justification
7775 with out using protected spaces or multiple hfills. Now it is
7776 "label" for left justified, "\hfill label\hfill" for center, and
7777 "\hfill label" for right justified. UserGuide.lyx sec. 3.3.6.5
7778 should be changed accordingly.
7780 2000-02-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7782 * src/lyxtext.h: change SetLayout() to take a
7783 LyXTextClass::size_type instead of a char (when there is more than
7784 127 layouts in a class); also change type of copylayouttype.
7785 * src/text2.C (SetLayout): ditto.
7786 * src/LyXView.C (updateLayoutChoice): ditto.
7788 * src/LaTeX.C (scanLogFile): errors where the line number was not
7789 given just after the '!'-line were ignored (from Dekel Tsur).
7791 * lib/lyxrc.example: fix description of \date_insert_format
7793 * lib/layouts/llncs.layout: new layout, contributed by Martin
7796 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7798 * config/lyxinclude.m4 (LYX_PROG_CXX): remove case support for gcc
7799 2.7.* and add case support for gcc 2.96*. Gcc 2.96 only exists in
7800 cvs at gcc.gnu.org (currently it fails with ICE on insetbib.C,
7801 insetindex.C, insetloa.C, insettext.C, filetools.C, BufferView.C,
7802 BufferView2.C, LyXView.C, buffer.C, lyx_cb.C, lyxfunc.C,
7803 paragraph.C, text.C, text2.C)
7805 2000-02-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7807 * src/insets/insettext.C (LocalDispatch): remove extra break
7810 * src/insets/insetert.[Ch] (Clone): change return value to Inset*
7811 * src/insets/insettext.[Ch] (Clone): change return value to Inset*
7813 * src/mathed/formulamacro.[Ch] (draw): add missing const qualifier
7814 * src/insets/insettext.[Ch] (GetCursorPos): ditto
7816 * src/insets/insetbib.h: move InsetBibkey::Holder and
7817 InsetCitation::Holder in public space.
7819 2000-02-25 Lars Gullik Bjønnes <larsbj@lyx.org>
7821 * src/insets/insettext.h: small change to get the new files from
7822 Juergen to compile (use "string", not "class string").
7824 * src/insets/insettext.[Ch], src/insets/insertert.[Ch]: use string
7825 const & as parameter to LocalDispatch, use LyXFont const & as
7826 paramter to some other func. This also had impacto on lyxinsets.h
7827 and the two mathed insets.
7829 2000-02-24 Juergen Vigna <jug@sad.it>
7832 * src/commandtags.h:
7834 * src/lyxfunc.C: added code for LFUN_INSET_ERT and LFUN_INSET_TEXT
7838 * src/BufferView2.C: added/updated code for various inset-functions
7840 * src/insets/insetert.[Ch]: added implementation of InsetERT
7842 * src/insets/insettext.[Ch]: added implementation of InsetText
7844 * src/insets/inset.C (Edit): added "unsigned int button" parameter
7845 (draw): added preliminary code for inset scrolling not finshed yet
7847 * src/insets/inset.C (LocalDispatch): changed arg parameter to string
7848 as it is in lyxfunc.C now
7850 * src/insets/lyxinset.h: Added functions for text-insets
7852 2000-02-22 Lars Gullik Bjønnes <larsbj@lyx.org>
7854 * src/lyx_cb.C src/UpdateInset.[Ch]: move the updateinsetlist into
7855 BufferView and reimplement the list as a queue put inside its own
7858 * src/bufferlist.[Ch] (updateInset): remove func, not needed.
7860 * several files: use the new interface to the "updateinsetlist"
7862 * src/WorkArea.C (work_area_handler): call BufferView::doubleClick
7864 (work_area_handler): call BufferView::trippleClick on trippleclick.
7866 * src/BufferView.C (doubleClick): new function, selects word on
7868 (trippleClick): new function, selects line on trippleclick.
7870 2000-02-22 Allan Rae <rae@lyx.org>
7872 * lib/bind/xemacs.bind: buffer-previous not supported
7874 2000-02-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7876 * src/insets/insettoc.[Ch] (LinuxDoc, DocBook): mark the methods
7879 2000-02-20 Lars Gullik Bjønnes <larsbj@lyx.org>
7881 * src/bufferlist.C: get rid of current_view from this file
7883 * src/spellchecker.C: get rid of current_view from this file
7885 * src/vspace.C: get rid of current_view from this file
7886 (inPixels): added BufferView parameter for this func
7887 (asLatexCommand): added a BufferParams for this func
7889 * src/text.C src/text2.C: get rid of current_view from these
7892 * src/lyxfont.C (getFontDirection): move this function here from
7895 * src/bufferparams.C (getDocumentDirection): move this function
7898 * src/paragraph.C (getParDirection): move this function here from
7900 (getLetterDirection): ditto
7902 2000-02-18 Lars Gullik Bjønnes <larsbj@lyx.org>
7904 * WorkArea, Painter, LyXScreen: Fixed the crash that occured on
7905 resize due to wrong pixmap beeing used. Also took the opurtunity
7906 to make the LyXScreen stateless on regard to WorkArea and some
7907 general cleanup in the same files.
7909 2000-02-17 Lars Gullik Bjønnes <larsbj@lyx.org>
7911 * src/Makefile.am: add missing direction.h
7913 * src/PainterBase.h: made the width functions const.
7915 * lib/kbd/iso8859-1.cdef: fix a couple of entries and define some
7918 * src/insets/insetcommand.C (draw): draw Editable as buttons.
7920 * src/insets/insetlatexaccent.C (draw): make the accents draw
7921 better, at present this will only work well with iso8859-1.
7923 * several files: remove the old drawing code, now we use the new
7926 * several files: remove support for mono_video, reverse_video and
7929 2000-02-17 Juergen Vigna <jug@sad.it>
7931 * src/mathed/math_cursor.[Ch] (SelGetArea): Changed form int * to
7932 int ** as we have to return the pointer, otherwise we have only
7933 NULL pointers in the returning function.
7935 2000-02-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7937 * src/LaTeX.C (operator()): quote file name when running latex.
7939 2000-02-15 Lars Gullik Bjønnes <larsbj@lyx.org>
7941 * src/toolbar.C (set): use fl_set_object_helper for the tooltop
7942 (bubble tip), this removes our special handling of this.
7944 * Remove all code that is unused now that we have the new
7945 workarea. (Code that are not active when NEW_WA is defined.)
7947 * Make the uses of XSync not conditionalized on define USE_XSYNC.
7949 2000-02-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7951 * src/lyxfunc.C (Dispatch): fix LFUN_LAYOUT when giving a
7952 nonexisting layout; correctly redirect obsoleted layouts.
7954 * lib/lyxrc.example: document \view_dvi_paper_option
7956 * src/lyxrc.[Ch]: add support for the \view_dvi_paper_option
7959 * src/lyx_cb.C (RunScript): handle $$FName for command names.
7960 (PreviewDVI): handle the view_dvi_paper_option variable.
7961 [Both from Roland Krause]
7963 2000-02-14 Lars Gullik Bjønnes <larsbj@lyx.org>
7965 * src/Painter.C (text(int,int,char,LyXFont)): call text(int, int,
7966 char const *, int, LyXFont)
7967 (text(int, int, string, LyXFont)): ditto
7969 * src/text.C (InsertCharInTable): attempt to fix the double-space
7970 feature in tables too.
7971 (BackspaceInTable): ditto.
7972 (GetVisibleRow): make bottom pagebreak line be a onoff line.
7974 2000-02-11 Lars Gullik Bjønnes <larsbj@lyx.org>
7976 * src/text2.C (owner): only complain if owner_ is set and bv != 0
7978 * src/BufferView.C (resizeCurrentBuffer): set the owner of the
7979 newly found text in textcache to this.
7980 (buffer): set the owner of the text put into the textcache to 0
7982 * src/insets/figinset.C (draw): fixed the drawing of figures with
7985 * src/text.C src/mathed/math_cursor.C: nailed and fixed the
7986 drawing of mathframe, hfills, protected space, table lines. I have
7987 now no outstanding drawing problems with the new Painter code.
7989 2000-02-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
7991 * src/PainterBase.C (ellipse, circle): do not specify the default
7994 * src/LColor.h: add using directive.
7996 * src/Painter.[Ch]: change return type of methods from Painter& to
7997 PainterBase&. Add a using directive.
7999 * src/WorkArea.C: wrap xforms callbacks in C functions
8002 * lib/layouts/foils.layout: font fix and simplifications from Carl
8005 2000-02-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8007 * a lot of files: The Painter, LColor and WorkArea from the old
8008 devel branch has been ported to lyx-devel. Some new files and a
8009 lot of #ifdeffed code. The new workarea is enabled by default, but
8010 if you want to test the new Painter and LColor you have to compile
8011 with USE_PAINTER defined (do this in config.h f.ex.) There are
8012 still some rought edges, and I'd like some help to clear those
8013 out. It looks stable (loads and displays the Userguide very well).
8016 2000-02-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8018 * src/buffer.C (pop_tag): revert to the previous implementation
8019 (use a global variable for both loops).
8021 * lib/kbd/iso8859-1.cdef: fix definition for \"{e}.
8023 * src/lyxrc.C (LyXRC): change slightly default date format.
8025 * src/paragraph.C (TeXOnePar): Generate a correct latex file when
8026 there is an English text with a footnote that starts with a Hebrew
8027 paragraph, or vice versa.
8028 (TeXFootnote): ditto.
8030 * src/text.C (LeftMargin): allow for negative values for
8031 parindent. Thanks to Philip Lehman <lehman@gmx.net> for testing
8034 * src/lyx_gui.C (create_forms): add iso88595 as a possible choice
8035 for input encoding (cyrillic)
8037 2000-02-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8039 * src/lyx_gui.C (create_forms): make combo box taller (from Dekel
8042 * src/toolbar.C (set): ditto
8043 * src/insets/insetbib.C (create_form_citation_form): ditto
8045 * lib/CREDITS: added Dekel Tsur.
8047 * lib/kbd/hebrew.kmap, lib/kbd/null.kmap,
8048 lib/layouts/heb-article.layout, lib/layouts/heb-letter.layout: new
8049 hebrew supports files from Dekel Tsur.
8051 * lib/kbd/iso8859-8.cdef: new file, from Tzafrir Cohen
8052 <tzafrir@technion.ac.il>
8054 * src/lyxrc.C: put \date_insert_format at the right place.
8056 * src/buffer.C (makeLaTeXFile): fix the handling of
8057 BufferParams::sides when writing out latex files.
8059 * src/BufferView2.C: add a "using" directive.
8061 * src/support/lyxsum.C (sum): when we use lyxstring,
8062 ostringstream::str needs an additional .c_str().
8064 2000-02-07 Lars Gullik Bjønnes <larsbj@lyx.org>
8066 * src/support/filetools.C (ChangeExtension): patch from Etienne
8069 * src/TextCache.C (show): remove const_cast and make second
8070 parameter non-const LyXText *.
8072 * src/TextCache.h: use non const LyXText in show.
8074 * src/paragraph.C (SimpleTeXSpecialChars): patch to make urls work
8077 2000-02-04 Lars Gullik Bjønnes <larsbj@lyx.org>
8079 * src/support/lyxsum.C: rework to be more flexible.
8081 * several places: don't check if a pointer is 0 if you are going
8084 * src/text.C: remove some dead code.
8086 * src/insets/figinset.C: remove some dead code
8088 * src/buffer.C: move the BufferView funcs to BufferView2.C
8089 remove all support for insetlatexdel
8090 remove support for oldpapersize stuff
8091 made some member funcs const
8093 * src/kbmap.C: use a std::list to store the bindings in.
8095 * src/BufferView2.C: new file
8097 * src/kbsequence.[Ch]: new files
8099 * src/LyXAction.C + others: remove all trace of buffer-previous
8101 * src/Bullet.[Ch]: moved ITEMIZE_DEFAULTS inside Bullet.C so that we
8102 only have one copy in the binary of this table.
8104 * hebrew patch: moved some functions from LyXText to more
8105 appropriate places. (LyXParagraph, BufferParams, LyXFont)
8107 * several files: remove support for XForms older than 0.88
8109 remove some #if 0 #endif code
8111 * src/TextCache.[Ch]: new file. Holds the textcache.
8113 * src/BufferView.C: changes to use the new TextCache interface.
8114 (waitForX): remove the now unused code.
8116 * src/BackStack.h: remove some commented code
8118 * lib/bind/emacs.bind: remove binding for buffer-previous
8120 2000-02-03 Lars Gullik Bjønnes <larsbj@lyx.org>
8122 * applied the hebrew patch.
8124 * src/lyxrow.h: make sure that all Row variables are initialized.
8126 * src/text2.C (TextHandleUndo): comment out a delete, this might
8127 introduce a memory leak, but should also help us to not try to
8128 read freed memory. We need to look at this one.
8130 * src/paragraph.C (SimpleDocBookOneTablePar): initialize column to 0
8131 (LyXParagraph): initalize footnotekind.
8133 * src/lyxrc.C (output): added case RC_DATE_INSERT_FORMAT. Jug
8134 forgot this when applying the patch. Please heed the warnings.
8136 * src/BufferView.C (buffer): a fix for the buffer-reload problem
8137 (aka. reformat problem)
8139 * src/bufferlist.C (exists): made const, and use const_iterator
8140 (isLoaded): new func.
8141 (release): use std::find to find the correct buffer.
8143 * src/bufferlist.h: made getState a const func.
8144 made empty a const func.
8145 made exists a const func.
8148 2000-02-01 Juergen Vigna <jug@sad.it>
8150 * src/lyxfunc.C lyxrc.C: changed from insert-date to date-insert
8152 * po/it.po: updated a bit the italian po file and also changed the
8153 'file nuovo' for newfile to 'filenuovo' without a space, this did
8156 * src/lyxrc.C (LyXRC): added support for a default insert_date_format
8157 for the new insert_date command.
8159 * src/lyxfunc.C (Dispatch): added support for a insert_date function
8160 from jdblair, to insert a date into the current text conforming to
8161 a strftime format (for now only considering the locale-set and not
8162 the document-language).
8164 2000-01-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8166 * src/lyxfont.C (textWidth): hopefully better fix for the Array
8167 Bounds Read error seen by purify. The problem was that islower is
8168 a macros which takes an unsigned char and uses it as an index for
8169 in array of characters properties (and is thus subject to the
8173 * src/lyx_cb.C (UpdateLayoutDocument): use a switch to set
8174 correctly the paper sides radio buttons.
8175 (UpdateDocumentButtons): ditto.
8177 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8179 * src/kbmap.C (getsym + others): change to return unsigned int,
8180 returning a long can give problems on 64 bit systems. (I assume
8181 that int is 32bit on 64bit systems)
8183 2000-01-27 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8185 * src/lyxfunc.C (processKeyEvent): fix a the buffer returned by
8186 LyXLookupString to be zero-terminated. Really fixes problems seen
8189 2000-01-27 Lars Gullik Bjønnes <larsbj@lyx.org>
8191 * src/lyxfunc.C (processKeyEvent): "fix" so that we never try to
8192 write a (char*)0 to the lyxerr stream.
8194 * src/lastfiles.C: move algorithm before the using statemets.
8196 2000-01-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8198 * src/lastfiles.C: move using directives in global scope (egcs 1.x
8199 complains otherwise).
8200 * src/table.C: ditto
8202 * lib/reLyX/reLyX.in: use variable @LYX_DIR@ as built-in data
8205 * lib/reLyX/configure.in (LYX_DIR): re-introduce this variable
8206 that I removed earlier... It is really needed.
8208 * lib/examples/multicol.lyx: new file, splitted from Extended.lyx.
8210 2000-01-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8212 * INSTALL: update xforms home page URL.
8214 * lib/configure.m4: fix a bug with unreadable layout files.
8216 * src/table.C (calculate_width_of_column): add "using std::max"
8219 2000-01-25 Lars Gullik Bjønnes <larsbj@lyx.org>
8221 * several files: marked several lines with "DEL LINE", this is
8222 lines that can be deleted without changing anything.
8223 if (<ptr>) // DEL LINE /* this line is _never_ needed. Delete
8224 checks this anyway */
8227 * src/insets/insetlatexaccent.C: Changed some debugs to Debug::KEY
8229 * src/DepTable.C (update): add a "+" at the end when the checksum
8230 is different. (debugging string only)
8232 * src/paragraph.C (ReturnNextInsetPointer): fix bug that caused
8233 the next inset to not be displayed. This should also fix the list
8234 of labels in the "Insert Crossreference" dialog.
8236 2000-01-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8238 * src/support/LSubstring.C (LSubstring): set pos to string::npos
8239 when regex was not found.
8241 * src/support/lstrings.C (lowercase): use handcoded transform always.
8244 * src/text.C (Delete): fixed the crash. cursor.par->prev and
8245 old_cursor.par->prev could be 0.
8247 * several files: changed post inc/dec to pre inc/dec
8249 * src/lastfiles.C (writeFile): use ostream_iterator and copy to
8250 write the lastfiles to file.
8252 * src/BufferView.C (buffer): only show TextCache info when debugging
8254 (resizeCurrentBuffer): ditto
8255 (workAreaExpose): ditto
8257 * lib/kbd/iso8859-7.cdef: changed to new quoting scheme
8259 * lib/kbd/iso8859-2.cdef: changed to new quoting scheme
8261 * src/insets/insetlatexaccent.C (Draw): make the display of UMLAUT
8262 a bit better by removing the special case for \i and \j.
8264 2000-01-24 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8266 * src/lyx_main.C (easyParse): remove test for bad comand line
8267 options, since this broke all xforms-related parsing.
8269 * src/kbmap.C (getsym): set return type to unsigned long, as
8270 declared in header. On an alpha, long is _not_ the same as int.
8272 * src/support/LOstream.h: add a "using std::flush;"
8274 * src/insets/figinset.C: ditto.
8276 2000-01-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8278 * src/bufferlist.C (write): use blinding fast file copy instead of
8279 "a char at a time", now we are doing it the C++ way.
8281 * src/insets/figinset.C: get rid of struct pidwaitpit, use a
8282 std::list<int> instead.
8283 (addpidwait): reflect move to std::list<int>
8284 (sigchldchecker): ditto
8286 * src/bmtable.c (fl_set_bmtable_file): have arguments in the X r5
8289 * src/paragraph.C (FirstPhysicalPar): remove assert and comment
8290 that obviously was wrong...
8292 * src/lyxfont.C (textWidth): have c as char c[2] instead of char
8293 c, this avoids warnings with purify and islower.
8295 * src/insets/figinset.C: rename struct queue to struct
8296 queue_element and rewrite to use a std::queue. gsqueue is now a
8297 std::queue<queue_element>
8298 (runqueue): reflect move to std::queue
8301 * src/support/lstrings.h (tostr): specialize for bool, otherwise
8302 we would get "1" "0" instead of "true" "false. Also make the tostr
8305 2000-01-21 Juergen Vigna <jug@sad.it>
8307 * src/buffer.C (writeFileAscii): Disabled code for special groff
8308 handling of tabulars till I fix this in table.C
8310 2000-01-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8312 * src/support/mkdir.C (mkdir): change second argument of mkdir to
8314 * src/support/lyxlib.h: ditto.
8316 2000-01-20 Lars Gullik Bjønnes <larsbj@lyx.org>
8318 * src/insets/insetlatexaccent.C (Draw): make accents on top of 'i'
8319 and 'j' look better. This might fix the "macron" bug that has been
8322 * src/support/lstrings.[Ch] (tostr): reimplement all the tostr
8323 functions as one template function. Delete the old versions.
8325 * src/support/lyxsum.C: move using std::ifstream inside
8328 * src/support/Makefile.am (libsupport_la_SOURCES): added mkdir.C
8331 * src/mathed/formulamacro.C: delete #include "bufferlist.h" never used
8333 * src/mathed/formula.C: delete #include "bufferlist.h" never used
8335 * src/insets/figinset.C (InitFigures): use new instead of malloc
8336 to allocate memory for figures and bitmaps.
8337 (DoneFigures): use delete[] instead of free to deallocate memory
8338 for figures and bitmaps.
8339 (runqueue): use new to allocate
8340 (getfigdata): use new/delete[] instead of malloc/free
8341 (RegisterFigure): ditto
8343 * some files: moved some declarations closer to first use, small
8344 whitespace changes use preincrement instead of postincrement where
8345 it does not make a difference.
8347 * src/kbmap.[Ch]: delete code according to define NO_HASH, it is a
8348 step on the way to use stl::containers for key maps.
8350 * src/bufferlist.h: add a typedef for const_iterator and const
8351 versions of begin and end.
8353 * src/bufferlist.[Ch]: change name of member variable _state to
8354 state_. (avoid reserved names)
8356 (getFileNames): returns the filenames of the buffers in a vector.
8358 * configure.in (ALL_LINGUAS): added ro
8360 * src/support/putenv.C: new file
8362 * src/support/mkdir.C: new file
8364 2000-01-20 Allan Rae <rae@lyx.org>
8366 * lib/layouts/IEEEtran.layout: Added several theorem environments
8368 * lib/templates/IEEEtran.lyx: Example theorem environments and a
8369 couple of minor additions.
8371 * lib/doc/LaTeXConfig.lyx.in: Use URL insets for ftp sites
8372 (except for those in footnotes of course)
8374 2000-01-19 Lars Gullik Bjønnes <larsbj@lyx.org>
8376 * src/lyxlookup.C (CloseLyXLookup): set xic=0; after destruction.
8378 * src/mathed/math_utils.C (MathedLookupBOP): rewrite to use
8379 std::sort and std::lower_bound instead of qsort and handwritten
8381 (struct compara): struct that holds the functors used by std::sort
8382 and std::lower_bound in MathedLookupBOP.
8384 2000-01-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8386 * src/support/LAssert.h: do not do partial specialization. We do
8389 * src/support/lyxlib.h: note that lyx::getUserName() and
8390 lyx::date() are not in use right now. Should these be suppressed?
8392 * src/buffer.C (makeLaTeXFile): we do not need the user name here.
8393 (makeLinuxDocFile): do not put date and user name in linuxdoc
8396 * src/support/lyxlib.h (kill): change first argument to long int,
8397 since that's what solaris uses.
8399 * src/support/kill.C (kill): fix declaration to match prototype.
8401 * config/lyxinclude.m4 (LYX_CXX_NAMESPACES): fix the macro to
8402 actually check whether namespaces are supported. This is not what
8405 * src/support/lyxsum.C: add a using directive.
8407 2000-01-17 Lars Gullik Bjønnes <larsbj@lyx.org>
8409 * src/support/kill.C: if we have namespace support we don't have
8410 to include lyxlib.h.
8412 * src/support/lyxlib.h: use namespace lyx if supported.
8414 2000-01-14 Lars Gullik Bjønnes <larsbj@lyx.org>
8416 * src/support/date.C: new file
8418 * src/support/chdir.C: new file
8420 * src/support/getUserName.C: new file
8422 * src/support/getcwd.C: new file
8424 * src/support/abort.C: new file
8426 * src/support/kill.C: new file
8428 * src/support/lyxlib.h: moved all the functions in this file
8429 insede struct lyx. Added also kill and abort to this struct. This
8430 is a way to avoid the "kill is not defined in <csignal>", we make
8431 C++ wrappers for functions that are not ANSI C or ANSI C++.
8433 * src/support/lyxsum.C (sum): use #ifdef MODERN_STL_STREAMS
8434 instead of #if __GLIBCPP__. Since lyxsum is now put inside struct
8435 lyx it has been renamed to sum.
8437 2000-01-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8439 * src/text.C: add using directives for std::min and std::max.
8441 2000-01-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8443 * src/texrow.C (getIdFromRow): actually return something useful in
8444 id and pos. Hopefully fixes the bug with positionning of errorbox
8447 * src/lyx_main.C (easyParse): output an error and exit if an
8448 incorrect command line option has been given.
8450 * src/spellchecker.C (ispell_check_word): document a memory leak.
8452 * src/bufferlist.C (write): fix mismatched allocation/deletion,
8453 where a "struct utimbuf" is allocated with "new" and deleted with
8456 2000-01-13 Lars Gullik Bjønnes <larsbj@lyx.org>
8458 * src/text2.C (CutSelection): don't delete double spaces.
8459 (PasteSelection): ditto
8460 (CopySelection): ditto
8462 * src/text.C (Backspace): don't delete double spaces.
8464 * src/lyxlex.C (next): fix a bug that were only present with
8465 conformant std::istream::get to read comment lines, use
8466 std::istream::getline instead. This seems to fix the problem.
8468 2000-01-12 Lars Gullik Bjønnes <larsbj@lyx.org>
8470 * src/text2.C (DeleteEmptyParagraphMechanism): fix for the "not
8471 allowed to insert space before space" editing problem. Please read
8472 commends at the beginning of the function. Comments about usage
8475 * src/text.C (InsertChar): fix for the "not allowed to insert
8476 space before space" editing problem.
8478 * src/text2.C (DeleteEmptyParagraphMechanism): when
8479 IsEmptyTableRow can only return false this last "else if" will
8480 always be a no-op. Commented out.
8482 * src/text.C (RedoParagraph): As far as I can understand tmp
8483 cursor is not really needed.
8485 * src/lyxtext.[Ch] (IsEmptyTableCell): commented out. As used at
8486 present it could only return false anyway.
8487 (several functions): Did something not so smart...added a const
8488 specifier on a lot of methods.
8490 * src/paragraph.C (BreakParagraph): removed the tmp->text.reserve
8491 and add a tmp->text.resize. The LyXParagraph constructor does the
8493 (BreakParagraphConservative): ditto
8495 * src/support/path.h (Path): add a define so that the wrong usage
8496 "Path("/tmp") will be flagged as a compilation error:
8497 "`unnamed_Path' undeclared (first use this function)"
8499 2000-01-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8501 * config/lyxinclude.m4 (LYX_FUNC_PUTENV_ARGTYPE): fix the macro,
8502 which was bogus for several reasons.
8504 * src/LaTeX.C (scanAux): fix the regular expression used to scan
8508 * autogen.sh: do not use "type -path" (what's that anyway?).
8510 * src/support/filetools.C (findtexfile): remove extraneous space
8511 which caused a kpsewhich warning (at least with kpathsea version
8514 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8516 * src/mathed/Makefile.am (noinst_LTLIBRARIES): use .la
8518 * src/insets/Makefile.am (noinst_LTLIBRARIES): use .la
8520 * src/Makefile.am (lyx_DEPENDENCIES): switch back to .la libs
8522 2000-01-11 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8524 * src/paragraph.C (BreakParagraph): do not reserve space on text
8525 if we don't need to (otherwise, if pos_end < pos, we end up
8526 reserving huge amounts of memory due to bad unsigned karma).
8527 (BreakParagraphConservative): ditto, although I have not seen
8528 evidence the bug can happen here.
8530 * src/lyxparagraph.h: add a using std::list.
8532 2000-01-11 Juergen Vigna <jug@sad.it>
8534 * src/menus.C (MenuDocu): output an Alert if the documentation-file
8537 2000-01-11 Lars Gullik Bjønnes <larsbj@lyx.org>
8539 * src/vc-backend.C (doVCCommand): change to be static and take one
8540 more parameter: the path to chdir too be fore executing the command.
8541 (retrive): new function equiv to "co -r"
8543 * src/bufferlist.C (loadLyXFile): implement the missing parts if
8544 file_not_found_hook is true.
8546 * src/lyxvc.C (file_not_found_hook): implement file_not_found_hook.
8548 * src/support/filetools.C (IsFileWriteable): use FileInfo to check
8549 if a file is readwrite,readonly...anything else.
8551 2000-01-10 Lars Gullik Bjønnes <larsbj@lyx.org>
8553 * src/lyx_cb.C (MakeLaTeXOutput): name change from MakeDVIOutput
8554 (CreatePostscript): name change from MenuRunDVIPS (or something)
8555 (PreviewPostscript): name change from MenuPreviewPS
8556 (PreviewDVI): name change from MenuPreviewDVI
8558 * lib/lyxrc.example: added \pdflatex_command, \pdf_mode,
8559 \view_pdf_command., \pdf_to_ps_command
8561 * lib/configure.m4: added search for PDF viewer, and search for
8562 PDF to PS converter.
8563 (lyxrc.defaults output): add \pdflatex_command,
8564 \view_pdf_command and \pdf_to_ps_command.
8566 * src/lyx_cb.C (MenuPreviewDVI): renamed from MenuPreview.
8568 * src/bufferlist.C (write): we don't use blocksize for anything so
8571 2000-01-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8573 * src/support/block.h: disable operator T* (), since it causes
8574 problems with both compilers I tried. See comments in the file.
8576 * lib/reLyX/configure.in: do not define LYX_DIR. support flag
8579 * lib/reLyX/reLyX.in: change LYX_DIR to pkgdatadir; change env.
8580 variable LYX_DIR_10x to LYX_DIR_11x.
8582 * src/Makefile.am: replace variable LYX_DIR with pkgdatadir.
8584 * INSTALL: document --with-lyxname.
8587 * configure.in: new configure flag --with-lyxname which allows to
8588 choose the name under which lyx is installed. Default is "lyx", of
8589 course. It used to be possible to do this with --program-suffix,
8590 but the later has in fact a different meaning for autoconf.
8592 * src/support/lstrings.h (lstrchr): reformat a bit.
8594 * src/lyxlex.h: include LIstream.h, for Sun CC this time.
8595 * src/mathed/math_defs.h: ditto.
8597 2000-01-09 Lars Gullik Bjønnes <larsbj@lyx.org>
8599 * src/lyxrc.[Ch]: New tag and variable "\make_backup". Defaults to
8600 true, decides if we create a backup file or not when saving. New
8601 tag and variable \pdf_mode, defaults to false. New tag and
8602 variable \pdflatex_command, defaults to pdflatex. New tag and
8603 variable \view_pdf_command, defaults to xpdf. New tag and variable
8604 \pdf_to_ps_command, defaults to pdf2ps.
8606 2000-01-08 Lars Gullik Bjønnes <larsbj@lyx.org>
8608 * src/bufferlist.C (close): don't call insetUnlock if the buffer
8609 does not have a BufferView.
8610 (unlockInset): ditto + don't access the_locking_inset if the
8611 buffer does not have a BufferView.
8613 * src/LyXView.C (KeyPressMask_raw_callback): add a XSync in
8614 certain circumstances so that we don't continue a keyboard
8615 operation long after the key was released. Try f.ex. to load a
8616 large document, press PageDown for some seconds and then release
8617 it. Before this change the document would contine to scroll for
8618 some time, with this change it stops imidiatly.
8620 * src/support/block.h: don't allocate more space than needed. As
8621 long as we don't try to write to the arr[x] in a array_type arr[x]
8622 it is perfectly ok. (if you write to it you might segfault).
8623 added operator value_type*() so that is possible to pass the array
8624 to functions expecting a C-pointer.
8626 * lib/Makefile.am (dist-hook): don't fail completely if unable to
8629 * intl/*: updated to gettext 0.10.35, tried to add our own
8630 required modifications. Please verify.
8632 * po/*: updated to gettext 0.10.35, tried to add our own required
8633 modifications. Please verify.
8635 * src/support/lstrings.C (tostr): go at fixing the problem with
8636 cxx and stringstream. When stringstream is used return
8637 oss.str().c_str() so that problems with lyxstring and basic_string
8638 are avoided. Note that the best solution would be for cxx to use
8639 basic_string all the way, but it is not conformant yet. (it seems)
8641 * src/lyx_cb.C + other files: moved several global functions to
8642 class BufferView, some have been moved to BufferView.[Ch] others
8643 are still located in lyx_cb.C. Code changes because of this. (part
8644 of "get rid of current_view project".)
8646 * src/buffer.C + other files: moved several Buffer functions to
8647 class BufferView, the functions are still present in buffer.C.
8648 Code changes because of this.
8650 * config/lcmessage.m4: updated to most recent. used when creating
8653 * config/progtest.m4: updated to most recent. used when creating
8656 * config/gettext.m4: updated to most recent. applied patch for
8659 * config/gettext.m4.patch: new file that shows what changes we
8660 have done to the local copy of gettext.m4.
8662 * config/libtool.m4: new file, used in creation of acinclude.m4
8664 * config/lyxinclude.m4: new file, this is the lyx created m4
8665 macros, used in making acinclude.m4.
8667 * autogen.sh: GNU m4 discovered as a separate task not as part of
8668 the lib/configure creation.
8669 Generate acinlucde from files in config. Actually cat
8670 lyxinclude.m4, libtool.m4 and gettext.m4 together. This makes it
8671 easier to upgrade .m4 files that really are external.
8673 * src/Spacing.h: moved using std::istringstream to right after
8674 <sstream>. This should fix the problem seen with some compilers.
8676 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8678 * src/lyx_cb.C: began some work to remove the dependency a lot of
8679 functions have on BufferView::text, even if not really needed.
8680 (GetCurrentTextClass): removed this func, it only hid the
8683 * src/Makefile.am (lyx_DEPENDENCIES): use support/libsupport.la I
8684 forgot this in last commit.
8686 * src/Bullet.C (bulletEntry): use static char const *[] for the
8687 tables, becuase of this the return arg had to change to string.
8689 (~Bullet): removed unneeded destructor
8691 * src/BufferView.C (beforeChange): moved from lyx_cb.C
8692 (insetSleep): moved from Buffer
8693 (insetWakeup): moved from Buffer
8694 (insetUnlock): moved from Buffer
8696 * buffer.[Ch], BufferView.[Ch] + others: moved the_locking_inset
8697 from Buffer to BufferView.
8699 * acinclude.m4: include libtool.m4 from libtool 1.3.4.
8701 * config/ltmain.sh: updated to version 1.3.4 of libtool
8703 * config/ltconfig: updated to version 1.3.4 of libtool
8705 2000-01-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8708 * src/buffer.C (pop_tag): fix a dubious for() loop initialization.
8709 Did I get that right?
8711 * src/lyxlex.h: add a "using" directive or two.
8712 * src/Spacing.h: ditto.
8713 * src/insets/figinset.C: ditto.
8714 * src/support/filetools.C: ditto.
8715 * src/support/lstrings.C: ditto.
8716 * src/BufferView.C: ditto.
8717 * src/bufferlist.C: ditto.
8718 * src/lyx_cb.C: ditto.
8719 * src/lyxlex.C: ditto.
8721 * NEWS: add some changes for 1.1.4.
8723 2000-01-06 Lars Gullik Bjønnes <larsbj@lyx.org>
8725 * src/BufferView.C: first go at a TextCache to speed up switching
8728 2000-01-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8730 * lib/examples/ItemizeBullets.lyx: update from Tino Meinen.
8731 * lib/examples/nl_voorbeeld_ruw.lyx: ditto.
8732 * lib/examples/nl_voorbeeld_verlyxt.lyx: ditto.
8733 * lib/examples/nl_opsommingstekens.lyx: new translation from Tino
8736 * src/mathed/math_defs.h (MathedRowSt): make sure that all
8737 members of the struct are correctly initialized to 0 (detected by
8739 * src/lyxrc.C (LyXRC): ditto for print_adapt_output.
8740 * src/insets/figinset.C (InsetFig): ditto for pswid and pshgh.
8742 * src/insets/figinset.C (sigchldchecker): use "delete" to free a
8743 pidwait, since it was allocated with "new". This was potentially
8744 very bad. Thanks to Michael Schmitt for running purify for us.
8747 2000-01-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8749 * src/lyx_gui_misc.C: add a 'using std::make_pair;' statement.
8751 * src/lyx_gui_misc.h: add a 'using std::pair;' statement.
8753 1999-12-30 Allan Rae <rae@lyx.org>
8755 * lib/templates/IEEEtran.lyx: minor change
8757 * src/lyxvc.C (registrer, checkIn), src/lyx_cb.C (MenuInsertLabel),
8758 src/mathed/formula.C (LocalDispatch): askForText changes
8760 * src/lyx_gui_misc.[Ch] (askForText): now returns a bool also so we
8761 know when a user has cancelled input. Fixes annoying problems with
8762 inserting labels and version control.
8764 1999-12-29 Lars Gullik Bjønnes <larsbj@lyx.org>
8766 * src/support/lstrings.C (tostr): rewritten to use strstream and
8769 1999-12-28 Lars Gullik Bjønnes <larsbj@lyx.org>
8771 * src/support/filetools.C (IsFileWriteable): use fstream to check
8772 (IsDirWriteable): use fileinfo to check
8774 * src/support/filetools.h (FilePtr): whole class deleted
8776 * src/insets/figinset.C (GetPSSizes): rewritten to use ifstream.
8778 * src/lyxparagraph.h (readSimpleWholeFile): make arg istream
8780 * src/lyx_cb.C (InsertAsciiFile): use ifstream instead of FilePtr
8782 * src/bufferlist.C (write): use ifstream and ofstream instead of
8785 * src/Spacing.h: use istrstream instead of sscanf
8787 * src/mathed/math_defs.h: change first arg to istream from FILE*
8789 * src/buffer.C (insertLyXFile): use ifstream instead of FilePtr
8791 * src/mathed/math_parser.C: have yyis to be an istream
8792 (LexGetArg): use istream (yyis)
8794 (mathed_parse): ditto
8795 (mathed_parser_file): first arg istream instead of FILE*, set yyis
8797 * src/mathed/formula.C (Read): rewritten to use istream
8799 * src/mathed/formulamacro.C (Read): rewritten to use istream
8801 * src/lyxlex.h (~LyXLex): deleted desturctor
8802 (getStream): new function, returns an istream
8803 (getFile): deleted funtion
8804 (IsOK): return is.good();
8806 * src/lyxlex.C (LyXLex): delete file and owns_file
8807 (setFile): open an filebuf and assign that to a istream instead of
8809 (setStream): new function, takes an istream as arg.
8810 (setFile): deleted function
8811 (EatLine): rewritten us use istream instead of FILE*
8815 * src/table.C (LyXTable): use istream instead of FILE*
8816 (Read): rewritten to take an istream instead of FILE*
8818 1999-12-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8820 * src/buffer.C (Dispatch): remove an extraneous break statement.
8822 * src/support/filetools.C (QuoteName): change to do simple
8823 'quoting'. More work is necessary. Also changed to do nothing
8824 under emx (needs fix too).
8825 (Putenv): Cast the argument of putenv() with PUTENV_TYPE_ARG.
8827 * acinclude.m4 (STL_STRING_FWD_H_LOCATION): add the comment for
8828 config.h.in to the AC_DEFINE_UNQUOTED() call.
8829 (LYX_FUNC_PUTENV_ARGTYPE): new macro. Checks whether putenv()
8830 needs char * as argument (because Solaris 7 declares it like
8833 * acconfig.h: remove placeholder for STL_STRING_FWD_H_LOCATION;
8834 remove definition of BZERO.
8836 1999-12-24 Lars Gullik Bjønnes <larsbj@lyx.org>
8838 * src/support/LRegex.C: include <regex.h> if HAVE_REGEX_H is
8839 defined, "lyxregex.h" if not.
8841 * src/support/Makefile.am (noinst_LTLIBRARIES): changed from
8843 (REGEX): new variable that is set to regex.c lyxregex.h when
8844 AM_CONDITIONAL USE_REGEX is set.
8845 (libsupport_la_SOURCES): add $(REGEX)
8847 * src/mathed/Makefile.am (noinst_LTLIBRARIES): changed from
8850 * src/insets/Makefile.am (noinst_LTLIBRARIES): changed from
8853 * configure.in: add call to LYX_REGEX
8855 * acinclude.m4 (LYX_REGEX): checks if we need to use the included
8856 regex or not. Uses a a AM_CONDITIONAL to decide what to compile.
8858 1999-12-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8860 * lib/bind/fi_menus.bind: new file, from
8861 pauli.virtanen@saunalahti.fi.
8863 * src/buffer.C (getBibkeyList): pass the parameter delim to
8864 InsetInclude::getKeys and InsetBibtex::getKeys.
8866 * src/insets/insetinclude.[Ch] (getKeys): add parameter delim, which
8867 is passed to Buffer::getBibkeyList
8869 * src/insets/insetbib.[Ch] (getKeys): add parameter delim, and use it
8870 instead of the hardcoded comma.
8872 * src/insets/insetbib.C (getKeys): make sure that there are not
8873 leading blanks in bibtex keys. Normal latex does not care, but
8874 harvard.sty seems to dislike blanks at the beginning of citation
8875 keys. In particular, the retturn value of the function is
8877 * INSTALL: make it clear that libstdc++ is needed and that gcc
8878 2.7.x probably does not work.
8880 * src/support/filetools.C (findtexfile): make debug message go to
8882 * src/insets/insetbib.C (getKeys): ditto
8884 * src/debug.C (showTags): make sure that the output is correctly
8887 * configure.in: add a comment for TWO_COLOR_ICON define.
8889 * acconfig.h: remove all the entries that already defined in
8890 configure.in or acinclude.m4.
8892 * src/buffer.C (makeLaTeXFile): headers of latex file also changed
8893 to avoid user name, date and copyright.
8895 1999-12-21 Juergen Vigna <jug@sad.it>
8897 * src/table.C (Read): Now read bogus row format informations
8898 if the format is < 5 so that afterwards the table can
8899 be read by lyx but without any format-info. Fixed the
8900 crash we experienced when not doing this.
8902 1999-12-21 Lars Gullik Bjønnes <larsbj@lyx.org>
8904 * src/text2.C (RedoHeightOfParagraph): rename arg cursor -> cur
8905 (RedoDrawingOfParagraph): ditto
8906 (RedoParagraphs): ditto
8907 (RemoveTableRow): ditto
8909 * src/text.C (Fill): rename arg paperwidth -> paper_width
8911 * src/buffer.C (insertLyXFile): rename var filename -> fname
8912 (writeFile): rename arg filename -> fname
8913 (writeFileAscii): ditto
8914 (makeLaTeXFile): ditto
8915 (makeLinuxDocFile): ditto
8916 (makeDocBookFile): ditto
8918 * src/LaTeX.C (runMakeIndex): change arg name from file -> f
8921 * src/Makefile.am (lyx_SOURCES): add bmtable.c and remove bmtable.C
8923 * src/bmtable.h: add extern "C" on this file when __cplusplus is
8926 * src/bmtable.c: new file, a C'ified copy of bmtable.C, this is
8927 compiled by a C compiler not C++.
8929 * src/layout.h (LyXTextClass): added typedef for const_iterator
8930 (LyXTextClassList): added typedef for const_iterator + member
8931 functions begin and end.
8933 * src/LyXView.C (UpdateDocumentClassChoice): rewritten to use
8934 iterators to fill the choice_class.
8935 (updateLayoutChoice): rewritten to use iterators to fill the
8936 layoutlist in the toolbar.
8938 * src/BufferView.h (BufferView::work_area_width): removed unused
8941 * src/lyx_gui_misc.C (WarnReadonly): added string parameter 'file'
8943 * src/buffer.C (sgmlOpenTag): drop the use of the static space array
8944 (sgmlCloseTag): ditto
8946 * src/support/lstrings.h: return type of countChar changed to
8949 * src/support/lstrings.C (countChar): use HAVE_STD_COUNT to choose
8950 what version of this func to use. Also made to return unsigned int.
8952 * configure.in: call LYX_STD_COUNT
8954 * acinclude.m4 (LYX_STD_COUNT): new function checks for a standard
8955 conforming std::count.
8957 1999-12-20 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
8959 * src/mathed/math_draw.C (Draw, Metrics): fix a bug where a prime
8960 and a subscript would give bad display (patch from Dekel Tsur
8961 <dekel@math.tau.ac.il>).
8963 * src/insets/insetlatexaccent.h: make sure ACCENT_TYPES is public.
8965 * src/spellchecker.C (create_ispell_pipe): use a const_cast to
8968 * src/chset.h: add a few 'using' directives
8970 * src/lyxfunc.C (Dispatch): check that LFUN_UNKNOWN_ACTION is not
8971 triggered when no buffer is active
8973 * src/layout.C: removed `break' after `return' in switch(), since
8976 * src/lyx_main.C (init): make sure LyX can be ran in place even
8977 when libtool has done its magic with shared libraries. Fix the
8978 test for the case when the system directory has not been found.
8980 * src/lyx_cb.C (MenuMakeLaTeX): make sure to keep the full path
8981 name for the latex file.
8982 (MenuMakeHTML): ditto
8984 * src/buffer.h: add an optional boolean argument, which is passed
8987 1999-12-20 Allan Rae <rae@lyx.org>
8989 * lib/templates/IEEEtran.lyx: small correction and update.
8991 * configure.in: Attempted to use LYX_PATH_HEADER
8993 * src/stl_string_fwd.h: Don't need HAVE_STL_STRING_FWD_H anymore
8995 * acconfig.h, acinclude.m4 (LYX_STL_STRING_FWD): totally revised after
8996 input from JMarc. Now use preprocessor to find the header.
8997 Also stopped making HAVE_STL_STRING_FWD_H and extended the comments.
8998 (LYX_PATH_HEADER): My, so far, failed attempt to generalize
8999 LYX_STL_STRING_FWD. See comments in file.
9001 1999-12-19 Asger Alstrup Nielsen <alstrup@diku.dk>
9003 * The global MiniBuffer * minibuffer variable is dead.
9005 * The global FD_form_main * fd_form_main variable is dead.
9007 1999-12-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9009 * src/toolbar.C (set): condition #warning on WITH_WARNINGS
9011 * src/table.h: add the LOstream.h header
9012 * src/debug.h: ditto
9014 * src/LyXAction.h: change the explaination of the ReadOnly
9015 attribute: is indicates that the function _can_ be used.
9017 * src/LyXAction.C (init): find-replace _can_ be used in read-only
9020 1999-12-16 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9022 * src/lyxfont.C (ascent): Make sure that char is _always_ used as
9028 * src/paragraph.C (GetWord): assert on pos>=0
9031 * src/support/lyxstring.C: condition the use of an invariant on
9033 * src/support/lyxstring.h: ditto
9035 * src/Bullet.[Ch]: replace DEBUG_AS_DEFAULT by ENABLE_ASSERTIONS.
9036 Use LAssert.h instead of plain assert().
9038 * src/support/lstrings.h: add LAssert.h, in case it is needed.
9040 * src/lyxfunc.C: do not include LAssert.h, it is not used.
9041 * src/support/filetools.C: ditto
9043 * src/support/LAssert.h: make Assert a no-op if ENABLE_ASSERTIONS
9046 * INSTALL: document the new configure flags
9048 * configure.in: suppress --with-debug; add --enable-assertions
9050 * acinclude.m4: various changes in alignment of help strings.
9052 1999-12-16 Lars Gullik Bjønnes <larsbj@lyx.org>
9054 * src/kbmap.C: commented out the use of the hash map in kb_map,
9055 beginning of movement to a stl::container.
9057 * several files: removed code that was not in effect when
9058 MOVE_TEXT was defined.
9060 * lib/kbd/iso8859-1.cdef: removed bogus backslashes. Backslashes
9061 for escaping should not be used. We can discuss if the string
9062 should be enclosed in f.ex. [] instead of "".
9064 * src/trans_mgr.C (insert): use the new returned value from
9065 encodeString to get deadkeys and keymaps done correctly.
9067 * src/chset.C (encodeString): changed to return a pair, to tell
9068 what to use if we know the string.
9070 * src/lyxscreen.h (fillArc): new function.
9072 * src/FontInfo.C (resize): rewritten to use more std::string like
9073 structore, especially string::replace.
9075 * src/insets/insetlatexaccent.C (Draw): use fillArc for the
9078 * configure.in (chmod +x some scripts): remove config/gcc-hack
9080 1999-12-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9082 * src/buffer.C (writeFile): change once again the top comment in a
9083 .lyx file to point to www.lyx.org and to use LYX_DOCVERSION
9084 instead of an hardcoded version number.
9085 (makeDocBookFile): ditto
9087 * src/version.h: add new define LYX_DOCVERSION
9089 * po/de.po: update from Pit Sütterlin
9090 * lib/bind/de_menus.bind: ditto.
9092 * src/lyxfunc.C (Dispatch): call MenuExport()
9093 * src/buffer.C (Dispatch): ditto
9095 * src/lyx_cb.C (MenuMakeHTML): new function, moved from
9096 LyXFunc::Dispatch().
9097 (MenuExport): new function, moved from
9098 LyXFunc::Dispatch().
9100 * src/trans_mgr.C (insert): small cleanup
9101 * src/chset.C (loadFile): ditto
9103 * lib/kbd/iso8859-1.cdef: add missing backslashes
9105 1999-12-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9107 * src/insets/insetlatexaccent.C (Lbearing): new function, used to
9108 help with placing the manually drawn accents better.
9110 (Draw): x2 and hg changed to float to minimize rounding errors and
9111 help place the accents better.
9113 * src/lyxfont.C (ascent): fixed faulty static_cast, casting from
9114 unsigned short to char is just wrong...cast the char to unsigned
9115 char instead so that the two values can compare sanely. This
9116 should also make the display of insetlatexaccents better and
9117 perhaps also some other insets.
9119 (lbearing): new function
9122 1999-12-15 Allan Rae <rae@lyx.org>
9124 * src/stl_string_fwd.h, src/Makefile.am (lyx_SOURCES): added new
9125 header that provides a wrapper around the very annoying SGI STL header
9128 * src/support/lyxstring.C, src/LString.h:
9129 removed old SGI-STL-compatability attempts.
9131 * configure.in: Use LYX_STL_STRING_FWD.
9133 * acinclude.m4 (LYX_STL_STRING_FWD), acconfig.h: Test if
9134 stl_string_fwd.h is around and try to determine it's location.
9135 Major improvement over previous SGI STL 3.2 compatability.
9136 Three small problems remain with this function due to my zero
9137 knowledge of autoconf. JMarc and lgb see the comments in the code.
9139 1999-12-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9141 * src/broken_const.h, config/hack-gcc, config/README: removed
9143 * configure.in: remove --with-gcc-hack option; do not call
9146 * INSTALL: remove documentation of --with-broken-const and
9149 * acconfig.h: remove all trace of BROKEN_CONST define
9151 * src/buffer.C (makeDocBookFile): update version number in output
9153 (SimpleDocBookOnePar): fix an assert when trying to a character
9154 access beyond string length
9157 1999-12-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9159 * po/de.po: fix the Export menu
9161 * lyx.man: update the description of -dbg
9163 * src/lyx_main.C (setDebuggingLevel): call Debug::showLevel()
9164 (commandLineHelp): updated
9165 (easyParse): show list of available debug levels if -dbg is passed
9168 * src/Makefile.am: add debug.C
9170 * src/debug.h: moved some code to debug.C
9172 * src/debug.C: new file. Contains code to set and show debug
9175 * src/layout.C: remove 'break' after 'continue' in switch
9176 statements, since these cannot be reached.
9178 1999-12-13 Allan Rae <rae@lyx.org>
9180 * src/mathed/math_hash.C (math_hash): renamed from hash(), name clash.
9181 (in_word_set): hash() -> math_hash()
9183 * src/LString.h: Used USING_EXCEPTIONS in SGI STL-3.2 support
9185 * acconfig.h: Added a test for whether we are using exceptions in the
9186 current compilation run. If so USING_EXCEPTIONS is defined.
9188 * config.in: Check for existance of stl_string_fwd.h
9189 * src/LString.h: If compiling --with-included-string and SGI's
9190 STL version 3.2 is present (see above test) we need to block their
9191 forward declaration of string and supply a __get_c_string().
9192 However, it turns out this is only necessary if compiling with
9193 exceptions enabled so I've a bit more to add yet.
9195 * src/insets/figinset.[Ch], src/insets/insetinclude.C,
9196 src/insets/insetloa.C, src/layout.h, src/lyxparagraph.h,
9197 src/support/LRegex.h, src/undo.h:
9198 Shuffle the order of the included files a little to ensure that
9199 LString.h gets included before anything that includes stl_string_fwd.h
9201 * src/support/lyxstring.C: We need to #include LString.h instead of
9202 lyxstring.h to get the necessary definition of __get_c_string.
9203 (__get_c_string): New function. This is defined static just like SGI's
9204 although why they need to do this I'm not sure. Perhaps it should be
9205 in lstrings.C instead.
9207 * lib/templates/IEEEtran.lyx: New template file.
9209 1999-12-12 Lars Gullik Bjønnes <larsbj@lyx.org>
9211 * Makefile.in.in (MKINSTALLDIRS): use $(srcdir)/@MKINSTALLDIRS@
9212 * intl/Makefile.in (MKINSTALLDIRS): ditto
9214 * src/LyXAction.C (init): changed to hold the LFUN data in a
9215 automatic array in stead of in callso to newFunc, this speeds up
9216 compilation a lot. Also all the memory used by the array is
9217 returned when the init is completed.
9219 * a lot of files: compiled with -Wold-style-cast, changed most of
9220 the reported offenders to C++ style casts. Did not change the
9221 offenders in C files.
9223 * src/trans.h (Match): change argument type to unsigned int.
9225 * src/support/DebugStream.C: fix some types on the streambufs so
9226 that it works on a conforming implementation.
9228 1999-12-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9230 * lib/examples/example_{raw,lyxified}.lyx: fix embarassing sentence.
9232 * src/support/lyxstring.C: remove the inline added earlier since
9233 they cause a bunch of unsatisfied symbols when linking with dec
9234 cxx. Cxx likes to have the body of inlines at the place where they
9237 * src/trans.C (AddDeadkey): add an 'unsigned char' cast to avoid
9238 accessing negative bounds in array. This fixes the crash when
9239 inserting accented characters.
9240 * src/trans.h (Match): ditto
9242 * src/buffer.C (Dispatch): since this is a void, it should not try
9243 to return anything...
9245 1999-12-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9247 * src/buffer.h: removed the two friends from Buffer. Some changes
9248 because of this. Buffer::getFileName and Buffer::setFileName
9249 renamed to Buffer::fileName() and Buffer::fileName(...).
9251 1999-12-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9253 * buffer.[Ch], BufferView.[Ch] + other files: Moved Buffer::text
9254 and Buffer::update(short) to BufferView. This move is currently
9255 controlled by a define MOVE_TEXT, this will be removed when all
9256 shows to be ok. This move paves the way for better separation
9257 between buffer contents and buffer view. One side effect is that
9258 the BufferView needs a rebreak when swiching buffers, if we want
9259 to avoid this we can add a cache that holds pointers to LyXText's
9260 that is not currently in use.
9262 * buffer.[Ch], lyx_main.C: small changes to the "-export" patch by
9265 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9267 * buffer.[Ch]: Dispatch() - new dispatcher on the buffer level
9269 * lyx_main.C: new command line option -x (or --execute) and
9270 -e (or --export). Now direct conversion from .lyx to .tex
9271 (.dvi, .ps, ...) is possible ('lyx file.lyx --export latex')
9272 Unfortunately, X is still needed and the GUI pops up during the
9275 1999-12-07 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9277 * src/Spacing.C: add a using directive to bring stream stuff into
9279 * src/paragraph.C: ditto
9280 * src/buffer.C: ditto
9282 * NEWS: updated a bit the new features of 1.1.3 (took a few things
9283 from Lars' announcement).
9285 * lib/examples/nl_voorbeeld_{ruw,verlyxt}.lyx: new tutorial
9286 example files from Tino Meinen.
9288 1999-12-06 Allan Rae <rae@lyx.org>
9290 * src/LaTeX.C (runBibTeX): fix typo in accessing submatch pair.
9292 1999-12-07 Lars Gullik Bjønnes <larsbj@lyx.org>
9294 * src/support/lyxstring.C: added a lot of inline for no good
9297 * src/lyxfont.[Ch]: removed latexWriteStartChanges, and
9298 latexWriteEndChanges, they were not used.
9300 * src/layout.h (operator<<): output operator for PageSides
9302 * src/mathed/math_iter.C (my_memcpy): slightly changed.
9304 * some example files: loaded in LyX 1.0.4 and saved again to update
9305 certain constructs (table format)
9307 * a lot of files: did the change to use fstream/iostream for all
9308 writing of files. Done with a close look at Andre Poenitz's patch.
9310 * some files: whitespace changes.
9312 1999-12-06 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9314 * src/mathed/math_iter.C (my_memcpy): new function. Since the
9315 built-in memcpy() is broken on egcs and gcc 2.95 for alpha
9316 architecture, we provide our own. It is used unconditionnally, but
9317 I do not think this is a performance problem. Thanks to Angus
9318 Leeming <a.leeming@ic.ac.uk> for the code (and again to Michal
9319 Jaegermann <michal@ellpspace.math.ualberta.ca> for finding it the
9321 (GetInset): use my_memcpy.
9325 * lib/chkconfig.ltx: some cleanup of the latex code. I am not sure
9326 it is easier to understand, but it uses less TeX-only constructs now.
9328 * acinclude.m4 (LYX_SEARCH_PROG): make it work when the PATH
9329 elements contain spaces
9331 * lib/configure: regenerated
9333 * lib/configure.m4 (SEARCH_PROG): make it work when the PATH
9334 elements contain spaces; display the list of programs that are
9337 * autogen.sh: make sure lib/configure is executable
9339 * lib/examples/*: rename the tutorial examples to begin with the
9340 two-letters language code.
9342 * src/lyxfunc.C (getStatus): do not query current font if no
9345 * src/lyx_cb.C (RunScript): use QuoteName
9346 (MenuRunDvips): ditto
9347 (PrintApplyCB): ditto
9349 * src/support/filetools.[Ch] (QuoteName): new function. Add quotes
9350 around argument, so that it works well with the current shell.
9351 Does not work properly with OS/2 shells currently.
9353 * src/LaTeXLog.C (ShowLatexLog): use Buffer::getLatexName
9354 * src/LyXSendto.C (SendtoApplyCB): ditto
9355 * src/lyxfunc.C (Dispatch): ditto
9356 * src/buffer.C (runLaTeX): ditto
9357 (runLiterate): ditto
9358 (buildProgram): ditto
9360 * src/lyx_cb.C (RunScript): ditto
9361 (MenuMakeLaTeX): ditto
9363 * src/buffer.h (getLatexName): new method
9365 * src/support/filetools.C (MakeLatexName): renamed from SpaceLess
9367 1999-12-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9369 * images/sqrt.xpm: change name of the sqrt icon to sqrt_xpm.
9370 * src/mathed/math_panel.C (mathed_get_pixmap_from_icon): ditto
9371 (create_math_panel): ditto
9373 * src/lyxfunc.C (getStatus): re-activate the code which gets
9374 current font and cursor; add test for export to html.
9376 * src/lyxrc.C (read): remove unreachable break statements; add a
9379 * src/bmtable.C (fl_set_bmtable_data): add a const_cast.
9381 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9383 * src/mathed/formula.C (LocalDispatch): fix small whitspace bug
9384 introduced by faulty regex.
9385 * src/buffer.C: ditto
9386 * src/lastfiles.C: ditto
9387 * src/paragraph.C: ditto
9388 * src/table.C: ditto
9389 * src/vspace.C: ditto
9390 * src/insets/figinset.C: ditto
9391 Note: most of these is absolutely harmless, except the one in
9392 src/mathed formula.C.
9394 1999-11-30 Kayvan A. Sylvan <kayvan@satyr.sylvan.com>
9396 * src/ImportNoweb.C (documentclass): fixed bounds for substr
9397 operation, yielding correct results for the reLyX command.
9399 1999-12-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9401 * src/support/filetools.C (ExpandPath): removed an over eager
9403 (ReplaceEnvironmentPath): ditto
9405 * src/toolbar.C (BubbleTimerCB): use C++ style casts. This clearly
9406 shows that we are doing something fishy in our code...
9410 * src/lyxrc.C (read): use a double switch trick to get more help
9411 from the compiler. (the same trick is used in layout.C)
9412 (write): new function. opens a ofstream and pass that to output
9413 (output): new function, takes a ostream and writes the lyxrc
9414 elemts to it. uses a dummy switch to make sure no elements are
9417 * src/lyxlex.h: added a struct pushpophelper for use in functions
9418 with more than one exit point.
9420 * src/lyxlex.[Ch] (GetInteger): made it const
9424 * src/lyxfunc.C (Dispatch): added case for LFUN_SAVEPREFERENCES
9426 * src/layout.[hC] : LayoutTags splitted into several enums, new
9427 methods created, better error handling cleaner use of lyxlex. Read
9430 * src/bmtable.[Ch]: change some member prototypes because of the
9431 image const changes.
9433 * commandtags.h, src/LyXAction.C (init): new function:
9434 "preferences-save", saves the lyxrc entries into .lyx/preferences.
9435 This file is not read automatically but you can add \input
9436 preferences to your lyxrc if you want to. We need to discuss how
9439 * src/LaTeX.C (runBibTeX): use regex to match for the needed lines
9440 in .aux, also remove .bib and .bst files from dependencies when
9443 * src/BufferView.C, src/LyXView.C: add const_cast several places
9444 because of changes to images.
9446 * lib/images/*: same change as for images/*
9448 * lib/lyxrc.example: Default for accept_compound is false not no.
9450 * images/*: changed to be const, however I have som misgivings
9451 about this change so it might be changed back.
9453 1999-11-26 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9455 * lib/configure, po/POTFILES.in: regenerated
9457 * autogen.sh: autogenerate lib/configure from lib/configure.m4
9459 * config/lib_configure.m4: removed
9461 * lib/configure.m4: new file (was config/lib_configure.m4)
9463 * configure.in: do not test for rtti, since we do not use it.
9465 1999-11-26 Lars Gullik Bjønnes <larsbj@lyx.org>
9467 * src/support/lyxstring.C (lyxstring::Srep): Changed to use a
9468 doubling of allocated space scheme. This makes it faster for large
9469 strings end to use less memory for small strings. xtra rememoved.
9471 * src/insets/figinset.C (waitalarm): commented out.
9472 (GhostscriptMsg): use static_cast
9473 (GhostscriptMsg): use new instead of malloc to allocate memory for
9474 cmap. also delete the memory after use.
9476 * src/lyx_cb.C (SetXtermCursor): made cursor_undefined a bool
9478 * src/LaTeX.C (scanAux): new method. Scans the .aux file and looks
9479 for changes in bibtex database or style.
9480 (runBibTeX): remove all .bib and .bst files from dep before we
9482 (run): use scanAuc in when dep file already exist.
9484 * src/DepTable.C (remove_files_with_extension): new method
9487 * src/DepTable.[Ch]: made many of the methods const.
9489 1999-11-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9491 * src/bufferparams.C: make sure that the default textclass is
9492 "article". It used to be the first one by description order, but
9493 now the first one is "docbook".
9495 * src/lyx_main.C (setDebuggingLevel): change type of argument to
9496 string; call Debug::value.
9497 (easyParse): pass complete argument to setDebuggingLevel().
9499 * src/debug.h (value): fix the code that parses debug levels.
9501 * src/debug.h: add new debug type ACTION, reserved for LyXAction
9504 * src/LyXAction.C: use Debug::ACTION as debug channel.
9506 * src/lyxlookup.C: make the debug statements go to Debug::KEY.
9508 * NEWS: updated for the future 1.1.3 release.
9510 * src/mathed/symbol_def.h: swap the definitions of \varepsilon and
9511 \epsilon. Now \epsilon shows as red text, and \varepsilon shows as
9512 it should. This is of course a controversial change (since many
9513 people will find that their lyx workscreen is suddenly full of
9514 red), but done for the sake of correctness.
9516 * src/mathed/formulamacro.h, src/mathed/math_macro.[Ch],
9517 src/mathed/math_root.[Ch] (Clone): return a MathedInset*
9519 * src/insets/inseterror.h, src/insets/inseturl.h,
9520 src/insets/insetinfo.h, src/insets/figinset.h,
9521 src/mathed/formulamacro.h, src/mathed/math_macro.h
9522 (EditMessage): add a missing const and add _() to make sure that
9525 * src/ImportNoweb.C, src/LyXAction.h, src/insets/figinset.C,
9526 src/insets/insetbib.C, src/support/filetools.C: add `using'
9529 * src/lyxfunc.C (Dispatch): make sure nothing bad happens when
9530 doing 'Insert index of last word' at the beginning of a paragraph.
9532 1999-11-24 Lars Gullik Bjønnes <larsbj@lyx.org>
9534 * several files: white-space changes.
9536 * src/mathed/formula.C: removed IsAlpha and IsDigit
9538 * src/insets/insetbib.C (getKeys): use findtexfile to look for the
9539 .bib file. use a ifstream instead of FilePtr when parsing the .bib
9542 * src/insets/figinset.C (GetPSSizes): don't break when
9543 "EndComments" is seen. But break when a boundingbox is read.
9545 * all classes inherited from Inset: return value of Clone
9546 changed back to Inset *.
9548 * all classes inherited form MathInset: return value of Clone
9549 changed back to MathedInset *.
9551 * src/insets/figinset.C (runqueue): use a ofstream to output the
9552 gs/ps file. Might need some setpresicion or setw. However I can
9553 see no problem with the current code.
9554 (runqueue): use sleep instead of the alarm/signal code. I just
9555 can't see the difference.
9557 * src/paragraph.C (LyXParagraph): reserve space in the new
9558 paragraph and resize the inserted paragraph to just fit.
9560 * src/lyxfunc.h (operator|=): added operator for func_status.
9562 * src/lyxfunc.C (MenuNew): use FileInfo instead of FilePtr to
9563 check for readable file.
9565 * src/lyx_cb.C (MenuMakeLaTeX): use FileInfo instead of FilePtr to
9566 check for readable file.
9567 (MenuMakeLinuxDoc): ditto
9568 (MenuMakeDocBook): ditto
9569 (MenuMakeAscii): ditto
9570 (InsertAsciiFile): split the test for openable and readable
9572 * src/bmtable.C (draw_bitmaptable): use
9573 fl_state[fl_get_vclass()].depth instead of DefualtScreen.
9575 * src/LaTeX.C, src/support/filetools.[Ch]: moved do_popen and
9576 findtexfile from LaTeX to filetools.
9578 * src/ImportNoweb.C (documentclass): rewrote to use ifstream
9579 instead of FilePtr. Needs to be verified by a literate user.
9581 1999-11-23 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9583 * src/mathed/formula.[Ch] (GetCursorPos): add a missing 'const'.
9584 (EditMessage): likewise.
9586 * src/paragraph.C (SimpleTeXSpecialChars): output ~ and ^
9587 respectively as \textasciitilde and \textasciicircum.
9589 1999-11-22 Lars Gullik Bjønnes <larsbj@lyx.org>
9591 * src/support/lyxstring.h: made the methods that take iterators
9594 * src/support/lstrings.C (countChar): use std::cound(itr, itr, val)
9595 (regexMatch): made is use the real regex class.
9597 * src/support/Makefile.am: changed to use libtool
9599 * src/support/.cvsignore: added *.lo, .libs and libsupport.la
9601 * src/mathed/math_defs.h: made the mathaligns be in a enum instead
9603 (MathIsInset ++): changed several macros to be inline functions
9606 * src/mathed/Makefile.am: changed to use libtool
9608 * src/mathed/.cvsignore: added *.lo, .libs and libmathed.la
9610 * src/insets/inset* : Clone changed to const and return type is
9611 the true insettype not just Inset*.
9613 * src/insets/Makefile.am: changed to use libtool
9615 * src/insets/.cvsignore: added *.lo, .libs and libinsets.la
9617 * src/undo.[Ch] : added empty() and changed some of the method
9620 * src/texrow.[Ch]: rewrote to store texrow's in a std::list.
9622 * src/lyxparagraph.h: use id() and id(...) instead of getID and
9623 setID use block<> for the bullets array, added const several places.
9625 * src/lyxfunc.C (getStatus): new function
9627 * src/lyxfunc.[Ch] : small changes to take advantage of the new
9628 LyXAction, added const to several funtions.
9630 * src/filedlg.[Ch]: rewrote to store userchache and groupchache in
9631 a std::map, and to store the dir items in a vector.
9633 * src/Makefile.am (lyx_DEPENDENCIES): changed to use libtool files
9636 * src/LyXView.[Ch] + other files : changed currentView to view.
9638 * src/LyXAction.[Ch] : ported from the old devel branch.
9640 * src/.cvsignore: added .libs and a.out
9642 * configure.in : changes to use libtool.
9644 * acinclude.m4 : inserted libtool.m4
9646 * .cvsignore: added libtool
9648 1999-11-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9650 * src/Makefile.am (lyx_DEPENDENCIES): give the explicit object
9651 file name in insets and mathed directories (otherwise the
9652 dependency is not taken in account under cygwin).
9654 * src/text2.C (InsertString[AB]): make sure that we do not try to
9655 read characters past the string length.
9657 1999-11-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9659 * lib/doc/LaTeXConfig.lyx.in,
9660 lib/chkconfig.ltx: remove the test for linuxdoc-sgml.sty.
9662 * src/buffer.C (writeFile): Do not add a comment on top of .lyx
9663 file saying who created them and when this heppened; this is
9664 useless and annoys tools like cvs.
9666 * lib/layouts/g-brief-{en,de}.layout,
9667 lib/templates/g-brief-{en,de}.lyx: new versions of the textclass
9668 from Thomas Hartkens <thomas@hartkens.de>.
9670 * src/{insets,mathed}/Makefile.am: do not declare an empty
9671 LDFLAGS, so that it can be set at configure time (useful on Irix
9674 * lib/reLyX/configure.in: make sure that the prefix is set
9675 correctly in LYX_DIR.
9677 1999-11-18 André Pönitz <poenitz@mathematik.tu-chemnitz.de>
9679 * src/commandtags.h: introduction of a new tag 'LFUN_SEQUENCE' to
9680 be used by 'command-sequence' this allows to bind a key to a
9681 sequence of LyX-commands
9682 (Example: 'command-sequence math-insert alpha; math-insert beta;")
9684 * src/LyXAction.C: add "command-sequence"
9686 * src/LyXFunction.C: handling of "command-sequence"
9688 * src/LyXFunction.[hC] changed LyXFunc::Dispatch(string const
9689 &cmd, string const &arg) to LyXFunc::Dispatch(string const& s)
9691 * src/lyxserver.C, src/minibuffer.C: Use this new interface
9693 1999-11-17 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9695 * src/buffer.C (writeFile): Do not output a comment giving user
9696 and date at the beginning of a .lyx file. This is useless and
9697 annoys cvs anyway; update version number to 1.1.
9699 * src/Makefile.am (LYX_DIR): add this definition, so that a
9700 default path is hardcoded in LyX.
9702 * configure.in: Use LYX_GNU_GETTEXT.
9704 * acinclude.m4 (LYX_GNU_GETTEXT): new macro, essentially a copy of
9705 AM_GNU_GETTEXT with a bug fixed.
9707 * src/lyx_cb.C (RunLinuxDoc): add a cast to please dec cxx.
9709 * src/chset.C: add "using std::ifstream;" to please dec cxx.
9711 * src/lyx_main.C (init), INSTALL.OS2: the environment variable
9712 which is used to point to LyX data is now LYX_DIR_11x.
9714 * lyx.man: convert to a unix text file; small updates.
9716 1999-11-15 Lars Gullik Bjønnes <larsbj@lyx.org>
9718 * src/support/LSubstring.[Ch]: made the second arg of most of the
9719 constructors be a const reference.
9721 * src/mathed/math_parser.C (LexInitCodes): small bug introduced by
9724 * src/support/lyxstring.[Ch] (swap): added missing member function
9725 and specialization of swap(str, str);
9727 * src/menus.C (ShowBufferMenu): to use the new BufferStorage
9729 * src/bufferlist.[Ch]: use the new BufferStorage class and remove all
9730 trace of the old one.
9732 * src/undo.[Ch]: made the undostack use std::list to store undo's in
9733 put the member definitions in undo.C.
9735 * src/lyxparagraph.h, src/paragraph.C + a lot of files: removed
9736 NEW_TEXT and have now only code that was included when this was
9739 * src/intl.C (LCombo): use static_cast
9741 (DispatchCallback): ditto
9743 * src/definitions.h: removed whole file
9745 * src/commandtags.h: comment out LFUN_INSERT_INSET_LATEX
9747 * src/chset.[Ch]: a lot rewritten, does not use lyxlex for cdef
9748 parsing and stores in a std:map. a regex defines the file format.
9749 removed unneeded members.
9751 * src/bufferparams.h: added several enums from definitions.h here.
9752 Removed unsused destructor. Changed some types to use proper enum
9753 types. use block to have the temp_bullets and user_defined_bullets
9754 and to make the whole class assignable.
9756 * src/bufferparams.C (Copy): removed this functions, use a default
9759 * src/buffer.h: made isLatex, isLinuxDoc, isDocBook, isSGML and
9762 * src/buffer.C (readLyXformat2): commend out all that have with
9763 oldpapersize to do. also comment out all that hve to do with
9764 insetlatex and insetlatexdel.
9765 (setOldPaperStuff): commented out
9767 * src/Makefile.am (lyx_SOURCES): remove definitions.h, add undo.C
9769 * src/LyXAction.C: remove use of inset-latex-insert
9771 * src/mathed/math_panel.C (button_cb): use static_cast
9773 * src/insets/Makefile.am (insets_o_SOURCES): removed
9776 * src/support/lyxstring.C (helper): use the unsigned long
9777 specifier, UL, instead of a static_cast.
9779 * src/support/Makefile.am (libsupport_a_SOURCES): added block.h
9781 * src/support/block.h: new file. to be used as a c-style array in
9782 classes, so that the class can be assignable.
9784 1999-11-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9786 * src/lyx_gui_misc.C (askForText): when fl_show_input() returns
9787 NULL, make sure to return an empty string (it is not possible to
9788 set a string to NULL).
9790 1999-11-10 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9792 * src/support/LRegex.C: use regex_t instead of re_pattern_buffer.
9794 * src/support/lyxstring.C (helper): fix bogus cast in assertion.
9796 * src/{mathed,insets}/Makefile.am (CXXLINK): add $(LDFLAGS) to the
9797 link line, so that Irix users (for example) can set it explicitely to
9800 * src/Makefile.am (lyx_LDADD): use LYX_LIB as a variable, so that
9801 it can be overidden at make time (static or dynamic link, for
9804 * src/vc-backend.C, src/LaTeXFeatures.h,
9805 src/support/LRegex.C, src/support/LRegex.h: add a few "using"
9806 statements to bring templates to global namespace.
9808 1999-11-10 Lars Gullik Bjønnes <larsbj@lyx.org>
9810 * src/support/lyxstring.C (operator[] const): make it standard
9813 * src/minibuffer.C (Init): changed to reflect that more
9814 information is given from the lyxvc and need not be provided here.
9816 * src/lyxvc.[Ch]: rewrote to use the vc-backend.
9818 * src/Makefile.am (lyx_SOURCES): add vc-backend.[Ch]
9820 * src/LyXView.C (UpdateTimerCB): use static_cast
9821 (KeyPressMask_raw_callback): ditto
9823 * src/BufferView.[Ch]: name change _owner -> owner_ and _buffer ->
9824 buffer_, a lot of changes because of this. currentBuffer() ->
9825 buffer(), setBuffer(...) -> buffer(...), getOwner() -> owner(),
9826 also changes to other files because of this.
9828 1999-11-09 Lars Gullik Bjønnes <larsbj@lyx.org>
9830 * src/vc-backend.[Ch]: new files. The backends for vc handling,
9831 have no support for RCS and partial support for CVS, will be
9834 * src/insets/ several files: changes because of function name
9835 changes in Bufferview and LyXView.
9837 * src/mathed/math_symbols.C (math_insert_symbol): use static_cast
9839 * src/support/LSubstring.[Ch]: new files. These implement a
9840 Substring that can be very convenient to use. i.e. is this
9842 string a = "Mary had a little sheep";
9843 Substring(a, "sheep") = "lamb";
9844 a is now "Mary has a little lamb".
9846 * src/support/LRegex.[Ch]: a regex class that can be used to pick
9847 out patterns and subpatterns of strings. It is used by LSubstring
9848 and also by vc-backend.C
9850 * src/support/lyxstring.C: went over all the assertions used and
9851 tried to correct the wrong ones and flag which of them is required
9852 by the standard. some bugs found because of this. Also removed a
9853 couple of assertions.
9855 * src/support/Makefile.am (libsupport_a_SOURCES): added
9856 LSubstring.[Ch] and LRegex.[Ch]
9858 * src/support/FileInfo.h: have struct stat buf as an object and
9859 not a pointer to one, some changes because of this.
9861 * src/LaTeXFeatures.C (getTClassPreamble): also use the
9862 information in layout when adding the layouts preamble to the
9865 * src/LaTeXFeatures.h: use a vector<bool> to store the layout
9868 * configure.in (CPPFLAGS): use AC_CHECK_FUNCS to check for XOpenIM
9869 because of bug in OS/2.
9871 1999-11-08 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9873 * lib/layouts/lyxmacros.inc (lyxcode): set the font with
9874 \verbatim@font instead of \ttfamily, so that it can be redefined.
9876 * src/BackStack.h, src/DepTable.C, src/DepTable.h, src/LaTeX.C,
9877 src/LaTeX.h, src/lastfiles.C, src/lastfiles.h, src/layout.C,
9878 src/layout.h, src/text2.C: add 'using' directive to bring the
9879 STL templates we need from the std:: namespace to the global one.
9880 Needed by DEC cxx in strict ansi mode.
9882 * src/support/LIstream.h,src/support/LOstream.h,
9883 src/support/lyxstring.h,src/table.h,
9884 src/lyxlookup.h: do not include <config.h> in header
9885 files. This should be done in the .C files only.
9887 * development/lyx.spec.in: WHATSNEW has been renamed to NEWS
9891 1999-11-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9893 * config/lib_configure.m4,lib/configure,lib/lyxrc.example: update
9894 from Kayvan to fix the tth invokation.
9896 * development/lyx.spec.in: updates from Kayvan to reflect the
9897 changes of file names.
9899 1999-11-05 Lars Gullik Bjønnes <larsbj@lyx.org>
9901 * src/text2.C (InsertStringB): use std::copy
9902 (InsertStringA): use std::copy
9904 * src/bufferlist.C: use a vector to store the buffers in. This is
9905 an internal change and should not affect any other thing.
9907 * src/BufferView.C (waitForX): use XSync instead of the lengthy
9910 * src/text.C (Fill): fix potential bug, one off bug.
9912 1999-11-04 Lars Gullik Bjønnes <larsbj@lyx.org>
9914 * src/Makefile.am (lyx_main.o): add more files it depends on.
9916 * src/lyx_cb.C (addNewlineAndDepth): parameters in wrong order.
9918 * src/support/lyxstring.C: use size_t for the reference count,
9919 size, reserved memory and xtra.
9920 (internal_compare): new private member function. Now the compare
9921 functions should work for std::strings that have embedded '\0'
9923 (compare): all compare functions rewritten to use
9926 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9928 * src/support/lyxstring.C (compare): pass c_str()
9929 (compare): pass c_str
9930 (compare): pass c_str
9932 1999-11-03 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9934 * src/support/DebugStream.C: <config.h> was not included correctly.
9936 * lib/configure: forgot to re-generate it :( I'll make this file
9937 auto generated soon.
9939 1999-11-03 Lars Gullik Bjønnes <larsbj@lyx.org>
9941 * acinclude.m4 (cross_compiling): add -fpermissive when gcc 2.95.x
9944 * src/support/lyxstring.C: some changes from length() to rep->sz.
9945 avoids a function call.
9947 * src/support/filetools.C (SpaceLess): yet another version of the
9948 algorithm...now per Jean-Marc's suggestions.
9950 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9952 * src/layout.C (less_textclass_desc): functor for use in sorting
9954 (LyXTextClass::Read): sort the textclasses after reading.
9956 * src/support/filetools.C (SpaceLess): new version of the
9957 SpaceLess functions. What problems does this one give? Please
9960 * images/banner_bw.xbm: made the arrays unsigned char *
9962 1999-11-02 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
9964 * src/support/lyxstring.C (find): remove bogus assertion in the
9965 two versions of find where this has not been done yet.
9967 * src/support/lyxlib.h: add missing int return type to
9970 * src/menus.C (ShowFileMenu): disable exporting to html if no
9971 html export command is present.
9973 * config/lib_configure.m4: add a test for an HTML converter. The
9974 programs checked for are, in this order: tth, latex2html and
9977 * lib/configure: generated from config/lib_configure.m4.
9979 * src/lyxfunc.C (Dispatch): update and improve the execution of an
9980 html converter. The parameters are now passed through $$FName and
9981 $$OutName, instead of standard input/output.
9983 * src/lyxrc.{C,h}: rename \tth_command to \html_command.
9985 * lib/lyxrc.example: update description of \html_command.
9986 add "quotes" around \screen_font_xxx font setting examples to help
9987 people who use fonts with spaces in their names.
9989 1999-11-02 Lars Gullik Bjønnes <larsbj@lyx.org>
9991 * Distribution files: updates for v1.1.2
9993 * src/support/lyxstring.C (find): remove bogus assert and return
9994 npos for the same condition.
9996 1999-11-01 Lars Gullik Bjønnes <larsbj@lyx.org>
9998 * added patch for OS/2 from SMiyata.
10000 1999-10-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10002 * src/text2.C (CutSelection): make space_wrapped a bool
10003 (CutSelection): dont declare int i until we have to.
10004 (alphaCounter): return a char const *.
10006 1999-10-28 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10008 * src/support/syscall.C (Systemcalls::kill):
10009 src/support/filetools.C (PutEnv, PutEnvPath):
10010 src/lyx_cb.C (addNewlineAndDepth):
10011 src/FontInfo.C (FontInfo::resize): condition some #warning
10012 directives with WITH_WARNINGS.
10015 1999-10-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10017 * src/layout.[Ch] + several files: access to class variables
10018 limited and made accessor functions instead a lot of code changed
10019 becuase of this. Also instead of returning pointers often a const
10020 reference is returned instead.
10022 * src/form1.C (create_form_Figure): added a couple fo "no-c-format"
10024 * src/Makefile.am (dist-hook): added used to remove the CVS from
10025 cheaders upon creating a dist
10026 (EXTRA_DIST): added cheaders
10028 * src/support/lstrings.C (tostr(char)): fix it to handle param as
10029 a character not as a small integer.
10031 * src/support/lyxstring.C (find): removed Assert and added i >=
10032 rep->sz to the first if.
10034 1999-10-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10036 * src/layout.[Ch] src/BufferView.C src/LaTeXFeatures.C
10037 src/LyXView.C src/buffer.C src/bufferparams.C
10038 src/lyx_cb.C src/lyxfunc.C src/paragraph.C src/text.C
10039 src/text2.C src/insets/insetinclude.C:
10040 lyxlayout renamed to textclasslist.
10042 * src/layout.C: some lyxerr changes.
10044 * src/layout.[Ch] (LyXLayout::Read): changed second paramter to
10045 LyXTextClass. rewrote LT_COPYSTYLE, rewrote LT_OBSOLETEDBY
10046 (LyXLayoutList): removed all traces of this class.
10047 (LyXTextClass::Read): rewrote LT_STYLE
10048 (LyXTextClass::hasLayout): new function
10049 (LyXTextClass::GetLayout): rewritten to return an iterator + has
10050 both const and nonconst version.
10051 (LyXTextClass::delete_layout): new function.
10052 (LyXTextClassList::Style): bug fix. do the right thing if layout
10054 (LyXTextClassList::NumberOfLayout): new acces to layoutlist.
10055 (LyXTextClassList::NameOfLayout): ditto
10056 (LyXTextClassList::Load): ditto
10058 * src/buffer.C (makeLaTeXFile): new access to layoutlist
10060 * src/LaTeXFeatures.C (getTClassPreamble): new access to layoutlist
10062 * src/LyXAction.C (LookupFunc): added a workaround for sun
10063 compiler, on the other hand...we don't know if the current code
10064 compiles on sun at all...
10066 * src/support/filetools.C (CleanupPath): subst fix
10068 * src/insets/insetbib.C (delDatabase): subst fix, this looks
10071 * src/support/filetools.C (PutEnvPath): subst fix, how come nobody
10072 complained about this one?
10074 * src/insets/insetinclude.C (Latex): subst fix
10076 * src/insets/insetbib.C (getKeys): subst fix
10078 * src/LyXSendto.C (SendtoApplyCB): subst fix
10080 * src/lyx_main.C (init): subst fix
10082 * src/layout.C (Read): subst fix
10084 * src/lyx_sendfax_main.C (button_send): subst fix
10086 * src/buffer.C (RoffAsciiTable): subst fix
10088 * src/lyx_cb.C (MenuFax): subst fix
10089 (PrintApplyCB): subst fix
10091 1999-10-26 Juergen Vigna <jug@sad.it>
10093 * src/table.C (TexEndOfCell) + (DocBookEndOfCell): removed some #if 0
10095 (Read): Cleaned up this code so now we read only format vestion >= 5
10097 1999-10-26 Lars Gullik Bjønnes <larsbj@lyx.org>
10099 * src/support/filetools.C (PutEnvPath): subst fix for EMX, how
10100 come nobody has complained about this one?
10102 * src/insets/insetinclude.C (Latex): subst fix
10104 * src/insets/insetbib.C (getKeys): subst fix
10106 * src/lyx_main.C (init): subst fix
10108 * src/layout.C (Read): subst fix
10110 * src/buffer.C (RoffAsciiTable): subst fix
10112 * src/lyx_cb.C (MenuFax): subst fix.
10114 * src/layout.[hC] + some other files: rewrote to use
10115 std::container to store textclasses and layouts in.
10116 Simplified, removed a lot of code. Make all classes
10117 assignable. Further simplifications and review of type
10118 use still to be one.
10120 * src/menus.C (ShowFileMenu/ShowFileMenu2): Use the iterators from
10121 lastfiles to create the lastfiles partr of the menu.
10123 * src/lastfiles.[Ch]: rewritten to use deque to store the
10124 lastfiles in. Uses fstream for reading and writing. Simplifies
10127 * src/support/syscall.C: remove explicit cast.
10129 * src/BufferView.C (CursorToggleCB): removed code snippets that
10130 were commented out.
10131 use explicat C++ style casts instead of C style casts. also use
10132 u_vdata instea of passing pointers in longs.
10134 * src/PaperLayout.C: removed code snippets that were commented out.
10136 * src/lyx_gui_misc.C: removed code snippets that were commented out.
10138 * src/lyx_main.C: removed code snippets that wer commented out.
10140 * src/paragraph.C: removed code snippets that were commented out.
10142 * src/lyxvc.C (logClose): use static_cast
10144 (viewLog): remove explicit cast to void*
10145 (showLog): removed old commented code
10147 * src/menus.C: use static_cast instead of C style casts. use
10148 u_vdata instead of u_ldata. remove explicit cast to (long) for
10149 pointers. Removed old code that was commented out.
10151 * src/insets/inset.C: removed old commented func
10153 * src/insets/insetref.C (InsetRef): removed old code that had been
10154 commented out for a long time.
10156 (escape): removed C style cast
10158 * src/insets/insetlatexaccent.C (Draw): removed old commented code
10160 * src/insets/insetlatex.C (Draw): removed old commented code
10161 (Read): rewritten to use string
10163 * src/insets/insetlabel.C (escape): removed C style cast
10165 * src/insets/insetindex.h: removed vdata and ldata from FD_index_form
10167 * src/insets/insetindex.C: use static_cast and u_vdata, removed
10168 old commented code.
10170 * src/insets/insetinclude.h: removed a couple of stupid bools
10172 * src/insets/insetinclude.C (include_cb): use static_cast and u_data.
10173 (Clone): remove C style cast
10174 (getKeys): changed list to lst because of std::list
10176 * src/insets/inseterror.C (Draw): removed som old commented code.
10178 * src/insets/insetcommand.C (Draw): removed some old commented code.
10180 * src/insets/insetbib.C (bibitem_cb): removed code that has been
10181 commented out forever.
10182 (bibitem_cb): use static_cast instead of C style cast
10183 use of vdata changed to u_vdata.
10185 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forward the data
10187 (CloseUrlCB): use static_cast instead of C style cast.
10188 (CloseUrlCB): added a fl_free form...it seemed to be missing.
10190 * src/insets/insetinfo.C (Edit): pass object in u_vdata instead
10191 (C_InsetInfo_CloseInfoCB): forward the ob parameter
10192 (CloseInfoCB): static_cast from ob->u_vdata instead.
10193 (Edit): removed bogus arg from fl_set_object_shortcut, set to 1
10196 * src/insets/inseterror.C (Edit): pass object in u_vdata instead
10197 (C_InsetError_CloseErrorCB): forward the ob parameter
10198 (CloseErrorCB): static_cast from ob->u_vdata instead.
10200 * src/vspace.h: include LString.h since we use string in this class.
10202 * src/vspace.C (lyx_advance): changed name from advance because of
10203 nameclash with stl. And since we cannot use namespaces yet...I
10204 used a lyx_ prefix instead. Expect this to change when we begin
10207 * src/BufferView.[Ch] (BufferView::~BufferView): removed
10209 * src/BackStack.h: rewrote to use std::stack. made BackStackItem
10210 and removed now defunct constructor and deconstructor.
10212 * src/BufferView.h: have backstack as a object not as a pointer.
10213 removed initialization from constructor. added include for BackStack
10215 * development/lyx.spec.in (%build): add CFLAGS also.
10217 * src/screen.C (drawFrame): removed another warning.
10219 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10221 * renamed WHATSNEW to NEWS (usual GNU style), CHANGES to
10222 OLD-CHANGES (not used anymore) and modified INSTALL, INSTALL.OS2,
10223 README and ANNOUNCE a bit for the next release. More work is
10226 * src/paragraph.C (SimpleTeXBlanks): spaces are automatically made
10227 unbreakable if we are in freespacing mode (LyX-Code), but not in
10230 1999-10-25 Lars Gullik Bjønnes <larsbj@lyx.org>
10232 * src/BackStack.h: fixed initialization order in constructor
10234 * Makefile.am (MAINTAINERCLEANFILES): removed po/POTFILES.in
10236 * acinclude.m4 (VERSION): new rules for when a version is
10237 development, added also a variable for prerelease.
10238 (warnings): we set with_warnings=yes for prereleases
10239 (lyx_opt): prereleases compile with same optimization as development
10240 (CXXFLAGS): only use pedantic if we are a development version
10242 * src/BufferView.C (restorePosition): don't do anything if the
10243 backstack is empty.
10245 * src/BackStack.h: added member empty, use this to test if there
10246 is anything to pop...
10248 1999-10-25 Juergen Vigna <jug@sad.it>
10251 * forms/layout_forms.fd +
10252 * forms/latexoptions.fd +
10253 * lyx.fd: changed for various form resize issues
10255 * src/mathed/math_panel.C +
10256 * src/insets/inseterror.C +
10257 * src/insets/insetinfo.C +
10258 * src/insets/inseturl.C +
10259 * src/insets/inseturl.h +
10261 * src/LyXSendto.C +
10262 * src/PaperLayout.C +
10263 * src/ParagraphExtra.C +
10264 * src/TableLayout.C +
10266 * src/layout_forms.C +
10273 * src/menus.C: fixed various resize issues. So now forms can be
10274 resized savely or not be resized at all.
10276 * forms/form_url.fd +
10277 * src/insets/form_url.[Ch]: added because it's cleaner and easier
10280 * src/insets/Makefile.am: added files form_url.[Ch]
10282 1999-10-25 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10284 * INSTALL: it is now possible to compile LyX with digital C++ 6.1
10285 (and presumably 6.2).
10287 * src/{BufferView,LyXView,combox,filedlg,intl,lyxserver,lyxvc,
10288 menus,minibuffer,toolbar}.{C,h}: added C_xxx wrappers around
10289 remaining static member callbacks.
10291 * src/lyxfunc.C (Dispatch): Use _() instead of N_() fot minibuffer
10294 * src/support/lyxstring.h: declare struct Srep as friend of
10295 lyxstring, since DEC cxx complains otherwise.
10297 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10299 1999-10-24 Lars Gullik Bjønnes <larsbj@lyx.org>
10301 * src/LaTeX.C (run): made run_bibtex also depend on files with
10303 (runBibTeX): added scans for "\\bibstyle", now also ".bst" files
10304 are put into the dependency file.
10306 * src/spellchecker.C (create_ispell_pipe): removed old #warning,
10307 the code has shown itself to work
10308 (create_ispell_pipe): removed another warning, added a comment
10311 * src/minibuffer.C (ExecutingCB): removed code that has been
10312 commented out a long time
10314 * src/lyxfunc.C (processKeyEvent): removed some very old commented
10315 out code + a warning.
10317 * src/support/lyxstring.h: comment out the three private
10318 operators, when compiling with string ansi conforming compilers
10319 they make problems.
10321 * src/mathed/math_symbols.C (AddBitmap): change 6th arg to be
10323 (pixmapFromBitmapData): change type of bdata to be unsigned char *
10324 (pixmapFromBitmapData): add a reinterpret_cast in the call to
10327 * src/mathed/math_panel.h: change 6th arg to AddBitmap to be
10330 * src/mathed/math_panel.C (create_math_panel): remove explicit
10333 * src/bmtable.h: change last paramter to fl_set_bmtable_data to be
10336 * src/bmtable.C (struct BMTABLE_SPEC): make bdata unsigned char *
10337 (draw_bitmaptable): add a reinterpret_cast to sp->bdata in the call
10338 to XCreatePixmapFromBitmapData
10339 (fl_set_bmtable_data): change the last argument to be unsigned
10341 (fl_set_bmtable_file): change bdata to unsinged char *, change bw
10342 and bh to be unsigned int, remove explicit casts in call to
10343 XReadBitmapFileData.
10345 * images/arrows.xbm: made the arrays unsigned char *
10346 * images/varsz.xbm: ditto
10347 * images/misc.xbm: ditto
10348 * images/greek.xbm: ditto
10349 * images/dots.xbm: ditto
10350 * images/brel.xbm: ditto
10351 * images/bop.xbm: ditto
10353 * Makefile.am (MAINTAINERCLEANFILES): added po/POTFILES.in
10355 * acinclude.m4 (LYX_GXX_STRENGHT_REDUCE): removed.
10356 (LYX_PROG_CXX): added -pedantic to g++ compile options when
10357 with-warnings, removed the __STRING_ANSI__ hack, seems to not be
10359 (LYX_CXX_CHEADERS): added <clocale> to the test.
10361 1999-10-23 Lars Gullik Bjønnes <larsbj@lyx.org>
10363 * src/lyx_cb.C (addNewlineAndDepth): changed to use string::append.
10365 * src/support/lyxstring.C (append): fixed something that must be a
10366 bug, rep->assign was used instead of rep->append.
10368 * src/support/Makefile.am (libsupport_a_SOURCES): added LIstream.h
10371 * src/lyxfunc.C (processKeyEvent): removed faulty line that made
10372 lyx insert double chars. Fix spotted by Kayvan.
10374 1999-10-23 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10376 * Fixed the tth support. I messed up with the Emacs patch apply feature
10377 and omitted the changes in lyxrc.C.
10379 1999-10-22 Juergen Vigna <jug@sad.it>
10381 * src/insets/figinset.C (CallbackFig): Just changed the defines a bit.
10383 * src/lyx_cb.C (MenuInsertRef) +
10384 * src/lyx_gui.C (create_forms): Inserted fl_set_form_minsize so that
10385 the form cannot be resized under it limits (fixes a segfault)
10387 * src/lyx.C (create_form_form_ref) +
10388 * forms/lyx.fd: Changed Gravity on name input field so that it is
10391 1999-10-22 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10393 * configure.in: use LYX_CXX_STL_MODERN_STREAMS; check for headers
10394 <ostream> and <istream>.
10396 * acinclude.m4 (LYX_CXX_STL_MODERN_STREAMS): new test. Checks
10397 whether <fstream> provides the latest standard features, or if we
10398 have an oldstyle library (like in egcs).
10399 (LYX_CXX_STL_STRING): fix the test.
10401 * src/support/DebugStream.{C,h}: use L{I,O}stream.h and condition the
10402 code on MODERN_STL_STREAM.
10404 * src/support/lyxstring.h: use L{I,O}stream.h.
10406 * src/support/L{I,O}stream.h: new files, designed to setup
10407 correctly streams for our use
10408 - includes the right header depending on STL capabilities
10409 - puts std::ostream and std::endl (for LOStream.h) or
10410 std::istream (LIStream.h) in toplevel namespace.
10412 1999-10-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10414 * src/LaTeX.C (run): added a check in 0 sumchange so that if it
10415 was a bib file that had been changed we ensure that bibtex is run.
10416 (runBibTeX): enhanced to extract the names of the bib files and
10417 getting their absolute path and enter them into the dep file.
10418 (findtexfile): static func that is used to look for tex-files,
10419 checks for absolute patchs and tries also with kpsewhich.
10420 Alternative ways of finding the correct files are wanted. Will
10422 (do_popen): function that runs a command using popen and returns
10423 the whole output of that command in a string. Should be moved to
10426 * src/DepTable.[Ch] (extchanged): new function that returns true if a
10427 file with extension ext has changed.
10429 * src/insets/figinset.C: added ifdef guards around the fl_free
10430 code that jug commented out. Now it is commented out when
10431 compiling with XForms == 0.89.
10433 * src/support/lyxstring.C: moved the definition of lyxstring::Srep
10434 to lyxstring.C, and only keep a forward declaration in
10435 lyxstring.h. Simplifies the header file a bit and should help a
10436 bit on compile time too. Also changes to Srep will not mandate a
10437 recompile of code just using string.
10438 (~lyxstring): definition moved here since it uses srep.
10439 (size): definition moved here since it uses srep.
10441 * src/support/lyxstring.h: removed a couple of "inline" that should
10444 1999-10-21 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10446 * src/insets/inseturl.C (C_InsetUrl_CloseUrlCB): forgot to pass
10449 1999-10-21 Juergen Vigna <jug@sad.it>
10451 * src/table.C (SetPWidth): Just a small fix so the alignment is not
10452 set to left if I just remove the width entry (or it is empty).
10454 * src/text2.C (SetCursorIntern): Fixed a bug calculating to use wrong
10455 paragraph when having dummy paragraphs.
10457 1999-10-20 Juergen Vigna <jug@sad.it>
10459 * src/insets/figinset.C: just commented some fl_free_form calls
10460 and added warnings so that this calls should be activated later
10461 again. This avoids for now a segfault, but we have a memory leak!
10463 * src/lyxfunc.C (processKeyEvent) (Dispatch): changed
10464 'const char * argument' to 'string argument', this should
10465 fix some Asserts() in lyxstring.C.
10467 * src/lyxfunc.h: Removed the function argAsString(const char *)
10468 as it is not used anymore.
10470 1999-10-20 Lars Gullik Bjønnes <larsbj@lyx.org>
10472 * src/support/lyxstring.C (getline): reads now _all_ chars. uses
10475 * src/Literate.h: some funcs moved from public to private to make
10476 interface clearer. Unneeded args removed.
10478 * src/Literate.C (scanLiterateLogFile): rewritten to use iostream
10480 (scanBuildLogFile): ditto
10482 * src/LaTeX.C (scanLogFile): merged LaTeX Error handling into
10483 normal TeX Error. Still room for improvement.
10485 * src/LaTeX.[Ch]: removed scanError. Wrong place and not needed.
10487 * src/buffer.C (insertErrors): changes to make the error
10488 desctription show properly.
10490 * src/LaTeX.C (deplog): removed the test for file in lyx doc dir.
10493 * src/support/lyxstring.C (helper): changed to use
10494 sizeof(object->rep->ref).
10495 (operator>>): changed to use a pointer instead.
10497 * src/support/lyxstring.h: changed const reference & to value_type
10498 const & lets see if that helps.
10500 1999-10-19 Lars Gullik Bjønnes <larsbj@lyx.org>
10502 * Makefile.am (rpmdist): fixed to have non static package and
10505 * src/support/lyxstring.C: removed the compilation guards
10507 * src/vspace.C (nextToken): use i + 1 instead of ++i. Maks things
10510 * src/support/Makefile.am (LYXSTRING): bruker USE_LYXSTRING for
10511 conditional compile of lyxstring.Ch
10513 * acinclude.m4 (LYX_CXX_STL_STRING): new and improved, still a
10514 stupid check, but it is a lot better than the bastring hack.
10515 (LYX_CXX_STL_STRING): bruker nå AM_CONDITIONAL(USE_LYXSTRING
10517 * several files: changed string::erase into string::clear. Not
10520 * src/chset.C (encodeString): use a char temporary instead
10522 * src/table.C (TexEndOfCell): added tostr around
10523 column_of_cell(fcell+i)+1 and around right_column_of_cell(fcell+i)+1
10524 (TexEndOfCell): ditto
10525 (TexEndOfCell): ditto
10526 (TexEndOfCell): ditto
10527 (DocBookEndOfCell): ditto
10528 (DocBookEndOfCell): ditto
10529 (DocBookEndOfCell): ditto
10530 (DocBookEndOfCell): ditto
10532 * src/paragraph.C (TeXEnvironment): added tostr around foot_count -1
10534 * src/lyxfr1.C (SearchReplaceAllCB): added tostr around replace_count
10536 * src/lyx_cb.C (MenuRunLaTeX): added tostr around ret
10537 (MenuBuildProg): added tostr around ret
10538 (MenuRunChktex): added tostr around ret
10539 (DocumentApplyCB): added tostr around ret
10541 * src/chset.C (encodeString): added tostr around t->ic
10543 * src/buffer.C (makeLaTeXFile): added tostr around secnumdepth
10544 (makeLaTeXFile): added tostr around tocdepth
10545 (makeLaTeXFile): added tostr around ftcound - 1
10547 * src/insets/insetbib.C (setCounter): added tostr around counter.
10549 * src/support/lyxstring.h: added an operator+=(int) to catch more
10552 * src/support/lyxstring.C (lyxstring): We DON'T allow NULL pointers.
10553 (lyxstring): We DON'T allow NULL pointers.
10555 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10557 * src/mathed/math_macro.C (MathMacroArgument::Write,
10558 MathMacroTemplate::WriteDef): add tostr() around macro arg numbers
10559 when writing them out.
10561 * src/LString.C: remove, since it is not used anymore.
10563 * src/support/lyxstring.C: condition the content to
10564 USE_INCLUDED_STRING macro.
10566 * src/mathed/math_symbols.C, src/support/lstrings.C,
10567 src/support/lyxstring.C: add `using' directive to specify what
10568 we need in <algorithm>. I do not think that we need to
10569 conditionalize this, but any thought is appreciated.
10571 * many files: change all callback functions to "C" linkage
10572 functions to please strict C++ compilers like DEC cxx 6.1 in mode
10573 strict_ansi. Those who were static are now global.
10574 The case of callbacks which are static class members is
10575 trickier, since we have to make C wrappers around them (see
10576 InsetError, InsetInfo and InsetUrl). The same holds for friends. I
10577 did not finish this yet, since it defeats the purpose of
10578 encapsulation, and I am not sure what the best route is.
10580 1999-10-19 Juergen Vigna <jug@sad.it>
10582 * src/support/lyxstring.C (lyxstring): we permit to have a null
10583 pointer as assignment value and just don't assign it.
10585 * src/vspace.C (nextToken): corrected this function substituting
10586 find_first(_not)_of with find_last_of.
10588 * src/TableLayout.C (UpdateLayoutTable) (TableOptionsCB)
10589 (TableOptCloseCB) (TableSpeCloseCB):
10590 inserted fl_set_focus call for problem with fl_hide_form() in
10593 1999-10-19 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10595 * src/lyx_cb.C (LayoutsCB): fix bug where int was added to a
10598 1999-10-18 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10600 * src/lyxrc.C (Read): RC_PRINTEXSTRAOPTIONS now uses
10601 LyXLex::next() and not eatline() to get its argument.
10603 1999-10-17 Lars Gullik Bjønnes <larsbj@lyx.org>
10605 * src/DepTable.[Ch]: rewritten to store the dependencies in a map
10606 instead, use fstreams for io of the depfile, removed unneeded
10607 functions and variables.
10609 * src/LaTeX.[Ch] (class TeXErrors): rewrote to store the errors in a
10610 vector instead, removed all functions and variables that is not in
10613 1999-10-16 Lars Gullik Bjønnes <larsbj@lyx.org>
10615 * src/buffer.C (insertErrors): use new interface to TeXError
10617 * Makefile.am (rpmdist): added a rpmdist target
10619 * lib/reLyX/Makefile.am: added RelyxFigure.pm and Verbatim.pm as
10620 per Kayvan's instructions.
10622 1999-10-15 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10624 * src/Makefile.am: add a definition for localedir, so that locales
10625 are found after installation (Kayvan)
10627 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10629 * development/.cvsignore: new file.
10631 1999-10-14 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10633 * acinclude.m4 (LYX_CXX_CHEADERS): New macro. Checks whether the
10634 C++ compiler provides wrappers for C headers and use our alternate
10637 * configure.in: use LYX_CXX_CHEADERS.
10639 * src/cheader/: new directory, populated with cname headers from
10640 libstdc++-2.8.1. They are a bit old, but probably good enough for
10641 what we want (support compilers who lack them).
10643 * src/insets/Makefile.am, src/mathed/Makefile.am: remove src/support
10644 from includes. It turns out is was stupid.
10646 1999-10-14 Lars Gullik Bjønnes <larsbj@lyx.org>
10648 * lib/Makefile.am (install-data-local): forgot a ';'
10649 (install-data-local): forgot a '\'
10650 (libinstalldirs): needed after all. reintroduced.
10652 1999-10-13 Lars Gullik Bjønnes <larsbj@lyx.org>
10654 * configure.in (AC_OUTPUT): added lyx.spec
10656 * development/lyx.spec: removed file
10658 * development/lyx.spec.in: new file
10660 * po/*.po: merged with lyx.pot becuase of make distcheck
10662 * lib/Makefile.am (dist-hook): added dist-hook so that
10663 documentation files will be included when doing a make
10664 dist/distdir/distcheck. Requires cvs export -r HEAD lyxdoc to run.
10665 (pkgdata_SCRIPTS): added configure.cmd for now, we can use som
10667 more: tried to make install do the right thing, exclude CVS dirs
10670 * src/LaTeXLog.C (ShowLatexLog): reordered som statements so that
10671 Path would fit in more nicely.
10673 * all files that used to use pathstack: uses now Path instead.
10674 This change was a lot easier than expected.
10676 * src/support/path.h: new file
10678 * src/support/Makefile.am (libsupport_a_SOURCES): added path.h
10680 * src/Makefile.am (lyx_SOURCES): removed pathstack.[Ch]
10682 * src/support/lyxstring.C (getline): Default arg was given for
10685 * Configure.cmd: removed file
10687 1999-10-13 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10689 * src/support/DebugStream.[Ch]: remove the explicit std:: before
10690 streams classes and types, add the proper 'using' statements when
10691 MODERN_STL is defined.
10693 * src/debug.h: move the << operator definition after the inclusion
10696 * src/support/filetools.C: include "LAssert.h", which is needed
10699 * src/insets/Makefile.am, src/mathed/Makefile.am: add src/support
10702 * src/lyxfont.h, src/commandtags.h, src/mathed/math_defs.h:
10703 include "debug.h" to define a proper ostream.
10705 1999-10-12 Asger Alstrup Nielsen <alstrup@alstrup.galaxy.dk>
10707 * src/sys*: Cleaned up the Systemcall stuff a bit. Added "kill(int)"
10708 method to the SystemCall class which can kill a process, but it's
10709 not fully implemented yet.
10711 * src/*.C: Changed Systemcalls::Startscript() to startscript()
10713 * src/support/FileInfo.h: Better documentation
10715 * src/lyxfunc.C: Added support for buffer-export html
10717 * src/menus.C: Added Export->As HTML...
10719 * lib/bind/*.bind: Added short-cut for buffer-export html
10721 * src/lyxrc.*: Added support for new \tth_command
10723 * lib/lyxrc.example: Added stuff for new \tth_command
10725 1999-10-12 Lars Gullik Bjønnes <larsbj@lyx.org>
10727 * lib/Makefile.am (IMAGES): removed images/README
10728 (pkgdata_SCRIPTS): use this instead of bin_SCRIPTS to that it
10729 installes in correct place. Check permisions is installed
10732 * src/LaTeX.C: some no-op changes moved declaration of some
10735 * src/LaTeX.h (LATEX_H): changed include guard name
10737 1999-10-12 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10739 * lib/reLyX/Makefile.am: install noweb2lyx.
10741 * lib/Makefile.am: install configure.
10743 * lib/reLyX/configure.in: declare a config aux dir; set package
10744 name to lyx (not sure what the best solution is); generate noweb2lyx.
10746 * lib/layouts/egs.layout: fix the bibliography layout.
10748 1999-10-08 Jürgen Vigna <jug@sad.it>
10750 * src/support/filetools.C (FileOpenSearch): Fixed a bug where
10751 when in the PATH was something like /usr/bin;;/bin (note: the ;;)
10752 it returned without continuing to search the path.
10754 1999-10-07 Lars Gullik Bjønnes <larsbj@lyx.org>
10756 * src/insets/insetquotes.C (Draw): Simplified a gread deal. This
10757 also fixes a bug. It is not allowed to do tricks with std::strings
10758 like: string a("hei"); &a[e]; this will not give what you
10759 think... Any reason for the complexity in this func?
10761 1999-10-06 Asger Alstrup Nielsen <alstrup@diku.dk>
10763 * Updated README and INSTALL a bit, mostly to check that my
10764 CVS rights are correctly set up.
10766 1999-10-06 Lars Gullik Bjønnes <larsbj@lyx.org>
10768 * src/support/lyxstring.C (helper): removed bogus Assert. strlen
10769 does not allow '\0' chars but lyxstring and std::string does.
10771 1999-10-05 Lars Gullik Bjønnes <larsbj@lyx.org>
10773 * autogen.sh (AUTOCONF): let the autogen script create the
10774 POTFILES.in file too. POTFILES.in should perhaps now not be
10775 included in the cvs module.
10777 * some more files changed to use C++ includes instead of C ones.
10779 * src/filedlg.C (Reread): fixed a bug wrt Time. It was appended
10781 (Reread): added tostr to nlink. buggy output otherwise.
10782 (Reread): added a string() around szMode when assigning to Buffer,
10783 without this I got a log of garbled info strings.
10785 * acconfig.h: commented out the PTR_AS_INT macros. They should not
10788 * I have added several ostream & operator<<(ostream &, some_type)
10789 functions. This has been done to avoid casting and warnings when
10790 outputting enums to lyxerr. This as thus eliminated a lot of
10791 explicit casts and has made the code clearer. Among the enums
10792 affected: kb_action, InsetLatexAccent::ACCENT_TYPE, a couple of
10793 mathed enums, some font enum the Debug::type enum.
10795 * src/support/lyxstring.h (clear): missing method. equivalent of
10798 * all files that contained "stderr": rewrote constructs that used
10799 stderr to use lyxerr instead. (except bmtable)
10801 * src/support/DebugStream.h (level): and the passed t with
10802 Debug::ANY to avoid spurious bits set.
10804 * src/debug.h (Debug::type value): made it accept strings of the
10805 type INFO,INIT,KEY.
10807 * configure.in (Check for programs): Added a check for kpsewhich,
10808 the latex generation will use this later to better the dicovery of
10811 * src/BufferView.C (create_view): we don't need to cast this to
10812 (void*) that is done automatically.
10813 (WorkAreaButtonPress): removed some dead code.
10815 1999-10-05 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10817 * src/minibuffer.C (Init): make sure that the "Welcome to LyX!"
10818 is not overwritten when translated (David Sua'rez de Lis).
10820 * lib/CREDITS: Added David Sua'rez de Lis
10822 * lib/reLyX/configure.in: setup LYX_DIR correctly in reLyX.
10824 * src/bufferparams.C (BufferParams): default input encoding is now
10827 * acinclude.m4 (cross_compiling): comment out macro
10828 LYX_GXX_STRENGTH_REDUCE.
10830 * acconfig.h: make sure that const is not defined (to empty) when
10831 we are compiling C++. Remove commented out code using SIZEOF_xx
10834 * configure.in : move the test for const and inline as late as
10835 possible so that these C tests do not interefere with C++ ones.
10836 Remove the call to LYX_GXX_STRENGTH_REDUCE, since its usefulness
10837 has not been proven.
10839 1999-10-04 Jean-Marc Lasgouttes <Jean-Marc.Lasgouttes@inria.fr>
10841 * src/table.C (getDocBookAlign): remove bad default value for
10842 isColumn parameter.
10844 * src/menus.C (ShowFileMenu): add a missing tostr() for lastfiles
10846 (ShowFileMenu2): ditto.
10848 * lib/reLyX/.cvsignore: add configure and aclocal.m4 to the list
10849 of files to ignore.
10851 1999-10-04 Lars Gullik Bjønnes <larsbj@lyx.org>
10853 * Most files: finished the change from the old error code to use
10854 DebugStream for all lyxerr debugging. Only minor changes remain
10855 (e.g. the setting of debug levels using strings instead of number)
10857 1999-10-02 Lars Gullik Bjønnes <larsbj@lyx.org>
10859 * src/layout.C (Add): Changed to use compare_no_case instead of
10862 * src/FontInfo.C: changed loop variable type too string::size_type.
10864 1999-10-01 Lars Gullik Bjønnes <larsbj@lyx.org>
10866 * src/support/Makefile.am: added -I${srcdir}/../ to INCLUDES and
10867 set ETAGS_ARGS to --c++
10869 1999-09-30 Lars Gullik Bjønnes <larsbj@lyx.org>
10871 * src/table.C (DocBookEndOfCell): commented out two unused variables
10873 * src/paragraph.C: commented out four unused variables.
10875 * src/lyx_cb.C (TocUpdateCB): moved variable i and added a new i
10876 insed a if clause with type string::size_type.
10878 * src/lyxfr1.C (IsSearchStringInText): changed iSrch from int to
10881 * src/lyxfunc.C (Dispatch): use string::size_type as loop variable.
10883 * src/lyx_cb.C (ReplaceWord): use string::size_type as loop
10884 variable, also changed loop to go from 0 to lenght + 1, instead of
10885 -1 to length. This should be correct.
10887 * src/LaTeX.C (scanError): use string::size_type as loop variable
10890 * src/BufferView.C (WorkAreaButtonPress): moved #if 0 up two lines
10891 (l.896) since y_tmp and row was not used anyway.
10893 * src/insets/insetref.C (escape): use string::size_type as loop
10896 * src/insets/insetquotes.C (Width): use string::size_type as loop
10898 (Draw): use string::size_type as loop variable type.
10900 * src/insets/insetlatexaccent.C (checkContents): use
10901 string::size_type as loop variable type.
10903 * src/insets/insetlabel.C (escape): use string::size_type as loop
10906 * src/insets/insetinfo.C: added an extern for current_view.
10908 * src/insets/insetcommand.C (scanCommand): use string::size_type
10909 as loop variable type.
10911 * most files: removed the RCS tags. With them we had to recompile
10912 a lot of files after a simple cvs commit. Also we have never used
10913 them for anything meaningful.
10915 * most files: tags-query-replace NULL 0. As adviced several plases
10916 we now use "0" instead of "NULL" in our code.
10918 * src/support/filetools.C (SpaceLess): use string::size_type as
10919 loop variable type.
10921 1999-09-29 Lars Gullik Bjønnes <larsbj@lyx.org>
10923 * src/paragraph.C: fixed up some more string stuff.
10925 1999-09-28 Lars Gullik Bjønnes <larsbj@lyx.org>
10927 * src/support/filetools.h: make modestr a std::string.
10929 * src/filetools.C (GetEnv): made ch really const.
10931 * src/lyxlib.h: removed the Maximum and Minimum inline functions,
10932 made code that used these use max/min from <algorithm> instead.
10934 * changed several c library include files to their equivalent c++
10935 library include files. All is not changed yet.
10937 * created a support subdir in src, put lyxstring and lstrings
10938 there + the extra files atexit, fileblock, strerror. Created
10939 Makefile.am. edited configure.in and src/Makefile.am to use this
10940 new subdir. More files moved to support.
10942 * imported som of the functions from repository lyx, filetools
10944 * ran tags-query-replace on LString -> string, corrected the bogus
10945 cases. Tried to make use of lstrings.[hC], debugged a lot. There
10946 is still some errors in there. This is errors where too much or
10947 too litle get deleted from strings (string::erase, string::substr,
10948 string::replace), there can also be some off by one errors, or
10949 just plain wrong use of functions from lstrings. Viewing of quotes
10952 * LyX is now running fairly well with string, but there are
10953 certainly some bugs yet (see above) also string is quite different
10954 from LString among others in that it does not allow null pointers
10955 passed in and will abort if it gets any.
10957 * Added the revtex4 files I forgot when setting up the repository.
10959 1999-09-27 Lars Gullik Bjønnes <larsbj@lyx.org>
10961 * All over: Tried to clean everything up so that only the files
10962 that we really need are included in the cvs repository.
10963 * Switched to use automake.
10964 * Generaton of reLyX is not perfect, LYX_DIR does not get substituted.
10965 * Install has not been checked.
10967 1999-09-22 Lars Gullik Bjønnes <larsbj@lyx.org>
10969 * po/pt.po: Three errors:
10970 l.533 and l.538 format specification error
10971 l. 402 duplicate entry, I just deleted it.